Version Description
Swipe support, fixed background and accessibility improvements.
=
Download this release
Release Info
Developer | RavanH |
Plugin | Easy FancyBox |
Version | 1.9 |
Comparing to | |
See all releases |
Code changes from version 1.8.19 to 1.9
- css/jquery.fancybox-ie.min.css +0 -1
- css/jquery.fancybox.min.css +0 -1
- easy-fancybox.php +57 -56
- {images → fancybox/1.3.26}/blank.gif +0 -0
- {images → fancybox/1.3.26}/fancy_close.png +0 -0
- {images → fancybox/1.3.26}/fancy_loading.png +0 -0
- {images → fancybox/1.3.26}/fancy_nav_left.png +0 -0
- {images → fancybox/1.3.26}/fancy_nav_right.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_e.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_n.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_ne.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_nw.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_s.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_se.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_sw.png +0 -0
- {images → fancybox/1.3.26}/fancy_shadow_w.png +0 -0
- {images → fancybox/1.3.26}/fancy_title_left.png +0 -0
- {images → fancybox/1.3.26}/fancy_title_main.png +0 -0
- {images → fancybox/1.3.26}/fancy_title_over.png +0 -0
- {images → fancybox/1.3.26}/fancy_title_right.png +0 -0
- {images → fancybox/1.3.26}/fancybox-x.png +0 -0
- {images → fancybox/1.3.26}/fancybox-y.png +0 -0
- {images → fancybox/1.3.26}/fancybox.png +0 -0
- {css → fancybox/1.3.26}/jquery.fancybox-ie.css +0 -0
- fancybox/1.3.26/jquery.fancybox-ie.min.css +1 -0
- {css → fancybox/1.3.26}/jquery.fancybox.css +316 -323
- fancybox/1.3.26/jquery.fancybox.js +1346 -0
- fancybox/1.3.26/jquery.fancybox.min.css +1 -0
- fancybox/1.3.26/jquery.fancybox.min.js +1 -0
- fancybox/1.5.0/jquery.fancybox.css +367 -0
- fancybox/1.5.0/jquery.fancybox.js +1195 -0
- fancybox/1.5.0/jquery.fancybox.min.css +1 -0
- fancybox/1.5.0/jquery.fancybox.min.js +1 -0
- fancybox/2.2.0/fancybox_loading.gif +0 -0
- fancybox/2.2.0/fancybox_loading@2x.gif +0 -0
- fancybox/2.2.0/fancybox_sprite.png +0 -0
- fancybox/2.2.0/fancybox_sprite@2x.png +0 -0
- fancybox/2.2.0/helpers/fancybox_buttons.png +0 -0
- fancybox/2.2.0/helpers/jquery.fancybox-buttons.css +91 -0
- fancybox/2.2.0/helpers/jquery.fancybox-buttons.js +122 -0
- fancybox/2.2.0/helpers/jquery.fancybox-buttons.min.css +1 -0
- fancybox/2.2.0/helpers/jquery.fancybox-buttons.min.js +16 -0
- fancybox/2.2.0/helpers/jquery.fancybox-media.js +161 -0
- fancybox/2.2.0/helpers/jquery.fancybox-media.min.js +2 -0
- fancybox/2.2.0/helpers/jquery.fancybox-thumbs.css +55 -0
- fancybox/2.2.0/helpers/jquery.fancybox-thumbs.js +165 -0
- fancybox/2.2.0/helpers/jquery.fancybox-thumbs.min.css +1 -0
- fancybox/2.2.0/helpers/jquery.fancybox-thumbs.min.js +17 -0
- fancybox/2.2.0/jquery.fancybox.css +295 -0
- fancybox/2.2.0/jquery.fancybox.js +2113 -0
- fancybox/2.2.0/jquery.fancybox.min.css +1 -0
- fancybox/2.2.0/jquery.fancybox.min.js +1 -0
- fancybox/3.5.7/jquery.fancybox.css +895 -0
- fancybox/3.5.7/jquery.fancybox.js +5632 -0
- fancybox/3.5.7/jquery.fancybox.min.css +1 -0
- fancybox/3.5.7/jquery.fancybox.min.js +1 -0
- inc/class-easyfancybox-admin.php +198 -68
- inc/class-easyfancybox.php +233 -405
- inc/fancybox-2-options.php +1485 -0
- inc/fancybox-2.php +503 -0
- inc/fancybox-classic-options.php +1479 -0
- inc/fancybox-classic.php +343 -0
- inc/{easyfancybox-options.php → fancybox-legacy-options.php} +238 -253
- inc/fancybox-legacy.php +341 -0
- js/jquery.fancybox.min.js +0 -1
- readme.txt +737 -760
- uninstall.php +222 -0
- vendor/fancybox-1.3.4/blank.gif +0 -0
- vendor/fancybox-1.3.4/fancy_close.png +0 -0
- vendor/fancybox-1.3.4/fancy_loading.png +0 -0
- vendor/fancybox-1.3.4/fancy_nav_left.png +0 -0
- vendor/fancybox-1.3.4/fancy_nav_right.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_e.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_n.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_ne.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_nw.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_s.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_se.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_sw.png +0 -0
- vendor/fancybox-1.3.4/fancy_shadow_w.png +0 -0
- vendor/fancybox-1.3.4/fancy_title_left.png +0 -0
- vendor/fancybox-1.3.4/fancy_title_main.png +0 -0
- vendor/fancybox-1.3.4/fancy_title_over.png +0 -0
- vendor/fancybox-1.3.4/fancy_title_right.png +0 -0
- vendor/fancybox-1.3.4/fancybox-x.png +0 -0
- vendor/fancybox-1.3.4/fancybox-y.png +0 -0
- vendor/fancybox-1.3.4/fancybox.png +0 -0
- vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.css +359 -0
- js/jquery.fancybox.js → vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.js +155 -355
- vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.pack.js +46 -0
- vendor/fancybox-2.1.7/.gitattributes +7 -0
- vendor/fancybox-2.1.7/.gitignore +3 -0
- vendor/fancybox-2.1.7/CHANGELOG.md +125 -0
- vendor/fancybox-2.1.7/README.md +244 -0
- vendor/fancybox-2.1.7/bower.json +35 -0
- vendor/fancybox-2.1.7/composer.json +14 -0
- vendor/fancybox-2.1.7/demo/1_b.jpg +0 -0
- vendor/fancybox-2.1.7/demo/1_s.jpg +0 -0
- vendor/fancybox-2.1.7/demo/2_b.jpg +0 -0
- vendor/fancybox-2.1.7/demo/2_s.jpg +0 -0
- vendor/fancybox-2.1.7/demo/3_b.jpg +0 -0
- vendor/fancybox-2.1.7/demo/3_s.jpg +0 -0
- vendor/fancybox-2.1.7/demo/4_b.jpg +0 -0
- vendor/fancybox-2.1.7/demo/4_s.jpg +0 -0
- vendor/fancybox-2.1.7/demo/5_b.jpg +0 -0
- vendor/fancybox-2.1.7/demo/5_s.jpg +0 -0
- vendor/fancybox-2.1.7/demo/ajax.txt +15 -0
- vendor/fancybox-2.1.7/demo/iframe.html +26 -0
- vendor/fancybox-2.1.7/demo/index.html +312 -0
- vendor/fancybox-2.1.7/fancybox.jquery.json +31 -0
- vendor/fancybox-2.1.7/gulpfile.js +76 -0
- vendor/fancybox-2.1.7/lib/jquery-1.10.2.min.js +6 -0
css/jquery.fancybox-ie.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
#fancybox-left:hover,#fancybox-right:hover{visibility:visible}.fancybox-ie6 #fancybox-bg-w,.fancybox-ie6 #fancybox-bg-e,.fancybox-ie6 #fancybox-left,.fancybox-ie6 #fancybox-right,#fancybox-hide-sel-frame{height:expression(this.parentNode.clientHeight+"px")}#fancybox-loading.fancybox-ie6{position:absolute;margin-top:0;top:expression((-20+(document.documentElement.clientHeight ? document.documentElement.clientHeight / 2:document.body.clientHeight / 2)+(ignoreMe=document.documentElement.scrollTop?document.documentElement.scrollTop:document.body.scrollTop))+"px")}.fancybox-bg{position:absolute;padding:0;margin:0;border:0;width:20px;height:20px;z-index:111001}#fancybox-bg-n{top:-20px;left:0;width:100%}#fancybox-bg-ne{top:-20px;right:-20px}#fancybox-bg-e{top:0;right:-20px;height:100%}#fancybox-bg-se{bottom:-20px;right:-20px}#fancybox-bg-s{bottom:-20px;left:0;width:100%}#fancybox-bg-sw{bottom:-20px;left:-20px}#fancybox-bg-w{top:0;left:-20px;height:100%}#fancybox-bg-nw{top:-20px;left:-20px}.fancybox-ie .fancybox-bg{background:transparent!important}
|
|
css/jquery.fancybox.min.css
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
#fancybox-loading,#fancybox-loading div,#fancybox-overlay,#fancybox-wrap,.fancybox-bg,#fancybox-outer,#fancybox-content,#fancybox-content>div,#fancybox-content>div>div,#fancybox-frame,#fancybox-close,#fancybox-title,#fancybox-title div,#fancybox-left,#fancybox-right,.fancy-ico{box-sizing:content-box;-moz-box-sizing:content-box}#fancybox-loading{position:fixed;top:50%;left:50%;width:40px;height:40px;margin-top:-20px;margin-left:-20px;cursor:pointer;overflow:hidden;z-index:111104;display:none}#fancybox-loading div{position:absolute;top:0;left:0;width:40px;height:480px;background-image:url('../images/fancybox.png')}#fancybox-overlay{position:absolute;top:0;left:0;width:100%;z-index:111100;display:none}#fancybox-tmp{padding:0;margin:0;border:0;overflow:auto;display:none}#fancybox-wrap{position:absolute;top:0;left:0;padding:20px;z-index:111101;display:none}#fancybox-outer{position:relative;width:100%;height:100%;background:#fff;box-shadow:0 0 20px #111;-moz-box-shadow:0 0 20px #111;-webkit-box-shadow:0 0 20px #111}#fancybox-content{width:0;height:0;padding:0;position:relative;-webkit-overflow-scrolling:touch;overflow-y:auto;z-index:111102;border:0 solid #fff;background:#fff;-moz-background-clip:padding;-webkit-background-clip:padding;background-clip:padding-box}#fancybox-content>div{max-width:100%;max-height:100%}#fancybox-hide-sel-frame{position:absolute;top:0;left:0;width:100%;height:100%;background:transparent;z-index:111101}#fancybox-close{position:absolute;top:-15px;right:-15px;width:30px;height:30px;background:transparent url('../images/fancybox.png') -40px 0;cursor:pointer;z-index:111103;display:none}#fancybox-error{color:#444;padding:14px;margin:0}#fancybox-frame,#fancybox-img{width:100%;height:100%;border:0}#fancybox-img{padding:0;margin:0;line-height:0;vertical-align:top;max-width:none!important;max-height:none!important}#fancybox-frame{display:block;width:100%;height:100%;z-index:0;-webkit-transform:translateZ(0px);-webkit-transform:translate3d(0,0,0);-webkit-perspective:1000}#fancybox-left,#fancybox-right{position:absolute;bottom:0;height:100%;width:35%;cursor:pointer;background:initial;z-index:111102;display:none}#fancybox-left{left:0}.rtl #fancybox-left{left:auto;right:0}#fancybox-right{right:0}.rtl #fancybox-right{left:0;right:auto}#fancybox-left-ico,#fancybox-right-ico{position:absolute;top:50%;left:-9999px;width:30px;height:30px;margin-top:-15px;cursor:pointer;z-index:111102;display:block}#fancybox-left-ico{background-image:url('../images/fancybox.png');background-position:-40px -30px}.rtl #fancybox-left-ico{background-position:-40px -60px;right:-9999px}#fancybox-right-ico{background-image:url('../images/fancybox.png');background-position:-40px -60px}.rtl #fancybox-right-ico{background-position:-40px -30px;right:-9999px}#fancybox-left:focus,#fancybox-right:focus{outline:0;background:initial}#fancybox-left:hover span{left:20px}.rtl #fancybox-left:hover span{right:20px}#fancybox-right:hover span{left:auto;right:20px}.rtl #fancybox-right:hover span{right:auto;left:20px}#fancybox-title{z-index:111102}.fancybox-title-inside{padding-bottom:10px;text-align:center;color:#333;position:relative}.fancybox-title-outside{padding-top:10px;color:#fff;font-weight:600}.fancybox-title-over{position:absolute;bottom:0;left:0;color:#FFF;text-align:left}.rtl .fancybox-title-over{text-align:right}#fancybox-title-over{padding:10px;background:rgba(0,0,0,.64);display:block}.fancybox-title-float{position:absolute;left:0;bottom:-20px;height:32px}#fancybox-title-float-wrap{border:0;border-collapse:collapse;width:auto}#fancybox-title-float-wrap tr,#fancybox-title-float-wrap td{border:0;white-space:nowrap}#fancybox-title-float-left{padding:0 0 0 15px;background:url('../images/fancybox.png') -40px -90px no-repeat}#fancybox-title-float-main{color:#fff;line-height:29px;font-weight:600;font-size:14px;padding:0 0 3px 0;background:url('../images/fancybox-x.png') 0 -40px}#fancybox-title-float-right{padding:0 0 0 15px;background:url('../images/fancybox.png') -55px -90px no-repeat}.fancybox-hidden{display:none}
|
|
easy-fancybox.php
CHANGED
@@ -1,56 +1,57 @@
|
|
1 |
-
<?php
|
2 |
-
/*
|
3 |
-
Plugin Name: Easy FancyBox
|
4 |
-
Plugin URI: http://status301.net/wordpress-plugins/easy-fancybox/
|
5 |
-
Description: Easily enable the
|
6 |
-
Text Domain: easy-fancybox
|
7 |
-
Domain Path: languages
|
8 |
-
Version: 1.
|
9 |
-
Author: RavanH
|
10 |
-
Author URI: http://status301.net/
|
11 |
-
*/
|
12 |
-
|
13 |
-
|
14 |
-
|
15 |
-
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
|
21 |
-
|
22 |
-
|
23 |
-
|
24 |
-
|
25 |
-
|
26 |
-
|
27 |
-
|
28 |
-
|
29 |
-
|
30 |
-
|
31 |
-
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
-
|
36 |
-
|
37 |
-
|
38 |
-
|
39 |
-
|
40 |
-
|
41 |
-
define( '
|
42 |
-
define( '
|
43 |
-
define( '
|
44 |
-
define( '
|
45 |
-
|
46 |
-
|
47 |
-
|
48 |
-
|
49 |
-
|
50 |
-
|
51 |
-
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
|
1 |
+
<?php
|
2 |
+
/*
|
3 |
+
Plugin Name: Easy FancyBox
|
4 |
+
Plugin URI: http://status301.net/wordpress-plugins/easy-fancybox/
|
5 |
+
Description: Easily enable the FancyBox jQuery light box on all media file links. Also supports iframe, inline content and well known video hosts.
|
6 |
+
Text Domain: easy-fancybox
|
7 |
+
Domain Path: languages
|
8 |
+
Version: 1.9
|
9 |
+
Author: RavanH
|
10 |
+
Author URI: http://status301.net/
|
11 |
+
*/
|
12 |
+
|
13 |
+
/**
|
14 |
+
* Copyright 2022 RavanH
|
15 |
+
* https://status301.net/
|
16 |
+
* mailto: ravanhagen@gmail.com
|
17 |
+
|
18 |
+
* This program is free software; you can redistribute it and/or modify
|
19 |
+
* it under the terms of the GNU General Public License version 3 as
|
20 |
+
* published by the Free Software Foundation.
|
21 |
+
|
22 |
+
* This program is distributed in the hope that it will be useful,
|
23 |
+
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
24 |
+
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
25 |
+
* GNU General Public License for more details.
|
26 |
+
*/
|
27 |
+
|
28 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
29 |
+
|
30 |
+
/**************
|
31 |
+
* CONSTANTS
|
32 |
+
**************/
|
33 |
+
|
34 |
+
define( 'EASY_FANCYBOX_VERSION', '1.9' );
|
35 |
+
define( 'FANCYBOX_VERSIONS', array(
|
36 |
+
'legacy' => '1.3.26',
|
37 |
+
'classic' => '1.5.0',
|
38 |
+
'fancyBox2' => '2.2.0',
|
39 |
+
//'fancyBox3' => '3.5.7'
|
40 |
+
) );
|
41 |
+
define( 'MOUSEWHEEL_VERSION', '3.1.13' );
|
42 |
+
define( 'EASING_VERSION', '1.4.1' );
|
43 |
+
define( 'METADATA_VERSION', '2.22.1' );
|
44 |
+
define( 'EASY_FANCYBOX_DIR', dirname( __FILE__ ) );
|
45 |
+
define( 'EASY_FANCYBOX_BASENAME', plugin_basename(__FILE__) );
|
46 |
+
|
47 |
+
/**************
|
48 |
+
* CLASSES
|
49 |
+
**************/
|
50 |
+
|
51 |
+
require_once EASY_FANCYBOX_DIR . '/inc/class-easyfancybox.php';
|
52 |
+
new easyFancyBox();
|
53 |
+
|
54 |
+
if ( is_admin() ) {
|
55 |
+
require_once EASY_FANCYBOX_DIR . '/inc/class-easyfancybox-admin.php';
|
56 |
+
new easyFancyBox_Admin();
|
57 |
+
}
|
{images → fancybox/1.3.26}/blank.gif
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_close.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_loading.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_nav_left.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_nav_right.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_e.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_n.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_ne.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_nw.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_s.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_se.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_sw.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_shadow_w.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_title_left.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_title_main.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_title_over.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancy_title_right.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancybox-x.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancybox-y.png
RENAMED
File without changes
|
{images → fancybox/1.3.26}/fancybox.png
RENAMED
File without changes
|
{css → fancybox/1.3.26}/jquery.fancybox-ie.css
RENAMED
File without changes
|
fancybox/1.3.26/jquery.fancybox-ie.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
#fancybox-left:hover,#fancybox-right:hover{visibility:visible;}.fancybox-ie6 #fancybox-bg-w,.fancybox-ie6 #fancybox-bg-e,.fancybox-ie6 #fancybox-left,.fancybox-ie6 #fancybox-right,#fancybox-hide-sel-frame{height:expression(this.parentNode.clientHeight + "px");}#fancybox-loading.fancybox-ie6{position:absolute;margin-top:0;top:expression((-20 + (document.documentElement.clientHeight ? document.documentElement.clientHeight / 2:document.body.clientHeight / 2) + (ignoreMe=document.documentElement.scrollTop?document.documentElement.scrollTop:document.body.scrollTop)) + "px");}.fancybox-bg{position:absolute;padding:0;margin:0;border:0;width:20px;height:20px;z-index:111001}#fancybox-bg-n{top:-20px;left:0;width:100%;}#fancybox-bg-ne{top:-20px;right:-20px;}#fancybox-bg-e{top:0;right:-20px;height:100%;}#fancybox-bg-se{bottom:-20px;right:-20px;}#fancybox-bg-s{bottom:-20px;left:0;width:100%;}#fancybox-bg-sw{bottom:-20px;left:-20px;}#fancybox-bg-w{top:0;left:-20px;height:100%;}#fancybox-bg-nw{top:-20px;left:-20px;}.fancybox-ie .fancybox-bg{background:transparent!important;}
|
{css → fancybox/1.3.26}/jquery.fancybox.css
RENAMED
@@ -1,323 +1,316 @@
|
|
1 |
-
|
2 |
-
* FancyBox - jQuery Plugin
|
3 |
-
* Simple and fancy lightbox alternative
|
4 |
-
*
|
5 |
-
* Examples and documentation at: http://fancybox.net
|
6 |
-
*
|
7 |
-
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
-
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
-
*
|
10 |
-
* Version: 1.3.
|
11 |
-
*
|
12 |
-
* Dual licensed under the MIT and GPL licenses:
|
13 |
-
* http://www.opensource.org/licenses/mit-license.php
|
14 |
-
* http://www.gnu.org/licenses/gpl.html
|
15 |
-
*/
|
16 |
-
|
17 |
-
#fancybox-loading, #fancybox-loading div,
|
18 |
-
#fancybox-overlay,
|
19 |
-
#fancybox-wrap, .fancybox-bg,
|
20 |
-
#fancybox-outer,
|
21 |
-
#fancybox-content,
|
22 |
-
#fancybox-content > div,
|
23 |
-
#fancybox-content > div > div,
|
24 |
-
#fancybox-frame,
|
25 |
-
#fancybox-close,
|
26 |
-
#fancybox-title, #fancybox-title div,
|
27 |
-
#fancybox-left, #fancybox-right, .fancy-ico {
|
28 |
-
box-sizing: content-box;
|
29 |
-
-moz-box-sizing: content-box;
|
30 |
-
}
|
31 |
-
|
32 |
-
#fancybox-loading {
|
33 |
-
position: fixed;
|
34 |
-
top: 50%;
|
35 |
-
left: 50%;
|
36 |
-
width: 40px;
|
37 |
-
height: 40px;
|
38 |
-
margin-top: -20px;
|
39 |
-
margin-left: -20px;
|
40 |
-
cursor: pointer;
|
41 |
-
overflow: hidden;
|
42 |
-
z-index: 111104;
|
43 |
-
display: none;
|
44 |
-
}
|
45 |
-
|
46 |
-
#fancybox-loading div {
|
47 |
-
position: absolute;
|
48 |
-
top: 0;
|
49 |
-
left: 0;
|
50 |
-
width: 40px;
|
51 |
-
height: 480px;
|
52 |
-
background-image: url('
|
53 |
-
}
|
54 |
-
|
55 |
-
#fancybox-overlay {
|
56 |
-
position: absolute;
|
57 |
-
top: 0;
|
58 |
-
left: 0;
|
59 |
-
width: 100%;
|
60 |
-
z-index: 111100;
|
61 |
-
display: none;
|
62 |
-
}
|
63 |
-
|
64 |
-
#fancybox-tmp {
|
65 |
-
padding: 0;
|
66 |
-
margin: 0;
|
67 |
-
border: 0;
|
68 |
-
overflow: auto;
|
69 |
-
display: none;
|
70 |
-
}
|
71 |
-
|
72 |
-
#fancybox-wrap {
|
73 |
-
position: absolute;
|
74 |
-
top: 0;
|
75 |
-
left: 0;
|
76 |
-
padding: 20px;
|
77 |
-
z-index: 111101;
|
78 |
-
display: none;
|
79 |
-
}
|
80 |
-
|
81 |
-
#fancybox-outer {
|
82 |
-
position: relative;
|
83 |
-
width: 100%;
|
84 |
-
height: 100%;
|
85 |
-
background: #fff;
|
86 |
-
box-shadow:0 0 20px #111;
|
87 |
-
-moz-box-shadow:0 0 20px #111;
|
88 |
-
-webkit-box-shadow:0 0 20px #111;
|
89 |
-
}
|
90 |
-
|
91 |
-
#fancybox-content {
|
92 |
-
width: 0;
|
93 |
-
height: 0;
|
94 |
-
padding: 0;
|
95 |
-
position: relative;
|
96 |
-
/*overflow: hidden;*/
|
97 |
-
-webkit-overflow-scrolling:touch;
|
98 |
-
overflow-y:auto;
|
99 |
-
z-index: 111102;
|
100 |
-
border: 0px solid #fff;
|
101 |
-
background: #fff;
|
102 |
-
-moz-background-clip: padding; /* Firefox 3.6 */
|
103 |
-
-webkit-background-clip: padding; /* Safari 4? Chrome 6? */
|
104 |
-
background-clip: padding-box; /* IE9+, Firefox 4+, Opera, Chrome */
|
105 |
-
}
|
106 |
-
|
107 |
-
#fancybox-content > div {
|
108 |
-
max-width: 100%;
|
109 |
-
max-height: 100%;
|
110 |
-
}
|
111 |
-
|
112 |
-
#fancybox-hide-sel-frame {
|
113 |
-
position: absolute;
|
114 |
-
top: 0;
|
115 |
-
left: 0;
|
116 |
-
width: 100%;
|
117 |
-
height: 100%;
|
118 |
-
background: transparent;
|
119 |
-
z-index: 111101;
|
120 |
-
}
|
121 |
-
|
122 |
-
#fancybox-close {
|
123 |
-
position: absolute;
|
124 |
-
top: -15px;
|
125 |
-
right: -15px;
|
126 |
-
width: 30px;
|
127 |
-
height: 30px;
|
128 |
-
background: transparent url('
|
129 |
-
cursor: pointer;
|
130 |
-
z-index: 111103;
|
131 |
-
display: none;
|
132 |
-
}
|
133 |
-
|
134 |
-
#fancybox-error {
|
135 |
-
color: #444;
|
136 |
-
padding: 14px;
|
137 |
-
margin: 0;
|
138 |
-
}
|
139 |
-
|
140 |
-
#fancybox-frame, #fancybox-img {
|
141 |
-
width: 100%;
|
142 |
-
height: 100%;
|
143 |
-
border: none;
|
144 |
-
}
|
145 |
-
|
146 |
-
#fancybox-img {
|
147 |
-
padding: 0;
|
148 |
-
margin: 0;
|
149 |
-
line-height: 0;
|
150 |
-
vertical-align: top;
|
151 |
-
max-width:none !important;
|
152 |
-
max-height:none !important
|
153 |
-
}
|
154 |
-
|
155 |
-
#fancybox-frame {
|
156 |
-
display: block;
|
157 |
-
width: 100%;
|
158 |
-
height: 100%;
|
159 |
-
z-index: 0; /* z-index bug with -webkit-overflow-scrolling */
|
160 |
-
|
161 |
-
|
162 |
-
|
163 |
-
|
164 |
-
|
165 |
-
|
166 |
-
|
167 |
-
|
168 |
-
|
169 |
-
|
170 |
-
|
171 |
-
|
172 |
-
|
173 |
-
|
174 |
-
|
175 |
-
|
176 |
-
|
177 |
-
|
178 |
-
|
179 |
-
|
180 |
-
|
181 |
-
|
182 |
-
|
183 |
-
|
184 |
-
|
185 |
-
|
186 |
-
|
187 |
-
|
188 |
-
|
189 |
-
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
|
209 |
-
|
210 |
-
|
211 |
-
|
212 |
-
|
213 |
-
|
214 |
-
|
215 |
-
|
216 |
-
|
217 |
-
|
218 |
-
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
|
269 |
-
|
270 |
-
|
271 |
-
|
272 |
-
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
-
|
297 |
-
|
298 |
-
|
299 |
-
|
300 |
-
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
padding: 0 0 0 15px;
|
318 |
-
background: url('../images/fancybox.png') -55px -90px no-repeat;
|
319 |
-
}
|
320 |
-
|
321 |
-
.fancybox-hidden {
|
322 |
-
display:none
|
323 |
-
}
|
1 |
+
/**
|
2 |
+
* FancyBox - jQuery Plugin
|
3 |
+
* Simple and fancy lightbox alternative
|
4 |
+
*
|
5 |
+
* Examples and documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Version: 1.3.26 (2018/10/01)
|
11 |
+
*
|
12 |
+
* Dual licensed under the MIT and GPL licenses:
|
13 |
+
* http://www.opensource.org/licenses/mit-license.php
|
14 |
+
* http://www.gnu.org/licenses/gpl.html
|
15 |
+
*/
|
16 |
+
|
17 |
+
#fancybox-loading, #fancybox-loading div,
|
18 |
+
#fancybox-overlay,
|
19 |
+
#fancybox-wrap, .fancybox-bg,
|
20 |
+
#fancybox-outer,
|
21 |
+
#fancybox-content,
|
22 |
+
#fancybox-content > div,
|
23 |
+
#fancybox-content > div > div,
|
24 |
+
#fancybox-frame,
|
25 |
+
#fancybox-close,
|
26 |
+
#fancybox-title, #fancybox-title div,
|
27 |
+
#fancybox-left, #fancybox-right, .fancy-ico {
|
28 |
+
box-sizing: content-box;
|
29 |
+
-moz-box-sizing: content-box;
|
30 |
+
}
|
31 |
+
|
32 |
+
#fancybox-loading {
|
33 |
+
position: fixed;
|
34 |
+
top: 50%;
|
35 |
+
left: 50%;
|
36 |
+
width: 40px;
|
37 |
+
height: 40px;
|
38 |
+
margin-top: -20px;
|
39 |
+
margin-left: -20px;
|
40 |
+
cursor: pointer;
|
41 |
+
overflow: hidden;
|
42 |
+
z-index: 111104;
|
43 |
+
display: none;
|
44 |
+
}
|
45 |
+
|
46 |
+
#fancybox-loading div {
|
47 |
+
position: absolute;
|
48 |
+
top: 0;
|
49 |
+
left: 0;
|
50 |
+
width: 40px;
|
51 |
+
height: 480px;
|
52 |
+
background-image: url('fancybox.png');
|
53 |
+
}
|
54 |
+
|
55 |
+
#fancybox-overlay {
|
56 |
+
position: absolute;
|
57 |
+
top: 0;
|
58 |
+
left: 0;
|
59 |
+
width: 100%;
|
60 |
+
z-index: 111100;
|
61 |
+
display: none;
|
62 |
+
}
|
63 |
+
|
64 |
+
#fancybox-tmp {
|
65 |
+
padding: 0;
|
66 |
+
margin: 0;
|
67 |
+
border: 0;
|
68 |
+
overflow: auto;
|
69 |
+
display: none;
|
70 |
+
}
|
71 |
+
|
72 |
+
#fancybox-wrap {
|
73 |
+
position: absolute;
|
74 |
+
top: 0;
|
75 |
+
left: 0;
|
76 |
+
padding: 20px;
|
77 |
+
z-index: 111101;
|
78 |
+
display: none;
|
79 |
+
}
|
80 |
+
|
81 |
+
#fancybox-outer {
|
82 |
+
position: relative;
|
83 |
+
width: 100%;
|
84 |
+
height: 100%;
|
85 |
+
background: #fff;
|
86 |
+
box-shadow:0 0 20px #111;
|
87 |
+
-moz-box-shadow:0 0 20px #111;
|
88 |
+
-webkit-box-shadow:0 0 20px #111;
|
89 |
+
}
|
90 |
+
|
91 |
+
#fancybox-content {
|
92 |
+
width: 0;
|
93 |
+
height: 0;
|
94 |
+
padding: 0;
|
95 |
+
position: relative;
|
96 |
+
/*overflow: hidden;*/
|
97 |
+
-webkit-overflow-scrolling:touch;
|
98 |
+
overflow-y:auto;
|
99 |
+
z-index: 111102;
|
100 |
+
border: 0px solid #fff;
|
101 |
+
background: #fff;
|
102 |
+
-moz-background-clip: padding; /* Firefox 3.6 */
|
103 |
+
-webkit-background-clip: padding; /* Safari 4? Chrome 6? */
|
104 |
+
background-clip: padding-box; /* IE9+, Firefox 4+, Opera, Chrome */
|
105 |
+
}
|
106 |
+
|
107 |
+
#fancybox-content > div {
|
108 |
+
max-width: 100%;
|
109 |
+
max-height: 100%;
|
110 |
+
}
|
111 |
+
|
112 |
+
#fancybox-hide-sel-frame {
|
113 |
+
position: absolute;
|
114 |
+
top: 0;
|
115 |
+
left: 0;
|
116 |
+
width: 100%;
|
117 |
+
height: 100%;
|
118 |
+
background: transparent;
|
119 |
+
z-index: 111101;
|
120 |
+
}
|
121 |
+
|
122 |
+
#fancybox-close {
|
123 |
+
position: absolute;
|
124 |
+
top: -15px;
|
125 |
+
right: -15px;
|
126 |
+
width: 30px;
|
127 |
+
height: 30px;
|
128 |
+
background: transparent url('fancybox.png') -40px 0px;
|
129 |
+
cursor: pointer;
|
130 |
+
z-index: 111103;
|
131 |
+
display: none;
|
132 |
+
}
|
133 |
+
|
134 |
+
#fancybox-error {
|
135 |
+
color: #444;
|
136 |
+
padding: 14px;
|
137 |
+
margin: 0;
|
138 |
+
}
|
139 |
+
|
140 |
+
#fancybox-frame, #fancybox-img {
|
141 |
+
width: 100%;
|
142 |
+
height: 100%;
|
143 |
+
border: none;
|
144 |
+
}
|
145 |
+
|
146 |
+
#fancybox-img {
|
147 |
+
padding: 0;
|
148 |
+
margin: 0;
|
149 |
+
line-height: 0;
|
150 |
+
vertical-align: top;
|
151 |
+
max-width:none !important;
|
152 |
+
max-height:none !important
|
153 |
+
}
|
154 |
+
|
155 |
+
#fancybox-frame {
|
156 |
+
display: block;
|
157 |
+
width: 100%;
|
158 |
+
height: 100%;
|
159 |
+
z-index: 0; /* z-index bug with -webkit-overflow-scrolling */
|
160 |
+
}
|
161 |
+
|
162 |
+
#fancybox-left, #fancybox-right {
|
163 |
+
position: absolute;
|
164 |
+
bottom: 0px;
|
165 |
+
height: 100%;
|
166 |
+
width: 35%;
|
167 |
+
cursor: pointer;
|
168 |
+
background: initial;
|
169 |
+
z-index: 111102;
|
170 |
+
display: none;
|
171 |
+
}
|
172 |
+
|
173 |
+
#fancybox-left {
|
174 |
+
left: 0px;
|
175 |
+
}
|
176 |
+
|
177 |
+
.rtl #fancybox-left {
|
178 |
+
left:auto;
|
179 |
+
right:0px
|
180 |
+
}
|
181 |
+
|
182 |
+
#fancybox-right {
|
183 |
+
right: 0px;
|
184 |
+
}
|
185 |
+
|
186 |
+
.rtl #fancybox-right {
|
187 |
+
left:0px;
|
188 |
+
right:auto
|
189 |
+
}
|
190 |
+
|
191 |
+
#fancybox-left-ico, #fancybox-right-ico {
|
192 |
+
position: absolute;
|
193 |
+
top: 50%;
|
194 |
+
left: -9999px;
|
195 |
+
width: 30px;
|
196 |
+
height: 30px;
|
197 |
+
margin-top: -15px;
|
198 |
+
cursor: pointer;
|
199 |
+
z-index: 111102;
|
200 |
+
display: block;
|
201 |
+
}
|
202 |
+
|
203 |
+
#fancybox-left-ico {
|
204 |
+
background-image: url('fancybox.png');
|
205 |
+
background-position: -40px -30px;
|
206 |
+
}
|
207 |
+
|
208 |
+
.rtl #fancybox-left-ico{
|
209 |
+
background-position:-40px -60px;
|
210 |
+
right:-9999px
|
211 |
+
}
|
212 |
+
|
213 |
+
#fancybox-right-ico {
|
214 |
+
background-image: url('fancybox.png');
|
215 |
+
background-position: -40px -60px;
|
216 |
+
}
|
217 |
+
|
218 |
+
.rtl #fancybox-right-ico{
|
219 |
+
background-position:-40px -30px;
|
220 |
+
right:-9999px
|
221 |
+
}
|
222 |
+
|
223 |
+
#fancybox-left:focus, #fancybox-right:focus {
|
224 |
+
outline: none;
|
225 |
+
background: initial;
|
226 |
+
}
|
227 |
+
|
228 |
+
#fancybox-left:hover span {
|
229 |
+
left: 20px;
|
230 |
+
}
|
231 |
+
|
232 |
+
.rtl #fancybox-left:hover span {
|
233 |
+
right:20px
|
234 |
+
}
|
235 |
+
|
236 |
+
#fancybox-right:hover span {
|
237 |
+
left: auto;
|
238 |
+
right: 20px;
|
239 |
+
}
|
240 |
+
|
241 |
+
.rtl #fancybox-right:hover span {
|
242 |
+
right:auto;
|
243 |
+
left:20px
|
244 |
+
}
|
245 |
+
|
246 |
+
#fancybox-title {
|
247 |
+
z-index: 111102;
|
248 |
+
}
|
249 |
+
|
250 |
+
.fancybox-title-inside {
|
251 |
+
padding-bottom: 10px;
|
252 |
+
text-align: center;
|
253 |
+
color: #333;
|
254 |
+
position: relative;
|
255 |
+
}
|
256 |
+
|
257 |
+
.fancybox-title-outside {
|
258 |
+
padding-top: 10px;
|
259 |
+
color: #fff;
|
260 |
+
font-weight: 600;
|
261 |
+
}
|
262 |
+
|
263 |
+
.fancybox-title-over {
|
264 |
+
position: absolute;
|
265 |
+
bottom: 0;
|
266 |
+
left: 0;
|
267 |
+
color: #FFF;
|
268 |
+
text-align: left;
|
269 |
+
}
|
270 |
+
|
271 |
+
.rtl .fancybox-title-over {
|
272 |
+
text-align:right
|
273 |
+
}
|
274 |
+
|
275 |
+
#fancybox-title-over {
|
276 |
+
padding: 10px;
|
277 |
+
background: rgba(0,0,0,.64);
|
278 |
+
display: block;
|
279 |
+
}
|
280 |
+
|
281 |
+
.fancybox-title-float {
|
282 |
+
position: absolute;
|
283 |
+
left: 0;
|
284 |
+
bottom: -20px;
|
285 |
+
height: 32px;
|
286 |
+
}
|
287 |
+
|
288 |
+
#fancybox-title-float-wrap {
|
289 |
+
border: none;
|
290 |
+
border-collapse: collapse;
|
291 |
+
width: auto;
|
292 |
+
}
|
293 |
+
|
294 |
+
#fancybox-title-float-wrap tr,#fancybox-title-float-wrap td {
|
295 |
+
border: none;
|
296 |
+
white-space: nowrap;
|
297 |
+
}
|
298 |
+
|
299 |
+
#fancybox-title-float-left {
|
300 |
+
padding: 0 0 0 15px;
|
301 |
+
background: url('fancybox.png') -40px -90px no-repeat;
|
302 |
+
}
|
303 |
+
|
304 |
+
#fancybox-title-float-main {
|
305 |
+
color: #fff;
|
306 |
+
line-height: 29px;
|
307 |
+
font-weight: 600;
|
308 |
+
font-size: 14px;
|
309 |
+
padding: 0 0 3px 0;
|
310 |
+
background: url('fancybox-x.png') 0px -40px;
|
311 |
+
}
|
312 |
+
|
313 |
+
#fancybox-title-float-right {
|
314 |
+
padding: 0 0 0 15px;
|
315 |
+
background: url('fancybox.png') -55px -90px no-repeat;
|
316 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
fancybox/1.3.26/jquery.fancybox.js
ADDED
@@ -0,0 +1,1346 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* FancyBox - jQuery Plugin
|
3 |
+
* Simple and fancy lightbox alternative
|
4 |
+
*
|
5 |
+
* Examples and documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Version: 1.3.26 (2019/04/07)
|
11 |
+
* Requires: jQuery v1.7+
|
12 |
+
*
|
13 |
+
* Dual licensed under the MIT and GPL licenses:
|
14 |
+
* http://www.opensource.org/licenses/mit-license.php
|
15 |
+
* http://www.gnu.org/licenses/gpl.html
|
16 |
+
*/
|
17 |
+
|
18 |
+
(function($) {
|
19 |
+
var tmp, loading, overlay, wrap, outer, content, close, title, nav_left, nav_right, resize_timeout,
|
20 |
+
selectedIndex = 0, selectedOpts = {}, selectedArray = [], currentIndex = 0, currentOpts = {}, currentArray = [],
|
21 |
+
ajaxLoader = null, imgPreloader = new Image(),
|
22 |
+
imgRegExp = /\.(jpg|gif|png|bmp|jpeg|webp)(.*)?$/i, swfRegExp = /[^\.]\.(swf)\s*$/i, svgRegExp = /[^\.]\.(svg)\s*$/i, pdfRegExp = /[^\.]\.(pdf)\s*$/i,
|
23 |
+
loadingTimer, loadingFrame = 1,
|
24 |
+
titleHeight = 0, titleStr = '', start_pos, final_pos, busy = false, fx = $.extend($('<div/>')[0], { prop: 0 }),
|
25 |
+
isIE = /MSIE|Trident/.test(window.navigator.userAgent), isIE6 = isIE && !window.XMLHttpRequest,
|
26 |
+
isTouch = document.createTouch !== undefined;
|
27 |
+
|
28 |
+
/*
|
29 |
+
* Private methods
|
30 |
+
*/
|
31 |
+
|
32 |
+
_abort = function() {
|
33 |
+
$.fancybox.hideActivity();
|
34 |
+
|
35 |
+
imgPreloader.onerror = imgPreloader.onload = null;
|
36 |
+
|
37 |
+
if (ajaxLoader) {
|
38 |
+
ajaxLoader.abort();
|
39 |
+
}
|
40 |
+
|
41 |
+
tmp.empty();
|
42 |
+
},
|
43 |
+
|
44 |
+
_error = function(msg) {
|
45 |
+
if (false === selectedOpts.onError(selectedArray, selectedIndex, selectedOpts)) {
|
46 |
+
$.fancybox.hideActivity();
|
47 |
+
busy = false;
|
48 |
+
return;
|
49 |
+
}
|
50 |
+
|
51 |
+
if ( typeof msg === 'undefined' ) {
|
52 |
+
msg = 'Please try again later.';
|
53 |
+
}
|
54 |
+
|
55 |
+
selectedOpts.titleShow = false;
|
56 |
+
|
57 |
+
selectedOpts.width = 'auto';
|
58 |
+
selectedOpts.height = 'auto';
|
59 |
+
|
60 |
+
tmp.html( '<p id="fancybox-error">The requested content cannot be loaded.<br />' + msg + '</p>' );
|
61 |
+
|
62 |
+
_process_inline();
|
63 |
+
},
|
64 |
+
|
65 |
+
_start = function() {
|
66 |
+
var obj = selectedArray[ selectedIndex ],
|
67 |
+
href,
|
68 |
+
type,
|
69 |
+
title,
|
70 |
+
str,
|
71 |
+
emb,
|
72 |
+
ret;
|
73 |
+
|
74 |
+
_abort();
|
75 |
+
|
76 |
+
selectedOpts = $.extend({}, $.fn.fancybox.defaults, (typeof $(obj).data('fancybox') == 'undefined' ? selectedOpts : $(obj).data('fancybox')));
|
77 |
+
|
78 |
+
if ( document.documentElement.clientWidth < selectedOpts.minViewportWidth ) {
|
79 |
+
busy = false;
|
80 |
+
return;
|
81 |
+
}
|
82 |
+
|
83 |
+
ret = selectedOpts.onStart(selectedArray, selectedIndex, selectedOpts);
|
84 |
+
|
85 |
+
if (ret === false) {
|
86 |
+
busy = false;
|
87 |
+
return;
|
88 |
+
} else if (typeof ret == 'object') {
|
89 |
+
selectedOpts = $.extend(selectedOpts, ret);
|
90 |
+
}
|
91 |
+
|
92 |
+
title = selectedOpts.title || (obj.nodeName ? $(obj).attr('title') : obj.title) || '';
|
93 |
+
|
94 |
+
if (obj.nodeName && !selectedOpts.orig) {
|
95 |
+
selectedOpts.orig = $(obj).find("img:first").length ? $(obj).find("img:first") : $(obj);
|
96 |
+
}
|
97 |
+
|
98 |
+
if (title === '' && selectedOpts.orig) {
|
99 |
+
title = selectedOpts.orig.attr('title') || (selectedOpts.titleFromAlt ? selectedOpts.orig.attr('alt') : '');
|
100 |
+
}
|
101 |
+
|
102 |
+
href = selectedOpts.href || (obj.nodeName ? $(obj).attr('href') : obj.href) || null;
|
103 |
+
|
104 |
+
if ((/^(?:javascript)/i).test(href) || href == '#') {
|
105 |
+
href = null;
|
106 |
+
}
|
107 |
+
|
108 |
+
if (selectedOpts.type) {
|
109 |
+
type = selectedOpts.type;
|
110 |
+
|
111 |
+
if (!href) {
|
112 |
+
href = selectedOpts.content;
|
113 |
+
}
|
114 |
+
|
115 |
+
} else if (selectedOpts.content) {
|
116 |
+
type = 'html';
|
117 |
+
|
118 |
+
} else if ( $(obj).hasClass('iframe') ) {
|
119 |
+
type = 'iframe';
|
120 |
+
|
121 |
+
} else if (href) {
|
122 |
+
if (href.match(imgRegExp) || $(obj).hasClass("image")) {
|
123 |
+
type = 'image';
|
124 |
+
|
125 |
+
} else if (href.match(swfRegExp)) {
|
126 |
+
type = 'swf';
|
127 |
+
|
128 |
+
} else if (href.match(svgRegExp)) {
|
129 |
+
type = 'svg';
|
130 |
+
|
131 |
+
} else if (href.match(pdfRegExp)) {
|
132 |
+
type = 'pdf';
|
133 |
+
|
134 |
+
} else if (href.indexOf("#") === 0) {
|
135 |
+
type = 'inline';
|
136 |
+
|
137 |
+
} else {
|
138 |
+
type = 'ajax';
|
139 |
+
}
|
140 |
+
}
|
141 |
+
|
142 |
+
if (!type) {
|
143 |
+
_error('No content type found.');
|
144 |
+
return;
|
145 |
+
}
|
146 |
+
|
147 |
+
if ($(obj).hasClass('modal')) {
|
148 |
+
selectedOpts.modal = true;
|
149 |
+
}
|
150 |
+
|
151 |
+
if (type == 'inline') {
|
152 |
+
obj = href.substr(href.indexOf("#"));
|
153 |
+
type = $(obj).length > 0 ? 'inline' : 'ajax';
|
154 |
+
}
|
155 |
+
|
156 |
+
selectedOpts.type = type;
|
157 |
+
selectedOpts.href = href;
|
158 |
+
selectedOpts.title = title;
|
159 |
+
|
160 |
+
if (selectedOpts.autoDimensions) {
|
161 |
+
if (selectedOpts.type == 'html' || selectedOpts.type == 'inline' || selectedOpts.type == 'ajax') {
|
162 |
+
selectedOpts.width = 'auto';
|
163 |
+
selectedOpts.height = 'auto';
|
164 |
+
} else {
|
165 |
+
selectedOpts.autoDimensions = false;
|
166 |
+
}
|
167 |
+
}
|
168 |
+
|
169 |
+
if (selectedOpts.modal) {
|
170 |
+
selectedOpts.overlayShow = true;
|
171 |
+
selectedOpts.hideOnOverlayClick = false;
|
172 |
+
selectedOpts.hideOnContentClick = false;
|
173 |
+
selectedOpts.enableEscapeButton = false;
|
174 |
+
selectedOpts.showCloseButton = false;
|
175 |
+
}
|
176 |
+
|
177 |
+
selectedOpts.padding = parseInt(selectedOpts.padding, 10);
|
178 |
+
selectedOpts.margin = parseInt(selectedOpts.margin, 10);
|
179 |
+
|
180 |
+
tmp.css('padding', (selectedOpts.padding + selectedOpts.margin));
|
181 |
+
|
182 |
+
$('.fancybox-inline-tmp').off('fancybox-cancel').on('fancybox-change', function() {
|
183 |
+
$(this).replaceWith(content.children());
|
184 |
+
});
|
185 |
+
|
186 |
+
switch (type) {
|
187 |
+
case 'html' :
|
188 |
+
tmp.html( selectedOpts.content );
|
189 |
+
_process_inline();
|
190 |
+
break;
|
191 |
+
|
192 |
+
case 'inline' :
|
193 |
+
if ( $(obj).parent().is('#fancybox-content') === true) {
|
194 |
+
busy = false;
|
195 |
+
return;
|
196 |
+
}
|
197 |
+
|
198 |
+
$('<div class="fancybox-inline-tmp" />')
|
199 |
+
.hide()
|
200 |
+
.insertBefore( $(obj) )
|
201 |
+
.on('fancybox-cleanup', function() {
|
202 |
+
$(this).replaceWith(content.find(obj));
|
203 |
+
}).on('fancybox-cancel', function() {
|
204 |
+
$(this).replaceWith(tmp.find(obj));
|
205 |
+
});
|
206 |
+
|
207 |
+
$(obj).appendTo(tmp);
|
208 |
+
|
209 |
+
_process_inline();
|
210 |
+
break;
|
211 |
+
|
212 |
+
case 'image':
|
213 |
+
selectedOpts.keepRatio = true;
|
214 |
+
|
215 |
+
busy = false;
|
216 |
+
|
217 |
+
$.fancybox.showActivity();
|
218 |
+
|
219 |
+
imgPreloader = new Image();
|
220 |
+
|
221 |
+
imgPreloader.onerror = function() {
|
222 |
+
_error('No image found.');
|
223 |
+
};
|
224 |
+
|
225 |
+
imgPreloader.onload = function() {
|
226 |
+
busy = true;
|
227 |
+
|
228 |
+
imgPreloader.onerror = imgPreloader.onload = null;
|
229 |
+
|
230 |
+
_process_image();
|
231 |
+
};
|
232 |
+
|
233 |
+
imgPreloader.src = href;
|
234 |
+
break;
|
235 |
+
|
236 |
+
case 'swf':
|
237 |
+
selectedOpts.scrolling = 'no';
|
238 |
+
selectedOpts.keepRatio = true;
|
239 |
+
|
240 |
+
str = '<object type="application/x-shockwave-flash" classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '"><param name="movie" value="' + href + '"></param>';
|
241 |
+
emb = '';
|
242 |
+
|
243 |
+
$.each(selectedOpts.swf, function(name, val) {
|
244 |
+
str += '<param name="' + name + '" value="' + val + '"></param>';
|
245 |
+
emb += ' ' + name + '="' + val + '"';
|
246 |
+
});
|
247 |
+
|
248 |
+
str += '<embed src="' + href + '" type="application/x-shockwave-flash" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '"' + emb + '></embed></object>';
|
249 |
+
|
250 |
+
tmp.html(str);
|
251 |
+
|
252 |
+
_process_inline();
|
253 |
+
break;
|
254 |
+
|
255 |
+
case 'svg':
|
256 |
+
selectedOpts.scrolling = 'no';
|
257 |
+
selectedOpts.keepRatio = true;
|
258 |
+
|
259 |
+
str = '<object type="image/svg+xml" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '" data="' + href + '"></object>';
|
260 |
+
|
261 |
+
tmp.html(str);
|
262 |
+
|
263 |
+
_process_inline();
|
264 |
+
break;
|
265 |
+
|
266 |
+
case 'pdf':
|
267 |
+
selectedOpts.scrolling = 'no';
|
268 |
+
selectedOpts.enableKeyboardNav = false;
|
269 |
+
selectedOpts.showNavArrows = false;
|
270 |
+
|
271 |
+
str = '<object type="application/pdf" width="100%" height="100%" data="' + href + '"><a href="' + href + '" style="display:block;position:absolute;top:48%;width:100%;text-align:center">' + $(obj).html() + '</a></object>';
|
272 |
+
|
273 |
+
tmp.html(str);
|
274 |
+
|
275 |
+
_process_inline();
|
276 |
+
break;
|
277 |
+
|
278 |
+
case 'ajax':
|
279 |
+
busy = false;
|
280 |
+
|
281 |
+
$.fancybox.showActivity();
|
282 |
+
|
283 |
+
selectedOpts.ajax.win = selectedOpts.ajax.success;
|
284 |
+
|
285 |
+
ajaxLoader = $.ajax($.extend({}, selectedOpts.ajax, {
|
286 |
+
url : href,
|
287 |
+
data : selectedOpts.ajax.data || {},
|
288 |
+
error : function(XMLHttpRequest, textStatus, errorThrown) {
|
289 |
+
if ( XMLHttpRequest.status > 0 ) {
|
290 |
+
_error(errorThrown);
|
291 |
+
}
|
292 |
+
},
|
293 |
+
success : function(data, textStatus, XMLHttpRequest) {
|
294 |
+
var o = typeof XMLHttpRequest == 'object' ? XMLHttpRequest : ajaxLoader;
|
295 |
+
if (o.status == 200) {
|
296 |
+
if ( typeof selectedOpts.ajax.win == 'function' ) {
|
297 |
+
ret = selectedOpts.ajax.win(href, data, textStatus, XMLHttpRequest);
|
298 |
+
|
299 |
+
if (ret === false) {
|
300 |
+
$.fancybox.hideActivity();
|
301 |
+
return;
|
302 |
+
} else if (typeof ret == 'string' || typeof ret == 'object') {
|
303 |
+
data = ret;
|
304 |
+
}
|
305 |
+
}
|
306 |
+
|
307 |
+
if ( data.indexOf("<!DOCTYPE") > -1 || data.indexOf("<html") > -1 || data.indexOf("<body") > -1 ) {
|
308 |
+
_error('Unexpected response.');
|
309 |
+
} else {
|
310 |
+
tmp.html( data );
|
311 |
+
_process_inline();
|
312 |
+
}
|
313 |
+
}
|
314 |
+
}
|
315 |
+
}));
|
316 |
+
break;
|
317 |
+
|
318 |
+
case 'iframe':
|
319 |
+
selectedOpts.enableKeyboardNav = false;
|
320 |
+
selectedOpts.showNavArrows = false;
|
321 |
+
|
322 |
+
$.fancybox.showActivity();
|
323 |
+
|
324 |
+
_show();
|
325 |
+
break;
|
326 |
+
}
|
327 |
+
},
|
328 |
+
|
329 |
+
_process_inline = function() {
|
330 |
+
var w = selectedOpts.width,
|
331 |
+
h = selectedOpts.height,
|
332 |
+
ww = $(window).width() == 0 ? window.innerWidth : $(window).width(),
|
333 |
+
wh = $(window).height() == 0 ? window.innerHeight : $(window).height();
|
334 |
+
|
335 |
+
if (w.toString().indexOf('%') > -1) {
|
336 |
+
w = parseInt( (ww - (selectedOpts.margin * 2)) * parseFloat(w) / 100, 10) + 'px';
|
337 |
+
|
338 |
+
} else {
|
339 |
+
w = w == 'auto' ? 'auto' : w + 'px';
|
340 |
+
}
|
341 |
+
|
342 |
+
if (h.toString().indexOf('%') > -1) {
|
343 |
+
h = parseInt( (wh - (selectedOpts.margin * 2)) * parseFloat(h) / 100, 10) + 'px';
|
344 |
+
|
345 |
+
} else {
|
346 |
+
h = h == 'auto' ? 'auto' : h + 'px';
|
347 |
+
}
|
348 |
+
|
349 |
+
tmp.wrapInner('<div style="width:' + w + ';height:' + h + ';overflow:' + (selectedOpts.scrolling == 'auto' ? 'auto' : (selectedOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + ';position:relative;"></div>');
|
350 |
+
|
351 |
+
selectedOpts.width = tmp.width();
|
352 |
+
selectedOpts.height = tmp.height();
|
353 |
+
|
354 |
+
_show();
|
355 |
+
},
|
356 |
+
|
357 |
+
_process_image = function() {
|
358 |
+
selectedOpts.width = imgPreloader.width;
|
359 |
+
selectedOpts.height = imgPreloader.height;
|
360 |
+
|
361 |
+
$("<img />").attr({
|
362 |
+
'id' : 'fancybox-img',
|
363 |
+
'src' : imgPreloader.src,
|
364 |
+
'alt' : selectedOpts.title
|
365 |
+
}).appendTo( tmp );
|
366 |
+
|
367 |
+
_show();
|
368 |
+
},
|
369 |
+
|
370 |
+
_show = function() {
|
371 |
+
var pos, equal;
|
372 |
+
|
373 |
+
if (selectedOpts.type !== 'iframe') {
|
374 |
+
$.fancybox.hideActivity();
|
375 |
+
}
|
376 |
+
|
377 |
+
if (wrap.is(":visible") && false === currentOpts.onCleanup(currentArray, currentIndex, currentOpts)) {
|
378 |
+
$('.fancybox-inline-tmp').trigger('fancybox-cancel');
|
379 |
+
|
380 |
+
busy = false;
|
381 |
+
return;
|
382 |
+
}
|
383 |
+
|
384 |
+
busy = true;
|
385 |
+
|
386 |
+
$(content.add( overlay )).off();
|
387 |
+
|
388 |
+
$(window).off("orientationchange.fb resize.fb scroll.fb");
|
389 |
+
$(document).off('keydown.fb');
|
390 |
+
|
391 |
+
if (wrap.is(":visible") && currentOpts.titlePosition !== 'outside') {
|
392 |
+
wrap.css('height', wrap.height());
|
393 |
+
}
|
394 |
+
|
395 |
+
currentArray = selectedArray;
|
396 |
+
currentIndex = selectedIndex;
|
397 |
+
currentOpts = selectedOpts;
|
398 |
+
|
399 |
+
if (currentOpts.overlayShow) {
|
400 |
+
overlay.css({
|
401 |
+
'background-color' : currentOpts.overlayColor,
|
402 |
+
'opacity' : currentOpts.overlayOpacity,
|
403 |
+
'cursor' : currentOpts.hideOnOverlayClick ? 'pointer' : 'auto',
|
404 |
+
'height' : $(document).height()
|
405 |
+
});
|
406 |
+
|
407 |
+
if (!overlay.is(':visible')) {
|
408 |
+
if (isIE6) {
|
409 |
+
$('select:not(#fancybox-tmp select)').filter(function() {
|
410 |
+
return this.style.visibility !== 'hidden';
|
411 |
+
}).css({'visibility' : 'hidden'}).one('fancybox-cleanup', function() {
|
412 |
+
this.style.visibility = 'inherit';
|
413 |
+
});
|
414 |
+
}
|
415 |
+
overlay.show();
|
416 |
+
}
|
417 |
+
} else {
|
418 |
+
overlay.hide();
|
419 |
+
}
|
420 |
+
|
421 |
+
final_pos = _get_zoom_to();
|
422 |
+
|
423 |
+
_process_title();
|
424 |
+
|
425 |
+
if (wrap.is(":visible")) {
|
426 |
+
$( close.add( nav_left ).add( nav_right ) ).hide();
|
427 |
+
|
428 |
+
pos = wrap.position(),
|
429 |
+
|
430 |
+
start_pos = {
|
431 |
+
top : pos.top,
|
432 |
+
left : pos.left,
|
433 |
+
width : wrap.width(),
|
434 |
+
height : wrap.height()
|
435 |
+
};
|
436 |
+
|
437 |
+
equal = (start_pos.width == final_pos.width && start_pos.height == final_pos.height);
|
438 |
+
|
439 |
+
content.fadeTo(currentOpts.changeFade, 0.3, function() {
|
440 |
+
var finish_resizing = function() {
|
441 |
+
content.html( tmp.contents() ).fadeTo(currentOpts.changeFade, 1, _finish);
|
442 |
+
};
|
443 |
+
|
444 |
+
$('.fancybox-inline-tmp').trigger('fancybox-change');
|
445 |
+
|
446 |
+
content
|
447 |
+
.empty()
|
448 |
+
.removeAttr('filter')
|
449 |
+
.css({
|
450 |
+
'border-width' : currentOpts.padding,
|
451 |
+
'width' : final_pos.width - currentOpts.padding * 2,
|
452 |
+
'height' : currentOpts.autoDimensions ? 'auto' : final_pos.height - titleHeight - currentOpts.padding * 2
|
453 |
+
});
|
454 |
+
|
455 |
+
if (equal) {
|
456 |
+
finish_resizing();
|
457 |
+
} else {
|
458 |
+
fx.prop = 0;
|
459 |
+
|
460 |
+
$(fx).animate({prop: 1}, {
|
461 |
+
duration : currentOpts.changeSpeed,
|
462 |
+
easing : currentOpts.easingChange,
|
463 |
+
step : _draw,
|
464 |
+
complete : finish_resizing
|
465 |
+
});
|
466 |
+
}
|
467 |
+
});
|
468 |
+
|
469 |
+
return;
|
470 |
+
}
|
471 |
+
|
472 |
+
wrap.removeAttr("style");
|
473 |
+
|
474 |
+
content.css('border-width', currentOpts.padding);
|
475 |
+
|
476 |
+
if (currentOpts.transitionIn == 'elastic') {
|
477 |
+
start_pos = _get_zoom_from();
|
478 |
+
|
479 |
+
content.html( tmp.contents() );
|
480 |
+
|
481 |
+
wrap.show();
|
482 |
+
|
483 |
+
if (currentOpts.opacity) {
|
484 |
+
final_pos.opacity = 0;
|
485 |
+
}
|
486 |
+
|
487 |
+
fx.prop = 0;
|
488 |
+
|
489 |
+
$(fx).animate({prop: 1}, {
|
490 |
+
duration : currentOpts.speedIn,
|
491 |
+
easing : currentOpts.easingIn,
|
492 |
+
step : _draw,
|
493 |
+
complete : _finish
|
494 |
+
});
|
495 |
+
|
496 |
+
return;
|
497 |
+
}
|
498 |
+
|
499 |
+
if (currentOpts.titlePosition == 'inside' && titleHeight > 0) {
|
500 |
+
title.show();
|
501 |
+
}
|
502 |
+
|
503 |
+
content
|
504 |
+
.css({
|
505 |
+
'width' : final_pos.width - currentOpts.padding * 2,
|
506 |
+
'height' : currentOpts.autoDimensions ? 'auto' : final_pos.height - titleHeight - currentOpts.padding * 2
|
507 |
+
})
|
508 |
+
.html( tmp.contents() );
|
509 |
+
|
510 |
+
wrap
|
511 |
+
.css(final_pos)
|
512 |
+
.fadeIn( currentOpts.transitionIn == 'none' ? 0 : currentOpts.speedIn, _finish );
|
513 |
+
},
|
514 |
+
|
515 |
+
_format_title = function(title) {
|
516 |
+
if (title && title.length) {
|
517 |
+
if (currentOpts.titlePosition == 'float') {
|
518 |
+
return '<table id="fancybox-title-float-wrap" style="border-spacing:0;border-collapse:collapse"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">' + title + '</td><td id="fancybox-title-float-right"></td></tr></table>';
|
519 |
+
}
|
520 |
+
|
521 |
+
return '<div id="fancybox-title-' + currentOpts.titlePosition + '">' + title + '</div>';
|
522 |
+
}
|
523 |
+
|
524 |
+
return false;
|
525 |
+
},
|
526 |
+
|
527 |
+
_process_title = function() {
|
528 |
+
titleStr = currentOpts.title || '';
|
529 |
+
titleHeight = 0;
|
530 |
+
|
531 |
+
title
|
532 |
+
.empty()
|
533 |
+
.removeAttr('style')
|
534 |
+
.removeClass();
|
535 |
+
|
536 |
+
if (currentOpts.titleShow === false) {
|
537 |
+
title.hide();
|
538 |
+
return;
|
539 |
+
}
|
540 |
+
|
541 |
+
titleStr = $.isFunction(currentOpts.titleFormat) ? currentOpts.titleFormat(titleStr, currentArray, currentIndex, currentOpts) : _format_title(titleStr);
|
542 |
+
|
543 |
+
if (!titleStr || titleStr === '') {
|
544 |
+
title.hide();
|
545 |
+
return;
|
546 |
+
}
|
547 |
+
|
548 |
+
title
|
549 |
+
.addClass('fancybox-title-' + currentOpts.titlePosition)
|
550 |
+
.html( titleStr )
|
551 |
+
.appendTo( 'body' )
|
552 |
+
.show();
|
553 |
+
|
554 |
+
switch (currentOpts.titlePosition) {
|
555 |
+
case 'inside':
|
556 |
+
title
|
557 |
+
.css({
|
558 |
+
'width' : final_pos.width - (currentOpts.padding * 2),
|
559 |
+
'marginLeft' : currentOpts.padding,
|
560 |
+
'marginRight' : currentOpts.padding
|
561 |
+
}).appendTo( outer );
|
562 |
+
|
563 |
+
titleHeight = title.outerHeight(true);
|
564 |
+
|
565 |
+
final_pos.height += titleHeight;
|
566 |
+
break;
|
567 |
+
|
568 |
+
case 'over':
|
569 |
+
title
|
570 |
+
.css({
|
571 |
+
'marginLeft' : currentOpts.padding,
|
572 |
+
'width' : final_pos.width - (currentOpts.padding * 2),
|
573 |
+
'bottom' : currentOpts.padding
|
574 |
+
})
|
575 |
+
.appendTo( outer );
|
576 |
+
break;
|
577 |
+
|
578 |
+
case 'float':
|
579 |
+
title
|
580 |
+
.css('left', parseInt( ( title.width() - final_pos.width ) / 2, 10 ) * -1 )
|
581 |
+
.appendTo( outer );
|
582 |
+
break;
|
583 |
+
|
584 |
+
default:
|
585 |
+
title
|
586 |
+
.css({
|
587 |
+
'width' : final_pos.width - (currentOpts.padding * 2),
|
588 |
+
'paddingLeft' : currentOpts.padding,
|
589 |
+
'paddingRight' : currentOpts.padding
|
590 |
+
})
|
591 |
+
.appendTo( wrap );
|
592 |
+
break;
|
593 |
+
}
|
594 |
+
|
595 |
+
title.hide();
|
596 |
+
},
|
597 |
+
|
598 |
+
_set_navigation = function() {
|
599 |
+
if (currentOpts.enableEscapeButton || currentOpts.enableKeyboardNav) {
|
600 |
+
$(document).on('keydown.fb', function(e) {
|
601 |
+
if (e.keyCode == 27 && currentOpts.enableEscapeButton) {
|
602 |
+
e.preventDefault();
|
603 |
+
$.fancybox.close();
|
604 |
+
} else if ((e.keyCode == 37 || e.keyCode == 39) && currentOpts.enableKeyboardNav && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
605 |
+
e.preventDefault();
|
606 |
+
$.fancybox[ e.keyCode == 37 ? 'prev' : 'next']();
|
607 |
+
} else if ((e.keyCode == 9) && currentOpts.enableKeyboardNav && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
608 |
+
e.preventDefault();
|
609 |
+
$.fancybox[ e.shiftKey ? 'prev' : 'next']();
|
610 |
+
}
|
611 |
+
});
|
612 |
+
}
|
613 |
+
|
614 |
+
if (!currentOpts.showNavArrows) {
|
615 |
+
nav_left.hide();
|
616 |
+
nav_right.hide();
|
617 |
+
return;
|
618 |
+
}
|
619 |
+
|
620 |
+
if ((currentOpts.cyclic && currentArray.length > 1) || currentIndex !== 0) {
|
621 |
+
nav_left.show();
|
622 |
+
}
|
623 |
+
|
624 |
+
if ((currentOpts.cyclic && currentArray.length > 1) || currentIndex != (currentArray.length -1)) {
|
625 |
+
nav_right.show();
|
626 |
+
}
|
627 |
+
},
|
628 |
+
|
629 |
+
_finish = function () {
|
630 |
+
if (isIE) {
|
631 |
+
content.css('filter', 0);
|
632 |
+
wrap.css('filter', 0);
|
633 |
+
}
|
634 |
+
|
635 |
+
if (currentOpts.autoDimensions) {
|
636 |
+
content.css('height','auto');
|
637 |
+
}
|
638 |
+
|
639 |
+
wrap.css('height', 'auto');
|
640 |
+
|
641 |
+
if (titleStr && titleStr.length) {
|
642 |
+
title.show();
|
643 |
+
}
|
644 |
+
|
645 |
+
if (currentOpts.showCloseButton) {
|
646 |
+
close.show();
|
647 |
+
}
|
648 |
+
|
649 |
+
_set_navigation();
|
650 |
+
|
651 |
+
if (currentOpts.hideOnContentClick) {
|
652 |
+
content.on('click', $.fancybox.close);
|
653 |
+
}
|
654 |
+
|
655 |
+
if (currentOpts.hideOnOverlayClick) {
|
656 |
+
overlay.on('click', $.fancybox.close);
|
657 |
+
}
|
658 |
+
|
659 |
+
if (currentOpts.autoResize) {
|
660 |
+
$(window).on("resize.fb", $.fancybox.resize);
|
661 |
+
}
|
662 |
+
|
663 |
+
if (currentOpts.centerOnScroll && !isTouch) {
|
664 |
+
$(window).on("scroll.fb", $.fancybox.center);
|
665 |
+
}
|
666 |
+
|
667 |
+
if ($.fn.mousewheel) {
|
668 |
+
wrap.on('mousewheel.fb', function(e, delta) {
|
669 |
+
if (busy) {
|
670 |
+
e.preventDefault();
|
671 |
+
} else if ( currentOpts.type == 'image' && ( $(e.target).outerHeight() == 0 || $(e.target).prop('scrollHeight') === $(e.target).outerHeight() ) ) {
|
672 |
+
e.preventDefault();
|
673 |
+
$.fancybox[ delta > 0 ? 'prev' : 'next' ]();
|
674 |
+
}
|
675 |
+
});
|
676 |
+
}
|
677 |
+
|
678 |
+
if (currentOpts.type == 'iframe') {
|
679 |
+
$('<iframe id="fancybox-frame" name="fancybox-frame' + new Date().getTime() + '"' + (navigator.userAgent.match(/msie [6]/i) ? ' allowtransparency="true""' : '')
|
680 |
+
+ ' style="border:0;margin:0;overflow:' + (currentOpts.scrolling == 'auto' ? 'auto' : (currentOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + '" src="'
|
681 |
+
+ currentOpts.href + '"' + (false === currentOpts.allowfullscreen ? '' : ' allowfullscreen') + ' allow="autoplay; encrypted-media" tabindex="999"></iframe>')
|
682 |
+
.appendTo(content).on('load',function() {
|
683 |
+
$.fancybox.hideActivity();
|
684 |
+
}).focus();
|
685 |
+
}
|
686 |
+
|
687 |
+
wrap.show();
|
688 |
+
|
689 |
+
busy = false;
|
690 |
+
|
691 |
+
$.fancybox.center();
|
692 |
+
|
693 |
+
currentOpts.onComplete(currentArray, currentIndex, currentOpts);
|
694 |
+
|
695 |
+
if (currentArray.length > 1) {
|
696 |
+
_preload_next();
|
697 |
+
_preload_prev();
|
698 |
+
}
|
699 |
+
},
|
700 |
+
|
701 |
+
_preload_next = function() {
|
702 |
+
var pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex + 1;
|
703 |
+
|
704 |
+
if ( pos >= currentArray.length ) {
|
705 |
+
if (currentOpts.cyclic) {
|
706 |
+
pos = 0;
|
707 |
+
} else {
|
708 |
+
return;
|
709 |
+
}
|
710 |
+
}
|
711 |
+
|
712 |
+
if ( pos == currentIndex ) {
|
713 |
+
currentOpts.enableKeyboardNav = false;
|
714 |
+
wrap.off('mousewheel.fb');
|
715 |
+
nav_right.hide();
|
716 |
+
return;
|
717 |
+
}
|
718 |
+
|
719 |
+
if ( _preload_image( pos ) ) {
|
720 |
+
return;
|
721 |
+
} else {
|
722 |
+
_preload_next( pos + 1 );
|
723 |
+
}
|
724 |
+
},
|
725 |
+
|
726 |
+
_preload_prev = function() {
|
727 |
+
var pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex - 1;
|
728 |
+
|
729 |
+
if ( pos < 0 ) {
|
730 |
+
if (currentOpts.cyclic) {
|
731 |
+
pos = currentArray.length - 1;
|
732 |
+
} else {
|
733 |
+
return;
|
734 |
+
}
|
735 |
+
}
|
736 |
+
|
737 |
+
if ( pos == currentIndex ) {
|
738 |
+
currentOpts.enableKeyboardNav = false;
|
739 |
+
wrap.off('mousewheel.fb');
|
740 |
+
nav_left.hide();
|
741 |
+
return;
|
742 |
+
}
|
743 |
+
|
744 |
+
if ( _preload_image( pos ) ) {
|
745 |
+
return;
|
746 |
+
} else {
|
747 |
+
_preload_prev( pos - 1 );
|
748 |
+
}
|
749 |
+
},
|
750 |
+
|
751 |
+
_preload_image = function(pos) {
|
752 |
+
var objNext, obj = currentArray[ pos ];
|
753 |
+
|
754 |
+
if ( typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href !== currentOpts.href && (obj.href.match(imgRegExp) || $(obj).hasClass("image")) ) {
|
755 |
+
objNext = new Image();
|
756 |
+
objNext.src = obj.href;
|
757 |
+
return true;
|
758 |
+
} else {
|
759 |
+
return false;
|
760 |
+
}
|
761 |
+
},
|
762 |
+
|
763 |
+
_draw = function(pos) {
|
764 |
+
var dim = {
|
765 |
+
width : parseInt(start_pos.width + (final_pos.width - start_pos.width) * pos, 10),
|
766 |
+
height : parseInt(start_pos.height + (final_pos.height - start_pos.height) * pos, 10),
|
767 |
+
|
768 |
+
top : parseInt(start_pos.top + (final_pos.top - start_pos.top) * pos, 10),
|
769 |
+
left : parseInt(start_pos.left + (final_pos.left - start_pos.left) * pos, 10)
|
770 |
+
};
|
771 |
+
|
772 |
+
if (typeof final_pos.opacity !== 'undefined') {
|
773 |
+
dim.opacity = pos < 0.5 ? 0.5 : pos;
|
774 |
+
}
|
775 |
+
|
776 |
+
wrap.css(dim);
|
777 |
+
|
778 |
+
content.css({
|
779 |
+
'width' : dim.width - currentOpts.padding * 2,
|
780 |
+
'height' : dim.height - (titleHeight * pos) - currentOpts.padding * 2
|
781 |
+
});
|
782 |
+
},
|
783 |
+
|
784 |
+
_get_viewport = function() {
|
785 |
+
var w = !isTouch && window.innerWidth && document.documentElement.clientWidth ?
|
786 |
+
Math.min(window.innerWidth, document.documentElement.clientWidth) :
|
787 |
+
window.innerWidth || document.documentElement.clientWidth || document.getElementsByTagName('body')[0].clientWidth,
|
788 |
+
h = !isTouch && window.innerHeight && document.documentElement.clientHeight ?
|
789 |
+
Math.min(window.innerHeight, document.documentElement.clientHeight) :
|
790 |
+
window.innerHeight || document.documentElement.clientHeight || document.getElementsByTagName('body')[0].clientHeight,
|
791 |
+
margin;
|
792 |
+
|
793 |
+
margin = arguments[0] === true ? 0 : currentOpts.margin;
|
794 |
+
|
795 |
+
return [
|
796 |
+
w - (margin * 2),
|
797 |
+
h - (margin * 2),
|
798 |
+
$(document).scrollLeft() + margin,
|
799 |
+
$(document).scrollTop() + margin
|
800 |
+
];
|
801 |
+
},
|
802 |
+
|
803 |
+
_get_zoom_to = function () {
|
804 |
+
var view = _get_viewport(),
|
805 |
+
to = {},
|
806 |
+
double_padding = currentOpts.padding * 2,
|
807 |
+
ratio;
|
808 |
+
|
809 |
+
if (currentOpts.width.toString().indexOf('%') > -1) {
|
810 |
+
to.width = parseInt((view[0] * parseFloat(currentOpts.width)) / 100, 10);
|
811 |
+
} else {
|
812 |
+
to.width = currentOpts.width + double_padding;
|
813 |
+
}
|
814 |
+
|
815 |
+
if (currentOpts.height.toString().indexOf('%') > -1) {
|
816 |
+
to.height = parseInt((view[1] * parseFloat(currentOpts.height)) / 100, 10);
|
817 |
+
} else {
|
818 |
+
to.height = currentOpts.height + double_padding;
|
819 |
+
}
|
820 |
+
|
821 |
+
if (currentOpts.autoScale && (to.width > view[0] || to.height > view[1])) {
|
822 |
+
if (currentOpts.keepRatio) {
|
823 |
+
ratio = currentOpts.width / currentOpts.height;
|
824 |
+
|
825 |
+
if ((to.width ) > view[0]) {
|
826 |
+
to.width = view[0];
|
827 |
+
to.height = parseInt(((to.width - double_padding) / ratio) + double_padding, 10);
|
828 |
+
}
|
829 |
+
|
830 |
+
if ((to.height) > view[1]) {
|
831 |
+
to.height = view[1];
|
832 |
+
to.width = parseInt(((to.height - double_padding) * ratio) + double_padding, 10);
|
833 |
+
}
|
834 |
+
} else {
|
835 |
+
to.width = Math.min(to.width, view[0]);
|
836 |
+
to.height = Math.min(to.height, view[1]);
|
837 |
+
}
|
838 |
+
}
|
839 |
+
|
840 |
+
to.top = parseInt(Math.max(view[3] - 20, view[3] + ((view[1] - to.height - 40) * 0.5)), 10);
|
841 |
+
to.left = parseInt(Math.max(view[2] - 20, view[2] + ((view[0] - to.width - 40) * 0.5)), 10);
|
842 |
+
|
843 |
+
return to;
|
844 |
+
},
|
845 |
+
|
846 |
+
_get_obj_pos = function(obj) {
|
847 |
+
var pos = obj.offset();
|
848 |
+
|
849 |
+
pos.top += parseInt( obj.css('paddingTop'), 10 ) || 0;
|
850 |
+
pos.left += parseInt( obj.css('paddingLeft'), 10 ) || 0;
|
851 |
+
|
852 |
+
pos.top += parseInt( obj.css('border-top-width'), 10 ) || 0;
|
853 |
+
pos.left += parseInt( obj.css('border-left-width'), 10 ) || 0;
|
854 |
+
|
855 |
+
pos.width = obj.width();
|
856 |
+
pos.height = obj.height();
|
857 |
+
|
858 |
+
return pos;
|
859 |
+
},
|
860 |
+
|
861 |
+
_get_zoom_from = function() {
|
862 |
+
var orig = selectedOpts.orig ? $(selectedOpts.orig) : false,
|
863 |
+
from = {},
|
864 |
+
pos,
|
865 |
+
view;
|
866 |
+
|
867 |
+
if (orig && orig.length) {
|
868 |
+
pos = _get_obj_pos(orig);
|
869 |
+
|
870 |
+
from = {
|
871 |
+
width : pos.width + (currentOpts.padding * 2),
|
872 |
+
height : pos.height + (currentOpts.padding * 2),
|
873 |
+
top : pos.top - currentOpts.padding - 20,
|
874 |
+
left : pos.left - currentOpts.padding - 20
|
875 |
+
};
|
876 |
+
|
877 |
+
} else {
|
878 |
+
view = _get_viewport();
|
879 |
+
|
880 |
+
from = {
|
881 |
+
width : currentOpts.padding * 2,
|
882 |
+
height : currentOpts.padding * 2,
|
883 |
+
top : parseInt((view[3] + view[1]) * 0.5, 10),
|
884 |
+
left : parseInt((view[2] + view[0]) * 0.5, 10)
|
885 |
+
};
|
886 |
+
}
|
887 |
+
|
888 |
+
return from;
|
889 |
+
},
|
890 |
+
|
891 |
+
_animate_loading = function() {
|
892 |
+
if (!loading.is(':visible')){
|
893 |
+
clearInterval(loadingTimer);
|
894 |
+
return;
|
895 |
+
}
|
896 |
+
|
897 |
+
$('div', loading).css('top', (loadingFrame * - 40 ) + 'px');
|
898 |
+
|
899 |
+
loadingFrame = (loadingFrame + 1) % 12;
|
900 |
+
};
|
901 |
+
|
902 |
+
/*
|
903 |
+
* Public methods
|
904 |
+
*/
|
905 |
+
|
906 |
+
$.fn.fancybox = function(options) {
|
907 |
+
if (!$(this).length) {
|
908 |
+
return this;
|
909 |
+
}
|
910 |
+
|
911 |
+
$(this)
|
912 |
+
.data('fancybox', $.extend({}, options, ($.metadata ? $(this).metadata() : {})))
|
913 |
+
.off('click.fb')
|
914 |
+
.on('click.fb', function(e) {
|
915 |
+
e.preventDefault();
|
916 |
+
|
917 |
+
if (busy) {
|
918 |
+
return;
|
919 |
+
}
|
920 |
+
|
921 |
+
busy = true;
|
922 |
+
|
923 |
+
$(this).blur();
|
924 |
+
|
925 |
+
selectedArray = [];
|
926 |
+
selectedIndex = 0;
|
927 |
+
|
928 |
+
var rel = $(this).attr('rel') || '';
|
929 |
+
|
930 |
+
if (rel == '' || rel.replace(/alternate|external|help|license|nofollow|noreferrer|noopener|\s+/gi,'') == '') {
|
931 |
+
selectedArray.push(this);
|
932 |
+
} else {
|
933 |
+
selectedArray = $('a[rel="' + rel + '"], area[rel="' + rel + '"]');
|
934 |
+
selectedIndex = selectedArray.index( this );
|
935 |
+
}
|
936 |
+
|
937 |
+
_start();
|
938 |
+
|
939 |
+
return false;
|
940 |
+
});
|
941 |
+
|
942 |
+
return this;
|
943 |
+
};
|
944 |
+
|
945 |
+
$.fancybox = function(obj) {
|
946 |
+
var opts;
|
947 |
+
|
948 |
+
if (busy) {
|
949 |
+
return;
|
950 |
+
}
|
951 |
+
|
952 |
+
busy = true;
|
953 |
+
opts = typeof arguments[1] !== 'undefined' ? arguments[1] : {};
|
954 |
+
|
955 |
+
selectedArray = [];
|
956 |
+
selectedIndex = parseInt(opts.index, 10) || 0;
|
957 |
+
|
958 |
+
if ( $.isArray(obj) ) {
|
959 |
+
for (var i = 0, j = obj.length; i < j; i++) {
|
960 |
+
if (typeof obj[i] == 'object') {
|
961 |
+
$(obj[i]).data('fancybox', $.extend({}, opts, obj[i]));
|
962 |
+
} else {
|
963 |
+
obj[i] = $({}).data('fancybox', $.extend({content : obj[i]}, opts));
|
964 |
+
}
|
965 |
+
}
|
966 |
+
|
967 |
+
selectedArray = jQuery.merge(selectedArray, obj);
|
968 |
+
|
969 |
+
} else {
|
970 |
+
if ( typeof obj == 'object' ) {
|
971 |
+
$(obj).data('fancybox', $.extend({}, opts, obj));
|
972 |
+
} else {
|
973 |
+
obj = $({}).data('fancybox', $.extend({content : obj}, opts));
|
974 |
+
}
|
975 |
+
|
976 |
+
selectedArray.push(obj);
|
977 |
+
}
|
978 |
+
|
979 |
+
if (selectedIndex > selectedArray.length || selectedIndex < 0) {
|
980 |
+
selectedIndex = 0;
|
981 |
+
}
|
982 |
+
|
983 |
+
_start();
|
984 |
+
};
|
985 |
+
|
986 |
+
$.fancybox.showActivity = function() {
|
987 |
+
clearInterval(loadingTimer);
|
988 |
+
|
989 |
+
loading.show();
|
990 |
+
loadingTimer = setInterval( _animate_loading, 66 );
|
991 |
+
};
|
992 |
+
|
993 |
+
$.fancybox.hideActivity = function() {
|
994 |
+
loading.hide();
|
995 |
+
};
|
996 |
+
|
997 |
+
$.fancybox.next = function() {
|
998 |
+
var obj, pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex + 1;
|
999 |
+
|
1000 |
+
if (pos >= currentArray.length) {
|
1001 |
+
if (currentOpts.cyclic) {
|
1002 |
+
pos = 0;
|
1003 |
+
} else {
|
1004 |
+
return;
|
1005 |
+
}
|
1006 |
+
}
|
1007 |
+
|
1008 |
+
obj = currentArray[pos];
|
1009 |
+
|
1010 |
+
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
1011 |
+
$.fancybox.next( pos + 1 );
|
1012 |
+
} else {
|
1013 |
+
$.fancybox.pos( pos );
|
1014 |
+
}
|
1015 |
+
|
1016 |
+
return;
|
1017 |
+
};
|
1018 |
+
|
1019 |
+
$.fancybox.prev = function() {
|
1020 |
+
var obj, pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex - 1;
|
1021 |
+
|
1022 |
+
if (pos < 0) {
|
1023 |
+
if (currentOpts.cyclic) {
|
1024 |
+
pos = currentArray.length - 1;
|
1025 |
+
} else {
|
1026 |
+
return;
|
1027 |
+
}
|
1028 |
+
}
|
1029 |
+
|
1030 |
+
obj = currentArray[pos];
|
1031 |
+
|
1032 |
+
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
1033 |
+
$.fancybox.prev( pos - 1 );
|
1034 |
+
} else {
|
1035 |
+
$.fancybox.pos( pos );
|
1036 |
+
}
|
1037 |
+
|
1038 |
+
return;
|
1039 |
+
};
|
1040 |
+
|
1041 |
+
$.fancybox.pos = function(pos) {
|
1042 |
+
if (busy) {
|
1043 |
+
return;
|
1044 |
+
}
|
1045 |
+
|
1046 |
+
pos = parseInt(pos);
|
1047 |
+
|
1048 |
+
selectedArray = currentArray;
|
1049 |
+
|
1050 |
+
if (pos > -1 && pos < currentArray.length) {
|
1051 |
+
selectedIndex = pos;
|
1052 |
+
_start();
|
1053 |
+
}
|
1054 |
+
|
1055 |
+
return;
|
1056 |
+
};
|
1057 |
+
|
1058 |
+
$.fancybox.cancel = function() {
|
1059 |
+
if (busy) {
|
1060 |
+
return;
|
1061 |
+
}
|
1062 |
+
|
1063 |
+
busy = true;
|
1064 |
+
|
1065 |
+
$('.fancybox-inline-tmp').trigger('fancybox-cancel');
|
1066 |
+
|
1067 |
+
_abort();
|
1068 |
+
|
1069 |
+
selectedOpts.onCancel(selectedArray, selectedIndex, selectedOpts);
|
1070 |
+
|
1071 |
+
busy = false;
|
1072 |
+
};
|
1073 |
+
|
1074 |
+
// Note: within an iframe use - parent.$.fancybox.close();
|
1075 |
+
$.fancybox.close = function() {
|
1076 |
+
if (busy || wrap.is(':hidden')) {
|
1077 |
+
return;
|
1078 |
+
}
|
1079 |
+
|
1080 |
+
busy = true;
|
1081 |
+
|
1082 |
+
if (currentOpts && false === currentOpts.onCleanup(currentArray, currentIndex, currentOpts)) {
|
1083 |
+
busy = false;
|
1084 |
+
return;
|
1085 |
+
}
|
1086 |
+
|
1087 |
+
_abort();
|
1088 |
+
|
1089 |
+
$(close.add( nav_left ).add( nav_right )).hide();
|
1090 |
+
|
1091 |
+
$(content.add( overlay )).off();
|
1092 |
+
|
1093 |
+
$(window).off("orientationchange.fb resize.fb scroll.fb mousewheel.fb");
|
1094 |
+
$(document).off('keydown.fb');
|
1095 |
+
|
1096 |
+
// This helps IE
|
1097 |
+
if (isIE) {
|
1098 |
+
content.find('iframe#fancybox-frame').attr('src', isIE6 && /^https/i.test(window.location.href || '') ? 'javascript:void(false)' : '//about:blank');
|
1099 |
+
}
|
1100 |
+
|
1101 |
+
if (currentOpts.titlePosition !== 'inside') {
|
1102 |
+
title.empty();
|
1103 |
+
}
|
1104 |
+
|
1105 |
+
wrap.stop();
|
1106 |
+
|
1107 |
+
function _cleanup() {
|
1108 |
+
overlay.fadeOut('fast');
|
1109 |
+
|
1110 |
+
title.empty().hide();
|
1111 |
+
wrap.hide();
|
1112 |
+
|
1113 |
+
$('.fancybox-inline-tmp').trigger('fancybox-cleanup');
|
1114 |
+
|
1115 |
+
content.empty();
|
1116 |
+
|
1117 |
+
currentOpts.onClosed(currentArray, currentIndex, currentOpts);
|
1118 |
+
|
1119 |
+
currentArray = selectedOpts = [];
|
1120 |
+
currentIndex = selectedIndex = 0;
|
1121 |
+
currentOpts = selectedOpts = {};
|
1122 |
+
|
1123 |
+
busy = false;
|
1124 |
+
}
|
1125 |
+
|
1126 |
+
if (currentOpts.transitionOut == 'elastic') {
|
1127 |
+
start_pos = _get_zoom_from();
|
1128 |
+
|
1129 |
+
var pos = wrap.position();
|
1130 |
+
|
1131 |
+
final_pos = {
|
1132 |
+
top : pos.top ,
|
1133 |
+
left : pos.left,
|
1134 |
+
width : wrap.width(),
|
1135 |
+
height : wrap.height()
|
1136 |
+
};
|
1137 |
+
|
1138 |
+
if (currentOpts.opacity) {
|
1139 |
+
final_pos.opacity = 1;
|
1140 |
+
}
|
1141 |
+
|
1142 |
+
title.empty().hide();
|
1143 |
+
|
1144 |
+
fx.prop = 1;
|
1145 |
+
|
1146 |
+
$(fx).animate({ prop: 0 }, {
|
1147 |
+
duration : currentOpts.speedOut,
|
1148 |
+
easing : currentOpts.easingOut,
|
1149 |
+
step : _draw,
|
1150 |
+
complete : _cleanup
|
1151 |
+
});
|
1152 |
+
|
1153 |
+
} else {
|
1154 |
+
wrap.fadeOut( currentOpts.transitionOut == 'none' ? 0 : currentOpts.speedOut, _cleanup);
|
1155 |
+
}
|
1156 |
+
};
|
1157 |
+
|
1158 |
+
$.fancybox.resize = function() {
|
1159 |
+
var pos;
|
1160 |
+
|
1161 |
+
clearTimeout( resize_timeout );
|
1162 |
+
|
1163 |
+
resize_timeout = setTimeout( function() {
|
1164 |
+
var finish_resizing = function() {
|
1165 |
+
if (selectedOpts.autoDimensions) {
|
1166 |
+
content.css('height','auto');
|
1167 |
+
}
|
1168 |
+
|
1169 |
+
wrap.css('height', 'auto');
|
1170 |
+
|
1171 |
+
if (titleStr && titleStr.length) {
|
1172 |
+
title.show();
|
1173 |
+
}
|
1174 |
+
|
1175 |
+
busy = false;
|
1176 |
+
|
1177 |
+
$.fancybox.center(true);
|
1178 |
+
};
|
1179 |
+
|
1180 |
+
if (overlay.is(':visible')) {
|
1181 |
+
overlay.css('height', $(document).height());
|
1182 |
+
}
|
1183 |
+
|
1184 |
+
pos = wrap.position(),
|
1185 |
+
|
1186 |
+
start_pos = {
|
1187 |
+
top : pos.top,
|
1188 |
+
left : pos.left,
|
1189 |
+
width : wrap.width(),
|
1190 |
+
height : wrap.height()
|
1191 |
+
};
|
1192 |
+
|
1193 |
+
final_pos = _get_zoom_to();
|
1194 |
+
|
1195 |
+
busy = true;
|
1196 |
+
|
1197 |
+
_process_title();
|
1198 |
+
|
1199 |
+
fx.prop = 0;
|
1200 |
+
|
1201 |
+
$(fx).animate({prop: 1}, {
|
1202 |
+
duration : currentOpts.changeSpeed,
|
1203 |
+
easing : currentOpts.easingChange,
|
1204 |
+
step : _draw,
|
1205 |
+
complete : finish_resizing
|
1206 |
+
});
|
1207 |
+
}, 500 );
|
1208 |
+
};
|
1209 |
+
|
1210 |
+
$.fancybox.center = function() {
|
1211 |
+
var view, align;
|
1212 |
+
|
1213 |
+
if (busy) {
|
1214 |
+
return;
|
1215 |
+
}
|
1216 |
+
|
1217 |
+
align = arguments[0] === true ? 1 : 0;
|
1218 |
+
view = _get_viewport(true);
|
1219 |
+
|
1220 |
+
if (!align && ((wrap.width() + 40) > view[0] || (wrap.height() + 40) > view[1])) {
|
1221 |
+
return;
|
1222 |
+
}
|
1223 |
+
|
1224 |
+
wrap
|
1225 |
+
.stop()
|
1226 |
+
.animate({
|
1227 |
+
'top' : parseInt(Math.max(view[3] - 20, view[3] + ((view[1] - content.height() - 40) * 0.5) - currentOpts.padding)),
|
1228 |
+
'left' : parseInt(Math.max(view[2] - 20, view[2] + ((view[0] - content.width() - 40) * 0.5) - currentOpts.padding))
|
1229 |
+
}, typeof arguments[0] == 'number' ? arguments[0] : 300);
|
1230 |
+
};
|
1231 |
+
|
1232 |
+
$.fancybox.init = function() {
|
1233 |
+
if ($("#fancybox-wrap").length) {
|
1234 |
+
return;
|
1235 |
+
}
|
1236 |
+
|
1237 |
+
$('body').append(
|
1238 |
+
tmp = $('<div id="fancybox-tmp"></div>'),
|
1239 |
+
loading = $('<div id="fancybox-loading"><div></div></div>'),
|
1240 |
+
overlay = $('<div id="fancybox-overlay"></div>'),
|
1241 |
+
wrap = $('<div id="fancybox-wrap"></div>')
|
1242 |
+
);
|
1243 |
+
|
1244 |
+
outer = $('<div id="fancybox-outer"></div>')
|
1245 |
+
.append('<div class="fancybox-bg" id="fancybox-bg-n"></div><div class="fancybox-bg" id="fancybox-bg-ne"></div><div class="fancybox-bg" id="fancybox-bg-e"></div><div class="fancybox-bg" id="fancybox-bg-se"></div><div class="fancybox-bg" id="fancybox-bg-s"></div><div class="fancybox-bg" id="fancybox-bg-sw"></div><div class="fancybox-bg" id="fancybox-bg-w"></div><div class="fancybox-bg" id="fancybox-bg-nw"></div>')
|
1246 |
+
.appendTo( wrap );
|
1247 |
+
|
1248 |
+
outer.append(
|
1249 |
+
content = $('<div id="fancybox-content"></div>'),
|
1250 |
+
close = $('<a id="fancybox-close" title="Close" class="fancy-ico" href="javascript:;"></a>'),
|
1251 |
+
title = $('<div id="fancybox-title"></div>'),
|
1252 |
+
|
1253 |
+
nav_left = $('<a id="fancybox-left" title="Previous" href="javascript:;"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),
|
1254 |
+
nav_right = $('<a id="fancybox-right" title="Next" href="javascript:;"><span class="fancy-ico" id="fancybox-right-ico"></span></a>')
|
1255 |
+
);
|
1256 |
+
|
1257 |
+
close.click($.fancybox.close);
|
1258 |
+
loading.click($.fancybox.cancel);
|
1259 |
+
|
1260 |
+
nav_left.click(function(e) {
|
1261 |
+
e.preventDefault();
|
1262 |
+
$.fancybox.prev();
|
1263 |
+
});
|
1264 |
+
|
1265 |
+
nav_right.click(function(e) {
|
1266 |
+
e.preventDefault();
|
1267 |
+
$.fancybox.next();
|
1268 |
+
});
|
1269 |
+
|
1270 |
+
if (isIE) {
|
1271 |
+
wrap.addClass('fancybox-ie');
|
1272 |
+
}
|
1273 |
+
|
1274 |
+
if (isIE6) {
|
1275 |
+
loading.addClass('fancybox-ie6');
|
1276 |
+
wrap.addClass('fancybox-ie6');
|
1277 |
+
|
1278 |
+
$('<iframe id="fancybox-hide-sel-frame" src="' + (/^https/i.test(window.location.href || '') ? 'javascript:void(false)' : 'about:blank' ) + '" style="overflow:hidden;border:0" tabindex="-1"></iframe>').prependTo(outer);
|
1279 |
+
}
|
1280 |
+
};
|
1281 |
+
|
1282 |
+
$.fn.fancybox.defaults = {
|
1283 |
+
padding : 10,
|
1284 |
+
margin : 40,
|
1285 |
+
opacity : false,
|
1286 |
+
modal : false,
|
1287 |
+
cyclic : false,
|
1288 |
+
allowfullscreen : false,
|
1289 |
+
scrolling : 'auto', // 'auto', 'yes' or 'no'
|
1290 |
+
|
1291 |
+
width : 560,
|
1292 |
+
height : 340,
|
1293 |
+
|
1294 |
+
autoScale : true,
|
1295 |
+
autoDimensions : true,
|
1296 |
+
centerOnScroll : false,
|
1297 |
+
autoResize : true,
|
1298 |
+
keepRatio : false,
|
1299 |
+
minViewportWidth : 0,
|
1300 |
+
|
1301 |
+
ajax : {},
|
1302 |
+
swf : { wmode: 'opaque' },
|
1303 |
+
svg : { wmode: 'opaque' },
|
1304 |
+
|
1305 |
+
hideOnOverlayClick : true,
|
1306 |
+
hideOnContentClick : false,
|
1307 |
+
|
1308 |
+
overlayShow : true,
|
1309 |
+
overlayOpacity : 0.7,
|
1310 |
+
overlayColor : '#777',
|
1311 |
+
|
1312 |
+
titleShow : true,
|
1313 |
+
titlePosition : 'float', // 'float', 'outside', 'inside' or 'over'
|
1314 |
+
titleFormat : null,
|
1315 |
+
titleFromAlt : true,
|
1316 |
+
|
1317 |
+
transitionIn : 'fade', // 'elastic', 'fade' or 'none'
|
1318 |
+
transitionOut : 'fade', // 'elastic', 'fade' or 'none'
|
1319 |
+
|
1320 |
+
speedIn : 300,
|
1321 |
+
speedOut : 300,
|
1322 |
+
|
1323 |
+
changeSpeed : 300,
|
1324 |
+
changeFade : 'fast',
|
1325 |
+
|
1326 |
+
easingIn : 'swing',
|
1327 |
+
easingOut : 'swing',
|
1328 |
+
|
1329 |
+
showCloseButton : true,
|
1330 |
+
showNavArrows : true,
|
1331 |
+
enableEscapeButton : true,
|
1332 |
+
enableKeyboardNav : true,
|
1333 |
+
|
1334 |
+
onStart : function(){},
|
1335 |
+
onCancel : function(){},
|
1336 |
+
onComplete : function(){},
|
1337 |
+
onCleanup : function(){},
|
1338 |
+
onClosed : function(){},
|
1339 |
+
onError : function(){}
|
1340 |
+
};
|
1341 |
+
|
1342 |
+
$(document).ready(function() {
|
1343 |
+
$.fancybox.init();
|
1344 |
+
});
|
1345 |
+
|
1346 |
+
})(jQuery);
|
fancybox/1.3.26/jquery.fancybox.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
#fancybox-loading,#fancybox-loading div,#fancybox-overlay,#fancybox-wrap,.fancybox-bg,#fancybox-outer,#fancybox-content,#fancybox-content>div,#fancybox-content>div>div,#fancybox-frame,#fancybox-close,#fancybox-title,#fancybox-title div,#fancybox-left,#fancybox-right,.fancy-ico{box-sizing:content-box;-moz-box-sizing:content-box;}#fancybox-loading{position:fixed;top:50%;left:50%;width:40px;height:40px;margin-top:-20px;margin-left:-20px;cursor:pointer;overflow:hidden;z-index:111104;display:none;}#fancybox-loading div{position:absolute;top:0;left:0;width:40px;height:480px;background-image:url('fancybox.png');}#fancybox-overlay{position:absolute;top:0;left:0;width:100%;z-index:111100;display:none;}#fancybox-tmp{padding:0;margin:0;border:0;overflow:auto;display:none;}#fancybox-wrap{position:absolute;top:0;left:0;padding:20px;z-index:111101;display:none;}#fancybox-outer{position:relative;width:100%;height:100%;background:#fff;box-shadow:0 0 20px #111;-moz-box-shadow:0 0 20px #111;-webkit-box-shadow:0 0 20px #111;}#fancybox-content{width:0;height:0;padding:0;position:relative;-webkit-overflow-scrolling:touch;overflow-y:auto;z-index:111102;border:0 solid #fff;background:#fff;-moz-background-clip:padding;-webkit-background-clip:padding;background-clip:padding-box}#fancybox-content>div{max-width:100%;max-height:100%;}#fancybox-hide-sel-frame{position:absolute;top:0;left:0;width:100%;height:100%;background:transparent;z-index:111101;}#fancybox-close{position:absolute;top:-15px;right:-15px;width:30px;height:30px;background:transparent url('fancybox.png') -40px 0;cursor:pointer;z-index:111103;display:none;}#fancybox-error{color:#444;padding:14px;margin:0;}#fancybox-frame,#fancybox-img{width:100%;height:100%;border:none;}#fancybox-img{padding:0;margin:0;line-height:0;vertical-align:top;max-width:none!important;max-height:none!important}#fancybox-frame{display:block;width:100%;height:100%;z-index:0}#fancybox-left,#fancybox-right{position:absolute;bottom:0;height:100%;width:35%;cursor:pointer;background:initial;z-index:111102;display:none;}#fancybox-left{left:0;}.rtl #fancybox-left{left:auto;right:0}#fancybox-right{right:0;}.rtl #fancybox-right{left:0;right:auto}#fancybox-left-ico,#fancybox-right-ico{position:absolute;top:50%;left:-9999px;width:30px;height:30px;margin-top:-15px;cursor:pointer;z-index:111102;display:block;}#fancybox-left-ico{background-image:url('fancybox.png');background-position:-40px -30px;}.rtl #fancybox-left-ico{background-position:-40px -60px;right:-9999px}#fancybox-right-ico{background-image:url('fancybox.png');background-position:-40px -60px;}.rtl #fancybox-right-ico{background-position:-40px -30px;right:-9999px}#fancybox-left:focus,#fancybox-right:focus{outline:none;background:initial;}#fancybox-left:hover span{left:20px;}.rtl #fancybox-left:hover span{right:20px}#fancybox-right:hover span{left:auto;right:20px;}.rtl #fancybox-right:hover span{right:auto;left:20px}#fancybox-title{z-index:111102;}.fancybox-title-inside{padding-bottom:10px;text-align:center;color:#333;position:relative;}.fancybox-title-outside{padding-top:10px;color:#fff;font-weight:600;}.fancybox-title-over{position:absolute;bottom:0;left:0;color:#FFF;text-align:left;}.rtl .fancybox-title-over{text-align:right}#fancybox-title-over{padding:10px;background:rgba(0,0,0,.64);display:block;}.fancybox-title-float{position:absolute;left:0;bottom:-20px;height:32px;}#fancybox-title-float-wrap{border:none;border-collapse:collapse;width:auto;}#fancybox-title-float-wrap tr,#fancybox-title-float-wrap td{border:none;white-space:nowrap;}#fancybox-title-float-left{padding:0 0 0 15px;background:url('fancybox.png') -40px -90px no-repeat;}#fancybox-title-float-main{color:#fff;line-height:29px;font-weight:600;font-size:14px;padding:0 0 3px 0;background:url('fancybox-x.png') 0px -40px;}#fancybox-title-float-right{padding:0 0 0 15px;background:url('fancybox.png') -55px -90px no-repeat;}
|
fancybox/1.3.26/jquery.fancybox.min.js
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
!function(e){var t,i,n,o,a,d,r,c,s,l,h,f,p,g,b=0,u={},y=[],m=0,w={},v=[],x=null,_=new Image,k=/\.(jpg|gif|png|bmp|jpeg|webp)(.*)?$/i,C=/[^\.]\.(swf)\s*$/i,I=/[^\.]\.(svg)\s*$/i,j=/[^\.]\.(pdf)\s*$/i,O=1,T=0,N="",A=!1,E=e.extend(e("<div/>")[0],{prop:0}),S=/MSIE|Trident/.test(window.navigator.userAgent),D=S&&!window.XMLHttpRequest,W=void 0!==document.createTouch;_abort=function(){e.fancybox.hideActivity(),_.onerror=_.onload=null,x&&x.abort(),t.empty()},_error=function(i){if(!1===u.onError(y,b,u))return e.fancybox.hideActivity(),void(A=!1);void 0===i&&(i="Please try again later."),u.titleShow=!1,u.width="auto",u.height="auto",t.html('<p id="fancybox-error">The requested content cannot be loaded.<br />'+i+"</p>"),_process_inline()},_start=function(){var i,n,o,a,r,c,s=y[b];if(_abort(),u=e.extend({},e.fn.fancybox.defaults,void 0===e(s).data("fancybox")?u:e(s).data("fancybox")),document.documentElement.clientWidth<u.minViewportWidth)A=!1;else if(!1!==(c=u.onStart(y,b,u)))if("object"==typeof c&&(u=e.extend(u,c)),o=u.title||(s.nodeName?e(s).attr("title"):s.title)||"",s.nodeName&&!u.orig&&(u.orig=e(s).find("img:first").length?e(s).find("img:first"):e(s)),""===o&&u.orig&&(o=u.orig.attr("title")||(u.titleFromAlt?u.orig.attr("alt"):"")),i=u.href||(s.nodeName?e(s).attr("href"):s.href)||null,(/^(?:javascript)/i.test(i)||"#"==i)&&(i=null),u.type?(n=u.type,i||(i=u.content)):u.content?n="html":e(s).hasClass("iframe")?n="iframe":i&&(n=i.match(k)||e(s).hasClass("image")?"image":i.match(C)?"swf":i.match(I)?"svg":i.match(j)?"pdf":0===i.indexOf("#")?"inline":"ajax"),n)switch(e(s).hasClass("modal")&&(u.modal=!0),"inline"==n&&(s=i.substr(i.indexOf("#")),n=e(s).length>0?"inline":"ajax"),u.type=n,u.href=i,u.title=o,u.autoDimensions&&("html"==u.type||"inline"==u.type||"ajax"==u.type?(u.width="auto",u.height="auto"):u.autoDimensions=!1),u.modal&&(u.overlayShow=!0,u.hideOnOverlayClick=!1,u.hideOnContentClick=!1,u.enableEscapeButton=!1,u.showCloseButton=!1),u.padding=parseInt(u.padding,10),u.margin=parseInt(u.margin,10),t.css("padding",u.padding+u.margin),e(".fancybox-inline-tmp").off("fancybox-cancel").on("fancybox-change",(function(){e(this).replaceWith(d.children())})),n){case"html":t.html(u.content),_process_inline();break;case"inline":if(!0===e(s).parent().is("#fancybox-content"))return void(A=!1);e('<div class="fancybox-inline-tmp" />').hide().insertBefore(e(s)).on("fancybox-cleanup",(function(){e(this).replaceWith(d.find(s))})).on("fancybox-cancel",(function(){e(this).replaceWith(t.find(s))})),e(s).appendTo(t),_process_inline();break;case"image":u.keepRatio=!0,A=!1,e.fancybox.showActivity(),(_=new Image).onerror=function(){_error("No image found.")},_.onload=function(){A=!0,_.onerror=_.onload=null,_process_image()},_.src=i;break;case"swf":u.scrolling="no",u.keepRatio=!0,a='<object type="application/x-shockwave-flash" classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="'+u.width+'" height="'+u.height+'"><param name="movie" value="'+i+'"></param>',r="",e.each(u.swf,(function(e,t){a+='<param name="'+e+'" value="'+t+'"></param>',r+=" "+e+'="'+t+'"'})),a+='<embed src="'+i+'" type="application/x-shockwave-flash" width="'+u.width+'" height="'+u.height+'"'+r+"></embed></object>",t.html(a),_process_inline();break;case"svg":u.scrolling="no",u.keepRatio=!0,a='<object type="image/svg+xml" width="'+u.width+'" height="'+u.height+'" data="'+i+'"></object>',t.html(a),_process_inline();break;case"pdf":u.scrolling="no",u.enableKeyboardNav=!1,u.showNavArrows=!1,a='<object type="application/pdf" width="100%" height="100%" data="'+i+'"><a href="'+i+'" style="display:block;position:absolute;top:48%;width:100%;text-align:center">'+e(s).html()+"</a></object>",t.html(a),_process_inline();break;case"ajax":A=!1,e.fancybox.showActivity(),u.ajax.win=u.ajax.success,x=e.ajax(e.extend({},u.ajax,{url:i,data:u.ajax.data||{},error:function(e,t,i){e.status>0&&_error(i)},success:function(n,o,a){if(200==("object"==typeof a?a:x).status){if("function"==typeof u.ajax.win){if(!1===(c=u.ajax.win(i,n,o,a)))return void e.fancybox.hideActivity();"string"!=typeof c&&"object"!=typeof c||(n=c)}n.indexOf("<!DOCTYPE")>-1||n.indexOf("<html")>-1||n.indexOf("<body")>-1?_error("Unexpected response."):(t.html(n),_process_inline())}}}));break;case"iframe":u.enableKeyboardNav=!1,u.showNavArrows=!1,e.fancybox.showActivity(),_show();break}else _error("No content type found.");else A=!1},_process_inline=function(){var i=u.width,n=u.height,o=0==e(window).width()?window.innerWidth:e(window).width(),a=0==e(window).height()?window.innerHeight:e(window).height();i=i.toString().indexOf("%")>-1?parseInt((o-2*u.margin)*parseFloat(i)/100,10)+"px":"auto"==i?"auto":i+"px",n=n.toString().indexOf("%")>-1?parseInt((a-2*u.margin)*parseFloat(n)/100,10)+"px":"auto"==n?"auto":n+"px",t.wrapInner('<div style="width:'+i+";height:"+n+";overflow:"+("auto"==u.scrolling?"auto":"yes"==u.scrolling?"scroll":"hidden")+';position:relative;"></div>'),u.width=t.width(),u.height=t.height(),_show()},_process_image=function(){u.width=_.width,u.height=_.height,e("<img />").attr({id:"fancybox-img",src:_.src,alt:u.title}).appendTo(t),_show()},_show=function(){var i,a;return"iframe"!==u.type&&e.fancybox.hideActivity(),o.is(":visible")&&!1===w.onCleanup(v,m,w)?(e(".fancybox-inline-tmp").trigger("fancybox-cancel"),void(A=!1)):(A=!0,e(d.add(n)).off(),e(window).off("orientationchange.fb resize.fb scroll.fb"),e(document).off("keydown.fb"),o.is(":visible")&&"outside"!==w.titlePosition&&o.css("height",o.height()),v=y,m=b,(w=u).overlayShow?(n.css({"background-color":w.overlayColor,opacity:w.overlayOpacity,cursor:w.hideOnOverlayClick?"pointer":"auto",height:e(document).height()}),n.is(":visible")||(D&&e("select:not(#fancybox-tmp select)").filter((function(){return"hidden"!==this.style.visibility})).css({visibility:"hidden"}).one("fancybox-cleanup",(function(){this.style.visibility="inherit"})),n.show())):n.hide(),g=_get_zoom_to(),_process_title(),o.is(":visible")?(e(r.add(s).add(l)).hide(),i=o.position(),p={top:i.top,left:i.left,width:o.width(),height:o.height()},a=p.width==g.width&&p.height==g.height,void d.fadeTo(w.changeFade,.3,(function(){var i=function(){d.html(t.contents()).fadeTo(w.changeFade,1,_finish)};e(".fancybox-inline-tmp").trigger("fancybox-change"),d.empty().removeAttr("filter").css({"border-width":w.padding,width:g.width-2*w.padding,height:w.autoDimensions?"auto":g.height-T-2*w.padding}),a?i():(E.prop=0,e(E).animate({prop:1},{duration:w.changeSpeed,easing:w.easingChange,step:_draw,complete:i}))}))):(o.removeAttr("style"),d.css("border-width",w.padding),"elastic"==w.transitionIn?(p=_get_zoom_from(),d.html(t.contents()),o.show(),w.opacity&&(g.opacity=0),E.prop=0,void e(E).animate({prop:1},{duration:w.speedIn,easing:w.easingIn,step:_draw,complete:_finish})):("inside"==w.titlePosition&&T>0&&c.show(),d.css({width:g.width-2*w.padding,height:w.autoDimensions?"auto":g.height-T-2*w.padding}).html(t.contents()),void o.css(g).fadeIn("none"==w.transitionIn?0:w.speedIn,_finish))))},_format_title=function(e){return!(!e||!e.length)&&("float"==w.titlePosition?'<table id="fancybox-title-float-wrap" style="border-spacing:0;border-collapse:collapse"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">'+e+'</td><td id="fancybox-title-float-right"></td></tr></table>':'<div id="fancybox-title-'+w.titlePosition+'">'+e+"</div>")},_process_title=function(){if(N=w.title||"",T=0,c.empty().removeAttr("style").removeClass(),!1!==w.titleShow)if((N=e.isFunction(w.titleFormat)?w.titleFormat(N,v,m,w):_format_title(N))&&""!==N){switch(c.addClass("fancybox-title-"+w.titlePosition).html(N).appendTo("body").show(),w.titlePosition){case"inside":c.css({width:g.width-2*w.padding,marginLeft:w.padding,marginRight:w.padding}).appendTo(a),T=c.outerHeight(!0),g.height+=T;break;case"over":c.css({marginLeft:w.padding,width:g.width-2*w.padding,bottom:w.padding}).appendTo(a);break;case"float":c.css("left",-1*parseInt((c.width()-g.width)/2,10)).appendTo(a);break;default:c.css({width:g.width-2*w.padding,paddingLeft:w.padding,paddingRight:w.padding}).appendTo(o);break}c.hide()}else c.hide();else c.hide()},_set_navigation=function(){if((w.enableEscapeButton||w.enableKeyboardNav)&&e(document).on("keydown.fb",(function(t){27==t.keyCode&&w.enableEscapeButton?(t.preventDefault(),e.fancybox.close()):37!=t.keyCode&&39!=t.keyCode||!w.enableKeyboardNav||"INPUT"===t.target.tagName||"TEXTAREA"===t.target.tagName||"SELECT"===t.target.tagName?9==t.keyCode&&w.enableKeyboardNav&&"INPUT"!==t.target.tagName&&"TEXTAREA"!==t.target.tagName&&"SELECT"!==t.target.tagName&&(t.preventDefault(),e.fancybox[t.shiftKey?"prev":"next"]()):(t.preventDefault(),e.fancybox[37==t.keyCode?"prev":"next"]())})),!w.showNavArrows)return s.hide(),void l.hide();(w.cyclic&&v.length>1||0!==m)&&s.show(),(w.cyclic&&v.length>1||m!=v.length-1)&&l.show()},_finish=function(){S&&(d.css("filter",0),o.css("filter",0)),w.autoDimensions&&d.css("height","auto"),o.css("height","auto"),N&&N.length&&c.show(),w.showCloseButton&&r.show(),_set_navigation(),w.hideOnContentClick&&d.on("click",e.fancybox.close),w.hideOnOverlayClick&&n.on("click",e.fancybox.close),w.autoResize&&e(window).on("resize.fb",e.fancybox.resize),w.centerOnScroll&&!W&&e(window).on("scroll.fb",e.fancybox.center),e.fn.mousewheel&&o.on("mousewheel.fb",(function(t,i){A?t.preventDefault():"image"!=w.type||0!=e(t.target).outerHeight()&&e(t.target).prop("scrollHeight")!==e(t.target).outerHeight()||(t.preventDefault(),e.fancybox[i>0?"prev":"next"]())})),"iframe"==w.type&&e('<iframe id="fancybox-frame" name="fancybox-frame'+(new Date).getTime()+'"'+(navigator.userAgent.match(/msie [6]/i)?' allowtransparency="true""':"")+' style="border:0;margin:0;overflow:'+("auto"==w.scrolling?"auto":"yes"==w.scrolling?"scroll":"hidden")+'" src="'+w.href+'"'+(!1===w.allowfullscreen?"":" allowfullscreen")+' allow="autoplay; encrypted-media" tabindex="999"></iframe>').appendTo(d).on("load",(function(){e.fancybox.hideActivity()})).focus(),o.show(),A=!1,e.fancybox.center(),w.onComplete(v,m,w),v.length>1&&(_preload_next(),_preload_prev())},_preload_next=function(){var e="number"==typeof arguments[0]?arguments[0]:m+1;if(e>=v.length){if(!w.cyclic)return;e=0}if(e==m)return w.enableKeyboardNav=!1,o.off("mousewheel.fb"),void l.hide();_preload_image(e)||_preload_next(e+1)},_preload_prev=function(){var e="number"==typeof arguments[0]?arguments[0]:m-1;if(e<0){if(!w.cyclic)return;e=v.length-1}if(e==m)return w.enableKeyboardNav=!1,o.off("mousewheel.fb"),void s.hide();_preload_image(e)||_preload_prev(e-1)},_preload_image=function(t){var i=v[t];return!(void 0===i||void 0===i.href||i.href===w.href||!i.href.match(k)&&!e(i).hasClass("image"))&&((new Image).src=i.href,!0)},_draw=function(e){var t={width:parseInt(p.width+(g.width-p.width)*e,10),height:parseInt(p.height+(g.height-p.height)*e,10),top:parseInt(p.top+(g.top-p.top)*e,10),left:parseInt(p.left+(g.left-p.left)*e,10)};void 0!==g.opacity&&(t.opacity=e<.5?.5:e),o.css(t),d.css({width:t.width-2*w.padding,height:t.height-T*e-2*w.padding})},_get_viewport=function(){var t,i=!W&&window.innerWidth&&document.documentElement.clientWidth?Math.min(window.innerWidth,document.documentElement.clientWidth):window.innerWidth||document.documentElement.clientWidth||document.getElementsByTagName("body")[0].clientWidth,n=!W&&window.innerHeight&&document.documentElement.clientHeight?Math.min(window.innerHeight,document.documentElement.clientHeight):window.innerHeight||document.documentElement.clientHeight||document.getElementsByTagName("body")[0].clientHeight;return[i-2*(t=!0===arguments[0]?0:w.margin),n-2*t,e(document).scrollLeft()+t,e(document).scrollTop()+t]},_get_zoom_to=function(){var e,t=_get_viewport(),i={},n=2*w.padding;return w.width.toString().indexOf("%")>-1?i.width=parseInt(t[0]*parseFloat(w.width)/100,10):i.width=w.width+n,w.height.toString().indexOf("%")>-1?i.height=parseInt(t[1]*parseFloat(w.height)/100,10):i.height=w.height+n,w.autoScale&&(i.width>t[0]||i.height>t[1])&&(w.keepRatio?(e=w.width/w.height,i.width>t[0]&&(i.width=t[0],i.height=parseInt((i.width-n)/e+n,10)),i.height>t[1]&&(i.height=t[1],i.width=parseInt((i.height-n)*e+n,10))):(i.width=Math.min(i.width,t[0]),i.height=Math.min(i.height,t[1]))),i.top=parseInt(Math.max(t[3]-20,t[3]+.5*(t[1]-i.height-40)),10),i.left=parseInt(Math.max(t[2]-20,t[2]+.5*(t[0]-i.width-40)),10),i},_get_obj_pos=function(e){var t=e.offset();return t.top+=parseInt(e.css("paddingTop"),10)||0,t.left+=parseInt(e.css("paddingLeft"),10)||0,t.top+=parseInt(e.css("border-top-width"),10)||0,t.left+=parseInt(e.css("border-left-width"),10)||0,t.width=e.width(),t.height=e.height(),t},_get_zoom_from=function(){var t,i,n=!!u.orig&&e(u.orig),o={};return n&&n.length?o={width:(t=_get_obj_pos(n)).width+2*w.padding,height:t.height+2*w.padding,top:t.top-w.padding-20,left:t.left-w.padding-20}:(i=_get_viewport(),o={width:2*w.padding,height:2*w.padding,top:parseInt(.5*(i[3]+i[1]),10),left:parseInt(.5*(i[2]+i[0]),10)}),o},_animate_loading=function(){i.is(":visible")?(e("div",i).css("top",-40*O+"px"),O=(O+1)%12):clearInterval(f)},e.fn.fancybox=function(t){return e(this).length?(e(this).data("fancybox",e.extend({},t,e.metadata?e(this).metadata():{})).off("click.fb").on("click.fb",(function(t){if(t.preventDefault(),!A){A=!0,e(this).blur(),y=[],b=0;var i=e(this).attr("rel")||"";return""==i||""==i.replace(/alternate|external|help|license|nofollow|noreferrer|noopener|\s+/gi,"")?y.push(this):(y=e('a[rel="'+i+'"], area[rel="'+i+'"]'),b=y.index(this)),_start(),!1}})),this):this},e.fancybox=function(t){var i;if(!A){if(A=!0,i=void 0!==arguments[1]?arguments[1]:{},y=[],b=parseInt(i.index,10)||0,e.isArray(t)){for(var n=0,o=t.length;n<o;n++)"object"==typeof t[n]?e(t[n]).data("fancybox",e.extend({},i,t[n])):t[n]=e({}).data("fancybox",e.extend({content:t[n]},i));y=jQuery.merge(y,t)}else"object"==typeof t?e(t).data("fancybox",e.extend({},i,t)):t=e({}).data("fancybox",e.extend({content:t},i)),y.push(t);(b>y.length||b<0)&&(b=0),_start()}},e.fancybox.showActivity=function(){clearInterval(f),i.show(),f=setInterval(_animate_loading,66)},e.fancybox.hideActivity=function(){i.hide()},e.fancybox.next=function(){var t,i="number"==typeof arguments[0]?arguments[0]:m+1;if(i>=v.length){if(!w.cyclic)return;i=0}t=v[i],i!=m&&void 0!==t&&void 0!==t.href&&t.href===w.href?e.fancybox.next(i+1):e.fancybox.pos(i)},e.fancybox.prev=function(){var t,i="number"==typeof arguments[0]?arguments[0]:m-1;if(i<0){if(!w.cyclic)return;i=v.length-1}t=v[i],i!=m&&void 0!==t&&void 0!==t.href&&t.href===w.href?e.fancybox.prev(i-1):e.fancybox.pos(i)},e.fancybox.pos=function(e){A||(e=parseInt(e),y=v,e>-1&&e<v.length&&(b=e,_start()))},e.fancybox.cancel=function(){A||(A=!0,e(".fancybox-inline-tmp").trigger("fancybox-cancel"),_abort(),u.onCancel(y,b,u),A=!1)},e.fancybox.close=function(){if(!A&&!o.is(":hidden"))if(A=!0,w&&!1===w.onCleanup(v,m,w))A=!1;else if(_abort(),e(r.add(s).add(l)).hide(),e(d.add(n)).off(),e(window).off("orientationchange.fb resize.fb scroll.fb mousewheel.fb"),e(document).off("keydown.fb"),S&&d.find("iframe#fancybox-frame").attr("src",D&&/^https/i.test(window.location.href||"")?"javascript:void(false)":"//about:blank"),"inside"!==w.titlePosition&&c.empty(),o.stop(),"elastic"==w.transitionOut){p=_get_zoom_from();var t=o.position();g={top:t.top,left:t.left,width:o.width(),height:o.height()},w.opacity&&(g.opacity=1),c.empty().hide(),E.prop=1,e(E).animate({prop:0},{duration:w.speedOut,easing:w.easingOut,step:_draw,complete:i})}else o.fadeOut("none"==w.transitionOut?0:w.speedOut,i);function i(){n.fadeOut("fast"),c.empty().hide(),o.hide(),e(".fancybox-inline-tmp").trigger("fancybox-cleanup"),d.empty(),w.onClosed(v,m,w),v=u=[],m=b=0,w=u={},A=!1}},e.fancybox.resize=function(){var t;clearTimeout(h),h=setTimeout((function(){n.is(":visible")&&n.css("height",e(document).height()),t=o.position(),p={top:t.top,left:t.left,width:o.width(),height:o.height()},g=_get_zoom_to(),A=!0,_process_title(),E.prop=0,e(E).animate({prop:1},{duration:w.changeSpeed,easing:w.easingChange,step:_draw,complete:function(){u.autoDimensions&&d.css("height","auto"),o.css("height","auto"),N&&N.length&&c.show(),A=!1,e.fancybox.center(!0)}})}),500)},e.fancybox.center=function(){var e,t;A||(t=!0===arguments[0]?1:0,e=_get_viewport(!0),!t&&(o.width()+40>e[0]||o.height()+40>e[1])||o.stop().animate({top:parseInt(Math.max(e[3]-20,e[3]+.5*(e[1]-d.height()-40)-w.padding)),left:parseInt(Math.max(e[2]-20,e[2]+.5*(e[0]-d.width()-40)-w.padding))},"number"==typeof arguments[0]?arguments[0]:300))},e.fancybox.init=function(){e("#fancybox-wrap").length||(e("body").append(t=e('<div id="fancybox-tmp"></div>'),i=e('<div id="fancybox-loading"><div></div></div>'),n=e('<div id="fancybox-overlay"></div>'),o=e('<div id="fancybox-wrap"></div>')),(a=e('<div id="fancybox-outer"></div>').append('<div class="fancybox-bg" id="fancybox-bg-n"></div><div class="fancybox-bg" id="fancybox-bg-ne"></div><div class="fancybox-bg" id="fancybox-bg-e"></div><div class="fancybox-bg" id="fancybox-bg-se"></div><div class="fancybox-bg" id="fancybox-bg-s"></div><div class="fancybox-bg" id="fancybox-bg-sw"></div><div class="fancybox-bg" id="fancybox-bg-w"></div><div class="fancybox-bg" id="fancybox-bg-nw"></div>').appendTo(o)).append(d=e('<div id="fancybox-content"></div>'),r=e('<a id="fancybox-close" title="Close" class="fancy-ico" href="javascript:;"></a>'),c=e('<div id="fancybox-title"></div>'),s=e('<a id="fancybox-left" title="Previous" href="javascript:;"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),l=e('<a id="fancybox-right" title="Next" href="javascript:;"><span class="fancy-ico" id="fancybox-right-ico"></span></a>')),r.click(e.fancybox.close),i.click(e.fancybox.cancel),s.click((function(t){t.preventDefault(),e.fancybox.prev()})),l.click((function(t){t.preventDefault(),e.fancybox.next()})),S&&o.addClass("fancybox-ie"),D&&(i.addClass("fancybox-ie6"),o.addClass("fancybox-ie6"),e('<iframe id="fancybox-hide-sel-frame" src="'+(/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank")+'" style="overflow:hidden;border:0" tabindex="-1"></iframe>').prependTo(a)))},e.fn.fancybox.defaults={padding:10,margin:40,opacity:!1,modal:!1,cyclic:!1,allowfullscreen:!1,scrolling:"auto",width:560,height:340,autoScale:!0,autoDimensions:!0,centerOnScroll:!1,autoResize:!0,keepRatio:!1,minViewportWidth:0,ajax:{},swf:{wmode:"opaque"},svg:{wmode:"opaque"},hideOnOverlayClick:!0,hideOnContentClick:!1,overlayShow:!0,overlayOpacity:.7,overlayColor:"#777",titleShow:!0,titlePosition:"float",titleFormat:null,titleFromAlt:!0,transitionIn:"fade",transitionOut:"fade",speedIn:300,speedOut:300,changeSpeed:300,changeFade:"fast",easingIn:"swing",easingOut:"swing",showCloseButton:!0,showNavArrows:!0,enableEscapeButton:!0,enableKeyboardNav:!0,onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}},e(document).ready((function(){e.fancybox.init()}))}(jQuery);
|
fancybox/1.5.0/jquery.fancybox.css
ADDED
@@ -0,0 +1,367 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* FancyBox - jQuery Plugin
|
3 |
+
* Simple and fancy lightbox alternative
|
4 |
+
*
|
5 |
+
* Examples and documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Copyright (c) 2020 - RavanH
|
11 |
+
* Version: 1.5.0 (2020/11/09)
|
12 |
+
*
|
13 |
+
* Dual licensed under the MIT and GPL licenses:
|
14 |
+
* http://www.opensource.org/licenses/mit-license.php
|
15 |
+
* http://www.gnu.org/licenses/gpl.html
|
16 |
+
*/
|
17 |
+
|
18 |
+
html.fancybox-active, html.fancybox-active body {
|
19 |
+
touch-action: none;
|
20 |
+
overscroll-behavior: none;
|
21 |
+
-webkit-overflow-scrolling: auto;
|
22 |
+
overflow: hidden;
|
23 |
+
}
|
24 |
+
html.fancybox-active body {
|
25 |
+
margin-right: var(--vertical-scrollbar);
|
26 |
+
margin-bottom: var(--horizontal-scrollbar);
|
27 |
+
}
|
28 |
+
html.fancybox-active body.rtl {
|
29 |
+
margin-right: 0;
|
30 |
+
margin-left: var(--vertical-scrollbar);
|
31 |
+
}
|
32 |
+
|
33 |
+
#fancybox-loading, #fancybox-loading div,
|
34 |
+
#fancybox-overlay,
|
35 |
+
#fancybox-wrap *,
|
36 |
+
#fancybox-wrap *::before, #fancybox-wrap *::after {
|
37 |
+
-webkit-box-sizing: border-box;
|
38 |
+
-moz-box-sizing: border-box;
|
39 |
+
box-sizing: border-box;
|
40 |
+
}
|
41 |
+
|
42 |
+
/* light box framework */
|
43 |
+
|
44 |
+
#fancybox-overlay {
|
45 |
+
position: fixed;
|
46 |
+
top: 0;
|
47 |
+
left: 0;
|
48 |
+
width: 100%;
|
49 |
+
height: 100%;
|
50 |
+
background-color: rgba(0,0,0,.7);
|
51 |
+
z-index: 111100;
|
52 |
+
display: none;
|
53 |
+
}
|
54 |
+
|
55 |
+
#fancybox-tmp {
|
56 |
+
padding: 0;
|
57 |
+
margin: 0;
|
58 |
+
border: 0;
|
59 |
+
overflow: auto;
|
60 |
+
display: none;
|
61 |
+
}
|
62 |
+
|
63 |
+
#fancybox-wrap {
|
64 |
+
position: absolute;
|
65 |
+
top: 0;
|
66 |
+
left: 0;
|
67 |
+
z-index: 111101;
|
68 |
+
display: none;
|
69 |
+
outline: none !important;
|
70 |
+
}
|
71 |
+
|
72 |
+
#fancybox-outer {
|
73 |
+
position: relative;
|
74 |
+
width: 100%;
|
75 |
+
height: 100%;
|
76 |
+
box-shadow:0 0 20px #111;
|
77 |
+
-moz-box-shadow:0 0 20px #111;
|
78 |
+
-webkit-box-shadow:0 0 20px #111;
|
79 |
+
}
|
80 |
+
|
81 |
+
#fancybox-content {
|
82 |
+
position: relative;
|
83 |
+
width: 100%;
|
84 |
+
height: 100%;
|
85 |
+
-webkit-overflow-scrolling: touch;
|
86 |
+
overflow-y: auto;
|
87 |
+
z-index: 111102;
|
88 |
+
border: 0px solid #fff;
|
89 |
+
background: #fff;
|
90 |
+
background-clip: padding-box;
|
91 |
+
}
|
92 |
+
|
93 |
+
#fancybox-content > div {
|
94 |
+
max-width: 100%;
|
95 |
+
max-height: 100%;
|
96 |
+
}
|
97 |
+
|
98 |
+
#fancybox-error {
|
99 |
+
color: #444;
|
100 |
+
padding: 14px;
|
101 |
+
margin: 0;
|
102 |
+
}
|
103 |
+
|
104 |
+
#fancybox-frame, #fancybox-img {
|
105 |
+
width: 100%;
|
106 |
+
height: 100%;
|
107 |
+
border: none;
|
108 |
+
}
|
109 |
+
|
110 |
+
#fancybox-img {
|
111 |
+
position: absolute;
|
112 |
+
padding: 0;
|
113 |
+
margin: 0;
|
114 |
+
line-height: 0;
|
115 |
+
vertical-align: top;
|
116 |
+
max-width:none !important;
|
117 |
+
max-height:none !important
|
118 |
+
}
|
119 |
+
|
120 |
+
#fancybox-frame {
|
121 |
+
display: block;
|
122 |
+
z-index: 0; /* z-index bug with -webkit-overflow-scrolling */
|
123 |
+
}
|
124 |
+
/* buttons */
|
125 |
+
.fancy-ico {
|
126 |
+
position: absolute;
|
127 |
+
width: 48px;
|
128 |
+
height: 48px;
|
129 |
+
border-radius: 50%;
|
130 |
+
}
|
131 |
+
.fancy-ico span {
|
132 |
+
display: block;
|
133 |
+
position: relative;
|
134 |
+
left: 12px;
|
135 |
+
top: 12px;
|
136 |
+
width: 24px;
|
137 |
+
height: 24px;
|
138 |
+
border-radius: 50%;
|
139 |
+
background: #000;
|
140 |
+
border: 2px solid white;
|
141 |
+
box-shadow: 0 0 4px #000;
|
142 |
+
transition: transform .25s ease-in-out;
|
143 |
+
}
|
144 |
+
#fancybox-close:hover span, #fancybox-next:hover span, body.rtl #fancybox-prev:hover span {
|
145 |
+
transform: rotate(360deg);
|
146 |
+
}
|
147 |
+
#fancybox-prev:hover span, body.rtl #fancybox-next:hover span {
|
148 |
+
transform: rotate(-360deg);
|
149 |
+
}
|
150 |
+
/* close button */
|
151 |
+
#fancybox-close {
|
152 |
+
top: -24px;
|
153 |
+
right: -24px;
|
154 |
+
cursor: pointer;
|
155 |
+
z-index: 111105;
|
156 |
+
display: none;
|
157 |
+
}
|
158 |
+
#fancybox-close span::after, #fancybox-close span::before {
|
159 |
+
content: '';
|
160 |
+
position: absolute;
|
161 |
+
top: 9px;
|
162 |
+
left: 4px;
|
163 |
+
width: 12px;
|
164 |
+
height: 2px;
|
165 |
+
background-color: #fff;
|
166 |
+
}
|
167 |
+
#fancybox-close span::before {
|
168 |
+
transform: rotate(45deg);
|
169 |
+
}
|
170 |
+
#fancybox-close span::after {
|
171 |
+
transform: rotate(-45deg);
|
172 |
+
}
|
173 |
+
|
174 |
+
/* navigation elements */
|
175 |
+
#fancybox-prev, #fancybox-next {
|
176 |
+
top: 50%;
|
177 |
+
margin-top: -24px;
|
178 |
+
cursor: pointer;
|
179 |
+
z-index: 111102;
|
180 |
+
display: none;
|
181 |
+
}
|
182 |
+
|
183 |
+
#fancybox-next,
|
184 |
+
body.rtl #fancybox-prev {
|
185 |
+
left: auto;
|
186 |
+
right: -24px;
|
187 |
+
}
|
188 |
+
|
189 |
+
#fancybox-prev,
|
190 |
+
body.rtl #fancybox-next {
|
191 |
+
left: -24px;
|
192 |
+
right: auto;
|
193 |
+
}
|
194 |
+
#fancybox-prev span::after, #fancybox-next span::after {
|
195 |
+
content: '';
|
196 |
+
position: absolute;
|
197 |
+
top: 6px;
|
198 |
+
width: 8px;
|
199 |
+
height: 8px;
|
200 |
+
border-top: 2px solid #fff;
|
201 |
+
border-right: 2px solid #fff;
|
202 |
+
}
|
203 |
+
#fancybox-prev span::after, body.rtl #fancybox-next span::after {
|
204 |
+
transform: rotate(-135deg);
|
205 |
+
left: 7px;
|
206 |
+
}
|
207 |
+
#fancybox-next span::after, body.rtl #fancybox-prev span::after {
|
208 |
+
transform: rotate(45deg);
|
209 |
+
left: initial;
|
210 |
+
right: 7px;
|
211 |
+
}
|
212 |
+
|
213 |
+
/* title elements */
|
214 |
+
|
215 |
+
#fancybox-title-wrap {
|
216 |
+
z-index: 111104;
|
217 |
+
}
|
218 |
+
|
219 |
+
.fancybox-title-inside {
|
220 |
+
padding-bottom: 10px;
|
221 |
+
text-align: center;
|
222 |
+
color: #333;
|
223 |
+
background-color: #fff;
|
224 |
+
position: relative;
|
225 |
+
}
|
226 |
+
|
227 |
+
.fancybox-title-outside {
|
228 |
+
padding-top: 10px;
|
229 |
+
color: #fff;
|
230 |
+
font-weight: 600;
|
231 |
+
}
|
232 |
+
|
233 |
+
.fancybox-title-over {
|
234 |
+
position: absolute;
|
235 |
+
width: 100%;
|
236 |
+
bottom: 0;
|
237 |
+
left: 0;
|
238 |
+
color: #fff;
|
239 |
+
text-align: left;
|
240 |
+
}
|
241 |
+
|
242 |
+
body.rtl .fancybox-title-over {
|
243 |
+
text-align:right
|
244 |
+
}
|
245 |
+
|
246 |
+
.fancybox-title-over #fancybox-title {
|
247 |
+
padding: 10px;
|
248 |
+
background: rgba(0,0,0,.6);
|
249 |
+
display: block;
|
250 |
+
}
|
251 |
+
|
252 |
+
.fancybox-title-float {
|
253 |
+
text-align: center;
|
254 |
+
}
|
255 |
+
|
256 |
+
.fancybox-title-float #fancybox-title {
|
257 |
+
display: table;
|
258 |
+
margin: -12px auto;
|
259 |
+
height: 24px;
|
260 |
+
padding: 0 15px;
|
261 |
+
line-height: 20px;
|
262 |
+
font-size: 16px;
|
263 |
+
color: #fff;
|
264 |
+
background: #000;
|
265 |
+
border: 2px solid #fff;
|
266 |
+
border-radius: 12px;
|
267 |
+
box-shadow: 0 0 4px #000;
|
268 |
+
position: relative;
|
269 |
+
z-index: 111104;
|
270 |
+
}
|
271 |
+
|
272 |
+
/* loader animation */
|
273 |
+
#fancybox-loading {
|
274 |
+
position: fixed;
|
275 |
+
top: 50%;
|
276 |
+
left: 50%;
|
277 |
+
width: 40px;
|
278 |
+
height: 40px;
|
279 |
+
margin-top: -20px;
|
280 |
+
margin-left: -20px;
|
281 |
+
background-color: rgba(0,0,0,.9);
|
282 |
+
border-radius: 5px;
|
283 |
+
cursor: pointer;
|
284 |
+
overflow: hidden;
|
285 |
+
z-index: 111104;
|
286 |
+
display: none;
|
287 |
+
}
|
288 |
+
#fancybox-loading div {
|
289 |
+
transform-origin: 20px 20px;
|
290 |
+
animation: fancybox-loading 1.2s linear infinite;
|
291 |
+
}
|
292 |
+
#fancybox-loading div::after {
|
293 |
+
content: '';
|
294 |
+
display: block;
|
295 |
+
position: absolute;
|
296 |
+
top: 7px;
|
297 |
+
left: 19px;
|
298 |
+
width: 2px;
|
299 |
+
height: 7px;
|
300 |
+
border-radius: 20%;
|
301 |
+
background: #fff;
|
302 |
+
}
|
303 |
+
#fancybox-loading div:nth-child(1) {
|
304 |
+
transform: rotate(0deg);
|
305 |
+
animation-delay: -1.1s;
|
306 |
+
}
|
307 |
+
#fancybox-loading div:nth-child(2) {
|
308 |
+
transform: rotate(30deg);
|
309 |
+
animation-delay: -1s;
|
310 |
+
}
|
311 |
+
#fancybox-loading div:nth-child(3) {
|
312 |
+
transform: rotate(60deg);
|
313 |
+
animation-delay: -0.9s;
|
314 |
+
}
|
315 |
+
#fancybox-loading div:nth-child(4) {
|
316 |
+
transform: rotate(90deg);
|
317 |
+
animation-delay: -0.8s;
|
318 |
+
}
|
319 |
+
#fancybox-loading div:nth-child(5) {
|
320 |
+
transform: rotate(120deg);
|
321 |
+
animation-delay: -0.7s;
|
322 |
+
}
|
323 |
+
#fancybox-loading div:nth-child(6) {
|
324 |
+
transform: rotate(150deg);
|
325 |
+
animation-delay: -0.6s;
|
326 |
+
}
|
327 |
+
#fancybox-loading div:nth-child(7) {
|
328 |
+
transform: rotate(180deg);
|
329 |
+
animation-delay: -0.5s;
|
330 |
+
}
|
331 |
+
#fancybox-loading div:nth-child(8) {
|
332 |
+
transform: rotate(210deg);
|
333 |
+
animation-delay: -0.4s;
|
334 |
+
}
|
335 |
+
#fancybox-loading div:nth-child(9) {
|
336 |
+
transform: rotate(240deg);
|
337 |
+
animation-delay: -0.3s;
|
338 |
+
}
|
339 |
+
#fancybox-loading div:nth-child(10) {
|
340 |
+
transform: rotate(270deg);
|
341 |
+
animation-delay: -0.2s;
|
342 |
+
}
|
343 |
+
#fancybox-loading div:nth-child(11) {
|
344 |
+
transform: rotate(300deg);
|
345 |
+
animation-delay: -0.1s;
|
346 |
+
}
|
347 |
+
#fancybox-loading div:nth-child(12) {
|
348 |
+
transform: rotate(330deg);
|
349 |
+
animation-delay: 0s;
|
350 |
+
}
|
351 |
+
@keyframes fancybox-loading {
|
352 |
+
0% {
|
353 |
+
opacity: 1;
|
354 |
+
}
|
355 |
+
100% {
|
356 |
+
opacity: 0;
|
357 |
+
}
|
358 |
+
}
|
359 |
+
|
360 |
+
/* other */
|
361 |
+
.fancybox-hidden {
|
362 |
+
display: none;
|
363 |
+
}
|
364 |
+
#fancybox-content .fancybox-hidden,
|
365 |
+
#fancybox-tmp .fancybox-hidden {
|
366 |
+
display: revert;
|
367 |
+
}
|
fancybox/1.5.0/jquery.fancybox.js
ADDED
@@ -0,0 +1,1195 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* FancyBox Classic - jQuery Plugin
|
3 |
+
* Simple but fancy lightbox, based on the original FancyBox by Janis Skarnelis, modernized.
|
4 |
+
*
|
5 |
+
* Examples and original documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Copyright (c) 2020 - RavanH
|
11 |
+
* Version: 1.5.0 (2020/11/09)
|
12 |
+
* Requires: jQuery v1.7+
|
13 |
+
*
|
14 |
+
* Dual licensed under the MIT and GPL licenses:
|
15 |
+
* http://www.opensource.org/licenses/mit-license.php
|
16 |
+
* http://www.gnu.org/licenses/gpl.html
|
17 |
+
*/
|
18 |
+
|
19 |
+
(function($) {
|
20 |
+
var tmp, loading, overlay, wrap, outer, content, close, title, nav_prev, nav_next, resize_timeout, previousType, clone, final_pos,
|
21 |
+
selectedIndex = 0, selectedOpts = {}, selectedArray = [], currentIndex = 0, currentOpts = {}, currentArray = [], ajaxLoader = null,
|
22 |
+
imgPreloader = new Image(), imgRegExp = /\.(jpg|gif|png|bmp|jpeg|webp)(.*)?$/i, svgRegExp = /[^\.]\.(svg)\s*$/i,
|
23 |
+
pdfRegExp = /[^\.]\.(pdf)\s*$/i, titleHeight = 0, titleStr = '', busy = false, swipe_busy = false, move_startX, move_endX, pixel_ratio = window.devicePixelRatio || 1,
|
24 |
+
isTouch = 'ontouchstart' in window || window.DocumentTouch && document instanceof DocumentTouch || navigator.maxTouchPoints > 0 || navigator.msMaxTouchPoints > 0;
|
25 |
+
|
26 |
+
/*
|
27 |
+
* Private methods
|
28 |
+
*/
|
29 |
+
|
30 |
+
_abort = function() {
|
31 |
+
$.fancybox.hideActivity();
|
32 |
+
|
33 |
+
imgPreloader.onerror = imgPreloader.onload = null;
|
34 |
+
|
35 |
+
if (ajaxLoader) {
|
36 |
+
ajaxLoader.abort();
|
37 |
+
}
|
38 |
+
|
39 |
+
tmp.empty();
|
40 |
+
};
|
41 |
+
|
42 |
+
_error = function(msg) {
|
43 |
+
if (false === selectedOpts.onError(selectedArray, selectedIndex, selectedOpts)) {
|
44 |
+
$.fancybox.hideActivity();
|
45 |
+
busy = false;
|
46 |
+
return;
|
47 |
+
}
|
48 |
+
|
49 |
+
if ( typeof msg === 'undefined' ) {
|
50 |
+
msg = selectedOpts.txt.error.later;
|
51 |
+
}
|
52 |
+
|
53 |
+
selectedOpts.type = 'html';
|
54 |
+
selectedOpts.enableSwipeNav = false;
|
55 |
+
selectedOpts.titleShow = false;
|
56 |
+
selectedOpts.width = 'auto';
|
57 |
+
selectedOpts.height = 'auto';
|
58 |
+
|
59 |
+
tmp.html('<p id="fancybox-error">' + selectedOpts.txt.error.content + '<br />' + msg + '</p>');
|
60 |
+
|
61 |
+
_process_inline();
|
62 |
+
};
|
63 |
+
|
64 |
+
_start = function() {
|
65 |
+
var obj = selectedArray[ selectedIndex ],
|
66 |
+
href, type, title, ret;
|
67 |
+
|
68 |
+
_abort();
|
69 |
+
|
70 |
+
selectedOpts = $.extend({}, $.fn.fancybox.defaults, (typeof $(obj).data('fancybox') == 'undefined' ? selectedOpts : $(obj).data('fancybox')));
|
71 |
+
|
72 |
+
$('html').addClass('fancybox-active');
|
73 |
+
|
74 |
+
$(document).trigger('fancybox-start', selectedArray, selectedIndex, selectedOpts);
|
75 |
+
|
76 |
+
ret = selectedOpts.onStart(selectedArray, selectedIndex, selectedOpts);
|
77 |
+
|
78 |
+
if (ret === false) {
|
79 |
+
busy = false;
|
80 |
+
return;
|
81 |
+
} else if (typeof ret == 'object') {
|
82 |
+
selectedOpts = $.extend(selectedOpts, ret);
|
83 |
+
}
|
84 |
+
|
85 |
+
title = selectedOpts.title || (obj.nodeName ? $(obj).attr('title') : obj.title) || '';
|
86 |
+
|
87 |
+
if (obj.nodeName && !selectedOpts.orig) {
|
88 |
+
selectedOpts.orig = $(obj).find("img:first").length ? $(obj).find("img:first") : $(obj);
|
89 |
+
}
|
90 |
+
|
91 |
+
if (title === '' && selectedOpts.orig) {
|
92 |
+
title = selectedOpts.orig.attr('title') || (selectedOpts.titleFromAlt ? selectedOpts.orig.attr('alt') : '');
|
93 |
+
}
|
94 |
+
|
95 |
+
href = selectedOpts.href || (obj.nodeName ? $(obj).attr('href') : obj.href) || null;
|
96 |
+
|
97 |
+
if ((/^(?:javascript)/i).test(href) || href == '#') {
|
98 |
+
href = null;
|
99 |
+
}
|
100 |
+
|
101 |
+
if (selectedOpts.type) {
|
102 |
+
type = selectedOpts.type;
|
103 |
+
if (!href) {
|
104 |
+
href = selectedOpts.content;
|
105 |
+
}
|
106 |
+
} else if (selectedOpts.content) {
|
107 |
+
type = 'html';
|
108 |
+
} else if ( $(obj).hasClass('iframe') ) {
|
109 |
+
type = 'iframe';
|
110 |
+
} else if (href) {
|
111 |
+
if (href.match(imgRegExp) || $(obj).hasClass("image")) {
|
112 |
+
type = 'image';
|
113 |
+
} else if (href.match(svgRegExp)) {
|
114 |
+
type = 'svg';
|
115 |
+
} else if (href.match(pdfRegExp)) {
|
116 |
+
type = 'pdf';
|
117 |
+
} else if (href.indexOf("#") === 0) {
|
118 |
+
type = 'inline';
|
119 |
+
} else {
|
120 |
+
type = 'ajax';
|
121 |
+
}
|
122 |
+
}
|
123 |
+
|
124 |
+
if (!type) {
|
125 |
+
_error(selectedOpts.txt.error.type);
|
126 |
+
return;
|
127 |
+
}
|
128 |
+
|
129 |
+
if ($(obj).hasClass('modal')) {
|
130 |
+
selectedOpts.modal = true;
|
131 |
+
}
|
132 |
+
|
133 |
+
if (type == 'inline') {
|
134 |
+
obj = href.substr(href.indexOf("#"));
|
135 |
+
type = $(obj).length > 0 ? 'inline' : 'ajax';
|
136 |
+
}
|
137 |
+
|
138 |
+
selectedOpts.type = type;
|
139 |
+
selectedOpts.href = href;
|
140 |
+
selectedOpts.title = title;
|
141 |
+
|
142 |
+
if (selectedOpts.autoDimensions) {
|
143 |
+
if (selectedOpts.type == 'html' || selectedOpts.type == 'inline' || selectedOpts.type == 'ajax') {
|
144 |
+
selectedOpts.width = 'auto';
|
145 |
+
selectedOpts.height = 'auto';
|
146 |
+
} else {
|
147 |
+
selectedOpts.autoDimensions = false;
|
148 |
+
}
|
149 |
+
}
|
150 |
+
|
151 |
+
if (selectedOpts.modal) {
|
152 |
+
selectedOpts.overlayShow = true;
|
153 |
+
selectedOpts.hideOnOverlayClick = false;
|
154 |
+
selectedOpts.hideOnContentClick = false;
|
155 |
+
selectedOpts.enableEscapeButton = false;
|
156 |
+
selectedOpts.showCloseButton = false;
|
157 |
+
}
|
158 |
+
|
159 |
+
selectedOpts.padding = parseInt(selectedOpts.padding, 10);
|
160 |
+
selectedOpts.margin = parseInt(selectedOpts.margin, 10);
|
161 |
+
|
162 |
+
tmp.css('padding', (selectedOpts.padding + selectedOpts.margin));
|
163 |
+
|
164 |
+
if (selectedOpts.enableEscapeButton) {
|
165 |
+
$(document).on('keydown.fb', function(e) {
|
166 |
+
if (e.keyCode == 27) {
|
167 |
+
e.preventDefault();
|
168 |
+
$.fancybox.cancel();
|
169 |
+
return false;
|
170 |
+
}
|
171 |
+
});
|
172 |
+
}
|
173 |
+
|
174 |
+
switch (type) {
|
175 |
+
case 'html' :
|
176 |
+
tmp.html( selectedOpts.content );
|
177 |
+
selectedOpts.enableSwipeNav = false;
|
178 |
+
|
179 |
+
_process_inline();
|
180 |
+
break;
|
181 |
+
|
182 |
+
case 'inline' :
|
183 |
+
if ( $(obj).parent().is('#fancybox-content') === true) {
|
184 |
+
busy = false;
|
185 |
+
return;
|
186 |
+
}
|
187 |
+
|
188 |
+
selectedOpts.enableSwipeNav = false;
|
189 |
+
|
190 |
+
$(obj).clone()
|
191 |
+
.attr('id', $(obj).attr('id')+'-tmp')
|
192 |
+
.insertBefore( $(obj) );
|
193 |
+
|
194 |
+
$(document).on('fancybox-cleanup fancybox-change', function() {
|
195 |
+
let theObj = content.children().children();
|
196 |
+
$('#'+theObj.attr('id')+'-tmp').replaceWith(theObj);
|
197 |
+
}).on('fancybox-cancel', function() {
|
198 |
+
let theObj = tmp.children();
|
199 |
+
if (!theObj.length) {
|
200 |
+
theObj = content.children().children();
|
201 |
+
}
|
202 |
+
$('#'+theObj.attr('id')+'-tmp').replaceWith(theObj);
|
203 |
+
});
|
204 |
+
|
205 |
+
$(obj).appendTo(tmp);
|
206 |
+
|
207 |
+
_process_inline();
|
208 |
+
break;
|
209 |
+
|
210 |
+
case 'image':
|
211 |
+
selectedOpts.keepRatio = true;
|
212 |
+
|
213 |
+
busy = false;
|
214 |
+
|
215 |
+
imgPreloader = new Image();
|
216 |
+
|
217 |
+
imgPreloader.onerror = function() {
|
218 |
+
_error(selectedOpts.txt.error.image);
|
219 |
+
};
|
220 |
+
|
221 |
+
imgPreloader.onload = function() {
|
222 |
+
busy = true;
|
223 |
+
|
224 |
+
$.fancybox.hideActivity();
|
225 |
+
|
226 |
+
imgPreloader.onerror = imgPreloader.onload = null;
|
227 |
+
|
228 |
+
selectedOpts.width = imgPreloader.width;
|
229 |
+
selectedOpts.height = imgPreloader.height;
|
230 |
+
|
231 |
+
$("<img />").attr({
|
232 |
+
'id' : 'fancybox-img',
|
233 |
+
'src' : imgPreloader.src,
|
234 |
+
'alt' : selectedOpts.title
|
235 |
+
}).appendTo(tmp);
|
236 |
+
|
237 |
+
_show();
|
238 |
+
};
|
239 |
+
|
240 |
+
imgPreloader.src = href;
|
241 |
+
|
242 |
+
$.fancybox.showActivity();
|
243 |
+
break;
|
244 |
+
|
245 |
+
case 'svg':
|
246 |
+
selectedOpts.scrolling = 'no';
|
247 |
+
selectedOpts.keepRatio = true;
|
248 |
+
|
249 |
+
var str = '<object type="image/svg+xml" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '" data="' + href + '"></object>';
|
250 |
+
|
251 |
+
tmp.html(str);
|
252 |
+
|
253 |
+
_process_inline();
|
254 |
+
break;
|
255 |
+
|
256 |
+
case 'pdf':
|
257 |
+
selectedOpts.scrolling = 'no';
|
258 |
+
selectedOpts.enableSwipeNav = false;
|
259 |
+
|
260 |
+
var str = '<object type="application/pdf" width="100%" height="100%" data="' + href + '"><a href="' + href + '" style="display:block;position:absolute;top:48%;width:100%;text-align:center">' + $(obj).html() + '</a></object>';
|
261 |
+
|
262 |
+
tmp.html(str);
|
263 |
+
|
264 |
+
_process_inline();
|
265 |
+
break;
|
266 |
+
|
267 |
+
case 'ajax':
|
268 |
+
selectedOpts.enableKeyboardNav = false;
|
269 |
+
selectedOpts.showNavArrows = false;
|
270 |
+
selectedOpts.enableSwipeNav = false;
|
271 |
+
|
272 |
+
busy = false;
|
273 |
+
|
274 |
+
$.fancybox.showActivity();
|
275 |
+
|
276 |
+
selectedOpts.ajax.win = selectedOpts.ajax.success;
|
277 |
+
|
278 |
+
ajaxLoader = $.ajax($.extend({}, selectedOpts.ajax, {
|
279 |
+
url : href,
|
280 |
+
data : selectedOpts.ajax.data || {},
|
281 |
+
error : function() {
|
282 |
+
if ( arguments[0].status > 0 ) { // XMLHttpRequest
|
283 |
+
_error(arguments[2]); // errorThrown
|
284 |
+
}
|
285 |
+
},
|
286 |
+
success : function(data, textStatus, XMLHttpRequest) {
|
287 |
+
var o = typeof XMLHttpRequest == 'object' ? XMLHttpRequest : ajaxLoader;
|
288 |
+
if (o.status == 200) {
|
289 |
+
if ( typeof selectedOpts.ajax.win == 'function' ) {
|
290 |
+
ret = selectedOpts.ajax.win(href, data, textStatus, XMLHttpRequest);
|
291 |
+
|
292 |
+
if (ret === false) {
|
293 |
+
$.fancybox.hideActivity();
|
294 |
+
return;
|
295 |
+
} else if (typeof ret == 'string' || typeof ret == 'object') {
|
296 |
+
data = ret;
|
297 |
+
}
|
298 |
+
}
|
299 |
+
|
300 |
+
if ( data.indexOf("<!DOCTYPE") > -1 || data.indexOf("<html") > -1 || data.indexOf("<body") > -1 ) {
|
301 |
+
_error(selectedOpts.txt.error.unexpected);
|
302 |
+
} else {
|
303 |
+
tmp.html(data);
|
304 |
+
_process_inline();
|
305 |
+
}
|
306 |
+
}
|
307 |
+
}
|
308 |
+
}));
|
309 |
+
break;
|
310 |
+
|
311 |
+
case 'iframe':
|
312 |
+
selectedOpts.enableSwipeNav = false;
|
313 |
+
|
314 |
+
$.fancybox.showActivity();
|
315 |
+
|
316 |
+
_show();
|
317 |
+
break;
|
318 |
+
}
|
319 |
+
};
|
320 |
+
|
321 |
+
_process_inline = function() {
|
322 |
+
var w = selectedOpts.width,
|
323 |
+
h = selectedOpts.height;
|
324 |
+
|
325 |
+
$.fancybox.hideActivity();
|
326 |
+
|
327 |
+
if (w.toString().indexOf('%') > -1) {
|
328 |
+
w = parseInt((window.innerWidth - (selectedOpts.margin * 2)) * parseFloat(w) / 100, 10) + 'px';
|
329 |
+
} else {
|
330 |
+
w = w == 'auto' ? 'auto' : w + 'px';
|
331 |
+
}
|
332 |
+
|
333 |
+
if (h.toString().indexOf('%') > -1) {
|
334 |
+
h = parseInt((window.innerHeight - (selectedOpts.margin * 2)) * parseFloat(h) / 100, 10) + 'px';
|
335 |
+
} else {
|
336 |
+
h = h == 'auto' ? 'auto' : h + 'px';
|
337 |
+
}
|
338 |
+
|
339 |
+
tmp.wrapInner('<div style="width:' + w + ';height:' + h + ';overflow:hidden;position:relative;"></div>');
|
340 |
+
|
341 |
+
selectedOpts.width = tmp.width();
|
342 |
+
selectedOpts.height = tmp.height();
|
343 |
+
|
344 |
+
_show();
|
345 |
+
};
|
346 |
+
|
347 |
+
_show = function() {
|
348 |
+
busy = true;
|
349 |
+
|
350 |
+
$(content.add( overlay )).off();
|
351 |
+
|
352 |
+
$(window).off('resize.fb');
|
353 |
+
|
354 |
+
previousType = currentOpts.type;
|
355 |
+
|
356 |
+
currentArray = selectedArray;
|
357 |
+
currentIndex = selectedIndex;
|
358 |
+
currentOpts = selectedOpts;
|
359 |
+
|
360 |
+
if (currentOpts.overlayShow) {
|
361 |
+
if (currentOpts.overlayColor)
|
362 |
+
overlay.css('background-color',currentOpts.overlayColor);
|
363 |
+
|
364 |
+
if (currentOpts.hideOnOverlayClick)
|
365 |
+
overlay.css('cursor','pointer');
|
366 |
+
|
367 |
+
if (!overlay.is(':visible')) {
|
368 |
+
overlay.fadeIn('fast');
|
369 |
+
}
|
370 |
+
} else {
|
371 |
+
overlay.hide();
|
372 |
+
}
|
373 |
+
|
374 |
+
_process_title();
|
375 |
+
|
376 |
+
final_pos = _get_zoom_to();
|
377 |
+
|
378 |
+
if (wrap.is(':visible')) {
|
379 |
+
$( close.add( nav_prev ).add( nav_next ) ).hide();
|
380 |
+
|
381 |
+
// if both images
|
382 |
+
if (previousType === 'image' && currentOpts.type === 'image') {
|
383 |
+
// crossfade
|
384 |
+
content.prepend( tmp.contents() );
|
385 |
+
content
|
386 |
+
.children()
|
387 |
+
.first()
|
388 |
+
.next().fadeOut(currentOpts.changeSpeed, function(){ $( this ).remove(); } );
|
389 |
+
|
390 |
+
content.css('border-width', currentOpts.padding);
|
391 |
+
|
392 |
+
wrap.animate(final_pos, {
|
393 |
+
duration : currentOpts.changeSpeed,
|
394 |
+
easing : currentOpts.easingChange,
|
395 |
+
complete : _finish
|
396 |
+
});
|
397 |
+
} else {
|
398 |
+
content.fadeTo(currentOpts.changeFade, 0.3, function() {
|
399 |
+
|
400 |
+
content.css('border-width', currentOpts.padding);
|
401 |
+
|
402 |
+
wrap.animate(final_pos, {
|
403 |
+
duration : currentOpts.changeSpeed,
|
404 |
+
easing : currentOpts.easingChange,
|
405 |
+
complete : function() {
|
406 |
+
content.html( tmp.contents() ).fadeTo(currentOpts.changeFade, 1, _finish);
|
407 |
+
}
|
408 |
+
});
|
409 |
+
});
|
410 |
+
}
|
411 |
+
|
412 |
+
return;
|
413 |
+
}
|
414 |
+
|
415 |
+
wrap.removeAttr("style");
|
416 |
+
|
417 |
+
content.css('border-width', currentOpts.padding);
|
418 |
+
|
419 |
+
content.html( tmp.contents() );
|
420 |
+
|
421 |
+
if (currentOpts.transitionIn == 'elastic') {
|
422 |
+
wrap.css(_get_orig_pos()).show();
|
423 |
+
|
424 |
+
final_pos.opacity = 1;
|
425 |
+
|
426 |
+
wrap
|
427 |
+
.attr('aria-hidden','false')
|
428 |
+
.animate(final_pos, {
|
429 |
+
duration : currentOpts.speedIn,
|
430 |
+
easing : currentOpts.easingIn,
|
431 |
+
complete : _finish
|
432 |
+
});
|
433 |
+
} else {
|
434 |
+
wrap
|
435 |
+
.css(final_pos)
|
436 |
+
.attr('aria-hidden','false')
|
437 |
+
.fadeIn( currentOpts.transitionIn == 'none' ? 0 : currentOpts.speedIn, _finish );
|
438 |
+
}
|
439 |
+
};
|
440 |
+
|
441 |
+
_format_title = function(title) {
|
442 |
+
if (title && title.length) {
|
443 |
+
return '<div id="fancybox-title">' + title + '</div>';
|
444 |
+
}
|
445 |
+
|
446 |
+
return false;
|
447 |
+
};
|
448 |
+
|
449 |
+
_process_title = function() {
|
450 |
+
titleStr = currentOpts.title || '';
|
451 |
+
titleHeight = 0;
|
452 |
+
|
453 |
+
title
|
454 |
+
.empty()
|
455 |
+
.removeAttr('style')
|
456 |
+
.removeClass();
|
457 |
+
|
458 |
+
if (currentOpts.titleShow === false) {
|
459 |
+
title.hide();
|
460 |
+
return;
|
461 |
+
}
|
462 |
+
|
463 |
+
titleStr = $.isFunction(currentOpts.titleFormat) ? currentOpts.titleFormat(titleStr, currentArray, currentIndex, currentOpts) : _format_title(titleStr);
|
464 |
+
|
465 |
+
if (!titleStr || titleStr === '') {
|
466 |
+
title.hide();
|
467 |
+
return;
|
468 |
+
}
|
469 |
+
|
470 |
+
title
|
471 |
+
.addClass('fancybox-title-' + currentOpts.titlePosition)
|
472 |
+
.html( titleStr )
|
473 |
+
.appendTo( 'body' )
|
474 |
+
.show();
|
475 |
+
|
476 |
+
switch (currentOpts.titlePosition) {
|
477 |
+
case 'outside':
|
478 |
+
case 'inside':
|
479 |
+
titleHeight = title.outerHeight(true);
|
480 |
+
title.appendTo( outer );
|
481 |
+
break;
|
482 |
+
|
483 |
+
case 'over':
|
484 |
+
if (content.is(':visible')) {
|
485 |
+
title.appendTo( content );
|
486 |
+
} else {
|
487 |
+
title.appendTo( tmp );
|
488 |
+
}
|
489 |
+
break;
|
490 |
+
|
491 |
+
default:
|
492 |
+
title
|
493 |
+
.css({
|
494 |
+
'paddingLeft' : currentOpts.padding,
|
495 |
+
'paddingRight' : currentOpts.padding
|
496 |
+
})
|
497 |
+
.appendTo( wrap );
|
498 |
+
}
|
499 |
+
|
500 |
+
title.hide();
|
501 |
+
};
|
502 |
+
|
503 |
+
_swipe = function() {
|
504 |
+
let dx = move_startX - move_endX;
|
505 |
+
|
506 |
+
move_startX = move_endX = 0;
|
507 |
+
|
508 |
+
if (Math.abs(dx) < currentOpts.swipeThreshold) return;
|
509 |
+
|
510 |
+
if ( dx < 0 ) {
|
511 |
+
$.fancybox.prev();
|
512 |
+
} else {
|
513 |
+
$.fancybox.next();
|
514 |
+
}
|
515 |
+
};
|
516 |
+
|
517 |
+
_set_navigation = function() {
|
518 |
+
if (currentArray.length === 1) return;
|
519 |
+
|
520 |
+
if (currentOpts.enableSwipeNav) {
|
521 |
+
wrap.css('cursor','move');
|
522 |
+
|
523 |
+
wrap.on('mousedown.fb', function(e) {
|
524 |
+
e.preventDefault();
|
525 |
+
move_startX = move_endX = typeof e.clientX !== 'undefined' ? e.clientX : e.originalEvent.clientX;
|
526 |
+
wrap.on('mousemove.fb', function(e) {
|
527 |
+
move_endX = typeof e.clientX !== 'undefined' ? e.clientX : e.originalEvent.clientX;
|
528 |
+
});
|
529 |
+
});
|
530 |
+
wrap.on('mouseup.fb', function() {
|
531 |
+
wrap.off('mousemove.fb');
|
532 |
+
_swipe();
|
533 |
+
});
|
534 |
+
if (isTouch) {
|
535 |
+
wrap.on('touchstart.fb', function(e) {
|
536 |
+
swipe_busy = e.touches.length === 1;
|
537 |
+
move_startX = move_endX = typeof e.touches !== 'undefined' ? e.touches[0].clientX : e.originalEvent.touches[0].clientX;
|
538 |
+
wrap.on('touchmove.fb', function(e) {
|
539 |
+
if (e.touches.length === 1) {
|
540 |
+
move_endX = typeof e.touches !== 'undefined' ? e.touches[0].clientX : e.originalEvent.touches[0].clientX;
|
541 |
+
} else { // more than one touch, probably pinch or zoom
|
542 |
+
swipe_busy = false;
|
543 |
+
wrap.off('touchmove.fb');
|
544 |
+
}
|
545 |
+
});
|
546 |
+
});
|
547 |
+
wrap.on('touchend.fb', function() {
|
548 |
+
wrap.off('touchmove.fb');
|
549 |
+
if (swipe_busy) {
|
550 |
+
swipe_busy = false;
|
551 |
+
_swipe();
|
552 |
+
}
|
553 |
+
});
|
554 |
+
}
|
555 |
+
}
|
556 |
+
|
557 |
+
if ($.fn.mousewheel) {
|
558 |
+
wrap.on('mousewheel.fb', function(e, delta) {
|
559 |
+
if (busy) {
|
560 |
+
e.preventDefault();
|
561 |
+
} else if ( currentOpts.type == 'image' && ( $(e.target).outerHeight() == 0 || $(e.target).prop('scrollHeight') === $(e.target).outerHeight() ) ) {
|
562 |
+
e.preventDefault();
|
563 |
+
$.fancybox[ delta > 0 ? 'prev' : 'next' ]();
|
564 |
+
}
|
565 |
+
});
|
566 |
+
}
|
567 |
+
|
568 |
+
$(document).off('keydown.fb');
|
569 |
+
if (currentOpts.enableEscapeButton || currentOpts.enableKeyboardNav) {
|
570 |
+
$(document).on('keydown.fb', function(e) {
|
571 |
+
if (currentOpts.enableEscapeButton && e.keyCode == 27) {
|
572 |
+
e.preventDefault();
|
573 |
+
$.fancybox.close();
|
574 |
+
return false;
|
575 |
+
} else if (currentOpts.enableKeyboardNav && (e.keyCode == 37 || e.keyCode == 39) && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
576 |
+
e.preventDefault();
|
577 |
+
$.fancybox[ e.keyCode == 37 ? 'prev' : 'next']();
|
578 |
+
} else if (currentOpts.enableKeyboardNav && (e.keyCode == 9) && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
579 |
+
e.preventDefault();
|
580 |
+
$.fancybox[ e.shiftKey ? 'prev' : 'next']();
|
581 |
+
}
|
582 |
+
});
|
583 |
+
}
|
584 |
+
|
585 |
+
if (currentOpts.showNavArrows) {
|
586 |
+
if (currentOpts.cyclic || currentIndex !== 0) {
|
587 |
+
nav_prev.attr('title',currentOpts.txt.prev).show();
|
588 |
+
}
|
589 |
+
|
590 |
+
if (currentOpts.cyclic || currentIndex != currentArray.length-1) {
|
591 |
+
nav_next.attr('title',currentOpts.txt.next).show();
|
592 |
+
}
|
593 |
+
}
|
594 |
+
};
|
595 |
+
|
596 |
+
_finish = function () {
|
597 |
+
if (titleStr && titleStr.length) {
|
598 |
+
title.fadeIn();
|
599 |
+
}
|
600 |
+
|
601 |
+
if (currentOpts.showCloseButton) {
|
602 |
+
close.attr('title',currentOpts.txt.close).show();
|
603 |
+
}
|
604 |
+
|
605 |
+
_set_navigation();
|
606 |
+
|
607 |
+
if (currentOpts.hideOnContentClick) {
|
608 |
+
content.on('click', $.fancybox.close).css('cursor','pointer');;
|
609 |
+
}
|
610 |
+
|
611 |
+
if (currentOpts.hideOnOverlayClick) {
|
612 |
+
overlay.on('click', $.fancybox.close);
|
613 |
+
}
|
614 |
+
|
615 |
+
if (currentOpts.autoResize) {
|
616 |
+
$(window).on("resize.fb", $.fancybox.resize);
|
617 |
+
}
|
618 |
+
|
619 |
+
if (currentOpts.type == 'iframe') {
|
620 |
+
$('<iframe id="fancybox-frame" name="fancybox-frame' + new Date().getTime() + '"'
|
621 |
+
+ ' style="border:0;margin:0;overflow:' + (currentOpts.scrolling == 'auto' ? 'auto' : (currentOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + '" src="'
|
622 |
+
+ currentOpts.href + '"' + (false === currentOpts.allowfullscreen ? '' : ' allowfullscreen') + ' allow="autoplay; encrypted-media" tabindex="999"></iframe>')
|
623 |
+
.appendTo(content).on('load',function() {
|
624 |
+
$.fancybox.hideActivity();
|
625 |
+
});
|
626 |
+
}
|
627 |
+
|
628 |
+
if (currentOpts.type == 'inline' || currentOpts.type == 'html') {
|
629 |
+
$(content).children().css('overflow', currentOpts.scrolling == 'auto' ? 'auto' : (currentOpts.scrolling == 'yes' ? 'scroll' : 'hidden') );
|
630 |
+
}
|
631 |
+
|
632 |
+
wrap.show().focus();
|
633 |
+
|
634 |
+
busy = false;
|
635 |
+
|
636 |
+
$(document).trigger('fancybox-complete', currentArray, currentIndex, currentOpts);
|
637 |
+
|
638 |
+
currentOpts.onComplete(currentArray, currentIndex, currentOpts);
|
639 |
+
|
640 |
+
if (currentArray.length > 1) {
|
641 |
+
_preload_next();
|
642 |
+
_preload_prev();
|
643 |
+
}
|
644 |
+
};
|
645 |
+
|
646 |
+
_preload_next = function() {
|
647 |
+
var pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex + 1;
|
648 |
+
|
649 |
+
if ( pos >= currentArray.length ) {
|
650 |
+
if (currentOpts.cyclic) {
|
651 |
+
pos = 0;
|
652 |
+
} else {
|
653 |
+
return;
|
654 |
+
}
|
655 |
+
}
|
656 |
+
|
657 |
+
if ( pos == currentIndex ) {
|
658 |
+
currentOpts.enableKeyboardNav = false;
|
659 |
+
currentOpts.enableSwipeNav = false;
|
660 |
+
wrap.off('mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb');
|
661 |
+
nav_next.hide();
|
662 |
+
return;
|
663 |
+
}
|
664 |
+
|
665 |
+
if ( _preload_image( pos ) ) {
|
666 |
+
return;
|
667 |
+
} else {
|
668 |
+
_preload_next( pos + 1 );
|
669 |
+
}
|
670 |
+
};
|
671 |
+
|
672 |
+
_preload_prev = function() {
|
673 |
+
var pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex - 1;
|
674 |
+
|
675 |
+
if ( pos < 0 ) {
|
676 |
+
if (currentOpts.cyclic) {
|
677 |
+
pos = currentArray.length - 1;
|
678 |
+
} else {
|
679 |
+
return;
|
680 |
+
}
|
681 |
+
}
|
682 |
+
|
683 |
+
if ( pos == currentIndex ) {
|
684 |
+
currentOpts.enableKeyboardNav = false;
|
685 |
+
currentOpts.enableSwipeNav = false;
|
686 |
+
wrap.off('mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb');
|
687 |
+
nav_prev.hide();
|
688 |
+
return;
|
689 |
+
}
|
690 |
+
|
691 |
+
if ( _preload_image( pos ) ) {
|
692 |
+
return;
|
693 |
+
} else {
|
694 |
+
_preload_prev( pos - 1 );
|
695 |
+
}
|
696 |
+
};
|
697 |
+
|
698 |
+
_preload_image = function(pos) {
|
699 |
+
var objNext, obj = currentArray[ pos ];
|
700 |
+
|
701 |
+
if ( typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href !== currentOpts.href && (obj.href.match(imgRegExp) || $(obj).hasClass("image")) ) {
|
702 |
+
objNext = new Image();
|
703 |
+
objNext.src = obj.href;
|
704 |
+
return true;
|
705 |
+
} else {
|
706 |
+
return false;
|
707 |
+
}
|
708 |
+
};
|
709 |
+
|
710 |
+
_get_zoom_to = function () {
|
711 |
+
var view = [
|
712 |
+
window.innerWidth - (currentOpts.margin * 2),
|
713 |
+
window.innerHeight - (currentOpts.margin * 2) - titleHeight,
|
714 |
+
$(document).scrollLeft() + currentOpts.margin,
|
715 |
+
$(document).scrollTop() + currentOpts.margin
|
716 |
+
],
|
717 |
+
to = {},
|
718 |
+
ratio = currentOpts.keepRatio && currentOpts.height ? currentOpts.width / currentOpts.height : 1;
|
719 |
+
|
720 |
+
if (currentOpts.width.toString().indexOf('%') > -1) {
|
721 |
+
to.width = parseInt((view[0] * parseFloat(currentOpts.width)) / 100, 10);
|
722 |
+
} else {
|
723 |
+
to.width = currentOpts.width + (currentOpts.padding * 2);
|
724 |
+
}
|
725 |
+
|
726 |
+
if (currentOpts.height.toString().indexOf('%') > -1) {
|
727 |
+
to.height = parseInt((view[1] * parseFloat(currentOpts.height)) / 100, 10);
|
728 |
+
} else {
|
729 |
+
to.height = currentOpts.height + (currentOpts.padding * 2);
|
730 |
+
}
|
731 |
+
|
732 |
+
// scale down to fit viewport, recalculate by ratio based on width and height without border and title
|
733 |
+
if (currentOpts.autoScale && to.width > view[0]) {
|
734 |
+
to.width = view[0] - (currentOpts.padding * 2);
|
735 |
+
to.height = parseInt(to.width / ratio, 10);
|
736 |
+
}
|
737 |
+
if (currentOpts.autoScale && to.height > view[1]) {
|
738 |
+
to.height = view[1] - (currentOpts.padding * 2);
|
739 |
+
to.width = parseInt(to.height * ratio, 10);
|
740 |
+
}
|
741 |
+
|
742 |
+
// calculate position
|
743 |
+
to.left = parseInt(Math.max(view[2], view[2] + (view[0] - to.width ) / 2), 10);
|
744 |
+
to.top = parseInt(Math.max(view[3], view[3] + (view[1] - to.height) / 2), 10);
|
745 |
+
|
746 |
+
return to;
|
747 |
+
};
|
748 |
+
|
749 |
+
_get_orig_pos = function() {
|
750 |
+
if ( !selectedOpts.orig ) return false;
|
751 |
+
|
752 |
+
var orig = $(selectedOpts.orig);
|
753 |
+
|
754 |
+
if ( !orig.length ) return false;
|
755 |
+
|
756 |
+
var pos = orig.offset();
|
757 |
+
|
758 |
+
pos.top += parseInt( orig.css('paddingTop'), 10 ) || parseInt( orig.css('border-top-width'), 10 ) || 0;
|
759 |
+
pos.left += parseInt( orig.css('paddingLeft'), 10 ) || parseInt( orig.css('border-left-width'), 10 ) || 0;
|
760 |
+
|
761 |
+
return {
|
762 |
+
width : orig.width() + (currentOpts.padding * 2),
|
763 |
+
height : orig.height() + (currentOpts.padding * 2),
|
764 |
+
top : pos.top - currentOpts.padding,
|
765 |
+
left : pos.left - currentOpts.padding,
|
766 |
+
opacity : 0
|
767 |
+
};
|
768 |
+
};
|
769 |
+
|
770 |
+
_closed = function() {
|
771 |
+
overlay.fadeOut('fast');
|
772 |
+
|
773 |
+
$(document).trigger('fancybox-closed', currentArray, currentIndex, currentOpts);
|
774 |
+
|
775 |
+
currentOpts.onClosed(currentArray, currentIndex, currentOpts);
|
776 |
+
|
777 |
+
_cleanup();
|
778 |
+
};
|
779 |
+
|
780 |
+
_cleanup = function() {
|
781 |
+
overlay.hide();
|
782 |
+
|
783 |
+
title.empty().hide();
|
784 |
+
wrap.hide().attr('aria-hidden','true');;
|
785 |
+
|
786 |
+
content.empty();
|
787 |
+
|
788 |
+
currentArray = selectedArray = [];
|
789 |
+
currentIndex = selectedIndex = 0;
|
790 |
+
currentOpts = selectedOpts = {};
|
791 |
+
|
792 |
+
$('html').css( { '--vertical-scrollbar' : '', '--horizontal-scrollbar' : '' } );
|
793 |
+
$('html').removeClass('fancybox-active');
|
794 |
+
|
795 |
+
$(document).off('fancybox-cancel fancybox-change fancybox-cleanup fancybox-closed');
|
796 |
+
|
797 |
+
busy = false;
|
798 |
+
};
|
799 |
+
|
800 |
+
/*
|
801 |
+
* Public methods
|
802 |
+
*/
|
803 |
+
|
804 |
+
$.fn.fancybox = function(options) {
|
805 |
+
if (!$(this).length) {
|
806 |
+
return this;
|
807 |
+
}
|
808 |
+
|
809 |
+
let objOpts = $.extend({}, options, ($.metadata ? $(this).metadata() : {}));
|
810 |
+
|
811 |
+
if ( ! objOpts.minViewportWidth || document.documentElement.clientWidth >= objOpts.minViewportWidth ) {
|
812 |
+
$(this)
|
813 |
+
.data('fancybox', objOpts)
|
814 |
+
.attr({'aria-controls':'fancybox','aria-haspopup':'dialog'})
|
815 |
+
.off('click.fb')
|
816 |
+
.on('click.fb', function(e) {
|
817 |
+
e.preventDefault();
|
818 |
+
|
819 |
+
if (busy) {
|
820 |
+
return false;
|
821 |
+
}
|
822 |
+
|
823 |
+
busy = true;
|
824 |
+
|
825 |
+
$(this).blur();
|
826 |
+
|
827 |
+
selectedArray = [];
|
828 |
+
selectedIndex = 0;
|
829 |
+
|
830 |
+
var rel = $(this).attr('rel') || '';
|
831 |
+
|
832 |
+
if (rel == '' || rel.replace(/alternate|external|help|license|nofollow|noreferrer|noopener|\s+/gi,'') == '') {
|
833 |
+
selectedArray.push(this);
|
834 |
+
} else {
|
835 |
+
selectedArray = $('a[rel="' + rel + '"], area[rel="' + rel + '"]');
|
836 |
+
selectedIndex = selectedArray.index( this );
|
837 |
+
}
|
838 |
+
|
839 |
+
$('html').css( { '--vertical-scrollbar' : window.innerWidth-$(window).width() + 'px', '--horizontal-scrollbar' : window.innerHeight-$(window).height() + 'px' } );
|
840 |
+
|
841 |
+
_start();
|
842 |
+
|
843 |
+
return false;
|
844 |
+
});
|
845 |
+
};
|
846 |
+
|
847 |
+
return this;
|
848 |
+
};
|
849 |
+
|
850 |
+
$.fancybox = function(obj) {
|
851 |
+
var opts;
|
852 |
+
|
853 |
+
if (busy) {
|
854 |
+
return;
|
855 |
+
}
|
856 |
+
|
857 |
+
busy = true;
|
858 |
+
opts = typeof arguments[1] !== 'undefined' ? arguments[1] : {};
|
859 |
+
|
860 |
+
selectedArray = [];
|
861 |
+
selectedIndex = parseInt(opts.index, 10) || 0;
|
862 |
+
|
863 |
+
if ( $.isArray(obj) ) {
|
864 |
+
for (var i = 0, j = obj.length; i < j; i++) {
|
865 |
+
if (typeof obj[i] == 'object') {
|
866 |
+
$(obj[i]).data('fancybox', $.extend({}, opts, obj[i]));
|
867 |
+
} else {
|
868 |
+
obj[i] = $({}).data('fancybox', $.extend({content : obj[i]}, opts));
|
869 |
+
}
|
870 |
+
}
|
871 |
+
|
872 |
+
selectedArray = jQuery.merge(selectedArray, obj);
|
873 |
+
} else {
|
874 |
+
if ( typeof obj == 'object' ) {
|
875 |
+
$(obj).data('fancybox', $.extend({}, opts, obj));
|
876 |
+
} else {
|
877 |
+
obj = $({}).data('fancybox', $.extend({content : obj}, opts));
|
878 |
+
}
|
879 |
+
|
880 |
+
selectedArray.push(obj);
|
881 |
+
}
|
882 |
+
|
883 |
+
if (selectedIndex > selectedArray.length || selectedIndex < 0) {
|
884 |
+
selectedIndex = 0;
|
885 |
+
}
|
886 |
+
|
887 |
+
$('html').css( { '--vertical-scrollbar' : window.innerWidth-$(window).width() + 'px', '--horizontal-scrollbar' : window.innerHeight-$(window).height() + 'px' } );
|
888 |
+
|
889 |
+
_start();
|
890 |
+
};
|
891 |
+
|
892 |
+
$.fancybox.showActivity = function() {
|
893 |
+
loading.attr('title',selectedOpts.txt.loading).show();
|
894 |
+
};
|
895 |
+
|
896 |
+
$.fancybox.hideActivity = function() {
|
897 |
+
loading.hide();
|
898 |
+
};
|
899 |
+
|
900 |
+
$.fancybox.next = function() {
|
901 |
+
var obj, pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex + 1;
|
902 |
+
|
903 |
+
if (pos >= currentArray.length) {
|
904 |
+
if (currentOpts.cyclic) {
|
905 |
+
pos = 0;
|
906 |
+
} else {
|
907 |
+
return;
|
908 |
+
}
|
909 |
+
}
|
910 |
+
|
911 |
+
obj = currentArray[pos];
|
912 |
+
|
913 |
+
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
914 |
+
$.fancybox.next( pos + 1 );
|
915 |
+
} else {
|
916 |
+
$.fancybox.pos( pos );
|
917 |
+
}
|
918 |
+
|
919 |
+
return;
|
920 |
+
};
|
921 |
+
|
922 |
+
$.fancybox.prev = function() {
|
923 |
+
var obj, pos = typeof arguments[0] == 'number' ? arguments[0] : currentIndex - 1;
|
924 |
+
|
925 |
+
if (pos < 0) {
|
926 |
+
if (currentOpts.cyclic) {
|
927 |
+
pos = currentArray.length - 1;
|
928 |
+
} else {
|
929 |
+
return;
|
930 |
+
}
|
931 |
+
}
|
932 |
+
|
933 |
+
obj = currentArray[pos];
|
934 |
+
|
935 |
+
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
936 |
+
$.fancybox.prev( pos - 1 );
|
937 |
+
} else {
|
938 |
+
$.fancybox.pos( pos );
|
939 |
+
}
|
940 |
+
|
941 |
+
return;
|
942 |
+
};
|
943 |
+
|
944 |
+
$.fancybox.pos = function(pos) {
|
945 |
+
if (busy) {
|
946 |
+
return;
|
947 |
+
}
|
948 |
+
|
949 |
+
pos = parseInt(pos);
|
950 |
+
|
951 |
+
if (currentArray.length > 1 && pos != currentIndex && pos > -1 && pos < currentArray.length) {
|
952 |
+
$(document).trigger('fancybox-change');
|
953 |
+
|
954 |
+
selectedArray = currentArray;
|
955 |
+
selectedIndex = pos;
|
956 |
+
|
957 |
+
wrap.off('mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb').css('cursor','initial');
|
958 |
+
content.off('click');
|
959 |
+
|
960 |
+
_start();
|
961 |
+
}
|
962 |
+
|
963 |
+
return;
|
964 |
+
};
|
965 |
+
|
966 |
+
$.fancybox.cancel = function() {
|
967 |
+
busy = true;
|
968 |
+
|
969 |
+
_abort();
|
970 |
+
|
971 |
+
$(document).trigger('fancybox-cancel', selectedArray, selectedIndex, selectedOpts);
|
972 |
+
|
973 |
+
if (selectedOpts && false === selectedOpts.onCancel(selectedArray, selectedIndex, selectedOpts) ) {
|
974 |
+
busy = false;
|
975 |
+
return;
|
976 |
+
};
|
977 |
+
|
978 |
+
$(selectedArray[ selectedIndex ]).focus();
|
979 |
+
|
980 |
+
$(close.add( nav_prev ).add( nav_next )).hide();
|
981 |
+
|
982 |
+
$(content.add( overlay )).off();
|
983 |
+
|
984 |
+
$(window).off('resize.fb');
|
985 |
+
$(wrap).off('mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb');
|
986 |
+
$(document).off('keydown.fb');
|
987 |
+
|
988 |
+
// This helps IE
|
989 |
+
if (/MSIE|Trident/.test(window.navigator.userAgent)) {
|
990 |
+
content.find('iframe#fancybox-frame').attr('src', '//about:blank');
|
991 |
+
}
|
992 |
+
|
993 |
+
wrap.stop();
|
994 |
+
|
995 |
+
_cleanup();
|
996 |
+
};
|
997 |
+
|
998 |
+
// Note: within an iframe use - parent.$.fancybox.close();
|
999 |
+
$.fancybox.close = function() {
|
1000 |
+
if (busy || wrap.is(':hidden')) {
|
1001 |
+
return;
|
1002 |
+
}
|
1003 |
+
|
1004 |
+
busy = true;
|
1005 |
+
|
1006 |
+
_abort();
|
1007 |
+
|
1008 |
+
$(document).trigger('fancybox-cleanup', currentArray, currentIndex, currentOpts);
|
1009 |
+
|
1010 |
+
if (currentOpts && false === currentOpts.onCleanup(currentArray, currentIndex, currentOpts)) {
|
1011 |
+
busy = false;
|
1012 |
+
return;
|
1013 |
+
}
|
1014 |
+
|
1015 |
+
$(currentArray[ currentIndex ]).focus();
|
1016 |
+
|
1017 |
+
$(close.add( nav_prev ).add( nav_next )).hide();
|
1018 |
+
|
1019 |
+
$(content.add( overlay )).off();
|
1020 |
+
|
1021 |
+
$(window).off('resize.fb');
|
1022 |
+
$(wrap).off('mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb');
|
1023 |
+
$(document).off('keydown.fb');
|
1024 |
+
|
1025 |
+
// This helps IE
|
1026 |
+
if (/MSIE|Trident/.test(window.navigator.userAgent)) {
|
1027 |
+
content.find('iframe#fancybox-frame').attr('src', '//about:blank');
|
1028 |
+
}
|
1029 |
+
|
1030 |
+
if (currentOpts.titlePosition !== 'inside') {
|
1031 |
+
title.empty();
|
1032 |
+
}
|
1033 |
+
|
1034 |
+
wrap.stop();
|
1035 |
+
|
1036 |
+
if (currentOpts.transitionOut == 'elastic') {
|
1037 |
+
title.empty().hide();
|
1038 |
+
|
1039 |
+
wrap.animate(_get_orig_pos(), {
|
1040 |
+
duration : currentOpts.speedOut,
|
1041 |
+
easing : currentOpts.easingOut,
|
1042 |
+
complete : _closed
|
1043 |
+
});
|
1044 |
+
|
1045 |
+
} else {
|
1046 |
+
wrap.fadeOut( currentOpts.transitionOut == 'none' ? 0 : currentOpts.speedOut, _closed);
|
1047 |
+
}
|
1048 |
+
};
|
1049 |
+
|
1050 |
+
$.fancybox.resize = function() {
|
1051 |
+
clearTimeout( resize_timeout );
|
1052 |
+
|
1053 |
+
resize_timeout = setTimeout( function() {
|
1054 |
+
var restore = [];
|
1055 |
+
|
1056 |
+
busy = true;
|
1057 |
+
|
1058 |
+
_process_title();
|
1059 |
+
|
1060 |
+
final_pos = _get_zoom_to();
|
1061 |
+
|
1062 |
+
close.is(':visible') && restore.push(close) && close.hide();
|
1063 |
+
nav_prev.is(':visible') && restore.push(nav_prev) && nav_prev.hide();
|
1064 |
+
nav_next.is(':visible') && restore.push(nav_next) && nav_next.hide();
|
1065 |
+
|
1066 |
+
wrap.animate(final_pos, {
|
1067 |
+
duration : currentOpts.changeSpeed,
|
1068 |
+
easing : currentOpts.easingChange,
|
1069 |
+
complete : function() {
|
1070 |
+
if (titleStr && titleStr.length) {
|
1071 |
+
title.fadeIn();
|
1072 |
+
}
|
1073 |
+
restore.forEach( function(el){ el.show(); } );
|
1074 |
+
busy = false;
|
1075 |
+
}
|
1076 |
+
});
|
1077 |
+
}, 500 );
|
1078 |
+
};
|
1079 |
+
|
1080 |
+
$.fancybox.init = function() {
|
1081 |
+
if ($("#fancybox-wrap").length) {
|
1082 |
+
return;
|
1083 |
+
}
|
1084 |
+
|
1085 |
+
$('body').append(
|
1086 |
+
tmp = $('<div id="fancybox-tmp"></div>'),
|
1087 |
+
loading = $('<div id="fancybox-loading" title="Cancel"><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div></div>'),
|
1088 |
+
overlay = $('<div id="fancybox-overlay"></div>'),
|
1089 |
+
wrap = $('<div id="fancybox-wrap" role="dialog" aria-hidden="true" aria-labelledby="fancybox-title" tabindex="-1"></div>')
|
1090 |
+
);
|
1091 |
+
|
1092 |
+
wrap.append(
|
1093 |
+
outer = $('<div id="fancybox-outer"></div>')
|
1094 |
+
);
|
1095 |
+
|
1096 |
+
outer.append(
|
1097 |
+
content = $('<div id="fancybox-content"></div>'),
|
1098 |
+
close = $('<a id="fancybox-close" href="javascript:;" title="Close" class="fancy-ico" tabindex="1"><span></span></a>'),
|
1099 |
+
nav_next = $('<a id="fancybox-next" href="javascript:;" title="Next" class="fancy-ico" tabindex="2"><span></span></a>'),
|
1100 |
+
nav_prev = $('<a id="fancybox-prev" href="javascript:;" title="Previous" class="fancy-ico" tabindex="3"><span></span></a>'),
|
1101 |
+
title = $('<div id="fancybox-title-wrap"></div>')
|
1102 |
+
);
|
1103 |
+
|
1104 |
+
close.click($.fancybox.close);
|
1105 |
+
loading.click($.fancybox.cancel);
|
1106 |
+
|
1107 |
+
nav_prev.click(function(e) {
|
1108 |
+
e.preventDefault();
|
1109 |
+
$.fancybox.prev();
|
1110 |
+
});
|
1111 |
+
|
1112 |
+
nav_next.click(function(e) {
|
1113 |
+
e.preventDefault();
|
1114 |
+
$.fancybox.next();
|
1115 |
+
});
|
1116 |
+
};
|
1117 |
+
|
1118 |
+
$.fn.fancybox.defaults = {
|
1119 |
+
padding : 10,
|
1120 |
+
margin : 40,
|
1121 |
+
modal : false,
|
1122 |
+
cyclic : false,
|
1123 |
+
allowfullscreen : false,
|
1124 |
+
scrolling : 'auto', // 'auto', 'yes' or 'no'
|
1125 |
+
|
1126 |
+
width : 560,
|
1127 |
+
height : 340,
|
1128 |
+
|
1129 |
+
autoScale : true,
|
1130 |
+
autoDimensions : true,
|
1131 |
+
autoResize : true,
|
1132 |
+
keepRatio : false,
|
1133 |
+
minViewportWidth : 0,
|
1134 |
+
|
1135 |
+
swipeThreshold: 80,
|
1136 |
+
|
1137 |
+
ajax : {},
|
1138 |
+
svg : { wmode: 'opaque' },
|
1139 |
+
|
1140 |
+
hideOnOverlayClick : true,
|
1141 |
+
hideOnContentClick : false,
|
1142 |
+
|
1143 |
+
overlayShow : true,
|
1144 |
+
overlayColor : '',
|
1145 |
+
|
1146 |
+
titleShow : true,
|
1147 |
+
titlePosition : 'float', // 'float', 'outside', 'inside' or 'over'
|
1148 |
+
titleFormat : null,
|
1149 |
+
titleFromAlt : true,
|
1150 |
+
|
1151 |
+
transitionIn : 'fade', // 'elastic', 'fade' or 'none'
|
1152 |
+
transitionOut : 'fade', // 'elastic', 'fade' or 'none'
|
1153 |
+
|
1154 |
+
speedIn : 400,
|
1155 |
+
speedOut : 400,
|
1156 |
+
|
1157 |
+
changeSpeed : 200,
|
1158 |
+
changeFade : 200,
|
1159 |
+
|
1160 |
+
easingIn : 'swing',
|
1161 |
+
easingOut : 'swing',
|
1162 |
+
|
1163 |
+
showCloseButton : true,
|
1164 |
+
showNavArrows : true,
|
1165 |
+
enableEscapeButton : true,
|
1166 |
+
enableKeyboardNav : true,
|
1167 |
+
enableSwipeNav : true,
|
1168 |
+
|
1169 |
+
txt: {
|
1170 |
+
error : {
|
1171 |
+
content : 'The requested content cannot be loaded.',
|
1172 |
+
later : 'Please try again later.',
|
1173 |
+
type : 'No content type found.',
|
1174 |
+
image : 'No image found.',
|
1175 |
+
unexpected : 'Unexpected response.'
|
1176 |
+
},
|
1177 |
+
loading : 'Cancel',
|
1178 |
+
close : 'Close',
|
1179 |
+
next : 'Next',
|
1180 |
+
prev : 'Previous'
|
1181 |
+
},
|
1182 |
+
|
1183 |
+
onStart : function(){},
|
1184 |
+
onCancel : function(){},
|
1185 |
+
onComplete : function(){},
|
1186 |
+
onCleanup : function(){},
|
1187 |
+
onClosed : function(){},
|
1188 |
+
onError : function(){}
|
1189 |
+
};
|
1190 |
+
|
1191 |
+
$(document).ready(function() {
|
1192 |
+
$.fancybox.init();
|
1193 |
+
});
|
1194 |
+
|
1195 |
+
})(jQuery);
|
fancybox/1.5.0/jquery.fancybox.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
html.fancybox-active,html.fancybox-active body{touch-action:none;overscroll-behavior:none;-webkit-overflow-scrolling:auto;overflow:hidden;}html.fancybox-active body{margin-right:var(--vertical-scrollbar);margin-bottom:var(--horizontal-scrollbar);}html.fancybox-active body.rtl{margin-right:0;margin-left:var(--vertical-scrollbar);}#fancybox-loading,#fancybox-loading div,#fancybox-overlay,#fancybox-wrap *,#fancybox-wrap *::before,#fancybox-wrap *::after{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;}#fancybox-overlay{position:fixed;top:0;left:0;width:100%;height:100%;background-color:rgba(0,0,0,.7);z-index:111100;display:none;}#fancybox-tmp{padding:0;margin:0;border:0;overflow:auto;display:none;}#fancybox-wrap{position:absolute;top:0;left:0;z-index:111101;display:none;outline:none!important;}#fancybox-outer{position:relative;width:100%;height:100%;box-shadow:0 0 20px #111;-moz-box-shadow:0 0 20px #111;-webkit-box-shadow:0 0 20px #111;}#fancybox-content{position:relative;width:100%;height:100%;-webkit-overflow-scrolling:touch;overflow-y:auto;z-index:111102;border:0 solid #fff;background:#fff;background-clip:padding-box;}#fancybox-content>div{max-width:100%;max-height:100%;}#fancybox-error{color:#444;padding:14px;margin:0;}#fancybox-frame,#fancybox-img{width:100%;height:100%;border:none;}#fancybox-img{position:absolute;padding:0;margin:0;line-height:0;vertical-align:top;max-width:none!important;max-height:none!important}#fancybox-frame{display:block;z-index:0}.fancy-ico{position:absolute;width:48px;height:48px;border-radius:50%;}.fancy-ico span{display:block;position:relative;left:12px;top:12px;width:24px;height:24px;border-radius:50%;background:#000;border:2px solid white;box-shadow:0 0 4px #000;transition:transform .25s ease-in-out;}#fancybox-close:hover span,#fancybox-next:hover span,body.rtl #fancybox-prev:hover span{transform:rotate(360deg);}#fancybox-prev:hover span,body.rtl #fancybox-next:hover span{transform:rotate(-360deg);}#fancybox-close{top:-24px;right:-24px;cursor:pointer;z-index:111105;display:none;}#fancybox-close span::after,#fancybox-close span::before{content:'';position:absolute;top:9px;left:4px;width:12px;height:2px;background-color:#fff;}#fancybox-close span::before{transform:rotate(45deg);}#fancybox-close span::after{transform:rotate(-45deg);}#fancybox-prev,#fancybox-next{top:50%;margin-top:-24px;cursor:pointer;z-index:111102;display:none;}#fancybox-next,body.rtl #fancybox-prev{left:auto;right:-24px;}#fancybox-prev,body.rtl #fancybox-next{left:-24px;right:auto;}#fancybox-prev span::after,#fancybox-next span::after{content:'';position:absolute;top:6px;width:8px;height:8px;border-top:2px solid #fff;border-right:2px solid #fff;}#fancybox-prev span::after,body.rtl #fancybox-next span::after{transform:rotate(-135deg);left:7px;}#fancybox-next span::after,body.rtl #fancybox-prev span::after{transform:rotate(45deg);left:initial;right:7px;}#fancybox-title-wrap{z-index:111104;}.fancybox-title-inside{padding-bottom:10px;text-align:center;color:#333;background-color:#fff;position:relative;}.fancybox-title-outside{padding-top:10px;color:#fff;font-weight:600;}.fancybox-title-over{position:absolute;width:100%;bottom:0;left:0;color:#fff;text-align:left;}body.rtl .fancybox-title-over{text-align:right}.fancybox-title-over #fancybox-title{padding:10px;background:rgba(0,0,0,.6);display:block;}.fancybox-title-float{text-align:center;}.fancybox-title-float #fancybox-title{display:table;margin:-12px auto;height:24px;padding:0 15px;line-height:20px;font-size:16px;color:#fff;background:#000;border:2px solid #fff;border-radius:12px;box-shadow:0 0 4px #000;position:relative;z-index:111104;}#fancybox-loading{position:fixed;top:50%;left:50%;width:40px;height:40px;margin-top:-20px;margin-left:-20px;background-color:rgba(0,0,0,.9);border-radius:5px;cursor:pointer;overflow:hidden;z-index:111104;display:none;}#fancybox-loading div{transform-origin:20px 20px;animation:fancybox-loading 1.2s linear infinite;}#fancybox-loading div::after{content:'';display:block;position:absolute;top:7px;left:19px;width:2px;height:7px;border-radius:20%;background:#fff;}#fancybox-loading div:nth-child(1){transform:rotate(0deg);animation-delay:-1.1s;}#fancybox-loading div:nth-child(2){transform:rotate(30deg);animation-delay:-1s;}#fancybox-loading div:nth-child(3){transform:rotate(60deg);animation-delay:-.9s;}#fancybox-loading div:nth-child(4){transform:rotate(90deg);animation-delay:-.8s;}#fancybox-loading div:nth-child(5){transform:rotate(120deg);animation-delay:-.7s;}#fancybox-loading div:nth-child(6){transform:rotate(150deg);animation-delay:-.6s;}#fancybox-loading div:nth-child(7){transform:rotate(180deg);animation-delay:-.5s;}#fancybox-loading div:nth-child(8){transform:rotate(210deg);animation-delay:-.4s;}#fancybox-loading div:nth-child(9){transform:rotate(240deg);animation-delay:-.3s;}#fancybox-loading div:nth-child(10){transform:rotate(270deg);animation-delay:-.2s;}#fancybox-loading div:nth-child(11){transform:rotate(300deg);animation-delay:-.1s;}#fancybox-loading div:nth-child(12){transform:rotate(330deg);animation-delay:0s;}@keyframes fancybox-loading{0%{opacity:1}100%{opacity:0}}.fancybox-hidden{display:none;}#fancybox-content .fancybox-hidden,#fancybox-tmp .fancybox-hidden{display:revert;}
|
fancybox/1.5.0/jquery.fancybox.min.js
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
!function(e){var t,n,o,i,a,r,c,d,s,l,f,h,u,p,b,g=0,m={},v=[],y=0,w={},x=[],_=null,C=new Image,k=/\.(jpg|gif|png|bmp|jpeg|webp)(.*)?$/i,I=/[^\.]\.(svg)\s*$/i,N=/[^\.]\.(pdf)\s*$/i,S=0,T="",O=!1,j=!1,A=(window.devicePixelRatio,"ontouchstart"in window||window.DocumentTouch&&document instanceof DocumentTouch||navigator.maxTouchPoints>0||navigator.msMaxTouchPoints>0);_abort=function(){e.fancybox.hideActivity(),C.onerror=C.onload=null,_&&_.abort(),t.empty()},_error=function(n){if(!1===m.onError(v,g,m))return e.fancybox.hideActivity(),void(O=!1);void 0===n&&(n=m.txt.error.later),m.type="html",m.enableSwipeNav=!1,m.titleShow=!1,m.width="auto",m.height="auto",t.html('<p id="fancybox-error">'+m.txt.error.content+"<br />"+n+"</p>"),_process_inline()},_start=function(){var n,o,i,a,c=v[g];if(_abort(),m=e.extend({},e.fn.fancybox.defaults,void 0===e(c).data("fancybox")?m:e(c).data("fancybox")),e("html").addClass("fancybox-active"),e(document).trigger("fancybox-start",v,g,m),!1!==(a=m.onStart(v,g,m)))if("object"==typeof a&&(m=e.extend(m,a)),i=m.title||(c.nodeName?e(c).attr("title"):c.title)||"",c.nodeName&&!m.orig&&(m.orig=e(c).find("img:first").length?e(c).find("img:first"):e(c)),""===i&&m.orig&&(i=m.orig.attr("title")||(m.titleFromAlt?m.orig.attr("alt"):"")),n=m.href||(c.nodeName?e(c).attr("href"):c.href)||null,(/^(?:javascript)/i.test(n)||"#"==n)&&(n=null),m.type?(o=m.type,n||(n=m.content)):m.content?o="html":e(c).hasClass("iframe")?o="iframe":n&&(o=n.match(k)||e(c).hasClass("image")?"image":n.match(I)?"svg":n.match(N)?"pdf":0===n.indexOf("#")?"inline":"ajax"),o)switch(e(c).hasClass("modal")&&(m.modal=!0),"inline"==o&&(c=n.substr(n.indexOf("#")),o=e(c).length>0?"inline":"ajax"),m.type=o,m.href=n,m.title=i,m.autoDimensions&&("html"==m.type||"inline"==m.type||"ajax"==m.type?(m.width="auto",m.height="auto"):m.autoDimensions=!1),m.modal&&(m.overlayShow=!0,m.hideOnOverlayClick=!1,m.hideOnContentClick=!1,m.enableEscapeButton=!1,m.showCloseButton=!1),m.padding=parseInt(m.padding,10),m.margin=parseInt(m.margin,10),t.css("padding",m.padding+m.margin),m.enableEscapeButton&&e(document).on("keydown.fb",(function(t){if(27==t.keyCode)return t.preventDefault(),e.fancybox.cancel(),!1})),o){case"html":t.html(m.content),m.enableSwipeNav=!1,_process_inline();break;case"inline":if(!0===e(c).parent().is("#fancybox-content"))return void(O=!1);m.enableSwipeNav=!1,e(c).clone().attr("id",e(c).attr("id")+"-tmp").insertBefore(e(c)),e(document).on("fancybox-cleanup fancybox-change",(function(){let t=r.children().children();e("#"+t.attr("id")+"-tmp").replaceWith(t)})).on("fancybox-cancel",(function(){let n=t.children();n.length||(n=r.children().children()),e("#"+n.attr("id")+"-tmp").replaceWith(n)})),e(c).appendTo(t),_process_inline();break;case"image":m.keepRatio=!0,O=!1,(C=new Image).onerror=function(){_error(m.txt.error.image)},C.onload=function(){O=!0,e.fancybox.hideActivity(),C.onerror=C.onload=null,m.width=C.width,m.height=C.height,e("<img />").attr({id:"fancybox-img",src:C.src,alt:m.title}).appendTo(t),_show()},C.src=n,e.fancybox.showActivity();break;case"svg":m.scrolling="no",m.keepRatio=!0;var d='<object type="image/svg+xml" width="'+m.width+'" height="'+m.height+'" data="'+n+'"></object>';t.html(d),_process_inline();break;case"pdf":m.scrolling="no",m.enableSwipeNav=!1;d='<object type="application/pdf" width="100%" height="100%" data="'+n+'"><a href="'+n+'" style="display:block;position:absolute;top:48%;width:100%;text-align:center">'+e(c).html()+"</a></object>";t.html(d),_process_inline();break;case"ajax":m.enableKeyboardNav=!1,m.showNavArrows=!1,m.enableSwipeNav=!1,O=!1,e.fancybox.showActivity(),m.ajax.win=m.ajax.success,_=e.ajax(e.extend({},m.ajax,{url:n,data:m.ajax.data||{},error:function(){arguments[0].status>0&&_error(arguments[2])},success:function(o,i,r){if(200==("object"==typeof r?r:_).status){if("function"==typeof m.ajax.win){if(!1===(a=m.ajax.win(n,o,i,r)))return void e.fancybox.hideActivity();"string"!=typeof a&&"object"!=typeof a||(o=a)}o.indexOf("<!DOCTYPE")>-1||o.indexOf("<html")>-1||o.indexOf("<body")>-1?_error(m.txt.error.unexpected):(t.html(o),_process_inline())}}}));break;case"iframe":m.enableSwipeNav=!1,e.fancybox.showActivity(),_show();break}else _error(m.txt.error.type);else O=!1},_process_inline=function(){var n=m.width,o=m.height;e.fancybox.hideActivity(),n=n.toString().indexOf("%")>-1?parseInt((window.innerWidth-2*m.margin)*parseFloat(n)/100,10)+"px":"auto"==n?"auto":n+"px",o=o.toString().indexOf("%")>-1?parseInt((window.innerHeight-2*m.margin)*parseFloat(o)/100,10)+"px":"auto"==o?"auto":o+"px",t.wrapInner('<div style="width:'+n+";height:"+o+';overflow:hidden;position:relative;"></div>'),m.width=t.width(),m.height=t.height(),_show()},_show=function(){if(O=!0,e(r.add(o)).off(),e(window).off("resize.fb"),h=w.type,x=v,y=g,(w=m).overlayShow?(w.overlayColor&&o.css("background-color",w.overlayColor),w.hideOnOverlayClick&&o.css("cursor","pointer"),o.is(":visible")||o.fadeIn("fast")):o.hide(),_process_title(),u=_get_zoom_to(),i.is(":visible"))return e(c.add(s).add(l)).hide(),void("image"===h&&"image"===w.type?(r.prepend(t.contents()),r.children().first().next().fadeOut(w.changeSpeed,(function(){e(this).remove()})),r.css("border-width",w.padding),i.animate(u,{duration:w.changeSpeed,easing:w.easingChange,complete:_finish})):r.fadeTo(w.changeFade,.3,(function(){r.css("border-width",w.padding),i.animate(u,{duration:w.changeSpeed,easing:w.easingChange,complete:function(){r.html(t.contents()).fadeTo(w.changeFade,1,_finish)}})})));i.removeAttr("style"),r.css("border-width",w.padding),r.html(t.contents()),"elastic"==w.transitionIn?(i.css(_get_orig_pos()).show(),u.opacity=1,i.attr("aria-hidden","false").animate(u,{duration:w.speedIn,easing:w.easingIn,complete:_finish})):i.css(u).attr("aria-hidden","false").fadeIn("none"==w.transitionIn?0:w.speedIn,_finish)},_format_title=function(e){return!(!e||!e.length)&&'<div id="fancybox-title">'+e+"</div>"},_process_title=function(){if(T=w.title||"",S=0,d.empty().removeAttr("style").removeClass(),!1!==w.titleShow)if((T=e.isFunction(w.titleFormat)?w.titleFormat(T,x,y,w):_format_title(T))&&""!==T){switch(d.addClass("fancybox-title-"+w.titlePosition).html(T).appendTo("body").show(),w.titlePosition){case"outside":case"inside":S=d.outerHeight(!0),d.appendTo(a);break;case"over":r.is(":visible")?d.appendTo(r):d.appendTo(t);break;default:d.css({paddingLeft:w.padding,paddingRight:w.padding}).appendTo(i)}d.hide()}else d.hide();else d.hide()},_swipe=function(){let t=p-b;p=b=0,Math.abs(t)<w.swipeThreshold||(t<0?e.fancybox.prev():e.fancybox.next())},_set_navigation=function(){1!==x.length&&(w.enableSwipeNav&&(i.css("cursor","move"),i.on("mousedown.fb",(function(e){e.preventDefault(),p=b=void 0!==e.clientX?e.clientX:e.originalEvent.clientX,i.on("mousemove.fb",(function(e){b=void 0!==e.clientX?e.clientX:e.originalEvent.clientX}))})),i.on("mouseup.fb",(function(){i.off("mousemove.fb"),_swipe()})),A&&(i.on("touchstart.fb",(function(e){j=1===e.touches.length,p=b=void 0!==e.touches?e.touches[0].clientX:e.originalEvent.touches[0].clientX,i.on("touchmove.fb",(function(e){1===e.touches.length?b=void 0!==e.touches?e.touches[0].clientX:e.originalEvent.touches[0].clientX:(j=!1,i.off("touchmove.fb"))}))})),i.on("touchend.fb",(function(){i.off("touchmove.fb"),j&&(j=!1,_swipe())})))),e.fn.mousewheel&&i.on("mousewheel.fb",(function(t,n){O?t.preventDefault():"image"!=w.type||0!=e(t.target).outerHeight()&&e(t.target).prop("scrollHeight")!==e(t.target).outerHeight()||(t.preventDefault(),e.fancybox[n>0?"prev":"next"]())})),e(document).off("keydown.fb"),(w.enableEscapeButton||w.enableKeyboardNav)&&e(document).on("keydown.fb",(function(t){if(w.enableEscapeButton&&27==t.keyCode)return t.preventDefault(),e.fancybox.close(),!1;!w.enableKeyboardNav||37!=t.keyCode&&39!=t.keyCode||"INPUT"===t.target.tagName||"TEXTAREA"===t.target.tagName||"SELECT"===t.target.tagName?w.enableKeyboardNav&&9==t.keyCode&&"INPUT"!==t.target.tagName&&"TEXTAREA"!==t.target.tagName&&"SELECT"!==t.target.tagName&&(t.preventDefault(),e.fancybox[t.shiftKey?"prev":"next"]()):(t.preventDefault(),e.fancybox[37==t.keyCode?"prev":"next"]())})),w.showNavArrows&&((w.cyclic||0!==y)&&s.attr("title",w.txt.prev).show(),(w.cyclic||y!=x.length-1)&&l.attr("title",w.txt.next).show()))},_finish=function(){T&&T.length&&d.fadeIn(),w.showCloseButton&&c.attr("title",w.txt.close).show(),_set_navigation(),w.hideOnContentClick&&r.on("click",e.fancybox.close).css("cursor","pointer"),w.hideOnOverlayClick&&o.on("click",e.fancybox.close),w.autoResize&&e(window).on("resize.fb",e.fancybox.resize),"iframe"==w.type&&e('<iframe id="fancybox-frame" name="fancybox-frame'+(new Date).getTime()+'" style="border:0;margin:0;overflow:'+("auto"==w.scrolling?"auto":"yes"==w.scrolling?"scroll":"hidden")+'" src="'+w.href+'"'+(!1===w.allowfullscreen?"":" allowfullscreen")+' allow="autoplay; encrypted-media" tabindex="999"></iframe>').appendTo(r).on("load",(function(){e.fancybox.hideActivity()})),"inline"!=w.type&&"html"!=w.type||e(r).children().css("overflow","auto"==w.scrolling?"auto":"yes"==w.scrolling?"scroll":"hidden"),i.show().focus(),O=!1,e(document).trigger("fancybox-complete",x,y,w),w.onComplete(x,y,w),x.length>1&&(_preload_next(),_preload_prev())},_preload_next=function(){var e="number"==typeof arguments[0]?arguments[0]:y+1;if(e>=x.length){if(!w.cyclic)return;e=0}if(e==y)return w.enableKeyboardNav=!1,w.enableSwipeNav=!1,i.off("mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb"),void l.hide();_preload_image(e)||_preload_next(e+1)},_preload_prev=function(){var e="number"==typeof arguments[0]?arguments[0]:y-1;if(e<0){if(!w.cyclic)return;e=x.length-1}if(e==y)return w.enableKeyboardNav=!1,w.enableSwipeNav=!1,i.off("mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb"),void s.hide();_preload_image(e)||_preload_prev(e-1)},_preload_image=function(t){var n=x[t];return!(void 0===n||void 0===n.href||n.href===w.href||!n.href.match(k)&&!e(n).hasClass("image"))&&((new Image).src=n.href,!0)},_get_zoom_to=function(){var t=[window.innerWidth-2*w.margin,window.innerHeight-2*w.margin-S,e(document).scrollLeft()+w.margin,e(document).scrollTop()+w.margin],n={},o=w.keepRatio&&w.height?w.width/w.height:1;return w.width.toString().indexOf("%")>-1?n.width=parseInt(t[0]*parseFloat(w.width)/100,10):n.width=w.width+2*w.padding,w.height.toString().indexOf("%")>-1?n.height=parseInt(t[1]*parseFloat(w.height)/100,10):n.height=w.height+2*w.padding,w.autoScale&&n.width>t[0]&&(n.width=t[0]-2*w.padding,n.height=parseInt(n.width/o,10)),w.autoScale&&n.height>t[1]&&(n.height=t[1]-2*w.padding,n.width=parseInt(n.height*o,10)),n.left=parseInt(Math.max(t[2],t[2]+(t[0]-n.width)/2),10),n.top=parseInt(Math.max(t[3],t[3]+(t[1]-n.height)/2),10),n},_get_orig_pos=function(){if(!m.orig)return!1;var t=e(m.orig);if(!t.length)return!1;var n=t.offset();return n.top+=parseInt(t.css("paddingTop"),10)||parseInt(t.css("border-top-width"),10)||0,n.left+=parseInt(t.css("paddingLeft"),10)||parseInt(t.css("border-left-width"),10)||0,{width:t.width()+2*w.padding,height:t.height()+2*w.padding,top:n.top-w.padding,left:n.left-w.padding,opacity:0}},_closed=function(){o.fadeOut("fast"),e(document).trigger("fancybox-closed",x,y,w),w.onClosed(x,y,w),_cleanup()},_cleanup=function(){o.hide(),d.empty().hide(),i.hide().attr("aria-hidden","true"),r.empty(),x=v=[],y=g=0,w=m={},e("html").css({"--vertical-scrollbar":"","--horizontal-scrollbar":""}),e("html").removeClass("fancybox-active"),e(document).off("fancybox-cancel fancybox-change fancybox-cleanup fancybox-closed"),O=!1},e.fn.fancybox=function(t){if(!e(this).length)return this;let n=e.extend({},t,e.metadata?e(this).metadata():{});return(!n.minViewportWidth||document.documentElement.clientWidth>=n.minViewportWidth)&&e(this).data("fancybox",n).attr({"aria-controls":"fancybox","aria-haspopup":"dialog"}).off("click.fb").on("click.fb",(function(t){if(t.preventDefault(),O)return!1;O=!0,e(this).blur(),v=[],g=0;var n=e(this).attr("rel")||"";return""==n||""==n.replace(/alternate|external|help|license|nofollow|noreferrer|noopener|\s+/gi,"")?v.push(this):(v=e('a[rel="'+n+'"], area[rel="'+n+'"]'),g=v.index(this)),e("html").css({"--vertical-scrollbar":window.innerWidth-e(window).width()+"px","--horizontal-scrollbar":window.innerHeight-e(window).height()+"px"}),_start(),!1})),this},e.fancybox=function(t){var n;if(!O){if(O=!0,n=void 0!==arguments[1]?arguments[1]:{},v=[],g=parseInt(n.index,10)||0,e.isArray(t)){for(var o=0,i=t.length;o<i;o++)"object"==typeof t[o]?e(t[o]).data("fancybox",e.extend({},n,t[o])):t[o]=e({}).data("fancybox",e.extend({content:t[o]},n));v=jQuery.merge(v,t)}else"object"==typeof t?e(t).data("fancybox",e.extend({},n,t)):t=e({}).data("fancybox",e.extend({content:t},n)),v.push(t);(g>v.length||g<0)&&(g=0),e("html").css({"--vertical-scrollbar":window.innerWidth-e(window).width()+"px","--horizontal-scrollbar":window.innerHeight-e(window).height()+"px"}),_start()}},e.fancybox.showActivity=function(){n.attr("title",m.txt.loading).show()},e.fancybox.hideActivity=function(){n.hide()},e.fancybox.next=function(){var t,n="number"==typeof arguments[0]?arguments[0]:y+1;if(n>=x.length){if(!w.cyclic)return;n=0}t=x[n],n!=y&&void 0!==t&&void 0!==t.href&&t.href===w.href?e.fancybox.next(n+1):e.fancybox.pos(n)},e.fancybox.prev=function(){var t,n="number"==typeof arguments[0]?arguments[0]:y-1;if(n<0){if(!w.cyclic)return;n=x.length-1}t=x[n],n!=y&&void 0!==t&&void 0!==t.href&&t.href===w.href?e.fancybox.prev(n-1):e.fancybox.pos(n)},e.fancybox.pos=function(t){O||(t=parseInt(t),x.length>1&&t!=y&&t>-1&&t<x.length&&(e(document).trigger("fancybox-change"),v=x,g=t,i.off("mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb").css("cursor","initial"),r.off("click"),_start()))},e.fancybox.cancel=function(){O=!0,_abort(),e(document).trigger("fancybox-cancel",v,g,m),m&&!1===m.onCancel(v,g,m)?O=!1:(e(v[g]).focus(),e(c.add(s).add(l)).hide(),e(r.add(o)).off(),e(window).off("resize.fb"),e(i).off("mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb"),e(document).off("keydown.fb"),/MSIE|Trident/.test(window.navigator.userAgent)&&r.find("iframe#fancybox-frame").attr("src","//about:blank"),i.stop(),_cleanup())},e.fancybox.close=function(){O||i.is(":hidden")||(O=!0,_abort(),e(document).trigger("fancybox-cleanup",x,y,w),w&&!1===w.onCleanup(x,y,w)?O=!1:(e(x[y]).focus(),e(c.add(s).add(l)).hide(),e(r.add(o)).off(),e(window).off("resize.fb"),e(i).off("mousewheel.fb touchstart.fb touchmove.fb touchend.fb mousedown.fb mousemove.fb mouseup.fb"),e(document).off("keydown.fb"),/MSIE|Trident/.test(window.navigator.userAgent)&&r.find("iframe#fancybox-frame").attr("src","//about:blank"),"inside"!==w.titlePosition&&d.empty(),i.stop(),"elastic"==w.transitionOut?(d.empty().hide(),i.animate(_get_orig_pos(),{duration:w.speedOut,easing:w.easingOut,complete:_closed})):i.fadeOut("none"==w.transitionOut?0:w.speedOut,_closed)))},e.fancybox.resize=function(){clearTimeout(f),f=setTimeout((function(){var e=[];O=!0,_process_title(),u=_get_zoom_to(),c.is(":visible")&&e.push(c)&&c.hide(),s.is(":visible")&&e.push(s)&&s.hide(),l.is(":visible")&&e.push(l)&&l.hide(),i.animate(u,{duration:w.changeSpeed,easing:w.easingChange,complete:function(){T&&T.length&&d.fadeIn(),e.forEach((function(e){e.show()})),O=!1}})}),500)},e.fancybox.init=function(){e("#fancybox-wrap").length||(e("body").append(t=e('<div id="fancybox-tmp"></div>'),n=e('<div id="fancybox-loading" title="Cancel"><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div><div></div></div>'),o=e('<div id="fancybox-overlay"></div>'),i=e('<div id="fancybox-wrap" role="dialog" aria-hidden="true" aria-labelledby="fancybox-title" tabindex="-1"></div>')),i.append(a=e('<div id="fancybox-outer"></div>')),a.append(r=e('<div id="fancybox-content"></div>'),c=e('<a id="fancybox-close" href="javascript:;" title="Close" class="fancy-ico" tabindex="1"><span></span></a>'),l=e('<a id="fancybox-next" href="javascript:;" title="Next" class="fancy-ico" tabindex="2"><span></span></a>'),s=e('<a id="fancybox-prev" href="javascript:;" title="Previous" class="fancy-ico" tabindex="3"><span></span></a>'),d=e('<div id="fancybox-title-wrap"></div>')),c.click(e.fancybox.close),n.click(e.fancybox.cancel),s.click((function(t){t.preventDefault(),e.fancybox.prev()})),l.click((function(t){t.preventDefault(),e.fancybox.next()})))},e.fn.fancybox.defaults={padding:10,margin:40,modal:!1,cyclic:!1,allowfullscreen:!1,scrolling:"auto",width:560,height:340,autoScale:!0,autoDimensions:!0,autoResize:!0,keepRatio:!1,minViewportWidth:0,swipeThreshold:80,ajax:{},svg:{wmode:"opaque"},hideOnOverlayClick:!0,hideOnContentClick:!1,overlayShow:!0,overlayColor:"",titleShow:!0,titlePosition:"float",titleFormat:null,titleFromAlt:!0,transitionIn:"fade",transitionOut:"fade",speedIn:400,speedOut:400,changeSpeed:200,changeFade:200,easingIn:"swing",easingOut:"swing",showCloseButton:!0,showNavArrows:!0,enableEscapeButton:!0,enableKeyboardNav:!0,enableSwipeNav:!0,txt:{error:{content:"The requested content cannot be loaded.",later:"Please try again later.",type:"No content type found.",image:"No image found.",unexpected:"Unexpected response."},loading:"Cancel",close:"Close",next:"Next",prev:"Previous"},onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}},e(document).ready((function(){e.fancybox.init()}))}(jQuery);
|
fancybox/2.2.0/fancybox_loading.gif
ADDED
Binary file
|
fancybox/2.2.0/fancybox_loading@2x.gif
ADDED
Binary file
|
fancybox/2.2.0/fancybox_sprite.png
ADDED
Binary file
|
fancybox/2.2.0/fancybox_sprite@2x.png
ADDED
Binary file
|
fancybox/2.2.0/helpers/fancybox_buttons.png
ADDED
Binary file
|
fancybox/2.2.0/helpers/jquery.fancybox-buttons.css
ADDED
@@ -0,0 +1,91 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
#fancybox-buttons {
|
2 |
+
position: fixed;
|
3 |
+
left: 0;
|
4 |
+
width: 100%;
|
5 |
+
z-index: 8050;
|
6 |
+
}
|
7 |
+
|
8 |
+
#fancybox-buttons.top {
|
9 |
+
top: 10px;
|
10 |
+
}
|
11 |
+
|
12 |
+
#fancybox-buttons.bottom {
|
13 |
+
bottom: 10px;
|
14 |
+
}
|
15 |
+
|
16 |
+
#fancybox-buttons ul {
|
17 |
+
display: block;
|
18 |
+
width: 166px;
|
19 |
+
height: 30px;
|
20 |
+
margin: 0 auto;
|
21 |
+
padding: 0;
|
22 |
+
list-style: none;
|
23 |
+
border: 1px solid #111;
|
24 |
+
border-radius: 3px;
|
25 |
+
box-shadow: inset 0 0 0 1px rgba(255,255,255,.05);
|
26 |
+
background: rgb(50,50,50);
|
27 |
+
background: -ms-linear-gradient(top, rgb(68,68,68) 0%,rgb(52,52,52) 50%,rgb(41,41,41) 50%,rgb(51,51,51) 100%);
|
28 |
+
background: linear-gradient(to bottom, rgb(68,68,68) 0%,rgb(52,52,52) 50%,rgb(41,41,41) 50%,rgb(51,51,51) 100%);
|
29 |
+
filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#444444', endColorstr='#222222',GradientType=0 );
|
30 |
+
}
|
31 |
+
|
32 |
+
#fancybox-buttons ul li {
|
33 |
+
float: left;
|
34 |
+
margin: 0;
|
35 |
+
padding: 0;
|
36 |
+
}
|
37 |
+
|
38 |
+
#fancybox-buttons a {
|
39 |
+
display: block;
|
40 |
+
width: 30px;
|
41 |
+
height: 30px;
|
42 |
+
text-indent: -9999px;
|
43 |
+
background-color: transparent;
|
44 |
+
background-image: url('fancybox_buttons.png');
|
45 |
+
background-repeat: no-repeat;
|
46 |
+
outline: none;
|
47 |
+
opacity: 0.8;
|
48 |
+
}
|
49 |
+
|
50 |
+
#fancybox-buttons a:hover {
|
51 |
+
opacity: 1;
|
52 |
+
}
|
53 |
+
|
54 |
+
#fancybox-buttons a.btnPrev {
|
55 |
+
background-position: 5px 0;
|
56 |
+
}
|
57 |
+
|
58 |
+
#fancybox-buttons a.btnNext {
|
59 |
+
background-position: -33px 0;
|
60 |
+
border-right: 1px solid #3e3e3e;
|
61 |
+
}
|
62 |
+
|
63 |
+
#fancybox-buttons a.btnPlay {
|
64 |
+
background-position: 0 -30px;
|
65 |
+
}
|
66 |
+
|
67 |
+
#fancybox-buttons a.btnPlayOn {
|
68 |
+
background-position: -30px -30px;
|
69 |
+
}
|
70 |
+
|
71 |
+
#fancybox-buttons a.btnToggle {
|
72 |
+
background-position: 3px -60px;
|
73 |
+
border-left: 1px solid #111;
|
74 |
+
border-right: 1px solid #3e3e3e;
|
75 |
+
width: 35px
|
76 |
+
}
|
77 |
+
|
78 |
+
#fancybox-buttons a.btnToggleOn {
|
79 |
+
background-position: -27px -60px;
|
80 |
+
}
|
81 |
+
|
82 |
+
#fancybox-buttons a.btnClose {
|
83 |
+
border-left: 1px solid #111;
|
84 |
+
width: 35px;
|
85 |
+
background-position: -56px 0px;
|
86 |
+
}
|
87 |
+
|
88 |
+
#fancybox-buttons a.btnDisabled {
|
89 |
+
opacity : 0.4;
|
90 |
+
cursor: default;
|
91 |
+
}
|
fancybox/2.2.0/helpers/jquery.fancybox-buttons.js
ADDED
@@ -0,0 +1,122 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* Buttons helper for fancyBox
|
3 |
+
* version: 1.0.5 (Mon, 15 Oct 2012)
|
4 |
+
* @requires fancyBox v2.0 or later
|
5 |
+
*
|
6 |
+
* Usage:
|
7 |
+
* $(".fancybox").fancybox({
|
8 |
+
* helpers : {
|
9 |
+
* buttons: {
|
10 |
+
* position : 'top'
|
11 |
+
* }
|
12 |
+
* }
|
13 |
+
* });
|
14 |
+
*
|
15 |
+
*/
|
16 |
+
;(function ($) {
|
17 |
+
//Shortcut for fancyBox object
|
18 |
+
var F = $.fancybox;
|
19 |
+
|
20 |
+
//Add helper object
|
21 |
+
F.helpers.buttons = {
|
22 |
+
defaults : {
|
23 |
+
skipSingle : false, // disables if gallery contains single image
|
24 |
+
position : 'top', // 'top' or 'bottom'
|
25 |
+
tpl : '<div id="fancybox-buttons"><ul><li><a class="btnPrev" title="Previous" href="javascript:;"></a></li><li><a class="btnPlay" title="Start slideshow" href="javascript:;"></a></li><li><a class="btnNext" title="Next" href="javascript:;"></a></li><li><a class="btnToggle" title="Toggle size" href="javascript:;"></a></li><li><a class="btnClose" title="Close" href="javascript:;"></a></li></ul></div>'
|
26 |
+
},
|
27 |
+
|
28 |
+
list : null,
|
29 |
+
buttons: null,
|
30 |
+
|
31 |
+
beforeLoad: function (opts, obj) {
|
32 |
+
//Remove self if gallery do not have at least two items
|
33 |
+
|
34 |
+
if (opts.skipSingle && obj.group.length < 2) {
|
35 |
+
obj.helpers.buttons = false;
|
36 |
+
obj.closeBtn = true;
|
37 |
+
|
38 |
+
return;
|
39 |
+
}
|
40 |
+
|
41 |
+
//Increase top margin to give space for buttons
|
42 |
+
obj.margin[ opts.position === 'bottom' ? 2 : 0 ] += 30;
|
43 |
+
},
|
44 |
+
|
45 |
+
onPlayStart: function () {
|
46 |
+
if (this.buttons) {
|
47 |
+
this.buttons.play.attr('title', 'Pause slideshow').addClass('btnPlayOn');
|
48 |
+
}
|
49 |
+
},
|
50 |
+
|
51 |
+
onPlayEnd: function () {
|
52 |
+
if (this.buttons) {
|
53 |
+
this.buttons.play.attr('title', 'Start slideshow').removeClass('btnPlayOn');
|
54 |
+
}
|
55 |
+
},
|
56 |
+
|
57 |
+
afterShow: function (opts, obj) {
|
58 |
+
var buttons = this.buttons;
|
59 |
+
|
60 |
+
if (!buttons) {
|
61 |
+
this.list = $(opts.tpl).addClass(opts.position).appendTo('body');
|
62 |
+
|
63 |
+
buttons = {
|
64 |
+
prev : this.list.find('.btnPrev').click( F.prev ),
|
65 |
+
next : this.list.find('.btnNext').click( F.next ),
|
66 |
+
play : this.list.find('.btnPlay').click( F.play ),
|
67 |
+
toggle : this.list.find('.btnToggle').click( F.toggle ),
|
68 |
+
close : this.list.find('.btnClose').click( F.close )
|
69 |
+
}
|
70 |
+
}
|
71 |
+
|
72 |
+
//Prev
|
73 |
+
if (obj.index > 0 || obj.loop) {
|
74 |
+
buttons.prev.removeClass('btnDisabled');
|
75 |
+
} else {
|
76 |
+
buttons.prev.addClass('btnDisabled');
|
77 |
+
}
|
78 |
+
|
79 |
+
//Next / Play
|
80 |
+
if (obj.loop || obj.index < obj.group.length - 1) {
|
81 |
+
buttons.next.removeClass('btnDisabled');
|
82 |
+
buttons.play.removeClass('btnDisabled');
|
83 |
+
|
84 |
+
} else {
|
85 |
+
buttons.next.addClass('btnDisabled');
|
86 |
+
buttons.play.addClass('btnDisabled');
|
87 |
+
}
|
88 |
+
|
89 |
+
this.buttons = buttons;
|
90 |
+
|
91 |
+
this.onUpdate(opts, obj);
|
92 |
+
},
|
93 |
+
|
94 |
+
onUpdate: function (opts, obj) {
|
95 |
+
var toggle;
|
96 |
+
|
97 |
+
if (!this.buttons) {
|
98 |
+
return;
|
99 |
+
}
|
100 |
+
|
101 |
+
toggle = this.buttons.toggle.removeClass('btnDisabled btnToggleOn');
|
102 |
+
|
103 |
+
//Size toggle button
|
104 |
+
if (obj.canShrink) {
|
105 |
+
toggle.addClass('btnToggleOn');
|
106 |
+
|
107 |
+
} else if (!obj.canExpand) {
|
108 |
+
toggle.addClass('btnDisabled');
|
109 |
+
}
|
110 |
+
},
|
111 |
+
|
112 |
+
beforeClose: function () {
|
113 |
+
if (this.list) {
|
114 |
+
this.list.remove();
|
115 |
+
}
|
116 |
+
|
117 |
+
this.list = null;
|
118 |
+
this.buttons = null;
|
119 |
+
}
|
120 |
+
};
|
121 |
+
|
122 |
+
}(jQuery));
|
fancybox/2.2.0/helpers/jquery.fancybox-buttons.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
#fancybox-buttons{position:fixed;left:0;width:100%;z-index:8050;}#fancybox-buttons.top{top:10px;}#fancybox-buttons.bottom{bottom:10px;}#fancybox-buttons ul{display:block;width:166px;height:30px;margin:0 auto;padding:0;list-style:none;border:1px solid #111;border-radius:3px;box-shadow:inset 0 0 0 1px rgba(255,255,255,.05);background:rgb(50,50,50);background:-ms-linear-gradient(top,rgb(68,68,68) 0%,rgb(52,52,52) 50%,rgb(41,41,41) 50%,rgb(51,51,51) 100%);background:linear-gradient(to bottom,rgb(68,68,68) 0%,rgb(52,52,52) 50%,rgb(41,41,41) 50%,rgb(51,51,51) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#444444',endColorstr='#222222',GradientType=0);}#fancybox-buttons ul li{float:left;margin:0;padding:0;}#fancybox-buttons a{display:block;width:30px;height:30px;text-indent:-9999px;background-color:transparent;background-image:url('fancybox_buttons.png');background-repeat:no-repeat;outline:none;opacity:.8;}#fancybox-buttons a:hover{opacity:1;}#fancybox-buttons a.btnPrev{background-position:5px 0;}#fancybox-buttons a.btnNext{background-position:-33px 0;border-right:1px solid #3e3e3e;}#fancybox-buttons a.btnPlay{background-position:0 -30px;}#fancybox-buttons a.btnPlayOn{background-position:-30px -30px;}#fancybox-buttons a.btnToggle{background-position:3px -60px;border-left:1px solid #111;border-right:1px solid #3e3e3e;width:35px}#fancybox-buttons a.btnToggleOn{background-position:-27px -60px;}#fancybox-buttons a.btnClose{border-left:1px solid #111;width:35px;background-position:-56px 0;}#fancybox-buttons a.btnDisabled{opacity:.4;cursor:default;}
|
fancybox/2.2.0/helpers/jquery.fancybox-buttons.min.js
ADDED
@@ -0,0 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* Buttons helper for fancyBox
|
3 |
+
* version: 1.0.5 (Mon, 15 Oct 2012)
|
4 |
+
* @requires fancyBox v2.0 or later
|
5 |
+
*
|
6 |
+
* Usage:
|
7 |
+
* $(".fancybox").fancybox({
|
8 |
+
* helpers : {
|
9 |
+
* buttons: {
|
10 |
+
* position : 'top'
|
11 |
+
* }
|
12 |
+
* }
|
13 |
+
* });
|
14 |
+
*
|
15 |
+
*/
|
16 |
+
!function(t){var s=t.fancybox;s.helpers.buttons={defaults:{skipSingle:!1,position:"top",tpl:'<div id="fancybox-buttons"><ul><li><a class="btnPrev" title="Previous" href="javascript:;"></a></li><li><a class="btnPlay" title="Start slideshow" href="javascript:;"></a></li><li><a class="btnNext" title="Next" href="javascript:;"></a></li><li><a class="btnToggle" title="Toggle size" href="javascript:;"></a></li><li><a class="btnClose" title="Close" href="javascript:;"></a></li></ul></div>'},list:null,buttons:null,beforeLoad:function(t,s){if(t.skipSingle&&s.group.length<2)return s.helpers.buttons=!1,void(s.closeBtn=!0);s.margin["bottom"===t.position?2:0]+=30},onPlayStart:function(){this.buttons&&this.buttons.play.attr("title","Pause slideshow").addClass("btnPlayOn")},onPlayEnd:function(){this.buttons&&this.buttons.play.attr("title","Start slideshow").removeClass("btnPlayOn")},afterShow:function(l,i){var n=this.buttons;n||(this.list=t(l.tpl).addClass(l.position).appendTo("body"),n={prev:this.list.find(".btnPrev").click(s.prev),next:this.list.find(".btnNext").click(s.next),play:this.list.find(".btnPlay").click(s.play),toggle:this.list.find(".btnToggle").click(s.toggle),close:this.list.find(".btnClose").click(s.close)}),i.index>0||i.loop?n.prev.removeClass("btnDisabled"):n.prev.addClass("btnDisabled"),i.loop||i.index<i.group.length-1?(n.next.removeClass("btnDisabled"),n.play.removeClass("btnDisabled")):(n.next.addClass("btnDisabled"),n.play.addClass("btnDisabled")),this.buttons=n,this.onUpdate(l,i)},onUpdate:function(t,s){var l;this.buttons&&(l=this.buttons.toggle.removeClass("btnDisabled btnToggleOn"),s.canShrink?l.addClass("btnToggleOn"):s.canExpand||l.addClass("btnDisabled"))},beforeClose:function(){this.list&&this.list.remove(),this.list=null,this.buttons=null}}}(jQuery);
|
fancybox/2.2.0/helpers/jquery.fancybox-media.js
ADDED
@@ -0,0 +1,161 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*! Media helper for fancyBox */
|
2 |
+
/**
|
3 |
+
* version: 1.1.1 (Fri, 14 Sep 2022)
|
4 |
+
* @requires fancyBox v2.0 or later
|
5 |
+
*
|
6 |
+
* Usage:
|
7 |
+
* $(".fancybox").fancybox({
|
8 |
+
* helpers : {
|
9 |
+
* media: true
|
10 |
+
* }
|
11 |
+
* });
|
12 |
+
*
|
13 |
+
* Set custom URL parameters:
|
14 |
+
* $(".fancybox").fancybox({
|
15 |
+
* helpers : {
|
16 |
+
* media: {
|
17 |
+
* youtube : {
|
18 |
+
* params : {
|
19 |
+
* autoplay : 0
|
20 |
+
* }
|
21 |
+
* }
|
22 |
+
* }
|
23 |
+
* }
|
24 |
+
* });
|
25 |
+
*
|
26 |
+
* Or:
|
27 |
+
* $(".fancybox").fancybox({,
|
28 |
+
* helpers : {
|
29 |
+
* media: true
|
30 |
+
* },
|
31 |
+
* youtube : {
|
32 |
+
* autoplay: 0
|
33 |
+
* }
|
34 |
+
* });
|
35 |
+
*
|
36 |
+
* Supports:
|
37 |
+
*
|
38 |
+
* Youtube
|
39 |
+
* http://www.youtube.com/watch?v=opj24KnzrWo
|
40 |
+
* http://www.youtube.com/embed/opj24KnzrWo
|
41 |
+
* http://youtu.be/opj24KnzrWo
|
42 |
+
* http://www.youtube-nocookie.com/embed/opj24KnzrWo
|
43 |
+
* Vimeo
|
44 |
+
* http://vimeo.com/40648169
|
45 |
+
* http://vimeo.com/channels/staffpicks/38843628
|
46 |
+
* http://vimeo.com/groups/surrealism/videos/36516384
|
47 |
+
* http://player.vimeo.com/video/45074303
|
48 |
+
* Dailymotion
|
49 |
+
* http://www.dailymotion.com/video/xoytqh_dr-seuss-the-lorax-premiere_people
|
50 |
+
* Instagram
|
51 |
+
* http://instagr.am/p/IejkuUGxQn/
|
52 |
+
* http://instagram.com/p/IejkuUGxQn/
|
53 |
+
* Google maps
|
54 |
+
* http://maps.google.com/maps?q=Eiffel+Tower,+Avenue+Gustave+Eiffel,+Paris,+France&t=h&z=17
|
55 |
+
* http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
|
56 |
+
* http://maps.google.com/?ll=48.859463,2.292626&spn=0.000965,0.002642&t=m&z=19&layer=c&cbll=48.859524,2.292532&panoid=YJ0lq28OOy3VT2IqIuVY0g&cbp=12,151.58,,0,-15.56
|
57 |
+
*/
|
58 |
+
;(function ($) {
|
59 |
+
"use strict";
|
60 |
+
|
61 |
+
//Shortcut for fancyBox object
|
62 |
+
var F = $.fancybox,
|
63 |
+
format = function( url, rez, params ) {
|
64 |
+
params = params || '';
|
65 |
+
|
66 |
+
if ( $.type( params ) === "object" ) {
|
67 |
+
params = $.param(params, true);
|
68 |
+
}
|
69 |
+
|
70 |
+
$.each(rez, function(key, value) {
|
71 |
+
url = url.replace( '$' + key, value || '' );
|
72 |
+
});
|
73 |
+
|
74 |
+
if (params.length) {
|
75 |
+
url += ( url.indexOf('?') > 0 ? '&' : '?' ) + params;
|
76 |
+
}
|
77 |
+
|
78 |
+
return url;
|
79 |
+
};
|
80 |
+
|
81 |
+
//Add helper object
|
82 |
+
F.helpers.media = {
|
83 |
+
defaults : {
|
84 |
+
youtube : {
|
85 |
+
matcher : /(youtube\.com|youtu\.be|youtube-nocookie\.com)\/(watch\?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*)).*/i,
|
86 |
+
params : {
|
87 |
+
autoplay : 1,
|
88 |
+
fs : 1,
|
89 |
+
rel : 0,
|
90 |
+
modestbranding : 1
|
91 |
+
},
|
92 |
+
type : 'iframe',
|
93 |
+
url : '//www.youtube.com/embed/$3'
|
94 |
+
},
|
95 |
+
vimeo : {
|
96 |
+
matcher : /(?:vimeo(?:pro)?.com)\/(?:[^\d]+)?(\d+)(?:.*)/,
|
97 |
+
params : {
|
98 |
+
autoplay : 1,
|
99 |
+
title : 1,
|
100 |
+
byline : 1,
|
101 |
+
portrait : 0
|
102 |
+
},
|
103 |
+
type : 'iframe',
|
104 |
+
url : '//player.vimeo.com/video/$1'
|
105 |
+
},
|
106 |
+
dailymotion : {
|
107 |
+
matcher : /dailymotion.com\/video\/(.*)\/?(.*)/,
|
108 |
+
params : {
|
109 |
+
autoplay : 1
|
110 |
+
},
|
111 |
+
type : 'iframe',
|
112 |
+
url : '//www.dailymotion.com/embed/video/$1'
|
113 |
+
},
|
114 |
+
instagram : {
|
115 |
+
matcher : /(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
|
116 |
+
type : 'image',
|
117 |
+
url : '//$1/p/$2/media/?size=l'
|
118 |
+
},
|
119 |
+
google_maps : {
|
120 |
+
matcher : /maps\.google\.([a-z]{2,3}(\.[a-z]{2})?)\/(\?ll=|maps\?)(.*)/i,
|
121 |
+
type : 'iframe',
|
122 |
+
url : function( rez ) {
|
123 |
+
return '//maps.google.' + rez[1] + '/' + rez[3] + '' + rez[4] + '&output=' + (rez[4].indexOf('layer=c') > 0 ? 'svembed' : 'embed');
|
124 |
+
}
|
125 |
+
}
|
126 |
+
},
|
127 |
+
|
128 |
+
beforeLoad : function(opts, obj) {
|
129 |
+
var url = obj.href || '',
|
130 |
+
type = false,
|
131 |
+
what,
|
132 |
+
item,
|
133 |
+
rez,
|
134 |
+
params;
|
135 |
+
|
136 |
+
for (what in opts) {
|
137 |
+
if (opts.hasOwnProperty(what)) {
|
138 |
+
item = opts[ what ];
|
139 |
+
rez = item && item.matcher ? url.match( item.matcher ) : false;
|
140 |
+
|
141 |
+
if (rez) {
|
142 |
+
type = item.type;
|
143 |
+
params = $.extend(true, {}, item.params, obj[ what ] || ($.isPlainObject(opts[ what ]) ? opts[ what ].params : null));
|
144 |
+
|
145 |
+
url = $.type( item.url ) === "function" ? item.url.call( this, rez, params, obj ) : format( item.url, rez, params );
|
146 |
+
|
147 |
+
break;
|
148 |
+
}
|
149 |
+
}
|
150 |
+
}
|
151 |
+
|
152 |
+
if (type) {
|
153 |
+
obj.href = url;
|
154 |
+
obj.type = type;
|
155 |
+
|
156 |
+
obj.autoHeight = false;
|
157 |
+
}
|
158 |
+
}
|
159 |
+
};
|
160 |
+
|
161 |
+
}(jQuery));
|
fancybox/2.2.0/helpers/jquery.fancybox-media.min.js
ADDED
@@ -0,0 +1,2 @@
|
|
|
|
|
1 |
+
/*! Media helper for fancyBox */
|
2 |
+
!function(e){"use strict";var a=e.fancybox,o=function(a,o,t){return t=t||"","object"===e.type(t)&&(t=e.param(t,!0)),e.each(o,(function(e,o){a=a.replace("$"+e,o||"")})),t.length&&(a+=(a.indexOf("?")>0?"&":"?")+t),a};a.helpers.media={defaults:{youtube:{matcher:/(youtube\.com|youtu\.be|youtube-nocookie\.com)\/(watch\?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*)).*/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"opaque",enablejsapi:1,ps:"docs",controls:1},type:"iframe",url:"//www.youtube.com/embed/$3"},vimeo:{matcher:/(?:vimeo(?:pro)?.com)\/(?:[^\d]+)?(\d+)(?:.*)/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},type:"iframe",url:"//player.vimeo.com/video/$1"},dailymotion:{matcher:/dailymotion.com\/video\/(.*)\/?(.*)/,params:{additionalInfos:0,autoStart:1},type:"iframe",url:"//www.dailymotion.com/embed/video/$1"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},google_maps:{matcher:/maps\.google\.([a-z]{2,3}(\.[a-z]{2})?)\/(\?ll=|maps\?)(.*)/i,type:"iframe",url:function(e){return"//maps.google."+e[1]+"/"+e[3]+e[4]+"&output="+(e[4].indexOf("layer=c")>0?"svembed":"embed")}}},beforeLoad:function(a,t){var r,i,m,l,u=t.href||"",n=!1;for(r in a)if(a.hasOwnProperty(r)&&(m=!(!(i=a[r])||!i.matcher)&&u.match(i.matcher))){n=i.type,l=e.extend(!0,{},i.params,t[r]||(e.isPlainObject(a[r])?a[r].params:null)),u="function"===e.type(i.url)?i.url.call(this,m,l,t):o(i.url,m,l);break}n&&(t.href=u,t.type=n,t.autoHeight=!1)}}}(jQuery);
|
fancybox/2.2.0/helpers/jquery.fancybox-thumbs.css
ADDED
@@ -0,0 +1,55 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
#fancybox-thumbs {
|
2 |
+
position: fixed;
|
3 |
+
left: 0;
|
4 |
+
width: 100%;
|
5 |
+
overflow: hidden;
|
6 |
+
z-index: 8050;
|
7 |
+
}
|
8 |
+
|
9 |
+
#fancybox-thumbs.bottom {
|
10 |
+
bottom: 2px;
|
11 |
+
}
|
12 |
+
|
13 |
+
#fancybox-thumbs.top {
|
14 |
+
top: 2px;
|
15 |
+
}
|
16 |
+
|
17 |
+
#fancybox-thumbs ul {
|
18 |
+
position: relative;
|
19 |
+
list-style: none;
|
20 |
+
margin: 0;
|
21 |
+
padding: 0;
|
22 |
+
}
|
23 |
+
|
24 |
+
#fancybox-thumbs ul li {
|
25 |
+
float: left;
|
26 |
+
padding: 1px;
|
27 |
+
opacity: 0.5;
|
28 |
+
}
|
29 |
+
|
30 |
+
#fancybox-thumbs ul li.active {
|
31 |
+
opacity: 0.75;
|
32 |
+
padding: 0;
|
33 |
+
border: 1px solid #fff;
|
34 |
+
}
|
35 |
+
|
36 |
+
#fancybox-thumbs ul li:hover {
|
37 |
+
opacity: 1;
|
38 |
+
}
|
39 |
+
|
40 |
+
#fancybox-thumbs ul li a {
|
41 |
+
display: block;
|
42 |
+
position: relative;
|
43 |
+
overflow: hidden;
|
44 |
+
border: 1px solid #222;
|
45 |
+
background: #111;
|
46 |
+
outline: none;
|
47 |
+
}
|
48 |
+
|
49 |
+
#fancybox-thumbs ul li img {
|
50 |
+
display: block;
|
51 |
+
position: relative;
|
52 |
+
border: 0;
|
53 |
+
padding: 0;
|
54 |
+
max-width: none;
|
55 |
+
}
|
fancybox/2.2.0/helpers/jquery.fancybox-thumbs.js
ADDED
@@ -0,0 +1,165 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* Thumbnail helper for fancyBox
|
3 |
+
* version: 1.0.7 (Mon, 01 Oct 2012)
|
4 |
+
* @requires fancyBox v2.0 or later
|
5 |
+
*
|
6 |
+
* Usage:
|
7 |
+
* $(".fancybox").fancybox({
|
8 |
+
* helpers : {
|
9 |
+
* thumbs: {
|
10 |
+
* width : 50,
|
11 |
+
* height : 50
|
12 |
+
* }
|
13 |
+
* }
|
14 |
+
* });
|
15 |
+
*
|
16 |
+
*/
|
17 |
+
;(function ($) {
|
18 |
+
//Shortcut for fancyBox object
|
19 |
+
var F = $.fancybox;
|
20 |
+
|
21 |
+
//Add helper object
|
22 |
+
F.helpers.thumbs = {
|
23 |
+
defaults : {
|
24 |
+
width : 50, // thumbnail width
|
25 |
+
height : 50, // thumbnail height
|
26 |
+
position : 'bottom', // 'top' or 'bottom'
|
27 |
+
source : function ( item ) { // function to obtain the URL of the thumbnail image
|
28 |
+
var href;
|
29 |
+
|
30 |
+
if (item.element) {
|
31 |
+
href = $(item.element).find('img').attr('src');
|
32 |
+
}
|
33 |
+
|
34 |
+
if (!href && item.type === 'image' && item.href) {
|
35 |
+
href = item.href;
|
36 |
+
}
|
37 |
+
|
38 |
+
return href;
|
39 |
+
}
|
40 |
+
},
|
41 |
+
|
42 |
+
wrap : null,
|
43 |
+
list : null,
|
44 |
+
width : 0,
|
45 |
+
|
46 |
+
init: function (opts, obj) {
|
47 |
+
var that = this,
|
48 |
+
list,
|
49 |
+
thumbWidth = opts.width,
|
50 |
+
thumbHeight = opts.height,
|
51 |
+
thumbSource = opts.source;
|
52 |
+
|
53 |
+
//Build list structure
|
54 |
+
list = '';
|
55 |
+
|
56 |
+
for (var n = 0; n < obj.group.length; n++) {
|
57 |
+
list += '<li><a style="width:' + thumbWidth + 'px;height:' + thumbHeight + 'px;" href="javascript:jQuery.fancybox.jumpto(' + n + ');"></a></li>';
|
58 |
+
}
|
59 |
+
|
60 |
+
this.wrap = $('<div id="fancybox-thumbs"></div>').addClass(opts.position).appendTo('body');
|
61 |
+
this.list = $('<ul>' + list + '</ul>').appendTo(this.wrap);
|
62 |
+
|
63 |
+
//Load each thumbnail
|
64 |
+
$.each(obj.group, function (i) {
|
65 |
+
var el = obj.group[ i ],
|
66 |
+
href = thumbSource( el );
|
67 |
+
|
68 |
+
if (!href) {
|
69 |
+
return;
|
70 |
+
}
|
71 |
+
|
72 |
+
$("<img />").on("load", function () {
|
73 |
+
var width = this.width,
|
74 |
+
height = this.height,
|
75 |
+
widthRatio, heightRatio, parent;
|
76 |
+
|
77 |
+
if (!that.list || !width || !height) {
|
78 |
+
return;
|
79 |
+
}
|
80 |
+
|
81 |
+
//Calculate thumbnail width/height and center it
|
82 |
+
widthRatio = width / thumbWidth;
|
83 |
+
heightRatio = height / thumbHeight;
|
84 |
+
|
85 |
+
parent = that.list.children().eq(i).find('a');
|
86 |
+
|
87 |
+
if (widthRatio >= 1 && heightRatio >= 1) {
|
88 |
+
if (widthRatio > heightRatio) {
|
89 |
+
width = Math.floor(width / heightRatio);
|
90 |
+
height = thumbHeight;
|
91 |
+
|
92 |
+
} else {
|
93 |
+
width = thumbWidth;
|
94 |
+
height = Math.floor(height / widthRatio);
|
95 |
+
}
|
96 |
+
}
|
97 |
+
|
98 |
+
$(this).css({
|
99 |
+
width : width,
|
100 |
+
height : height,
|
101 |
+
top : Math.floor(thumbHeight / 2 - height / 2),
|
102 |
+
left : Math.floor(thumbWidth / 2 - width / 2)
|
103 |
+
});
|
104 |
+
|
105 |
+
parent.width(thumbWidth).height(thumbHeight);
|
106 |
+
|
107 |
+
$(this).hide().appendTo(parent).fadeIn(300);
|
108 |
+
|
109 |
+
})
|
110 |
+
.attr('src', href)
|
111 |
+
.attr('title', el.title);
|
112 |
+
});
|
113 |
+
|
114 |
+
//Set initial width
|
115 |
+
this.width = this.list.children().eq(0).outerWidth(true);
|
116 |
+
|
117 |
+
this.list.width(this.width * (obj.group.length + 1)).css('left', Math.floor($(window).width() * 0.5 - (obj.index * this.width + this.width * 0.5)));
|
118 |
+
},
|
119 |
+
|
120 |
+
beforeLoad: function (opts, obj) {
|
121 |
+
//Remove self if gallery do not have at least two items
|
122 |
+
if (obj.group.length < 2) {
|
123 |
+
obj.helpers.thumbs = false;
|
124 |
+
|
125 |
+
return;
|
126 |
+
}
|
127 |
+
|
128 |
+
//Increase bottom margin to give space for thumbs
|
129 |
+
obj.margin[ opts.position === 'top' ? 0 : 2 ] += ((opts.height) + 15);
|
130 |
+
},
|
131 |
+
|
132 |
+
afterShow: function (opts, obj) {
|
133 |
+
//Check if exists and create or update list
|
134 |
+
if (this.list) {
|
135 |
+
this.onUpdate(opts, obj);
|
136 |
+
|
137 |
+
} else {
|
138 |
+
this.init(opts, obj);
|
139 |
+
}
|
140 |
+
|
141 |
+
//Set active element
|
142 |
+
this.list.children().removeClass('active').eq(obj.index).addClass('active');
|
143 |
+
},
|
144 |
+
|
145 |
+
//Center list
|
146 |
+
onUpdate: function (opts, obj) {
|
147 |
+
if (this.list) {
|
148 |
+
this.list.stop(true).animate({
|
149 |
+
'left': Math.floor($(window).width() * 0.5 - (obj.index * this.width + this.width * 0.5))
|
150 |
+
}, 150);
|
151 |
+
}
|
152 |
+
},
|
153 |
+
|
154 |
+
beforeClose: function () {
|
155 |
+
if (this.wrap) {
|
156 |
+
this.wrap.remove();
|
157 |
+
}
|
158 |
+
|
159 |
+
this.wrap = null;
|
160 |
+
this.list = null;
|
161 |
+
this.width = 0;
|
162 |
+
}
|
163 |
+
}
|
164 |
+
|
165 |
+
}(jQuery));
|
fancybox/2.2.0/helpers/jquery.fancybox-thumbs.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
#fancybox-thumbs{position:fixed;left:0;width:100%;overflow:hidden;z-index:8050;}#fancybox-thumbs.bottom{bottom:2px;}#fancybox-thumbs.top{top:2px;}#fancybox-thumbs ul{position:relative;list-style:none;margin:0;padding:0;}#fancybox-thumbs ul li{float:left;padding:1px;opacity:.5;}#fancybox-thumbs ul li.active{opacity:.75;padding:0;border:1px solid #fff;}#fancybox-thumbs ul li:hover{opacity:1;}#fancybox-thumbs ul li a{display:block;position:relative;overflow:hidden;border:1px solid #222;background:#111;outline:none;}#fancybox-thumbs ul li img{display:block;position:relative;border:0;padding:0;max-width:none;}
|
fancybox/2.2.0/helpers/jquery.fancybox-thumbs.min.js
ADDED
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*!
|
2 |
+
* Thumbnail helper for fancyBox
|
3 |
+
* version: 1.0.7 (Mon, 01 Oct 2012)
|
4 |
+
* @requires fancyBox v2.0 or later
|
5 |
+
*
|
6 |
+
* Usage:
|
7 |
+
* $(".fancybox").fancybox({
|
8 |
+
* helpers : {
|
9 |
+
* thumbs: {
|
10 |
+
* width : 50,
|
11 |
+
* height : 50
|
12 |
+
* }
|
13 |
+
* }
|
14 |
+
* });
|
15 |
+
*
|
16 |
+
*/
|
17 |
+
!function(t){t.fancybox.helpers.thumbs={defaults:{width:50,height:50,position:"bottom",source:function(i){var h;return i.element&&(h=t(i.element).find("img").attr("src")),!h&&"image"===i.type&&i.href&&(h=i.href),h}},wrap:null,list:null,width:0,init:function(i,h){var e,s=this,o=i.width,n=i.height,l=i.source;e="";for(var a=0;a<h.group.length;a++)e+='<li><a style="width:'+o+"px;height:"+n+'px;" href="javascript:jQuery.fancybox.jumpto('+a+');"></a></li>';this.wrap=t('<div id="fancybox-thumbs"></div>').addClass(i.position).appendTo("body"),this.list=t("<ul>"+e+"</ul>").appendTo(this.wrap),t.each(h.group,(function(i){var e=h.group[i],a=l(e);a&&t("<img />").on("load",(function(){var h,e,l,a=this.width,r=this.height;s.list&&a&&r&&(h=a/o,e=r/n,l=s.list.children().eq(i).find("a"),h>=1&&e>=1&&(h>e?(a=Math.floor(a/e),r=n):(a=o,r=Math.floor(r/h))),t(this).css({width:a,height:r,top:Math.floor(n/2-r/2),left:Math.floor(o/2-a/2)}),l.width(o).height(n),t(this).hide().appendTo(l).fadeIn(300))})).attr("src",a).attr("title",e.title)})),this.width=this.list.children().eq(0).outerWidth(!0),this.list.width(this.width*(h.group.length+1)).css("left",Math.floor(.5*t(window).width()-(h.index*this.width+.5*this.width)))},beforeLoad:function(t,i){i.group.length<2?i.helpers.thumbs=!1:i.margin["top"===t.position?0:2]+=t.height+15},afterShow:function(t,i){this.list?this.onUpdate(t,i):this.init(t,i),this.list.children().removeClass("active").eq(i.index).addClass("active")},onUpdate:function(i,h){this.list&&this.list.stop(!0).animate({left:Math.floor(.5*t(window).width()-(h.index*this.width+.5*this.width))},150)},beforeClose:function(){this.wrap&&this.wrap.remove(),this.wrap=null,this.list=null,this.width=0}}}(jQuery);
|
fancybox/2.2.0/jquery.fancybox.css
ADDED
@@ -0,0 +1,295 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* fancyBox - jQuery Plugin
|
3 |
+
* version: 2.2.0 (Tue, 16 Sep 2022)
|
4 |
+
* requires jQuery v1.6 or later
|
5 |
+
*
|
6 |
+
* Licensed GPLv3 for open source use
|
7 |
+
* or fancyBox Commercial License for commercial use
|
8 |
+
* Examples at http://fancyapps.com/fancybox/
|
9 |
+
* License: www.fancyapps.com/fancybox/#license
|
10 |
+
*
|
11 |
+
* Copyright 2017 fancyapps.com
|
12 |
+
*/
|
13 |
+
|
14 |
+
.fancybox-wrap,
|
15 |
+
.fancybox-skin,
|
16 |
+
.fancybox-outer,
|
17 |
+
.fancybox-inner,
|
18 |
+
.fancybox-wrap img,
|
19 |
+
.fancybox-wrap iframe,
|
20 |
+
.fancybox-wrap object,
|
21 |
+
.fancybox-nav,
|
22 |
+
.fancybox-nav span,
|
23 |
+
.fancybox-tmp
|
24 |
+
{
|
25 |
+
padding: 0;
|
26 |
+
margin: 0;
|
27 |
+
border: 0;
|
28 |
+
outline: none;
|
29 |
+
vertical-align: top;
|
30 |
+
}
|
31 |
+
|
32 |
+
.fancybox-wrap {
|
33 |
+
position: absolute;
|
34 |
+
top: 0;
|
35 |
+
left: 0;
|
36 |
+
transform: translate3d(0, 0, 0);
|
37 |
+
z-index: 100020;
|
38 |
+
}
|
39 |
+
|
40 |
+
.fancybox-skin {
|
41 |
+
position: relative;
|
42 |
+
background: #f9f9f9;
|
43 |
+
color: #444;
|
44 |
+
text-shadow: none;
|
45 |
+
}
|
46 |
+
|
47 |
+
.fancybox-opened {
|
48 |
+
z-index: 100030;
|
49 |
+
}
|
50 |
+
|
51 |
+
.fancybox-opened .fancybox-skin {
|
52 |
+
box-shadow: 0 10px 25px rgba(0, 0, 0, 0.5);
|
53 |
+
}
|
54 |
+
|
55 |
+
.fancybox-outer, .fancybox-inner {
|
56 |
+
position: relative;
|
57 |
+
}
|
58 |
+
|
59 |
+
.fancybox-inner {
|
60 |
+
overflow: hidden;
|
61 |
+
}
|
62 |
+
|
63 |
+
.fancybox-type-iframe .fancybox-inner {
|
64 |
+
-webkit-overflow-scrolling: touch;
|
65 |
+
}
|
66 |
+
|
67 |
+
.fancybox-error {
|
68 |
+
color: #444;
|
69 |
+
font: 14px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;
|
70 |
+
margin: 0;
|
71 |
+
padding: 15px;
|
72 |
+
white-space: nowrap;
|
73 |
+
}
|
74 |
+
|
75 |
+
.fancybox-wrap .fancybox-image, .fancybox-wrap .fancybox-iframe {
|
76 |
+
display: block;
|
77 |
+
width: 100%;
|
78 |
+
height: 100%;
|
79 |
+
}
|
80 |
+
|
81 |
+
.fancybox-wrap .fancybox-image {
|
82 |
+
max-width: 100%;
|
83 |
+
max-height: 100%;
|
84 |
+
}
|
85 |
+
|
86 |
+
#fancybox-loading, .fancybox-close, .fancybox-prev span, .fancybox-next span {
|
87 |
+
background-image: url(fancybox_sprite.png);
|
88 |
+
}
|
89 |
+
|
90 |
+
#fancybox-loading {
|
91 |
+
position: fixed;
|
92 |
+
top: 50%;
|
93 |
+
left: 50%;
|
94 |
+
margin-top: -22px;
|
95 |
+
margin-left: -22px;
|
96 |
+
background-position: 0 -108px;
|
97 |
+
opacity: 0.8;
|
98 |
+
cursor: pointer;
|
99 |
+
z-index: 100060;
|
100 |
+
}
|
101 |
+
|
102 |
+
#fancybox-loading div {
|
103 |
+
width: 44px;
|
104 |
+
height: 44px;
|
105 |
+
background: url(fancybox_loading.gif) center center no-repeat;
|
106 |
+
}
|
107 |
+
|
108 |
+
.fancybox-close {
|
109 |
+
position: absolute;
|
110 |
+
top: -18px;
|
111 |
+
right: -18px;
|
112 |
+
width: 36px;
|
113 |
+
height: 36px;
|
114 |
+
cursor: pointer;
|
115 |
+
z-index: 100040;
|
116 |
+
}
|
117 |
+
|
118 |
+
.fancybox-nav {
|
119 |
+
position: absolute;
|
120 |
+
top: 0;
|
121 |
+
width: 40%;
|
122 |
+
height: 100%;
|
123 |
+
cursor: pointer;
|
124 |
+
text-decoration: none;
|
125 |
+
background: transparent;
|
126 |
+
-webkit-tap-highlight-color: rgba(0,0,0,0);
|
127 |
+
z-index: 100040;
|
128 |
+
}
|
129 |
+
|
130 |
+
.fancybox-prev {
|
131 |
+
left: 0;
|
132 |
+
}
|
133 |
+
|
134 |
+
.fancybox-next {
|
135 |
+
right: 0;
|
136 |
+
}
|
137 |
+
|
138 |
+
.fancybox-nav span {
|
139 |
+
position: absolute;
|
140 |
+
top: 50%;
|
141 |
+
width: 36px;
|
142 |
+
height: 34px;
|
143 |
+
margin-top: -18px;
|
144 |
+
cursor: pointer;
|
145 |
+
z-index: 100040;
|
146 |
+
visibility: hidden;
|
147 |
+
}
|
148 |
+
|
149 |
+
.fancybox-prev span {
|
150 |
+
left: 10px;
|
151 |
+
background-position: 0 -36px;
|
152 |
+
}
|
153 |
+
|
154 |
+
.fancybox-next span {
|
155 |
+
right: 10px;
|
156 |
+
background-position: 0 -72px;
|
157 |
+
}
|
158 |
+
|
159 |
+
.fancybox-nav:hover span {
|
160 |
+
visibility: visible;
|
161 |
+
}
|
162 |
+
|
163 |
+
.fancybox-tmp {
|
164 |
+
position: absolute;
|
165 |
+
top: -99999px;
|
166 |
+
left: -99999px;
|
167 |
+
max-width: 99999px;
|
168 |
+
max-height: 99999px;
|
169 |
+
overflow: visible !important;
|
170 |
+
}
|
171 |
+
|
172 |
+
/* Overlay helper */
|
173 |
+
|
174 |
+
.fancybox-lock {
|
175 |
+
overflow: visible !important;
|
176 |
+
width: auto;
|
177 |
+
}
|
178 |
+
|
179 |
+
.fancybox-lock body {
|
180 |
+
overflow: hidden !important;
|
181 |
+
}
|
182 |
+
|
183 |
+
.fancybox-lock-test {
|
184 |
+
overflow-y: hidden !important;
|
185 |
+
}
|
186 |
+
|
187 |
+
.fancybox-overlay {
|
188 |
+
position: absolute;
|
189 |
+
top: 0;
|
190 |
+
left: 0;
|
191 |
+
overflow: hidden;
|
192 |
+
display: none;
|
193 |
+
z-index: 100010;
|
194 |
+
background-color: rgba(0,0,0,.7);
|
195 |
+
}
|
196 |
+
|
197 |
+
.fancybox-overlay-fixed {
|
198 |
+
position: fixed;
|
199 |
+
bottom: 0;
|
200 |
+
right: 0;
|
201 |
+
}
|
202 |
+
|
203 |
+
.fancybox-lock .fancybox-overlay {
|
204 |
+
overflow: auto;
|
205 |
+
overflow-y: scroll;
|
206 |
+
}
|
207 |
+
|
208 |
+
/* Title helper */
|
209 |
+
|
210 |
+
.fancybox-title {
|
211 |
+
visibility: hidden;
|
212 |
+
font: normal 13px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;
|
213 |
+
position: relative;
|
214 |
+
text-shadow: none;
|
215 |
+
z-index: 100050;
|
216 |
+
}
|
217 |
+
|
218 |
+
.fancybox-opened .fancybox-title {
|
219 |
+
visibility: visible;
|
220 |
+
}
|
221 |
+
|
222 |
+
.fancybox-title-float-wrap {
|
223 |
+
position: absolute;
|
224 |
+
bottom: 0;
|
225 |
+
right: 50%;
|
226 |
+
margin-bottom: -37px;
|
227 |
+
z-index: 100050;
|
228 |
+
text-align: center;
|
229 |
+
}
|
230 |
+
|
231 |
+
.fancybox-title-float-wrap .child {
|
232 |
+
display: inline-block;
|
233 |
+
margin-right: -100%;
|
234 |
+
padding: 2px 20px;
|
235 |
+
background: black;
|
236 |
+
border: 2px solid white;
|
237 |
+
border-radius: 15px;
|
238 |
+
color: #FFF;
|
239 |
+
font-weight: bold;
|
240 |
+
line-height: 22px;
|
241 |
+
white-space: nowrap;
|
242 |
+
}
|
243 |
+
|
244 |
+
.fancybox-title-outside-wrap {
|
245 |
+
position: relative;
|
246 |
+
margin-top: 10px;
|
247 |
+
color: #fff;
|
248 |
+
}
|
249 |
+
.fancybox-title-outside-wrap:first-child {
|
250 |
+
margin-top: 0;
|
251 |
+
margin-bottom: 10px;
|
252 |
+
}
|
253 |
+
|
254 |
+
.fancybox-title-inside-wrap {
|
255 |
+
padding-top: 10px;
|
256 |
+
}
|
257 |
+
.fancybox-title-inside-wrap:first-child {
|
258 |
+
padding-top: 0;
|
259 |
+
padding-bottom: 10px;
|
260 |
+
}
|
261 |
+
|
262 |
+
.fancybox-title-over-wrap {
|
263 |
+
position: absolute;
|
264 |
+
bottom: 0;
|
265 |
+
left: 0;
|
266 |
+
right: 0;
|
267 |
+
color: #fff;
|
268 |
+
padding: 10px;
|
269 |
+
background: #000;
|
270 |
+
background: rgba(0, 0, 0, .8);
|
271 |
+
}
|
272 |
+
|
273 |
+
/* Other */
|
274 |
+
.fancybox-hidden {
|
275 |
+
display: none;
|
276 |
+
}
|
277 |
+
.fancybox-inner .fancybox-hidden {
|
278 |
+
display: revert;
|
279 |
+
}
|
280 |
+
|
281 |
+
/*Retina graphics!*/
|
282 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5),
|
283 |
+
only screen and (min--moz-device-pixel-ratio: 1.5),
|
284 |
+
only screen and (min-device-pixel-ratio: 1.5){
|
285 |
+
|
286 |
+
#fancybox-loading, .fancybox-close, .fancybox-prev span, .fancybox-next span {
|
287 |
+
background-image: url(fancybox_sprite@2x.png);
|
288 |
+
background-size: 44px 152px; /*The size of the normal image, half the size of the hi-res image*/
|
289 |
+
}
|
290 |
+
|
291 |
+
#fancybox-loading div {
|
292 |
+
background-image: url(fancybox_loading@2x.gif);
|
293 |
+
background-size: 24px 24px; /*The size of the normal image, half the size of the hi-res image*/
|
294 |
+
}
|
295 |
+
}
|
fancybox/2.2.0/jquery.fancybox.js
ADDED
@@ -0,0 +1,2113 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/**
|
2 |
+
* fancyBox - jQuery Plugin
|
3 |
+
* version: 2.2.0 (Tue, 16 Sep 2022)
|
4 |
+
* requires jQuery v1.6 or later
|
5 |
+
*
|
6 |
+
* Licensed GPLv3 for open source use
|
7 |
+
* or fancyBox Commercial License for commercial use
|
8 |
+
*
|
9 |
+
* Examples at http://fancyapps.com/fancybox/
|
10 |
+
* License: www.fancyapps.com/fancybox/#license
|
11 |
+
*
|
12 |
+
* Copyright 2017 fancyapps.com
|
13 |
+
*/
|
14 |
+
|
15 |
+
;(function (window, document, $, undefined) {
|
16 |
+
"use strict";
|
17 |
+
|
18 |
+
var H = $("html"),
|
19 |
+
W = $(window),
|
20 |
+
D = $(document),
|
21 |
+
F = $.fancybox = function () {
|
22 |
+
F.open.apply( this, arguments );
|
23 |
+
},
|
24 |
+
IE = navigator.userAgent.match(/msie/i),
|
25 |
+
didUpdate = null,
|
26 |
+
isTouch = 'ontouchstart' in window || window.DocumentTouch && document instanceof DocumentTouch || navigator.maxTouchPoints > 0 || navigator.msMaxTouchPoints > 0,
|
27 |
+
|
28 |
+
isQuery = function(obj) {
|
29 |
+
return obj && obj.hasOwnProperty && obj instanceof $;
|
30 |
+
},
|
31 |
+
isString = function(str) {
|
32 |
+
return str && $.type(str) === "string";
|
33 |
+
},
|
34 |
+
isPercentage = function(str) {
|
35 |
+
return isString(str) && str.indexOf('%') > 0;
|
36 |
+
},
|
37 |
+
isScrollable = function(el) {
|
38 |
+
return (el && !(el.style.overflow && el.style.overflow === 'hidden') && ((el.clientWidth && el.scrollWidth > el.clientWidth) || (el.clientHeight && el.scrollHeight > el.clientHeight)));
|
39 |
+
},
|
40 |
+
getScalar = function(orig, dim) {
|
41 |
+
var value = parseInt(orig, 10) || 0;
|
42 |
+
|
43 |
+
if (dim && isPercentage(orig)) {
|
44 |
+
value = F.getViewport()[ dim ] / 100 * value;
|
45 |
+
}
|
46 |
+
|
47 |
+
return Math.ceil(value);
|
48 |
+
},
|
49 |
+
getValue = function(value, dim) {
|
50 |
+
return getScalar(value, dim) + 'px';
|
51 |
+
};
|
52 |
+
|
53 |
+
$.extend(F, {
|
54 |
+
// The current version of fancyBox
|
55 |
+
version: '2.2.0',
|
56 |
+
|
57 |
+
defaults: {
|
58 |
+
padding : 15,
|
59 |
+
margin : 20,
|
60 |
+
|
61 |
+
width : 800,
|
62 |
+
height : 600,
|
63 |
+
minWidth : 100,
|
64 |
+
minHeight : 100,
|
65 |
+
maxWidth : 9999,
|
66 |
+
maxHeight : 9999,
|
67 |
+
pixelRatio: window.devicePixelRatio || 1, // Set to 2 for retina display support
|
68 |
+
|
69 |
+
autoSize : true,
|
70 |
+
autoHeight : false,
|
71 |
+
autoWidth : false,
|
72 |
+
|
73 |
+
autoResize : true,
|
74 |
+
autoCenter : !isTouch,
|
75 |
+
fitToView : true,
|
76 |
+
aspectRatio : false,
|
77 |
+
topRatio : 0.5,
|
78 |
+
leftRatio : 0.5,
|
79 |
+
minVpWidth : 320,
|
80 |
+
minVpHeight : 320,
|
81 |
+
|
82 |
+
scrolling : 'auto', // 'auto', 'yes' or 'no'
|
83 |
+
wrapCSS : '',
|
84 |
+
|
85 |
+
arrows : true,
|
86 |
+
closeBtn : true,
|
87 |
+
closeClick : false,
|
88 |
+
nextClick : false,
|
89 |
+
zoomClick : false,
|
90 |
+
mouseWheel : true,
|
91 |
+
swipe : isTouch,
|
92 |
+
autoPlay : false,
|
93 |
+
playSpeed : 3000,
|
94 |
+
preload : 3,
|
95 |
+
modal : false,
|
96 |
+
loop : true,
|
97 |
+
|
98 |
+
ajax : {
|
99 |
+
dataType : 'html',
|
100 |
+
headers : { 'X-fancyBox': true }
|
101 |
+
},
|
102 |
+
iframe : {
|
103 |
+
scrolling : 'auto',
|
104 |
+
allowfullscreen : true,
|
105 |
+
preload : true
|
106 |
+
},
|
107 |
+
svg : {},
|
108 |
+
|
109 |
+
keys : {
|
110 |
+
next : {
|
111 |
+
13 : 'left', // enter
|
112 |
+
34 : 'up', // page down
|
113 |
+
39 : 'left', // right arrow
|
114 |
+
40 : 'up' // down arrow
|
115 |
+
},
|
116 |
+
prev : {
|
117 |
+
8 : 'right', // backspace
|
118 |
+
33 : 'down', // page up
|
119 |
+
37 : 'right', // left arrow
|
120 |
+
38 : 'down' // up arrow
|
121 |
+
},
|
122 |
+
close : [27], // escape key
|
123 |
+
play : [32], // space - start/stop slideshow
|
124 |
+
toggle : [70] // letter "f" - toggle fullscreen
|
125 |
+
},
|
126 |
+
|
127 |
+
direction : {
|
128 |
+
next : 'left',
|
129 |
+
prev : 'right'
|
130 |
+
},
|
131 |
+
|
132 |
+
scrollOutside : true,
|
133 |
+
|
134 |
+
// Override some properties
|
135 |
+
index : 0,
|
136 |
+
type : null,
|
137 |
+
href : null,
|
138 |
+
content : null,
|
139 |
+
title : null,
|
140 |
+
|
141 |
+
// HTML templates
|
142 |
+
tpl: {
|
143 |
+
wrap : '<div class="fancybox-wrap" tabIndex="-1"><div class="fancybox-skin"><div class="fancybox-outer"><div class="fancybox-inner"></div></div></div></div>',
|
144 |
+
image : '<img class="fancybox-image" src="{href}" alt="" />',
|
145 |
+
iframe : '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" allow="autoplay"' + (IE ? ' allowtransparency="true"' : '') + '></iframe>',
|
146 |
+
error : '<p class="fancybox-error">{error}</p>',
|
147 |
+
close : '<a title="{close}" class="fancybox-item fancybox-close" href="javascript:;"></a>',
|
148 |
+
next : '<a title="{next}" class="fancybox-nav fancybox-next" href="javascript:;"><span></span></a>',
|
149 |
+
prev : '<a title="{prev}" class="fancybox-nav fancybox-prev" href="javascript:;"><span></span></a>',
|
150 |
+
loading : '<div id="fancybox-loading"><div></div></div>'
|
151 |
+
},
|
152 |
+
|
153 |
+
// Texts
|
154 |
+
txt: {
|
155 |
+
error : {
|
156 |
+
content : 'The requested content cannot be loaded.<br/>Please try again later.',
|
157 |
+
image : 'The requested image cannot be loaded.<br/>Please try again later.',
|
158 |
+
ajax : 'An AJAX error occurred.<br/>Please contact the site administrator.',
|
159 |
+
href : 'Missing media target URL.<br/>Please contact the site administrator.',
|
160 |
+
},
|
161 |
+
close : 'Close',
|
162 |
+
next : 'Next',
|
163 |
+
prev : 'Previous'
|
164 |
+
},
|
165 |
+
|
166 |
+
// Properties for each animation type
|
167 |
+
// Opening fancyBox
|
168 |
+
openEffect : 'fade', // 'elastic', 'fade' or 'none'
|
169 |
+
openSpeed : 250,
|
170 |
+
openEasing : 'swing',
|
171 |
+
openOpacity : true,
|
172 |
+
openMethod : 'zoomIn',
|
173 |
+
|
174 |
+
// Closing fancyBox
|
175 |
+
closeEffect : 'fade', // 'elastic', 'fade' or 'none'
|
176 |
+
closeSpeed : 250,
|
177 |
+
closeEasing : 'swing',
|
178 |
+
closeOpacity : true,
|
179 |
+
closeMethod : 'zoomOut',
|
180 |
+
|
181 |
+
// Changing next gallery item
|
182 |
+
nextEffect : 'elastic', // 'elastic', 'fade' or 'none'
|
183 |
+
nextSpeed : 250,
|
184 |
+
nextEasing : 'swing',
|
185 |
+
nextMethod : 'changeIn',
|
186 |
+
|
187 |
+
// Changing previous gallery item
|
188 |
+
prevEffect : 'elastic', // 'elastic', 'fade' or 'none'
|
189 |
+
prevSpeed : 250,
|
190 |
+
prevEasing : 'swing',
|
191 |
+
prevMethod : 'changeOut',
|
192 |
+
|
193 |
+
// Enable default helpers
|
194 |
+
helpers : {
|
195 |
+
overlay : true,
|
196 |
+
title : true
|
197 |
+
},
|
198 |
+
|
199 |
+
// Callbacks
|
200 |
+
onCancel : $.noop, // If canceling
|
201 |
+
beforeLoad : $.noop, // Before loading
|
202 |
+
afterLoad : $.noop, // After loading
|
203 |
+
beforeShow : $.noop, // Before changing in current item
|
204 |
+
afterShow : $.noop, // After opening
|
205 |
+
beforeChange : $.noop, // Before changing gallery item
|
206 |
+
beforeClose : $.noop, // Before closing
|
207 |
+
afterClose : $.noop // After closing
|
208 |
+
},
|
209 |
+
|
210 |
+
//Current state
|
211 |
+
group : {}, // Selected group
|
212 |
+
opts : {}, // Group options
|
213 |
+
previous : null, // Previous element
|
214 |
+
coming : null, // Element being loaded
|
215 |
+
current : null, // Currently loaded element
|
216 |
+
isActive : false, // Is activated
|
217 |
+
isOpen : false, // Is currently open
|
218 |
+
isOpened : false, // Have been fully opened at least once
|
219 |
+
|
220 |
+
wrap : null,
|
221 |
+
skin : null,
|
222 |
+
outer : null,
|
223 |
+
inner : null,
|
224 |
+
|
225 |
+
player : {
|
226 |
+
timer : null,
|
227 |
+
isActive : false
|
228 |
+
},
|
229 |
+
|
230 |
+
// Loaders
|
231 |
+
ajaxLoad : null,
|
232 |
+
imgPreload : null,
|
233 |
+
|
234 |
+
// Some collections
|
235 |
+
transitions : {},
|
236 |
+
helpers : {},
|
237 |
+
|
238 |
+
/*
|
239 |
+
* Static methods
|
240 |
+
*/
|
241 |
+
|
242 |
+
open: function (group, opts) {
|
243 |
+
if (!group) {
|
244 |
+
return;
|
245 |
+
}
|
246 |
+
|
247 |
+
if (!$.isPlainObject(opts)) {
|
248 |
+
opts = {};
|
249 |
+
}
|
250 |
+
|
251 |
+
// Close if already active
|
252 |
+
if (false === F.close(true)) {
|
253 |
+
return;
|
254 |
+
}
|
255 |
+
|
256 |
+
// Normalize group
|
257 |
+
if (!$.isArray(group)) {
|
258 |
+
group = isQuery(group) ? $(group).get() : [group];
|
259 |
+
}
|
260 |
+
|
261 |
+
// Recheck if the type of each element is `object` and set content type (image, ajax, etc)
|
262 |
+
$.each(group, function(i, element) {
|
263 |
+
var obj = {},
|
264 |
+
href,
|
265 |
+
title,
|
266 |
+
content,
|
267 |
+
type,
|
268 |
+
rez,
|
269 |
+
hrefParts,
|
270 |
+
selector;
|
271 |
+
|
272 |
+
if ($.type(element) === "object") {
|
273 |
+
// Check if is DOM element
|
274 |
+
if (element.nodeType) {
|
275 |
+
element = $(element);
|
276 |
+
}
|
277 |
+
|
278 |
+
if (isQuery(element)) {
|
279 |
+
obj = {
|
280 |
+
href : element.data('fancybox-href') || element.attr('href'),
|
281 |
+
title : $('<div/>').text( element.data('fancybox-title') || element.attr('title') || '' ).html(),
|
282 |
+
isDom : true,
|
283 |
+
element : element
|
284 |
+
};
|
285 |
+
|
286 |
+
if ($.metadata) {
|
287 |
+
$.extend(true, obj, element.metadata());
|
288 |
+
}
|
289 |
+
}
|
290 |
+
else {
|
291 |
+
obj = element;
|
292 |
+
}
|
293 |
+
}
|
294 |
+
|
295 |
+
href = opts.href || obj.href || (isString(element) ? element : null);
|
296 |
+
title = opts.title !== undefined ? opts.title : obj.title || '';
|
297 |
+
|
298 |
+
content = opts.content || obj.content;
|
299 |
+
type = content ? 'html' : (opts.type || obj.type);
|
300 |
+
|
301 |
+
if (!type && obj.isDom) {
|
302 |
+
type = element.data('fancybox-type');
|
303 |
+
|
304 |
+
if (!type) {
|
305 |
+
rez = element.prop('class').match(/fancybox\.(\w+)/);
|
306 |
+
type = rez ? rez[1] : null;
|
307 |
+
}
|
308 |
+
}
|
309 |
+
|
310 |
+
if (isString(href)) {
|
311 |
+
// Try to guess the content type
|
312 |
+
if (!type) {
|
313 |
+
if (F.isImage(href)) {
|
314 |
+
type = 'image';
|
315 |
+
}
|
316 |
+
else if (F.isSVG(href)) {
|
317 |
+
type = 'svg';
|
318 |
+
}
|
319 |
+
else if (href.charAt(0) === '#') {
|
320 |
+
type = 'inline';
|
321 |
+
}
|
322 |
+
else if (isString(element)) {
|
323 |
+
type = 'html';
|
324 |
+
content = element;
|
325 |
+
}
|
326 |
+
}
|
327 |
+
|
328 |
+
// Split url into two pieces with source url and content selector, e.g,
|
329 |
+
// "/mypage.html #my_id" will load "/mypage.html" and display element having id "my_id"
|
330 |
+
if (type === 'ajax') {
|
331 |
+
hrefParts = href.split(/\s+/, 2);
|
332 |
+
href = hrefParts.shift();
|
333 |
+
selector = hrefParts.shift();
|
334 |
+
}
|
335 |
+
}
|
336 |
+
|
337 |
+
if (!content) {
|
338 |
+
if (type === 'inline') {
|
339 |
+
if (href) {
|
340 |
+
content = $( isString(href) ? href.replace(/.*(?=#[^\s]+$)/, '') : href ); //strip for ie7
|
341 |
+
}
|
342 |
+
else if (obj.isDom) {
|
343 |
+
content = element;
|
344 |
+
}
|
345 |
+
}
|
346 |
+
else if (type === 'html') {
|
347 |
+
content = href;
|
348 |
+
}
|
349 |
+
else if (!type && !href && obj.isDom) {
|
350 |
+
type = 'inline';
|
351 |
+
content = element;
|
352 |
+
}
|
353 |
+
}
|
354 |
+
|
355 |
+
$.extend(obj, {
|
356 |
+
href : href,
|
357 |
+
type : type,
|
358 |
+
content : content,
|
359 |
+
title : title,
|
360 |
+
selector : selector
|
361 |
+
});
|
362 |
+
|
363 |
+
group[ i ] = obj;
|
364 |
+
});
|
365 |
+
|
366 |
+
// Extend the defaults
|
367 |
+
F.opts = $.extend(true, {}, F.defaults, opts);
|
368 |
+
|
369 |
+
// All options are merged recursive except keys
|
370 |
+
if (opts.keys !== undefined) {
|
371 |
+
F.opts.keys = opts.keys ? $.extend({}, F.defaults.keys, opts.keys) : false;
|
372 |
+
}
|
373 |
+
|
374 |
+
F.group = group;
|
375 |
+
|
376 |
+
return F._start(F.opts.index);
|
377 |
+
},
|
378 |
+
|
379 |
+
// Cancel image loading or abort ajax request
|
380 |
+
cancel: function () {
|
381 |
+
var coming = F.coming;
|
382 |
+
|
383 |
+
if (coming && false === F.trigger('onCancel')) {
|
384 |
+
return;
|
385 |
+
}
|
386 |
+
|
387 |
+
F.hideLoading();
|
388 |
+
|
389 |
+
if (!coming) {
|
390 |
+
return;
|
391 |
+
}
|
392 |
+
|
393 |
+
if (F.ajaxLoad) {
|
394 |
+
F.ajaxLoad.abort();
|
395 |
+
}
|
396 |
+
|
397 |
+
F.ajaxLoad = null;
|
398 |
+
|
399 |
+
if (F.imgPreload) {
|
400 |
+
F.imgPreload.onload = F.imgPreload.onerror = null;
|
401 |
+
}
|
402 |
+
|
403 |
+
if (coming.wrap) {
|
404 |
+
coming.wrap.stop(true, true).trigger('onReset').remove();
|
405 |
+
}
|
406 |
+
|
407 |
+
F.coming = null;
|
408 |
+
|
409 |
+
// If the first item has been canceled, then clear everything
|
410 |
+
if (!F.current) {
|
411 |
+
F._afterZoomOut( coming );
|
412 |
+
}
|
413 |
+
},
|
414 |
+
|
415 |
+
// Start closing animation if is open; remove immediately if opening/closing
|
416 |
+
close: function (event) {
|
417 |
+
F.cancel();
|
418 |
+
|
419 |
+
if (false === F.trigger('beforeClose')) {
|
420 |
+
return;
|
421 |
+
}
|
422 |
+
|
423 |
+
F.unbindEvents();
|
424 |
+
|
425 |
+
if (!F.isActive) {
|
426 |
+
return;
|
427 |
+
}
|
428 |
+
|
429 |
+
if (!F.isOpen || event === true) {
|
430 |
+
$('.fancybox-wrap').stop(true).trigger('onReset').remove();
|
431 |
+
|
432 |
+
F._afterZoomOut();
|
433 |
+
}
|
434 |
+
else {
|
435 |
+
F.isOpen = F.isOpened = false;
|
436 |
+
F.isClosing = true;
|
437 |
+
|
438 |
+
$('.fancybox-item, .fancybox-nav').remove();
|
439 |
+
|
440 |
+
F.wrap.stop(true, true).removeClass('fancybox-opened');
|
441 |
+
|
442 |
+
F.transitions[ F.current.closeMethod ]();
|
443 |
+
}
|
444 |
+
},
|
445 |
+
|
446 |
+
// Manage slideshow:
|
447 |
+
// $.fancybox.play(); - toggle slideshow
|
448 |
+
// $.fancybox.play( true ); - start
|
449 |
+
// $.fancybox.play( false ); - stop
|
450 |
+
play: function ( action ) {
|
451 |
+
var clear = function () {
|
452 |
+
clearTimeout(F.player.timer);
|
453 |
+
},
|
454 |
+
set = function () {
|
455 |
+
clear();
|
456 |
+
|
457 |
+
if (F.current && F.player.isActive) {
|
458 |
+
F.player.timer = setTimeout(F.next, F.current.playSpeed);
|
459 |
+
}
|
460 |
+
},
|
461 |
+
stop = function () {
|
462 |
+
clear();
|
463 |
+
|
464 |
+
D.off('.player');
|
465 |
+
|
466 |
+
F.player.isActive = false;
|
467 |
+
|
468 |
+
F.trigger('onPlayEnd');
|
469 |
+
},
|
470 |
+
start = function () {
|
471 |
+
if (F.current && (F.current.loop || F.current.index < F.group.length - 1)) {
|
472 |
+
F.player.isActive = true;
|
473 |
+
|
474 |
+
D.on({
|
475 |
+
'onCancel.player beforeClose.player' : stop,
|
476 |
+
'onUpdate.player' : set,
|
477 |
+
'beforeLoad.player' : clear
|
478 |
+
});
|
479 |
+
|
480 |
+
set();
|
481 |
+
|
482 |
+
F.trigger('onPlayStart');
|
483 |
+
}
|
484 |
+
};
|
485 |
+
|
486 |
+
if (action === true || (!F.player.isActive && action !== false)) {
|
487 |
+
start();
|
488 |
+
}
|
489 |
+
else {
|
490 |
+
stop();
|
491 |
+
}
|
492 |
+
},
|
493 |
+
|
494 |
+
// Navigate on mousewheel, swipe or drag
|
495 |
+
swipe: function ( deltaX, deltaY, threshold ) {
|
496 |
+
if ( deltaX > threshold || deltaY > threshold ) {
|
497 |
+
F.wrap.off('touchstart.fb touchmove.fb touchend.fb mouseup.fb mousedown.fb mousemove.fb mousewheel.fb');
|
498 |
+
F.next( deltaY > threshold ? 'up' : 'left' );
|
499 |
+
}
|
500 |
+
else if ( deltaX < -threshold || deltaY < -threshold ) {
|
501 |
+
F.wrap.off('touchstart.fb touchmove.fb touchend.fb mouseup.fb mousedown.fb mousemove.fb mousewheel.fb');
|
502 |
+
F.prev( deltaY < -threshold ? 'down' : 'right' );
|
503 |
+
}
|
504 |
+
},
|
505 |
+
|
506 |
+
// Navigate to next gallery item
|
507 |
+
next: function ( direction ) {
|
508 |
+
var current = F.current;
|
509 |
+
|
510 |
+
if (current) {
|
511 |
+
if (!isString(direction)) {
|
512 |
+
direction = current.direction.next;
|
513 |
+
}
|
514 |
+
|
515 |
+
F.jumpto(current.index + 1, direction, 'next');
|
516 |
+
}
|
517 |
+
},
|
518 |
+
|
519 |
+
// Navigate to previous gallery item
|
520 |
+
prev: function ( direction ) {
|
521 |
+
var current = F.current;
|
522 |
+
|
523 |
+
if (current) {
|
524 |
+
if (!isString(direction)) {
|
525 |
+
direction = current.direction.prev;
|
526 |
+
}
|
527 |
+
|
528 |
+
F.jumpto(current.index - 1, direction, 'prev');
|
529 |
+
}
|
530 |
+
},
|
531 |
+
|
532 |
+
// Navigate to gallery item by index
|
533 |
+
jumpto: function ( index, direction, router ) {
|
534 |
+
var current = F.current;
|
535 |
+
|
536 |
+
if (!current) {
|
537 |
+
return;
|
538 |
+
}
|
539 |
+
|
540 |
+
index = getScalar(index);
|
541 |
+
|
542 |
+
F.direction = direction || current.direction[ (index >= current.index ? 'next' : 'prev') ];
|
543 |
+
F.router = router || 'jumpto';
|
544 |
+
|
545 |
+
if (current.loop) {
|
546 |
+
if (index < 0) {
|
547 |
+
index = current.group.length + (index % current.group.length);
|
548 |
+
}
|
549 |
+
|
550 |
+
index = index % current.group.length;
|
551 |
+
}
|
552 |
+
|
553 |
+
if (current.group[ index ] !== undefined) {
|
554 |
+
F.cancel();
|
555 |
+
F.isJumping = true;
|
556 |
+
F._start(index);
|
557 |
+
}
|
558 |
+
},
|
559 |
+
|
560 |
+
canScroll: function ( target ) {
|
561 |
+
let canScroll = false,
|
562 |
+
parent = $(target);
|
563 |
+
|
564 |
+
while (parent.length) {
|
565 |
+
if (canScroll || parent.is('.fancybox-skin') || parent.is('.fancybox-wrap')) {
|
566 |
+
break;
|
567 |
+
}
|
568 |
+
canScroll = isScrollable( parent[0] );
|
569 |
+
parent = $(parent).parent();
|
570 |
+
}
|
571 |
+
|
572 |
+
return canScroll;
|
573 |
+
},
|
574 |
+
|
575 |
+
// Center inside viewport and toggle position type to fixed or absolute if needed
|
576 |
+
reposition: function (e, onlyAbsolute) {
|
577 |
+
var current = F.current,
|
578 |
+
wrap = current ? current.wrap : null,
|
579 |
+
pos;
|
580 |
+
|
581 |
+
if (wrap) {
|
582 |
+
pos = F._getPosition(onlyAbsolute);
|
583 |
+
|
584 |
+
if (e && e.type === 'scroll') {
|
585 |
+
delete pos.position;
|
586 |
+
|
587 |
+
wrap.stop(true, true).animate(pos, 200);
|
588 |
+
}
|
589 |
+
else {
|
590 |
+
wrap.css(pos);
|
591 |
+
|
592 |
+
current.pos = $.extend({}, current.dim, pos);
|
593 |
+
}
|
594 |
+
}
|
595 |
+
},
|
596 |
+
|
597 |
+
update: function (e) {
|
598 |
+
var type = (e && e.originalEvent && e.originalEvent.type),
|
599 |
+
anyway = !type || type === 'orientationchange';
|
600 |
+
|
601 |
+
if (anyway) {
|
602 |
+
clearTimeout(didUpdate);
|
603 |
+
|
604 |
+
didUpdate = null;
|
605 |
+
}
|
606 |
+
|
607 |
+
if (!F.isOpen || didUpdate) {
|
608 |
+
return;
|
609 |
+
}
|
610 |
+
|
611 |
+
didUpdate = setTimeout(function() {
|
612 |
+
var current = F.current;
|
613 |
+
|
614 |
+
if (!current || F.isClosing) {
|
615 |
+
return;
|
616 |
+
}
|
617 |
+
|
618 |
+
F.wrap.removeClass('fancybox-tmp');
|
619 |
+
|
620 |
+
if (anyway || type === 'load' || (type === 'resize' && current.autoResize)) {
|
621 |
+
F._setDimension();
|
622 |
+
}
|
623 |
+
|
624 |
+
if (!(type === 'scroll' && current.canShrink)) {
|
625 |
+
F.reposition(e);
|
626 |
+
}
|
627 |
+
|
628 |
+
if (current.zoomClick) {
|
629 |
+
F.inner.css('cursor', current.canExpand ? 'zoom-in' : 'zoom-out');
|
630 |
+
}
|
631 |
+
|
632 |
+
F.trigger('onUpdate');
|
633 |
+
|
634 |
+
didUpdate = null;
|
635 |
+
|
636 |
+
}, (anyway && !isTouch ? 0 : 300));
|
637 |
+
},
|
638 |
+
|
639 |
+
// Shrink content to fit inside viewport or restore if resized
|
640 |
+
toggle: function ( action ) {
|
641 |
+
if (F.isOpen) {
|
642 |
+
F.current.fitToView = $.type(action) === "boolean" ? action : !F.current.fitToView;
|
643 |
+
|
644 |
+
// Help browser to restore document dimensions
|
645 |
+
if (isTouch) {
|
646 |
+
F.wrap.removeAttr('style').addClass('fancybox-tmp');
|
647 |
+
|
648 |
+
F.trigger('onUpdate');
|
649 |
+
}
|
650 |
+
|
651 |
+
F.update();
|
652 |
+
}
|
653 |
+
},
|
654 |
+
|
655 |
+
hideLoading: function () {
|
656 |
+
D.off('.loading');
|
657 |
+
|
658 |
+
$('#fancybox-loading').remove();
|
659 |
+
},
|
660 |
+
|
661 |
+
showLoading: function () {
|
662 |
+
var el, viewport;
|
663 |
+
|
664 |
+
F.hideLoading();
|
665 |
+
|
666 |
+
el = $(F.opts.tpl.loading).click(F.cancel).appendTo('body');
|
667 |
+
|
668 |
+
// If user will press the escape-button, the request will be canceled
|
669 |
+
D.on('keydown.loading', function(e) {
|
670 |
+
if ((e.which || e.keyCode) === 27) {
|
671 |
+
F.cancel();
|
672 |
+
|
673 |
+
e.preventDefault();
|
674 |
+
return false;
|
675 |
+
}
|
676 |
+
});
|
677 |
+
|
678 |
+
if (!F.defaults.fixed) {
|
679 |
+
viewport = F.getViewport();
|
680 |
+
|
681 |
+
el.css({
|
682 |
+
position : 'absolute',
|
683 |
+
top : (viewport.h * 0.5) + viewport.y,
|
684 |
+
left : (viewport.w * 0.5) + viewport.x
|
685 |
+
});
|
686 |
+
}
|
687 |
+
|
688 |
+
F.trigger('onLoading');
|
689 |
+
},
|
690 |
+
|
691 |
+
getViewport: function () {
|
692 |
+
var locked = (F.current && F.current.locked) || false,
|
693 |
+
rez = {
|
694 |
+
x: W.scrollLeft(),
|
695 |
+
y: W.scrollTop()
|
696 |
+
};
|
697 |
+
|
698 |
+
if (locked && locked.length) {
|
699 |
+
rez.w = locked[0].clientWidth;
|
700 |
+
rez.h = locked[0].clientHeight;
|
701 |
+
}
|
702 |
+
else {
|
703 |
+
// See http://bugs.jquery.com/ticket/6724
|
704 |
+
rez.w = isTouch && window.innerWidth ? window.innerWidth : W.width();
|
705 |
+
rez.h = isTouch && window.innerHeight ? window.innerHeight : W.height();
|
706 |
+
}
|
707 |
+
|
708 |
+
return rez;
|
709 |
+
},
|
710 |
+
|
711 |
+
// Unbind the keyboard / clicking actions
|
712 |
+
unbindEvents: function () {
|
713 |
+
if (F.wrap && isQuery(F.wrap)) {
|
714 |
+
F.wrap.off('.fb');
|
715 |
+
}
|
716 |
+
|
717 |
+
D.off('.fb');
|
718 |
+
W.off('.fb');
|
719 |
+
},
|
720 |
+
|
721 |
+
bindEvents: function () {
|
722 |
+
var current = F.current,
|
723 |
+
keys;
|
724 |
+
|
725 |
+
if (!current) {
|
726 |
+
return;
|
727 |
+
}
|
728 |
+
|
729 |
+
// Changing document height on iOS devices triggers a 'resize' event,
|
730 |
+
// that can change document height... repeating infinitely
|
731 |
+
W.on('orientationchange.fb' + (isTouch ? '' : ' resize.fb') + (current.autoCenter && !current.locked ? ' scroll.fb' : ''), F.update);
|
732 |
+
|
733 |
+
keys = current.keys;
|
734 |
+
|
735 |
+
if (keys) {
|
736 |
+
D.on('keydown.fb', function (e) {
|
737 |
+
var code = e.which || e.keyCode,
|
738 |
+
target = e.target || e.srcElement;
|
739 |
+
|
740 |
+
// Skip esc key if loading, because showLoading will cancel preloading
|
741 |
+
if (code === 27 && F.coming) {
|
742 |
+
return false;
|
743 |
+
}
|
744 |
+
|
745 |
+
// Ignore key combinations and key events within form elements
|
746 |
+
if (!e.ctrlKey && !e.altKey && !e.shiftKey && !e.metaKey && !(target && (target.type || $(target).is('[contenteditable]')))) {
|
747 |
+
$.each(keys, function(i, val) {
|
748 |
+
if (current.group.length > 1 && val[ code ] !== undefined) {
|
749 |
+
F[ i ]( val[ code ] );
|
750 |
+
|
751 |
+
e.preventDefault();
|
752 |
+
return false;
|
753 |
+
}
|
754 |
+
|
755 |
+
if ($.inArray(code, val) > -1) {
|
756 |
+
F[ i ] ();
|
757 |
+
|
758 |
+
e.preventDefault();
|
759 |
+
return false;
|
760 |
+
}
|
761 |
+
});
|
762 |
+
}
|
763 |
+
});
|
764 |
+
}
|
765 |
+
|
766 |
+
if (current.group.length > 1) {
|
767 |
+
F.wrap.css('cursor','move');
|
768 |
+
F.wrap.on('mousedown.fb', function(e){
|
769 |
+
let drag = {};
|
770 |
+
|
771 |
+
e.preventDefault();
|
772 |
+
|
773 |
+
drag.startX = typeof e.clientX !== 'undefined' ? e.clientX : e.originalEvent.clientX;
|
774 |
+
drag.startY = typeof e.clientY !== 'undefined' ? e.clientY : e.originalEvent.clientY;
|
775 |
+
|
776 |
+
F.wrap.on('mousemove.fb',function(e) {
|
777 |
+
e.preventDefault();
|
778 |
+
|
779 |
+
drag.endX = typeof e.clientX !== 'undefined' ? e.clientX : e.originalEvent.clientX;
|
780 |
+
drag.endY = typeof e.clientY !== 'undefined' ? e.clientY : e.originalEvent.clientY;
|
781 |
+
});
|
782 |
+
|
783 |
+
F.wrap.on('mouseup.fb', function(){
|
784 |
+
F.wrap.off('mousemove.fb');
|
785 |
+
F.swipe(drag.startX - drag.endX, drag.startY - drag.endY, 100);
|
786 |
+
});
|
787 |
+
});
|
788 |
+
|
789 |
+
if (current.swipe) {
|
790 |
+
F.wrap.on('touchstart.fb', function(e){
|
791 |
+
let target = e.target || null,
|
792 |
+
touch = {},
|
793 |
+
fingers = typeof e.touches !== 'undefined' ? e.touches.length : e.originalEvent.touches.length;
|
794 |
+
|
795 |
+
if ( current.canShrink || fingers > 1 || F.canScroll( target ) ) {
|
796 |
+
return;
|
797 |
+
}
|
798 |
+
|
799 |
+
e.preventDefault();
|
800 |
+
|
801 |
+
touch.startX = typeof e.touches !== 'undefined' ? e.touches[0].clientX : e.originalEvent.touches[0].clientX;
|
802 |
+
touch.startY = typeof e.touches !== 'undefined' ? e.touches[0].clientY : e.originalEvent.touches[0].clientY;
|
803 |
+
|
804 |
+
F.wrap.on('touchmove.fb',function(e) {
|
805 |
+
fingers = typeof e.touches !== 'undefined' ? e.touches.length : e.originalEvent.touches.length;
|
806 |
+
if ( fingers > 1 ) {
|
807 |
+
return;
|
808 |
+
}
|
809 |
+
e.preventDefault();
|
810 |
+
|
811 |
+
let x = typeof e.touches !== 'undefined' ? e.touches[0].clientX : e.originalEvent.touches[0].clientX,
|
812 |
+
y = typeof e.touches !== 'undefined' ? e.touches[0].clientY : e.originalEvent.touches[0].clientY;
|
813 |
+
|
814 |
+
F.swipe(touch.startX - x, touch.startY - y, 100);
|
815 |
+
});
|
816 |
+
});
|
817 |
+
F.wrap.on('touchend.fb', function(){
|
818 |
+
F.wrap.off('touchmove.fb');
|
819 |
+
});
|
820 |
+
}
|
821 |
+
|
822 |
+
if ($.fn.mousewheel && current.mouseWheel) {
|
823 |
+
F.wrap.on('mousewheel.fb', function (e, delta, deltaX, deltaY) {
|
824 |
+
let target = e.target || null;
|
825 |
+
|
826 |
+
if (current.canShrink || delta === 0 || F.canScroll(target)) {
|
827 |
+
return;
|
828 |
+
}
|
829 |
+
|
830 |
+
e.preventDefault();
|
831 |
+
|
832 |
+
F.swipe(-deltaX, -deltaY, 0);
|
833 |
+
});
|
834 |
+
}
|
835 |
+
}
|
836 |
+
},
|
837 |
+
|
838 |
+
trigger: function (event, o) {
|
839 |
+
var ret, obj = o || F.coming || F.current;
|
840 |
+
|
841 |
+
if (obj) {
|
842 |
+
if ($.isFunction( obj[event] )) {
|
843 |
+
ret = obj[event].apply(obj, Array.prototype.slice.call(arguments, 1));
|
844 |
+
}
|
845 |
+
|
846 |
+
if (ret === false) {
|
847 |
+
return false;
|
848 |
+
}
|
849 |
+
|
850 |
+
if (obj.helpers) {
|
851 |
+
$.each(obj.helpers, function (helper, opts) {
|
852 |
+
if (opts && F.helpers[helper] && $.isFunction(F.helpers[helper][event])) {
|
853 |
+
F.helpers[helper][event]($.extend(true, {}, F.helpers[helper].defaults, opts), obj);
|
854 |
+
}
|
855 |
+
});
|
856 |
+
}
|
857 |
+
}
|
858 |
+
|
859 |
+
D.trigger(event);
|
860 |
+
},
|
861 |
+
|
862 |
+
isImage: function (str) {
|
863 |
+
return isString(str) && str.match(/(^data:image\/.*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg)((\?|#).*)?$)/i);
|
864 |
+
},
|
865 |
+
|
866 |
+
isSVG: function (str) {
|
867 |
+
return isString(str) && str.match(/\.(svg)((\?|#).*)?$/i);
|
868 |
+
},
|
869 |
+
|
870 |
+
_start: function (index) {
|
871 |
+
var coming = {},
|
872 |
+
obj,
|
873 |
+
href,
|
874 |
+
type,
|
875 |
+
margin,
|
876 |
+
padding;
|
877 |
+
|
878 |
+
index = getScalar( index );
|
879 |
+
obj = F.group[ index ] || null;
|
880 |
+
|
881 |
+
if (!obj) {
|
882 |
+
return false;
|
883 |
+
}
|
884 |
+
|
885 |
+
coming = $.extend(true, {}, F.opts, obj);
|
886 |
+
|
887 |
+
// Convert margin and padding properties to array - top, right, bottom, left
|
888 |
+
margin = coming.margin;
|
889 |
+
padding = coming.padding;
|
890 |
+
|
891 |
+
if ($.type(margin) === 'number') {
|
892 |
+
coming.margin = [margin, margin, margin, margin];
|
893 |
+
}
|
894 |
+
|
895 |
+
if ($.type(padding) === 'number') {
|
896 |
+
coming.padding = [padding, padding, padding, padding];
|
897 |
+
}
|
898 |
+
|
899 |
+
// 'modal' propery is just a shortcut
|
900 |
+
if (coming.modal) {
|
901 |
+
$.extend(true, coming, {
|
902 |
+
closeBtn : false,
|
903 |
+
closeClick : false,
|
904 |
+
nextClick : false,
|
905 |
+
zoomClick : false,
|
906 |
+
arrows : false,
|
907 |
+
mouseWheel : false,
|
908 |
+
keys : null,
|
909 |
+
helpers: {
|
910 |
+
overlay : {
|
911 |
+
closeClick : false
|
912 |
+
}
|
913 |
+
}
|
914 |
+
});
|
915 |
+
}
|
916 |
+
|
917 |
+
// 'autoSize' property is a shortcut, too
|
918 |
+
if (coming.autoSize) {
|
919 |
+
coming.autoWidth = coming.autoHeight = true;
|
920 |
+
}
|
921 |
+
|
922 |
+
if (coming.width === 'auto') {
|
923 |
+
coming.autoWidth = true;
|
924 |
+
}
|
925 |
+
|
926 |
+
if (coming.height === 'auto') {
|
927 |
+
coming.autoHeight = true;
|
928 |
+
}
|
929 |
+
|
930 |
+
/*
|
931 |
+
* Add reference to the group, so it`s possible to access from callbacks, example:
|
932 |
+
* afterLoad : function() {
|
933 |
+
* this.title = 'Image ' + (this.index + 1) + ' of ' + this.group.length + (this.title ? ' - ' + this.title : '');
|
934 |
+
* }
|
935 |
+
*/
|
936 |
+
|
937 |
+
coming.group = F.group;
|
938 |
+
coming.index = index;
|
939 |
+
|
940 |
+
// Give a chance for callback or helpers to update coming item (type, title, etc)
|
941 |
+
F.coming = coming;
|
942 |
+
|
943 |
+
if (false === F.trigger('beforeLoad')) {
|
944 |
+
F.coming = null;
|
945 |
+
|
946 |
+
return;
|
947 |
+
}
|
948 |
+
|
949 |
+
type = coming.type;
|
950 |
+
href = coming.href;
|
951 |
+
|
952 |
+
if (!type) {
|
953 |
+
F.coming = null;
|
954 |
+
|
955 |
+
//If we can not determine content type then drop silently or display next/prev item if looping through gallery
|
956 |
+
if (F.current && F.router && F.router !== 'jumpto') {
|
957 |
+
F.current.index = index;
|
958 |
+
|
959 |
+
return F[ F.router ]( F.direction );
|
960 |
+
}
|
961 |
+
|
962 |
+
return false;
|
963 |
+
}
|
964 |
+
|
965 |
+
F.isActive = true;
|
966 |
+
|
967 |
+
if (type === 'image' || type === 'svg') {
|
968 |
+
coming.autoHeight = coming.autoWidth = false;
|
969 |
+
coming.scrolling = 'visible';
|
970 |
+
coming.aspectRatio = true;
|
971 |
+
}
|
972 |
+
|
973 |
+
if (type === 'iframe' && isTouch) {
|
974 |
+
coming.scrolling = 'scroll';
|
975 |
+
}
|
976 |
+
|
977 |
+
// Build the neccessary markup
|
978 |
+
coming.wrap = $(coming.tpl.wrap).addClass('fancybox-' + (isTouch ? 'mobile' : 'desktop') + ' fancybox-type-' + type + ' fancybox-tmp ' + coming.wrapCSS).appendTo( coming.parent || 'body' );
|
979 |
+
|
980 |
+
$.extend(coming, {
|
981 |
+
skin : $('.fancybox-skin', coming.wrap),
|
982 |
+
outer : $('.fancybox-outer', coming.wrap),
|
983 |
+
inner : $('.fancybox-inner', coming.wrap)
|
984 |
+
});
|
985 |
+
|
986 |
+
$.each(["Top", "Right", "Bottom", "Left"], function(i, v) {
|
987 |
+
coming.skin.css('padding' + v, getValue(coming.padding[ i ]));
|
988 |
+
});
|
989 |
+
|
990 |
+
F.trigger('onReady');
|
991 |
+
|
992 |
+
// Check before try to load; 'inline' and 'html' types need content, others - href
|
993 |
+
if (type === 'inline' || type === 'html') {
|
994 |
+
if (!coming.content || !coming.content.length) {
|
995 |
+
return F._error( 'content' );
|
996 |
+
}
|
997 |
+
}
|
998 |
+
else if (!href) {
|
999 |
+
return F._error( 'href' );
|
1000 |
+
}
|
1001 |
+
|
1002 |
+
if (type === 'image') {
|
1003 |
+
F._loadImage();
|
1004 |
+
}
|
1005 |
+
else if (type === 'ajax') {
|
1006 |
+
F._loadAjax();
|
1007 |
+
}
|
1008 |
+
else if (type === 'iframe') {
|
1009 |
+
F._loadIframe();
|
1010 |
+
}
|
1011 |
+
else {
|
1012 |
+
F._afterLoad();
|
1013 |
+
}
|
1014 |
+
},
|
1015 |
+
|
1016 |
+
_error: function ( type ) {
|
1017 |
+
let msg = F.coming.txt.error[type] || F.coming.txt.error['content'];
|
1018 |
+
if( arguments.length > 1 ) {
|
1019 |
+
msg = msg + '<br/><br/>' + arguments[1];
|
1020 |
+
}
|
1021 |
+
$.extend(F.coming, {
|
1022 |
+
type : 'html',
|
1023 |
+
autoWidth : true,
|
1024 |
+
autoHeight : true,
|
1025 |
+
minWidth : 0,
|
1026 |
+
minHeight : 0,
|
1027 |
+
scrolling : 'no',
|
1028 |
+
content : F.coming.tpl.error.replace(/\{error\}/g, msg)
|
1029 |
+
});
|
1030 |
+
|
1031 |
+
F._afterLoad();
|
1032 |
+
},
|
1033 |
+
|
1034 |
+
_loadImage: function () {
|
1035 |
+
// Reset preload image so it is later possible to check "complete" property
|
1036 |
+
var img = F.imgPreload = new Image();
|
1037 |
+
|
1038 |
+
img.onload = function () {
|
1039 |
+
this.onload = this.onerror = null;
|
1040 |
+
|
1041 |
+
F.coming.width = this.width / F.opts.pixelRatio;
|
1042 |
+
F.coming.height = this.height / F.opts.pixelRatio;
|
1043 |
+
|
1044 |
+
F._afterLoad();
|
1045 |
+
};
|
1046 |
+
|
1047 |
+
img.onerror = function () {
|
1048 |
+
this.onload = this.onerror = null;
|
1049 |
+
|
1050 |
+
F._error( 'image' );
|
1051 |
+
};
|
1052 |
+
|
1053 |
+
img.src = F.coming.href;
|
1054 |
+
|
1055 |
+
if (img.complete !== true) {
|
1056 |
+
F.showLoading();
|
1057 |
+
}
|
1058 |
+
},
|
1059 |
+
|
1060 |
+
_loadAjax: function () {
|
1061 |
+
var coming = F.coming;
|
1062 |
+
|
1063 |
+
F.showLoading();
|
1064 |
+
|
1065 |
+
F.ajaxLoad = $.ajax($.extend({}, coming.ajax, {
|
1066 |
+
url: coming.href,
|
1067 |
+
error: function (jqXHR, textStatus) {
|
1068 |
+
if (F.coming && textStatus !== 'abort') {
|
1069 |
+
F._error( 'ajax', jqXHR );
|
1070 |
+
}
|
1071 |
+
else {
|
1072 |
+
F.hideLoading();
|
1073 |
+
}
|
1074 |
+
},
|
1075 |
+
success: function (data, textStatus) {
|
1076 |
+
if (textStatus === 'success') {
|
1077 |
+
coming.content = data;
|
1078 |
+
|
1079 |
+
F._afterLoad();
|
1080 |
+
}
|
1081 |
+
}
|
1082 |
+
}));
|
1083 |
+
},
|
1084 |
+
|
1085 |
+
_loadIframe: function() {
|
1086 |
+
var coming = F.coming,
|
1087 |
+
iframe = $(coming.tpl.iframe.replace(/\{rnd\}/g, new Date().getTime()))
|
1088 |
+
.attr({
|
1089 |
+
'scrolling' : (isTouch ? 'auto' : coming.iframe.scrolling),
|
1090 |
+
'src' : coming.href,
|
1091 |
+
'webkitallowfullscreen' : coming.iframe.allowfullscreen,
|
1092 |
+
'mozallowfullscreen' : coming.iframe.allowfullscreen,
|
1093 |
+
'allowfullscreen' : coming.iframe.allowfullscreen
|
1094 |
+
});
|
1095 |
+
|
1096 |
+
// This helps IE
|
1097 |
+
$(coming.wrap).on('onReset', function () {
|
1098 |
+
try {
|
1099 |
+
$(this).find('iframe').hide().attr('src', '//about:blank').end().empty();
|
1100 |
+
} catch (e) {}
|
1101 |
+
});
|
1102 |
+
|
1103 |
+
if (coming.iframe.preload) {
|
1104 |
+
F.showLoading();
|
1105 |
+
|
1106 |
+
iframe.one('load', function() {
|
1107 |
+
$(this).data('ready', 1);
|
1108 |
+
|
1109 |
+
// iOS will lose scrolling if we resize
|
1110 |
+
if (!isTouch) {
|
1111 |
+
$(this).on('load.fb', F.update);
|
1112 |
+
}
|
1113 |
+
|
1114 |
+
// Without this trick:
|
1115 |
+
// - iframe won't scroll on iOS devices
|
1116 |
+
// - IE7 sometimes displays empty iframe
|
1117 |
+
$(this).parents('.fancybox-wrap').width('100%').removeClass('fancybox-tmp').show();
|
1118 |
+
|
1119 |
+
F._afterLoad();
|
1120 |
+
});
|
1121 |
+
}
|
1122 |
+
|
1123 |
+
coming.content = iframe.appendTo( coming.inner );
|
1124 |
+
|
1125 |
+
if (!coming.iframe.preload) {
|
1126 |
+
F._afterLoad();
|
1127 |
+
}
|
1128 |
+
},
|
1129 |
+
|
1130 |
+
_preloadImages: function() {
|
1131 |
+
var group = F.group,
|
1132 |
+
current = F.current,
|
1133 |
+
len = group.length,
|
1134 |
+
cnt = current.preload ? Math.min(current.preload, len - 1) : 0,
|
1135 |
+
item,
|
1136 |
+
i;
|
1137 |
+
|
1138 |
+
for (i = 1; i <= cnt; i += 1) {
|
1139 |
+
item = group[ (current.index + i ) % len ];
|
1140 |
+
|
1141 |
+
if (item.type === 'image' && item.href) {
|
1142 |
+
new Image().src = item.href;
|
1143 |
+
}
|
1144 |
+
}
|
1145 |
+
},
|
1146 |
+
|
1147 |
+
_afterLoad: function () {
|
1148 |
+
var coming = F.coming,
|
1149 |
+
previous = F.current,
|
1150 |
+
placeholder = 'fancybox-placeholder',
|
1151 |
+
current,
|
1152 |
+
content,
|
1153 |
+
type,
|
1154 |
+
scrolling,
|
1155 |
+
href,
|
1156 |
+
embed;
|
1157 |
+
|
1158 |
+
F.hideLoading();
|
1159 |
+
|
1160 |
+
if (!coming || F.isActive === false) {
|
1161 |
+
return;
|
1162 |
+
}
|
1163 |
+
|
1164 |
+
if (false === F.trigger('afterLoad', coming, previous)) {
|
1165 |
+
coming.wrap.stop(true).trigger('onReset').remove();
|
1166 |
+
|
1167 |
+
F.coming = null;
|
1168 |
+
|
1169 |
+
return;
|
1170 |
+
}
|
1171 |
+
|
1172 |
+
if (previous) {
|
1173 |
+
F.trigger('beforeChange', previous);
|
1174 |
+
|
1175 |
+
previous.wrap.stop(true).removeClass('fancybox-opened')
|
1176 |
+
.find('.fancybox-item, .fancybox-nav')
|
1177 |
+
.remove();
|
1178 |
+
}
|
1179 |
+
|
1180 |
+
F.unbindEvents();
|
1181 |
+
|
1182 |
+
current = coming;
|
1183 |
+
content = coming.content;
|
1184 |
+
type = coming.type;
|
1185 |
+
scrolling = coming.scrolling;
|
1186 |
+
|
1187 |
+
$.extend(F, {
|
1188 |
+
wrap : current.wrap,
|
1189 |
+
skin : current.skin,
|
1190 |
+
outer : current.outer,
|
1191 |
+
inner : current.inner,
|
1192 |
+
current : current,
|
1193 |
+
previous : previous
|
1194 |
+
});
|
1195 |
+
|
1196 |
+
href = current.href;
|
1197 |
+
|
1198 |
+
switch (type) {
|
1199 |
+
case 'image':
|
1200 |
+
content = current.tpl.image.replace(/\{href\}/g, href);
|
1201 |
+
break;
|
1202 |
+
|
1203 |
+
case 'svg':
|
1204 |
+
content = '<object type="image/svg+xml" width="100%" height="100%" data="' + href + '"></object>';
|
1205 |
+
break;
|
1206 |
+
|
1207 |
+
case 'inline':
|
1208 |
+
case 'ajax':
|
1209 |
+
case 'html':
|
1210 |
+
if (current.selector) {
|
1211 |
+
content = $('<div>').html(content).find(current.selector);
|
1212 |
+
}
|
1213 |
+
else if (isQuery(content)) {
|
1214 |
+
if (!content.data(placeholder)) {
|
1215 |
+
content.data(placeholder, content.clone().removeAttr('id').addClass(placeholder).insertAfter( content ) );
|
1216 |
+
}
|
1217 |
+
|
1218 |
+
content = content.detach();
|
1219 |
+
|
1220 |
+
current.wrap.on('onReset', function () {
|
1221 |
+
if ($(this).find(content).length) {
|
1222 |
+
content.replaceAll( content.data(placeholder) ).data(placeholder, false);
|
1223 |
+
}
|
1224 |
+
});
|
1225 |
+
}
|
1226 |
+
break;
|
1227 |
+
}
|
1228 |
+
|
1229 |
+
if (!(isQuery(content) && content.parent().is(current.inner))) {
|
1230 |
+
current.inner.append( content );
|
1231 |
+
}
|
1232 |
+
|
1233 |
+
// Give a chance for helpers or callbacks to update elements
|
1234 |
+
F.trigger('beforeShow');
|
1235 |
+
|
1236 |
+
// Set scrolling before calculating dimensions
|
1237 |
+
current.inner.css('overflow', scrolling === 'yes' ? 'scroll' : (scrolling === 'no' ? 'hidden' : scrolling));
|
1238 |
+
|
1239 |
+
// Set initial dimensions and start position
|
1240 |
+
F._setDimension();
|
1241 |
+
|
1242 |
+
F.reposition();
|
1243 |
+
|
1244 |
+
F.isOpen = false;
|
1245 |
+
F.coming = null;
|
1246 |
+
|
1247 |
+
F.bindEvents();
|
1248 |
+
|
1249 |
+
if (!F.isOpened) {
|
1250 |
+
$('.fancybox-wrap').not( current.wrap ).stop(true).trigger('onReset').remove();
|
1251 |
+
}
|
1252 |
+
else if (previous.prevMethod) {
|
1253 |
+
F.transitions[ previous.prevMethod ]();
|
1254 |
+
}
|
1255 |
+
|
1256 |
+
F.transitions[ F.isOpened ? current.nextMethod : current.openMethod ]();
|
1257 |
+
|
1258 |
+
F._preloadImages();
|
1259 |
+
},
|
1260 |
+
|
1261 |
+
_setDimension: function () {
|
1262 |
+
var viewport = F.getViewport(),
|
1263 |
+
steps = 0,
|
1264 |
+
canShrink = false,
|
1265 |
+
canExpand = false,
|
1266 |
+
wrap = F.wrap,
|
1267 |
+
skin = F.skin,
|
1268 |
+
inner = F.inner,
|
1269 |
+
current = F.current,
|
1270 |
+
width = current.width,
|
1271 |
+
height = current.height,
|
1272 |
+
minWidth = current.minWidth,
|
1273 |
+
minHeight = current.minHeight,
|
1274 |
+
maxWidth = current.maxWidth,
|
1275 |
+
maxHeight = current.maxHeight,
|
1276 |
+
scrolling = current.scrolling,
|
1277 |
+
scrollOut = current.scrollOutside ? current.scrollbarWidth : 0,
|
1278 |
+
margin = current.margin,
|
1279 |
+
wMargin = getScalar(margin[1] + margin[3]),
|
1280 |
+
hMargin = getScalar(margin[0] + margin[2]),
|
1281 |
+
wPadding,
|
1282 |
+
hPadding,
|
1283 |
+
wSpace,
|
1284 |
+
hSpace,
|
1285 |
+
origWidth,
|
1286 |
+
origHeight,
|
1287 |
+
origMaxWidth,
|
1288 |
+
origMaxHeight,
|
1289 |
+
ratio,
|
1290 |
+
width_,
|
1291 |
+
height_,
|
1292 |
+
maxWidth_,
|
1293 |
+
maxHeight_,
|
1294 |
+
iframe,
|
1295 |
+
body;
|
1296 |
+
|
1297 |
+
// Reset dimensions so we could re-check actual size
|
1298 |
+
wrap.add(skin).add(inner).width('auto').height('auto').removeClass('fancybox-tmp');
|
1299 |
+
|
1300 |
+
wPadding = getScalar(skin.outerWidth(true) - skin.width());
|
1301 |
+
hPadding = getScalar(skin.outerHeight(true) - skin.height());
|
1302 |
+
|
1303 |
+
// Any space between content and viewport (margin, padding, border, title)
|
1304 |
+
wSpace = wMargin + wPadding;
|
1305 |
+
hSpace = hMargin + hPadding;
|
1306 |
+
|
1307 |
+
origWidth = isPercentage(width) ? (viewport.w - wSpace) * getScalar(width) / 100 : width;
|
1308 |
+
origHeight = isPercentage(height) ? (viewport.h - hSpace) * getScalar(height) / 100 : height;
|
1309 |
+
|
1310 |
+
if (current.type === 'iframe') {
|
1311 |
+
iframe = current.content;
|
1312 |
+
|
1313 |
+
if (current.autoHeight && iframe && iframe.data('ready') === 1) {
|
1314 |
+
try {
|
1315 |
+
if (iframe[0].contentWindow.document.location) {
|
1316 |
+
inner.width( origWidth ).height(9999);
|
1317 |
+
|
1318 |
+
body = iframe.contents().find('body');
|
1319 |
+
|
1320 |
+
if (scrollOut) {
|
1321 |
+
body.css('overflow-x', 'hidden');
|
1322 |
+
}
|
1323 |
+
|
1324 |
+
origHeight = body.outerHeight(true);
|
1325 |
+
}
|
1326 |
+
|
1327 |
+
} catch (e) {}
|
1328 |
+
}
|
1329 |
+
}
|
1330 |
+
else if (current.autoWidth || current.autoHeight) {
|
1331 |
+
inner.addClass( 'fancybox-tmp' );
|
1332 |
+
|
1333 |
+
// Set width or height in case we need to calculate only one dimension
|
1334 |
+
if (!current.autoWidth) {
|
1335 |
+
inner.width( origWidth );
|
1336 |
+
}
|
1337 |
+
|
1338 |
+
if (!current.autoHeight) {
|
1339 |
+
inner.height( origHeight );
|
1340 |
+
}
|
1341 |
+
|
1342 |
+
if (current.autoWidth) {
|
1343 |
+
origWidth = inner.width();
|
1344 |
+
}
|
1345 |
+
|
1346 |
+
if (current.autoHeight) {
|
1347 |
+
origHeight = inner.height();
|
1348 |
+
}
|
1349 |
+
|
1350 |
+
inner.removeClass( 'fancybox-tmp' );
|
1351 |
+
}
|
1352 |
+
|
1353 |
+
width = getScalar( origWidth );
|
1354 |
+
height = getScalar( origHeight );
|
1355 |
+
|
1356 |
+
ratio = origWidth / origHeight;
|
1357 |
+
|
1358 |
+
// Calculations for the content
|
1359 |
+
minWidth = getScalar(isPercentage(minWidth) ? getScalar(minWidth, 'w') - wSpace : minWidth);
|
1360 |
+
maxWidth = getScalar(isPercentage(maxWidth) ? getScalar(maxWidth, 'w') - wSpace : maxWidth);
|
1361 |
+
|
1362 |
+
minHeight = getScalar(isPercentage(minHeight) ? getScalar(minHeight, 'h') - hSpace : minHeight);
|
1363 |
+
maxHeight = getScalar(isPercentage(maxHeight) ? getScalar(maxHeight, 'h') - hSpace : maxHeight);
|
1364 |
+
|
1365 |
+
// These will be used to determine if wrap can fit in the viewport
|
1366 |
+
origMaxWidth = maxWidth;
|
1367 |
+
origMaxHeight = maxHeight;
|
1368 |
+
|
1369 |
+
if (current.fitToView) {
|
1370 |
+
maxWidth = Math.min(viewport.w - wSpace, maxWidth);
|
1371 |
+
maxHeight = Math.min(viewport.h - hSpace, maxHeight);
|
1372 |
+
}
|
1373 |
+
|
1374 |
+
maxWidth_ = viewport.w - wMargin;
|
1375 |
+
maxHeight_ = viewport.h - hMargin;
|
1376 |
+
|
1377 |
+
if (current.aspectRatio) {
|
1378 |
+
if (width > maxWidth) {
|
1379 |
+
width = maxWidth;
|
1380 |
+
height = getScalar(width / ratio);
|
1381 |
+
}
|
1382 |
+
|
1383 |
+
if (height > maxHeight) {
|
1384 |
+
height = maxHeight;
|
1385 |
+
width = getScalar(height * ratio);
|
1386 |
+
}
|
1387 |
+
|
1388 |
+
if (width < minWidth) {
|
1389 |
+
width = minWidth;
|
1390 |
+
height = getScalar(width / ratio);
|
1391 |
+
}
|
1392 |
+
|
1393 |
+
if (height < minHeight) {
|
1394 |
+
height = minHeight;
|
1395 |
+
width = getScalar(height * ratio);
|
1396 |
+
}
|
1397 |
+
}
|
1398 |
+
else {
|
1399 |
+
width = Math.max(minWidth, Math.min(width, maxWidth));
|
1400 |
+
|
1401 |
+
if (current.autoHeight && current.type !== 'iframe') {
|
1402 |
+
inner.width( width );
|
1403 |
+
|
1404 |
+
height = inner.height();
|
1405 |
+
}
|
1406 |
+
|
1407 |
+
height = Math.max(minHeight, Math.min(height, maxHeight));
|
1408 |
+
}
|
1409 |
+
|
1410 |
+
// Try to fit inside viewport (including the title)
|
1411 |
+
if (current.fitToView) {
|
1412 |
+
inner.width( width ).height( height );
|
1413 |
+
|
1414 |
+
wrap.width( width + wPadding );
|
1415 |
+
|
1416 |
+
// Real wrap dimensions
|
1417 |
+
width_ = wrap.width();
|
1418 |
+
height_ = wrap.height();
|
1419 |
+
|
1420 |
+
if (current.aspectRatio) {
|
1421 |
+
while ((width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight) {
|
1422 |
+
if (steps++ > 19) {
|
1423 |
+
break;
|
1424 |
+
}
|
1425 |
+
|
1426 |
+
height = Math.max(minHeight, Math.min(maxHeight, height - 10));
|
1427 |
+
width = getScalar(height * ratio);
|
1428 |
+
|
1429 |
+
if (width < minWidth) {
|
1430 |
+
width = minWidth;
|
1431 |
+
height = getScalar(width / ratio);
|
1432 |
+
}
|
1433 |
+
|
1434 |
+
if (width > maxWidth) {
|
1435 |
+
width = maxWidth;
|
1436 |
+
height = getScalar(width / ratio);
|
1437 |
+
}
|
1438 |
+
|
1439 |
+
inner.width( width ).height( height );
|
1440 |
+
|
1441 |
+
wrap.width( width + wPadding );
|
1442 |
+
|
1443 |
+
width_ = wrap.width();
|
1444 |
+
height_ = wrap.height();
|
1445 |
+
}
|
1446 |
+
}
|
1447 |
+
else {
|
1448 |
+
width = Math.max(minWidth, Math.min(width, width - (width_ - maxWidth_)));
|
1449 |
+
height = Math.max(minHeight, Math.min(height, height - (height_ - maxHeight_)));
|
1450 |
+
}
|
1451 |
+
}
|
1452 |
+
|
1453 |
+
if (scrollOut && scrolling === 'auto' && height < origHeight && (width + wPadding + scrollOut) < maxWidth_) {
|
1454 |
+
width += scrollOut;
|
1455 |
+
}
|
1456 |
+
|
1457 |
+
inner.width( width ).height( height );
|
1458 |
+
|
1459 |
+
wrap.width( width + wPadding );
|
1460 |
+
|
1461 |
+
width_ = wrap.width();
|
1462 |
+
height_ = wrap.height();
|
1463 |
+
|
1464 |
+
canShrink = (width_ > maxWidth_ || height_ > maxHeight_) && width > minWidth && height > minHeight;
|
1465 |
+
canExpand = current.aspectRatio ? (width < origMaxWidth && height < origMaxHeight && width < origWidth && height < origHeight) : ((width < origMaxWidth || height < origMaxHeight) && (width < origWidth || height < origHeight));
|
1466 |
+
|
1467 |
+
$.extend(current, {
|
1468 |
+
dim : {
|
1469 |
+
width : getValue( width_ ),
|
1470 |
+
height : getValue( height_ )
|
1471 |
+
},
|
1472 |
+
origWidth : origWidth,
|
1473 |
+
origHeight : origHeight,
|
1474 |
+
canShrink : canShrink,
|
1475 |
+
canExpand : canExpand,
|
1476 |
+
wPadding : wPadding,
|
1477 |
+
hPadding : hPadding,
|
1478 |
+
wrapSpace : height_ - skin.outerHeight(true),
|
1479 |
+
skinSpace : skin.height() - height
|
1480 |
+
});
|
1481 |
+
|
1482 |
+
if (!iframe && current.autoHeight && height > minHeight && height < maxHeight && !canExpand) {
|
1483 |
+
inner.height('auto');
|
1484 |
+
}
|
1485 |
+
},
|
1486 |
+
|
1487 |
+
_getPosition: function (onlyAbsolute) {
|
1488 |
+
var current = F.current,
|
1489 |
+
viewport = F.getViewport(),
|
1490 |
+
margin = current.margin,
|
1491 |
+
width = F.wrap.width() + margin[1] + margin[3],
|
1492 |
+
height = F.wrap.height() + margin[0] + margin[2],
|
1493 |
+
rez = {
|
1494 |
+
position: 'absolute',
|
1495 |
+
top : margin[0],
|
1496 |
+
left : margin[3]
|
1497 |
+
};
|
1498 |
+
|
1499 |
+
if (current.autoCenter && current.fixed && !onlyAbsolute && height <= viewport.h && width <= viewport.w) {
|
1500 |
+
rez.position = 'fixed';
|
1501 |
+
}
|
1502 |
+
else if (!current.locked) {
|
1503 |
+
rez.top += viewport.y;
|
1504 |
+
rez.left += viewport.x;
|
1505 |
+
}
|
1506 |
+
|
1507 |
+
rez.top = getValue(Math.max(rez.top, rez.top + ((viewport.h - height) * current.topRatio)));
|
1508 |
+
rez.left = getValue(Math.max(rez.left, rez.left + ((viewport.w - width) * current.leftRatio)));
|
1509 |
+
|
1510 |
+
return rez;
|
1511 |
+
},
|
1512 |
+
|
1513 |
+
_afterZoomIn: function () {
|
1514 |
+
var current = F.current;
|
1515 |
+
|
1516 |
+
if (!current) {
|
1517 |
+
return;
|
1518 |
+
}
|
1519 |
+
|
1520 |
+
F.isOpen = F.isOpened = true;
|
1521 |
+
|
1522 |
+
F.wrap.css('overflow', 'visible').addClass('fancybox-opened').hide().show(0);
|
1523 |
+
|
1524 |
+
F.update();
|
1525 |
+
|
1526 |
+
// Assign a click event
|
1527 |
+
if ( current.zoomClick || current.closeClick || (current.nextClick && F.group.length > 1) ) {
|
1528 |
+
F.inner.css('cursor', !current.zoomClick ? 'pointer' : (current.canExpand ? 'zoom-in' : 'zoom-out')).on('click.fb', function(e) {
|
1529 |
+
if (!$(e.target).is('a') && !$(e.target).parent().is('a')) {
|
1530 |
+
e.preventDefault();
|
1531 |
+
|
1532 |
+
F[ current.zoomClick && (current.canExpand || current.canShrink) ? 'toggle' : ( current.closeClick ? 'close' : 'next' ) ]();
|
1533 |
+
}
|
1534 |
+
});
|
1535 |
+
}
|
1536 |
+
|
1537 |
+
// Create a close button
|
1538 |
+
if (current.closeBtn) {
|
1539 |
+
$(current.tpl.close.replace(/\{close\}/g, current.txt.close)).appendTo(F.skin).on('click.fb', function(e) {
|
1540 |
+
e.preventDefault();
|
1541 |
+
|
1542 |
+
F.close();
|
1543 |
+
});
|
1544 |
+
}
|
1545 |
+
|
1546 |
+
// Create navigation arrows
|
1547 |
+
if (current.arrows && F.group.length > 1) {
|
1548 |
+
if (current.loop || current.index > 0) {
|
1549 |
+
$(current.tpl.prev.replace(/\{prev\}/g, current.txt.prev)).appendTo(F.outer).on('click.fb', F.prev);
|
1550 |
+
}
|
1551 |
+
|
1552 |
+
if (current.loop || current.index < F.group.length - 1) {
|
1553 |
+
$(current.tpl.next.replace(/\{next\}/g, current.txt.next)).appendTo(F.outer).on('click.fb', F.next);
|
1554 |
+
}
|
1555 |
+
}
|
1556 |
+
|
1557 |
+
F.trigger('afterShow');
|
1558 |
+
|
1559 |
+
// Stop the slideshow if this is the last item
|
1560 |
+
if (!current.loop && current.index === current.group.length - 1) {
|
1561 |
+
|
1562 |
+
F.play( false );
|
1563 |
+
}
|
1564 |
+
else if (F.opts.autoPlay && !F.player.isActive) {
|
1565 |
+
F.opts.autoPlay = false;
|
1566 |
+
|
1567 |
+
F.play(true);
|
1568 |
+
}
|
1569 |
+
},
|
1570 |
+
|
1571 |
+
_afterZoomOut: function ( obj ) {
|
1572 |
+
obj = obj || F.current;
|
1573 |
+
|
1574 |
+
$('.fancybox-wrap').trigger('onReset').remove();
|
1575 |
+
|
1576 |
+
$.extend(F, {
|
1577 |
+
group : {},
|
1578 |
+
opts : {},
|
1579 |
+
router : false,
|
1580 |
+
current : null,
|
1581 |
+
isActive : false,
|
1582 |
+
isOpened : false,
|
1583 |
+
isOpen : false,
|
1584 |
+
isClosing : false,
|
1585 |
+
wrap : null,
|
1586 |
+
skin : null,
|
1587 |
+
outer : null,
|
1588 |
+
inner : null
|
1589 |
+
});
|
1590 |
+
|
1591 |
+
F.trigger('afterClose', obj);
|
1592 |
+
}
|
1593 |
+
});
|
1594 |
+
|
1595 |
+
/*
|
1596 |
+
* Default transitions
|
1597 |
+
*/
|
1598 |
+
|
1599 |
+
F.transitions = {
|
1600 |
+
getOrigPosition: function () {
|
1601 |
+
var current = F.current,
|
1602 |
+
element = current.element,
|
1603 |
+
orig = current.orig,
|
1604 |
+
pos = {},
|
1605 |
+
width = 50,
|
1606 |
+
height = 50,
|
1607 |
+
hPadding = current.hPadding,
|
1608 |
+
wPadding = current.wPadding,
|
1609 |
+
viewport = F.getViewport();
|
1610 |
+
|
1611 |
+
if (!orig && current.isDom && element.is(':visible')) {
|
1612 |
+
orig = element.find('img:first');
|
1613 |
+
|
1614 |
+
if (!orig.length) {
|
1615 |
+
orig = element;
|
1616 |
+
}
|
1617 |
+
}
|
1618 |
+
|
1619 |
+
if (isQuery(orig)) {
|
1620 |
+
pos = orig.offset();
|
1621 |
+
|
1622 |
+
if (orig.is('img')) {
|
1623 |
+
width = orig.outerWidth();
|
1624 |
+
height = orig.outerHeight();
|
1625 |
+
}
|
1626 |
+
}
|
1627 |
+
else {
|
1628 |
+
pos.top = viewport.y + (viewport.h - height) * current.topRatio;
|
1629 |
+
pos.left = viewport.x + (viewport.w - width) * current.leftRatio;
|
1630 |
+
}
|
1631 |
+
|
1632 |
+
if (F.wrap.css('position') === 'fixed' || current.locked) {
|
1633 |
+
pos.top -= viewport.y;
|
1634 |
+
pos.left -= viewport.x;
|
1635 |
+
}
|
1636 |
+
|
1637 |
+
pos = {
|
1638 |
+
top : getValue(pos.top - hPadding * current.topRatio),
|
1639 |
+
left : getValue(pos.left - wPadding * current.leftRatio),
|
1640 |
+
width : getValue(width + wPadding),
|
1641 |
+
height : getValue(height + hPadding)
|
1642 |
+
};
|
1643 |
+
|
1644 |
+
return pos;
|
1645 |
+
},
|
1646 |
+
|
1647 |
+
step: function (now, fx) {
|
1648 |
+
var ratio,
|
1649 |
+
padding,
|
1650 |
+
value,
|
1651 |
+
prop = fx.prop,
|
1652 |
+
current = F.current,
|
1653 |
+
wrapSpace = current.wrapSpace,
|
1654 |
+
skinSpace = current.skinSpace;
|
1655 |
+
|
1656 |
+
if (prop === 'width' || prop === 'height') {
|
1657 |
+
ratio = fx.end === fx.start ? 1 : (now - fx.start) / (fx.end - fx.start);
|
1658 |
+
|
1659 |
+
if (F.isClosing) {
|
1660 |
+
ratio = 1 - ratio;
|
1661 |
+
}
|
1662 |
+
|
1663 |
+
padding = prop === 'width' ? current.wPadding : current.hPadding;
|
1664 |
+
value = now - padding;
|
1665 |
+
|
1666 |
+
F.skin[ prop ]( getScalar( prop === 'width' ? value : value - (wrapSpace * ratio) ) );
|
1667 |
+
F.inner[ prop ]( getScalar( prop === 'width' ? value : value - (wrapSpace * ratio) - (skinSpace * ratio) ) );
|
1668 |
+
}
|
1669 |
+
},
|
1670 |
+
|
1671 |
+
zoomIn: function () {
|
1672 |
+
var current = F.current,
|
1673 |
+
startPos = current.pos,
|
1674 |
+
effect = current.openEffect,
|
1675 |
+
elastic = effect === 'elastic',
|
1676 |
+
endPos = $.extend({opacity : 1}, startPos);
|
1677 |
+
|
1678 |
+
// Remove "position" property that breaks older IE
|
1679 |
+
delete endPos.position;
|
1680 |
+
|
1681 |
+
if (elastic) {
|
1682 |
+
startPos = this.getOrigPosition();
|
1683 |
+
|
1684 |
+
if (current.openOpacity) {
|
1685 |
+
startPos.opacity = 0.1;
|
1686 |
+
}
|
1687 |
+
}
|
1688 |
+
else if (effect === 'fade') {
|
1689 |
+
startPos.opacity = 0.1;
|
1690 |
+
}
|
1691 |
+
|
1692 |
+
F.wrap.css(startPos).animate(endPos, {
|
1693 |
+
duration : effect === 'none' ? 0 : current.openSpeed,
|
1694 |
+
easing : current.openEasing,
|
1695 |
+
step : elastic ? this.step : null,
|
1696 |
+
complete : F._afterZoomIn
|
1697 |
+
});
|
1698 |
+
},
|
1699 |
+
|
1700 |
+
zoomOut: function () {
|
1701 |
+
var current = F.current,
|
1702 |
+
effect = current.closeEffect,
|
1703 |
+
elastic = effect === 'elastic',
|
1704 |
+
endPos = {opacity : 0.1};
|
1705 |
+
|
1706 |
+
if (elastic) {
|
1707 |
+
endPos = this.getOrigPosition();
|
1708 |
+
|
1709 |
+
if (current.closeOpacity) {
|
1710 |
+
endPos.opacity = 0.1;
|
1711 |
+
}
|
1712 |
+
}
|
1713 |
+
|
1714 |
+
F.wrap.animate(endPos, {
|
1715 |
+
duration : effect === 'none' ? 0 : current.closeSpeed,
|
1716 |
+
easing : current.closeEasing,
|
1717 |
+
step : elastic ? this.step : null,
|
1718 |
+
complete : F._afterZoomOut
|
1719 |
+
});
|
1720 |
+
},
|
1721 |
+
|
1722 |
+
changeIn: function () {
|
1723 |
+
var current = F.current,
|
1724 |
+
effect = current.nextEffect,
|
1725 |
+
startPos = current.pos,
|
1726 |
+
endPos = { opacity : 1 },
|
1727 |
+
direction = F.direction,
|
1728 |
+
distance = 200,
|
1729 |
+
field;
|
1730 |
+
|
1731 |
+
startPos.opacity = 0.1;
|
1732 |
+
|
1733 |
+
if (effect === 'elastic') {
|
1734 |
+
field = direction === 'down' || direction === 'up' ? 'top' : 'left';
|
1735 |
+
|
1736 |
+
if (direction === 'down' || direction === 'right') {
|
1737 |
+
startPos[ field ] = getValue(getScalar(startPos[ field ]) - distance);
|
1738 |
+
endPos[ field ] = '+=' + distance + 'px';
|
1739 |
+
}
|
1740 |
+
else {
|
1741 |
+
startPos[ field ] = getValue(getScalar(startPos[ field ]) + distance);
|
1742 |
+
endPos[ field ] = '-=' + distance + 'px';
|
1743 |
+
}
|
1744 |
+
}
|
1745 |
+
|
1746 |
+
// Workaround for http://bugs.jquery.com/ticket/12273
|
1747 |
+
if (effect === 'none') {
|
1748 |
+
F._afterZoomIn();
|
1749 |
+
}
|
1750 |
+
else {
|
1751 |
+
F.wrap.css(startPos).animate(endPos, {
|
1752 |
+
duration : current.nextSpeed,
|
1753 |
+
easing : current.nextEasing,
|
1754 |
+
complete : F._afterZoomIn
|
1755 |
+
});
|
1756 |
+
}
|
1757 |
+
},
|
1758 |
+
|
1759 |
+
changeOut: function () {
|
1760 |
+
var previous = F.previous,
|
1761 |
+
effect = previous.prevEffect,
|
1762 |
+
endPos = { opacity : 0.1 },
|
1763 |
+
direction = F.direction,
|
1764 |
+
distance = 200;
|
1765 |
+
|
1766 |
+
if (effect === 'elastic') {
|
1767 |
+
endPos[ direction === 'down' || direction === 'up' ? 'top' : 'left' ] = ( direction === 'up' || direction === 'left' ? '-' : '+' ) + '=' + distance + 'px';
|
1768 |
+
}
|
1769 |
+
|
1770 |
+
previous.wrap.animate(endPos, {
|
1771 |
+
duration : effect === 'none' ? 0 : previous.prevSpeed,
|
1772 |
+
easing : previous.prevEasing,
|
1773 |
+
complete : function () {
|
1774 |
+
$(this).trigger('onReset').remove();
|
1775 |
+
}
|
1776 |
+
});
|
1777 |
+
}
|
1778 |
+
};
|
1779 |
+
|
1780 |
+
/*
|
1781 |
+
* Overlay helper
|
1782 |
+
*/
|
1783 |
+
|
1784 |
+
F.helpers.overlay = {
|
1785 |
+
defaults : {
|
1786 |
+
closeClick : true, // if true, fancyBox will be closed when user clicks on the overlay
|
1787 |
+
speedOut : 200, // duration of fadeOut animation
|
1788 |
+
showEarly : true, // indicates if should be opened immediately or wait until the content is ready
|
1789 |
+
css : {}, // custom CSS properties
|
1790 |
+
locked : !isTouch, // if true, the content will be locked into overlay
|
1791 |
+
fixed : true // if false, the overlay CSS position property will not be set to "fixed"
|
1792 |
+
},
|
1793 |
+
|
1794 |
+
overlay : null, // current handle
|
1795 |
+
fixed : false, // indicates if the overlay has position "fixed"
|
1796 |
+
el : $('html'), // element that contains "the lock"
|
1797 |
+
|
1798 |
+
// Public methods
|
1799 |
+
create : function(opts) {
|
1800 |
+
var parent;
|
1801 |
+
|
1802 |
+
opts = $.extend({}, this.defaults, opts);
|
1803 |
+
|
1804 |
+
if (this.overlay) {
|
1805 |
+
this.close();
|
1806 |
+
}
|
1807 |
+
|
1808 |
+
parent = F.coming ? F.coming.parent : opts.parent;
|
1809 |
+
|
1810 |
+
this.overlay = $('<div class="fancybox-overlay"></div>').appendTo( parent && parent.length ? parent : 'body' );
|
1811 |
+
this.fixed = false;
|
1812 |
+
|
1813 |
+
if (opts.fixed && F.defaults.fixed) {
|
1814 |
+
this.overlay.addClass('fancybox-overlay-fixed');
|
1815 |
+
|
1816 |
+
this.fixed = true;
|
1817 |
+
}
|
1818 |
+
},
|
1819 |
+
|
1820 |
+
open : function(opts) {
|
1821 |
+
var that = this;
|
1822 |
+
|
1823 |
+
opts = $.extend({}, this.defaults, opts);
|
1824 |
+
|
1825 |
+
if (this.overlay) {
|
1826 |
+
this.overlay.off('.overlay').width('auto').height('auto');
|
1827 |
+
}
|
1828 |
+
else {
|
1829 |
+
this.create(opts);
|
1830 |
+
}
|
1831 |
+
|
1832 |
+
if (!this.fixed) {
|
1833 |
+
W.on('resize.overlay', $.proxy( this.update, this) );
|
1834 |
+
|
1835 |
+
this.update();
|
1836 |
+
}
|
1837 |
+
|
1838 |
+
if (opts.closeClick) {
|
1839 |
+
this.overlay.on('click.overlay', function(e) {
|
1840 |
+
if ($(e.target).hasClass('fancybox-overlay')) {
|
1841 |
+
if (F.isActive) {
|
1842 |
+
F.close();
|
1843 |
+
}
|
1844 |
+
else {
|
1845 |
+
that.close();
|
1846 |
+
}
|
1847 |
+
return false;
|
1848 |
+
}
|
1849 |
+
});
|
1850 |
+
}
|
1851 |
+
|
1852 |
+
this.overlay.css( opts.css ).show();
|
1853 |
+
},
|
1854 |
+
|
1855 |
+
close : function() {
|
1856 |
+
W.off('resize.overlay');
|
1857 |
+
|
1858 |
+
if (this.el.hasClass('fancybox-lock')) {
|
1859 |
+
$('.fancybox-margin').removeClass('fancybox-margin');
|
1860 |
+
|
1861 |
+
this.el.removeClass('fancybox-lock');
|
1862 |
+
|
1863 |
+
W.scrollTop( this.scrollV ).scrollLeft( this.scrollH );
|
1864 |
+
}
|
1865 |
+
|
1866 |
+
$('.fancybox-overlay').remove().hide();
|
1867 |
+
|
1868 |
+
$.extend(this, {
|
1869 |
+
overlay : null,
|
1870 |
+
fixed : false
|
1871 |
+
});
|
1872 |
+
},
|
1873 |
+
|
1874 |
+
// Private, callbacks
|
1875 |
+
|
1876 |
+
update : function () {
|
1877 |
+
var width = '100%', offsetWidth;
|
1878 |
+
|
1879 |
+
// Reset width/height so it will not mess
|
1880 |
+
this.overlay.width(width).height('100%');
|
1881 |
+
|
1882 |
+
// jQuery does not return reliable result for IE
|
1883 |
+
if (IE) {
|
1884 |
+
offsetWidth = Math.max(document.documentElement.offsetWidth, document.body.offsetWidth);
|
1885 |
+
|
1886 |
+
if (D.width() > offsetWidth) {
|
1887 |
+
width = D.width();
|
1888 |
+
}
|
1889 |
+
}
|
1890 |
+
else if (D.width() > W.width()) {
|
1891 |
+
width = D.width();
|
1892 |
+
}
|
1893 |
+
|
1894 |
+
this.overlay.width(width).height(D.height());
|
1895 |
+
},
|
1896 |
+
|
1897 |
+
// This is where we can manipulate DOM, because later it would cause iframes to reload
|
1898 |
+
onReady : function (opts, obj) {
|
1899 |
+
var overlay = this.overlay;
|
1900 |
+
|
1901 |
+
$('.fancybox-overlay').stop(true, true);
|
1902 |
+
|
1903 |
+
if (!overlay) {
|
1904 |
+
this.create(opts);
|
1905 |
+
}
|
1906 |
+
|
1907 |
+
if (opts.locked && this.fixed && obj.fixed) {
|
1908 |
+
obj.locked = this.overlay.append( obj.wrap );
|
1909 |
+
obj.fixed = false;
|
1910 |
+
}
|
1911 |
+
|
1912 |
+
if (opts.showEarly === true) {
|
1913 |
+
this.beforeShow.apply(this, arguments);
|
1914 |
+
}
|
1915 |
+
},
|
1916 |
+
|
1917 |
+
beforeShow : function(opts, obj) {
|
1918 |
+
if (obj.locked && !this.el.hasClass('fancybox-lock')) {
|
1919 |
+
if (this.fixPosition !== false) {
|
1920 |
+
$('*:not(object)').filter(function(){
|
1921 |
+
return ($(this).css('position') === 'fixed' && !$(this).hasClass("fancybox-overlay") && !$(this).hasClass("fancybox-wrap") );
|
1922 |
+
}).addClass('fancybox-margin');
|
1923 |
+
}
|
1924 |
+
|
1925 |
+
this.el.addClass('fancybox-margin');
|
1926 |
+
|
1927 |
+
this.scrollV = W.scrollTop();
|
1928 |
+
this.scrollH = W.scrollLeft();
|
1929 |
+
|
1930 |
+
this.el.addClass('fancybox-lock');
|
1931 |
+
|
1932 |
+
W.scrollTop( this.scrollV ).scrollLeft( this.scrollH );
|
1933 |
+
}
|
1934 |
+
|
1935 |
+
this.open(opts);
|
1936 |
+
},
|
1937 |
+
|
1938 |
+
onUpdate : function() {
|
1939 |
+
if (!this.fixed) {
|
1940 |
+
this.update();
|
1941 |
+
}
|
1942 |
+
},
|
1943 |
+
|
1944 |
+
afterClose: function (opts) {
|
1945 |
+
// Remove overlay if exists and fancyBox is not opening
|
1946 |
+
// (e.g., it is not being open using afterClose callback)
|
1947 |
+
if (this.overlay && !F.coming) {
|
1948 |
+
this.overlay.fadeOut(opts.speedOut, $.proxy( this.close, this ));
|
1949 |
+
}
|
1950 |
+
}
|
1951 |
+
};
|
1952 |
+
|
1953 |
+
/*
|
1954 |
+
* Title helper
|
1955 |
+
*/
|
1956 |
+
|
1957 |
+
F.helpers.title = {
|
1958 |
+
defaults : {
|
1959 |
+
type : 'float', // 'float', 'inside', 'outside' or 'over',
|
1960 |
+
position : 'bottom' // 'top' or 'bottom'
|
1961 |
+
},
|
1962 |
+
|
1963 |
+
beforeShow: function (opts) {
|
1964 |
+
var current = F.current,
|
1965 |
+
text = current.title,
|
1966 |
+
type = opts.type,
|
1967 |
+
title,
|
1968 |
+
target;
|
1969 |
+
|
1970 |
+
if ($.isFunction(text)) {
|
1971 |
+
text = text.call(current.element, current);
|
1972 |
+
}
|
1973 |
+
|
1974 |
+
if (!isString(text) || $.trim(text) === '') {
|
1975 |
+
return;
|
1976 |
+
}
|
1977 |
+
|
1978 |
+
title = $('<div class="fancybox-title fancybox-title-' + type + '-wrap">' + text + '</div>');
|
1979 |
+
|
1980 |
+
switch (type) {
|
1981 |
+
case 'inside':
|
1982 |
+
target = F.skin;
|
1983 |
+
break;
|
1984 |
+
|
1985 |
+
case 'outside':
|
1986 |
+
target = F.wrap;
|
1987 |
+
break;
|
1988 |
+
|
1989 |
+
case 'over':
|
1990 |
+
target = F.inner;
|
1991 |
+
break;
|
1992 |
+
|
1993 |
+
default: // 'float'
|
1994 |
+
target = F.skin;
|
1995 |
+
|
1996 |
+
title.appendTo('body');
|
1997 |
+
|
1998 |
+
if (IE) {
|
1999 |
+
title.width( title.width() );
|
2000 |
+
}
|
2001 |
+
|
2002 |
+
title.wrapInner('<span class="child"></span>');
|
2003 |
+
|
2004 |
+
//Increase bottom margin so this title will also fit into viewport
|
2005 |
+
F.current.margin[2] += Math.abs( getScalar(title.css('margin-bottom')) );
|
2006 |
+
break;
|
2007 |
+
}
|
2008 |
+
|
2009 |
+
title[ (opts.position === 'top' ? 'prependTo' : 'appendTo') ](target);
|
2010 |
+
}
|
2011 |
+
};
|
2012 |
+
|
2013 |
+
// jQuery plugin initialization
|
2014 |
+
$.fn.fancybox = function (options) {
|
2015 |
+
var index,
|
2016 |
+
that = $(this),
|
2017 |
+
selector = this.selector || '',
|
2018 |
+
run = function(e) {
|
2019 |
+
var what = $(this).blur(), idx = index, relType, relVal;
|
2020 |
+
|
2021 |
+
if (!(e.ctrlKey || e.altKey || e.shiftKey || e.metaKey) && !what.is('.fancybox-wrap')) {
|
2022 |
+
relType = options.groupAttr || 'data-fancybox-group';
|
2023 |
+
relVal = what.attr(relType);
|
2024 |
+
|
2025 |
+
if (!relVal) {
|
2026 |
+
relType = 'rel';
|
2027 |
+
relVal = what.get(0)[ relType ];
|
2028 |
+
}
|
2029 |
+
|
2030 |
+
if (relVal && relVal !== '' && relVal !== 'nofollow') {
|
2031 |
+
what = selector.length ? $(selector) : that;
|
2032 |
+
what = what.filter('[' + relType + '="' + relVal + '"]');
|
2033 |
+
idx = what.index(this);
|
2034 |
+
}
|
2035 |
+
|
2036 |
+
options.index = idx;
|
2037 |
+
|
2038 |
+
// Abort if not enough screen space
|
2039 |
+
var viewport = F.getViewport();
|
2040 |
+
if ( (options.minVpWidth && viewport.w < options.minVpWidth) || (options.minVpHeight && viewport.h < options.minVpHeight) ) {
|
2041 |
+
return;
|
2042 |
+
}
|
2043 |
+
|
2044 |
+
// Stop an event from bubbling if everything is fine
|
2045 |
+
if (F.open(what, options) !== false) {
|
2046 |
+
e.preventDefault();
|
2047 |
+
return false;
|
2048 |
+
}
|
2049 |
+
}
|
2050 |
+
};
|
2051 |
+
|
2052 |
+
options = options || {};
|
2053 |
+
index = options.index || 0;
|
2054 |
+
|
2055 |
+
if (!selector || options.live === false) {
|
2056 |
+
that.off('click.fb-start').on('click.fb-start', run);
|
2057 |
+
}
|
2058 |
+
else {
|
2059 |
+
D.undelegate(selector, 'click.fb-start').delegate(selector + ":not('.fancybox-item, .fancybox-nav')", 'click.fb-start', run);
|
2060 |
+
}
|
2061 |
+
|
2062 |
+
this.filter('[data-fancybox-start=1]').trigger('click');
|
2063 |
+
|
2064 |
+
return this;
|
2065 |
+
};
|
2066 |
+
|
2067 |
+
// Tests that need a body at doc ready
|
2068 |
+
D.ready(function() {
|
2069 |
+
var w1, w2;
|
2070 |
+
|
2071 |
+
if ( $.scrollbarWidth === undefined ) {
|
2072 |
+
// http://benalman.com/projects/jquery-misc-plugins/#scrollbarwidth
|
2073 |
+
$.scrollbarWidth = function() {
|
2074 |
+
var parent = $('<div style="width:50px;height:50px;overflow:auto"><div/></div>').appendTo('body'),
|
2075 |
+
child = parent.children(),
|
2076 |
+
width = child.innerWidth() - child.height( 99 ).innerWidth();
|
2077 |
+
|
2078 |
+
parent.remove();
|
2079 |
+
|
2080 |
+
return width;
|
2081 |
+
};
|
2082 |
+
}
|
2083 |
+
|
2084 |
+
if ( $.support.fixedPosition === undefined ) {
|
2085 |
+
$.support.fixedPosition = (function() {
|
2086 |
+
var elem = $('<div style="position:fixed;top:20px;"></div>').appendTo('body'),
|
2087 |
+
fixed = ( elem[0].offsetTop === 20 || elem[0].offsetTop === 15 );
|
2088 |
+
|
2089 |
+
elem.remove();
|
2090 |
+
|
2091 |
+
return fixed;
|
2092 |
+
}());
|
2093 |
+
}
|
2094 |
+
|
2095 |
+
$.extend(F.defaults, {
|
2096 |
+
scrollbarWidth : $.scrollbarWidth(),
|
2097 |
+
fixed : $.support.fixedPosition,
|
2098 |
+
parent : $('body')
|
2099 |
+
});
|
2100 |
+
|
2101 |
+
//Get real width of page scroll-bar
|
2102 |
+
w1 = $(window).width();
|
2103 |
+
|
2104 |
+
H.addClass('fancybox-lock-test');
|
2105 |
+
|
2106 |
+
w2 = $(window).width();
|
2107 |
+
|
2108 |
+
H.removeClass('fancybox-lock-test');
|
2109 |
+
|
2110 |
+
$("<style type='text/css'>.fancybox-margin{margin-right:" + (w2 - w1) + "px;}</style>").appendTo("head");
|
2111 |
+
});
|
2112 |
+
|
2113 |
+
}(window, document, jQuery));
|
fancybox/2.2.0/jquery.fancybox.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
.fancybox-wrap,.fancybox-skin,.fancybox-outer,.fancybox-inner,.fancybox-wrap img,.fancybox-wrap iframe,.fancybox-wrap object,.fancybox-nav,.fancybox-nav span,.fancybox-tmp{padding:0;margin:0;border:0;outline:none;vertical-align:top;}.fancybox-wrap{position:absolute;top:0;left:0;transform:translate3d(0,0,0);z-index:100020;}.fancybox-skin{position:relative;background:#f9f9f9;color:#444;text-shadow:none;}.fancybox-opened{z-index:100030;}.fancybox-opened .fancybox-skin{box-shadow:0 10px 25px rgba(0,0,0,.5);}.fancybox-outer,.fancybox-inner{position:relative;}.fancybox-inner{overflow:hidden;}.fancybox-type-iframe .fancybox-inner{-webkit-overflow-scrolling:touch;}.fancybox-error{color:#444;font:14px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;margin:0;padding:15px;white-space:nowrap;}.fancybox-wrap .fancybox-image,.fancybox-wrap .fancybox-iframe{display:block;width:100%;height:100%;}.fancybox-wrap .fancybox-image{max-width:100%;max-height:100%;}#fancybox-loading,.fancybox-close,.fancybox-prev span,.fancybox-next span{background-image:url(fancybox_sprite.png);}#fancybox-loading{position:fixed;top:50%;left:50%;margin-top:-22px;margin-left:-22px;background-position:0 -108px;opacity:.8;cursor:pointer;z-index:100060;}#fancybox-loading div{width:44px;height:44px;background:url(fancybox_loading.gif) center center no-repeat;}.fancybox-close{position:absolute;top:-18px;right:-18px;width:36px;height:36px;cursor:pointer;z-index:100040;}.fancybox-nav{position:absolute;top:0;width:40%;height:100%;cursor:pointer;text-decoration:none;background:transparent;-webkit-tap-highlight-color:rgba(0,0,0,0);z-index:100040;}.fancybox-prev{left:0;}.fancybox-next{right:0;}.fancybox-nav span{position:absolute;top:50%;width:36px;height:34px;margin-top:-18px;cursor:pointer;z-index:100040;visibility:hidden;}.fancybox-prev span{left:10px;background-position:0 -36px;}.fancybox-next span{right:10px;background-position:0 -72px;}.fancybox-nav:hover span{visibility:visible;}.fancybox-tmp{position:absolute;top:-99999px;left:-99999px;max-width:99999px;max-height:99999px;overflow:visible!important;}.fancybox-lock{overflow:visible!important;width:auto;}.fancybox-lock body{overflow:hidden!important;}.fancybox-lock-test{overflow-y:hidden!important;}.fancybox-overlay{position:absolute;top:0;left:0;overflow:hidden;display:none;z-index:100010;background-color:rgba(0,0,0,.7);}.fancybox-overlay-fixed{position:fixed;bottom:0;right:0;}.fancybox-lock .fancybox-overlay{overflow:auto;overflow-y:scroll;}.fancybox-title{visibility:hidden;font:normal 13px/20px "Helvetica Neue",Helvetica,Arial,sans-serif;position:relative;text-shadow:none;z-index:100050;}.fancybox-opened .fancybox-title{visibility:visible;}.fancybox-title-float-wrap{position:absolute;bottom:0;right:50%;margin-bottom:-37px;z-index:100050;text-align:center;}.fancybox-title-float-wrap .child{display:inline-block;margin-right:-100%;padding:2px 20px;background:black;border:2px solid white;border-radius:15px;color:#FFF;font-weight:bold;line-height:22px;white-space:nowrap;}.fancybox-title-outside-wrap{position:relative;margin-top:10px;color:#fff;}.fancybox-title-outside-wrap:first-child{margin-top:0;margin-bottom:10px;}.fancybox-title-inside-wrap{padding-top:10px;}.fancybox-title-inside-wrap:first-child{padding-top:0;padding-bottom:10px;}.fancybox-title-over-wrap{position:absolute;bottom:0;left:0;right:0;color:#fff;padding:10px;background:#000;background:rgba(0,0,0,.8);}.fancybox-hidden{display:none;}.fancybox-inner .fancybox-hidden{display:revert;}@media only screen and (-webkit-min-device-pixel-ratio:1.5),only screen and (min--moz-device-pixel-ratio:1.5),only screen and (min-device-pixel-ratio:1.5){#fancybox-loading,.fancybox-close,.fancybox-prev span,.fancybox-next span{background-image:url(fancybox_sprite@2x.png);background-size:44px 152px}#fancybox-loading div{background-image:url(fancybox_loading@2x.gif);background-size:24px 24px}}
|
fancybox/2.2.0/jquery.fancybox.min.js
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
!function(e,t,o,n){"use strict";var i=o("html"),a=o(e),r=o(t),l=o.fancybox=function(){l.open.apply(this,arguments)},s=navigator.userAgent.match(/msie/i),c=null,p="ontouchstart"in e||e.DocumentTouch&&t instanceof DocumentTouch||navigator.maxTouchPoints>0||navigator.msMaxTouchPoints>0,d=function(e){return e&&e.hasOwnProperty&&e instanceof o},h=function(e){return e&&"string"===o.type(e)},f=function(e){return h(e)&&e.indexOf("%")>0},u=function(e,t){var o=parseInt(e,10)||0;return t&&f(e)&&(o=l.getViewport()[t]/100*o),Math.ceil(o)},g=function(e,t){return u(e,t)+"px"};o.extend(l,{version:"2.2.0",defaults:{padding:15,margin:20,width:800,height:600,minWidth:100,minHeight:100,maxWidth:9999,maxHeight:9999,pixelRatio:e.devicePixelRatio||1,autoSize:!0,autoHeight:!1,autoWidth:!1,autoResize:!0,autoCenter:!p,fitToView:!0,aspectRatio:!1,topRatio:.5,leftRatio:.5,minVpWidth:320,minVpHeight:320,scrolling:"auto",wrapCSS:"",arrows:!0,closeBtn:!0,closeClick:!1,nextClick:!1,zoomClick:!1,mouseWheel:!0,swipe:p,autoPlay:!1,playSpeed:3e3,preload:3,modal:!1,loop:!0,ajax:{dataType:"html",headers:{"X-fancyBox":!0}},iframe:{scrolling:"auto",allowfullscreen:!0,preload:!0},svg:{},keys:{next:{13:"left",34:"up",39:"left",40:"up"},prev:{8:"right",33:"down",37:"right",38:"down"},close:[27],play:[32],toggle:[70]},direction:{next:"left",prev:"right"},scrollOutside:!0,index:0,type:null,href:null,content:null,title:null,tpl:{wrap:'<div class="fancybox-wrap" tabIndex="-1"><div class="fancybox-skin"><div class="fancybox-outer"><div class="fancybox-inner"></div></div></div></div>',image:'<img class="fancybox-image" src="{href}" alt="" />',iframe:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" frameborder="0" vspace="0" hspace="0" allow="autoplay"'+(s?' allowtransparency="true"':"")+"></iframe>",error:'<p class="fancybox-error">{error}</p>',close:'<a title="{close}" class="fancybox-item fancybox-close" href="javascript:;"></a>',next:'<a title="{next}" class="fancybox-nav fancybox-next" href="javascript:;"><span></span></a>',prev:'<a title="{prev}" class="fancybox-nav fancybox-prev" href="javascript:;"><span></span></a>',loading:'<div id="fancybox-loading"><div></div></div>'},txt:{error:{content:"The requested content cannot be loaded.<br/>Please try again later.",image:"The requested image cannot be loaded.<br/>Please try again later.",ajax:"An AJAX error occurred.<br/>Please contact the site administrator.",href:"Missing media target URL.<br/>Please contact the site administrator."},close:"Close",next:"Next",prev:"Previous"},openEffect:"fade",openSpeed:250,openEasing:"swing",openOpacity:!0,openMethod:"zoomIn",closeEffect:"fade",closeSpeed:250,closeEasing:"swing",closeOpacity:!0,closeMethod:"zoomOut",nextEffect:"elastic",nextSpeed:250,nextEasing:"swing",nextMethod:"changeIn",prevEffect:"elastic",prevSpeed:250,prevEasing:"swing",prevMethod:"changeOut",helpers:{overlay:!0,title:!0},onCancel:o.noop,beforeLoad:o.noop,afterLoad:o.noop,beforeShow:o.noop,afterShow:o.noop,beforeChange:o.noop,beforeClose:o.noop,afterClose:o.noop},group:{},opts:{},previous:null,coming:null,current:null,isActive:!1,isOpen:!1,isOpened:!1,wrap:null,skin:null,outer:null,inner:null,player:{timer:null,isActive:!1},ajaxLoad:null,imgPreload:null,transitions:{},helpers:{},open:function(e,t){if(e&&(o.isPlainObject(t)||(t={}),!1!==l.close(!0)))return o.isArray(e)||(e=d(e)?o(e).get():[e]),o.each(e,(function(i,a){var r,s,c,p,f,u,g,m={};"object"===o.type(a)&&(a.nodeType&&(a=o(a)),d(a)?(m={href:a.data("fancybox-href")||a.attr("href"),title:o("<div/>").text(a.data("fancybox-title")||a.attr("title")||"").html(),isDom:!0,element:a},o.metadata&&o.extend(!0,m,a.metadata())):m=a),r=t.href||m.href||(h(a)?a:null),s=t.title!==n?t.title:m.title||"",!(p=(c=t.content||m.content)?"html":t.type||m.type)&&m.isDom&&((p=a.data("fancybox-type"))||(p=(f=a.prop("class").match(/fancybox\.(\w+)/))?f[1]:null)),h(r)&&(p||(l.isImage(r)?p="image":l.isSVG(r)?p="svg":"#"===r.charAt(0)?p="inline":h(a)&&(p="html",c=a)),"ajax"===p&&(u=r.split(/\s+/,2),r=u.shift(),g=u.shift())),c||("inline"===p?r?c=o(h(r)?r.replace(/.*(?=#[^\s]+$)/,""):r):m.isDom&&(c=a):"html"===p?c=r:p||r||!m.isDom||(p="inline",c=a)),o.extend(m,{href:r,type:p,content:c,title:s,selector:g}),e[i]=m})),l.opts=o.extend(!0,{},l.defaults,t),t.keys!==n&&(l.opts.keys=!!t.keys&&o.extend({},l.defaults.keys,t.keys)),l.group=e,l._start(l.opts.index)},cancel:function(){var e=l.coming;e&&!1===l.trigger("onCancel")||(l.hideLoading(),e&&(l.ajaxLoad&&l.ajaxLoad.abort(),l.ajaxLoad=null,l.imgPreload&&(l.imgPreload.onload=l.imgPreload.onerror=null),e.wrap&&e.wrap.stop(!0,!0).trigger("onReset").remove(),l.coming=null,l.current||l._afterZoomOut(e)))},close:function(e){l.cancel(),!1!==l.trigger("beforeClose")&&(l.unbindEvents(),l.isActive&&(l.isOpen&&!0!==e?(l.isOpen=l.isOpened=!1,l.isClosing=!0,o(".fancybox-item, .fancybox-nav").remove(),l.wrap.stop(!0,!0).removeClass("fancybox-opened"),l.transitions[l.current.closeMethod]()):(o(".fancybox-wrap").stop(!0).trigger("onReset").remove(),l._afterZoomOut())))},play:function(e){var t=function(){clearTimeout(l.player.timer)},o=function(){t(),l.current&&l.player.isActive&&(l.player.timer=setTimeout(l.next,l.current.playSpeed))},n=function(){t(),r.off(".player"),l.player.isActive=!1,l.trigger("onPlayEnd")};!0===e||!l.player.isActive&&!1!==e?l.current&&(l.current.loop||l.current.index<l.group.length-1)&&(l.player.isActive=!0,r.on({"onCancel.player beforeClose.player":n,"onUpdate.player":o,"beforeLoad.player":t}),o(),l.trigger("onPlayStart")):n()},swipe:function(e,t,o){e>o||t>o?(l.wrap.off("touchstart.fb touchmove.fb touchend.fb mouseup.fb mousedown.fb mousemove.fb mousewheel.fb"),l.next(t>o?"up":"left")):(e<-o||t<-o)&&(l.wrap.off("touchstart.fb touchmove.fb touchend.fb mouseup.fb mousedown.fb mousemove.fb mousewheel.fb"),l.prev(t<-o?"down":"right"))},next:function(e){var t=l.current;t&&(h(e)||(e=t.direction.next),l.jumpto(t.index+1,e,"next"))},prev:function(e){var t=l.current;t&&(h(e)||(e=t.direction.prev),l.jumpto(t.index-1,e,"prev"))},jumpto:function(e,t,o){var i=l.current;i&&(e=u(e),l.direction=t||i.direction[e>=i.index?"next":"prev"],l.router=o||"jumpto",i.loop&&(e<0&&(e=i.group.length+e%i.group.length),e%=i.group.length),i.group[e]!==n&&(l.cancel(),l.isJumping=!0,l._start(e)))},canScroll:function(e){let t=!1,n=o(e);for(;n.length&&!(t||n.is(".fancybox-skin")||n.is(".fancybox-wrap"));)t=(i=n[0])&&!(i.style.overflow&&"hidden"===i.style.overflow)&&(i.clientWidth&&i.scrollWidth>i.clientWidth||i.clientHeight&&i.scrollHeight>i.clientHeight),n=o(n).parent();var i;return t},reposition:function(e,t){var n,i=l.current,a=i?i.wrap:null;a&&(n=l._getPosition(t),e&&"scroll"===e.type?(delete n.position,a.stop(!0,!0).animate(n,200)):(a.css(n),i.pos=o.extend({},i.dim,n)))},update:function(e){var t=e&&e.originalEvent&&e.originalEvent.type,o=!t||"orientationchange"===t;o&&(clearTimeout(c),c=null),l.isOpen&&!c&&(c=setTimeout((function(){var n=l.current;n&&!l.isClosing&&(l.wrap.removeClass("fancybox-tmp"),(o||"load"===t||"resize"===t&&n.autoResize)&&l._setDimension(),"scroll"===t&&n.canShrink||l.reposition(e),n.zoomClick&&l.inner.css("cursor",n.canExpand?"zoom-in":"zoom-out"),l.trigger("onUpdate"),c=null)}),o&&!p?0:300))},toggle:function(e){l.isOpen&&(l.current.fitToView="boolean"===o.type(e)?e:!l.current.fitToView,p&&(l.wrap.removeAttr("style").addClass("fancybox-tmp"),l.trigger("onUpdate")),l.update())},hideLoading:function(){r.off(".loading"),o("#fancybox-loading").remove()},showLoading:function(){var e,t;l.hideLoading(),e=o(l.opts.tpl.loading).click(l.cancel).appendTo("body"),r.on("keydown.loading",(function(e){if(27===(e.which||e.keyCode))return l.cancel(),e.preventDefault(),!1})),l.defaults.fixed||(t=l.getViewport(),e.css({position:"absolute",top:.5*t.h+t.y,left:.5*t.w+t.x})),l.trigger("onLoading")},getViewport:function(){var t=l.current&&l.current.locked||!1,o={x:a.scrollLeft(),y:a.scrollTop()};return t&&t.length?(o.w=t[0].clientWidth,o.h=t[0].clientHeight):(o.w=p&&e.innerWidth?e.innerWidth:a.width(),o.h=p&&e.innerHeight?e.innerHeight:a.height()),o},unbindEvents:function(){l.wrap&&d(l.wrap)&&l.wrap.off(".fb"),r.off(".fb"),a.off(".fb")},bindEvents:function(){var e,t=l.current;t&&(a.on("orientationchange.fb"+(p?"":" resize.fb")+(t.autoCenter&&!t.locked?" scroll.fb":""),l.update),(e=t.keys)&&r.on("keydown.fb",(function(i){var a=i.which||i.keyCode,r=i.target||i.srcElement;if(27===a&&l.coming)return!1;i.ctrlKey||i.altKey||i.shiftKey||i.metaKey||r&&(r.type||o(r).is("[contenteditable]"))||o.each(e,(function(e,r){return t.group.length>1&&r[a]!==n?(l[e](r[a]),i.preventDefault(),!1):o.inArray(a,r)>-1?(l[e](),i.preventDefault(),!1):void 0}))})),t.group.length>1&&(l.wrap.css("cursor","move"),l.wrap.on("mousedown.fb",(function(e){let t={};e.preventDefault(),t.startX=void 0!==e.clientX?e.clientX:e.originalEvent.clientX,t.startY=void 0!==e.clientY?e.clientY:e.originalEvent.clientY,l.wrap.on("mousemove.fb",(function(e){e.preventDefault(),t.endX=void 0!==e.clientX?e.clientX:e.originalEvent.clientX,t.endY=void 0!==e.clientY?e.clientY:e.originalEvent.clientY})),l.wrap.on("mouseup.fb",(function(){l.wrap.off("mousemove.fb"),l.swipe(t.startX-t.endX,t.startY-t.endY,100)}))})),t.swipe&&(l.wrap.on("touchstart.fb",(function(e){let o=e.target||null,n={},i=void 0!==e.touches?e.touches.length:e.originalEvent.touches.length;t.canShrink||i>1||l.canScroll(o)||(e.preventDefault(),n.startX=void 0!==e.touches?e.touches[0].clientX:e.originalEvent.touches[0].clientX,n.startY=void 0!==e.touches?e.touches[0].clientY:e.originalEvent.touches[0].clientY,l.wrap.on("touchmove.fb",(function(e){if(i=void 0!==e.touches?e.touches.length:e.originalEvent.touches.length,i>1)return;e.preventDefault();let t=void 0!==e.touches?e.touches[0].clientX:e.originalEvent.touches[0].clientX,o=void 0!==e.touches?e.touches[0].clientY:e.originalEvent.touches[0].clientY;l.swipe(n.startX-t,n.startY-o,100)})))})),l.wrap.on("touchend.fb",(function(){l.wrap.off("touchmove.fb")}))),o.fn.mousewheel&&t.mouseWheel&&l.wrap.on("mousewheel.fb",(function(e,o,n,i){let a=e.target||null;t.canShrink||0===o||l.canScroll(a)||(e.preventDefault(),l.swipe(-n,-i,0))}))))},trigger:function(e,t){var n,i=t||l.coming||l.current;if(i){if(o.isFunction(i[e])&&(n=i[e].apply(i,Array.prototype.slice.call(arguments,1))),!1===n)return!1;i.helpers&&o.each(i.helpers,(function(t,n){n&&l.helpers[t]&&o.isFunction(l.helpers[t][e])&&l.helpers[t][e](o.extend(!0,{},l.helpers[t].defaults,n),i)}))}r.trigger(e)},isImage:function(e){return h(e)&&e.match(/(^data:image\/.*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg)((\?|#).*)?$)/i)},isSVG:function(e){return h(e)&&e.match(/\.(svg)((\?|#).*)?$/i)},_start:function(e){var t,n,i,a,r,s={};if(e=u(e),!(t=l.group[e]||null))return!1;if(a=(s=o.extend(!0,{},l.opts,t)).margin,r=s.padding,"number"===o.type(a)&&(s.margin=[a,a,a,a]),"number"===o.type(r)&&(s.padding=[r,r,r,r]),s.modal&&o.extend(!0,s,{closeBtn:!1,closeClick:!1,nextClick:!1,zoomClick:!1,arrows:!1,mouseWheel:!1,keys:null,helpers:{overlay:{closeClick:!1}}}),s.autoSize&&(s.autoWidth=s.autoHeight=!0),"auto"===s.width&&(s.autoWidth=!0),"auto"===s.height&&(s.autoHeight=!0),s.group=l.group,s.index=e,l.coming=s,!1!==l.trigger("beforeLoad")){if(i=s.type,n=s.href,!i)return l.coming=null,!(!l.current||!l.router||"jumpto"===l.router)&&(l.current.index=e,l[l.router](l.direction));if(l.isActive=!0,"image"!==i&&"svg"!==i||(s.autoHeight=s.autoWidth=!1,s.scrolling="visible",s.aspectRatio=!0),"iframe"===i&&p&&(s.scrolling="scroll"),s.wrap=o(s.tpl.wrap).addClass("fancybox-"+(p?"mobile":"desktop")+" fancybox-type-"+i+" fancybox-tmp "+s.wrapCSS).appendTo(s.parent||"body"),o.extend(s,{skin:o(".fancybox-skin",s.wrap),outer:o(".fancybox-outer",s.wrap),inner:o(".fancybox-inner",s.wrap)}),o.each(["Top","Right","Bottom","Left"],(function(e,t){s.skin.css("padding"+t,g(s.padding[e]))})),l.trigger("onReady"),"inline"===i||"html"===i){if(!s.content||!s.content.length)return l._error("content")}else if(!n)return l._error("href");"image"===i?l._loadImage():"ajax"===i?l._loadAjax():"iframe"===i?l._loadIframe():l._afterLoad()}else l.coming=null},_error:function(e){let t=l.coming.txt.error[e]||l.coming.txt.error.content;arguments.length>1&&(t=t+"<br/><br/>"+arguments[1]),o.extend(l.coming,{type:"html",autoWidth:!0,autoHeight:!0,minWidth:0,minHeight:0,scrolling:"no",content:l.coming.tpl.error.replace(/\{error\}/g,t)}),l._afterLoad()},_loadImage:function(){var e=l.imgPreload=new Image;e.onload=function(){this.onload=this.onerror=null,l.coming.width=this.width/l.opts.pixelRatio,l.coming.height=this.height/l.opts.pixelRatio,l._afterLoad()},e.onerror=function(){this.onload=this.onerror=null,l._error("image")},e.src=l.coming.href,!0!==e.complete&&l.showLoading()},_loadAjax:function(){var e=l.coming;l.showLoading(),l.ajaxLoad=o.ajax(o.extend({},e.ajax,{url:e.href,error:function(e,t){l.coming&&"abort"!==t?l._error("ajax",e):l.hideLoading()},success:function(t,o){"success"===o&&(e.content=t,l._afterLoad())}}))},_loadIframe:function(){var e=l.coming,t=o(e.tpl.iframe.replace(/\{rnd\}/g,(new Date).getTime())).attr({scrolling:p?"auto":e.iframe.scrolling,src:e.href,webkitallowfullscreen:e.iframe.allowfullscreen,mozallowfullscreen:e.iframe.allowfullscreen,allowfullscreen:e.iframe.allowfullscreen});o(e.wrap).on("onReset",(function(){try{o(this).find("iframe").hide().attr("src","//about:blank").end().empty()}catch(e){}})),e.iframe.preload&&(l.showLoading(),t.one("load",(function(){o(this).data("ready",1),p||o(this).on("load.fb",l.update),o(this).parents(".fancybox-wrap").width("100%").removeClass("fancybox-tmp").show(),l._afterLoad()}))),e.content=t.appendTo(e.inner),e.iframe.preload||l._afterLoad()},_preloadImages:function(){var e,t,o=l.group,n=l.current,i=o.length,a=n.preload?Math.min(n.preload,i-1):0;for(t=1;t<=a;t+=1)"image"===(e=o[(n.index+t)%i]).type&&e.href&&((new Image).src=e.href)},_afterLoad:function(){var e,t,n,i,a,r=l.coming,s=l.current,c="fancybox-placeholder";if(l.hideLoading(),r&&!1!==l.isActive){if(!1===l.trigger("afterLoad",r,s))return r.wrap.stop(!0).trigger("onReset").remove(),void(l.coming=null);switch(s&&(l.trigger("beforeChange",s),s.wrap.stop(!0).removeClass("fancybox-opened").find(".fancybox-item, .fancybox-nav").remove()),l.unbindEvents(),e=r,t=r.content,n=r.type,i=r.scrolling,o.extend(l,{wrap:e.wrap,skin:e.skin,outer:e.outer,inner:e.inner,current:e,previous:s}),a=e.href,n){case"image":t=e.tpl.image.replace(/\{href\}/g,a);break;case"svg":t='<object type="image/svg+xml" width="100%" height="100%" data="'+a+'"></object>';break;case"inline":case"ajax":case"html":e.selector?t=o("<div>").html(t).find(e.selector):d(t)&&(t.data(c)||t.data(c,t.clone().removeAttr("id").addClass(c).insertAfter(t)),t=t.detach(),e.wrap.on("onReset",(function(){o(this).find(t).length&&t.replaceAll(t.data(c)).data(c,!1)})));break}d(t)&&t.parent().is(e.inner)||e.inner.append(t),l.trigger("beforeShow"),e.inner.css("overflow","yes"===i?"scroll":"no"===i?"hidden":i),l._setDimension(),l.reposition(),l.isOpen=!1,l.coming=null,l.bindEvents(),l.isOpened?s.prevMethod&&l.transitions[s.prevMethod]():o(".fancybox-wrap").not(e.wrap).stop(!0).trigger("onReset").remove(),l.transitions[l.isOpened?e.nextMethod:e.openMethod](),l._preloadImages()}},_setDimension:function(){var e,t,n,i,a,r,s,c,p,d,h,m,v,y,x,w,b,k=l.getViewport(),C=0,E=l.wrap,S=l.skin,T=l.inner,W=l.current,O=W.width,_=W.height,P=W.minWidth,H=W.minHeight,L=W.maxWidth,R=W.maxHeight,j=W.scrolling,M=W.scrollOutside?W.scrollbarWidth:0,A=W.margin,z=u(A[1]+A[3]),V=u(A[0]+A[2]);if(E.add(S).add(T).width("auto").height("auto").removeClass("fancybox-tmp"),a=z+(n=u(S.outerWidth(!0)-S.width())),r=V+(i=u(S.outerHeight(!0)-S.height())),s=f(O)?(k.w-a)*u(O)/100:O,c=f(_)?(k.h-r)*u(_)/100:_,"iframe"===W.type){if(w=W.content,W.autoHeight&&w&&1===w.data("ready"))try{w[0].contentWindow.document.location&&(T.width(s).height(9999),b=w.contents().find("body"),M&&b.css("overflow-x","hidden"),c=b.outerHeight(!0))}catch(e){}}else(W.autoWidth||W.autoHeight)&&(T.addClass("fancybox-tmp"),W.autoWidth||T.width(s),W.autoHeight||T.height(c),W.autoWidth&&(s=T.width()),W.autoHeight&&(c=T.height()),T.removeClass("fancybox-tmp"));if(O=u(s),_=u(c),h=s/c,P=u(f(P)?u(P,"w")-a:P),L=u(f(L)?u(L,"w")-a:L),H=u(f(H)?u(H,"h")-r:H),p=L,d=R=u(f(R)?u(R,"h")-r:R),W.fitToView&&(L=Math.min(k.w-a,L),R=Math.min(k.h-r,R)),y=k.w-z,x=k.h-V,W.aspectRatio?(O>L&&(_=u((O=L)/h)),_>R&&(O=u((_=R)*h)),O<P&&(_=u((O=P)/h)),_<H&&(O=u((_=H)*h))):(O=Math.max(P,Math.min(O,L)),W.autoHeight&&"iframe"!==W.type&&(T.width(O),_=T.height()),_=Math.max(H,Math.min(_,R))),W.fitToView)if(T.width(O).height(_),E.width(O+n),m=E.width(),v=E.height(),W.aspectRatio)for(;(m>y||v>x)&&O>P&&_>H&&!(C++>19);)_=Math.max(H,Math.min(R,_-10)),(O=u(_*h))<P&&(_=u((O=P)/h)),O>L&&(_=u((O=L)/h)),T.width(O).height(_),E.width(O+n),m=E.width(),v=E.height();else O=Math.max(P,Math.min(O,O-(m-y))),_=Math.max(H,Math.min(_,_-(v-x)));M&&"auto"===j&&_<c&&O+n+M<y&&(O+=M),T.width(O).height(_),E.width(O+n),m=E.width(),v=E.height(),e=(m>y||v>x)&&O>P&&_>H,t=W.aspectRatio?O<p&&_<d&&O<s&&_<c:(O<p||_<d)&&(O<s||_<c),o.extend(W,{dim:{width:g(m),height:g(v)},origWidth:s,origHeight:c,canShrink:e,canExpand:t,wPadding:n,hPadding:i,wrapSpace:v-S.outerHeight(!0),skinSpace:S.height()-_}),!w&&W.autoHeight&&_>H&&_<R&&!t&&T.height("auto")},_getPosition:function(e){var t=l.current,o=l.getViewport(),n=t.margin,i=l.wrap.width()+n[1]+n[3],a=l.wrap.height()+n[0]+n[2],r={position:"absolute",top:n[0],left:n[3]};return t.autoCenter&&t.fixed&&!e&&a<=o.h&&i<=o.w?r.position="fixed":t.locked||(r.top+=o.y,r.left+=o.x),r.top=g(Math.max(r.top,r.top+(o.h-a)*t.topRatio)),r.left=g(Math.max(r.left,r.left+(o.w-i)*t.leftRatio)),r},_afterZoomIn:function(){var e=l.current;e&&(l.isOpen=l.isOpened=!0,l.wrap.css("overflow","visible").addClass("fancybox-opened").hide().show(0),l.update(),(e.zoomClick||e.closeClick||e.nextClick&&l.group.length>1)&&l.inner.css("cursor",e.zoomClick?e.canExpand?"zoom-in":"zoom-out":"pointer").on("click.fb",(function(t){o(t.target).is("a")||o(t.target).parent().is("a")||(t.preventDefault(),l[e.zoomClick&&(e.canExpand||e.canShrink)?"toggle":e.closeClick?"close":"next"]())})),e.closeBtn&&o(e.tpl.close.replace(/\{close\}/g,e.txt.close)).appendTo(l.skin).on("click.fb",(function(e){e.preventDefault(),l.close()})),e.arrows&&l.group.length>1&&((e.loop||e.index>0)&&o(e.tpl.prev.replace(/\{prev\}/g,e.txt.prev)).appendTo(l.outer).on("click.fb",l.prev),(e.loop||e.index<l.group.length-1)&&o(e.tpl.next.replace(/\{next\}/g,e.txt.next)).appendTo(l.outer).on("click.fb",l.next)),l.trigger("afterShow"),e.loop||e.index!==e.group.length-1?l.opts.autoPlay&&!l.player.isActive&&(l.opts.autoPlay=!1,l.play(!0)):l.play(!1))},_afterZoomOut:function(e){e=e||l.current,o(".fancybox-wrap").trigger("onReset").remove(),o.extend(l,{group:{},opts:{},router:!1,current:null,isActive:!1,isOpened:!1,isOpen:!1,isClosing:!1,wrap:null,skin:null,outer:null,inner:null}),l.trigger("afterClose",e)}}),l.transitions={getOrigPosition:function(){var e=l.current,t=e.element,o=e.orig,n={},i=50,a=50,r=e.hPadding,s=e.wPadding,c=l.getViewport();return!o&&e.isDom&&t.is(":visible")&&((o=t.find("img:first")).length||(o=t)),d(o)?(n=o.offset(),o.is("img")&&(i=o.outerWidth(),a=o.outerHeight())):(n.top=c.y+(c.h-a)*e.topRatio,n.left=c.x+(c.w-i)*e.leftRatio),("fixed"===l.wrap.css("position")||e.locked)&&(n.top-=c.y,n.left-=c.x),n={top:g(n.top-r*e.topRatio),left:g(n.left-s*e.leftRatio),width:g(i+s),height:g(a+r)}},step:function(e,t){var o,n,i=t.prop,a=l.current,r=a.wrapSpace,s=a.skinSpace;"width"!==i&&"height"!==i||(o=t.end===t.start?1:(e-t.start)/(t.end-t.start),l.isClosing&&(o=1-o),n=e-("width"===i?a.wPadding:a.hPadding),l.skin[i](u("width"===i?n:n-r*o)),l.inner[i](u("width"===i?n:n-r*o-s*o)))},zoomIn:function(){var e=l.current,t=e.pos,n=e.openEffect,i="elastic"===n,a=o.extend({opacity:1},t);delete a.position,i?(t=this.getOrigPosition(),e.openOpacity&&(t.opacity=.1)):"fade"===n&&(t.opacity=.1),l.wrap.css(t).animate(a,{duration:"none"===n?0:e.openSpeed,easing:e.openEasing,step:i?this.step:null,complete:l._afterZoomIn})},zoomOut:function(){var e=l.current,t=e.closeEffect,o="elastic"===t,n={opacity:.1};o&&(n=this.getOrigPosition(),e.closeOpacity&&(n.opacity=.1)),l.wrap.animate(n,{duration:"none"===t?0:e.closeSpeed,easing:e.closeEasing,step:o?this.step:null,complete:l._afterZoomOut})},changeIn:function(){var e,t=l.current,o=t.nextEffect,n=t.pos,i={opacity:1},a=l.direction,r=200;n.opacity=.1,"elastic"===o&&(e="down"===a||"up"===a?"top":"left","down"===a||"right"===a?(n[e]=g(u(n[e])-r),i[e]="+=200px"):(n[e]=g(u(n[e])+r),i[e]="-=200px")),"none"===o?l._afterZoomIn():l.wrap.css(n).animate(i,{duration:t.nextSpeed,easing:t.nextEasing,complete:l._afterZoomIn})},changeOut:function(){var e=l.previous,t=e.prevEffect,n={opacity:.1},i=l.direction;"elastic"===t&&(n["down"===i||"up"===i?"top":"left"]=("up"===i||"left"===i?"-":"+")+"=200px"),e.wrap.animate(n,{duration:"none"===t?0:e.prevSpeed,easing:e.prevEasing,complete:function(){o(this).trigger("onReset").remove()}})}},l.helpers.overlay={defaults:{closeClick:!0,speedOut:200,showEarly:!0,css:{},locked:!p,fixed:!0},overlay:null,fixed:!1,el:o("html"),create:function(e){var t;e=o.extend({},this.defaults,e),this.overlay&&this.close(),t=l.coming?l.coming.parent:e.parent,this.overlay=o('<div class="fancybox-overlay"></div>').appendTo(t&&t.length?t:"body"),this.fixed=!1,e.fixed&&l.defaults.fixed&&(this.overlay.addClass("fancybox-overlay-fixed"),this.fixed=!0)},open:function(e){var t=this;e=o.extend({},this.defaults,e),this.overlay?this.overlay.off(".overlay").width("auto").height("auto"):this.create(e),this.fixed||(a.on("resize.overlay",o.proxy(this.update,this)),this.update()),e.closeClick&&this.overlay.on("click.overlay",(function(e){if(o(e.target).hasClass("fancybox-overlay"))return l.isActive?l.close():t.close(),!1})),this.overlay.css(e.css).show()},close:function(){a.off("resize.overlay"),this.el.hasClass("fancybox-lock")&&(o(".fancybox-margin").removeClass("fancybox-margin"),this.el.removeClass("fancybox-lock"),a.scrollTop(this.scrollV).scrollLeft(this.scrollH)),o(".fancybox-overlay").remove().hide(),o.extend(this,{overlay:null,fixed:!1})},update:function(){var e,o="100%";this.overlay.width(o).height("100%"),s?(e=Math.max(t.documentElement.offsetWidth,t.body.offsetWidth),r.width()>e&&(o=r.width())):r.width()>a.width()&&(o=r.width()),this.overlay.width(o).height(r.height())},onReady:function(e,t){var n=this.overlay;o(".fancybox-overlay").stop(!0,!0),n||this.create(e),e.locked&&this.fixed&&t.fixed&&(t.locked=this.overlay.append(t.wrap),t.fixed=!1),!0===e.showEarly&&this.beforeShow.apply(this,arguments)},beforeShow:function(e,t){t.locked&&!this.el.hasClass("fancybox-lock")&&(!1!==this.fixPosition&&o("*:not(object)").filter((function(){return"fixed"===o(this).css("position")&&!o(this).hasClass("fancybox-overlay")&&!o(this).hasClass("fancybox-wrap")})).addClass("fancybox-margin"),this.el.addClass("fancybox-margin"),this.scrollV=a.scrollTop(),this.scrollH=a.scrollLeft(),this.el.addClass("fancybox-lock"),a.scrollTop(this.scrollV).scrollLeft(this.scrollH)),this.open(e)},onUpdate:function(){this.fixed||this.update()},afterClose:function(e){this.overlay&&!l.coming&&this.overlay.fadeOut(e.speedOut,o.proxy(this.close,this))}},l.helpers.title={defaults:{type:"float",position:"bottom"},beforeShow:function(e){var t,n,i=l.current,a=i.title,r=e.type;if(o.isFunction(a)&&(a=a.call(i.element,i)),h(a)&&""!==o.trim(a)){switch(t=o('<div class="fancybox-title fancybox-title-'+r+'-wrap">'+a+"</div>"),r){case"inside":n=l.skin;break;case"outside":n=l.wrap;break;case"over":n=l.inner;break;default:n=l.skin,t.appendTo("body"),s&&t.width(t.width()),t.wrapInner('<span class="child"></span>'),l.current.margin[2]+=Math.abs(u(t.css("margin-bottom")));break}t["top"===e.position?"prependTo":"appendTo"](n)}}},o.fn.fancybox=function(e){var t,n=o(this),i=this.selector||"",a=function(a){var r,s,c=o(this).blur(),p=t;if(!(a.ctrlKey||a.altKey||a.shiftKey||a.metaKey||c.is(".fancybox-wrap"))){r=e.groupAttr||"data-fancybox-group",(s=c.attr(r))||(r="rel",s=c.get(0)[r]),s&&""!==s&&"nofollow"!==s&&(p=(c=(c=i.length?o(i):n).filter("["+r+'="'+s+'"]')).index(this)),e.index=p;var d=l.getViewport();if(e.minVpWidth&&d.w<e.minVpWidth||e.minVpHeight&&d.h<e.minVpHeight)return;if(!1!==l.open(c,e))return a.preventDefault(),!1}};return t=(e=e||{}).index||0,i&&!1!==e.live?r.undelegate(i,"click.fb-start").delegate(i+":not('.fancybox-item, .fancybox-nav')","click.fb-start",a):n.off("click.fb-start").on("click.fb-start",a),this.filter("[data-fancybox-start=1]").trigger("click"),this},r.ready((function(){var t,a,r,s;o.scrollbarWidth===n&&(o.scrollbarWidth=function(){var e=o('<div style="width:50px;height:50px;overflow:auto"><div/></div>').appendTo("body"),t=e.children(),n=t.innerWidth()-t.height(99).innerWidth();return e.remove(),n}),o.support.fixedPosition===n&&(o.support.fixedPosition=(r=o('<div style="position:fixed;top:20px;"></div>').appendTo("body"),s=20===r[0].offsetTop||15===r[0].offsetTop,r.remove(),s)),o.extend(l.defaults,{scrollbarWidth:o.scrollbarWidth(),fixed:o.support.fixedPosition,parent:o("body")}),t=o(e).width(),i.addClass("fancybox-lock-test"),a=o(e).width(),i.removeClass("fancybox-lock-test"),o("<style type='text/css'>.fancybox-margin{margin-right:"+(a-t)+"px;}</style>").appendTo("head")}))}(window,document,jQuery);
|
fancybox/3.5.7/jquery.fancybox.css
ADDED
@@ -0,0 +1,895 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
body.compensate-for-scrollbar {
|
2 |
+
overflow: hidden;
|
3 |
+
}
|
4 |
+
|
5 |
+
.fancybox-active {
|
6 |
+
height: auto;
|
7 |
+
}
|
8 |
+
|
9 |
+
.fancybox-is-hidden {
|
10 |
+
left: -9999px;
|
11 |
+
margin: 0;
|
12 |
+
position: absolute !important;
|
13 |
+
top: -9999px;
|
14 |
+
visibility: hidden;
|
15 |
+
}
|
16 |
+
|
17 |
+
.fancybox-container {
|
18 |
+
-webkit-backface-visibility: hidden;
|
19 |
+
height: 100%;
|
20 |
+
left: 0;
|
21 |
+
outline: none;
|
22 |
+
position: fixed;
|
23 |
+
-webkit-tap-highlight-color: transparent;
|
24 |
+
top: 0;
|
25 |
+
-ms-touch-action: manipulation;
|
26 |
+
touch-action: manipulation;
|
27 |
+
transform: translateZ(0);
|
28 |
+
width: 100%;
|
29 |
+
z-index: 99992;
|
30 |
+
}
|
31 |
+
|
32 |
+
.fancybox-container * {
|
33 |
+
box-sizing: border-box;
|
34 |
+
}
|
35 |
+
|
36 |
+
.fancybox-outer,
|
37 |
+
.fancybox-inner,
|
38 |
+
.fancybox-bg,
|
39 |
+
.fancybox-stage {
|
40 |
+
bottom: 0;
|
41 |
+
left: 0;
|
42 |
+
position: absolute;
|
43 |
+
right: 0;
|
44 |
+
top: 0;
|
45 |
+
}
|
46 |
+
|
47 |
+
.fancybox-outer {
|
48 |
+
-webkit-overflow-scrolling: touch;
|
49 |
+
overflow-y: auto;
|
50 |
+
}
|
51 |
+
|
52 |
+
.fancybox-bg {
|
53 |
+
background: rgb(30, 30, 30);
|
54 |
+
opacity: 0;
|
55 |
+
transition-duration: inherit;
|
56 |
+
transition-property: opacity;
|
57 |
+
transition-timing-function: cubic-bezier(.47, 0, .74, .71);
|
58 |
+
}
|
59 |
+
|
60 |
+
.fancybox-is-open .fancybox-bg {
|
61 |
+
opacity: .9;
|
62 |
+
transition-timing-function: cubic-bezier(.22, .61, .36, 1);
|
63 |
+
}
|
64 |
+
|
65 |
+
.fancybox-infobar,
|
66 |
+
.fancybox-toolbar,
|
67 |
+
.fancybox-caption,
|
68 |
+
.fancybox-navigation .fancybox-button {
|
69 |
+
direction: ltr;
|
70 |
+
opacity: 0;
|
71 |
+
position: absolute;
|
72 |
+
transition: opacity .25s ease, visibility 0s ease .25s;
|
73 |
+
visibility: hidden;
|
74 |
+
z-index: 99997;
|
75 |
+
}
|
76 |
+
|
77 |
+
.fancybox-show-infobar .fancybox-infobar,
|
78 |
+
.fancybox-show-toolbar .fancybox-toolbar,
|
79 |
+
.fancybox-show-caption .fancybox-caption,
|
80 |
+
.fancybox-show-nav .fancybox-navigation .fancybox-button {
|
81 |
+
opacity: 1;
|
82 |
+
transition: opacity .25s ease 0s, visibility 0s ease 0s;
|
83 |
+
visibility: visible;
|
84 |
+
}
|
85 |
+
|
86 |
+
.fancybox-infobar {
|
87 |
+
color: #ccc;
|
88 |
+
font-size: 13px;
|
89 |
+
-webkit-font-smoothing: subpixel-antialiased;
|
90 |
+
height: 44px;
|
91 |
+
left: 0;
|
92 |
+
line-height: 44px;
|
93 |
+
min-width: 44px;
|
94 |
+
mix-blend-mode: difference;
|
95 |
+
padding: 0 10px;
|
96 |
+
pointer-events: none;
|
97 |
+
top: 0;
|
98 |
+
-webkit-touch-callout: none;
|
99 |
+
-webkit-user-select: none;
|
100 |
+
-moz-user-select: none;
|
101 |
+
-ms-user-select: none;
|
102 |
+
user-select: none;
|
103 |
+
}
|
104 |
+
|
105 |
+
.fancybox-toolbar {
|
106 |
+
right: 0;
|
107 |
+
top: 0;
|
108 |
+
}
|
109 |
+
|
110 |
+
.fancybox-stage {
|
111 |
+
direction: ltr;
|
112 |
+
overflow: visible;
|
113 |
+
transform: translateZ(0);
|
114 |
+
z-index: 99994;
|
115 |
+
}
|
116 |
+
|
117 |
+
.fancybox-is-open .fancybox-stage {
|
118 |
+
overflow: hidden;
|
119 |
+
}
|
120 |
+
|
121 |
+
.fancybox-slide {
|
122 |
+
-webkit-backface-visibility: hidden;
|
123 |
+
/* Using without prefix would break IE11 */
|
124 |
+
display: none;
|
125 |
+
height: 100%;
|
126 |
+
left: 0;
|
127 |
+
outline: none;
|
128 |
+
overflow: auto;
|
129 |
+
-webkit-overflow-scrolling: touch;
|
130 |
+
padding: 44px;
|
131 |
+
position: absolute;
|
132 |
+
text-align: center;
|
133 |
+
top: 0;
|
134 |
+
transition-property: transform, opacity;
|
135 |
+
white-space: normal;
|
136 |
+
width: 100%;
|
137 |
+
z-index: 99994;
|
138 |
+
}
|
139 |
+
|
140 |
+
.fancybox-slide::before {
|
141 |
+
content: '';
|
142 |
+
display: inline-block;
|
143 |
+
font-size: 0;
|
144 |
+
height: 100%;
|
145 |
+
vertical-align: middle;
|
146 |
+
width: 0;
|
147 |
+
}
|
148 |
+
|
149 |
+
.fancybox-is-sliding .fancybox-slide,
|
150 |
+
.fancybox-slide--previous,
|
151 |
+
.fancybox-slide--current,
|
152 |
+
.fancybox-slide--next {
|
153 |
+
display: block;
|
154 |
+
}
|
155 |
+
|
156 |
+
.fancybox-slide--image {
|
157 |
+
overflow: hidden;
|
158 |
+
padding: 44px 0;
|
159 |
+
}
|
160 |
+
|
161 |
+
.fancybox-slide--image::before {
|
162 |
+
display: none;
|
163 |
+
}
|
164 |
+
|
165 |
+
.fancybox-slide--html {
|
166 |
+
padding: 6px;
|
167 |
+
}
|
168 |
+
|
169 |
+
.fancybox-content {
|
170 |
+
background: #fff;
|
171 |
+
display: inline-block;
|
172 |
+
margin: 0;
|
173 |
+
max-width: 100%;
|
174 |
+
overflow: auto;
|
175 |
+
-webkit-overflow-scrolling: touch;
|
176 |
+
padding: 44px;
|
177 |
+
position: relative;
|
178 |
+
text-align: left;
|
179 |
+
vertical-align: middle;
|
180 |
+
}
|
181 |
+
|
182 |
+
.fancybox-slide--image .fancybox-content {
|
183 |
+
animation-timing-function: cubic-bezier(.5, 0, .14, 1);
|
184 |
+
-webkit-backface-visibility: hidden;
|
185 |
+
background: transparent;
|
186 |
+
background-repeat: no-repeat;
|
187 |
+
background-size: 100% 100%;
|
188 |
+
left: 0;
|
189 |
+
max-width: none;
|
190 |
+
overflow: visible;
|
191 |
+
padding: 0;
|
192 |
+
position: absolute;
|
193 |
+
top: 0;
|
194 |
+
-ms-transform-origin: top left;
|
195 |
+
transform-origin: top left;
|
196 |
+
transition-property: transform, opacity;
|
197 |
+
-webkit-user-select: none;
|
198 |
+
-moz-user-select: none;
|
199 |
+
-ms-user-select: none;
|
200 |
+
user-select: none;
|
201 |
+
z-index: 99995;
|
202 |
+
}
|
203 |
+
|
204 |
+
.fancybox-can-zoomOut .fancybox-content {
|
205 |
+
cursor: zoom-out;
|
206 |
+
}
|
207 |
+
|
208 |
+
.fancybox-can-zoomIn .fancybox-content {
|
209 |
+
cursor: zoom-in;
|
210 |
+
}
|
211 |
+
|
212 |
+
.fancybox-can-swipe .fancybox-content,
|
213 |
+
.fancybox-can-pan .fancybox-content {
|
214 |
+
cursor: -webkit-grab;
|
215 |
+
cursor: grab;
|
216 |
+
}
|
217 |
+
|
218 |
+
.fancybox-is-grabbing .fancybox-content {
|
219 |
+
cursor: -webkit-grabbing;
|
220 |
+
cursor: grabbing;
|
221 |
+
}
|
222 |
+
|
223 |
+
.fancybox-container [data-selectable='true'] {
|
224 |
+
cursor: text;
|
225 |
+
}
|
226 |
+
|
227 |
+
.fancybox-image,
|
228 |
+
.fancybox-spaceball {
|
229 |
+
background: transparent;
|
230 |
+
border: 0;
|
231 |
+
height: 100%;
|
232 |
+
left: 0;
|
233 |
+
margin: 0;
|
234 |
+
max-height: none;
|
235 |
+
max-width: none;
|
236 |
+
padding: 0;
|
237 |
+
position: absolute;
|
238 |
+
top: 0;
|
239 |
+
-webkit-user-select: none;
|
240 |
+
-moz-user-select: none;
|
241 |
+
-ms-user-select: none;
|
242 |
+
user-select: none;
|
243 |
+
width: 100%;
|
244 |
+
}
|
245 |
+
|
246 |
+
.fancybox-spaceball {
|
247 |
+
z-index: 1;
|
248 |
+
}
|
249 |
+
|
250 |
+
.fancybox-slide--video .fancybox-content,
|
251 |
+
.fancybox-slide--map .fancybox-content,
|
252 |
+
.fancybox-slide--pdf .fancybox-content,
|
253 |
+
.fancybox-slide--iframe .fancybox-content {
|
254 |
+
height: 100%;
|
255 |
+
overflow: visible;
|
256 |
+
padding: 0;
|
257 |
+
width: 100%;
|
258 |
+
}
|
259 |
+
|
260 |
+
.fancybox-slide--video .fancybox-content {
|
261 |
+
background: #000;
|
262 |
+
}
|
263 |
+
|
264 |
+
.fancybox-slide--map .fancybox-content {
|
265 |
+
background: #e5e3df;
|
266 |
+
}
|
267 |
+
|
268 |
+
.fancybox-slide--iframe .fancybox-content {
|
269 |
+
background: #fff;
|
270 |
+
}
|
271 |
+
|
272 |
+
.fancybox-video,
|
273 |
+
.fancybox-iframe {
|
274 |
+
background: transparent;
|
275 |
+
border: 0;
|
276 |
+
display: block;
|
277 |
+
height: 100%;
|
278 |
+
margin: 0;
|
279 |
+
overflow: hidden;
|
280 |
+
padding: 0;
|
281 |
+
width: 100%;
|
282 |
+
}
|
283 |
+
|
284 |
+
/* Fix iOS */
|
285 |
+
.fancybox-iframe {
|
286 |
+
left: 0;
|
287 |
+
position: absolute;
|
288 |
+
top: 0;
|
289 |
+
}
|
290 |
+
|
291 |
+
.fancybox-error {
|
292 |
+
background: #fff;
|
293 |
+
cursor: default;
|
294 |
+
max-width: 400px;
|
295 |
+
padding: 40px;
|
296 |
+
width: 100%;
|
297 |
+
}
|
298 |
+
|
299 |
+
.fancybox-error p {
|
300 |
+
color: #444;
|
301 |
+
font-size: 16px;
|
302 |
+
line-height: 20px;
|
303 |
+
margin: 0;
|
304 |
+
padding: 0;
|
305 |
+
}
|
306 |
+
|
307 |
+
/* Buttons */
|
308 |
+
|
309 |
+
.fancybox-button {
|
310 |
+
background: rgba(30, 30, 30, .6);
|
311 |
+
border: 0;
|
312 |
+
border-radius: 0;
|
313 |
+
box-shadow: none;
|
314 |
+
cursor: pointer;
|
315 |
+
display: inline-block;
|
316 |
+
height: 44px;
|
317 |
+
margin: 0;
|
318 |
+
padding: 10px;
|
319 |
+
position: relative;
|
320 |
+
transition: color .2s;
|
321 |
+
vertical-align: top;
|
322 |
+
visibility: inherit;
|
323 |
+
width: 44px;
|
324 |
+
}
|
325 |
+
|
326 |
+
.fancybox-button,
|
327 |
+
.fancybox-button:visited,
|
328 |
+
.fancybox-button:link {
|
329 |
+
color: #ccc;
|
330 |
+
}
|
331 |
+
|
332 |
+
.fancybox-button:hover {
|
333 |
+
color: #fff;
|
334 |
+
}
|
335 |
+
|
336 |
+
.fancybox-button:focus {
|
337 |
+
outline: none;
|
338 |
+
}
|
339 |
+
|
340 |
+
.fancybox-button.fancybox-focus {
|
341 |
+
outline: 1px dotted;
|
342 |
+
}
|
343 |
+
|
344 |
+
.fancybox-button[disabled],
|
345 |
+
.fancybox-button[disabled]:hover {
|
346 |
+
color: #888;
|
347 |
+
cursor: default;
|
348 |
+
outline: none;
|
349 |
+
}
|
350 |
+
|
351 |
+
/* Fix IE11 */
|
352 |
+
.fancybox-button div {
|
353 |
+
height: 100%;
|
354 |
+
}
|
355 |
+
|
356 |
+
.fancybox-button svg {
|
357 |
+
display: block;
|
358 |
+
height: 100%;
|
359 |
+
overflow: visible;
|
360 |
+
position: relative;
|
361 |
+
width: 100%;
|
362 |
+
}
|
363 |
+
|
364 |
+
.fancybox-button svg path {
|
365 |
+
fill: currentColor;
|
366 |
+
stroke-width: 0;
|
367 |
+
}
|
368 |
+
|
369 |
+
.fancybox-button--play svg:nth-child(2),
|
370 |
+
.fancybox-button--fsenter svg:nth-child(2) {
|
371 |
+
display: none;
|
372 |
+
}
|
373 |
+
|
374 |
+
.fancybox-button--pause svg:nth-child(1),
|
375 |
+
.fancybox-button--fsexit svg:nth-child(1) {
|
376 |
+
display: none;
|
377 |
+
}
|
378 |
+
|
379 |
+
.fancybox-progress {
|
380 |
+
background: #ff5268;
|
381 |
+
height: 2px;
|
382 |
+
left: 0;
|
383 |
+
position: absolute;
|
384 |
+
right: 0;
|
385 |
+
top: 0;
|
386 |
+
-ms-transform: scaleX(0);
|
387 |
+
transform: scaleX(0);
|
388 |
+
-ms-transform-origin: 0;
|
389 |
+
transform-origin: 0;
|
390 |
+
transition-property: transform;
|
391 |
+
transition-timing-function: linear;
|
392 |
+
z-index: 99998;
|
393 |
+
}
|
394 |
+
|
395 |
+
/* Close button on the top right corner of html content */
|
396 |
+
|
397 |
+
.fancybox-close-small {
|
398 |
+
background: transparent;
|
399 |
+
border: 0;
|
400 |
+
border-radius: 0;
|
401 |
+
color: #ccc;
|
402 |
+
cursor: pointer;
|
403 |
+
opacity: .8;
|
404 |
+
padding: 8px;
|
405 |
+
position: absolute;
|
406 |
+
right: -12px;
|
407 |
+
top: -44px;
|
408 |
+
z-index: 401;
|
409 |
+
}
|
410 |
+
|
411 |
+
.fancybox-close-small:hover {
|
412 |
+
color: #fff;
|
413 |
+
opacity: 1;
|
414 |
+
}
|
415 |
+
|
416 |
+
.fancybox-slide--html .fancybox-close-small {
|
417 |
+
color: currentColor;
|
418 |
+
padding: 10px;
|
419 |
+
right: 0;
|
420 |
+
top: 0;
|
421 |
+
}
|
422 |
+
|
423 |
+
.fancybox-slide--image.fancybox-is-scaling .fancybox-content {
|
424 |
+
overflow: hidden;
|
425 |
+
}
|
426 |
+
|
427 |
+
.fancybox-is-scaling .fancybox-close-small,
|
428 |
+
.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small {
|
429 |
+
display: none;
|
430 |
+
}
|
431 |
+
|
432 |
+
/* Navigation arrows */
|
433 |
+
|
434 |
+
.fancybox-navigation .fancybox-button {
|
435 |
+
background-clip: content-box;
|
436 |
+
height: 100px;
|
437 |
+
opacity: 0;
|
438 |
+
position: absolute;
|
439 |
+
top: calc(50% - 50px);
|
440 |
+
width: 70px;
|
441 |
+
}
|
442 |
+
|
443 |
+
.fancybox-navigation .fancybox-button div {
|
444 |
+
padding: 7px;
|
445 |
+
}
|
446 |
+
|
447 |
+
.fancybox-navigation .fancybox-button--arrow_left {
|
448 |
+
left: 0;
|
449 |
+
left: env(safe-area-inset-left);
|
450 |
+
padding: 31px 26px 31px 6px;
|
451 |
+
}
|
452 |
+
|
453 |
+
.fancybox-navigation .fancybox-button--arrow_right {
|
454 |
+
padding: 31px 6px 31px 26px;
|
455 |
+
right: 0;
|
456 |
+
right: env(safe-area-inset-right);
|
457 |
+
}
|
458 |
+
|
459 |
+
/* Caption */
|
460 |
+
|
461 |
+
.fancybox-caption {
|
462 |
+
background: linear-gradient(to top,
|
463 |
+
rgba(0, 0, 0, .85) 0%,
|
464 |
+
rgba(0, 0, 0, .3) 50%,
|
465 |
+
rgba(0, 0, 0, .15) 65%,
|
466 |
+
rgba(0, 0, 0, .075) 75.5%,
|
467 |
+
rgba(0, 0, 0, .037) 82.85%,
|
468 |
+
rgba(0, 0, 0, .019) 88%,
|
469 |
+
rgba(0, 0, 0, 0) 100%);
|
470 |
+
bottom: 0;
|
471 |
+
color: #eee;
|
472 |
+
font-size: 14px;
|
473 |
+
font-weight: 400;
|
474 |
+
left: 0;
|
475 |
+
line-height: 1.5;
|
476 |
+
padding: 75px 44px 25px 44px;
|
477 |
+
pointer-events: none;
|
478 |
+
right: 0;
|
479 |
+
text-align: center;
|
480 |
+
z-index: 99996;
|
481 |
+
}
|
482 |
+
|
483 |
+
@supports (padding: max(0px)) {
|
484 |
+
.fancybox-caption {
|
485 |
+
padding: 75px max(44px, env(safe-area-inset-right)) max(25px, env(safe-area-inset-bottom)) max(44px, env(safe-area-inset-left));
|
486 |
+
}
|
487 |
+
}
|
488 |
+
|
489 |
+
.fancybox-caption--separate {
|
490 |
+
margin-top: -50px;
|
491 |
+
}
|
492 |
+
|
493 |
+
.fancybox-caption__body {
|
494 |
+
max-height: 50vh;
|
495 |
+
overflow: auto;
|
496 |
+
pointer-events: all;
|
497 |
+
}
|
498 |
+
|
499 |
+
.fancybox-caption a,
|
500 |
+
.fancybox-caption a:link,
|
501 |
+
.fancybox-caption a:visited {
|
502 |
+
color: #ccc;
|
503 |
+
text-decoration: none;
|
504 |
+
}
|
505 |
+
|
506 |
+
.fancybox-caption a:hover {
|
507 |
+
color: #fff;
|
508 |
+
text-decoration: underline;
|
509 |
+
}
|
510 |
+
|
511 |
+
/* Loading indicator */
|
512 |
+
|
513 |
+
.fancybox-loading {
|
514 |
+
animation: fancybox-rotate 1s linear infinite;
|
515 |
+
background: transparent;
|
516 |
+
border: 4px solid #888;
|
517 |
+
border-bottom-color: #fff;
|
518 |
+
border-radius: 50%;
|
519 |
+
height: 50px;
|
520 |
+
left: 50%;
|
521 |
+
margin: -25px 0 0 -25px;
|
522 |
+
opacity: .7;
|
523 |
+
padding: 0;
|
524 |
+
position: absolute;
|
525 |
+
top: 50%;
|
526 |
+
width: 50px;
|
527 |
+
z-index: 99999;
|
528 |
+
}
|
529 |
+
|
530 |
+
@keyframes fancybox-rotate {
|
531 |
+
100% {
|
532 |
+
transform: rotate(360deg);
|
533 |
+
}
|
534 |
+
}
|
535 |
+
|
536 |
+
/* Transition effects */
|
537 |
+
|
538 |
+
.fancybox-animated {
|
539 |
+
transition-timing-function: cubic-bezier(0, 0, .25, 1);
|
540 |
+
}
|
541 |
+
|
542 |
+
/* transitionEffect: slide */
|
543 |
+
|
544 |
+
.fancybox-fx-slide.fancybox-slide--previous {
|
545 |
+
opacity: 0;
|
546 |
+
transform: translate3d(-100%, 0, 0);
|
547 |
+
}
|
548 |
+
|
549 |
+
.fancybox-fx-slide.fancybox-slide--next {
|
550 |
+
opacity: 0;
|
551 |
+
transform: translate3d(100%, 0, 0);
|
552 |
+
}
|
553 |
+
|
554 |
+
.fancybox-fx-slide.fancybox-slide--current {
|
555 |
+
opacity: 1;
|
556 |
+
transform: translate3d(0, 0, 0);
|
557 |
+
}
|
558 |
+
|
559 |
+
/* transitionEffect: fade */
|
560 |
+
|
561 |
+
.fancybox-fx-fade.fancybox-slide--previous,
|
562 |
+
.fancybox-fx-fade.fancybox-slide--next {
|
563 |
+
opacity: 0;
|
564 |
+
transition-timing-function: cubic-bezier(.19, 1, .22, 1);
|
565 |
+
}
|
566 |
+
|
567 |
+
.fancybox-fx-fade.fancybox-slide--current {
|
568 |
+
opacity: 1;
|
569 |
+
}
|
570 |
+
|
571 |
+
/* transitionEffect: zoom-in-out */
|
572 |
+
|
573 |
+
.fancybox-fx-zoom-in-out.fancybox-slide--previous {
|
574 |
+
opacity: 0;
|
575 |
+
transform: scale3d(1.5, 1.5, 1.5);
|
576 |
+
}
|
577 |
+
|
578 |
+
.fancybox-fx-zoom-in-out.fancybox-slide--next {
|
579 |
+
opacity: 0;
|
580 |
+
transform: scale3d(.5, .5, .5);
|
581 |
+
}
|
582 |
+
|
583 |
+
.fancybox-fx-zoom-in-out.fancybox-slide--current {
|
584 |
+
opacity: 1;
|
585 |
+
transform: scale3d(1, 1, 1);
|
586 |
+
}
|
587 |
+
|
588 |
+
/* transitionEffect: rotate */
|
589 |
+
|
590 |
+
.fancybox-fx-rotate.fancybox-slide--previous {
|
591 |
+
opacity: 0;
|
592 |
+
-ms-transform: rotate(-360deg);
|
593 |
+
transform: rotate(-360deg);
|
594 |
+
}
|
595 |
+
|
596 |
+
.fancybox-fx-rotate.fancybox-slide--next {
|
597 |
+
opacity: 0;
|
598 |
+
-ms-transform: rotate(360deg);
|
599 |
+
transform: rotate(360deg);
|
600 |
+
}
|
601 |
+
|
602 |
+
.fancybox-fx-rotate.fancybox-slide--current {
|
603 |
+
opacity: 1;
|
604 |
+
-ms-transform: rotate(0deg);
|
605 |
+
transform: rotate(0deg);
|
606 |
+
}
|
607 |
+
|
608 |
+
/* transitionEffect: circular */
|
609 |
+
|
610 |
+
.fancybox-fx-circular.fancybox-slide--previous {
|
611 |
+
opacity: 0;
|
612 |
+
transform: scale3d(0, 0, 0) translate3d(-100%, 0, 0);
|
613 |
+
}
|
614 |
+
|
615 |
+
.fancybox-fx-circular.fancybox-slide--next {
|
616 |
+
opacity: 0;
|
617 |
+
transform: scale3d(0, 0, 0) translate3d(100%, 0, 0);
|
618 |
+
}
|
619 |
+
|
620 |
+
.fancybox-fx-circular.fancybox-slide--current {
|
621 |
+
opacity: 1;
|
622 |
+
transform: scale3d(1, 1, 1) translate3d(0, 0, 0);
|
623 |
+
}
|
624 |
+
|
625 |
+
/* transitionEffect: tube */
|
626 |
+
|
627 |
+
.fancybox-fx-tube.fancybox-slide--previous {
|
628 |
+
transform: translate3d(-100%, 0, 0) scale(.1) skew(-10deg);
|
629 |
+
}
|
630 |
+
|
631 |
+
.fancybox-fx-tube.fancybox-slide--next {
|
632 |
+
transform: translate3d(100%, 0, 0) scale(.1) skew(10deg);
|
633 |
+
}
|
634 |
+
|
635 |
+
.fancybox-fx-tube.fancybox-slide--current {
|
636 |
+
transform: translate3d(0, 0, 0) scale(1);
|
637 |
+
}
|
638 |
+
|
639 |
+
/* Styling for Small-Screen Devices */
|
640 |
+
@media all and (max-height: 576px) {
|
641 |
+
.fancybox-slide {
|
642 |
+
padding-left: 6px;
|
643 |
+
padding-right: 6px;
|
644 |
+
}
|
645 |
+
|
646 |
+
.fancybox-slide--image {
|
647 |
+
padding: 6px 0;
|
648 |
+
}
|
649 |
+
|
650 |
+
.fancybox-close-small {
|
651 |
+
right: -6px;
|
652 |
+
}
|
653 |
+
|
654 |
+
.fancybox-slide--image .fancybox-close-small {
|
655 |
+
background: #4e4e4e;
|
656 |
+
color: #f2f4f6;
|
657 |
+
height: 36px;
|
658 |
+
opacity: 1;
|
659 |
+
padding: 6px;
|
660 |
+
right: 0;
|
661 |
+
top: 0;
|
662 |
+
width: 36px;
|
663 |
+
}
|
664 |
+
|
665 |
+
.fancybox-caption {
|
666 |
+
padding-left: 12px;
|
667 |
+
padding-right: 12px;
|
668 |
+
}
|
669 |
+
|
670 |
+
@supports (padding: max(0px)) {
|
671 |
+
.fancybox-caption {
|
672 |
+
padding-left: max(12px, env(safe-area-inset-left));
|
673 |
+
padding-right: max(12px, env(safe-area-inset-right));
|
674 |
+
}
|
675 |
+
}
|
676 |
+
}
|
677 |
+
/* Share */
|
678 |
+
|
679 |
+
.fancybox-share {
|
680 |
+
background: #f4f4f4;
|
681 |
+
border-radius: 3px;
|
682 |
+
max-width: 90%;
|
683 |
+
padding: 30px;
|
684 |
+
text-align: center;
|
685 |
+
}
|
686 |
+
|
687 |
+
.fancybox-share h1 {
|
688 |
+
color: #222;
|
689 |
+
font-size: 35px;
|
690 |
+
font-weight: 700;
|
691 |
+
margin: 0 0 20px 0;
|
692 |
+
}
|
693 |
+
|
694 |
+
.fancybox-share p {
|
695 |
+
margin: 0;
|
696 |
+
padding: 0;
|
697 |
+
}
|
698 |
+
|
699 |
+
.fancybox-share__button {
|
700 |
+
border: 0;
|
701 |
+
border-radius: 3px;
|
702 |
+
display: inline-block;
|
703 |
+
font-size: 14px;
|
704 |
+
font-weight: 700;
|
705 |
+
line-height: 40px;
|
706 |
+
margin: 0 5px 10px 5px;
|
707 |
+
min-width: 130px;
|
708 |
+
padding: 0 15px;
|
709 |
+
text-decoration: none;
|
710 |
+
transition: all .2s;
|
711 |
+
-webkit-user-select: none;
|
712 |
+
-moz-user-select: none;
|
713 |
+
-ms-user-select: none;
|
714 |
+
user-select: none;
|
715 |
+
white-space: nowrap;
|
716 |
+
}
|
717 |
+
|
718 |
+
.fancybox-share__button:visited,
|
719 |
+
.fancybox-share__button:link {
|
720 |
+
color: #fff;
|
721 |
+
}
|
722 |
+
|
723 |
+
.fancybox-share__button:hover {
|
724 |
+
text-decoration: none;
|
725 |
+
}
|
726 |
+
|
727 |
+
.fancybox-share__button--fb {
|
728 |
+
background: #3b5998;
|
729 |
+
}
|
730 |
+
|
731 |
+
.fancybox-share__button--fb:hover {
|
732 |
+
background: #344e86;
|
733 |
+
}
|
734 |
+
|
735 |
+
.fancybox-share__button--pt {
|
736 |
+
background: #bd081d;
|
737 |
+
}
|
738 |
+
|
739 |
+
.fancybox-share__button--pt:hover {
|
740 |
+
background: #aa0719;
|
741 |
+
}
|
742 |
+
|
743 |
+
.fancybox-share__button--tw {
|
744 |
+
background: #1da1f2;
|
745 |
+
}
|
746 |
+
|
747 |
+
.fancybox-share__button--tw:hover {
|
748 |
+
background: #0d95e8;
|
749 |
+
}
|
750 |
+
|
751 |
+
.fancybox-share__button svg {
|
752 |
+
height: 25px;
|
753 |
+
margin-right: 7px;
|
754 |
+
position: relative;
|
755 |
+
top: -1px;
|
756 |
+
vertical-align: middle;
|
757 |
+
width: 25px;
|
758 |
+
}
|
759 |
+
|
760 |
+
.fancybox-share__button svg path {
|
761 |
+
fill: #fff;
|
762 |
+
}
|
763 |
+
|
764 |
+
.fancybox-share__input {
|
765 |
+
background: transparent;
|
766 |
+
border: 0;
|
767 |
+
border-bottom: 1px solid #d7d7d7;
|
768 |
+
border-radius: 0;
|
769 |
+
color: #5d5b5b;
|
770 |
+
font-size: 14px;
|
771 |
+
margin: 10px 0 0 0;
|
772 |
+
outline: none;
|
773 |
+
padding: 10px 15px;
|
774 |
+
width: 100%;
|
775 |
+
}
|
776 |
+
/* Thumbs */
|
777 |
+
|
778 |
+
.fancybox-thumbs {
|
779 |
+
background: #ddd;
|
780 |
+
bottom: 0;
|
781 |
+
display: none;
|
782 |
+
margin: 0;
|
783 |
+
-webkit-overflow-scrolling: touch;
|
784 |
+
-ms-overflow-style: -ms-autohiding-scrollbar;
|
785 |
+
padding: 2px 2px 4px 2px;
|
786 |
+
position: absolute;
|
787 |
+
right: 0;
|
788 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
789 |
+
top: 0;
|
790 |
+
width: 212px;
|
791 |
+
z-index: 99995;
|
792 |
+
}
|
793 |
+
|
794 |
+
.fancybox-thumbs-x {
|
795 |
+
overflow-x: auto;
|
796 |
+
overflow-y: hidden;
|
797 |
+
}
|
798 |
+
|
799 |
+
.fancybox-show-thumbs .fancybox-thumbs {
|
800 |
+
display: block;
|
801 |
+
}
|
802 |
+
|
803 |
+
.fancybox-show-thumbs .fancybox-inner {
|
804 |
+
right: 212px;
|
805 |
+
}
|
806 |
+
|
807 |
+
.fancybox-thumbs__list {
|
808 |
+
font-size: 0;
|
809 |
+
height: 100%;
|
810 |
+
list-style: none;
|
811 |
+
margin: 0;
|
812 |
+
overflow-x: hidden;
|
813 |
+
overflow-y: auto;
|
814 |
+
padding: 0;
|
815 |
+
position: absolute;
|
816 |
+
position: relative;
|
817 |
+
white-space: nowrap;
|
818 |
+
width: 100%;
|
819 |
+
}
|
820 |
+
|
821 |
+
.fancybox-thumbs-x .fancybox-thumbs__list {
|
822 |
+
overflow: hidden;
|
823 |
+
}
|
824 |
+
|
825 |
+
.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar {
|
826 |
+
width: 7px;
|
827 |
+
}
|
828 |
+
|
829 |
+
.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track {
|
830 |
+
background: #fff;
|
831 |
+
border-radius: 10px;
|
832 |
+
box-shadow: inset 0 0 6px rgba(0, 0, 0, .3);
|
833 |
+
}
|
834 |
+
|
835 |
+
.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb {
|
836 |
+
background: #2a2a2a;
|
837 |
+
border-radius: 10px;
|
838 |
+
}
|
839 |
+
|
840 |
+
.fancybox-thumbs__list a {
|
841 |
+
-webkit-backface-visibility: hidden;
|
842 |
+
backface-visibility: hidden;
|
843 |
+
background-color: rgba(0, 0, 0, .1);
|
844 |
+
background-position: center center;
|
845 |
+
background-repeat: no-repeat;
|
846 |
+
background-size: cover;
|
847 |
+
cursor: pointer;
|
848 |
+
float: left;
|
849 |
+
height: 75px;
|
850 |
+
margin: 2px;
|
851 |
+
max-height: calc(100% - 8px);
|
852 |
+
max-width: calc(50% - 4px);
|
853 |
+
outline: none;
|
854 |
+
overflow: hidden;
|
855 |
+
padding: 0;
|
856 |
+
position: relative;
|
857 |
+
-webkit-tap-highlight-color: transparent;
|
858 |
+
width: 100px;
|
859 |
+
}
|
860 |
+
|
861 |
+
.fancybox-thumbs__list a::before {
|
862 |
+
border: 6px solid #ff5268;
|
863 |
+
bottom: 0;
|
864 |
+
content: '';
|
865 |
+
left: 0;
|
866 |
+
opacity: 0;
|
867 |
+
position: absolute;
|
868 |
+
right: 0;
|
869 |
+
top: 0;
|
870 |
+
transition: all .2s cubic-bezier(.25, .46, .45, .94);
|
871 |
+
z-index: 99991;
|
872 |
+
}
|
873 |
+
|
874 |
+
.fancybox-thumbs__list a:focus::before {
|
875 |
+
opacity: .5;
|
876 |
+
}
|
877 |
+
|
878 |
+
.fancybox-thumbs__list a.fancybox-thumbs-active::before {
|
879 |
+
opacity: 1;
|
880 |
+
}
|
881 |
+
|
882 |
+
/* Styling for Small-Screen Devices */
|
883 |
+
@media all and (max-width: 576px) {
|
884 |
+
.fancybox-thumbs {
|
885 |
+
width: 110px;
|
886 |
+
}
|
887 |
+
|
888 |
+
.fancybox-show-thumbs .fancybox-inner {
|
889 |
+
right: 110px;
|
890 |
+
}
|
891 |
+
|
892 |
+
.fancybox-thumbs__list a {
|
893 |
+
max-width: calc(100% - 10px);
|
894 |
+
}
|
895 |
+
}
|
fancybox/3.5.7/jquery.fancybox.js
ADDED
@@ -0,0 +1,5632 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
// ==================================================
|
2 |
+
// fancyBox v3.5.7
|
3 |
+
//
|
4 |
+
// Licensed GPLv3 for open source use
|
5 |
+
// or fancyBox Commercial License for commercial use
|
6 |
+
//
|
7 |
+
// http://fancyapps.com/fancybox/
|
8 |
+
// Copyright 2019 fancyApps
|
9 |
+
//
|
10 |
+
// ==================================================
|
11 |
+
(function (window, document, $, undefined) {
|
12 |
+
"use strict";
|
13 |
+
|
14 |
+
window.console = window.console || {
|
15 |
+
info: function (stuff) {}
|
16 |
+
};
|
17 |
+
|
18 |
+
// If there's no jQuery, fancyBox can't work
|
19 |
+
// =========================================
|
20 |
+
|
21 |
+
if (!$) {
|
22 |
+
return;
|
23 |
+
}
|
24 |
+
|
25 |
+
// Check if fancyBox is already initialized
|
26 |
+
// ========================================
|
27 |
+
|
28 |
+
if ($.fn.fancybox) {
|
29 |
+
console.info("fancyBox already initialized");
|
30 |
+
|
31 |
+
return;
|
32 |
+
}
|
33 |
+
|
34 |
+
// Private default settings
|
35 |
+
// ========================
|
36 |
+
|
37 |
+
var defaults = {
|
38 |
+
// Close existing modals
|
39 |
+
// Set this to false if you do not need to stack multiple instances
|
40 |
+
closeExisting: false,
|
41 |
+
|
42 |
+
// Enable infinite gallery navigation
|
43 |
+
loop: false,
|
44 |
+
|
45 |
+
// Horizontal space between slides
|
46 |
+
gutter: 50,
|
47 |
+
|
48 |
+
// Enable keyboard navigation
|
49 |
+
keyboard: true,
|
50 |
+
|
51 |
+
// Should allow caption to overlap the content
|
52 |
+
preventCaptionOverlap: true,
|
53 |
+
|
54 |
+
// Should display navigation arrows at the screen edges
|
55 |
+
arrows: true,
|
56 |
+
|
57 |
+
// Should display counter at the top left corner
|
58 |
+
infobar: true,
|
59 |
+
|
60 |
+
// Should display close button (using `btnTpl.smallBtn` template) over the content
|
61 |
+
// Can be true, false, "auto"
|
62 |
+
// If "auto" - will be automatically enabled for "html", "inline" or "ajax" items
|
63 |
+
smallBtn: "auto",
|
64 |
+
|
65 |
+
// Should display toolbar (buttons at the top)
|
66 |
+
// Can be true, false, "auto"
|
67 |
+
// If "auto" - will be automatically hidden if "smallBtn" is enabled
|
68 |
+
toolbar: "auto",
|
69 |
+
|
70 |
+
// What buttons should appear in the top right corner.
|
71 |
+
// Buttons will be created using templates from `btnTpl` option
|
72 |
+
// and they will be placed into toolbar (class="fancybox-toolbar"` element)
|
73 |
+
buttons: [
|
74 |
+
"zoom",
|
75 |
+
//"share",
|
76 |
+
"slideShow",
|
77 |
+
//"fullScreen",
|
78 |
+
//"download",
|
79 |
+
"thumbs",
|
80 |
+
"close"
|
81 |
+
],
|
82 |
+
|
83 |
+
// Detect "idle" time in seconds
|
84 |
+
idleTime: 3,
|
85 |
+
|
86 |
+
// Disable right-click and use simple image protection for images
|
87 |
+
protect: false,
|
88 |
+
|
89 |
+
// Shortcut to make content "modal" - disable keyboard navigtion, hide buttons, etc
|
90 |
+
modal: false,
|
91 |
+
|
92 |
+
image: {
|
93 |
+
// Wait for images to load before displaying
|
94 |
+
// true - wait for image to load and then display;
|
95 |
+
// false - display thumbnail and load the full-sized image over top,
|
96 |
+
// requires predefined image dimensions (`data-width` and `data-height` attributes)
|
97 |
+
preload: false
|
98 |
+
},
|
99 |
+
|
100 |
+
ajax: {
|
101 |
+
// Object containing settings for ajax request
|
102 |
+
settings: {
|
103 |
+
// This helps to indicate that request comes from the modal
|
104 |
+
// Feel free to change naming
|
105 |
+
data: {
|
106 |
+
fancybox: true
|
107 |
+
}
|
108 |
+
}
|
109 |
+
},
|
110 |
+
|
111 |
+
iframe: {
|
112 |
+
// Iframe template
|
113 |
+
tpl: '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',
|
114 |
+
|
115 |
+
// Preload iframe before displaying it
|
116 |
+
// This allows to calculate iframe content width and height
|
117 |
+
// (note: Due to "Same Origin Policy", you can't get cross domain data).
|
118 |
+
preload: true,
|
119 |
+
|
120 |
+
// Custom CSS styling for iframe wrapping element
|
121 |
+
// You can use this to set custom iframe dimensions
|
122 |
+
css: {},
|
123 |
+
|
124 |
+
// Iframe tag attributes
|
125 |
+
attr: {
|
126 |
+
scrolling: "auto"
|
127 |
+
}
|
128 |
+
},
|
129 |
+
|
130 |
+
// For HTML5 video only
|
131 |
+
video: {
|
132 |
+
tpl: '<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}">' +
|
133 |
+
'<source src="{{src}}" type="{{format}}" />' +
|
134 |
+
'Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!' +
|
135 |
+
"</video>",
|
136 |
+
format: "", // custom video format
|
137 |
+
autoStart: true
|
138 |
+
},
|
139 |
+
|
140 |
+
// Default content type if cannot be detected automatically
|
141 |
+
defaultType: "image",
|
142 |
+
|
143 |
+
// Open/close animation type
|
144 |
+
// Possible values:
|
145 |
+
// false - disable
|
146 |
+
// "zoom" - zoom images from/to thumbnail
|
147 |
+
// "fade"
|
148 |
+
// "zoom-in-out"
|
149 |
+
//
|
150 |
+
animationEffect: "zoom",
|
151 |
+
|
152 |
+
// Duration in ms for open/close animation
|
153 |
+
animationDuration: 366,
|
154 |
+
|
155 |
+
// Should image change opacity while zooming
|
156 |
+
// If opacity is "auto", then opacity will be changed if image and thumbnail have different aspect ratios
|
157 |
+
zoomOpacity: "auto",
|
158 |
+
|
159 |
+
// Transition effect between slides
|
160 |
+
//
|
161 |
+
// Possible values:
|
162 |
+
// false - disable
|
163 |
+
// "fade'
|
164 |
+
// "slide'
|
165 |
+
// "circular'
|
166 |
+
// "tube'
|
167 |
+
// "zoom-in-out'
|
168 |
+
// "rotate'
|
169 |
+
//
|
170 |
+
transitionEffect: "fade",
|
171 |
+
|
172 |
+
// Duration in ms for transition animation
|
173 |
+
transitionDuration: 366,
|
174 |
+
|
175 |
+
// Custom CSS class for slide element
|
176 |
+
slideClass: "",
|
177 |
+
|
178 |
+
// Custom CSS class for layout
|
179 |
+
baseClass: "",
|
180 |
+
|
181 |
+
// Base template for layout
|
182 |
+
baseTpl: '<div class="fancybox-container" role="dialog" tabindex="-1">' +
|
183 |
+
'<div class="fancybox-bg"></div>' +
|
184 |
+
'<div class="fancybox-inner">' +
|
185 |
+
'<div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div>' +
|
186 |
+
'<div class="fancybox-toolbar">{{buttons}}</div>' +
|
187 |
+
'<div class="fancybox-navigation">{{arrows}}</div>' +
|
188 |
+
'<div class="fancybox-stage"></div>' +
|
189 |
+
'<div class="fancybox-caption"><div class="fancybox-caption__body"></div></div>' +
|
190 |
+
"</div>" +
|
191 |
+
"</div>",
|
192 |
+
|
193 |
+
// Loading indicator template
|
194 |
+
spinnerTpl: '<div class="fancybox-loading"></div>',
|
195 |
+
|
196 |
+
// Error message template
|
197 |
+
errorTpl: '<div class="fancybox-error"><p>{{ERROR}}</p></div>',
|
198 |
+
|
199 |
+
btnTpl: {
|
200 |
+
download: '<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;">' +
|
201 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg>' +
|
202 |
+
"</a>",
|
203 |
+
|
204 |
+
zoom: '<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}">' +
|
205 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg>' +
|
206 |
+
"</button>",
|
207 |
+
|
208 |
+
close: '<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}">' +
|
209 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg>' +
|
210 |
+
"</button>",
|
211 |
+
|
212 |
+
// Arrows
|
213 |
+
arrowLeft: '<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}">' +
|
214 |
+
'<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div>' +
|
215 |
+
"</button>",
|
216 |
+
|
217 |
+
arrowRight: '<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}">' +
|
218 |
+
'<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div>' +
|
219 |
+
"</button>",
|
220 |
+
|
221 |
+
// This small close button will be appended to your html/inline/ajax content by default,
|
222 |
+
// if "smallBtn" option is not set to false
|
223 |
+
smallBtn: '<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}">' +
|
224 |
+
'<svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg>' +
|
225 |
+
"</button>"
|
226 |
+
},
|
227 |
+
|
228 |
+
// Container is injected into this element
|
229 |
+
parentEl: "body",
|
230 |
+
|
231 |
+
// Hide browser vertical scrollbars; use at your own risk
|
232 |
+
hideScrollbar: true,
|
233 |
+
|
234 |
+
// Focus handling
|
235 |
+
// ==============
|
236 |
+
|
237 |
+
// Try to focus on the first focusable element after opening
|
238 |
+
autoFocus: true,
|
239 |
+
|
240 |
+
// Put focus back to active element after closing
|
241 |
+
backFocus: true,
|
242 |
+
|
243 |
+
// Do not let user to focus on element outside modal content
|
244 |
+
trapFocus: true,
|
245 |
+
|
246 |
+
// Module specific options
|
247 |
+
// =======================
|
248 |
+
|
249 |
+
fullScreen: {
|
250 |
+
autoStart: false
|
251 |
+
},
|
252 |
+
|
253 |
+
// Set `touch: false` to disable panning/swiping
|
254 |
+
touch: {
|
255 |
+
vertical: true, // Allow to drag content vertically
|
256 |
+
momentum: true // Continue movement after releasing mouse/touch when panning
|
257 |
+
},
|
258 |
+
|
259 |
+
// Hash value when initializing manually,
|
260 |
+
// set `false` to disable hash change
|
261 |
+
hash: null,
|
262 |
+
|
263 |
+
// Customize or add new media types
|
264 |
+
// Example:
|
265 |
+
/*
|
266 |
+
media : {
|
267 |
+
youtube : {
|
268 |
+
params : {
|
269 |
+
autoplay : 0
|
270 |
+
}
|
271 |
+
}
|
272 |
+
}
|
273 |
+
*/
|
274 |
+
media: {},
|
275 |
+
|
276 |
+
slideShow: {
|
277 |
+
autoStart: false,
|
278 |
+
speed: 3000
|
279 |
+
},
|
280 |
+
|
281 |
+
thumbs: {
|
282 |
+
autoStart: false, // Display thumbnails on opening
|
283 |
+
hideOnClose: true, // Hide thumbnail grid when closing animation starts
|
284 |
+
parentEl: ".fancybox-container", // Container is injected into this element
|
285 |
+
axis: "y" // Vertical (y) or horizontal (x) scrolling
|
286 |
+
},
|
287 |
+
|
288 |
+
// Use mousewheel to navigate gallery
|
289 |
+
// If 'auto' - enabled for images only
|
290 |
+
wheel: "auto",
|
291 |
+
|
292 |
+
// Callbacks
|
293 |
+
//==========
|
294 |
+
|
295 |
+
// See Documentation/API/Events for more information
|
296 |
+
// Example:
|
297 |
+
/*
|
298 |
+
afterShow: function( instance, current ) {
|
299 |
+
console.info( 'Clicked element:' );
|
300 |
+
console.info( current.opts.$orig );
|
301 |
+
}
|
302 |
+
*/
|
303 |
+
|
304 |
+
onInit: $.noop, // When instance has been initialized
|
305 |
+
|
306 |
+
beforeLoad: $.noop, // Before the content of a slide is being loaded
|
307 |
+
afterLoad: $.noop, // When the content of a slide is done loading
|
308 |
+
|
309 |
+
beforeShow: $.noop, // Before open animation starts
|
310 |
+
afterShow: $.noop, // When content is done loading and animating
|
311 |
+
|
312 |
+
beforeClose: $.noop, // Before the instance attempts to close. Return false to cancel the close.
|
313 |
+
afterClose: $.noop, // After instance has been closed
|
314 |
+
|
315 |
+
onActivate: $.noop, // When instance is brought to front
|
316 |
+
onDeactivate: $.noop, // When other instance has been activated
|
317 |
+
|
318 |
+
// Interaction
|
319 |
+
// ===========
|
320 |
+
|
321 |
+
// Use options below to customize taken action when user clicks or double clicks on the fancyBox area,
|
322 |
+
// each option can be string or method that returns value.
|
323 |
+
//
|
324 |
+
// Possible values:
|
325 |
+
// "close" - close instance
|
326 |
+
// "next" - move to next gallery item
|
327 |
+
// "nextOrClose" - move to next gallery item or close if gallery has only one item
|
328 |
+
// "toggleControls" - show/hide controls
|
329 |
+
// "zoom" - zoom image (if loaded)
|
330 |
+
// false - do nothing
|
331 |
+
|
332 |
+
// Clicked on the content
|
333 |
+
clickContent: function (current, event) {
|
334 |
+
return current.type === "image" ? "zoom" : false;
|
335 |
+
},
|
336 |
+
|
337 |
+
// Clicked on the slide
|
338 |
+
clickSlide: "close",
|
339 |
+
|
340 |
+
// Clicked on the background (backdrop) element;
|
341 |
+
// if you have not changed the layout, then most likely you need to use `clickSlide` option
|
342 |
+
clickOutside: "close",
|
343 |
+
|
344 |
+
// Same as previous two, but for double click
|
345 |
+
dblclickContent: false,
|
346 |
+
dblclickSlide: false,
|
347 |
+
dblclickOutside: false,
|
348 |
+
|
349 |
+
// Custom options when mobile device is detected
|
350 |
+
// =============================================
|
351 |
+
|
352 |
+
mobile: {
|
353 |
+
preventCaptionOverlap: false,
|
354 |
+
idleTime: false,
|
355 |
+
clickContent: function (current, event) {
|
356 |
+
return current.type === "image" ? "toggleControls" : false;
|
357 |
+
},
|
358 |
+
clickSlide: function (current, event) {
|
359 |
+
return current.type === "image" ? "toggleControls" : "close";
|
360 |
+
},
|
361 |
+
dblclickContent: function (current, event) {
|
362 |
+
return current.type === "image" ? "zoom" : false;
|
363 |
+
},
|
364 |
+
dblclickSlide: function (current, event) {
|
365 |
+
return current.type === "image" ? "zoom" : false;
|
366 |
+
}
|
367 |
+
},
|
368 |
+
|
369 |
+
// Internationalization
|
370 |
+
// ====================
|
371 |
+
|
372 |
+
lang: "en",
|
373 |
+
i18n: {
|
374 |
+
en: {
|
375 |
+
CLOSE: "Close",
|
376 |
+
NEXT: "Next",
|
377 |
+
PREV: "Previous",
|
378 |
+
ERROR: "The requested content cannot be loaded. <br/> Please try again later.",
|
379 |
+
PLAY_START: "Start slideshow",
|
380 |
+
PLAY_STOP: "Pause slideshow",
|
381 |
+
FULL_SCREEN: "Full screen",
|
382 |
+
THUMBS: "Thumbnails",
|
383 |
+
DOWNLOAD: "Download",
|
384 |
+
SHARE: "Share",
|
385 |
+
ZOOM: "Zoom"
|
386 |
+
},
|
387 |
+
de: {
|
388 |
+
CLOSE: "Schließen",
|
389 |
+
NEXT: "Weiter",
|
390 |
+
PREV: "Zurück",
|
391 |
+
ERROR: "Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",
|
392 |
+
PLAY_START: "Diaschau starten",
|
393 |
+
PLAY_STOP: "Diaschau beenden",
|
394 |
+
FULL_SCREEN: "Vollbild",
|
395 |
+
THUMBS: "Vorschaubilder",
|
396 |
+
DOWNLOAD: "Herunterladen",
|
397 |
+
SHARE: "Teilen",
|
398 |
+
ZOOM: "Vergrößern"
|
399 |
+
}
|
400 |
+
}
|
401 |
+
};
|
402 |
+
|
403 |
+
// Few useful variables and methods
|
404 |
+
// ================================
|
405 |
+
|
406 |
+
var $W = $(window);
|
407 |
+
var $D = $(document);
|
408 |
+
|
409 |
+
var called = 0;
|
410 |
+
|
411 |
+
// Check if an object is a jQuery object and not a native JavaScript object
|
412 |
+
// ========================================================================
|
413 |
+
var isQuery = function (obj) {
|
414 |
+
return obj && obj.hasOwnProperty && obj instanceof $;
|
415 |
+
};
|
416 |
+
|
417 |
+
// Handle multiple browsers for "requestAnimationFrame" and "cancelAnimationFrame"
|
418 |
+
// ===============================================================================
|
419 |
+
var requestAFrame = (function () {
|
420 |
+
return (
|
421 |
+
window.requestAnimationFrame ||
|
422 |
+
window.webkitRequestAnimationFrame ||
|
423 |
+
window.mozRequestAnimationFrame ||
|
424 |
+
window.oRequestAnimationFrame ||
|
425 |
+
// if all else fails, use setTimeout
|
426 |
+
function (callback) {
|
427 |
+
return window.setTimeout(callback, 1000 / 60);
|
428 |
+
}
|
429 |
+
);
|
430 |
+
})();
|
431 |
+
|
432 |
+
var cancelAFrame = (function () {
|
433 |
+
return (
|
434 |
+
window.cancelAnimationFrame ||
|
435 |
+
window.webkitCancelAnimationFrame ||
|
436 |
+
window.mozCancelAnimationFrame ||
|
437 |
+
window.oCancelAnimationFrame ||
|
438 |
+
function (id) {
|
439 |
+
window.clearTimeout(id);
|
440 |
+
}
|
441 |
+
);
|
442 |
+
})();
|
443 |
+
|
444 |
+
// Detect the supported transition-end event property name
|
445 |
+
// =======================================================
|
446 |
+
var transitionEnd = (function () {
|
447 |
+
var el = document.createElement("fakeelement"),
|
448 |
+
t;
|
449 |
+
|
450 |
+
var transitions = {
|
451 |
+
transition: "transitionend",
|
452 |
+
OTransition: "oTransitionEnd",
|
453 |
+
MozTransition: "transitionend",
|
454 |
+
WebkitTransition: "webkitTransitionEnd"
|
455 |
+
};
|
456 |
+
|
457 |
+
for (t in transitions) {
|
458 |
+
if (el.style[t] !== undefined) {
|
459 |
+
return transitions[t];
|
460 |
+
}
|
461 |
+
}
|
462 |
+
|
463 |
+
return "transitionend";
|
464 |
+
})();
|
465 |
+
|
466 |
+
// Force redraw on an element.
|
467 |
+
// This helps in cases where the browser doesn't redraw an updated element properly
|
468 |
+
// ================================================================================
|
469 |
+
var forceRedraw = function ($el) {
|
470 |
+
return $el && $el.length && $el[0].offsetHeight;
|
471 |
+
};
|
472 |
+
|
473 |
+
// Exclude array (`buttons`) options from deep merging
|
474 |
+
// ===================================================
|
475 |
+
var mergeOpts = function (opts1, opts2) {
|
476 |
+
var rez = $.extend(true, {}, opts1, opts2);
|
477 |
+
|
478 |
+
$.each(opts2, function (key, value) {
|
479 |
+
if ($.isArray(value)) {
|
480 |
+
rez[key] = value;
|
481 |
+
}
|
482 |
+
});
|
483 |
+
|
484 |
+
return rez;
|
485 |
+
};
|
486 |
+
|
487 |
+
// How much of an element is visible in viewport
|
488 |
+
// =============================================
|
489 |
+
|
490 |
+
var inViewport = function (elem) {
|
491 |
+
var elemCenter, rez;
|
492 |
+
|
493 |
+
if (!elem || elem.ownerDocument !== document) {
|
494 |
+
return false;
|
495 |
+
}
|
496 |
+
|
497 |
+
$(".fancybox-container").css("pointer-events", "none");
|
498 |
+
|
499 |
+
elemCenter = {
|
500 |
+
x: elem.getBoundingClientRect().left + elem.offsetWidth / 2,
|
501 |
+
y: elem.getBoundingClientRect().top + elem.offsetHeight / 2
|
502 |
+
};
|
503 |
+
|
504 |
+
rez = document.elementFromPoint(elemCenter.x, elemCenter.y) === elem;
|
505 |
+
|
506 |
+
$(".fancybox-container").css("pointer-events", "");
|
507 |
+
|
508 |
+
return rez;
|
509 |
+
};
|
510 |
+
|
511 |
+
// Class definition
|
512 |
+
// ================
|
513 |
+
|
514 |
+
var FancyBox = function (content, opts, index) {
|
515 |
+
var self = this;
|
516 |
+
|
517 |
+
self.opts = mergeOpts({
|
518 |
+
index: index
|
519 |
+
}, $.fancybox.defaults);
|
520 |
+
|
521 |
+
if ($.isPlainObject(opts)) {
|
522 |
+
self.opts = mergeOpts(self.opts, opts);
|
523 |
+
}
|
524 |
+
|
525 |
+
if ($.fancybox.isMobile) {
|
526 |
+
self.opts = mergeOpts(self.opts, self.opts.mobile);
|
527 |
+
}
|
528 |
+
|
529 |
+
self.id = self.opts.id || ++called;
|
530 |
+
|
531 |
+
self.currIndex = parseInt(self.opts.index, 10) || 0;
|
532 |
+
self.prevIndex = null;
|
533 |
+
|
534 |
+
self.prevPos = null;
|
535 |
+
self.currPos = 0;
|
536 |
+
|
537 |
+
self.firstRun = true;
|
538 |
+
|
539 |
+
// All group items
|
540 |
+
self.group = [];
|
541 |
+
|
542 |
+
// Existing slides (for current, next and previous gallery items)
|
543 |
+
self.slides = {};
|
544 |
+
|
545 |
+
// Create group elements
|
546 |
+
self.addContent(content);
|
547 |
+
|
548 |
+
if (!self.group.length) {
|
549 |
+
return;
|
550 |
+
}
|
551 |
+
|
552 |
+
self.init();
|
553 |
+
};
|
554 |
+
|
555 |
+
$.extend(FancyBox.prototype, {
|
556 |
+
// Create DOM structure
|
557 |
+
// ====================
|
558 |
+
|
559 |
+
init: function () {
|
560 |
+
var self = this,
|
561 |
+
firstItem = self.group[self.currIndex],
|
562 |
+
firstItemOpts = firstItem.opts,
|
563 |
+
$container,
|
564 |
+
buttonStr;
|
565 |
+
|
566 |
+
if (firstItemOpts.closeExisting) {
|
567 |
+
$.fancybox.close(true);
|
568 |
+
}
|
569 |
+
|
570 |
+
// Hide scrollbars
|
571 |
+
// ===============
|
572 |
+
|
573 |
+
$("body").addClass("fancybox-active");
|
574 |
+
|
575 |
+
if (
|
576 |
+
!$.fancybox.getInstance() &&
|
577 |
+
firstItemOpts.hideScrollbar !== false &&
|
578 |
+
!$.fancybox.isMobile &&
|
579 |
+
document.body.scrollHeight > window.innerHeight
|
580 |
+
) {
|
581 |
+
$("head").append(
|
582 |
+
'<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:' +
|
583 |
+
(window.innerWidth - document.documentElement.clientWidth) +
|
584 |
+
"px;}</style>"
|
585 |
+
);
|
586 |
+
|
587 |
+
$("body").addClass("compensate-for-scrollbar");
|
588 |
+
}
|
589 |
+
|
590 |
+
// Build html markup and set references
|
591 |
+
// ====================================
|
592 |
+
|
593 |
+
// Build html code for buttons and insert into main template
|
594 |
+
buttonStr = "";
|
595 |
+
|
596 |
+
$.each(firstItemOpts.buttons, function (index, value) {
|
597 |
+
buttonStr += firstItemOpts.btnTpl[value] || "";
|
598 |
+
});
|
599 |
+
|
600 |
+
// Create markup from base template, it will be initially hidden to
|
601 |
+
// avoid unnecessary work like painting while initializing is not complete
|
602 |
+
$container = $(
|
603 |
+
self.translate(
|
604 |
+
self,
|
605 |
+
firstItemOpts.baseTpl
|
606 |
+
.replace("{{buttons}}", buttonStr)
|
607 |
+
.replace("{{arrows}}", firstItemOpts.btnTpl.arrowLeft + firstItemOpts.btnTpl.arrowRight)
|
608 |
+
)
|
609 |
+
)
|
610 |
+
.attr("id", "fancybox-container-" + self.id)
|
611 |
+
.addClass(firstItemOpts.baseClass)
|
612 |
+
.data("FancyBox", self)
|
613 |
+
.appendTo(firstItemOpts.parentEl);
|
614 |
+
|
615 |
+
// Create object holding references to jQuery wrapped nodes
|
616 |
+
self.$refs = {
|
617 |
+
container: $container
|
618 |
+
};
|
619 |
+
|
620 |
+
["bg", "inner", "infobar", "toolbar", "stage", "caption", "navigation"].forEach(function (item) {
|
621 |
+
self.$refs[item] = $container.find(".fancybox-" + item);
|
622 |
+
});
|
623 |
+
|
624 |
+
self.trigger("onInit");
|
625 |
+
|
626 |
+
// Enable events, deactive previous instances
|
627 |
+
self.activate();
|
628 |
+
|
629 |
+
// Build slides, load and reveal content
|
630 |
+
self.jumpTo(self.currIndex);
|
631 |
+
},
|
632 |
+
|
633 |
+
// Simple i18n support - replaces object keys found in template
|
634 |
+
// with corresponding values
|
635 |
+
// ============================================================
|
636 |
+
|
637 |
+
translate: function (obj, str) {
|
638 |
+
var arr = obj.opts.i18n[obj.opts.lang] || obj.opts.i18n.en;
|
639 |
+
|
640 |
+
return str.replace(/\{\{(\w+)\}\}/g, function (match, n) {
|
641 |
+
return arr[n] === undefined ? match : arr[n];
|
642 |
+
});
|
643 |
+
},
|
644 |
+
|
645 |
+
// Populate current group with fresh content
|
646 |
+
// Check if each object has valid type and content
|
647 |
+
// ===============================================
|
648 |
+
|
649 |
+
addContent: function (content) {
|
650 |
+
var self = this,
|
651 |
+
items = $.makeArray(content),
|
652 |
+
thumbs;
|
653 |
+
|
654 |
+
$.each(items, function (i, item) {
|
655 |
+
var obj = {},
|
656 |
+
opts = {},
|
657 |
+
$item,
|
658 |
+
type,
|
659 |
+
found,
|
660 |
+
src,
|
661 |
+
srcParts;
|
662 |
+
|
663 |
+
// Step 1 - Make sure we have an object
|
664 |
+
// ====================================
|
665 |
+
|
666 |
+
if ($.isPlainObject(item)) {
|
667 |
+
// We probably have manual usage here, something like
|
668 |
+
// $.fancybox.open( [ { src : "image.jpg", type : "image" } ] )
|
669 |
+
|
670 |
+
obj = item;
|
671 |
+
opts = item.opts || item;
|
672 |
+
} else if ($.type(item) === "object" && $(item).length) {
|
673 |
+
// Here we probably have jQuery collection returned by some selector
|
674 |
+
$item = $(item);
|
675 |
+
|
676 |
+
// Support attributes like `data-options='{"touch" : false}'` and `data-touch='false'`
|
677 |
+
opts = $item.data() || {};
|
678 |
+
opts = $.extend(true, {}, opts, opts.options);
|
679 |
+
|
680 |
+
// Here we store clicked element
|
681 |
+
opts.$orig = $item;
|
682 |
+
|
683 |
+
obj.src = self.opts.src || opts.src || $item.attr("href");
|
684 |
+
|
685 |
+
// Assume that simple syntax is used, for example:
|
686 |
+
// `$.fancybox.open( $("#test"), {} );`
|
687 |
+
if (!obj.type && !obj.src) {
|
688 |
+
obj.type = "inline";
|
689 |
+
obj.src = item;
|
690 |
+
}
|
691 |
+
} else {
|
692 |
+
// Assume we have a simple html code, for example:
|
693 |
+
// $.fancybox.open( '<div><h1>Hi!</h1></div>' );
|
694 |
+
obj = {
|
695 |
+
type: "html",
|
696 |
+
src: item + ""
|
697 |
+
};
|
698 |
+
}
|
699 |
+
|
700 |
+
// Each gallery object has full collection of options
|
701 |
+
obj.opts = $.extend(true, {}, self.opts, opts);
|
702 |
+
|
703 |
+
// Do not merge buttons array
|
704 |
+
if ($.isArray(opts.buttons)) {
|
705 |
+
obj.opts.buttons = opts.buttons;
|
706 |
+
}
|
707 |
+
|
708 |
+
if ($.fancybox.isMobile && obj.opts.mobile) {
|
709 |
+
obj.opts = mergeOpts(obj.opts, obj.opts.mobile);
|
710 |
+
}
|
711 |
+
|
712 |
+
// Step 2 - Make sure we have content type, if not - try to guess
|
713 |
+
// ==============================================================
|
714 |
+
|
715 |
+
type = obj.type || obj.opts.type;
|
716 |
+
src = obj.src || "";
|
717 |
+
|
718 |
+
if (!type && src) {
|
719 |
+
if ((found = src.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))) {
|
720 |
+
type = "video";
|
721 |
+
|
722 |
+
if (!obj.opts.video.format) {
|
723 |
+
obj.opts.video.format = "video/" + (found[1] === "ogv" ? "ogg" : found[1]);
|
724 |
+
}
|
725 |
+
} else if (src.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)) {
|
726 |
+
type = "image";
|
727 |
+
} else if (src.match(/\.(pdf)((\?|#).*)?$/i)) {
|
728 |
+
type = "iframe";
|
729 |
+
obj = $.extend(true, obj, {
|
730 |
+
contentType: "pdf",
|
731 |
+
opts: {
|
732 |
+
iframe: {
|
733 |
+
preload: false
|
734 |
+
}
|
735 |
+
}
|
736 |
+
});
|
737 |
+
} else if (src.charAt(0) === "#") {
|
738 |
+
type = "inline";
|
739 |
+
}
|
740 |
+
}
|
741 |
+
|
742 |
+
if (type) {
|
743 |
+
obj.type = type;
|
744 |
+
} else {
|
745 |
+
self.trigger("objectNeedsType", obj);
|
746 |
+
}
|
747 |
+
|
748 |
+
if (!obj.contentType) {
|
749 |
+
obj.contentType = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1 ? "html" : obj.type;
|
750 |
+
}
|
751 |
+
|
752 |
+
// Step 3 - Some adjustments
|
753 |
+
// =========================
|
754 |
+
|
755 |
+
obj.index = self.group.length;
|
756 |
+
|
757 |
+
if (obj.opts.smallBtn == "auto") {
|
758 |
+
obj.opts.smallBtn = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1;
|
759 |
+
}
|
760 |
+
|
761 |
+
if (obj.opts.toolbar === "auto") {
|
762 |
+
obj.opts.toolbar = !obj.opts.smallBtn;
|
763 |
+
}
|
764 |
+
|
765 |
+
// Find thumbnail image, check if exists and if is in the viewport
|
766 |
+
obj.$thumb = obj.opts.$thumb || null;
|
767 |
+
|
768 |
+
if (obj.opts.$trigger && obj.index === self.opts.index) {
|
769 |
+
obj.$thumb = obj.opts.$trigger.find("img:first");
|
770 |
+
|
771 |
+
if (obj.$thumb.length) {
|
772 |
+
obj.opts.$orig = obj.opts.$trigger;
|
773 |
+
}
|
774 |
+
}
|
775 |
+
|
776 |
+
if (!(obj.$thumb && obj.$thumb.length) && obj.opts.$orig) {
|
777 |
+
obj.$thumb = obj.opts.$orig.find("img:first");
|
778 |
+
}
|
779 |
+
|
780 |
+
if (obj.$thumb && !obj.$thumb.length) {
|
781 |
+
obj.$thumb = null;
|
782 |
+
}
|
783 |
+
|
784 |
+
obj.thumb = obj.opts.thumb || (obj.$thumb ? obj.$thumb[0].src : null);
|
785 |
+
|
786 |
+
// "caption" is a "special" option, it can be used to customize caption per gallery item
|
787 |
+
if ($.type(obj.opts.caption) === "function") {
|
788 |
+
obj.opts.caption = obj.opts.caption.apply(item, [self, obj]);
|
789 |
+
}
|
790 |
+
|
791 |
+
if ($.type(self.opts.caption) === "function") {
|
792 |
+
obj.opts.caption = self.opts.caption.apply(item, [self, obj]);
|
793 |
+
}
|
794 |
+
|
795 |
+
// Make sure we have caption as a string or jQuery object
|
796 |
+
if (!(obj.opts.caption instanceof $)) {
|
797 |
+
obj.opts.caption = obj.opts.caption === undefined ? "" : obj.opts.caption + "";
|
798 |
+
}
|
799 |
+
|
800 |
+
// Check if url contains "filter" used to filter the content
|
801 |
+
// Example: "ajax.html #something"
|
802 |
+
if (obj.type === "ajax") {
|
803 |
+
srcParts = src.split(/\s+/, 2);
|
804 |
+
|
805 |
+
if (srcParts.length > 1) {
|
806 |
+
obj.src = srcParts.shift();
|
807 |
+
|
808 |
+
obj.opts.filter = srcParts.shift();
|
809 |
+
}
|
810 |
+
}
|
811 |
+
|
812 |
+
// Hide all buttons and disable interactivity for modal items
|
813 |
+
if (obj.opts.modal) {
|
814 |
+
obj.opts = $.extend(true, obj.opts, {
|
815 |
+
trapFocus: true,
|
816 |
+
// Remove buttons
|
817 |
+
infobar: 0,
|
818 |
+
toolbar: 0,
|
819 |
+
|
820 |
+
smallBtn: 0,
|
821 |
+
|
822 |
+
// Disable keyboard navigation
|
823 |
+
keyboard: 0,
|
824 |
+
|
825 |
+
// Disable some modules
|
826 |
+
slideShow: 0,
|
827 |
+
fullScreen: 0,
|
828 |
+
thumbs: 0,
|
829 |
+
touch: 0,
|
830 |
+
|
831 |
+
// Disable click event handlers
|
832 |
+
clickContent: false,
|
833 |
+
clickSlide: false,
|
834 |
+
clickOutside: false,
|
835 |
+
dblclickContent: false,
|
836 |
+
dblclickSlide: false,
|
837 |
+
dblclickOutside: false
|
838 |
+
});
|
839 |
+
}
|
840 |
+
|
841 |
+
// Step 4 - Add processed object to group
|
842 |
+
// ======================================
|
843 |
+
|
844 |
+
self.group.push(obj);
|
845 |
+
});
|
846 |
+
|
847 |
+
// Update controls if gallery is already opened
|
848 |
+
if (Object.keys(self.slides).length) {
|
849 |
+
self.updateControls();
|
850 |
+
|
851 |
+
// Update thumbnails, if needed
|
852 |
+
thumbs = self.Thumbs;
|
853 |
+
|
854 |
+
if (thumbs && thumbs.isActive) {
|
855 |
+
thumbs.create();
|
856 |
+
|
857 |
+
thumbs.focus();
|
858 |
+
}
|
859 |
+
}
|
860 |
+
},
|
861 |
+
|
862 |
+
// Attach an event handler functions for:
|
863 |
+
// - navigation buttons
|
864 |
+
// - browser scrolling, resizing;
|
865 |
+
// - focusing
|
866 |
+
// - keyboard
|
867 |
+
// - detecting inactivity
|
868 |
+
// ======================================
|
869 |
+
|
870 |
+
addEvents: function () {
|
871 |
+
var self = this;
|
872 |
+
|
873 |
+
self.removeEvents();
|
874 |
+
|
875 |
+
// Make navigation elements clickable
|
876 |
+
// ==================================
|
877 |
+
|
878 |
+
self.$refs.container
|
879 |
+
.on("click.fb-close", "[data-fancybox-close]", function (e) {
|
880 |
+
e.stopPropagation();
|
881 |
+
e.preventDefault();
|
882 |
+
|
883 |
+
self.close(e);
|
884 |
+
})
|
885 |
+
.on("touchstart.fb-prev click.fb-prev", "[data-fancybox-prev]", function (e) {
|
886 |
+
e.stopPropagation();
|
887 |
+
e.preventDefault();
|
888 |
+
|
889 |
+
self.previous();
|
890 |
+
})
|
891 |
+
.on("touchstart.fb-next click.fb-next", "[data-fancybox-next]", function (e) {
|
892 |
+
e.stopPropagation();
|
893 |
+
e.preventDefault();
|
894 |
+
|
895 |
+
self.next();
|
896 |
+
})
|
897 |
+
.on("click.fb", "[data-fancybox-zoom]", function (e) {
|
898 |
+
// Click handler for zoom button
|
899 |
+
self[self.isScaledDown() ? "scaleToActual" : "scaleToFit"]();
|
900 |
+
});
|
901 |
+
|
902 |
+
// Handle page scrolling and browser resizing
|
903 |
+
// ==========================================
|
904 |
+
|
905 |
+
$W.on("orientationchange.fb resize.fb", function (e) {
|
906 |
+
if (e && e.originalEvent && e.originalEvent.type === "resize") {
|
907 |
+
if (self.requestId) {
|
908 |
+
cancelAFrame(self.requestId);
|
909 |
+
}
|
910 |
+
|
911 |
+
self.requestId = requestAFrame(function () {
|
912 |
+
self.update(e);
|
913 |
+
});
|
914 |
+
} else {
|
915 |
+
if (self.current && self.current.type === "iframe") {
|
916 |
+
self.$refs.stage.hide();
|
917 |
+
}
|
918 |
+
|
919 |
+
setTimeout(
|
920 |
+
function () {
|
921 |
+
self.$refs.stage.show();
|
922 |
+
|
923 |
+
self.update(e);
|
924 |
+
},
|
925 |
+
$.fancybox.isMobile ? 600 : 250
|
926 |
+
);
|
927 |
+
}
|
928 |
+
});
|
929 |
+
|
930 |
+
$D.on("keydown.fb", function (e) {
|
931 |
+
var instance = $.fancybox ? $.fancybox.getInstance() : null,
|
932 |
+
current = instance.current,
|
933 |
+
keycode = e.keyCode || e.which;
|
934 |
+
|
935 |
+
// Trap keyboard focus inside of the modal
|
936 |
+
// =======================================
|
937 |
+
|
938 |
+
if (keycode == 9) {
|
939 |
+
if (current.opts.trapFocus) {
|
940 |
+
self.focus(e);
|
941 |
+
}
|
942 |
+
|
943 |
+
return;
|
944 |
+
}
|
945 |
+
|
946 |
+
// Enable keyboard navigation
|
947 |
+
// ==========================
|
948 |
+
|
949 |
+
if (!current.opts.keyboard || e.ctrlKey || e.altKey || e.shiftKey || $(e.target).is("input,textarea,video,audio,select")) {
|
950 |
+
return;
|
951 |
+
}
|
952 |
+
|
953 |
+
// Backspace and Esc keys
|
954 |
+
if (keycode === 8 || keycode === 27) {
|
955 |
+
e.preventDefault();
|
956 |
+
|
957 |
+
self.close(e);
|
958 |
+
|
959 |
+
return;
|
960 |
+
}
|
961 |
+
|
962 |
+
// Left arrow and Up arrow
|
963 |
+
if (keycode === 37 || keycode === 38) {
|
964 |
+
e.preventDefault();
|
965 |
+
|
966 |
+
self.previous();
|
967 |
+
|
968 |
+
return;
|
969 |
+
}
|
970 |
+
|
971 |
+
// Righ arrow and Down arrow
|
972 |
+
if (keycode === 39 || keycode === 40) {
|
973 |
+
e.preventDefault();
|
974 |
+
|
975 |
+
self.next();
|
976 |
+
|
977 |
+
return;
|
978 |
+
}
|
979 |
+
|
980 |
+
self.trigger("afterKeydown", e, keycode);
|
981 |
+
});
|
982 |
+
|
983 |
+
// Hide controls after some inactivity period
|
984 |
+
if (self.group[self.currIndex].opts.idleTime) {
|
985 |
+
self.idleSecondsCounter = 0;
|
986 |
+
|
987 |
+
$D.on(
|
988 |
+
"mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",
|
989 |
+
function (e) {
|
990 |
+
self.idleSecondsCounter = 0;
|
991 |
+
|
992 |
+
if (self.isIdle) {
|
993 |
+
self.showControls();
|
994 |
+
}
|
995 |
+
|
996 |
+
self.isIdle = false;
|
997 |
+
}
|
998 |
+
);
|
999 |
+
|
1000 |
+
self.idleInterval = window.setInterval(function () {
|
1001 |
+
self.idleSecondsCounter++;
|
1002 |
+
|
1003 |
+
if (self.idleSecondsCounter >= self.group[self.currIndex].opts.idleTime && !self.isDragging) {
|
1004 |
+
self.isIdle = true;
|
1005 |
+
self.idleSecondsCounter = 0;
|
1006 |
+
|
1007 |
+
self.hideControls();
|
1008 |
+
}
|
1009 |
+
}, 1000);
|
1010 |
+
}
|
1011 |
+
},
|
1012 |
+
|
1013 |
+
// Remove events added by the core
|
1014 |
+
// ===============================
|
1015 |
+
|
1016 |
+
removeEvents: function () {
|
1017 |
+
var self = this;
|
1018 |
+
|
1019 |
+
$W.off("orientationchange.fb resize.fb");
|
1020 |
+
$D.off("keydown.fb .fb-idle");
|
1021 |
+
|
1022 |
+
this.$refs.container.off(".fb-close .fb-prev .fb-next");
|
1023 |
+
|
1024 |
+
if (self.idleInterval) {
|
1025 |
+
window.clearInterval(self.idleInterval);
|
1026 |
+
|
1027 |
+
self.idleInterval = null;
|
1028 |
+
}
|
1029 |
+
},
|
1030 |
+
|
1031 |
+
// Change to previous gallery item
|
1032 |
+
// ===============================
|
1033 |
+
|
1034 |
+
previous: function (duration) {
|
1035 |
+
return this.jumpTo(this.currPos - 1, duration);
|
1036 |
+
},
|
1037 |
+
|
1038 |
+
// Change to next gallery item
|
1039 |
+
// ===========================
|
1040 |
+
|
1041 |
+
next: function (duration) {
|
1042 |
+
return this.jumpTo(this.currPos + 1, duration);
|
1043 |
+
},
|
1044 |
+
|
1045 |
+
// Switch to selected gallery item
|
1046 |
+
// ===============================
|
1047 |
+
|
1048 |
+
jumpTo: function (pos, duration) {
|
1049 |
+
var self = this,
|
1050 |
+
groupLen = self.group.length,
|
1051 |
+
firstRun,
|
1052 |
+
isMoved,
|
1053 |
+
loop,
|
1054 |
+
current,
|
1055 |
+
previous,
|
1056 |
+
slidePos,
|
1057 |
+
stagePos,
|
1058 |
+
prop,
|
1059 |
+
diff;
|
1060 |
+
|
1061 |
+
if (self.isDragging || self.isClosing || (self.isAnimating && self.firstRun)) {
|
1062 |
+
return;
|
1063 |
+
}
|
1064 |
+
|
1065 |
+
// Should loop?
|
1066 |
+
pos = parseInt(pos, 10);
|
1067 |
+
loop = self.current ? self.current.opts.loop : self.opts.loop;
|
1068 |
+
|
1069 |
+
if (!loop && (pos < 0 || pos >= groupLen)) {
|
1070 |
+
return false;
|
1071 |
+
}
|
1072 |
+
|
1073 |
+
// Check if opening for the first time; this helps to speed things up
|
1074 |
+
firstRun = self.firstRun = !Object.keys(self.slides).length;
|
1075 |
+
|
1076 |
+
// Create slides
|
1077 |
+
previous = self.current;
|
1078 |
+
|
1079 |
+
self.prevIndex = self.currIndex;
|
1080 |
+
self.prevPos = self.currPos;
|
1081 |
+
|
1082 |
+
current = self.createSlide(pos);
|
1083 |
+
|
1084 |
+
if (groupLen > 1) {
|
1085 |
+
if (loop || current.index < groupLen - 1) {
|
1086 |
+
self.createSlide(pos + 1);
|
1087 |
+
}
|
1088 |
+
|
1089 |
+
if (loop || current.index > 0) {
|
1090 |
+
self.createSlide(pos - 1);
|
1091 |
+
}
|
1092 |
+
}
|
1093 |
+
|
1094 |
+
self.current = current;
|
1095 |
+
self.currIndex = current.index;
|
1096 |
+
self.currPos = current.pos;
|
1097 |
+
|
1098 |
+
self.trigger("beforeShow", firstRun);
|
1099 |
+
|
1100 |
+
self.updateControls();
|
1101 |
+
|
1102 |
+
// Validate duration length
|
1103 |
+
current.forcedDuration = undefined;
|
1104 |
+
|
1105 |
+
if ($.isNumeric(duration)) {
|
1106 |
+
current.forcedDuration = duration;
|
1107 |
+
} else {
|
1108 |
+
duration = current.opts[firstRun ? "animationDuration" : "transitionDuration"];
|
1109 |
+
}
|
1110 |
+
|
1111 |
+
duration = parseInt(duration, 10);
|
1112 |
+
|
1113 |
+
// Check if user has swiped the slides or if still animating
|
1114 |
+
isMoved = self.isMoved(current);
|
1115 |
+
|
1116 |
+
// Make sure current slide is visible
|
1117 |
+
current.$slide.addClass("fancybox-slide--current");
|
1118 |
+
|
1119 |
+
// Fresh start - reveal container, current slide and start loading content
|
1120 |
+
if (firstRun) {
|
1121 |
+
if (current.opts.animationEffect && duration) {
|
1122 |
+
self.$refs.container.css("transition-duration", duration + "ms");
|
1123 |
+
}
|
1124 |
+
|
1125 |
+
self.$refs.container.addClass("fancybox-is-open").trigger("focus");
|
1126 |
+
|
1127 |
+
// Attempt to load content into slide
|
1128 |
+
// This will later call `afterLoad` -> `revealContent`
|
1129 |
+
self.loadSlide(current);
|
1130 |
+
|
1131 |
+
self.preload("image");
|
1132 |
+
|
1133 |
+
return;
|
1134 |
+
}
|
1135 |
+
|
1136 |
+
// Get actual slide/stage positions (before cleaning up)
|
1137 |
+
slidePos = $.fancybox.getTranslate(previous.$slide);
|
1138 |
+
stagePos = $.fancybox.getTranslate(self.$refs.stage);
|
1139 |
+
|
1140 |
+
// Clean up all slides
|
1141 |
+
$.each(self.slides, function (index, slide) {
|
1142 |
+
$.fancybox.stop(slide.$slide, true);
|
1143 |
+
});
|
1144 |
+
|
1145 |
+
if (previous.pos !== current.pos) {
|
1146 |
+
previous.isComplete = false;
|
1147 |
+
}
|
1148 |
+
|
1149 |
+
previous.$slide.removeClass("fancybox-slide--complete fancybox-slide--current");
|
1150 |
+
|
1151 |
+
// If slides are out of place, then animate them to correct position
|
1152 |
+
if (isMoved) {
|
1153 |
+
// Calculate horizontal swipe distance
|
1154 |
+
diff = slidePos.left - (previous.pos * slidePos.width + previous.pos * previous.opts.gutter);
|
1155 |
+
|
1156 |
+
$.each(self.slides, function (index, slide) {
|
1157 |
+
slide.$slide.removeClass("fancybox-animated").removeClass(function (index, className) {
|
1158 |
+
return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
|
1159 |
+
});
|
1160 |
+
|
1161 |
+
// Make sure that each slide is in equal distance
|
1162 |
+
// This is mostly needed for freshly added slides, because they are not yet positioned
|
1163 |
+
var leftPos = slide.pos * slidePos.width + slide.pos * slide.opts.gutter;
|
1164 |
+
|
1165 |
+
$.fancybox.setTranslate(slide.$slide, {
|
1166 |
+
top: 0,
|
1167 |
+
left: leftPos - stagePos.left + diff
|
1168 |
+
});
|
1169 |
+
|
1170 |
+
if (slide.pos !== current.pos) {
|
1171 |
+
slide.$slide.addClass("fancybox-slide--" + (slide.pos > current.pos ? "next" : "previous"));
|
1172 |
+
}
|
1173 |
+
|
1174 |
+
// Redraw to make sure that transition will start
|
1175 |
+
forceRedraw(slide.$slide);
|
1176 |
+
|
1177 |
+
// Animate the slide
|
1178 |
+
$.fancybox.animate(
|
1179 |
+
slide.$slide, {
|
1180 |
+
top: 0,
|
1181 |
+
left: (slide.pos - current.pos) * slidePos.width + (slide.pos - current.pos) * slide.opts.gutter
|
1182 |
+
},
|
1183 |
+
duration,
|
1184 |
+
function () {
|
1185 |
+
slide.$slide
|
1186 |
+
.css({
|
1187 |
+
transform: "",
|
1188 |
+
opacity: ""
|
1189 |
+
})
|
1190 |
+
.removeClass("fancybox-slide--next fancybox-slide--previous");
|
1191 |
+
|
1192 |
+
if (slide.pos === self.currPos) {
|
1193 |
+
self.complete();
|
1194 |
+
}
|
1195 |
+
}
|
1196 |
+
);
|
1197 |
+
});
|
1198 |
+
} else if (duration && current.opts.transitionEffect) {
|
1199 |
+
// Set transition effect for previously active slide
|
1200 |
+
prop = "fancybox-animated fancybox-fx-" + current.opts.transitionEffect;
|
1201 |
+
|
1202 |
+
previous.$slide.addClass("fancybox-slide--" + (previous.pos > current.pos ? "next" : "previous"));
|
1203 |
+
|
1204 |
+
$.fancybox.animate(
|
1205 |
+
previous.$slide,
|
1206 |
+
prop,
|
1207 |
+
duration,
|
1208 |
+
function () {
|
1209 |
+
previous.$slide.removeClass(prop).removeClass("fancybox-slide--next fancybox-slide--previous");
|
1210 |
+
},
|
1211 |
+
false
|
1212 |
+
);
|
1213 |
+
}
|
1214 |
+
|
1215 |
+
if (current.isLoaded) {
|
1216 |
+
self.revealContent(current);
|
1217 |
+
} else {
|
1218 |
+
self.loadSlide(current);
|
1219 |
+
}
|
1220 |
+
|
1221 |
+
self.preload("image");
|
1222 |
+
},
|
1223 |
+
|
1224 |
+
// Create new "slide" element
|
1225 |
+
// These are gallery items that are actually added to DOM
|
1226 |
+
// =======================================================
|
1227 |
+
|
1228 |
+
createSlide: function (pos) {
|
1229 |
+
var self = this,
|
1230 |
+
$slide,
|
1231 |
+
index;
|
1232 |
+
|
1233 |
+
index = pos % self.group.length;
|
1234 |
+
index = index < 0 ? self.group.length + index : index;
|
1235 |
+
|
1236 |
+
if (!self.slides[pos] && self.group[index]) {
|
1237 |
+
$slide = $('<div class="fancybox-slide"></div>').appendTo(self.$refs.stage);
|
1238 |
+
|
1239 |
+
self.slides[pos] = $.extend(true, {}, self.group[index], {
|
1240 |
+
pos: pos,
|
1241 |
+
$slide: $slide,
|
1242 |
+
isLoaded: false
|
1243 |
+
});
|
1244 |
+
|
1245 |
+
self.updateSlide(self.slides[pos]);
|
1246 |
+
}
|
1247 |
+
|
1248 |
+
return self.slides[pos];
|
1249 |
+
},
|
1250 |
+
|
1251 |
+
// Scale image to the actual size of the image;
|
1252 |
+
// x and y values should be relative to the slide
|
1253 |
+
// ==============================================
|
1254 |
+
|
1255 |
+
scaleToActual: function (x, y, duration) {
|
1256 |
+
var self = this,
|
1257 |
+
current = self.current,
|
1258 |
+
$content = current.$content,
|
1259 |
+
canvasWidth = $.fancybox.getTranslate(current.$slide).width,
|
1260 |
+
canvasHeight = $.fancybox.getTranslate(current.$slide).height,
|
1261 |
+
newImgWidth = current.width,
|
1262 |
+
newImgHeight = current.height,
|
1263 |
+
imgPos,
|
1264 |
+
posX,
|
1265 |
+
posY,
|
1266 |
+
scaleX,
|
1267 |
+
scaleY;
|
1268 |
+
|
1269 |
+
if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
|
1270 |
+
return;
|
1271 |
+
}
|
1272 |
+
|
1273 |
+
self.isAnimating = true;
|
1274 |
+
|
1275 |
+
$.fancybox.stop($content);
|
1276 |
+
|
1277 |
+
x = x === undefined ? canvasWidth * 0.5 : x;
|
1278 |
+
y = y === undefined ? canvasHeight * 0.5 : y;
|
1279 |
+
|
1280 |
+
imgPos = $.fancybox.getTranslate($content);
|
1281 |
+
|
1282 |
+
imgPos.top -= $.fancybox.getTranslate(current.$slide).top;
|
1283 |
+
imgPos.left -= $.fancybox.getTranslate(current.$slide).left;
|
1284 |
+
|
1285 |
+
scaleX = newImgWidth / imgPos.width;
|
1286 |
+
scaleY = newImgHeight / imgPos.height;
|
1287 |
+
|
1288 |
+
// Get center position for original image
|
1289 |
+
posX = canvasWidth * 0.5 - newImgWidth * 0.5;
|
1290 |
+
posY = canvasHeight * 0.5 - newImgHeight * 0.5;
|
1291 |
+
|
1292 |
+
// Make sure image does not move away from edges
|
1293 |
+
if (newImgWidth > canvasWidth) {
|
1294 |
+
posX = imgPos.left * scaleX - (x * scaleX - x);
|
1295 |
+
|
1296 |
+
if (posX > 0) {
|
1297 |
+
posX = 0;
|
1298 |
+
}
|
1299 |
+
|
1300 |
+
if (posX < canvasWidth - newImgWidth) {
|
1301 |
+
posX = canvasWidth - newImgWidth;
|
1302 |
+
}
|
1303 |
+
}
|
1304 |
+
|
1305 |
+
if (newImgHeight > canvasHeight) {
|
1306 |
+
posY = imgPos.top * scaleY - (y * scaleY - y);
|
1307 |
+
|
1308 |
+
if (posY > 0) {
|
1309 |
+
posY = 0;
|
1310 |
+
}
|
1311 |
+
|
1312 |
+
if (posY < canvasHeight - newImgHeight) {
|
1313 |
+
posY = canvasHeight - newImgHeight;
|
1314 |
+
}
|
1315 |
+
}
|
1316 |
+
|
1317 |
+
self.updateCursor(newImgWidth, newImgHeight);
|
1318 |
+
|
1319 |
+
$.fancybox.animate(
|
1320 |
+
$content, {
|
1321 |
+
top: posY,
|
1322 |
+
left: posX,
|
1323 |
+
scaleX: scaleX,
|
1324 |
+
scaleY: scaleY
|
1325 |
+
},
|
1326 |
+
duration || 366,
|
1327 |
+
function () {
|
1328 |
+
self.isAnimating = false;
|
1329 |
+
}
|
1330 |
+
);
|
1331 |
+
|
1332 |
+
// Stop slideshow
|
1333 |
+
if (self.SlideShow && self.SlideShow.isActive) {
|
1334 |
+
self.SlideShow.stop();
|
1335 |
+
}
|
1336 |
+
},
|
1337 |
+
|
1338 |
+
// Scale image to fit inside parent element
|
1339 |
+
// ========================================
|
1340 |
+
|
1341 |
+
scaleToFit: function (duration) {
|
1342 |
+
var self = this,
|
1343 |
+
current = self.current,
|
1344 |
+
$content = current.$content,
|
1345 |
+
end;
|
1346 |
+
|
1347 |
+
if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
|
1348 |
+
return;
|
1349 |
+
}
|
1350 |
+
|
1351 |
+
self.isAnimating = true;
|
1352 |
+
|
1353 |
+
$.fancybox.stop($content);
|
1354 |
+
|
1355 |
+
end = self.getFitPos(current);
|
1356 |
+
|
1357 |
+
self.updateCursor(end.width, end.height);
|
1358 |
+
|
1359 |
+
$.fancybox.animate(
|
1360 |
+
$content, {
|
1361 |
+
top: end.top,
|
1362 |
+
left: end.left,
|
1363 |
+
scaleX: end.width / $content.width(),
|
1364 |
+
scaleY: end.height / $content.height()
|
1365 |
+
},
|
1366 |
+
duration || 366,
|
1367 |
+
function () {
|
1368 |
+
self.isAnimating = false;
|
1369 |
+
}
|
1370 |
+
);
|
1371 |
+
},
|
1372 |
+
|
1373 |
+
// Calculate image size to fit inside viewport
|
1374 |
+
// ===========================================
|
1375 |
+
|
1376 |
+
getFitPos: function (slide) {
|
1377 |
+
var self = this,
|
1378 |
+
$content = slide.$content,
|
1379 |
+
$slide = slide.$slide,
|
1380 |
+
width = slide.width || slide.opts.width,
|
1381 |
+
height = slide.height || slide.opts.height,
|
1382 |
+
maxWidth,
|
1383 |
+
maxHeight,
|
1384 |
+
minRatio,
|
1385 |
+
aspectRatio,
|
1386 |
+
rez = {};
|
1387 |
+
|
1388 |
+
if (!slide.isLoaded || !$content || !$content.length) {
|
1389 |
+
return false;
|
1390 |
+
}
|
1391 |
+
|
1392 |
+
maxWidth = $.fancybox.getTranslate(self.$refs.stage).width;
|
1393 |
+
maxHeight = $.fancybox.getTranslate(self.$refs.stage).height;
|
1394 |
+
|
1395 |
+
maxWidth -=
|
1396 |
+
parseFloat($slide.css("paddingLeft")) +
|
1397 |
+
parseFloat($slide.css("paddingRight")) +
|
1398 |
+
parseFloat($content.css("marginLeft")) +
|
1399 |
+
parseFloat($content.css("marginRight"));
|
1400 |
+
|
1401 |
+
maxHeight -=
|
1402 |
+
parseFloat($slide.css("paddingTop")) +
|
1403 |
+
parseFloat($slide.css("paddingBottom")) +
|
1404 |
+
parseFloat($content.css("marginTop")) +
|
1405 |
+
parseFloat($content.css("marginBottom"));
|
1406 |
+
|
1407 |
+
if (!width || !height) {
|
1408 |
+
width = maxWidth;
|
1409 |
+
height = maxHeight;
|
1410 |
+
}
|
1411 |
+
|
1412 |
+
minRatio = Math.min(1, maxWidth / width, maxHeight / height);
|
1413 |
+
|
1414 |
+
width = minRatio * width;
|
1415 |
+
height = minRatio * height;
|
1416 |
+
|
1417 |
+
// Adjust width/height to precisely fit into container
|
1418 |
+
if (width > maxWidth - 0.5) {
|
1419 |
+
width = maxWidth;
|
1420 |
+
}
|
1421 |
+
|
1422 |
+
if (height > maxHeight - 0.5) {
|
1423 |
+
height = maxHeight;
|
1424 |
+
}
|
1425 |
+
|
1426 |
+
if (slide.type === "image") {
|
1427 |
+
rez.top = Math.floor((maxHeight - height) * 0.5) + parseFloat($slide.css("paddingTop"));
|
1428 |
+
rez.left = Math.floor((maxWidth - width) * 0.5) + parseFloat($slide.css("paddingLeft"));
|
1429 |
+
} else if (slide.contentType === "video") {
|
1430 |
+
// Force aspect ratio for the video
|
1431 |
+
// "I say the whole world must learn of our peaceful ways… by force!"
|
1432 |
+
aspectRatio = slide.opts.width && slide.opts.height ? width / height : slide.opts.ratio || 16 / 9;
|
1433 |
+
|
1434 |
+
if (height > width / aspectRatio) {
|
1435 |
+
height = width / aspectRatio;
|
1436 |
+
} else if (width > height * aspectRatio) {
|
1437 |
+
width = height * aspectRatio;
|
1438 |
+
}
|
1439 |
+
}
|
1440 |
+
|
1441 |
+
rez.width = width;
|
1442 |
+
rez.height = height;
|
1443 |
+
|
1444 |
+
return rez;
|
1445 |
+
},
|
1446 |
+
|
1447 |
+
// Update content size and position for all slides
|
1448 |
+
// ==============================================
|
1449 |
+
|
1450 |
+
update: function (e) {
|
1451 |
+
var self = this;
|
1452 |
+
|
1453 |
+
$.each(self.slides, function (key, slide) {
|
1454 |
+
self.updateSlide(slide, e);
|
1455 |
+
});
|
1456 |
+
},
|
1457 |
+
|
1458 |
+
// Update slide content position and size
|
1459 |
+
// ======================================
|
1460 |
+
|
1461 |
+
updateSlide: function (slide, e) {
|
1462 |
+
var self = this,
|
1463 |
+
$content = slide && slide.$content,
|
1464 |
+
width = slide.width || slide.opts.width,
|
1465 |
+
height = slide.height || slide.opts.height,
|
1466 |
+
$slide = slide.$slide;
|
1467 |
+
|
1468 |
+
// First, prevent caption overlap, if needed
|
1469 |
+
self.adjustCaption(slide);
|
1470 |
+
|
1471 |
+
// Then resize content to fit inside the slide
|
1472 |
+
if ($content && (width || height || slide.contentType === "video") && !slide.hasError) {
|
1473 |
+
$.fancybox.stop($content);
|
1474 |
+
|
1475 |
+
$.fancybox.setTranslate($content, self.getFitPos(slide));
|
1476 |
+
|
1477 |
+
if (slide.pos === self.currPos) {
|
1478 |
+
self.isAnimating = false;
|
1479 |
+
|
1480 |
+
self.updateCursor();
|
1481 |
+
}
|
1482 |
+
}
|
1483 |
+
|
1484 |
+
// Then some adjustments
|
1485 |
+
self.adjustLayout(slide);
|
1486 |
+
|
1487 |
+
if ($slide.length) {
|
1488 |
+
$slide.trigger("refresh");
|
1489 |
+
|
1490 |
+
if (slide.pos === self.currPos) {
|
1491 |
+
self.$refs.toolbar
|
1492 |
+
.add(self.$refs.navigation.find(".fancybox-button--arrow_right"))
|
1493 |
+
.toggleClass("compensate-for-scrollbar", $slide.get(0).scrollHeight > $slide.get(0).clientHeight);
|
1494 |
+
}
|
1495 |
+
}
|
1496 |
+
|
1497 |
+
self.trigger("onUpdate", slide, e);
|
1498 |
+
},
|
1499 |
+
|
1500 |
+
// Horizontally center slide
|
1501 |
+
// =========================
|
1502 |
+
|
1503 |
+
centerSlide: function (duration) {
|
1504 |
+
var self = this,
|
1505 |
+
current = self.current,
|
1506 |
+
$slide = current.$slide;
|
1507 |
+
|
1508 |
+
if (self.isClosing || !current) {
|
1509 |
+
return;
|
1510 |
+
}
|
1511 |
+
|
1512 |
+
$slide.siblings().css({
|
1513 |
+
transform: "",
|
1514 |
+
opacity: ""
|
1515 |
+
});
|
1516 |
+
|
1517 |
+
$slide
|
1518 |
+
.parent()
|
1519 |
+
.children()
|
1520 |
+
.removeClass("fancybox-slide--previous fancybox-slide--next");
|
1521 |
+
|
1522 |
+
$.fancybox.animate(
|
1523 |
+
$slide, {
|
1524 |
+
top: 0,
|
1525 |
+
left: 0,
|
1526 |
+
opacity: 1
|
1527 |
+
},
|
1528 |
+
duration === undefined ? 0 : duration,
|
1529 |
+
function () {
|
1530 |
+
// Clean up
|
1531 |
+
$slide.css({
|
1532 |
+
transform: "",
|
1533 |
+
opacity: ""
|
1534 |
+
});
|
1535 |
+
|
1536 |
+
if (!current.isComplete) {
|
1537 |
+
self.complete();
|
1538 |
+
}
|
1539 |
+
},
|
1540 |
+
false
|
1541 |
+
);
|
1542 |
+
},
|
1543 |
+
|
1544 |
+
// Check if current slide is moved (swiped)
|
1545 |
+
// ========================================
|
1546 |
+
|
1547 |
+
isMoved: function (slide) {
|
1548 |
+
var current = slide || this.current,
|
1549 |
+
slidePos,
|
1550 |
+
stagePos;
|
1551 |
+
|
1552 |
+
if (!current) {
|
1553 |
+
return false;
|
1554 |
+
}
|
1555 |
+
|
1556 |
+
stagePos = $.fancybox.getTranslate(this.$refs.stage);
|
1557 |
+
slidePos = $.fancybox.getTranslate(current.$slide);
|
1558 |
+
|
1559 |
+
return (
|
1560 |
+
!current.$slide.hasClass("fancybox-animated") &&
|
1561 |
+
(Math.abs(slidePos.top - stagePos.top) > 0.5 || Math.abs(slidePos.left - stagePos.left) > 0.5)
|
1562 |
+
);
|
1563 |
+
},
|
1564 |
+
|
1565 |
+
// Update cursor style depending if content can be zoomed
|
1566 |
+
// ======================================================
|
1567 |
+
|
1568 |
+
updateCursor: function (nextWidth, nextHeight) {
|
1569 |
+
var self = this,
|
1570 |
+
current = self.current,
|
1571 |
+
$container = self.$refs.container,
|
1572 |
+
canPan,
|
1573 |
+
isZoomable;
|
1574 |
+
|
1575 |
+
if (!current || self.isClosing || !self.Guestures) {
|
1576 |
+
return;
|
1577 |
+
}
|
1578 |
+
|
1579 |
+
$container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan");
|
1580 |
+
|
1581 |
+
canPan = self.canPan(nextWidth, nextHeight);
|
1582 |
+
|
1583 |
+
isZoomable = canPan ? true : self.isZoomable();
|
1584 |
+
|
1585 |
+
$container.toggleClass("fancybox-is-zoomable", isZoomable);
|
1586 |
+
|
1587 |
+
$("[data-fancybox-zoom]").prop("disabled", !isZoomable);
|
1588 |
+
|
1589 |
+
if (canPan) {
|
1590 |
+
$container.addClass("fancybox-can-pan");
|
1591 |
+
} else if (
|
1592 |
+
isZoomable &&
|
1593 |
+
(current.opts.clickContent === "zoom" || ($.isFunction(current.opts.clickContent) && current.opts.clickContent(current) == "zoom"))
|
1594 |
+
) {
|
1595 |
+
$container.addClass("fancybox-can-zoomIn");
|
1596 |
+
} else if (current.opts.touch && (current.opts.touch.vertical || self.group.length > 1) && current.contentType !== "video") {
|
1597 |
+
$container.addClass("fancybox-can-swipe");
|
1598 |
+
}
|
1599 |
+
},
|
1600 |
+
|
1601 |
+
// Check if current slide is zoomable
|
1602 |
+
// ==================================
|
1603 |
+
|
1604 |
+
isZoomable: function () {
|
1605 |
+
var self = this,
|
1606 |
+
current = self.current,
|
1607 |
+
fitPos;
|
1608 |
+
|
1609 |
+
// Assume that slide is zoomable if:
|
1610 |
+
// - image is still loading
|
1611 |
+
// - actual size of the image is smaller than available area
|
1612 |
+
if (current && !self.isClosing && current.type === "image" && !current.hasError) {
|
1613 |
+
if (!current.isLoaded) {
|
1614 |
+
return true;
|
1615 |
+
}
|
1616 |
+
|
1617 |
+
fitPos = self.getFitPos(current);
|
1618 |
+
|
1619 |
+
if (fitPos && (current.width > fitPos.width || current.height > fitPos.height)) {
|
1620 |
+
return true;
|
1621 |
+
}
|
1622 |
+
}
|
1623 |
+
|
1624 |
+
return false;
|
1625 |
+
},
|
1626 |
+
|
1627 |
+
// Check if current image dimensions are smaller than actual
|
1628 |
+
// =========================================================
|
1629 |
+
|
1630 |
+
isScaledDown: function (nextWidth, nextHeight) {
|
1631 |
+
var self = this,
|
1632 |
+
rez = false,
|
1633 |
+
current = self.current,
|
1634 |
+
$content = current.$content;
|
1635 |
+
|
1636 |
+
if (nextWidth !== undefined && nextHeight !== undefined) {
|
1637 |
+
rez = nextWidth < current.width && nextHeight < current.height;
|
1638 |
+
} else if ($content) {
|
1639 |
+
rez = $.fancybox.getTranslate($content);
|
1640 |
+
rez = rez.width < current.width && rez.height < current.height;
|
1641 |
+
}
|
1642 |
+
|
1643 |
+
return rez;
|
1644 |
+
},
|
1645 |
+
|
1646 |
+
// Check if image dimensions exceed parent element
|
1647 |
+
// ===============================================
|
1648 |
+
|
1649 |
+
canPan: function (nextWidth, nextHeight) {
|
1650 |
+
var self = this,
|
1651 |
+
current = self.current,
|
1652 |
+
pos = null,
|
1653 |
+
rez = false;
|
1654 |
+
|
1655 |
+
if (current.type === "image" && (current.isComplete || (nextWidth && nextHeight)) && !current.hasError) {
|
1656 |
+
rez = self.getFitPos(current);
|
1657 |
+
|
1658 |
+
if (nextWidth !== undefined && nextHeight !== undefined) {
|
1659 |
+
pos = {
|
1660 |
+
width: nextWidth,
|
1661 |
+
height: nextHeight
|
1662 |
+
};
|
1663 |
+
} else if (current.isComplete) {
|
1664 |
+
pos = $.fancybox.getTranslate(current.$content);
|
1665 |
+
}
|
1666 |
+
|
1667 |
+
if (pos && rez) {
|
1668 |
+
rez = Math.abs(pos.width - rez.width) > 1.5 || Math.abs(pos.height - rez.height) > 1.5;
|
1669 |
+
}
|
1670 |
+
}
|
1671 |
+
|
1672 |
+
return rez;
|
1673 |
+
},
|
1674 |
+
|
1675 |
+
// Load content into the slide
|
1676 |
+
// ===========================
|
1677 |
+
|
1678 |
+
loadSlide: function (slide) {
|
1679 |
+
var self = this,
|
1680 |
+
type,
|
1681 |
+
$slide,
|
1682 |
+
ajaxLoad;
|
1683 |
+
|
1684 |
+
if (slide.isLoading || slide.isLoaded) {
|
1685 |
+
return;
|
1686 |
+
}
|
1687 |
+
|
1688 |
+
slide.isLoading = true;
|
1689 |
+
|
1690 |
+
if (self.trigger("beforeLoad", slide) === false) {
|
1691 |
+
slide.isLoading = false;
|
1692 |
+
|
1693 |
+
return false;
|
1694 |
+
}
|
1695 |
+
|
1696 |
+
type = slide.type;
|
1697 |
+
$slide = slide.$slide;
|
1698 |
+
|
1699 |
+
$slide
|
1700 |
+
.off("refresh")
|
1701 |
+
.trigger("onReset")
|
1702 |
+
.addClass(slide.opts.slideClass);
|
1703 |
+
|
1704 |
+
// Create content depending on the type
|
1705 |
+
switch (type) {
|
1706 |
+
case "image":
|
1707 |
+
self.setImage(slide);
|
1708 |
+
|
1709 |
+
break;
|
1710 |
+
|
1711 |
+
case "iframe":
|
1712 |
+
self.setIframe(slide);
|
1713 |
+
|
1714 |
+
break;
|
1715 |
+
|
1716 |
+
case "html":
|
1717 |
+
self.setContent(slide, slide.src || slide.content);
|
1718 |
+
|
1719 |
+
break;
|
1720 |
+
|
1721 |
+
case "video":
|
1722 |
+
self.setContent(
|
1723 |
+
slide,
|
1724 |
+
slide.opts.video.tpl
|
1725 |
+
.replace(/\{\{src\}\}/gi, slide.src)
|
1726 |
+
.replace("{{format}}", slide.opts.videoFormat || slide.opts.video.format || "")
|
1727 |
+
.replace("{{poster}}", slide.thumb || "")
|
1728 |
+
);
|
1729 |
+
|
1730 |
+
break;
|
1731 |
+
|
1732 |
+
case "inline":
|
1733 |
+
if ($(slide.src).length) {
|
1734 |
+
self.setContent(slide, $(slide.src));
|
1735 |
+
} else {
|
1736 |
+
self.setError(slide);
|
1737 |
+
}
|
1738 |
+
|
1739 |
+
break;
|
1740 |
+
|
1741 |
+
case "ajax":
|
1742 |
+
self.showLoading(slide);
|
1743 |
+
|
1744 |
+
ajaxLoad = $.ajax(
|
1745 |
+
$.extend({}, slide.opts.ajax.settings, {
|
1746 |
+
url: slide.src,
|
1747 |
+
success: function (data, textStatus) {
|
1748 |
+
if (textStatus === "success") {
|
1749 |
+
self.setContent(slide, data);
|
1750 |
+
}
|
1751 |
+
},
|
1752 |
+
error: function (jqXHR, textStatus) {
|
1753 |
+
if (jqXHR && textStatus !== "abort") {
|
1754 |
+
self.setError(slide);
|
1755 |
+
}
|
1756 |
+
}
|
1757 |
+
})
|
1758 |
+
);
|
1759 |
+
|
1760 |
+
$slide.one("onReset", function () {
|
1761 |
+
ajaxLoad.abort();
|
1762 |
+
});
|
1763 |
+
|
1764 |
+
break;
|
1765 |
+
|
1766 |
+
default:
|
1767 |
+
self.setError(slide);
|
1768 |
+
|
1769 |
+
break;
|
1770 |
+
}
|
1771 |
+
|
1772 |
+
return true;
|
1773 |
+
},
|
1774 |
+
|
1775 |
+
// Use thumbnail image, if possible
|
1776 |
+
// ================================
|
1777 |
+
|
1778 |
+
setImage: function (slide) {
|
1779 |
+
var self = this,
|
1780 |
+
ghost;
|
1781 |
+
|
1782 |
+
// Check if need to show loading icon
|
1783 |
+
setTimeout(function () {
|
1784 |
+
var $img = slide.$image;
|
1785 |
+
|
1786 |
+
if (!self.isClosing && slide.isLoading && (!$img || !$img.length || !$img[0].complete) && !slide.hasError) {
|
1787 |
+
self.showLoading(slide);
|
1788 |
+
}
|
1789 |
+
}, 50);
|
1790 |
+
|
1791 |
+
//Check if image has srcset
|
1792 |
+
self.checkSrcset(slide);
|
1793 |
+
|
1794 |
+
// This will be wrapper containing both ghost and actual image
|
1795 |
+
slide.$content = $('<div class="fancybox-content"></div>')
|
1796 |
+
.addClass("fancybox-is-hidden")
|
1797 |
+
.appendTo(slide.$slide.addClass("fancybox-slide--image"));
|
1798 |
+
|
1799 |
+
// If we have a thumbnail, we can display it while actual image is loading
|
1800 |
+
// Users will not stare at black screen and actual image will appear gradually
|
1801 |
+
if (slide.opts.preload !== false && slide.opts.width && slide.opts.height && slide.thumb) {
|
1802 |
+
slide.width = slide.opts.width;
|
1803 |
+
slide.height = slide.opts.height;
|
1804 |
+
|
1805 |
+
ghost = document.createElement("img");
|
1806 |
+
|
1807 |
+
ghost.onerror = function () {
|
1808 |
+
$(this).remove();
|
1809 |
+
|
1810 |
+
slide.$ghost = null;
|
1811 |
+
};
|
1812 |
+
|
1813 |
+
ghost.onload = function () {
|
1814 |
+
self.afterLoad(slide);
|
1815 |
+
};
|
1816 |
+
|
1817 |
+
slide.$ghost = $(ghost)
|
1818 |
+
.addClass("fancybox-image")
|
1819 |
+
.appendTo(slide.$content)
|
1820 |
+
.attr("src", slide.thumb);
|
1821 |
+
}
|
1822 |
+
|
1823 |
+
// Start loading actual image
|
1824 |
+
self.setBigImage(slide);
|
1825 |
+
},
|
1826 |
+
|
1827 |
+
// Check if image has srcset and get the source
|
1828 |
+
// ============================================
|
1829 |
+
checkSrcset: function (slide) {
|
1830 |
+
var srcset = slide.opts.srcset || slide.opts.image.srcset,
|
1831 |
+
found,
|
1832 |
+
temp,
|
1833 |
+
pxRatio,
|
1834 |
+
windowWidth;
|
1835 |
+
|
1836 |
+
// If we have "srcset", then we need to find first matching "src" value.
|
1837 |
+
// This is necessary, because when you set an src attribute, the browser will preload the image
|
1838 |
+
// before any javascript or even CSS is applied.
|
1839 |
+
if (srcset) {
|
1840 |
+
pxRatio = window.devicePixelRatio || 1;
|
1841 |
+
windowWidth = window.innerWidth * pxRatio;
|
1842 |
+
|
1843 |
+
temp = srcset.split(",").map(function (el) {
|
1844 |
+
var ret = {};
|
1845 |
+
|
1846 |
+
el.trim()
|
1847 |
+
.split(/\s+/)
|
1848 |
+
.forEach(function (el, i) {
|
1849 |
+
var value = parseInt(el.substring(0, el.length - 1), 10);
|
1850 |
+
|
1851 |
+
if (i === 0) {
|
1852 |
+
return (ret.url = el);
|
1853 |
+
}
|
1854 |
+
|
1855 |
+
if (value) {
|
1856 |
+
ret.value = value;
|
1857 |
+
ret.postfix = el[el.length - 1];
|
1858 |
+
}
|
1859 |
+
});
|
1860 |
+
|
1861 |
+
return ret;
|
1862 |
+
});
|
1863 |
+
|
1864 |
+
// Sort by value
|
1865 |
+
temp.sort(function (a, b) {
|
1866 |
+
return a.value - b.value;
|
1867 |
+
});
|
1868 |
+
|
1869 |
+
// Ok, now we have an array of all srcset values
|
1870 |
+
for (var j = 0; j < temp.length; j++) {
|
1871 |
+
var el = temp[j];
|
1872 |
+
|
1873 |
+
if ((el.postfix === "w" && el.value >= windowWidth) || (el.postfix === "x" && el.value >= pxRatio)) {
|
1874 |
+
found = el;
|
1875 |
+
break;
|
1876 |
+
}
|
1877 |
+
}
|
1878 |
+
|
1879 |
+
// If not found, take the last one
|
1880 |
+
if (!found && temp.length) {
|
1881 |
+
found = temp[temp.length - 1];
|
1882 |
+
}
|
1883 |
+
|
1884 |
+
if (found) {
|
1885 |
+
slide.src = found.url;
|
1886 |
+
|
1887 |
+
// If we have default width/height values, we can calculate height for matching source
|
1888 |
+
if (slide.width && slide.height && found.postfix == "w") {
|
1889 |
+
slide.height = (slide.width / slide.height) * found.value;
|
1890 |
+
slide.width = found.value;
|
1891 |
+
}
|
1892 |
+
|
1893 |
+
slide.opts.srcset = srcset;
|
1894 |
+
}
|
1895 |
+
}
|
1896 |
+
},
|
1897 |
+
|
1898 |
+
// Create full-size image
|
1899 |
+
// ======================
|
1900 |
+
|
1901 |
+
setBigImage: function (slide) {
|
1902 |
+
var self = this,
|
1903 |
+
img = document.createElement("img"),
|
1904 |
+
$img = $(img);
|
1905 |
+
|
1906 |
+
slide.$image = $img
|
1907 |
+
.one("error", function () {
|
1908 |
+
self.setError(slide);
|
1909 |
+
})
|
1910 |
+
.one("load", function () {
|
1911 |
+
var sizes;
|
1912 |
+
|
1913 |
+
if (!slide.$ghost) {
|
1914 |
+
self.resolveImageSlideSize(slide, this.naturalWidth, this.naturalHeight);
|
1915 |
+
|
1916 |
+
self.afterLoad(slide);
|
1917 |
+
}
|
1918 |
+
|
1919 |
+
if (self.isClosing) {
|
1920 |
+
return;
|
1921 |
+
}
|
1922 |
+
|
1923 |
+
if (slide.opts.srcset) {
|
1924 |
+
sizes = slide.opts.sizes;
|
1925 |
+
|
1926 |
+
if (!sizes || sizes === "auto") {
|
1927 |
+
sizes =
|
1928 |
+
(slide.width / slide.height > 1 && $W.width() / $W.height() > 1 ? "100" : Math.round((slide.width / slide.height) * 100)) +
|
1929 |
+
"vw";
|
1930 |
+
}
|
1931 |
+
|
1932 |
+
$img.attr("sizes", sizes).attr("srcset", slide.opts.srcset);
|
1933 |
+
}
|
1934 |
+
|
1935 |
+
// Hide temporary image after some delay
|
1936 |
+
if (slide.$ghost) {
|
1937 |
+
setTimeout(function () {
|
1938 |
+
if (slide.$ghost && !self.isClosing) {
|
1939 |
+
slide.$ghost.hide();
|
1940 |
+
}
|
1941 |
+
}, Math.min(300, Math.max(1000, slide.height / 1600)));
|
1942 |
+
}
|
1943 |
+
|
1944 |
+
self.hideLoading(slide);
|
1945 |
+
})
|
1946 |
+
.addClass("fancybox-image")
|
1947 |
+
.attr("src", slide.src)
|
1948 |
+
.appendTo(slide.$content);
|
1949 |
+
|
1950 |
+
if ((img.complete || img.readyState == "complete") && $img.naturalWidth && $img.naturalHeight) {
|
1951 |
+
$img.trigger("load");
|
1952 |
+
} else if (img.error) {
|
1953 |
+
$img.trigger("error");
|
1954 |
+
}
|
1955 |
+
},
|
1956 |
+
|
1957 |
+
// Computes the slide size from image size and maxWidth/maxHeight
|
1958 |
+
// ==============================================================
|
1959 |
+
|
1960 |
+
resolveImageSlideSize: function (slide, imgWidth, imgHeight) {
|
1961 |
+
var maxWidth = parseInt(slide.opts.width, 10),
|
1962 |
+
maxHeight = parseInt(slide.opts.height, 10);
|
1963 |
+
|
1964 |
+
// Sets the default values from the image
|
1965 |
+
slide.width = imgWidth;
|
1966 |
+
slide.height = imgHeight;
|
1967 |
+
|
1968 |
+
if (maxWidth > 0) {
|
1969 |
+
slide.width = maxWidth;
|
1970 |
+
slide.height = Math.floor((maxWidth * imgHeight) / imgWidth);
|
1971 |
+
}
|
1972 |
+
|
1973 |
+
if (maxHeight > 0) {
|
1974 |
+
slide.width = Math.floor((maxHeight * imgWidth) / imgHeight);
|
1975 |
+
slide.height = maxHeight;
|
1976 |
+
}
|
1977 |
+
},
|
1978 |
+
|
1979 |
+
// Create iframe wrapper, iframe and bindings
|
1980 |
+
// ==========================================
|
1981 |
+
|
1982 |
+
setIframe: function (slide) {
|
1983 |
+
var self = this,
|
1984 |
+
opts = slide.opts.iframe,
|
1985 |
+
$slide = slide.$slide,
|
1986 |
+
$iframe;
|
1987 |
+
|
1988 |
+
slide.$content = $('<div class="fancybox-content' + (opts.preload ? " fancybox-is-hidden" : "") + '"></div>')
|
1989 |
+
.css(opts.css)
|
1990 |
+
.appendTo($slide);
|
1991 |
+
|
1992 |
+
$slide.addClass("fancybox-slide--" + slide.contentType);
|
1993 |
+
|
1994 |
+
slide.$iframe = $iframe = $(opts.tpl.replace(/\{rnd\}/g, new Date().getTime()))
|
1995 |
+
.attr(opts.attr)
|
1996 |
+
.appendTo(slide.$content);
|
1997 |
+
|
1998 |
+
if (opts.preload) {
|
1999 |
+
self.showLoading(slide);
|
2000 |
+
|
2001 |
+
// Unfortunately, it is not always possible to determine if iframe is successfully loaded
|
2002 |
+
// (due to browser security policy)
|
2003 |
+
|
2004 |
+
$iframe.on("load.fb error.fb", function (e) {
|
2005 |
+
this.isReady = 1;
|
2006 |
+
|
2007 |
+
slide.$slide.trigger("refresh");
|
2008 |
+
|
2009 |
+
self.afterLoad(slide);
|
2010 |
+
});
|
2011 |
+
|
2012 |
+
// Recalculate iframe content size
|
2013 |
+
// ===============================
|
2014 |
+
|
2015 |
+
$slide.on("refresh.fb", function () {
|
2016 |
+
var $content = slide.$content,
|
2017 |
+
frameWidth = opts.css.width,
|
2018 |
+
frameHeight = opts.css.height,
|
2019 |
+
$contents,
|
2020 |
+
$body;
|
2021 |
+
|
2022 |
+
if ($iframe[0].isReady !== 1) {
|
2023 |
+
return;
|
2024 |
+
}
|
2025 |
+
|
2026 |
+
try {
|
2027 |
+
$contents = $iframe.contents();
|
2028 |
+
$body = $contents.find("body");
|
2029 |
+
} catch (ignore) {}
|
2030 |
+
|
2031 |
+
// Calculate content dimensions, if it is accessible
|
2032 |
+
if ($body && $body.length && $body.children().length) {
|
2033 |
+
// Avoid scrolling to top (if multiple instances)
|
2034 |
+
$slide.css("overflow", "visible");
|
2035 |
+
|
2036 |
+
$content.css({
|
2037 |
+
width: "100%",
|
2038 |
+
"max-width": "100%",
|
2039 |
+
height: "9999px"
|
2040 |
+
});
|
2041 |
+
|
2042 |
+
if (frameWidth === undefined) {
|
2043 |
+
frameWidth = Math.ceil(Math.max($body[0].clientWidth, $body.outerWidth(true)));
|
2044 |
+
}
|
2045 |
+
|
2046 |
+
$content.css("width", frameWidth ? frameWidth : "").css("max-width", "");
|
2047 |
+
|
2048 |
+
if (frameHeight === undefined) {
|
2049 |
+
frameHeight = Math.ceil(Math.max($body[0].clientHeight, $body.outerHeight(true)));
|
2050 |
+
}
|
2051 |
+
|
2052 |
+
$content.css("height", frameHeight ? frameHeight : "");
|
2053 |
+
|
2054 |
+
$slide.css("overflow", "auto");
|
2055 |
+
}
|
2056 |
+
|
2057 |
+
$content.removeClass("fancybox-is-hidden");
|
2058 |
+
});
|
2059 |
+
} else {
|
2060 |
+
self.afterLoad(slide);
|
2061 |
+
}
|
2062 |
+
|
2063 |
+
$iframe.attr("src", slide.src);
|
2064 |
+
|
2065 |
+
// Remove iframe if closing or changing gallery item
|
2066 |
+
$slide.one("onReset", function () {
|
2067 |
+
// This helps IE not to throw errors when closing
|
2068 |
+
try {
|
2069 |
+
$(this)
|
2070 |
+
.find("iframe")
|
2071 |
+
.hide()
|
2072 |
+
.unbind()
|
2073 |
+
.attr("src", "//about:blank");
|
2074 |
+
} catch (ignore) {}
|
2075 |
+
|
2076 |
+
$(this)
|
2077 |
+
.off("refresh.fb")
|
2078 |
+
.empty();
|
2079 |
+
|
2080 |
+
slide.isLoaded = false;
|
2081 |
+
slide.isRevealed = false;
|
2082 |
+
});
|
2083 |
+
},
|
2084 |
+
|
2085 |
+
// Wrap and append content to the slide
|
2086 |
+
// ======================================
|
2087 |
+
|
2088 |
+
setContent: function (slide, content) {
|
2089 |
+
var self = this;
|
2090 |
+
|
2091 |
+
if (self.isClosing) {
|
2092 |
+
return;
|
2093 |
+
}
|
2094 |
+
|
2095 |
+
self.hideLoading(slide);
|
2096 |
+
|
2097 |
+
if (slide.$content) {
|
2098 |
+
$.fancybox.stop(slide.$content);
|
2099 |
+
}
|
2100 |
+
|
2101 |
+
slide.$slide.empty();
|
2102 |
+
|
2103 |
+
// If content is a jQuery object, then it will be moved to the slide.
|
2104 |
+
// The placeholder is created so we will know where to put it back.
|
2105 |
+
if (isQuery(content) && content.parent().length) {
|
2106 |
+
// Make sure content is not already moved to fancyBox
|
2107 |
+
if (content.hasClass("fancybox-content") || content.parent().hasClass("fancybox-content")) {
|
2108 |
+
content.parents(".fancybox-slide").trigger("onReset");
|
2109 |
+
}
|
2110 |
+
|
2111 |
+
// Create temporary element marking original place of the content
|
2112 |
+
slide.$placeholder = $("<div>")
|
2113 |
+
.hide()
|
2114 |
+
.insertAfter(content);
|
2115 |
+
|
2116 |
+
// Make sure content is visible
|
2117 |
+
content.css("display", "inline-block");
|
2118 |
+
} else if (!slide.hasError) {
|
2119 |
+
// If content is just a plain text, try to convert it to html
|
2120 |
+
if ($.type(content) === "string") {
|
2121 |
+
content = $("<div>")
|
2122 |
+
.append($.trim(content))
|
2123 |
+
.contents();
|
2124 |
+
}
|
2125 |
+
|
2126 |
+
// If "filter" option is provided, then filter content
|
2127 |
+
if (slide.opts.filter) {
|
2128 |
+
content = $("<div>")
|
2129 |
+
.html(content)
|
2130 |
+
.find(slide.opts.filter);
|
2131 |
+
}
|
2132 |
+
}
|
2133 |
+
|
2134 |
+
slide.$slide.one("onReset", function () {
|
2135 |
+
// Pause all html5 video/audio
|
2136 |
+
$(this)
|
2137 |
+
.find("video,audio")
|
2138 |
+
.trigger("pause");
|
2139 |
+
|
2140 |
+
// Put content back
|
2141 |
+
if (slide.$placeholder) {
|
2142 |
+
slide.$placeholder.after(content.removeClass("fancybox-content").hide()).remove();
|
2143 |
+
|
2144 |
+
slide.$placeholder = null;
|
2145 |
+
}
|
2146 |
+
|
2147 |
+
// Remove custom close button
|
2148 |
+
if (slide.$smallBtn) {
|
2149 |
+
slide.$smallBtn.remove();
|
2150 |
+
|
2151 |
+
slide.$smallBtn = null;
|
2152 |
+
}
|
2153 |
+
|
2154 |
+
// Remove content and mark slide as not loaded
|
2155 |
+
if (!slide.hasError) {
|
2156 |
+
$(this).empty();
|
2157 |
+
|
2158 |
+
slide.isLoaded = false;
|
2159 |
+
slide.isRevealed = false;
|
2160 |
+
}
|
2161 |
+
});
|
2162 |
+
|
2163 |
+
$(content).appendTo(slide.$slide);
|
2164 |
+
|
2165 |
+
if ($(content).is("video,audio")) {
|
2166 |
+
$(content).addClass("fancybox-video");
|
2167 |
+
|
2168 |
+
$(content).wrap("<div></div>");
|
2169 |
+
|
2170 |
+
slide.contentType = "video";
|
2171 |
+
|
2172 |
+
slide.opts.width = slide.opts.width || $(content).attr("width");
|
2173 |
+
slide.opts.height = slide.opts.height || $(content).attr("height");
|
2174 |
+
}
|
2175 |
+
|
2176 |
+
slide.$content = slide.$slide
|
2177 |
+
.children()
|
2178 |
+
.filter("div,form,main,video,audio,article,.fancybox-content")
|
2179 |
+
.first();
|
2180 |
+
|
2181 |
+
slide.$content.siblings().hide();
|
2182 |
+
|
2183 |
+
// Re-check if there is a valid content
|
2184 |
+
// (in some cases, ajax response can contain various elements or plain text)
|
2185 |
+
if (!slide.$content.length) {
|
2186 |
+
slide.$content = slide.$slide
|
2187 |
+
.wrapInner("<div></div>")
|
2188 |
+
.children()
|
2189 |
+
.first();
|
2190 |
+
}
|
2191 |
+
|
2192 |
+
slide.$content.addClass("fancybox-content");
|
2193 |
+
|
2194 |
+
slide.$slide.addClass("fancybox-slide--" + slide.contentType);
|
2195 |
+
|
2196 |
+
self.afterLoad(slide);
|
2197 |
+
},
|
2198 |
+
|
2199 |
+
// Display error message
|
2200 |
+
// =====================
|
2201 |
+
|
2202 |
+
setError: function (slide) {
|
2203 |
+
slide.hasError = true;
|
2204 |
+
|
2205 |
+
slide.$slide
|
2206 |
+
.trigger("onReset")
|
2207 |
+
.removeClass("fancybox-slide--" + slide.contentType)
|
2208 |
+
.addClass("fancybox-slide--error");
|
2209 |
+
|
2210 |
+
slide.contentType = "html";
|
2211 |
+
|
2212 |
+
this.setContent(slide, this.translate(slide, slide.opts.errorTpl));
|
2213 |
+
|
2214 |
+
if (slide.pos === this.currPos) {
|
2215 |
+
this.isAnimating = false;
|
2216 |
+
}
|
2217 |
+
},
|
2218 |
+
|
2219 |
+
// Show loading icon inside the slide
|
2220 |
+
// ==================================
|
2221 |
+
|
2222 |
+
showLoading: function (slide) {
|
2223 |
+
var self = this;
|
2224 |
+
|
2225 |
+
slide = slide || self.current;
|
2226 |
+
|
2227 |
+
if (slide && !slide.$spinner) {
|
2228 |
+
slide.$spinner = $(self.translate(self, self.opts.spinnerTpl))
|
2229 |
+
.appendTo(slide.$slide)
|
2230 |
+
.hide()
|
2231 |
+
.fadeIn("fast");
|
2232 |
+
}
|
2233 |
+
},
|
2234 |
+
|
2235 |
+
// Remove loading icon from the slide
|
2236 |
+
// ==================================
|
2237 |
+
|
2238 |
+
hideLoading: function (slide) {
|
2239 |
+
var self = this;
|
2240 |
+
|
2241 |
+
slide = slide || self.current;
|
2242 |
+
|
2243 |
+
if (slide && slide.$spinner) {
|
2244 |
+
slide.$spinner.stop().remove();
|
2245 |
+
|
2246 |
+
delete slide.$spinner;
|
2247 |
+
}
|
2248 |
+
},
|
2249 |
+
|
2250 |
+
// Adjustments after slide content has been loaded
|
2251 |
+
// ===============================================
|
2252 |
+
|
2253 |
+
afterLoad: function (slide) {
|
2254 |
+
var self = this;
|
2255 |
+
|
2256 |
+
if (self.isClosing) {
|
2257 |
+
return;
|
2258 |
+
}
|
2259 |
+
|
2260 |
+
slide.isLoading = false;
|
2261 |
+
slide.isLoaded = true;
|
2262 |
+
|
2263 |
+
self.trigger("afterLoad", slide);
|
2264 |
+
|
2265 |
+
self.hideLoading(slide);
|
2266 |
+
|
2267 |
+
// Add small close button
|
2268 |
+
if (slide.opts.smallBtn && (!slide.$smallBtn || !slide.$smallBtn.length)) {
|
2269 |
+
slide.$smallBtn = $(self.translate(slide, slide.opts.btnTpl.smallBtn)).appendTo(slide.$content);
|
2270 |
+
}
|
2271 |
+
|
2272 |
+
// Disable right click
|
2273 |
+
if (slide.opts.protect && slide.$content && !slide.hasError) {
|
2274 |
+
slide.$content.on("contextmenu.fb", function (e) {
|
2275 |
+
if (e.button == 2) {
|
2276 |
+
e.preventDefault();
|
2277 |
+
}
|
2278 |
+
|
2279 |
+
return true;
|
2280 |
+
});
|
2281 |
+
|
2282 |
+
// Add fake element on top of the image
|
2283 |
+
// This makes a bit harder for user to select image
|
2284 |
+
if (slide.type === "image") {
|
2285 |
+
$('<div class="fancybox-spaceball"></div>').appendTo(slide.$content);
|
2286 |
+
}
|
2287 |
+
}
|
2288 |
+
|
2289 |
+
self.adjustCaption(slide);
|
2290 |
+
|
2291 |
+
self.adjustLayout(slide);
|
2292 |
+
|
2293 |
+
if (slide.pos === self.currPos) {
|
2294 |
+
self.updateCursor();
|
2295 |
+
}
|
2296 |
+
|
2297 |
+
self.revealContent(slide);
|
2298 |
+
},
|
2299 |
+
|
2300 |
+
// Prevent caption overlap,
|
2301 |
+
// fix css inconsistency across browsers
|
2302 |
+
// =====================================
|
2303 |
+
|
2304 |
+
adjustCaption: function (slide) {
|
2305 |
+
var self = this,
|
2306 |
+
current = slide || self.current,
|
2307 |
+
caption = current.opts.caption,
|
2308 |
+
preventOverlap = current.opts.preventCaptionOverlap,
|
2309 |
+
$caption = self.$refs.caption,
|
2310 |
+
$clone,
|
2311 |
+
captionH = false;
|
2312 |
+
|
2313 |
+
$caption.toggleClass("fancybox-caption--separate", preventOverlap);
|
2314 |
+
|
2315 |
+
if (preventOverlap && caption && caption.length) {
|
2316 |
+
if (current.pos !== self.currPos) {
|
2317 |
+
$clone = $caption.clone().appendTo($caption.parent());
|
2318 |
+
|
2319 |
+
$clone
|
2320 |
+
.children()
|
2321 |
+
.eq(0)
|
2322 |
+
.empty()
|
2323 |
+
.html(caption);
|
2324 |
+
|
2325 |
+
captionH = $clone.outerHeight(true);
|
2326 |
+
|
2327 |
+
$clone.empty().remove();
|
2328 |
+
} else if (self.$caption) {
|
2329 |
+
captionH = self.$caption.outerHeight(true);
|
2330 |
+
}
|
2331 |
+
|
2332 |
+
current.$slide.css("padding-bottom", captionH || "");
|
2333 |
+
}
|
2334 |
+
},
|
2335 |
+
|
2336 |
+
// Simple hack to fix inconsistency across browsers, described here (affects Edge, too):
|
2337 |
+
// https://bugzilla.mozilla.org/show_bug.cgi?id=748518
|
2338 |
+
// ====================================================================================
|
2339 |
+
|
2340 |
+
adjustLayout: function (slide) {
|
2341 |
+
var self = this,
|
2342 |
+
current = slide || self.current,
|
2343 |
+
scrollHeight,
|
2344 |
+
marginBottom,
|
2345 |
+
inlinePadding,
|
2346 |
+
actualPadding;
|
2347 |
+
|
2348 |
+
if (current.isLoaded && current.opts.disableLayoutFix !== true) {
|
2349 |
+
current.$content.css("margin-bottom", "");
|
2350 |
+
|
2351 |
+
// If we would always set margin-bottom for the content,
|
2352 |
+
// then it would potentially break vertical align
|
2353 |
+
if (current.$content.outerHeight() > current.$slide.height() + 0.5) {
|
2354 |
+
inlinePadding = current.$slide[0].style["padding-bottom"];
|
2355 |
+
actualPadding = current.$slide.css("padding-bottom");
|
2356 |
+
|
2357 |
+
if (parseFloat(actualPadding) > 0) {
|
2358 |
+
scrollHeight = current.$slide[0].scrollHeight;
|
2359 |
+
|
2360 |
+
current.$slide.css("padding-bottom", 0);
|
2361 |
+
|
2362 |
+
if (Math.abs(scrollHeight - current.$slide[0].scrollHeight) < 1) {
|
2363 |
+
marginBottom = actualPadding;
|
2364 |
+
}
|
2365 |
+
|
2366 |
+
current.$slide.css("padding-bottom", inlinePadding);
|
2367 |
+
}
|
2368 |
+
}
|
2369 |
+
|
2370 |
+
current.$content.css("margin-bottom", marginBottom);
|
2371 |
+
}
|
2372 |
+
},
|
2373 |
+
|
2374 |
+
// Make content visible
|
2375 |
+
// This method is called right after content has been loaded or
|
2376 |
+
// user navigates gallery and transition should start
|
2377 |
+
// ============================================================
|
2378 |
+
|
2379 |
+
revealContent: function (slide) {
|
2380 |
+
var self = this,
|
2381 |
+
$slide = slide.$slide,
|
2382 |
+
end = false,
|
2383 |
+
start = false,
|
2384 |
+
isMoved = self.isMoved(slide),
|
2385 |
+
isRevealed = slide.isRevealed,
|
2386 |
+
effect,
|
2387 |
+
effectClassName,
|
2388 |
+
duration,
|
2389 |
+
opacity;
|
2390 |
+
|
2391 |
+
slide.isRevealed = true;
|
2392 |
+
|
2393 |
+
effect = slide.opts[self.firstRun ? "animationEffect" : "transitionEffect"];
|
2394 |
+
duration = slide.opts[self.firstRun ? "animationDuration" : "transitionDuration"];
|
2395 |
+
|
2396 |
+
duration = parseInt(slide.forcedDuration === undefined ? duration : slide.forcedDuration, 10);
|
2397 |
+
|
2398 |
+
if (isMoved || slide.pos !== self.currPos || !duration) {
|
2399 |
+
effect = false;
|
2400 |
+
}
|
2401 |
+
|
2402 |
+
// Check if can zoom
|
2403 |
+
if (effect === "zoom") {
|
2404 |
+
if (slide.pos === self.currPos && duration && slide.type === "image" && !slide.hasError && (start = self.getThumbPos(slide))) {
|
2405 |
+
end = self.getFitPos(slide);
|
2406 |
+
} else {
|
2407 |
+
effect = "fade";
|
2408 |
+
}
|
2409 |
+
}
|
2410 |
+
|
2411 |
+
// Zoom animation
|
2412 |
+
// ==============
|
2413 |
+
if (effect === "zoom") {
|
2414 |
+
self.isAnimating = true;
|
2415 |
+
|
2416 |
+
end.scaleX = end.width / start.width;
|
2417 |
+
end.scaleY = end.height / start.height;
|
2418 |
+
|
2419 |
+
// Check if we need to animate opacity
|
2420 |
+
opacity = slide.opts.zoomOpacity;
|
2421 |
+
|
2422 |
+
if (opacity == "auto") {
|
2423 |
+
opacity = Math.abs(slide.width / slide.height - start.width / start.height) > 0.1;
|
2424 |
+
}
|
2425 |
+
|
2426 |
+
if (opacity) {
|
2427 |
+
start.opacity = 0.1;
|
2428 |
+
end.opacity = 1;
|
2429 |
+
}
|
2430 |
+
|
2431 |
+
// Draw image at start position
|
2432 |
+
$.fancybox.setTranslate(slide.$content.removeClass("fancybox-is-hidden"), start);
|
2433 |
+
|
2434 |
+
forceRedraw(slide.$content);
|
2435 |
+
|
2436 |
+
// Start animation
|
2437 |
+
$.fancybox.animate(slide.$content, end, duration, function () {
|
2438 |
+
self.isAnimating = false;
|
2439 |
+
|
2440 |
+
self.complete();
|
2441 |
+
});
|
2442 |
+
|
2443 |
+
return;
|
2444 |
+
}
|
2445 |
+
|
2446 |
+
self.updateSlide(slide);
|
2447 |
+
|
2448 |
+
// Simply show content if no effect
|
2449 |
+
// ================================
|
2450 |
+
if (!effect) {
|
2451 |
+
slide.$content.removeClass("fancybox-is-hidden");
|
2452 |
+
|
2453 |
+
if (!isRevealed && isMoved && slide.type === "image" && !slide.hasError) {
|
2454 |
+
slide.$content.hide().fadeIn("fast");
|
2455 |
+
}
|
2456 |
+
|
2457 |
+
if (slide.pos === self.currPos) {
|
2458 |
+
self.complete();
|
2459 |
+
}
|
2460 |
+
|
2461 |
+
return;
|
2462 |
+
}
|
2463 |
+
|
2464 |
+
// Prepare for CSS transiton
|
2465 |
+
// =========================
|
2466 |
+
$.fancybox.stop($slide);
|
2467 |
+
|
2468 |
+
//effectClassName = "fancybox-animated fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-fx-" + effect;
|
2469 |
+
effectClassName = "fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-animated fancybox-fx-" + effect;
|
2470 |
+
|
2471 |
+
$slide.addClass(effectClassName).removeClass("fancybox-slide--current"); //.addClass(effectClassName);
|
2472 |
+
|
2473 |
+
slide.$content.removeClass("fancybox-is-hidden");
|
2474 |
+
|
2475 |
+
// Force reflow
|
2476 |
+
forceRedraw($slide);
|
2477 |
+
|
2478 |
+
if (slide.type !== "image") {
|
2479 |
+
slide.$content.hide().show(0);
|
2480 |
+
}
|
2481 |
+
|
2482 |
+
$.fancybox.animate(
|
2483 |
+
$slide,
|
2484 |
+
"fancybox-slide--current",
|
2485 |
+
duration,
|
2486 |
+
function () {
|
2487 |
+
$slide.removeClass(effectClassName).css({
|
2488 |
+
transform: "",
|
2489 |
+
opacity: ""
|
2490 |
+
});
|
2491 |
+
|
2492 |
+
if (slide.pos === self.currPos) {
|
2493 |
+
self.complete();
|
2494 |
+
}
|
2495 |
+
},
|
2496 |
+
true
|
2497 |
+
);
|
2498 |
+
},
|
2499 |
+
|
2500 |
+
// Check if we can and have to zoom from thumbnail
|
2501 |
+
//================================================
|
2502 |
+
|
2503 |
+
getThumbPos: function (slide) {
|
2504 |
+
var rez = false,
|
2505 |
+
$thumb = slide.$thumb,
|
2506 |
+
thumbPos,
|
2507 |
+
btw,
|
2508 |
+
brw,
|
2509 |
+
bbw,
|
2510 |
+
blw;
|
2511 |
+
|
2512 |
+
if (!$thumb || !inViewport($thumb[0])) {
|
2513 |
+
return false;
|
2514 |
+
}
|
2515 |
+
|
2516 |
+
thumbPos = $.fancybox.getTranslate($thumb);
|
2517 |
+
|
2518 |
+
btw = parseFloat($thumb.css("border-top-width") || 0);
|
2519 |
+
brw = parseFloat($thumb.css("border-right-width") || 0);
|
2520 |
+
bbw = parseFloat($thumb.css("border-bottom-width") || 0);
|
2521 |
+
blw = parseFloat($thumb.css("border-left-width") || 0);
|
2522 |
+
|
2523 |
+
rez = {
|
2524 |
+
top: thumbPos.top + btw,
|
2525 |
+
left: thumbPos.left + blw,
|
2526 |
+
width: thumbPos.width - brw - blw,
|
2527 |
+
height: thumbPos.height - btw - bbw,
|
2528 |
+
scaleX: 1,
|
2529 |
+
scaleY: 1
|
2530 |
+
};
|
2531 |
+
|
2532 |
+
return thumbPos.width > 0 && thumbPos.height > 0 ? rez : false;
|
2533 |
+
},
|
2534 |
+
|
2535 |
+
// Final adjustments after current gallery item is moved to position
|
2536 |
+
// and it`s content is loaded
|
2537 |
+
// ==================================================================
|
2538 |
+
|
2539 |
+
complete: function () {
|
2540 |
+
var self = this,
|
2541 |
+
current = self.current,
|
2542 |
+
slides = {},
|
2543 |
+
$el;
|
2544 |
+
|
2545 |
+
if (self.isMoved() || !current.isLoaded) {
|
2546 |
+
return;
|
2547 |
+
}
|
2548 |
+
|
2549 |
+
if (!current.isComplete) {
|
2550 |
+
current.isComplete = true;
|
2551 |
+
|
2552 |
+
current.$slide.siblings().trigger("onReset");
|
2553 |
+
|
2554 |
+
self.preload("inline");
|
2555 |
+
|
2556 |
+
// Trigger any CSS transiton inside the slide
|
2557 |
+
forceRedraw(current.$slide);
|
2558 |
+
|
2559 |
+
current.$slide.addClass("fancybox-slide--complete");
|
2560 |
+
|
2561 |
+
// Remove unnecessary slides
|
2562 |
+
$.each(self.slides, function (key, slide) {
|
2563 |
+
if (slide.pos >= self.currPos - 1 && slide.pos <= self.currPos + 1) {
|
2564 |
+
slides[slide.pos] = slide;
|
2565 |
+
} else if (slide) {
|
2566 |
+
$.fancybox.stop(slide.$slide);
|
2567 |
+
|
2568 |
+
slide.$slide.off().remove();
|
2569 |
+
}
|
2570 |
+
});
|
2571 |
+
|
2572 |
+
self.slides = slides;
|
2573 |
+
}
|
2574 |
+
|
2575 |
+
self.isAnimating = false;
|
2576 |
+
|
2577 |
+
self.updateCursor();
|
2578 |
+
|
2579 |
+
self.trigger("afterShow");
|
2580 |
+
|
2581 |
+
// Autoplay first html5 video/audio
|
2582 |
+
if (!!current.opts.video.autoStart) {
|
2583 |
+
current.$slide
|
2584 |
+
.find("video,audio")
|
2585 |
+
.filter(":visible:first")
|
2586 |
+
.trigger("play")
|
2587 |
+
.one("ended", function () {
|
2588 |
+
if (Document.exitFullscreen) {
|
2589 |
+
Document.exitFullscreen();
|
2590 |
+
} else if (this.webkitExitFullscreen) {
|
2591 |
+
this.webkitExitFullscreen();
|
2592 |
+
}
|
2593 |
+
|
2594 |
+
self.next();
|
2595 |
+
});
|
2596 |
+
}
|
2597 |
+
|
2598 |
+
// Try to focus on the first focusable element
|
2599 |
+
if (current.opts.autoFocus && current.contentType === "html") {
|
2600 |
+
// Look for the first input with autofocus attribute
|
2601 |
+
$el = current.$content.find("input[autofocus]:enabled:visible:first");
|
2602 |
+
|
2603 |
+
if ($el.length) {
|
2604 |
+
$el.trigger("focus");
|
2605 |
+
} else {
|
2606 |
+
self.focus(null, true);
|
2607 |
+
}
|
2608 |
+
}
|
2609 |
+
|
2610 |
+
// Avoid jumping
|
2611 |
+
current.$slide.scrollTop(0).scrollLeft(0);
|
2612 |
+
},
|
2613 |
+
|
2614 |
+
// Preload next and previous slides
|
2615 |
+
// ================================
|
2616 |
+
|
2617 |
+
preload: function (type) {
|
2618 |
+
var self = this,
|
2619 |
+
prev,
|
2620 |
+
next;
|
2621 |
+
|
2622 |
+
if (self.group.length < 2) {
|
2623 |
+
return;
|
2624 |
+
}
|
2625 |
+
|
2626 |
+
next = self.slides[self.currPos + 1];
|
2627 |
+
prev = self.slides[self.currPos - 1];
|
2628 |
+
|
2629 |
+
if (prev && prev.type === type) {
|
2630 |
+
self.loadSlide(prev);
|
2631 |
+
}
|
2632 |
+
|
2633 |
+
if (next && next.type === type) {
|
2634 |
+
self.loadSlide(next);
|
2635 |
+
}
|
2636 |
+
},
|
2637 |
+
|
2638 |
+
// Try to find and focus on the first focusable element
|
2639 |
+
// ====================================================
|
2640 |
+
|
2641 |
+
focus: function (e, firstRun) {
|
2642 |
+
var self = this,
|
2643 |
+
focusableStr = [
|
2644 |
+
"a[href]",
|
2645 |
+
"area[href]",
|
2646 |
+
'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',
|
2647 |
+
"select:not([disabled]):not([aria-hidden])",
|
2648 |
+
"textarea:not([disabled]):not([aria-hidden])",
|
2649 |
+
"button:not([disabled]):not([aria-hidden])",
|
2650 |
+
"iframe",
|
2651 |
+
"object",
|
2652 |
+
"embed",
|
2653 |
+
"video",
|
2654 |
+
"audio",
|
2655 |
+
"[contenteditable]",
|
2656 |
+
'[tabindex]:not([tabindex^="-"])'
|
2657 |
+
].join(","),
|
2658 |
+
focusableItems,
|
2659 |
+
focusedItemIndex;
|
2660 |
+
|
2661 |
+
if (self.isClosing) {
|
2662 |
+
return;
|
2663 |
+
}
|
2664 |
+
|
2665 |
+
if (e || !self.current || !self.current.isComplete) {
|
2666 |
+
// Focus on any element inside fancybox
|
2667 |
+
focusableItems = self.$refs.container.find("*:visible");
|
2668 |
+
} else {
|
2669 |
+
// Focus inside current slide
|
2670 |
+
focusableItems = self.current.$slide.find("*:visible" + (firstRun ? ":not(.fancybox-close-small)" : ""));
|
2671 |
+
}
|
2672 |
+
|
2673 |
+
focusableItems = focusableItems.filter(focusableStr).filter(function () {
|
2674 |
+
return $(this).css("visibility") !== "hidden" && !$(this).hasClass("disabled");
|
2675 |
+
});
|
2676 |
+
|
2677 |
+
if (focusableItems.length) {
|
2678 |
+
focusedItemIndex = focusableItems.index(document.activeElement);
|
2679 |
+
|
2680 |
+
if (e && e.shiftKey) {
|
2681 |
+
// Back tab
|
2682 |
+
if (focusedItemIndex < 0 || focusedItemIndex == 0) {
|
2683 |
+
e.preventDefault();
|
2684 |
+
|
2685 |
+
focusableItems.eq(focusableItems.length - 1).trigger("focus");
|
2686 |
+
}
|
2687 |
+
} else {
|
2688 |
+
// Outside or Forward tab
|
2689 |
+
if (focusedItemIndex < 0 || focusedItemIndex == focusableItems.length - 1) {
|
2690 |
+
if (e) {
|
2691 |
+
e.preventDefault();
|
2692 |
+
}
|
2693 |
+
|
2694 |
+
focusableItems.eq(0).trigger("focus");
|
2695 |
+
}
|
2696 |
+
}
|
2697 |
+
} else {
|
2698 |
+
self.$refs.container.trigger("focus");
|
2699 |
+
}
|
2700 |
+
},
|
2701 |
+
|
2702 |
+
// Activates current instance - brings container to the front and enables keyboard,
|
2703 |
+
// notifies other instances about deactivating
|
2704 |
+
// =================================================================================
|
2705 |
+
|
2706 |
+
activate: function () {
|
2707 |
+
var self = this;
|
2708 |
+
|
2709 |
+
// Deactivate all instances
|
2710 |
+
$(".fancybox-container").each(function () {
|
2711 |
+
var instance = $(this).data("FancyBox");
|
2712 |
+
|
2713 |
+
// Skip self and closing instances
|
2714 |
+
if (instance && instance.id !== self.id && !instance.isClosing) {
|
2715 |
+
instance.trigger("onDeactivate");
|
2716 |
+
|
2717 |
+
instance.removeEvents();
|
2718 |
+
|
2719 |
+
instance.isVisible = false;
|
2720 |
+
}
|
2721 |
+
});
|
2722 |
+
|
2723 |
+
self.isVisible = true;
|
2724 |
+
|
2725 |
+
if (self.current || self.isIdle) {
|
2726 |
+
self.update();
|
2727 |
+
|
2728 |
+
self.updateControls();
|
2729 |
+
}
|
2730 |
+
|
2731 |
+
self.trigger("onActivate");
|
2732 |
+
|
2733 |
+
self.addEvents();
|
2734 |
+
},
|
2735 |
+
|
2736 |
+
// Start closing procedure
|
2737 |
+
// This will start "zoom-out" animation if needed and clean everything up afterwards
|
2738 |
+
// =================================================================================
|
2739 |
+
|
2740 |
+
close: function (e, d) {
|
2741 |
+
var self = this,
|
2742 |
+
current = self.current,
|
2743 |
+
effect,
|
2744 |
+
duration,
|
2745 |
+
$content,
|
2746 |
+
domRect,
|
2747 |
+
opacity,
|
2748 |
+
start,
|
2749 |
+
end;
|
2750 |
+
|
2751 |
+
var done = function () {
|
2752 |
+
self.cleanUp(e);
|
2753 |
+
};
|
2754 |
+
|
2755 |
+
if (self.isClosing) {
|
2756 |
+
return false;
|
2757 |
+
}
|
2758 |
+
|
2759 |
+
self.isClosing = true;
|
2760 |
+
|
2761 |
+
// If beforeClose callback prevents closing, make sure content is centered
|
2762 |
+
if (self.trigger("beforeClose", e) === false) {
|
2763 |
+
self.isClosing = false;
|
2764 |
+
|
2765 |
+
requestAFrame(function () {
|
2766 |
+
self.update();
|
2767 |
+
});
|
2768 |
+
|
2769 |
+
return false;
|
2770 |
+
}
|
2771 |
+
|
2772 |
+
// Remove all events
|
2773 |
+
// If there are multiple instances, they will be set again by "activate" method
|
2774 |
+
self.removeEvents();
|
2775 |
+
|
2776 |
+
$content = current.$content;
|
2777 |
+
effect = current.opts.animationEffect;
|
2778 |
+
duration = $.isNumeric(d) ? d : effect ? current.opts.animationDuration : 0;
|
2779 |
+
|
2780 |
+
current.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated");
|
2781 |
+
|
2782 |
+
if (e !== true) {
|
2783 |
+
$.fancybox.stop(current.$slide);
|
2784 |
+
} else {
|
2785 |
+
effect = false;
|
2786 |
+
}
|
2787 |
+
|
2788 |
+
// Remove other slides
|
2789 |
+
current.$slide
|
2790 |
+
.siblings()
|
2791 |
+
.trigger("onReset")
|
2792 |
+
.remove();
|
2793 |
+
|
2794 |
+
// Trigger animations
|
2795 |
+
if (duration) {
|
2796 |
+
self.$refs.container
|
2797 |
+
.removeClass("fancybox-is-open")
|
2798 |
+
.addClass("fancybox-is-closing")
|
2799 |
+
.css("transition-duration", duration + "ms");
|
2800 |
+
}
|
2801 |
+
|
2802 |
+
// Clean up
|
2803 |
+
self.hideLoading(current);
|
2804 |
+
|
2805 |
+
self.hideControls(true);
|
2806 |
+
|
2807 |
+
self.updateCursor();
|
2808 |
+
|
2809 |
+
// Check if possible to zoom-out
|
2810 |
+
if (
|
2811 |
+
effect === "zoom" &&
|
2812 |
+
!($content && duration && current.type === "image" && !self.isMoved() && !current.hasError && (end = self.getThumbPos(current)))
|
2813 |
+
) {
|
2814 |
+
effect = "fade";
|
2815 |
+
}
|
2816 |
+
|
2817 |
+
if (effect === "zoom") {
|
2818 |
+
$.fancybox.stop($content);
|
2819 |
+
|
2820 |
+
domRect = $.fancybox.getTranslate($content);
|
2821 |
+
|
2822 |
+
start = {
|
2823 |
+
top: domRect.top,
|
2824 |
+
left: domRect.left,
|
2825 |
+
scaleX: domRect.width / end.width,
|
2826 |
+
scaleY: domRect.height / end.height,
|
2827 |
+
width: end.width,
|
2828 |
+
height: end.height
|
2829 |
+
};
|
2830 |
+
|
2831 |
+
// Check if we need to animate opacity
|
2832 |
+
opacity = current.opts.zoomOpacity;
|
2833 |
+
|
2834 |
+
if (opacity == "auto") {
|
2835 |
+
opacity = Math.abs(current.width / current.height - end.width / end.height) > 0.1;
|
2836 |
+
}
|
2837 |
+
|
2838 |
+
if (opacity) {
|
2839 |
+
end.opacity = 0;
|
2840 |
+
}
|
2841 |
+
|
2842 |
+
$.fancybox.setTranslate($content, start);
|
2843 |
+
|
2844 |
+
forceRedraw($content);
|
2845 |
+
|
2846 |
+
$.fancybox.animate($content, end, duration, done);
|
2847 |
+
|
2848 |
+
return true;
|
2849 |
+
}
|
2850 |
+
|
2851 |
+
if (effect && duration) {
|
2852 |
+
$.fancybox.animate(
|
2853 |
+
current.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),
|
2854 |
+
"fancybox-animated fancybox-fx-" + effect,
|
2855 |
+
duration,
|
2856 |
+
done
|
2857 |
+
);
|
2858 |
+
} else {
|
2859 |
+
// If skip animation
|
2860 |
+
if (e === true) {
|
2861 |
+
setTimeout(done, duration);
|
2862 |
+
} else {
|
2863 |
+
done();
|
2864 |
+
}
|
2865 |
+
}
|
2866 |
+
|
2867 |
+
return true;
|
2868 |
+
},
|
2869 |
+
|
2870 |
+
// Final adjustments after removing the instance
|
2871 |
+
// =============================================
|
2872 |
+
|
2873 |
+
cleanUp: function (e) {
|
2874 |
+
var self = this,
|
2875 |
+
instance,
|
2876 |
+
$focus = self.current.opts.$orig,
|
2877 |
+
x,
|
2878 |
+
y;
|
2879 |
+
|
2880 |
+
self.current.$slide.trigger("onReset");
|
2881 |
+
|
2882 |
+
self.$refs.container.empty().remove();
|
2883 |
+
|
2884 |
+
self.trigger("afterClose", e);
|
2885 |
+
|
2886 |
+
// Place back focus
|
2887 |
+
if (!!self.current.opts.backFocus) {
|
2888 |
+
if (!$focus || !$focus.length || !$focus.is(":visible")) {
|
2889 |
+
$focus = self.$trigger;
|
2890 |
+
}
|
2891 |
+
|
2892 |
+
if ($focus && $focus.length) {
|
2893 |
+
x = window.scrollX;
|
2894 |
+
y = window.scrollY;
|
2895 |
+
|
2896 |
+
$focus.trigger("focus");
|
2897 |
+
|
2898 |
+
$("html, body")
|
2899 |
+
.scrollTop(y)
|
2900 |
+
.scrollLeft(x);
|
2901 |
+
}
|
2902 |
+
}
|
2903 |
+
|
2904 |
+
self.current = null;
|
2905 |
+
|
2906 |
+
// Check if there are other instances
|
2907 |
+
instance = $.fancybox.getInstance();
|
2908 |
+
|
2909 |
+
if (instance) {
|
2910 |
+
instance.activate();
|
2911 |
+
} else {
|
2912 |
+
$("body").removeClass("fancybox-active compensate-for-scrollbar");
|
2913 |
+
|
2914 |
+
$("#fancybox-style-noscroll").remove();
|
2915 |
+
}
|
2916 |
+
},
|
2917 |
+
|
2918 |
+
// Call callback and trigger an event
|
2919 |
+
// ==================================
|
2920 |
+
|
2921 |
+
trigger: function (name, slide) {
|
2922 |
+
var args = Array.prototype.slice.call(arguments, 1),
|
2923 |
+
self = this,
|
2924 |
+
obj = slide && slide.opts ? slide : self.current,
|
2925 |
+
rez;
|
2926 |
+
|
2927 |
+
if (obj) {
|
2928 |
+
args.unshift(obj);
|
2929 |
+
} else {
|
2930 |
+
obj = self;
|
2931 |
+
}
|
2932 |
+
|
2933 |
+
args.unshift(self);
|
2934 |
+
|
2935 |
+
if ($.isFunction(obj.opts[name])) {
|
2936 |
+
rez = obj.opts[name].apply(obj, args);
|
2937 |
+
}
|
2938 |
+
|
2939 |
+
if (rez === false) {
|
2940 |
+
return rez;
|
2941 |
+
}
|
2942 |
+
|
2943 |
+
if (name === "afterClose" || !self.$refs) {
|
2944 |
+
$D.trigger(name + ".fb", args);
|
2945 |
+
} else {
|
2946 |
+
self.$refs.container.trigger(name + ".fb", args);
|
2947 |
+
}
|
2948 |
+
},
|
2949 |
+
|
2950 |
+
// Update infobar values, navigation button states and reveal caption
|
2951 |
+
// ==================================================================
|
2952 |
+
|
2953 |
+
updateControls: function () {
|
2954 |
+
var self = this,
|
2955 |
+
current = self.current,
|
2956 |
+
index = current.index,
|
2957 |
+
$container = self.$refs.container,
|
2958 |
+
$caption = self.$refs.caption,
|
2959 |
+
caption = current.opts.caption;
|
2960 |
+
|
2961 |
+
// Recalculate content dimensions
|
2962 |
+
current.$slide.trigger("refresh");
|
2963 |
+
|
2964 |
+
// Set caption
|
2965 |
+
if (caption && caption.length) {
|
2966 |
+
self.$caption = $caption;
|
2967 |
+
|
2968 |
+
$caption
|
2969 |
+
.children()
|
2970 |
+
.eq(0)
|
2971 |
+
.html(caption);
|
2972 |
+
} else {
|
2973 |
+
self.$caption = null;
|
2974 |
+
}
|
2975 |
+
|
2976 |
+
if (!self.hasHiddenControls && !self.isIdle) {
|
2977 |
+
self.showControls();
|
2978 |
+
}
|
2979 |
+
|
2980 |
+
// Update info and navigation elements
|
2981 |
+
$container.find("[data-fancybox-count]").html(self.group.length);
|
2982 |
+
$container.find("[data-fancybox-index]").html(index + 1);
|
2983 |
+
|
2984 |
+
$container.find("[data-fancybox-prev]").prop("disabled", !current.opts.loop && index <= 0);
|
2985 |
+
$container.find("[data-fancybox-next]").prop("disabled", !current.opts.loop && index >= self.group.length - 1);
|
2986 |
+
|
2987 |
+
if (current.type === "image") {
|
2988 |
+
// Re-enable buttons; update download button source
|
2989 |
+
$container
|
2990 |
+
.find("[data-fancybox-zoom]")
|
2991 |
+
.show()
|
2992 |
+
.end()
|
2993 |
+
.find("[data-fancybox-download]")
|
2994 |
+
.attr("href", current.opts.image.src || current.src)
|
2995 |
+
.show();
|
2996 |
+
} else if (current.opts.toolbar) {
|
2997 |
+
$container.find("[data-fancybox-download],[data-fancybox-zoom]").hide();
|
2998 |
+
}
|
2999 |
+
|
3000 |
+
// Make sure focus is not on disabled button/element
|
3001 |
+
if ($(document.activeElement).is(":hidden,[disabled]")) {
|
3002 |
+
self.$refs.container.trigger("focus");
|
3003 |
+
}
|
3004 |
+
},
|
3005 |
+
|
3006 |
+
// Hide toolbar and caption
|
3007 |
+
// ========================
|
3008 |
+
|
3009 |
+
hideControls: function (andCaption) {
|
3010 |
+
var self = this,
|
3011 |
+
arr = ["infobar", "toolbar", "nav"];
|
3012 |
+
|
3013 |
+
if (andCaption || !self.current.opts.preventCaptionOverlap) {
|
3014 |
+
arr.push("caption");
|
3015 |
+
}
|
3016 |
+
|
3017 |
+
this.$refs.container.removeClass(
|
3018 |
+
arr
|
3019 |
+
.map(function (i) {
|
3020 |
+
return "fancybox-show-" + i;
|
3021 |
+
})
|
3022 |
+
.join(" ")
|
3023 |
+
);
|
3024 |
+
|
3025 |
+
this.hasHiddenControls = true;
|
3026 |
+
},
|
3027 |
+
|
3028 |
+
showControls: function () {
|
3029 |
+
var self = this,
|
3030 |
+
opts = self.current ? self.current.opts : self.opts,
|
3031 |
+
$container = self.$refs.container;
|
3032 |
+
|
3033 |
+
self.hasHiddenControls = false;
|
3034 |
+
self.idleSecondsCounter = 0;
|
3035 |
+
|
3036 |
+
$container
|
3037 |
+
.toggleClass("fancybox-show-toolbar", !!(opts.toolbar && opts.buttons))
|
3038 |
+
.toggleClass("fancybox-show-infobar", !!(opts.infobar && self.group.length > 1))
|
3039 |
+
.toggleClass("fancybox-show-caption", !!self.$caption)
|
3040 |
+
.toggleClass("fancybox-show-nav", !!(opts.arrows && self.group.length > 1))
|
3041 |
+
.toggleClass("fancybox-is-modal", !!opts.modal);
|
3042 |
+
},
|
3043 |
+
|
3044 |
+
// Toggle toolbar and caption
|
3045 |
+
// ==========================
|
3046 |
+
|
3047 |
+
toggleControls: function () {
|
3048 |
+
if (this.hasHiddenControls) {
|
3049 |
+
this.showControls();
|
3050 |
+
} else {
|
3051 |
+
this.hideControls();
|
3052 |
+
}
|
3053 |
+
}
|
3054 |
+
});
|
3055 |
+
|
3056 |
+
$.fancybox = {
|
3057 |
+
version: "3.5.7",
|
3058 |
+
defaults: defaults,
|
3059 |
+
|
3060 |
+
// Get current instance and execute a command.
|
3061 |
+
//
|
3062 |
+
// Examples of usage:
|
3063 |
+
//
|
3064 |
+
// $instance = $.fancybox.getInstance();
|
3065 |
+
// $.fancybox.getInstance().jumpTo( 1 );
|
3066 |
+
// $.fancybox.getInstance( 'jumpTo', 1 );
|
3067 |
+
// $.fancybox.getInstance( function() {
|
3068 |
+
// console.info( this.currIndex );
|
3069 |
+
// });
|
3070 |
+
// ======================================================
|
3071 |
+
|
3072 |
+
getInstance: function (command) {
|
3073 |
+
var instance = $('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),
|
3074 |
+
args = Array.prototype.slice.call(arguments, 1);
|
3075 |
+
|
3076 |
+
if (instance instanceof FancyBox) {
|
3077 |
+
if ($.type(command) === "string") {
|
3078 |
+
instance[command].apply(instance, args);
|
3079 |
+
} else if ($.type(command) === "function") {
|
3080 |
+
command.apply(instance, args);
|
3081 |
+
}
|
3082 |
+
|
3083 |
+
return instance;
|
3084 |
+
}
|
3085 |
+
|
3086 |
+
return false;
|
3087 |
+
},
|
3088 |
+
|
3089 |
+
// Create new instance
|
3090 |
+
// ===================
|
3091 |
+
|
3092 |
+
open: function (items, opts, index) {
|
3093 |
+
return new FancyBox(items, opts, index);
|
3094 |
+
},
|
3095 |
+
|
3096 |
+
// Close current or all instances
|
3097 |
+
// ==============================
|
3098 |
+
|
3099 |
+
close: function (all) {
|
3100 |
+
var instance = this.getInstance();
|
3101 |
+
|
3102 |
+
if (instance) {
|
3103 |
+
instance.close();
|
3104 |
+
|
3105 |
+
// Try to find and close next instance
|
3106 |
+
if (all === true) {
|
3107 |
+
this.close(all);
|
3108 |
+
}
|
3109 |
+
}
|
3110 |
+
},
|
3111 |
+
|
3112 |
+
// Close all instances and unbind all events
|
3113 |
+
// =========================================
|
3114 |
+
|
3115 |
+
destroy: function () {
|
3116 |
+
this.close(true);
|
3117 |
+
|
3118 |
+
$D.add("body").off("click.fb-start", "**");
|
3119 |
+
},
|
3120 |
+
|
3121 |
+
// Try to detect mobile devices
|
3122 |
+
// ============================
|
3123 |
+
|
3124 |
+
isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
|
3125 |
+
|
3126 |
+
// Detect if 'translate3d' support is available
|
3127 |
+
// ============================================
|
3128 |
+
|
3129 |
+
use3d: (function () {
|
3130 |
+
var div = document.createElement("div");
|
3131 |
+
|
3132 |
+
return (
|
3133 |
+
window.getComputedStyle &&
|
3134 |
+
window.getComputedStyle(div) &&
|
3135 |
+
window.getComputedStyle(div).getPropertyValue("transform") &&
|
3136 |
+
!(document.documentMode && document.documentMode < 11)
|
3137 |
+
);
|
3138 |
+
})(),
|
3139 |
+
|
3140 |
+
// Helper function to get current visual state of an element
|
3141 |
+
// returns array[ top, left, horizontal-scale, vertical-scale, opacity ]
|
3142 |
+
// =====================================================================
|
3143 |
+
|
3144 |
+
getTranslate: function ($el) {
|
3145 |
+
var domRect;
|
3146 |
+
|
3147 |
+
if (!$el || !$el.length) {
|
3148 |
+
return false;
|
3149 |
+
}
|
3150 |
+
|
3151 |
+
domRect = $el[0].getBoundingClientRect();
|
3152 |
+
|
3153 |
+
return {
|
3154 |
+
top: domRect.top || 0,
|
3155 |
+
left: domRect.left || 0,
|
3156 |
+
width: domRect.width,
|
3157 |
+
height: domRect.height,
|
3158 |
+
opacity: parseFloat($el.css("opacity"))
|
3159 |
+
};
|
3160 |
+
},
|
3161 |
+
|
3162 |
+
// Shortcut for setting "translate3d" properties for element
|
3163 |
+
// Can set be used to set opacity, too
|
3164 |
+
// ========================================================
|
3165 |
+
|
3166 |
+
setTranslate: function ($el, props) {
|
3167 |
+
var str = "",
|
3168 |
+
css = {};
|
3169 |
+
|
3170 |
+
if (!$el || !props) {
|
3171 |
+
return;
|
3172 |
+
}
|
3173 |
+
|
3174 |
+
if (props.left !== undefined || props.top !== undefined) {
|
3175 |
+
str =
|
3176 |
+
(props.left === undefined ? $el.position().left : props.left) +
|
3177 |
+
"px, " +
|
3178 |
+
(props.top === undefined ? $el.position().top : props.top) +
|
3179 |
+
"px";
|
3180 |
+
|
3181 |
+
if (this.use3d) {
|
3182 |
+
str = "translate3d(" + str + ", 0px)";
|
3183 |
+
} else {
|
3184 |
+
str = "translate(" + str + ")";
|
3185 |
+
}
|
3186 |
+
}
|
3187 |
+
|
3188 |
+
if (props.scaleX !== undefined && props.scaleY !== undefined) {
|
3189 |
+
str += " scale(" + props.scaleX + ", " + props.scaleY + ")";
|
3190 |
+
} else if (props.scaleX !== undefined) {
|
3191 |
+
str += " scaleX(" + props.scaleX + ")";
|
3192 |
+
}
|
3193 |
+
|
3194 |
+
if (str.length) {
|
3195 |
+
css.transform = str;
|
3196 |
+
}
|
3197 |
+
|
3198 |
+
if (props.opacity !== undefined) {
|
3199 |
+
css.opacity = props.opacity;
|
3200 |
+
}
|
3201 |
+
|
3202 |
+
if (props.width !== undefined) {
|
3203 |
+
css.width = props.width;
|
3204 |
+
}
|
3205 |
+
|
3206 |
+
if (props.height !== undefined) {
|
3207 |
+
css.height = props.height;
|
3208 |
+
}
|
3209 |
+
|
3210 |
+
return $el.css(css);
|
3211 |
+
},
|
3212 |
+
|
3213 |
+
// Simple CSS transition handler
|
3214 |
+
// =============================
|
3215 |
+
|
3216 |
+
animate: function ($el, to, duration, callback, leaveAnimationName) {
|
3217 |
+
var self = this,
|
3218 |
+
from;
|
3219 |
+
|
3220 |
+
if ($.isFunction(duration)) {
|
3221 |
+
callback = duration;
|
3222 |
+
duration = null;
|
3223 |
+
}
|
3224 |
+
|
3225 |
+
self.stop($el);
|
3226 |
+
|
3227 |
+
from = self.getTranslate($el);
|
3228 |
+
|
3229 |
+
$el.on(transitionEnd, function (e) {
|
3230 |
+
// Skip events from child elements and z-index change
|
3231 |
+
if (e && e.originalEvent && (!$el.is(e.originalEvent.target) || e.originalEvent.propertyName == "z-index")) {
|
3232 |
+
return;
|
3233 |
+
}
|
3234 |
+
|
3235 |
+
self.stop($el);
|
3236 |
+
|
3237 |
+
if ($.isNumeric(duration)) {
|
3238 |
+
$el.css("transition-duration", "");
|
3239 |
+
}
|
3240 |
+
|
3241 |
+
if ($.isPlainObject(to)) {
|
3242 |
+
if (to.scaleX !== undefined && to.scaleY !== undefined) {
|
3243 |
+
self.setTranslate($el, {
|
3244 |
+
top: to.top,
|
3245 |
+
left: to.left,
|
3246 |
+
width: from.width * to.scaleX,
|
3247 |
+
height: from.height * to.scaleY,
|
3248 |
+
scaleX: 1,
|
3249 |
+
scaleY: 1
|
3250 |
+
});
|
3251 |
+
}
|
3252 |
+
} else if (leaveAnimationName !== true) {
|
3253 |
+
$el.removeClass(to);
|
3254 |
+
}
|
3255 |
+
|
3256 |
+
if ($.isFunction(callback)) {
|
3257 |
+
callback(e);
|
3258 |
+
}
|
3259 |
+
});
|
3260 |
+
|
3261 |
+
if ($.isNumeric(duration)) {
|
3262 |
+
$el.css("transition-duration", duration + "ms");
|
3263 |
+
}
|
3264 |
+
|
3265 |
+
// Start animation by changing CSS properties or class name
|
3266 |
+
if ($.isPlainObject(to)) {
|
3267 |
+
if (to.scaleX !== undefined && to.scaleY !== undefined) {
|
3268 |
+
delete to.width;
|
3269 |
+
delete to.height;
|
3270 |
+
|
3271 |
+
if ($el.parent().hasClass("fancybox-slide--image")) {
|
3272 |
+
$el.parent().addClass("fancybox-is-scaling");
|
3273 |
+
}
|
3274 |
+
}
|
3275 |
+
|
3276 |
+
$.fancybox.setTranslate($el, to);
|
3277 |
+
} else {
|
3278 |
+
$el.addClass(to);
|
3279 |
+
}
|
3280 |
+
|
3281 |
+
// Make sure that `transitionend` callback gets fired
|
3282 |
+
$el.data(
|
3283 |
+
"timer",
|
3284 |
+
setTimeout(function () {
|
3285 |
+
$el.trigger(transitionEnd);
|
3286 |
+
}, duration + 33)
|
3287 |
+
);
|
3288 |
+
},
|
3289 |
+
|
3290 |
+
stop: function ($el, callCallback) {
|
3291 |
+
if ($el && $el.length) {
|
3292 |
+
clearTimeout($el.data("timer"));
|
3293 |
+
|
3294 |
+
if (callCallback) {
|
3295 |
+
$el.trigger(transitionEnd);
|
3296 |
+
}
|
3297 |
+
|
3298 |
+
$el.off(transitionEnd).css("transition-duration", "");
|
3299 |
+
|
3300 |
+
$el.parent().removeClass("fancybox-is-scaling");
|
3301 |
+
}
|
3302 |
+
}
|
3303 |
+
};
|
3304 |
+
|
3305 |
+
// Default click handler for "fancyboxed" links
|
3306 |
+
// ============================================
|
3307 |
+
|
3308 |
+
function _run(e, opts) {
|
3309 |
+
var items = [],
|
3310 |
+
index = 0,
|
3311 |
+
$target,
|
3312 |
+
value,
|
3313 |
+
instance;
|
3314 |
+
|
3315 |
+
// Avoid opening multiple times
|
3316 |
+
if (e && e.isDefaultPrevented()) {
|
3317 |
+
return;
|
3318 |
+
}
|
3319 |
+
|
3320 |
+
e.preventDefault();
|
3321 |
+
|
3322 |
+
opts = opts || {};
|
3323 |
+
|
3324 |
+
if (e && e.data) {
|
3325 |
+
opts = mergeOpts(e.data.options, opts);
|
3326 |
+
}
|
3327 |
+
|
3328 |
+
$target = opts.$target || $(e.currentTarget).trigger("blur");
|
3329 |
+
instance = $.fancybox.getInstance();
|
3330 |
+
|
3331 |
+
if (instance && instance.$trigger && instance.$trigger.is($target)) {
|
3332 |
+
return;
|
3333 |
+
}
|
3334 |
+
|
3335 |
+
if (opts.selector) {
|
3336 |
+
items = $(opts.selector);
|
3337 |
+
} else {
|
3338 |
+
// Get all related items and find index for clicked one
|
3339 |
+
value = $target.attr("data-fancybox") || "";
|
3340 |
+
|
3341 |
+
if (value) {
|
3342 |
+
items = e.data ? e.data.items : [];
|
3343 |
+
items = items.length ? items.filter('[data-fancybox="' + value + '"]') : $('[data-fancybox="' + value + '"]');
|
3344 |
+
} else {
|
3345 |
+
items = [$target];
|
3346 |
+
}
|
3347 |
+
}
|
3348 |
+
|
3349 |
+
index = $(items).index($target);
|
3350 |
+
|
3351 |
+
// Sometimes current item can not be found
|
3352 |
+
if (index < 0) {
|
3353 |
+
index = 0;
|
3354 |
+
}
|
3355 |
+
|
3356 |
+
instance = $.fancybox.open(items, opts, index);
|
3357 |
+
|
3358 |
+
// Save last active element
|
3359 |
+
instance.$trigger = $target;
|
3360 |
+
}
|
3361 |
+
|
3362 |
+
// Create a jQuery plugin
|
3363 |
+
// ======================
|
3364 |
+
|
3365 |
+
$.fn.fancybox = function (options) {
|
3366 |
+
var selector;
|
3367 |
+
|
3368 |
+
options = options || {};
|
3369 |
+
selector = options.selector || false;
|
3370 |
+
|
3371 |
+
if (selector) {
|
3372 |
+
// Use body element instead of document so it executes first
|
3373 |
+
$("body")
|
3374 |
+
.off("click.fb-start", selector)
|
3375 |
+
.on("click.fb-start", selector, {
|
3376 |
+
options: options
|
3377 |
+
}, _run);
|
3378 |
+
} else {
|
3379 |
+
this.off("click.fb-start").on(
|
3380 |
+
"click.fb-start", {
|
3381 |
+
items: this,
|
3382 |
+
options: options
|
3383 |
+
},
|
3384 |
+
_run
|
3385 |
+
);
|
3386 |
+
}
|
3387 |
+
|
3388 |
+
return this;
|
3389 |
+
};
|
3390 |
+
|
3391 |
+
// Self initializing plugin for all elements having `data-fancybox` attribute
|
3392 |
+
// ==========================================================================
|
3393 |
+
|
3394 |
+
$D.on("click.fb-start", "[data-fancybox]", _run);
|
3395 |
+
|
3396 |
+
// Enable "trigger elements"
|
3397 |
+
// =========================
|
3398 |
+
|
3399 |
+
$D.on("click.fb-start", "[data-fancybox-trigger]", function (e) {
|
3400 |
+
$('[data-fancybox="' + $(this).attr("data-fancybox-trigger") + '"]')
|
3401 |
+
.eq($(this).attr("data-fancybox-index") || 0)
|
3402 |
+
.trigger("click.fb-start", {
|
3403 |
+
$trigger: $(this)
|
3404 |
+
});
|
3405 |
+
});
|
3406 |
+
|
3407 |
+
// Track focus event for better accessibility styling
|
3408 |
+
// ==================================================
|
3409 |
+
(function () {
|
3410 |
+
var buttonStr = ".fancybox-button",
|
3411 |
+
focusStr = "fancybox-focus",
|
3412 |
+
$pressed = null;
|
3413 |
+
|
3414 |
+
$D.on("mousedown mouseup focus blur", buttonStr, function (e) {
|
3415 |
+
switch (e.type) {
|
3416 |
+
case "mousedown":
|
3417 |
+
$pressed = $(this);
|
3418 |
+
break;
|
3419 |
+
case "mouseup":
|
3420 |
+
$pressed = null;
|
3421 |
+
break;
|
3422 |
+
case "focusin":
|
3423 |
+
$(buttonStr).removeClass(focusStr);
|
3424 |
+
|
3425 |
+
if (!$(this).is($pressed) && !$(this).is("[disabled]")) {
|
3426 |
+
$(this).addClass(focusStr);
|
3427 |
+
}
|
3428 |
+
break;
|
3429 |
+
case "focusout":
|
3430 |
+
$(buttonStr).removeClass(focusStr);
|
3431 |
+
break;
|
3432 |
+
}
|
3433 |
+
});
|
3434 |
+
})();
|
3435 |
+
})(window, document, jQuery);
|
3436 |
+
// ==========================================================================
|
3437 |
+
//
|
3438 |
+
// Media
|
3439 |
+
// Adds additional media type support
|
3440 |
+
//
|
3441 |
+
// ==========================================================================
|
3442 |
+
(function ($) {
|
3443 |
+
"use strict";
|
3444 |
+
|
3445 |
+
// Object containing properties for each media type
|
3446 |
+
var defaults = {
|
3447 |
+
youtube: {
|
3448 |
+
matcher: /(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,
|
3449 |
+
params: {
|
3450 |
+
autoplay: 1,
|
3451 |
+
autohide: 1,
|
3452 |
+
fs: 1,
|
3453 |
+
rel: 0,
|
3454 |
+
hd: 1,
|
3455 |
+
wmode: "transparent",
|
3456 |
+
enablejsapi: 1,
|
3457 |
+
html5: 1
|
3458 |
+
},
|
3459 |
+
paramPlace: 8,
|
3460 |
+
type: "iframe",
|
3461 |
+
url: "https://www.youtube-nocookie.com/embed/$4",
|
3462 |
+
thumb: "https://img.youtube.com/vi/$4/hqdefault.jpg"
|
3463 |
+
},
|
3464 |
+
|
3465 |
+
vimeo: {
|
3466 |
+
matcher: /^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,
|
3467 |
+
params: {
|
3468 |
+
autoplay: 1,
|
3469 |
+
hd: 1,
|
3470 |
+
show_title: 1,
|
3471 |
+
show_byline: 1,
|
3472 |
+
show_portrait: 0,
|
3473 |
+
fullscreen: 1
|
3474 |
+
},
|
3475 |
+
paramPlace: 3,
|
3476 |
+
type: "iframe",
|
3477 |
+
url: "//player.vimeo.com/video/$2"
|
3478 |
+
},
|
3479 |
+
|
3480 |
+
instagram: {
|
3481 |
+
matcher: /(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
|
3482 |
+
type: "image",
|
3483 |
+
url: "//$1/p/$2/media/?size=l"
|
3484 |
+
},
|
3485 |
+
|
3486 |
+
// Examples:
|
3487 |
+
// http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
|
3488 |
+
// https://www.google.com/maps/@37.7852006,-122.4146355,14.65z
|
3489 |
+
// https://www.google.com/maps/@52.2111123,2.9237542,6.61z?hl=en
|
3490 |
+
// https://www.google.com/maps/place/Googleplex/@37.4220041,-122.0833494,17z/data=!4m5!3m4!1s0x0:0x6c296c66619367e0!8m2!3d37.4219998!4d-122.0840572
|
3491 |
+
gmap_place: {
|
3492 |
+
matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,
|
3493 |
+
type: "iframe",
|
3494 |
+
url: function (rez) {
|
3495 |
+
return (
|
3496 |
+
"//maps.google." +
|
3497 |
+
rez[2] +
|
3498 |
+
"/?ll=" +
|
3499 |
+
(rez[9] ? rez[9] + "&z=" + Math.floor(rez[10]) + (rez[12] ? rez[12].replace(/^\//, "&") : "") : rez[12] + "").replace(/\?/, "&") +
|
3500 |
+
"&output=" +
|
3501 |
+
(rez[12] && rez[12].indexOf("layer=c") > 0 ? "svembed" : "embed")
|
3502 |
+
);
|
3503 |
+
}
|
3504 |
+
},
|
3505 |
+
|
3506 |
+
// Examples:
|
3507 |
+
// https://www.google.com/maps/search/Empire+State+Building/
|
3508 |
+
// https://www.google.com/maps/search/?api=1&query=centurylink+field
|
3509 |
+
// https://www.google.com/maps/search/?api=1&query=47.5951518,-122.3316393
|
3510 |
+
gmap_search: {
|
3511 |
+
matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,
|
3512 |
+
type: "iframe",
|
3513 |
+
url: function (rez) {
|
3514 |
+
return "//maps.google." + rez[2] + "/maps?q=" + rez[5].replace("query=", "q=").replace("api=1", "") + "&output=embed";
|
3515 |
+
}
|
3516 |
+
}
|
3517 |
+
};
|
3518 |
+
|
3519 |
+
// Formats matching url to final form
|
3520 |
+
var format = function (url, rez, params) {
|
3521 |
+
if (!url) {
|
3522 |
+
return;
|
3523 |
+
}
|
3524 |
+
|
3525 |
+
params = params || "";
|
3526 |
+
|
3527 |
+
if ($.type(params) === "object") {
|
3528 |
+
params = $.param(params, true);
|
3529 |
+
}
|
3530 |
+
|
3531 |
+
$.each(rez, function (key, value) {
|
3532 |
+
url = url.replace("$" + key, value || "");
|
3533 |
+
});
|
3534 |
+
|
3535 |
+
if (params.length) {
|
3536 |
+
url += (url.indexOf("?") > 0 ? "&" : "?") + params;
|
3537 |
+
}
|
3538 |
+
|
3539 |
+
return url;
|
3540 |
+
};
|
3541 |
+
|
3542 |
+
$(document).on("objectNeedsType.fb", function (e, instance, item) {
|
3543 |
+
var url = item.src || "",
|
3544 |
+
type = false,
|
3545 |
+
media,
|
3546 |
+
thumb,
|
3547 |
+
rez,
|
3548 |
+
params,
|
3549 |
+
urlParams,
|
3550 |
+
paramObj,
|
3551 |
+
provider;
|
3552 |
+
|
3553 |
+
media = $.extend(true, {}, defaults, item.opts.media);
|
3554 |
+
|
3555 |
+
// Look for any matching media type
|
3556 |
+
$.each(media, function (providerName, providerOpts) {
|
3557 |
+
rez = url.match(providerOpts.matcher);
|
3558 |
+
|
3559 |
+
if (!rez) {
|
3560 |
+
return;
|
3561 |
+
}
|
3562 |
+
|
3563 |
+
type = providerOpts.type;
|
3564 |
+
provider = providerName;
|
3565 |
+
paramObj = {};
|
3566 |
+
|
3567 |
+
if (providerOpts.paramPlace && rez[providerOpts.paramPlace]) {
|
3568 |
+
urlParams = rez[providerOpts.paramPlace];
|
3569 |
+
|
3570 |
+
if (urlParams[0] == "?") {
|
3571 |
+
urlParams = urlParams.substring(1);
|
3572 |
+
}
|
3573 |
+
|
3574 |
+
urlParams = urlParams.split("&");
|
3575 |
+
|
3576 |
+
for (var m = 0; m < urlParams.length; ++m) {
|
3577 |
+
var p = urlParams[m].split("=", 2);
|
3578 |
+
|
3579 |
+
if (p.length == 2) {
|
3580 |
+
paramObj[p[0]] = decodeURIComponent(p[1].replace(/\+/g, " "));
|
3581 |
+
}
|
3582 |
+
}
|
3583 |
+
}
|
3584 |
+
|
3585 |
+
params = $.extend(true, {}, providerOpts.params, item.opts[providerName], paramObj);
|
3586 |
+
|
3587 |
+
url =
|
3588 |
+
$.type(providerOpts.url) === "function" ? providerOpts.url.call(this, rez, params, item) : format(providerOpts.url, rez, params);
|
3589 |
+
|
3590 |
+
thumb =
|
3591 |
+
$.type(providerOpts.thumb) === "function" ? providerOpts.thumb.call(this, rez, params, item) : format(providerOpts.thumb, rez);
|
3592 |
+
|
3593 |
+
if (providerName === "youtube") {
|
3594 |
+
url = url.replace(/&t=((\d+)m)?(\d+)s/, function (match, p1, m, s) {
|
3595 |
+
return "&start=" + ((m ? parseInt(m, 10) * 60 : 0) + parseInt(s, 10));
|
3596 |
+
});
|
3597 |
+
} else if (providerName === "vimeo") {
|
3598 |
+
url = url.replace("&%23", "#");
|
3599 |
+
}
|
3600 |
+
|
3601 |
+
return false;
|
3602 |
+
});
|
3603 |
+
|
3604 |
+
// If it is found, then change content type and update the url
|
3605 |
+
|
3606 |
+
if (type) {
|
3607 |
+
if (!item.opts.thumb && !(item.opts.$thumb && item.opts.$thumb.length)) {
|
3608 |
+
item.opts.thumb = thumb;
|
3609 |
+
}
|
3610 |
+
|
3611 |
+
if (type === "iframe") {
|
3612 |
+
item.opts = $.extend(true, item.opts, {
|
3613 |
+
iframe: {
|
3614 |
+
preload: false,
|
3615 |
+
attr: {
|
3616 |
+
scrolling: "no"
|
3617 |
+
}
|
3618 |
+
}
|
3619 |
+
});
|
3620 |
+
}
|
3621 |
+
|
3622 |
+
$.extend(item, {
|
3623 |
+
type: type,
|
3624 |
+
src: url,
|
3625 |
+
origSrc: item.src,
|
3626 |
+
contentSource: provider,
|
3627 |
+
contentType: type === "image" ? "image" : provider == "gmap_place" || provider == "gmap_search" ? "map" : "video"
|
3628 |
+
});
|
3629 |
+
} else if (url) {
|
3630 |
+
item.type = item.opts.defaultType;
|
3631 |
+
}
|
3632 |
+
});
|
3633 |
+
|
3634 |
+
// Load YouTube/Video API on request to detect when video finished playing
|
3635 |
+
var VideoAPILoader = {
|
3636 |
+
youtube: {
|
3637 |
+
src: "https://www.youtube.com/iframe_api",
|
3638 |
+
class: "YT",
|
3639 |
+
loading: false,
|
3640 |
+
loaded: false
|
3641 |
+
},
|
3642 |
+
|
3643 |
+
vimeo: {
|
3644 |
+
src: "https://player.vimeo.com/api/player.js",
|
3645 |
+
class: "Vimeo",
|
3646 |
+
loading: false,
|
3647 |
+
loaded: false
|
3648 |
+
},
|
3649 |
+
|
3650 |
+
load: function (vendor) {
|
3651 |
+
var _this = this,
|
3652 |
+
script;
|
3653 |
+
|
3654 |
+
if (this[vendor].loaded) {
|
3655 |
+
setTimeout(function () {
|
3656 |
+
_this.done(vendor);
|
3657 |
+
});
|
3658 |
+
return;
|
3659 |
+
}
|
3660 |
+
|
3661 |
+
if (this[vendor].loading) {
|
3662 |
+
return;
|
3663 |
+
}
|
3664 |
+
|
3665 |
+
this[vendor].loading = true;
|
3666 |
+
|
3667 |
+
script = document.createElement("script");
|
3668 |
+
script.type = "text/javascript";
|
3669 |
+
script.src = this[vendor].src;
|
3670 |
+
|
3671 |
+
if (vendor === "youtube") {
|
3672 |
+
window.onYouTubeIframeAPIReady = function () {
|
3673 |
+
_this[vendor].loaded = true;
|
3674 |
+
_this.done(vendor);
|
3675 |
+
};
|
3676 |
+
} else {
|
3677 |
+
script.onload = function () {
|
3678 |
+
_this[vendor].loaded = true;
|
3679 |
+
_this.done(vendor);
|
3680 |
+
};
|
3681 |
+
}
|
3682 |
+
|
3683 |
+
document.body.appendChild(script);
|
3684 |
+
},
|
3685 |
+
done: function (vendor) {
|
3686 |
+
var instance, $el, player;
|
3687 |
+
|
3688 |
+
if (vendor === "youtube") {
|
3689 |
+
delete window.onYouTubeIframeAPIReady;
|
3690 |
+
}
|
3691 |
+
|
3692 |
+
instance = $.fancybox.getInstance();
|
3693 |
+
|
3694 |
+
if (instance) {
|
3695 |
+
$el = instance.current.$content.find("iframe");
|
3696 |
+
|
3697 |
+
if (vendor === "youtube" && YT !== undefined && YT) {
|
3698 |
+
player = new YT.Player($el.attr("id"), {
|
3699 |
+
events: {
|
3700 |
+
onStateChange: function (e) {
|
3701 |
+
if (e.data == 0) {
|
3702 |
+
instance.next();
|
3703 |
+
}
|
3704 |
+
}
|
3705 |
+
}
|
3706 |
+
});
|
3707 |
+
} else if (vendor === "vimeo" && Vimeo !== undefined && Vimeo) {
|
3708 |
+
player = new Vimeo.Player($el);
|
3709 |
+
|
3710 |
+
player.on("ended", function () {
|
3711 |
+
instance.next();
|
3712 |
+
});
|
3713 |
+
}
|
3714 |
+
}
|
3715 |
+
}
|
3716 |
+
};
|
3717 |
+
|
3718 |
+
$(document).on({
|
3719 |
+
"afterShow.fb": function (e, instance, current) {
|
3720 |
+
if (instance.group.length > 1 && (current.contentSource === "youtube" || current.contentSource === "vimeo")) {
|
3721 |
+
VideoAPILoader.load(current.contentSource);
|
3722 |
+
}
|
3723 |
+
}
|
3724 |
+
});
|
3725 |
+
})(jQuery);
|
3726 |
+
// ==========================================================================
|
3727 |
+
//
|
3728 |
+
// Guestures
|
3729 |
+
// Adds touch guestures, handles click and tap events
|
3730 |
+
//
|
3731 |
+
// ==========================================================================
|
3732 |
+
(function (window, document, $) {
|
3733 |
+
"use strict";
|
3734 |
+
|
3735 |
+
var requestAFrame = (function () {
|
3736 |
+
return (
|
3737 |
+
window.requestAnimationFrame ||
|
3738 |
+
window.webkitRequestAnimationFrame ||
|
3739 |
+
window.mozRequestAnimationFrame ||
|
3740 |
+
window.oRequestAnimationFrame ||
|
3741 |
+
// if all else fails, use setTimeout
|
3742 |
+
function (callback) {
|
3743 |
+
return window.setTimeout(callback, 1000 / 60);
|
3744 |
+
}
|
3745 |
+
);
|
3746 |
+
})();
|
3747 |
+
|
3748 |
+
var cancelAFrame = (function () {
|
3749 |
+
return (
|
3750 |
+
window.cancelAnimationFrame ||
|
3751 |
+
window.webkitCancelAnimationFrame ||
|
3752 |
+
window.mozCancelAnimationFrame ||
|
3753 |
+
window.oCancelAnimationFrame ||
|
3754 |
+
function (id) {
|
3755 |
+
window.clearTimeout(id);
|
3756 |
+
}
|
3757 |
+
);
|
3758 |
+
})();
|
3759 |
+
|
3760 |
+
var getPointerXY = function (e) {
|
3761 |
+
var result = [];
|
3762 |
+
|
3763 |
+
e = e.originalEvent || e || window.e;
|
3764 |
+
e = e.touches && e.touches.length ? e.touches : e.changedTouches && e.changedTouches.length ? e.changedTouches : [e];
|
3765 |
+
|
3766 |
+
for (var key in e) {
|
3767 |
+
if (e[key].pageX) {
|
3768 |
+
result.push({
|
3769 |
+
x: e[key].pageX,
|
3770 |
+
y: e[key].pageY
|
3771 |
+
});
|
3772 |
+
} else if (e[key].clientX) {
|
3773 |
+
result.push({
|
3774 |
+
x: e[key].clientX,
|
3775 |
+
y: e[key].clientY
|
3776 |
+
});
|
3777 |
+
}
|
3778 |
+
}
|
3779 |
+
|
3780 |
+
return result;
|
3781 |
+
};
|
3782 |
+
|
3783 |
+
var distance = function (point2, point1, what) {
|
3784 |
+
if (!point1 || !point2) {
|
3785 |
+
return 0;
|
3786 |
+
}
|
3787 |
+
|
3788 |
+
if (what === "x") {
|
3789 |
+
return point2.x - point1.x;
|
3790 |
+
} else if (what === "y") {
|
3791 |
+
return point2.y - point1.y;
|
3792 |
+
}
|
3793 |
+
|
3794 |
+
return Math.sqrt(Math.pow(point2.x - point1.x, 2) + Math.pow(point2.y - point1.y, 2));
|
3795 |
+
};
|
3796 |
+
|
3797 |
+
var isClickable = function ($el) {
|
3798 |
+
if (
|
3799 |
+
$el.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe') ||
|
3800 |
+
$.isFunction($el.get(0).onclick) ||
|
3801 |
+
$el.data("selectable")
|
3802 |
+
) {
|
3803 |
+
return true;
|
3804 |
+
}
|
3805 |
+
|
3806 |
+
// Check for attributes like data-fancybox-next or data-fancybox-close
|
3807 |
+
for (var i = 0, atts = $el[0].attributes, n = atts.length; i < n; i++) {
|
3808 |
+
if (atts[i].nodeName.substr(0, 14) === "data-fancybox-") {
|
3809 |
+
return true;
|
3810 |
+
}
|
3811 |
+
}
|
3812 |
+
|
3813 |
+
return false;
|
3814 |
+
};
|
3815 |
+
|
3816 |
+
var hasScrollbars = function (el) {
|
3817 |
+
var overflowY = window.getComputedStyle(el)["overflow-y"],
|
3818 |
+
overflowX = window.getComputedStyle(el)["overflow-x"],
|
3819 |
+
vertical = (overflowY === "scroll" || overflowY === "auto") && el.scrollHeight > el.clientHeight,
|
3820 |
+
horizontal = (overflowX === "scroll" || overflowX === "auto") && el.scrollWidth > el.clientWidth;
|
3821 |
+
|
3822 |
+
return vertical || horizontal;
|
3823 |
+
};
|
3824 |
+
|
3825 |
+
var isScrollable = function ($el) {
|
3826 |
+
var rez = false;
|
3827 |
+
|
3828 |
+
while (true) {
|
3829 |
+
rez = hasScrollbars($el.get(0));
|
3830 |
+
|
3831 |
+
if (rez) {
|
3832 |
+
break;
|
3833 |
+
}
|
3834 |
+
|
3835 |
+
$el = $el.parent();
|
3836 |
+
|
3837 |
+
if (!$el.length || $el.hasClass("fancybox-stage") || $el.is("body")) {
|
3838 |
+
break;
|
3839 |
+
}
|
3840 |
+
}
|
3841 |
+
|
3842 |
+
return rez;
|
3843 |
+
};
|
3844 |
+
|
3845 |
+
var Guestures = function (instance) {
|
3846 |
+
var self = this;
|
3847 |
+
|
3848 |
+
self.instance = instance;
|
3849 |
+
|
3850 |
+
self.$bg = instance.$refs.bg;
|
3851 |
+
self.$stage = instance.$refs.stage;
|
3852 |
+
self.$container = instance.$refs.container;
|
3853 |
+
|
3854 |
+
self.destroy();
|
3855 |
+
|
3856 |
+
self.$container.on("touchstart.fb.touch mousedown.fb.touch", $.proxy(self, "ontouchstart"));
|
3857 |
+
};
|
3858 |
+
|
3859 |
+
Guestures.prototype.destroy = function () {
|
3860 |
+
var self = this;
|
3861 |
+
|
3862 |
+
self.$container.off(".fb.touch");
|
3863 |
+
|
3864 |
+
$(document).off(".fb.touch");
|
3865 |
+
|
3866 |
+
if (self.requestId) {
|
3867 |
+
cancelAFrame(self.requestId);
|
3868 |
+
self.requestId = null;
|
3869 |
+
}
|
3870 |
+
|
3871 |
+
if (self.tapped) {
|
3872 |
+
clearTimeout(self.tapped);
|
3873 |
+
self.tapped = null;
|
3874 |
+
}
|
3875 |
+
};
|
3876 |
+
|
3877 |
+
Guestures.prototype.ontouchstart = function (e) {
|
3878 |
+
var self = this,
|
3879 |
+
$target = $(e.target),
|
3880 |
+
instance = self.instance,
|
3881 |
+
current = instance.current,
|
3882 |
+
$slide = current.$slide,
|
3883 |
+
$content = current.$content,
|
3884 |
+
isTouchDevice = e.type == "touchstart";
|
3885 |
+
|
3886 |
+
// Do not respond to both (touch and mouse) events
|
3887 |
+
if (isTouchDevice) {
|
3888 |
+
self.$container.off("mousedown.fb.touch");
|
3889 |
+
}
|
3890 |
+
|
3891 |
+
// Ignore right click
|
3892 |
+
if (e.originalEvent && e.originalEvent.button == 2) {
|
3893 |
+
return;
|
3894 |
+
}
|
3895 |
+
|
3896 |
+
// Ignore taping on links, buttons, input elements
|
3897 |
+
if (!$slide.length || !$target.length || isClickable($target) || isClickable($target.parent())) {
|
3898 |
+
return;
|
3899 |
+
}
|
3900 |
+
// Ignore clicks on the scrollbar
|
3901 |
+
if (!$target.is("img") && e.originalEvent.clientX > $target[0].clientWidth + $target.offset().left) {
|
3902 |
+
return;
|
3903 |
+
}
|
3904 |
+
|
3905 |
+
// Ignore clicks while zooming or closing
|
3906 |
+
if (!current || instance.isAnimating || current.$slide.hasClass("fancybox-animated")) {
|
3907 |
+
e.stopPropagation();
|
3908 |
+
e.preventDefault();
|
3909 |
+
|
3910 |
+
return;
|
3911 |
+
}
|
3912 |
+
|
3913 |
+
self.realPoints = self.startPoints = getPointerXY(e);
|
3914 |
+
|
3915 |
+
if (!self.startPoints.length) {
|
3916 |
+
return;
|
3917 |
+
}
|
3918 |
+
|
3919 |
+
// Allow other scripts to catch touch event if "touch" is set to false
|
3920 |
+
if (current.touch) {
|
3921 |
+
e.stopPropagation();
|
3922 |
+
}
|
3923 |
+
|
3924 |
+
self.startEvent = e;
|
3925 |
+
|
3926 |
+
self.canTap = true;
|
3927 |
+
self.$target = $target;
|
3928 |
+
self.$content = $content;
|
3929 |
+
self.opts = current.opts.touch;
|
3930 |
+
|
3931 |
+
self.isPanning = false;
|
3932 |
+
self.isSwiping = false;
|
3933 |
+
self.isZooming = false;
|
3934 |
+
self.isScrolling = false;
|
3935 |
+
self.canPan = instance.canPan();
|
3936 |
+
|
3937 |
+
self.startTime = new Date().getTime();
|
3938 |
+
self.distanceX = self.distanceY = self.distance = 0;
|
3939 |
+
|
3940 |
+
self.canvasWidth = Math.round($slide[0].clientWidth);
|
3941 |
+
self.canvasHeight = Math.round($slide[0].clientHeight);
|
3942 |
+
|
3943 |
+
self.contentLastPos = null;
|
3944 |
+
self.contentStartPos = $.fancybox.getTranslate(self.$content) || {
|
3945 |
+
top: 0,
|
3946 |
+
left: 0
|
3947 |
+
};
|
3948 |
+
self.sliderStartPos = $.fancybox.getTranslate($slide);
|
3949 |
+
|
3950 |
+
// Since position will be absolute, but we need to make it relative to the stage
|
3951 |
+
self.stagePos = $.fancybox.getTranslate(instance.$refs.stage);
|
3952 |
+
|
3953 |
+
self.sliderStartPos.top -= self.stagePos.top;
|
3954 |
+
self.sliderStartPos.left -= self.stagePos.left;
|
3955 |
+
|
3956 |
+
self.contentStartPos.top -= self.stagePos.top;
|
3957 |
+
self.contentStartPos.left -= self.stagePos.left;
|
3958 |
+
|
3959 |
+
$(document)
|
3960 |
+
.off(".fb.touch")
|
3961 |
+
.on(isTouchDevice ? "touchend.fb.touch touchcancel.fb.touch" : "mouseup.fb.touch mouseleave.fb.touch", $.proxy(self, "ontouchend"))
|
3962 |
+
.on(isTouchDevice ? "touchmove.fb.touch" : "mousemove.fb.touch", $.proxy(self, "ontouchmove"));
|
3963 |
+
|
3964 |
+
if ($.fancybox.isMobile) {
|
3965 |
+
document.addEventListener("scroll", self.onscroll, true);
|
3966 |
+
}
|
3967 |
+
|
3968 |
+
// Skip if clicked outside the sliding area
|
3969 |
+
if (!(self.opts || self.canPan) || !($target.is(self.$stage) || self.$stage.find($target).length)) {
|
3970 |
+
if ($target.is(".fancybox-image")) {
|
3971 |
+
e.preventDefault();
|
3972 |
+
}
|
3973 |
+
|
3974 |
+
if (!($.fancybox.isMobile && $target.parents(".fancybox-caption").length)) {
|
3975 |
+
return;
|
3976 |
+
}
|
3977 |
+
}
|
3978 |
+
|
3979 |
+
self.isScrollable = isScrollable($target) || isScrollable($target.parent());
|
3980 |
+
|
3981 |
+
// Check if element is scrollable and try to prevent default behavior (scrolling)
|
3982 |
+
if (!($.fancybox.isMobile && self.isScrollable)) {
|
3983 |
+
e.preventDefault();
|
3984 |
+
}
|
3985 |
+
|
3986 |
+
// One finger or mouse click - swipe or pan an image
|
3987 |
+
if (self.startPoints.length === 1 || current.hasError) {
|
3988 |
+
if (self.canPan) {
|
3989 |
+
$.fancybox.stop(self.$content);
|
3990 |
+
|
3991 |
+
self.isPanning = true;
|
3992 |
+
} else {
|
3993 |
+
self.isSwiping = true;
|
3994 |
+
}
|
3995 |
+
|
3996 |
+
self.$container.addClass("fancybox-is-grabbing");
|
3997 |
+
}
|
3998 |
+
|
3999 |
+
// Two fingers - zoom image
|
4000 |
+
if (self.startPoints.length === 2 && current.type === "image" && (current.isLoaded || current.$ghost)) {
|
4001 |
+
self.canTap = false;
|
4002 |
+
self.isSwiping = false;
|
4003 |
+
self.isPanning = false;
|
4004 |
+
|
4005 |
+
self.isZooming = true;
|
4006 |
+
|
4007 |
+
$.fancybox.stop(self.$content);
|
4008 |
+
|
4009 |
+
self.centerPointStartX = (self.startPoints[0].x + self.startPoints[1].x) * 0.5 - $(window).scrollLeft();
|
4010 |
+
self.centerPointStartY = (self.startPoints[0].y + self.startPoints[1].y) * 0.5 - $(window).scrollTop();
|
4011 |
+
|
4012 |
+
self.percentageOfImageAtPinchPointX = (self.centerPointStartX - self.contentStartPos.left) / self.contentStartPos.width;
|
4013 |
+
self.percentageOfImageAtPinchPointY = (self.centerPointStartY - self.contentStartPos.top) / self.contentStartPos.height;
|
4014 |
+
|
4015 |
+
self.startDistanceBetweenFingers = distance(self.startPoints[0], self.startPoints[1]);
|
4016 |
+
}
|
4017 |
+
};
|
4018 |
+
|
4019 |
+
Guestures.prototype.onscroll = function (e) {
|
4020 |
+
var self = this;
|
4021 |
+
|
4022 |
+
self.isScrolling = true;
|
4023 |
+
|
4024 |
+
document.removeEventListener("scroll", self.onscroll, true);
|
4025 |
+
};
|
4026 |
+
|
4027 |
+
Guestures.prototype.ontouchmove = function (e) {
|
4028 |
+
var self = this;
|
4029 |
+
|
4030 |
+
// Make sure user has not released over iframe or disabled element
|
4031 |
+
if (e.originalEvent.buttons !== undefined && e.originalEvent.buttons === 0) {
|
4032 |
+
self.ontouchend(e);
|
4033 |
+
return;
|
4034 |
+
}
|
4035 |
+
|
4036 |
+
if (self.isScrolling) {
|
4037 |
+
self.canTap = false;
|
4038 |
+
return;
|
4039 |
+
}
|
4040 |
+
|
4041 |
+
self.newPoints = getPointerXY(e);
|
4042 |
+
|
4043 |
+
if (!(self.opts || self.canPan) || !self.newPoints.length || !self.newPoints.length) {
|
4044 |
+
return;
|
4045 |
+
}
|
4046 |
+
|
4047 |
+
if (!(self.isSwiping && self.isSwiping === true)) {
|
4048 |
+
e.preventDefault();
|
4049 |
+
}
|
4050 |
+
|
4051 |
+
self.distanceX = distance(self.newPoints[0], self.startPoints[0], "x");
|
4052 |
+
self.distanceY = distance(self.newPoints[0], self.startPoints[0], "y");
|
4053 |
+
|
4054 |
+
self.distance = distance(self.newPoints[0], self.startPoints[0]);
|
4055 |
+
|
4056 |
+
// Skip false ontouchmove events (Chrome)
|
4057 |
+
if (self.distance > 0) {
|
4058 |
+
if (self.isSwiping) {
|
4059 |
+
self.onSwipe(e);
|
4060 |
+
} else if (self.isPanning) {
|
4061 |
+
self.onPan();
|
4062 |
+
} else if (self.isZooming) {
|
4063 |
+
self.onZoom();
|
4064 |
+
}
|
4065 |
+
}
|
4066 |
+
};
|
4067 |
+
|
4068 |
+
Guestures.prototype.onSwipe = function (e) {
|
4069 |
+
var self = this,
|
4070 |
+
instance = self.instance,
|
4071 |
+
swiping = self.isSwiping,
|
4072 |
+
left = self.sliderStartPos.left || 0,
|
4073 |
+
angle;
|
4074 |
+
|
4075 |
+
// If direction is not yet determined
|
4076 |
+
if (swiping === true) {
|
4077 |
+
// We need at least 10px distance to correctly calculate an angle
|
4078 |
+
if (Math.abs(self.distance) > 10) {
|
4079 |
+
self.canTap = false;
|
4080 |
+
|
4081 |
+
if (instance.group.length < 2 && self.opts.vertical) {
|
4082 |
+
self.isSwiping = "y";
|
4083 |
+
} else if (instance.isDragging || self.opts.vertical === false || (self.opts.vertical === "auto" && $(window).width() > 800)) {
|
4084 |
+
self.isSwiping = "x";
|
4085 |
+
} else {
|
4086 |
+
angle = Math.abs((Math.atan2(self.distanceY, self.distanceX) * 180) / Math.PI);
|
4087 |
+
|
4088 |
+
self.isSwiping = angle > 45 && angle < 135 ? "y" : "x";
|
4089 |
+
}
|
4090 |
+
|
4091 |
+
if (self.isSwiping === "y" && $.fancybox.isMobile && self.isScrollable) {
|
4092 |
+
self.isScrolling = true;
|
4093 |
+
|
4094 |
+
return;
|
4095 |
+
}
|
4096 |
+
|
4097 |
+
instance.isDragging = self.isSwiping;
|
4098 |
+
|
4099 |
+
// Reset points to avoid jumping, because we dropped first swipes to calculate the angle
|
4100 |
+
self.startPoints = self.newPoints;
|
4101 |
+
|
4102 |
+
$.each(instance.slides, function (index, slide) {
|
4103 |
+
var slidePos, stagePos;
|
4104 |
+
|
4105 |
+
$.fancybox.stop(slide.$slide);
|
4106 |
+
|
4107 |
+
slidePos = $.fancybox.getTranslate(slide.$slide);
|
4108 |
+
stagePos = $.fancybox.getTranslate(instance.$refs.stage);
|
4109 |
+
|
4110 |
+
slide.$slide
|
4111 |
+
.css({
|
4112 |
+
transform: "",
|
4113 |
+
opacity: "",
|
4114 |
+
"transition-duration": ""
|
4115 |
+
})
|
4116 |
+
.removeClass("fancybox-animated")
|
4117 |
+
.removeClass(function (index, className) {
|
4118 |
+
return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
|
4119 |
+
});
|
4120 |
+
|
4121 |
+
if (slide.pos === instance.current.pos) {
|
4122 |
+
self.sliderStartPos.top = slidePos.top - stagePos.top;
|
4123 |
+
self.sliderStartPos.left = slidePos.left - stagePos.left;
|
4124 |
+
}
|
4125 |
+
|
4126 |
+
$.fancybox.setTranslate(slide.$slide, {
|
4127 |
+
top: slidePos.top - stagePos.top,
|
4128 |
+
left: slidePos.left - stagePos.left
|
4129 |
+
});
|
4130 |
+
});
|
4131 |
+
|
4132 |
+
// Stop slideshow
|
4133 |
+
if (instance.SlideShow && instance.SlideShow.isActive) {
|
4134 |
+
instance.SlideShow.stop();
|
4135 |
+
}
|
4136 |
+
}
|
4137 |
+
|
4138 |
+
return;
|
4139 |
+
}
|
4140 |
+
|
4141 |
+
// Sticky edges
|
4142 |
+
if (swiping == "x") {
|
4143 |
+
if (
|
4144 |
+
self.distanceX > 0 &&
|
4145 |
+
(self.instance.group.length < 2 || (self.instance.current.index === 0 && !self.instance.current.opts.loop))
|
4146 |
+
) {
|
4147 |
+
left = left + Math.pow(self.distanceX, 0.8);
|
4148 |
+
} else if (
|
4149 |
+
self.distanceX < 0 &&
|
4150 |
+
(self.instance.group.length < 2 ||
|
4151 |
+
(self.instance.current.index === self.instance.group.length - 1 && !self.instance.current.opts.loop))
|
4152 |
+
) {
|
4153 |
+
left = left - Math.pow(-self.distanceX, 0.8);
|
4154 |
+
} else {
|
4155 |
+
left = left + self.distanceX;
|
4156 |
+
}
|
4157 |
+
}
|
4158 |
+
|
4159 |
+
self.sliderLastPos = {
|
4160 |
+
top: swiping == "x" ? 0 : self.sliderStartPos.top + self.distanceY,
|
4161 |
+
left: left
|
4162 |
+
};
|
4163 |
+
|
4164 |
+
if (self.requestId) {
|
4165 |
+
cancelAFrame(self.requestId);
|
4166 |
+
|
4167 |
+
self.requestId = null;
|
4168 |
+
}
|
4169 |
+
|
4170 |
+
self.requestId = requestAFrame(function () {
|
4171 |
+
if (self.sliderLastPos) {
|
4172 |
+
$.each(self.instance.slides, function (index, slide) {
|
4173 |
+
var pos = slide.pos - self.instance.currPos;
|
4174 |
+
|
4175 |
+
$.fancybox.setTranslate(slide.$slide, {
|
4176 |
+
top: self.sliderLastPos.top,
|
4177 |
+
left: self.sliderLastPos.left + pos * self.canvasWidth + pos * slide.opts.gutter
|
4178 |
+
});
|
4179 |
+
});
|
4180 |
+
|
4181 |
+
self.$container.addClass("fancybox-is-sliding");
|
4182 |
+
}
|
4183 |
+
});
|
4184 |
+
};
|
4185 |
+
|
4186 |
+
Guestures.prototype.onPan = function () {
|
4187 |
+
var self = this;
|
4188 |
+
|
4189 |
+
// Prevent accidental movement (sometimes, when tapping casually, finger can move a bit)
|
4190 |
+
if (distance(self.newPoints[0], self.realPoints[0]) < ($.fancybox.isMobile ? 10 : 5)) {
|
4191 |
+
self.startPoints = self.newPoints;
|
4192 |
+
return;
|
4193 |
+
}
|
4194 |
+
|
4195 |
+
self.canTap = false;
|
4196 |
+
|
4197 |
+
self.contentLastPos = self.limitMovement();
|
4198 |
+
|
4199 |
+
if (self.requestId) {
|
4200 |
+
cancelAFrame(self.requestId);
|
4201 |
+
}
|
4202 |
+
|
4203 |
+
self.requestId = requestAFrame(function () {
|
4204 |
+
$.fancybox.setTranslate(self.$content, self.contentLastPos);
|
4205 |
+
});
|
4206 |
+
};
|
4207 |
+
|
4208 |
+
// Make panning sticky to the edges
|
4209 |
+
Guestures.prototype.limitMovement = function () {
|
4210 |
+
var self = this;
|
4211 |
+
|
4212 |
+
var canvasWidth = self.canvasWidth;
|
4213 |
+
var canvasHeight = self.canvasHeight;
|
4214 |
+
|
4215 |
+
var distanceX = self.distanceX;
|
4216 |
+
var distanceY = self.distanceY;
|
4217 |
+
|
4218 |
+
var contentStartPos = self.contentStartPos;
|
4219 |
+
|
4220 |
+
var currentOffsetX = contentStartPos.left;
|
4221 |
+
var currentOffsetY = contentStartPos.top;
|
4222 |
+
|
4223 |
+
var currentWidth = contentStartPos.width;
|
4224 |
+
var currentHeight = contentStartPos.height;
|
4225 |
+
|
4226 |
+
var minTranslateX, minTranslateY, maxTranslateX, maxTranslateY, newOffsetX, newOffsetY;
|
4227 |
+
|
4228 |
+
if (currentWidth > canvasWidth) {
|
4229 |
+
newOffsetX = currentOffsetX + distanceX;
|
4230 |
+
} else {
|
4231 |
+
newOffsetX = currentOffsetX;
|
4232 |
+
}
|
4233 |
+
|
4234 |
+
newOffsetY = currentOffsetY + distanceY;
|
4235 |
+
|
4236 |
+
// Slow down proportionally to traveled distance
|
4237 |
+
minTranslateX = Math.max(0, canvasWidth * 0.5 - currentWidth * 0.5);
|
4238 |
+
minTranslateY = Math.max(0, canvasHeight * 0.5 - currentHeight * 0.5);
|
4239 |
+
|
4240 |
+
maxTranslateX = Math.min(canvasWidth - currentWidth, canvasWidth * 0.5 - currentWidth * 0.5);
|
4241 |
+
maxTranslateY = Math.min(canvasHeight - currentHeight, canvasHeight * 0.5 - currentHeight * 0.5);
|
4242 |
+
|
4243 |
+
// ->
|
4244 |
+
if (distanceX > 0 && newOffsetX > minTranslateX) {
|
4245 |
+
newOffsetX = minTranslateX - 1 + Math.pow(-minTranslateX + currentOffsetX + distanceX, 0.8) || 0;
|
4246 |
+
}
|
4247 |
+
|
4248 |
+
// <-
|
4249 |
+
if (distanceX < 0 && newOffsetX < maxTranslateX) {
|
4250 |
+
newOffsetX = maxTranslateX + 1 - Math.pow(maxTranslateX - currentOffsetX - distanceX, 0.8) || 0;
|
4251 |
+
}
|
4252 |
+
|
4253 |
+
// \/
|
4254 |
+
if (distanceY > 0 && newOffsetY > minTranslateY) {
|
4255 |
+
newOffsetY = minTranslateY - 1 + Math.pow(-minTranslateY + currentOffsetY + distanceY, 0.8) || 0;
|
4256 |
+
}
|
4257 |
+
|
4258 |
+
// /\
|
4259 |
+
if (distanceY < 0 && newOffsetY < maxTranslateY) {
|
4260 |
+
newOffsetY = maxTranslateY + 1 - Math.pow(maxTranslateY - currentOffsetY - distanceY, 0.8) || 0;
|
4261 |
+
}
|
4262 |
+
|
4263 |
+
return {
|
4264 |
+
top: newOffsetY,
|
4265 |
+
left: newOffsetX
|
4266 |
+
};
|
4267 |
+
};
|
4268 |
+
|
4269 |
+
Guestures.prototype.limitPosition = function (newOffsetX, newOffsetY, newWidth, newHeight) {
|
4270 |
+
var self = this;
|
4271 |
+
|
4272 |
+
var canvasWidth = self.canvasWidth;
|
4273 |
+
var canvasHeight = self.canvasHeight;
|
4274 |
+
|
4275 |
+
if (newWidth > canvasWidth) {
|
4276 |
+
newOffsetX = newOffsetX > 0 ? 0 : newOffsetX;
|
4277 |
+
newOffsetX = newOffsetX < canvasWidth - newWidth ? canvasWidth - newWidth : newOffsetX;
|
4278 |
+
} else {
|
4279 |
+
// Center horizontally
|
4280 |
+
newOffsetX = Math.max(0, canvasWidth / 2 - newWidth / 2);
|
4281 |
+
}
|
4282 |
+
|
4283 |
+
if (newHeight > canvasHeight) {
|
4284 |
+
newOffsetY = newOffsetY > 0 ? 0 : newOffsetY;
|
4285 |
+
newOffsetY = newOffsetY < canvasHeight - newHeight ? canvasHeight - newHeight : newOffsetY;
|
4286 |
+
} else {
|
4287 |
+
// Center vertically
|
4288 |
+
newOffsetY = Math.max(0, canvasHeight / 2 - newHeight / 2);
|
4289 |
+
}
|
4290 |
+
|
4291 |
+
return {
|
4292 |
+
top: newOffsetY,
|
4293 |
+
left: newOffsetX
|
4294 |
+
};
|
4295 |
+
};
|
4296 |
+
|
4297 |
+
Guestures.prototype.onZoom = function () {
|
4298 |
+
var self = this;
|
4299 |
+
|
4300 |
+
// Calculate current distance between points to get pinch ratio and new width and height
|
4301 |
+
var contentStartPos = self.contentStartPos;
|
4302 |
+
|
4303 |
+
var currentWidth = contentStartPos.width;
|
4304 |
+
var currentHeight = contentStartPos.height;
|
4305 |
+
|
4306 |
+
var currentOffsetX = contentStartPos.left;
|
4307 |
+
var currentOffsetY = contentStartPos.top;
|
4308 |
+
|
4309 |
+
var endDistanceBetweenFingers = distance(self.newPoints[0], self.newPoints[1]);
|
4310 |
+
|
4311 |
+
var pinchRatio = endDistanceBetweenFingers / self.startDistanceBetweenFingers;
|
4312 |
+
|
4313 |
+
var newWidth = Math.floor(currentWidth * pinchRatio);
|
4314 |
+
var newHeight = Math.floor(currentHeight * pinchRatio);
|
4315 |
+
|
4316 |
+
// This is the translation due to pinch-zooming
|
4317 |
+
var translateFromZoomingX = (currentWidth - newWidth) * self.percentageOfImageAtPinchPointX;
|
4318 |
+
var translateFromZoomingY = (currentHeight - newHeight) * self.percentageOfImageAtPinchPointY;
|
4319 |
+
|
4320 |
+
// Point between the two touches
|
4321 |
+
var centerPointEndX = (self.newPoints[0].x + self.newPoints[1].x) / 2 - $(window).scrollLeft();
|
4322 |
+
var centerPointEndY = (self.newPoints[0].y + self.newPoints[1].y) / 2 - $(window).scrollTop();
|
4323 |
+
|
4324 |
+
// And this is the translation due to translation of the centerpoint
|
4325 |
+
// between the two fingers
|
4326 |
+
var translateFromTranslatingX = centerPointEndX - self.centerPointStartX;
|
4327 |
+
var translateFromTranslatingY = centerPointEndY - self.centerPointStartY;
|
4328 |
+
|
4329 |
+
// The new offset is the old/current one plus the total translation
|
4330 |
+
var newOffsetX = currentOffsetX + (translateFromZoomingX + translateFromTranslatingX);
|
4331 |
+
var newOffsetY = currentOffsetY + (translateFromZoomingY + translateFromTranslatingY);
|
4332 |
+
|
4333 |
+
var newPos = {
|
4334 |
+
top: newOffsetY,
|
4335 |
+
left: newOffsetX,
|
4336 |
+
scaleX: pinchRatio,
|
4337 |
+
scaleY: pinchRatio
|
4338 |
+
};
|
4339 |
+
|
4340 |
+
self.canTap = false;
|
4341 |
+
|
4342 |
+
self.newWidth = newWidth;
|
4343 |
+
self.newHeight = newHeight;
|
4344 |
+
|
4345 |
+
self.contentLastPos = newPos;
|
4346 |
+
|
4347 |
+
if (self.requestId) {
|
4348 |
+
cancelAFrame(self.requestId);
|
4349 |
+
}
|
4350 |
+
|
4351 |
+
self.requestId = requestAFrame(function () {
|
4352 |
+
$.fancybox.setTranslate(self.$content, self.contentLastPos);
|
4353 |
+
});
|
4354 |
+
};
|
4355 |
+
|
4356 |
+
Guestures.prototype.ontouchend = function (e) {
|
4357 |
+
var self = this;
|
4358 |
+
|
4359 |
+
var swiping = self.isSwiping;
|
4360 |
+
var panning = self.isPanning;
|
4361 |
+
var zooming = self.isZooming;
|
4362 |
+
var scrolling = self.isScrolling;
|
4363 |
+
|
4364 |
+
self.endPoints = getPointerXY(e);
|
4365 |
+
self.dMs = Math.max(new Date().getTime() - self.startTime, 1);
|
4366 |
+
|
4367 |
+
self.$container.removeClass("fancybox-is-grabbing");
|
4368 |
+
|
4369 |
+
$(document).off(".fb.touch");
|
4370 |
+
|
4371 |
+
document.removeEventListener("scroll", self.onscroll, true);
|
4372 |
+
|
4373 |
+
if (self.requestId) {
|
4374 |
+
cancelAFrame(self.requestId);
|
4375 |
+
|
4376 |
+
self.requestId = null;
|
4377 |
+
}
|
4378 |
+
|
4379 |
+
self.isSwiping = false;
|
4380 |
+
self.isPanning = false;
|
4381 |
+
self.isZooming = false;
|
4382 |
+
self.isScrolling = false;
|
4383 |
+
|
4384 |
+
self.instance.isDragging = false;
|
4385 |
+
|
4386 |
+
if (self.canTap) {
|
4387 |
+
return self.onTap(e);
|
4388 |
+
}
|
4389 |
+
|
4390 |
+
self.speed = 100;
|
4391 |
+
|
4392 |
+
// Speed in px/ms
|
4393 |
+
self.velocityX = (self.distanceX / self.dMs) * 0.5;
|
4394 |
+
self.velocityY = (self.distanceY / self.dMs) * 0.5;
|
4395 |
+
|
4396 |
+
if (panning) {
|
4397 |
+
self.endPanning();
|
4398 |
+
} else if (zooming) {
|
4399 |
+
self.endZooming();
|
4400 |
+
} else {
|
4401 |
+
self.endSwiping(swiping, scrolling);
|
4402 |
+
}
|
4403 |
+
|
4404 |
+
return;
|
4405 |
+
};
|
4406 |
+
|
4407 |
+
Guestures.prototype.endSwiping = function (swiping, scrolling) {
|
4408 |
+
var self = this,
|
4409 |
+
ret = false,
|
4410 |
+
len = self.instance.group.length,
|
4411 |
+
distanceX = Math.abs(self.distanceX),
|
4412 |
+
canAdvance = swiping == "x" && len > 1 && ((self.dMs > 130 && distanceX > 10) || distanceX > 50),
|
4413 |
+
speedX = 300;
|
4414 |
+
|
4415 |
+
self.sliderLastPos = null;
|
4416 |
+
|
4417 |
+
// Close if swiped vertically / navigate if horizontally
|
4418 |
+
if (swiping == "y" && !scrolling && Math.abs(self.distanceY) > 50) {
|
4419 |
+
// Continue vertical movement
|
4420 |
+
$.fancybox.animate(
|
4421 |
+
self.instance.current.$slide, {
|
4422 |
+
top: self.sliderStartPos.top + self.distanceY + self.velocityY * 150,
|
4423 |
+
opacity: 0
|
4424 |
+
},
|
4425 |
+
200
|
4426 |
+
);
|
4427 |
+
ret = self.instance.close(true, 250);
|
4428 |
+
} else if (canAdvance && self.distanceX > 0) {
|
4429 |
+
ret = self.instance.previous(speedX);
|
4430 |
+
} else if (canAdvance && self.distanceX < 0) {
|
4431 |
+
ret = self.instance.next(speedX);
|
4432 |
+
}
|
4433 |
+
|
4434 |
+
if (ret === false && (swiping == "x" || swiping == "y")) {
|
4435 |
+
self.instance.centerSlide(200);
|
4436 |
+
}
|
4437 |
+
|
4438 |
+
self.$container.removeClass("fancybox-is-sliding");
|
4439 |
+
};
|
4440 |
+
|
4441 |
+
// Limit panning from edges
|
4442 |
+
// ========================
|
4443 |
+
Guestures.prototype.endPanning = function () {
|
4444 |
+
var self = this,
|
4445 |
+
newOffsetX,
|
4446 |
+
newOffsetY,
|
4447 |
+
newPos;
|
4448 |
+
|
4449 |
+
if (!self.contentLastPos) {
|
4450 |
+
return;
|
4451 |
+
}
|
4452 |
+
|
4453 |
+
if (self.opts.momentum === false || self.dMs > 350) {
|
4454 |
+
newOffsetX = self.contentLastPos.left;
|
4455 |
+
newOffsetY = self.contentLastPos.top;
|
4456 |
+
} else {
|
4457 |
+
// Continue movement
|
4458 |
+
newOffsetX = self.contentLastPos.left + self.velocityX * 500;
|
4459 |
+
newOffsetY = self.contentLastPos.top + self.velocityY * 500;
|
4460 |
+
}
|
4461 |
+
|
4462 |
+
newPos = self.limitPosition(newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height);
|
4463 |
+
|
4464 |
+
newPos.width = self.contentStartPos.width;
|
4465 |
+
newPos.height = self.contentStartPos.height;
|
4466 |
+
|
4467 |
+
$.fancybox.animate(self.$content, newPos, 366);
|
4468 |
+
};
|
4469 |
+
|
4470 |
+
Guestures.prototype.endZooming = function () {
|
4471 |
+
var self = this;
|
4472 |
+
|
4473 |
+
var current = self.instance.current;
|
4474 |
+
|
4475 |
+
var newOffsetX, newOffsetY, newPos, reset;
|
4476 |
+
|
4477 |
+
var newWidth = self.newWidth;
|
4478 |
+
var newHeight = self.newHeight;
|
4479 |
+
|
4480 |
+
if (!self.contentLastPos) {
|
4481 |
+
return;
|
4482 |
+
}
|
4483 |
+
|
4484 |
+
newOffsetX = self.contentLastPos.left;
|
4485 |
+
newOffsetY = self.contentLastPos.top;
|
4486 |
+
|
4487 |
+
reset = {
|
4488 |
+
top: newOffsetY,
|
4489 |
+
left: newOffsetX,
|
4490 |
+
width: newWidth,
|
4491 |
+
height: newHeight,
|
4492 |
+
scaleX: 1,
|
4493 |
+
scaleY: 1
|
4494 |
+
};
|
4495 |
+
|
4496 |
+
// Reset scalex/scaleY values; this helps for perfomance and does not break animation
|
4497 |
+
$.fancybox.setTranslate(self.$content, reset);
|
4498 |
+
|
4499 |
+
if (newWidth < self.canvasWidth && newHeight < self.canvasHeight) {
|
4500 |
+
self.instance.scaleToFit(150);
|
4501 |
+
} else if (newWidth > current.width || newHeight > current.height) {
|
4502 |
+
self.instance.scaleToActual(self.centerPointStartX, self.centerPointStartY, 150);
|
4503 |
+
} else {
|
4504 |
+
newPos = self.limitPosition(newOffsetX, newOffsetY, newWidth, newHeight);
|
4505 |
+
|
4506 |
+
$.fancybox.animate(self.$content, newPos, 150);
|
4507 |
+
}
|
4508 |
+
};
|
4509 |
+
|
4510 |
+
Guestures.prototype.onTap = function (e) {
|
4511 |
+
var self = this;
|
4512 |
+
var $target = $(e.target);
|
4513 |
+
|
4514 |
+
var instance = self.instance;
|
4515 |
+
var current = instance.current;
|
4516 |
+
|
4517 |
+
var endPoints = (e && getPointerXY(e)) || self.startPoints;
|
4518 |
+
|
4519 |
+
var tapX = endPoints[0] ? endPoints[0].x - $(window).scrollLeft() - self.stagePos.left : 0;
|
4520 |
+
var tapY = endPoints[0] ? endPoints[0].y - $(window).scrollTop() - self.stagePos.top : 0;
|
4521 |
+
|
4522 |
+
var where;
|
4523 |
+
|
4524 |
+
var process = function (prefix) {
|
4525 |
+
var action = current.opts[prefix];
|
4526 |
+
|
4527 |
+
if ($.isFunction(action)) {
|
4528 |
+
action = action.apply(instance, [current, e]);
|
4529 |
+
}
|
4530 |
+
|
4531 |
+
if (!action) {
|
4532 |
+
return;
|
4533 |
+
}
|
4534 |
+
|
4535 |
+
switch (action) {
|
4536 |
+
case "close":
|
4537 |
+
instance.close(self.startEvent);
|
4538 |
+
|
4539 |
+
break;
|
4540 |
+
|
4541 |
+
case "toggleControls":
|
4542 |
+
instance.toggleControls();
|
4543 |
+
|
4544 |
+
break;
|
4545 |
+
|
4546 |
+
case "next":
|
4547 |
+
instance.next();
|
4548 |
+
|
4549 |
+
break;
|
4550 |
+
|
4551 |
+
case "nextOrClose":
|
4552 |
+
if (instance.group.length > 1) {
|
4553 |
+
instance.next();
|
4554 |
+
} else {
|
4555 |
+
instance.close(self.startEvent);
|
4556 |
+
}
|
4557 |
+
|
4558 |
+
break;
|
4559 |
+
|
4560 |
+
case "zoom":
|
4561 |
+
if (current.type == "image" && (current.isLoaded || current.$ghost)) {
|
4562 |
+
if (instance.canPan()) {
|
4563 |
+
instance.scaleToFit();
|
4564 |
+
} else if (instance.isScaledDown()) {
|
4565 |
+
instance.scaleToActual(tapX, tapY);
|
4566 |
+
} else if (instance.group.length < 2) {
|
4567 |
+
instance.close(self.startEvent);
|
4568 |
+
}
|
4569 |
+
}
|
4570 |
+
|
4571 |
+
break;
|
4572 |
+
}
|
4573 |
+
};
|
4574 |
+
|
4575 |
+
// Ignore right click
|
4576 |
+
if (e.originalEvent && e.originalEvent.button == 2) {
|
4577 |
+
return;
|
4578 |
+
}
|
4579 |
+
|
4580 |
+
// Skip if clicked on the scrollbar
|
4581 |
+
if (!$target.is("img") && tapX > $target[0].clientWidth + $target.offset().left) {
|
4582 |
+
return;
|
4583 |
+
}
|
4584 |
+
|
4585 |
+
// Check where is clicked
|
4586 |
+
if ($target.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container")) {
|
4587 |
+
where = "Outside";
|
4588 |
+
} else if ($target.is(".fancybox-slide")) {
|
4589 |
+
where = "Slide";
|
4590 |
+
} else if (
|
4591 |
+
instance.current.$content &&
|
4592 |
+
instance.current.$content
|
4593 |
+
.find($target)
|
4594 |
+
.addBack()
|
4595 |
+
.filter($target).length
|
4596 |
+
) {
|
4597 |
+
where = "Content";
|
4598 |
+
} else {
|
4599 |
+
return;
|
4600 |
+
}
|
4601 |
+
|
4602 |
+
// Check if this is a double tap
|
4603 |
+
if (self.tapped) {
|
4604 |
+
// Stop previously created single tap
|
4605 |
+
clearTimeout(self.tapped);
|
4606 |
+
self.tapped = null;
|
4607 |
+
|
4608 |
+
// Skip if distance between taps is too big
|
4609 |
+
if (Math.abs(tapX - self.tapX) > 50 || Math.abs(tapY - self.tapY) > 50) {
|
4610 |
+
return this;
|
4611 |
+
}
|
4612 |
+
|
4613 |
+
// OK, now we assume that this is a double-tap
|
4614 |
+
process("dblclick" + where);
|
4615 |
+
} else {
|
4616 |
+
// Single tap will be processed if user has not clicked second time within 300ms
|
4617 |
+
// or there is no need to wait for double-tap
|
4618 |
+
self.tapX = tapX;
|
4619 |
+
self.tapY = tapY;
|
4620 |
+
|
4621 |
+
if (current.opts["dblclick" + where] && current.opts["dblclick" + where] !== current.opts["click" + where]) {
|
4622 |
+
self.tapped = setTimeout(function () {
|
4623 |
+
self.tapped = null;
|
4624 |
+
|
4625 |
+
if (!instance.isAnimating) {
|
4626 |
+
process("click" + where);
|
4627 |
+
}
|
4628 |
+
}, 500);
|
4629 |
+
} else {
|
4630 |
+
process("click" + where);
|
4631 |
+
}
|
4632 |
+
}
|
4633 |
+
|
4634 |
+
return this;
|
4635 |
+
};
|
4636 |
+
|
4637 |
+
$(document)
|
4638 |
+
.on("onActivate.fb", function (e, instance) {
|
4639 |
+
if (instance && !instance.Guestures) {
|
4640 |
+
instance.Guestures = new Guestures(instance);
|
4641 |
+
}
|
4642 |
+
})
|
4643 |
+
.on("beforeClose.fb", function (e, instance) {
|
4644 |
+
if (instance && instance.Guestures) {
|
4645 |
+
instance.Guestures.destroy();
|
4646 |
+
}
|
4647 |
+
});
|
4648 |
+
})(window, document, jQuery);
|
4649 |
+
// ==========================================================================
|
4650 |
+
//
|
4651 |
+
// SlideShow
|
4652 |
+
// Enables slideshow functionality
|
4653 |
+
//
|
4654 |
+
// Example of usage:
|
4655 |
+
// $.fancybox.getInstance().SlideShow.start()
|
4656 |
+
//
|
4657 |
+
// ==========================================================================
|
4658 |
+
(function (document, $) {
|
4659 |
+
"use strict";
|
4660 |
+
|
4661 |
+
$.extend(true, $.fancybox.defaults, {
|
4662 |
+
btnTpl: {
|
4663 |
+
slideShow: '<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}">' +
|
4664 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg>' +
|
4665 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg>' +
|
4666 |
+
"</button>"
|
4667 |
+
},
|
4668 |
+
slideShow: {
|
4669 |
+
autoStart: false,
|
4670 |
+
speed: 3000,
|
4671 |
+
progress: true
|
4672 |
+
}
|
4673 |
+
});
|
4674 |
+
|
4675 |
+
var SlideShow = function (instance) {
|
4676 |
+
this.instance = instance;
|
4677 |
+
this.init();
|
4678 |
+
};
|
4679 |
+
|
4680 |
+
$.extend(SlideShow.prototype, {
|
4681 |
+
timer: null,
|
4682 |
+
isActive: false,
|
4683 |
+
$button: null,
|
4684 |
+
|
4685 |
+
init: function () {
|
4686 |
+
var self = this,
|
4687 |
+
instance = self.instance,
|
4688 |
+
opts = instance.group[instance.currIndex].opts.slideShow;
|
4689 |
+
|
4690 |
+
self.$button = instance.$refs.toolbar.find("[data-fancybox-play]").on("click", function () {
|
4691 |
+
self.toggle();
|
4692 |
+
});
|
4693 |
+
|
4694 |
+
if (instance.group.length < 2 || !opts) {
|
4695 |
+
self.$button.hide();
|
4696 |
+
} else if (opts.progress) {
|
4697 |
+
self.$progress = $('<div class="fancybox-progress"></div>').appendTo(instance.$refs.inner);
|
4698 |
+
}
|
4699 |
+
},
|
4700 |
+
|
4701 |
+
set: function (force) {
|
4702 |
+
var self = this,
|
4703 |
+
instance = self.instance,
|
4704 |
+
current = instance.current;
|
4705 |
+
|
4706 |
+
// Check if reached last element
|
4707 |
+
if (current && (force === true || current.opts.loop || instance.currIndex < instance.group.length - 1)) {
|
4708 |
+
if (self.isActive && current.contentType !== "video") {
|
4709 |
+
if (self.$progress) {
|
4710 |
+
$.fancybox.animate(self.$progress.show(), {
|
4711 |
+
scaleX: 1
|
4712 |
+
}, current.opts.slideShow.speed);
|
4713 |
+
}
|
4714 |
+
|
4715 |
+
self.timer = setTimeout(function () {
|
4716 |
+
if (!instance.current.opts.loop && instance.current.index == instance.group.length - 1) {
|
4717 |
+
instance.jumpTo(0);
|
4718 |
+
} else {
|
4719 |
+
instance.next();
|
4720 |
+
}
|
4721 |
+
}, current.opts.slideShow.speed);
|
4722 |
+
}
|
4723 |
+
} else {
|
4724 |
+
self.stop();
|
4725 |
+
instance.idleSecondsCounter = 0;
|
4726 |
+
instance.showControls();
|
4727 |
+
}
|
4728 |
+
},
|
4729 |
+
|
4730 |
+
clear: function () {
|
4731 |
+
var self = this;
|
4732 |
+
|
4733 |
+
clearTimeout(self.timer);
|
4734 |
+
|
4735 |
+
self.timer = null;
|
4736 |
+
|
4737 |
+
if (self.$progress) {
|
4738 |
+
self.$progress.removeAttr("style").hide();
|
4739 |
+
}
|
4740 |
+
},
|
4741 |
+
|
4742 |
+
start: function () {
|
4743 |
+
var self = this,
|
4744 |
+
current = self.instance.current;
|
4745 |
+
|
4746 |
+
if (current) {
|
4747 |
+
self.$button
|
4748 |
+
.attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_STOP)
|
4749 |
+
.removeClass("fancybox-button--play")
|
4750 |
+
.addClass("fancybox-button--pause");
|
4751 |
+
|
4752 |
+
self.isActive = true;
|
4753 |
+
|
4754 |
+
if (current.isComplete) {
|
4755 |
+
self.set(true);
|
4756 |
+
}
|
4757 |
+
|
4758 |
+
self.instance.trigger("onSlideShowChange", true);
|
4759 |
+
}
|
4760 |
+
},
|
4761 |
+
|
4762 |
+
stop: function () {
|
4763 |
+
var self = this,
|
4764 |
+
current = self.instance.current;
|
4765 |
+
|
4766 |
+
self.clear();
|
4767 |
+
|
4768 |
+
self.$button
|
4769 |
+
.attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_START)
|
4770 |
+
.removeClass("fancybox-button--pause")
|
4771 |
+
.addClass("fancybox-button--play");
|
4772 |
+
|
4773 |
+
self.isActive = false;
|
4774 |
+
|
4775 |
+
self.instance.trigger("onSlideShowChange", false);
|
4776 |
+
|
4777 |
+
if (self.$progress) {
|
4778 |
+
self.$progress.removeAttr("style").hide();
|
4779 |
+
}
|
4780 |
+
},
|
4781 |
+
|
4782 |
+
toggle: function () {
|
4783 |
+
var self = this;
|
4784 |
+
|
4785 |
+
if (self.isActive) {
|
4786 |
+
self.stop();
|
4787 |
+
} else {
|
4788 |
+
self.start();
|
4789 |
+
}
|
4790 |
+
}
|
4791 |
+
});
|
4792 |
+
|
4793 |
+
$(document).on({
|
4794 |
+
"onInit.fb": function (e, instance) {
|
4795 |
+
if (instance && !instance.SlideShow) {
|
4796 |
+
instance.SlideShow = new SlideShow(instance);
|
4797 |
+
}
|
4798 |
+
},
|
4799 |
+
|
4800 |
+
"beforeShow.fb": function (e, instance, current, firstRun) {
|
4801 |
+
var SlideShow = instance && instance.SlideShow;
|
4802 |
+
|
4803 |
+
if (firstRun) {
|
4804 |
+
if (SlideShow && current.opts.slideShow.autoStart) {
|
4805 |
+
SlideShow.start();
|
4806 |
+
}
|
4807 |
+
} else if (SlideShow && SlideShow.isActive) {
|
4808 |
+
SlideShow.clear();
|
4809 |
+
}
|
4810 |
+
},
|
4811 |
+
|
4812 |
+
"afterShow.fb": function (e, instance, current) {
|
4813 |
+
var SlideShow = instance && instance.SlideShow;
|
4814 |
+
|
4815 |
+
if (SlideShow && SlideShow.isActive) {
|
4816 |
+
SlideShow.set();
|
4817 |
+
}
|
4818 |
+
},
|
4819 |
+
|
4820 |
+
"afterKeydown.fb": function (e, instance, current, keypress, keycode) {
|
4821 |
+
var SlideShow = instance && instance.SlideShow;
|
4822 |
+
|
4823 |
+
// "P" or Spacebar
|
4824 |
+
if (SlideShow && current.opts.slideShow && (keycode === 80 || keycode === 32) && !$(document.activeElement).is("button,a,input")) {
|
4825 |
+
keypress.preventDefault();
|
4826 |
+
|
4827 |
+
SlideShow.toggle();
|
4828 |
+
}
|
4829 |
+
},
|
4830 |
+
|
4831 |
+
"beforeClose.fb onDeactivate.fb": function (e, instance) {
|
4832 |
+
var SlideShow = instance && instance.SlideShow;
|
4833 |
+
|
4834 |
+
if (SlideShow) {
|
4835 |
+
SlideShow.stop();
|
4836 |
+
}
|
4837 |
+
}
|
4838 |
+
});
|
4839 |
+
|
4840 |
+
// Page Visibility API to pause slideshow when window is not active
|
4841 |
+
$(document).on("visibilitychange", function () {
|
4842 |
+
var instance = $.fancybox.getInstance(),
|
4843 |
+
SlideShow = instance && instance.SlideShow;
|
4844 |
+
|
4845 |
+
if (SlideShow && SlideShow.isActive) {
|
4846 |
+
if (document.hidden) {
|
4847 |
+
SlideShow.clear();
|
4848 |
+
} else {
|
4849 |
+
SlideShow.set();
|
4850 |
+
}
|
4851 |
+
}
|
4852 |
+
});
|
4853 |
+
})(document, jQuery);
|
4854 |
+
// ==========================================================================
|
4855 |
+
//
|
4856 |
+
// FullScreen
|
4857 |
+
// Adds fullscreen functionality
|
4858 |
+
//
|
4859 |
+
// ==========================================================================
|
4860 |
+
(function (document, $) {
|
4861 |
+
"use strict";
|
4862 |
+
|
4863 |
+
// Collection of methods supported by user browser
|
4864 |
+
var fn = (function () {
|
4865 |
+
var fnMap = [
|
4866 |
+
["requestFullscreen", "exitFullscreen", "fullscreenElement", "fullscreenEnabled", "fullscreenchange", "fullscreenerror"],
|
4867 |
+
// new WebKit
|
4868 |
+
[
|
4869 |
+
"webkitRequestFullscreen",
|
4870 |
+
"webkitExitFullscreen",
|
4871 |
+
"webkitFullscreenElement",
|
4872 |
+
"webkitFullscreenEnabled",
|
4873 |
+
"webkitfullscreenchange",
|
4874 |
+
"webkitfullscreenerror"
|
4875 |
+
],
|
4876 |
+
// old WebKit (Safari 5.1)
|
4877 |
+
[
|
4878 |
+
"webkitRequestFullScreen",
|
4879 |
+
"webkitCancelFullScreen",
|
4880 |
+
"webkitCurrentFullScreenElement",
|
4881 |
+
"webkitCancelFullScreen",
|
4882 |
+
"webkitfullscreenchange",
|
4883 |
+
"webkitfullscreenerror"
|
4884 |
+
],
|
4885 |
+
[
|
4886 |
+
"mozRequestFullScreen",
|
4887 |
+
"mozCancelFullScreen",
|
4888 |
+
"mozFullScreenElement",
|
4889 |
+
"mozFullScreenEnabled",
|
4890 |
+
"mozfullscreenchange",
|
4891 |
+
"mozfullscreenerror"
|
4892 |
+
],
|
4893 |
+
["msRequestFullscreen", "msExitFullscreen", "msFullscreenElement", "msFullscreenEnabled", "MSFullscreenChange", "MSFullscreenError"]
|
4894 |
+
];
|
4895 |
+
|
4896 |
+
var ret = {};
|
4897 |
+
|
4898 |
+
for (var i = 0; i < fnMap.length; i++) {
|
4899 |
+
var val = fnMap[i];
|
4900 |
+
|
4901 |
+
if (val && val[1] in document) {
|
4902 |
+
for (var j = 0; j < val.length; j++) {
|
4903 |
+
ret[fnMap[0][j]] = val[j];
|
4904 |
+
}
|
4905 |
+
|
4906 |
+
return ret;
|
4907 |
+
}
|
4908 |
+
}
|
4909 |
+
|
4910 |
+
return false;
|
4911 |
+
})();
|
4912 |
+
|
4913 |
+
if (fn) {
|
4914 |
+
var FullScreen = {
|
4915 |
+
request: function (elem) {
|
4916 |
+
elem = elem || document.documentElement;
|
4917 |
+
|
4918 |
+
elem[fn.requestFullscreen](elem.ALLOW_KEYBOARD_INPUT);
|
4919 |
+
},
|
4920 |
+
exit: function () {
|
4921 |
+
document[fn.exitFullscreen]();
|
4922 |
+
},
|
4923 |
+
toggle: function (elem) {
|
4924 |
+
elem = elem || document.documentElement;
|
4925 |
+
|
4926 |
+
if (this.isFullscreen()) {
|
4927 |
+
this.exit();
|
4928 |
+
} else {
|
4929 |
+
this.request(elem);
|
4930 |
+
}
|
4931 |
+
},
|
4932 |
+
isFullscreen: function () {
|
4933 |
+
return Boolean(document[fn.fullscreenElement]);
|
4934 |
+
},
|
4935 |
+
enabled: function () {
|
4936 |
+
return Boolean(document[fn.fullscreenEnabled]);
|
4937 |
+
}
|
4938 |
+
};
|
4939 |
+
|
4940 |
+
$.extend(true, $.fancybox.defaults, {
|
4941 |
+
btnTpl: {
|
4942 |
+
fullScreen: '<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}">' +
|
4943 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg>' +
|
4944 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg>' +
|
4945 |
+
"</button>"
|
4946 |
+
},
|
4947 |
+
fullScreen: {
|
4948 |
+
autoStart: false
|
4949 |
+
}
|
4950 |
+
});
|
4951 |
+
|
4952 |
+
$(document).on(fn.fullscreenchange, function () {
|
4953 |
+
var isFullscreen = FullScreen.isFullscreen(),
|
4954 |
+
instance = $.fancybox.getInstance();
|
4955 |
+
|
4956 |
+
if (instance) {
|
4957 |
+
// If image is zooming, then force to stop and reposition properly
|
4958 |
+
if (instance.current && instance.current.type === "image" && instance.isAnimating) {
|
4959 |
+
instance.isAnimating = false;
|
4960 |
+
|
4961 |
+
instance.update(true, true, 0);
|
4962 |
+
|
4963 |
+
if (!instance.isComplete) {
|
4964 |
+
instance.complete();
|
4965 |
+
}
|
4966 |
+
}
|
4967 |
+
|
4968 |
+
instance.trigger("onFullscreenChange", isFullscreen);
|
4969 |
+
|
4970 |
+
instance.$refs.container.toggleClass("fancybox-is-fullscreen", isFullscreen);
|
4971 |
+
|
4972 |
+
instance.$refs.toolbar
|
4973 |
+
.find("[data-fancybox-fullscreen]")
|
4974 |
+
.toggleClass("fancybox-button--fsenter", !isFullscreen)
|
4975 |
+
.toggleClass("fancybox-button--fsexit", isFullscreen);
|
4976 |
+
}
|
4977 |
+
});
|
4978 |
+
}
|
4979 |
+
|
4980 |
+
$(document).on({
|
4981 |
+
"onInit.fb": function (e, instance) {
|
4982 |
+
var $container;
|
4983 |
+
|
4984 |
+
if (!fn) {
|
4985 |
+
instance.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();
|
4986 |
+
|
4987 |
+
return;
|
4988 |
+
}
|
4989 |
+
|
4990 |
+
if (instance && instance.group[instance.currIndex].opts.fullScreen) {
|
4991 |
+
$container = instance.$refs.container;
|
4992 |
+
|
4993 |
+
$container.on("click.fb-fullscreen", "[data-fancybox-fullscreen]", function (e) {
|
4994 |
+
e.stopPropagation();
|
4995 |
+
e.preventDefault();
|
4996 |
+
|
4997 |
+
FullScreen.toggle();
|
4998 |
+
});
|
4999 |
+
|
5000 |
+
if (instance.opts.fullScreen && instance.opts.fullScreen.autoStart === true) {
|
5001 |
+
FullScreen.request();
|
5002 |
+
}
|
5003 |
+
|
5004 |
+
// Expose API
|
5005 |
+
instance.FullScreen = FullScreen;
|
5006 |
+
} else if (instance) {
|
5007 |
+
instance.$refs.toolbar.find("[data-fancybox-fullscreen]").hide();
|
5008 |
+
}
|
5009 |
+
},
|
5010 |
+
|
5011 |
+
"afterKeydown.fb": function (e, instance, current, keypress, keycode) {
|
5012 |
+
// "F"
|
5013 |
+
if (instance && instance.FullScreen && keycode === 70) {
|
5014 |
+
keypress.preventDefault();
|
5015 |
+
|
5016 |
+
instance.FullScreen.toggle();
|
5017 |
+
}
|
5018 |
+
},
|
5019 |
+
|
5020 |
+
"beforeClose.fb": function (e, instance) {
|
5021 |
+
if (instance && instance.FullScreen && instance.$refs.container.hasClass("fancybox-is-fullscreen")) {
|
5022 |
+
FullScreen.exit();
|
5023 |
+
}
|
5024 |
+
}
|
5025 |
+
});
|
5026 |
+
})(document, jQuery);
|
5027 |
+
// ==========================================================================
|
5028 |
+
//
|
5029 |
+
// Thumbs
|
5030 |
+
// Displays thumbnails in a grid
|
5031 |
+
//
|
5032 |
+
// ==========================================================================
|
5033 |
+
(function (document, $) {
|
5034 |
+
"use strict";
|
5035 |
+
|
5036 |
+
var CLASS = "fancybox-thumbs",
|
5037 |
+
CLASS_ACTIVE = CLASS + "-active";
|
5038 |
+
|
5039 |
+
// Make sure there are default values
|
5040 |
+
$.fancybox.defaults = $.extend(
|
5041 |
+
true, {
|
5042 |
+
btnTpl: {
|
5043 |
+
thumbs: '<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}">' +
|
5044 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg>' +
|
5045 |
+
"</button>"
|
5046 |
+
},
|
5047 |
+
thumbs: {
|
5048 |
+
autoStart: false, // Display thumbnails on opening
|
5049 |
+
hideOnClose: true, // Hide thumbnail grid when closing animation starts
|
5050 |
+
parentEl: ".fancybox-container", // Container is injected into this element
|
5051 |
+
axis: "y" // Vertical (y) or horizontal (x) scrolling
|
5052 |
+
}
|
5053 |
+
},
|
5054 |
+
$.fancybox.defaults
|
5055 |
+
);
|
5056 |
+
|
5057 |
+
var FancyThumbs = function (instance) {
|
5058 |
+
this.init(instance);
|
5059 |
+
};
|
5060 |
+
|
5061 |
+
$.extend(FancyThumbs.prototype, {
|
5062 |
+
$button: null,
|
5063 |
+
$grid: null,
|
5064 |
+
$list: null,
|
5065 |
+
isVisible: false,
|
5066 |
+
isActive: false,
|
5067 |
+
|
5068 |
+
init: function (instance) {
|
5069 |
+
var self = this,
|
5070 |
+
group = instance.group,
|
5071 |
+
enabled = 0;
|
5072 |
+
|
5073 |
+
self.instance = instance;
|
5074 |
+
self.opts = group[instance.currIndex].opts.thumbs;
|
5075 |
+
|
5076 |
+
instance.Thumbs = self;
|
5077 |
+
|
5078 |
+
self.$button = instance.$refs.toolbar.find("[data-fancybox-thumbs]");
|
5079 |
+
|
5080 |
+
// Enable thumbs if at least two group items have thumbnails
|
5081 |
+
for (var i = 0, len = group.length; i < len; i++) {
|
5082 |
+
if (group[i].thumb) {
|
5083 |
+
enabled++;
|
5084 |
+
}
|
5085 |
+
|
5086 |
+
if (enabled > 1) {
|
5087 |
+
break;
|
5088 |
+
}
|
5089 |
+
}
|
5090 |
+
|
5091 |
+
if (enabled > 1 && !!self.opts) {
|
5092 |
+
self.$button.removeAttr("style").on("click", function () {
|
5093 |
+
self.toggle();
|
5094 |
+
});
|
5095 |
+
|
5096 |
+
self.isActive = true;
|
5097 |
+
} else {
|
5098 |
+
self.$button.hide();
|
5099 |
+
}
|
5100 |
+
},
|
5101 |
+
|
5102 |
+
create: function () {
|
5103 |
+
var self = this,
|
5104 |
+
instance = self.instance,
|
5105 |
+
parentEl = self.opts.parentEl,
|
5106 |
+
list = [],
|
5107 |
+
src;
|
5108 |
+
|
5109 |
+
if (!self.$grid) {
|
5110 |
+
// Create main element
|
5111 |
+
self.$grid = $('<div class="' + CLASS + " " + CLASS + "-" + self.opts.axis + '"></div>').appendTo(
|
5112 |
+
instance.$refs.container
|
5113 |
+
.find(parentEl)
|
5114 |
+
.addBack()
|
5115 |
+
.filter(parentEl)
|
5116 |
+
);
|
5117 |
+
|
5118 |
+
// Add "click" event that performs gallery navigation
|
5119 |
+
self.$grid.on("click", "a", function () {
|
5120 |
+
instance.jumpTo($(this).attr("data-index"));
|
5121 |
+
});
|
5122 |
+
}
|
5123 |
+
|
5124 |
+
// Build the list
|
5125 |
+
if (!self.$list) {
|
5126 |
+
self.$list = $('<div class="' + CLASS + '__list">').appendTo(self.$grid);
|
5127 |
+
}
|
5128 |
+
|
5129 |
+
$.each(instance.group, function (i, item) {
|
5130 |
+
src = item.thumb;
|
5131 |
+
|
5132 |
+
if (!src && item.type === "image") {
|
5133 |
+
src = item.src;
|
5134 |
+
}
|
5135 |
+
|
5136 |
+
list.push(
|
5137 |
+
'<a href="javascript:;" tabindex="0" data-index="' +
|
5138 |
+
i +
|
5139 |
+
'"' +
|
5140 |
+
(src && src.length ? ' style="background-image:url(' + src + ')"' : 'class="fancybox-thumbs-missing"') +
|
5141 |
+
"></a>"
|
5142 |
+
);
|
5143 |
+
});
|
5144 |
+
|
5145 |
+
self.$list[0].innerHTML = list.join("");
|
5146 |
+
|
5147 |
+
if (self.opts.axis === "x") {
|
5148 |
+
// Set fixed width for list element to enable horizontal scrolling
|
5149 |
+
self.$list.width(
|
5150 |
+
parseInt(self.$grid.css("padding-right"), 10) +
|
5151 |
+
instance.group.length *
|
5152 |
+
self.$list
|
5153 |
+
.children()
|
5154 |
+
.eq(0)
|
5155 |
+
.outerWidth(true)
|
5156 |
+
);
|
5157 |
+
}
|
5158 |
+
},
|
5159 |
+
|
5160 |
+
focus: function (duration) {
|
5161 |
+
var self = this,
|
5162 |
+
$list = self.$list,
|
5163 |
+
$grid = self.$grid,
|
5164 |
+
thumb,
|
5165 |
+
thumbPos;
|
5166 |
+
|
5167 |
+
if (!self.instance.current) {
|
5168 |
+
return;
|
5169 |
+
}
|
5170 |
+
|
5171 |
+
thumb = $list
|
5172 |
+
.children()
|
5173 |
+
.removeClass(CLASS_ACTIVE)
|
5174 |
+
.filter('[data-index="' + self.instance.current.index + '"]')
|
5175 |
+
.addClass(CLASS_ACTIVE);
|
5176 |
+
|
5177 |
+
thumbPos = thumb.position();
|
5178 |
+
|
5179 |
+
// Check if need to scroll to make current thumb visible
|
5180 |
+
if (self.opts.axis === "y" && (thumbPos.top < 0 || thumbPos.top > $list.height() - thumb.outerHeight())) {
|
5181 |
+
$list.stop().animate({
|
5182 |
+
scrollTop: $list.scrollTop() + thumbPos.top
|
5183 |
+
},
|
5184 |
+
duration
|
5185 |
+
);
|
5186 |
+
} else if (
|
5187 |
+
self.opts.axis === "x" &&
|
5188 |
+
(thumbPos.left < $grid.scrollLeft() || thumbPos.left > $grid.scrollLeft() + ($grid.width() - thumb.outerWidth()))
|
5189 |
+
) {
|
5190 |
+
$list
|
5191 |
+
.parent()
|
5192 |
+
.stop()
|
5193 |
+
.animate({
|
5194 |
+
scrollLeft: thumbPos.left
|
5195 |
+
},
|
5196 |
+
duration
|
5197 |
+
);
|
5198 |
+
}
|
5199 |
+
},
|
5200 |
+
|
5201 |
+
update: function () {
|
5202 |
+
var that = this;
|
5203 |
+
that.instance.$refs.container.toggleClass("fancybox-show-thumbs", this.isVisible);
|
5204 |
+
|
5205 |
+
if (that.isVisible) {
|
5206 |
+
if (!that.$grid) {
|
5207 |
+
that.create();
|
5208 |
+
}
|
5209 |
+
|
5210 |
+
that.instance.trigger("onThumbsShow");
|
5211 |
+
|
5212 |
+
that.focus(0);
|
5213 |
+
} else if (that.$grid) {
|
5214 |
+
that.instance.trigger("onThumbsHide");
|
5215 |
+
}
|
5216 |
+
|
5217 |
+
// Update content position
|
5218 |
+
that.instance.update();
|
5219 |
+
},
|
5220 |
+
|
5221 |
+
hide: function () {
|
5222 |
+
this.isVisible = false;
|
5223 |
+
this.update();
|
5224 |
+
},
|
5225 |
+
|
5226 |
+
show: function () {
|
5227 |
+
this.isVisible = true;
|
5228 |
+
this.update();
|
5229 |
+
},
|
5230 |
+
|
5231 |
+
toggle: function () {
|
5232 |
+
this.isVisible = !this.isVisible;
|
5233 |
+
this.update();
|
5234 |
+
}
|
5235 |
+
});
|
5236 |
+
|
5237 |
+
$(document).on({
|
5238 |
+
"onInit.fb": function (e, instance) {
|
5239 |
+
var Thumbs;
|
5240 |
+
|
5241 |
+
if (instance && !instance.Thumbs) {
|
5242 |
+
Thumbs = new FancyThumbs(instance);
|
5243 |
+
|
5244 |
+
if (Thumbs.isActive && Thumbs.opts.autoStart === true) {
|
5245 |
+
Thumbs.show();
|
5246 |
+
}
|
5247 |
+
}
|
5248 |
+
},
|
5249 |
+
|
5250 |
+
"beforeShow.fb": function (e, instance, item, firstRun) {
|
5251 |
+
var Thumbs = instance && instance.Thumbs;
|
5252 |
+
|
5253 |
+
if (Thumbs && Thumbs.isVisible) {
|
5254 |
+
Thumbs.focus(firstRun ? 0 : 250);
|
5255 |
+
}
|
5256 |
+
},
|
5257 |
+
|
5258 |
+
"afterKeydown.fb": function (e, instance, current, keypress, keycode) {
|
5259 |
+
var Thumbs = instance && instance.Thumbs;
|
5260 |
+
|
5261 |
+
// "G"
|
5262 |
+
if (Thumbs && Thumbs.isActive && keycode === 71) {
|
5263 |
+
keypress.preventDefault();
|
5264 |
+
|
5265 |
+
Thumbs.toggle();
|
5266 |
+
}
|
5267 |
+
},
|
5268 |
+
|
5269 |
+
"beforeClose.fb": function (e, instance) {
|
5270 |
+
var Thumbs = instance && instance.Thumbs;
|
5271 |
+
|
5272 |
+
if (Thumbs && Thumbs.isVisible && Thumbs.opts.hideOnClose !== false) {
|
5273 |
+
Thumbs.$grid.hide();
|
5274 |
+
}
|
5275 |
+
}
|
5276 |
+
});
|
5277 |
+
})(document, jQuery);
|
5278 |
+
//// ==========================================================================
|
5279 |
+
//
|
5280 |
+
// Share
|
5281 |
+
// Displays simple form for sharing current url
|
5282 |
+
//
|
5283 |
+
// ==========================================================================
|
5284 |
+
(function (document, $) {
|
5285 |
+
"use strict";
|
5286 |
+
|
5287 |
+
$.extend(true, $.fancybox.defaults, {
|
5288 |
+
btnTpl: {
|
5289 |
+
share: '<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}">' +
|
5290 |
+
'<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg>' +
|
5291 |
+
"</button>"
|
5292 |
+
},
|
5293 |
+
share: {
|
5294 |
+
url: function (instance, item) {
|
5295 |
+
return (
|
5296 |
+
(!instance.currentHash && !(item.type === "inline" || item.type === "html") ? item.origSrc || item.src : false) || window.location
|
5297 |
+
);
|
5298 |
+
},
|
5299 |
+
tpl: '<div class="fancybox-share">' +
|
5300 |
+
"<h1>{{SHARE}}</h1>" +
|
5301 |
+
"<p>" +
|
5302 |
+
'<a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}">' +
|
5303 |
+
'<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg>' +
|
5304 |
+
"<span>Facebook</span>" +
|
5305 |
+
"</a>" +
|
5306 |
+
'<a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}">' +
|
5307 |
+
'<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg>' +
|
5308 |
+
"<span>Twitter</span>" +
|
5309 |
+
"</a>" +
|
5310 |
+
'<a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}">' +
|
5311 |
+
'<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg>' +
|
5312 |
+
"<span>Pinterest</span>" +
|
5313 |
+
"</a>" +
|
5314 |
+
"</p>" +
|
5315 |
+
'<p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p>' +
|
5316 |
+
"</div>"
|
5317 |
+
}
|
5318 |
+
});
|
5319 |
+
|
5320 |
+
function escapeHtml(string) {
|
5321 |
+
var entityMap = {
|
5322 |
+
"&": "&",
|
5323 |
+
"<": "<",
|
5324 |
+
">": ">",
|
5325 |
+
'"': """,
|
5326 |
+
"'": "'",
|
5327 |
+
"/": "/",
|
5328 |
+
"`": "`",
|
5329 |
+
"=": "="
|
5330 |
+
};
|
5331 |
+
|
5332 |
+
return String(string).replace(/[&<>"'`=\/]/g, function (s) {
|
5333 |
+
return entityMap[s];
|
5334 |
+
});
|
5335 |
+
}
|
5336 |
+
|
5337 |
+
$(document).on("click", "[data-fancybox-share]", function () {
|
5338 |
+
var instance = $.fancybox.getInstance(),
|
5339 |
+
current = instance.current || null,
|
5340 |
+
url,
|
5341 |
+
tpl;
|
5342 |
+
|
5343 |
+
if (!current) {
|
5344 |
+
return;
|
5345 |
+
}
|
5346 |
+
|
5347 |
+
if ($.type(current.opts.share.url) === "function") {
|
5348 |
+
url = current.opts.share.url.apply(current, [instance, current]);
|
5349 |
+
}
|
5350 |
+
|
5351 |
+
tpl = current.opts.share.tpl
|
5352 |
+
.replace(/\{\{media\}\}/g, current.type === "image" ? encodeURIComponent(current.src) : "")
|
5353 |
+
.replace(/\{\{url\}\}/g, encodeURIComponent(url))
|
5354 |
+
.replace(/\{\{url_raw\}\}/g, escapeHtml(url))
|
5355 |
+
.replace(/\{\{descr\}\}/g, instance.$caption ? encodeURIComponent(instance.$caption.text()) : "");
|
5356 |
+
|
5357 |
+
$.fancybox.open({
|
5358 |
+
src: instance.translate(instance, tpl),
|
5359 |
+
type: "html",
|
5360 |
+
opts: {
|
5361 |
+
touch: false,
|
5362 |
+
animationEffect: false,
|
5363 |
+
afterLoad: function (shareInstance, shareCurrent) {
|
5364 |
+
// Close self if parent instance is closing
|
5365 |
+
instance.$refs.container.one("beforeClose.fb", function () {
|
5366 |
+
shareInstance.close(null, 0);
|
5367 |
+
});
|
5368 |
+
|
5369 |
+
// Opening links in a popup window
|
5370 |
+
shareCurrent.$content.find(".fancybox-share__button").click(function () {
|
5371 |
+
window.open(this.href, "Share", "width=550, height=450");
|
5372 |
+
return false;
|
5373 |
+
});
|
5374 |
+
},
|
5375 |
+
mobile: {
|
5376 |
+
autoFocus: false
|
5377 |
+
}
|
5378 |
+
}
|
5379 |
+
});
|
5380 |
+
});
|
5381 |
+
})(document, jQuery);
|
5382 |
+
// ==========================================================================
|
5383 |
+
//
|
5384 |
+
// Hash
|
5385 |
+
// Enables linking to each modal
|
5386 |
+
//
|
5387 |
+
// ==========================================================================
|
5388 |
+
(function (window, document, $) {
|
5389 |
+
"use strict";
|
5390 |
+
|
5391 |
+
// Simple $.escapeSelector polyfill (for jQuery prior v3)
|
5392 |
+
if (!$.escapeSelector) {
|
5393 |
+
$.escapeSelector = function (sel) {
|
5394 |
+
var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
|
5395 |
+
var fcssescape = function (ch, asCodePoint) {
|
5396 |
+
if (asCodePoint) {
|
5397 |
+
// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
|
5398 |
+
if (ch === "\0") {
|
5399 |
+
return "\uFFFD";
|
5400 |
+
}
|
5401 |
+
|
5402 |
+
// Control characters and (dependent upon position) numbers get escaped as code points
|
5403 |
+
return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
|
5404 |
+
}
|
5405 |
+
|
5406 |
+
// Other potentially-special ASCII characters get backslash-escaped
|
5407 |
+
return "\\" + ch;
|
5408 |
+
};
|
5409 |
+
|
5410 |
+
return (sel + "").replace(rcssescape, fcssescape);
|
5411 |
+
};
|
5412 |
+
}
|
5413 |
+
|
5414 |
+
// Get info about gallery name and current index from url
|
5415 |
+
function parseUrl() {
|
5416 |
+
var hash = window.location.hash.substr(1),
|
5417 |
+
rez = hash.split("-"),
|
5418 |
+
index = rez.length > 1 && /^\+?\d+$/.test(rez[rez.length - 1]) ? parseInt(rez.pop(-1), 10) || 1 : 1,
|
5419 |
+
gallery = rez.join("-");
|
5420 |
+
|
5421 |
+
return {
|
5422 |
+
hash: hash,
|
5423 |
+
/* Index is starting from 1 */
|
5424 |
+
index: index < 1 ? 1 : index,
|
5425 |
+
gallery: gallery
|
5426 |
+
};
|
5427 |
+
}
|
5428 |
+
|
5429 |
+
// Trigger click evnt on links to open new fancyBox instance
|
5430 |
+
function triggerFromUrl(url) {
|
5431 |
+
if (url.gallery !== "") {
|
5432 |
+
// If we can find element matching 'data-fancybox' atribute,
|
5433 |
+
// then triggering click event should start fancyBox
|
5434 |
+
$("[data-fancybox='" + $.escapeSelector(url.gallery) + "']")
|
5435 |
+
.eq(url.index - 1)
|
5436 |
+
.focus()
|
5437 |
+
.trigger("click.fb-start");
|
5438 |
+
}
|
5439 |
+
}
|
5440 |
+
|
5441 |
+
// Get gallery name from current instance
|
5442 |
+
function getGalleryID(instance) {
|
5443 |
+
var opts, ret;
|
5444 |
+
|
5445 |
+
if (!instance) {
|
5446 |
+
return false;
|
5447 |
+
}
|
5448 |
+
|
5449 |
+
opts = instance.current ? instance.current.opts : instance.opts;
|
5450 |
+
ret = opts.hash || (opts.$orig ? opts.$orig.data("fancybox") || opts.$orig.data("fancybox-trigger") : "");
|
5451 |
+
|
5452 |
+
return ret === "" ? false : ret;
|
5453 |
+
}
|
5454 |
+
|
5455 |
+
// Start when DOM becomes ready
|
5456 |
+
$(function () {
|
5457 |
+
// Check if user has disabled this module
|
5458 |
+
if ($.fancybox.defaults.hash === false) {
|
5459 |
+
return;
|
5460 |
+
}
|
5461 |
+
|
5462 |
+
// Update hash when opening/closing fancyBox
|
5463 |
+
$(document).on({
|
5464 |
+
"onInit.fb": function (e, instance) {
|
5465 |
+
var url, gallery;
|
5466 |
+
|
5467 |
+
if (instance.group[instance.currIndex].opts.hash === false) {
|
5468 |
+
return;
|
5469 |
+
}
|
5470 |
+
|
5471 |
+
url = parseUrl();
|
5472 |
+
gallery = getGalleryID(instance);
|
5473 |
+
|
5474 |
+
// Make sure gallery start index matches index from hash
|
5475 |
+
if (gallery && url.gallery && gallery == url.gallery) {
|
5476 |
+
instance.currIndex = url.index - 1;
|
5477 |
+
}
|
5478 |
+
},
|
5479 |
+
|
5480 |
+
"beforeShow.fb": function (e, instance, current, firstRun) {
|
5481 |
+
var gallery;
|
5482 |
+
|
5483 |
+
if (!current || current.opts.hash === false) {
|
5484 |
+
return;
|
5485 |
+
}
|
5486 |
+
|
5487 |
+
// Check if need to update window hash
|
5488 |
+
gallery = getGalleryID(instance);
|
5489 |
+
|
5490 |
+
if (!gallery) {
|
5491 |
+
return;
|
5492 |
+
}
|
5493 |
+
|
5494 |
+
// Variable containing last hash value set by fancyBox
|
5495 |
+
// It will be used to determine if fancyBox needs to close after hash change is detected
|
5496 |
+
instance.currentHash = gallery + (instance.group.length > 1 ? "-" + (current.index + 1) : "");
|
5497 |
+
|
5498 |
+
// If current hash is the same (this instance most likely is opened by hashchange), then do nothing
|
5499 |
+
if (window.location.hash === "#" + instance.currentHash) {
|
5500 |
+
return;
|
5501 |
+
}
|
5502 |
+
|
5503 |
+
if (firstRun && !instance.origHash) {
|
5504 |
+
instance.origHash = window.location.hash;
|
5505 |
+
}
|
5506 |
+
|
5507 |
+
if (instance.hashTimer) {
|
5508 |
+
clearTimeout(instance.hashTimer);
|
5509 |
+
}
|
5510 |
+
|
5511 |
+
// Update hash
|
5512 |
+
instance.hashTimer = setTimeout(function () {
|
5513 |
+
if ("replaceState" in window.history) {
|
5514 |
+
window.history[firstRun ? "pushState" : "replaceState"]({},
|
5515 |
+
document.title,
|
5516 |
+
window.location.pathname + window.location.search + "#" + instance.currentHash
|
5517 |
+
);
|
5518 |
+
|
5519 |
+
if (firstRun) {
|
5520 |
+
instance.hasCreatedHistory = true;
|
5521 |
+
}
|
5522 |
+
} else {
|
5523 |
+
window.location.hash = instance.currentHash;
|
5524 |
+
}
|
5525 |
+
|
5526 |
+
instance.hashTimer = null;
|
5527 |
+
}, 300);
|
5528 |
+
},
|
5529 |
+
|
5530 |
+
"beforeClose.fb": function (e, instance, current) {
|
5531 |
+
if (!current || current.opts.hash === false) {
|
5532 |
+
return;
|
5533 |
+
}
|
5534 |
+
|
5535 |
+
clearTimeout(instance.hashTimer);
|
5536 |
+
|
5537 |
+
// Goto previous history entry
|
5538 |
+
if (instance.currentHash && instance.hasCreatedHistory) {
|
5539 |
+
window.history.back();
|
5540 |
+
} else if (instance.currentHash) {
|
5541 |
+
if ("replaceState" in window.history) {
|
5542 |
+
window.history.replaceState({}, document.title, window.location.pathname + window.location.search + (instance.origHash || ""));
|
5543 |
+
} else {
|
5544 |
+
window.location.hash = instance.origHash;
|
5545 |
+
}
|
5546 |
+
}
|
5547 |
+
|
5548 |
+
instance.currentHash = null;
|
5549 |
+
}
|
5550 |
+
});
|
5551 |
+
|
5552 |
+
// Check if need to start/close after url has changed
|
5553 |
+
$(window).on("hashchange.fb", function () {
|
5554 |
+
var url = parseUrl(),
|
5555 |
+
fb = null;
|
5556 |
+
|
5557 |
+
// Find last fancyBox instance that has "hash"
|
5558 |
+
$.each(
|
5559 |
+
$(".fancybox-container")
|
5560 |
+
.get()
|
5561 |
+
.reverse(),
|
5562 |
+
function (index, value) {
|
5563 |
+
var tmp = $(value).data("FancyBox");
|
5564 |
+
|
5565 |
+
if (tmp && tmp.currentHash) {
|
5566 |
+
fb = tmp;
|
5567 |
+
return false;
|
5568 |
+
}
|
5569 |
+
}
|
5570 |
+
);
|
5571 |
+
|
5572 |
+
if (fb) {
|
5573 |
+
// Now, compare hash values
|
5574 |
+
if (fb.currentHash !== url.gallery + "-" + url.index && !(url.index === 1 && fb.currentHash == url.gallery)) {
|
5575 |
+
fb.currentHash = null;
|
5576 |
+
|
5577 |
+
fb.close();
|
5578 |
+
}
|
5579 |
+
} else if (url.gallery !== "") {
|
5580 |
+
triggerFromUrl(url);
|
5581 |
+
}
|
5582 |
+
});
|
5583 |
+
|
5584 |
+
// Check current hash and trigger click event on matching element to start fancyBox, if needed
|
5585 |
+
setTimeout(function () {
|
5586 |
+
if (!$.fancybox.getInstance()) {
|
5587 |
+
triggerFromUrl(parseUrl());
|
5588 |
+
}
|
5589 |
+
}, 50);
|
5590 |
+
});
|
5591 |
+
})(window, document, jQuery);
|
5592 |
+
// ==========================================================================
|
5593 |
+
//
|
5594 |
+
// Wheel
|
5595 |
+
// Basic mouse weheel support for gallery navigation
|
5596 |
+
//
|
5597 |
+
// ==========================================================================
|
5598 |
+
(function (document, $) {
|
5599 |
+
"use strict";
|
5600 |
+
|
5601 |
+
var prevTime = new Date().getTime();
|
5602 |
+
|
5603 |
+
$(document).on({
|
5604 |
+
"onInit.fb": function (e, instance, current) {
|
5605 |
+
instance.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll", function (e) {
|
5606 |
+
var current = instance.current,
|
5607 |
+
currTime = new Date().getTime();
|
5608 |
+
|
5609 |
+
if (instance.group.length < 2 || current.opts.wheel === false || (current.opts.wheel === "auto" && current.type !== "image")) {
|
5610 |
+
return;
|
5611 |
+
}
|
5612 |
+
|
5613 |
+
e.preventDefault();
|
5614 |
+
e.stopPropagation();
|
5615 |
+
|
5616 |
+
if (current.$slide.hasClass("fancybox-animated")) {
|
5617 |
+
return;
|
5618 |
+
}
|
5619 |
+
|
5620 |
+
e = e.originalEvent || e;
|
5621 |
+
|
5622 |
+
if (currTime - prevTime < 250) {
|
5623 |
+
return;
|
5624 |
+
}
|
5625 |
+
|
5626 |
+
prevTime = currTime;
|
5627 |
+
|
5628 |
+
instance[(-e.deltaY || -e.deltaX || e.wheelDelta || -e.detail) < 0 ? "next" : "previous"]();
|
5629 |
+
});
|
5630 |
+
}
|
5631 |
+
});
|
5632 |
+
})(document, jQuery);
|
fancybox/3.5.7/jquery.fancybox.min.css
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
body.compensate-for-scrollbar{overflow:hidden;}.fancybox-active{height:auto;}.fancybox-is-hidden{left:-9999px;margin:0;position:absolute!important;top:-9999px;visibility:hidden;}.fancybox-container{-webkit-backface-visibility:hidden;height:100%;left:0;outline:none;position:fixed;-webkit-tap-highlight-color:transparent;top:0;-ms-touch-action:manipulation;touch-action:manipulation;transform:translateZ(0);width:100%;z-index:99992;}.fancybox-container *{box-sizing:border-box;}.fancybox-outer,.fancybox-inner,.fancybox-bg,.fancybox-stage{bottom:0;left:0;position:absolute;right:0;top:0;}.fancybox-outer{-webkit-overflow-scrolling:touch;overflow-y:auto;}.fancybox-bg{background:rgb(30,30,30);opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71);}.fancybox-is-open .fancybox-bg{opacity:.9;transition-timing-function:cubic-bezier(.22,.61,.36,1);}.fancybox-infobar,.fancybox-toolbar,.fancybox-caption,.fancybox-navigation .fancybox-button{direction:ltr;opacity:0;position:absolute;transition:opacity .25s ease,visibility 0s ease .25s;visibility:hidden;z-index:99997;}.fancybox-show-infobar .fancybox-infobar,.fancybox-show-toolbar .fancybox-toolbar,.fancybox-show-caption .fancybox-caption,.fancybox-show-nav .fancybox-navigation .fancybox-button{opacity:1;transition:opacity .25s ease 0s,visibility 0s ease 0s;visibility:visible;}.fancybox-infobar{color:#ccc;font-size:13px;-webkit-font-smoothing:subpixel-antialiased;height:44px;left:0;line-height:44px;min-width:44px;mix-blend-mode:difference;padding:0 10px;pointer-events:none;top:0;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;}.fancybox-toolbar{right:0;top:0;}.fancybox-stage{direction:ltr;overflow:visible;transform:translateZ(0);z-index:99994;}.fancybox-is-open .fancybox-stage{overflow:hidden;}.fancybox-slide{-webkit-backface-visibility:hidden;display:none;height:100%;left:0;outline:none;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:absolute;text-align:center;top:0;transition-property:transform,opacity;white-space:normal;width:100%;z-index:99994;}.fancybox-slide::before{content:'';display:inline-block;font-size:0;height:100%;vertical-align:middle;width:0;}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--previous,.fancybox-slide--current,.fancybox-slide--next{display:block;}.fancybox-slide--image{overflow:hidden;padding:44px 0;}.fancybox-slide--image::before{display:none;}.fancybox-slide--html{padding:6px;}.fancybox-content{background:#fff;display:inline-block;margin:0;max-width:100%;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:relative;text-align:left;vertical-align:middle;}.fancybox-slide--image .fancybox-content{animation-timing-function:cubic-bezier(.5,0,.14,1);-webkit-backface-visibility:hidden;background:transparent;background-repeat:no-repeat;background-size:100% 100%;left:0;max-width:none;overflow:visible;padding:0;position:absolute;top:0;-ms-transform-origin:top left;transform-origin:top left;transition-property:transform,opacity;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;z-index:99995;}.fancybox-can-zoomOut .fancybox-content{cursor:zoom-out;}.fancybox-can-zoomIn .fancybox-content{cursor:zoom-in;}.fancybox-can-swipe .fancybox-content,.fancybox-can-pan .fancybox-content{cursor:-webkit-grab;cursor:grab;}.fancybox-is-grabbing .fancybox-content{cursor:-webkit-grabbing;cursor:grabbing;}.fancybox-container [data-selectable='true']{cursor:text;}.fancybox-image,.fancybox-spaceball{background:transparent;border:0;height:100%;left:0;margin:0;max-height:none;max-width:none;padding:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%;}.fancybox-spaceball{z-index:1;}.fancybox-slide--video .fancybox-content,.fancybox-slide--map .fancybox-content,.fancybox-slide--pdf .fancybox-content,.fancybox-slide--iframe .fancybox-content{height:100%;overflow:visible;padding:0;width:100%;}.fancybox-slide--video .fancybox-content{background:#000;}.fancybox-slide--map .fancybox-content{background:#e5e3df;}.fancybox-slide--iframe .fancybox-content{background:#fff;}.fancybox-video,.fancybox-iframe{background:transparent;border:0;display:block;height:100%;margin:0;overflow:hidden;padding:0;width:100%;}.fancybox-iframe{left:0;position:absolute;top:0;}.fancybox-error{background:#fff;cursor:default;max-width:400px;padding:40px;width:100%;}.fancybox-error p{color:#444;font-size:16px;line-height:20px;margin:0;padding:0;}.fancybox-button{background:rgba(30,30,30,.6);border:0;border-radius:0;box-shadow:none;cursor:pointer;display:inline-block;height:44px;margin:0;padding:10px;position:relative;transition:color .2s;vertical-align:top;visibility:inherit;width:44px;}.fancybox-button,.fancybox-button:visited,.fancybox-button:link{color:#ccc;}.fancybox-button:hover{color:#fff;}.fancybox-button:focus{outline:none;}.fancybox-button.fancybox-focus{outline:1px dotted;}.fancybox-button[disabled],.fancybox-button[disabled]:hover{color:#888;cursor:default;outline:none;}.fancybox-button div{height:100%;}.fancybox-button svg{display:block;height:100%;overflow:visible;position:relative;width:100%;}.fancybox-button svg path{fill:currentColor;stroke-width:0;}.fancybox-button--play svg:nth-child(2),.fancybox-button--fsenter svg:nth-child(2){display:none;}.fancybox-button--pause svg:nth-child(1),.fancybox-button--fsexit svg:nth-child(1){display:none;}.fancybox-progress{background:#ff5268;height:2px;left:0;position:absolute;right:0;top:0;-ms-transform:scaleX(0);transform:scaleX(0);-ms-transform-origin:0;transform-origin:0;transition-property:transform;transition-timing-function:linear;z-index:99998;}.fancybox-close-small{background:transparent;border:0;border-radius:0;color:#ccc;cursor:pointer;opacity:.8;padding:8px;position:absolute;right:-12px;top:-44px;z-index:401;}.fancybox-close-small:hover{color:#fff;opacity:1;}.fancybox-slide--html .fancybox-close-small{color:currentColor;padding:10px;right:0;top:0;}.fancybox-slide--image.fancybox-is-scaling .fancybox-content{overflow:hidden;}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small{display:none;}.fancybox-navigation .fancybox-button{background-clip:content-box;height:100px;opacity:0;position:absolute;top:calc(50% - 50px);width:70px;}.fancybox-navigation .fancybox-button div{padding:7px;}.fancybox-navigation .fancybox-button--arrow_left{left:0;left:env(safe-area-inset-left);padding:31px 26px 31px 6px;}.fancybox-navigation .fancybox-button--arrow_right{padding:31px 6px 31px 26px;right:0;right:env(safe-area-inset-right);}.fancybox-caption{background:linear-gradient(to top,rgba(0,0,0,.85) 0%,rgba(0,0,0,.3) 50%,rgba(0,0,0,.15) 65%,rgba(0,0,0,.075) 75.5%,rgba(0,0,0,.037) 82.85%,rgba(0,0,0,.019) 88%,rgba(0,0,0,0) 100%);bottom:0;color:#eee;font-size:14px;font-weight:400;left:0;line-height:1.5;padding:75px 44px 25px 44px;pointer-events:none;right:0;text-align:center;z-index:99996;}@supports (padding:max(0)){.fancybox-caption{padding:75px max(44px,env(safe-area-inset-right)) max(25px,env(safe-area-inset-bottom)) max(44px,env(safe-area-inset-left))}}.fancybox-caption--separate{margin-top:-50px;}.fancybox-caption__body{max-height:50vh;overflow:auto;pointer-events:all;}.fancybox-caption a,.fancybox-caption a:link,.fancybox-caption a:visited{color:#ccc;text-decoration:none;}.fancybox-caption a:hover{color:#fff;text-decoration:underline;}.fancybox-loading{animation:fancybox-rotate 1s linear infinite;background:transparent;border:4px solid #888;border-bottom-color:#fff;border-radius:50%;height:50px;left:50%;margin:-25px 0 0 -25px;opacity:.7;padding:0;position:absolute;top:50%;width:50px;z-index:99999;}@keyframes fancybox-rotate{100%{transform:rotate(360deg)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1);}.fancybox-fx-slide.fancybox-slide--previous{opacity:0;transform:translate3d(-100%,0,0);}.fancybox-fx-slide.fancybox-slide--next{opacity:0;transform:translate3d(100%,0,0);}.fancybox-fx-slide.fancybox-slide--current{opacity:1;transform:translate3d(0,0,0);}.fancybox-fx-fade.fancybox-slide--previous,.fancybox-fx-fade.fancybox-slide--next{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1);}.fancybox-fx-fade.fancybox-slide--current{opacity:1;}.fancybox-fx-zoom-in-out.fancybox-slide--previous{opacity:0;transform:scale3d(1.5,1.5,1.5);}.fancybox-fx-zoom-in-out.fancybox-slide--next{opacity:0;transform:scale3d(.5,.5,.5);}.fancybox-fx-zoom-in-out.fancybox-slide--current{opacity:1;transform:scale3d(1,1,1);}.fancybox-fx-rotate.fancybox-slide--previous{opacity:0;-ms-transform:rotate(-360deg);transform:rotate(-360deg);}.fancybox-fx-rotate.fancybox-slide--next{opacity:0;-ms-transform:rotate(360deg);transform:rotate(360deg);}.fancybox-fx-rotate.fancybox-slide--current{opacity:1;-ms-transform:rotate(0deg);transform:rotate(0deg);}.fancybox-fx-circular.fancybox-slide--previous{opacity:0;transform:scale3d(0,0,0) translate3d(-100%,0,0);}.fancybox-fx-circular.fancybox-slide--next{opacity:0;transform:scale3d(0,0,0) translate3d(100%,0,0);}.fancybox-fx-circular.fancybox-slide--current{opacity:1;transform:scale3d(1,1,1) translate3d(0,0,0);}.fancybox-fx-tube.fancybox-slide--previous{transform:translate3d(-100%,0,0) scale(.1) skew(-10deg);}.fancybox-fx-tube.fancybox-slide--next{transform:translate3d(100%,0,0) scale(.1) skew(10deg);}.fancybox-fx-tube.fancybox-slide--current{transform:translate3d(0,0,0) scale(1);}@media all and (max-height:576px){.fancybox-slide{padding-left:6px;padding-right:6px}.fancybox-slide--image{padding:6px 0}.fancybox-close-small{right:-6px}.fancybox-slide--image .fancybox-close-small{background:#4e4e4e;color:#f2f4f6;height:36px;opacity:1;padding:6px;right:0;top:0;width:36px}.fancybox-caption{padding-left:12px;padding-right:12px}@supports (padding:max(0)){.fancybox-caption{padding-left:max(12px,env(safe-area-inset-left));padding-right:max(12px,env(safe-area-inset-right))}}}.fancybox-share{background:#f4f4f4;border-radius:3px;max-width:90%;padding:30px;text-align:center;}.fancybox-share h1{color:#222;font-size:35px;font-weight:700;margin:0 0 20px 0;}.fancybox-share p{margin:0;padding:0;}.fancybox-share__button{border:0;border-radius:3px;display:inline-block;font-size:14px;font-weight:700;line-height:40px;margin:0 5px 10px 5px;min-width:130px;padding:0 15px;text-decoration:none;transition:all .2s;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;white-space:nowrap;}.fancybox-share__button:visited,.fancybox-share__button:link{color:#fff;}.fancybox-share__button:hover{text-decoration:none;}.fancybox-share__button--fb{background:#3b5998;}.fancybox-share__button--fb:hover{background:#344e86;}.fancybox-share__button--pt{background:#bd081d;}.fancybox-share__button--pt:hover{background:#aa0719;}.fancybox-share__button--tw{background:#1da1f2;}.fancybox-share__button--tw:hover{background:#0d95e8;}.fancybox-share__button svg{height:25px;margin-right:7px;position:relative;top:-1px;vertical-align:middle;width:25px;}.fancybox-share__button svg path{fill:#fff;}.fancybox-share__input{background:transparent;border:0;border-bottom:1px solid #d7d7d7;border-radius:0;color:#5d5b5b;font-size:14px;margin:10px 0 0 0;outline:none;padding:10px 15px;width:100%;}.fancybox-thumbs{background:#ddd;bottom:0;display:none;margin:0;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;padding:2px 2px 4px 2px;position:absolute;right:0;-webkit-tap-highlight-color:rgba(0,0,0,0);top:0;width:212px;z-index:99995;}.fancybox-thumbs-x{overflow-x:auto;overflow-y:hidden;}.fancybox-show-thumbs .fancybox-thumbs{display:block;}.fancybox-show-thumbs .fancybox-inner{right:212px;}.fancybox-thumbs__list{font-size:0;height:100%;list-style:none;margin:0;overflow-x:hidden;overflow-y:auto;padding:0;position:absolute;position:relative;white-space:nowrap;width:100%;}.fancybox-thumbs-x .fancybox-thumbs__list{overflow:hidden;}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar{width:7px;}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3);}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px;}.fancybox-thumbs__list a{-webkit-backface-visibility:hidden;backface-visibility:hidden;background-color:rgba(0,0,0,.1);background-position:center center;background-repeat:no-repeat;background-size:cover;cursor:pointer;float:left;height:75px;margin:2px;max-height:calc(100% - 8px);max-width:calc(50% - 4px);outline:none;overflow:hidden;padding:0;position:relative;-webkit-tap-highlight-color:transparent;width:100px;}.fancybox-thumbs__list a::before{border:6px solid #ff5268;bottom:0;content:'';left:0;opacity:0;position:absolute;right:0;top:0;transition:all .2s cubic-bezier(.25,.46,.45,.94);z-index:99991;}.fancybox-thumbs__list a:focus::before{opacity:.5;}.fancybox-thumbs__list a.fancybox-thumbs-active::before{opacity:1;}@media all and (max-width:576px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs__list a{max-width:calc(100% - 10px)}}
|
fancybox/3.5.7/jquery.fancybox.min.js
ADDED
@@ -0,0 +1 @@
|
|
|
1 |
+
!function(t,e,n,o){"use strict";if(t.console=t.console||{info:function(t){}},n&&!n.fn.fancybox){var a,i,s,r,c={closeExisting:!1,loop:!1,gutter:50,keyboard:!0,preventCaptionOverlap:!0,arrows:!0,infobar:!0,smallBtn:"auto",toolbar:"auto",buttons:["zoom","slideShow","thumbs","close"],idleTime:3,protect:!1,modal:!1,image:{preload:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},video:{tpl:'<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}"><source src="{{src}}" type="{{format}}" />Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!</video>',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption"><div class="fancybox-caption__body"></div></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}</p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div></button>',smallBtn:'<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg></button>'},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schließen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Vergrößern"}}},l=n(t),d=n(e),u=0,p=t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)},f=t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)},h=function(){var t,n=e.createElement("fakeelement"),a={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in a)if(n.style[t]!==o)return a[t];return"transitionend"}(),g=function(t){return t&&t.length&&t[0].offsetHeight},b=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,(function(t,e){n.isArray(e)&&(o[t]=e)})),o},m=function(t,e,o){var a=this;a.opts=b({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(a.opts=b(a.opts,e)),n.fancybox.isMobile&&(a.opts=b(a.opts,a.opts.mobile)),a.id=a.opts.id||++u,a.currIndex=parseInt(a.opts.index,10)||0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=!0,a.group=[],a.slides={},a.addContent(t),a.group.length&&a.init()};n.extend(m.prototype,{init:function(){var o,a,i=this,s=i.group[i.currIndex].opts;s.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&!1!==s.hideScrollbar&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:'+(t.innerWidth-e.documentElement.clientWidth)+"px;}</style>"),n("body").addClass("compensate-for-scrollbar")),a="",n.each(s.buttons,(function(t,e){a+=s.btnTpl[e]||""})),o=n(i.translate(i,s.baseTpl.replace("{{buttons}}",a).replace("{{arrows}}",s.btnTpl.arrowLeft+s.btnTpl.arrowRight))).attr("id","fancybox-container-"+i.id).addClass(s.baseClass).data("FancyBox",i).appendTo(s.parentEl),i.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach((function(t){i.$refs[t]=o.find(".fancybox-"+t)})),i.trigger("onInit"),i.activate(),i.jumpTo(i.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,(function(t,e){return n[e]===o?t:n[e]}))},addContent:function(t){var e,a=this,i=n.makeArray(t);n.each(i,(function(t,e){var i,s,r,c,l,d={},u={};n.isPlainObject(e)?(d=e,u=e.opts||e):"object"===n.type(e)&&n(e).length?(u=(i=n(e)).data()||{},(u=n.extend(!0,{},u,u.options)).$orig=i,d.src=a.opts.src||u.src||i.attr("href"),d.type||d.src||(d.type="inline",d.src=e)):d={type:"html",src:e+""},d.opts=n.extend(!0,{},a.opts,u),n.isArray(u.buttons)&&(d.opts.buttons=u.buttons),n.fancybox.isMobile&&d.opts.mobile&&(d.opts=b(d.opts,d.opts.mobile)),s=d.type||d.opts.type,c=d.src||"",!s&&c&&((r=c.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))?(s="video",d.opts.video.format||(d.opts.video.format="video/"+("ogv"===r[1]?"ogg":r[1]))):c.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?s="image":c.match(/\.(pdf)((\?|#).*)?$/i)?(s="iframe",d=n.extend(!0,d,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===c.charAt(0)&&(s="inline")),s?d.type=s:a.trigger("objectNeedsType",d),d.contentType||(d.contentType=n.inArray(d.type,["html","inline","ajax"])>-1?"html":d.type),d.index=a.group.length,"auto"==d.opts.smallBtn&&(d.opts.smallBtn=n.inArray(d.type,["html","inline","ajax"])>-1),"auto"===d.opts.toolbar&&(d.opts.toolbar=!d.opts.smallBtn),d.$thumb=d.opts.$thumb||null,d.opts.$trigger&&d.index===a.opts.index&&(d.$thumb=d.opts.$trigger.find("img:first"),d.$thumb.length&&(d.opts.$orig=d.opts.$trigger)),d.$thumb&&d.$thumb.length||!d.opts.$orig||(d.$thumb=d.opts.$orig.find("img:first")),d.$thumb&&!d.$thumb.length&&(d.$thumb=null),d.thumb=d.opts.thumb||(d.$thumb?d.$thumb[0].src:null),"function"===n.type(d.opts.caption)&&(d.opts.caption=d.opts.caption.apply(e,[a,d])),"function"===n.type(a.opts.caption)&&(d.opts.caption=a.opts.caption.apply(e,[a,d])),d.opts.caption instanceof n||(d.opts.caption=d.opts.caption===o?"":d.opts.caption+""),"ajax"===d.type&&(l=c.split(/\s+/,2)).length>1&&(d.src=l.shift(),d.opts.filter=l.shift()),d.opts.modal&&(d.opts=n.extend(!0,d.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),a.group.push(d)})),Object.keys(a.slides).length&&(a.updateControls(),(e=a.Thumbs)&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",(function(t){t.stopPropagation(),t.preventDefault(),e.close(t)})).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",(function(t){t.stopPropagation(),t.preventDefault(),e.previous()})).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",(function(t){t.stopPropagation(),t.preventDefault(),e.next()})).on("click.fb","[data-fancybox-zoom]",(function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()})),l.on("orientationchange.fb resize.fb",(function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&f(e.requestId),e.requestId=p((function(){e.update(t)}))):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout((function(){e.$refs.stage.show(),e.update(t)}),n.fancybox.isMobile?600:250))})),d.on("keydown.fb",(function(t){var o=(n.fancybox?n.fancybox.getInstance():null).current,a=t.keyCode||t.which;if(9!=a){if(!(!o.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is("input,textarea,video,audio,select")))return 8===a||27===a?(t.preventDefault(),void e.close(t)):37===a||38===a?(t.preventDefault(),void e.previous()):39===a||40===a?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,a)}else o.opts.trapFocus&&e.focus(t)})),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,d.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",(function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1})),e.idleInterval=t.setInterval((function(){e.idleSecondsCounter++,e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())}),1e3))},removeEvents:function(){var e=this;l.off("orientationchange.fb resize.fb"),d.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var a,i,s,r,c,l,d,u,p,f=this,h=f.group.length;if(!(f.isDragging||f.isClosing||f.isAnimating&&f.firstRun)){if(t=parseInt(t,10),!(s=f.current?f.current.opts.loop:f.opts.loop)&&(t<0||t>=h))return!1;if(a=f.firstRun=!Object.keys(f.slides).length,c=f.current,f.prevIndex=f.currIndex,f.prevPos=f.currPos,r=f.createSlide(t),h>1&&((s||r.index<h-1)&&f.createSlide(t+1),(s||r.index>0)&&f.createSlide(t-1)),f.current=r,f.currIndex=r.index,f.currPos=r.pos,f.trigger("beforeShow",a),f.updateControls(),r.forcedDuration=o,n.isNumeric(e)?r.forcedDuration=e:e=r.opts[a?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=f.isMoved(r),r.$slide.addClass("fancybox-slide--current"),a)return r.opts.animationEffect&&e&&f.$refs.container.css("transition-duration",e+"ms"),f.$refs.container.addClass("fancybox-is-open").trigger("focus"),f.loadSlide(r),void f.preload("image");l=n.fancybox.getTranslate(c.$slide),d=n.fancybox.getTranslate(f.$refs.stage),n.each(f.slides,(function(t,e){n.fancybox.stop(e.$slide,!0)})),c.pos!==r.pos&&(c.isComplete=!1),c.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(p=l.left-(c.pos*l.width+c.pos*c.opts.gutter),n.each(f.slides,(function(t,o){o.$slide.removeClass("fancybox-animated").removeClass((function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")}));var a=o.pos*l.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:a-d.left+p}),o.pos!==r.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>r.pos?"next":"previous")),g(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-r.pos)*l.width+(o.pos-r.pos)*o.opts.gutter},e,(function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===f.currPos&&f.complete()}))}))):e&&r.opts.transitionEffect&&(u="fancybox-animated fancybox-fx-"+r.opts.transitionEffect,c.$slide.addClass("fancybox-slide--"+(c.pos>r.pos?"next":"previous")),n.fancybox.animate(c.$slide,u,e,(function(){c.$slide.removeClass(u).removeClass("fancybox-slide--next fancybox-slide--previous")}),!1)),r.isLoaded?f.revealContent(r):f.loadSlide(r),f.preload("image")}},createSlide:function(t){var e,o,a=this;return o=(o=t%a.group.length)<0?a.group.length+o:o,!a.slides[t]&&a.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(a.$refs.stage),a.slides[t]=n.extend(!0,{},a.group[o],{pos:t,$slide:e,isLoaded:!1}),a.updateSlide(a.slides[t])),a.slides[t]},scaleToActual:function(t,e,a){var i,s,r,c,l,d=this,u=d.current,p=u.$content,f=n.fancybox.getTranslate(u.$slide).width,h=n.fancybox.getTranslate(u.$slide).height,g=u.width,b=u.height;d.isAnimating||d.isMoved()||!p||"image"!=u.type||!u.isLoaded||u.hasError||(d.isAnimating=!0,n.fancybox.stop(p),t=t===o?.5*f:t,e=e===o?.5*h:e,(i=n.fancybox.getTranslate(p)).top-=n.fancybox.getTranslate(u.$slide).top,i.left-=n.fancybox.getTranslate(u.$slide).left,c=g/i.width,l=b/i.height,s=.5*f-.5*g,r=.5*h-.5*b,g>f&&((s=i.left*c-(t*c-t))>0&&(s=0),s<f-g&&(s=f-g)),b>h&&((r=i.top*l-(e*l-e))>0&&(r=0),r<h-b&&(r=h-b)),d.updateCursor(g,b),n.fancybox.animate(p,{top:r,left:s,scaleX:c,scaleY:l},a||366,(function(){d.isAnimating=!1})),d.SlideShow&&d.SlideShow.isActive&&d.SlideShow.stop())},scaleToFit:function(t){var e,o=this,a=o.current,i=a.$content;o.isAnimating||o.isMoved()||!i||"image"!=a.type||!a.isLoaded||a.hasError||(o.isAnimating=!0,n.fancybox.stop(i),e=o.getFitPos(a),o.updateCursor(e.width,e.height),n.fancybox.animate(i,{top:e.top,left:e.left,scaleX:e.width/i.width(),scaleY:e.height/i.height()},t||366,(function(){o.isAnimating=!1})))},getFitPos:function(t){var e,o,a,i,s=t.$content,r=t.$slide,c=t.width||t.opts.width,l=t.height||t.opts.height,d={};return!!(t.isLoaded&&s&&s.length)&&(e=n.fancybox.getTranslate(this.$refs.stage).width,o=n.fancybox.getTranslate(this.$refs.stage).height,e-=parseFloat(r.css("paddingLeft"))+parseFloat(r.css("paddingRight"))+parseFloat(s.css("marginLeft"))+parseFloat(s.css("marginRight")),o-=parseFloat(r.css("paddingTop"))+parseFloat(r.css("paddingBottom"))+parseFloat(s.css("marginTop"))+parseFloat(s.css("marginBottom")),c&&l||(c=e,l=o),(c*=a=Math.min(1,e/c,o/l))>e-.5&&(c=e),(l*=a)>o-.5&&(l=o),"image"===t.type?(d.top=Math.floor(.5*(o-l))+parseFloat(r.css("paddingTop")),d.left=Math.floor(.5*(e-c))+parseFloat(r.css("paddingLeft"))):"video"===t.contentType&&(l>c/(i=t.opts.width&&t.opts.height?c/l:t.opts.ratio||16/9)?l=c/i:c>l*i&&(c=l*i)),d.width=c,d.height=l,d)},update:function(t){var e=this;n.each(e.slides,(function(n,o){e.updateSlide(o,t)}))},updateSlide:function(t,e){var o=this,a=t&&t.$content,i=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),a&&(i||s||"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(a),n.fancybox.setTranslate(a,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,a=e.current,i=a.$slide;!e.isClosing&&a&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},t===o?0:t,(function(){i.css({transform:"",opacity:""}),a.isComplete||e.complete()}),!1))},isMoved:function(t){var e,o,a=t||this.current;return!!a&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(a.$slide),!a.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,a,i=this,s=i.current,r=i.$refs.container;s&&!i.isClosing&&i.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),a=!!(o=i.canPan(t,e))||i.isZoomable(),r.toggleClass("fancybox-is-zoomable",a),n("[data-fancybox-zoom]").prop("disabled",!a),o?r.addClass("fancybox-can-pan"):a&&("zoom"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical||i.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if((t=e.getFitPos(n))&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var a=!1,i=this.current,s=i.$content;return t!==o&&e!==o?a=t<i.width&&e<i.height:s&&(a=(a=n.fancybox.getTranslate(s)).width<i.width&&a.height<i.height),a},canPan:function(t,e){var a=this.current,i=null,s=!1;return"image"===a.type&&(a.isComplete||t&&e)&&!a.hasError&&(s=this.getFitPos(a),t!==o&&e!==o?i={width:t,height:e}:a.isComplete&&(i=n.fancybox.getTranslate(a.$content)),i&&s&&(s=Math.abs(i.width-s.width)>1.5||Math.abs(i.height-s.height)>1.5)),s},loadSlide:function(t){var e,o,a,i=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,!1===i.trigger("beforeLoad",t))return t.isLoading=!1,!1;switch(e=t.type,(o=t.$slide).off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":i.setImage(t);break;case"iframe":i.setIframe(t);break;case"html":i.setContent(t,t.src||t.content);break;case"video":i.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat||t.opts.video.format||"").replace("{{poster}}",t.thumb||""));break;case"inline":n(t.src).length?i.setContent(t,n(t.src)):i.setError(t);break;case"ajax":i.showLoading(t),a=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&i.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&i.setError(t)}})),o.one("onReset",(function(){a.abort()}));break;default:i.setError(t);break}return!0}},setImage:function(t){var o,a=this;setTimeout((function(){var e=t.$image;a.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||a.showLoading(t)}),50),a.checkSrcset(t),t.$content=n('<div class="fancybox-content"></div>').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),!1!==t.opts.preload&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,(o=e.createElement("img")).onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){a.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),a.setBigImage(t)},checkSrcset:function(e){var n,o,a,i,s=e.opts.srcset||e.opts.image.srcset;if(s){a=t.devicePixelRatio||1,i=t.innerWidth*a,o=s.split(",").map((function(t){var e={};return t.trim().split(/\s+/).forEach((function(t,n){var o=parseInt(t.substring(0,t.length-1),10);if(0===n)return e.url=t;o&&(e.value=o,e.postfix=t[t.length-1])})),e})),o.sort((function(t,e){return t.value-e.value}));for(var r=0;r<o.length;r++){var c=o[r];if("w"===c.postfix&&c.value>=i||"x"===c.postfix&&c.value>=a){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,a=e.createElement("img"),i=n(a);t.$image=i.one("error",(function(){o.setError(t)})).one("load",(function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&((e=t.opts.sizes)&&"auto"!==e||(e=(t.width/t.height>1&&l.width()/l.height()>1?"100":Math.round(t.width/t.height*100))+"vw"),i.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout((function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()}),Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))})).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(a.complete||"complete"==a.readyState)&&i.naturalWidth&&i.naturalHeight?i.trigger("load"):a.error&&i.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),a=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),a>0&&(t.width=Math.floor(a*e/n),t.height=a)},setIframe:function(t){var e,a=this,i=t.opts.iframe,s=t.$slide;t.$content=n('<div class="fancybox-content'+(i.preload?" fancybox-is-hidden":"")+'"></div>').css(i.css).appendTo(s),s.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(a.showLoading(t),e.on("load.fb error.fb",(function(e){this.isReady=1,t.$slide.trigger("refresh"),a.afterLoad(t)})),s.on("refresh.fb",(function(){var n,a=t.$content,r=i.css.width,c=i.css.height;if(1===e[0].isReady){try{n=e.contents().find("body")}catch(t){}n&&n.length&&n.children().length&&(s.css("overflow","visible"),a.css({width:"100%","max-width":"100%",height:"9999px"}),r===o&&(r=Math.ceil(Math.max(n[0].clientWidth,n.outerWidth(!0)))),a.css("width",r||"").css("max-width",""),c===o&&(c=Math.ceil(Math.max(n[0].clientHeight,n.outerHeight(!0)))),a.css("height",c||""),s.css("overflow","auto")),a.removeClass("fancybox-is-hidden")}}))):a.afterLoad(t),e.attr("src",t.src),s.one("onReset",(function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1}))},setContent:function(t,e){var o,a=this;a.isClosing||(a.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),(o=e)&&o.hasOwnProperty&&o instanceof n&&e.parent().length?((e.hasClass("fancybox-content")||e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("<div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents()),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",(function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)})),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("<div></div>"),t.contentType="video",t.opts.width=t.opts.width||n(e).attr("width"),t.opts.height=t.opts.height||n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner("<div></div>").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),a.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){(t=t||this.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",(function(t){return 2==t.button&&t.preventDefault(),!0})),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,a=o.opts.caption,i=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass("fancybox-caption--separate",i),i&&a&&a.length&&(o.pos!==n.currPos?((e=s.clone().appendTo(s.parent())).children().eq(0).empty().html(a),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css("padding-bottom",r||""))},adjustLayout:function(t){var e,n,o,a,i=t||this.current;i.isLoaded&&!0!==i.opts.disableLayoutFix&&(i.$content.css("margin-bottom",""),i.$content.outerHeight()>i.$slide.height()+.5&&(o=i.$slide[0].style["padding-bottom"],a=i.$slide.css("padding-bottom"),parseFloat(a)>0&&(e=i.$slide[0].scrollHeight,i.$slide.css("padding-bottom",0),Math.abs(e-i.$slide[0].scrollHeight)<1&&(n=a),i.$slide.css("padding-bottom",o))),i.$content.css("margin-bottom",n))},revealContent:function(t){var e,a,i,s,r=this,c=t.$slide,l=!1,d=!1,u=r.isMoved(t),p=t.isRevealed;return t.isRevealed=!0,e=t.opts[r.firstRun?"animationEffect":"transitionEffect"],i=t.opts[r.firstRun?"animationDuration":"transitionDuration"],i=parseInt(t.forcedDuration===o?i:t.forcedDuration,10),!u&&t.pos===r.currPos&&i||(e=!1),"zoom"===e&&(t.pos===r.currPos&&i&&"image"===t.type&&!t.hasError&&(d=r.getThumbPos(t))?l=r.getFitPos(t):e="fade"),"zoom"===e?(r.isAnimating=!0,l.scaleX=l.width/d.width,l.scaleY=l.height/d.height,"auto"==(s=t.opts.zoomOpacity)&&(s=Math.abs(t.width/t.height-d.width/d.height)>.1),s&&(d.opacity=.1,l.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),d),g(t.$content),void n.fancybox.animate(t.$content,l,i,(function(){r.isAnimating=!1,r.complete()}))):(r.updateSlide(t),e?(n.fancybox.stop(c),a="fancybox-slide--"+(t.pos>=r.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,c.addClass(a).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),g(c),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(c,"fancybox-slide--current",i,(function(){c.removeClass(a).css({transform:"",opacity:""}),t.pos===r.currPos&&r.complete()}),!0)):(t.$content.removeClass("fancybox-is-hidden"),p||!u||"image"!==t.type||t.hasError||t.$content.hide().fadeIn("fast"),void(t.pos===r.currPos&&r.complete())))},getThumbPos:function(t){var o,a,i,s,r,c,l=t.$thumb;return!(!l||!function(t){var o,a;return!(!t||t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},a=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),a)}(l[0]))&&(a=n.fancybox.getTranslate(l),i=parseFloat(l.css("border-top-width")||0),s=parseFloat(l.css("border-right-width")||0),r=parseFloat(l.css("border-bottom-width")||0),c=parseFloat(l.css("border-left-width")||0),o={top:a.top+i,left:a.left+c,width:a.width-s-c,height:a.height-i-r,scaleX:1,scaleY:1},a.width>0&&a.height>0&&o)},complete:function(){var t,e=this,o=e.current,a={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),g(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,(function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?a[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())})),e.slides=a),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",(function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()})),o.opts.autoFocus&&"html"===o.contentType&&((t=o.$content.find("input[autofocus]:enabled:visible:first")).length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],(e=o.slides[o.currPos-1])&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var a,i,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","video","audio","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing||((a=(a=!t&&s.current&&s.current.isComplete?s.current.$slide.find("*:visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible")).filter(r).filter((function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}))).length?(i=a.index(e.activeElement),t&&t.shiftKey?(i<0||0==i)&&(t.preventDefault(),a.eq(a.length-1).trigger("focus")):(i<0||i==a.length-1)&&(t&&t.preventDefault(),a.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each((function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)})),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,a,i,s,r,c,l,d=this,u=d.current,f=function(){d.cleanUp(t)};return!d.isClosing&&(d.isClosing=!0,!1===d.trigger("beforeClose",t)?(d.isClosing=!1,p((function(){d.update()})),!1):(d.removeEvents(),i=u.$content,o=u.opts.animationEffect,a=n.isNumeric(e)?e:o?u.opts.animationDuration:0,u.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),!0!==t?n.fancybox.stop(u.$slide):o=!1,u.$slide.siblings().trigger("onReset").remove(),a&&d.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",a+"ms"),d.hideLoading(u),d.hideControls(!0),d.updateCursor(),"zoom"!==o||i&&a&&"image"===u.type&&!d.isMoved()&&!u.hasError&&(l=d.getThumbPos(u))||(o="fade"),"zoom"===o?(n.fancybox.stop(i),c={top:(s=n.fancybox.getTranslate(i)).top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},"auto"==(r=u.opts.zoomOpacity)&&(r=Math.abs(u.width/u.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(i,c),g(i),n.fancybox.animate(i,l,a,f),!0):(o&&a?n.fancybox.animate(u.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,a,f):!0===t?setTimeout(f,a):f(),!0)))},cleanUp:function(e){var o,a,i,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")||(r=s.$trigger),r&&r.length&&(a=t.scrollX,i=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(i).scrollLeft(a))),s.current=null,(o=n.fancybox.getInstance())?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,a=Array.prototype.slice.call(arguments,1),i=this,s=e&&e.opts?e:i.current;if(s?a.unshift(s):s=i,a.unshift(i),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,a)),!1===o)return o;"afterClose"!==t&&i.$refs?i.$refs.container.trigger(t+".fb",a):d.trigger(t+".fb",a)},updateControls:function(){var t=this,o=t.current,a=o.index,i=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),i.find("[data-fancybox-count]").html(t.group.length),i.find("[data-fancybox-index]").html(a+1),i.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&a<=0),i.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&a>=t.group.length-1),"image"===o.type?i.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src||o.src).show():o.opts.toolbar&&i.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=["infobar","toolbar","nav"];!t&&this.current.opts.preventCaptionOverlap||e.push("caption"),this.$refs.container.removeClass(e.map((function(t){return"fancybox-show-"+t})).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.7",defaults:c,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof m&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new m(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),d.add("body").off("click.fb-start","**")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:(a=e.createElement("div"),t.getComputedStyle&&t.getComputedStyle(a)&&t.getComputedStyle(a).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)),getTranslate:function(t){var e;return!(!t||!t.length)&&{top:(e=t[0].getBoundingClientRect()).top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))}},setTranslate:function(t,e){var n="",a={};if(t&&e)return e.left===o&&e.top===o||(n=(e.left===o?t.position().left:e.left)+"px, "+(e.top===o?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),e.scaleX!==o&&e.scaleY!==o?n+=" scale("+e.scaleX+", "+e.scaleY+")":e.scaleX!==o&&(n+=" scaleX("+e.scaleX+")"),n.length&&(a.transform=n),e.opacity!==o&&(a.opacity=e.opacity),e.width!==o&&(a.width=e.width),e.height!==o&&(a.height=e.height),t.css(a)},animate:function(t,e,a,i,s){var r,c=this;n.isFunction(a)&&(i=a,a=null),c.stop(t),r=c.getTranslate(t),t.on(h,(function(l){(!l||!l.originalEvent||t.is(l.originalEvent.target)&&"z-index"!=l.originalEvent.propertyName)&&(c.stop(t),n.isNumeric(a)&&t.css("transition-duration",""),n.isPlainObject(e)?e.scaleX!==o&&e.scaleY!==o&&c.setTranslate(t,{top:e.top,left:e.left,width:r.width*e.scaleX,height:r.height*e.scaleY,scaleX:1,scaleY:1}):!0!==s&&t.removeClass(e),n.isFunction(i)&&i(l))})),n.isNumeric(a)&&t.css("transition-duration",a+"ms"),n.isPlainObject(e)?(e.scaleX!==o&&e.scaleY!==o&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout((function(){t.trigger(h)}),a+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(h),t.off(h).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return(e=(t=t||{}).selector||!1)?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},y):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},y),this},d.on("click.fb-start","[data-fancybox]",y),d.on("click.fb-start","[data-fancybox-trigger]",(function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")||0).trigger("click.fb-start",{$trigger:n(this)})})),i=".fancybox-button",s="fancybox-focus",r=null,d.on("mousedown mouseup focus blur",i,(function(t){switch(t.type){case"mousedown":r=n(this);break;case"mouseup":r=null;break;case"focusin":n(i).removeClass(s),n(this).is(r)||n(this).is("[disabled]")||n(this).addClass(s);break;case"focusout":n(i).removeClass(s);break}}))}function y(t,e){var o,a,i,s=[],r=0;t&&t.isDefaultPrevented()||(t.preventDefault(),e=e||{},t&&t.data&&(e=b(t.data.options,e)),o=e.$target||n(t.currentTarget).trigger("blur"),(i=n.fancybox.getInstance())&&i.$trigger&&i.$trigger.is(o)||(s=e.selector?n(e.selector):(a=o.attr("data-fancybox")||"")?(s=t.data?t.data.items:[]).length?s.filter('[data-fancybox="'+a+'"]'):n('[data-fancybox="'+a+'"]'):[o],(r=n(s).index(o))<0&&(r=0),(i=n.fancybox.open(s,e,r)).$trigger=o))}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"https://www.youtube-nocookie.com/embed/$4",thumb:"https://img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,(function(t,n){e=e.replace("$"+t,n||"")})),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",(function(o,a,i){var s,r,c,l,d,u,p,f=i.src||"",h=!1;s=t.extend(!0,{},e,i.opts.media),t.each(s,(function(e,o){if(c=f.match(o.matcher)){if(h=o.type,p=e,u={},o.paramPlace&&c[o.paramPlace]){"?"==(d=c[o.paramPlace])[0]&&(d=d.substring(1)),d=d.split("&");for(var a=0;a<d.length;++a){var s=d[a].split("=",2);2==s.length&&(u[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,i.opts[e],u),f="function"===t.type(o.url)?o.url.call(this,c,l,i):n(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,i):n(o.thumb,c),"youtube"===e?f=f.replace(/&t=((\d+)m)?(\d+)s/,(function(t,e,n,o){return"&start="+((n?60*parseInt(n,10):0)+parseInt(o,10))})):"vimeo"===e&&(f=f.replace("&%23","#")),!1}})),h?(i.opts.thumb||i.opts.$thumb&&i.opts.$thumb.length||(i.opts.thumb=r),"iframe"===h&&(i.opts=t.extend(!0,i.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}})),t.extend(i,{type:h,src:f,origSrc:i.src,contentSource:p,contentType:"image"===h?"image":"gmap_place"==p||"gmap_search"==p?"map":"video"})):f&&(i.type=i.opts.defaultType)}));var o={youtube:{src:"https://www.youtube.com/iframe_api",class:"YT",loading:!1,loaded:!1},vimeo:{src:"https://player.vimeo.com/api/player.js",class:"Vimeo",loading:!1,loaded:!1},load:function(t){var e,n=this;this[t].loaded?setTimeout((function(){n.done(t)})):this[t].loading||(this[t].loading=!0,(e=document.createElement("script")).type="text/javascript",e.src=this[t].src,"youtube"===t?window.onYouTubeIframeAPIReady=function(){n[t].loaded=!0,n.done(t)}:e.onload=function(){n[t].loaded=!0,n.done(t)},document.body.appendChild(e))},done:function(e){var n,o;"youtube"===e&&delete window.onYouTubeIframeAPIReady,(n=t.fancybox.getInstance())&&(o=n.current.$content.find("iframe"),"youtube"===e&&void 0!==YT&&YT?new YT.Player(o.attr("id"),{events:{onStateChange:function(t){0==t.data&&n.next()}}}):"vimeo"===e&&void 0!==Vimeo&&Vimeo&&new Vimeo.Player(o).on("ended",(function(){n.next()})))}};t(document).on({"afterShow.fb":function(t,e,n){e.group.length>1&&("youtube"===n.contentSource||"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)},a=t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)},i=function(e){var n=[];for(var o in e=(e=e.originalEvent||e||t.e).touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e])e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,a=o.length;e<a;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){for(var n,o,a,i,s,r=!1;n=e.get(0),o=void 0,a=void 0,i=void 0,s=void 0,o=t.getComputedStyle(n)["overflow-y"],a=t.getComputedStyle(n)["overflow-x"],i=("scroll"===o||"auto"===o)&&n.scrollHeight>n.clientHeight,s=("scroll"===a||"auto"===a)&&n.scrollWidth>n.clientWidth,!(r=i||s)&&(e=e.parent()).length&&!e.hasClass("fancybox-stage")&&!e.is("body"););return r},l=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};l.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(a(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},l.prototype.ontouchstart=function(o){var a=this,l=n(o.target),d=a.instance,u=d.current,p=u.$slide,f=u.$content,h="touchstart"==o.type;if(h&&a.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&p.length&&l.length&&!r(l)&&!r(l.parent())&&(l.is("img")||!(o.originalEvent.clientX>l[0].clientWidth+l.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();a.realPoints=a.startPoints=i(o),a.startPoints.length&&(u.touch&&o.stopPropagation(),a.startEvent=o,a.canTap=!0,a.$target=l,a.$content=f,a.opts=u.opts.touch,a.isPanning=!1,a.isSwiping=!1,a.isZooming=!1,a.isScrolling=!1,a.canPan=d.canPan(),a.startTime=(new Date).getTime(),a.distanceX=a.distanceY=a.distance=0,a.canvasWidth=Math.round(p[0].clientWidth),a.canvasHeight=Math.round(p[0].clientHeight),a.contentLastPos=null,a.contentStartPos=n.fancybox.getTranslate(a.$content)||{top:0,left:0},a.sliderStartPos=n.fancybox.getTranslate(p),a.stagePos=n.fancybox.getTranslate(d.$refs.stage),a.sliderStartPos.top-=a.stagePos.top,a.sliderStartPos.left-=a.stagePos.left,a.contentStartPos.top-=a.stagePos.top,a.contentStartPos.left-=a.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(a,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(a,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",a.onscroll,!0),((a.opts||a.canPan)&&(l.is(a.$stage)||a.$stage.find(l).length)||(l.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&l.parents(".fancybox-caption").length))&&(a.isScrollable=c(l)||c(l.parent()),n.fancybox.isMobile&&a.isScrollable||o.preventDefault(),(1===a.startPoints.length||u.hasError)&&(a.canPan?(n.fancybox.stop(a.$content),a.isPanning=!0):a.isSwiping=!0,a.$container.addClass("fancybox-is-grabbing")),2===a.startPoints.length&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(a.canTap=!1,a.isSwiping=!1,a.isPanning=!1,a.isZooming=!0,n.fancybox.stop(a.$content),a.centerPointStartX=.5*(a.startPoints[0].x+a.startPoints[1].x)-n(t).scrollLeft(),a.centerPointStartY=.5*(a.startPoints[0].y+a.startPoints[1].y)-n(t).scrollTop(),a.percentageOfImageAtPinchPointX=(a.centerPointStartX-a.contentStartPos.left)/a.contentStartPos.width,a.percentageOfImageAtPinchPointY=(a.centerPointStartY-a.contentStartPos.top)/a.contentStartPos.height,a.startDistanceBetweenFingers=s(a.startPoints[0],a.startPoints[1]))))}},l.prototype.onscroll=function(t){this.isScrolling=!0,e.removeEventListener("scroll",this.onscroll,!0)},l.prototype.ontouchmove=function(t){var e=this;void 0===t.originalEvent.buttons||0!==t.originalEvent.buttons?e.isScrolling?e.canTap=!1:(e.newPoints=i(t),(e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))):e.ontouchend(t)},l.prototype.onSwipe=function(e){var i,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(a(s.requestId),s.requestId=null),s.requestId=o((function(){s.sliderLastPos&&(n.each(s.instance.slides,(function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})})),s.$container.addClass("fancybox-is-sliding"))}));else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging||!1===s.opts.vertical||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(i=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=i>45&&i<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,(function(t,e){var o,a;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),a=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass((function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")})),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-a.top,s.sliderStartPos.left=o.left-a.left),n.fancybox.setTranslate(e.$slide,{top:o.top-a.top,left:o.left-a.left})})),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},l.prototype.onPan=function(){var t=this;s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5)?t.startPoints=t.newPoints:(t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&a(t.requestId),t.requestId=o((function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})))},l.prototype.limitMovement=function(){var t,e,n,o,a,i,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,p=u.left,f=u.top,h=u.width,g=u.height;return a=h>r?p+l:p,i=f+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&a>t&&(a=t-1+Math.pow(-t+p+l,.8)||0),l<0&&a<n&&(a=n+1-Math.pow(n-p-l,.8)||0),d>0&&i>e&&(i=e-1+Math.pow(-e+f+d,.8)||0),d<0&&i<o&&(i=o+1-Math.pow(o-f-d,.8)||0),{top:i,left:a}},l.prototype.limitPosition=function(t,e,n,o){var a=this.canvasWidth,i=this.canvasHeight;return t=n>a?(t=t>0?0:t)<a-n?a-n:t:Math.max(0,a/2-n/2),{top:e=o>i?(e=e>0?0:e)<i-o?i-o:e:Math.max(0,i/2-o/2),left:t}},l.prototype.onZoom=function(){var e=this,i=e.contentStartPos,r=i.width,c=i.height,l=i.left,d=i.top,u=s(e.newPoints[0],e.newPoints[1])/e.startDistanceBetweenFingers,p=Math.floor(r*u),f=Math.floor(c*u),h=(r-p)*e.percentageOfImageAtPinchPointX,g=(c-f)*e.percentageOfImageAtPinchPointY,b=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),m=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=b-e.centerPointStartX,v={top:d+(g+(m-e.centerPointStartY)),left:l+(h+y),scaleX:u,scaleY:u};e.canTap=!1,e.newWidth=p,e.newHeight=f,e.contentLastPos=v,e.requestId&&a(e.requestId),e.requestId=o((function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)}))},l.prototype.ontouchend=function(t){var o=this,s=o.isSwiping,r=o.isPanning,c=o.isZooming,l=o.isScrolling;if(o.endPoints=i(t),o.dMs=Math.max((new Date).getTime()-o.startTime,1),o.$container.removeClass("fancybox-is-grabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(a(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap)return o.onTap(t);o.speed=100,o.velocityX=o.distanceX/o.dMs*.5,o.velocityY=o.distanceY/o.dMs*.5,r?o.endPanning():c?o.endZooming():o.endSwiping(s,l)},l.prototype.endSwiping=function(t,e){var o=this,a=!1,i=o.instance.group.length,s=Math.abs(o.distanceX),r="x"==t&&i>1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),a=o.instance.close(!0,250)):r&&o.distanceX>0?a=o.instance.previous(300):r&&o.distanceX<0&&(a=o.instance.next(300)),!1!==a||"x"!=t&&"y"!=t||o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},l.prototype.endPanning=function(){var t,e,o,a=this;a.contentLastPos&&(!1===a.opts.momentum||a.dMs>350?(t=a.contentLastPos.left,e=a.contentLastPos.top):(t=a.contentLastPos.left+500*a.velocityX,e=a.contentLastPos.top+500*a.velocityY),(o=a.limitPosition(t,e,a.contentStartPos.width,a.contentStartPos.height)).width=a.contentStartPos.width,o.height=a.contentStartPos.height,n.fancybox.animate(a.$content,o,366))},l.prototype.endZooming=function(){var t,e,o,a,i=this,s=i.instance.current,r=i.newWidth,c=i.newHeight;i.contentLastPos&&(t=i.contentLastPos.left,a={top:e=i.contentLastPos.top,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(i.$content,a),r<i.canvasWidth&&c<i.canvasHeight?i.instance.scaleToFit(150):r>s.width||c>s.height?i.instance.scaleToActual(i.centerPointStartX,i.centerPointStartY,150):(o=i.limitPosition(t,e,r,c),n.fancybox.animate(i.$content,o,150)))},l.prototype.onTap=function(e){var o,a=this,s=n(e.target),r=a.instance,c=r.current,l=e&&i(e)||a.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-a.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-a.stagePos.top:0,p=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(a.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(a.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(a.startEvent));break}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is("img")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(a.tapped){if(clearTimeout(a.tapped),a.tapped=null,Math.abs(d-a.tapX)>50||Math.abs(u-a.tapY)>50)return this;p("dblclick"+o)}else a.tapX=d,a.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?a.tapped=setTimeout((function(){a.tapped=null,r.isAnimating||p("click"+o)}),500):p("click"+o);return this}},n(e).on("onActivate.fb",(function(t,e){e&&!e.Guestures&&(e.Guestures=new l(e))})).on("beforeClose.fb",(function(t,e){e&&e.Guestures&&e.Guestures.destroy()}))}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg></button>'},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",(function(){t.toggle()})),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('<div class="fancybox-progress"></div>').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,a=o.current;a&&(!0===t||a.opts.loop||o.currIndex<o.group.length-1)?n.isActive&&"video"!==a.contentType&&(n.$progress&&e.fancybox.animate(n.$progress.show(),{scaleX:1},a.opts.slideShow.speed),n.timer=setTimeout((function(){o.current.opts.loop||o.current.index!=o.group.length-1?o.next():o.jumpTo(0)}),a.opts.slideShow.speed)):(n.stop(),o.idleSecondsCounter=0,o.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null,t.$progress&&t.$progress.removeAttr("style").hide()},start:function(){var t=this,e=t.instance.current;e&&(t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.isActive=!0,e.isComplete&&t.set(!0),t.instance.trigger("onSlideShowChange",!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1,t.instance.trigger("onSlideShowChange",!1),t.$progress&&t.$progress.removeAttr("style").hide()},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var a=e&&e.SlideShow;o?a&&n.opts.slideShow.autoStart&&a.start():a&&a.isActive&&a.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,a,i,s){var r=o&&o.SlideShow;!r||!a.opts.slideShow||80!==s&&32!==s||e(t.activeElement).is("button,a,input")||(i.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",(function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())}))}(document,jQuery),function(t,e){"use strict";var n=function(){for(var e=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],n={},o=0;o<e.length;o++){var a=e[o];if(a&&a[1]in t){for(var i=0;i<a.length;i++)n[e[0][i]]=a[i];return n}}return!1}();if(n){var o={request:function(e){(e=e||t.documentElement)[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e||t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,(function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))}))}e(t).on({"onInit.fb":function(t,e){n?e&&e.group[e.currIndex].opts.fullScreen?(e.$refs.container.on("click.fb-fullscreen","[data-fancybox-fullscreen]",(function(t){t.stopPropagation(),t.preventDefault(),o.toggle()})),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide():e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove()},"afterKeydown.fb":function(t,e,n,o,a){e&&e.FullScreen&&70===a&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs",o=n+"-active";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var a=function(t){this.init(t)};e.extend(a.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var a=0,i=n.length;a<i&&(n[a].thumb&&o++,!(o>1));a++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",(function(){e.toggle()})),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,a=o.instance,i=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('<div class="'+n+" "+n+"-"+o.opts.axis+'"></div>').appendTo(a.$refs.container.find(i).addBack().filter(i)),o.$grid.on("click","a",(function(){a.jumpTo(e(this).attr("data-index"))}))),o.$list||(o.$list=e('<div class="'+n+'__list">').appendTo(o.$grid)),e.each(a.group,(function(e,n){(t=n.thumb)||"image"!==n.type||(t=n.src),s.push('<a href="javascript:;" tabindex="0" data-index="'+e+'"'+(t&&t.length?' style="background-image:url('+t+')"':'class="fancybox-thumbs-missing"')+"></a>")})),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+a.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,a=this,i=a.$list,s=a.$grid;a.instance.current&&(n=(e=i.children().removeClass(o).filter('[data-index="'+a.instance.current.index+'"]').addClass(o)).position(),"y"===a.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===a.opts.axis&&(n.left<s.scrollLeft()||n.left>s.scrollLeft()+(s.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new a(e)).isActive&&!0===n.opts.autoStart&&n.show()},"beforeShow.fb":function(t,e,n,o){var a=e&&e.Thumbs;a&&a.isVisible&&a.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,a){var i=e&&e.Thumbs;i&&i.isActive&&71===a&&(o.preventDefault(),i.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg></button>'},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc||e.src)||window.location},tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p></div>'}}),e(t).on("click","[data-fancybox-share]",(function(){var t,n,o,a,i=e.fancybox.getInstance(),s=i.current||null;s&&("function"===e.type(s.opts.share.url)&&(t=s.opts.share.url.apply(s,[i,s])),n=s.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===s.type?encodeURIComponent(s.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,(o=t,a={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="},String(o).replace(/[&<>"'`=\/]/g,(function(t){return a[t]})))).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,n),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one("beforeClose.fb",(function(){t.close(null,0)})),e.$content.find(".fancybox-share__button").click((function(){return window.open(this.href,"Share","width=550, height=450"),!1}))},mobile:{autoFocus:!1}}}))}))}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])&&parseInt(n.pop(-1),10)||1;return{hash:e,index:o<1?1:o,gallery:n.join("-")}}function a(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function i(t){var e,n;return!!t&&(""!==(n=(e=t.current?t.current.opts:t.opts).hash||(e.$orig?e.$orig.data("fancybox")||e.$orig.data("fancybox-trigger"):""))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+"").replace(/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,(function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t}))}),n((function(){!1!==n.fancybox.defaults.hash&&(n(e).on({"onInit.fb":function(t,e){var n,a;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(a=i(e))&&n.gallery&&a==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,a,s){var r;a&&!1!==a.opts.hash&&(r=i(o))&&(o.currentHash=r+(o.group.length>1?"-"+(a.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout((function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null}),300)))},"beforeClose.fb":function(n,o,a){a&&!1!==a.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",(function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),(function(t,o){var a=n(o).data("FancyBox");if(a&&a.currentHash)return e=a,!1})),e?e.currentHash===t.gallery+"-"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):""!==t.gallery&&a(t)})),setTimeout((function(){n.fancybox.getInstance()||a(o())}),50))}))}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",(function(t){var o=e.current,a=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,a-n<250||(n=a,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))}))}})}(document,jQuery);
|
inc/class-easyfancybox-admin.php
CHANGED
@@ -2,34 +2,166 @@
|
|
2 |
/**
|
3 |
* Easy FancyBox Admin Class.
|
4 |
*/
|
5 |
-
class easyFancyBox_Admin
|
6 |
|
7 |
-
|
|
|
|
|
|
|
8 |
|
9 |
-
|
10 |
|
11 |
-
|
12 |
|
13 |
/**
|
14 |
* ADMIN METHODS
|
15 |
*/
|
16 |
|
17 |
-
public static function
|
18 |
{
|
19 |
-
add_settings_section('fancybox_section', __('FancyBox','easy-fancybox'),
|
20 |
}
|
21 |
|
22 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
23 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
24 |
if ( empty( $args ) ) {
|
25 |
-
$args =
|
26 |
}
|
27 |
|
28 |
foreach ( $args as $key => $value ) {
|
29 |
// Check to see if the section is enabled, else skip to next.
|
30 |
if ( ! isset( $value['input'] ) ||
|
31 |
-
array_key_exists($key,
|
32 |
-
!get_option(
|
33 |
) {
|
34 |
continue;
|
35 |
}
|
@@ -37,7 +169,7 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
37 |
switch( $value['input'] ) {
|
38 |
case 'deep':
|
39 |
// Go deeper by looping back on itself.
|
40 |
-
self::
|
41 |
break;
|
42 |
|
43 |
case 'multiple':
|
@@ -49,6 +181,7 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
49 |
$sanitize_callback = array( __CLASS__, $_value['sanitize_callback'] );
|
50 |
if ( isset($_value['id']) )
|
51 |
register_setting( 'media', $_value['id'], $sanitize_callback );
|
|
|
52 |
}
|
53 |
break;
|
54 |
|
@@ -63,35 +196,6 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
63 |
}
|
64 |
}
|
65 |
|
66 |
-
// Add our FancyBox Media Settings Section on Settings > Media admin page.
|
67 |
-
public static function settings_section()
|
68 |
-
{
|
69 |
-
echo '<style type="text/css">.options-media-php br { display: initial; }</style><!-- undo WP style rule introduced in 4.9 on settings-media -->
|
70 |
-
<p><a href="https://www.paypal.com/cgi-bin/webscr?cmd=_donations&business=ravanhagen%40gmail%2ecom&item_name=Easy%20FancyBox&item_number='.EASY_FANCYBOX_VERSION.'&no_shipping=0&tax=0&charset=UTF%2d8¤cy_code=EUR" title="'.__('Donate to keep the Easy FancyBox plugin development going!','easy-fancybox').'">
|
71 |
-
<img src="https://www.paypalobjects.com/en_US/i/btn/btn_donate_LG.gif" style="border:none;float:right;margin:5px 0 0 10px" alt="'.__('Donate to keep the Easy FancyBox plugin development going!','easy-fancybox').'" width="92" height="26" /></a>';
|
72 |
-
echo sprintf( __( 'The options in this section are provided by the plugin %s and determine the <strong>Media Lightbox</strong> overlay appearance and behavior controlled by %s.', 'easy-fancybox' ), '<strong><a href="http://status301.net/wordpress-plugins/easy-fancybox/">' . __( 'Easy FancyBox', 'easy-fancybox' ) . '</a></strong>', '<strong><a href="http://fancybox.net/">' . __( 'FancyBox', 'easy-fancybox' ) . '</a></strong>' );
|
73 |
-
echo '</p><p>'.__( 'First enable each sub-section that you need. Then save and come back to adjust its specific settings.', 'easy-fancybox' ) . ' ' . __( 'Note: Each additional sub-section and features like <em>Auto-detection</em>, <em>Elastic transitions</em> and all <em>Easing effects</em> (except Swing) will have some extra impact on client-side page speed. Enable only those sub-sections and options that you actually need on your site.', 'easy-fancybox' ) . ' ' . __( 'Some setting like Transition options are unavailable for SWF video, PDF and iFrame content to ensure browser compatibility and readability.', 'easy-fancybox' ) . '</p>';
|
74 |
-
|
75 |
-
// Pro extension message.
|
76 |
-
if ( ! class_exists('easyFancyBox_Advanced') ) {
|
77 |
-
echo '<p><a href="'.easyFancyBox::$pro_plugin_url.'"><strong><em>' . __( 'For advanced options and support, please get the Easy FancyBox - Pro extension.', 'easy-fancybox' ) . '</strong></a></p>';
|
78 |
-
} else {
|
79 |
-
echo '<p><strong><em>' . __( 'Thank you for purchasing the Easy FancyBox - Pro extension. Your advanced options are available!', 'easy-fancybox' ) . ' <a href="https://premium.status301.com/support/forum/easy-fancybox-pro/">' . __( 'Get support here.', 'easy-fancybox' ) . '</a></em></strong></p>';
|
80 |
-
}
|
81 |
-
|
82 |
-
// Pro extension version compatibility message.
|
83 |
-
if ( self::$do_compat_warning ) {
|
84 |
-
echo '<p class="update-nag">';
|
85 |
-
_e( 'Notice: The current Easy FancyBox plugin version is not fully compatible with your version of the Pro extension. Some advanced options may not be functional.', 'easy-fancybox' );
|
86 |
-
echo ' ';
|
87 |
-
if ( current_user_can( 'install_plugins' ) )
|
88 |
-
printf( __( 'Please <a href="%1$s" target="_blank">download and install the latest Pro version</a>.', 'easy-fancybox' ), 'https://premium.status301.com/account/' );
|
89 |
-
else
|
90 |
-
_e( 'Please contact your web site administrator.', 'easy-fancybox' );
|
91 |
-
echo '</p>';
|
92 |
-
}
|
93 |
-
}
|
94 |
-
|
95 |
// Add our FancyBox Media Settings Fields.
|
96 |
public static function settings_fields( $args )
|
97 |
{
|
@@ -187,7 +291,6 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
187 |
if ( isset( $args['description'] ) ) {
|
188 |
$output[] = $args['description'];
|
189 |
}
|
190 |
-
|
191 |
}
|
192 |
|
193 |
else :
|
@@ -206,8 +309,10 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
206 |
*/
|
207 |
public static function add_action_link( $links )
|
208 |
{
|
209 |
-
$
|
210 |
-
|
|
|
|
|
211 |
return $links;
|
212 |
}
|
213 |
|
@@ -216,7 +321,7 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
216 |
*/
|
217 |
public static function plugin_meta_links( $links, $file )
|
218 |
{
|
219 |
-
if ( $file ==
|
220 |
$links[] = '<a target="_blank" href="https://wordpress.org/support/plugin/easy-fancybox/">' . __('Support','easy-fancybox') . '</a>';
|
221 |
$links[] = '<a target="_blank" href="https://wordpress.org/support/plugin/easy-fancybox/reviews/?filter=5#new-post">' . __('Rate ★★★★★','easy-fancybox') . '</a>';
|
222 |
}
|
@@ -245,11 +350,33 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
245 |
}
|
246 |
|
247 |
public static function colorval( $setting = '' ) {
|
248 |
-
|
249 |
-
$
|
250 |
|
251 |
-
//
|
252 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
253 |
|
254 |
return $sanitized;
|
255 |
}
|
@@ -283,32 +410,29 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
283 |
{
|
284 |
global $current_user;
|
285 |
|
|
|
|
|
|
|
|
|
286 |
/* Version Nag */
|
287 |
-
if ( self::$do_compat_warning
|
288 |
-
|
289 |
-
//echo '<a href="?easy_fancybox_ignore_notice=1" title="' . __('Hide message','easy-fancybox') . '" style="display:block;float:right">X</a>';
|
290 |
-
_e('Notice: The current Easy FancyBox plugin version is not fully compatible with your version of the Pro extension. Some advanced options may not be functional.','easy-fancybox');
|
291 |
-
echo '<br />';
|
292 |
-
printf(__('Please <a href="%1$s" target="_blank">download and install the latest Pro version</a>.','easy-fancybox'), 'https://premium.status301.com/account/');
|
293 |
-
echo ' ';
|
294 |
-
printf(__('Or you can ignore and <a href="%1$s">hide this message</a>.','easy-fancybox'), '?easy_fancybox_ignore_notice=1');
|
295 |
-
echo '</p></div>';
|
296 |
}
|
297 |
}
|
298 |
|
299 |
public static function load_textdomain()
|
300 |
{
|
301 |
-
load_plugin_textdomain('easy-fancybox', false, dirname(
|
302 |
}
|
303 |
|
304 |
-
public static function
|
305 |
{
|
306 |
/* Dismissable notice */
|
307 |
/* If user clicks to ignore the notice, add that to their user meta */
|
308 |
global $current_user;
|
309 |
|
310 |
if ( isset( $_GET['easy_fancybox_ignore_notice'] ) && '1' == $_GET['easy_fancybox_ignore_notice'] ) {
|
311 |
-
add_user_meta($current_user->ID, 'easy_fancybox_ignore_notice', 'true', true);
|
312 |
}
|
313 |
|
314 |
if (
|
@@ -326,15 +450,21 @@ class easyFancyBox_Admin extends easyFancyBox {
|
|
326 |
|
327 |
public function __construct()
|
328 |
{
|
329 |
-
|
330 |
-
add_action('
|
331 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
332 |
|
333 |
-
//
|
334 |
-
//add_action('
|
|
|
335 |
|
336 |
-
add_action('admin_init', array(__CLASS__, '
|
337 |
-
add_action('admin_init', array(__CLASS__, '
|
338 |
-
add_action('admin_init', array(__CLASS__, 'admin_init'));
|
339 |
}
|
340 |
}
|
2 |
/**
|
3 |
* Easy FancyBox Admin Class.
|
4 |
*/
|
5 |
+
class easyFancyBox_Admin {
|
6 |
|
7 |
+
/**
|
8 |
+
* Holds the values to be used in the fields callbacks
|
9 |
+
*/
|
10 |
+
private static $screen_id;
|
11 |
|
12 |
+
private static $compat_pro_min = '1.8';
|
13 |
|
14 |
+
private static $do_compat_warning = false;
|
15 |
|
16 |
/**
|
17 |
* ADMIN METHODS
|
18 |
*/
|
19 |
|
20 |
+
public static function add_media_settings_section()
|
21 |
{
|
22 |
+
add_settings_section( 'fancybox_section', '<a name="fancybox"></a>'.__( 'FancyBox', 'easy-fancybox' ), function() { include EASY_FANCYBOX_DIR . '/views/settings-section-intro.php'; }, 'media' );
|
23 |
}
|
24 |
|
25 |
+
/**
|
26 |
+
* Add options page
|
27 |
+
*/
|
28 |
+
public static function add_options_page()
|
29 |
+
{
|
30 |
+
// This page will be under "Settings".
|
31 |
+
$screen_id = add_options_page (
|
32 |
+
__( 'FancyBox', 'easy-fancybox' ),
|
33 |
+
__( 'FancyBox', 'easy-fancybox' ),
|
34 |
+
'manage_options',
|
35 |
+
'easy_fancybox',
|
36 |
+
array( __CLASS__, 'options_page' ),
|
37 |
+
5
|
38 |
+
);
|
39 |
+
|
40 |
+
// Help tab.
|
41 |
+
add_action(
|
42 |
+
'load-'.$screen_id,
|
43 |
+
array( __CLASS__, 'help_tab' )
|
44 |
+
);
|
45 |
+
}
|
46 |
+
|
47 |
+
public static function help_tab()
|
48 |
+
{
|
49 |
+
// TODO
|
50 |
+
}
|
51 |
+
|
52 |
+
public static function options_page()
|
53 |
{
|
54 |
+
// Prepare sections and settings and nav tabs.
|
55 |
+
self::add_settings();
|
56 |
+
|
57 |
+
// Prepare nav tabs.
|
58 |
+
$active_tab = isset( $_GET[ 'tab' ] ) ? $_GET[ 'tab' ] : 'general';
|
59 |
+
$tabs = array (
|
60 |
+
'general' => translate( 'General' ),
|
61 |
+
//'appearance' => translate( 'Appearance' ),
|
62 |
+
//'behavior' => esc_html__( 'Behavior', 'easy-fancybox' ),
|
63 |
+
'images' => get_option( 'fancybox_enableImg' ) ? esc_html__( 'Images', 'easy-fancybox' ) : false,
|
64 |
+
'inline' => get_option( 'fancybox_enableInline' ) ? esc_html__( 'Inline', 'easy-fancybox' ) : false,
|
65 |
+
'pdf' => get_option( 'fancybox_enablePDF' ) ? esc_html__( 'PDF', 'easy-fancybox' ) : false,
|
66 |
+
'swf' => get_option( 'fancybox_enableSWF' ) ? esc_html__( 'SWF', 'easy-fancybox' ) : false,
|
67 |
+
/*'video' => get_option( 'fancybox_enableVideoPress' ) ||
|
68 |
+
get_option( 'fancybox_enableYoutube' ) || get_option( 'fancybox_enableVimeo' ) ||
|
69 |
+
get_option( 'fancybox_enableDailymotion' ) ? esc_html__( 'Video', 'easy-fancybox' ) : false,*/
|
70 |
+
'videopress' => get_option( 'fancybox_enableVideoPress' ) ? esc_html__( 'VideoPress', 'easy-fancybox' ) : false,
|
71 |
+
'youtube' => get_option( 'fancybox_enableYoutube' ) ? esc_html__( 'YouTube', 'easy-fancybox' ) : false,
|
72 |
+
'vimeo' => get_option( 'fancybox_enableVimeo' ) ? esc_html__( 'Vimeo', 'easy-fancybox' ) : false,
|
73 |
+
'dailymotion' => get_option( 'fancybox_enableDailymotion' ) ? esc_html__( 'Dailymotion', 'easy-fancybox' ) : false,
|
74 |
+
'instagram' => get_option( 'fancybox_enableInstagram' ) ? esc_html__( 'Instagram', 'easy-fancybox' ) : false,
|
75 |
+
'googlemaps' => get_option( 'fancybox_enableGoogleMaps' ) ? esc_html__( 'Google Maps', 'easy-fancybox' ) : false,
|
76 |
+
'iframe' => get_option( 'fancybox_enableiFrame' ) ? esc_html__( 'iFrames', 'easy-fancybox' ) : false,
|
77 |
+
//'advanced' => esc_html__( 'Advanced', 'easy-fancybox' ),
|
78 |
+
);
|
79 |
+
|
80 |
+
// Render page.
|
81 |
+
include EASY_FANCYBOX_DIR . '/views/admin-page.php';
|
82 |
+
}
|
83 |
+
|
84 |
+
public static function add_settings()
|
85 |
+
{
|
86 |
+
/** SECTIONS */
|
87 |
+
add_settings_section( 'easy_fancybox_general_section', null, null, 'easy_fancybox_general' );
|
88 |
+
//add_settings_section( 'easy_fancybox_appearance_section', null, null, 'easy_fancybox_appearance' );
|
89 |
+
//add_settings_section( 'easy_fancybox_behavior_section', null, null, 'easy_fancybox_behavior' );
|
90 |
+
|
91 |
+
// Media sections.
|
92 |
+
add_settings_section( 'easy_fancybox_images_section', null, null, 'easy_fancybox_images' );
|
93 |
+
add_settings_section( 'easy_fancybox_inline_section', null, null, 'easy_fancybox_inline' );
|
94 |
+
add_settings_section( 'easy_fancybox_pdf_section', null, null, 'easy_fancybox_pdf' );
|
95 |
+
add_settings_section( 'easy_fancybox_swf_section', null, null, 'easy_fancybox_swf' );
|
96 |
+
add_settings_section( 'easy_fancybox_videopress_section', null, null, 'easy_fancybox_videopress' );
|
97 |
+
add_settings_section( 'easy_fancybox_youtube_section', null, null, 'easy_fancybox_youtube' );
|
98 |
+
add_settings_section( 'easy_fancybox_vimeo_section', null, null, 'easy_fancybox_vimeo' );
|
99 |
+
add_settings_section( 'easy_fancybox_dailymotion_section', null, null, 'easy_fancybox_dailymotion' );
|
100 |
+
add_settings_section( 'easy_fancybox_instagram_section', null, null, 'easy_fancybox_instagram' );
|
101 |
+
add_settings_section( 'easy_fancybox_googlemaps_section', null, null, 'easy_fancybox_googlemaps' );
|
102 |
+
add_settings_section( 'easy_fancybox_iframe_section', null, null, 'easy_fancybox_iframe' );
|
103 |
+
|
104 |
+
/** GENERAL */
|
105 |
+
add_settings_field( 'fancybox_version', esc_html__( 'Version', 'easy-fancybox' ), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-version.php'; }, 'easy_fancybox_general', 'easy_fancybox_general_section', array('label_for'=>'fancybox_scriptVersion') );
|
106 |
+
add_settings_field( 'fancybox_media', esc_html__( 'Media', 'easy-fancybox' ), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-media.php'; }, 'easy_fancybox_general', 'easy_fancybox_general_section' );
|
107 |
+
|
108 |
+
/** IMAGES */
|
109 |
+
if ( get_option('fancybox_enableImg') ) {
|
110 |
+
add_settings_field( 'fancybox_auto', esc_html__( 'Autodetect', 'easy-fancybox' ), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-images-auto.php'; }, 'easy_fancybox_images', 'easy_fancybox_images_section', array('label_for'=>'fancybox_autoAttribute') );
|
111 |
+
//add_settings_field( 'fancybox_autolimit', esc_html__( 'Autodetect', 'easy-fancybox' ), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-images-auto-limit.php'; }, 'easy_fancybox_images', 'easy_fancybox_images_section', array('label_for'=>'fancybox_autoAttributeLimit') );
|
112 |
+
|
113 |
+
}
|
114 |
+
}
|
115 |
+
|
116 |
+
public static function register_settings()
|
117 |
+
{
|
118 |
+
// Version.
|
119 |
+
register_setting( 'easy_fancybox_general', 'fancybox_scriptVersion', array( 'default' => 'classic', 'sanitize_callback' => 'sanitize_text_field' ) );
|
120 |
+
// Media.
|
121 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableImg', array( 'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network( EASY_FANCYBOX_BASENAME ) ) ? '' : '1', 'sanitize_callback' => 'boolval' ) );
|
122 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableInline', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
123 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enablePDF', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
124 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableSWF', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
125 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableVideoPress', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
126 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableYoutube', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
127 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableVimeo', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
128 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableDailymotion', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
129 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableInstagram', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
130 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableGoogleMaps', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
131 |
+
register_setting( 'easy_fancybox_general', 'fancybox_enableiFrame', array( 'default' => '', 'sanitize_callback' => 'boolval' ) );
|
132 |
+
|
133 |
+
// Images.
|
134 |
+
register_setting( 'easy_fancybox_images', 'fancybox_autoAttribute', array( 'default' => '.jpg,.png,.webp', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
135 |
+
register_setting( 'easy_fancybox_images', 'fancybox_autoAttributeLimit', array( 'default' => '', 'sanitize_callback' => 'sanitize_text_field' ) );
|
136 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
137 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
138 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
139 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
140 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
141 |
+
//register_setting( 'easy_fancybox_images', 'fancybox_', array( 'default' => '', 'sanitize_callback' => array( __CLASS__, 'csl_text' ) ) );
|
142 |
+
}
|
143 |
+
|
144 |
+
public static function register_media_settings( $args = array() )
|
145 |
+
{
|
146 |
+
/* if ( ! in_array( get_option( 'fancybox_scriptVersion', 'classic' ), array( 'classic', 'legacy' ) ) ) {
|
147 |
+
register_setting( 'media', 'easy_fancyboxEnabled', array( 'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network( EASY_FANCYBOX_BASENAME ) ) ? '' : '1', 'sanitize_callback' => 'int' ) );
|
148 |
+
add_settings_field( 'easy_fancyboxEnabled', esc_html__('FancyBox','easy-fancybox'), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-enable.php'; }, 'media', 'fancybox_section', array('label_for'=>'easy_fancyboxEnabled') );
|
149 |
+
return;
|
150 |
+
}*/
|
151 |
+
|
152 |
+
// Version.
|
153 |
+
add_settings_field( 'fancybox_scriptVersion', esc_html__('Version','easy-fancybox'), function(){ include EASY_FANCYBOX_DIR . '/views/settings-field-version.php'; }, 'media', 'fancybox_section', array('label_for'=>'fancybox_scriptVersion') );
|
154 |
+
register_setting( 'media', 'fancybox_scriptVersion', 'sanitize_text_field' );
|
155 |
+
|
156 |
if ( empty( $args ) ) {
|
157 |
+
$args = easyFancyBox::$options;
|
158 |
}
|
159 |
|
160 |
foreach ( $args as $key => $value ) {
|
161 |
// Check to see if the section is enabled, else skip to next.
|
162 |
if ( ! isset( $value['input'] ) ||
|
163 |
+
array_key_exists($key, easyFancyBox::$options['Global']['options']['Enable']['options']) &&
|
164 |
+
!get_option( easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'], easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['default'])
|
165 |
) {
|
166 |
continue;
|
167 |
}
|
169 |
switch( $value['input'] ) {
|
170 |
case 'deep':
|
171 |
// Go deeper by looping back on itself.
|
172 |
+
self::register_media_settings($value['options']);
|
173 |
break;
|
174 |
|
175 |
case 'multiple':
|
181 |
$sanitize_callback = array( __CLASS__, $_value['sanitize_callback'] );
|
182 |
if ( isset($_value['id']) )
|
183 |
register_setting( 'media', $_value['id'], $sanitize_callback );
|
184 |
+
//register_setting( 'media', $_value['id'], isset($_value['sanitize_callback']) ? array( __CLASS__, $_value['sanitize_callback'] ) : '' );
|
185 |
}
|
186 |
break;
|
187 |
|
196 |
}
|
197 |
}
|
198 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
199 |
// Add our FancyBox Media Settings Fields.
|
200 |
public static function settings_fields( $args )
|
201 |
{
|
291 |
if ( isset( $args['description'] ) ) {
|
292 |
$output[] = $args['description'];
|
293 |
}
|
|
|
294 |
}
|
295 |
|
296 |
else :
|
309 |
*/
|
310 |
public static function add_action_link( $links )
|
311 |
{
|
312 |
+
$url = admin_url( 'options-media.php#fancybox' );
|
313 |
+
|
314 |
+
array_unshift( $links, '<a href="' . $url . '">' . translate( 'Settings' ) . '</a>' );
|
315 |
+
|
316 |
return $links;
|
317 |
}
|
318 |
|
321 |
*/
|
322 |
public static function plugin_meta_links( $links, $file )
|
323 |
{
|
324 |
+
if ( $file == EASY_FANCYBOX_BASENAME ) {
|
325 |
$links[] = '<a target="_blank" href="https://wordpress.org/support/plugin/easy-fancybox/">' . __('Support','easy-fancybox') . '</a>';
|
326 |
$links[] = '<a target="_blank" href="https://wordpress.org/support/plugin/easy-fancybox/reviews/?filter=5#new-post">' . __('Rate ★★★★★','easy-fancybox') . '</a>';
|
327 |
}
|
350 |
}
|
351 |
|
352 |
public static function colorval( $setting = '' ) {
|
353 |
+
$setting = trim( $setting );
|
354 |
+
$sanitized = '';
|
355 |
|
356 |
+
// Is it a hex value?
|
357 |
+
if ( substr( $setting, 0, 1 ) == '#' ) {
|
358 |
+
// Strip #.
|
359 |
+
$setting = substr( $setting, 1 );
|
360 |
+
|
361 |
+
// Only allow hex values or empty string.
|
362 |
+
$sanitized = ctype_xdigit( $setting ) ? '#'.$setting : '';
|
363 |
+
}
|
364 |
+
|
365 |
+
// Is it an rgb value?
|
366 |
+
if ( substr( $setting, 0, 3 ) == 'rgb' ) {
|
367 |
+
// Strip...
|
368 |
+
$setting = str_replace( array('rgb(','rgba(',')'), '', $setting );
|
369 |
+
|
370 |
+
$rgb_array = explode( ',', $setting );
|
371 |
+
|
372 |
+
if ( $rgb_array ) {
|
373 |
+
$r = isset( $rgb_array[0] ) ? (int) $rgb_array[0] : 119;
|
374 |
+
$g = isset( $rgb_array[1] ) ? (int) $rgb_array[1] : 119;
|
375 |
+
$b = isset( $rgb_array[2] ) ? (int) $rgb_array[2] : 119;
|
376 |
+
$a = isset( $rgb_array[3] ) ? (float) $rgb_array[3] : 0.7;
|
377 |
+
$sanitized = 'rgba('.$r.','.$g.','.$b.','.$a.')';
|
378 |
+
}
|
379 |
+
}
|
380 |
|
381 |
return $sanitized;
|
382 |
}
|
410 |
{
|
411 |
global $current_user;
|
412 |
|
413 |
+
if ( get_user_meta( $current_user->ID, 'easy_fancybox_ignore_notice' ) || ! current_user_can( 'install_plugins' ) ) {
|
414 |
+
return;
|
415 |
+
}
|
416 |
+
|
417 |
/* Version Nag */
|
418 |
+
if ( self::$do_compat_warning ) {
|
419 |
+
include EASY_FANCYBOX_DIR . '/views/admin-notice.php';
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
420 |
}
|
421 |
}
|
422 |
|
423 |
public static function load_textdomain()
|
424 |
{
|
425 |
+
load_plugin_textdomain('easy-fancybox', false, dirname( EASY_FANCYBOX_BASENAME ) . '/languages' );
|
426 |
}
|
427 |
|
428 |
+
public static function compat_warning()
|
429 |
{
|
430 |
/* Dismissable notice */
|
431 |
/* If user clicks to ignore the notice, add that to their user meta */
|
432 |
global $current_user;
|
433 |
|
434 |
if ( isset( $_GET['easy_fancybox_ignore_notice'] ) && '1' == $_GET['easy_fancybox_ignore_notice'] ) {
|
435 |
+
add_user_meta( $current_user->ID, 'easy_fancybox_ignore_notice', 'true', true );
|
436 |
}
|
437 |
|
438 |
if (
|
450 |
|
451 |
public function __construct()
|
452 |
{
|
453 |
+
// Text domain.
|
454 |
+
add_action( 'plugins_loaded', array(__CLASS__, 'load_textdomain') );
|
455 |
+
|
456 |
+
// Admin notices.
|
457 |
+
add_action( 'admin_init', array(__CLASS__, 'compat_warning') );
|
458 |
+
add_action( 'admin_notices', array(__CLASS__, 'admin_notice') );
|
459 |
+
|
460 |
+
// Plugin action links.
|
461 |
+
add_filter( 'plugin_action_links_'.EASY_FANCYBOX_BASENAME, array(__CLASS__, 'add_action_link') );
|
462 |
|
463 |
+
// Options page V2
|
464 |
+
//add_action( 'admin_init', array(__CLASS__, 'register_settings') );
|
465 |
+
//add_action( 'admin_menu', array(__CLASS__, 'add_options_page') );
|
466 |
|
467 |
+
add_action( 'admin_init', array(__CLASS__, 'register_media_settings') );
|
468 |
+
add_action( 'admin_init', array(__CLASS__, 'add_media_settings_section') );
|
|
|
469 |
}
|
470 |
}
|
inc/class-easyfancybox.php
CHANGED
@@ -5,23 +5,38 @@
|
|
5 |
|
6 |
class easyFancyBox {
|
7 |
|
8 |
-
|
|
|
|
|
9 |
|
10 |
public static $plugin_basename;
|
11 |
|
12 |
-
public static $
|
13 |
|
14 |
-
|
|
|
|
|
|
|
15 |
|
16 |
-
|
17 |
|
18 |
-
|
19 |
|
20 |
-
public static $
|
21 |
|
22 |
-
public static $
|
|
|
|
|
|
|
|
|
|
|
|
|
23 |
|
24 |
-
public static $
|
|
|
|
|
|
|
|
|
25 |
|
26 |
public static $options = array();
|
27 |
|
@@ -29,395 +44,130 @@ class easyFancyBox {
|
|
29 |
|
30 |
public static $pro_plugin_url = "https://premium.status301.com/downloads/easy-fancybox-pro/";
|
31 |
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
|
36 |
-
|
37 |
{
|
38 |
-
//
|
39 |
-
|
40 |
-
|
41 |
-
self::$add_scripts = true;
|
42 |
-
break;
|
43 |
-
}
|
44 |
}
|
45 |
|
46 |
-
|
47 |
-
|
48 |
-
|
49 |
-
|
50 |
-
|
51 |
-
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
57 |
-
|
58 |
-
|
59 |
-
if (
|
60 |
-
|
61 |
-
$parm = get_option($_value['id'], $_value['default']);
|
62 |
-
else
|
63 |
-
$parm = get_option($_value['id']);
|
64 |
-
elseif ( isset($_value['default']) )
|
65 |
-
$parm = $_value['default'];
|
66 |
-
else
|
67 |
-
$parm = '';
|
68 |
-
|
69 |
-
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
70 |
-
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
71 |
-
|
72 |
-
if( !isset($_value['hide']) && $parm!='' ) {
|
73 |
-
$quote = (is_numeric($parm) || (isset($_value['noquotes']) && $_value['noquotes'] == true) ) ? '' : '\'';
|
74 |
-
if ($more>0)
|
75 |
-
$script .= ',';
|
76 |
-
$script .= '\''.$_key.'\':';
|
77 |
-
$script .= $quote.$parm.$quote;
|
78 |
-
$more++;
|
79 |
-
} else {
|
80 |
-
${$_key} = $parm;
|
81 |
}
|
82 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
83 |
}
|
84 |
|
85 |
-
|
86 |
-
if(
|
87 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
88 |
|
89 |
-
|
90 |
-
|
91 |
-
|
92 |
-
|
93 |
-
$script .= '
|
94 |
-
jQuery(' . $exclude_selectors . '.join(\',\')).addClass(\'nofancybox\');';
|
95 |
}
|
96 |
|
97 |
-
|
98 |
-
|
99 |
-
|
100 |
-
|
101 |
-
// Check if not enabled or hide=true then skip.
|
102 |
-
if ( isset( $value['hide'] ) || ! isset( self::$options['Global']['options']['Enable']['options'][$key]['id'] ) || ! get_option( self::$options['Global']['options']['Enable']['options'][$key]['id'], self::$options['Global']['options']['Enable']['options'][$key]['default'] ) )
|
103 |
-
continue;
|
104 |
-
|
105 |
-
$script .= '
|
106 |
-
/* ' . $key . ' */';
|
107 |
|
108 |
-
|
109 |
-
|
110 |
-
|
111 |
-
|
112 |
|
113 |
-
|
114 |
-
|
115 |
-
|
116 |
-
|
|
|
117 |
} else {
|
118 |
-
//
|
119 |
-
|
120 |
-
$more = 0;
|
121 |
-
$script .= '
|
122 |
-
var fb_'.$key.'_select=\'';
|
123 |
-
foreach ( $file_types as $type ) {
|
124 |
-
if ($type == "jpg" || $type == "jpeg" || $type == "png" || $type == "webp" || $type == "gif")
|
125 |
-
$type = '.'.$type;
|
126 |
-
if ($more>0)
|
127 |
-
$script .= ',';
|
128 |
-
$script .= 'a['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox,li.nofancybox>a),area['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox)';
|
129 |
-
$more++;
|
130 |
-
}
|
131 |
-
$script .= '\';';
|
132 |
-
|
133 |
-
$autoselector = class_exists('easyFancyBox_Advanced') ? get_option($value['options']['autoSelector']['id'],$value['options']['autoSelector']['default']) : $value['options']['autoSelector']['default'];
|
134 |
-
|
135 |
-
// Class and rel depending on settings.
|
136 |
-
if( '1' == get_option($value['options']['autoAttributeLimit']['id'],$value['options']['autoAttributeLimit']['default']) ) {
|
137 |
-
// Add class.
|
138 |
-
$script .= '
|
139 |
-
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
140 |
-
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
141 |
-
// Set rel.
|
142 |
-
switch( get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
143 |
-
case '':
|
144 |
-
default :
|
145 |
-
$script .= ';});';
|
146 |
-
break;
|
147 |
-
|
148 |
-
case '1':
|
149 |
-
$script .= '.attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
150 |
-
break;
|
151 |
-
|
152 |
-
case '2':
|
153 |
-
$script .= '.attr(\'rel\',\'gallery\');});';
|
154 |
-
break;
|
155 |
-
}
|
156 |
-
} else {
|
157 |
-
// Add class.
|
158 |
-
$script .= '
|
159 |
-
jQuery(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
160 |
-
// Set rel.
|
161 |
-
switch( get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
162 |
-
case '':
|
163 |
-
default :
|
164 |
-
$script .= ';';
|
165 |
-
break;
|
166 |
-
|
167 |
-
case '1':
|
168 |
-
$script .= ';
|
169 |
-
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
170 |
-
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
171 |
-
break;
|
172 |
-
|
173 |
-
case '2':
|
174 |
-
$script .= '.attr(\'rel\',\'gallery\');';
|
175 |
-
break;
|
176 |
-
}
|
177 |
-
}
|
178 |
}
|
179 |
}
|
180 |
-
|
181 |
-
|
182 |
-
|
183 |
-
|
184 |
-
|
185 |
-
|
186 |
-
|
187 |
-
|
188 |
-
|
189 |
-
$script .= '
|
190 |
-
jQuery(\'' . $value['options']['tag']['default'] . '\')';
|
191 |
-
|
192 |
-
// Use each() to allow different metadata values per instance; fix by Elron. Thanks!
|
193 |
-
$script .= '.each(function(){';
|
194 |
-
|
195 |
-
// Filter here.
|
196 |
-
$bind = 'jQuery(this).fancybox(jQuery.extend({},fb_opts,{';
|
197 |
-
$more = 0;
|
198 |
-
foreach ( $value['options'] as $_key => $_value ) {
|
199 |
-
if ( isset($_value['id']) || isset($_value['default']) )
|
200 |
-
$parm = isset($_value['id']) ? strval( get_option($_value['id'], $_value['default']) ) : strval( $_value['default'] );
|
201 |
-
else
|
202 |
-
$parm = '';
|
203 |
-
|
204 |
-
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
205 |
-
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
206 |
-
|
207 |
-
if ( !isset($_value['hide']) && $parm!='' ) {
|
208 |
-
$quote = ( is_numeric($parm) || ( isset($_value['noquotes']) && $_value['noquotes'] == true ) ) ? '' : '\'';
|
209 |
-
if ( $more > 0 )
|
210 |
-
$bind .= ',';
|
211 |
-
$bind .= '\''.$_key.'\':';
|
212 |
-
$bind .= $quote.$parm.$quote;
|
213 |
-
$more++;
|
214 |
-
}
|
215 |
}
|
216 |
-
$bind .= '}))';
|
217 |
-
|
218 |
-
$script .= apply_filters( 'easy_fancybox_bind', $bind );
|
219 |
-
|
220 |
-
$script .= '});';
|
221 |
}
|
222 |
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
$script .= '
|
240 |
-
var easy_fancybox_auto=function(){setTimeout(function(){if(location.hash){jQuery(location.hash).trigger(\'click\');}},'.$delayClick.');};';
|
241 |
-
self::$onready_auto = true;
|
242 |
-
break;
|
243 |
-
|
244 |
-
case '99':
|
245 |
-
$script .= '
|
246 |
-
var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class|="fancybox"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
247 |
-
self::$onready_auto = true;
|
248 |
-
break;
|
249 |
-
|
250 |
-
default :
|
251 |
-
if ( !empty($trigger) ) {
|
252 |
-
$script .= '
|
253 |
-
var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class*="'.$trigger.'"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
254 |
-
self::$onready_auto = true;
|
255 |
}
|
256 |
-
}
|
257 |
-
|
258 |
-
$script .= PHP_EOL;
|
259 |
-
|
260 |
-
self::$inline_script = apply_filters( 'easy_fancybox_inline_script', $script );
|
261 |
-
|
262 |
-
/**
|
263 |
-
* HEADER STYLES
|
264 |
-
*/
|
265 |
-
|
266 |
-
// Customized styles.
|
267 |
-
$styles = '';
|
268 |
-
if ( isset($overlaySpotlight) && 'true' == $overlaySpotlight )
|
269 |
-
$styles .= '#fancybox-overlay{background-attachment:fixed;background-image:url("' . self::$plugin_url . 'images/light-mask.png");background-position:center;background-repeat:no-repeat;background-size:100% 100%}';
|
270 |
-
|
271 |
-
if ( !empty($borderRadius) )
|
272 |
-
$styles .= '#fancybox-outer,#fancybox-content{border-radius:'.$borderRadius.'px}.fancybox-title-inside{padding-top:'.$borderRadius.'px;margin-top:-'.$borderRadius.'px !important;border-radius: 0 0 '.$borderRadius.'px '.$borderRadius.'px}';
|
273 |
-
|
274 |
-
$content_style = '';
|
275 |
-
if ( !empty($backgroundColor) )
|
276 |
-
$content_style .= 'background:'.$backgroundColor.';';
|
277 |
-
|
278 |
-
if ( !empty($paddingColor) )
|
279 |
-
$content_style .= 'border-color:'.$paddingColor.';';
|
280 |
-
|
281 |
-
if ( !empty($textColor) ) {
|
282 |
-
$content_style .= 'color:'.$textColor.';';
|
283 |
-
$styles .= '#fancybox-outer{background:'.$paddingColor.'}'; //.fancybox-title-inside{background-color:'.$paddingColor.';margin-left:0 !important;margin-right:0 !important;width:100% !important;}
|
284 |
-
}
|
285 |
-
if ( !empty($content_style) )
|
286 |
-
$styles .= '#fancybox-content{'.$content_style.'}';
|
287 |
-
|
288 |
-
if ( !empty($titleColor) )
|
289 |
-
$styles .= '#fancybox-title,#fancybox-title-float-main{color:'.$titleColor.'}';
|
290 |
-
|
291 |
-
if ( !empty($styles) )
|
292 |
-
self::$inline_style = wp_strip_all_tags( $styles, true );
|
293 |
-
|
294 |
-
// Running our IE alphaimageloader relative path styles here.
|
295 |
-
if ( isset($compatIE8) && 'true' == $compatIE8 ) {
|
296 |
-
self::$inline_style_ie = '/* IE6 */
|
297 |
-
.fancybox-ie6 #fancybox-close{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_close.png",sizingMethod="scale")}
|
298 |
-
.fancybox-ie6 #fancybox-left-ico{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_nav_left.png",sizingMethod="scale")}
|
299 |
-
.fancybox-ie6 #fancybox-right-ico{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_nav_right.png",sizingMethod="scale")}
|
300 |
-
.fancybox-ie6 #fancybox-title-over{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_title_over.png",sizingMethod="scale");zoom:1}
|
301 |
-
.fancybox-ie6 #fancybox-title-float-left{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_title_left.png",sizingMethod="scale")}
|
302 |
-
.fancybox-ie6 #fancybox-title-float-main{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_title_main.png",sizingMethod="scale")}
|
303 |
-
.fancybox-ie6 #fancybox-title-float-right{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_title_right.png",sizingMethod="scale")}
|
304 |
-
#fancybox-loading.fancybox-ie6 div{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_loading.png",sizingMethod="scale")}
|
305 |
-
/* IE6, IE7, IE8 */
|
306 |
-
.fancybox-ie #fancybox-title-over{background-image:url('.self::$plugin_url.'images/fancy_title_over.png)}
|
307 |
-
.fancybox-ie #fancybox-bg-n{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_n.png",sizingMethod="scale")}
|
308 |
-
.fancybox-ie #fancybox-bg-ne{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_ne.png",sizingMethod="scale")}
|
309 |
-
.fancybox-ie #fancybox-bg-e{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_e.png",sizingMethod="scale")}
|
310 |
-
.fancybox-ie #fancybox-bg-se{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_se.png",sizingMethod="scale")}
|
311 |
-
.fancybox-ie #fancybox-bg-s{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_s.png",sizingMethod="scale")}
|
312 |
-
.fancybox-ie #fancybox-bg-sw{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_sw.png",sizingMethod="scale")}
|
313 |
-
.fancybox-ie #fancybox-bg-w{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_w.png",sizingMethod="scale")}
|
314 |
-
.fancybox-ie #fancybox-bg-nw{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/fancy_shadow_nw.png",sizingMethod="scale")}';
|
315 |
-
|
316 |
-
if ( isset($overlaySpotlight) && 'true' == $overlaySpotlight )
|
317 |
-
self::$inline_style_ie .= '
|
318 |
-
#fancybox-overlay{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.self::$plugin_url.'images/light-mask.png",sizingMethod="scale")}';
|
319 |
-
}
|
320 |
-
|
321 |
-
return true;
|
322 |
-
}
|
323 |
-
|
324 |
-
/***********************
|
325 |
-
ACTIONS & FILTERS
|
326 |
-
***********************/
|
327 |
-
|
328 |
-
public static function enqueue_scripts()
|
329 |
-
{
|
330 |
-
// Make sure whe actually need to do anything.
|
331 |
-
if ( !self::$add_scripts )
|
332 |
-
return;
|
333 |
-
|
334 |
-
global $wp_styles;
|
335 |
-
$min = ( defined('WP_DEBUG') && WP_DEBUG ) ? '' : '.min';
|
336 |
-
|
337 |
-
// ENQUEUE STYLE
|
338 |
-
wp_enqueue_style( 'fancybox', self::$plugin_url.'css/jquery.fancybox'.$min.'.css', false, FANCYBOX_VERSION, 'screen' );
|
339 |
-
if ( !empty(self::$inline_style_ie) ) {
|
340 |
-
wp_enqueue_style( 'fancybox-ie', self::$plugin_url.'css/jquery.fancybox-ie'.$min.'.css', false, FANCYBOX_VERSION, 'screen' );
|
341 |
-
$wp_styles->add_data( 'fancybox-ie', 'conditional', 'lt IE 9' );
|
342 |
-
}
|
343 |
-
|
344 |
-
// ENQUEUE SCRIPTS
|
345 |
-
$dep = get_option( 'fancybox_nojQuery', false ) ? array() : array('jquery');
|
346 |
-
$footer = get_option( 'fancybox_noFooter', false ) ? false : true;
|
347 |
-
|
348 |
-
// Register main fancybox script.
|
349 |
-
wp_enqueue_script( 'jquery-fancybox', self::$plugin_url.'js/jquery.fancybox'.$min.'.js', $dep, FANCYBOX_VERSION, $footer );
|
350 |
-
|
351 |
-
// jQuery Easing, which is ot needed if jQueryUI Core Effects are loaded.
|
352 |
-
if ( !wp_script_is( 'jquery-effects-core', 'enqueued' ) ) {
|
353 |
-
$add_easing = false;
|
354 |
-
// Test for easing in IMG settings.
|
355 |
-
if ( get_option( 'fancybox_enableImg', self::$options['Global']['options']['Enable']['options']['IMG']['default'] )
|
356 |
-
&& ( 'elastic' === get_option( 'fancybox_transitionIn', 'elastic' )
|
357 |
-
|| 'elastic' === get_option( 'fancybox_transitionOut', 'elastic' ) ) )
|
358 |
-
$add_easing = true;
|
359 |
-
// Test for easing in Inline settings.
|
360 |
-
if ( get_option( 'fancybox_enableInline', false )
|
361 |
-
&& ( 'elastic' === get_option( 'fancybox_transitionInInline' )
|
362 |
-
|| 'elastic' === get_option( 'fancybox_transitionOutInline' ) ) )
|
363 |
-
$add_easing = true;
|
364 |
-
// Enqueue easing?
|
365 |
-
if ( $add_easing ) {
|
366 |
-
wp_enqueue_script( 'jquery-easing', self::$plugin_url.'js/jquery.easing'.$min.'.js', $dep, EASING_VERSION, $footer );
|
367 |
}
|
368 |
-
}
|
369 |
-
|
370 |
-
// jQuery Mousewheel, which is not needed if jQueryUI Mouse is loaded.
|
371 |
-
if ( get_option( 'fancybox_mouseWheel', true ) && !wp_script_is( 'jquery-ui-mouse', 'enqueued' ) ) {
|
372 |
-
wp_enqueue_script( 'jquery-mousewheel', self::$plugin_url.'js/jquery.mousewheel'.$min.'.js', $dep, MOUSEWHEEL_VERSION, $footer );
|
373 |
-
}
|
374 |
-
|
375 |
-
// Metadata in Miscellaneous settings?
|
376 |
-
if ( get_option( 'fancybox_metaData' ) ) {
|
377 |
-
wp_enqueue_script( 'jquery-metadata',self::$plugin_url.'js/jquery.metadata'.$min.'.js', $dep, METADATA_VERSION, $footer );
|
378 |
-
}
|
379 |
-
|
380 |
-
if ( get_option( 'fancybox_pre45Compat', false ) || !function_exists( 'wp_add_inline_script' ) ) {
|
381 |
-
// Do it the old way.
|
382 |
-
if ( !empty(self::$inline_style) )
|
383 |
-
add_action( 'wp_head', array(__CLASS__, 'print_inline_style'), 11 );
|
384 |
-
if ( !empty(self::$inline_style_ie) )
|
385 |
-
add_action( 'wp_head', array(__CLASS__, 'print_inline_style_ie'), 12 );
|
386 |
-
if ( !empty(self::$inline_script) )
|
387 |
-
add_action( $footer ? 'wp_footer' : 'wp_head', array(__CLASS__, 'print_inline_script'), self::$priority + 1 );
|
388 |
} else {
|
389 |
-
if ( !
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
}
|
396 |
|
397 |
-
do_action( 'easy_fancybox_enqueue_scripts', array($min,$dep,$footer) );
|
398 |
-
}
|
399 |
-
|
400 |
-
// Fallback methods for WordPress pre-4.5
|
401 |
-
public static function print_inline_script()
|
402 |
-
{
|
403 |
-
print( '<script type="text/javascript">' . self::$inline_script . '</script>' );
|
404 |
-
}
|
405 |
-
|
406 |
-
public static function print_inline_style()
|
407 |
-
{
|
408 |
-
print( '<style id="fancybox-inline-css" type="text/css">' . self::$inline_style . '</style>' );
|
409 |
-
}
|
410 |
-
|
411 |
-
public static function print_inline_style_ie()
|
412 |
-
{
|
413 |
-
print( '<!--[if lt IE 9]><style id="fancybox-inline-css-ie" type="text/css">' . self::$inline_style_ie . '</style><![endif]-->' );
|
414 |
}
|
415 |
|
416 |
// Hack to fix missing wmode in Youtube oEmbed code based on David C's code in the comments on
|
417 |
// http://www.mehigh.biz/wordpress/adding-wmode-transparent-to-wordpress-3-media-embeds.html
|
418 |
// without the wmode, videos will float over the light box no matter what z-index is set.
|
419 |
-
public static function add_video_wmode_opaque($html)
|
420 |
{
|
|
|
|
|
|
|
|
|
|
|
421 |
if ( strpos($html, "<embed src=" ) !== false ) {
|
422 |
$html = str_replace('</param><embed', '</param><param name="wmode" value="opaque"></param><embed wmode="opaque"', $html);
|
423 |
} elseif ( strpos($html, 'youtube' ) !== false && strpos($html, 'wmode' ) == false ) {
|
@@ -427,75 +177,153 @@ var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class*="'.$tr
|
|
427 |
} elseif ( strpos($html, "dailymotion" ) !== false && strpos($html, 'wmode' ) == false ) {
|
428 |
$html = str_replace('" width', '?wmode=opaque" width', $html);
|
429 |
}
|
|
|
430 |
return $html;
|
431 |
}
|
432 |
|
433 |
-
public static function
|
434 |
{
|
435 |
-
$
|
436 |
|
437 |
-
if (
|
438 |
-
|
439 |
-
|
440 |
-
return $content;
|
441 |
}
|
442 |
|
443 |
public static function upgrade( $old_version )
|
444 |
{
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
449 |
}
|
450 |
}
|
|
|
451 |
// Save new version.
|
452 |
update_option( 'easy_fancybox_version', EASY_FANCYBOX_VERSION );
|
453 |
}
|
454 |
|
455 |
-
public static function
|
456 |
{
|
457 |
-
if (
|
458 |
-
|
459 |
-
|
|
|
460 |
}
|
|
|
|
|
461 |
}
|
462 |
|
463 |
-
public static function
|
464 |
{
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
self::upgrade( $old_version );
|
469 |
}
|
|
|
|
|
470 |
}
|
471 |
|
472 |
-
public static function
|
473 |
{
|
474 |
-
|
475 |
-
if (
|
476 |
-
$
|
477 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
478 |
|
479 |
-
|
480 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
481 |
}
|
|
|
|
|
|
|
482 |
}
|
483 |
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
|
488 |
-
public function __construct(
|
489 |
{
|
490 |
// VARS
|
491 |
-
self::$plugin_url = plugins_url( '/',
|
492 |
-
self::$plugin_basename = plugin_basename( $file );
|
493 |
-
self::$plugin_dir = dirname( $file );
|
494 |
-
|
495 |
-
add_action( 'init', array(__CLASS__, 'maybe_upgrade') );
|
496 |
-
add_action( 'init', array(__CLASS__, 'load_defaults') );
|
497 |
-
add_action( 'init', array(__CLASS__, 'load_main'), 12 );
|
498 |
|
499 |
-
|
|
|
500 |
}
|
501 |
}
|
5 |
|
6 |
class easyFancyBox {
|
7 |
|
8 |
+
public static $plugin_url;
|
9 |
+
|
10 |
+
public static $priority;
|
11 |
|
12 |
public static $plugin_basename;
|
13 |
|
14 |
+
public static $add_scripts;
|
15 |
|
16 |
+
public static $styles = array();
|
17 |
+
public static $inline_styles = array();
|
18 |
+
public static $scripts = array();
|
19 |
+
public static $inline_scripts = array();
|
20 |
|
21 |
+
public static $style_url;
|
22 |
|
23 |
+
public static $style_ie_url;
|
24 |
|
25 |
+
public static $script_url;
|
26 |
|
27 |
+
public static $inline_script;
|
28 |
+
|
29 |
+
public static $inline_style;
|
30 |
+
|
31 |
+
public static $inline_style_ie;
|
32 |
+
|
33 |
+
public static $easing_script_url;
|
34 |
|
35 |
+
public static $mousewheel_script_url;
|
36 |
+
|
37 |
+
public static $metadata_script_url;
|
38 |
+
|
39 |
+
public static $onready_auto = false;
|
40 |
|
41 |
public static $options = array();
|
42 |
|
44 |
|
45 |
public static $pro_plugin_url = "https://premium.status301.com/downloads/easy-fancybox-pro/";
|
46 |
|
47 |
+
/**
|
48 |
+
* ACTIONS & FILTERS
|
49 |
+
*/
|
50 |
|
51 |
+
public static function enqueue_scripts()
|
52 |
{
|
53 |
+
// Make sure whe actually need to do anything.
|
54 |
+
if ( ! self::add_scripts() ){
|
55 |
+
return;
|
|
|
|
|
|
|
56 |
}
|
57 |
|
58 |
+
global $wp_styles;
|
59 |
+
$_dep = get_option( 'fancybox_nojQuery', false ) ? array() : array( 'jquery' );
|
60 |
+
$_ver = defined( 'WP_DEBUG' ) && WP_DEBUG ? time() : false;
|
61 |
+
$_footer = get_option( 'fancybox_noFooter', false ) ? false : true;
|
62 |
+
|
63 |
+
// ENQUEUE STYLES
|
64 |
+
if ( !empty( self::$styles ) ) {
|
65 |
+
foreach ( self::$styles as $handle => $options ) {
|
66 |
+
$src = ! empty( $options['src'] ) ? $options['src'] : '';
|
67 |
+
$deps = ! empty( $options['deps'] ) ? (array) $options['deps'] : array();
|
68 |
+
$ver = ! empty( $options['ver'] ) ? $options['ver'] : $_ver;
|
69 |
+
$media = ! empty( $options['media'] ) ? $options['media'] : 'all';
|
70 |
+
wp_enqueue_style( $handle, $src, $deps, $ver, $media );
|
71 |
+
if ( ! empty( $options['conditional']) ) {
|
72 |
+
$wp_styles->add_data( $handle, 'conditional', $options['conditional'] );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
73 |
}
|
74 |
}
|
75 |
+
} else {
|
76 |
+
wp_enqueue_style( 'fancybox', self::$style_url, array(), $_ver, 'screen' );
|
77 |
+
if ( ! empty( self::$inline_style_ie ) ) {
|
78 |
+
wp_enqueue_style( 'fancybox-ie', self::$style_ie_url, false, null, 'screen' );
|
79 |
+
$wp_styles->add_data( 'fancybox-ie', 'conditional', 'lt IE 9' );
|
80 |
+
}
|
81 |
}
|
82 |
|
83 |
+
// ENQUEUE SCRIPTS
|
84 |
+
if ( !empty( self::$scripts ) ) {
|
85 |
+
foreach ( self::$scripts as $handle => $options ) {
|
86 |
+
$src = ! empty( $options['src'] ) ? $options['src'] : '';
|
87 |
+
$deps = ! empty( $options['deps'] ) ? (array) $options['deps'] : array();
|
88 |
+
$ver = ! empty( $options['ver'] ) ? $options['ver'] : $_ver;
|
89 |
+
wp_enqueue_script( $handle, $src, $deps, $ver, ! empty( $options['footer'] ) );
|
90 |
+
}
|
91 |
+
} else {
|
92 |
+
// Register main fancybox script.
|
93 |
+
wp_enqueue_script( 'jquery-fancybox', self::$script_url, $_dep, $_ver, $_footer );
|
94 |
|
95 |
+
// Metadata in Miscellaneous settings?
|
96 |
+
if ( ! empty( self::$metadata_script_url ) ) {
|
97 |
+
wp_enqueue_script( 'jquery-metadata', self::$metadata_script_url, $_dep, METADATA_VERSION, $_footer );
|
98 |
+
}
|
|
|
|
|
99 |
}
|
100 |
|
101 |
+
// jQuery Easing, which is not needed if jQueryUI Core Effects are loaded or when using fancyBox 3.
|
102 |
+
if ( ! empty( self::$easing_script_url ) && ! wp_script_is( 'jquery-effects-core', 'enqueued' ) ) {
|
103 |
+
wp_enqueue_script( 'jquery-easing', self::$easing_script_url, $_dep, EASING_VERSION, $_footer );
|
104 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
105 |
|
106 |
+
// jQuery Mousewheel, which is not needed if jQueryUI Mouse is loaded or when using fancyBox 3.
|
107 |
+
if ( ! empty( self::$mousewheel_script_url ) && ! wp_script_is( 'jquery-ui-mouse', 'enqueued' ) ) {
|
108 |
+
wp_enqueue_script( 'jquery-mousewheel', self::$mousewheel_script_url, $_dep, MOUSEWHEEL_VERSION, $_footer );
|
109 |
+
}
|
110 |
|
111 |
+
// Inline styles.
|
112 |
+
if ( !empty( self::$inline_styles ) ) {
|
113 |
+
foreach ( self::$inline_styles as $handle => $data ) {
|
114 |
+
if ( function_exists( 'wp_add_inline_style' ) && ! get_option( 'fancybox_pre45Compat', false ) ) {
|
115 |
+
wp_add_inline_style( $handle, $data );
|
116 |
} else {
|
117 |
+
// Do it the old way.
|
118 |
+
add_action( 'wp_head', function() use ( $data ) { print( '<style id="fancybox-inline-css" type="text/css">' . $data . '</style>' ); }, self::priority() );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
119 |
}
|
120 |
}
|
121 |
+
} else {
|
122 |
+
if ( function_exists( 'wp_add_inline_style' ) && ! get_option( 'fancybox_pre45Compat', false ) ) {
|
123 |
+
empty( self::$inline_style ) || wp_add_inline_style( 'fancybox', self::$inline_style );
|
124 |
+
empty( self::$inline_style_ie ) || wp_add_inline_style( 'fancybox-ie', self::$inline_style_ie );
|
125 |
+
} else {
|
126 |
+
// Do it the old way.
|
127 |
+
empty( self::$inline_style ) || add_action( 'wp_head', function() { print( '<style id="fancybox-inline-css" type="text/css">' . self::$inline_style . '</style>' ); }, self::priority() );
|
128 |
+
empty( self::$inline_style_ie ) || add_action( 'wp_head', function() { print( '<!--[if lt IE 9]><style id="fancybox-inline-css-ie" type="text/css">' . self::$inline_style_ie . '</style><![endif]-->' ); }, self::priority() );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
129 |
}
|
|
|
|
|
|
|
|
|
|
|
130 |
}
|
131 |
|
132 |
+
// Inline scripts.
|
133 |
+
if ( !empty( self::$inline_scripts ) ) {
|
134 |
+
foreach ( self::$inline_scripts as $handle => $data ) {
|
135 |
+
if ( is_array( $data ) ) {
|
136 |
+
$position = ! empty( $data['position'] ) ? $data['position'] : 'after';
|
137 |
+
$data = ! empty( $data['data'] ) ? $data['data'] : '';
|
138 |
+
}
|
139 |
+
if ( function_exists( 'wp_add_inline_script' ) && ! get_option( 'fancybox_pre45Compat', false ) ) {
|
140 |
+
wp_add_inline_script( $handle, $data, $position );
|
141 |
+
} else {
|
142 |
+
// Do it the old way.
|
143 |
+
$priority = self::priority();
|
144 |
+
if ( 'after' !== $position ) {
|
145 |
+
$priority = $priority - 1;
|
146 |
+
}
|
147 |
+
add_action( $_footer ? 'wp_footer' : 'wp_head', function() use ( $data ) { print( '<script type="text/javascript">' . $data . '</script>' ); }, $priority );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
148 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
149 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
150 |
} else {
|
151 |
+
if ( function_exists( 'wp_add_inline_script' ) && ! get_option( 'fancybox_pre45Compat', false ) ) {
|
152 |
+
empty( self::$inline_script ) || wp_add_inline_script( 'jquery-fancybox', self::$inline_script );
|
153 |
+
} else {
|
154 |
+
// Do it the old way.
|
155 |
+
empty( self::$inline_script ) || add_action( $_footer ? 'wp_footer' : 'wp_head', function() { print( '<script type="text/javascript">' . self::$inline_script . '</script>' ); }, self::priority() );
|
156 |
+
}
|
157 |
}
|
158 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
159 |
}
|
160 |
|
161 |
// Hack to fix missing wmode in Youtube oEmbed code based on David C's code in the comments on
|
162 |
// http://www.mehigh.biz/wordpress/adding-wmode-transparent-to-wordpress-3-media-embeds.html
|
163 |
// without the wmode, videos will float over the light box no matter what z-index is set.
|
164 |
+
public static function add_video_wmode_opaque( $html )
|
165 |
{
|
166 |
+
// Make sure whe actually need this at all.
|
167 |
+
if ( ! self::add_scripts() ) {
|
168 |
+
return $html;
|
169 |
+
}
|
170 |
+
|
171 |
if ( strpos($html, "<embed src=" ) !== false ) {
|
172 |
$html = str_replace('</param><embed', '</param><param name="wmode" value="opaque"></param><embed wmode="opaque"', $html);
|
173 |
} elseif ( strpos($html, 'youtube' ) !== false && strpos($html, 'wmode' ) == false ) {
|
177 |
} elseif ( strpos($html, "dailymotion" ) !== false && strpos($html, 'wmode' ) == false ) {
|
178 |
$html = str_replace('" width', '?wmode=opaque" width', $html);
|
179 |
}
|
180 |
+
|
181 |
return $html;
|
182 |
}
|
183 |
|
184 |
+
public static function maybe_upgrade()
|
185 |
{
|
186 |
+
$old_version = get_option( 'easy_fancybox_version', 0 );
|
187 |
|
188 |
+
if ( 0 !== version_compare( EASY_FANCYBOX_VERSION, $old_version ) ) {
|
189 |
+
self::upgrade( $old_version );
|
190 |
+
}
|
|
|
191 |
}
|
192 |
|
193 |
public static function upgrade( $old_version )
|
194 |
{
|
195 |
+
// Upgrade from 1.7 or older.
|
196 |
+
if ( ! $old_version ) {
|
197 |
+
delete_option( 'fancybox_PDFclassType' );
|
198 |
+
}
|
199 |
+
|
200 |
+
// Upgrade from before 1.9.
|
201 |
+
if ( version_compare( $old_version, '0', '>' ) && version_compare( $old_version, '1.9', '<' ) ) {
|
202 |
+
// Introducing script version.
|
203 |
+
add_option( 'fancybox_scriptVersion', 'classic' );
|
204 |
+
|
205 |
+
// Change PDF embed option default.
|
206 |
+
$onstart = get_option('fancybox_PDFonStart');
|
207 |
+
$replaces = array(
|
208 |
+
'function(a,i,o){o.type=\'pdf\';}' => '{{object}}',
|
209 |
+
'function(a,i,o){o.type=\'html\';o.content=\'<embed src="\'+a[i].href+\'" type="application/pdf" height="100%" width="100%" />\'}' => '{{embed}}',
|
210 |
+
'function(a,i,o){o.href=\'https://docs.google.com/viewer?embedded=true&url=\'+a[i].href;}' => '{{googleviewer}}'
|
211 |
+
);
|
212 |
+
if ( false === $onstart ) {
|
213 |
+
add_option( 'fancybox_PDFonStart', '{{object}}' );
|
214 |
+
} elseif ( array_key_exists( $onstart, $replaces ) ) {
|
215 |
+
update_option( 'fancybox_PDFonStart', $replaces[$onstart] );
|
216 |
+
} else {
|
217 |
+
update_option( 'fancybox_PDFonStart', '' );
|
218 |
}
|
219 |
}
|
220 |
+
|
221 |
// Save new version.
|
222 |
update_option( 'easy_fancybox_version', EASY_FANCYBOX_VERSION );
|
223 |
}
|
224 |
|
225 |
+
public static function priority()
|
226 |
{
|
227 |
+
if ( null === self::$priority ) {
|
228 |
+
$priority = get_option( 'fancybox_scriptPriority' );
|
229 |
+
|
230 |
+
self::$priority = is_numeric( $priority ) ? (int) $priority : 10;
|
231 |
}
|
232 |
+
|
233 |
+
return self::$priority;
|
234 |
}
|
235 |
|
236 |
+
public static function add_scripts()
|
237 |
{
|
238 |
+
if ( null === self::$add_scripts ) {
|
239 |
+
_doing_it_wrong( __FUNCTION__, 'Method easyFancyBox::add_scripts() has been called before init.', '2.0' );
|
240 |
+
return false;
|
|
|
241 |
}
|
242 |
+
|
243 |
+
return self::$add_scripts;
|
244 |
}
|
245 |
|
246 |
+
public static function extend()
|
247 |
{
|
248 |
+
$script_version = get_option( 'fancybox_scriptVersion', 'classic' );
|
249 |
+
if ( ! array_key_exists( $script_version, FANCYBOX_VERSIONS ) ) {
|
250 |
+
$script_version = 'classic';
|
251 |
+
}
|
252 |
+
|
253 |
+
switch( $script_version ) {
|
254 |
+
case 'legacy':
|
255 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-legacy.php';
|
256 |
+
// Load defaults.
|
257 |
+
if ( empty( self::$options ) ) {
|
258 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-legacy-options.php';
|
259 |
+
self::$options = $efb_options;
|
260 |
+
}
|
261 |
+
// Check for any enabled sections to set the scripts flag.
|
262 |
+
foreach ( self::$options['Global']['options']['Enable']['options'] as $value ) {
|
263 |
+
if ( isset($value['id']) && '1' == get_option($value['id'],$value['default']) ) {
|
264 |
+
self::$add_scripts = true;
|
265 |
+
break;
|
266 |
+
} else {
|
267 |
+
self::$add_scripts = false;
|
268 |
+
}
|
269 |
+
}
|
270 |
+
break;
|
271 |
+
|
272 |
+
case 'fancyBox2':
|
273 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-2.php';
|
274 |
+
// Load defaults.
|
275 |
+
if ( empty( self::$options ) ) {
|
276 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-2-options.php';
|
277 |
+
self::$options = $efb_options;
|
278 |
+
}
|
279 |
+
// Check for any enabled sections to set the scripts flag.
|
280 |
+
foreach ( self::$options['Global']['options']['Enable']['options'] as $value ) {
|
281 |
+
if ( isset($value['id']) && '1' == get_option($value['id'],$value['default']) ) {
|
282 |
+
self::$add_scripts = true;
|
283 |
+
break;
|
284 |
+
} else {
|
285 |
+
self::$add_scripts = false;
|
286 |
+
}
|
287 |
+
}
|
288 |
+
break;
|
289 |
|
290 |
+
case 'fancyBox3':
|
291 |
+
//include EASY_FANCYBOX_DIR . '/inc/fancybox-3.php';
|
292 |
+
break;
|
293 |
+
|
294 |
+
case 'classic':
|
295 |
+
default:
|
296 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-classic.php';
|
297 |
+
// Load defaults.
|
298 |
+
if ( empty( self::$options ) ) {
|
299 |
+
include EASY_FANCYBOX_DIR . '/inc/fancybox-classic-options.php';
|
300 |
+
self::$options = $efb_options;
|
301 |
+
}
|
302 |
+
// Check for any enabled sections to set the scripts flag.
|
303 |
+
foreach ( self::$options['Global']['options']['Enable']['options'] as $value ) {
|
304 |
+
if ( isset($value['id']) && '1' == get_option($value['id'],$value['default']) ) {
|
305 |
+
self::$add_scripts = true;
|
306 |
+
break;
|
307 |
+
} else {
|
308 |
+
self::$add_scripts = false;
|
309 |
+
}
|
310 |
+
}
|
311 |
}
|
312 |
+
|
313 |
+
add_action( 'wp_enqueue_scripts', array( __CLASS__, 'enqueue_scripts' ), self::priority() );
|
314 |
+
//add_filter( 'embed_oembed_html', array( __CLASS__, 'add_video_wmode_opaque' ) ); // Maybe TODO: make optional?
|
315 |
}
|
316 |
|
317 |
+
/**
|
318 |
+
* RUN
|
319 |
+
*/
|
320 |
|
321 |
+
public function __construct()
|
322 |
{
|
323 |
// VARS
|
324 |
+
self::$plugin_url = plugins_url( '/', EASY_FANCYBOX_BASENAME /* EASY_FANCYBOX_DIR.'/easy-fancybox.php' */ );
|
|
|
|
|
|
|
|
|
|
|
|
|
325 |
|
326 |
+
add_action( 'init', array( __CLASS__, 'maybe_upgrade' ), 9 );
|
327 |
+
add_action( 'init', array( __CLASS__, 'extend' ), 9 );
|
328 |
}
|
329 |
}
|
inc/fancybox-2-options.php
ADDED
@@ -0,0 +1,1485 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* FancyBox v2 options and their defaults array.
|
4 |
+
*/
|
5 |
+
|
6 |
+
$efb_options = array (
|
7 |
+
'Global' => array(
|
8 |
+
'title' => esc_html__('Global settings','easy-fancybox'),
|
9 |
+
'input' => 'deep',
|
10 |
+
'hide' => true,
|
11 |
+
'options' => array(
|
12 |
+
'Enable' => array (
|
13 |
+
'title' => esc_html__('Media','easy-fancybox'),
|
14 |
+
'input' => 'multiple',
|
15 |
+
'hide' => true,
|
16 |
+
'options' => array(
|
17 |
+
'p1' => array (
|
18 |
+
'hide' => true,
|
19 |
+
'description' => esc_html__('Enable FancyBox for','easy-fancybox') . '<br />'
|
20 |
+
),
|
21 |
+
'IMG' => array (
|
22 |
+
'id' => 'fancybox_enableImg',
|
23 |
+
'input' => 'checkbox',
|
24 |
+
'hide' => true,
|
25 |
+
'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network( EASY_FANCYBOX_BASENAME ) ) ? '' : '1',
|
26 |
+
'description' => '<strong>' . esc_html__( 'Images', 'easy-fancybox' ) . '</strong>' . ( get_option('fancybox_enableImg') ? ' — <a href="#IMG">' . translate( 'Settings' ) . '</a>' : '' )
|
27 |
+
),
|
28 |
+
'Inline' => array (
|
29 |
+
'id' => 'fancybox_enableInline',
|
30 |
+
'input' => 'checkbox',
|
31 |
+
'hide' => true,
|
32 |
+
'default' => '',
|
33 |
+
'description' => '<strong>' . esc_html__( 'Inline content', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableInline') ? ' — <a href="#Inline">' . translate( 'Settings' ) . '</a>' : '' )
|
34 |
+
),
|
35 |
+
'PDF' => array (
|
36 |
+
'id' => 'fancybox_enablePDF',
|
37 |
+
'input' => 'checkbox',
|
38 |
+
'hide' => true,
|
39 |
+
'default' => '',
|
40 |
+
'description' => '<strong>' . esc_html__( 'PDF', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enablePDF') ? ' — <a href="#PDF">' . translate( 'Settings' ) . '</a>' : '' )
|
41 |
+
),
|
42 |
+
'SVG' => array (
|
43 |
+
'id' => 'fancybox_enableSVG',
|
44 |
+
'input' => 'checkbox',
|
45 |
+
'hide' => true,
|
46 |
+
'default' => '',
|
47 |
+
'description' => '<strong>' . esc_html__( 'SVG', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableSVG') ? ' — <a href="#SVG">' . translate( 'Settings' ) . '</a>' : '' )
|
48 |
+
),
|
49 |
+
'VideoPress' => array (
|
50 |
+
'id' => '',
|
51 |
+
'input' => 'checkbox',
|
52 |
+
'hide' => true,
|
53 |
+
'default' => '',
|
54 |
+
'status' => 'disabled',
|
55 |
+
'description' => '<strong>' . esc_html__( 'VideoPress', 'easy-fancybox' ) . '</strong>' . ' ' . '<em>' . esc_html__('Under development','easy-fancybox') . '</em>'
|
56 |
+
),
|
57 |
+
'YouTube' => array (
|
58 |
+
'id' => 'fancybox_enableYoutube',
|
59 |
+
'input' => 'checkbox',
|
60 |
+
'hide' => true,
|
61 |
+
'default' => '',
|
62 |
+
'description' => '<strong>' . esc_html__( 'YouTube', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableYouTube') ? ' — <a href="#YouTube">' . translate( 'Settings' ) . '</a>' : '' )
|
63 |
+
),
|
64 |
+
'Vimeo' => array (
|
65 |
+
'id' => 'fancybox_enableVimeo',
|
66 |
+
'input' => 'checkbox',
|
67 |
+
'hide' => true,
|
68 |
+
'default' => '',
|
69 |
+
'description' => '<strong>' . esc_html__( 'Vimeo', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableVimeo') ? ' — <a href="#Vimeo">' . translate( 'Settings' ) . '</a>' : '' )
|
70 |
+
),
|
71 |
+
'Dailymotion' => array (
|
72 |
+
'id' => 'fancybox_enableDailymotion',
|
73 |
+
'input' => 'checkbox',
|
74 |
+
'hide' => true,
|
75 |
+
'default' => '',
|
76 |
+
'description' => '<strong>' . esc_html__( 'Dailymotion', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableDailymotion') ? ' — <a href="#Dailymotion">' . translate( 'Settings' ) . '</a>' : '' )
|
77 |
+
),
|
78 |
+
'Instagram' => array (
|
79 |
+
'id' => 'fancybox_enableInstagram',
|
80 |
+
'input' => 'checkbox',
|
81 |
+
'hide' => true,
|
82 |
+
'status' => 'disabled',
|
83 |
+
'default' => '',
|
84 |
+
'description' => '<strong>' . esc_html__( 'Instagram', 'easy-fancybox' ) . '</strong>' . ' ' . '<em>' . esc_html__('Under development','easy-fancybox') . '</em>'
|
85 |
+
),
|
86 |
+
'GoogleMaps' => array (
|
87 |
+
'id' => 'fancybox_enableGoogleMaps',
|
88 |
+
'input' => 'checkbox',
|
89 |
+
'hide' => true,
|
90 |
+
'status' => 'disabled',
|
91 |
+
'default' => '',
|
92 |
+
'description' => '<strong>' . esc_html__( 'Google Maps', 'easy-fancybox' ) . '</strong>' . ' ' . '<em>' . esc_html__('Under development','easy-fancybox') . '</em>'
|
93 |
+
),
|
94 |
+
'iFrame' => array (
|
95 |
+
'id' => 'fancybox_enableiFrame',
|
96 |
+
'input' => 'checkbox',
|
97 |
+
'hide' => true,
|
98 |
+
'default' => '',
|
99 |
+
'description' => '<strong>' . esc_html__('iFrames','easy-fancybox') . '</strong>' . '</strong>' . ( get_option('fancybox_enableiFrame') ? ' — <a href="#iFrame">' . translate( 'Settings' ) . '</a>' : '' )
|
100 |
+
)
|
101 |
+
),
|
102 |
+
'description' => ''
|
103 |
+
),
|
104 |
+
'Overlay' => array (
|
105 |
+
'title' => esc_html__('Overlay','easy-fancybox'),
|
106 |
+
'input' => 'multiple',
|
107 |
+
'hide' => true,
|
108 |
+
'options' => array(
|
109 |
+
'overlayShow' => array (
|
110 |
+
'id' => 'fancybox_overlayShow',
|
111 |
+
'input' => 'checkbox',
|
112 |
+
'hide' => true,
|
113 |
+
'default' => '1',
|
114 |
+
'description' => esc_html__('Show the overlay around content opened in FancyBox.','easy-fancybox')
|
115 |
+
),
|
116 |
+
'hideOnOverlayClick' => array (
|
117 |
+
'id' => 'fancybox_hideOnOverlayClick',
|
118 |
+
'input' => 'checkbox',
|
119 |
+
'hide' => true,
|
120 |
+
'default' => '1',
|
121 |
+
'description' => esc_html__('Close FancyBox when overlay is clicked.','easy-fancybox')
|
122 |
+
),
|
123 |
+
'overlayColor' => array (
|
124 |
+
'id' => 'fancybox_overlayColor',
|
125 |
+
'title' => esc_html__('Color','easy-fancybox'),
|
126 |
+
'label_for' => 'fancybox_overlayColor',
|
127 |
+
'input' => 'text',
|
128 |
+
'hide' => true,
|
129 |
+
'sanitize_callback' => 'colorval',
|
130 |
+
'class' => '',
|
131 |
+
'default' => '',
|
132 |
+
'description' => esc_html__('Enter an RGBA color value.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' rgba(119,119,119,0.7)</em><br />'
|
133 |
+
),
|
134 |
+
'overlaySpotlight' => array (
|
135 |
+
'id' => 'fancybox_overlaySpotlight',
|
136 |
+
'input' => 'checkbox',
|
137 |
+
'hide' => true,
|
138 |
+
'status' => get_option('fancybox_overlaySpotlight') ? '' : 'disabled',
|
139 |
+
'default' => '',
|
140 |
+
'description' => esc_html__('Spotlight effect','easy-fancybox') . ( get_option('fancybox_overlaySpotlight') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
141 |
+
)
|
142 |
+
)
|
143 |
+
),
|
144 |
+
'Window' => array (
|
145 |
+
'title' => esc_html__('Window','easy-fancybox'),
|
146 |
+
'input' => 'multiple',
|
147 |
+
'hide' => true,
|
148 |
+
'options' => array(
|
149 |
+
'p1' => array (
|
150 |
+
'hide' => true,
|
151 |
+
'description' => '<strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
152 |
+
),
|
153 |
+
'closeBtn' => array (
|
154 |
+
'id' => 'fancybox_showCloseButton',
|
155 |
+
'input' => 'checkbox',
|
156 |
+
'default' => '1',
|
157 |
+
'description' => esc_html__('Show the (X) close button','easy-fancybox')
|
158 |
+
),
|
159 |
+
'backgroundColor' => array (
|
160 |
+
'id' => 'fancybox_backgroundColor',
|
161 |
+
'hide' => true,
|
162 |
+
'title' => esc_html__('Background color','easy-fancybox'),
|
163 |
+
'label_for' => 'fancybox_backgroundColor',
|
164 |
+
'input' => 'text',
|
165 |
+
'sanitize_callback' => 'colorval',
|
166 |
+
'status' => 'disabled',
|
167 |
+
'class' => 'small-text',
|
168 |
+
'default' => '',
|
169 |
+
'description' => ''
|
170 |
+
),
|
171 |
+
'textColor' => array (
|
172 |
+
'id' => 'fancybox_textColor',
|
173 |
+
'hide' => true,
|
174 |
+
'title' => esc_html__('Text color','easy-fancybox'),
|
175 |
+
'label_for' => 'fancybox_textColor',
|
176 |
+
'input' => 'text',
|
177 |
+
'sanitize_callback' => 'colorval',
|
178 |
+
'status' => 'disabled',
|
179 |
+
'class' => 'small-text',
|
180 |
+
'default' => '',
|
181 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
182 |
+
),
|
183 |
+
'titleColor' => array (
|
184 |
+
'id' => 'fancybox_titleColor',
|
185 |
+
'hide' => true,
|
186 |
+
'title' => esc_html__('Title color','easy-fancybox'),
|
187 |
+
'label_for' => 'fancybox_titleColor',
|
188 |
+
'input' => 'text',
|
189 |
+
'sanitize_callback' => 'colorval',
|
190 |
+
'class' => 'small-text',
|
191 |
+
'default' => '',
|
192 |
+
'description' => ''
|
193 |
+
),
|
194 |
+
'paddingColor' => array (
|
195 |
+
'id' => 'fancybox_paddingColor',
|
196 |
+
'hide' => true,
|
197 |
+
'title' => esc_html__('Border color','easy-fancybox'),
|
198 |
+
'label_for' => 'fancybox_paddingColor',
|
199 |
+
'input' => 'text',
|
200 |
+
'sanitize_callback' => 'colorval',
|
201 |
+
'class' => 'small-text',
|
202 |
+
'default' => '',
|
203 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' #000 x #fff</em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Use RGBA notation for semi-transparent borders.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' rgba(10,10,30,0.7)</em><br />'
|
204 |
+
),
|
205 |
+
'borderRadius' => array (
|
206 |
+
'id' => 'fancybox_borderRadius',
|
207 |
+
'hide' => true,
|
208 |
+
'title' => esc_html__('Border radius','easy-fancybox'),
|
209 |
+
'label_for' => 'fancybox_borderRadius',
|
210 |
+
'input' => 'number',
|
211 |
+
'step' => '1',
|
212 |
+
'min' => '0',
|
213 |
+
'max' => '99',
|
214 |
+
'sanitize_callback' => 'intval',
|
215 |
+
'status' => 'disabled',
|
216 |
+
'class' => 'small-text',
|
217 |
+
'default' => '4',
|
218 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
219 |
+
),
|
220 |
+
|
221 |
+
'p11' => array (
|
222 |
+
'hide' => true,
|
223 |
+
'description' => '<br /><strong>' . esc_html__('Dimensions','easy-fancybox') . '</strong><br />'
|
224 |
+
),
|
225 |
+
'width' => array (
|
226 |
+
'id' => 'fancybox_width',
|
227 |
+
'title' => translate('Width'),
|
228 |
+
'label_for' => 'fancybox_width',
|
229 |
+
'input' => 'text',
|
230 |
+
'sanitize_callback' => 'intval',
|
231 |
+
'class' => 'small-text',
|
232 |
+
'default' => '',
|
233 |
+
'description' => ' '
|
234 |
+
),
|
235 |
+
'height' => array (
|
236 |
+
'id' => 'fancybox_height',
|
237 |
+
'title' => translate('Height'),
|
238 |
+
'label_for' => 'fancybox_height',
|
239 |
+
'input' => 'text',
|
240 |
+
'sanitize_callback' => 'intval',
|
241 |
+
'class' => 'small-text',
|
242 |
+
'default' => '',
|
243 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 800 x 600</em><br />' . esc_html__('If content size is not set or cannot be determined automatically, these default dimensions will be used.','easy-fancybox') . '<br />'
|
244 |
+
),
|
245 |
+
// TODO: minWidth minHeight maxWidth maxHeight
|
246 |
+
'padding' => array (
|
247 |
+
'id' => 'fancybox_padding',
|
248 |
+
'title' => translate('Border'),
|
249 |
+
'label_for' => 'fancybox_padding',
|
250 |
+
'input' => 'number',
|
251 |
+
'step' => '1',
|
252 |
+
'min' => '0',
|
253 |
+
'max' => '100',
|
254 |
+
'sanitize_callback' => 'intval',
|
255 |
+
'class' => 'small-text',
|
256 |
+
'default' => '',
|
257 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 15</em><br />'
|
258 |
+
),
|
259 |
+
'margin' => array (
|
260 |
+
'id' => 'fancybox_margin',
|
261 |
+
'title' => esc_html__('Margin','easy-fancybox'),
|
262 |
+
'label_for' => 'fancybox_margin',
|
263 |
+
'input' => 'number',
|
264 |
+
'step' => '1',
|
265 |
+
'min' => '20',
|
266 |
+
'max' => '80',
|
267 |
+
'sanitize_callback' => 'intval',
|
268 |
+
'class' => 'small-text',
|
269 |
+
'default' => '20',
|
270 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 20</em><br />'
|
271 |
+
),
|
272 |
+
|
273 |
+
'p2' => array (
|
274 |
+
'hide' => true,
|
275 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
276 |
+
),
|
277 |
+
/* TODO: autoResize
|
278 |
+
/* TODO: Autocenter select box for always true, always false or default (!isTouch)
|
279 |
+
'autoCenter' => array (
|
280 |
+
'id' => 'fancybox_centerOnScroll',
|
281 |
+
'input' => 'checkbox',
|
282 |
+
'default' => '!isTouch',
|
283 |
+
'description' => esc_html__('Center while scrolling (always disabled on touch devices and when content, including the title, might be larger than the viewport)','easy-fancybox')
|
284 |
+
),*/
|
285 |
+
/* TODO: Section to define keyboard keys for gallery navigation, closing and slideshow
|
286 |
+
Default value:
|
287 |
+
'keys' : {
|
288 |
+
next : {
|
289 |
+
13 : 'left', // enter
|
290 |
+
34 : 'up', // page down
|
291 |
+
39 : 'left', // right arrow
|
292 |
+
40 : 'up' // down arrow
|
293 |
+
},
|
294 |
+
prev : {
|
295 |
+
8 : 'right', // backspace
|
296 |
+
33 : 'down', // page up
|
297 |
+
37 : 'right', // left arrow
|
298 |
+
38 : 'down' // up arrow
|
299 |
+
},
|
300 |
+
close : [27], // escape key
|
301 |
+
play : [32], // space - start/stop slideshow
|
302 |
+
toggle : [70] // letter "f" - toggle fullscreen
|
303 |
+
}*/
|
304 |
+
'enableEscapeButton' => array (
|
305 |
+
'id' => 'fancybox_enableEscapeButton',
|
306 |
+
'input' => 'checkbox',
|
307 |
+
'hide' => true,
|
308 |
+
'default' => '1',
|
309 |
+
'description' => esc_html__('Esc key stroke closes FancyBox','easy-fancybox')
|
310 |
+
),
|
311 |
+
/* TODO: topRatio leftRatio for centering adjustments. */
|
312 |
+
'fitToView' => array (
|
313 |
+
'id' => 'fancybox_autoScale',
|
314 |
+
'input' => 'checkbox',
|
315 |
+
'default' => '1',
|
316 |
+
'description' => esc_html__('Scale large content down to fit in the browser viewport.','easy-fancybox')
|
317 |
+
),
|
318 |
+
'openSpeed' => array (
|
319 |
+
'id' => 'fancybox_speedIn',
|
320 |
+
'title' => esc_html__('Opening speed','easy-fancybox'),
|
321 |
+
'label_for' => 'fancybox_speedIn',
|
322 |
+
'input' => 'number',
|
323 |
+
'step' => '100',
|
324 |
+
'min' => '0',
|
325 |
+
'max' => '6000',
|
326 |
+
'sanitize_callback' => 'intval',
|
327 |
+
'class' => 'small-text',
|
328 |
+
'default' => '',
|
329 |
+
),
|
330 |
+
'closeSpeed' => array (
|
331 |
+
'id' => 'fancybox_speedOut',
|
332 |
+
'title' => esc_html__('Closing speed','easy-fancybox'),
|
333 |
+
'label_for' => 'fancybox_speedOut',
|
334 |
+
'input' => 'number',
|
335 |
+
'step' => '100',
|
336 |
+
'min' => '0',
|
337 |
+
'max' => '6000',
|
338 |
+
'sanitize_callback' => 'intval',
|
339 |
+
'class' => 'small-text',
|
340 |
+
'default' => '',
|
341 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 250</em><br />'
|
342 |
+
)
|
343 |
+
)
|
344 |
+
),
|
345 |
+
|
346 |
+
'Miscellaneous' => array (
|
347 |
+
'title' => esc_html__('Miscellaneous','easy-fancybox'),
|
348 |
+
'input' => 'multiple',
|
349 |
+
'hide' => true,
|
350 |
+
'options' => array(
|
351 |
+
'p0' => array (
|
352 |
+
'hide' => true,
|
353 |
+
'description' => '<strong>' . esc_html__('Auto popup','easy-fancybox') . '</strong><br />'
|
354 |
+
),
|
355 |
+
'autoClick' => array (
|
356 |
+
'id' => 'fancybox_autoClick',
|
357 |
+
'title' => esc_html__('Open on page load','easy-fancybox'),
|
358 |
+
'label_for' => 'fancybox_autoClick',
|
359 |
+
'hide' => true,
|
360 |
+
'input' => 'select',
|
361 |
+
'options' => array(
|
362 |
+
'' => translate('None'),
|
363 |
+
'1' => esc_html__('Link with ID "fancybox-auto"','easy-fancybox'),
|
364 |
+
),
|
365 |
+
'default' => '1',
|
366 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
367 |
+
),
|
368 |
+
'delayClick' => array (
|
369 |
+
'id' => 'fancybox_delayClick',
|
370 |
+
'title' => esc_html__('Delay in milliseconds','easy-fancybox'),
|
371 |
+
'label_for' => 'fancybox_delayClick',
|
372 |
+
'hide' => true,
|
373 |
+
'input' => 'number',
|
374 |
+
'step' => '100',
|
375 |
+
'min' => '0',
|
376 |
+
'max' => '',
|
377 |
+
'sanitize_callback' => 'intval',
|
378 |
+
'class' => 'small-text',
|
379 |
+
'default' => '1000',
|
380 |
+
'description' => ' <em>' . esc_html__('Default:','easy-fancybox') . ' 1000</em><br />'
|
381 |
+
),
|
382 |
+
'jqCookie' => array (
|
383 |
+
'id' => '',
|
384 |
+
'title' => esc_html__('Hide popup after first visit?','easy-fancybox'),
|
385 |
+
'hide' => true,
|
386 |
+
'input' => 'select',
|
387 |
+
'status' => 'disabled',
|
388 |
+
'default' => '0',
|
389 |
+
'sanitize_callback' => 'intval',
|
390 |
+
'options' => array(
|
391 |
+
'0' => translate('No'),
|
392 |
+
'1' => esc_html__('1 Day','easy-fancybox'),
|
393 |
+
'7' => esc_html__('1 Week','easy-fancybox'),
|
394 |
+
'30' => esc_html__('1 Month','easy-fancybox'),
|
395 |
+
'365' => esc_html__('1 Year','easy-fancybox')
|
396 |
+
),
|
397 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
398 |
+
),
|
399 |
+
'cookiePath' => array (
|
400 |
+
'id' => '',
|
401 |
+
'default' => '',
|
402 |
+
'hide' => true
|
403 |
+
),
|
404 |
+
'p1' => array (
|
405 |
+
'hide' => true,
|
406 |
+
'description' => '<br /><strong>' . esc_html__('Browser & device compatibility','easy-fancybox') . '</strong><br />'
|
407 |
+
),
|
408 |
+
'minVpWidth' => array (
|
409 |
+
'id' => 'fancybox_minViewportWidth',
|
410 |
+
'title' => esc_html__('Minimum browser/device viewport width','easy-fancybox'),
|
411 |
+
'label_for' => 'fancybox_minViewportWidth',
|
412 |
+
'input' => 'number',
|
413 |
+
'step' => '1',
|
414 |
+
'min' => '320',
|
415 |
+
'max' => '900',
|
416 |
+
'sanitize_callback' => 'intval',
|
417 |
+
'class' => 'small-text',
|
418 |
+
'default' => '',
|
419 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 320</em><br />'
|
420 |
+
),
|
421 |
+
'minVpHeight' => array (
|
422 |
+
'id' => 'fancybox_minViewportHeight',
|
423 |
+
'title' => esc_html__('Minimum browser/device viewport height','easy-fancybox'),
|
424 |
+
'label_for' => 'fancybox_minViewportHeight',
|
425 |
+
'input' => 'number',
|
426 |
+
'step' => '1',
|
427 |
+
'min' => '320',
|
428 |
+
'max' => '900',
|
429 |
+
'sanitize_callback' => 'intval',
|
430 |
+
'class' => 'small-text',
|
431 |
+
'default' => '',
|
432 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 320</em><br />'
|
433 |
+
),
|
434 |
+
/* 'forceNewtab' => array (
|
435 |
+
'id' => 'fancybox_forceNewtab',
|
436 |
+
'input' => 'checkbox',
|
437 |
+
'hide' => true,
|
438 |
+
'default' => '1',
|
439 |
+
'description' => esc_html__('Make media links open in a new tab when viewport falls below minimum width (above)','easy-fancybox')
|
440 |
+
),*/
|
441 |
+
'p2' => array (
|
442 |
+
'hide' => true,
|
443 |
+
'description' => '<br /><strong>' . esc_html__('Theme & plugins compatibility','easy-fancybox') . '</strong><br />'
|
444 |
+
. esc_html__('Try to deactivate all conflicting light box scripts in your theme or other plugins. If this is not possible, try a higher script priority number which means scripts are added later, wich may allow them to override conflicting scripts. A lower priority number, excluding WordPress standard jQuery, or even moving the plugin scripts to the header may work in cases where there are blocking errors occuring in other script.','easy-fancybox')
|
445 |
+
. '<br /><br />'
|
446 |
+
),
|
447 |
+
'scriptPriority' => array (
|
448 |
+
'id' => 'fancybox_scriptPriority',
|
449 |
+
'title' => esc_html__('FancyBox script priority','easy-fancybox'),
|
450 |
+
'label_for' => 'fancybox_scriptPriority',
|
451 |
+
'hide' => true,
|
452 |
+
'input' => 'number',
|
453 |
+
'step' => '1',
|
454 |
+
'min' => '-99',
|
455 |
+
'max' => '999',
|
456 |
+
'sanitize_callback' => 'intval',
|
457 |
+
'class' => 'small-text',
|
458 |
+
'default' => '10',
|
459 |
+
'description' => esc_html__('Default priority is 10.','easy-fancybox') . ' ' . esc_html__('Higher is later.','easy-fancybox') . '<br/>'
|
460 |
+
),
|
461 |
+
'noFooter' => array (
|
462 |
+
'id' => 'fancybox_noFooter',
|
463 |
+
'input' => 'checkbox',
|
464 |
+
'hide' => true,
|
465 |
+
'default' => '',
|
466 |
+
'description' => esc_html__('Move scripts from footer to theme head section (not recommended for site load times!)','easy-fancybox')
|
467 |
+
),
|
468 |
+
'nojQuery' => array (
|
469 |
+
'id' => 'fancybox_nojQuery',
|
470 |
+
'input' => 'checkbox',
|
471 |
+
'hide' => true,
|
472 |
+
'default' => '',
|
473 |
+
'description' => esc_html__('Do not include standard WordPress jQuery library (do this only if you are sure jQuery is included from another source!)','easy-fancybox')
|
474 |
+
),
|
475 |
+
'pre45Compat' => array (
|
476 |
+
'id' => 'fancybox_pre45Compat',
|
477 |
+
'input' => 'checkbox',
|
478 |
+
'hide' => true,
|
479 |
+
'default' => function_exists( 'wp_add_inline_script' ) ? '' : '1',
|
480 |
+
'description' => esc_html__('Do not use wp_add_inline_script/style functions (may solve issues with older script minification plugins)','easy-fancybox')
|
481 |
+
),
|
482 |
+
'p3' => array (
|
483 |
+
'hide' => true,
|
484 |
+
'description' => '<br /><strong>' . esc_html__('Advanced','easy-fancybox') . '</strong><br />'
|
485 |
+
),
|
486 |
+
'metaData' => array (
|
487 |
+
'id' => 'fancybox_metaData',
|
488 |
+
'hide' => true,
|
489 |
+
'input' => 'checkbox',
|
490 |
+
'status' => get_option('fancybox_metaData') ? '' : 'disabled',
|
491 |
+
'default' => '',
|
492 |
+
'description' => esc_html__('Include the Metadata jQuery extension script to allow passing custom parameters via link class.','easy-fancybox') . ( get_option('fancybox_metaData') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
493 |
+
),
|
494 |
+
'vcMasonryCompat' => array (
|
495 |
+
'id' => 'fancybox_vcMasonryCompat',
|
496 |
+
'hide' => true,
|
497 |
+
'input' => 'checkbox',
|
498 |
+
'status' => 'disabled',
|
499 |
+
'default' => '',
|
500 |
+
'description' => esc_html__('WPBakery / Visual Composer - Masonry Grid Gallery compatibility.','easy-fancybox') . ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
501 |
+
),
|
502 |
+
'autoExclude' => array (
|
503 |
+
'id' => 'fancybox_autoExclude',
|
504 |
+
'title' => esc_html__('Exclude','easy-fancybox'),
|
505 |
+
'label_for' => 'fancybox_autoExclude',
|
506 |
+
'input' => 'text',
|
507 |
+
'class' => 'regular-text',
|
508 |
+
'hide' => true,
|
509 |
+
'default' => '.nolightbox,a.wp-block-file__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']',
|
510 |
+
'sanitize_callback' => 'csl_text',
|
511 |
+
'description' => esc_html__('A comma-separated list of selectors for elements to which FancyBox should not automatically bind itself. Media links inside these elements will be ignored by Autodetect.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' .nolightbox,a.wp-block-file__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']</em><br />'
|
512 |
+
)
|
513 |
+
)
|
514 |
+
)
|
515 |
+
)
|
516 |
+
),
|
517 |
+
|
518 |
+
'IMG' => array(
|
519 |
+
'title' => esc_html__('Images','easy-fancybox'),
|
520 |
+
'input' => 'multiple',
|
521 |
+
'options' => array(
|
522 |
+
'intro' => array (
|
523 |
+
'hide' => true,
|
524 |
+
'description' => esc_html__('To make images open in an overlay, add their extension to the Autodetect field or use the class "fancybox" for its link. Clear field to switch off all autodetection.','easy-fancybox') . '<br />'
|
525 |
+
),
|
526 |
+
'tag' => array (
|
527 |
+
'hide' => true,
|
528 |
+
'default' => 'a.fancybox,area.fancybox,.fancybox>a'
|
529 |
+
),
|
530 |
+
'class' => array (
|
531 |
+
'hide' => true,
|
532 |
+
'default' => 'fancybox'
|
533 |
+
),
|
534 |
+
'autoAttribute' => array (
|
535 |
+
'id' => 'fancybox_autoAttribute',
|
536 |
+
'title' => esc_html__('Autodetect','easy-fancybox'),
|
537 |
+
'label_for' => 'fancybox_autoAttribute',
|
538 |
+
'input' => 'text',
|
539 |
+
'class' => 'regular-text',
|
540 |
+
'hide' => true,
|
541 |
+
'default' => '.jpg,.png,.webp',
|
542 |
+
'sanitize_callback' => 'csl_text',
|
543 |
+
'selector' => 'href*=',
|
544 |
+
'description' => esc_html__('A comma-separated list of image file extensions to which FancyBox should automatically bind itself.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' .jpg,.png,.gif,.jpeg</em><br />'
|
545 |
+
),
|
546 |
+
'autoAttributeLimit' => array (
|
547 |
+
'id' => 'fancybox_autoAttributeLimit',
|
548 |
+
'title' => esc_html__('Apply to','easy-fancybox'),
|
549 |
+
'label_for' => 'fancybox_autoAttributeLimit',
|
550 |
+
'hide' => true,
|
551 |
+
'input' => 'select',
|
552 |
+
'options' => array(
|
553 |
+
'' => esc_html__('All image links', 'easy-fancybox')
|
554 |
+
),
|
555 |
+
'default' => '',
|
556 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
557 |
+
),
|
558 |
+
'type' => array (
|
559 |
+
'id' => 'fancybox_classType',
|
560 |
+
'title' => esc_html__('Force FancyBox to treat all media linked with class="fancybox" as images?','easy-fancybox'),
|
561 |
+
'label_for' => 'fancybox_classType',
|
562 |
+
'input' => 'select',
|
563 |
+
'options' => array(
|
564 |
+
'image' => translate('Yes'),
|
565 |
+
'' => translate('No')
|
566 |
+
),
|
567 |
+
'default' => get_option('fancybox_enableInline') ? 'image' : '',
|
568 |
+
'description' => '<br/>'
|
569 |
+
),
|
570 |
+
'p2' => array (
|
571 |
+
'hide' => true,
|
572 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
573 |
+
),
|
574 |
+
'openEffect' => array (
|
575 |
+
'id' => 'fancybox_transitionIn',
|
576 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
577 |
+
'label_for' => 'fancybox_transitionIn',
|
578 |
+
'input' => 'select',
|
579 |
+
'options' => array(
|
580 |
+
'none' => translate('None'),
|
581 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
582 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
583 |
+
),
|
584 |
+
'default' => 'elastic',
|
585 |
+
'description' => ' '
|
586 |
+
),
|
587 |
+
'easingIn' => array ( // converted to openEasing
|
588 |
+
'id' => 'fancybox_easingIn',
|
589 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
590 |
+
'label_for' => 'fancybox_easingIn',
|
591 |
+
'input' => 'select',
|
592 |
+
'options' => array(
|
593 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
594 |
+
'' => esc_html__('Swing','easy-fancybox')
|
595 |
+
),
|
596 |
+
'default' => '',
|
597 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
598 |
+
),
|
599 |
+
'closeEffect' => array (
|
600 |
+
'id' => 'fancybox_transitionOut',
|
601 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
602 |
+
'label_for' => 'fancybox_transitionOut',
|
603 |
+
'input' => 'select',
|
604 |
+
'options' => array(
|
605 |
+
'none' => translate('None'),
|
606 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
607 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
608 |
+
),
|
609 |
+
'default' => 'elastic',
|
610 |
+
'description' => ' '
|
611 |
+
),
|
612 |
+
'easingOut' => array ( // converted to closeEasing
|
613 |
+
'id' => 'fancybox_easingOut',
|
614 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
615 |
+
'label_for' => 'fancybox_easingOut',
|
616 |
+
'input' => 'select',
|
617 |
+
'options' => array(
|
618 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
619 |
+
'' => esc_html__('Swing','easy-fancybox')
|
620 |
+
),
|
621 |
+
'default' => '',
|
622 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
623 |
+
),
|
624 |
+
/*'openOpacity' => array (
|
625 |
+
'id' => 'fancybox_openOpacity',
|
626 |
+
'input' => 'checkbox',
|
627 |
+
'default' => '1',
|
628 |
+
'description' => esc_html__('Transparency fade during elastic open transition.','easy-fancybox')
|
629 |
+
),
|
630 |
+
'closeOpacity' => array (
|
631 |
+
'id' => 'fancybox_closeOpacity',
|
632 |
+
'input' => 'checkbox',
|
633 |
+
'default' => '1',
|
634 |
+
'description' => esc_html__('Transparency fade during elastic close transition.','easy-fancybox')
|
635 |
+
),*/
|
636 |
+
/* TODO: openMethod / closeMethod / nextMethod / prevMethod */
|
637 |
+
'closeClick' => array (
|
638 |
+
'id' => 'fancybox_hideOnContentClick',
|
639 |
+
'input' => 'checkbox',
|
640 |
+
'default' => '',
|
641 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
642 |
+
),
|
643 |
+
'p1' => array (
|
644 |
+
'hide' => true,
|
645 |
+
'description' => '<br /><strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
646 |
+
),
|
647 |
+
'titleShow' => array (
|
648 |
+
'id' => 'fancybox_titleShow',
|
649 |
+
'input' => 'checkbox',
|
650 |
+
'hide' => true,
|
651 |
+
'default' => '1',
|
652 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
653 |
+
),
|
654 |
+
'titlePosition' => array (
|
655 |
+
'id' => 'fancybox_titlePosition',
|
656 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
657 |
+
'label_for' => 'fancybox_titlePosition',
|
658 |
+
'input' => 'select',
|
659 |
+
'hide' => true,
|
660 |
+
'options' => array(
|
661 |
+
'' => esc_html__('Float','easy-fancybox'),
|
662 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
663 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
664 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
665 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
666 |
+
'over' => esc_html__('Overlay','easy-fancybox')
|
667 |
+
),
|
668 |
+
'default' => '',
|
669 |
+
'description' => '<br />'
|
670 |
+
),
|
671 |
+
'titleFromAlt' => array (
|
672 |
+
'id' => 'fancybox_titleFromAlt',
|
673 |
+
'input' => 'checkbox',
|
674 |
+
'hide' => true,
|
675 |
+
'default' => '1',
|
676 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
677 |
+
),
|
678 |
+
'beforeLoad' => array (
|
679 |
+
'id' => '',
|
680 |
+
'title' => esc_html__('Advanced','easy-fancybox'),
|
681 |
+
'hide' => true,
|
682 |
+
'input' => 'select',
|
683 |
+
'status' => 'disabled',
|
684 |
+
'options' => array(
|
685 |
+
'' => esc_html__('Hide/show title on mouse hover action','easy-fancybox')
|
686 |
+
),
|
687 |
+
'default' => '',
|
688 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
689 |
+
),
|
690 |
+
'p3' => array (
|
691 |
+
'hide' => true,
|
692 |
+
'description' => '<br /><strong>' . esc_html__('Gallery','easy-fancybox') . '</strong><br />'
|
693 |
+
),
|
694 |
+
'autoGallery' => array (
|
695 |
+
'id' => 'fancybox_autoGallery',
|
696 |
+
'title' => esc_html__('Autogallery','easy-fancybox'),
|
697 |
+
'label_for' => 'fancybox_autoGallery',
|
698 |
+
'hide' => true,
|
699 |
+
'input' => 'select',
|
700 |
+
'options' => array(
|
701 |
+
'' => translate('Disabled'),
|
702 |
+
'1' => esc_html__('WordPress galleries only','easy-fancybox'),
|
703 |
+
'2' => esc_html__('All in one gallery','easy-fancybox')
|
704 |
+
),
|
705 |
+
'default' => '1',
|
706 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('When disabled, you can use the rel attribute to manually group image links together.','easy-fancybox') . '<br /><br />'
|
707 |
+
),
|
708 |
+
'arrows' => array (
|
709 |
+
'id' => 'fancybox_showNavArrows',
|
710 |
+
'input' => 'checkbox',
|
711 |
+
'default' => '1',
|
712 |
+
'description' => esc_html__('Show the gallery navigation arrows','easy-fancybox')
|
713 |
+
),
|
714 |
+
/* TODO: nextClick to navigate to next gallery item when user clicks the content, default false */
|
715 |
+
'enableKeyboardNav' => array (
|
716 |
+
'id' => 'fancybox_enableKeyboardNav',
|
717 |
+
'input' => 'checkbox',
|
718 |
+
'hide' => true,
|
719 |
+
'default' => '1',
|
720 |
+
'description' => esc_html__('Arrow key strokes browse the gallery','easy-fancybox')
|
721 |
+
),
|
722 |
+
'loop' => array (
|
723 |
+
'id' => 'fancybox_cyclic',
|
724 |
+
'input' => 'checkbox',
|
725 |
+
'hide' => true,
|
726 |
+
'default' => '',
|
727 |
+
'description' => esc_html__('Make galleries cyclic, allowing you to keep pressing next/back.','easy-fancybox')
|
728 |
+
),
|
729 |
+
'mouseWheel' => array (
|
730 |
+
'id' => 'fancybox_mouseWheel',
|
731 |
+
'input' => 'checkbox',
|
732 |
+
'default' => '1',
|
733 |
+
'description' => esc_html__('Allow gallery browsing by mousewheel action.','easy-fancybox')
|
734 |
+
),
|
735 |
+
'changeSpeed' => array (
|
736 |
+
'id' => 'fancybox_changeSpeed',
|
737 |
+
'title' => esc_html__( 'Change speed', 'easy-fancybox' ),
|
738 |
+
'label_for' => 'fancybox_changeSpeed',
|
739 |
+
'input' => 'number',
|
740 |
+
'step' => '1',
|
741 |
+
'min' => '0',
|
742 |
+
'max' => '6000',
|
743 |
+
'sanitize_callback' => 'intval',
|
744 |
+
'class' => 'small-text',
|
745 |
+
'default' => '',
|
746 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 250</em><br /><br />'
|
747 |
+
),
|
748 |
+
'autoSelector' => array (
|
749 |
+
'id' => 'fancybox_autoSelector',
|
750 |
+
'hide' => true,
|
751 |
+
'input' => 'hidden',
|
752 |
+
'default' => '.gallery,.wp-block-gallery,.tiled-gallery,.wp-block-jetpack-tiled-gallery'
|
753 |
+
),
|
754 |
+
'autoPlay' => array (
|
755 |
+
'id' => 'fancybox_autoPlay',
|
756 |
+
'input' => 'checkbox',
|
757 |
+
'default' => '',
|
758 |
+
'description' => esc_html__( 'Slideshow', 'easy-fancybox' )
|
759 |
+
)
|
760 |
+
)
|
761 |
+
),
|
762 |
+
|
763 |
+
'Inline' => array(
|
764 |
+
'title' => esc_html__('Inline content','easy-fancybox'),
|
765 |
+
'input' => 'multiple',
|
766 |
+
'options' => array(
|
767 |
+
'intro' => array (
|
768 |
+
'hide' => true,
|
769 |
+
'description' => esc_html__('To make inline content open in an overlay, wrap that content in a div with a unique ID, create a link with target "#uniqueID" and give it a class "fancybox-inline" attribute.','easy-fancybox') . '<br /><br />'
|
770 |
+
),
|
771 |
+
'tag' => array (
|
772 |
+
'hide' => true,
|
773 |
+
'default' => 'a.fancybox-inline,area.fancybox-inline,.fancybox-inline>a'
|
774 |
+
),
|
775 |
+
'class' => array (
|
776 |
+
'hide' => true,
|
777 |
+
'default' => 'fancybox-inline'
|
778 |
+
),
|
779 |
+
'type' => array (
|
780 |
+
'default' => 'inline'
|
781 |
+
),
|
782 |
+
'autoSize' => array (
|
783 |
+
'id' => 'fancybox_autoDimensions',
|
784 |
+
'input' => 'checkbox',
|
785 |
+
'default' => '1',
|
786 |
+
'description' => esc_html__('Try to adjust size to inline/html content. If unchecked the default dimensions will be used.','easy-fancybox') . ''
|
787 |
+
),
|
788 |
+
/* TODO: autoHeight autoWidth */
|
789 |
+
'scrolling' => array (
|
790 |
+
'id' => 'fancybox_InlineScrolling',
|
791 |
+
'title' => esc_html__('Scrolling','easy-fancybox'),
|
792 |
+
'label_for' => 'fancybox_InlineScrolling',
|
793 |
+
'input' => 'select',
|
794 |
+
'options' => array(
|
795 |
+
'auto' => esc_html__('Auto','easy-fancybox'),
|
796 |
+
'yes' => esc_html__('Always','easy-fancybox'),
|
797 |
+
'no' => esc_html__('Never','easy-fancybox')
|
798 |
+
),
|
799 |
+
'default' => 'auto',
|
800 |
+
'description' => esc_html__('Define scrolling and scrollbar visibility.','easy-fancybox') . '<br /><br />'
|
801 |
+
),
|
802 |
+
'openEffect' => array (
|
803 |
+
'id' => 'fancybox_transitionInInline',
|
804 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
805 |
+
'label_for' => 'fancybox_transitionInInline',
|
806 |
+
'input' => 'select',
|
807 |
+
'options' => array(
|
808 |
+
'none' => translate('None'),
|
809 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
810 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
811 |
+
),
|
812 |
+
'default' => '',
|
813 |
+
'description' => ' '
|
814 |
+
),
|
815 |
+
'easingIn' => array ( // converted to openEasing
|
816 |
+
'id' => 'fancybox_easingInInline',
|
817 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
818 |
+
'label_for' => 'fancybox_easingInInline',
|
819 |
+
'input' => 'select',
|
820 |
+
'options' => array(
|
821 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
822 |
+
'' => esc_html__('Swing','easy-fancybox')
|
823 |
+
),
|
824 |
+
'default' => '',
|
825 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
826 |
+
),
|
827 |
+
'closeEffect' => array (
|
828 |
+
'id' => 'fancybox_transitionOutInline',
|
829 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
830 |
+
'label_for' => 'fancybox_transitionOutInline',
|
831 |
+
'input' => 'select',
|
832 |
+
'options' => array(
|
833 |
+
'none' => translate('None'),
|
834 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
835 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
836 |
+
),
|
837 |
+
'default' => '',
|
838 |
+
'description' => ' '
|
839 |
+
),
|
840 |
+
'easingOut' => array ( // converted to closeEasing
|
841 |
+
'id' => 'fancybox_easingOutInline',
|
842 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
843 |
+
'label_for' => 'fancybox_easingOutInline',
|
844 |
+
'input' => 'select',
|
845 |
+
'options' => array(
|
846 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
847 |
+
'' => esc_html__('Swing','easy-fancybox')
|
848 |
+
),
|
849 |
+
'default' => '',
|
850 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
851 |
+
),
|
852 |
+
'closeClick' => array (
|
853 |
+
'id' => 'fancybox_hideOnContentClickInline',
|
854 |
+
'input' => 'checkbox',
|
855 |
+
'default' => '',
|
856 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
857 |
+
),
|
858 |
+
'titleShow' => array (
|
859 |
+
'default' => 'false',
|
860 |
+
'hide' => true
|
861 |
+
)
|
862 |
+
)
|
863 |
+
),
|
864 |
+
|
865 |
+
'PDF' => array(
|
866 |
+
'title' => esc_html__('PDF','easy-fancybox'),
|
867 |
+
'input' => 'multiple',
|
868 |
+
'options' => array(
|
869 |
+
'intro' => array (
|
870 |
+
'hide' => true,
|
871 |
+
'description' => esc_html__('To make any PDF document file open in an overlay, switch on Autodetect or use the class "fancybox-pdf" for its link.','easy-fancybox') . '<br />'
|
872 |
+
),
|
873 |
+
'autoAttribute' => array (
|
874 |
+
'id' => 'fancybox_autoAttributePDF',
|
875 |
+
'input' => 'checkbox',
|
876 |
+
'hide' => true,
|
877 |
+
'default' => '1',
|
878 |
+
'selector' => '\'a[href*=".pdf"],area[href*=".pdf"],a[href*=".PDF"],area[href*=".PDF"]\'',
|
879 |
+
'description' => esc_html__('Autodetect','easy-fancybox')
|
880 |
+
),
|
881 |
+
'tag' => array (
|
882 |
+
'hide' => true,
|
883 |
+
'default' => 'a.fancybox-pdf,area.fancybox-pdf,.fancybox-pdf>a'
|
884 |
+
),
|
885 |
+
'class' => array (
|
886 |
+
'hide' => true,
|
887 |
+
'default' => 'fancybox-pdf'
|
888 |
+
),
|
889 |
+
'type' => array (
|
890 |
+
'default' => 'iframe'
|
891 |
+
),
|
892 |
+
'beforeLoad' => array (
|
893 |
+
'id' => 'fancybox_PDFonStart',
|
894 |
+
'title' => esc_html__('Embed with','easy-fancybox'),
|
895 |
+
'label_for' => 'fancybox_PDFonStart',
|
896 |
+
'input' => 'select',
|
897 |
+
'options' => array(
|
898 |
+
'{{object}}' => esc_html__('Object tag (plus fall-back link)','easy-fancybox'),
|
899 |
+
'{{embed}}' => esc_html__('Embed tag','easy-fancybox'),
|
900 |
+
'' => esc_html__('iFrame tag (let browser decide)','easy-fancybox'),
|
901 |
+
'{{googleviewer}}' => esc_html__('Google Docs Viewer (external)','easy-fancybox')
|
902 |
+
),
|
903 |
+
'default' => '',
|
904 |
+
'description' => esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('External viewers have bandwidth, usage rate and and file size limits.','easy-fancybox') . '<br /><br />'
|
905 |
+
),
|
906 |
+
'width' => array (
|
907 |
+
'id' => 'fancybox_PDFwidth',
|
908 |
+
'title' => translate('Width'),
|
909 |
+
'label_for' => 'fancybox_PDFwidth',
|
910 |
+
'input' => 'text',
|
911 |
+
'sanitize_callback' => 'intval',
|
912 |
+
'class' => 'small-text',
|
913 |
+
'default' => '90%',
|
914 |
+
'description' => ' '
|
915 |
+
),
|
916 |
+
'height' => array (
|
917 |
+
'id' => 'fancybox_PDFheight',
|
918 |
+
'title' => translate('Height'),
|
919 |
+
'label_for' => 'fancybox_PDFheight',
|
920 |
+
'input' => 'text',
|
921 |
+
'sanitize_callback' => 'intval',
|
922 |
+
'class' => 'small-text',
|
923 |
+
'default' => '90%'
|
924 |
+
),
|
925 |
+
'padding' => array (
|
926 |
+
'id' => 'fancybox_PDFpadding',
|
927 |
+
'title' => translate('Border'),
|
928 |
+
'label_for' => 'fancybox_PDFpadding',
|
929 |
+
'input' => 'number',
|
930 |
+
'step' => '1',
|
931 |
+
'min' => '0',
|
932 |
+
'max' => '100',
|
933 |
+
'sanitize_callback' => 'intval',
|
934 |
+
'class' => 'small-text',
|
935 |
+
'default' => '10',
|
936 |
+
'description' => '<br /><br />'
|
937 |
+
),
|
938 |
+
'titleShow' => array (
|
939 |
+
'id' => 'fancybox_PDFtitleShow',
|
940 |
+
'input' => 'checkbox',
|
941 |
+
'hide' => true,
|
942 |
+
'default' => '',
|
943 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
944 |
+
),
|
945 |
+
'titlePosition' => array (
|
946 |
+
'id' => 'fancybox_PDFtitlePosition',
|
947 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
948 |
+
'label_for' => 'fancybox_PDFtitlePosition',
|
949 |
+
'input' => 'select',
|
950 |
+
'hide' => true,
|
951 |
+
'options' => array(
|
952 |
+
'' => esc_html__('Float','easy-fancybox'),
|
953 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
954 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
955 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
956 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
957 |
+
),
|
958 |
+
'default' => '',
|
959 |
+
'description' => '<br />'
|
960 |
+
),
|
961 |
+
'titleFromAlt' => array (
|
962 |
+
'id' => 'fancybox_PDFtitleFromAlt',
|
963 |
+
'input' => 'checkbox',
|
964 |
+
'hide' => true,
|
965 |
+
'default' => '1',
|
966 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
967 |
+
),
|
968 |
+
'scrolling' => array (
|
969 |
+
'default' => 'no',
|
970 |
+
)
|
971 |
+
)
|
972 |
+
),
|
973 |
+
|
974 |
+
'SVG' => array(
|
975 |
+
'title' => esc_html__('SVG','easy-fancybox'),
|
976 |
+
'input' => 'multiple',
|
977 |
+
'options' => array(
|
978 |
+
'tag' => array (
|
979 |
+
'hide' => true,
|
980 |
+
'default' => 'a.fancybox-svg,area.fancybox-svg,.fancybox-svg>a'
|
981 |
+
),
|
982 |
+
'intro' => array (
|
983 |
+
'hide' => true,
|
984 |
+
'description' => esc_html__('To make any SVG (.svg) file open in an overlay, switch on Autodetect or use the class "fancybox-svg" for its link.','easy-fancybox') . '<br />'
|
985 |
+
),
|
986 |
+
'autoAttribute' => array (
|
987 |
+
'id' => 'fancybox_autoAttributeSVG',
|
988 |
+
'input' => 'checkbox',
|
989 |
+
'hide' => true,
|
990 |
+
'default' => '1',
|
991 |
+
'selector' => '\'a[href*=".svg"],area[href*=".svg"],a[href*=".SVG"],area[href*=".SVG"]\'',
|
992 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
993 |
+
),
|
994 |
+
'class' => array (
|
995 |
+
'hide' => true,
|
996 |
+
'default' => 'fancybox-svg'
|
997 |
+
),
|
998 |
+
'type' => array(
|
999 |
+
'default' => 'svg'
|
1000 |
+
),
|
1001 |
+
'width' => array (
|
1002 |
+
'id' => 'fancybox_SVGWidth',
|
1003 |
+
'title' => translate('Width'),
|
1004 |
+
'label_for' => 'fancybox_SVGWidth',
|
1005 |
+
'input' => 'text',
|
1006 |
+
'sanitize_callback' => 'intval',
|
1007 |
+
'class' => 'small-text',
|
1008 |
+
'options' => array(),
|
1009 |
+
'default' => '680',
|
1010 |
+
'description' => ' '
|
1011 |
+
),
|
1012 |
+
'height' => array (
|
1013 |
+
'id' => 'fancybox_SVGHeight',
|
1014 |
+
'title' => translate('Height'),
|
1015 |
+
'label_for' => 'fancybox_SVGHeight',
|
1016 |
+
'input' => 'text',
|
1017 |
+
'sanitize_callback' => 'intval',
|
1018 |
+
'class' => 'small-text',
|
1019 |
+
'options' => array(),
|
1020 |
+
'default' => '495',
|
1021 |
+
),
|
1022 |
+
'padding' => array (
|
1023 |
+
'id' => 'fancybox_SVGpadding',
|
1024 |
+
'title' => translate('Border'),
|
1025 |
+
'label_for' => 'fancybox_SVGpadding',
|
1026 |
+
'input' => 'number',
|
1027 |
+
'step' => '1',
|
1028 |
+
'min' => '0',
|
1029 |
+
'max' => '100',
|
1030 |
+
'sanitize_callback' => 'intval',
|
1031 |
+
'class' => 'small-text',
|
1032 |
+
'default' => '0',
|
1033 |
+
'description' => '<br /><br />'
|
1034 |
+
),
|
1035 |
+
'titleShow' => array (
|
1036 |
+
'id' => 'fancybox_SVGtitleShow',
|
1037 |
+
'input' => 'checkbox',
|
1038 |
+
'hide' => true,
|
1039 |
+
'default' => '',
|
1040 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1041 |
+
),
|
1042 |
+
'titlePosition' => array (
|
1043 |
+
'id' => 'fancybox_SVGtitlePosition',
|
1044 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
1045 |
+
'label_for' => 'fancybox_SVGtitlePosition',
|
1046 |
+
'input' => 'select',
|
1047 |
+
'hide' => true,
|
1048 |
+
'options' => array(
|
1049 |
+
'' => esc_html__('Float','easy-fancybox'),
|
1050 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1051 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
1052 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
1053 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
1054 |
+
),
|
1055 |
+
'default' => '',
|
1056 |
+
'description' => '<br />'
|
1057 |
+
),
|
1058 |
+
'titleFromAlt' => array (
|
1059 |
+
'id' => 'fancybox_SVGtitleFromAlt',
|
1060 |
+
'input' => 'checkbox',
|
1061 |
+
'hide' => true,
|
1062 |
+
'default' => '1',
|
1063 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1064 |
+
),
|
1065 |
+
'svg' => array (
|
1066 |
+
'default' => '{\'wmode\':\'opaque\',\'allowfullscreen\':true}'
|
1067 |
+
)
|
1068 |
+
)
|
1069 |
+
),
|
1070 |
+
|
1071 |
+
'VideoPress' => array(
|
1072 |
+
),
|
1073 |
+
|
1074 |
+
'YouTube' => array(
|
1075 |
+
'title' => esc_html__('YouTube','easy-fancybox'),
|
1076 |
+
'input' => 'multiple',
|
1077 |
+
'options' => array(
|
1078 |
+
'intro' => array (
|
1079 |
+
'hide' => true,
|
1080 |
+
'description' => esc_html__('To make any YouTube movie open in an overlay, switch on Autodetect or use the class "fancybox-youtube" for its link.','easy-fancybox') . '<br />'
|
1081 |
+
),
|
1082 |
+
'autoAttribute' => array (
|
1083 |
+
'id' => 'fancybox_autoAttributeYoutube',
|
1084 |
+
'input' => 'checkbox',
|
1085 |
+
'hide' => true,
|
1086 |
+
'default' => '1',
|
1087 |
+
'selector' => '\'a[href*="youtu.be/"],area[href*="youtu.be/"],a[href*="youtube.com/"],area[href*="youtube.com/"]\').filter(function(){return this.href.match(/\/(?:youtu\.be|watch\?|embed\/)/);}',
|
1088 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1089 |
+
),
|
1090 |
+
'tag' => array (
|
1091 |
+
'hide' => true,
|
1092 |
+
'default' => 'a.fancybox-youtube,area.fancybox-youtube,.fancybox-youtube>a'
|
1093 |
+
),
|
1094 |
+
'class' => array (
|
1095 |
+
'hide' => true,
|
1096 |
+
'default' => 'fancybox-youtube'
|
1097 |
+
),
|
1098 |
+
'width' => array (
|
1099 |
+
'id' => 'fancybox_YoutubeWidth',
|
1100 |
+
'title' => translate('Width'),
|
1101 |
+
'label_for' => 'fancybox_YoutubeWidth',
|
1102 |
+
'input' => 'number',
|
1103 |
+
'step' => '1',
|
1104 |
+
'min' => '420',
|
1105 |
+
'max' => '1500',
|
1106 |
+
'sanitize_callback' => 'intval',
|
1107 |
+
'class' => 'small-text',
|
1108 |
+
'default' => '640',
|
1109 |
+
'description' => ' '
|
1110 |
+
),
|
1111 |
+
'height' => array (
|
1112 |
+
'id' => 'fancybox_YoutubeHeight',
|
1113 |
+
'title' => translate('Height'),
|
1114 |
+
'label_for' => 'fancybox_YoutubeHeight',
|
1115 |
+
'input' => 'number',
|
1116 |
+
'step' => '1',
|
1117 |
+
'min' => '315',
|
1118 |
+
'max' => '900',
|
1119 |
+
'sanitize_callback' => 'intval',
|
1120 |
+
'class' => 'small-text',
|
1121 |
+
'default' => '360',
|
1122 |
+
),
|
1123 |
+
'padding' => array (
|
1124 |
+
'id' => 'fancybox_Youtubepadding',
|
1125 |
+
'title' => translate('Border'),
|
1126 |
+
'label_for' => 'fancybox_Youtubepadding',
|
1127 |
+
'input' => 'number',
|
1128 |
+
'step' => '1',
|
1129 |
+
'min' => '0',
|
1130 |
+
'max' => '100',
|
1131 |
+
'sanitize_callback' => 'intval',
|
1132 |
+
'class' => 'small-text',
|
1133 |
+
'default' => '0',
|
1134 |
+
'description' => '<br /><br />'
|
1135 |
+
),
|
1136 |
+
'aspectRatio' => array(
|
1137 |
+
'default' => '1'
|
1138 |
+
),
|
1139 |
+
'titleShow' => array (
|
1140 |
+
'id' => 'fancybox_YoutubetitleShow',
|
1141 |
+
'input' => 'checkbox',
|
1142 |
+
'hide' => true,
|
1143 |
+
'default' => '',
|
1144 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1145 |
+
),
|
1146 |
+
'titlePosition' => array (
|
1147 |
+
'id' => 'fancybox_YoutubetitlePosition',
|
1148 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
1149 |
+
'label_for' => 'fancybox_YoutubetitlePosition',
|
1150 |
+
'input' => 'select',
|
1151 |
+
'hide' => true,
|
1152 |
+
'options' => array(
|
1153 |
+
'' => esc_html__('Float','easy-fancybox'),
|
1154 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1155 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
1156 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
1157 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
1158 |
+
),
|
1159 |
+
'default' => '',
|
1160 |
+
'description' => '<br />'
|
1161 |
+
),
|
1162 |
+
'titleFromAlt' => array (
|
1163 |
+
'id' => 'fancybox_YoutubetitleFromAlt',
|
1164 |
+
'input' => 'checkbox',
|
1165 |
+
'hide' => true,
|
1166 |
+
'default' => '1',
|
1167 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1168 |
+
)
|
1169 |
+
)
|
1170 |
+
),
|
1171 |
+
|
1172 |
+
'Vimeo' => array(
|
1173 |
+
'title' => esc_html__('Vimeo','easy-fancybox'),
|
1174 |
+
'input' => 'multiple',
|
1175 |
+
'options' => array(
|
1176 |
+
'intro' => array (
|
1177 |
+
'hide' => true,
|
1178 |
+
'description' => esc_html__('To make any Vimeo movie open in an overlay, switch on Autodetect or use the class "fancybox-vimeo" for its link.','easy-fancybox') . '<br />'
|
1179 |
+
),
|
1180 |
+
'autoAttribute' => array (
|
1181 |
+
'id' => 'fancybox_autoAttributeVimeo',
|
1182 |
+
'input' => 'checkbox',
|
1183 |
+
'hide' => true,
|
1184 |
+
'default' => '1',
|
1185 |
+
'selector' => '\'a[href*="vimeo.com/"],area[href*="vimeo.com/"]\').filter(function(){return this.href.match(/\/(?:[0-9]+|video\/)/);}',
|
1186 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1187 |
+
),
|
1188 |
+
'tag' => array (
|
1189 |
+
'hide' => true,
|
1190 |
+
'default' => 'a.fancybox-vimeo,area.fancybox-vimeo,.fancybox-vimeo>a'
|
1191 |
+
),
|
1192 |
+
'class' => array (
|
1193 |
+
'hide' => true,
|
1194 |
+
'default' => 'fancybox-vimeo'
|
1195 |
+
),
|
1196 |
+
'width' => array (
|
1197 |
+
'id' => 'fancybox_VimeoWidth',
|
1198 |
+
'title' => translate('Width'),
|
1199 |
+
'label_for' => 'fancybox_VimeoWidth',
|
1200 |
+
'input' => 'number',
|
1201 |
+
'step' => '1',
|
1202 |
+
'min' => '400',
|
1203 |
+
'max' => '1500',
|
1204 |
+
'sanitize_callback' => 'intval',
|
1205 |
+
'class' => 'small-text',
|
1206 |
+
'default' => '500',
|
1207 |
+
'description' => ' '
|
1208 |
+
),
|
1209 |
+
'height' => array (
|
1210 |
+
'id' => 'fancybox_VimeoHeight',
|
1211 |
+
'title' => translate('Height'),
|
1212 |
+
'label_for' => 'fancybox_VimeoHeight',
|
1213 |
+
'input' => 'number',
|
1214 |
+
'step' => '1',
|
1215 |
+
'min' => '225',
|
1216 |
+
'max' => '900',
|
1217 |
+
'sanitize_callback' => 'intval',
|
1218 |
+
'class' => 'small-text',
|
1219 |
+
'default' => '281'
|
1220 |
+
),
|
1221 |
+
'padding' => array (
|
1222 |
+
'id' => 'fancybox_Vimeopadding',
|
1223 |
+
'title' => translate('Border'),
|
1224 |
+
'label_for' => 'fancybox_Vimeopadding',
|
1225 |
+
'input' => 'number',
|
1226 |
+
'step' => '1',
|
1227 |
+
'min' => '0',
|
1228 |
+
'max' => '100',
|
1229 |
+
'sanitize_callback' => 'intval',
|
1230 |
+
'class' => 'small-text',
|
1231 |
+
'default' => '0',
|
1232 |
+
'description' => '<br /><br />'
|
1233 |
+
),
|
1234 |
+
'aspectRatio' => array(
|
1235 |
+
'default' => '1'
|
1236 |
+
),
|
1237 |
+
'titleShow' => array (
|
1238 |
+
'id' => 'fancybox_VimeotitleShow',
|
1239 |
+
'input' => 'checkbox',
|
1240 |
+
'hide' => true,
|
1241 |
+
'default' => '',
|
1242 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1243 |
+
),
|
1244 |
+
'titlePosition' => array (
|
1245 |
+
'id' => 'fancybox_VimeotitlePosition',
|
1246 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
1247 |
+
'label_for' => 'fancybox_VimeotitlePosition',
|
1248 |
+
'input' => 'select',
|
1249 |
+
'hide' => true,
|
1250 |
+
'options' => array(
|
1251 |
+
'' => esc_html__('Float','easy-fancybox'),
|
1252 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1253 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
1254 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
1255 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
1256 |
+
),
|
1257 |
+
'default' => '',
|
1258 |
+
'description' => '<br />'
|
1259 |
+
),
|
1260 |
+
'titleFromAlt' => array (
|
1261 |
+
'id' => 'fancybox_VimeotitleFromAlt',
|
1262 |
+
'input' => 'checkbox',
|
1263 |
+
'hide' => true,
|
1264 |
+
'default' => '1',
|
1265 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1266 |
+
)
|
1267 |
+
)
|
1268 |
+
),
|
1269 |
+
|
1270 |
+
'Dailymotion' => array(
|
1271 |
+
'title' => esc_html__('Dailymotion','easy-fancybox'),
|
1272 |
+
'input' => 'multiple',
|
1273 |
+
'options' => array(
|
1274 |
+
'intro' => array (
|
1275 |
+
'hide' => true,
|
1276 |
+
'description' => esc_html__('To make any Dailymotion movie open in an overlay, switch on Autodetect or use the class "fancybox-dailymotion" for its link.','easy-fancybox') . '<br />'
|
1277 |
+
),
|
1278 |
+
'autoAttribute' => array (
|
1279 |
+
'id' => 'fancybox_autoAttributeDailymotion',
|
1280 |
+
'input' => 'checkbox',
|
1281 |
+
'hide' => true,
|
1282 |
+
'default' => '1',
|
1283 |
+
'selector' => '\'a[href*="dailymotion.com/"],area[href*="dailymotion.com/"]\').filter(function(){return this.href.match(/\/video\//);}',
|
1284 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1285 |
+
),
|
1286 |
+
'tag' => array (
|
1287 |
+
'hide' => true,
|
1288 |
+
'default' => 'a.fancybox-dailymotion,area.fancybox-dailymotion,.fancybox-dailymotion>a'
|
1289 |
+
),
|
1290 |
+
'class' => array (
|
1291 |
+
'hide' => true,
|
1292 |
+
'default' => 'fancybox-dailymotion'
|
1293 |
+
),
|
1294 |
+
'width' => array (
|
1295 |
+
'id' => 'fancybox_DailymotionWidth',
|
1296 |
+
'title' => translate('Width'),
|
1297 |
+
'label_for' => 'fancybox_DailymotionWidth',
|
1298 |
+
'input' => 'number',
|
1299 |
+
'step' => '1',
|
1300 |
+
'min' => '320',
|
1301 |
+
'max' => '1500',
|
1302 |
+
'sanitize_callback' => 'intval',
|
1303 |
+
'class' => 'small-text',
|
1304 |
+
'default' => '560',
|
1305 |
+
'description' => ' '
|
1306 |
+
),
|
1307 |
+
'height' => array (
|
1308 |
+
'id' => 'fancybox_DailymotionHeight',
|
1309 |
+
'title' => translate('Height'),
|
1310 |
+
'label_for' => 'fancybox_DailymotionHeight',
|
1311 |
+
'input' => 'number',
|
1312 |
+
'step' => '1',
|
1313 |
+
'min' => '180',
|
1314 |
+
'max' => '900',
|
1315 |
+
'sanitize_callback' => 'intval',
|
1316 |
+
'class' => 'small-text',
|
1317 |
+
'default' => '315'
|
1318 |
+
),
|
1319 |
+
'padding' => array (
|
1320 |
+
'id' => 'fancybox_DailymotionPadding',
|
1321 |
+
'title' => translate('Border'),
|
1322 |
+
'label_for' => 'fancybox_DailymotionPadding',
|
1323 |
+
'input' => 'number',
|
1324 |
+
'step' => '1',
|
1325 |
+
'min' => '0',
|
1326 |
+
'max' => '100',
|
1327 |
+
'sanitize_callback' => 'intval',
|
1328 |
+
'class' => 'small-text',
|
1329 |
+
'default' => '0',
|
1330 |
+
'description' => '<br /><br />'
|
1331 |
+
),
|
1332 |
+
'aspectRatio' => array(
|
1333 |
+
'default' => '1'
|
1334 |
+
),
|
1335 |
+
'titleShow' => array (
|
1336 |
+
'id' => 'fancybox_DailymotiontitleShow',
|
1337 |
+
'input' => 'checkbox',
|
1338 |
+
'hide' => true,
|
1339 |
+
'default' => '',
|
1340 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1341 |
+
),
|
1342 |
+
'titlePosition' => array (
|
1343 |
+
'id' => 'fancybox_DailymotiontitlePosition',
|
1344 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
1345 |
+
'label_for' => 'fancybox_DailymotiontitlePosition',
|
1346 |
+
'input' => 'select',
|
1347 |
+
'hide' => true,
|
1348 |
+
'options' => array(
|
1349 |
+
'' => esc_html__('Float','easy-fancybox'),
|
1350 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1351 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
1352 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
1353 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
1354 |
+
),
|
1355 |
+
'default' => '',
|
1356 |
+
'description' => '<br />'
|
1357 |
+
),
|
1358 |
+
'titleFromAlt' => array (
|
1359 |
+
'id' => 'fancybox_DailymotiontitleFromAlt',
|
1360 |
+
'input' => 'checkbox',
|
1361 |
+
'hide' => true,
|
1362 |
+
'default' => '1',
|
1363 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1364 |
+
)
|
1365 |
+
)
|
1366 |
+
),
|
1367 |
+
|
1368 |
+
/* 'Tudou' => array(
|
1369 |
+
'id' => 'fancybox_Tudou',
|
1370 |
+
'title' => esc_html__('Tudou','easy-fancybox'),
|
1371 |
+
'label_for' => '',
|
1372 |
+
'input' => 'multiple',
|
1373 |
+
'class' => '', 'description' => '',
|
1374 |
+
'options' => array(
|
1375 |
+
'autoAttributeTudou' => array (
|
1376 |
+
'id' => 'fancybox_autoAttributeTudou',
|
1377 |
+
'label_for' => '',
|
1378 |
+
'input' => 'checkbox',
|
1379 |
+
'class' => '',
|
1380 |
+
'options' => array(),
|
1381 |
+
'hide' => true,
|
1382 |
+
'default' => '1',
|
1383 |
+
'description' => esc_html__('Tudou links','easy-fancybox')
|
1384 |
+
)
|
1385 |
+
)
|
1386 |
+
),*/
|
1387 |
+
|
1388 |
+
/* 'Animoto' => array(),
|
1389 |
+
|
1390 |
+
Example ANIMOTO page link http://animoto.com/play/Kf9POzQMSOGWyu41gtOtsw should become
|
1391 |
+
http://static.animoto.com/swf/w.swf?w=swf/vp1&f=Kf9POzQMSOGWyu41gtOtsw&i=m
|
1392 |
+
|
1393 |
+
*/
|
1394 |
+
|
1395 |
+
'iFrame' => array(
|
1396 |
+
'title' => esc_html__('iFrames','easy-fancybox'),
|
1397 |
+
'input' => 'multiple',
|
1398 |
+
'options' => array(
|
1399 |
+
'intro' => array (
|
1400 |
+
'hide' => true,
|
1401 |
+
'description' => esc_html__('To make a website or HTML document open in an overlay, use the class "fancybox-iframe" for its link.','easy-fancybox') . '<br /><br />'
|
1402 |
+
),
|
1403 |
+
'tag' => array (
|
1404 |
+
'hide' => true,
|
1405 |
+
'default' => 'a.fancybox-iframe,area.fancybox-iframe,.fancybox-iframe>a'
|
1406 |
+
),
|
1407 |
+
'class' => array (
|
1408 |
+
'hide' => true,
|
1409 |
+
'default' => 'fancybox-iframe'
|
1410 |
+
),
|
1411 |
+
'type' => array (
|
1412 |
+
'default' => 'iframe'
|
1413 |
+
),
|
1414 |
+
'width' => array (
|
1415 |
+
'id' => 'fancybox_iFramewidth',
|
1416 |
+
'title' => translate('Width'),
|
1417 |
+
'label_for' => 'fancybox_iFramewidth',
|
1418 |
+
'input' => 'text',
|
1419 |
+
'sanitize_callback' => 'intval',
|
1420 |
+
'class' => 'small-text',
|
1421 |
+
'default' => '70%',
|
1422 |
+
'description' => ' '
|
1423 |
+
),
|
1424 |
+
'height' => array (
|
1425 |
+
'id' => 'fancybox_iFrameheight',
|
1426 |
+
'title' => translate('Height'),
|
1427 |
+
'label_for' => 'fancybox_iFrameheight',
|
1428 |
+
'input' => 'text',
|
1429 |
+
'sanitize_callback' => 'intval',
|
1430 |
+
'class' => 'small-text',
|
1431 |
+
'default' => '90%',
|
1432 |
+
),
|
1433 |
+
'padding' => array (
|
1434 |
+
'id' => 'fancybox_iFramepadding',
|
1435 |
+
'title' => translate('Border'),
|
1436 |
+
'label_for' => 'fancybox_iFramepadding',
|
1437 |
+
'input' => 'number',
|
1438 |
+
'step' => '1',
|
1439 |
+
'min' => '0',
|
1440 |
+
'max' => '100',
|
1441 |
+
'sanitize_callback' => 'intval',
|
1442 |
+
'class' => 'small-text',
|
1443 |
+
'default' => '0',
|
1444 |
+
'description' => '<br /><br />'
|
1445 |
+
),
|
1446 |
+
'titleShow' => array (
|
1447 |
+
'id' => 'fancybox_iFrametitleShow',
|
1448 |
+
'input' => 'checkbox',
|
1449 |
+
'hide' => true,
|
1450 |
+
'default' => '',
|
1451 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1452 |
+
),
|
1453 |
+
'titlePosition' => array (
|
1454 |
+
'id' => 'fancybox_iFrametitlePosition',
|
1455 |
+
'title' => esc_html__('Title Style','easy-fancybox'),
|
1456 |
+
'label_for' => 'fancybox_iFrametitlePosition',
|
1457 |
+
'input' => 'select',
|
1458 |
+
'hide' => true,
|
1459 |
+
'options' => array(
|
1460 |
+
'' => esc_html__('Float','easy-fancybox'),
|
1461 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1462 |
+
'outside-top' => esc_html__('Outside top','easy-fancybox'),
|
1463 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
1464 |
+
'inside-top' => esc_html__('Inside top','easy-fancybox'),
|
1465 |
+
),
|
1466 |
+
'default' => '',
|
1467 |
+
'description' => '<br />'
|
1468 |
+
),
|
1469 |
+
'titleFromAlt' => array (
|
1470 |
+
'id' => 'fancybox_iFrametitleFromAlt',
|
1471 |
+
'input' => 'checkbox',
|
1472 |
+
'hide' => true,
|
1473 |
+
'default' => '1',
|
1474 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox') . '<br/>'
|
1475 |
+
),
|
1476 |
+
'allowFullScreen' => array (
|
1477 |
+
'id' => 'fancybox_allowFullScreen',
|
1478 |
+
'input' => 'checkbox',
|
1479 |
+
'hide' => true,
|
1480 |
+
'default' => '1',
|
1481 |
+
'description' => esc_html__('Allow embedded content to jump to full screen mode','easy-fancybox')
|
1482 |
+
)
|
1483 |
+
)
|
1484 |
+
)
|
1485 |
+
);
|
inc/fancybox-2.php
ADDED
@@ -0,0 +1,503 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* FancyBox v1
|
4 |
+
*/
|
5 |
+
|
6 |
+
namespace easyFancyBox\fancyBox_2;
|
7 |
+
|
8 |
+
/**
|
9 |
+
* MAIN INLINE SCRIPT & STYLE
|
10 |
+
*/
|
11 |
+
|
12 |
+
function prepare_inline_scripts() {
|
13 |
+
/**
|
14 |
+
* Global parameters and value extraction.
|
15 |
+
*/
|
16 |
+
$fb_opts = array();
|
17 |
+
|
18 |
+
foreach ( \easyFancyBox::$options['Global']['options'] as $globals ) {
|
19 |
+
foreach ( $globals['options'] as $_key => $_value ) {
|
20 |
+
if ( isset($_value['id']) )
|
21 |
+
if ( isset($_value['default']) )
|
22 |
+
$parm = \get_option($_value['id'], $_value['default']);
|
23 |
+
else
|
24 |
+
$parm = \get_option($_value['id']);
|
25 |
+
elseif ( isset($_value['default']) )
|
26 |
+
$parm = $_value['default'];
|
27 |
+
else
|
28 |
+
$parm = '';
|
29 |
+
|
30 |
+
if ( isset($_value['input']) && 'checkbox' == $_value['input'] ) {
|
31 |
+
$parm = ( '1' == $parm ) ? true : false;
|
32 |
+
}
|
33 |
+
|
34 |
+
if( ! isset($_value['hide']) && $parm !== '' ) {
|
35 |
+
$fb_opts[$_key] = $parm;
|
36 |
+
} else {
|
37 |
+
${$_key} = $parm;
|
38 |
+
}
|
39 |
+
}
|
40 |
+
}
|
41 |
+
|
42 |
+
// Change speeds.
|
43 |
+
$changespeed = get_option( 'fancybox_changeSpeed' );
|
44 |
+
if ( ! empty( $changespeed ) ) {
|
45 |
+
$fb_opts['prevSpeed'] = intval( $changespeed );
|
46 |
+
$fb_opts['nextSpeed'] = intval( $changespeed );
|
47 |
+
}
|
48 |
+
|
49 |
+
// Keys.
|
50 |
+
if ( ! \get_option( 'fancybox_enableEscapeButton', true ) ) {
|
51 |
+
$fb_opts['keys'] = array( 'close' => null );
|
52 |
+
}
|
53 |
+
|
54 |
+
// Overlay.
|
55 |
+
if ( \get_option( 'fancybox_overlayShow', true ) ) {
|
56 |
+
if ( ! \get_option( 'fancybox_hideOnOverlayClick', true ) ) {
|
57 |
+
$fb_opts['helpers']['overlay']['closeClick'] = false;
|
58 |
+
}
|
59 |
+
if ( \get_option( 'fancybox_overlayColor' ) ) {
|
60 |
+
$fb_opts['helpers']['overlay']['css'] = array(
|
61 |
+
'background' =>
|
62 |
+
\esc_attr( \get_option('fancybox_overlayColor') )
|
63 |
+
);
|
64 |
+
}
|
65 |
+
} else {
|
66 |
+
$fb_opts['helpers']['overlay'] = null;
|
67 |
+
}
|
68 |
+
|
69 |
+
// Media helpers.
|
70 |
+
if ( add_media() ) {
|
71 |
+
$fb_opts['helpers']['media'] = array();
|
72 |
+
|
73 |
+
// Null the unselected.
|
74 |
+
\get_option( 'fancybox_enableYoutube' ) || $fb_opts['helpers']['media']['youtube'] = null;
|
75 |
+
\get_option( 'fancybox_enableVimeo' ) || $fb_opts['helpers']['media']['vimeo'] = null;
|
76 |
+
\get_option( 'fancybox_enableDailymotion' ) || $fb_opts['helpers']['media']['dailymotion'] = null;
|
77 |
+
\get_option( 'fancybox_enableInstagram' ) || $fb_opts['helpers']['media']['instagram'] = null;
|
78 |
+
\get_option( 'fancybox_enableGoogleMaps' ) || $fb_opts['helpers']['media']['google_maps'] = null;
|
79 |
+
}
|
80 |
+
|
81 |
+
$fb_opts = apply_filters( 'easy_fancybox_fb_opts', $fb_opts );
|
82 |
+
|
83 |
+
/**
|
84 |
+
* Build main handler.
|
85 |
+
*/
|
86 |
+
$fb_handler = 'function(){';
|
87 |
+
|
88 |
+
// Exclude.
|
89 |
+
$exclude = \get_option( 'fancybox_autoExclude', \easyFancyBox::$options['Global']['options']['Miscellaneous']['options']['autoExclude']['default'] );
|
90 |
+
$exclude_array = $exclude ? \explode( ',', $exclude ) : array();
|
91 |
+
$exclude_selectors = ! empty( $exclude_array ) ? \json_encode( $exclude_array ) : false;
|
92 |
+
|
93 |
+
$fb_handler .= $exclude_selectors ? PHP_EOL . 'jQuery(' . $exclude_selectors . '.join(\',\')).addClass(\'nofancybox\');' : '';
|
94 |
+
|
95 |
+
// Close link.
|
96 |
+
$fb_handler .= PHP_EOL . 'jQuery(\'a.fancybox-close\').on(\'click\',function(e){e.preventDefault();jQuery.fancybox.close()});';
|
97 |
+
|
98 |
+
foreach ( \easyFancyBox::$options as $key => $value ) {
|
99 |
+
// Check if not enabled or hide=true then skip.
|
100 |
+
if ( isset( $value['hide'] ) || ! isset( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'] ) || ! \get_option( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'], \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['default'] ) )
|
101 |
+
continue;
|
102 |
+
|
103 |
+
$fb_handler .= '
|
104 |
+
/* ' . $key . ' */';
|
105 |
+
|
106 |
+
/**
|
107 |
+
* Auto-detection routines (2x)
|
108 |
+
*/
|
109 |
+
$autoAttribute = isset( $value['options']['autoAttribute'] ) ? \get_option( $value['options']['autoAttribute']['id'], $value['options']['autoAttribute']['default'] ) : '';
|
110 |
+
|
111 |
+
if ( !empty($autoAttribute) ) {
|
112 |
+
if ( is_numeric($autoAttribute) ) {
|
113 |
+
$fb_handler .= '
|
114 |
+
jQuery('.$value['options']['autoAttribute']['selector'].').not(\'.nofancybox,li.nofancybox>a\').addClass(\''.$value['options']['class']['default'].'\');';
|
115 |
+
} else {
|
116 |
+
// Set selectors.
|
117 |
+
$file_types = array_filter( explode( ',', str_replace( ' ', ',', $autoAttribute ) ) );
|
118 |
+
$more = 0;
|
119 |
+
$fb_handler .= '
|
120 |
+
var fb_'.$key.'_select=\'';
|
121 |
+
foreach ( $file_types as $type ) {
|
122 |
+
if ($type == "jpg" || $type == "jpeg" || $type == "png" || $type == "webp" || $type == "gif")
|
123 |
+
$type = '.'.$type;
|
124 |
+
if ($more>0)
|
125 |
+
$fb_handler .= ',';
|
126 |
+
$fb_handler .= 'a['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox,li.nofancybox>a),area['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox)';
|
127 |
+
$more++;
|
128 |
+
}
|
129 |
+
$fb_handler .= '\';';
|
130 |
+
|
131 |
+
$autoselector = class_exists('easyFancyBox_Advanced') ? \get_option($value['options']['autoSelector']['id'],$value['options']['autoSelector']['default']) : $value['options']['autoSelector']['default'];
|
132 |
+
|
133 |
+
// Class and rel depending on settings.
|
134 |
+
if( '1' == \get_option($value['options']['autoAttributeLimit']['id'],$value['options']['autoAttributeLimit']['default']) ) {
|
135 |
+
// Add class.
|
136 |
+
$fb_handler .= '
|
137 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
138 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
139 |
+
// Set rel.
|
140 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
141 |
+
case '':
|
142 |
+
default :
|
143 |
+
$fb_handler .= ';});';
|
144 |
+
break;
|
145 |
+
|
146 |
+
case '1':
|
147 |
+
$fb_handler .= '.attr(\'data-fancybox-group\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
148 |
+
break;
|
149 |
+
|
150 |
+
case '2':
|
151 |
+
$fb_handler .= '.attr(\'data-fancybox-group\',\'gallery\');});';
|
152 |
+
break;
|
153 |
+
}
|
154 |
+
} else {
|
155 |
+
// Add class.
|
156 |
+
$fb_handler .= '
|
157 |
+
jQuery(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
158 |
+
// Set rel.
|
159 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
160 |
+
case '':
|
161 |
+
default :
|
162 |
+
$fb_handler .= ';';
|
163 |
+
break;
|
164 |
+
|
165 |
+
case '1':
|
166 |
+
$fb_handler .= ';
|
167 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
168 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).attr(\'data-fancybox-group\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
169 |
+
break;
|
170 |
+
|
171 |
+
case '2':
|
172 |
+
$fb_handler .= '.attr(\'data-fancybox-group\',\'gallery\');';
|
173 |
+
break;
|
174 |
+
}
|
175 |
+
}
|
176 |
+
}
|
177 |
+
}
|
178 |
+
|
179 |
+
// Prepare auto popup.
|
180 |
+
$trigger = $key == $autoClick ? $value['options']['class']['default'] : '';
|
181 |
+
|
182 |
+
/**
|
183 |
+
* Generate .fancybox() bind.
|
184 |
+
*/
|
185 |
+
|
186 |
+
$bind_parameters = array();
|
187 |
+
foreach ( $value['options'] as $_key => $_value ) {
|
188 |
+
// Treat some known keys differently
|
189 |
+
$convert_to = array(
|
190 |
+
'easingIn' => 'openEasing',
|
191 |
+
'easingOut' => 'closeEasing',
|
192 |
+
);
|
193 |
+
if ( array_key_exists ( $_key, $convert_to ) ) {
|
194 |
+
$_key = $convert_to[$_key];
|
195 |
+
}
|
196 |
+
|
197 |
+
if ( isset($_value['id']) || isset($_value['default']) )
|
198 |
+
$parm = ! empty($_value['id']) ? strval( \get_option($_value['id'], isset($_value['default']) ? $_value['default'] : '' ) ) : strval( $_value['default'] );
|
199 |
+
else
|
200 |
+
$parm = '';
|
201 |
+
|
202 |
+
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
203 |
+
$parm = ( '1' == $parm ) ? true : false;
|
204 |
+
|
205 |
+
if ( ! isset($_value['hide']) && $parm !== '' ) {
|
206 |
+
$bind_parameters[$_key] = $parm;
|
207 |
+
}
|
208 |
+
}
|
209 |
+
|
210 |
+
// Title.
|
211 |
+
if ( isset( $value['options']['titleShow'] ) && ! empty( $value['options']['titleShow']['id'] ) && \get_option( $value['options']['titleShow']['id'] ) ) {
|
212 |
+
$bind_parameters['helpers'] = array( 'title' => array() );
|
213 |
+
/*if ( isset( $value['options']['titleType'] ) && \get_option( $value['options']['titleType']['id'] ) ) {
|
214 |
+
$bind_parameters['helpers']['title']['type'] = \esc_attr( \get_option( $value['options']['titleType']['id'] ) );
|
215 |
+
}*/
|
216 |
+
if ( isset( $value['options']['titlePosition'] ) ) {
|
217 |
+
$position = \get_option( $value['options']['titlePosition']['id'], $value['options']['titlePosition']['default'] );
|
218 |
+
$title = explode( '-', $position );
|
219 |
+
if ( ! empty( $title ) ) {
|
220 |
+
$bind_parameters['helpers']['title']['type'] = $title[0];
|
221 |
+
isset( $title[1] ) && $bind_parameters['helpers']['title']['position'] = $title[1];
|
222 |
+
}
|
223 |
+
}
|
224 |
+
if ( isset( $value['options']['titleFromAlt'] ) && \get_option( $value['options']['titleFromAlt']['id'] ) ) {
|
225 |
+
$bind_parameters['beforeShow'] = '{{titleFromAlt}}'; //;
|
226 |
+
}
|
227 |
+
} else {
|
228 |
+
$bind_parameters['helpers'] = array( 'title' => null );
|
229 |
+
}
|
230 |
+
|
231 |
+
// Iframe
|
232 |
+
if ( isset( $value['options']['allowFullScreen'] ) && ! \get_option( $value['options']['allowFullScreen']['id'], $value['options']['allowFullScreen']['default'] ) ) {
|
233 |
+
$bind_parameters['iframe'] = array( 'allowfullscreen' => false ); //;
|
234 |
+
}
|
235 |
+
|
236 |
+
// Keys.
|
237 |
+
if ( isset( $value['options']['enableKeyboardNav'] ) && ! empty( $value['options']['enableKeyboardNav']['id'] ) && ! \get_option( $value['options']['enableKeyboardNav']['id'], true ) ) {
|
238 |
+
$bind_parameters['keys'] = array( 'next' => null, 'prev' => null );
|
239 |
+
}
|
240 |
+
|
241 |
+
// Cyclic.
|
242 |
+
if ( isset( $value['options']['loop'] ) && ! empty( $value['options']['loop']['id'] ) && ! \get_option( $value['options']['loop']['id'] ) ) {
|
243 |
+
$bind_parameters['loop'] = false;
|
244 |
+
}
|
245 |
+
|
246 |
+
$fb_handler .= PHP_EOL . 'jQuery(\'' . $value['options']['tag']['default'] . '\').fancybox(jQuery.extend(true,{},fb_opts,' . \json_encode( $bind_parameters, JSON_NUMERIC_CHECK ) . '));';
|
247 |
+
}
|
248 |
+
|
249 |
+
$fb_handler .= '};';
|
250 |
+
|
251 |
+
// Replace TitleFromAlt shortcode.
|
252 |
+
$fb_handler = str_replace( '"{{titleFromAlt}}"', 'function(){var alt=this.element.find(\'img\').attr(\'alt\');this.inner.find(\'img\').attr(\'alt\',alt);this.title=this.title||alt;}', $fb_handler );
|
253 |
+
|
254 |
+
// Replace PDF embed shortcodes.
|
255 |
+
if ( ! empty( get_option('fancybox_enablePDF') ) && ! empty( get_option('fancybox_PDFonStart', '{{object}}') ) ) {
|
256 |
+
$replaces = array(
|
257 |
+
'"{{object}}"' => 'function(){this.type=\'html\';this.content=\'<object data="\'+this.href+\'" type="application/pdf" height="\'+this.width+\'" width="\'+this.height+\'" aria-label="\'+this.title+\'" />\'}',
|
258 |
+
'"{{embed}}"' => 'function(){this.type=\'html\';this.autoSize=false;this.content=\'<embed src="\'+this.href+\'" type="application/pdf" height="\'+this.width+\'" width="\'+this.height+\'" aria-label="\'+this.title+\'" />\'}',
|
259 |
+
'"{{googleviewer}}"' => 'function(){this.href=\'https://docs.google.com/viewer?embedded=true&url=\'+this.href;}'
|
260 |
+
);
|
261 |
+
foreach ($replaces as $short => $replace) {
|
262 |
+
$fb_handler = str_replace( $short, $replace, $fb_handler );
|
263 |
+
}
|
264 |
+
}
|
265 |
+
|
266 |
+
// Build script.
|
267 |
+
$script = 'var fb_timeout,fb_opts=' . \json_encode( $fb_opts, JSON_NUMERIC_CHECK ) . ',' . PHP_EOL .
|
268 |
+
'easy_fancybox_handler=easy_fancybox_handler||' . $fb_handler . '' . PHP_EOL;
|
269 |
+
|
270 |
+
if ( empty( $delayClick ) ) $delayClick = '0';
|
271 |
+
|
272 |
+
switch ( $autoClick ) {
|
273 |
+
case '':
|
274 |
+
break;
|
275 |
+
|
276 |
+
case '1':
|
277 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a#fancybox-auto,#fancybox-auto>a\').first().trigger(\'click\')},'.$delayClick.');};';
|
278 |
+
\easyFancyBox::$onready_auto = true;
|
279 |
+
break;
|
280 |
+
|
281 |
+
case '2':
|
282 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){if(location.hash){jQuery(location.hash).trigger(\'click\');}},'.$delayClick.');};';
|
283 |
+
\easyFancyBox::$onready_auto = true;
|
284 |
+
break;
|
285 |
+
|
286 |
+
case '99':
|
287 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class|="fancybox"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
288 |
+
\easyFancyBox::$onready_auto = true;
|
289 |
+
break;
|
290 |
+
|
291 |
+
default :
|
292 |
+
if ( ! empty( $trigger ) ) {
|
293 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class*="'.$trigger.'"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
294 |
+
\easyFancyBox::$onready_auto = true;
|
295 |
+
}
|
296 |
+
}
|
297 |
+
|
298 |
+
$script .= 'jQuery(easy_fancybox_handler);jQuery(document).on(\'' . implode( " ", \easyFancyBox::$events ) . '\',easy_fancybox_handler);' . PHP_EOL;
|
299 |
+
|
300 |
+
if ( \easyFancyBox::$onready_auto ) {
|
301 |
+
$script .= \apply_filters( 'easy_fancybox_onready_auto', 'jQuery(easy_fancybox_auto);' );
|
302 |
+
}
|
303 |
+
|
304 |
+
$script = \apply_filters( 'easy_fancybox_inline_script', $script );
|
305 |
+
|
306 |
+
\easyFancyBox::$inline_scripts['jquery-fancybox'] = array(
|
307 |
+
'data' => $script,
|
308 |
+
'position' => 'after'
|
309 |
+
);
|
310 |
+
}
|
311 |
+
|
312 |
+
function prepare_inline_styles() {
|
313 |
+
$styles = '';
|
314 |
+
|
315 |
+
$backgroundColor = get_option( 'fancybox_backgroundColor' );
|
316 |
+
$textColor = get_option( 'fancybox_textColor' );
|
317 |
+
$borderRadius = get_option( 'fancybox_borderRadius' );
|
318 |
+
$paddingColor = get_option( 'fancybox_paddingColor' );
|
319 |
+
$overlaySpotlight = get_option( 'fancybox_overlaySpotlight' );
|
320 |
+
$titleColor = get_option( 'fancybox_titleColor' );
|
321 |
+
|
322 |
+
// Content styles.
|
323 |
+
$content_style = '';
|
324 |
+
empty( $backgroundColor ) || $content_style .= 'background:'.$backgroundColor.';';
|
325 |
+
empty( $textColor ) || $content_style .= 'color:'.$textColor.';';
|
326 |
+
|
327 |
+
// Skin styles.
|
328 |
+
$skin_style = '';
|
329 |
+
empty( $borderRadius ) || $skin_style .= 'border-radius:'.$borderRadius.'px;';
|
330 |
+
empty( $paddingColor ) || $skin_style .= 'background:'.$paddingColor.';';
|
331 |
+
|
332 |
+
// Overlay.
|
333 |
+
empty( $overlaySpotlight ) || $styles .= '.fancybox-overlay{background-image:url("' . \easyFancyBox::$plugin_url . 'images/light-mask.png")!important;background-repeat:no-repeat!important;background-size:100% 100% !important}';
|
334 |
+
// Content.
|
335 |
+
empty( $content_style ) || $styles .= '.fancybox-inner{'.$content_style.'}';
|
336 |
+
// Skin.
|
337 |
+
empty( $skin_style ) || $styles .= '.fancybox-skin{'.$skin_style.'}';
|
338 |
+
// Title.
|
339 |
+
empty( $titleColor ) || $styles .= '.fancybox-title{color:'.$titleColor.'}';
|
340 |
+
|
341 |
+
$styles = \apply_filters( 'easy_fancybox_inline_style', $styles );
|
342 |
+
|
343 |
+
\easyFancyBox::$inline_styles['fancybox'] = \wp_strip_all_tags( $styles, true );
|
344 |
+
}
|
345 |
+
|
346 |
+
function add_media() {
|
347 |
+
static $add;
|
348 |
+
|
349 |
+
if ( null === $add ) {
|
350 |
+
$add = \get_option( 'fancybox_enableYoutube' ) ||
|
351 |
+
\get_option( 'fancybox_enableVimeo' ) ||
|
352 |
+
\get_option( 'fancybox_enableDailymotion' ) ||
|
353 |
+
\get_option( 'fancybox_enableInstagram' ) ||
|
354 |
+
\get_option( 'fancybox_enableGoogleMaps' );
|
355 |
+
}
|
356 |
+
|
357 |
+
return $add;
|
358 |
+
}
|
359 |
+
|
360 |
+
function add_thumbs() {
|
361 |
+
static $add;
|
362 |
+
|
363 |
+
if ( null === $add ) {
|
364 |
+
$add = apply_filters( 'easy_fancybox_add_thumbs', false );
|
365 |
+
}
|
366 |
+
|
367 |
+
return $add;
|
368 |
+
}
|
369 |
+
|
370 |
+
function add_buttons() {
|
371 |
+
static $add;
|
372 |
+
|
373 |
+
if ( null === $add ) {
|
374 |
+
$add = apply_filters( 'easy_fancybox_add_thumbs', false );;
|
375 |
+
}
|
376 |
+
|
377 |
+
return $add;
|
378 |
+
}
|
379 |
+
|
380 |
+
function add_easing() {
|
381 |
+
// Check IMG settings.
|
382 |
+
if ( \get_option( 'fancybox_enableImg', \easyFancyBox::$options['Global']['options']['Enable']['options']['IMG']['default'] ) &&
|
383 |
+
(
|
384 |
+
( 'linear' !== \get_option( 'fancybox_easingIn', '' ) && '' !== \get_option( 'fancybox_easingIn', '' ) ) ||
|
385 |
+
( 'linear' !== \get_option( 'fancybox_easingOut', '' ) && '' !== \get_option( 'fancybox_easingOut', '' ) )
|
386 |
+
)
|
387 |
+
) {
|
388 |
+
return true;
|
389 |
+
}
|
390 |
+
|
391 |
+
// Check Inline Content settings.
|
392 |
+
if ( \get_option( 'fancybox_enableInline', false ) &&
|
393 |
+
(
|
394 |
+
( 'linear' !== \get_option( 'fancybox_easingInInline', '' ) && '' !== \get_option( 'fancybox_easingInInline', '' ) ) ||
|
395 |
+
( 'linear' !== \get_option( 'fancybox_easingOutInline', '' ) && '' !== \get_option( 'fancybox_easingOutInline', '' ) )
|
396 |
+
)
|
397 |
+
) {
|
398 |
+
return true;
|
399 |
+
}
|
400 |
+
|
401 |
+
return false;
|
402 |
+
}
|
403 |
+
|
404 |
+
/**
|
405 |
+
* ACTIONS & FILTERS
|
406 |
+
*/
|
407 |
+
|
408 |
+
function prepare_scripts_styles() {
|
409 |
+
// Make sure whe actually need to do anything.
|
410 |
+
if ( ! \easyFancyBox::add_scripts() ){
|
411 |
+
return;
|
412 |
+
}
|
413 |
+
|
414 |
+
// INLINE SCRIPT & STYLE
|
415 |
+
prepare_inline_scripts();
|
416 |
+
prepare_inline_styles();
|
417 |
+
|
418 |
+
// SCRIPT & STYLE URLS
|
419 |
+
|
420 |
+
$dep = get_option( 'fancybox_nojQuery', false ) ? array() : array( 'jquery' );
|
421 |
+
$ver = defined( 'WP_DEBUG' ) && WP_DEBUG ? time() : false;
|
422 |
+
$min = defined( 'WP_DEBUG' ) && WP_DEBUG ? '' : '.min';
|
423 |
+
$footer = get_option( 'fancybox_noFooter', false ) ? false : true;
|
424 |
+
|
425 |
+
// https://cdnjs.com/libraries/fancybox
|
426 |
+
|
427 |
+
// FancyBox.
|
428 |
+
\easyFancyBox::$styles['fancybox'] = array(
|
429 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/jquery.fancybox'.$min.'.css',
|
430 |
+
'deps' => array(),
|
431 |
+
'ver' => $ver,
|
432 |
+
'media' => 'screen'
|
433 |
+
);
|
434 |
+
\easyFancyBox::$scripts['jquery-fancybox'] = array(
|
435 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/jquery.fancybox'.$min.'.js',
|
436 |
+
'deps' => $dep,
|
437 |
+
'ver' => $ver,
|
438 |
+
'footer' => $footer
|
439 |
+
);
|
440 |
+
|
441 |
+
// Fancybox Media Helpers.
|
442 |
+
if ( add_media() ) {
|
443 |
+
\easyFancyBox::$scripts['jquery-fancybox-media'] = array(
|
444 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/helpers/jquery.fancybox-media'.$min.'.js',
|
445 |
+
'deps' => array('jquery-fancybox'),
|
446 |
+
'ver' => $ver,
|
447 |
+
'footer' => $footer
|
448 |
+
);
|
449 |
+
}
|
450 |
+
|
451 |
+
// Fancybox Thumbs Helpers.
|
452 |
+
if ( add_thumbs() ) {
|
453 |
+
\easyFancyBox::$styles['fancybox-thumbs'] = array(
|
454 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/helpers/jquery.fancybox-thumbs'.$min.'.css',
|
455 |
+
'deps' => array('fancybox'),
|
456 |
+
'ver' => $ver,
|
457 |
+
'media' => 'screen'
|
458 |
+
);
|
459 |
+
\easyFancyBox::$scripts['jquery-fancybox-thumbs'] = array(
|
460 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/helpers/jquery.fancybox-thumbs'.$min.'.js',
|
461 |
+
'deps' => array('jquery-fancybox'),
|
462 |
+
'ver' => $ver,
|
463 |
+
'footer' => $footer
|
464 |
+
);
|
465 |
+
}
|
466 |
+
|
467 |
+
// Fancybox Buttons Helpers.
|
468 |
+
if ( add_thumbs() ) {
|
469 |
+
\easyFancyBox::$styles['fancybox-buttons'] = array(
|
470 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/helpers/jquery.fancybox-buttons'.$min.'.css',
|
471 |
+
'deps' => array('fancybox'),
|
472 |
+
'ver' => $ver,
|
473 |
+
'media' => 'screen'
|
474 |
+
);
|
475 |
+
\easyFancyBox::$scripts['jquery-fancybox-buttons'] = array(
|
476 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['fancyBox2'].'/helpers/jquery.fancybox-buttons'.$min.'.js',
|
477 |
+
'deps' => array('jquery-fancybox'),
|
478 |
+
'ver' => $ver,
|
479 |
+
'footer' => $footer
|
480 |
+
);
|
481 |
+
}
|
482 |
+
|
483 |
+
// jQuery Easing, which is not needed if Easing is set to swing or linear.
|
484 |
+
if ( add_easing() ) {
|
485 |
+
\easyFancyBox::$easing_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.easing.min.js';
|
486 |
+
}
|
487 |
+
|
488 |
+
// jQuery Mousewheel, which is not needed if jQueryUI Mouse is loaded or when using fancyBox 3.
|
489 |
+
if ( \get_option( 'fancybox_mouseWheel', true ) ) {
|
490 |
+
\easyFancyBox::$mousewheel_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.mousewheel.min.js';
|
491 |
+
}
|
492 |
+
|
493 |
+
// Metadata in Miscellaneous settings?
|
494 |
+
if ( \get_option( 'fancybox_metaData' ) ) {
|
495 |
+
\easyFancyBox::$scripts['jquery-metadata'] = array(
|
496 |
+
'src' => \easyFancyBox::$plugin_url.'vendor/jquery.metadata.min.js',
|
497 |
+
'deps' => $dep,
|
498 |
+
'ver' => METADATA_VERSION,
|
499 |
+
'footer' => $footer
|
500 |
+
);
|
501 |
+
}
|
502 |
+
}
|
503 |
+
\add_action( 'init', __NAMESPACE__.'\prepare_scripts_styles', 12 );
|
inc/fancybox-classic-options.php
ADDED
@@ -0,0 +1,1479 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* FancyBox v1 options and their defaults array.
|
4 |
+
*/
|
5 |
+
|
6 |
+
$efb_options = array (
|
7 |
+
'Global' => array (
|
8 |
+
'backwardcompatible' => true, // Marks older Pro version compatibility.
|
9 |
+
'input' => 'deep',
|
10 |
+
'hide' => true,
|
11 |
+
'options' => array(
|
12 |
+
'Enable' => array (
|
13 |
+
'title' => esc_html__('Media','easy-fancybox'),
|
14 |
+
'input' => 'multiple',
|
15 |
+
'hide' => true,
|
16 |
+
'options' => array(
|
17 |
+
'p1' => array (
|
18 |
+
'hide' => true,
|
19 |
+
'description' => esc_html__('Enable FancyBox for','easy-fancybox') . '<br />'
|
20 |
+
),
|
21 |
+
'IMG' => array (
|
22 |
+
'id' => 'fancybox_enableImg',
|
23 |
+
'input' => 'checkbox',
|
24 |
+
'hide' => true,
|
25 |
+
'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network( EASY_FANCYBOX_BASENAME ) ) ? '' : '1',
|
26 |
+
'description' => '<strong>' . esc_html__( 'Images', 'easy-fancybox' ) . '</strong>' . ( get_option('fancybox_enableImg') ? ' — <a href="#IMG">' . translate( 'Settings' ) . '</a>' : '' )
|
27 |
+
),
|
28 |
+
'Inline' => array (
|
29 |
+
'id' => 'fancybox_enableInline',
|
30 |
+
'input' => 'checkbox',
|
31 |
+
'hide' => true,
|
32 |
+
'default' => '',
|
33 |
+
'description' => '<strong>' . esc_html__( 'Inline content', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableInline') ? ' — <a href="#Inline">' . translate( 'Settings' ) . '</a>' : '' )
|
34 |
+
),
|
35 |
+
'PDF' => array (
|
36 |
+
'id' => 'fancybox_enablePDF',
|
37 |
+
'input' => 'checkbox',
|
38 |
+
'hide' => true,
|
39 |
+
'default' => '',
|
40 |
+
'description' => '<strong>' . esc_html__( 'PDF', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enablePDF') ? ' — <a href="#PDF">' . translate( 'Settings' ) . '</a>' : '' )
|
41 |
+
),
|
42 |
+
'SVG' => array (
|
43 |
+
'id' => 'fancybox_enableSVG',
|
44 |
+
'input' => 'checkbox',
|
45 |
+
'hide' => true,
|
46 |
+
'default' => '',
|
47 |
+
'description' => '<strong>' . esc_html__( 'SVG', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableSVG') ? ' — <a href="#SVG">' . translate( 'Settings' ) . '</a>' : '' )
|
48 |
+
),
|
49 |
+
'VideoPress' => array (
|
50 |
+
'id' => '',
|
51 |
+
'input' => 'checkbox',
|
52 |
+
'hide' => true,
|
53 |
+
'default' => '',
|
54 |
+
'status' => 'disabled',
|
55 |
+
'description' => '<strong>' . esc_html__( 'VideoPress', 'easy-fancybox' ) . '</strong>' . ' ' . '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
56 |
+
),
|
57 |
+
'YouTube' => array (
|
58 |
+
'id' => 'fancybox_enableYoutube',
|
59 |
+
'input' => 'checkbox',
|
60 |
+
'hide' => true,
|
61 |
+
'default' => '',
|
62 |
+
'description' => '<strong>' . esc_html__( 'YouTube', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableYouTube') ? ' — <a href="#YouTube">' . translate( 'Settings' ) . '</a>' : '' )
|
63 |
+
),
|
64 |
+
'Vimeo' => array (
|
65 |
+
'id' => 'fancybox_enableVimeo',
|
66 |
+
'input' => 'checkbox',
|
67 |
+
'hide' => true,
|
68 |
+
'default' => '',
|
69 |
+
'description' => '<strong>' . esc_html__( 'Vimeo', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableVimeo') ? ' — <a href="#Vimeo">' . translate( 'Settings' ) . '</a>' : '' )
|
70 |
+
),
|
71 |
+
'Dailymotion' => array (
|
72 |
+
'id' => 'fancybox_enableDailymotion',
|
73 |
+
'input' => 'checkbox',
|
74 |
+
'hide' => true,
|
75 |
+
'default' => '',
|
76 |
+
'description' => '<strong>' . esc_html__( 'Dailymotion', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableDailymotion') ? ' — <a href="#Dailymotion">' . translate( 'Settings' ) . '</a>' : '' )
|
77 |
+
),
|
78 |
+
'iFrame' => array (
|
79 |
+
'id' => 'fancybox_enableiFrame',
|
80 |
+
'input' => 'checkbox',
|
81 |
+
'hide' => true,
|
82 |
+
'default' => '',
|
83 |
+
'description' => '<strong>' . esc_html__('iFrames','easy-fancybox') . '</strong>' . '</strong>' . ( get_option('fancybox_enableiFrame') ? ' — <a href="#iFrame">' . translate( 'Settings' ) . '</a>' : '' )
|
84 |
+
)
|
85 |
+
),
|
86 |
+
'description' => ''
|
87 |
+
),
|
88 |
+
'Overlay' => array (
|
89 |
+
'title' => esc_html__('Overlay','easy-fancybox'),
|
90 |
+
'input' => 'multiple',
|
91 |
+
'hide' => true,
|
92 |
+
'options' => array(
|
93 |
+
'overlayShow' => array (
|
94 |
+
'id' => 'fancybox_overlayShow',
|
95 |
+
'input' => 'checkbox',
|
96 |
+
'noquotes' => true,
|
97 |
+
'default' => '1',
|
98 |
+
'description' => esc_html__('Show the overlay around content opened in FancyBox.','easy-fancybox')
|
99 |
+
),
|
100 |
+
'hideOnOverlayClick' => array (
|
101 |
+
'id' => 'fancybox_hideOnOverlayClick',
|
102 |
+
'input' => 'checkbox',
|
103 |
+
'noquotes' => true,
|
104 |
+
'default' => '1',
|
105 |
+
'description' => esc_html__('Close FancyBox when overlay is clicked.','easy-fancybox')
|
106 |
+
),
|
107 |
+
'overlayOpacity' => array (
|
108 |
+
'id' => 'fancybox_overlayOpacity',
|
109 |
+
'title' => esc_html__('Opacity','easy-fancybox'),
|
110 |
+
'label_for' => 'fancybox_overlayOpacity',
|
111 |
+
'input' => 'number',
|
112 |
+
'step' => '0.1',
|
113 |
+
'min' => '0',
|
114 |
+
'max' => '1',
|
115 |
+
'class' => 'small-text',
|
116 |
+
'default' => '',
|
117 |
+
'description' => esc_html__('Value between 0 and 1. ','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 0.7</em><br />'
|
118 |
+
),
|
119 |
+
'overlayColor' => array (
|
120 |
+
'id' => 'fancybox_overlayColor',
|
121 |
+
'title' => esc_html__('Color','easy-fancybox'),
|
122 |
+
'label_for' => 'fancybox_overlayColor',
|
123 |
+
'input' => 'text',
|
124 |
+
'sanitize_callback' => 'colorval',
|
125 |
+
'class' => 'small-text',
|
126 |
+
'default' => '',
|
127 |
+
'description' => esc_html__('Enter an HTML color value.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' #777</em><br />'
|
128 |
+
),
|
129 |
+
'overlaySpotlight' => array (
|
130 |
+
'id' => 'fancybox_overlaySpotlight',
|
131 |
+
'input' => 'checkbox',
|
132 |
+
'hide' => true,
|
133 |
+
'status' => get_option('fancybox_overlaySpotlight') ? '' : 'disabled',
|
134 |
+
'default' => '',
|
135 |
+
'description' => esc_html__('Spotlight effect','easy-fancybox') . ( get_option('fancybox_overlaySpotlight') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
136 |
+
)
|
137 |
+
)
|
138 |
+
),
|
139 |
+
'Window' => array (
|
140 |
+
'title' => esc_html__('Window','easy-fancybox'),
|
141 |
+
'input' => 'multiple',
|
142 |
+
'hide' => true,
|
143 |
+
'options' => array(
|
144 |
+
'p1' => array (
|
145 |
+
'hide' => true,
|
146 |
+
'description' => '<strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
147 |
+
),
|
148 |
+
'showCloseButton' => array (
|
149 |
+
'id' => 'fancybox_showCloseButton',
|
150 |
+
'input' => 'checkbox',
|
151 |
+
'noquotes' => true,
|
152 |
+
'default' => '1',
|
153 |
+
'description' => esc_html__('Show the (X) close button','easy-fancybox')
|
154 |
+
),
|
155 |
+
'backgroundColor' => array (
|
156 |
+
'id' => 'fancybox_backgroundColor',
|
157 |
+
'hide' => true,
|
158 |
+
'title' => esc_html__('Background color','easy-fancybox'),
|
159 |
+
'label_for' => 'fancybox_backgroundColor',
|
160 |
+
'input' => 'text',
|
161 |
+
'sanitize_callback' => 'colorval',
|
162 |
+
'status' => 'disabled',
|
163 |
+
'class' => 'small-text',
|
164 |
+
'default' => '',
|
165 |
+
'description' => ''
|
166 |
+
),
|
167 |
+
'textColor' => array (
|
168 |
+
'id' => 'fancybox_textColor',
|
169 |
+
'hide' => true,
|
170 |
+
'title' => esc_html__('Text color','easy-fancybox'),
|
171 |
+
'label_for' => 'fancybox_textColor',
|
172 |
+
'input' => 'text',
|
173 |
+
'sanitize_callback' => 'colorval',
|
174 |
+
'status' => 'disabled',
|
175 |
+
'class' => 'small-text',
|
176 |
+
'default' => '',
|
177 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
178 |
+
),
|
179 |
+
'titleColor' => array (
|
180 |
+
'id' => 'fancybox_titleColor',
|
181 |
+
'hide' => true,
|
182 |
+
'title' => esc_html__('Title color','easy-fancybox'),
|
183 |
+
'label_for' => 'fancybox_titleColor',
|
184 |
+
'input' => 'text',
|
185 |
+
'sanitize_callback' => 'colorval',
|
186 |
+
'class' => 'small-text',
|
187 |
+
'default' => '',
|
188 |
+
'description' => ''
|
189 |
+
),
|
190 |
+
'paddingColor' => array (
|
191 |
+
'id' => 'fancybox_paddingColor',
|
192 |
+
'hide' => true,
|
193 |
+
'title' => esc_html__('Border color','easy-fancybox'),
|
194 |
+
'label_for' => 'fancybox_paddingColor',
|
195 |
+
'input' => 'text',
|
196 |
+
'sanitize_callback' => 'colorval',
|
197 |
+
'class' => 'small-text',
|
198 |
+
'default' => '',
|
199 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' #000 x #fff</em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Use RGBA notation for semi-transparent borders.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' rgba(10,10,30,0.7)</em><br />'
|
200 |
+
),
|
201 |
+
'borderRadius' => array (
|
202 |
+
'id' => 'fancybox_borderRadius',
|
203 |
+
'hide' => true,
|
204 |
+
'title' => esc_html__('Border radius','easy-fancybox'),
|
205 |
+
'label_for' => 'fancybox_borderRadius',
|
206 |
+
'input' => 'number',
|
207 |
+
'step' => '1',
|
208 |
+
'min' => '0',
|
209 |
+
'max' => '99',
|
210 |
+
'sanitize_callback' => 'intval',
|
211 |
+
'status' => 'disabled',
|
212 |
+
'class' => 'small-text',
|
213 |
+
'default' => '',
|
214 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
215 |
+
),
|
216 |
+
|
217 |
+
'p11' => array (
|
218 |
+
'hide' => true,
|
219 |
+
'description' => '<br /><strong>' . esc_html__('Dimensions','easy-fancybox') . '</strong><br />'
|
220 |
+
),
|
221 |
+
'width' => array (
|
222 |
+
'id' => 'fancybox_width',
|
223 |
+
'title' => translate('Width'),
|
224 |
+
'label_for' => 'fancybox_width',
|
225 |
+
'input' => 'text',
|
226 |
+
'sanitize_callback' => 'intval',
|
227 |
+
'class' => 'small-text',
|
228 |
+
'default' => '',
|
229 |
+
'description' => ' '
|
230 |
+
),
|
231 |
+
'height' => array (
|
232 |
+
'id' => 'fancybox_height',
|
233 |
+
'title' => translate('Height'),
|
234 |
+
'label_for' => 'fancybox_height',
|
235 |
+
'input' => 'text',
|
236 |
+
'sanitize_callback' => 'intval',
|
237 |
+
'class' => 'small-text',
|
238 |
+
'default' => '',
|
239 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 560 x 340</em><br />' . esc_html__('If content size is not set or cannot be determined automatically, these default dimensions will be used.','easy-fancybox') . '<br />'
|
240 |
+
),
|
241 |
+
'padding' => array (
|
242 |
+
'id' => 'fancybox_padding',
|
243 |
+
'title' => translate('Border'),
|
244 |
+
'label_for' => 'fancybox_padding',
|
245 |
+
'input' => 'number',
|
246 |
+
'step' => '1',
|
247 |
+
'min' => '0',
|
248 |
+
'max' => '100',
|
249 |
+
'sanitize_callback' => 'intval',
|
250 |
+
'class' => 'small-text',
|
251 |
+
'default' => '',
|
252 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 10</em><br />'
|
253 |
+
),
|
254 |
+
'margin' => array (
|
255 |
+
'id' => 'fancybox_margin',
|
256 |
+
'title' => esc_html__('Margin','easy-fancybox'),
|
257 |
+
'label_for' => 'fancybox_margin',
|
258 |
+
'input' => 'number',
|
259 |
+
'step' => '1',
|
260 |
+
'min' => '20',
|
261 |
+
'max' => '80',
|
262 |
+
'sanitize_callback' => 'intval',
|
263 |
+
'class' => 'small-text',
|
264 |
+
'default' => '20',
|
265 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 40</em><br />'
|
266 |
+
),
|
267 |
+
|
268 |
+
'p2' => array (
|
269 |
+
'hide' => true,
|
270 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
271 |
+
),
|
272 |
+
'enableEscapeButton' => array (
|
273 |
+
'id' => 'fancybox_enableEscapeButton',
|
274 |
+
'input' => 'checkbox',
|
275 |
+
'noquotes' => true,
|
276 |
+
'default' => '1',
|
277 |
+
'description' => esc_html__('Esc key stroke closes FancyBox','easy-fancybox')
|
278 |
+
),
|
279 |
+
'autoScale' => array (
|
280 |
+
'id' => 'fancybox_autoScale',
|
281 |
+
'input' => 'checkbox',
|
282 |
+
'noquotes' => true,
|
283 |
+
'default' => '1',
|
284 |
+
'description' => esc_html__('Scale large content down to fit in the browser viewport.','easy-fancybox')
|
285 |
+
),
|
286 |
+
'speedIn' => array (
|
287 |
+
'id' => 'fancybox_speedIn',
|
288 |
+
'title' => esc_html__('Opening speed','easy-fancybox'),
|
289 |
+
'label_for' => 'fancybox_speedIn',
|
290 |
+
'input' => 'number',
|
291 |
+
'step' => '100',
|
292 |
+
'min' => '0',
|
293 |
+
'max' => '6000',
|
294 |
+
'sanitize_callback' => 'intval',
|
295 |
+
'class' => 'small-text',
|
296 |
+
'default' => '',
|
297 |
+
),
|
298 |
+
'speedOut' => array (
|
299 |
+
'id' => 'fancybox_speedOut',
|
300 |
+
'title' => esc_html__('Closing speed','easy-fancybox'),
|
301 |
+
'label_for' => 'fancybox_speedOut',
|
302 |
+
'input' => 'number',
|
303 |
+
'step' => '100',
|
304 |
+
'min' => '0',
|
305 |
+
'max' => '6000',
|
306 |
+
'sanitize_callback' => 'intval',
|
307 |
+
'class' => 'small-text',
|
308 |
+
'default' => '',
|
309 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 300</em><br />'
|
310 |
+
),
|
311 |
+
'mouseWheel' => array (
|
312 |
+
'id' => 'fancybox_mouseWheel',
|
313 |
+
'hide' => true,
|
314 |
+
'input' => 'checkbox',
|
315 |
+
'default' => '',
|
316 |
+
'description' => esc_html__('Include the Mousewheel jQuery extension script to allow gallery browsing by mousewheel action.','easy-fancybox')
|
317 |
+
)
|
318 |
+
)
|
319 |
+
),
|
320 |
+
|
321 |
+
'Miscellaneous' => array (
|
322 |
+
'title' => esc_html__('Miscellaneous','easy-fancybox'),
|
323 |
+
'input' => 'multiple',
|
324 |
+
'hide' => true,
|
325 |
+
'options' => array(
|
326 |
+
'p0' => array (
|
327 |
+
'hide' => true,
|
328 |
+
'description' => '<strong>' . esc_html__('Auto popup','easy-fancybox') . '</strong><br />'
|
329 |
+
),
|
330 |
+
'autoClick' => array (
|
331 |
+
'id' => 'fancybox_autoClick',
|
332 |
+
'title' => esc_html__('Open on page load','easy-fancybox'),
|
333 |
+
'label_for' => 'fancybox_autoClick',
|
334 |
+
'hide' => true,
|
335 |
+
'input' => 'select',
|
336 |
+
'options' => array(
|
337 |
+
'' => translate('None'),
|
338 |
+
'1' => esc_html__('Link with ID "fancybox-auto"','easy-fancybox'),
|
339 |
+
),
|
340 |
+
'default' => '1',
|
341 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
342 |
+
),
|
343 |
+
'delayClick' => array (
|
344 |
+
'id' => 'fancybox_delayClick',
|
345 |
+
'title' => esc_html__('Delay in milliseconds','easy-fancybox'),
|
346 |
+
'label_for' => 'fancybox_delayClick',
|
347 |
+
'hide' => true,
|
348 |
+
'input' => 'number',
|
349 |
+
'step' => '100',
|
350 |
+
'min' => '0',
|
351 |
+
'max' => '',
|
352 |
+
'sanitize_callback' => 'intval',
|
353 |
+
'class' => 'small-text',
|
354 |
+
'default' => '1000',
|
355 |
+
'description' => ' <em>' . esc_html__('Default:','easy-fancybox') . ' 1000</em><br />'
|
356 |
+
),
|
357 |
+
'jqCookie' => array (
|
358 |
+
'id' => '',
|
359 |
+
'title' => esc_html__('Hide popup after first visit?','easy-fancybox'),
|
360 |
+
'hide' => true,
|
361 |
+
'input' => 'select',
|
362 |
+
'status' => 'disabled',
|
363 |
+
'default' => '0',
|
364 |
+
'sanitize_callback' => 'intval',
|
365 |
+
'options' => array(
|
366 |
+
'0' => translate('No'),
|
367 |
+
'1' => esc_html__('1 Day','easy-fancybox'),
|
368 |
+
'7' => esc_html__('1 Week','easy-fancybox'),
|
369 |
+
'30' => esc_html__('1 Month','easy-fancybox'),
|
370 |
+
'365' => esc_html__('1 Year','easy-fancybox')
|
371 |
+
),
|
372 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
373 |
+
),
|
374 |
+
'cookiePath' => array (
|
375 |
+
'id' => '',
|
376 |
+
'default' => '',
|
377 |
+
'hide' => true
|
378 |
+
),
|
379 |
+
'p1' => array (
|
380 |
+
'hide' => true,
|
381 |
+
'description' => '<br /><strong>' . esc_html__('Browser & device compatibility','easy-fancybox') . '</strong><br />'
|
382 |
+
),
|
383 |
+
'minViewportWidth' => array (
|
384 |
+
'id' => 'fancybox_minViewportWidth',
|
385 |
+
'title' => esc_html__('Minimum browser/device viewport width','easy-fancybox'),
|
386 |
+
'label_for' => 'fancybox_minViewportWidth',
|
387 |
+
'input' => 'number',
|
388 |
+
'step' => '1',
|
389 |
+
'min' => '320',
|
390 |
+
'max' => '900',
|
391 |
+
'sanitize_callback' => 'intval',
|
392 |
+
'class' => 'small-text',
|
393 |
+
'default' => '',
|
394 |
+
'description' => esc_html__('(leave empty to ignore)','easy-fancybox') . '<br/>'
|
395 |
+
),
|
396 |
+
/* 'forceNewtab' => array (
|
397 |
+
'id' => 'fancybox_forceNewtab',
|
398 |
+
'input' => 'checkbox',
|
399 |
+
'hide' => true,
|
400 |
+
'default' => '1',
|
401 |
+
'description' => esc_html__('Make media links open in a new tab when viewport falls below minimum width (above)','easy-fancybox')
|
402 |
+
),*/
|
403 |
+
'p2' => array (
|
404 |
+
'hide' => true,
|
405 |
+
'description' => '<br /><strong>' . esc_html__('Theme & plugins compatibility','easy-fancybox') . '</strong><br />'
|
406 |
+
. esc_html__('Try to deactivate all conflicting light box scripts in your theme or other plugins. If this is not possible, try a higher script priority number which means scripts are added later, wich may allow them to override conflicting scripts. A lower priority number, excluding WordPress standard jQuery, or even moving the plugin scripts to the header may work in cases where there are blocking errors occuring in other script.','easy-fancybox')
|
407 |
+
. '<br /><br />'
|
408 |
+
),
|
409 |
+
'scriptPriority' => array (
|
410 |
+
'id' => 'fancybox_scriptPriority',
|
411 |
+
'title' => esc_html__('FancyBox script priority','easy-fancybox'),
|
412 |
+
'label_for' => 'fancybox_scriptPriority',
|
413 |
+
'hide' => true,
|
414 |
+
'input' => 'number',
|
415 |
+
'step' => '1',
|
416 |
+
'min' => '-99',
|
417 |
+
'max' => '999',
|
418 |
+
'sanitize_callback' => 'intval',
|
419 |
+
'class' => 'small-text',
|
420 |
+
'default' => '10',
|
421 |
+
'description' => esc_html__('Default priority is 10.','easy-fancybox') . ' ' . esc_html__('Higher is later.','easy-fancybox') . '<br/>'
|
422 |
+
),
|
423 |
+
'noFooter' => array (
|
424 |
+
'id' => 'fancybox_noFooter',
|
425 |
+
'input' => 'checkbox',
|
426 |
+
'hide' => true,
|
427 |
+
'default' => '',
|
428 |
+
'description' => esc_html__('Move scripts from footer to theme head section (not recommended for site load times!)','easy-fancybox')
|
429 |
+
),
|
430 |
+
'nojQuery' => array (
|
431 |
+
'id' => 'fancybox_nojQuery',
|
432 |
+
'input' => 'checkbox',
|
433 |
+
'hide' => true,
|
434 |
+
'default' => '',
|
435 |
+
'description' => esc_html__('Do not include standard WordPress jQuery library (do this only if you are sure jQuery is included from another source!)','easy-fancybox')
|
436 |
+
),
|
437 |
+
'pre45Compat' => array (
|
438 |
+
'id' => 'fancybox_pre45Compat',
|
439 |
+
'input' => 'checkbox',
|
440 |
+
'hide' => true,
|
441 |
+
'default' => function_exists( 'wp_add_inline_script' ) ? '' : '1',
|
442 |
+
'description' => esc_html__('Do not use wp_add_inline_script/style functions (may solve issues with older script minification plugins)','easy-fancybox')
|
443 |
+
),
|
444 |
+
'p3' => array (
|
445 |
+
'hide' => true,
|
446 |
+
'description' => '<br /><strong>' . esc_html__('Advanced','easy-fancybox') . '</strong><br />'
|
447 |
+
),
|
448 |
+
'metaData' => array (
|
449 |
+
'id' => 'fancybox_metaData',
|
450 |
+
'hide' => true,
|
451 |
+
'input' => 'checkbox',
|
452 |
+
'status' => get_option('fancybox_metaData') ? '' : 'disabled',
|
453 |
+
'default' => '',
|
454 |
+
'description' => esc_html__('Include the Metadata jQuery extension script to allow passing custom parameters via link class.','easy-fancybox') . ( get_option('fancybox_metaData') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
455 |
+
),
|
456 |
+
'vcMasonryCompat' => array (
|
457 |
+
'id' => 'fancybox_vcMasonryCompat',
|
458 |
+
'hide' => true,
|
459 |
+
'input' => 'checkbox',
|
460 |
+
'status' => 'disabled',
|
461 |
+
'default' => '',
|
462 |
+
'description' => esc_html__('WPBakery / Visual Composer - Masonry Grid Gallery compatibility.','easy-fancybox') . ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
463 |
+
),
|
464 |
+
'autoExclude' => array (
|
465 |
+
'id' => 'fancybox_autoExclude',
|
466 |
+
'title' => esc_html__('Exclude','easy-fancybox'),
|
467 |
+
'label_for' => 'fancybox_autoExclude',
|
468 |
+
'input' => 'text',
|
469 |
+
'class' => 'regular-text',
|
470 |
+
'hide' => true,
|
471 |
+
'default' => '.nolightbox,a.wp-block-fileesc_html__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']',
|
472 |
+
'sanitize_callback' => 'csl_text',
|
473 |
+
'description' => esc_html__('A comma-separated list of selectors for elements to which FancyBox should not automatically bind itself. Media links inside these elements will be ignored by Autodetect.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' .nolightbox,a.wp-block-fileesc_html__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']</em><br />'
|
474 |
+
)
|
475 |
+
)
|
476 |
+
)
|
477 |
+
)
|
478 |
+
),
|
479 |
+
|
480 |
+
'IMG' => array(
|
481 |
+
'title' => esc_html__('Images','easy-fancybox'),
|
482 |
+
'input' => 'multiple',
|
483 |
+
'options' => array(
|
484 |
+
'intro' => array (
|
485 |
+
'hide' => true,
|
486 |
+
'description' => esc_html__('To make images open in an overlay, add their extension to the Autodetect field or use the class "fancybox" for its link. Clear field to switch off all autodetection.','easy-fancybox') . '<br />'
|
487 |
+
),
|
488 |
+
'tag' => array (
|
489 |
+
'hide' => true,
|
490 |
+
'default' => 'a.fancybox,area.fancybox,.fancybox>a'
|
491 |
+
),
|
492 |
+
'class' => array (
|
493 |
+
'hide' => true,
|
494 |
+
'default' => 'fancybox image'
|
495 |
+
),
|
496 |
+
'autoAttribute' => array (
|
497 |
+
'id' => 'fancybox_autoAttribute',
|
498 |
+
'title' => esc_html__('Autodetect','easy-fancybox'),
|
499 |
+
'label_for' => 'fancybox_autoAttribute',
|
500 |
+
'input' => 'text',
|
501 |
+
'class' => 'regular-text',
|
502 |
+
'hide' => true,
|
503 |
+
'default' => '.jpg,.png,.webp',
|
504 |
+
'sanitize_callback' => 'csl_text',
|
505 |
+
'selector' => 'href*=',
|
506 |
+
'description' => esc_html__('A comma-separated list of image file extensions to which FancyBox should automatically bind itself.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' .jpg,.png,.gif,.jpeg</em><br />'
|
507 |
+
),
|
508 |
+
'autoAttributeLimit' => array (
|
509 |
+
'id' => 'fancybox_autoAttributeLimit',
|
510 |
+
'title' => esc_html__('Apply to','easy-fancybox'),
|
511 |
+
'label_for' => 'fancybox_autoAttributeLimit',
|
512 |
+
'hide' => true,
|
513 |
+
'input' => 'select',
|
514 |
+
'options' => array(
|
515 |
+
'' => esc_html__('All image links', 'easy-fancybox')
|
516 |
+
),
|
517 |
+
'default' => '',
|
518 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
519 |
+
),
|
520 |
+
'type' => array (
|
521 |
+
'id' => 'fancybox_classType',
|
522 |
+
'title' => esc_html__('Force FancyBox to treat all media linked with class="fancybox" as images?','easy-fancybox'),
|
523 |
+
'label_for' => 'fancybox_classType',
|
524 |
+
'input' => 'select',
|
525 |
+
'options' => array(
|
526 |
+
'image' => translate('Yes'),
|
527 |
+
'' => translate('No')
|
528 |
+
),
|
529 |
+
'default' => get_option('fancybox_enableInline') ? 'image' : '',
|
530 |
+
'description' => '<br/>'
|
531 |
+
),
|
532 |
+
'p2' => array (
|
533 |
+
'hide' => true,
|
534 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
535 |
+
),
|
536 |
+
'transitionIn' => array (
|
537 |
+
'id' => 'fancybox_transitionIn',
|
538 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
539 |
+
'label_for' => 'fancybox_transitionIn',
|
540 |
+
'input' => 'select',
|
541 |
+
'options' => array(
|
542 |
+
'none' => translate('None'),
|
543 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
544 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
545 |
+
),
|
546 |
+
'default' => 'elastic',
|
547 |
+
'description' => ' '
|
548 |
+
),
|
549 |
+
'easingIn' => array (
|
550 |
+
'id' => 'fancybox_easingIn',
|
551 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
552 |
+
'label_for' => 'fancybox_easingIn',
|
553 |
+
'input' => 'select',
|
554 |
+
'options' => array(
|
555 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
556 |
+
'' => esc_html__('Swing','easy-fancybox')
|
557 |
+
),
|
558 |
+
'default' => '',
|
559 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
560 |
+
),
|
561 |
+
'transitionOut' => array (
|
562 |
+
'id' => 'fancybox_transitionOut',
|
563 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
564 |
+
'label_for' => 'fancybox_transitionOut',
|
565 |
+
'input' => 'select',
|
566 |
+
'options' => array(
|
567 |
+
'none' => translate('None'),
|
568 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
569 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
570 |
+
),
|
571 |
+
'default' => 'elastic',
|
572 |
+
'description' => ' '
|
573 |
+
),
|
574 |
+
'easingOut' => array (
|
575 |
+
'id' => 'fancybox_easingOut',
|
576 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
577 |
+
'label_for' => 'fancybox_easingOut',
|
578 |
+
'input' => 'select',
|
579 |
+
'options' => array(
|
580 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
581 |
+
'' => esc_html__('Swing','easy-fancybox')
|
582 |
+
),
|
583 |
+
'default' => '',
|
584 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
585 |
+
),
|
586 |
+
'opacity' => array (
|
587 |
+
'id' => 'fancybox_opacity',
|
588 |
+
'input' => 'checkbox',
|
589 |
+
'noquotes' => true,
|
590 |
+
'default' => '',
|
591 |
+
'description' => esc_html__('Transparency fade during elastic transition. CAUTION: Use only when at least Transition In is set to Elastic!','easy-fancybox')
|
592 |
+
),
|
593 |
+
'hideOnContentClick' => array (
|
594 |
+
'id' => 'fancybox_hideOnContentClick',
|
595 |
+
'input' => 'checkbox',
|
596 |
+
'noquotes' => true,
|
597 |
+
'default' => '',
|
598 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
599 |
+
),
|
600 |
+
'p1' => array (
|
601 |
+
'hide' => true,
|
602 |
+
'description' => '<br /><strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
603 |
+
),
|
604 |
+
'titleShow' => array (
|
605 |
+
'id' => 'fancybox_titleShow',
|
606 |
+
'input' => 'checkbox',
|
607 |
+
'noquotes' => true,
|
608 |
+
'default' => '1',
|
609 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
610 |
+
),
|
611 |
+
'titlePosition' => array (
|
612 |
+
'id' => 'fancybox_titlePosition',
|
613 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
614 |
+
'label_for' => 'fancybox_titlePosition',
|
615 |
+
'input' => 'select',
|
616 |
+
'options' => array(
|
617 |
+
'' => esc_html__('Float','easy-fancybox'),
|
618 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
619 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
620 |
+
'over' => esc_html__('Overlay','easy-fancybox')
|
621 |
+
),
|
622 |
+
'default' => 'over',
|
623 |
+
'description' => '<br />'
|
624 |
+
),
|
625 |
+
'titleFromAlt' => array (
|
626 |
+
'id' => 'fancybox_titleFromAlt',
|
627 |
+
'input' => 'checkbox',
|
628 |
+
'noquotes' => true,
|
629 |
+
'default' => '1',
|
630 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
631 |
+
),
|
632 |
+
'onStart' => array (
|
633 |
+
'id' => '',
|
634 |
+
'title' => esc_html__('Advanced','easy-fancybox'),
|
635 |
+
'input' => 'select',
|
636 |
+
'status' => 'disabled',
|
637 |
+
'options' => array(
|
638 |
+
'' => esc_html__('Hide/show title on mouse hover action','easy-fancybox')
|
639 |
+
),
|
640 |
+
'default' => '',
|
641 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
642 |
+
),
|
643 |
+
'p3' => array (
|
644 |
+
'hide' => true,
|
645 |
+
'description' => '<br /><strong>' . esc_html__('Gallery','easy-fancybox') . '</strong><br />'
|
646 |
+
),
|
647 |
+
'autoGallery' => array (
|
648 |
+
'id' => 'fancybox_autoGallery',
|
649 |
+
'title' => esc_html__('Autogallery','easy-fancybox'),
|
650 |
+
'label_for' => 'fancybox_autoGallery',
|
651 |
+
'hide' => true,
|
652 |
+
'input' => 'select',
|
653 |
+
'options' => array(
|
654 |
+
'' => translate('Disabled'),
|
655 |
+
'1' => esc_html__('WordPress galleries only','easy-fancybox'),
|
656 |
+
'2' => esc_html__('All in one gallery','easy-fancybox')
|
657 |
+
),
|
658 |
+
'default' => '1',
|
659 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('When disabled, you can use the rel attribute to manually group image links together.','easy-fancybox') . '<br /><br />'
|
660 |
+
),
|
661 |
+
'showNavArrows' => array (
|
662 |
+
'id' => 'fancybox_showNavArrows',
|
663 |
+
'input' => 'checkbox',
|
664 |
+
'noquotes' => true,
|
665 |
+
'default' => '1',
|
666 |
+
'description' => esc_html__('Show the gallery navigation arrows','easy-fancybox')
|
667 |
+
),
|
668 |
+
'enableKeyboardNav' => array (
|
669 |
+
'id' => 'fancybox_enableKeyboardNav',
|
670 |
+
'input' => 'checkbox',
|
671 |
+
'noquotes' => true,
|
672 |
+
'default' => '1',
|
673 |
+
'description' => esc_html__('Arrow key strokes browse the gallery','easy-fancybox')
|
674 |
+
),
|
675 |
+
'cyclic' => array (
|
676 |
+
'id' => 'fancybox_cyclic',
|
677 |
+
'input' => 'checkbox',
|
678 |
+
'noquotes' => true,
|
679 |
+
'default' => '',
|
680 |
+
'description' => esc_html__('Make galleries cyclic, allowing you to keep pressing next/back.','easy-fancybox')
|
681 |
+
),
|
682 |
+
'changeSpeed' => array (
|
683 |
+
'id' => 'fancybox_changeSpeed',
|
684 |
+
'title' => esc_html__('Change speed','easy-fancybox'),
|
685 |
+
'label_for' => 'fancybox_changeSpeed',
|
686 |
+
'input' => 'number',
|
687 |
+
'step' => '1',
|
688 |
+
'min' => '0',
|
689 |
+
'max' => '6000',
|
690 |
+
'sanitize_callback' => 'intval',
|
691 |
+
'class' => 'small-text',
|
692 |
+
'default' => '',
|
693 |
+
),
|
694 |
+
'changeFade' => array (
|
695 |
+
'id' => 'fancybox_changeFade',
|
696 |
+
'title' => esc_html__('Fade speed','easy-fancybox'),
|
697 |
+
'label_for' => 'fancybox_changeFade',
|
698 |
+
'input' => 'number',
|
699 |
+
'step' => '1',
|
700 |
+
'min' => '0',
|
701 |
+
'max' => '6000',
|
702 |
+
'sanitize_callback' => 'intval',
|
703 |
+
'class' => 'small-text',
|
704 |
+
'default' => '',
|
705 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 300</em><br /><br />'
|
706 |
+
),
|
707 |
+
'autoSelector' => array (
|
708 |
+
'id' => 'fancybox_autoSelector',
|
709 |
+
'hide' => true,
|
710 |
+
'input' => 'hidden',
|
711 |
+
'default' => '.gallery,.wp-block-gallery,.tiled-gallery,.wp-block-jetpack-tiled-gallery'
|
712 |
+
),
|
713 |
+
'onComplete' => array (
|
714 |
+
'id' => '',
|
715 |
+
'title' => esc_html__('Advanced','easy-fancybox'),
|
716 |
+
'input' => 'select',
|
717 |
+
'status' => 'disabled',
|
718 |
+
'options' => array(
|
719 |
+
'' => esc_html__('Slideshow','easy-fancybox')
|
720 |
+
),
|
721 |
+
'default' => '',
|
722 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
723 |
+
)
|
724 |
+
)
|
725 |
+
),
|
726 |
+
|
727 |
+
'Inline' => array(
|
728 |
+
'title' => esc_html__('Inline content','easy-fancybox'),
|
729 |
+
'input' => 'multiple',
|
730 |
+
'options' => array(
|
731 |
+
'intro' => array (
|
732 |
+
'hide' => true,
|
733 |
+
'description' => esc_html__('To make inline content open in an overlay, wrap that content in a div with a unique ID, create a link with target "#uniqueID" and give it a class "fancybox-inline" attribute.','easy-fancybox') . '<br /><br />'
|
734 |
+
),
|
735 |
+
'tag' => array (
|
736 |
+
'hide' => true,
|
737 |
+
'default' => 'a.fancybox-inline,area.fancybox-inline,.fancybox-inline>a'
|
738 |
+
),
|
739 |
+
'class' => array (
|
740 |
+
'hide' => true,
|
741 |
+
'default' => 'fancybox-inline'
|
742 |
+
),
|
743 |
+
'type' => array (
|
744 |
+
'default' => 'inline'
|
745 |
+
),
|
746 |
+
'autoDimensions' => array (
|
747 |
+
'id' => 'fancybox_autoDimensions',
|
748 |
+
'input' => 'checkbox',
|
749 |
+
'noquotes' => true,
|
750 |
+
'default' => '1',
|
751 |
+
'description' => esc_html__('Try to adjust size to inline/html content. If unchecked the default dimensions will be used.','easy-fancybox') . ''
|
752 |
+
),
|
753 |
+
'scrolling' => array (
|
754 |
+
'id' => 'fancybox_InlineScrolling',
|
755 |
+
'title' => esc_html__('Scrolling','easy-fancybox'),
|
756 |
+
'label_for' => 'fancybox_InlineScrolling',
|
757 |
+
'input' => 'select',
|
758 |
+
'options' => array(
|
759 |
+
'auto' => esc_html__('Auto','easy-fancybox'),
|
760 |
+
'yes' => esc_html__('Always','easy-fancybox'),
|
761 |
+
'no' => esc_html__('Never','easy-fancybox')
|
762 |
+
),
|
763 |
+
'default' => 'no',
|
764 |
+
'description' => esc_html__('Define scrolling and scrollbar visibility.','easy-fancybox') . '<br /><br />'
|
765 |
+
),
|
766 |
+
'transitionIn' => array (
|
767 |
+
'id' => 'fancybox_transitionInInline',
|
768 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
769 |
+
'label_for' => 'fancybox_transitionInInline',
|
770 |
+
'input' => 'select',
|
771 |
+
'options' => array(
|
772 |
+
'none' => translate('None'),
|
773 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
774 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
775 |
+
),
|
776 |
+
'default' => '',
|
777 |
+
'description' => ' '
|
778 |
+
),
|
779 |
+
'easingIn' => array (
|
780 |
+
'id' => 'fancybox_easingInInline',
|
781 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
782 |
+
'label_for' => 'fancybox_easingInInline',
|
783 |
+
'input' => 'select',
|
784 |
+
'options' => array(
|
785 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
786 |
+
'' => esc_html__('Swing','easy-fancybox')
|
787 |
+
),
|
788 |
+
'default' => 'easeOutBack',
|
789 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
790 |
+
),
|
791 |
+
'transitionOut' => array (
|
792 |
+
'id' => 'fancybox_transitionOutInline',
|
793 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
794 |
+
'label_for' => 'fancybox_transitionOutInline',
|
795 |
+
'input' => 'select',
|
796 |
+
'options' => array(
|
797 |
+
'none' => translate('None'),
|
798 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
799 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
800 |
+
),
|
801 |
+
'default' => '',
|
802 |
+
'description' => ' '
|
803 |
+
),
|
804 |
+
'easingOut' => array (
|
805 |
+
'id' => 'fancybox_easingOutInline',
|
806 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
807 |
+
'label_for' => 'fancybox_easingOutInline',
|
808 |
+
'input' => 'select',
|
809 |
+
'options' => array(
|
810 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
811 |
+
'' => esc_html__('Swing','easy-fancybox')
|
812 |
+
),
|
813 |
+
'default' => '',
|
814 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
815 |
+
),
|
816 |
+
'opacity' => array (
|
817 |
+
'id' => 'fancybox_opacityInline',
|
818 |
+
'input' => 'checkbox',
|
819 |
+
'noquotes' => true,
|
820 |
+
'default' => '',
|
821 |
+
'description' => esc_html__('Transparency fade during elastic transition. CAUTION: Use only when at least Transition In is set to Elastic!','easy-fancybox')
|
822 |
+
),
|
823 |
+
'hideOnContentClick' => array (
|
824 |
+
'id' => 'fancybox_hideOnContentClickInline',
|
825 |
+
'input' => 'checkbox',
|
826 |
+
'noquotes' => true,
|
827 |
+
'default' => '',
|
828 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
829 |
+
),
|
830 |
+
'titleShow' => array (
|
831 |
+
'noquotes' => true,
|
832 |
+
'default' => 'false',
|
833 |
+
)
|
834 |
+
)
|
835 |
+
),
|
836 |
+
|
837 |
+
'PDF' => array(
|
838 |
+
'title' => esc_html__('PDF','easy-fancybox'),
|
839 |
+
'input' => 'multiple',
|
840 |
+
'options' => array(
|
841 |
+
'intro' => array (
|
842 |
+
'hide' => true,
|
843 |
+
'description' => esc_html__('To make any PDF document file open in an overlay, switch on Autodetect or use the class "fancybox-pdf" for its link.','easy-fancybox') . '<br />'
|
844 |
+
),
|
845 |
+
'autoAttribute' => array (
|
846 |
+
'id' => 'fancybox_autoAttributePDF',
|
847 |
+
'input' => 'checkbox',
|
848 |
+
'hide' => true,
|
849 |
+
'default' => '1',
|
850 |
+
'selector' => '\'a[href*=".pdf"],area[href*=".pdf"],a[href*=".PDF"],area[href*=".PDF"]\'',
|
851 |
+
'description' => esc_html__('Autodetect','easy-fancybox')
|
852 |
+
),
|
853 |
+
'tag' => array (
|
854 |
+
'hide' => true,
|
855 |
+
'default' => 'a.fancybox-pdf,area.fancybox-pdf,.fancybox-pdf>a'
|
856 |
+
),
|
857 |
+
'class' => array (
|
858 |
+
'hide' => true,
|
859 |
+
'default' => 'fancybox-pdf'
|
860 |
+
),
|
861 |
+
'type' => array (
|
862 |
+
'default' => 'iframe'
|
863 |
+
),
|
864 |
+
'onStart' => array (
|
865 |
+
'id' => 'fancybox_PDFonStart',
|
866 |
+
'noquotes' => true,
|
867 |
+
'title' => esc_html__('Embed with','easy-fancybox'),
|
868 |
+
'label_for' => 'fancybox_PDFonStart',
|
869 |
+
'input' => 'select',
|
870 |
+
'options' => array(
|
871 |
+
'{{object}}' => esc_html__('Object tag (plus fall-back link)','easy-fancybox'),
|
872 |
+
'{{embed}}' => esc_html__('Embed tag','easy-fancybox'),
|
873 |
+
'' => esc_html__('iFrame tag (let browser decide)','easy-fancybox'),
|
874 |
+
'{{googleviewer}}' => esc_html__('Google Docs Viewer (external)','easy-fancybox')
|
875 |
+
),
|
876 |
+
'default' => '{{object}}',
|
877 |
+
'description' => esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('External viewers have bandwidth, usage rate and and file size limits.','easy-fancybox') . '<br /><br />'
|
878 |
+
),
|
879 |
+
'width' => array (
|
880 |
+
'id' => 'fancybox_PDFwidth',
|
881 |
+
'title' => translate('Width'),
|
882 |
+
'label_for' => 'fancybox_PDFwidth',
|
883 |
+
'input' => 'text',
|
884 |
+
'sanitize_callback' => 'intval',
|
885 |
+
'class' => 'small-text',
|
886 |
+
'default' => '90%',
|
887 |
+
'description' => ' '
|
888 |
+
),
|
889 |
+
'height' => array (
|
890 |
+
'id' => 'fancybox_PDFheight',
|
891 |
+
'title' => translate('Height'),
|
892 |
+
'label_for' => 'fancybox_PDFheight',
|
893 |
+
'input' => 'text',
|
894 |
+
'sanitize_callback' => 'intval',
|
895 |
+
'class' => 'small-text',
|
896 |
+
'default' => '90%'
|
897 |
+
),
|
898 |
+
'padding' => array (
|
899 |
+
'id' => 'fancybox_PDFpadding',
|
900 |
+
'title' => translate('Border'),
|
901 |
+
'label_for' => 'fancybox_PDFpadding',
|
902 |
+
'input' => 'number',
|
903 |
+
'step' => '1',
|
904 |
+
'min' => '0',
|
905 |
+
'max' => '100',
|
906 |
+
'sanitize_callback' => 'intval',
|
907 |
+
'class' => 'small-text',
|
908 |
+
'default' => '10',
|
909 |
+
'description' => '<br /><br />'
|
910 |
+
),
|
911 |
+
'titleShow' => array (
|
912 |
+
'id' => 'fancybox_PDFtitleShow',
|
913 |
+
'input' => 'checkbox',
|
914 |
+
'noquotes' => true,
|
915 |
+
'default' => '',
|
916 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
917 |
+
),
|
918 |
+
'titlePosition' => array (
|
919 |
+
'id' => 'fancybox_PDFtitlePosition',
|
920 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
921 |
+
'label_for' => 'fancybox_PDFtitlePosition',
|
922 |
+
'input' => 'select',
|
923 |
+
'options' => array(
|
924 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
925 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
926 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
927 |
+
),
|
928 |
+
'default' => 'float',
|
929 |
+
'description' => '<br />'
|
930 |
+
),
|
931 |
+
'titleFromAlt' => array (
|
932 |
+
'id' => 'fancybox_PDFtitleFromAlt',
|
933 |
+
'input' => 'checkbox',
|
934 |
+
'noquotes' => true,
|
935 |
+
'default' => '1',
|
936 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
937 |
+
),
|
938 |
+
'autoDimensions' => array (
|
939 |
+
'noquotes' => true,
|
940 |
+
'default' => 'false'
|
941 |
+
),
|
942 |
+
'scrolling' => array (
|
943 |
+
'default' => 'no',
|
944 |
+
),
|
945 |
+
)
|
946 |
+
),
|
947 |
+
|
948 |
+
'SVG' => array(
|
949 |
+
'title' => esc_html__('SVG','easy-fancybox'),
|
950 |
+
'input' => 'multiple',
|
951 |
+
'options' => array(
|
952 |
+
'intro' => array (
|
953 |
+
'hide' => true,
|
954 |
+
'description' => esc_html__('To make any SVG (.svg) file open in an overlay, switch on Autodetect or use the class "fancybox-svg" for its link.','easy-fancybox') . '<br />'
|
955 |
+
),
|
956 |
+
'autoAttribute' => array (
|
957 |
+
'id' => 'fancybox_autoAttributeSVG',
|
958 |
+
'input' => 'checkbox',
|
959 |
+
'hide' => true,
|
960 |
+
'default' => '1',
|
961 |
+
'selector' => '\'a[href*=".svg"],area[href*=".svg"],a[href*=".SVG"],area[href*=".SVG"]\'',
|
962 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
963 |
+
),
|
964 |
+
'tag' => array (
|
965 |
+
'hide' => true,
|
966 |
+
'default' => 'a.fancybox-svg,area.fancybox-svg,.fancybox-svg>a'
|
967 |
+
),
|
968 |
+
'class' => array (
|
969 |
+
'hide' => true,
|
970 |
+
'default' => 'fancybox-svg'
|
971 |
+
),
|
972 |
+
'type' => array(
|
973 |
+
'default' => 'svg'
|
974 |
+
),
|
975 |
+
'width' => array (
|
976 |
+
'id' => 'fancybox_SVGWidth',
|
977 |
+
'title' => translate('Width'),
|
978 |
+
'label_for' => 'fancybox_SVGWidth',
|
979 |
+
'input' => 'text',
|
980 |
+
'sanitize_callback' => 'intval',
|
981 |
+
'class' => 'small-text',
|
982 |
+
'options' => array(),
|
983 |
+
'default' => '680',
|
984 |
+
'description' => ' '
|
985 |
+
),
|
986 |
+
'height' => array (
|
987 |
+
'id' => 'fancybox_SVGHeight',
|
988 |
+
'title' => translate('Height'),
|
989 |
+
'label_for' => 'fancybox_SVGHeight',
|
990 |
+
'input' => 'text',
|
991 |
+
'sanitize_callback' => 'intval',
|
992 |
+
'class' => 'small-text',
|
993 |
+
'options' => array(),
|
994 |
+
'default' => '495',
|
995 |
+
),
|
996 |
+
'padding' => array (
|
997 |
+
'id' => 'fancybox_SVGpadding',
|
998 |
+
'title' => translate('Border'),
|
999 |
+
'label_for' => 'fancybox_SVGpadding',
|
1000 |
+
'input' => 'number',
|
1001 |
+
'step' => '1',
|
1002 |
+
'min' => '0',
|
1003 |
+
'max' => '100',
|
1004 |
+
'sanitize_callback' => 'intval',
|
1005 |
+
'class' => 'small-text',
|
1006 |
+
'default' => '0',
|
1007 |
+
'description' => '<br /><br />'
|
1008 |
+
),
|
1009 |
+
'titleShow' => array (
|
1010 |
+
'id' => 'fancybox_SVGtitleShow',
|
1011 |
+
'input' => 'checkbox',
|
1012 |
+
'noquotes' => true,
|
1013 |
+
'default' => '',
|
1014 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1015 |
+
),
|
1016 |
+
'titlePosition' => array (
|
1017 |
+
'id' => 'fancybox_SVGtitlePosition',
|
1018 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1019 |
+
'label_for' => 'fancybox_SVGtitlePosition',
|
1020 |
+
'input' => 'select',
|
1021 |
+
'options' => array(
|
1022 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1023 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1024 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1025 |
+
//,'over' => esc_html__('Overlay','easy-fancybox')
|
1026 |
+
),
|
1027 |
+
'default' => 'float',
|
1028 |
+
'description' => '<br />'
|
1029 |
+
),
|
1030 |
+
'titleFromAlt' => array (
|
1031 |
+
'id' => 'fancybox_SVGtitleFromAlt',
|
1032 |
+
'input' => 'checkbox',
|
1033 |
+
'noquotes' => true,
|
1034 |
+
'default' => '1',
|
1035 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1036 |
+
),
|
1037 |
+
'svg' => array (
|
1038 |
+
'noquotes' => true,
|
1039 |
+
'default' => '{\'wmode\':\'opaque\',\'allowfullscreen\':true}'
|
1040 |
+
)
|
1041 |
+
)
|
1042 |
+
),
|
1043 |
+
|
1044 |
+
'VideoPress' => array(
|
1045 |
+
),
|
1046 |
+
|
1047 |
+
'YouTube' => array(
|
1048 |
+
'title' => esc_html__('YouTube','easy-fancybox'),
|
1049 |
+
'input' => 'multiple',
|
1050 |
+
'options' => array(
|
1051 |
+
'intro' => array (
|
1052 |
+
'hide' => true,
|
1053 |
+
'description' => esc_html__('To make any YouTube movie open in an overlay, switch on Autodetect or use the class "fancybox-youtube" for its link.','easy-fancybox') . '<br />'
|
1054 |
+
),
|
1055 |
+
'autoAttribute' => array (
|
1056 |
+
'id' => 'fancybox_autoAttributeYoutube',
|
1057 |
+
'input' => 'checkbox',
|
1058 |
+
'hide' => true,
|
1059 |
+
'default' => '1',
|
1060 |
+
'selector' => '\'a[href*="youtu.be/"],area[href*="youtu.be/"],a[href*="youtube.com/"],area[href*="youtube.com/"]\').filter(function(){return this.href.match(/\/(?:youtu\.be|watch\?|embed\/)/);}',
|
1061 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1062 |
+
),
|
1063 |
+
'tag' => array (
|
1064 |
+
'hide' => true,
|
1065 |
+
'default' => 'a.fancybox-youtube,area.fancybox-youtube,.fancybox-youtube>a'
|
1066 |
+
),
|
1067 |
+
'class' => array (
|
1068 |
+
'hide' => true,
|
1069 |
+
'default' => 'fancybox-youtube'
|
1070 |
+
),
|
1071 |
+
'type' => array(
|
1072 |
+
'default' => 'iframe'
|
1073 |
+
),
|
1074 |
+
'noCookie' => array (
|
1075 |
+
'id' => 'fancybox_YoutubenoCookie',
|
1076 |
+
'input' => 'checkbox',
|
1077 |
+
'hide' => true,
|
1078 |
+
'default' => '',
|
1079 |
+
'description' => esc_html__('Enable privacy-enhanced mode','easy-fancybox') . '<br />'
|
1080 |
+
),
|
1081 |
+
'width' => array (
|
1082 |
+
'id' => 'fancybox_YoutubeWidth',
|
1083 |
+
'title' => translate('Width'),
|
1084 |
+
'label_for' => 'fancybox_YoutubeWidth',
|
1085 |
+
'input' => 'number',
|
1086 |
+
'step' => '1',
|
1087 |
+
'min' => '420',
|
1088 |
+
'max' => '1500',
|
1089 |
+
'sanitize_callback' => 'intval',
|
1090 |
+
'class' => 'small-text',
|
1091 |
+
'default' => '640',
|
1092 |
+
'description' => ' '
|
1093 |
+
),
|
1094 |
+
'height' => array (
|
1095 |
+
'id' => 'fancybox_YoutubeHeight',
|
1096 |
+
'title' => translate('Height'),
|
1097 |
+
'label_for' => 'fancybox_YoutubeHeight',
|
1098 |
+
'input' => 'number',
|
1099 |
+
'step' => '1',
|
1100 |
+
'min' => '315',
|
1101 |
+
'max' => '900',
|
1102 |
+
'sanitize_callback' => 'intval',
|
1103 |
+
'class' => 'small-text',
|
1104 |
+
'default' => '360',
|
1105 |
+
),
|
1106 |
+
'padding' => array (
|
1107 |
+
'id' => 'fancybox_Youtubepadding',
|
1108 |
+
'title' => translate('Border'),
|
1109 |
+
'label_for' => 'fancybox_Youtubepadding',
|
1110 |
+
'input' => 'number',
|
1111 |
+
'step' => '1',
|
1112 |
+
'min' => '0',
|
1113 |
+
'max' => '100',
|
1114 |
+
'sanitize_callback' => 'intval',
|
1115 |
+
'class' => 'small-text',
|
1116 |
+
'default' => '0',
|
1117 |
+
'description' => '<br /><br />'
|
1118 |
+
),
|
1119 |
+
'keepRatio' => array(
|
1120 |
+
'noquotes' => true,
|
1121 |
+
'default' => '1'
|
1122 |
+
),
|
1123 |
+
'titleShow' => array (
|
1124 |
+
'id' => 'fancybox_YoutubetitleShow',
|
1125 |
+
'input' => 'checkbox',
|
1126 |
+
'noquotes' => true,
|
1127 |
+
'default' => '',
|
1128 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1129 |
+
),
|
1130 |
+
'titlePosition' => array (
|
1131 |
+
'id' => 'fancybox_YoutubetitlePosition',
|
1132 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1133 |
+
'label_for' => 'fancybox_YoutubetitlePosition',
|
1134 |
+
'input' => 'select',
|
1135 |
+
'options' => array(
|
1136 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1137 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1138 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1139 |
+
),
|
1140 |
+
'default' => 'float',
|
1141 |
+
'description' => '<br />'
|
1142 |
+
),
|
1143 |
+
'titleFromAlt' => array (
|
1144 |
+
'id' => 'fancybox_YoutubetitleFromAlt',
|
1145 |
+
'input' => 'checkbox',
|
1146 |
+
'noquotes' => true,
|
1147 |
+
'default' => '1',
|
1148 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1149 |
+
),
|
1150 |
+
'onStart' => array (
|
1151 |
+
'noquotes' => true,
|
1152 |
+
'default' => get_option( 'fancybox_YoutubenoCookie' ) ?
|
1153 |
+
'function(a,i,o){var splitOn=a[i].href.indexOf("?");var urlParms=(splitOn>-1)?a[i].href.substring(splitOn):"";o.allowfullscreen=(urlParms.indexOf("fs=0")>-1)?false:true;o.href=a[i].href.replace(/https?:\/\/(?:www\.)?youtu(?:\.be\/([^\?]+)\??|be\.com\/watch\?(.*(?=v=))v=([^&]+))(.*)/gi,"https://www.youtube-nocookie.com/embed/$1$3?$2$4");}' :
|
1154 |
+
'function(a,i,o){var splitOn=a[i].href.indexOf("?");var urlParms=(splitOn>-1)?a[i].href.substring(splitOn):"";o.allowfullscreen=(urlParms.indexOf("fs=0")>-1)?false:true;o.href=a[i].href.replace(/https?:\/\/(?:www\.)?youtu(?:\.be\/([^\?]+)\??|be\.com\/watch\?(.*(?=v=))v=([^&]+))(.*)/gi,"https://www.youtube.com/embed/$1$3?$2$4&autoplay=1");}'
|
1155 |
+
)
|
1156 |
+
)
|
1157 |
+
),
|
1158 |
+
|
1159 |
+
'Vimeo' => array(
|
1160 |
+
'title' => esc_html__('Vimeo','easy-fancybox'),
|
1161 |
+
'input' => 'multiple',
|
1162 |
+
'options' => array(
|
1163 |
+
'intro' => array (
|
1164 |
+
'hide' => true,
|
1165 |
+
'description' => esc_html__('To make any Vimeo movie open in an overlay, switch on Autodetect or use the class "fancybox-vimeo" for its link.','easy-fancybox') . '<br />'
|
1166 |
+
),
|
1167 |
+
'autoAttribute' => array (
|
1168 |
+
'id' => 'fancybox_autoAttributeVimeo',
|
1169 |
+
'input' => 'checkbox',
|
1170 |
+
'hide' => true,
|
1171 |
+
'default' => '1',
|
1172 |
+
'selector' => '\'a[href*="vimeo.com/"],area[href*="vimeo.com/"]\').filter(function(){return this.href.match(/\/(?:[0-9]+|video\/)/);}',
|
1173 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1174 |
+
),
|
1175 |
+
'tag' => array (
|
1176 |
+
'hide' => true,
|
1177 |
+
'default' => 'a.fancybox-vimeo,area.fancybox-vimeo,.fancybox-vimeo>a'
|
1178 |
+
),
|
1179 |
+
'class' => array (
|
1180 |
+
'hide' => true,
|
1181 |
+
'default' => 'fancybox-vimeo'
|
1182 |
+
),
|
1183 |
+
'type' => array(
|
1184 |
+
'default' => 'iframe'
|
1185 |
+
),
|
1186 |
+
'width' => array (
|
1187 |
+
'id' => 'fancybox_VimeoWidth',
|
1188 |
+
'title' => translate('Width'),
|
1189 |
+
'label_for' => 'fancybox_VimeoWidth',
|
1190 |
+
'input' => 'number',
|
1191 |
+
'step' => '1',
|
1192 |
+
'min' => '400',
|
1193 |
+
'max' => '1500',
|
1194 |
+
'sanitize_callback' => 'intval',
|
1195 |
+
'class' => 'small-text',
|
1196 |
+
'default' => '500',
|
1197 |
+
'description' => ' '
|
1198 |
+
),
|
1199 |
+
'height' => array (
|
1200 |
+
'id' => 'fancybox_VimeoHeight',
|
1201 |
+
'title' => translate('Height'),
|
1202 |
+
'label_for' => 'fancybox_VimeoHeight',
|
1203 |
+
'input' => 'number',
|
1204 |
+
'step' => '1',
|
1205 |
+
'min' => '225',
|
1206 |
+
'max' => '900',
|
1207 |
+
'sanitize_callback' => 'intval',
|
1208 |
+
'class' => 'small-text',
|
1209 |
+
'default' => '281'
|
1210 |
+
),
|
1211 |
+
'padding' => array (
|
1212 |
+
'id' => 'fancybox_Vimeopadding',
|
1213 |
+
'title' => translate('Border'),
|
1214 |
+
'label_for' => 'fancybox_Vimeopadding',
|
1215 |
+
'input' => 'number',
|
1216 |
+
'step' => '1',
|
1217 |
+
'min' => '0',
|
1218 |
+
'max' => '100',
|
1219 |
+
'sanitize_callback' => 'intval',
|
1220 |
+
'class' => 'small-text',
|
1221 |
+
'default' => '0',
|
1222 |
+
'description' => '<br /><br />'
|
1223 |
+
),
|
1224 |
+
'keepRatio' => array(
|
1225 |
+
'noquotes' => true,
|
1226 |
+
'default' => '1'
|
1227 |
+
),
|
1228 |
+
'titleShow' => array (
|
1229 |
+
'id' => 'fancybox_VimeotitleShow',
|
1230 |
+
'input' => 'checkbox',
|
1231 |
+
'noquotes' => true,
|
1232 |
+
'default' => '',
|
1233 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1234 |
+
),
|
1235 |
+
'titlePosition' => array (
|
1236 |
+
'id' => 'fancybox_VimeotitlePosition',
|
1237 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1238 |
+
'label_for' => 'fancybox_VimeotitlePosition',
|
1239 |
+
'input' => 'select',
|
1240 |
+
'options' => array(
|
1241 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1242 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1243 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1244 |
+
),
|
1245 |
+
'default' => 'float',
|
1246 |
+
'description' => '<br />'
|
1247 |
+
),
|
1248 |
+
'titleFromAlt' => array (
|
1249 |
+
'id' => 'fancybox_VimeotitleFromAlt',
|
1250 |
+
'input' => 'checkbox',
|
1251 |
+
'noquotes' => true,
|
1252 |
+
'default' => '1',
|
1253 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1254 |
+
),
|
1255 |
+
'onStart' => array (
|
1256 |
+
'noquotes' => true,
|
1257 |
+
'default' => 'function(a,i,o){var splitOn=a[i].href.indexOf("?");var urlParms=(splitOn>-1)?a[i].href.substring(splitOn):"";o.allowfullscreen=(urlParms.indexOf("fullscreen=0")>-1)?false:true;o.href=a[i].href.replace(/https?:\/\/(?:www\.)?vimeo\.com\/([0-9]+)\??(.*)/gi,"https://player.vimeo.com/video/$1?$2&autoplay=1");}'
|
1258 |
+
)
|
1259 |
+
)
|
1260 |
+
),
|
1261 |
+
|
1262 |
+
'Dailymotion' => array(
|
1263 |
+
'title' => esc_html__('Dailymotion','easy-fancybox'),
|
1264 |
+
'input' => 'multiple',
|
1265 |
+
'options' => array(
|
1266 |
+
'intro' => array (
|
1267 |
+
'hide' => true,
|
1268 |
+
'description' => esc_html__('To make any Dailymotion movie open in an overlay, switch on Autodetect or use the class "fancybox-dailymotion" for its link.','easy-fancybox') . '<br />'
|
1269 |
+
),
|
1270 |
+
'autoAttribute' => array (
|
1271 |
+
'id' => 'fancybox_autoAttributeDailymotion',
|
1272 |
+
'input' => 'checkbox',
|
1273 |
+
'hide' => true,
|
1274 |
+
'default' => '1',
|
1275 |
+
'selector' => '\'a[href*="dailymotion.com/"],area[href*="dailymotion.com/"]\').filter(function(){return this.href.match(/\/video\//);}',
|
1276 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1277 |
+
),
|
1278 |
+
'tag' => array (
|
1279 |
+
'hide' => true,
|
1280 |
+
'default' => 'a.fancybox-dailymotion,area.fancybox-dailymotion,.fancybox-dailymotion>a'
|
1281 |
+
),
|
1282 |
+
'class' => array (
|
1283 |
+
'hide' => true,
|
1284 |
+
'default' => 'fancybox-dailymotion'
|
1285 |
+
),
|
1286 |
+
'type' => array(
|
1287 |
+
'default' => 'iframe'
|
1288 |
+
),
|
1289 |
+
'width' => array (
|
1290 |
+
'id' => 'fancybox_DailymotionWidth',
|
1291 |
+
'title' => translate('Width'),
|
1292 |
+
'label_for' => 'fancybox_DailymotionWidth',
|
1293 |
+
'input' => 'number',
|
1294 |
+
'step' => '1',
|
1295 |
+
'min' => '320',
|
1296 |
+
'max' => '1500',
|
1297 |
+
'sanitize_callback' => 'intval',
|
1298 |
+
'class' => 'small-text',
|
1299 |
+
'default' => '560',
|
1300 |
+
'description' => ' '
|
1301 |
+
),
|
1302 |
+
'height' => array (
|
1303 |
+
'id' => 'fancybox_DailymotionHeight',
|
1304 |
+
'title' => translate('Height'),
|
1305 |
+
'label_for' => 'fancybox_DailymotionHeight',
|
1306 |
+
'input' => 'number',
|
1307 |
+
'step' => '1',
|
1308 |
+
'min' => '180',
|
1309 |
+
'max' => '900',
|
1310 |
+
'sanitize_callback' => 'intval',
|
1311 |
+
'class' => 'small-text',
|
1312 |
+
'default' => '315'
|
1313 |
+
),
|
1314 |
+
'padding' => array (
|
1315 |
+
'id' => 'fancybox_DailymotionPadding',
|
1316 |
+
'title' => translate('Border'),
|
1317 |
+
'label_for' => 'fancybox_DailymotionPadding',
|
1318 |
+
'input' => 'number',
|
1319 |
+
'step' => '1',
|
1320 |
+
'min' => '0',
|
1321 |
+
'max' => '100',
|
1322 |
+
'sanitize_callback' => 'intval',
|
1323 |
+
'class' => 'small-text',
|
1324 |
+
'default' => '0',
|
1325 |
+
'description' => '<br /><br />'
|
1326 |
+
),
|
1327 |
+
'keepRatio' => array(
|
1328 |
+
'noquotes' => true,
|
1329 |
+
'default' => '1'
|
1330 |
+
),
|
1331 |
+
'titleShow' => array (
|
1332 |
+
'id' => 'fancybox_DailymotiontitleShow',
|
1333 |
+
'input' => 'checkbox',
|
1334 |
+
'noquotes' => true,
|
1335 |
+
'default' => '',
|
1336 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1337 |
+
),
|
1338 |
+
'titlePosition' => array (
|
1339 |
+
'id' => 'fancybox_DailymotiontitlePosition',
|
1340 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1341 |
+
'label_for' => 'fancybox_DailymotiontitlePosition',
|
1342 |
+
'input' => 'select',
|
1343 |
+
'options' => array(
|
1344 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1345 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1346 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1347 |
+
),
|
1348 |
+
'default' => 'float',
|
1349 |
+
'description' => '<br />'
|
1350 |
+
),
|
1351 |
+
'titleFromAlt' => array (
|
1352 |
+
'id' => 'fancybox_DailymotiontitleFromAlt',
|
1353 |
+
'input' => 'checkbox',
|
1354 |
+
'noquotes' => true,
|
1355 |
+
'default' => '1',
|
1356 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1357 |
+
),
|
1358 |
+
'onStart' => array (
|
1359 |
+
'noquotes' => true,
|
1360 |
+
'default' => 'function(a,i,o){var splitOn=a[i].href.indexOf("?");var urlParms=(splitOn>-1)?a[i].href.substring(splitOn):"";o.allowfullscreen=(urlParms.indexOf("fullscreen=0")>-1)?false:true;o.href=a[i].href.replace(/^https?:\/\/(?:www\.)?dailymotion.com\/video\/([^\?]+)(.*)/gi,"https://www.dailymotion.com/embed/video/$1?$2&autoPlay=1");}'
|
1361 |
+
)
|
1362 |
+
)
|
1363 |
+
),
|
1364 |
+
|
1365 |
+
/* 'Tudou' => array(
|
1366 |
+
'id' => 'fancybox_Tudou',
|
1367 |
+
'title' => esc_html__('Tudou','easy-fancybox'),
|
1368 |
+
'label_for' => '',
|
1369 |
+
'input' => 'multiple',
|
1370 |
+
'class' => '', 'description' => '',
|
1371 |
+
'options' => array(
|
1372 |
+
'autoAttributeTudou' => array (
|
1373 |
+
'id' => 'fancybox_autoAttributeTudou',
|
1374 |
+
'label_for' => '',
|
1375 |
+
'input' => 'checkbox',
|
1376 |
+
'class' => '',
|
1377 |
+
'options' => array(),
|
1378 |
+
'hide' => true,
|
1379 |
+
'default' => '1',
|
1380 |
+
'description' => esc_html__('Tudou links','easy-fancybox')
|
1381 |
+
)
|
1382 |
+
)
|
1383 |
+
),*/
|
1384 |
+
|
1385 |
+
/* 'Animoto' => array(),
|
1386 |
+
|
1387 |
+
Example ANIMOTO page link http://animoto.com/play/Kf9POzQMSOGWyu41gtOtsw should become
|
1388 |
+
http://static.animoto.com/swf/w.swf?w=swf/vp1&f=Kf9POzQMSOGWyu41gtOtsw&i=m
|
1389 |
+
|
1390 |
+
*/
|
1391 |
+
|
1392 |
+
'iFrame' => array(
|
1393 |
+
'title' => esc_html__('iFrames','easy-fancybox'),
|
1394 |
+
'input' => 'multiple',
|
1395 |
+
'options' => array(
|
1396 |
+
'intro' => array (
|
1397 |
+
'hide' => true,
|
1398 |
+
'description' => esc_html__('To make a website or HTML document open in an overlay, use the class "fancybox-iframe" for its link.','easy-fancybox') . '<br /><br />'
|
1399 |
+
),
|
1400 |
+
'tag' => array (
|
1401 |
+
'hide' => true,
|
1402 |
+
'default' => 'a.fancybox-iframe,area.fancybox-iframe,.fancybox-iframe>a'
|
1403 |
+
),
|
1404 |
+
'class' => array (
|
1405 |
+
'hide' => true,
|
1406 |
+
'default' => 'fancybox-iframe'
|
1407 |
+
),
|
1408 |
+
'type' => array (
|
1409 |
+
'default' => 'iframe'
|
1410 |
+
),
|
1411 |
+
'width' => array (
|
1412 |
+
'id' => 'fancybox_iFramewidth',
|
1413 |
+
'title' => translate('Width'),
|
1414 |
+
'label_for' => 'fancybox_iFramewidth',
|
1415 |
+
'input' => 'text',
|
1416 |
+
'sanitize_callback' => 'intval',
|
1417 |
+
'class' => 'small-text',
|
1418 |
+
'default' => '70%',
|
1419 |
+
'description' => ' '
|
1420 |
+
),
|
1421 |
+
'height' => array (
|
1422 |
+
'id' => 'fancybox_iFrameheight',
|
1423 |
+
'title' => translate('Height'),
|
1424 |
+
'label_for' => 'fancybox_iFrameheight',
|
1425 |
+
'input' => 'text',
|
1426 |
+
'sanitize_callback' => 'intval',
|
1427 |
+
'class' => 'small-text',
|
1428 |
+
'default' => '90%',
|
1429 |
+
),
|
1430 |
+
'padding' => array (
|
1431 |
+
'id' => 'fancybox_iFramepadding',
|
1432 |
+
'title' => translate('Border'),
|
1433 |
+
'label_for' => 'fancybox_iFramepadding',
|
1434 |
+
'input' => 'number',
|
1435 |
+
'step' => '1',
|
1436 |
+
'min' => '0',
|
1437 |
+
'max' => '100',
|
1438 |
+
'sanitize_callback' => 'intval',
|
1439 |
+
'class' => 'small-text',
|
1440 |
+
'default' => '0',
|
1441 |
+
'description' => '<br /><br />'
|
1442 |
+
),
|
1443 |
+
'titleShow' => array (
|
1444 |
+
'id' => 'fancybox_iFrametitleShow',
|
1445 |
+
'input' => 'checkbox',
|
1446 |
+
'noquotes' => true,
|
1447 |
+
'default' => '',
|
1448 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1449 |
+
),
|
1450 |
+
'titlePosition' => array (
|
1451 |
+
'id' => 'fancybox_iFrametitlePosition',
|
1452 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1453 |
+
'label_for' => 'fancybox_iFrametitlePosition',
|
1454 |
+
'input' => 'select',
|
1455 |
+
'options' => array(
|
1456 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1457 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1458 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1459 |
+
),
|
1460 |
+
'default' => 'float',
|
1461 |
+
'description' => '<br />'
|
1462 |
+
),
|
1463 |
+
'titleFromAlt' => array (
|
1464 |
+
'id' => 'fancybox_iFrametitleFromAlt',
|
1465 |
+
'input' => 'checkbox',
|
1466 |
+
'noquotes' => true,
|
1467 |
+
'default' => '1',
|
1468 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox') . '<br/>'
|
1469 |
+
),
|
1470 |
+
'allowfullscreen' => array (
|
1471 |
+
'id' => 'fancybox_allowFullScreen',
|
1472 |
+
'input' => 'checkbox',
|
1473 |
+
'noquotes' => true,
|
1474 |
+
'default' => '',
|
1475 |
+
'description' => esc_html__('Allow embedded content to jump to full screen mode','easy-fancybox')
|
1476 |
+
)
|
1477 |
+
)
|
1478 |
+
)
|
1479 |
+
);
|
inc/fancybox-classic.php
ADDED
@@ -0,0 +1,343 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* FancyBox v1
|
4 |
+
*/
|
5 |
+
|
6 |
+
namespace easyFancyBox\fancyBox_1;
|
7 |
+
|
8 |
+
/**
|
9 |
+
* MAIN INLINE SCRIPT
|
10 |
+
*/
|
11 |
+
|
12 |
+
function prepare_inline() {
|
13 |
+
// Begin building output FancyBox settings.
|
14 |
+
$script = 'var fb_timeout, fb_opts={';
|
15 |
+
|
16 |
+
/**
|
17 |
+
* Global settings routine.
|
18 |
+
*/
|
19 |
+
$more = 0;
|
20 |
+
foreach ( \easyFancyBox::$options['Global']['options'] as $globals ) {
|
21 |
+
foreach ( $globals['options'] as $_key => $_value ) {
|
22 |
+
if ( isset($_value['id']) )
|
23 |
+
if ( isset($_value['default']) )
|
24 |
+
$parm = \get_option($_value['id'], $_value['default']);
|
25 |
+
else
|
26 |
+
$parm = \get_option($_value['id']);
|
27 |
+
elseif ( isset($_value['default']) )
|
28 |
+
$parm = $_value['default'];
|
29 |
+
else
|
30 |
+
$parm = '';
|
31 |
+
|
32 |
+
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
33 |
+
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
34 |
+
|
35 |
+
if( ! isset($_value['hide']) && $parm!='' ) {
|
36 |
+
$quote = ( is_numeric($parm) || (isset($_value['noquotes']) && $_value['noquotes'] == true) ) ? '' : '\'';
|
37 |
+
if ($more>0)
|
38 |
+
$script .= ',';
|
39 |
+
$script .= '\''.$_key.'\':';
|
40 |
+
$script .= $quote.$parm.$quote;
|
41 |
+
$more++;
|
42 |
+
} else {
|
43 |
+
${$_key} = $parm;
|
44 |
+
}
|
45 |
+
}
|
46 |
+
}
|
47 |
+
|
48 |
+
$script .= ' };
|
49 |
+
if(typeof easy_fancybox_handler===\'undefined\'){
|
50 |
+
var easy_fancybox_handler=function(){';
|
51 |
+
|
52 |
+
$exclude = \get_option( 'fancybox_autoExclude', \easyFancyBox::$options['Global']['options']['Miscellaneous']['options']['autoExclude']['default'] );
|
53 |
+
$exclude_array = $exclude ? explode( ',', $exclude ) : array();
|
54 |
+
$exclude_selectors = ! empty( $exclude_array ) ? \wp_json_encode( $exclude_array ) : false;
|
55 |
+
if ( $exclude_selectors ) {
|
56 |
+
$script .= '
|
57 |
+
jQuery(' . $exclude_selectors . '.join(\',\')).addClass(\'nofancybox\');';
|
58 |
+
}
|
59 |
+
|
60 |
+
$script .= '
|
61 |
+
jQuery(\'a.fancybox-close\').on(\'click\',function(e){e.preventDefault();jQuery.fancybox.close()});';
|
62 |
+
|
63 |
+
foreach ( \easyFancyBox::$options as $key => $value ) {
|
64 |
+
// Check if not enabled or hide=true then skip.
|
65 |
+
if ( isset( $value['hide'] ) || ! isset( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'] ) || ! \get_option( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'], \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['default'] ) )
|
66 |
+
continue;
|
67 |
+
|
68 |
+
$script .= '
|
69 |
+
/* ' . $key . ' */';
|
70 |
+
|
71 |
+
/**
|
72 |
+
* Auto-detection routines (2x)
|
73 |
+
*/
|
74 |
+
$autoAttribute = isset( $value['options']['autoAttribute'] ) ? \get_option( $value['options']['autoAttribute']['id'], $value['options']['autoAttribute']['default'] ) : '';
|
75 |
+
|
76 |
+
if ( !empty($autoAttribute) ) {
|
77 |
+
if ( is_numeric($autoAttribute) ) {
|
78 |
+
$script .= '
|
79 |
+
jQuery('.$value['options']['autoAttribute']['selector'].').not(\'.nofancybox,li.nofancybox>a\').addClass(\''.$value['options']['class']['default'].'\');';
|
80 |
+
} else {
|
81 |
+
// Set selectors.
|
82 |
+
$file_types = array_filter( explode( ',', str_replace( ' ', ',', $autoAttribute ) ) );
|
83 |
+
$more = 0;
|
84 |
+
$script .= '
|
85 |
+
var fb_'.$key.'_select=\'';
|
86 |
+
foreach ( $file_types as $type ) {
|
87 |
+
if ($type == "jpg" || $type == "jpeg" || $type == "png" || $type == "webp" || $type == "gif")
|
88 |
+
$type = '.'.$type;
|
89 |
+
if ($more>0)
|
90 |
+
$script .= ',';
|
91 |
+
$script .= 'a['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox,li.nofancybox>a),area['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox)';
|
92 |
+
$more++;
|
93 |
+
}
|
94 |
+
$script .= '\';';
|
95 |
+
|
96 |
+
$autoselector = class_exists('easyFancyBox_Advanced') ? \get_option($value['options']['autoSelector']['id'],$value['options']['autoSelector']['default']) : $value['options']['autoSelector']['default'];
|
97 |
+
|
98 |
+
// Class and rel depending on settings.
|
99 |
+
if( '1' == \get_option($value['options']['autoAttributeLimit']['id'],$value['options']['autoAttributeLimit']['default']) ) {
|
100 |
+
// Add class.
|
101 |
+
$script .= '
|
102 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
103 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
104 |
+
// Set rel.
|
105 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
106 |
+
case '':
|
107 |
+
default :
|
108 |
+
$script .= ';});';
|
109 |
+
break;
|
110 |
+
|
111 |
+
case '1':
|
112 |
+
$script .= '.attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
113 |
+
break;
|
114 |
+
|
115 |
+
case '2':
|
116 |
+
$script .= '.attr(\'rel\',\'gallery\');});';
|
117 |
+
break;
|
118 |
+
}
|
119 |
+
} else {
|
120 |
+
// Add class.
|
121 |
+
$script .= '
|
122 |
+
jQuery(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
123 |
+
// Set rel.
|
124 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
125 |
+
case '':
|
126 |
+
default :
|
127 |
+
$script .= ';';
|
128 |
+
break;
|
129 |
+
|
130 |
+
case '1':
|
131 |
+
$script .= ';
|
132 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
133 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
134 |
+
break;
|
135 |
+
|
136 |
+
case '2':
|
137 |
+
$script .= '.attr(\'rel\',\'gallery\');';
|
138 |
+
break;
|
139 |
+
}
|
140 |
+
}
|
141 |
+
}
|
142 |
+
}
|
143 |
+
|
144 |
+
/**
|
145 |
+
* Generate .fancybox() bind.
|
146 |
+
*/
|
147 |
+
|
148 |
+
// Prepare auto popup.
|
149 |
+
if ( $key == $autoClick )
|
150 |
+
$trigger = $value['options']['class']['default'];
|
151 |
+
|
152 |
+
$script .= '
|
153 |
+
jQuery(\'' . $value['options']['tag']['default'] . '\')';
|
154 |
+
|
155 |
+
// Use each() to allow different metadata values per instance; fix by Elron. Thanks!
|
156 |
+
$script .= '.each(function(){';
|
157 |
+
|
158 |
+
// Filter here.
|
159 |
+
$bind = 'jQuery(this).fancybox(jQuery.extend(true,{},fb_opts,{';
|
160 |
+
$more = 0;
|
161 |
+
foreach ( $value['options'] as $_key => $_value ) {
|
162 |
+
if ( isset($_value['id']) || isset($_value['default']) )
|
163 |
+
$parm = isset($_value['id']) ? strval( \get_option($_value['id'], isset($_value['default']) ? $_value['default'] : '' ) ) : strval( $_value['default'] );
|
164 |
+
else
|
165 |
+
$parm = '';
|
166 |
+
|
167 |
+
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
168 |
+
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
169 |
+
|
170 |
+
if ( !isset($_value['hide']) && $parm!='' ) {
|
171 |
+
$quote = ( is_numeric($parm) || ( isset($_value['noquotes']) && $_value['noquotes'] == true ) ) ? '' : '\'';
|
172 |
+
if ( $more > 0 )
|
173 |
+
$bind .= ',';
|
174 |
+
$bind .= '\''.$_key.'\':';
|
175 |
+
$bind .= $quote.$parm.$quote;
|
176 |
+
$more++;
|
177 |
+
}
|
178 |
+
}
|
179 |
+
$bind .= '}))';
|
180 |
+
|
181 |
+
$script .= \apply_filters( 'easy_fancybox_bind', $bind );
|
182 |
+
|
183 |
+
$script .= '});';
|
184 |
+
}
|
185 |
+
|
186 |
+
$script .= '
|
187 |
+
};};';
|
188 |
+
|
189 |
+
if ( empty( $delayClick ) ) $delayClick = '0';
|
190 |
+
|
191 |
+
switch ( $autoClick ) {
|
192 |
+
case '':
|
193 |
+
break;
|
194 |
+
|
195 |
+
case '1':
|
196 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a#fancybox-auto,#fancybox-auto>a\').first().trigger(\'click\')},'.$delayClick.');};';
|
197 |
+
\easyFancyBox::$onready_auto = true;
|
198 |
+
break;
|
199 |
+
|
200 |
+
case '2':
|
201 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){if(location.hash){jQuery(location.hash).trigger(\'click\');}},'.$delayClick.');};';
|
202 |
+
\easyFancyBox::$onready_auto = true;
|
203 |
+
break;
|
204 |
+
|
205 |
+
case '99':
|
206 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class|="fancybox"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
207 |
+
\easyFancyBox::$onready_auto = true;
|
208 |
+
break;
|
209 |
+
|
210 |
+
default :
|
211 |
+
if ( ! empty( $trigger ) ) {
|
212 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class*="'.$trigger.'"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
213 |
+
\easyFancyBox::$onready_auto = true;
|
214 |
+
}
|
215 |
+
}
|
216 |
+
|
217 |
+
|
218 |
+
$script .= PHP_EOL;
|
219 |
+
|
220 |
+
// Replace PDF embed shortcodes.
|
221 |
+
if ( ! empty( get_option('fancybox_enablePDF') ) && ! empty( get_option( 'fancybox_PDFonStart', '{{object}}' ) ) ) {
|
222 |
+
$replaces = array(
|
223 |
+
'{{object}}' => 'function(a,i,o){o.type=\'pdf\';}',
|
224 |
+
'{{embed}}' => 'function(a,i,o){o.type=\'html\';o.content=\'<embed src="\'+a[i].href+\'" type="application/pdf" height="100%" width="100%" />\'}',
|
225 |
+
'{{googleviewer}}' => 'function(a,i,o){o.href=\'https://docs.google.com/viewer?embedded=true&url=\'+a[i].href;}'
|
226 |
+
);
|
227 |
+
foreach ($replaces as $short => $replace) {
|
228 |
+
$script = str_replace( $short, $replace, $script );
|
229 |
+
}
|
230 |
+
}
|
231 |
+
\easyFancyBox::$inline_script = \apply_filters( 'easy_fancybox_inline_script', $script );
|
232 |
+
|
233 |
+
/**
|
234 |
+
* HEADER STYLES
|
235 |
+
*/
|
236 |
+
|
237 |
+
// Customized styles.
|
238 |
+
$styles = '';
|
239 |
+
! isset( $overlaySpotlight ) || 'true' !== $overlaySpotlight || $styles .= '#fancybox-overlay{background-attachment:fixed;background-image:url("' . \easyFancyBox::$plugin_url . 'images/light-mask.png");background-position:center;background-repeat:no-repeat;background-size:100% 100%}';
|
240 |
+
|
241 |
+
empty( $borderRadius ) || $styles .= '#fancybox-outer,#fancybox-content{border-radius:'.$borderRadius.'px}.fancybox-title-inside{padding-top:'.$borderRadius.'px;margin-top:-'.$borderRadius.'px !important;border-radius: 0 0 '.$borderRadius.'px '.$borderRadius.'px}';
|
242 |
+
|
243 |
+
$content_style = '';
|
244 |
+
empty( $backgroundColor ) || $content_style .= 'background:'.$backgroundColor.';';
|
245 |
+
empty( $paddingColor ) || $content_style .= 'border-color:'.$paddingColor.';';
|
246 |
+
if ( ! empty( $textColor ) ) {
|
247 |
+
$content_style .= 'color:'.$textColor.';';
|
248 |
+
$styles .= '#fancybox-outer{background:'.$paddingColor.'}'; //.fancybox-title-inside{background-color:'.$paddingColor.';margin-left:0 !important;margin-right:0 !important;width:100% !important;}
|
249 |
+
}
|
250 |
+
empty( $content_style ) || $styles .= '#fancybox-content{'.$content_style.'}';
|
251 |
+
|
252 |
+
empty( $titleColor ) || $styles .= '#fancybox-title,#fancybox-title-float-main{color:'.$titleColor.'}';
|
253 |
+
|
254 |
+
empty( $styles ) || \easyFancyBox::$inline_style = \wp_strip_all_tags( $styles );
|
255 |
+
}
|
256 |
+
|
257 |
+
function add_easing() {
|
258 |
+
// Check IMG settings.
|
259 |
+
if (
|
260 |
+
\get_option( 'fancybox_enableImg', \easyFancyBox::$options['Global']['options']['Enable']['options']['IMG']['default'] ) &&
|
261 |
+
( 'elastic' === \get_option( 'fancybox_transitionIn', 'elastic' ) || 'elastic' === \get_option( 'fancybox_transitionOut', 'elastic' ) )
|
262 |
+
) {
|
263 |
+
return true;
|
264 |
+
}
|
265 |
+
|
266 |
+
// Check Inline Content settings.
|
267 |
+
if (
|
268 |
+
\get_option( 'fancybox_enableInline', false ) &&
|
269 |
+
( 'elastic' === \get_option( 'fancybox_transitionInInline' ) || 'elastic' === \get_option( 'fancybox_transitionOutInline' ) )
|
270 |
+
) {
|
271 |
+
return true;
|
272 |
+
}
|
273 |
+
|
274 |
+
return false;
|
275 |
+
}
|
276 |
+
|
277 |
+
/**
|
278 |
+
* ACTIONS & FILTERS
|
279 |
+
*/
|
280 |
+
|
281 |
+
function prepare_scripts_styles() {
|
282 |
+
// Make sure whe actually need to do anything.
|
283 |
+
if ( ! \easyFancyBox::add_scripts() ){
|
284 |
+
return;
|
285 |
+
}
|
286 |
+
|
287 |
+
// INLINE SCRIPT & STYLE
|
288 |
+
prepare_inline();
|
289 |
+
|
290 |
+
$min = ( defined('WP_DEBUG') && WP_DEBUG ) ? '' : '.min';
|
291 |
+
|
292 |
+
// SCRIPT & STYLE URLS
|
293 |
+
|
294 |
+
$dep = get_option( 'fancybox_nojQuery', false ) ? array() : array( 'jquery' );
|
295 |
+
$ver = defined( 'WP_DEBUG' ) && WP_DEBUG ? time() : false;
|
296 |
+
$min = defined( 'WP_DEBUG' ) && WP_DEBUG ? '' : '.min';
|
297 |
+
$footer = get_option( 'fancybox_noFooter', false ) ? false : true;
|
298 |
+
|
299 |
+
// FancyBox.
|
300 |
+
\easyFancyBox::$styles['fancybox'] = array(
|
301 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['classic'].'/jquery.fancybox'.$min.'.css',
|
302 |
+
'deps' => array(),
|
303 |
+
'ver' => $ver,
|
304 |
+
'media' => 'screen'
|
305 |
+
);
|
306 |
+
\easyFancyBox::$scripts['jquery-fancybox'] = array(
|
307 |
+
'src' => \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['classic'].'/jquery.fancybox'.$min.'.js',
|
308 |
+
'deps' => $dep,
|
309 |
+
'ver' => $ver,
|
310 |
+
'footer' => $footer
|
311 |
+
);
|
312 |
+
|
313 |
+
// jQuery Easing, which is not needed if jQueryUI Core Effects are loaded or when using fancyBox 3.
|
314 |
+
if ( add_easing() ) {
|
315 |
+
\easyFancyBox::$easing_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.easing'.$min.'.js';
|
316 |
+
}
|
317 |
+
|
318 |
+
// jQuery Mousewheel, which is not needed if jQueryUI Mouse is loaded or when using fancyBox 3.
|
319 |
+
if ( \get_option( 'fancybox_mouseWheel', true ) ) {
|
320 |
+
\easyFancyBox::$mousewheel_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.mousewheel'.$min.'.js';
|
321 |
+
}
|
322 |
+
|
323 |
+
// Metadata in Miscellaneous settings?
|
324 |
+
if ( \get_option( 'fancybox_metaData' ) ) {
|
325 |
+
\easyFancyBox::$scripts['jquery-metadata'] = array(
|
326 |
+
'src' => \easyFancyBox::$plugin_url.'vendor/jquery.metadata.min.js',
|
327 |
+
'deps' => $dep,
|
328 |
+
'ver' => METADATA_VERSION,
|
329 |
+
'footer' => $footer
|
330 |
+
);
|
331 |
+
}
|
332 |
+
}
|
333 |
+
\add_action( 'init', __NAMESPACE__.'\prepare_scripts_styles', 12 );
|
334 |
+
|
335 |
+
function onready_callback( $content ) {
|
336 |
+
$content .= 'jQuery(easy_fancybox_handler);jQuery(document).on(\'' . implode( " ", \easyFancyBox::$events ) . '\',easy_fancybox_handler);' . PHP_EOL;
|
337 |
+
|
338 |
+
if ( \easyFancyBox::$onready_auto )
|
339 |
+
$content .= \apply_filters( 'easy_fancybox_onready_auto', 'jQuery(easy_fancybox_auto);' );
|
340 |
+
|
341 |
+
return $content;
|
342 |
+
}
|
343 |
+
\add_filter( 'easy_fancybox_inline_script', __NAMESPACE__.'\onready_callback' );
|
inc/{easyfancybox-options.php → fancybox-legacy-options.php}
RENAMED
@@ -1,99 +1,99 @@
|
|
1 |
<?php
|
2 |
/**
|
3 |
-
*
|
4 |
*/
|
5 |
|
6 |
$efb_options = array (
|
7 |
-
'Global' => array(
|
8 |
-
'
|
9 |
'input' => 'deep',
|
10 |
'hide' => true,
|
11 |
'options' => array(
|
12 |
'Enable' => array (
|
13 |
-
'title' =>
|
14 |
'input' => 'multiple',
|
15 |
'hide' => true,
|
16 |
'options' => array(
|
17 |
'p1' => array (
|
18 |
'hide' => true,
|
19 |
-
'description' =>
|
20 |
),
|
21 |
'IMG' => array (
|
22 |
'id' => 'fancybox_enableImg',
|
23 |
'input' => 'checkbox',
|
24 |
'hide' => true,
|
25 |
-
'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network(
|
26 |
-
'description' => '<strong>' .
|
27 |
),
|
28 |
'Inline' => array (
|
29 |
'id' => 'fancybox_enableInline',
|
30 |
'input' => 'checkbox',
|
31 |
'hide' => true,
|
32 |
'default' => '',
|
33 |
-
'description' => '<strong>' .
|
34 |
),
|
35 |
'PDF' => array (
|
36 |
'id' => 'fancybox_enablePDF',
|
37 |
'input' => 'checkbox',
|
38 |
'hide' => true,
|
39 |
'default' => '',
|
40 |
-
'description' => '<strong>' .
|
41 |
),
|
42 |
'SWF' => array (
|
43 |
'id' => 'fancybox_enableSWF',
|
44 |
'input' => 'checkbox',
|
45 |
'hide' => true,
|
46 |
'default' => '',
|
47 |
-
'description' => '<strong>' .
|
48 |
),
|
49 |
'SVG' => array (
|
50 |
'id' => 'fancybox_enableSVG',
|
51 |
'input' => 'checkbox',
|
52 |
'hide' => true,
|
53 |
'default' => '',
|
54 |
-
'description' => '<strong>' .
|
55 |
),
|
56 |
'VideoPress' => array (
|
57 |
-
'id' => '
|
58 |
'input' => 'checkbox',
|
59 |
'hide' => true,
|
60 |
'default' => '',
|
61 |
'status' => 'disabled',
|
62 |
-
'description' => '<strong>' .
|
63 |
),
|
64 |
'YouTube' => array (
|
65 |
'id' => 'fancybox_enableYoutube',
|
66 |
'input' => 'checkbox',
|
67 |
'hide' => true,
|
68 |
'default' => '',
|
69 |
-
'description' => '<strong>' .
|
70 |
),
|
71 |
'Vimeo' => array (
|
72 |
'id' => 'fancybox_enableVimeo',
|
73 |
'input' => 'checkbox',
|
74 |
'hide' => true,
|
75 |
'default' => '',
|
76 |
-
'description' => '<strong>' .
|
77 |
),
|
78 |
'Dailymotion' => array (
|
79 |
'id' => 'fancybox_enableDailymotion',
|
80 |
'input' => 'checkbox',
|
81 |
'hide' => true,
|
82 |
'default' => '',
|
83 |
-
'description' => '<strong>' .
|
84 |
),
|
85 |
'iFrame' => array (
|
86 |
'id' => 'fancybox_enableiFrame',
|
87 |
'input' => 'checkbox',
|
88 |
'hide' => true,
|
89 |
'default' => '',
|
90 |
-
'description' => '<strong>' .
|
91 |
)
|
92 |
),
|
93 |
'description' => ''
|
94 |
),
|
95 |
'Overlay' => array (
|
96 |
-
'title' =>
|
97 |
'input' => 'multiple',
|
98 |
'hide' => true,
|
99 |
'options' => array(
|
@@ -102,18 +102,18 @@ $efb_options = array (
|
|
102 |
'input' => 'checkbox',
|
103 |
'noquotes' => true,
|
104 |
'default' => '1',
|
105 |
-
'description' =>
|
106 |
),
|
107 |
'hideOnOverlayClick' => array (
|
108 |
'id' => 'fancybox_hideOnOverlayClick',
|
109 |
'input' => 'checkbox',
|
110 |
'noquotes' => true,
|
111 |
'default' => '1',
|
112 |
-
'description' =>
|
113 |
),
|
114 |
'overlayOpacity' => array (
|
115 |
'id' => 'fancybox_overlayOpacity',
|
116 |
-
'title' =>
|
117 |
'label_for' => 'fancybox_overlayOpacity',
|
118 |
'input' => 'number',
|
119 |
'step' => '0.1',
|
@@ -121,17 +121,17 @@ $efb_options = array (
|
|
121 |
'max' => '1',
|
122 |
'class' => 'small-text',
|
123 |
'default' => '',
|
124 |
-
'description' =>
|
125 |
),
|
126 |
'overlayColor' => array (
|
127 |
'id' => 'fancybox_overlayColor',
|
128 |
-
'title' =>
|
129 |
'label_for' => 'fancybox_overlayColor',
|
130 |
'input' => 'text',
|
131 |
'sanitize_callback' => 'colorval',
|
132 |
'class' => 'small-text',
|
133 |
'default' => '',
|
134 |
-
'description' =>
|
135 |
),
|
136 |
'overlaySpotlight' => array (
|
137 |
'id' => 'fancybox_overlaySpotlight',
|
@@ -139,30 +139,30 @@ $efb_options = array (
|
|
139 |
'hide' => true,
|
140 |
'status' => get_option('fancybox_overlaySpotlight') ? '' : 'disabled',
|
141 |
'default' => '',
|
142 |
-
'description' =>
|
143 |
)
|
144 |
)
|
145 |
),
|
146 |
'Window' => array (
|
147 |
-
'title' =>
|
148 |
'input' => 'multiple',
|
149 |
'hide' => true,
|
150 |
'options' => array(
|
151 |
'p1' => array (
|
152 |
'hide' => true,
|
153 |
-
'description' => '<strong>' .
|
154 |
),
|
155 |
'showCloseButton' => array (
|
156 |
'id' => 'fancybox_showCloseButton',
|
157 |
'input' => 'checkbox',
|
158 |
'noquotes' => true,
|
159 |
'default' => '1',
|
160 |
-
'description' =>
|
161 |
),
|
162 |
'backgroundColor' => array (
|
163 |
'id' => 'fancybox_backgroundColor',
|
164 |
'hide' => true,
|
165 |
-
'title' =>
|
166 |
'label_for' => 'fancybox_backgroundColor',
|
167 |
'input' => 'text',
|
168 |
'sanitize_callback' => 'colorval',
|
@@ -174,19 +174,19 @@ $efb_options = array (
|
|
174 |
'textColor' => array (
|
175 |
'id' => 'fancybox_textColor',
|
176 |
'hide' => true,
|
177 |
-
'title' =>
|
178 |
'label_for' => 'fancybox_textColor',
|
179 |
'input' => 'text',
|
180 |
'sanitize_callback' => 'colorval',
|
181 |
'status' => 'disabled',
|
182 |
'class' => 'small-text',
|
183 |
'default' => '',
|
184 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
185 |
),
|
186 |
'titleColor' => array (
|
187 |
'id' => 'fancybox_titleColor',
|
188 |
'hide' => true,
|
189 |
-
'title' =>
|
190 |
'label_for' => 'fancybox_titleColor',
|
191 |
'input' => 'text',
|
192 |
'sanitize_callback' => 'colorval',
|
@@ -197,18 +197,18 @@ $efb_options = array (
|
|
197 |
'paddingColor' => array (
|
198 |
'id' => 'fancybox_paddingColor',
|
199 |
'hide' => true,
|
200 |
-
'title' =>
|
201 |
'label_for' => 'fancybox_paddingColor',
|
202 |
'input' => 'text',
|
203 |
'sanitize_callback' => 'colorval',
|
204 |
'class' => 'small-text',
|
205 |
'default' => '',
|
206 |
-
'description' => '<em>' .
|
207 |
),
|
208 |
'borderRadius' => array (
|
209 |
'id' => 'fancybox_borderRadius',
|
210 |
'hide' => true,
|
211 |
-
'title' =>
|
212 |
'label_for' => 'fancybox_borderRadius',
|
213 |
'input' => 'number',
|
214 |
'step' => '1',
|
@@ -218,12 +218,12 @@ $efb_options = array (
|
|
218 |
'status' => 'disabled',
|
219 |
'class' => 'small-text',
|
220 |
'default' => '',
|
221 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
222 |
),
|
223 |
|
224 |
'p11' => array (
|
225 |
'hide' => true,
|
226 |
-
'description' => '<br /><strong>' .
|
227 |
),
|
228 |
'width' => array (
|
229 |
'id' => 'fancybox_width',
|
@@ -243,7 +243,7 @@ $efb_options = array (
|
|
243 |
'sanitize_callback' => 'intval',
|
244 |
'class' => 'small-text',
|
245 |
'default' => '',
|
246 |
-
'description' => '<em>' .
|
247 |
),
|
248 |
'padding' => array (
|
249 |
'id' => 'fancybox_padding',
|
@@ -256,11 +256,11 @@ $efb_options = array (
|
|
256 |
'sanitize_callback' => 'intval',
|
257 |
'class' => 'small-text',
|
258 |
'default' => '',
|
259 |
-
'description' => '<em>' .
|
260 |
),
|
261 |
'margin' => array (
|
262 |
'id' => 'fancybox_margin',
|
263 |
-
'title' =>
|
264 |
'label_for' => 'fancybox_margin',
|
265 |
'input' => 'number',
|
266 |
'step' => '1',
|
@@ -269,37 +269,30 @@ $efb_options = array (
|
|
269 |
'sanitize_callback' => 'intval',
|
270 |
'class' => 'small-text',
|
271 |
'default' => '20',
|
272 |
-
'description' => '<em>' .
|
273 |
),
|
274 |
|
275 |
'p2' => array (
|
276 |
'hide' => true,
|
277 |
-
'description' => '<br /><strong>' .
|
278 |
-
),
|
279 |
-
'centerOnScroll' => array (
|
280 |
-
'id' => 'fancybox_centerOnScroll',
|
281 |
-
'input' => 'checkbox',
|
282 |
-
'noquotes' => true,
|
283 |
-
'default' => '',
|
284 |
-
'description' => __('Center while scrolling (always disabled on touch devices and when content, including the title, might be larger than the viewport)','easy-fancybox')
|
285 |
),
|
286 |
'enableEscapeButton' => array (
|
287 |
'id' => 'fancybox_enableEscapeButton',
|
288 |
'input' => 'checkbox',
|
289 |
'noquotes' => true,
|
290 |
'default' => '1',
|
291 |
-
'description' =>
|
292 |
),
|
293 |
'autoScale' => array (
|
294 |
'id' => 'fancybox_autoScale',
|
295 |
'input' => 'checkbox',
|
296 |
'noquotes' => true,
|
297 |
'default' => '1',
|
298 |
-
'description' =>
|
299 |
),
|
300 |
'speedIn' => array (
|
301 |
'id' => 'fancybox_speedIn',
|
302 |
-
'title' =>
|
303 |
'label_for' => 'fancybox_speedIn',
|
304 |
'input' => 'number',
|
305 |
'step' => '100',
|
@@ -311,7 +304,7 @@ $efb_options = array (
|
|
311 |
),
|
312 |
'speedOut' => array (
|
313 |
'id' => 'fancybox_speedOut',
|
314 |
-
'title' =>
|
315 |
'label_for' => 'fancybox_speedOut',
|
316 |
'input' => 'number',
|
317 |
'step' => '100',
|
@@ -320,43 +313,43 @@ $efb_options = array (
|
|
320 |
'sanitize_callback' => 'intval',
|
321 |
'class' => 'small-text',
|
322 |
'default' => '',
|
323 |
-
'description' => '<br />' .
|
324 |
),
|
325 |
'mouseWheel' => array (
|
326 |
'id' => 'fancybox_mouseWheel',
|
327 |
'hide' => true,
|
328 |
'input' => 'checkbox',
|
329 |
'default' => '',
|
330 |
-
'description' =>
|
331 |
)
|
332 |
)
|
333 |
),
|
334 |
|
335 |
'Miscellaneous' => array (
|
336 |
-
'title' =>
|
337 |
'input' => 'multiple',
|
338 |
'hide' => true,
|
339 |
'options' => array(
|
340 |
'p0' => array (
|
341 |
'hide' => true,
|
342 |
-
'description' => '<strong>' .
|
343 |
),
|
344 |
'autoClick' => array (
|
345 |
'id' => 'fancybox_autoClick',
|
346 |
-
'title' =>
|
347 |
'label_for' => 'fancybox_autoClick',
|
348 |
'hide' => true,
|
349 |
'input' => 'select',
|
350 |
'options' => array(
|
351 |
'' => translate('None'),
|
352 |
-
'1' =>
|
353 |
),
|
354 |
'default' => '1',
|
355 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
356 |
),
|
357 |
'delayClick' => array (
|
358 |
'id' => 'fancybox_delayClick',
|
359 |
-
'title' =>
|
360 |
'label_for' => 'fancybox_delayClick',
|
361 |
'hide' => true,
|
362 |
'input' => 'number',
|
@@ -366,11 +359,11 @@ $efb_options = array (
|
|
366 |
'sanitize_callback' => 'intval',
|
367 |
'class' => 'small-text',
|
368 |
'default' => '1000',
|
369 |
-
'description' => ' <em>' .
|
370 |
),
|
371 |
'jqCookie' => array (
|
372 |
'id' => '',
|
373 |
-
'title' =>
|
374 |
'hide' => true,
|
375 |
'input' => 'select',
|
376 |
'status' => 'disabled',
|
@@ -378,12 +371,12 @@ $efb_options = array (
|
|
378 |
'sanitize_callback' => 'intval',
|
379 |
'options' => array(
|
380 |
'0' => translate('No'),
|
381 |
-
'1' =>
|
382 |
-
'7' =>
|
383 |
-
'30' =>
|
384 |
-
'365' =>
|
385 |
),
|
386 |
-
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
387 |
),
|
388 |
'cookiePath' => array (
|
389 |
'id' => '',
|
@@ -392,11 +385,11 @@ $efb_options = array (
|
|
392 |
),
|
393 |
'p1' => array (
|
394 |
'hide' => true,
|
395 |
-
'description' => '<br /><strong>' .
|
396 |
),
|
397 |
'minViewportWidth' => array (
|
398 |
'id' => 'fancybox_minViewportWidth',
|
399 |
-
'title' =>
|
400 |
'label_for' => 'fancybox_minViewportWidth',
|
401 |
'input' => 'number',
|
402 |
'step' => '1',
|
@@ -405,31 +398,31 @@ $efb_options = array (
|
|
405 |
'sanitize_callback' => 'intval',
|
406 |
'class' => 'small-text',
|
407 |
'default' => '',
|
408 |
-
'description' =>
|
409 |
),
|
410 |
/* 'forceNewtab' => array (
|
411 |
'id' => 'fancybox_forceNewtab',
|
412 |
'input' => 'checkbox',
|
413 |
'hide' => true,
|
414 |
'default' => '1',
|
415 |
-
'description' =>
|
416 |
),*/
|
417 |
'compatIE8' => array (
|
418 |
'id' => 'fancybox_compatIE8',
|
419 |
'input' => 'checkbox',
|
420 |
'hide' => true,
|
421 |
'default' => '',
|
422 |
-
'description' =>
|
423 |
),
|
424 |
'p2' => array (
|
425 |
'hide' => true,
|
426 |
-
'description' => '<br /><strong>' .
|
427 |
-
.
|
428 |
. '<br /><br />'
|
429 |
),
|
430 |
'scriptPriority' => array (
|
431 |
'id' => 'fancybox_scriptPriority',
|
432 |
-
'title' =>
|
433 |
'label_for' => 'fancybox_scriptPriority',
|
434 |
'hide' => true,
|
435 |
'input' => 'number',
|
@@ -439,32 +432,32 @@ $efb_options = array (
|
|
439 |
'sanitize_callback' => 'intval',
|
440 |
'class' => 'small-text',
|
441 |
'default' => '10',
|
442 |
-
'description' =>
|
443 |
),
|
444 |
'noFooter' => array (
|
445 |
'id' => 'fancybox_noFooter',
|
446 |
'input' => 'checkbox',
|
447 |
'hide' => true,
|
448 |
'default' => '',
|
449 |
-
'description' =>
|
450 |
),
|
451 |
'nojQuery' => array (
|
452 |
'id' => 'fancybox_nojQuery',
|
453 |
'input' => 'checkbox',
|
454 |
'hide' => true,
|
455 |
'default' => '',
|
456 |
-
'description' =>
|
457 |
),
|
458 |
'pre45Compat' => array (
|
459 |
'id' => 'fancybox_pre45Compat',
|
460 |
'input' => 'checkbox',
|
461 |
'hide' => true,
|
462 |
'default' => function_exists( 'wp_add_inline_script' ) ? '' : '1',
|
463 |
-
'description' =>
|
464 |
),
|
465 |
'p3' => array (
|
466 |
'hide' => true,
|
467 |
-
'description' => '<br /><strong>' .
|
468 |
),
|
469 |
'metaData' => array (
|
470 |
'id' => 'fancybox_metaData',
|
@@ -472,7 +465,7 @@ $efb_options = array (
|
|
472 |
'input' => 'checkbox',
|
473 |
'status' => get_option('fancybox_metaData') ? '' : 'disabled',
|
474 |
'default' => '',
|
475 |
-
'description' =>
|
476 |
),
|
477 |
'vcMasonryCompat' => array (
|
478 |
'id' => 'fancybox_vcMasonryCompat',
|
@@ -480,18 +473,18 @@ $efb_options = array (
|
|
480 |
'input' => 'checkbox',
|
481 |
'status' => 'disabled',
|
482 |
'default' => '',
|
483 |
-
'description' =>
|
484 |
),
|
485 |
'autoExclude' => array (
|
486 |
'id' => 'fancybox_autoExclude',
|
487 |
-
'title' =>
|
488 |
'label_for' => 'fancybox_autoExclude',
|
489 |
'input' => 'text',
|
490 |
'class' => 'regular-text',
|
491 |
'hide' => true,
|
492 |
'default' => '.nolightbox,a.wp-block-file__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']',
|
493 |
'sanitize_callback' => 'csl_text',
|
494 |
-
'description' =>
|
495 |
)
|
496 |
)
|
497 |
)
|
@@ -499,16 +492,16 @@ $efb_options = array (
|
|
499 |
),
|
500 |
|
501 |
'IMG' => array(
|
502 |
-
'title' =>
|
503 |
'input' => 'multiple',
|
504 |
'options' => array(
|
505 |
'intro' => array (
|
506 |
'hide' => true,
|
507 |
-
'description' =>
|
508 |
),
|
509 |
'tag' => array (
|
510 |
'hide' => true,
|
511 |
-
'default' => 'a.fancybox,area.fancybox
|
512 |
),
|
513 |
'class' => array (
|
514 |
'hide' => true,
|
@@ -516,7 +509,7 @@ $efb_options = array (
|
|
516 |
),
|
517 |
'autoAttribute' => array (
|
518 |
'id' => 'fancybox_autoAttribute',
|
519 |
-
'title' =>
|
520 |
'label_for' => 'fancybox_autoAttribute',
|
521 |
'input' => 'text',
|
522 |
'class' => 'regular-text',
|
@@ -524,23 +517,23 @@ $efb_options = array (
|
|
524 |
'default' => '.jpg,.png,.webp',
|
525 |
'sanitize_callback' => 'csl_text',
|
526 |
'selector' => 'href*=',
|
527 |
-
'description' =>
|
528 |
),
|
529 |
'autoAttributeLimit' => array (
|
530 |
'id' => 'fancybox_autoAttributeLimit',
|
531 |
-
'title' =>
|
532 |
'label_for' => 'fancybox_autoAttributeLimit',
|
533 |
'hide' => true,
|
534 |
'input' => 'select',
|
535 |
'options' => array(
|
536 |
-
'' =>
|
537 |
),
|
538 |
'default' => '',
|
539 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
540 |
),
|
541 |
'type' => array (
|
542 |
'id' => 'fancybox_classType',
|
543 |
-
'title' =>
|
544 |
'label_for' => 'fancybox_classType',
|
545 |
'input' => 'select',
|
546 |
'options' => array(
|
@@ -552,97 +545,93 @@ $efb_options = array (
|
|
552 |
),
|
553 |
'p2' => array (
|
554 |
'hide' => true,
|
555 |
-
'description' => '<br /><strong>' .
|
556 |
),
|
557 |
'transitionIn' => array (
|
558 |
'id' => 'fancybox_transitionIn',
|
559 |
-
'title' =>
|
560 |
'label_for' => 'fancybox_transitionIn',
|
561 |
'input' => 'select',
|
562 |
'options' => array(
|
563 |
'none' => translate('None'),
|
564 |
-
'' =>
|
565 |
-
'elastic' =>
|
566 |
),
|
567 |
'default' => 'elastic',
|
568 |
'description' => ' '
|
569 |
),
|
570 |
'easingIn' => array (
|
571 |
'id' => 'fancybox_easingIn',
|
572 |
-
'title' =>
|
573 |
'label_for' => 'fancybox_easingIn',
|
574 |
'input' => 'select',
|
575 |
'options' => array(
|
576 |
-
'linear' =>
|
577 |
-
'' =>
|
578 |
-
'easeInBack' => __('easeInBack','easy-fancybox'),
|
579 |
-
'easeOutBack' => __('easeOutBack','easy-fancybox')
|
580 |
),
|
581 |
-
'default' => '
|
582 |
-
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
583 |
),
|
584 |
'transitionOut' => array (
|
585 |
'id' => 'fancybox_transitionOut',
|
586 |
-
'title' =>
|
587 |
'label_for' => 'fancybox_transitionOut',
|
588 |
'input' => 'select',
|
589 |
'options' => array(
|
590 |
'none' => translate('None'),
|
591 |
-
'' =>
|
592 |
-
'elastic' =>
|
593 |
),
|
594 |
'default' => 'elastic',
|
595 |
'description' => ' '
|
596 |
),
|
597 |
'easingOut' => array (
|
598 |
'id' => 'fancybox_easingOut',
|
599 |
-
'title' =>
|
600 |
'label_for' => 'fancybox_easingOut',
|
601 |
'input' => 'select',
|
602 |
'options' => array(
|
603 |
-
'linear' =>
|
604 |
-
'' =>
|
605 |
-
'easeInBack' => __('easeInBack','easy-fancybox'),
|
606 |
-
'easeOutBack' => __('easeOutBack','easy-fancybox')
|
607 |
),
|
608 |
-
'default' => '
|
609 |
-
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
610 |
),
|
611 |
'opacity' => array (
|
612 |
'id' => 'fancybox_opacity',
|
613 |
'input' => 'checkbox',
|
614 |
'noquotes' => true,
|
615 |
'default' => '',
|
616 |
-
'description' =>
|
617 |
),
|
618 |
'hideOnContentClick' => array (
|
619 |
'id' => 'fancybox_hideOnContentClick',
|
620 |
'input' => 'checkbox',
|
621 |
'noquotes' => true,
|
622 |
'default' => '',
|
623 |
-
'description' =>
|
624 |
),
|
625 |
'p1' => array (
|
626 |
'hide' => true,
|
627 |
-
'description' => '<br /><strong>' .
|
628 |
),
|
629 |
'titleShow' => array (
|
630 |
'id' => 'fancybox_titleShow',
|
631 |
'input' => 'checkbox',
|
632 |
'noquotes' => true,
|
633 |
'default' => '1',
|
634 |
-
'description' =>
|
635 |
),
|
636 |
'titlePosition' => array (
|
637 |
'id' => 'fancybox_titlePosition',
|
638 |
-
'title' =>
|
639 |
'label_for' => 'fancybox_titlePosition',
|
640 |
'input' => 'select',
|
641 |
'options' => array(
|
642 |
-
'' =>
|
643 |
-
'outside' =>
|
644 |
-
'inside' =>
|
645 |
-
'over' =>
|
646 |
),
|
647 |
'default' => 'over',
|
648 |
'description' => '<br />'
|
@@ -652,61 +641,61 @@ $efb_options = array (
|
|
652 |
'input' => 'checkbox',
|
653 |
'noquotes' => true,
|
654 |
'default' => '1',
|
655 |
-
'description' =>
|
656 |
),
|
657 |
'onStart' => array (
|
658 |
'id' => '',
|
659 |
-
'title' =>
|
660 |
'input' => 'select',
|
661 |
'status' => 'disabled',
|
662 |
'options' => array(
|
663 |
-
'' =>
|
664 |
),
|
665 |
'default' => '',
|
666 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
667 |
),
|
668 |
'p3' => array (
|
669 |
'hide' => true,
|
670 |
-
'description' => '<br /><strong>' .
|
671 |
),
|
672 |
'autoGallery' => array (
|
673 |
'id' => 'fancybox_autoGallery',
|
674 |
-
'title' =>
|
675 |
'label_for' => 'fancybox_autoGallery',
|
676 |
'hide' => true,
|
677 |
'input' => 'select',
|
678 |
'options' => array(
|
679 |
'' => translate('Disabled'),
|
680 |
-
'1' =>
|
681 |
-
'2' =>
|
682 |
),
|
683 |
'default' => '1',
|
684 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
685 |
),
|
686 |
'showNavArrows' => array (
|
687 |
'id' => 'fancybox_showNavArrows',
|
688 |
'input' => 'checkbox',
|
689 |
'noquotes' => true,
|
690 |
'default' => '1',
|
691 |
-
'description' =>
|
692 |
),
|
693 |
'enableKeyboardNav' => array (
|
694 |
'id' => 'fancybox_enableKeyboardNav',
|
695 |
'input' => 'checkbox',
|
696 |
'noquotes' => true,
|
697 |
'default' => '1',
|
698 |
-
'description' =>
|
699 |
),
|
700 |
'cyclic' => array (
|
701 |
'id' => 'fancybox_cyclic',
|
702 |
'input' => 'checkbox',
|
703 |
'noquotes' => true,
|
704 |
'default' => '',
|
705 |
-
'description' =>
|
706 |
),
|
707 |
'changeSpeed' => array (
|
708 |
'id' => 'fancybox_changeSpeed',
|
709 |
-
'title' =>
|
710 |
'label_for' => 'fancybox_changeSpeed',
|
711 |
'input' => 'number',
|
712 |
'step' => '1',
|
@@ -718,7 +707,7 @@ $efb_options = array (
|
|
718 |
),
|
719 |
'changeFade' => array (
|
720 |
'id' => 'fancybox_changeFade',
|
721 |
-
'title' =>
|
722 |
'label_for' => 'fancybox_changeFade',
|
723 |
'input' => 'number',
|
724 |
'step' => '1',
|
@@ -727,7 +716,7 @@ $efb_options = array (
|
|
727 |
'sanitize_callback' => 'intval',
|
728 |
'class' => 'small-text',
|
729 |
'default' => '',
|
730 |
-
'description' => '<br />' .
|
731 |
),
|
732 |
'autoSelector' => array (
|
733 |
'id' => 'fancybox_autoSelector',
|
@@ -737,29 +726,29 @@ $efb_options = array (
|
|
737 |
),
|
738 |
'onComplete' => array (
|
739 |
'id' => '',
|
740 |
-
'title' =>
|
741 |
'input' => 'select',
|
742 |
'status' => 'disabled',
|
743 |
'options' => array(
|
744 |
-
'' =>
|
745 |
),
|
746 |
'default' => '',
|
747 |
-
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
748 |
)
|
749 |
)
|
750 |
),
|
751 |
|
752 |
'Inline' => array(
|
753 |
-
'title' =>
|
754 |
'input' => 'multiple',
|
755 |
'options' => array(
|
756 |
'intro' => array (
|
757 |
'hide' => true,
|
758 |
-
'description' =>
|
759 |
),
|
760 |
'tag' => array (
|
761 |
'hide' => true,
|
762 |
-
'default' => 'a.fancybox-inline,area.fancybox-inline
|
763 |
),
|
764 |
'class' => array (
|
765 |
'hide' => true,
|
@@ -773,88 +762,84 @@ $efb_options = array (
|
|
773 |
'input' => 'checkbox',
|
774 |
'noquotes' => true,
|
775 |
'default' => '1',
|
776 |
-
'description' =>
|
777 |
),
|
778 |
'scrolling' => array (
|
779 |
'id' => 'fancybox_InlineScrolling',
|
780 |
-
'title' =>
|
781 |
'label_for' => 'fancybox_InlineScrolling',
|
782 |
'input' => 'select',
|
783 |
'options' => array(
|
784 |
-
'auto' =>
|
785 |
-
'yes' =>
|
786 |
-
'no' =>
|
787 |
),
|
788 |
'default' => 'no',
|
789 |
-
'description' =>
|
790 |
),
|
791 |
'transitionIn' => array (
|
792 |
'id' => 'fancybox_transitionInInline',
|
793 |
-
'title' =>
|
794 |
'label_for' => 'fancybox_transitionInInline',
|
795 |
'input' => 'select',
|
796 |
'options' => array(
|
797 |
'none' => translate('None'),
|
798 |
-
'' =>
|
799 |
-
'elastic' =>
|
800 |
),
|
801 |
'default' => '',
|
802 |
'description' => ' '
|
803 |
),
|
804 |
'easingIn' => array (
|
805 |
'id' => 'fancybox_easingInInline',
|
806 |
-
'title' =>
|
807 |
'label_for' => 'fancybox_easingInInline',
|
808 |
'input' => 'select',
|
809 |
'options' => array(
|
810 |
-
'linear' =>
|
811 |
-
'' =>
|
812 |
-
'easeInBack' => __('easeInBack','easy-fancybox'),
|
813 |
-
'easeOutBack' => __('easeOutBack','easy-fancybox')
|
814 |
),
|
815 |
'default' => 'easeOutBack',
|
816 |
-
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
817 |
),
|
818 |
'transitionOut' => array (
|
819 |
'id' => 'fancybox_transitionOutInline',
|
820 |
-
'title' =>
|
821 |
'label_for' => 'fancybox_transitionOutInline',
|
822 |
'input' => 'select',
|
823 |
'options' => array(
|
824 |
'none' => translate('None'),
|
825 |
-
'' =>
|
826 |
-
'elastic' =>
|
827 |
),
|
828 |
'default' => '',
|
829 |
'description' => ' '
|
830 |
),
|
831 |
'easingOut' => array (
|
832 |
'id' => 'fancybox_easingOutInline',
|
833 |
-
'title' =>
|
834 |
'label_for' => 'fancybox_easingOutInline',
|
835 |
'input' => 'select',
|
836 |
'options' => array(
|
837 |
-
'linear' =>
|
838 |
-
'' =>
|
839 |
-
'easeInBack' => __('easeInBack','easy-fancybox'),
|
840 |
-
'easeOutBack' => __('easeOutBack','easy-fancybox')
|
841 |
),
|
842 |
-
'default' => '
|
843 |
-
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' .
|
844 |
),
|
845 |
'opacity' => array (
|
846 |
'id' => 'fancybox_opacityInline',
|
847 |
'input' => 'checkbox',
|
848 |
'noquotes' => true,
|
849 |
'default' => '',
|
850 |
-
'description' =>
|
851 |
),
|
852 |
'hideOnContentClick' => array (
|
853 |
'id' => 'fancybox_hideOnContentClickInline',
|
854 |
'input' => 'checkbox',
|
855 |
'noquotes' => true,
|
856 |
'default' => '',
|
857 |
-
'description' =>
|
858 |
),
|
859 |
'titleShow' => array (
|
860 |
'noquotes' => true,
|
@@ -864,12 +849,12 @@ $efb_options = array (
|
|
864 |
),
|
865 |
|
866 |
'PDF' => array(
|
867 |
-
'title' =>
|
868 |
'input' => 'multiple',
|
869 |
'options' => array(
|
870 |
'intro' => array (
|
871 |
'hide' => true,
|
872 |
-
'description' =>
|
873 |
),
|
874 |
'autoAttribute' => array (
|
875 |
'id' => 'fancybox_autoAttributePDF',
|
@@ -877,11 +862,11 @@ $efb_options = array (
|
|
877 |
'hide' => true,
|
878 |
'default' => '1',
|
879 |
'selector' => '\'a[href*=".pdf"],area[href*=".pdf"],a[href*=".PDF"],area[href*=".PDF"]\'',
|
880 |
-
'description' =>
|
881 |
),
|
882 |
'tag' => array (
|
883 |
'hide' => true,
|
884 |
-
'default' => 'a.fancybox-pdf,area.fancybox-pdf
|
885 |
),
|
886 |
'class' => array (
|
887 |
'hide' => true,
|
@@ -893,17 +878,17 @@ $efb_options = array (
|
|
893 |
'onStart' => array (
|
894 |
'id' => 'fancybox_PDFonStart',
|
895 |
'noquotes' => true,
|
896 |
-
'title' =>
|
897 |
'label_for' => 'fancybox_PDFonStart',
|
898 |
'input' => 'select',
|
899 |
'options' => array(
|
900 |
-
'
|
901 |
-
'
|
902 |
-
''
|
903 |
-
'
|
904 |
),
|
905 |
-
'default' => '',
|
906 |
-
'description' =>
|
907 |
),
|
908 |
'width' => array (
|
909 |
'id' => 'fancybox_PDFwidth',
|
@@ -942,17 +927,17 @@ $efb_options = array (
|
|
942 |
'input' => 'checkbox',
|
943 |
'noquotes' => true,
|
944 |
'default' => '',
|
945 |
-
'description' =>
|
946 |
),
|
947 |
'titlePosition' => array (
|
948 |
'id' => 'fancybox_PDFtitlePosition',
|
949 |
-
'title' =>
|
950 |
'label_for' => 'fancybox_PDFtitlePosition',
|
951 |
'input' => 'select',
|
952 |
'options' => array(
|
953 |
-
'float' =>
|
954 |
-
'outside' =>
|
955 |
-
'inside' =>
|
956 |
),
|
957 |
'default' => 'float',
|
958 |
'description' => '<br />'
|
@@ -962,7 +947,7 @@ $efb_options = array (
|
|
962 |
'input' => 'checkbox',
|
963 |
'noquotes' => true,
|
964 |
'default' => '1',
|
965 |
-
'description' =>
|
966 |
),
|
967 |
'autoDimensions' => array (
|
968 |
'noquotes' => true,
|
@@ -975,12 +960,12 @@ $efb_options = array (
|
|
975 |
),
|
976 |
|
977 |
'SWF' => array(
|
978 |
-
'title' =>
|
979 |
'input' => 'multiple',
|
980 |
'options' => array(
|
981 |
'intro' => array (
|
982 |
'hide' => true,
|
983 |
-
'description' =>
|
984 |
),
|
985 |
'autoAttribute' => array (
|
986 |
'id' => 'fancybox_autoAttributeSWF',
|
@@ -988,11 +973,11 @@ $efb_options = array (
|
|
988 |
'hide' => true,
|
989 |
'default' => '1',
|
990 |
'selector' => '\'a[href*=".swf"],area[href*=".swf"],a[href*=".SWF"],area[href*=".SWF"]\'',
|
991 |
-
'description' =>
|
992 |
),
|
993 |
'tag' => array (
|
994 |
'hide' => true,
|
995 |
-
'default' => 'a.fancybox-swf,area.fancybox-swf
|
996 |
),
|
997 |
'class' => array (
|
998 |
'hide' => true,
|
@@ -1040,17 +1025,17 @@ $efb_options = array (
|
|
1040 |
'input' => 'checkbox',
|
1041 |
'noquotes' => true,
|
1042 |
'default' => '',
|
1043 |
-
'description' =>
|
1044 |
),
|
1045 |
'titlePosition' => array (
|
1046 |
'id' => 'fancybox_SWFtitlePosition',
|
1047 |
-
'title' =>
|
1048 |
'label_for' => 'fancybox_SWFtitlePosition',
|
1049 |
'input' => 'select',
|
1050 |
'options' => array(
|
1051 |
-
'float' =>
|
1052 |
-
'outside' =>
|
1053 |
-
'inside' =>
|
1054 |
),
|
1055 |
'default' => 'float',
|
1056 |
'description' => '<br />'
|
@@ -1060,7 +1045,7 @@ $efb_options = array (
|
|
1060 |
'input' => 'checkbox',
|
1061 |
'noquotes' => true,
|
1062 |
'default' => '1',
|
1063 |
-
'description' =>
|
1064 |
),
|
1065 |
'swf' => array (
|
1066 |
'noquotes' => true,
|
@@ -1070,12 +1055,12 @@ $efb_options = array (
|
|
1070 |
),
|
1071 |
|
1072 |
'SVG' => array(
|
1073 |
-
'title' =>
|
1074 |
'input' => 'multiple',
|
1075 |
'options' => array(
|
1076 |
'intro' => array (
|
1077 |
'hide' => true,
|
1078 |
-
'description' =>
|
1079 |
),
|
1080 |
'autoAttribute' => array (
|
1081 |
'id' => 'fancybox_autoAttributeSVG',
|
@@ -1083,11 +1068,11 @@ $efb_options = array (
|
|
1083 |
'hide' => true,
|
1084 |
'default' => '1',
|
1085 |
'selector' => '\'a[href*=".svg"],area[href*=".svg"],a[href*=".SVG"],area[href*=".SVG"]\'',
|
1086 |
-
'description' =>
|
1087 |
),
|
1088 |
'tag' => array (
|
1089 |
'hide' => true,
|
1090 |
-
'default' => 'a.fancybox-svg,area.fancybox-svg
|
1091 |
),
|
1092 |
'class' => array (
|
1093 |
'hide' => true,
|
@@ -1135,18 +1120,18 @@ $efb_options = array (
|
|
1135 |
'input' => 'checkbox',
|
1136 |
'noquotes' => true,
|
1137 |
'default' => '',
|
1138 |
-
'description' =>
|
1139 |
),
|
1140 |
'titlePosition' => array (
|
1141 |
'id' => 'fancybox_SVGtitlePosition',
|
1142 |
-
'title' =>
|
1143 |
'label_for' => 'fancybox_SVGtitlePosition',
|
1144 |
'input' => 'select',
|
1145 |
'options' => array(
|
1146 |
-
'float' =>
|
1147 |
-
'outside' =>
|
1148 |
-
'inside' =>
|
1149 |
-
//,'over' =>
|
1150 |
),
|
1151 |
'default' => 'float',
|
1152 |
'description' => '<br />'
|
@@ -1156,7 +1141,7 @@ $efb_options = array (
|
|
1156 |
'input' => 'checkbox',
|
1157 |
'noquotes' => true,
|
1158 |
'default' => '1',
|
1159 |
-
'description' =>
|
1160 |
),
|
1161 |
'svg' => array (
|
1162 |
'noquotes' => true,
|
@@ -1169,12 +1154,12 @@ $efb_options = array (
|
|
1169 |
),
|
1170 |
|
1171 |
'YouTube' => array(
|
1172 |
-
'title' =>
|
1173 |
'input' => 'multiple',
|
1174 |
'options' => array(
|
1175 |
'intro' => array (
|
1176 |
'hide' => true,
|
1177 |
-
'description' =>
|
1178 |
),
|
1179 |
'autoAttribute' => array (
|
1180 |
'id' => 'fancybox_autoAttributeYoutube',
|
@@ -1182,11 +1167,11 @@ $efb_options = array (
|
|
1182 |
'hide' => true,
|
1183 |
'default' => '1',
|
1184 |
'selector' => '\'a[href*="youtu.be/"],area[href*="youtu.be/"],a[href*="youtube.com/"],area[href*="youtube.com/"]\').filter(function(){return this.href.match(/\/(?:youtu\.be|watch\?|embed\/)/);}',
|
1185 |
-
'description' =>
|
1186 |
),
|
1187 |
'tag' => array (
|
1188 |
'hide' => true,
|
1189 |
-
'default' => 'a.fancybox-youtube,area.fancybox-youtube
|
1190 |
),
|
1191 |
'class' => array (
|
1192 |
'hide' => true,
|
@@ -1200,7 +1185,7 @@ $efb_options = array (
|
|
1200 |
'input' => 'checkbox',
|
1201 |
'hide' => true,
|
1202 |
'default' => '',
|
1203 |
-
'description' =>
|
1204 |
),
|
1205 |
'width' => array (
|
1206 |
'id' => 'fancybox_YoutubeWidth',
|
@@ -1249,17 +1234,17 @@ $efb_options = array (
|
|
1249 |
'input' => 'checkbox',
|
1250 |
'noquotes' => true,
|
1251 |
'default' => '',
|
1252 |
-
'description' =>
|
1253 |
),
|
1254 |
'titlePosition' => array (
|
1255 |
'id' => 'fancybox_YoutubetitlePosition',
|
1256 |
-
'title' =>
|
1257 |
'label_for' => 'fancybox_YoutubetitlePosition',
|
1258 |
'input' => 'select',
|
1259 |
'options' => array(
|
1260 |
-
'float' =>
|
1261 |
-
'outside' =>
|
1262 |
-
'inside' =>
|
1263 |
),
|
1264 |
'default' => 'float',
|
1265 |
'description' => '<br />'
|
@@ -1269,7 +1254,7 @@ $efb_options = array (
|
|
1269 |
'input' => 'checkbox',
|
1270 |
'noquotes' => true,
|
1271 |
'default' => '1',
|
1272 |
-
'description' =>
|
1273 |
),
|
1274 |
'onStart' => array (
|
1275 |
'noquotes' => true,
|
@@ -1281,12 +1266,12 @@ $efb_options = array (
|
|
1281 |
),
|
1282 |
|
1283 |
'Vimeo' => array(
|
1284 |
-
'title' =>
|
1285 |
'input' => 'multiple',
|
1286 |
'options' => array(
|
1287 |
'intro' => array (
|
1288 |
'hide' => true,
|
1289 |
-
'description' =>
|
1290 |
),
|
1291 |
'autoAttribute' => array (
|
1292 |
'id' => 'fancybox_autoAttributeVimeo',
|
@@ -1294,11 +1279,11 @@ $efb_options = array (
|
|
1294 |
'hide' => true,
|
1295 |
'default' => '1',
|
1296 |
'selector' => '\'a[href*="vimeo.com/"],area[href*="vimeo.com/"]\').filter(function(){return this.href.match(/\/(?:[0-9]+|video\/)/);}',
|
1297 |
-
'description' =>
|
1298 |
),
|
1299 |
'tag' => array (
|
1300 |
'hide' => true,
|
1301 |
-
'default' => 'a.fancybox-vimeo,area.fancybox-vimeo
|
1302 |
),
|
1303 |
'class' => array (
|
1304 |
'hide' => true,
|
@@ -1354,17 +1339,17 @@ $efb_options = array (
|
|
1354 |
'input' => 'checkbox',
|
1355 |
'noquotes' => true,
|
1356 |
'default' => '',
|
1357 |
-
'description' =>
|
1358 |
),
|
1359 |
'titlePosition' => array (
|
1360 |
'id' => 'fancybox_VimeotitlePosition',
|
1361 |
-
'title' =>
|
1362 |
'label_for' => 'fancybox_VimeotitlePosition',
|
1363 |
'input' => 'select',
|
1364 |
'options' => array(
|
1365 |
-
'float' =>
|
1366 |
-
'outside' =>
|
1367 |
-
'inside' =>
|
1368 |
),
|
1369 |
'default' => 'float',
|
1370 |
'description' => '<br />'
|
@@ -1374,7 +1359,7 @@ $efb_options = array (
|
|
1374 |
'input' => 'checkbox',
|
1375 |
'noquotes' => true,
|
1376 |
'default' => '1',
|
1377 |
-
'description' =>
|
1378 |
),
|
1379 |
'onStart' => array (
|
1380 |
'noquotes' => true,
|
@@ -1384,12 +1369,12 @@ $efb_options = array (
|
|
1384 |
),
|
1385 |
|
1386 |
'Dailymotion' => array(
|
1387 |
-
'title' =>
|
1388 |
'input' => 'multiple',
|
1389 |
'options' => array(
|
1390 |
'intro' => array (
|
1391 |
'hide' => true,
|
1392 |
-
'description' =>
|
1393 |
),
|
1394 |
'autoAttribute' => array (
|
1395 |
'id' => 'fancybox_autoAttributeDailymotion',
|
@@ -1397,11 +1382,11 @@ $efb_options = array (
|
|
1397 |
'hide' => true,
|
1398 |
'default' => '1',
|
1399 |
'selector' => '\'a[href*="dailymotion.com/"],area[href*="dailymotion.com/"]\').filter(function(){return this.href.match(/\/video\//);}',
|
1400 |
-
'description' =>
|
1401 |
),
|
1402 |
'tag' => array (
|
1403 |
'hide' => true,
|
1404 |
-
'default' => 'a.fancybox-dailymotion,area.fancybox-dailymotion
|
1405 |
),
|
1406 |
'class' => array (
|
1407 |
'hide' => true,
|
@@ -1457,17 +1442,17 @@ $efb_options = array (
|
|
1457 |
'input' => 'checkbox',
|
1458 |
'noquotes' => true,
|
1459 |
'default' => '',
|
1460 |
-
'description' =>
|
1461 |
),
|
1462 |
'titlePosition' => array (
|
1463 |
'id' => 'fancybox_DailymotiontitlePosition',
|
1464 |
-
'title' =>
|
1465 |
'label_for' => 'fancybox_DailymotiontitlePosition',
|
1466 |
'input' => 'select',
|
1467 |
'options' => array(
|
1468 |
-
'float' =>
|
1469 |
-
'outside' =>
|
1470 |
-
'inside' =>
|
1471 |
),
|
1472 |
'default' => 'float',
|
1473 |
'description' => '<br />'
|
@@ -1477,7 +1462,7 @@ $efb_options = array (
|
|
1477 |
'input' => 'checkbox',
|
1478 |
'noquotes' => true,
|
1479 |
'default' => '1',
|
1480 |
-
'description' =>
|
1481 |
),
|
1482 |
'onStart' => array (
|
1483 |
'noquotes' => true,
|
@@ -1488,7 +1473,7 @@ $efb_options = array (
|
|
1488 |
|
1489 |
/* 'Tudou' => array(
|
1490 |
'id' => 'fancybox_Tudou',
|
1491 |
-
'title' =>
|
1492 |
'label_for' => '',
|
1493 |
'input' => 'multiple',
|
1494 |
'class' => '', 'description' => '',
|
@@ -1501,7 +1486,7 @@ $efb_options = array (
|
|
1501 |
'options' => array(),
|
1502 |
'hide' => true,
|
1503 |
'default' => '1',
|
1504 |
-
'description' =>
|
1505 |
)
|
1506 |
)
|
1507 |
),*/
|
@@ -1514,16 +1499,16 @@ http://static.animoto.com/swf/w.swf?w=swf/vp1&f=Kf9POzQMSOGWyu41gtOtsw&i=m
|
|
1514 |
*/
|
1515 |
|
1516 |
'iFrame' => array(
|
1517 |
-
'title' =>
|
1518 |
'input' => 'multiple',
|
1519 |
'options' => array(
|
1520 |
'intro' => array (
|
1521 |
'hide' => true,
|
1522 |
-
'description' =>
|
1523 |
),
|
1524 |
'tag' => array (
|
1525 |
'hide' => true,
|
1526 |
-
'default' => 'a.fancybox-iframe,area.fancybox-iframe
|
1527 |
),
|
1528 |
'class' => array (
|
1529 |
'hide' => true,
|
@@ -1569,17 +1554,17 @@ http://static.animoto.com/swf/w.swf?w=swf/vp1&f=Kf9POzQMSOGWyu41gtOtsw&i=m
|
|
1569 |
'input' => 'checkbox',
|
1570 |
'noquotes' => true,
|
1571 |
'default' => '',
|
1572 |
-
'description' =>
|
1573 |
),
|
1574 |
'titlePosition' => array (
|
1575 |
'id' => 'fancybox_iFrametitlePosition',
|
1576 |
-
'title' =>
|
1577 |
'label_for' => 'fancybox_iFrametitlePosition',
|
1578 |
'input' => 'select',
|
1579 |
'options' => array(
|
1580 |
-
'float' =>
|
1581 |
-
'outside' =>
|
1582 |
-
'inside' =>
|
1583 |
),
|
1584 |
'default' => 'float',
|
1585 |
'description' => '<br />'
|
@@ -1589,14 +1574,14 @@ http://static.animoto.com/swf/w.swf?w=swf/vp1&f=Kf9POzQMSOGWyu41gtOtsw&i=m
|
|
1589 |
'input' => 'checkbox',
|
1590 |
'noquotes' => true,
|
1591 |
'default' => '1',
|
1592 |
-
'description' =>
|
1593 |
),
|
1594 |
'allowfullscreen' => array (
|
1595 |
'id' => 'fancybox_allowFullScreen',
|
1596 |
'input' => 'checkbox',
|
1597 |
'noquotes' => true,
|
1598 |
'default' => '',
|
1599 |
-
'description' =>
|
1600 |
)
|
1601 |
)
|
1602 |
)
|
1 |
<?php
|
2 |
/**
|
3 |
+
* FancyBox v1 options and their defaults array.
|
4 |
*/
|
5 |
|
6 |
$efb_options = array (
|
7 |
+
'Global' => array (
|
8 |
+
'backwardcompatible' => true, // Marks older Pro version compatibility.
|
9 |
'input' => 'deep',
|
10 |
'hide' => true,
|
11 |
'options' => array(
|
12 |
'Enable' => array (
|
13 |
+
'title' => esc_html__('Media','easy-fancybox'),
|
14 |
'input' => 'multiple',
|
15 |
'hide' => true,
|
16 |
'options' => array(
|
17 |
'p1' => array (
|
18 |
'hide' => true,
|
19 |
+
'description' => esc_html__('Enable FancyBox for','easy-fancybox') . '<br />'
|
20 |
),
|
21 |
'IMG' => array (
|
22 |
'id' => 'fancybox_enableImg',
|
23 |
'input' => 'checkbox',
|
24 |
'hide' => true,
|
25 |
+
'default' => ( function_exists( 'is_plugin_active_for_network' ) && is_plugin_active_for_network( EASY_FANCYBOX_BASENAME ) ) ? '' : '1',
|
26 |
+
'description' => '<strong>' . esc_html__( 'Images', 'easy-fancybox' ) . '</strong>' . ( get_option('fancybox_enableImg') ? ' — <a href="#IMG">' . translate( 'Settings' ) . '</a>' : '' )
|
27 |
),
|
28 |
'Inline' => array (
|
29 |
'id' => 'fancybox_enableInline',
|
30 |
'input' => 'checkbox',
|
31 |
'hide' => true,
|
32 |
'default' => '',
|
33 |
+
'description' => '<strong>' . esc_html__( 'Inline content', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableInline') ? ' — <a href="#Inline">' . translate( 'Settings' ) . '</a>' : '' )
|
34 |
),
|
35 |
'PDF' => array (
|
36 |
'id' => 'fancybox_enablePDF',
|
37 |
'input' => 'checkbox',
|
38 |
'hide' => true,
|
39 |
'default' => '',
|
40 |
+
'description' => '<strong>' . esc_html__( 'PDF', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enablePDF') ? ' — <a href="#PDF">' . translate( 'Settings' ) . '</a>' : '' )
|
41 |
),
|
42 |
'SWF' => array (
|
43 |
'id' => 'fancybox_enableSWF',
|
44 |
'input' => 'checkbox',
|
45 |
'hide' => true,
|
46 |
'default' => '',
|
47 |
+
'description' => '<strong>' . esc_html__( 'SWF', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableSWF') ? ' — <a href="#SWF">' . translate( 'Settings' ) . '</a>' : '' )
|
48 |
),
|
49 |
'SVG' => array (
|
50 |
'id' => 'fancybox_enableSVG',
|
51 |
'input' => 'checkbox',
|
52 |
'hide' => true,
|
53 |
'default' => '',
|
54 |
+
'description' => '<strong>' . esc_html__( 'SVG', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableSVG') ? ' — <a href="#SVG">' . translate( 'Settings' ) . '</a>' : '' )
|
55 |
),
|
56 |
'VideoPress' => array (
|
57 |
+
'id' => '',
|
58 |
'input' => 'checkbox',
|
59 |
'hide' => true,
|
60 |
'default' => '',
|
61 |
'status' => 'disabled',
|
62 |
+
'description' => '<strong>' . esc_html__( 'VideoPress', 'easy-fancybox' ) . '</strong>' . ' ' . '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
63 |
),
|
64 |
'YouTube' => array (
|
65 |
'id' => 'fancybox_enableYoutube',
|
66 |
'input' => 'checkbox',
|
67 |
'hide' => true,
|
68 |
'default' => '',
|
69 |
+
'description' => '<strong>' . esc_html__( 'YouTube', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableYouTube') ? ' — <a href="#YouTube">' . translate( 'Settings' ) . '</a>' : '' )
|
70 |
),
|
71 |
'Vimeo' => array (
|
72 |
'id' => 'fancybox_enableVimeo',
|
73 |
'input' => 'checkbox',
|
74 |
'hide' => true,
|
75 |
'default' => '',
|
76 |
+
'description' => '<strong>' . esc_html__( 'Vimeo', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableVimeo') ? ' — <a href="#Vimeo">' . translate( 'Settings' ) . '</a>' : '' )
|
77 |
),
|
78 |
'Dailymotion' => array (
|
79 |
'id' => 'fancybox_enableDailymotion',
|
80 |
'input' => 'checkbox',
|
81 |
'hide' => true,
|
82 |
'default' => '',
|
83 |
+
'description' => '<strong>' . esc_html__( 'Dailymotion', 'easy-fancybox' ) . '</strong>' . '</strong>' . ( get_option('fancybox_enableDailymotion') ? ' — <a href="#Dailymotion">' . translate( 'Settings' ) . '</a>' : '' )
|
84 |
),
|
85 |
'iFrame' => array (
|
86 |
'id' => 'fancybox_enableiFrame',
|
87 |
'input' => 'checkbox',
|
88 |
'hide' => true,
|
89 |
'default' => '',
|
90 |
+
'description' => '<strong>' . esc_html__('iFrames','easy-fancybox') . '</strong>' . '</strong>' . ( get_option('fancybox_enableiFrame') ? ' — <a href="#iFrame">' . translate( 'Settings' ) . '</a>' : '' )
|
91 |
)
|
92 |
),
|
93 |
'description' => ''
|
94 |
),
|
95 |
'Overlay' => array (
|
96 |
+
'title' => esc_html__('Overlay','easy-fancybox'),
|
97 |
'input' => 'multiple',
|
98 |
'hide' => true,
|
99 |
'options' => array(
|
102 |
'input' => 'checkbox',
|
103 |
'noquotes' => true,
|
104 |
'default' => '1',
|
105 |
+
'description' => esc_html__('Show the overlay around content opened in FancyBox.','easy-fancybox')
|
106 |
),
|
107 |
'hideOnOverlayClick' => array (
|
108 |
'id' => 'fancybox_hideOnOverlayClick',
|
109 |
'input' => 'checkbox',
|
110 |
'noquotes' => true,
|
111 |
'default' => '1',
|
112 |
+
'description' => esc_html__('Close FancyBox when overlay is clicked.','easy-fancybox')
|
113 |
),
|
114 |
'overlayOpacity' => array (
|
115 |
'id' => 'fancybox_overlayOpacity',
|
116 |
+
'title' => esc_html__('Opacity','easy-fancybox'),
|
117 |
'label_for' => 'fancybox_overlayOpacity',
|
118 |
'input' => 'number',
|
119 |
'step' => '0.1',
|
121 |
'max' => '1',
|
122 |
'class' => 'small-text',
|
123 |
'default' => '',
|
124 |
+
'description' => esc_html__('Value between 0 and 1. ','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 0.7</em><br />'
|
125 |
),
|
126 |
'overlayColor' => array (
|
127 |
'id' => 'fancybox_overlayColor',
|
128 |
+
'title' => esc_html__('Color','easy-fancybox'),
|
129 |
'label_for' => 'fancybox_overlayColor',
|
130 |
'input' => 'text',
|
131 |
'sanitize_callback' => 'colorval',
|
132 |
'class' => 'small-text',
|
133 |
'default' => '',
|
134 |
+
'description' => esc_html__('Enter an HTML color value.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' #777</em><br />'
|
135 |
),
|
136 |
'overlaySpotlight' => array (
|
137 |
'id' => 'fancybox_overlaySpotlight',
|
139 |
'hide' => true,
|
140 |
'status' => get_option('fancybox_overlaySpotlight') ? '' : 'disabled',
|
141 |
'default' => '',
|
142 |
+
'description' => esc_html__('Spotlight effect','easy-fancybox') . ( get_option('fancybox_overlaySpotlight') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
143 |
)
|
144 |
)
|
145 |
),
|
146 |
'Window' => array (
|
147 |
+
'title' => esc_html__('Window','easy-fancybox'),
|
148 |
'input' => 'multiple',
|
149 |
'hide' => true,
|
150 |
'options' => array(
|
151 |
'p1' => array (
|
152 |
'hide' => true,
|
153 |
+
'description' => '<strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
154 |
),
|
155 |
'showCloseButton' => array (
|
156 |
'id' => 'fancybox_showCloseButton',
|
157 |
'input' => 'checkbox',
|
158 |
'noquotes' => true,
|
159 |
'default' => '1',
|
160 |
+
'description' => esc_html__('Show the (X) close button','easy-fancybox')
|
161 |
),
|
162 |
'backgroundColor' => array (
|
163 |
'id' => 'fancybox_backgroundColor',
|
164 |
'hide' => true,
|
165 |
+
'title' => esc_html__('Background color','easy-fancybox'),
|
166 |
'label_for' => 'fancybox_backgroundColor',
|
167 |
'input' => 'text',
|
168 |
'sanitize_callback' => 'colorval',
|
174 |
'textColor' => array (
|
175 |
'id' => 'fancybox_textColor',
|
176 |
'hide' => true,
|
177 |
+
'title' => esc_html__('Text color','easy-fancybox'),
|
178 |
'label_for' => 'fancybox_textColor',
|
179 |
'input' => 'text',
|
180 |
'sanitize_callback' => 'colorval',
|
181 |
'status' => 'disabled',
|
182 |
'class' => 'small-text',
|
183 |
'default' => '',
|
184 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
185 |
),
|
186 |
'titleColor' => array (
|
187 |
'id' => 'fancybox_titleColor',
|
188 |
'hide' => true,
|
189 |
+
'title' => esc_html__('Title color','easy-fancybox'),
|
190 |
'label_for' => 'fancybox_titleColor',
|
191 |
'input' => 'text',
|
192 |
'sanitize_callback' => 'colorval',
|
197 |
'paddingColor' => array (
|
198 |
'id' => 'fancybox_paddingColor',
|
199 |
'hide' => true,
|
200 |
+
'title' => esc_html__('Border color','easy-fancybox'),
|
201 |
'label_for' => 'fancybox_paddingColor',
|
202 |
'input' => 'text',
|
203 |
'sanitize_callback' => 'colorval',
|
204 |
'class' => 'small-text',
|
205 |
'default' => '',
|
206 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' #000 x #fff</em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Use RGBA notation for semi-transparent borders.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' rgba(10,10,30,0.7)</em><br />'
|
207 |
),
|
208 |
'borderRadius' => array (
|
209 |
'id' => 'fancybox_borderRadius',
|
210 |
'hide' => true,
|
211 |
+
'title' => esc_html__('Border radius','easy-fancybox'),
|
212 |
'label_for' => 'fancybox_borderRadius',
|
213 |
'input' => 'number',
|
214 |
'step' => '1',
|
218 |
'status' => 'disabled',
|
219 |
'class' => 'small-text',
|
220 |
'default' => '',
|
221 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
222 |
),
|
223 |
|
224 |
'p11' => array (
|
225 |
'hide' => true,
|
226 |
+
'description' => '<br /><strong>' . esc_html__('Dimensions','easy-fancybox') . '</strong><br />'
|
227 |
),
|
228 |
'width' => array (
|
229 |
'id' => 'fancybox_width',
|
243 |
'sanitize_callback' => 'intval',
|
244 |
'class' => 'small-text',
|
245 |
'default' => '',
|
246 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 560 x 340</em><br />' . esc_html__('If content size is not set or cannot be determined automatically, these default dimensions will be used.','easy-fancybox') . '<br />'
|
247 |
),
|
248 |
'padding' => array (
|
249 |
'id' => 'fancybox_padding',
|
256 |
'sanitize_callback' => 'intval',
|
257 |
'class' => 'small-text',
|
258 |
'default' => '',
|
259 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 10</em><br />'
|
260 |
),
|
261 |
'margin' => array (
|
262 |
'id' => 'fancybox_margin',
|
263 |
+
'title' => esc_html__('Margin','easy-fancybox'),
|
264 |
'label_for' => 'fancybox_margin',
|
265 |
'input' => 'number',
|
266 |
'step' => '1',
|
269 |
'sanitize_callback' => 'intval',
|
270 |
'class' => 'small-text',
|
271 |
'default' => '20',
|
272 |
+
'description' => '<em>' . esc_html__('Default:','easy-fancybox') . ' 40</em><br />'
|
273 |
),
|
274 |
|
275 |
'p2' => array (
|
276 |
'hide' => true,
|
277 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
278 |
),
|
279 |
'enableEscapeButton' => array (
|
280 |
'id' => 'fancybox_enableEscapeButton',
|
281 |
'input' => 'checkbox',
|
282 |
'noquotes' => true,
|
283 |
'default' => '1',
|
284 |
+
'description' => esc_html__('Esc key stroke closes FancyBox','easy-fancybox')
|
285 |
),
|
286 |
'autoScale' => array (
|
287 |
'id' => 'fancybox_autoScale',
|
288 |
'input' => 'checkbox',
|
289 |
'noquotes' => true,
|
290 |
'default' => '1',
|
291 |
+
'description' => esc_html__('Scale large content down to fit in the browser viewport.','easy-fancybox')
|
292 |
),
|
293 |
'speedIn' => array (
|
294 |
'id' => 'fancybox_speedIn',
|
295 |
+
'title' => esc_html__('Opening speed','easy-fancybox'),
|
296 |
'label_for' => 'fancybox_speedIn',
|
297 |
'input' => 'number',
|
298 |
'step' => '100',
|
304 |
),
|
305 |
'speedOut' => array (
|
306 |
'id' => 'fancybox_speedOut',
|
307 |
+
'title' => esc_html__('Closing speed','easy-fancybox'),
|
308 |
'label_for' => 'fancybox_speedOut',
|
309 |
'input' => 'number',
|
310 |
'step' => '100',
|
313 |
'sanitize_callback' => 'intval',
|
314 |
'class' => 'small-text',
|
315 |
'default' => '',
|
316 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 300</em><br />'
|
317 |
),
|
318 |
'mouseWheel' => array (
|
319 |
'id' => 'fancybox_mouseWheel',
|
320 |
'hide' => true,
|
321 |
'input' => 'checkbox',
|
322 |
'default' => '',
|
323 |
+
'description' => esc_html__('Include the Mousewheel jQuery extension script to allow gallery browsing by mousewheel action.','easy-fancybox')
|
324 |
)
|
325 |
)
|
326 |
),
|
327 |
|
328 |
'Miscellaneous' => array (
|
329 |
+
'title' => esc_html__('Miscellaneous','easy-fancybox'),
|
330 |
'input' => 'multiple',
|
331 |
'hide' => true,
|
332 |
'options' => array(
|
333 |
'p0' => array (
|
334 |
'hide' => true,
|
335 |
+
'description' => '<strong>' . esc_html__('Auto popup','easy-fancybox') . '</strong><br />'
|
336 |
),
|
337 |
'autoClick' => array (
|
338 |
'id' => 'fancybox_autoClick',
|
339 |
+
'title' => esc_html__('Open on page load','easy-fancybox'),
|
340 |
'label_for' => 'fancybox_autoClick',
|
341 |
'hide' => true,
|
342 |
'input' => 'select',
|
343 |
'options' => array(
|
344 |
'' => translate('None'),
|
345 |
+
'1' => esc_html__('Link with ID "fancybox-auto"','easy-fancybox'),
|
346 |
),
|
347 |
'default' => '1',
|
348 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
349 |
),
|
350 |
'delayClick' => array (
|
351 |
'id' => 'fancybox_delayClick',
|
352 |
+
'title' => esc_html__('Delay in milliseconds','easy-fancybox'),
|
353 |
'label_for' => 'fancybox_delayClick',
|
354 |
'hide' => true,
|
355 |
'input' => 'number',
|
359 |
'sanitize_callback' => 'intval',
|
360 |
'class' => 'small-text',
|
361 |
'default' => '1000',
|
362 |
+
'description' => ' <em>' . esc_html__('Default:','easy-fancybox') . ' 1000</em><br />'
|
363 |
),
|
364 |
'jqCookie' => array (
|
365 |
'id' => '',
|
366 |
+
'title' => esc_html__('Hide popup after first visit?','easy-fancybox'),
|
367 |
'hide' => true,
|
368 |
'input' => 'select',
|
369 |
'status' => 'disabled',
|
371 |
'sanitize_callback' => 'intval',
|
372 |
'options' => array(
|
373 |
'0' => translate('No'),
|
374 |
+
'1' => esc_html__('1 Day','easy-fancybox'),
|
375 |
+
'7' => esc_html__('1 Week','easy-fancybox'),
|
376 |
+
'30' => esc_html__('1 Month','easy-fancybox'),
|
377 |
+
'365' => esc_html__('1 Year','easy-fancybox')
|
378 |
),
|
379 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
380 |
),
|
381 |
'cookiePath' => array (
|
382 |
'id' => '',
|
385 |
),
|
386 |
'p1' => array (
|
387 |
'hide' => true,
|
388 |
+
'description' => '<br /><strong>' . esc_html__('Browser & device compatibility','easy-fancybox') . '</strong><br />'
|
389 |
),
|
390 |
'minViewportWidth' => array (
|
391 |
'id' => 'fancybox_minViewportWidth',
|
392 |
+
'title' => esc_html__('Minimum browser/device viewport width','easy-fancybox'),
|
393 |
'label_for' => 'fancybox_minViewportWidth',
|
394 |
'input' => 'number',
|
395 |
'step' => '1',
|
398 |
'sanitize_callback' => 'intval',
|
399 |
'class' => 'small-text',
|
400 |
'default' => '',
|
401 |
+
'description' => esc_html__('(leave empty to ignore)','easy-fancybox') . '<br/>'
|
402 |
),
|
403 |
/* 'forceNewtab' => array (
|
404 |
'id' => 'fancybox_forceNewtab',
|
405 |
'input' => 'checkbox',
|
406 |
'hide' => true,
|
407 |
'default' => '1',
|
408 |
+
'description' => esc_html__('Make media links open in a new tab when viewport falls below minimum width (above)','easy-fancybox')
|
409 |
),*/
|
410 |
'compatIE8' => array (
|
411 |
'id' => 'fancybox_compatIE8',
|
412 |
'input' => 'checkbox',
|
413 |
'hide' => true,
|
414 |
'default' => '',
|
415 |
+
'description' => esc_html__('Include IE 8 compatibility style rules','easy-fancybox')
|
416 |
),
|
417 |
'p2' => array (
|
418 |
'hide' => true,
|
419 |
+
'description' => '<br /><strong>' . esc_html__('Theme & plugins compatibility','easy-fancybox') . '</strong><br />'
|
420 |
+
. esc_html__('Try to deactivate all conflicting light box scripts in your theme or other plugins. If this is not possible, try a higher script priority number which means scripts are added later, wich may allow them to override conflicting scripts. A lower priority number, excluding WordPress standard jQuery, or even moving the plugin scripts to the header may work in cases where there are blocking errors occuring in other script.','easy-fancybox')
|
421 |
. '<br /><br />'
|
422 |
),
|
423 |
'scriptPriority' => array (
|
424 |
'id' => 'fancybox_scriptPriority',
|
425 |
+
'title' => esc_html__('FancyBox script priority','easy-fancybox'),
|
426 |
'label_for' => 'fancybox_scriptPriority',
|
427 |
'hide' => true,
|
428 |
'input' => 'number',
|
432 |
'sanitize_callback' => 'intval',
|
433 |
'class' => 'small-text',
|
434 |
'default' => '10',
|
435 |
+
'description' => esc_html__('Default priority is 10.','easy-fancybox') . ' ' . esc_html__('Higher is later.','easy-fancybox') . '<br/>'
|
436 |
),
|
437 |
'noFooter' => array (
|
438 |
'id' => 'fancybox_noFooter',
|
439 |
'input' => 'checkbox',
|
440 |
'hide' => true,
|
441 |
'default' => '',
|
442 |
+
'description' => esc_html__('Move scripts from footer to theme head section (not recommended for site load times!)','easy-fancybox')
|
443 |
),
|
444 |
'nojQuery' => array (
|
445 |
'id' => 'fancybox_nojQuery',
|
446 |
'input' => 'checkbox',
|
447 |
'hide' => true,
|
448 |
'default' => '',
|
449 |
+
'description' => esc_html__('Do not include standard WordPress jQuery library (do this only if you are sure jQuery is included from another source!)','easy-fancybox')
|
450 |
),
|
451 |
'pre45Compat' => array (
|
452 |
'id' => 'fancybox_pre45Compat',
|
453 |
'input' => 'checkbox',
|
454 |
'hide' => true,
|
455 |
'default' => function_exists( 'wp_add_inline_script' ) ? '' : '1',
|
456 |
+
'description' => esc_html__('Do not use wp_add_inline_script/style functions (may solve issues with older script minification plugins)','easy-fancybox')
|
457 |
),
|
458 |
'p3' => array (
|
459 |
'hide' => true,
|
460 |
+
'description' => '<br /><strong>' . esc_html__('Advanced','easy-fancybox') . '</strong><br />'
|
461 |
),
|
462 |
'metaData' => array (
|
463 |
'id' => 'fancybox_metaData',
|
465 |
'input' => 'checkbox',
|
466 |
'status' => get_option('fancybox_metaData') ? '' : 'disabled',
|
467 |
'default' => '',
|
468 |
+
'description' => esc_html__('Include the Metadata jQuery extension script to allow passing custom parameters via link class.','easy-fancybox') . ( get_option('fancybox_metaData') ? '' : '. <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') ) . '</a></em>'
|
469 |
),
|
470 |
'vcMasonryCompat' => array (
|
471 |
'id' => 'fancybox_vcMasonryCompat',
|
473 |
'input' => 'checkbox',
|
474 |
'status' => 'disabled',
|
475 |
'default' => '',
|
476 |
+
'description' => esc_html__('WPBakery / Visual Composer - Masonry Grid Gallery compatibility.','easy-fancybox') . ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
477 |
),
|
478 |
'autoExclude' => array (
|
479 |
'id' => 'fancybox_autoExclude',
|
480 |
+
'title' => esc_html__('Exclude','easy-fancybox'),
|
481 |
'label_for' => 'fancybox_autoExclude',
|
482 |
'input' => 'text',
|
483 |
'class' => 'regular-text',
|
484 |
'hide' => true,
|
485 |
'default' => '.nolightbox,a.wp-block-file__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']',
|
486 |
'sanitize_callback' => 'csl_text',
|
487 |
+
'description' => esc_html__('A comma-separated list of selectors for elements to which FancyBox should not automatically bind itself. Media links inside these elements will be ignored by Autodetect.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' .nolightbox,a.wp-block-file__button,a.pin-it-button,a[href*=\'pinterest.com/pin/create\'],a[href*=\'facebook.com/share\'],a[href*=\'twitter.com/share\']</em><br />'
|
488 |
)
|
489 |
)
|
490 |
)
|
492 |
),
|
493 |
|
494 |
'IMG' => array(
|
495 |
+
'title' => esc_html__('Images','easy-fancybox'),
|
496 |
'input' => 'multiple',
|
497 |
'options' => array(
|
498 |
'intro' => array (
|
499 |
'hide' => true,
|
500 |
+
'description' => esc_html__('To make images open in an overlay, add their extension to the Autodetect field or use the class "fancybox" for its link. Clear field to switch off all autodetection.','easy-fancybox') . '<br />'
|
501 |
),
|
502 |
'tag' => array (
|
503 |
'hide' => true,
|
504 |
+
'default' => 'a.fancybox,area.fancybox,.fancybox>a'
|
505 |
),
|
506 |
'class' => array (
|
507 |
'hide' => true,
|
509 |
),
|
510 |
'autoAttribute' => array (
|
511 |
'id' => 'fancybox_autoAttribute',
|
512 |
+
'title' => esc_html__('Autodetect','easy-fancybox'),
|
513 |
'label_for' => 'fancybox_autoAttribute',
|
514 |
'input' => 'text',
|
515 |
'class' => 'regular-text',
|
517 |
'default' => '.jpg,.png,.webp',
|
518 |
'sanitize_callback' => 'csl_text',
|
519 |
'selector' => 'href*=',
|
520 |
+
'description' => esc_html__('A comma-separated list of image file extensions to which FancyBox should automatically bind itself.','easy-fancybox') . ' <em>' . esc_html__('Example:','easy-fancybox') . ' .jpg,.png,.gif,.jpeg</em><br />'
|
521 |
),
|
522 |
'autoAttributeLimit' => array (
|
523 |
'id' => 'fancybox_autoAttributeLimit',
|
524 |
+
'title' => esc_html__('Apply to','easy-fancybox'),
|
525 |
'label_for' => 'fancybox_autoAttributeLimit',
|
526 |
'hide' => true,
|
527 |
'input' => 'select',
|
528 |
'options' => array(
|
529 |
+
'' => esc_html__('All image links', 'easy-fancybox')
|
530 |
),
|
531 |
'default' => '',
|
532 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
533 |
),
|
534 |
'type' => array (
|
535 |
'id' => 'fancybox_classType',
|
536 |
+
'title' => esc_html__('Force FancyBox to treat all media linked with class="fancybox" as images?','easy-fancybox'),
|
537 |
'label_for' => 'fancybox_classType',
|
538 |
'input' => 'select',
|
539 |
'options' => array(
|
545 |
),
|
546 |
'p2' => array (
|
547 |
'hide' => true,
|
548 |
+
'description' => '<br /><strong>' . esc_html__('Behavior','easy-fancybox') . '</strong><br />'
|
549 |
),
|
550 |
'transitionIn' => array (
|
551 |
'id' => 'fancybox_transitionIn',
|
552 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
553 |
'label_for' => 'fancybox_transitionIn',
|
554 |
'input' => 'select',
|
555 |
'options' => array(
|
556 |
'none' => translate('None'),
|
557 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
558 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
559 |
),
|
560 |
'default' => 'elastic',
|
561 |
'description' => ' '
|
562 |
),
|
563 |
'easingIn' => array (
|
564 |
'id' => 'fancybox_easingIn',
|
565 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
566 |
'label_for' => 'fancybox_easingIn',
|
567 |
'input' => 'select',
|
568 |
'options' => array(
|
569 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
570 |
+
'' => esc_html__('Swing','easy-fancybox')
|
|
|
|
|
571 |
),
|
572 |
+
'default' => '',
|
573 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
574 |
),
|
575 |
'transitionOut' => array (
|
576 |
'id' => 'fancybox_transitionOut',
|
577 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
578 |
'label_for' => 'fancybox_transitionOut',
|
579 |
'input' => 'select',
|
580 |
'options' => array(
|
581 |
'none' => translate('None'),
|
582 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
583 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
584 |
),
|
585 |
'default' => 'elastic',
|
586 |
'description' => ' '
|
587 |
),
|
588 |
'easingOut' => array (
|
589 |
'id' => 'fancybox_easingOut',
|
590 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
591 |
'label_for' => 'fancybox_easingOut',
|
592 |
'input' => 'select',
|
593 |
'options' => array(
|
594 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
595 |
+
'' => esc_html__('Swing','easy-fancybox')
|
|
|
|
|
596 |
),
|
597 |
+
'default' => '',
|
598 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
599 |
),
|
600 |
'opacity' => array (
|
601 |
'id' => 'fancybox_opacity',
|
602 |
'input' => 'checkbox',
|
603 |
'noquotes' => true,
|
604 |
'default' => '',
|
605 |
+
'description' => esc_html__('Transparency fade during elastic transition. CAUTION: Use only when at least Transition In is set to Elastic!','easy-fancybox')
|
606 |
),
|
607 |
'hideOnContentClick' => array (
|
608 |
'id' => 'fancybox_hideOnContentClick',
|
609 |
'input' => 'checkbox',
|
610 |
'noquotes' => true,
|
611 |
'default' => '',
|
612 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
613 |
),
|
614 |
'p1' => array (
|
615 |
'hide' => true,
|
616 |
+
'description' => '<br /><strong>' . esc_html__('Appearance','easy-fancybox') . '</strong><br />'
|
617 |
),
|
618 |
'titleShow' => array (
|
619 |
'id' => 'fancybox_titleShow',
|
620 |
'input' => 'checkbox',
|
621 |
'noquotes' => true,
|
622 |
'default' => '1',
|
623 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
624 |
),
|
625 |
'titlePosition' => array (
|
626 |
'id' => 'fancybox_titlePosition',
|
627 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
628 |
'label_for' => 'fancybox_titlePosition',
|
629 |
'input' => 'select',
|
630 |
'options' => array(
|
631 |
+
'' => esc_html__('Float','easy-fancybox'),
|
632 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
633 |
+
'inside' => esc_html__('Inside','easy-fancybox'),
|
634 |
+
'over' => esc_html__('Overlay','easy-fancybox')
|
635 |
),
|
636 |
'default' => 'over',
|
637 |
'description' => '<br />'
|
641 |
'input' => 'checkbox',
|
642 |
'noquotes' => true,
|
643 |
'default' => '1',
|
644 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
645 |
),
|
646 |
'onStart' => array (
|
647 |
'id' => '',
|
648 |
+
'title' => esc_html__('Advanced','easy-fancybox'),
|
649 |
'input' => 'select',
|
650 |
'status' => 'disabled',
|
651 |
'options' => array(
|
652 |
+
'' => esc_html__('Hide/show title on mouse hover action','easy-fancybox')
|
653 |
),
|
654 |
'default' => '',
|
655 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em><br />'
|
656 |
),
|
657 |
'p3' => array (
|
658 |
'hide' => true,
|
659 |
+
'description' => '<br /><strong>' . esc_html__('Gallery','easy-fancybox') . '</strong><br />'
|
660 |
),
|
661 |
'autoGallery' => array (
|
662 |
'id' => 'fancybox_autoGallery',
|
663 |
+
'title' => esc_html__('Autogallery','easy-fancybox'),
|
664 |
'label_for' => 'fancybox_autoGallery',
|
665 |
'hide' => true,
|
666 |
'input' => 'select',
|
667 |
'options' => array(
|
668 |
'' => translate('Disabled'),
|
669 |
+
'1' => esc_html__('WordPress galleries only','easy-fancybox'),
|
670 |
+
'2' => esc_html__('All in one gallery','easy-fancybox')
|
671 |
),
|
672 |
'default' => '1',
|
673 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('When disabled, you can use the rel attribute to manually group image links together.','easy-fancybox') . '<br /><br />'
|
674 |
),
|
675 |
'showNavArrows' => array (
|
676 |
'id' => 'fancybox_showNavArrows',
|
677 |
'input' => 'checkbox',
|
678 |
'noquotes' => true,
|
679 |
'default' => '1',
|
680 |
+
'description' => esc_html__('Show the gallery navigation arrows','easy-fancybox')
|
681 |
),
|
682 |
'enableKeyboardNav' => array (
|
683 |
'id' => 'fancybox_enableKeyboardNav',
|
684 |
'input' => 'checkbox',
|
685 |
'noquotes' => true,
|
686 |
'default' => '1',
|
687 |
+
'description' => esc_html__('Arrow key strokes browse the gallery','easy-fancybox')
|
688 |
),
|
689 |
'cyclic' => array (
|
690 |
'id' => 'fancybox_cyclic',
|
691 |
'input' => 'checkbox',
|
692 |
'noquotes' => true,
|
693 |
'default' => '',
|
694 |
+
'description' => esc_html__('Make galleries cyclic, allowing you to keep pressing next/back.','easy-fancybox')
|
695 |
),
|
696 |
'changeSpeed' => array (
|
697 |
'id' => 'fancybox_changeSpeed',
|
698 |
+
'title' => esc_html__('Change speed','easy-fancybox'),
|
699 |
'label_for' => 'fancybox_changeSpeed',
|
700 |
'input' => 'number',
|
701 |
'step' => '1',
|
707 |
),
|
708 |
'changeFade' => array (
|
709 |
'id' => 'fancybox_changeFade',
|
710 |
+
'title' => esc_html__('Fade speed','easy-fancybox'),
|
711 |
'label_for' => 'fancybox_changeFade',
|
712 |
'input' => 'number',
|
713 |
'step' => '1',
|
716 |
'sanitize_callback' => 'intval',
|
717 |
'class' => 'small-text',
|
718 |
'default' => '',
|
719 |
+
'description' => '<br />' . esc_html__('Duration in milliseconds. Higher is slower.','easy-fancybox') . ' <em>' . esc_html__('Default:','easy-fancybox') . ' 300</em><br /><br />'
|
720 |
),
|
721 |
'autoSelector' => array (
|
722 |
'id' => 'fancybox_autoSelector',
|
726 |
),
|
727 |
'onComplete' => array (
|
728 |
'id' => '',
|
729 |
+
'title' => esc_html__('Advanced','easy-fancybox'),
|
730 |
'input' => 'select',
|
731 |
'status' => 'disabled',
|
732 |
'options' => array(
|
733 |
+
'' => esc_html__('Slideshow','easy-fancybox')
|
734 |
),
|
735 |
'default' => '',
|
736 |
+
'description' => '<em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('Make available »','easy-fancybox') . '</a></em>'
|
737 |
)
|
738 |
)
|
739 |
),
|
740 |
|
741 |
'Inline' => array(
|
742 |
+
'title' => esc_html__('Inline content','easy-fancybox'),
|
743 |
'input' => 'multiple',
|
744 |
'options' => array(
|
745 |
'intro' => array (
|
746 |
'hide' => true,
|
747 |
+
'description' => esc_html__('To make inline content open in an overlay, wrap that content in a div with a unique ID, create a link with target "#uniqueID" and give it a class "fancybox-inline" attribute.','easy-fancybox') . '<br /><br />'
|
748 |
),
|
749 |
'tag' => array (
|
750 |
'hide' => true,
|
751 |
+
'default' => 'a.fancybox-inline,area.fancybox-inline,.fancybox-inline>a'
|
752 |
),
|
753 |
'class' => array (
|
754 |
'hide' => true,
|
762 |
'input' => 'checkbox',
|
763 |
'noquotes' => true,
|
764 |
'default' => '1',
|
765 |
+
'description' => esc_html__('Try to adjust size to inline/html content. If unchecked the default dimensions will be used.','easy-fancybox') . ''
|
766 |
),
|
767 |
'scrolling' => array (
|
768 |
'id' => 'fancybox_InlineScrolling',
|
769 |
+
'title' => esc_html__('Scrolling','easy-fancybox'),
|
770 |
'label_for' => 'fancybox_InlineScrolling',
|
771 |
'input' => 'select',
|
772 |
'options' => array(
|
773 |
+
'auto' => esc_html__('Auto','easy-fancybox'),
|
774 |
+
'yes' => esc_html__('Always','easy-fancybox'),
|
775 |
+
'no' => esc_html__('Never','easy-fancybox')
|
776 |
),
|
777 |
'default' => 'no',
|
778 |
+
'description' => esc_html__('Define scrolling and scrollbar visibility.','easy-fancybox') . '<br /><br />'
|
779 |
),
|
780 |
'transitionIn' => array (
|
781 |
'id' => 'fancybox_transitionInInline',
|
782 |
+
'title' => esc_html__('Transition In','easy-fancybox'),
|
783 |
'label_for' => 'fancybox_transitionInInline',
|
784 |
'input' => 'select',
|
785 |
'options' => array(
|
786 |
'none' => translate('None'),
|
787 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
788 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
789 |
),
|
790 |
'default' => '',
|
791 |
'description' => ' '
|
792 |
),
|
793 |
'easingIn' => array (
|
794 |
'id' => 'fancybox_easingInInline',
|
795 |
+
'title' => esc_html__('Easing In','easy-fancybox'),
|
796 |
'label_for' => 'fancybox_easingInInline',
|
797 |
'input' => 'select',
|
798 |
'options' => array(
|
799 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
800 |
+
'' => esc_html__('Swing','easy-fancybox')
|
|
|
|
|
801 |
),
|
802 |
'default' => 'easeOutBack',
|
803 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />'
|
804 |
),
|
805 |
'transitionOut' => array (
|
806 |
'id' => 'fancybox_transitionOutInline',
|
807 |
+
'title' => esc_html__('Transition Out','easy-fancybox'),
|
808 |
'label_for' => 'fancybox_transitionOutInline',
|
809 |
'input' => 'select',
|
810 |
'options' => array(
|
811 |
'none' => translate('None'),
|
812 |
+
'' => esc_html__('Fade','easy-fancybox'),
|
813 |
+
'elastic' => esc_html__('Elastic','easy-fancybox'),
|
814 |
),
|
815 |
'default' => '',
|
816 |
'description' => ' '
|
817 |
),
|
818 |
'easingOut' => array (
|
819 |
'id' => 'fancybox_easingOutInline',
|
820 |
+
'title' => esc_html__('Easing Out','easy-fancybox'),
|
821 |
'label_for' => 'fancybox_easingOutInline',
|
822 |
'input' => 'select',
|
823 |
'options' => array(
|
824 |
+
'linear' => esc_html__('Linear','easy-fancybox'),
|
825 |
+
'' => esc_html__('Swing','easy-fancybox')
|
|
|
|
|
826 |
),
|
827 |
+
'default' => '',
|
828 |
+
'description' => ' <em><a href="'.easyFancyBox::$pro_plugin_url.'">' . esc_html__('More options »','easy-fancybox') . '</a></em><br />' . esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('Easing effects only apply when Transition is set to Elastic. ','easy-fancybox') . '<br /><br />'
|
829 |
),
|
830 |
'opacity' => array (
|
831 |
'id' => 'fancybox_opacityInline',
|
832 |
'input' => 'checkbox',
|
833 |
'noquotes' => true,
|
834 |
'default' => '',
|
835 |
+
'description' => esc_html__('Transparency fade during elastic transition. CAUTION: Use only when at least Transition In is set to Elastic!','easy-fancybox')
|
836 |
),
|
837 |
'hideOnContentClick' => array (
|
838 |
'id' => 'fancybox_hideOnContentClickInline',
|
839 |
'input' => 'checkbox',
|
840 |
'noquotes' => true,
|
841 |
'default' => '',
|
842 |
+
'description' => esc_html__('Close FancyBox when content is clicked','easy-fancybox')
|
843 |
),
|
844 |
'titleShow' => array (
|
845 |
'noquotes' => true,
|
849 |
),
|
850 |
|
851 |
'PDF' => array(
|
852 |
+
'title' => esc_html__('PDF','easy-fancybox'),
|
853 |
'input' => 'multiple',
|
854 |
'options' => array(
|
855 |
'intro' => array (
|
856 |
'hide' => true,
|
857 |
+
'description' => esc_html__('To make any PDF document file open in an overlay, switch on Autodetect or use the class "fancybox-pdf" for its link.','easy-fancybox') . '<br />'
|
858 |
),
|
859 |
'autoAttribute' => array (
|
860 |
'id' => 'fancybox_autoAttributePDF',
|
862 |
'hide' => true,
|
863 |
'default' => '1',
|
864 |
'selector' => '\'a[href*=".pdf"],area[href*=".pdf"],a[href*=".PDF"],area[href*=".PDF"]\'',
|
865 |
+
'description' => esc_html__('Autodetect','easy-fancybox')
|
866 |
),
|
867 |
'tag' => array (
|
868 |
'hide' => true,
|
869 |
+
'default' => 'a.fancybox-pdf,area.fancybox-pdf,.fancybox-pdf>a'
|
870 |
),
|
871 |
'class' => array (
|
872 |
'hide' => true,
|
878 |
'onStart' => array (
|
879 |
'id' => 'fancybox_PDFonStart',
|
880 |
'noquotes' => true,
|
881 |
+
'title' => esc_html__('Embed with','easy-fancybox'),
|
882 |
'label_for' => 'fancybox_PDFonStart',
|
883 |
'input' => 'select',
|
884 |
'options' => array(
|
885 |
+
'{{object}}' => esc_html__('Object tag (plus fall-back link)','easy-fancybox'),
|
886 |
+
'{{embed}}' => esc_html__('Embed tag','easy-fancybox'),
|
887 |
+
'' => esc_html__('iFrame tag (let browser decide)','easy-fancybox'),
|
888 |
+
'{{googleviewer}}' => esc_html__('Google Docs Viewer (external)','easy-fancybox')
|
889 |
),
|
890 |
+
'default' => '{{object}}',
|
891 |
+
'description' => esc_html__('Note:','easy-fancybox') . ' ' . esc_html__('External viewers have bandwidth, usage rate and and file size limits.','easy-fancybox') . '<br /><br />'
|
892 |
),
|
893 |
'width' => array (
|
894 |
'id' => 'fancybox_PDFwidth',
|
927 |
'input' => 'checkbox',
|
928 |
'noquotes' => true,
|
929 |
'default' => '',
|
930 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
931 |
),
|
932 |
'titlePosition' => array (
|
933 |
'id' => 'fancybox_PDFtitlePosition',
|
934 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
935 |
'label_for' => 'fancybox_PDFtitlePosition',
|
936 |
'input' => 'select',
|
937 |
'options' => array(
|
938 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
939 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
940 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
941 |
),
|
942 |
'default' => 'float',
|
943 |
'description' => '<br />'
|
947 |
'input' => 'checkbox',
|
948 |
'noquotes' => true,
|
949 |
'default' => '1',
|
950 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
951 |
),
|
952 |
'autoDimensions' => array (
|
953 |
'noquotes' => true,
|
960 |
),
|
961 |
|
962 |
'SWF' => array(
|
963 |
+
'title' => esc_html__('SWF','easy-fancybox'),
|
964 |
'input' => 'multiple',
|
965 |
'options' => array(
|
966 |
'intro' => array (
|
967 |
'hide' => true,
|
968 |
+
'description' => esc_html__('To make any Flash (.swf) file open in an overlay, switch on Autodetect or use the class "fancybox-swf" for its link.','easy-fancybox') . '<br />'
|
969 |
),
|
970 |
'autoAttribute' => array (
|
971 |
'id' => 'fancybox_autoAttributeSWF',
|
973 |
'hide' => true,
|
974 |
'default' => '1',
|
975 |
'selector' => '\'a[href*=".swf"],area[href*=".swf"],a[href*=".SWF"],area[href*=".SWF"]\'',
|
976 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
977 |
),
|
978 |
'tag' => array (
|
979 |
'hide' => true,
|
980 |
+
'default' => 'a.fancybox-swf,area.fancybox-swf,.fancybox-swf>a'
|
981 |
),
|
982 |
'class' => array (
|
983 |
'hide' => true,
|
1025 |
'input' => 'checkbox',
|
1026 |
'noquotes' => true,
|
1027 |
'default' => '',
|
1028 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1029 |
),
|
1030 |
'titlePosition' => array (
|
1031 |
'id' => 'fancybox_SWFtitlePosition',
|
1032 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1033 |
'label_for' => 'fancybox_SWFtitlePosition',
|
1034 |
'input' => 'select',
|
1035 |
'options' => array(
|
1036 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1037 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1038 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1039 |
),
|
1040 |
'default' => 'float',
|
1041 |
'description' => '<br />'
|
1045 |
'input' => 'checkbox',
|
1046 |
'noquotes' => true,
|
1047 |
'default' => '1',
|
1048 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1049 |
),
|
1050 |
'swf' => array (
|
1051 |
'noquotes' => true,
|
1055 |
),
|
1056 |
|
1057 |
'SVG' => array(
|
1058 |
+
'title' => esc_html__('SVG','easy-fancybox'),
|
1059 |
'input' => 'multiple',
|
1060 |
'options' => array(
|
1061 |
'intro' => array (
|
1062 |
'hide' => true,
|
1063 |
+
'description' => esc_html__('To make any SVG (.svg) file open in an overlay, switch on Autodetect or use the class "fancybox-svg" for its link.','easy-fancybox') . '<br />'
|
1064 |
),
|
1065 |
'autoAttribute' => array (
|
1066 |
'id' => 'fancybox_autoAttributeSVG',
|
1068 |
'hide' => true,
|
1069 |
'default' => '1',
|
1070 |
'selector' => '\'a[href*=".svg"],area[href*=".svg"],a[href*=".SVG"],area[href*=".SVG"]\'',
|
1071 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1072 |
),
|
1073 |
'tag' => array (
|
1074 |
'hide' => true,
|
1075 |
+
'default' => 'a.fancybox-svg,area.fancybox-svg,.fancybox-svg>a'
|
1076 |
),
|
1077 |
'class' => array (
|
1078 |
'hide' => true,
|
1120 |
'input' => 'checkbox',
|
1121 |
'noquotes' => true,
|
1122 |
'default' => '',
|
1123 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1124 |
),
|
1125 |
'titlePosition' => array (
|
1126 |
'id' => 'fancybox_SVGtitlePosition',
|
1127 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1128 |
'label_for' => 'fancybox_SVGtitlePosition',
|
1129 |
'input' => 'select',
|
1130 |
'options' => array(
|
1131 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1132 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1133 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1134 |
+
//,'over' => esc_html__('Overlay','easy-fancybox')
|
1135 |
),
|
1136 |
'default' => 'float',
|
1137 |
'description' => '<br />'
|
1141 |
'input' => 'checkbox',
|
1142 |
'noquotes' => true,
|
1143 |
'default' => '1',
|
1144 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1145 |
),
|
1146 |
'svg' => array (
|
1147 |
'noquotes' => true,
|
1154 |
),
|
1155 |
|
1156 |
'YouTube' => array(
|
1157 |
+
'title' => esc_html__('YouTube','easy-fancybox'),
|
1158 |
'input' => 'multiple',
|
1159 |
'options' => array(
|
1160 |
'intro' => array (
|
1161 |
'hide' => true,
|
1162 |
+
'description' => esc_html__('To make any YouTube movie open in an overlay, switch on Autodetect or use the class "fancybox-youtube" for its link.','easy-fancybox') . '<br />'
|
1163 |
),
|
1164 |
'autoAttribute' => array (
|
1165 |
'id' => 'fancybox_autoAttributeYoutube',
|
1167 |
'hide' => true,
|
1168 |
'default' => '1',
|
1169 |
'selector' => '\'a[href*="youtu.be/"],area[href*="youtu.be/"],a[href*="youtube.com/"],area[href*="youtube.com/"]\').filter(function(){return this.href.match(/\/(?:youtu\.be|watch\?|embed\/)/);}',
|
1170 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1171 |
),
|
1172 |
'tag' => array (
|
1173 |
'hide' => true,
|
1174 |
+
'default' => 'a.fancybox-youtube,area.fancybox-youtube,.fancybox-youtube>a'
|
1175 |
),
|
1176 |
'class' => array (
|
1177 |
'hide' => true,
|
1185 |
'input' => 'checkbox',
|
1186 |
'hide' => true,
|
1187 |
'default' => '',
|
1188 |
+
'description' => esc_html__('Enable privacy-enhanced mode','easy-fancybox') . '<br />'
|
1189 |
),
|
1190 |
'width' => array (
|
1191 |
'id' => 'fancybox_YoutubeWidth',
|
1234 |
'input' => 'checkbox',
|
1235 |
'noquotes' => true,
|
1236 |
'default' => '',
|
1237 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1238 |
),
|
1239 |
'titlePosition' => array (
|
1240 |
'id' => 'fancybox_YoutubetitlePosition',
|
1241 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1242 |
'label_for' => 'fancybox_YoutubetitlePosition',
|
1243 |
'input' => 'select',
|
1244 |
'options' => array(
|
1245 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1246 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1247 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1248 |
),
|
1249 |
'default' => 'float',
|
1250 |
'description' => '<br />'
|
1254 |
'input' => 'checkbox',
|
1255 |
'noquotes' => true,
|
1256 |
'default' => '1',
|
1257 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1258 |
),
|
1259 |
'onStart' => array (
|
1260 |
'noquotes' => true,
|
1266 |
),
|
1267 |
|
1268 |
'Vimeo' => array(
|
1269 |
+
'title' => esc_html__('Vimeo','easy-fancybox'),
|
1270 |
'input' => 'multiple',
|
1271 |
'options' => array(
|
1272 |
'intro' => array (
|
1273 |
'hide' => true,
|
1274 |
+
'description' => esc_html__('To make any Vimeo movie open in an overlay, switch on Autodetect or use the class "fancybox-vimeo" for its link.','easy-fancybox') . '<br />'
|
1275 |
),
|
1276 |
'autoAttribute' => array (
|
1277 |
'id' => 'fancybox_autoAttributeVimeo',
|
1279 |
'hide' => true,
|
1280 |
'default' => '1',
|
1281 |
'selector' => '\'a[href*="vimeo.com/"],area[href*="vimeo.com/"]\').filter(function(){return this.href.match(/\/(?:[0-9]+|video\/)/);}',
|
1282 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1283 |
),
|
1284 |
'tag' => array (
|
1285 |
'hide' => true,
|
1286 |
+
'default' => 'a.fancybox-vimeo,area.fancybox-vimeo,.fancybox-vimeo>a'
|
1287 |
),
|
1288 |
'class' => array (
|
1289 |
'hide' => true,
|
1339 |
'input' => 'checkbox',
|
1340 |
'noquotes' => true,
|
1341 |
'default' => '',
|
1342 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1343 |
),
|
1344 |
'titlePosition' => array (
|
1345 |
'id' => 'fancybox_VimeotitlePosition',
|
1346 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1347 |
'label_for' => 'fancybox_VimeotitlePosition',
|
1348 |
'input' => 'select',
|
1349 |
'options' => array(
|
1350 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1351 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1352 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1353 |
),
|
1354 |
'default' => 'float',
|
1355 |
'description' => '<br />'
|
1359 |
'input' => 'checkbox',
|
1360 |
'noquotes' => true,
|
1361 |
'default' => '1',
|
1362 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1363 |
),
|
1364 |
'onStart' => array (
|
1365 |
'noquotes' => true,
|
1369 |
),
|
1370 |
|
1371 |
'Dailymotion' => array(
|
1372 |
+
'title' => esc_html__('Dailymotion','easy-fancybox'),
|
1373 |
'input' => 'multiple',
|
1374 |
'options' => array(
|
1375 |
'intro' => array (
|
1376 |
'hide' => true,
|
1377 |
+
'description' => esc_html__('To make any Dailymotion movie open in an overlay, switch on Autodetect or use the class "fancybox-dailymotion" for its link.','easy-fancybox') . '<br />'
|
1378 |
),
|
1379 |
'autoAttribute' => array (
|
1380 |
'id' => 'fancybox_autoAttributeDailymotion',
|
1382 |
'hide' => true,
|
1383 |
'default' => '1',
|
1384 |
'selector' => '\'a[href*="dailymotion.com/"],area[href*="dailymotion.com/"]\').filter(function(){return this.href.match(/\/video\//);}',
|
1385 |
+
'description' => esc_html__('Autodetect','easy-fancybox') . '<br />'
|
1386 |
),
|
1387 |
'tag' => array (
|
1388 |
'hide' => true,
|
1389 |
+
'default' => 'a.fancybox-dailymotion,area.fancybox-dailymotion,.fancybox-dailymotion>a'
|
1390 |
),
|
1391 |
'class' => array (
|
1392 |
'hide' => true,
|
1442 |
'input' => 'checkbox',
|
1443 |
'noquotes' => true,
|
1444 |
'default' => '',
|
1445 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1446 |
),
|
1447 |
'titlePosition' => array (
|
1448 |
'id' => 'fancybox_DailymotiontitlePosition',
|
1449 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1450 |
'label_for' => 'fancybox_DailymotiontitlePosition',
|
1451 |
'input' => 'select',
|
1452 |
'options' => array(
|
1453 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1454 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1455 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1456 |
),
|
1457 |
'default' => 'float',
|
1458 |
'description' => '<br />'
|
1462 |
'input' => 'checkbox',
|
1463 |
'noquotes' => true,
|
1464 |
'default' => '1',
|
1465 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox')
|
1466 |
),
|
1467 |
'onStart' => array (
|
1468 |
'noquotes' => true,
|
1473 |
|
1474 |
/* 'Tudou' => array(
|
1475 |
'id' => 'fancybox_Tudou',
|
1476 |
+
'title' => esc_html__('Tudou','easy-fancybox'),
|
1477 |
'label_for' => '',
|
1478 |
'input' => 'multiple',
|
1479 |
'class' => '', 'description' => '',
|
1486 |
'options' => array(),
|
1487 |
'hide' => true,
|
1488 |
'default' => '1',
|
1489 |
+
'description' => esc_html__('Tudou links','easy-fancybox')
|
1490 |
)
|
1491 |
)
|
1492 |
),*/
|
1499 |
*/
|
1500 |
|
1501 |
'iFrame' => array(
|
1502 |
+
'title' => esc_html__('iFrames','easy-fancybox'),
|
1503 |
'input' => 'multiple',
|
1504 |
'options' => array(
|
1505 |
'intro' => array (
|
1506 |
'hide' => true,
|
1507 |
+
'description' => esc_html__('To make a website or HTML document open in an overlay, use the class "fancybox-iframe" for its link.','easy-fancybox') . '<br /><br />'
|
1508 |
),
|
1509 |
'tag' => array (
|
1510 |
'hide' => true,
|
1511 |
+
'default' => 'a.fancybox-iframe,area.fancybox-iframe,.fancybox-iframe>a'
|
1512 |
),
|
1513 |
'class' => array (
|
1514 |
'hide' => true,
|
1554 |
'input' => 'checkbox',
|
1555 |
'noquotes' => true,
|
1556 |
'default' => '',
|
1557 |
+
'description' => esc_html__('Show title.','easy-fancybox') . ' ' . esc_html__('FancyBox will try to get a title from the link or thumbnail title attributes.','easy-fancybox')
|
1558 |
),
|
1559 |
'titlePosition' => array (
|
1560 |
'id' => 'fancybox_iFrametitlePosition',
|
1561 |
+
'title' => esc_html__('Title Position','easy-fancybox'),
|
1562 |
'label_for' => 'fancybox_iFrametitlePosition',
|
1563 |
'input' => 'select',
|
1564 |
'options' => array(
|
1565 |
+
'float' => esc_html__('Float','easy-fancybox'),
|
1566 |
+
'outside' => esc_html__('Outside','easy-fancybox'),
|
1567 |
+
'inside' => esc_html__('Inside','easy-fancybox')
|
1568 |
),
|
1569 |
'default' => 'float',
|
1570 |
'description' => '<br />'
|
1574 |
'input' => 'checkbox',
|
1575 |
'noquotes' => true,
|
1576 |
'default' => '1',
|
1577 |
+
'description' => esc_html__('Allow title from thumbnail alt attribute.','easy-fancybox') . '<br/>'
|
1578 |
),
|
1579 |
'allowfullscreen' => array (
|
1580 |
'id' => 'fancybox_allowFullScreen',
|
1581 |
'input' => 'checkbox',
|
1582 |
'noquotes' => true,
|
1583 |
'default' => '',
|
1584 |
+
'description' => esc_html__('Allow embedded content to jump to full screen mode','easy-fancybox')
|
1585 |
)
|
1586 |
)
|
1587 |
)
|
inc/fancybox-legacy.php
ADDED
@@ -0,0 +1,341 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* FancyBox v1
|
4 |
+
*/
|
5 |
+
|
6 |
+
namespace easyFancyBox\fancyBox_1;
|
7 |
+
|
8 |
+
/**
|
9 |
+
* MAIN INLINE SCRIPT
|
10 |
+
*/
|
11 |
+
|
12 |
+
function prepare_inline() {
|
13 |
+
// Begin building output FancyBox settings.
|
14 |
+
$script = 'var fb_timeout, fb_opts={';
|
15 |
+
|
16 |
+
/**
|
17 |
+
* Global settings routine.
|
18 |
+
*/
|
19 |
+
$more = 0;
|
20 |
+
foreach ( \easyFancyBox::$options['Global']['options'] as $globals ) {
|
21 |
+
foreach ( $globals['options'] as $_key => $_value ) {
|
22 |
+
if ( isset($_value['id']) )
|
23 |
+
if ( isset($_value['default']) )
|
24 |
+
$parm = \get_option($_value['id'], $_value['default']);
|
25 |
+
else
|
26 |
+
$parm = \get_option($_value['id']);
|
27 |
+
elseif ( isset($_value['default']) )
|
28 |
+
$parm = $_value['default'];
|
29 |
+
else
|
30 |
+
$parm = '';
|
31 |
+
|
32 |
+
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
33 |
+
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
34 |
+
|
35 |
+
if( ! isset($_value['hide']) && $parm!='' ) {
|
36 |
+
$quote = ( is_numeric($parm) || (isset($_value['noquotes']) && $_value['noquotes'] == true) ) ? '' : '\'';
|
37 |
+
if ($more>0)
|
38 |
+
$script .= ',';
|
39 |
+
$script .= '\''.$_key.'\':';
|
40 |
+
$script .= $quote.$parm.$quote;
|
41 |
+
$more++;
|
42 |
+
} else {
|
43 |
+
${$_key} = $parm;
|
44 |
+
}
|
45 |
+
}
|
46 |
+
}
|
47 |
+
|
48 |
+
$script .= ' };
|
49 |
+
if(typeof easy_fancybox_handler===\'undefined\'){
|
50 |
+
var easy_fancybox_handler=function(){';
|
51 |
+
|
52 |
+
$exclude = \get_option( 'fancybox_autoExclude', \easyFancyBox::$options['Global']['options']['Miscellaneous']['options']['autoExclude']['default'] );
|
53 |
+
$exclude_array = $exclude ? explode( ',', $exclude ) : array();
|
54 |
+
$exclude_selectors = ! empty( $exclude_array ) ? \wp_json_encode( $exclude_array ) : false;
|
55 |
+
if ( $exclude_selectors ) {
|
56 |
+
$script .= '
|
57 |
+
jQuery(' . $exclude_selectors . '.join(\',\')).addClass(\'nofancybox\');';
|
58 |
+
}
|
59 |
+
|
60 |
+
$script .= '
|
61 |
+
jQuery(\'a.fancybox-close\').on(\'click\',function(e){e.preventDefault();jQuery.fancybox.close()});';
|
62 |
+
|
63 |
+
foreach ( \easyFancyBox::$options as $key => $value ) {
|
64 |
+
// Check if not enabled or hide=true then skip.
|
65 |
+
if ( isset( $value['hide'] ) || ! isset( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'] ) || ! \get_option( \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['id'], \easyFancyBox::$options['Global']['options']['Enable']['options'][$key]['default'] ) )
|
66 |
+
continue;
|
67 |
+
|
68 |
+
$script .= '
|
69 |
+
/* ' . $key . ' */';
|
70 |
+
|
71 |
+
/**
|
72 |
+
* Auto-detection routines (2x)
|
73 |
+
*/
|
74 |
+
$autoAttribute = isset( $value['options']['autoAttribute'] ) ? \get_option( $value['options']['autoAttribute']['id'], $value['options']['autoAttribute']['default'] ) : '';
|
75 |
+
|
76 |
+
if ( !empty($autoAttribute) ) {
|
77 |
+
if ( is_numeric($autoAttribute) ) {
|
78 |
+
$script .= '
|
79 |
+
jQuery('.$value['options']['autoAttribute']['selector'].').not(\'.nofancybox,li.nofancybox>a\').addClass(\''.$value['options']['class']['default'].'\');';
|
80 |
+
} else {
|
81 |
+
// Set selectors.
|
82 |
+
$file_types = array_filter( explode( ',', str_replace( ' ', ',', $autoAttribute ) ) );
|
83 |
+
$more = 0;
|
84 |
+
$script .= '
|
85 |
+
var fb_'.$key.'_select=\'';
|
86 |
+
foreach ( $file_types as $type ) {
|
87 |
+
if ($type == "jpg" || $type == "jpeg" || $type == "png" || $type == "webp" || $type == "gif")
|
88 |
+
$type = '.'.$type;
|
89 |
+
if ($more>0)
|
90 |
+
$script .= ',';
|
91 |
+
$script .= 'a['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox,li.nofancybox>a),area['.$value['options']['autoAttribute']['selector'].'"'.$type.'"]:not(.nofancybox)';
|
92 |
+
$more++;
|
93 |
+
}
|
94 |
+
$script .= '\';';
|
95 |
+
|
96 |
+
$autoselector = class_exists('easyFancyBox_Advanced') ? \get_option($value['options']['autoSelector']['id'],$value['options']['autoSelector']['default']) : $value['options']['autoSelector']['default'];
|
97 |
+
|
98 |
+
// Class and rel depending on settings.
|
99 |
+
if( '1' == \get_option($value['options']['autoAttributeLimit']['id'],$value['options']['autoAttributeLimit']['default']) ) {
|
100 |
+
// Add class.
|
101 |
+
$script .= '
|
102 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
103 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
104 |
+
// Set rel.
|
105 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
106 |
+
case '':
|
107 |
+
default :
|
108 |
+
$script .= ';});';
|
109 |
+
break;
|
110 |
+
|
111 |
+
case '1':
|
112 |
+
$script .= '.attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
113 |
+
break;
|
114 |
+
|
115 |
+
case '2':
|
116 |
+
$script .= '.attr(\'rel\',\'gallery\');});';
|
117 |
+
break;
|
118 |
+
}
|
119 |
+
} else {
|
120 |
+
// Add class.
|
121 |
+
$script .= '
|
122 |
+
jQuery(fb_'.$key.'_select).addClass(\''.$value['options']['class']['default'].'\')';
|
123 |
+
// Set rel.
|
124 |
+
switch( \get_option($value['options']['autoGallery']['id'],$value['options']['autoGallery']['default']) ) {
|
125 |
+
case '':
|
126 |
+
default :
|
127 |
+
$script .= ';';
|
128 |
+
break;
|
129 |
+
|
130 |
+
case '1':
|
131 |
+
$script .= ';
|
132 |
+
var fb_'.$key.'_sections=jQuery(\''.$autoselector.'\');
|
133 |
+
fb_'.$key.'_sections.each(function(){jQuery(this).find(fb_'.$key.'_select).attr(\'rel\',\'gallery-\'+fb_'.$key.'_sections.index(this));});';
|
134 |
+
break;
|
135 |
+
|
136 |
+
case '2':
|
137 |
+
$script .= '.attr(\'rel\',\'gallery\');';
|
138 |
+
break;
|
139 |
+
}
|
140 |
+
}
|
141 |
+
}
|
142 |
+
}
|
143 |
+
|
144 |
+
/**
|
145 |
+
* Generate .fancybox() bind.
|
146 |
+
*/
|
147 |
+
|
148 |
+
// Prepare auto popup.
|
149 |
+
if ( $key == $autoClick )
|
150 |
+
$trigger = $value['options']['class']['default'];
|
151 |
+
|
152 |
+
$script .= '
|
153 |
+
jQuery(\'' . $value['options']['tag']['default'] . '\')';
|
154 |
+
|
155 |
+
// Use each() to allow different metadata values per instance; fix by Elron. Thanks!
|
156 |
+
$script .= '.each(function(){';
|
157 |
+
|
158 |
+
// Filter here.
|
159 |
+
$bind = 'jQuery(this).fancybox(jQuery.extend({},fb_opts,{';
|
160 |
+
$more = 0;
|
161 |
+
foreach ( $value['options'] as $_key => $_value ) {
|
162 |
+
if ( isset($_value['id']) || isset($_value['default']) )
|
163 |
+
$parm = isset($_value['id']) ? strval( \get_option($_value['id'], isset($_value['default']) ? $_value['default'] : '' ) ) : strval( $_value['default'] );
|
164 |
+
else
|
165 |
+
$parm = '';
|
166 |
+
|
167 |
+
if ( isset($_value['input']) && 'checkbox'==$_value['input'] )
|
168 |
+
$parm = ( '1' == $parm ) ? 'true' : 'false';
|
169 |
+
|
170 |
+
if ( !isset($_value['hide']) && $parm!='' ) {
|
171 |
+
$quote = ( is_numeric($parm) || ( isset($_value['noquotes']) && $_value['noquotes'] == true ) ) ? '' : '\'';
|
172 |
+
if ( $more > 0 )
|
173 |
+
$bind .= ',';
|
174 |
+
$bind .= '\''.$_key.'\':';
|
175 |
+
$bind .= $quote.$parm.$quote;
|
176 |
+
$more++;
|
177 |
+
}
|
178 |
+
}
|
179 |
+
$bind .= '}))';
|
180 |
+
|
181 |
+
$script .= \apply_filters( 'easy_fancybox_bind', $bind );
|
182 |
+
|
183 |
+
$script .= '});';
|
184 |
+
}
|
185 |
+
|
186 |
+
$script .= '
|
187 |
+
};};';
|
188 |
+
|
189 |
+
if ( empty( $delayClick ) ) $delayClick = '0';
|
190 |
+
|
191 |
+
switch ( $autoClick ) {
|
192 |
+
case '':
|
193 |
+
break;
|
194 |
+
|
195 |
+
case '1':
|
196 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a#fancybox-auto,#fancybox-auto>a\').first().trigger(\'click\')},'.$delayClick.');};';
|
197 |
+
\easyFancyBox::$onready_auto = true;
|
198 |
+
break;
|
199 |
+
|
200 |
+
case '2':
|
201 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){if(location.hash){jQuery(location.hash).trigger(\'click\');}},'.$delayClick.');};';
|
202 |
+
\easyFancyBox::$onready_auto = true;
|
203 |
+
break;
|
204 |
+
|
205 |
+
case '99':
|
206 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class|="fancybox"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
207 |
+
\easyFancyBox::$onready_auto = true;
|
208 |
+
break;
|
209 |
+
|
210 |
+
default :
|
211 |
+
if ( ! empty( $trigger ) ) {
|
212 |
+
$script .= PHP_EOL . 'var easy_fancybox_auto=function(){setTimeout(function(){jQuery(\'a[class*="'.$trigger.'"]\').filter(\':first\').trigger(\'click\')},'.$delayClick.');};';
|
213 |
+
\easyFancyBox::$onready_auto = true;
|
214 |
+
}
|
215 |
+
}
|
216 |
+
|
217 |
+
$script .= PHP_EOL;
|
218 |
+
|
219 |
+
// Replace PDF embed shortcodes.
|
220 |
+
if ( ! empty( get_option('fancybox_enablePDF') ) && ! empty( get_option('fancybox_PDFonStart', '{{object}}') ) ) {
|
221 |
+
$replaces = array(
|
222 |
+
'{{object}}' => 'function(a,i,o){o.type=\'pdf\';}',
|
223 |
+
'{{embed}}' => 'function(a,i,o){o.type=\'html\';o.content=\'<embed src="\'+a[i].href+\'" type="application/pdf" height="100%" width="100%" />\'}',
|
224 |
+
'{{googleviewer}}' => 'function(a,i,o){o.href=\'https://docs.google.com/viewer?embedded=true&url=\'+a[i].href;}'
|
225 |
+
);
|
226 |
+
foreach ($replaces as $needle => $replace) {
|
227 |
+
$script = str_replace( $needle, $replace, $script );
|
228 |
+
}
|
229 |
+
}
|
230 |
+
|
231 |
+
\easyFancyBox::$inline_script = \apply_filters( 'easy_fancybox_inline_script', $script );
|
232 |
+
|
233 |
+
/**
|
234 |
+
* HEADER STYLES
|
235 |
+
*/
|
236 |
+
|
237 |
+
// Customized styles.
|
238 |
+
$styles = '';
|
239 |
+
! isset( $overlaySpotlight ) || 'true' !== $overlaySpotlight || $styles .= '#fancybox-overlay{background-attachment:fixed;background-image:url("' . \easyFancyBox::$plugin_url . 'images/light-mask.png");background-position:center;background-repeat:no-repeat;background-size:100% 100%}';
|
240 |
+
|
241 |
+
empty( $borderRadius ) || $styles .= '#fancybox-outer,#fancybox-content{border-radius:'.$borderRadius.'px}.fancybox-title-inside{padding-top:'.$borderRadius.'px;margin-top:-'.$borderRadius.'px !important;border-radius: 0 0 '.$borderRadius.'px '.$borderRadius.'px}';
|
242 |
+
|
243 |
+
$content_style = '';
|
244 |
+
empty( $backgroundColor ) || $content_style .= 'background:'.$backgroundColor.';';
|
245 |
+
empty( $paddingColor ) || $content_style .= 'border-color:'.$paddingColor.';';
|
246 |
+
if ( ! empty( $textColor ) ) {
|
247 |
+
$content_style .= 'color:'.$textColor.';';
|
248 |
+
$styles .= '#fancybox-outer{background:'.$paddingColor.'}'; //.fancybox-title-inside{background-color:'.$paddingColor.';margin-left:0 !important;margin-right:0 !important;width:100% !important;}
|
249 |
+
}
|
250 |
+
empty( $content_style ) || $styles .= '#fancybox-content{'.$content_style.'}';
|
251 |
+
|
252 |
+
empty( $titleColor ) || $styles .= '#fancybox-title,#fancybox-title-float-main{color:'.$titleColor.'}';
|
253 |
+
|
254 |
+
$styles .= '.fancybox-hidden{display:none}#fancybox-content .fancybox-hidden,#fancybox-tmp .fancybox-hidden{display:revert}';
|
255 |
+
|
256 |
+
empty( $styles ) || \easyFancyBox::$inline_style = \wp_strip_all_tags( $styles );
|
257 |
+
|
258 |
+
// Running our IE alphaimageloader relative path styles here.
|
259 |
+
if ( isset( $compatIE8 ) && 'true' == $compatIE8 ) {
|
260 |
+
\easyFancyBox::$inline_style_ie = '/* IE6 */
|
261 |
+
.fancybox-ie6 #fancybox-close{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_close.png",sizingMethod="scale")}
|
262 |
+
.fancybox-ie6 #fancybox-left-ico{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_nav_left.png",sizingMethod="scale")}
|
263 |
+
.fancybox-ie6 #fancybox-right-ico{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_nav_right.png",sizingMethod="scale")}
|
264 |
+
.fancybox-ie6 #fancybox-title-over{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_title_over.png",sizingMethod="scale");zoom:1}
|
265 |
+
.fancybox-ie6 #fancybox-title-float-left{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_title_left.png",sizingMethod="scale")}
|
266 |
+
.fancybox-ie6 #fancybox-title-float-main{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_title_main.png",sizingMethod="scale")}
|
267 |
+
.fancybox-ie6 #fancybox-title-float-right{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_title_right.png",sizingMethod="scale")}
|
268 |
+
#fancybox-loading.fancybox-ie6 div{background:transparent;filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_loading.png",sizingMethod="scale")}
|
269 |
+
/* IE6, IE7, IE8 */
|
270 |
+
.fancybox-ie #fancybox-title-over{background-image:url('.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_title_over.png)}
|
271 |
+
.fancybox-ie #fancybox-bg-n{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_n.png",sizingMethod="scale")}
|
272 |
+
.fancybox-ie #fancybox-bg-ne{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_ne.png",sizingMethod="scale")}
|
273 |
+
.fancybox-ie #fancybox-bg-e{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_e.png",sizingMethod="scale")}
|
274 |
+
.fancybox-ie #fancybox-bg-se{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_se.png",sizingMethod="scale")}
|
275 |
+
.fancybox-ie #fancybox-bg-s{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_s.png",sizingMethod="scale")}
|
276 |
+
.fancybox-ie #fancybox-bg-sw{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_sw.png",sizingMethod="scale")}
|
277 |
+
.fancybox-ie #fancybox-bg-w{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_w.png",sizingMethod="scale")}
|
278 |
+
.fancybox-ie #fancybox-bg-nw{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/fancy_shadow_nw.png",sizingMethod="scale")}
|
279 |
+
.fancybox-ie #fancybox-left, .fancybox-ie #fancybox-right{background-image:url("'.\easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/blank.gif");}';
|
280 |
+
|
281 |
+
if ( isset( $overlaySpotlight ) && 'true' == $overlaySpotlight )
|
282 |
+
\easyFancyBox::$inline_style_ie .= '
|
283 |
+
#fancybox-overlay{filter:progid:DXImageTransform.Microsoft.AlphaImageLoader(src="'.\easyFancyBox::$plugin_url.'images/light-mask.png",sizingMethod="scale")}';
|
284 |
+
}
|
285 |
+
}
|
286 |
+
|
287 |
+
/**
|
288 |
+
* ACTIONS & FILTERS
|
289 |
+
*/
|
290 |
+
|
291 |
+
function prepare_scripts_styles() {
|
292 |
+
// Make sure whe actually need to do anything.
|
293 |
+
if ( ! \easyFancyBox::add_scripts() ){
|
294 |
+
return;
|
295 |
+
}
|
296 |
+
|
297 |
+
// INLINE SCRIPT & STYLE
|
298 |
+
prepare_inline();
|
299 |
+
|
300 |
+
$min = ( defined('WP_DEBUG') && WP_DEBUG ) ? '' : '.min';
|
301 |
+
|
302 |
+
// STYLE URLS
|
303 |
+
\easyFancyBox::$style_url = \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/jquery.fancybox'.$min.'.css';
|
304 |
+
\easyFancyBox::$style_ie_url = \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/jquery.fancybox-ie'.$min.'.css';
|
305 |
+
|
306 |
+
// SCRIPT URLS
|
307 |
+
|
308 |
+
// Register main fancybox script.
|
309 |
+
\easyFancyBox::$script_url = \easyFancyBox::$plugin_url.'fancybox/'.FANCYBOX_VERSIONS['legacy'].'/jquery.fancybox'.$min.'.js';
|
310 |
+
|
311 |
+
// jQuery Easing, which is not needed if jQueryUI Core Effects are loaded or when using fancyBox 3.
|
312 |
+
if (
|
313 |
+
// Check IMG settings.
|
314 |
+
( \get_option( 'fancybox_enableImg', \easyFancyBox::$options['Global']['options']['Enable']['options']['IMG']['default'] ) && ( 'elastic' === \get_option( 'fancybox_transitionIn', 'elastic' ) || 'elastic' === \get_option( 'fancybox_transitionOut', 'elastic' ) ) ) ||
|
315 |
+
// Check Inline Content settings.
|
316 |
+
( \get_option( 'fancybox_enableInline', false ) && ( 'elastic' === \get_option( 'fancybox_transitionInInline' ) || 'elastic' === \get_option( 'fancybox_transitionOutInline' ) ) )
|
317 |
+
) {
|
318 |
+
\easyFancyBox::$easing_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.easing'.$min.'.js';
|
319 |
+
}
|
320 |
+
|
321 |
+
// jQuery Mousewheel, which is not needed if jQueryUI Mouse is loaded or when using fancyBox 3.
|
322 |
+
if ( \get_option( 'fancybox_mouseWheel', true ) ) {
|
323 |
+
\easyFancyBox::$mousewheel_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.mousewheel'.$min.'.js';
|
324 |
+
}
|
325 |
+
|
326 |
+
// Metadata in Miscellaneous settings?
|
327 |
+
if ( \get_option( 'fancybox_metaData' ) ) {
|
328 |
+
\easyFancyBox::$metadata_script_url = \easyFancyBox::$plugin_url.'vendor/jquery.metadata'.$min.'.js';
|
329 |
+
}
|
330 |
+
}
|
331 |
+
\add_action( 'init', __NAMESPACE__.'\prepare_scripts_styles', 12 );
|
332 |
+
|
333 |
+
function onready_callback( $content ) {
|
334 |
+
$content .= 'jQuery(easy_fancybox_handler);jQuery(document).on(\'' . implode( " ", \easyFancyBox::$events ) . '\',easy_fancybox_handler);' . PHP_EOL;
|
335 |
+
|
336 |
+
if ( \easyFancyBox::$onready_auto )
|
337 |
+
$content .= \apply_filters( 'easy_fancybox_onready_auto', 'jQuery(easy_fancybox_auto);' );
|
338 |
+
|
339 |
+
return $content;
|
340 |
+
}
|
341 |
+
\add_filter( 'easy_fancybox_inline_script', __NAMESPACE__.'\onready_callback' );
|
js/jquery.fancybox.min.js
DELETED
@@ -1 +0,0 @@
|
|
1 |
-
(function(l){var D,j,B,r,c,z,w,H,v,i,F,g=0,y={},h=[],d=0,a={},e=[],k=null,E=new Image(),u=/\.(jpg|gif|png|bmp|jpeg|webp)(.*)?$/i,p=/[^\.]\.(swf)\s*$/i,A=/[^\.]\.(svg)\s*$/i,G=/[^\.]\.(pdf)\s*$/i,m,o=1,q=0,b="",t,n,C=false,f=l.extend(l("<div/>")[0],{prop:0}),x=navigator.userAgent.match(/msie [6]/i)&&!window.XMLHttpRequest,s=document.createTouch!==undefined;_abort=function(){l.fancybox.hideActivity();E.onerror=E.onload=null;if(k){k.abort()}D.empty()},_error=function(I){if(false===y.onError(h,g,y)){l.fancybox.hideActivity();C=false;return}if(typeof I==="undefined"){I="Please try again later."}y.titleShow=false;y.width="auto";y.height="auto";D.html('<p id="fancybox-error">The requested content cannot be loaded.<br />'+I+"</p>");_process_inline()},_start=function(){var M=h[g],J,L,O,N,I,K;_abort();y=l.extend({},l.fn.fancybox.defaults,(typeof l(M).data("fancybox")=="undefined"?y:l(M).data("fancybox")));if(document.documentElement.clientWidth<y.minViewportWidth){C=false;return}if("object"===typeof arguments[0]&&"click"===arguments[0].type){arguments[0].preventDefault()}K=y.onStart(h,g,y);if(K===false){C=false;return}else{if(typeof K=="object"){y=l.extend(y,K)}}O=y.title||(M.nodeName?l(M).attr("title"):M.title)||"";if(M.nodeName&&!y.orig){y.orig=l(M).find("img:first").length?l(M).find("img:first"):l(M)}if(O===""&&y.orig){O=y.orig.attr("title")||(y.titleFromAlt?y.orig.attr("alt"):"")}J=y.href||(M.nodeName?l(M).attr("href"):M.href)||null;if((/^(?:javascript)/i).test(J)||J=="#"){J=null}if(y.type){L=y.type;if(!J){J=y.content}}else{if(y.content){L="html"}else{if(l(M).hasClass("iframe")){L="iframe"}else{if(J){if(J.match(u)||l(M).hasClass("image")){L="image"}else{if(J.match(p)){L="swf"}else{if(J.match(A)){L="svg"}else{if(J.match(G)){L="pdf"}else{if(J.indexOf("#")===0){L="inline"}else{L="ajax"}}}}}}}}}if(!L){_error("No content type found.");return}if(l(M).hasClass("modal")){y.modal=true}if(L=="inline"){M=J.substr(J.indexOf("#"));L=l(M).length>0?"inline":"ajax"}y.type=L;y.href=J;y.title=O;if(y.autoDimensions){if(y.type=="html"||y.type=="inline"||y.type=="ajax"){y.width="auto";y.height="auto"}else{y.autoDimensions=false}}if(y.modal){y.overlayShow=true;y.hideOnOverlayClick=false;y.hideOnContentClick=false;y.enableEscapeButton=false;y.showCloseButton=false}y.padding=parseInt(y.padding,10);y.margin=parseInt(y.margin,10);D.css("padding",(y.padding+y.margin));l(".fancybox-inline-tmp").off("fancybox-cancel").on("fancybox-change",function(){l(this).replaceWith(z.children())});switch(L){case"html":D.html(y.content);_process_inline();break;case"inline":if(l(M).parent().is("#fancybox-content")===true){C=false;return}l('<div class="fancybox-inline-tmp" />').hide().insertBefore(l(M)).on("fancybox-cleanup",function(){l(this).replaceWith(z.find(M))}).on("fancybox-cancel",function(){l(this).replaceWith(D.find(M))});l(M).appendTo(D);_process_inline();break;case"image":y.keepRatio=true;C=false;l.fancybox.showActivity();E=new Image();E.onerror=function(){_error("No image found.")};E.onload=function(){C=true;E.onerror=E.onload=null;_process_image()};E.src=J;break;case"swf":y.scrolling="no";y.keepRatio=true;N='<object type="application/x-shockwave-flash" classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="'+y.width+'" height="'+y.height+'"><param name="movie" value="'+J+'"></param>';I="";l.each(y.swf,function(P,Q){N+='<param name="'+P+'" value="'+Q+'"></param>';I+=" "+P+'="'+Q+'"'});N+='<embed src="'+J+'" type="application/x-shockwave-flash" width="'+y.width+'" height="'+y.height+'"'+I+"></embed></object>";D.html(N);_process_inline();break;case"svg":y.scrolling="no";y.keepRatio=true;N='<object type="image/svg+xml" width="'+y.width+'" height="'+y.height+'" data="'+J+'"></object>';D.html(N);_process_inline();break;case"pdf":y.scrolling="no";y.enableKeyboardNav=false;y.showNavArrows=false;N='<object type="application/pdf" width="100%" height="100%" data="'+J+'"><a href="'+J+'" style="display:block;position:absolute;top:48%;width:100%;text-align:center">'+l(M).html()+"</a></object>";D.html(N);_process_inline();break;case"ajax":C=false;l.fancybox.showActivity();y.ajax.win=y.ajax.success;k=l.ajax(l.extend({},y.ajax,{url:J,data:y.ajax.data||{},error:function(P,R,Q){if(P.status>0){_error(Q)}},success:function(Q,S,P){var R=typeof P=="object"?P:k;if(R.status==200){if(typeof y.ajax.win=="function"){K=y.ajax.win(J,Q,S,P);if(K===false){l.fancybox.hideActivity();return}else{if(typeof K=="string"||typeof K=="object"){Q=K}}}if(Q.indexOf("<!DOCTYPE")>-1||Q.indexOf("<html")>-1||Q.indexOf("<body")>-1){_error("Unexpected response.")}else{D.html(Q);_process_inline()}}}}));break;case"iframe":y.enableKeyboardNav=false;y.showNavArrows=false;l.fancybox.showActivity();_show();break}},_process_inline=function(){var J=y.width,K=y.height,L=l(window).width()==0?window.innerWidth:l(window).width(),I=l(window).height()==0?window.innerHeight:l(window).height();if(J.toString().indexOf("%")>-1){J=parseInt((L-(y.margin*2))*parseFloat(J)/100,10)+"px"}else{J=J=="auto"?"auto":J+"px"}if(K.toString().indexOf("%")>-1){K=parseInt((I-(y.margin*2))*parseFloat(K)/100,10)+"px"}else{K=K=="auto"?"auto":K+"px"}D.wrapInner('<div style="width:'+J+";height:"+K+";overflow:"+(y.scrolling=="auto"?"auto":(y.scrolling=="yes"?"scroll":"hidden"))+';position:relative;"></div>');y.width=D.width();y.height=D.height();_show()},_process_image=function(){y.width=E.width;y.height=E.height;l("<img />").attr({id:"fancybox-img",src:E.src,alt:y.title}).appendTo(D);_show()},_show=function(){var J,I;if(y.type!=="iframe"){l.fancybox.hideActivity()}if(r.is(":visible")&&false===a.onCleanup(e,d,a)){l(".fancybox-inline-tmp").trigger("fancybox-cancel");C=false;return}C=true;l(z.add(B)).off();l(window).off("orientationchange.fb resize.fb scroll.fb");l(document).off("keydown.fb");if(r.is(":visible")&&a.titlePosition!=="outside"){r.css("height",r.height())}e=h;d=g;a=y;if(a.overlayShow){l("html").addClass("fancybox-active");B.css({"background-color":a.overlayColor,opacity:a.overlayOpacity,cursor:a.hideOnOverlayClick?"pointer":"auto",height:l(document).height()});if(!B.is(":visible")){if(x){l("select:not(#fancybox-tmp select)").filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one("fancybox-cleanup",function(){this.style.visibility="inherit"})}B.show()}}else{B.hide()}n=_get_zoom_to();_process_title();if(r.is(":visible")){l(w.add(v).add(i)).hide();J=r.position(),t={top:J.top,left:J.left,width:r.width(),height:r.height()};I=(t.width==n.width&&t.height==n.height);z.fadeTo(a.changeFade,0.3,function(){var K=function(){z.html(D.contents()).fadeTo(a.changeFade,1,_finish)};l(".fancybox-inline-tmp").trigger("fancybox-change");z.empty().removeAttr("filter").css({"border-width":a.padding,width:n.width-a.padding*2,height:a.autoDimensions?"auto":n.height-q-a.padding*2});if(I){K()}else{f.prop=0;l(f).animate({prop:1},{duration:a.changeSpeed,easing:a.easingChange,step:_draw,complete:K})}});return}r.removeAttr("style");z.css("border-width",a.padding);if(a.transitionIn=="elastic"){t=_get_zoom_from();z.html(D.contents());r.show();if(a.opacity){n.opacity=0}f.prop=0;l(f).animate({prop:1},{duration:a.speedIn,easing:a.easingIn,step:_draw,complete:_finish});return}if(a.titlePosition=="inside"&&q>0){H.show()}z.css({width:n.width-a.padding*2,height:a.autoDimensions?"auto":n.height-q-a.padding*2}).html(D.contents());r.css(n).fadeIn(a.transitionIn=="none"?0:a.speedIn,_finish)},_format_title=function(I){if(I&&I.length){if(a.titlePosition=="float"){return'<table id="fancybox-title-float-wrap" style="border-spacing:0;border-collapse:collapse"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">'+I+'</td><td id="fancybox-title-float-right"></td></tr></table>'}return'<div id="fancybox-title-'+a.titlePosition+'">'+I+"</div>"}return false},_process_title=function(){b=a.title||"";q=0;H.empty().removeAttr("style").removeClass();if(a.titleShow===false){H.hide();return}b=l.isFunction(a.titleFormat)?a.titleFormat(b,e,d,a):_format_title(b);if(!b||b===""){H.hide();return}H.addClass("fancybox-title-"+a.titlePosition).html(b).appendTo("body").show();switch(a.titlePosition){case"inside":H.css({width:n.width-(a.padding*2),marginLeft:a.padding,marginRight:a.padding}).appendTo(c);q=H.outerHeight(true);n.height+=q;break;case"over":H.css({marginLeft:a.padding,width:n.width-(a.padding*2),bottom:a.padding}).appendTo(c);break;case"float":H.css("left",parseInt((H.width()-n.width)/2,10)*-1).appendTo(c);break;default:H.css({width:n.width-(a.padding*2),paddingLeft:a.padding,paddingRight:a.padding}).appendTo(r);break}H.hide()},_set_navigation=function(){if(a.enableEscapeButton||a.enableKeyboardNav){l(document).on("keydown.fb",function(I){if(I.keyCode==27&&a.enableEscapeButton){I.preventDefault();l.fancybox.close()}else{if((I.keyCode==37||I.keyCode==39)&&a.enableKeyboardNav&&I.target.tagName!=="INPUT"&&I.target.tagName!=="TEXTAREA"&&I.target.tagName!=="SELECT"){I.preventDefault();l.fancybox[I.keyCode==37?"prev":"next"]()}else{if((I.keyCode==9)&&a.enableKeyboardNav&&I.target.tagName!=="INPUT"&&I.target.tagName!=="TEXTAREA"&&I.target.tagName!=="SELECT"){I.preventDefault();l.fancybox[I.shiftKey?"prev":"next"]()}}}})}if(!a.showNavArrows){v.hide();i.hide();return}if((a.cyclic&&e.length>1)||d!==0){v.show()}if((a.cyclic&&e.length>1)||d!=(e.length-1)){i.show()}},_finish=function(){if(!l.support.opacity){z.css("filter",0);r.css("filter",0)}if(a.autoDimensions){z.css("height","auto")}r.css("height","auto");if(b&&b.length){H.show()}if(a.showCloseButton){w.show()}_set_navigation();if(a.hideOnContentClick){z.on("click",l.fancybox.close)}if(a.hideOnOverlayClick){B.on("click",l.fancybox.close)}if(a.autoResize){l(window).on("resize.fb",l.fancybox.resize)}if(a.centerOnScroll&&!s){l(window).on("scroll.fb",l.fancybox.center)}if(l.fn.mousewheel){r.on("mousewheel.fb",function(I,J){if(C){I.preventDefault()}else{if(a.type=="image"&&(l(I.target).outerHeight()==0||l(I.target).prop("scrollHeight")===l(I.target).outerHeight())){I.preventDefault();l.fancybox[J>0?"prev":"next"]()}}})}if(a.type=="iframe"){l('<iframe id="fancybox-frame" name="fancybox-frame'+new Date().getTime()+'"'+(navigator.userAgent.match(/msie [6]/i)?' allowtransparency="true""':"")+' style="border:0;margin:0;overflow:'+(a.scrolling=="auto"?"auto":(a.scrolling=="yes"?"scroll":"hidden"))+'" src="'+a.href+'"'+(false===a.allowfullscreen?"":" allowfullscreen")+' allow="autoplay; encrypted-media" tabindex="999"></iframe>').appendTo(z).on("load",function(){l.fancybox.hideActivity()}).focus()}r.show();C=false;l.fancybox.center();a.onComplete(e,d,a);if(e.length>1){_preload_next();_preload_prev()}},_preload_next=function(){var I=typeof arguments[0]=="number"?arguments[0]:d+1;if(I>=e.length){if(a.cyclic){I=0}else{return}}if(I==d){a.enableKeyboardNav=false;r.off("mousewheel.fb");i.hide();return}if(_preload_image(I)){return}else{_preload_next(I+1)}},_preload_prev=function(){var I=typeof arguments[0]=="number"?arguments[0]:d-1;if(I<0){if(a.cyclic){I=e.length-1}else{return}}if(I==d){a.enableKeyboardNav=false;r.off("mousewheel.fb");v.hide();return}if(_preload_image(I)){return}else{_preload_prev(I-1)}},_preload_image=function(K){var J,I=e[K];if(typeof I!=="undefined"&&typeof I.href!=="undefined"&&I.href!==a.href&&(I.href.match(u)||l(I).hasClass("image"))){J=new Image();J.src=I.href;return true}else{return false}},_draw=function(J){var I={width:parseInt(t.width+(n.width-t.width)*J,10),height:parseInt(t.height+(n.height-t.height)*J,10),top:parseInt(t.top+(n.top-t.top)*J,10),left:parseInt(t.left+(n.left-t.left)*J,10)};if(typeof n.opacity!=="undefined"){I.opacity=J<0.5?0.5:J}r.css(I);z.css({width:I.width-a.padding*2,height:I.height-(q*J)-a.padding*2})},_get_viewport=function(){var I=!s&&window.innerWidth&&document.documentElement.clientWidth?Math.min(window.innerWidth,document.documentElement.clientWidth):window.innerWidth||document.documentElement.clientWidth||document.getElementsByTagName("body")[0].clientWidth,J=!s&&window.innerHeight&&document.documentElement.clientHeight?Math.min(window.innerHeight,document.documentElement.clientHeight):window.innerHeight||document.documentElement.clientHeight||document.getElementsByTagName("body")[0].clientHeight,K;K=arguments[0]===true?0:a.margin;return[I-(K*2),J-(K*2),l(document).scrollLeft()+K,l(document).scrollTop()+K]},_get_zoom_to=function(){var I=_get_viewport(),L={},J=a.padding*2,K;if(a.width.toString().indexOf("%")>-1){L.width=parseInt((I[0]*parseFloat(a.width))/100,10)}else{L.width=a.width+J}if(a.height.toString().indexOf("%")>-1){L.height=parseInt((I[1]*parseFloat(a.height))/100,10)}else{L.height=a.height+J}if(a.autoScale&&(L.width>I[0]||L.height>I[1])){if(a.keepRatio){K=a.width/a.height;if((L.width)>I[0]){L.width=I[0];L.height=parseInt(((L.width-J)/K)+J,10)}if((L.height)>I[1]){L.height=I[1];L.width=parseInt(((L.height-J)*K)+J,10)}}else{L.width=Math.min(L.width,I[0]);L.height=Math.min(L.height,I[1])}}L.top=parseInt(Math.max(I[3]-20,I[3]+((I[1]-L.height-40)*0.5)),10);L.left=parseInt(Math.max(I[2]-20,I[2]+((I[0]-L.width-40)*0.5)),10);return L},_get_obj_pos=function(I){var J=I.offset();J.top+=parseInt(I.css("paddingTop"),10)||0;J.left+=parseInt(I.css("paddingLeft"),10)||0;J.top+=parseInt(I.css("border-top-width"),10)||0;J.left+=parseInt(I.css("border-left-width"),10)||0;J.width=I.width();J.height=I.height();return J},_get_zoom_from=function(){var L=y.orig?l(y.orig):false,K={},J,I;if(L&&L.length){J=_get_obj_pos(L);K={width:J.width+(a.padding*2),height:J.height+(a.padding*2),top:J.top-a.padding-20,left:J.left-a.padding-20}}else{I=_get_viewport();K={width:a.padding*2,height:a.padding*2,top:parseInt((I[3]+I[1])*0.5,10),left:parseInt((I[2]+I[0])*0.5,10)}}return K},_animate_loading=function(){if(!j.is(":visible")){clearInterval(m);return}l("div",j).css("top",(o*-40)+"px");o=(o+1)%12};l.fn.fancybox=function(I){if(!l(this).length){return this}l(this).data("fancybox",l.extend({},I,(l.metadata?l(this).metadata():{}))).off("click.fb").on("click.fb",function(K){if(C){return}C=true;l(this).blur();h=[];g=0;var J=l(this).attr("rel")||"";if(J==""||J.replace(/alternate|external|help|license|nofollow|noreferrer|noopener|\s+/gi,"")==""){h.push(this)}else{h=l('a[rel="'+J+'"], area[rel="'+J+'"]');g=h.index(this)}_start(K);return});return this};l.fancybox=function(L){var K;if(C){return}C=true;K=typeof arguments[1]!=="undefined"?arguments[1]:{};h=[];g=parseInt(K.index,10)||0;if(l.isArray(L)){for(var J=0,I=L.length;J<I;J++){if(typeof L[J]=="object"){l(L[J]).data("fancybox",l.extend({},K,L[J]))}else{L[J]=l({}).data("fancybox",l.extend({content:L[J]},K))}}h=jQuery.merge(h,L)}else{if(typeof L=="object"){l(L).data("fancybox",l.extend({},K,L))}else{L=l({}).data("fancybox",l.extend({content:L},K))}h.push(L)}if(g>h.length||g<0){g=0}_start()};l.fancybox.showActivity=function(){clearInterval(m);j.show();m=setInterval(_animate_loading,66)};l.fancybox.hideActivity=function(){j.hide()};l.fancybox.next=function(){var I,J=typeof arguments[0]=="number"?arguments[0]:d+1;if(J>=e.length){if(a.cyclic){J=0}else{return}}I=e[J];if(J!=d&&typeof I!=="undefined"&&typeof I.href!=="undefined"&&I.href===a.href){l.fancybox.next(J+1)}else{l.fancybox.pos(J)}return};l.fancybox.prev=function(){var I,J=typeof arguments[0]=="number"?arguments[0]:d-1;if(J<0){if(a.cyclic){J=e.length-1}else{return}}I=e[J];if(J!=d&&typeof I!=="undefined"&&typeof I.href!=="undefined"&&I.href===a.href){l.fancybox.prev(J-1)}else{l.fancybox.pos(J)}return};l.fancybox.pos=function(I){if(C){return}I=parseInt(I);h=e;if(I>-1&&I<e.length){g=I;_start()}return};l.fancybox.cancel=function(){if(C){return}C=true;l(".fancybox-inline-tmp").trigger("fancybox-cancel");_abort();y.onCancel(h,g,y);C=false};l.fancybox.close=function(){if(C||r.is(":hidden")){return}C=true;if(a&&false===a.onCleanup(e,d,a)){C=false;return}_abort();l(w.add(v).add(i)).hide();l(z.add(B)).off();l(window).off("orientationchange.fb resize.fb scroll.fb mousewheel.fb");l(document).off("keydown.fb");if(a.titlePosition!=="inside"){H.empty()}r.stop();function I(){B.fadeOut("fast");H.empty().hide();r.hide();l(".fancybox-inline-tmp").trigger("fancybox-cleanup");z.empty();a.onClosed(e,d,a);e=y=[];d=g=0;a=y={};C=false}if(a.transitionOut=="elastic"){t=_get_zoom_from();var J=r.position();n={top:J.top,left:J.left,width:r.width(),height:r.height()};if(a.opacity){n.opacity=1}H.empty().hide();f.prop=1;l(f).animate({prop:0},{duration:a.speedOut,easing:a.easingOut,step:_draw,complete:I})}else{r.fadeOut(a.transitionOut=="none"?0:a.speedOut,I)}l("html").removeClass("fancybox-active")};l.fancybox.resize=function(){var I;clearTimeout(F);F=setTimeout(function(){var J=function(){if(y.autoDimensions){z.css("height","auto")}r.css("height","auto");if(b&&b.length){H.show()}C=false;l.fancybox.center(true)};if(B.is(":visible")){B.css("height",l(document).height())}I=r.position(),t={top:I.top,left:I.left,width:r.width(),height:r.height()};n=_get_zoom_to();C=true;_process_title();f.prop=0;l(f).animate({prop:1},{duration:a.changeSpeed,easing:a.easingChange,step:_draw,complete:J})},500)};l.fancybox.center=function(){var I,J;if(C){return}J=arguments[0]===true?1:0;I=_get_viewport(true);if(!J&&((r.width()+40)>I[0]||(r.height()+40)>I[1])){return}r.stop().animate({top:parseInt(Math.max(I[3]-20,I[3]+((I[1]-z.height()-40)*0.5)-a.padding)),left:parseInt(Math.max(I[2]-20,I[2]+((I[0]-z.width()-40)*0.5)-a.padding))},typeof arguments[0]=="number"?arguments[0]:300)};l.fancybox.init=function(){if(l("#fancybox-wrap").length){return}l("body").append(D=l('<div id="fancybox-tmp"></div>'),j=l('<div id="fancybox-loading"><div></div></div>'),B=l('<div id="fancybox-overlay"></div>'),r=l('<div id="fancybox-wrap"></div>'));c=l('<div id="fancybox-outer"></div>').append('<div class="fancybox-bg" id="fancybox-bg-n"></div><div class="fancybox-bg" id="fancybox-bg-ne"></div><div class="fancybox-bg" id="fancybox-bg-e"></div><div class="fancybox-bg" id="fancybox-bg-se"></div><div class="fancybox-bg" id="fancybox-bg-s"></div><div class="fancybox-bg" id="fancybox-bg-sw"></div><div class="fancybox-bg" id="fancybox-bg-w"></div><div class="fancybox-bg" id="fancybox-bg-nw"></div>').appendTo(r);c.append(z=l('<div id="fancybox-content"></div>'),w=l('<a id="fancybox-close"></a>'),H=l('<div id="fancybox-title"></div>'),v=l('<a id="fancybox-left"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),i=l('<a id="fancybox-right"><span class="fancy-ico" id="fancybox-right-ico"></span></a>'));w.click(l.fancybox.close);j.click(l.fancybox.cancel);v.click(function(I){I.preventDefault();l.fancybox.prev()});i.click(function(I){I.preventDefault();l.fancybox.next()});if(!l.support.opacity){r.addClass("fancybox-ie")}if(x){j.addClass("fancybox-ie6");r.addClass("fancybox-ie6");l('<iframe id="fancybox-hide-sel-frame" src="'+(/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank")+'" style="overflow:hidden;border:0" tabindex="-1"></iframe>').prependTo(c)}};l.fn.fancybox.defaults={padding:10,margin:40,opacity:false,modal:false,cyclic:false,allowfullscreen:false,scrolling:"auto",width:560,height:340,autoScale:true,autoDimensions:true,centerOnScroll:false,autoResize:true,keepRatio:false,minViewportWidth:0,ajax:{},swf:{wmode:"opaque"},svg:{wmode:"opaque"},hideOnOverlayClick:true,hideOnContentClick:false,overlayShow:true,overlayOpacity:0.7,overlayColor:"#777",titleShow:true,titlePosition:"float",titleFormat:null,titleFromAlt:true,transitionIn:"fade",transitionOut:"fade",speedIn:300,speedOut:300,changeSpeed:300,changeFade:"fast",easingIn:"swing",easingOut:"swing",showCloseButton:true,showNavArrows:true,enableEscapeButton:true,enableKeyboardNav:true,onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}};l(document).ready(function(){l.fancybox.init()})})(jQuery);
|
|
readme.txt
CHANGED
@@ -1,760 +1,737 @@
|
|
1 |
-
=== Easy FancyBox ===
|
2 |
-
Contributors: RavanH
|
3 |
-
Donate link: https://www.paypal.com/cgi-bin/webscr?cmd=_donations&business=ravanhagen%40gmail%2ecom&item_name=Easy%20FancyBox
|
4 |
-
Tags: fancybox, lightbox, gallery, image, photo, video,
|
5 |
-
Requires at least: 3.3
|
6 |
-
Tested up to: 6.
|
7 |
-
Stable tag: 1.
|
8 |
-
|
9 |
-
Easily enable the FancyBox
|
10 |
-
|
11 |
-
== Description ==
|
12 |
-
|
13 |
-
Easy FancyBox plugin for WordPress websites gives you a flexible and aesthetic light box solution for just about all media links on your website. Easy FancyBox uses an updated version of the traditional FancyBox jQuery extension and is WP 3+ Multi-Site compatible. After activation you can find a new section **FancyBox** on your **Settings > Media** admin page where you can manage the media light box options.
|
14 |
-
|
15 |
-
After activation, all links to **JPG, GIF and PNG images** are automatically opened in the [FancyBox](http://fancybox.net/) Mac/Gnome-style lightbox that floats over the web page.
|
16 |
-
|
17 |
-
**GDPR / EU Privacy**
|
18 |
-
|
19 |
-
This plugin does not collect any data and does not set any browser cookies. However, the PRO version offers an option to disable the automatic popup after the first visit, which needs a browser cookie. This cookie stores the visitors first website visit timestamp and path on the client side. It is not shared nor is any data stored server side or elsewhere.
|
20 |
-
|
21 |
-
**FEATURES**
|
22 |
-
|
23 |
-
Supported media and content types:
|
24 |
-
|
25 |
-
- All common image formats _including_ webp
|
26 |
-
- Hosted video on **Youtube**, **Vimeo** _and_ **Dailmotion**
|
27 |
-
- PDF files (embed with object tag, in iframe or in external Google Docs Viewer)
|
28 |
-
-
|
29 |
-
-
|
30 |
-
-
|
31 |
-
|
32 |
-
|
33 |
-
|
34 |
-
|
35 |
-
-
|
36 |
-
-
|
37 |
-
-
|
38 |
-
-
|
39 |
-
|
40 |
-
|
41 |
-
|
42 |
-
|
43 |
-
-
|
44 |
-
- Automatic detection of
|
45 |
-
-
|
46 |
-
-
|
47 |
-
-
|
48 |
-
|
49 |
-
|
50 |
-
|
51 |
-
|
52 |
-
|
53 |
-
|
54 |
-
|
55 |
-
|
56 |
-
|
57 |
-
|
58 |
-
|
59 |
-
|
60 |
-
-
|
61 |
-
-
|
62 |
-
-
|
63 |
-
-
|
64 |
-
- More
|
65 |
-
-
|
66 |
-
-
|
67 |
-
-
|
68 |
-
-
|
69 |
-
|
70 |
-
|
71 |
-
|
72 |
-
|
73 |
-
|
74 |
-
|
75 |
-
|
76 |
-
|
77 |
-
|
78 |
-
|
79 |
-
|
80 |
-
|
81 |
-
|
82 |
-
|
83 |
-
|
84 |
-
-
|
85 |
-
-
|
86 |
-
-
|
87 |
-
|
88 |
-
|
89 |
-
|
90 |
-
|
91 |
-
|
92 |
-
- Google
|
93 |
-
-
|
94 |
-
- **
|
95 |
-
-
|
96 |
-
- **
|
97 |
-
|
98 |
-
|
99 |
-
|
100 |
-
|
101 |
-
|
102 |
-
-
|
103 |
-
-
|
104 |
-
- **
|
105 |
-
|
106 |
-
|
107 |
-
|
108 |
-
|
109 |
-
|
110 |
-
|
111 |
-
|
112 |
-
|
113 |
-
|
114 |
-
|
115 |
-
|
116 |
-
|
117 |
-
|
118 |
-
|
119 |
-
|
120 |
-
|
121 |
-
|
122 |
-
|
123 |
-
|
124 |
-
|
125 |
-
|
126 |
-
|
127 |
-
|
128 |
-
|
129 |
-
|
130 |
-
|
131 |
-
|
132 |
-
|
133 |
-
|
134 |
-
|
135 |
-
|
136 |
-
|
137 |
-
|
138 |
-
|
139 |
-
|
140 |
-
=
|
141 |
-
|
142 |
-
|
143 |
-
|
144 |
-
|
145 |
-
|
146 |
-
|
147 |
-
|
148 |
-
|
149 |
-
|
150 |
-
|
151 |
-
|
152 |
-
|
153 |
-
|
154 |
-
|
155 |
-
|
156 |
-
|
157 |
-
|
158 |
-
|
159 |
-
|
160 |
-
|
161 |
-
|
162 |
-
|
163 |
-
|
164 |
-
|
165 |
-
|
166 |
-
|
167 |
-
|
168 |
-
|
169 |
-
=
|
170 |
-
|
171 |
-
|
172 |
-
|
173 |
-
|
174 |
-
|
175 |
-
|
176 |
-
|
177 |
-
|
178 |
-
|
179 |
-
|
180 |
-
|
181 |
-
|
182 |
-
|
183 |
-
|
184 |
-
|
185 |
-
|
186 |
-
|
187 |
-
|
188 |
-
|
189 |
-
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
|
197 |
-
1.
|
198 |
-
|
199 |
-
1.
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
**
|
209 |
-
|
210 |
-
**
|
211 |
-
|
212 |
-
|
213 |
-
`
|
214 |
-
|
215 |
-
`
|
216 |
-
|
217 |
-
**
|
218 |
-
|
219 |
-
|
220 |
-
`
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
**
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
1.
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
`
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
=
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
|
269 |
-
|
270 |
-
|
271 |
-
1.
|
272 |
-
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
jQuery(
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/
|
294 |
-
|
295 |
-
|
296 |
-
`
|
297 |
-
|
298 |
-
|
299 |
-
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/
|
300 |
-
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/
|
301 |
-
https://img.youtube.com/
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
|
325 |
-
|
326 |
-
|
327 |
-
|
328 |
-
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
=
|
335 |
-
|
336 |
-
|
337 |
-
|
338 |
-
|
339 |
-
|
340 |
-
|
341 |
-
|
342 |
-
`
|
343 |
-
<
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
|
348 |
-
|
349 |
-
`
|
350 |
-
<
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
`
|
356 |
-
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
|
363 |
-
</
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
`
|
402 |
-
|
403 |
-
|
404 |
-
|
405 |
-
|
406 |
-
|
407 |
-
|
408 |
-
|
409 |
-
|
410 |
-
|
411 |
-
|
412 |
-
|
413 |
-
|
414 |
-
|
415 |
-
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
-
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
=
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
`
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
|
450 |
-
|
451 |
-
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
|
456 |
-
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
=
|
466 |
-
|
467 |
-
|
468 |
-
|
469 |
-
|
470 |
-
|
471 |
-
=
|
472 |
-
|
473 |
-
|
474 |
-
|
475 |
-
|
476 |
-
|
477 |
-
|
478 |
-
|
479 |
-
|
480 |
-
|
481 |
-
|
482 |
-
|
483 |
-
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
= 1.8.
|
503 |
-
*
|
504 |
-
*
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
510 |
-
*
|
511 |
-
|
512 |
-
|
513 |
-
|
514 |
-
*
|
515 |
-
|
516 |
-
|
517 |
-
|
518 |
-
* FIX:
|
519 |
-
*
|
520 |
-
|
521 |
-
|
522 |
-
|
523 |
-
*
|
524 |
-
|
525 |
-
|
526 |
-
*
|
527 |
-
*
|
528 |
-
|
529 |
-
= 1.8.
|
530 |
-
* FIX:
|
531 |
-
|
532 |
-
= 1.8.
|
533 |
-
*
|
534 |
-
|
535 |
-
|
536 |
-
|
537 |
-
* FIX:
|
538 |
-
|
539 |
-
|
540 |
-
|
541 |
-
|
542 |
-
* FIX:
|
543 |
-
*
|
544 |
-
|
545 |
-
|
546 |
-
*
|
547 |
-
*
|
548 |
-
*
|
549 |
-
|
550 |
-
|
551 |
-
|
552 |
-
|
553 |
-
*
|
554 |
-
|
555 |
-
|
556 |
-
*
|
557 |
-
*
|
558 |
-
|
559 |
-
|
560 |
-
|
561 |
-
|
562 |
-
*
|
563 |
-
|
564 |
-
|
565 |
-
*
|
566 |
-
*
|
567 |
-
* FIX:
|
568 |
-
* FIX:
|
569 |
-
* FIX:
|
570 |
-
*
|
571 |
-
|
572 |
-
|
573 |
-
|
574 |
-
|
575 |
-
|
576 |
-
*
|
577 |
-
|
578 |
-
|
579 |
-
*
|
580 |
-
*
|
581 |
-
*
|
582 |
-
*
|
583 |
-
|
584 |
-
|
585 |
-
|
586 |
-
*
|
587 |
-
*
|
588 |
-
*
|
589 |
-
*
|
590 |
-
|
591 |
-
|
592 |
-
*
|
593 |
-
*
|
594 |
-
|
595 |
-
= 1.
|
596 |
-
* FIX:
|
597 |
-
|
598 |
-
|
599 |
-
*
|
600 |
-
|
601 |
-
|
602 |
-
*
|
603 |
-
*
|
604 |
-
*
|
605 |
-
*
|
606 |
-
*
|
607 |
-
|
608 |
-
|
609 |
-
|
610 |
-
|
611 |
-
*
|
612 |
-
*
|
613 |
-
|
614 |
-
|
615 |
-
*
|
616 |
-
*
|
617 |
-
|
618 |
-
= 1.5.
|
619 |
-
*
|
620 |
-
*
|
621 |
-
*
|
622 |
-
*
|
623 |
-
|
624 |
-
|
625 |
-
*
|
626 |
-
*
|
627 |
-
*
|
628 |
-
*
|
629 |
-
|
630 |
-
|
631 |
-
*
|
632 |
-
|
633 |
-
= 1.5.
|
634 |
-
* FIX:
|
635 |
-
*
|
636 |
-
*
|
637 |
-
|
638 |
-
|
639 |
-
*
|
640 |
-
|
641 |
-
|
642 |
-
*
|
643 |
-
*
|
644 |
-
*
|
645 |
-
*
|
646 |
-
|
647 |
-
|
648 |
-
*
|
649 |
-
*
|
650 |
-
*
|
651 |
-
*
|
652 |
-
|
653 |
-
|
654 |
-
*
|
655 |
-
|
656 |
-
|
657 |
-
*
|
658 |
-
*
|
659 |
-
*
|
660 |
-
|
661 |
-
|
662 |
-
*
|
663 |
-
*
|
664 |
-
*
|
665 |
-
|
666 |
-
|
667 |
-
*
|
668 |
-
*
|
669 |
-
* NEW:
|
670 |
-
* NEW:
|
671 |
-
* NEW
|
672 |
-
*
|
673 |
-
*
|
674 |
-
*
|
675 |
-
*
|
676 |
-
*
|
677 |
-
*
|
678 |
-
*
|
679 |
-
*
|
680 |
-
|
681 |
-
|
682 |
-
*
|
683 |
-
*
|
684 |
-
*
|
685 |
-
*
|
686 |
-
*
|
687 |
-
|
688 |
-
|
689 |
-
|
690 |
-
* NEW:
|
691 |
-
* NEW:
|
692 |
-
* NEW:
|
693 |
-
*
|
694 |
-
*
|
695 |
-
*
|
696 |
-
*
|
697 |
-
|
698 |
-
|
699 |
-
*
|
700 |
-
*
|
701 |
-
*
|
702 |
-
*
|
703 |
-
|
704 |
-
|
705 |
-
|
706 |
-
|
707 |
-
*
|
708 |
-
* BIGFIX:
|
709 |
-
* BIGFIX:
|
710 |
-
|
711 |
-
= 1.3.4
|
712 |
-
*
|
713 |
-
*
|
714 |
-
*
|
715 |
-
*
|
716 |
-
*
|
717 |
-
|
718 |
-
|
719 |
-
*
|
720 |
-
|
721 |
-
= 1.3.
|
722 |
-
*
|
723 |
-
*
|
724 |
-
* NEW:
|
725 |
-
*
|
726 |
-
*
|
727 |
-
|
728 |
-
|
729 |
-
|
730 |
-
*
|
731 |
-
*
|
732 |
-
|
733 |
-
|
734 |
-
|
735 |
-
|
736 |
-
|
737 |
-
*
|
738 |
-
* Auto-recognition and seperate class `fancybox-youtube` for YouTube
|
739 |
-
* Auto-recognition and seperate class `fancybox-vimeo` for Vimeo
|
740 |
-
|
741 |
-
= 1.3.2 =
|
742 |
-
* FancyBox script version 1.3.2 (2010/10/10 - http://fancybox.net/changelog/)
|
743 |
-
|
744 |
-
= 1.3.1.3 =
|
745 |
-
* translation .pot file available
|
746 |
-
* Dutch translation
|
747 |
-
* NEW: YouTube and Flash movie support
|
748 |
-
* NEW: Iframe support
|
749 |
-
* added option Auto-enable for...
|
750 |
-
|
751 |
-
= 1.3.1.2 =
|
752 |
-
* added option titlePosition : over / inside / outside
|
753 |
-
* added option transitionIn : elastic / fade / none
|
754 |
-
* added option transitionOut : elastic / fade / none
|
755 |
-
|
756 |
-
= 1.3.1.1 =
|
757 |
-
* small jQuery speed improvement by chaining object calls
|
758 |
-
|
759 |
-
= 1.3.1 =
|
760 |
-
* Using FancyBox version 1.3.1
|
1 |
+
=== Easy FancyBox ===
|
2 |
+
Contributors: RavanH
|
3 |
+
Donate link: https://www.paypal.com/cgi-bin/webscr?cmd=_donations&business=ravanhagen%40gmail%2ecom&item_name=Easy%20FancyBox
|
4 |
+
Tags: fancybox, lightbox, gallery, image, photo, video, overlay, youtube, vimeo, dailymotion, pdf, svg, iframe, jquery, webp
|
5 |
+
Requires at least: 3.3
|
6 |
+
Tested up to: 6.1-RC1
|
7 |
+
Stable tag: 1.9
|
8 |
+
|
9 |
+
Easily enable the FancyBox light box on just about all media links. Multi-Site compatible. Supports iframe, inline content and well known video hosts.
|
10 |
+
|
11 |
+
== Description ==
|
12 |
+
|
13 |
+
Easy FancyBox plugin for WordPress websites gives you a flexible and aesthetic light box solution for just about all media links on your website. Easy FancyBox uses an updated version of the traditional FancyBox jQuery extension and is WP 3+ Multi-Site compatible. After activation you can find a new section **FancyBox** on your **Settings > Media** admin page where you can manage the media light box options.
|
14 |
+
|
15 |
+
After activation, all links to **JPG, GIF and PNG images** are automatically opened in the [FancyBox](http://fancybox.net/) Mac/Gnome-style lightbox that floats over the web page.
|
16 |
+
|
17 |
+
**GDPR / EU Privacy**
|
18 |
+
|
19 |
+
This plugin does not collect any data and does not set any browser cookies. However, the PRO version offers an option to disable the automatic popup after the first visit, which needs a browser cookie. This cookie stores the visitors first website visit timestamp and path on the client side. It is not shared nor is any data stored server side or elsewhere.
|
20 |
+
|
21 |
+
**FEATURES**
|
22 |
+
|
23 |
+
Supported media and content types:
|
24 |
+
|
25 |
+
- All common image formats _including_ webp
|
26 |
+
- Hosted video on **Youtube**, **Vimeo** _and_ **Dailmotion**
|
27 |
+
- PDF files (embed with object tag, in iframe or in external Google Docs Viewer)
|
28 |
+
- SVG media images (thanks to Simon Maillard)
|
29 |
+
- Inline HTML content (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#how%20can%20i%20display%20inline%20content%20in%20a%20fancybox%20overlay%20%3F))
|
30 |
+
- External web pages (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#can%20i%20display%20web%20pages%20or%20html%20files%20in%20a%20fancybox%20overlay%3F))
|
31 |
+
|
32 |
+
Also supports:
|
33 |
+
|
34 |
+
- WordPress Galleries (option "Link to" must be set to "Media File")
|
35 |
+
- NextGEN galleries (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#can%20nextgen%20gallery%20work%20with%20easy%20fancybox%20%3F))
|
36 |
+
- Image maps
|
37 |
+
- WordPress menu items (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#can%20i%20make%20a%20menu%20item%20open%20in%20a%20fancybox%20overlay%20%3F))
|
38 |
+
- Jetpack Infinite Scroll
|
39 |
+
|
40 |
+
Additional features:
|
41 |
+
|
42 |
+
- Modal window option (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#can%20i%20have%20a%20modal%20window%20%3F))
|
43 |
+
- Automatic detection of media file links
|
44 |
+
- Automatic detection of galleries
|
45 |
+
- Popup on page load optional (see [instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#can%20i%20make%20an%20image%20or%20hidden%20content%20to%20pop%20up%20in%20fancybox%20on%20page%20load%3F))
|
46 |
+
- Fade or Elastic popup effects
|
47 |
+
- Styling options for light box overlay (color and opacity) and window (border size and color)
|
48 |
+
|
49 |
+
For **advanced options** and **priority support**, there is a **[Pro extension](https://premium.status301.com/downloads/easy-fancybox-pro/)** available. See Pro features below.
|
50 |
+
|
51 |
+
See [FAQ's](https://wordpress.org/plugins/easy-fancybox/#faq) for instructions to manage YouTube, Dailymotion and Vimeo movies (and similar services) and tips to make inline content display in a FancyBox overlay.
|
52 |
+
|
53 |
+
Get support on the [Easy FancyBox web page](https://status301.net/wordpress-plugins/easy-fancybox/) or [WordPress forum](https://wordpress.org/support/plugin/easy-fancybox).
|
54 |
+
|
55 |
+
Visit [FancyBox](http://fancybox.net/) for more information and examples.
|
56 |
+
|
57 |
+
**PRO FEATURES**
|
58 |
+
|
59 |
+
- Priority support on dedicated forum
|
60 |
+
- Slideshow effect for galleries (autorotation)
|
61 |
+
- Spotlight effect for the light box overlay
|
62 |
+
- FacetWP, Gravity Forms and TablePress compatibility
|
63 |
+
- More styling options: rounded corners, inline content background and text colors
|
64 |
+
- More automatic popup options: triggered by URL hash, first link by media type, hide popup after first visit
|
65 |
+
- Pass dedicated light box setting per media link via link class (see [Metadata instructions in the FAQs](https://wordpress.org/plugins/easy-fancybox#how%20do%20i%20show%20content%20with%20different%20sizes%3F))
|
66 |
+
- More elastic (easing) popup effects on open and close
|
67 |
+
- Show/hide image title on mouse hover
|
68 |
+
- Fine-tune media link and gallery autodetection to match your theme source markup to allow galleries per post for example
|
69 |
+
|
70 |
+
For these additional features, you need to install the **[Pro extension](https://premium.status301.com/downloads/easy-fancybox-pro/)** alongside this free plugin.
|
71 |
+
|
72 |
+
|
73 |
+
= Contribute =
|
74 |
+
|
75 |
+
If you're happy with this plugin as it is, please consider writing a quick [rating](https://wordpress.org/support/plugin/easy-fancybox/reviews/#new-post) or helping other users out on the [support forum](https://wordpress.org/support/plugin/easy-fancybox).
|
76 |
+
|
77 |
+
If you wish to help build this plugin, you're very welcome to [translate Easy FancyBox into your language](https://translate.wordpress.org/projects/wp-plugins/easy-fancybox/) or contribute bug reports, feature suggestions and/or code on [Github](https://github.com/RavanH/easy-fancybox/).
|
78 |
+
|
79 |
+
**KNOWN ISSUES**
|
80 |
+
|
81 |
+
= General =
|
82 |
+
|
83 |
+
- **Outbound click or Download tracking** in some of the stats plugins can interfere with FancyBox. Disable such options or exclude links manually with a class if possible (see instructions for SlimStat below)
|
84 |
+
- Most plugins and themes that already include a light box script. Continue reading to see if you are using one of the know ones or follow the troubleshooting steps to find out what is conflicting on your site.
|
85 |
+
- Any theme that is missing the obligatory `<?php wp_footer(); ?>` call in the footer.php template.
|
86 |
+
- When showing an iframe as inline content in FancyBox -- not advised, use fancybox-iframe instead! -- the iframe will become blank after opening and closing it. The solution is to link directly to the iframe source and use `class="fancybox-iframe"` instead.
|
87 |
+
|
88 |
+
= Plugin conflicts =
|
89 |
+
|
90 |
+
- Google Translate plugins like **GTranslate**, **Weglot** and **Google Language Translator** cause the light box to be off-center, pushed downward for logged-in users (with admin bar). A work-around: add `.admin-bar #fancybox-outer{margin-top:-32px}` to Custom CSS in your theme Customizer.
|
91 |
+
- **WP Slimstat** and **Matomo/Piwik** with Track Outbound Clicks enabled, will break the light box effect on some browsers. Adding `fancybox` (or any of the other classes like `fancybox-youtube,fancybox-iframe,fancybox-inline` depending on which media should be displayed in FancyBox) to the Do Not Track field is reported to solve the issue. Slimstat also might interfere with the YouTube url conversion. When clicking a Youtube link, the movie opens in an overlay as it is supposed to but immediately after that, the complete page gets redirected to the original YouTube page. Adding a `class="noslimstat"` to the link is reported to work around the issue.
|
92 |
+
- **Google Analytics for WordPress** converts links like `href="#anyID"` to `href="http://yoursite.url/page/#anyID"`, disabling inline content shown in FancyBox.
|
93 |
+
- Both the **uBillBoard** and **Camera slideshow** have their own easing script hard-coded which conflicts with the one in Easy FancyBox. The only way around the conflict is to set both the Easing In and Easing Out options on your Settings > Media page to **Swing**.
|
94 |
+
- **Wordpress Firewall 2** blocks access to image files needed for proper display of the FancyBox overlay in older IE and other non-css3 browsers.
|
95 |
+
- **WordPress Amazon Associate**: A script provided by Amazon and the FancyBox script are incompatible. Disabling _Product Preview_ in the **WP - Amazon > Settings** page should work around the issue.
|
96 |
+
- **WP Supersized** uses the Animate Enhanced jQuery extension which causes a conflict with the Easing extension used by FancyBox resulting in a 0px sized lightbox frame and/or some kind of positioning issue with auto-centering.
|
97 |
+
|
98 |
+
= Theme conflicts =
|
99 |
+
|
100 |
+
- Older versions of **Elegant Themes** have FancyBox integrated in a hard-coded way, making them incompatible with Easy FancyBox. In the latest versions of these themes, there is an option to disable the included FancyBox. Use this option to make your theme compatible with Easy FancyBox :)
|
101 |
+
- The **Mystique** theme has two options called "Lightbox" and "Optimize website for faster loading" that will break Easy FancyBox. Disable both in Mystique's options > Advanced.
|
102 |
+
- **Imbalance** and other themes that uses the Photo Galleria jQuery extension: turn of the JSGallery option.
|
103 |
+
- Themes like **Envisioned**, **Chameleon** and many others have FancyBox baked in. There is no solution other than stripping the theme of all FancyBox related code or better: disable the plugin and use the theme provided version...
|
104 |
+
- Themes based on the **Thesis** framework might see issues in IE 8, for which [a hack has been proposed](https://voidzonemedia.com/solutions/thesis-ie8-remove-ie7-emulation/)
|
105 |
+
|
106 |
+
|
107 |
+
== Installation ==
|
108 |
+
|
109 |
+
= Wordpress =
|
110 |
+
|
111 |
+
Quick installation: [Install now](https://coveredwebservices.com/wp-plugin-install/?plugin=easy-fancybox) !
|
112 |
+
|
113 |
+
… OR …
|
114 |
+
|
115 |
+
Search for "easy fancybox" and install with that slick **Plugins > Add New** back-end page.
|
116 |
+
|
117 |
+
… OR …
|
118 |
+
|
119 |
+
Follow these steps:
|
120 |
+
|
121 |
+
1. Download archive.
|
122 |
+
|
123 |
+
2. Upload the zip file via the Plugins > Add New > Upload page … OR … unpack and upload with your favorite FTP client to the /plugins/ folder.
|
124 |
+
|
125 |
+
3. Activate the plugin on the Plug-ins page.
|
126 |
+
|
127 |
+
Done! By default, any images that are linked to directly (not to a WordPress page) from within your posts and pages, should now be opening in a FancyBox overlay :)
|
128 |
+
|
129 |
+
Not happy with the default settings? Check out the new options under **Settings > Media**.
|
130 |
+
|
131 |
+
= Wordpress MU / WordPress 3+ in Multi Site mode =
|
132 |
+
|
133 |
+
Same as above but do a **Network Activate** to activate FancyBox image overlays on each site on your network. No database tables are created or manipulated and no activation hook needs to be run for it to function with default settings.
|
134 |
+
|
135 |
+
|
136 |
+
== Frequently Asked Questions ==
|
137 |
+
|
138 |
+
= BASIC =
|
139 |
+
|
140 |
+
= What's FancyBox? =
|
141 |
+
|
142 |
+
Basically, it is a fancy way of presenting images, movies, portable documents and inline content on your website. For example, if you have scaled-down images in your posts which are linked to the original large version, instead of opening them on a blank page, FancyBox opens those in a smooth overlay. Visit [FancyBox](http://fancybox.net/) for more information and examples.
|
143 |
+
|
144 |
+
|
145 |
+
= Which version of FancyBox does this plugin use? =
|
146 |
+
|
147 |
+
This plugin uses an **updated version** of the original [FancyBox 1.3.4](http://fancybox.net), better adapted to the mobile era.
|
148 |
+
|
149 |
+
|
150 |
+
= I installed the plugin. What now? =
|
151 |
+
|
152 |
+
First, make sure that image thumbnails in your posts and pages are linked to their full size counterpart directly. Open any post with thumbnail images in it for editing and select the first thumbnail. Click the **Edit Image** button that appears and choose **Link To: Media File**. From now on, clicking that thumbnail should open the full size version in FancyBox.
|
153 |
+
|
154 |
+
The same thing goes for WordPress Galleries. Choose **Link To: Media File** when inserting a gallery tag.
|
155 |
+
|
156 |
+
|
157 |
+
= Where is the settings page? =
|
158 |
+
|
159 |
+
There is no new settings page but there are many options you can change. You will find a new **FancyBox** section on **Settings > Media**. To see the default, check out the example under [Screenshots](https://wordpress.org/plugins/easy-fancybox/screenshots/) ...
|
160 |
+
|
161 |
+
|
162 |
+
= Help! It does not work... =
|
163 |
+
|
164 |
+
Please follow the trouble shooting steps near the end of the plugin description above to determine the cause. If that fails, ask for support on the [Easy FancyBox WordPress forum](https://wordpress.org/support/plugin/easy-fancybox) or go to the [development site](https://status301.net/wordpress-plugins/easy-fancybox/)
|
165 |
+
|
166 |
+
|
167 |
+
= ADVANCED =
|
168 |
+
|
169 |
+
= Will a WordPress gallery be displayed in a FancyBox overlay? =
|
170 |
+
|
171 |
+
Yes, but _only_ if you used the option **Link To: Media File** when inserting the gallery! The gallery quicktag/shortcode should look something like `[ gallery link="file" ]`.
|
172 |
+
|
173 |
+
|
174 |
+
= The lightbox does not look good on mobile devices. What can I do about that? =
|
175 |
+
|
176 |
+
The original FancyBox 1.3.4 script was not developed with mobile devices in mind and although the version used in this plugin has some adaptations for mobile devices, it might still be less optimal for very small screens. The only way around this issue is currently to disable FancyBox for small screen sizes on **Settings > Media** in the section **Miscellaneous > Browser & device compatibility**.
|
177 |
+
|
178 |
+
|
179 |
+
= Can I make a slideshow from my gallery? =
|
180 |
+
|
181 |
+
In the [Pro extension](https://premium.status301.com/downloads/easy-fancybox-pro/), there is an Advanced option called "Gallery Auto-rotation" for that.
|
182 |
+
|
183 |
+
|
184 |
+
= Can I exclude images or other links from auto-attribution? =
|
185 |
+
|
186 |
+
Yes. All links with class **nolightbox** that would normally get auto-enabled, will be excluded from opening in a FancyBox overlay.
|
187 |
+
|
188 |
+
`<a href="url/to/fullimg.jpg" class="nolightbox"><img src="url/to/thumbnail.jpg" /></a>`
|
189 |
+
|
190 |
+
|
191 |
+
= Can NextGEN Gallery work with Easy FancyBox ? =
|
192 |
+
|
193 |
+
NetxGEN has its own built in FancyBox version along with a choice of other light box scripts but if you prefer to use Easy FancyBox (because of better customizability and other media support) then you need to take some steps to make the two plugins compatible.
|
194 |
+
|
195 |
+
1. Go to your Settings > Media admin page and switch OFF the FancyBox "Auto-gallery" option in the Images section;
|
196 |
+
1. Go to Gallery > Other Options and set the Lightbox Effects option to "Custom" and click on **Show Advanced Settings**;
|
197 |
+
1. fill the Code field with
|
198 |
+
`class="fancybox" rel="%GALLERY_NAME%"`
|
199 |
+
1. Leave the other fields empty and save your settings.
|
200 |
+
|
201 |
+
|
202 |
+
= Can I use ONE thumbnail to open a complete gallery ? =
|
203 |
+
|
204 |
+
It can be done manually (using the internal WordPress gallery feature, or not) _or_ in combination with NextGen Gallery.
|
205 |
+
|
206 |
+
**Manual**
|
207 |
+
|
208 |
+
**A.** Open your post for editing in HTML mode and insert the first image thumbnail in your post content (linking to the images file, not page) to serve as the gallery thumbnail.
|
209 |
+
|
210 |
+
**B.** Place the following code to start a hidden div containing all the other images that should only be visible in FancyBox:
|
211 |
+
`
|
212 |
+
<div class="fancybox-hidden">
|
213 |
+
`
|
214 |
+
|
215 |
+
**C.** Right after that starting on a new line, insert all other images you want to show in your gallery. You can even use the WordPress internal gallery feature with the shortcode `[ gallery link="file" ]`. NOTE: if the gallery thumbnail is attached to the post, it will be show a second time when flipping through the gallery in FancyBox. If you do not want that, use an image that is not attached to the post as gallery thumbnail.
|
216 |
+
|
217 |
+
**D.** Close the hidden div with the following code on a new line:
|
218 |
+
`
|
219 |
+
</div>
|
220 |
+
`
|
221 |
+
|
222 |
+
**With NextGEN Gallery**
|
223 |
+
|
224 |
+
You can choose between two shortcodes to show a gallery that (1) limits images per gallery using the shortcode `[nggallery id=x]` or (2) per tag name (accross galleries; you need to set tag name manually => more work but more control) using the shortcode `[nggtags gallery=YourTagName,AnotherTagName]`.
|
225 |
+
|
226 |
+
General steps:
|
227 |
+
|
228 |
+
**A.** Place the shortcode of your choice in your page/post content.
|
229 |
+
|
230 |
+
**B.** Configure NextGen on **Gallery > Gallery Settings** to Display galleries as "NextGEN Basic Thumbnails" and then under the NextGEN Basic Thumbnails to at least have the following options set like this:
|
231 |
+
|
232 |
+
1. Number of images per page: 1
|
233 |
+
1. Use imagebrowser effect: No
|
234 |
+
1. Add hidden images: Yes
|
235 |
+
|
236 |
+
**C.** Optional: add the following new CSS rule to your theme stylesheet (or install [Custom CSS](https://wordpress.org/plugins/safecss/) or [Jetpack](https://wordpress.org/plugins/jetpack/) and add it on the new Appearance > Edit CSS admin page) to hide the page browsing links below the gallery thumbnail.
|
237 |
+
`
|
238 |
+
.ngg-navigation {
|
239 |
+
display:none;
|
240 |
+
}
|
241 |
+
`
|
242 |
+
|
243 |
+
= Can I play YouTube, Dailymotion and Vimeo movies in a FancyBox overlay? =
|
244 |
+
|
245 |
+
Yes. Simply create a link using the Share URL (the full Page URL, the Short URL with or without options like HD etc.) to the YouTube/Vimeo/Dailymotion page in your post content. If you have Auto-detect enabled, the plugin will take care of the rest for you! :)
|
246 |
+
|
247 |
+
If you have disabled Auto-detection, give the link a class attribute like `class="fancybox-youtube"` for Youtube, `class="fancybox-vimeo"` for Vimeo and `class="fancybox-dailymotion"` for Dailymotion, to manually enable FancyBox for it.
|
248 |
+
|
249 |
+
Both YouTube and Vimeo movies can be made to play immediately after opening by adding the paramer `autoplay=1` to the URL. For example, a short-url YouTube link that should play in HD mode, have the full screen button and auto-start on open, would look like:
|
250 |
+
`
|
251 |
+
<a href="https://youtu.be/N_tONWXYviM?hd=1&fs=1&autoplay=1">text or thumbnail</a>
|
252 |
+
`
|
253 |
+
|
254 |
+
|
255 |
+
= I want that 'Show in full-screen' button on my YouTube movies =
|
256 |
+
|
257 |
+
Append `&fs=1` to your YouTube share URL.
|
258 |
+
|
259 |
+
|
260 |
+
= Can I show a Youtube playlist in FancyBox? =
|
261 |
+
|
262 |
+
Yes, just go to Youtube page of any movie that's in the playlist and use the Share button to get the share URL just like with single movies, but this time place a checkmark at the 'Share with playlist' option.
|
263 |
+
|
264 |
+
|
265 |
+
= Can I link a NextGEN thumbnail to a Youtube movie in FancyBox? =
|
266 |
+
|
267 |
+
User Mark Szoldan shared a neat trick how to do this:
|
268 |
+
|
269 |
+
1. Follow the instructions to make Easy FancyBox work smoothly with NextGEN above and make sure it all works correctly for normal thumbnails linked to their full-size version.
|
270 |
+
1. Then give the image that you want to link to a Youtube movie the URL to the Youtube page as title.
|
271 |
+
1. Finally paste the code below into a Custom HTML widget that will live in your sidebar or footer bar, or you can hard-code it into your theme but make sure it come before the `wp_footer()` call...
|
272 |
+
|
273 |
+
`
|
274 |
+
<script type="text/javascript">
|
275 |
+
jQuery('.fancybox [title*="www.youtube.com"]').each(function() {
|
276 |
+
var title = jQuery(this).attr('title');
|
277 |
+
var desc = jQuery(this).parent().attr('title');
|
278 |
+
jQuery(this).attr('title', desc);
|
279 |
+
jQuery(this).parent().attr('href', title);
|
280 |
+
});
|
281 |
+
</script>
|
282 |
+
`
|
283 |
+
|
284 |
+
This script snippet will scan the image titles and if it finds a Youtube URL there, it will replace the links href attribute value accordingly.
|
285 |
+
|
286 |
+
|
287 |
+
= Can I create a gallery of Youtube thumbnails which open in FancyBox? =
|
288 |
+
|
289 |
+
You could do this manually by uploading individual thumbnails that you can retrieve by using the unique movie ID in these URLs for three different sizes:
|
290 |
+
`
|
291 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/default.jpg
|
292 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/mqdefault.jpg
|
293 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/hqdefault.jpg
|
294 |
+
`
|
295 |
+
Other locations might be
|
296 |
+
`
|
297 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/0.jpg (same as hqdefault.jpg)
|
298 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/1.jpg
|
299 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/2.jpg
|
300 |
+
https://img.youtube.com/vi/UNIQUE-MOVIE-ID/3.jpg
|
301 |
+
https://img.youtube.com/vi_webp/UNIQUE-MOVIE-ID/0.webp (same as hqdefault.webp)
|
302 |
+
etc...
|
303 |
+
|
304 |
+
`
|
305 |
+
|
306 |
+
But an easier method is this one, shared by Shashank Shekhar (thanks!) :
|
307 |
+
|
308 |
+
To create Youtube thumbnail galleries, install https://wordpress.org/plugins/youtube-simplegallery/ and set the 'Effect' option to fancybox. Then disable Youtube autodetection on Settings > Media.
|
309 |
+
|
310 |
+
|
311 |
+
= Can I display web pages or HTML files in a FancyBox overlay? =
|
312 |
+
|
313 |
+
Yes. First, enable the iFrame option on Settings > Media. Then, in your post or page content create a link to any web page or .htm(l) file in your content. Then switch to the Text tab in the Classic Editor or to Edit as HTML (under More options in the block menu) in Gutenberg, find the link `<a ... >` tag and give it a `class="fancybox-iframe"` attribute.
|
314 |
+
|
315 |
+
Note: Not all external web pages are allowed to be embedded in an iframe and may be blocked by a server response header or script. The result will be either an empty/blank light box or the target page "breaking out" of the light box and loading in the main browser tab.
|
316 |
+
|
317 |
+
|
318 |
+
= Can I show PDF files in a FancyBox overlay? =
|
319 |
+
|
320 |
+
Yes. Just place a link _with the URL ending in .pdf_ to your Portable Document file in the page content.
|
321 |
+
|
322 |
+
If you don't have *Auto-detect* checked under **PDF** on Settings > Media admin page, you will need to add `class="fancybox-pdf"` (to force pdf content recognition) to the link to enable FancyBox for it.
|
323 |
+
|
324 |
+
|
325 |
+
= How do I show content with different sizes? =
|
326 |
+
|
327 |
+
FancyBox tries to detect the size of the content automatically but if it can not find a size, it will default to the settings for that particular content type as set on the Settings > Media page.
|
328 |
+
|
329 |
+
The **[Pro extension](https://premium.status301.com/downloads/easy-fancybox-pro/)** provides an extra option to allow you to manually override this by defining the width and height wrapped in curly braces in the class attribute of the link itself. Make sure the option "Include the Metadata jQuery extension script..." under FancyBox | Miscellaneous | Advanced on Settings > Media is enabled.
|
330 |
+
|
331 |
+
For example, an SVG file with different size:
|
332 |
+
|
333 |
+
`
|
334 |
+
<a class="fancybox-svg {width:1024,height:675}" href="_your_svg_"></a>
|
335 |
+
`
|
336 |
+
|
337 |
+
= How can I display INLINE content in a FancyBox overlay ? =
|
338 |
+
|
339 |
+
First go to your **Settings > Media** admin page and activate the **Inline** option under the FancyBox settings. After saving, the amin page will show a new section called Inline where you can tweak its parameters.
|
340 |
+
|
341 |
+
Next, open your page/post for editing in the HTML tab and wrap the inline content in
|
342 |
+
`
|
343 |
+
<div style="display:none" class="fancybox-hidden"><div id="fancyboxID-1" class="hentry" style="width:460px;max-width:100%;">
|
344 |
+
...inline content here...
|
345 |
+
</div></div>
|
346 |
+
`
|
347 |
+
|
348 |
+
Then place a FancyBox link tag with class attribute "fancybox-inline" anywhere else in the post/page content that will point to the inline content like
|
349 |
+
`
|
350 |
+
<a href="#fancyboxID-1" class="fancybox-inline">Read my inline content</a>
|
351 |
+
`
|
352 |
+
|
353 |
+
NOTE: The wrapping divs ID *must* be unique and it must correspond with the links HREF with a # in front of it. When using the above example for more FancyBox inline content (hidden div + opening link) combinations on one page, give the second one the ID fancyboxID-2 and so on...
|
354 |
+
|
355 |
+
NOTE 2: If you find that the inline content shown in FancyBox is styled very different than the rests of the page content, then you might want to change the div tag attribute `class="hentry"` to something else that matches your theme. Find out what class name is used for the main content on your site and re-use that.
|
356 |
+
|
357 |
+
|
358 |
+
= Can I display a contact form in FancyBox? =
|
359 |
+
|
360 |
+
Yes. There are several methods imaginable but the easiest would be to use the Inline method. First go to your Settings > Media admin page and enable the Inline Content option. Next, go back to edit your post or page in the Text editor tab. The inline content can be a shortcode like in this example using Contact Forms 7 and Easy FancyBox:
|
361 |
+
|
362 |
+
`
|
363 |
+
<a href="#contact_form_pop" class="fancybox-inline">Contact Us</a>
|
364 |
+
|
365 |
+
<div style="display:none" class="fancybox-hidden">
|
366 |
+
<div id="contact_form_pop" class="hentry" style="width:460px;max-width:100%;">
|
367 |
+
[contact-form-7 id="87" title="Contact form 1"]
|
368 |
+
</div>
|
369 |
+
</div>
|
370 |
+
`
|
371 |
+
Where you replace the shortcode (between the [ and ] characters) with the one given by the plugin. It can also work with shortcode by other plugins like Jetpack's Contact Form module. Change the class attribute to reflect the class used for the div that wraps your post content to have any form CSS style rules that are limited to post content, be applied to the inline content inside FancyBox.
|
372 |
+
|
373 |
+
|
374 |
+
= Can I make an image or hidden content to pop up in FancyBox on page load? =
|
375 |
+
|
376 |
+
Yes. A link that has the ID **fancybox-auto** (Note: there can be only ONE link like that on a page!) will be triggered automatically on page load.
|
377 |
+
|
378 |
+
Use the instructions above for inline content but this time give the link also `id="fancybox-auto"` (leave the class too) and remove the anchor text to hide it. Now the hidden div content will pop up automatically when a visitor opens the page.
|
379 |
+
|
380 |
+
Same can be done with any other media or iframe link! But please remember there can be only **one** item using the ID fancybox-auto per page...
|
381 |
+
|
382 |
+
|
383 |
+
= Can I have a modal window ? =
|
384 |
+
|
385 |
+
Yes, just create a hidden inline content light box (can be auto-popup) as described above and give the link an extra class "modal". This will remove all options to close the light box, like the close button, an overlay click or escape key.
|
386 |
+
|
387 |
+
This means there is NO option to close the light box, unless you create a link like this inside the hidden inline content div:
|
388 |
+
|
389 |
+
`
|
390 |
+
<a href="" class="fancybox-close">Accept</a>
|
391 |
+
`
|
392 |
+
|
393 |
+
|
394 |
+
= Can I make a menu item open in a FancyBox overlay ? =
|
395 |
+
|
396 |
+
Yes. But it depends on you theme what you need to do to make it work. If you are on WordPress 3+ and your theme supports the new internal Custom Menu feature or if you are using a custom menu in a sidebar widget, it's easy:
|
397 |
+
|
398 |
+
1. Go to Settings > Media and enable FancyBox iFrame support.
|
399 |
+
2. Go to Appearance > Menus and open the little tab "Screen Options" in the top-right corner.
|
400 |
+
3. Enable the option "CSS Classes" under Advanced menu properties.
|
401 |
+
4. Now give the menu item you want to open in a FancyBox iframe the class `fancybox-iframe`.
|
402 |
+
|
403 |
+
If you are on an older version of WordPress or if you cannot use WP's Menus, you will need to do some heavy theme hacking to get it to work. Basically, what you need to achieve is that the menu item you want opened in a lightbox overlay, should get a `class="fancybox-iframe"` attribute.
|
404 |
+
|
405 |
+
|
406 |
+
= How can I make AJAX loaded content be seen by FancyBox ? =
|
407 |
+
|
408 |
+
Easy FancyBox initially scans the page source for media links on the "Document Loaded" event. This means right after the page source has become available to and read by the browser. When content is added or modified through AJAX (meaning after initial page load) by your theme or another plugin, then FancyBox will not be aware of any media links in that new content.
|
409 |
+
|
410 |
+
To make Easy FancyBox rescan the updated page source after content has been modified though AJAX, there is an event listener available. This event is also triggered by the Jetpack Infinite Scroll module. To use this event, you'll need to modify the theme or other plugin script that handles the AJAX calls.
|
411 |
+
|
412 |
+
You can trigger the event like this:
|
413 |
+
`
|
414 |
+
jQuery(document.body).trigger('post-load');
|
415 |
+
`
|
416 |
+
|
417 |
+
Note: It completely depends on the AJAX script where this code snippet should be placed. Optimally, right _after_ the DOM modification where content is added or modified. In most cases at the end of the AJAX Success handler.
|
418 |
+
|
419 |
+
|
420 |
+
= Is Easy FancyBox multi-site compatible? =
|
421 |
+
|
422 |
+
Yes. Designed to work with **Network Activate** and does not require manual activation on each site in your network.
|
423 |
+
|
424 |
+
|
425 |
+
= TROUBLE SHOOTING =
|
426 |
+
|
427 |
+
If, after activation, your images do not open in a FancyBox overlay, there are several possible reasons. Some are easily solved, others are more difficult. Follow these basic checks to make sure everything is in place:
|
428 |
+
|
429 |
+
= Basic checks =
|
430 |
+
|
431 |
+
1. Make sure that thumbnail images are linked *directly* to their larger counterpart, not to a dynamic WordPress page that includes the larger image. This means when you insert an image in your posts or pages, you need to select **Media File** at the Link option instead of Page URL. You'll have to manually edit your old posts if you have always inserted images with `Page URL` before, FancyBox cannot do this for you.
|
432 |
+
1. Make sure you have all the needed media and their *Auto-detect* options activated on your **Settings > Media** admin page. If you are using images in other formats that JPG, GIF or PNG, you need to add the extensions to the Auto-detect field for Images. Please note: The image file names must actaully _end_ with that extension! This means that if you have an image file that (for example) has _no_ extension (does not end with .jpg or any other) even if is in JPEG compressed format, the FancyBox will not be able to detect is as an image. You will need to manually give those links the class `fancybox image` to trigger FancyBox.
|
433 |
+
|
434 |
+
= General trouble shooting steps =
|
435 |
+
|
436 |
+
1. Switch off all other plugins and switch your sites appearance to the default Twenty Seventeen theme. FancyBox should work now. If so, continue with the next step. If not, re-install the plugin and verify the basic steps above.
|
437 |
+
1. Switch back to your original theme and check if FancyBox is still working. If so, continue with the next step. If not, See the Theme Incompatibility checks below.
|
438 |
+
1. One by one, switch each plugin that you had running before back ON. Keep checking to see at which point FancyBox starts failing and you will hve found the conflicting plugin.
|
439 |
+
|
440 |
+
= Theme Incompatibility checks =
|
441 |
+
|
442 |
+
1. See known theme conflicts above first, then continue with these following steps.
|
443 |
+
1. Make sure your theme is capable of placing the needed javascript and css in the page header and footer. Open any page on your site and view the source code by right-clicking on an empty section and selecting 'View source...' (or similar). There you will need to check of there are any references to javascript files like `jquery.fancybox.min.js?ver=x.x.x` near the closing `</body>` tag. There should also be a `easy-fancybox.min.css?ver=x.x.x` in the head section... If it's not there, your theme is really out of date. Consider switching to a new theme fast!
|
444 |
+
1. Make sure that your theme does not load the main jQuery library file more than once. Look for references to javascript files like `jquery.js?ver=x.x.x` or `jquery.min.js` in the page source code. If you find more than one, try to find out in which theme template file that second reference is hard-coded and remove that line. Usually in header.php or footer.php
|
445 |
+
1. Check if your theme loads another or the same lightbox script. Look for references to Thickbox, Prettyphoto, Lightbox2, Colorbox or FancyBox script files or code. These are very likely to cause the incompatibility and you will either have to remove these by hacking your theme or switch to another theme.
|
446 |
+
|
447 |
+
If you still do not get to see your images in FancyBox, ask on the [Easy FancyBox WordPress forum](https://wordpress.org/tags/easy-fancybox) or go to the [development site](https://status301.net/wordpress-plugins/easy-fancybox/)
|
448 |
+
|
449 |
+
= Plugin Incompatibility checks =
|
450 |
+
|
451 |
+
1. If you followed the general trouble shooting steps above, you should now be aware of which plugin is conflicting whith Easy FancyBox. See known plugin conflicts above first. If the plugin and its solution are not mentioned there, continue with the following steps.
|
452 |
+
1. Make sure that the plugins do not make the main jQuery library file load more than once. Look for references to javascript files like `jquery.js?ver=x.x.x` or `jquery.min.js` in the page source code. If you find more than one, try to find out where that comes from.
|
453 |
+
1. Check if your theme loads another or the same lightbox script or any other of the needed jQuery extensions like jquery.easing or jquery.mousewheel. Look for references to Thickbox, Prettyphoto, Lightbox2, Colorbox or FancyBox script files or code. These are very likely to cause the incompatibility and you will have to either find a setting in the other plugin to switch OFF the use of the conflicting script (possible in NextGEN for example, see under Advanced below) or choose between the two conflicting plugins.
|
454 |
+
|
455 |
+
|
456 |
+
== Screenshots ==
|
457 |
+
|
458 |
+
1. Example image with **Overlay** caption. This is the default way Easy FancyBox displays images. Other options are **Inside** and the old **Outside**.
|
459 |
+
|
460 |
+
2. Example of a YouTube movie in overlay.
|
461 |
+
|
462 |
+
|
463 |
+
== Upgrade Notice ==
|
464 |
+
|
465 |
+
= 1.9 =
|
466 |
+
|
467 |
+
Swipe support, fixed background and accessibility improvements.
|
468 |
+
|
469 |
+
== Changelog ==
|
470 |
+
|
471 |
+
= 1.9 =
|
472 |
+
* NEW: Swipe support
|
473 |
+
* NEW: Optional fancyBox 2 or Legacy scripts
|
474 |
+
* Fixed background
|
475 |
+
* Dropped IE6-8 support
|
476 |
+
* Dropped SWF support (only availbale in Legacy)
|
477 |
+
* Accessibility improvements
|
478 |
+
|
479 |
+
= 1.8.19 =
|
480 |
+
* Admin settings links
|
481 |
+
* Pro compatibility message for VideoPress
|
482 |
+
* NEW: Exclude selector option
|
483 |
+
* FIX: border 0 ignored sometimes
|
484 |
+
|
485 |
+
= 1.8.18 =
|
486 |
+
* FIX: Jetpack Tiled Gallery block compatibility
|
487 |
+
* Don't include mousewheel script by default
|
488 |
+
* SECURITY: fixed failing color value sanitization + added inline styles output filter, issue reported by Jakob Hagl sba-research.org
|
489 |
+
|
490 |
+
= 1.8.17 =
|
491 |
+
* Pro compatibility messages
|
492 |
+
* Support forum link
|
493 |
+
|
494 |
+
= 1.8.16 =
|
495 |
+
* FIX: Trying to get property 'ID' of non-object
|
496 |
+
* mark WordPress 5.2 compatible
|
497 |
+
|
498 |
+
= 1.8.15 =
|
499 |
+
* FIX: inline wrapper nesting issue
|
500 |
+
* Revert to file names without version
|
501 |
+
|
502 |
+
= 1.8.13 =
|
503 |
+
* FIX: version constant issue
|
504 |
+
* Prepare Visual Composer Masonry Grid Gallery compatibility option
|
505 |
+
|
506 |
+
= 1.8.11 =
|
507 |
+
* FIX: Vimeo player direct links breaking
|
508 |
+
|
509 |
+
= 1.8.10 =
|
510 |
+
* Force default autoselector for galleries
|
511 |
+
|
512 |
+
= 1.8.9 =
|
513 |
+
* Prevent gallery next/prev links to show dud target
|
514 |
+
* FIX: allow youtube url parameters before v=
|
515 |
+
|
516 |
+
= 1.8.7 =
|
517 |
+
* Autoplay Youtube/Vimeo/Dailymotion
|
518 |
+
* FIX: Exclude Vimeo user pages from autodetect
|
519 |
+
* FIX: Exclude facebook/twitter share link
|
520 |
+
* FIX: PDF embed tag
|
521 |
+
|
522 |
+
= 1.8.6 =
|
523 |
+
* Gutenberg file block download button compatibility
|
524 |
+
* Gutenberg gallery block compatibility
|
525 |
+
* FIX: Missing argument in easyFancyBox::add_video_wmode_opaque()
|
526 |
+
* Remove version URL parameters
|
527 |
+
* FIX: jQuery 3+ e.indexOf is not a function
|
528 |
+
|
529 |
+
= 1.8.5 =
|
530 |
+
* FIX: prevent Inline content title
|
531 |
+
|
532 |
+
= 1.8.4 =
|
533 |
+
* Improved center on scroll behavior with title outside
|
534 |
+
* FIX: Pro options compatibility
|
535 |
+
|
536 |
+
= 1.8.3 =
|
537 |
+
* FIX: AutoScale option restored
|
538 |
+
* FIX: outline issue in Firefox
|
539 |
+
* Prevent SiteGround Optimizer warning about break outside loop
|
540 |
+
|
541 |
+
= 1.8.2 =
|
542 |
+
* FIX: main method not returning true in some cases
|
543 |
+
* Force all hosted video to https
|
544 |
+
* FIX: video iframe needs allow="autoplay" on modern browsers
|
545 |
+
* FIX: default enqueue priority not 10
|
546 |
+
* FIX: possible infinite loop in prev/next and image preloader
|
547 |
+
* Move main method (back) to init, position 9
|
548 |
+
* Introducing easy_fancybox_enqueue_scripts action hook
|
549 |
+
|
550 |
+
= 1.8 =
|
551 |
+
* NEW: Google Docs Viewer for PDF
|
552 |
+
* NEW: Youtube privacy-enhanced embed
|
553 |
+
* NEW: Compatibility options: late script inclusion, jquery exclusion, no wp_add_inline_script
|
554 |
+
* FancyBox: Improved mobile viewport height detection
|
555 |
+
* FancyBox: now skips subsequent double links in gallery
|
556 |
+
* FancyBox: new PDF content type
|
557 |
+
* FancyBox: improved error messages
|
558 |
+
* Dedicated IE8 stylesheet
|
559 |
+
* jQuery Easing update to 1.4.1
|
560 |
+
|
561 |
+
= 1.7 =
|
562 |
+
* NEW: Aspect ratio for video frames on smaller screens
|
563 |
+
* NEW: Global minimum screen size
|
564 |
+
* NEW: Loading icon for video/iframe content
|
565 |
+
* NEW: Resize light box on device orientation or browser window size change
|
566 |
+
* NEW: Modal window class and close button class
|
567 |
+
* FIX: pre PHP 5.4 compatibility
|
568 |
+
* FIX: iPhone iframe scrolling
|
569 |
+
* FIX: Autoptimize compatibility
|
570 |
+
* Switch to wp_add_inline_script() script printing, thanks @szepeviktor
|
571 |
+
|
572 |
+
= 1.6.3 =
|
573 |
+
* FIX: inline js minification incompatibility, thanks @alexiswilke
|
574 |
+
|
575 |
+
= 1.6.2 =
|
576 |
+
* FIX: line breaks hidden on options media admin page since WP 4.9, thanks @garrett-eclipse
|
577 |
+
|
578 |
+
= 1.6.1 =
|
579 |
+
* Nolightbox class in menu also for other media types than images
|
580 |
+
* FIX: CSS color code
|
581 |
+
* Spelling fixes, thanks @garrett-eclipse
|
582 |
+
* FIX: Pinterest button compatibility
|
583 |
+
* FIX: Double load plugin text domain
|
584 |
+
|
585 |
+
= 1.6 =
|
586 |
+
* Add webp to default Autodetect image types
|
587 |
+
* Exclude more rel attribute values from galleries
|
588 |
+
* BUGFIX: gallery preload
|
589 |
+
* Update jquery.easing.js and jquery.mousewheel.js
|
590 |
+
|
591 |
+
= 1.5.8.2 =
|
592 |
+
* BUGFIX: use dirname(__FILE__) instead of relying on __DIR__ to be available
|
593 |
+
* Explicit transparency for gallery navigation links
|
594 |
+
|
595 |
+
= 1.5.8 =
|
596 |
+
* FIX: variable variable php 7 compat
|
597 |
+
* FIX: obj undefined in minified js
|
598 |
+
* FIX: nofancybox in menu ignored, thanks Trishah
|
599 |
+
* Color value sanitize
|
600 |
+
* NEW: auto popup delay
|
601 |
+
* NEW: pro extension version compatibility check routine
|
602 |
+
* NEW: margin option
|
603 |
+
* NEW: iFrame alow full screen option
|
604 |
+
* Dropped mu-plugins support
|
605 |
+
* Added support for universal nolightbox class
|
606 |
+
* Set focus on iframe after load
|
607 |
+
* FIX: No center on scroll on touch devices
|
608 |
+
* FIX: Allow fullscreen videos
|
609 |
+
|
610 |
+
= 1.5.7 =
|
611 |
+
* FIX: Pro extension link update
|
612 |
+
* NEW: WebP support and class='image' to force image media type
|
613 |
+
* IE 6-8 css rules optional
|
614 |
+
* iframe embed for Youtube, Vimeo and Dailymotion
|
615 |
+
* Croation translation
|
616 |
+
* HTML5 players allowfullscreen default
|
617 |
+
|
618 |
+
= 1.5.6 =
|
619 |
+
* iPad positioning patch
|
620 |
+
* Don't unregister scripts that are not ours even for conflict prevention
|
621 |
+
* box-sizing: border-box issue in Firefox fixed
|
622 |
+
* Allow mousewheel scrolling page in the background again
|
623 |
+
|
624 |
+
= 1.5.5 =
|
625 |
+
* Prevent mousewheel scrolling page in the background
|
626 |
+
* New stylesheet IE alphaimageloader path fix approach
|
627 |
+
* Czech translation added
|
628 |
+
* Updated Indonesian translation
|
629 |
+
|
630 |
+
= 1.5.2 =
|
631 |
+
* BUGFIX: easy_fancybox_handler() in combo with trigger('click') causes Uncaught Exception script error
|
632 |
+
|
633 |
+
= 1.5.1 =
|
634 |
+
* FIX: jQuery 1.9+ compatibility
|
635 |
+
* Dropping support for gForms again -- "Cannot convert 'c' to object" error in combination with some older gForms version :(
|
636 |
+
* NEW: support for Infinite Scroll by Jetpack
|
637 |
+
|
638 |
+
= 1.5.0 =
|
639 |
+
* FIX: CSS3 box-sizing issue (Twenty Thirteen) misplacing close button
|
640 |
+
* NEW: Added SVG support. Thanks to Simon Maillard.
|
641 |
+
* Pre WP 3.6: jQuery 1.9+ compatibility
|
642 |
+
* JQuery Mousewheel extension update to 3.1.3
|
643 |
+
* NEW: Elegant Themes compatibility
|
644 |
+
* Some small Touch device compatibility improvement hacks to the 1.3.4 script
|
645 |
+
* Major plugin overhaul: Class implementation
|
646 |
+
* NEW: Disable hide on overlay click
|
647 |
+
* NEW: Allow automatic resizing to large image size set on Settings > Media during media upload via the hidden WordPress function media_upload_max_image_resize()
|
648 |
+
* NEW Options: iFrame scrolling, autoScale, key navigation/close, cyclic galleries
|
649 |
+
* Metadata custom parameters and Mousewheel gallery scrolling scripts optional
|
650 |
+
* Basic RTL languages/text direction support (gallery navigation inversion, title position)
|
651 |
+
* BUGFIX: https in stylesheet on Windows IIS
|
652 |
+
* Improved W3TC compatibility: query string issue
|
653 |
+
* Gravity Forms in ajax mode compatibility
|
654 |
+
* Use jQuery's bind('ready') for better ajax content compatibility
|
655 |
+
* Dynamic stylesheet response headers to allow browser caching
|
656 |
+
* Minified version of jquery.metadata.js
|
657 |
+
* Auto-detect on image map areas
|
658 |
+
* nolightbox class for menu items
|
659 |
+
* SECURITY: Settings sanitization
|
660 |
+
* BUGFIX: load_textdomain firing after the main settings array is loaded, leaving text strings in it untranslated.
|
661 |
+
* BUGFIX: missing signs in Youtube url regular expression
|
662 |
+
* BUGFIX: unquoted rel attribute selectors in jquery.fancybox-1.3.4.js
|
663 |
+
* BUGFIX: broken url path in IE stylesheet when missing $_SERVER['SERVER_NAME']
|
664 |
+
* BUGFIX: easing extension not needed on linear easing
|
665 |
+
|
666 |
+
= 1.3.4.9 =
|
667 |
+
* NEW: Lithuanian translation
|
668 |
+
* NEW: Hindi translation
|
669 |
+
* NEW: Indonesian translation
|
670 |
+
* NEW: Romanian translation
|
671 |
+
* NEW: Polish translation
|
672 |
+
* NEW: Spanish translation
|
673 |
+
* NEW: jQuery Metadata support
|
674 |
+
* NEW: Image map AREA support for all content types
|
675 |
+
* NEW: new iFrame/HTML5 embed code for YouTube, Vimeo and Dailymotion
|
676 |
+
* NEW: fix WordPress Dailymotion auto-embed code missing wmode
|
677 |
+
* Some changes to default settings
|
678 |
+
* Updated Dutch translation
|
679 |
+
* BUGFIX: Opening speed
|
680 |
+
|
681 |
+
= 1.3.4.8 =
|
682 |
+
* NEW: Advanced option: Gallery auto-rotation
|
683 |
+
* NEW: Spotlight effect
|
684 |
+
* Improved auto-enable and auto-gallery settings
|
685 |
+
* BIGFIX: CSS IE6 hack
|
686 |
+
* BIGFIX: PDF object in IE7
|
687 |
+
|
688 |
+
= 1.3.4.6 =
|
689 |
+
* PDF embed compatibility improvement
|
690 |
+
* NEW: Show/hide title on mouse hover action
|
691 |
+
* NEW: Auto-gallery modes (Disabled, page/post images only, all)
|
692 |
+
* NEW: Dailymotion support
|
693 |
+
* Links with id **fancybox-auto** will be triggered on page load
|
694 |
+
* Anything with class **fancybox-hidden"** will be hidden
|
695 |
+
* Support for menu items in iframe
|
696 |
+
* Added class **nofancybox** for exclusion when auto-enabling
|
697 |
+
|
698 |
+
= 1.3.4.5 =
|
699 |
+
* FancyBox script version 1.3.4 (2010/11/11 - http://fancybox.net/changelog/)
|
700 |
+
* NEW: Support for PDF
|
701 |
+
* NEW: Easing options
|
702 |
+
* YouTube, Vimeo and iFrame options adjustable
|
703 |
+
* lots and lots of more options!
|
704 |
+
* BIGFIX: work-around for missing wmode in WordPress (auto-)embedded movies (credits: Crantea Mihaita)
|
705 |
+
|
706 |
+
= 1.3.3.4.2 =
|
707 |
+
* BIGFIX: iframe width
|
708 |
+
* BIGFIX: image overlay size in Google Chrome browser issue (FancyBox 1.3.3)
|
709 |
+
* BIGFIX: fancybox-swf
|
710 |
+
|
711 |
+
= 1.3.3.4 =
|
712 |
+
* FancyBox script version 1.3.3 (2010/11/4 - http://fancybox.net/changelog/)
|
713 |
+
* Vimeo support
|
714 |
+
* YouTube Short URL support (disabled by default)
|
715 |
+
* Auto-recognition and seperate class `fancybox-youtube` for YouTube
|
716 |
+
* Auto-recognition and seperate class `fancybox-vimeo` for Vimeo
|
717 |
+
|
718 |
+
= 1.3.2 =
|
719 |
+
* FancyBox script version 1.3.2 (2010/10/10 - http://fancybox.net/changelog/)
|
720 |
+
|
721 |
+
= 1.3.1.3 =
|
722 |
+
* translation .pot file available
|
723 |
+
* Dutch translation
|
724 |
+
* NEW: YouTube and Flash movie support
|
725 |
+
* NEW: Iframe support
|
726 |
+
* added option Auto-enable for...
|
727 |
+
|
728 |
+
= 1.3.1.2 =
|
729 |
+
* added option titlePosition : over / inside / outside
|
730 |
+
* added option transitionIn : elastic / fade / none
|
731 |
+
* added option transitionOut : elastic / fade / none
|
732 |
+
|
733 |
+
= 1.3.1.1 =
|
734 |
+
* small jQuery speed improvement by chaining object calls
|
735 |
+
|
736 |
+
= 1.3.1 =
|
737 |
+
* Using FancyBox version 1.3.1
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
uninstall.php
ADDED
@@ -0,0 +1,222 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* EASY_FANCYBOX_MS_UNINSTALL
|
4 |
+
*
|
5 |
+
* Set this constant in wp-config.php if you want to allow looping over each site
|
6 |
+
* in the network to run XMLSitemapFeed_Uninstall->uninstall() defined in uninstall.php
|
7 |
+
*
|
8 |
+
* There is NO batch-processing so it does not scale on large networks.
|
9 |
+
* The constant is ignored on networks over 10k sites.
|
10 |
+
*
|
11 |
+
* example:
|
12 |
+
* define( 'EASY_FANCYBOX_MS_UNINSTALL', true);
|
13 |
+
*/
|
14 |
+
|
15 |
+
// Exit if uninstall not called from WordPress.
|
16 |
+
defined( 'WP_UNINSTALL_PLUGIN' ) || exit();
|
17 |
+
|
18 |
+
/*
|
19 |
+
* Easy FancyBox uninstallation.
|
20 |
+
*
|
21 |
+
* @since 1.9
|
22 |
+
*/
|
23 |
+
class easyFancyBox_Uninstall {
|
24 |
+
|
25 |
+
/*
|
26 |
+
* constructor: manages uninstall for multisite
|
27 |
+
*
|
28 |
+
* @since 1.9
|
29 |
+
*/
|
30 |
+
function __construct()
|
31 |
+
{
|
32 |
+
global $wpdb;
|
33 |
+
|
34 |
+
// Check if it is a multisite and if EASY_FANCYBOX_MS_UNINSTALL constant is defined and
|
35 |
+
// if so, run the uninstall function for each blog id.
|
36 |
+
if ( is_multisite() && defined( 'EASY_FANCYBOX_MS_UNINSTALL' ) && EASY_FANCYBOX_MS_UNINSTALL && ! wp_is_large_network() ) {
|
37 |
+
error_log( 'Clearing Easy FancyBox settings from each site before uninstall:' );
|
38 |
+
$field = 'blog_id';
|
39 |
+
$table = $wpdb->prefix.'blogs';
|
40 |
+
foreach ( $wpdb->get_col("SELECT {$field} FROM {$table}") as $blog_id ) {
|
41 |
+
switch_to_blog($blog_id);
|
42 |
+
$this->uninstall($blog_id);
|
43 |
+
}
|
44 |
+
restore_current_blog();
|
45 |
+
} else {
|
46 |
+
$this->uninstall();
|
47 |
+
}
|
48 |
+
}
|
49 |
+
|
50 |
+
/**
|
51 |
+
* Remove plugin settings.
|
52 |
+
*
|
53 |
+
* @since 1.9
|
54 |
+
*/
|
55 |
+
function uninstall( $blog_id = false )
|
56 |
+
{
|
57 |
+
delete_option( 'easy_fancybox_version' );
|
58 |
+
|
59 |
+
// General settings.
|
60 |
+
delete_option( 'fancybox_scriptVersion' );
|
61 |
+
delete_option( 'fancybox_enableImg' );
|
62 |
+
delete_option( 'fancybox_enableInline' );
|
63 |
+
delete_option( 'fancybox_enablePDF' );
|
64 |
+
delete_option( 'fancybox_enableSWF' );
|
65 |
+
delete_option( 'fancybox_enableSVG' );
|
66 |
+
delete_option( 'fancybox_enableYoutube' );
|
67 |
+
delete_option( 'fancybox_enableVimeo' );
|
68 |
+
delete_option( 'fancybox_enableDailymotion' );
|
69 |
+
delete_option( 'fancybox_enableiFrame' );
|
70 |
+
|
71 |
+
// Overlay settings.
|
72 |
+
delete_option( 'fancybox_overlayShow' );
|
73 |
+
delete_option( 'fancybox_hideOnOverlayClick' );
|
74 |
+
delete_option( 'fancybox_overlayColor' );
|
75 |
+
delete_option( 'fancybox_overlaySpotlight' );
|
76 |
+
delete_option( 'fancybox_overlayOpacity' );
|
77 |
+
|
78 |
+
// Window settings.
|
79 |
+
delete_option( 'fancybox_showCloseButton' );
|
80 |
+
delete_option( 'fancybox_backgroundColor' );
|
81 |
+
delete_option( 'fancybox_textColor' );
|
82 |
+
delete_option( 'fancybox_titleColor' );
|
83 |
+
delete_option( 'fancybox_paddingColor' );
|
84 |
+
delete_option( 'fancybox_borderRadius' );
|
85 |
+
delete_option( 'fancybox_width' );
|
86 |
+
delete_option( 'fancybox_height' );
|
87 |
+
delete_option( 'fancybox_padding' );
|
88 |
+
delete_option( 'fancybox_margin' );
|
89 |
+
delete_option( 'fancybox_centerOnScroll' );
|
90 |
+
delete_option( 'fancybox_enableEscapeButton' );
|
91 |
+
delete_option( 'fancybox_autoScale' );
|
92 |
+
delete_option( 'fancybox_speedIn' );
|
93 |
+
delete_option( 'fancybox_speedOut' );
|
94 |
+
|
95 |
+
// Miscellaneous.
|
96 |
+
delete_option( 'fancybox_autoClick' );
|
97 |
+
delete_option( 'fancybox_delayClick' );
|
98 |
+
delete_option( 'fancybox_minViewportWidth' );
|
99 |
+
delete_option( 'fancybox_minViewportHeight' ); // fb2
|
100 |
+
delete_option( 'fancybox_scriptPriority' );
|
101 |
+
delete_option( 'fancybox_noFooter' );
|
102 |
+
delete_option( 'fancybox_nojQuery' );
|
103 |
+
delete_option( 'fancybox_pre45Compat' );
|
104 |
+
delete_option( 'fancybox_vcMasonryCompat' );
|
105 |
+
delete_option( 'fancybox_autoExclude' );
|
106 |
+
delete_option( 'fancybox_compatIE8' );
|
107 |
+
delete_option( 'fancybox_mouseWheel' );
|
108 |
+
delete_option( 'fancybox_metaData' );
|
109 |
+
|
110 |
+
// Image
|
111 |
+
delete_option( 'fancybox_autoAttribute' );
|
112 |
+
delete_option( 'fancybox_autoAttributeLimit' );
|
113 |
+
delete_option( 'fancybox_classType' );
|
114 |
+
delete_option( 'fancybox_transitionIn' );
|
115 |
+
delete_option( 'fancybox_easingIn' );
|
116 |
+
delete_option( 'fancybox_transitionOut' );
|
117 |
+
delete_option( 'fancybox_easingOut' );
|
118 |
+
delete_option( 'fancybox_opacity' );
|
119 |
+
delete_option( 'fancybox_hideOnContentClick' );
|
120 |
+
delete_option( 'fancybox_titleShow' );
|
121 |
+
delete_option( 'fancybox_titlePosition' );
|
122 |
+
delete_option( 'fancybox_titleFromAlt' );
|
123 |
+
delete_option( 'fancybox_autoGallery' );
|
124 |
+
delete_option( 'fancybox_showNavArrows' );
|
125 |
+
delete_option( 'fancybox_enableKeyboardNav' );
|
126 |
+
delete_option( 'fancybox_cyclic' );
|
127 |
+
delete_option( 'fancybox_changeSpeed' );
|
128 |
+
delete_option( 'fancybox_changeFade' );
|
129 |
+
delete_option( 'fancybox_autoSelector' );
|
130 |
+
delete_option( 'fancybox_autoPlay' ); // fb 2
|
131 |
+
|
132 |
+
// Inline.
|
133 |
+
delete_option( 'fancybox_autoDimensions' );
|
134 |
+
delete_option( 'fancybox_InlineScrolling' );
|
135 |
+
delete_option( 'fancybox_transitionInInline' );
|
136 |
+
delete_option( 'fancybox_easingInInline' );
|
137 |
+
delete_option( 'fancybox_transitionOutInline' );
|
138 |
+
delete_option( 'fancybox_easingOutInline' );
|
139 |
+
delete_option( 'fancybox_opacityInline' );
|
140 |
+
delete_option( 'fancybox_hideOnContentClickInline' );
|
141 |
+
|
142 |
+
// PDF.
|
143 |
+
delete_option( 'fancybox_autoAttributePDF' );
|
144 |
+
delete_option( 'fancybox_PDFonStart' );
|
145 |
+
delete_option( 'fancybox_PDFwidth' );
|
146 |
+
delete_option( 'fancybox_PDFheight' );
|
147 |
+
delete_option( 'fancybox_PDFpadding' );
|
148 |
+
delete_option( 'fancybox_PDFtitleShow' );
|
149 |
+
delete_option( 'fancybox_PDFtitlePosition' );
|
150 |
+
delete_option( 'fancybox_PDFtitleFromAlt' );
|
151 |
+
|
152 |
+
// SWF.
|
153 |
+
delete_option( 'fancybox_autoAttributeSWF' );
|
154 |
+
delete_option( 'fancybox_SWFWidth' );
|
155 |
+
delete_option( 'fancybox_SWFHeight' );
|
156 |
+
delete_option( 'fancybox_SWFpadding' );
|
157 |
+
delete_option( 'fancybox_SWFtitleShow' );
|
158 |
+
delete_option( 'fancybox_SWFtitlePosition' );
|
159 |
+
delete_option( 'fancybox_SWFtitleFromAlt' );
|
160 |
+
|
161 |
+
// SVG.
|
162 |
+
delete_option( 'fancybox_autoAttributeSVG' );
|
163 |
+
delete_option( 'fancybox_SVGWidth' );
|
164 |
+
delete_option( 'fancybox_SVGHeight' );
|
165 |
+
delete_option( 'fancybox_SVGpadding' );
|
166 |
+
delete_option( 'fancybox_SVGtitleShow' );
|
167 |
+
delete_option( 'fancybox_SVGtitlePosition' );
|
168 |
+
delete_option( 'fancybox_SVGtitleFromAlt' );
|
169 |
+
|
170 |
+
// Youtube.
|
171 |
+
delete_option( 'fancybox_autoAttributeYoutube' );
|
172 |
+
delete_option( 'fancybox_YoutubeWidth' );
|
173 |
+
delete_option( 'fancybox_YoutubeHeight' );
|
174 |
+
delete_option( 'fancybox_Youtubepadding' );
|
175 |
+
delete_option( 'fancybox_YoutubetitleShow' );
|
176 |
+
delete_option( 'fancybox_YoutubetitlePosition' );
|
177 |
+
delete_option( 'fancybox_YoutubetitleFromAlt' );
|
178 |
+
delete_option( 'fancybox_YoutubenoCookie' );
|
179 |
+
|
180 |
+
// Vimeo.
|
181 |
+
delete_option( 'fancybox_autoAttributeVimeo' );
|
182 |
+
delete_option( 'fancybox_VimeoWidth' );
|
183 |
+
delete_option( 'fancybox_VimeoHeight' );
|
184 |
+
delete_option( 'fancybox_Vimeopadding' );
|
185 |
+
delete_option( 'fancybox_VimeotitleShow' );
|
186 |
+
delete_option( 'fancybox_VimeotitlePosition' );
|
187 |
+
delete_option( 'fancybox_VimeotitleFromAlt' );
|
188 |
+
|
189 |
+
// Dailymotion.
|
190 |
+
delete_option( 'fancybox_autoAttributeDailymotion' );
|
191 |
+
delete_option( 'fancybox_DailymotionWidth' );
|
192 |
+
delete_option( 'fancybox_DailymotionHeight' );
|
193 |
+
delete_option( 'fancybox_DailymotionPadding' );
|
194 |
+
delete_option( 'fancybox_DailymotiontitleShow' );
|
195 |
+
delete_option( 'fancybox_DailymotiontitlePosition' );
|
196 |
+
delete_option( 'fancybox_DailymotiontitleFromAlt' );
|
197 |
+
|
198 |
+
// Iframe.
|
199 |
+
delete_option( 'fancybox_iFramewidth' );
|
200 |
+
delete_option( 'fancybox_iFrameheight' );
|
201 |
+
delete_option( 'fancybox_iFramepadding' );
|
202 |
+
delete_option( 'fancybox_iFrametitleShow' );
|
203 |
+
delete_option( 'fancybox_iFrametitlePosition' );
|
204 |
+
delete_option( 'fancybox_iFrametitleFromAlt' );
|
205 |
+
delete_option( 'fancybox_allowFullScreen' );
|
206 |
+
|
207 |
+
// Google Maps.
|
208 |
+
delete_option( 'fancybox_enableGoogleMaps' ); // fb 2
|
209 |
+
// Instagram
|
210 |
+
delete_option( 'fancybox_enableInstagram' ); // fb 2
|
211 |
+
|
212 |
+
// Kilroy was here.
|
213 |
+
if ( defined( 'WP_DEBUG' ) && WP_DEBUG ) {
|
214 |
+
if ($blog_id)
|
215 |
+
error_log( $blog_id );
|
216 |
+
else
|
217 |
+
error_log( 'Easy FancyBox settings cleared on uninstall.' );
|
218 |
+
}
|
219 |
+
}
|
220 |
+
}
|
221 |
+
|
222 |
+
new easyFancyBox_Uninstall();
|
vendor/fancybox-1.3.4/blank.gif
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_close.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_loading.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_nav_left.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_nav_right.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_e.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_n.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_ne.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_nw.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_s.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_se.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_sw.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_shadow_w.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_title_left.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_title_main.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_title_over.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancy_title_right.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancybox-x.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancybox-y.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/fancybox.png
ADDED
Binary file
|
vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.css
ADDED
@@ -0,0 +1,359 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* FancyBox - jQuery Plugin
|
3 |
+
* Simple and fancy lightbox alternative
|
4 |
+
*
|
5 |
+
* Examples and documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Version: 1.3.4 (11/11/2010)
|
11 |
+
* Requires: jQuery v1.3+
|
12 |
+
*
|
13 |
+
* Dual licensed under the MIT and GPL licenses:
|
14 |
+
* http://www.opensource.org/licenses/mit-license.php
|
15 |
+
* http://www.gnu.org/licenses/gpl.html
|
16 |
+
*/
|
17 |
+
|
18 |
+
#fancybox-loading {
|
19 |
+
position: fixed;
|
20 |
+
top: 50%;
|
21 |
+
left: 50%;
|
22 |
+
width: 40px;
|
23 |
+
height: 40px;
|
24 |
+
margin-top: -20px;
|
25 |
+
margin-left: -20px;
|
26 |
+
cursor: pointer;
|
27 |
+
overflow: hidden;
|
28 |
+
z-index: 1104;
|
29 |
+
display: none;
|
30 |
+
}
|
31 |
+
|
32 |
+
#fancybox-loading div {
|
33 |
+
position: absolute;
|
34 |
+
top: 0;
|
35 |
+
left: 0;
|
36 |
+
width: 40px;
|
37 |
+
height: 480px;
|
38 |
+
background-image: url('fancybox.png');
|
39 |
+
}
|
40 |
+
|
41 |
+
#fancybox-overlay {
|
42 |
+
position: absolute;
|
43 |
+
top: 0;
|
44 |
+
left: 0;
|
45 |
+
width: 100%;
|
46 |
+
z-index: 1100;
|
47 |
+
display: none;
|
48 |
+
}
|
49 |
+
|
50 |
+
#fancybox-tmp {
|
51 |
+
padding: 0;
|
52 |
+
margin: 0;
|
53 |
+
border: 0;
|
54 |
+
overflow: auto;
|
55 |
+
display: none;
|
56 |
+
}
|
57 |
+
|
58 |
+
#fancybox-wrap {
|
59 |
+
position: absolute;
|
60 |
+
top: 0;
|
61 |
+
left: 0;
|
62 |
+
padding: 20px;
|
63 |
+
z-index: 1101;
|
64 |
+
outline: none;
|
65 |
+
display: none;
|
66 |
+
}
|
67 |
+
|
68 |
+
#fancybox-outer {
|
69 |
+
position: relative;
|
70 |
+
width: 100%;
|
71 |
+
height: 100%;
|
72 |
+
background: #fff;
|
73 |
+
}
|
74 |
+
|
75 |
+
#fancybox-content {
|
76 |
+
width: 0;
|
77 |
+
height: 0;
|
78 |
+
padding: 0;
|
79 |
+
outline: none;
|
80 |
+
position: relative;
|
81 |
+
overflow: hidden;
|
82 |
+
z-index: 1102;
|
83 |
+
border: 0px solid #fff;
|
84 |
+
}
|
85 |
+
|
86 |
+
#fancybox-hide-sel-frame {
|
87 |
+
position: absolute;
|
88 |
+
top: 0;
|
89 |
+
left: 0;
|
90 |
+
width: 100%;
|
91 |
+
height: 100%;
|
92 |
+
background: transparent;
|
93 |
+
z-index: 1101;
|
94 |
+
}
|
95 |
+
|
96 |
+
#fancybox-close {
|
97 |
+
position: absolute;
|
98 |
+
top: -15px;
|
99 |
+
right: -15px;
|
100 |
+
width: 30px;
|
101 |
+
height: 30px;
|
102 |
+
background: transparent url('fancybox.png') -40px 0px;
|
103 |
+
cursor: pointer;
|
104 |
+
z-index: 1103;
|
105 |
+
display: none;
|
106 |
+
}
|
107 |
+
|
108 |
+
#fancybox-error {
|
109 |
+
color: #444;
|
110 |
+
font: normal 12px/20px Arial;
|
111 |
+
padding: 14px;
|
112 |
+
margin: 0;
|
113 |
+
}
|
114 |
+
|
115 |
+
#fancybox-img {
|
116 |
+
width: 100%;
|
117 |
+
height: 100%;
|
118 |
+
padding: 0;
|
119 |
+
margin: 0;
|
120 |
+
border: none;
|
121 |
+
outline: none;
|
122 |
+
line-height: 0;
|
123 |
+
vertical-align: top;
|
124 |
+
}
|
125 |
+
|
126 |
+
#fancybox-frame {
|
127 |
+
width: 100%;
|
128 |
+
height: 100%;
|
129 |
+
border: none;
|
130 |
+
display: block;
|
131 |
+
}
|
132 |
+
|
133 |
+
#fancybox-left, #fancybox-right {
|
134 |
+
position: absolute;
|
135 |
+
bottom: 0px;
|
136 |
+
height: 100%;
|
137 |
+
width: 35%;
|
138 |
+
cursor: pointer;
|
139 |
+
outline: none;
|
140 |
+
background: transparent url('blank.gif');
|
141 |
+
z-index: 1102;
|
142 |
+
display: none;
|
143 |
+
}
|
144 |
+
|
145 |
+
#fancybox-left {
|
146 |
+
left: 0px;
|
147 |
+
}
|
148 |
+
|
149 |
+
#fancybox-right {
|
150 |
+
right: 0px;
|
151 |
+
}
|
152 |
+
|
153 |
+
#fancybox-left-ico, #fancybox-right-ico {
|
154 |
+
position: absolute;
|
155 |
+
top: 50%;
|
156 |
+
left: -9999px;
|
157 |
+
width: 30px;
|
158 |
+
height: 30px;
|
159 |
+
margin-top: -15px;
|
160 |
+
cursor: pointer;
|
161 |
+
z-index: 1102;
|
162 |
+
display: block;
|
163 |
+
}
|
164 |
+
|
165 |
+
#fancybox-left-ico {
|
166 |
+
background-image: url('fancybox.png');
|
167 |
+
background-position: -40px -30px;
|
168 |
+
}
|
169 |
+
|
170 |
+
#fancybox-right-ico {
|
171 |
+
background-image: url('fancybox.png');
|
172 |
+
background-position: -40px -60px;
|
173 |
+
}
|
174 |
+
|
175 |
+
#fancybox-left:hover, #fancybox-right:hover {
|
176 |
+
visibility: visible; /* IE6 */
|
177 |
+
}
|
178 |
+
|
179 |
+
#fancybox-left:hover span {
|
180 |
+
left: 20px;
|
181 |
+
}
|
182 |
+
|
183 |
+
#fancybox-right:hover span {
|
184 |
+
left: auto;
|
185 |
+
right: 20px;
|
186 |
+
}
|
187 |
+
|
188 |
+
.fancybox-bg {
|
189 |
+
position: absolute;
|
190 |
+
padding: 0;
|
191 |
+
margin: 0;
|
192 |
+
border: 0;
|
193 |
+
width: 20px;
|
194 |
+
height: 20px;
|
195 |
+
z-index: 1001;
|
196 |
+
}
|
197 |
+
|
198 |
+
#fancybox-bg-n {
|
199 |
+
top: -20px;
|
200 |
+
left: 0;
|
201 |
+
width: 100%;
|
202 |
+
background-image: url('fancybox-x.png');
|
203 |
+
}
|
204 |
+
|
205 |
+
#fancybox-bg-ne {
|
206 |
+
top: -20px;
|
207 |
+
right: -20px;
|
208 |
+
background-image: url('fancybox.png');
|
209 |
+
background-position: -40px -162px;
|
210 |
+
}
|
211 |
+
|
212 |
+
#fancybox-bg-e {
|
213 |
+
top: 0;
|
214 |
+
right: -20px;
|
215 |
+
height: 100%;
|
216 |
+
background-image: url('fancybox-y.png');
|
217 |
+
background-position: -20px 0px;
|
218 |
+
}
|
219 |
+
|
220 |
+
#fancybox-bg-se {
|
221 |
+
bottom: -20px;
|
222 |
+
right: -20px;
|
223 |
+
background-image: url('fancybox.png');
|
224 |
+
background-position: -40px -182px;
|
225 |
+
}
|
226 |
+
|
227 |
+
#fancybox-bg-s {
|
228 |
+
bottom: -20px;
|
229 |
+
left: 0;
|
230 |
+
width: 100%;
|
231 |
+
background-image: url('fancybox-x.png');
|
232 |
+
background-position: 0px -20px;
|
233 |
+
}
|
234 |
+
|
235 |
+
#fancybox-bg-sw {
|
236 |
+
bottom: -20px;
|
237 |
+
left: -20px;
|
238 |
+
background-image: url('fancybox.png');
|
239 |
+
background-position: -40px -142px;
|
240 |
+
}
|
241 |
+
|
242 |
+
#fancybox-bg-w {
|
243 |
+
top: 0;
|
244 |
+
left: -20px;
|
245 |
+
height: 100%;
|
246 |
+
background-image: url('fancybox-y.png');
|
247 |
+
}
|
248 |
+
|
249 |
+
#fancybox-bg-nw {
|
250 |
+
top: -20px;
|
251 |
+
left: -20px;
|
252 |
+
background-image: url('fancybox.png');
|
253 |
+
background-position: -40px -122px;
|
254 |
+
}
|
255 |
+
|
256 |
+
#fancybox-title {
|
257 |
+
font-family: Helvetica;
|
258 |
+
font-size: 12px;
|
259 |
+
z-index: 1102;
|
260 |
+
}
|
261 |
+
|
262 |
+
.fancybox-title-inside {
|
263 |
+
padding-bottom: 10px;
|
264 |
+
text-align: center;
|
265 |
+
color: #333;
|
266 |
+
background: #fff;
|
267 |
+
position: relative;
|
268 |
+
}
|
269 |
+
|
270 |
+
.fancybox-title-outside {
|
271 |
+
padding-top: 10px;
|
272 |
+
color: #fff;
|
273 |
+
}
|
274 |
+
|
275 |
+
.fancybox-title-over {
|
276 |
+
position: absolute;
|
277 |
+
bottom: 0;
|
278 |
+
left: 0;
|
279 |
+
color: #FFF;
|
280 |
+
text-align: left;
|
281 |
+
}
|
282 |
+
|
283 |
+
#fancybox-title-over {
|
284 |
+
padding: 10px;
|
285 |
+
background-image: url('fancy_title_over.png');
|
286 |
+
display: block;
|
287 |
+
}
|
288 |
+
|
289 |
+
.fancybox-title-float {
|
290 |
+
position: absolute;
|
291 |
+
left: 0;
|
292 |
+
bottom: -20px;
|
293 |
+
height: 32px;
|
294 |
+
}
|
295 |
+
|
296 |
+
#fancybox-title-float-wrap {
|
297 |
+
border: none;
|
298 |
+
border-collapse: collapse;
|
299 |
+
width: auto;
|
300 |
+
}
|
301 |
+
|
302 |
+
#fancybox-title-float-wrap td {
|
303 |
+
border: none;
|
304 |
+
white-space: nowrap;
|
305 |
+
}
|
306 |
+
|
307 |
+
#fancybox-title-float-left {
|
308 |
+
padding: 0 0 0 15px;
|
309 |
+
background: url('fancybox.png') -40px -90px no-repeat;
|
310 |
+
}
|
311 |
+
|
312 |
+
#fancybox-title-float-main {
|
313 |
+
color: #FFF;
|
314 |
+
line-height: 29px;
|
315 |
+
font-weight: bold;
|
316 |
+
padding: 0 0 3px 0;
|
317 |
+
background: url('fancybox-x.png') 0px -40px;
|
318 |
+
}
|
319 |
+
|
320 |
+
#fancybox-title-float-right {
|
321 |
+
padding: 0 0 0 15px;
|
322 |
+
background: url('fancybox.png') -55px -90px no-repeat;
|
323 |
+
}
|
324 |
+
|
325 |
+
/* IE6 */
|
326 |
+
|
327 |
+
.fancybox-ie6 #fancybox-close { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_close.png', sizingMethod='scale'); }
|
328 |
+
|
329 |
+
.fancybox-ie6 #fancybox-left-ico { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_nav_left.png', sizingMethod='scale'); }
|
330 |
+
.fancybox-ie6 #fancybox-right-ico { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_nav_right.png', sizingMethod='scale'); }
|
331 |
+
|
332 |
+
.fancybox-ie6 #fancybox-title-over { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_over.png', sizingMethod='scale'); zoom: 1; }
|
333 |
+
.fancybox-ie6 #fancybox-title-float-left { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_left.png', sizingMethod='scale'); }
|
334 |
+
.fancybox-ie6 #fancybox-title-float-main { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_main.png', sizingMethod='scale'); }
|
335 |
+
.fancybox-ie6 #fancybox-title-float-right { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_title_right.png', sizingMethod='scale'); }
|
336 |
+
|
337 |
+
.fancybox-ie6 #fancybox-bg-w, .fancybox-ie6 #fancybox-bg-e, .fancybox-ie6 #fancybox-left, .fancybox-ie6 #fancybox-right, #fancybox-hide-sel-frame {
|
338 |
+
height: expression(this.parentNode.clientHeight + "px");
|
339 |
+
}
|
340 |
+
|
341 |
+
#fancybox-loading.fancybox-ie6 {
|
342 |
+
position: absolute; margin-top: 0;
|
343 |
+
top: expression( (-20 + (document.documentElement.clientHeight ? document.documentElement.clientHeight/2 : document.body.clientHeight/2 ) + ( ignoreMe = document.documentElement.scrollTop ? document.documentElement.scrollTop : document.body.scrollTop )) + 'px');
|
344 |
+
}
|
345 |
+
|
346 |
+
#fancybox-loading.fancybox-ie6 div { background: transparent; filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_loading.png', sizingMethod='scale'); }
|
347 |
+
|
348 |
+
/* IE6, IE7, IE8 */
|
349 |
+
|
350 |
+
.fancybox-ie .fancybox-bg { background: transparent !important; }
|
351 |
+
|
352 |
+
.fancybox-ie #fancybox-bg-n { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_n.png', sizingMethod='scale'); }
|
353 |
+
.fancybox-ie #fancybox-bg-ne { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_ne.png', sizingMethod='scale'); }
|
354 |
+
.fancybox-ie #fancybox-bg-e { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_e.png', sizingMethod='scale'); }
|
355 |
+
.fancybox-ie #fancybox-bg-se { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_se.png', sizingMethod='scale'); }
|
356 |
+
.fancybox-ie #fancybox-bg-s { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_s.png', sizingMethod='scale'); }
|
357 |
+
.fancybox-ie #fancybox-bg-sw { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_sw.png', sizingMethod='scale'); }
|
358 |
+
.fancybox-ie #fancybox-bg-w { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_w.png', sizingMethod='scale'); }
|
359 |
+
.fancybox-ie #fancybox-bg-nw { filter: progid:DXImageTransform.Microsoft.AlphaImageLoader(src='fancybox/fancy_shadow_nw.png', sizingMethod='scale'); }
|
js/jquery.fancybox.js → vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.js
RENAMED
@@ -7,36 +7,33 @@
|
|
7 |
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
*
|
10 |
-
* Version: 1.3.
|
11 |
-
* Requires: jQuery v1.
|
12 |
*
|
13 |
* Dual licensed under the MIT and GPL licenses:
|
14 |
* http://www.opensource.org/licenses/mit-license.php
|
15 |
* http://www.gnu.org/licenses/gpl.html
|
16 |
*/
|
17 |
-
(function($) {
|
18 |
-
var tmp, loading, overlay, wrap, outer, content, close, title, nav_left, nav_right, resize_timeout,
|
19 |
|
20 |
-
|
|
|
21 |
|
22 |
-
|
23 |
|
24 |
-
imgRegExp = /\.(jpg|gif|png|bmp|jpeg
|
25 |
|
26 |
loadingTimer, loadingFrame = 1,
|
27 |
|
28 |
titleHeight = 0, titleStr = '', start_pos, final_pos, busy = false, fx = $.extend($('<div/>')[0], { prop: 0 }),
|
29 |
|
30 |
-
isIE6 =
|
31 |
-
|
32 |
-
isTouch = document.createTouch !== undefined;
|
33 |
|
34 |
/*
|
35 |
-
* Private methods
|
36 |
*/
|
37 |
|
38 |
_abort = function() {
|
39 |
-
|
40 |
|
41 |
imgPreloader.onerror = imgPreloader.onload = null;
|
42 |
|
@@ -47,31 +44,27 @@
|
|
47 |
tmp.empty();
|
48 |
},
|
49 |
|
50 |
-
_error = function(
|
51 |
if (false === selectedOpts.onError(selectedArray, selectedIndex, selectedOpts)) {
|
52 |
-
|
53 |
busy = false;
|
54 |
return;
|
55 |
}
|
56 |
|
57 |
-
if ( typeof msg === 'undefined' ) {
|
58 |
-
msg = 'Please try again later.';
|
59 |
-
}
|
60 |
-
|
61 |
selectedOpts.titleShow = false;
|
62 |
|
63 |
selectedOpts.width = 'auto';
|
64 |
selectedOpts.height = 'auto';
|
65 |
|
66 |
-
tmp.html( '<p id="fancybox-error">The requested content cannot be loaded.<br />
|
67 |
|
68 |
_process_inline();
|
69 |
},
|
70 |
|
71 |
_start = function() {
|
72 |
var obj = selectedArray[ selectedIndex ],
|
73 |
-
href,
|
74 |
-
type,
|
75 |
title,
|
76 |
str,
|
77 |
emb,
|
@@ -81,15 +74,6 @@
|
|
81 |
|
82 |
selectedOpts = $.extend({}, $.fn.fancybox.defaults, (typeof $(obj).data('fancybox') == 'undefined' ? selectedOpts : $(obj).data('fancybox')));
|
83 |
|
84 |
-
if ( document.documentElement.clientWidth < selectedOpts.minViewportWidth ) {
|
85 |
-
busy = false;
|
86 |
-
return;
|
87 |
-
}
|
88 |
-
|
89 |
-
if ('object' === typeof arguments[0] && 'click' === arguments[0].type) {
|
90 |
-
arguments[0].preventDefault();
|
91 |
-
}
|
92 |
-
|
93 |
ret = selectedOpts.onStart(selectedArray, selectedIndex, selectedOpts);
|
94 |
|
95 |
if (ret === false) {
|
@@ -102,11 +86,11 @@
|
|
102 |
title = selectedOpts.title || (obj.nodeName ? $(obj).attr('title') : obj.title) || '';
|
103 |
|
104 |
if (obj.nodeName && !selectedOpts.orig) {
|
105 |
-
selectedOpts.orig = $(obj).
|
106 |
}
|
107 |
|
108 |
-
if (title === '' && selectedOpts.orig) {
|
109 |
-
title = selectedOpts.orig.attr('
|
110 |
}
|
111 |
|
112 |
href = selectedOpts.href || (obj.nodeName ? $(obj).attr('href') : obj.href) || null;
|
@@ -125,21 +109,15 @@
|
|
125 |
} else if (selectedOpts.content) {
|
126 |
type = 'html';
|
127 |
|
128 |
-
} else if ( $(obj).hasClass('iframe') ) {
|
129 |
-
type = 'iframe';
|
130 |
-
|
131 |
} else if (href) {
|
132 |
-
if (href.match(imgRegExp)
|
133 |
type = 'image';
|
134 |
|
135 |
} else if (href.match(swfRegExp)) {
|
136 |
type = 'swf';
|
137 |
|
138 |
-
} else if (
|
139 |
-
type = '
|
140 |
-
|
141 |
-
} else if (href.match(pdfRegExp)) {
|
142 |
-
type = 'pdf';
|
143 |
|
144 |
} else if (href.indexOf("#") === 0) {
|
145 |
type = 'inline';
|
@@ -150,14 +128,10 @@
|
|
150 |
}
|
151 |
|
152 |
if (!type) {
|
153 |
-
_error(
|
154 |
return;
|
155 |
}
|
156 |
|
157 |
-
if ($(obj).hasClass('modal')) {
|
158 |
-
selectedOpts.modal = true;
|
159 |
-
}
|
160 |
-
|
161 |
if (type == 'inline') {
|
162 |
obj = href.substr(href.indexOf("#"));
|
163 |
type = $(obj).length > 0 ? 'inline' : 'ajax';
|
@@ -172,7 +146,7 @@
|
|
172 |
selectedOpts.width = 'auto';
|
173 |
selectedOpts.height = 'auto';
|
174 |
} else {
|
175 |
-
selectedOpts.autoDimensions = false;
|
176 |
}
|
177 |
}
|
178 |
|
@@ -189,8 +163,8 @@
|
|
189 |
|
190 |
tmp.css('padding', (selectedOpts.padding + selectedOpts.margin));
|
191 |
|
192 |
-
$('.fancybox-inline-tmp').
|
193 |
-
$(this).replaceWith(content.children());
|
194 |
});
|
195 |
|
196 |
switch (type) {
|
@@ -208,10 +182,10 @@
|
|
208 |
$('<div class="fancybox-inline-tmp" />')
|
209 |
.hide()
|
210 |
.insertBefore( $(obj) )
|
211 |
-
.
|
212 |
-
$(this).replaceWith(content.
|
213 |
-
}).
|
214 |
-
$(this).replaceWith(tmp.
|
215 |
});
|
216 |
|
217 |
$(obj).appendTo(tmp);
|
@@ -220,8 +194,6 @@
|
|
220 |
break;
|
221 |
|
222 |
case 'image':
|
223 |
-
selectedOpts.keepRatio = true;
|
224 |
-
|
225 |
busy = false;
|
226 |
|
227 |
$.fancybox.showActivity();
|
@@ -229,7 +201,7 @@
|
|
229 |
imgPreloader = new Image();
|
230 |
|
231 |
imgPreloader.onerror = function() {
|
232 |
-
_error(
|
233 |
};
|
234 |
|
235 |
imgPreloader.onload = function() {
|
@@ -245,9 +217,8 @@
|
|
245 |
|
246 |
case 'swf':
|
247 |
selectedOpts.scrolling = 'no';
|
248 |
-
selectedOpts.keepRatio = true;
|
249 |
|
250 |
-
str = '<object
|
251 |
emb = '';
|
252 |
|
253 |
$.each(selectedOpts.swf, function(name, val) {
|
@@ -262,29 +233,6 @@
|
|
262 |
_process_inline();
|
263 |
break;
|
264 |
|
265 |
-
case 'svg':
|
266 |
-
selectedOpts.scrolling = 'no';
|
267 |
-
selectedOpts.keepRatio = true;
|
268 |
-
|
269 |
-
str = '<object type="image/svg+xml" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '" data="' + href + '"></object>';
|
270 |
-
|
271 |
-
tmp.html(str);
|
272 |
-
|
273 |
-
_process_inline();
|
274 |
-
break;
|
275 |
-
|
276 |
-
case 'pdf':
|
277 |
-
selectedOpts.scrolling = 'no';
|
278 |
-
selectedOpts.enableKeyboardNav = false;
|
279 |
-
selectedOpts.showNavArrows = false;
|
280 |
-
|
281 |
-
str = '<object type="application/pdf" width="100%" height="100%" data="' + href + '"><a href="' + href + '" style="display:block;position:absolute;top:48%;width:100%;text-align:center">' + $(obj).html() + '</a></object>';
|
282 |
-
|
283 |
-
tmp.html(str);
|
284 |
-
|
285 |
-
_process_inline();
|
286 |
-
break;
|
287 |
-
|
288 |
case 'ajax':
|
289 |
busy = false;
|
290 |
|
@@ -297,7 +245,7 @@
|
|
297 |
data : selectedOpts.ajax.data || {},
|
298 |
error : function(XMLHttpRequest, textStatus, errorThrown) {
|
299 |
if ( XMLHttpRequest.status > 0 ) {
|
300 |
-
_error(
|
301 |
}
|
302 |
},
|
303 |
success : function(data, textStatus, XMLHttpRequest) {
|
@@ -307,56 +255,47 @@
|
|
307 |
ret = selectedOpts.ajax.win(href, data, textStatus, XMLHttpRequest);
|
308 |
|
309 |
if (ret === false) {
|
310 |
-
|
311 |
return;
|
312 |
} else if (typeof ret == 'string' || typeof ret == 'object') {
|
313 |
data = ret;
|
314 |
}
|
315 |
}
|
316 |
|
317 |
-
|
318 |
-
|
319 |
-
} else {
|
320 |
-
tmp.html( data );
|
321 |
-
_process_inline();
|
322 |
-
}
|
323 |
}
|
324 |
}
|
325 |
}));
|
|
|
326 |
break;
|
327 |
|
328 |
case 'iframe':
|
329 |
-
selectedOpts.enableKeyboardNav = false;
|
330 |
-
selectedOpts.showNavArrows = false;
|
331 |
-
|
332 |
-
$.fancybox.showActivity();
|
333 |
-
|
334 |
_show();
|
335 |
break;
|
336 |
}
|
337 |
},
|
338 |
|
339 |
_process_inline = function() {
|
340 |
-
var
|
341 |
-
|
342 |
-
|
343 |
-
wh = $(window).height() == 0 ? window.innerHeight : $(window).height();
|
344 |
|
345 |
if (w.toString().indexOf('%') > -1) {
|
346 |
-
w = parseInt( (
|
347 |
|
348 |
} else {
|
349 |
-
w = w == 'auto' ? 'auto' : w + 'px';
|
350 |
}
|
351 |
|
352 |
if (h.toString().indexOf('%') > -1) {
|
353 |
-
h = parseInt( (
|
354 |
|
355 |
} else {
|
356 |
-
h = h == 'auto' ? 'auto' : h + 'px';
|
357 |
}
|
358 |
|
359 |
-
tmp.wrapInner('<div style="width:' + w + ';height:' + h + ';overflow:' + (selectedOpts.scrolling == 'auto' ? 'auto' : (selectedOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + ';position:relative;"></div>');
|
360 |
|
361 |
selectedOpts.width = tmp.width();
|
362 |
selectedOpts.height = tmp.height();
|
@@ -380,12 +319,10 @@
|
|
380 |
_show = function() {
|
381 |
var pos, equal;
|
382 |
|
383 |
-
|
384 |
-
$.fancybox.hideActivity();
|
385 |
-
}
|
386 |
|
387 |
if (wrap.is(":visible") && false === currentOpts.onCleanup(currentArray, currentIndex, currentOpts)) {
|
388 |
-
|
389 |
|
390 |
busy = false;
|
391 |
return;
|
@@ -393,10 +330,10 @@
|
|
393 |
|
394 |
busy = true;
|
395 |
|
396 |
-
$(content.add( overlay )).
|
397 |
|
398 |
-
$(window).
|
399 |
-
$(document).
|
400 |
|
401 |
if (wrap.is(":visible") && currentOpts.titlePosition !== 'outside') {
|
402 |
wrap.css('height', wrap.height());
|
@@ -407,8 +344,6 @@
|
|
407 |
currentOpts = selectedOpts;
|
408 |
|
409 |
if (currentOpts.overlayShow) {
|
410 |
-
$('html').addClass('fancybox-active');
|
411 |
-
|
412 |
overlay.css({
|
413 |
'background-color' : currentOpts.overlayColor,
|
414 |
'opacity' : currentOpts.overlayOpacity,
|
@@ -424,6 +359,7 @@
|
|
424 |
this.style.visibility = 'inherit';
|
425 |
});
|
426 |
}
|
|
|
427 |
overlay.show();
|
428 |
}
|
429 |
} else {
|
@@ -453,7 +389,7 @@
|
|
453 |
content.html( tmp.contents() ).fadeTo(currentOpts.changeFade, 1, _finish);
|
454 |
};
|
455 |
|
456 |
-
|
457 |
|
458 |
content
|
459 |
.empty()
|
@@ -461,11 +397,12 @@
|
|
461 |
.css({
|
462 |
'border-width' : currentOpts.padding,
|
463 |
'width' : final_pos.width - currentOpts.padding * 2,
|
464 |
-
'height' :
|
465 |
});
|
466 |
|
467 |
if (equal) {
|
468 |
finish_resizing();
|
|
|
469 |
} else {
|
470 |
fx.prop = 0;
|
471 |
|
@@ -508,14 +445,14 @@
|
|
508 |
return;
|
509 |
}
|
510 |
|
511 |
-
if (currentOpts.titlePosition == 'inside' && titleHeight > 0) {
|
512 |
-
title.show();
|
513 |
}
|
514 |
|
515 |
content
|
516 |
.css({
|
517 |
'width' : final_pos.width - currentOpts.padding * 2,
|
518 |
-
'height' :
|
519 |
})
|
520 |
.html( tmp.contents() );
|
521 |
|
@@ -527,7 +464,7 @@
|
|
527 |
_format_title = function(title) {
|
528 |
if (title && title.length) {
|
529 |
if (currentOpts.titlePosition == 'float') {
|
530 |
-
return '<table id="fancybox-title-float-wrap"
|
531 |
}
|
532 |
|
533 |
return '<div id="fancybox-title-' + currentOpts.titlePosition + '">' + title + '</div>';
|
@@ -570,10 +507,12 @@
|
|
570 |
'width' : final_pos.width - (currentOpts.padding * 2),
|
571 |
'marginLeft' : currentOpts.padding,
|
572 |
'marginRight' : currentOpts.padding
|
573 |
-
})
|
574 |
|
575 |
titleHeight = title.outerHeight(true);
|
576 |
|
|
|
|
|
577 |
final_pos.height += titleHeight;
|
578 |
break;
|
579 |
|
@@ -589,8 +528,8 @@
|
|
589 |
|
590 |
case 'float':
|
591 |
title
|
592 |
-
.css('left', parseInt(
|
593 |
-
.appendTo(
|
594 |
break;
|
595 |
|
596 |
default:
|
@@ -609,21 +548,19 @@
|
|
609 |
|
610 |
_set_navigation = function() {
|
611 |
if (currentOpts.enableEscapeButton || currentOpts.enableKeyboardNav) {
|
612 |
-
$(document).
|
613 |
if (e.keyCode == 27 && currentOpts.enableEscapeButton) {
|
614 |
e.preventDefault();
|
615 |
$.fancybox.close();
|
|
|
616 |
} else if ((e.keyCode == 37 || e.keyCode == 39) && currentOpts.enableKeyboardNav && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
617 |
e.preventDefault();
|
618 |
$.fancybox[ e.keyCode == 37 ? 'prev' : 'next']();
|
619 |
-
} else if ((e.keyCode == 9) && currentOpts.enableKeyboardNav && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
620 |
-
e.preventDefault();
|
621 |
-
$.fancybox[ e.shiftKey ? 'prev' : 'next']();
|
622 |
}
|
623 |
});
|
624 |
}
|
625 |
|
626 |
-
if (!currentOpts.showNavArrows) {
|
627 |
nav_left.hide();
|
628 |
nav_right.hide();
|
629 |
return;
|
@@ -640,12 +577,12 @@
|
|
640 |
|
641 |
_finish = function () {
|
642 |
if (!$.support.opacity) {
|
643 |
-
content.
|
644 |
-
wrap.
|
645 |
}
|
646 |
|
647 |
-
if (
|
648 |
-
content.css('height','auto');
|
649 |
}
|
650 |
|
651 |
wrap.css('height', 'auto');
|
@@ -659,41 +596,23 @@
|
|
659 |
}
|
660 |
|
661 |
_set_navigation();
|
662 |
-
|
663 |
if (currentOpts.hideOnContentClick) {
|
664 |
-
content.
|
665 |
}
|
666 |
|
667 |
if (currentOpts.hideOnOverlayClick) {
|
668 |
-
overlay.
|
669 |
}
|
670 |
|
671 |
-
|
672 |
-
$(window).on("resize.fb", $.fancybox.resize);
|
673 |
-
}
|
674 |
-
|
675 |
-
if (currentOpts.centerOnScroll && !isTouch) {
|
676 |
-
$(window).on("scroll.fb", $.fancybox.center);
|
677 |
-
}
|
678 |
|
679 |
-
if (
|
680 |
-
|
681 |
-
if (busy) {
|
682 |
-
e.preventDefault();
|
683 |
-
} else if ( currentOpts.type == 'image' && ( $(e.target).outerHeight() == 0 || $(e.target).prop('scrollHeight') === $(e.target).outerHeight() ) ) {
|
684 |
-
e.preventDefault();
|
685 |
-
$.fancybox[ delta > 0 ? 'prev' : 'next' ]();
|
686 |
-
}
|
687 |
-
});
|
688 |
}
|
689 |
|
690 |
if (currentOpts.type == 'iframe') {
|
691 |
-
$('<iframe id="fancybox-frame" name="fancybox-frame' + new Date().getTime() + '"' + (
|
692 |
-
+ ' style="border:0;margin:0;overflow:' + (currentOpts.scrolling == 'auto' ? 'auto' : (currentOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + '" src="'
|
693 |
-
+ currentOpts.href + '"' + (false === currentOpts.allowfullscreen ? '' : ' allowfullscreen') + ' allow="autoplay; encrypted-media" tabindex="999"></iframe>')
|
694 |
-
.appendTo(content).on('load',function() {
|
695 |
-
$.fancybox.hideActivity();
|
696 |
-
}).focus();
|
697 |
}
|
698 |
|
699 |
wrap.show();
|
@@ -704,71 +623,29 @@
|
|
704 |
|
705 |
currentOpts.onComplete(currentArray, currentIndex, currentOpts);
|
706 |
|
707 |
-
|
708 |
-
_preload_next();
|
709 |
-
_preload_prev();
|
710 |
-
}
|
711 |
},
|
712 |
|
713 |
-
|
714 |
-
var
|
715 |
-
|
716 |
-
if ( pos >= currentArray.length ) {
|
717 |
-
if (currentOpts.cyclic) {
|
718 |
-
pos = 0;
|
719 |
-
} else {
|
720 |
-
return;
|
721 |
-
}
|
722 |
-
}
|
723 |
-
|
724 |
-
if ( pos == currentIndex ) {
|
725 |
-
currentOpts.enableKeyboardNav = false;
|
726 |
-
wrap.off('mousewheel.fb');
|
727 |
-
nav_right.hide();
|
728 |
-
return;
|
729 |
-
}
|
730 |
-
|
731 |
-
if ( _preload_image( pos ) ) {
|
732 |
-
return;
|
733 |
-
} else {
|
734 |
-
_preload_next( pos + 1 );
|
735 |
-
}
|
736 |
-
},
|
737 |
|
738 |
-
|
739 |
-
|
740 |
|
741 |
-
|
742 |
-
|
743 |
-
|
744 |
-
} else {
|
745 |
-
return;
|
746 |
}
|
747 |
}
|
748 |
|
749 |
-
if (
|
750 |
-
|
751 |
-
wrap.off('mousewheel.fb');
|
752 |
-
nav_left.hide();
|
753 |
-
return;
|
754 |
-
}
|
755 |
-
|
756 |
-
if ( _preload_image( pos ) ) {
|
757 |
-
return;
|
758 |
-
} else {
|
759 |
-
_preload_prev( pos - 1 );
|
760 |
-
}
|
761 |
-
},
|
762 |
-
|
763 |
-
_preload_image = function(pos) {
|
764 |
-
var objNext, obj = currentArray[ pos ];
|
765 |
|
766 |
-
|
767 |
-
|
768 |
-
|
769 |
-
|
770 |
-
} else {
|
771 |
-
return false;
|
772 |
}
|
773 |
},
|
774 |
|
@@ -794,27 +671,18 @@
|
|
794 |
},
|
795 |
|
796 |
_get_viewport = function() {
|
797 |
-
var w = !isTouch && window.innerWidth && document.documentElement.clientWidth ?
|
798 |
-
Math.min(window.innerWidth, document.documentElement.clientWidth) :
|
799 |
-
window.innerWidth || document.documentElement.clientWidth || document.getElementsByTagName('body')[0].clientWidth,
|
800 |
-
h = !isTouch && window.innerHeight && document.documentElement.clientHeight ?
|
801 |
-
Math.min(window.innerHeight, document.documentElement.clientHeight) :
|
802 |
-
window.innerHeight || document.documentElement.clientHeight || document.getElementsByTagName('body')[0].clientHeight,
|
803 |
-
margin;
|
804 |
-
|
805 |
-
margin = arguments[0] === true ? 0 : currentOpts.margin;
|
806 |
-
|
807 |
return [
|
808 |
-
|
809 |
-
|
810 |
-
$(document).scrollLeft() + margin,
|
811 |
-
$(document).scrollTop() + margin
|
812 |
];
|
813 |
},
|
814 |
|
815 |
_get_zoom_to = function () {
|
816 |
var view = _get_viewport(),
|
817 |
to = {},
|
|
|
818 |
double_padding = currentOpts.padding * 2,
|
819 |
ratio;
|
820 |
|
@@ -830,9 +698,9 @@
|
|
830 |
to.height = currentOpts.height + double_padding;
|
831 |
}
|
832 |
|
833 |
-
if (
|
834 |
-
if (
|
835 |
-
ratio = currentOpts.width / currentOpts.height;
|
836 |
|
837 |
if ((to.width ) > view[0]) {
|
838 |
to.width = view[0];
|
@@ -843,6 +711,7 @@
|
|
843 |
to.height = view[1];
|
844 |
to.width = parseInt(((to.height - double_padding) * ratio) + double_padding, 10);
|
845 |
}
|
|
|
846 |
} else {
|
847 |
to.width = Math.min(to.width, view[0]);
|
848 |
to.height = Math.min(to.height, view[1]);
|
@@ -882,7 +751,7 @@
|
|
882 |
from = {
|
883 |
width : pos.width + (currentOpts.padding * 2),
|
884 |
height : pos.height + (currentOpts.padding * 2),
|
885 |
-
top
|
886 |
left : pos.left - currentOpts.padding - 20
|
887 |
};
|
888 |
|
@@ -892,8 +761,8 @@
|
|
892 |
from = {
|
893 |
width : currentOpts.padding * 2,
|
894 |
height : currentOpts.padding * 2,
|
895 |
-
top
|
896 |
-
left : parseInt(
|
897 |
};
|
898 |
}
|
899 |
|
@@ -906,13 +775,13 @@
|
|
906 |
return;
|
907 |
}
|
908 |
|
909 |
-
$('div', loading).css('top', (loadingFrame * -
|
910 |
|
911 |
loadingFrame = (loadingFrame + 1) % 12;
|
912 |
};
|
913 |
|
914 |
/*
|
915 |
-
* Public methods
|
916 |
*/
|
917 |
|
918 |
$.fn.fancybox = function(options) {
|
@@ -922,8 +791,10 @@
|
|
922 |
|
923 |
$(this)
|
924 |
.data('fancybox', $.extend({}, options, ($.metadata ? $(this).metadata() : {})))
|
925 |
-
.
|
926 |
-
.
|
|
|
|
|
927 |
if (busy) {
|
928 |
return;
|
929 |
}
|
@@ -937,14 +808,15 @@
|
|
937 |
|
938 |
var rel = $(this).attr('rel') || '';
|
939 |
|
940 |
-
if (rel == '' || rel
|
941 |
selectedArray.push(this);
|
|
|
942 |
} else {
|
943 |
-
selectedArray = $(
|
944 |
selectedIndex = selectedArray.index( this );
|
945 |
}
|
946 |
|
947 |
-
_start(
|
948 |
|
949 |
return;
|
950 |
});
|
@@ -965,7 +837,7 @@
|
|
965 |
selectedArray = [];
|
966 |
selectedIndex = parseInt(opts.index, 10) || 0;
|
967 |
|
968 |
-
if (
|
969 |
for (var i = 0, j = obj.length; i < j; i++) {
|
970 |
if (typeof obj[i] == 'object') {
|
971 |
$(obj[i]).data('fancybox', $.extend({}, opts, obj[i]));
|
@@ -977,7 +849,7 @@
|
|
977 |
selectedArray = jQuery.merge(selectedArray, obj);
|
978 |
|
979 |
} else {
|
980 |
-
if (
|
981 |
$(obj).data('fancybox', $.extend({}, opts, obj));
|
982 |
} else {
|
983 |
obj = $({}).data('fancybox', $.extend({content : obj}, opts));
|
@@ -997,7 +869,7 @@
|
|
997 |
clearInterval(loadingTimer);
|
998 |
|
999 |
loading.show();
|
1000 |
-
loadingTimer = setInterval(
|
1001 |
};
|
1002 |
|
1003 |
$.fancybox.hideActivity = function() {
|
@@ -1005,47 +877,11 @@
|
|
1005 |
};
|
1006 |
|
1007 |
$.fancybox.next = function() {
|
1008 |
-
|
1009 |
-
|
1010 |
-
if (pos >= currentArray.length) {
|
1011 |
-
if (currentOpts.cyclic) {
|
1012 |
-
pos = 0;
|
1013 |
-
} else {
|
1014 |
-
return;
|
1015 |
-
}
|
1016 |
-
}
|
1017 |
-
|
1018 |
-
obj = currentArray[pos];
|
1019 |
-
|
1020 |
-
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
1021 |
-
$.fancybox.next( pos + 1 );
|
1022 |
-
} else {
|
1023 |
-
$.fancybox.pos( pos );
|
1024 |
-
}
|
1025 |
-
|
1026 |
-
return;
|
1027 |
};
|
1028 |
|
1029 |
$.fancybox.prev = function() {
|
1030 |
-
|
1031 |
-
|
1032 |
-
if (pos < 0) {
|
1033 |
-
if (currentOpts.cyclic) {
|
1034 |
-
pos = currentArray.length - 1;
|
1035 |
-
} else {
|
1036 |
-
return;
|
1037 |
-
}
|
1038 |
-
}
|
1039 |
-
|
1040 |
-
obj = currentArray[pos];
|
1041 |
-
|
1042 |
-
if ( pos != currentIndex && typeof obj !== 'undefined' && typeof obj.href !== 'undefined' && obj.href === currentOpts.href ) {
|
1043 |
-
$.fancybox.prev( pos - 1 );
|
1044 |
-
} else {
|
1045 |
-
$.fancybox.pos( pos );
|
1046 |
-
}
|
1047 |
-
|
1048 |
-
return;
|
1049 |
};
|
1050 |
|
1051 |
$.fancybox.pos = function(pos) {
|
@@ -1060,6 +896,10 @@
|
|
1060 |
if (pos > -1 && pos < currentArray.length) {
|
1061 |
selectedIndex = pos;
|
1062 |
_start();
|
|
|
|
|
|
|
|
|
1063 |
}
|
1064 |
|
1065 |
return;
|
@@ -1072,7 +912,7 @@
|
|
1072 |
|
1073 |
busy = true;
|
1074 |
|
1075 |
-
|
1076 |
|
1077 |
_abort();
|
1078 |
|
@@ -1098,13 +938,12 @@
|
|
1098 |
|
1099 |
$(close.add( nav_left ).add( nav_right )).hide();
|
1100 |
|
1101 |
-
$(content.add( overlay )).
|
1102 |
|
1103 |
-
$(window).
|
1104 |
-
$(document).
|
1105 |
|
1106 |
-
|
1107 |
-
content.find('iframe#fancybox-frame').attr('src', isIE6 && /^https/i.test(window.location.href || '') ? 'javascript:void(false)' : 'about:blank');*/
|
1108 |
|
1109 |
if (currentOpts.titlePosition !== 'inside') {
|
1110 |
title.empty();
|
@@ -1118,7 +957,7 @@
|
|
1118 |
title.empty().hide();
|
1119 |
wrap.hide();
|
1120 |
|
1121 |
-
|
1122 |
|
1123 |
content.empty();
|
1124 |
|
@@ -1137,7 +976,7 @@
|
|
1137 |
var pos = wrap.position();
|
1138 |
|
1139 |
final_pos = {
|
1140 |
-
top
|
1141 |
left : pos.left,
|
1142 |
width : wrap.width(),
|
1143 |
height : wrap.height()
|
@@ -1161,74 +1000,28 @@
|
|
1161 |
} else {
|
1162 |
wrap.fadeOut( currentOpts.transitionOut == 'none' ? 0 : currentOpts.speedOut, _cleanup);
|
1163 |
}
|
1164 |
-
|
1165 |
-
$('html').removeClass('fancybox-active');
|
1166 |
};
|
1167 |
|
1168 |
$.fancybox.resize = function() {
|
1169 |
-
|
1170 |
-
|
1171 |
-
|
1172 |
-
|
1173 |
-
resize_timeout = setTimeout( function() {
|
1174 |
-
var finish_resizing = function() {
|
1175 |
-
if (selectedOpts.autoDimensions) {
|
1176 |
-
content.css('height','auto');
|
1177 |
-
}
|
1178 |
-
|
1179 |
-
wrap.css('height', 'auto');
|
1180 |
-
|
1181 |
-
if (titleStr && titleStr.length) {
|
1182 |
-
title.show();
|
1183 |
-
}
|
1184 |
-
|
1185 |
-
busy = false;
|
1186 |
-
|
1187 |
-
$.fancybox.center(true);
|
1188 |
-
};
|
1189 |
-
|
1190 |
-
if (overlay.is(':visible')) {
|
1191 |
-
overlay.css('height', $(document).height());
|
1192 |
-
}
|
1193 |
-
|
1194 |
-
pos = wrap.position(),
|
1195 |
-
|
1196 |
-
start_pos = {
|
1197 |
-
top : pos.top,
|
1198 |
-
left : pos.left,
|
1199 |
-
width : wrap.width(),
|
1200 |
-
height : wrap.height()
|
1201 |
-
};
|
1202 |
-
|
1203 |
-
final_pos = _get_zoom_to();
|
1204 |
-
|
1205 |
-
busy = true;
|
1206 |
-
|
1207 |
-
_process_title();
|
1208 |
-
|
1209 |
-
fx.prop = 0;
|
1210 |
|
1211 |
-
|
1212 |
-
duration : currentOpts.changeSpeed,
|
1213 |
-
easing : currentOpts.easingChange,
|
1214 |
-
step : _draw,
|
1215 |
-
complete : finish_resizing
|
1216 |
-
});
|
1217 |
-
}, 500 );
|
1218 |
};
|
1219 |
|
1220 |
$.fancybox.center = function() {
|
1221 |
var view, align;
|
1222 |
|
1223 |
if (busy) {
|
1224 |
-
return;
|
1225 |
}
|
1226 |
|
1227 |
align = arguments[0] === true ? 1 : 0;
|
1228 |
-
view = _get_viewport(
|
1229 |
|
1230 |
-
if (!align && (
|
1231 |
-
return;
|
1232 |
}
|
1233 |
|
1234 |
wrap
|
@@ -1236,7 +1029,7 @@
|
|
1236 |
.animate({
|
1237 |
'top' : parseInt(Math.max(view[3] - 20, view[3] + ((view[1] - content.height() - 40) * 0.5) - currentOpts.padding)),
|
1238 |
'left' : parseInt(Math.max(view[2] - 20, view[2] + ((view[0] - content.width() - 40) * 0.5) - currentOpts.padding))
|
1239 |
-
}, typeof arguments[0] == 'number' ? arguments[0] :
|
1240 |
};
|
1241 |
|
1242 |
$.fancybox.init = function() {
|
@@ -1260,8 +1053,8 @@
|
|
1260 |
close = $('<a id="fancybox-close"></a>'),
|
1261 |
title = $('<div id="fancybox-title"></div>'),
|
1262 |
|
1263 |
-
nav_left = $('<a id="fancybox-left"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),
|
1264 |
-
nav_right = $('<a id="fancybox-right"><span class="fancy-ico" id="fancybox-right-ico"></span></a>')
|
1265 |
);
|
1266 |
|
1267 |
close.click($.fancybox.close);
|
@@ -1277,6 +1070,18 @@
|
|
1277 |
$.fancybox.next();
|
1278 |
});
|
1279 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1280 |
if (!$.support.opacity) {
|
1281 |
wrap.addClass('fancybox-ie');
|
1282 |
}
|
@@ -1285,7 +1090,7 @@
|
|
1285 |
loading.addClass('fancybox-ie6');
|
1286 |
wrap.addClass('fancybox-ie6');
|
1287 |
|
1288 |
-
$('<iframe id="fancybox-hide-sel-frame" src="' + (/^https/i.test(window.location.href || '') ? 'javascript:void(false)' : 'about:blank' ) + '"
|
1289 |
}
|
1290 |
};
|
1291 |
|
@@ -1295,7 +1100,6 @@
|
|
1295 |
opacity : false,
|
1296 |
modal : false,
|
1297 |
cyclic : false,
|
1298 |
-
allowfullscreen : false,
|
1299 |
scrolling : 'auto', // 'auto', 'yes' or 'no'
|
1300 |
|
1301 |
width : 560,
|
@@ -1304,13 +1108,9 @@
|
|
1304 |
autoScale : true,
|
1305 |
autoDimensions : true,
|
1306 |
centerOnScroll : false,
|
1307 |
-
autoResize : true,
|
1308 |
-
keepRatio : false,
|
1309 |
-
minViewportWidth : 0,
|
1310 |
|
1311 |
ajax : {},
|
1312 |
-
swf : { wmode: '
|
1313 |
-
svg : { wmode: 'opaque' },
|
1314 |
|
1315 |
hideOnOverlayClick : true,
|
1316 |
hideOnContentClick : false,
|
@@ -1322,7 +1122,7 @@
|
|
1322 |
titleShow : true,
|
1323 |
titlePosition : 'float', // 'float', 'outside', 'inside' or 'over'
|
1324 |
titleFormat : null,
|
1325 |
-
titleFromAlt :
|
1326 |
|
1327 |
transitionIn : 'fade', // 'elastic', 'fade' or 'none'
|
1328 |
transitionOut : 'fade', // 'elastic', 'fade' or 'none'
|
@@ -1353,4 +1153,4 @@
|
|
1353 |
$.fancybox.init();
|
1354 |
});
|
1355 |
|
1356 |
-
})(jQuery);
|
7 |
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
*
|
10 |
+
* Version: 1.3.4 (11/11/2010)
|
11 |
+
* Requires: jQuery v1.3+
|
12 |
*
|
13 |
* Dual licensed under the MIT and GPL licenses:
|
14 |
* http://www.opensource.org/licenses/mit-license.php
|
15 |
* http://www.gnu.org/licenses/gpl.html
|
16 |
*/
|
|
|
|
|
17 |
|
18 |
+
;(function($) {
|
19 |
+
var tmp, loading, overlay, wrap, outer, content, close, title, nav_left, nav_right,
|
20 |
|
21 |
+
selectedIndex = 0, selectedOpts = {}, selectedArray = [], currentIndex = 0, currentOpts = {}, currentArray = [],
|
22 |
|
23 |
+
ajaxLoader = null, imgPreloader = new Image(), imgRegExp = /\.(jpg|gif|png|bmp|jpeg)(.*)?$/i, swfRegExp = /[^\.]\.(swf)\s*$/i,
|
24 |
|
25 |
loadingTimer, loadingFrame = 1,
|
26 |
|
27 |
titleHeight = 0, titleStr = '', start_pos, final_pos, busy = false, fx = $.extend($('<div/>')[0], { prop: 0 }),
|
28 |
|
29 |
+
isIE6 = $.browser.msie && $.browser.version < 7 && !window.XMLHttpRequest,
|
|
|
|
|
30 |
|
31 |
/*
|
32 |
+
* Private methods
|
33 |
*/
|
34 |
|
35 |
_abort = function() {
|
36 |
+
loading.hide();
|
37 |
|
38 |
imgPreloader.onerror = imgPreloader.onload = null;
|
39 |
|
44 |
tmp.empty();
|
45 |
},
|
46 |
|
47 |
+
_error = function() {
|
48 |
if (false === selectedOpts.onError(selectedArray, selectedIndex, selectedOpts)) {
|
49 |
+
loading.hide();
|
50 |
busy = false;
|
51 |
return;
|
52 |
}
|
53 |
|
|
|
|
|
|
|
|
|
54 |
selectedOpts.titleShow = false;
|
55 |
|
56 |
selectedOpts.width = 'auto';
|
57 |
selectedOpts.height = 'auto';
|
58 |
|
59 |
+
tmp.html( '<p id="fancybox-error">The requested content cannot be loaded.<br />Please try again later.</p>' );
|
60 |
|
61 |
_process_inline();
|
62 |
},
|
63 |
|
64 |
_start = function() {
|
65 |
var obj = selectedArray[ selectedIndex ],
|
66 |
+
href,
|
67 |
+
type,
|
68 |
title,
|
69 |
str,
|
70 |
emb,
|
74 |
|
75 |
selectedOpts = $.extend({}, $.fn.fancybox.defaults, (typeof $(obj).data('fancybox') == 'undefined' ? selectedOpts : $(obj).data('fancybox')));
|
76 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
77 |
ret = selectedOpts.onStart(selectedArray, selectedIndex, selectedOpts);
|
78 |
|
79 |
if (ret === false) {
|
86 |
title = selectedOpts.title || (obj.nodeName ? $(obj).attr('title') : obj.title) || '';
|
87 |
|
88 |
if (obj.nodeName && !selectedOpts.orig) {
|
89 |
+
selectedOpts.orig = $(obj).children("img:first").length ? $(obj).children("img:first") : $(obj);
|
90 |
}
|
91 |
|
92 |
+
if (title === '' && selectedOpts.orig && selectedOpts.titleFromAlt) {
|
93 |
+
title = selectedOpts.orig.attr('alt');
|
94 |
}
|
95 |
|
96 |
href = selectedOpts.href || (obj.nodeName ? $(obj).attr('href') : obj.href) || null;
|
109 |
} else if (selectedOpts.content) {
|
110 |
type = 'html';
|
111 |
|
|
|
|
|
|
|
112 |
} else if (href) {
|
113 |
+
if (href.match(imgRegExp)) {
|
114 |
type = 'image';
|
115 |
|
116 |
} else if (href.match(swfRegExp)) {
|
117 |
type = 'swf';
|
118 |
|
119 |
+
} else if ($(obj).hasClass("iframe")) {
|
120 |
+
type = 'iframe';
|
|
|
|
|
|
|
121 |
|
122 |
} else if (href.indexOf("#") === 0) {
|
123 |
type = 'inline';
|
128 |
}
|
129 |
|
130 |
if (!type) {
|
131 |
+
_error();
|
132 |
return;
|
133 |
}
|
134 |
|
|
|
|
|
|
|
|
|
135 |
if (type == 'inline') {
|
136 |
obj = href.substr(href.indexOf("#"));
|
137 |
type = $(obj).length > 0 ? 'inline' : 'ajax';
|
146 |
selectedOpts.width = 'auto';
|
147 |
selectedOpts.height = 'auto';
|
148 |
} else {
|
149 |
+
selectedOpts.autoDimensions = false;
|
150 |
}
|
151 |
}
|
152 |
|
163 |
|
164 |
tmp.css('padding', (selectedOpts.padding + selectedOpts.margin));
|
165 |
|
166 |
+
$('.fancybox-inline-tmp').unbind('fancybox-cancel').bind('fancybox-change', function() {
|
167 |
+
$(this).replaceWith(content.children());
|
168 |
});
|
169 |
|
170 |
switch (type) {
|
182 |
$('<div class="fancybox-inline-tmp" />')
|
183 |
.hide()
|
184 |
.insertBefore( $(obj) )
|
185 |
+
.bind('fancybox-cleanup', function() {
|
186 |
+
$(this).replaceWith(content.children());
|
187 |
+
}).bind('fancybox-cancel', function() {
|
188 |
+
$(this).replaceWith(tmp.children());
|
189 |
});
|
190 |
|
191 |
$(obj).appendTo(tmp);
|
194 |
break;
|
195 |
|
196 |
case 'image':
|
|
|
|
|
197 |
busy = false;
|
198 |
|
199 |
$.fancybox.showActivity();
|
201 |
imgPreloader = new Image();
|
202 |
|
203 |
imgPreloader.onerror = function() {
|
204 |
+
_error();
|
205 |
};
|
206 |
|
207 |
imgPreloader.onload = function() {
|
217 |
|
218 |
case 'swf':
|
219 |
selectedOpts.scrolling = 'no';
|
|
|
220 |
|
221 |
+
str = '<object classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="' + selectedOpts.width + '" height="' + selectedOpts.height + '"><param name="movie" value="' + href + '"></param>';
|
222 |
emb = '';
|
223 |
|
224 |
$.each(selectedOpts.swf, function(name, val) {
|
233 |
_process_inline();
|
234 |
break;
|
235 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
236 |
case 'ajax':
|
237 |
busy = false;
|
238 |
|
245 |
data : selectedOpts.ajax.data || {},
|
246 |
error : function(XMLHttpRequest, textStatus, errorThrown) {
|
247 |
if ( XMLHttpRequest.status > 0 ) {
|
248 |
+
_error();
|
249 |
}
|
250 |
},
|
251 |
success : function(data, textStatus, XMLHttpRequest) {
|
255 |
ret = selectedOpts.ajax.win(href, data, textStatus, XMLHttpRequest);
|
256 |
|
257 |
if (ret === false) {
|
258 |
+
loading.hide();
|
259 |
return;
|
260 |
} else if (typeof ret == 'string' || typeof ret == 'object') {
|
261 |
data = ret;
|
262 |
}
|
263 |
}
|
264 |
|
265 |
+
tmp.html( data );
|
266 |
+
_process_inline();
|
|
|
|
|
|
|
|
|
267 |
}
|
268 |
}
|
269 |
}));
|
270 |
+
|
271 |
break;
|
272 |
|
273 |
case 'iframe':
|
|
|
|
|
|
|
|
|
|
|
274 |
_show();
|
275 |
break;
|
276 |
}
|
277 |
},
|
278 |
|
279 |
_process_inline = function() {
|
280 |
+
var
|
281 |
+
w = selectedOpts.width,
|
282 |
+
h = selectedOpts.height;
|
|
|
283 |
|
284 |
if (w.toString().indexOf('%') > -1) {
|
285 |
+
w = parseInt( ($(window).width() - (selectedOpts.margin * 2)) * parseFloat(w) / 100, 10) + 'px';
|
286 |
|
287 |
} else {
|
288 |
+
w = w == 'auto' ? 'auto' : w + 'px';
|
289 |
}
|
290 |
|
291 |
if (h.toString().indexOf('%') > -1) {
|
292 |
+
h = parseInt( ($(window).height() - (selectedOpts.margin * 2)) * parseFloat(h) / 100, 10) + 'px';
|
293 |
|
294 |
} else {
|
295 |
+
h = h == 'auto' ? 'auto' : h + 'px';
|
296 |
}
|
297 |
|
298 |
+
tmp.wrapInner('<div style="width:' + w + ';height:' + h + ';overflow: ' + (selectedOpts.scrolling == 'auto' ? 'auto' : (selectedOpts.scrolling == 'yes' ? 'scroll' : 'hidden')) + ';position:relative;"></div>');
|
299 |
|
300 |
selectedOpts.width = tmp.width();
|
301 |
selectedOpts.height = tmp.height();
|
319 |
_show = function() {
|
320 |
var pos, equal;
|
321 |
|
322 |
+
loading.hide();
|
|
|
|
|
323 |
|
324 |
if (wrap.is(":visible") && false === currentOpts.onCleanup(currentArray, currentIndex, currentOpts)) {
|
325 |
+
$.event.trigger('fancybox-cancel');
|
326 |
|
327 |
busy = false;
|
328 |
return;
|
330 |
|
331 |
busy = true;
|
332 |
|
333 |
+
$(content.add( overlay )).unbind();
|
334 |
|
335 |
+
$(window).unbind("resize.fb scroll.fb");
|
336 |
+
$(document).unbind('keydown.fb');
|
337 |
|
338 |
if (wrap.is(":visible") && currentOpts.titlePosition !== 'outside') {
|
339 |
wrap.css('height', wrap.height());
|
344 |
currentOpts = selectedOpts;
|
345 |
|
346 |
if (currentOpts.overlayShow) {
|
|
|
|
|
347 |
overlay.css({
|
348 |
'background-color' : currentOpts.overlayColor,
|
349 |
'opacity' : currentOpts.overlayOpacity,
|
359 |
this.style.visibility = 'inherit';
|
360 |
});
|
361 |
}
|
362 |
+
|
363 |
overlay.show();
|
364 |
}
|
365 |
} else {
|
389 |
content.html( tmp.contents() ).fadeTo(currentOpts.changeFade, 1, _finish);
|
390 |
};
|
391 |
|
392 |
+
$.event.trigger('fancybox-change');
|
393 |
|
394 |
content
|
395 |
.empty()
|
397 |
.css({
|
398 |
'border-width' : currentOpts.padding,
|
399 |
'width' : final_pos.width - currentOpts.padding * 2,
|
400 |
+
'height' : selectedOpts.autoDimensions ? 'auto' : final_pos.height - titleHeight - currentOpts.padding * 2
|
401 |
});
|
402 |
|
403 |
if (equal) {
|
404 |
finish_resizing();
|
405 |
+
|
406 |
} else {
|
407 |
fx.prop = 0;
|
408 |
|
445 |
return;
|
446 |
}
|
447 |
|
448 |
+
if (currentOpts.titlePosition == 'inside' && titleHeight > 0) {
|
449 |
+
title.show();
|
450 |
}
|
451 |
|
452 |
content
|
453 |
.css({
|
454 |
'width' : final_pos.width - currentOpts.padding * 2,
|
455 |
+
'height' : selectedOpts.autoDimensions ? 'auto' : final_pos.height - titleHeight - currentOpts.padding * 2
|
456 |
})
|
457 |
.html( tmp.contents() );
|
458 |
|
464 |
_format_title = function(title) {
|
465 |
if (title && title.length) {
|
466 |
if (currentOpts.titlePosition == 'float') {
|
467 |
+
return '<table id="fancybox-title-float-wrap" cellpadding="0" cellspacing="0"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">' + title + '</td><td id="fancybox-title-float-right"></td></tr></table>';
|
468 |
}
|
469 |
|
470 |
return '<div id="fancybox-title-' + currentOpts.titlePosition + '">' + title + '</div>';
|
507 |
'width' : final_pos.width - (currentOpts.padding * 2),
|
508 |
'marginLeft' : currentOpts.padding,
|
509 |
'marginRight' : currentOpts.padding
|
510 |
+
});
|
511 |
|
512 |
titleHeight = title.outerHeight(true);
|
513 |
|
514 |
+
title.appendTo( outer );
|
515 |
+
|
516 |
final_pos.height += titleHeight;
|
517 |
break;
|
518 |
|
528 |
|
529 |
case 'float':
|
530 |
title
|
531 |
+
.css('left', parseInt((title.width() - final_pos.width - 40)/ 2, 10) * -1)
|
532 |
+
.appendTo( wrap );
|
533 |
break;
|
534 |
|
535 |
default:
|
548 |
|
549 |
_set_navigation = function() {
|
550 |
if (currentOpts.enableEscapeButton || currentOpts.enableKeyboardNav) {
|
551 |
+
$(document).bind('keydown.fb', function(e) {
|
552 |
if (e.keyCode == 27 && currentOpts.enableEscapeButton) {
|
553 |
e.preventDefault();
|
554 |
$.fancybox.close();
|
555 |
+
|
556 |
} else if ((e.keyCode == 37 || e.keyCode == 39) && currentOpts.enableKeyboardNav && e.target.tagName !== 'INPUT' && e.target.tagName !== 'TEXTAREA' && e.target.tagName !== 'SELECT') {
|
557 |
e.preventDefault();
|
558 |
$.fancybox[ e.keyCode == 37 ? 'prev' : 'next']();
|
|
|
|
|
|
|
559 |
}
|
560 |
});
|
561 |
}
|
562 |
|
563 |
+
if (!currentOpts.showNavArrows) {
|
564 |
nav_left.hide();
|
565 |
nav_right.hide();
|
566 |
return;
|
577 |
|
578 |
_finish = function () {
|
579 |
if (!$.support.opacity) {
|
580 |
+
content.get(0).style.removeAttribute('filter');
|
581 |
+
wrap.get(0).style.removeAttribute('filter');
|
582 |
}
|
583 |
|
584 |
+
if (selectedOpts.autoDimensions) {
|
585 |
+
content.css('height', 'auto');
|
586 |
}
|
587 |
|
588 |
wrap.css('height', 'auto');
|
596 |
}
|
597 |
|
598 |
_set_navigation();
|
599 |
+
|
600 |
if (currentOpts.hideOnContentClick) {
|
601 |
+
content.bind('click', $.fancybox.close);
|
602 |
}
|
603 |
|
604 |
if (currentOpts.hideOnOverlayClick) {
|
605 |
+
overlay.bind('click', $.fancybox.close);
|
606 |
}
|
607 |
|
608 |
+
$(window).bind("resize.fb", $.fancybox.resize);
|
|
|
|
|
|
|
|
|
|
|
|
|
609 |
|
610 |
+
if (currentOpts.centerOnScroll) {
|
611 |
+
$(window).bind("scroll.fb", $.fancybox.center);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
612 |
}
|
613 |
|
614 |
if (currentOpts.type == 'iframe') {
|
615 |
+
$('<iframe id="fancybox-frame" name="fancybox-frame' + new Date().getTime() + '" frameborder="0" hspace="0" ' + ($.browser.msie ? 'allowtransparency="true""' : '') + ' scrolling="' + selectedOpts.scrolling + '" src="' + currentOpts.href + '"></iframe>').appendTo(content);
|
|
|
|
|
|
|
|
|
|
|
616 |
}
|
617 |
|
618 |
wrap.show();
|
623 |
|
624 |
currentOpts.onComplete(currentArray, currentIndex, currentOpts);
|
625 |
|
626 |
+
_preload_images();
|
|
|
|
|
|
|
627 |
},
|
628 |
|
629 |
+
_preload_images = function() {
|
630 |
+
var href,
|
631 |
+
objNext;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
632 |
|
633 |
+
if ((currentArray.length -1) > currentIndex) {
|
634 |
+
href = currentArray[ currentIndex + 1 ].href;
|
635 |
|
636 |
+
if (typeof href !== 'undefined' && href.match(imgRegExp)) {
|
637 |
+
objNext = new Image();
|
638 |
+
objNext.src = href;
|
|
|
|
|
639 |
}
|
640 |
}
|
641 |
|
642 |
+
if (currentIndex > 0) {
|
643 |
+
href = currentArray[ currentIndex - 1 ].href;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
644 |
|
645 |
+
if (typeof href !== 'undefined' && href.match(imgRegExp)) {
|
646 |
+
objNext = new Image();
|
647 |
+
objNext.src = href;
|
648 |
+
}
|
|
|
|
|
649 |
}
|
650 |
},
|
651 |
|
671 |
},
|
672 |
|
673 |
_get_viewport = function() {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
674 |
return [
|
675 |
+
$(window).width() - (currentOpts.margin * 2),
|
676 |
+
$(window).height() - (currentOpts.margin * 2),
|
677 |
+
$(document).scrollLeft() + currentOpts.margin,
|
678 |
+
$(document).scrollTop() + currentOpts.margin
|
679 |
];
|
680 |
},
|
681 |
|
682 |
_get_zoom_to = function () {
|
683 |
var view = _get_viewport(),
|
684 |
to = {},
|
685 |
+
resize = currentOpts.autoScale,
|
686 |
double_padding = currentOpts.padding * 2,
|
687 |
ratio;
|
688 |
|
698 |
to.height = currentOpts.height + double_padding;
|
699 |
}
|
700 |
|
701 |
+
if (resize && (to.width > view[0] || to.height > view[1])) {
|
702 |
+
if (selectedOpts.type == 'image' || selectedOpts.type == 'swf') {
|
703 |
+
ratio = (currentOpts.width ) / (currentOpts.height );
|
704 |
|
705 |
if ((to.width ) > view[0]) {
|
706 |
to.width = view[0];
|
711 |
to.height = view[1];
|
712 |
to.width = parseInt(((to.height - double_padding) * ratio) + double_padding, 10);
|
713 |
}
|
714 |
+
|
715 |
} else {
|
716 |
to.width = Math.min(to.width, view[0]);
|
717 |
to.height = Math.min(to.height, view[1]);
|
751 |
from = {
|
752 |
width : pos.width + (currentOpts.padding * 2),
|
753 |
height : pos.height + (currentOpts.padding * 2),
|
754 |
+
top : pos.top - currentOpts.padding - 20,
|
755 |
left : pos.left - currentOpts.padding - 20
|
756 |
};
|
757 |
|
761 |
from = {
|
762 |
width : currentOpts.padding * 2,
|
763 |
height : currentOpts.padding * 2,
|
764 |
+
top : parseInt(view[3] + view[1] * 0.5, 10),
|
765 |
+
left : parseInt(view[2] + view[0] * 0.5, 10)
|
766 |
};
|
767 |
}
|
768 |
|
775 |
return;
|
776 |
}
|
777 |
|
778 |
+
$('div', loading).css('top', (loadingFrame * -40) + 'px');
|
779 |
|
780 |
loadingFrame = (loadingFrame + 1) % 12;
|
781 |
};
|
782 |
|
783 |
/*
|
784 |
+
* Public methods
|
785 |
*/
|
786 |
|
787 |
$.fn.fancybox = function(options) {
|
791 |
|
792 |
$(this)
|
793 |
.data('fancybox', $.extend({}, options, ($.metadata ? $(this).metadata() : {})))
|
794 |
+
.unbind('click.fb')
|
795 |
+
.bind('click.fb', function(e) {
|
796 |
+
e.preventDefault();
|
797 |
+
|
798 |
if (busy) {
|
799 |
return;
|
800 |
}
|
808 |
|
809 |
var rel = $(this).attr('rel') || '';
|
810 |
|
811 |
+
if (!rel || rel == '' || rel === 'nofollow') {
|
812 |
selectedArray.push(this);
|
813 |
+
|
814 |
} else {
|
815 |
+
selectedArray = $("a[rel=" + rel + "], area[rel=" + rel + "]");
|
816 |
selectedIndex = selectedArray.index( this );
|
817 |
}
|
818 |
|
819 |
+
_start();
|
820 |
|
821 |
return;
|
822 |
});
|
837 |
selectedArray = [];
|
838 |
selectedIndex = parseInt(opts.index, 10) || 0;
|
839 |
|
840 |
+
if ($.isArray(obj)) {
|
841 |
for (var i = 0, j = obj.length; i < j; i++) {
|
842 |
if (typeof obj[i] == 'object') {
|
843 |
$(obj[i]).data('fancybox', $.extend({}, opts, obj[i]));
|
849 |
selectedArray = jQuery.merge(selectedArray, obj);
|
850 |
|
851 |
} else {
|
852 |
+
if (typeof obj == 'object') {
|
853 |
$(obj).data('fancybox', $.extend({}, opts, obj));
|
854 |
} else {
|
855 |
obj = $({}).data('fancybox', $.extend({content : obj}, opts));
|
869 |
clearInterval(loadingTimer);
|
870 |
|
871 |
loading.show();
|
872 |
+
loadingTimer = setInterval(_animate_loading, 66);
|
873 |
};
|
874 |
|
875 |
$.fancybox.hideActivity = function() {
|
877 |
};
|
878 |
|
879 |
$.fancybox.next = function() {
|
880 |
+
return $.fancybox.pos( currentIndex + 1);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
881 |
};
|
882 |
|
883 |
$.fancybox.prev = function() {
|
884 |
+
return $.fancybox.pos( currentIndex - 1);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
885 |
};
|
886 |
|
887 |
$.fancybox.pos = function(pos) {
|
896 |
if (pos > -1 && pos < currentArray.length) {
|
897 |
selectedIndex = pos;
|
898 |
_start();
|
899 |
+
|
900 |
+
} else if (currentOpts.cyclic && currentArray.length > 1) {
|
901 |
+
selectedIndex = pos >= currentArray.length ? 0 : currentArray.length - 1;
|
902 |
+
_start();
|
903 |
}
|
904 |
|
905 |
return;
|
912 |
|
913 |
busy = true;
|
914 |
|
915 |
+
$.event.trigger('fancybox-cancel');
|
916 |
|
917 |
_abort();
|
918 |
|
938 |
|
939 |
$(close.add( nav_left ).add( nav_right )).hide();
|
940 |
|
941 |
+
$(content.add( overlay )).unbind();
|
942 |
|
943 |
+
$(window).unbind("resize.fb scroll.fb");
|
944 |
+
$(document).unbind('keydown.fb');
|
945 |
|
946 |
+
content.find('iframe').attr('src', isIE6 && /^https/i.test(window.location.href || '') ? 'javascript:void(false)' : 'about:blank');
|
|
|
947 |
|
948 |
if (currentOpts.titlePosition !== 'inside') {
|
949 |
title.empty();
|
957 |
title.empty().hide();
|
958 |
wrap.hide();
|
959 |
|
960 |
+
$.event.trigger('fancybox-cleanup');
|
961 |
|
962 |
content.empty();
|
963 |
|
976 |
var pos = wrap.position();
|
977 |
|
978 |
final_pos = {
|
979 |
+
top : pos.top ,
|
980 |
left : pos.left,
|
981 |
width : wrap.width(),
|
982 |
height : wrap.height()
|
1000 |
} else {
|
1001 |
wrap.fadeOut( currentOpts.transitionOut == 'none' ? 0 : currentOpts.speedOut, _cleanup);
|
1002 |
}
|
|
|
|
|
1003 |
};
|
1004 |
|
1005 |
$.fancybox.resize = function() {
|
1006 |
+
if (overlay.is(':visible')) {
|
1007 |
+
overlay.css('height', $(document).height());
|
1008 |
+
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1009 |
|
1010 |
+
$.fancybox.center(true);
|
|
|
|
|
|
|
|
|
|
|
|
|
1011 |
};
|
1012 |
|
1013 |
$.fancybox.center = function() {
|
1014 |
var view, align;
|
1015 |
|
1016 |
if (busy) {
|
1017 |
+
return;
|
1018 |
}
|
1019 |
|
1020 |
align = arguments[0] === true ? 1 : 0;
|
1021 |
+
view = _get_viewport();
|
1022 |
|
1023 |
+
if (!align && (wrap.width() > view[0] || wrap.height() > view[1])) {
|
1024 |
+
return;
|
1025 |
}
|
1026 |
|
1027 |
wrap
|
1029 |
.animate({
|
1030 |
'top' : parseInt(Math.max(view[3] - 20, view[3] + ((view[1] - content.height() - 40) * 0.5) - currentOpts.padding)),
|
1031 |
'left' : parseInt(Math.max(view[2] - 20, view[2] + ((view[0] - content.width() - 40) * 0.5) - currentOpts.padding))
|
1032 |
+
}, typeof arguments[0] == 'number' ? arguments[0] : 200);
|
1033 |
};
|
1034 |
|
1035 |
$.fancybox.init = function() {
|
1053 |
close = $('<a id="fancybox-close"></a>'),
|
1054 |
title = $('<div id="fancybox-title"></div>'),
|
1055 |
|
1056 |
+
nav_left = $('<a href="javascript:;" id="fancybox-left"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),
|
1057 |
+
nav_right = $('<a href="javascript:;" id="fancybox-right"><span class="fancy-ico" id="fancybox-right-ico"></span></a>')
|
1058 |
);
|
1059 |
|
1060 |
close.click($.fancybox.close);
|
1070 |
$.fancybox.next();
|
1071 |
});
|
1072 |
|
1073 |
+
if ($.fn.mousewheel) {
|
1074 |
+
wrap.bind('mousewheel.fb', function(e, delta) {
|
1075 |
+
if (busy) {
|
1076 |
+
e.preventDefault();
|
1077 |
+
|
1078 |
+
} else if ($(e.target).get(0).clientHeight == 0 || $(e.target).get(0).scrollHeight === $(e.target).get(0).clientHeight) {
|
1079 |
+
e.preventDefault();
|
1080 |
+
$.fancybox[ delta > 0 ? 'prev' : 'next']();
|
1081 |
+
}
|
1082 |
+
});
|
1083 |
+
}
|
1084 |
+
|
1085 |
if (!$.support.opacity) {
|
1086 |
wrap.addClass('fancybox-ie');
|
1087 |
}
|
1090 |
loading.addClass('fancybox-ie6');
|
1091 |
wrap.addClass('fancybox-ie6');
|
1092 |
|
1093 |
+
$('<iframe id="fancybox-hide-sel-frame" src="' + (/^https/i.test(window.location.href || '') ? 'javascript:void(false)' : 'about:blank' ) + '" scrolling="no" border="0" frameborder="0" tabindex="-1"></iframe>').prependTo(outer);
|
1094 |
}
|
1095 |
};
|
1096 |
|
1100 |
opacity : false,
|
1101 |
modal : false,
|
1102 |
cyclic : false,
|
|
|
1103 |
scrolling : 'auto', // 'auto', 'yes' or 'no'
|
1104 |
|
1105 |
width : 560,
|
1108 |
autoScale : true,
|
1109 |
autoDimensions : true,
|
1110 |
centerOnScroll : false,
|
|
|
|
|
|
|
1111 |
|
1112 |
ajax : {},
|
1113 |
+
swf : { wmode: 'transparent' },
|
|
|
1114 |
|
1115 |
hideOnOverlayClick : true,
|
1116 |
hideOnContentClick : false,
|
1122 |
titleShow : true,
|
1123 |
titlePosition : 'float', // 'float', 'outside', 'inside' or 'over'
|
1124 |
titleFormat : null,
|
1125 |
+
titleFromAlt : false,
|
1126 |
|
1127 |
transitionIn : 'fade', // 'elastic', 'fade' or 'none'
|
1128 |
transitionOut : 'fade', // 'elastic', 'fade' or 'none'
|
1153 |
$.fancybox.init();
|
1154 |
});
|
1155 |
|
1156 |
+
})(jQuery);
|
vendor/fancybox-1.3.4/jquery.fancybox-1.3.4.pack.js
ADDED
@@ -0,0 +1,46 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*
|
2 |
+
* FancyBox - jQuery Plugin
|
3 |
+
* Simple and fancy lightbox alternative
|
4 |
+
*
|
5 |
+
* Examples and documentation at: http://fancybox.net
|
6 |
+
*
|
7 |
+
* Copyright (c) 2008 - 2010 Janis Skarnelis
|
8 |
+
* That said, it is hardly a one-person project. Many people have submitted bugs, code, and offered their advice freely. Their support is greatly appreciated.
|
9 |
+
*
|
10 |
+
* Version: 1.3.4 (11/11/2010)
|
11 |
+
* Requires: jQuery v1.3+
|
12 |
+
*
|
13 |
+
* Dual licensed under the MIT and GPL licenses:
|
14 |
+
* http://www.opensource.org/licenses/mit-license.php
|
15 |
+
* http://www.gnu.org/licenses/gpl.html
|
16 |
+
*/
|
17 |
+
|
18 |
+
;(function(b){var m,t,u,f,D,j,E,n,z,A,q=0,e={},o=[],p=0,d={},l=[],G=null,v=new Image,J=/\.(jpg|gif|png|bmp|jpeg)(.*)?$/i,W=/[^\.]\.(swf)\s*$/i,K,L=1,y=0,s="",r,i,h=false,B=b.extend(b("<div/>")[0],{prop:0}),M=b.browser.msie&&b.browser.version<7&&!window.XMLHttpRequest,N=function(){t.hide();v.onerror=v.onload=null;G&&G.abort();m.empty()},O=function(){if(false===e.onError(o,q,e)){t.hide();h=false}else{e.titleShow=false;e.width="auto";e.height="auto";m.html('<p id="fancybox-error">The requested content cannot be loaded.<br />Please try again later.</p>');
|
19 |
+
F()}},I=function(){var a=o[q],c,g,k,C,P,w;N();e=b.extend({},b.fn.fancybox.defaults,typeof b(a).data("fancybox")=="undefined"?e:b(a).data("fancybox"));w=e.onStart(o,q,e);if(w===false)h=false;else{if(typeof w=="object")e=b.extend(e,w);k=e.title||(a.nodeName?b(a).attr("title"):a.title)||"";if(a.nodeName&&!e.orig)e.orig=b(a).children("img:first").length?b(a).children("img:first"):b(a);if(k===""&&e.orig&&e.titleFromAlt)k=e.orig.attr("alt");c=e.href||(a.nodeName?b(a).attr("href"):a.href)||null;if(/^(?:javascript)/i.test(c)||
|
20 |
+
c=="#")c=null;if(e.type){g=e.type;if(!c)c=e.content}else if(e.content)g="html";else if(c)g=c.match(J)?"image":c.match(W)?"swf":b(a).hasClass("iframe")?"iframe":c.indexOf("#")===0?"inline":"ajax";if(g){if(g=="inline"){a=c.substr(c.indexOf("#"));g=b(a).length>0?"inline":"ajax"}e.type=g;e.href=c;e.title=k;if(e.autoDimensions)if(e.type=="html"||e.type=="inline"||e.type=="ajax"){e.width="auto";e.height="auto"}else e.autoDimensions=false;if(e.modal){e.overlayShow=true;e.hideOnOverlayClick=false;e.hideOnContentClick=
|
21 |
+
false;e.enableEscapeButton=false;e.showCloseButton=false}e.padding=parseInt(e.padding,10);e.margin=parseInt(e.margin,10);m.css("padding",e.padding+e.margin);b(".fancybox-inline-tmp").unbind("fancybox-cancel").bind("fancybox-change",function(){b(this).replaceWith(j.children())});switch(g){case "html":m.html(e.content);F();break;case "inline":if(b(a).parent().is("#fancybox-content")===true){h=false;break}b('<div class="fancybox-inline-tmp" />').hide().insertBefore(b(a)).bind("fancybox-cleanup",function(){b(this).replaceWith(j.children())}).bind("fancybox-cancel",
|
22 |
+
function(){b(this).replaceWith(m.children())});b(a).appendTo(m);F();break;case "image":h=false;b.fancybox.showActivity();v=new Image;v.onerror=function(){O()};v.onload=function(){h=true;v.onerror=v.onload=null;e.width=v.width;e.height=v.height;b("<img />").attr({id:"fancybox-img",src:v.src,alt:e.title}).appendTo(m);Q()};v.src=c;break;case "swf":e.scrolling="no";C='<object classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000" width="'+e.width+'" height="'+e.height+'"><param name="movie" value="'+c+
|
23 |
+
'"></param>';P="";b.each(e.swf,function(x,H){C+='<param name="'+x+'" value="'+H+'"></param>';P+=" "+x+'="'+H+'"'});C+='<embed src="'+c+'" type="application/x-shockwave-flash" width="'+e.width+'" height="'+e.height+'"'+P+"></embed></object>";m.html(C);F();break;case "ajax":h=false;b.fancybox.showActivity();e.ajax.win=e.ajax.success;G=b.ajax(b.extend({},e.ajax,{url:c,data:e.ajax.data||{},error:function(x){x.status>0&&O()},success:function(x,H,R){if((typeof R=="object"?R:G).status==200){if(typeof e.ajax.win==
|
24 |
+
"function"){w=e.ajax.win(c,x,H,R);if(w===false){t.hide();return}else if(typeof w=="string"||typeof w=="object")x=w}m.html(x);F()}}}));break;case "iframe":Q()}}else O()}},F=function(){var a=e.width,c=e.height;a=a.toString().indexOf("%")>-1?parseInt((b(window).width()-e.margin*2)*parseFloat(a)/100,10)+"px":a=="auto"?"auto":a+"px";c=c.toString().indexOf("%")>-1?parseInt((b(window).height()-e.margin*2)*parseFloat(c)/100,10)+"px":c=="auto"?"auto":c+"px";m.wrapInner('<div style="width:'+a+";height:"+c+
|
25 |
+
";overflow: "+(e.scrolling=="auto"?"auto":e.scrolling=="yes"?"scroll":"hidden")+';position:relative;"></div>');e.width=m.width();e.height=m.height();Q()},Q=function(){var a,c;t.hide();if(f.is(":visible")&&false===d.onCleanup(l,p,d)){b.event.trigger("fancybox-cancel");h=false}else{h=true;b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");f.is(":visible")&&d.titlePosition!=="outside"&&f.css("height",f.height());l=o;p=q;d=e;if(d.overlayShow){u.css({"background-color":d.overlayColor,
|
26 |
+
opacity:d.overlayOpacity,cursor:d.hideOnOverlayClick?"pointer":"auto",height:b(document).height()});if(!u.is(":visible")){M&&b("select:not(#fancybox-tmp select)").filter(function(){return this.style.visibility!=="hidden"}).css({visibility:"hidden"}).one("fancybox-cleanup",function(){this.style.visibility="inherit"});u.show()}}else u.hide();i=X();s=d.title||"";y=0;n.empty().removeAttr("style").removeClass();if(d.titleShow!==false){if(b.isFunction(d.titleFormat))a=d.titleFormat(s,l,p,d);else a=s&&s.length?
|
27 |
+
d.titlePosition=="float"?'<table id="fancybox-title-float-wrap" cellpadding="0" cellspacing="0"><tr><td id="fancybox-title-float-left"></td><td id="fancybox-title-float-main">'+s+'</td><td id="fancybox-title-float-right"></td></tr></table>':'<div id="fancybox-title-'+d.titlePosition+'">'+s+"</div>":false;s=a;if(!(!s||s==="")){n.addClass("fancybox-title-"+d.titlePosition).html(s).appendTo("body").show();switch(d.titlePosition){case "inside":n.css({width:i.width-d.padding*2,marginLeft:d.padding,marginRight:d.padding});
|
28 |
+
y=n.outerHeight(true);n.appendTo(D);i.height+=y;break;case "over":n.css({marginLeft:d.padding,width:i.width-d.padding*2,bottom:d.padding}).appendTo(D);break;case "float":n.css("left",parseInt((n.width()-i.width-40)/2,10)*-1).appendTo(f);break;default:n.css({width:i.width-d.padding*2,paddingLeft:d.padding,paddingRight:d.padding}).appendTo(f)}}}n.hide();if(f.is(":visible")){b(E.add(z).add(A)).hide();a=f.position();r={top:a.top,left:a.left,width:f.width(),height:f.height()};c=r.width==i.width&&r.height==
|
29 |
+
i.height;j.fadeTo(d.changeFade,0.3,function(){var g=function(){j.html(m.contents()).fadeTo(d.changeFade,1,S)};b.event.trigger("fancybox-change");j.empty().removeAttr("filter").css({"border-width":d.padding,width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2});if(c)g();else{B.prop=0;b(B).animate({prop:1},{duration:d.changeSpeed,easing:d.easingChange,step:T,complete:g})}})}else{f.removeAttr("style");j.css("border-width",d.padding);if(d.transitionIn=="elastic"){r=V();j.html(m.contents());
|
30 |
+
f.show();if(d.opacity)i.opacity=0;B.prop=0;b(B).animate({prop:1},{duration:d.speedIn,easing:d.easingIn,step:T,complete:S})}else{d.titlePosition=="inside"&&y>0&&n.show();j.css({width:i.width-d.padding*2,height:e.autoDimensions?"auto":i.height-y-d.padding*2}).html(m.contents());f.css(i).fadeIn(d.transitionIn=="none"?0:d.speedIn,S)}}}},Y=function(){if(d.enableEscapeButton||d.enableKeyboardNav)b(document).bind("keydown.fb",function(a){if(a.keyCode==27&&d.enableEscapeButton){a.preventDefault();b.fancybox.close()}else if((a.keyCode==
|
31 |
+
37||a.keyCode==39)&&d.enableKeyboardNav&&a.target.tagName!=="INPUT"&&a.target.tagName!=="TEXTAREA"&&a.target.tagName!=="SELECT"){a.preventDefault();b.fancybox[a.keyCode==37?"prev":"next"]()}});if(d.showNavArrows){if(d.cyclic&&l.length>1||p!==0)z.show();if(d.cyclic&&l.length>1||p!=l.length-1)A.show()}else{z.hide();A.hide()}},S=function(){if(!b.support.opacity){j.get(0).style.removeAttribute("filter");f.get(0).style.removeAttribute("filter")}e.autoDimensions&&j.css("height","auto");f.css("height","auto");
|
32 |
+
s&&s.length&&n.show();d.showCloseButton&&E.show();Y();d.hideOnContentClick&&j.bind("click",b.fancybox.close);d.hideOnOverlayClick&&u.bind("click",b.fancybox.close);b(window).bind("resize.fb",b.fancybox.resize);d.centerOnScroll&&b(window).bind("scroll.fb",b.fancybox.center);if(d.type=="iframe")b('<iframe id="fancybox-frame" name="fancybox-frame'+(new Date).getTime()+'" frameborder="0" hspace="0" '+(b.browser.msie?'allowtransparency="true""':"")+' scrolling="'+e.scrolling+'" src="'+d.href+'"></iframe>').appendTo(j);
|
33 |
+
f.show();h=false;b.fancybox.center();d.onComplete(l,p,d);var a,c;if(l.length-1>p){a=l[p+1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}if(p>0){a=l[p-1].href;if(typeof a!=="undefined"&&a.match(J)){c=new Image;c.src=a}}},T=function(a){var c={width:parseInt(r.width+(i.width-r.width)*a,10),height:parseInt(r.height+(i.height-r.height)*a,10),top:parseInt(r.top+(i.top-r.top)*a,10),left:parseInt(r.left+(i.left-r.left)*a,10)};if(typeof i.opacity!=="undefined")c.opacity=a<0.5?0.5:a;f.css(c);
|
34 |
+
j.css({width:c.width-d.padding*2,height:c.height-y*a-d.padding*2})},U=function(){return[b(window).width()-d.margin*2,b(window).height()-d.margin*2,b(document).scrollLeft()+d.margin,b(document).scrollTop()+d.margin]},X=function(){var a=U(),c={},g=d.autoScale,k=d.padding*2;c.width=d.width.toString().indexOf("%")>-1?parseInt(a[0]*parseFloat(d.width)/100,10):d.width+k;c.height=d.height.toString().indexOf("%")>-1?parseInt(a[1]*parseFloat(d.height)/100,10):d.height+k;if(g&&(c.width>a[0]||c.height>a[1]))if(e.type==
|
35 |
+
"image"||e.type=="swf"){g=d.width/d.height;if(c.width>a[0]){c.width=a[0];c.height=parseInt((c.width-k)/g+k,10)}if(c.height>a[1]){c.height=a[1];c.width=parseInt((c.height-k)*g+k,10)}}else{c.width=Math.min(c.width,a[0]);c.height=Math.min(c.height,a[1])}c.top=parseInt(Math.max(a[3]-20,a[3]+(a[1]-c.height-40)*0.5),10);c.left=parseInt(Math.max(a[2]-20,a[2]+(a[0]-c.width-40)*0.5),10);return c},V=function(){var a=e.orig?b(e.orig):false,c={};if(a&&a.length){c=a.offset();c.top+=parseInt(a.css("paddingTop"),
|
36 |
+
10)||0;c.left+=parseInt(a.css("paddingLeft"),10)||0;c.top+=parseInt(a.css("border-top-width"),10)||0;c.left+=parseInt(a.css("border-left-width"),10)||0;c.width=a.width();c.height=a.height();c={width:c.width+d.padding*2,height:c.height+d.padding*2,top:c.top-d.padding-20,left:c.left-d.padding-20}}else{a=U();c={width:d.padding*2,height:d.padding*2,top:parseInt(a[3]+a[1]*0.5,10),left:parseInt(a[2]+a[0]*0.5,10)}}return c},Z=function(){if(t.is(":visible")){b("div",t).css("top",L*-40+"px");L=(L+1)%12}else clearInterval(K)};
|
37 |
+
b.fn.fancybox=function(a){if(!b(this).length)return this;b(this).data("fancybox",b.extend({},a,b.metadata?b(this).metadata():{})).unbind("click.fb").bind("click.fb",function(c){c.preventDefault();if(!h){h=true;b(this).blur();o=[];q=0;c=b(this).attr("rel")||"";if(!c||c==""||c==="nofollow")o.push(this);else{o=b("a[rel="+c+"], area[rel="+c+"]");q=o.index(this)}I()}});return this};b.fancybox=function(a,c){var g;if(!h){h=true;g=typeof c!=="undefined"?c:{};o=[];q=parseInt(g.index,10)||0;if(b.isArray(a)){for(var k=
|
38 |
+
0,C=a.length;k<C;k++)if(typeof a[k]=="object")b(a[k]).data("fancybox",b.extend({},g,a[k]));else a[k]=b({}).data("fancybox",b.extend({content:a[k]},g));o=jQuery.merge(o,a)}else{if(typeof a=="object")b(a).data("fancybox",b.extend({},g,a));else a=b({}).data("fancybox",b.extend({content:a},g));o.push(a)}if(q>o.length||q<0)q=0;I()}};b.fancybox.showActivity=function(){clearInterval(K);t.show();K=setInterval(Z,66)};b.fancybox.hideActivity=function(){t.hide()};b.fancybox.next=function(){return b.fancybox.pos(p+
|
39 |
+
1)};b.fancybox.prev=function(){return b.fancybox.pos(p-1)};b.fancybox.pos=function(a){if(!h){a=parseInt(a);o=l;if(a>-1&&a<l.length){q=a;I()}else if(d.cyclic&&l.length>1){q=a>=l.length?0:l.length-1;I()}}};b.fancybox.cancel=function(){if(!h){h=true;b.event.trigger("fancybox-cancel");N();e.onCancel(o,q,e);h=false}};b.fancybox.close=function(){function a(){u.fadeOut("fast");n.empty().hide();f.hide();b.event.trigger("fancybox-cleanup");j.empty();d.onClosed(l,p,d);l=e=[];p=q=0;d=e={};h=false}if(!(h||f.is(":hidden"))){h=
|
40 |
+
true;if(d&&false===d.onCleanup(l,p,d))h=false;else{N();b(E.add(z).add(A)).hide();b(j.add(u)).unbind();b(window).unbind("resize.fb scroll.fb");b(document).unbind("keydown.fb");j.find("iframe").attr("src",M&&/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank");d.titlePosition!=="inside"&&n.empty();f.stop();if(d.transitionOut=="elastic"){r=V();var c=f.position();i={top:c.top,left:c.left,width:f.width(),height:f.height()};if(d.opacity)i.opacity=1;n.empty().hide();B.prop=1;
|
41 |
+
b(B).animate({prop:0},{duration:d.speedOut,easing:d.easingOut,step:T,complete:a})}else f.fadeOut(d.transitionOut=="none"?0:d.speedOut,a)}}};b.fancybox.resize=function(){u.is(":visible")&&u.css("height",b(document).height());b.fancybox.center(true)};b.fancybox.center=function(a){var c,g;if(!h){g=a===true?1:0;c=U();!g&&(f.width()>c[0]||f.height()>c[1])||f.stop().animate({top:parseInt(Math.max(c[3]-20,c[3]+(c[1]-j.height()-40)*0.5-d.padding)),left:parseInt(Math.max(c[2]-20,c[2]+(c[0]-j.width()-40)*0.5-
|
42 |
+
d.padding))},typeof a=="number"?a:200)}};b.fancybox.init=function(){if(!b("#fancybox-wrap").length){b("body").append(m=b('<div id="fancybox-tmp"></div>'),t=b('<div id="fancybox-loading"><div></div></div>'),u=b('<div id="fancybox-overlay"></div>'),f=b('<div id="fancybox-wrap"></div>'));D=b('<div id="fancybox-outer"></div>').append('<div class="fancybox-bg" id="fancybox-bg-n"></div><div class="fancybox-bg" id="fancybox-bg-ne"></div><div class="fancybox-bg" id="fancybox-bg-e"></div><div class="fancybox-bg" id="fancybox-bg-se"></div><div class="fancybox-bg" id="fancybox-bg-s"></div><div class="fancybox-bg" id="fancybox-bg-sw"></div><div class="fancybox-bg" id="fancybox-bg-w"></div><div class="fancybox-bg" id="fancybox-bg-nw"></div>').appendTo(f);
|
43 |
+
D.append(j=b('<div id="fancybox-content"></div>'),E=b('<a id="fancybox-close"></a>'),n=b('<div id="fancybox-title"></div>'),z=b('<a href="javascript:;" id="fancybox-left"><span class="fancy-ico" id="fancybox-left-ico"></span></a>'),A=b('<a href="javascript:;" id="fancybox-right"><span class="fancy-ico" id="fancybox-right-ico"></span></a>'));E.click(b.fancybox.close);t.click(b.fancybox.cancel);z.click(function(a){a.preventDefault();b.fancybox.prev()});A.click(function(a){a.preventDefault();b.fancybox.next()});
|
44 |
+
b.fn.mousewheel&&f.bind("mousewheel.fb",function(a,c){if(h)a.preventDefault();else if(b(a.target).get(0).clientHeight==0||b(a.target).get(0).scrollHeight===b(a.target).get(0).clientHeight){a.preventDefault();b.fancybox[c>0?"prev":"next"]()}});b.support.opacity||f.addClass("fancybox-ie");if(M){t.addClass("fancybox-ie6");f.addClass("fancybox-ie6");b('<iframe id="fancybox-hide-sel-frame" src="'+(/^https/i.test(window.location.href||"")?"javascript:void(false)":"about:blank")+'" scrolling="no" border="0" frameborder="0" tabindex="-1"></iframe>').prependTo(D)}}};
|
45 |
+
b.fn.fancybox.defaults={padding:10,margin:40,opacity:false,modal:false,cyclic:false,scrolling:"auto",width:560,height:340,autoScale:true,autoDimensions:true,centerOnScroll:false,ajax:{},swf:{wmode:"transparent"},hideOnOverlayClick:true,hideOnContentClick:false,overlayShow:true,overlayOpacity:0.7,overlayColor:"#777",titleShow:true,titlePosition:"float",titleFormat:null,titleFromAlt:false,transitionIn:"fade",transitionOut:"fade",speedIn:300,speedOut:300,changeSpeed:300,changeFade:"fast",easingIn:"swing",
|
46 |
+
easingOut:"swing",showCloseButton:true,showNavArrows:true,enableEscapeButton:true,enableKeyboardNav:true,onStart:function(){},onCancel:function(){},onComplete:function(){},onCleanup:function(){},onClosed:function(){},onError:function(){}};b(document).ready(function(){b.fancybox.init()})})(jQuery);
|
vendor/fancybox-2.1.7/.gitattributes
ADDED
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
# Auto detect text files and perform LF normalization
|
2 |
+
* text=auto
|
3 |
+
|
4 |
+
# Denote all files that are truly binary and should not be modified.
|
5 |
+
*.png binary
|
6 |
+
*.jpg binary
|
7 |
+
*.gif binary
|
vendor/fancybox-2.1.7/.gitignore
ADDED
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
1 |
+
.project
|
2 |
+
.settings
|
3 |
+
dist/
|
vendor/fancybox-2.1.7/CHANGELOG.md
ADDED
@@ -0,0 +1,125 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
fancyBox - Changelog
|
2 |
+
=========
|
3 |
+
|
4 |
+
### Version 2.1.5 - June 14, 2013
|
5 |
+
* Fixed #493 - Broken slideshow
|
6 |
+
* Fixed #556 - Parent option
|
7 |
+
* Retina graphics (#564) and retina display support (#420)
|
8 |
+
* Improved "lock" feature
|
9 |
+
|
10 |
+
### Version 2.1.4 - January 10, 2013
|
11 |
+
* Update to be compatible with jQuery v1.9
|
12 |
+
* Small changes that should fix usability issues for certain users
|
13 |
+
|
14 |
+
### Version 2.1.3 - October 23, 2012
|
15 |
+
|
16 |
+
* Fixed #426 - Broken IE7
|
17 |
+
* Fixed #423 - Background flickering on iOS
|
18 |
+
* Fixed #418 - Automatically Grow/Shrink and Center
|
19 |
+
* Updated the script to work with jQuery 1.6
|
20 |
+
* Media helper supports YouTube video series
|
21 |
+
|
22 |
+
### Version 2.1.2 - October 15, 2012
|
23 |
+
|
24 |
+
* Fixed #414 - Don't allow nextClick if there is only one item
|
25 |
+
* Fixed #397 - Button helper 'Menu' not visible in IE7
|
26 |
+
* Overlay can be opened/closed manually:
|
27 |
+
* $.fancybox.helpers.overlay.open();
|
28 |
+
* $.fancybox.helpers.overlay.open({closeClick : false});
|
29 |
+
* $.fancybox.helpers.overlay.close();
|
30 |
+
* Optimized for Internet Explorer 10 (Windows 8)
|
31 |
+
|
32 |
+
### Version 2.1.1 - October 01, 2012
|
33 |
+
|
34 |
+
* Fixed #357 - Converting values like 'auto' in getScalar()
|
35 |
+
* Fixed #358 - Updated overlay background image
|
36 |
+
* New "fancybox-href" and "fancybox-title" HTML5 data-attributes (#317)
|
37 |
+
* Improved helpers:
|
38 |
+
* - now they can have a property 'defaults' that contains default settings
|
39 |
+
* - updated vimeo and youtube parsers for media helper
|
40 |
+
* Content locking now can be turned off
|
41 |
+
|
42 |
+
### Version 2.1.0 - August 20, 2012
|
43 |
+
|
44 |
+
* Fixed #103 - DOM element re-injection after closing
|
45 |
+
* Fixed #188 - navigation keys inside editable content
|
46 |
+
* New animation directions (see https://github.com/fancyapps/fancyBox/issues/233#issuecomment-5512453)
|
47 |
+
* New option "iframe" - it is now possible to separate scrolling for iframe and wrapping element; choose to preload
|
48 |
+
* New option "swf" - brings back functionality from fancyBox v1
|
49 |
+
* Improved media helper - better support for vimeo and youtube; links are now configurable
|
50 |
+
* Rewritten overlay helper:
|
51 |
+
* - new option "showEarly" - toggles if should be open before of after content is loaded
|
52 |
+
* - Facebook-style (https://github.com/fancyapps/fancyBox/issues/24) and therefore uses image for background
|
53 |
+
* Option "padding" accepts array (e.g., padding: [15, 50, 10, 5])
|
54 |
+
* One of dimensions (width or height) can now be set to "auto" (option "autoSize" needs to be "false")
|
55 |
+
* Updated callbacks:
|
56 |
+
* - "beforeClose" is now called only once
|
57 |
+
* - "afterLoad" receives current and previous object as arguments
|
58 |
+
* Method "$.fancybox.update();" recalculates content width/height
|
59 |
+
* Updated to work with jQuery v1.8
|
60 |
+
|
61 |
+
### Version 2.0.6 - April 16, 2012
|
62 |
+
|
63 |
+
* Fixed #188 - keystrokes in contenteditable
|
64 |
+
* Fixed #171 - non-images should not be preloaded
|
65 |
+
* Fixed #158 - 'closeClick: true' breaks gallery navigation
|
66 |
+
* New "media" helper - detects and displays various media types
|
67 |
+
* New option "groupAttr" - name of group selector attribute, default is "data-fancybox-group"
|
68 |
+
* New feature - selector expressions in URLs, see #170
|
69 |
+
* Improved 'overlay' helper to use "position: fixed"
|
70 |
+
* Improved autoSize, fixed wrong height in some cases
|
71 |
+
* Improved centering and iframe scrolling for iOS
|
72 |
+
* Updated markup, new element '.fancybox-skin' is now used for styling
|
73 |
+
|
74 |
+
### Version 2.0.5 - February 21, 2012
|
75 |
+
|
76 |
+
* Fixed #155 - easing for prev/next animations
|
77 |
+
* Fixed #153 - overriding "keys" options
|
78 |
+
* Fixed #147 - IE7 problem with #hash links
|
79 |
+
* Fixed #130 - changing dynamically data-fancybox-group
|
80 |
+
* Fixed #126 - obey minWidth/minHeight
|
81 |
+
* Fixed #118 - placement of loading icon and navigation arrows
|
82 |
+
* Fixed #101 - "index" option not working
|
83 |
+
* Fixed #94 - "orig" option not working
|
84 |
+
* Fixed #80 - does not work on IE6
|
85 |
+
* Fixed #72 - can't set overlay opacity to 0
|
86 |
+
* Fixed #63 - properly set gallery index
|
87 |
+
* New option "autoCenter" - toggles centering on window resize or scroll, disabled for mobile devices by default
|
88 |
+
* New option "autoResize" - toggles responsivity, disabled for mobile devices by default
|
89 |
+
* New option "preload" - number of images to preload
|
90 |
+
* New feature to target mobile/desktop browsers using CSS, see #108
|
91 |
+
* Changed ajax option defaults to "{ dataType: 'html', headers: { 'X-fancyBox': true } }", see #150 and #128
|
92 |
+
* Updated loading icon for IE7, IE8
|
93 |
+
* Calculates height of the iframe if 'autoSize' is set to 'true' and the iframe is on the same domain as the main page
|
94 |
+
|
95 |
+
### Version 2.0.4 - December 12, 2011
|
96 |
+
|
97 |
+
* Fixed #47 - fix overriding properties
|
98 |
+
* New option "position" to thumbnail and button helpers
|
99 |
+
|
100 |
+
|
101 |
+
### Version 2.0.3 - November 29, 2011
|
102 |
+
|
103 |
+
* Fixed #29 - broken elastic transitions
|
104 |
+
|
105 |
+
|
106 |
+
### Version 2.0.2 - November 28, 2011
|
107 |
+
|
108 |
+
* Fixed slideshow
|
109 |
+
* Fixed scrollbars issue when displayed a very tall image
|
110 |
+
* New option "nextClick" - navigate to next gallery item when user clicks the content
|
111 |
+
* New option "modal" - to disable navigation and closing
|
112 |
+
* Add 'metadata' plugin support
|
113 |
+
* Add ability to create groups using 'data-fancybox-group' attribute
|
114 |
+
* Updated manual usage to match earlier releases
|
115 |
+
|
116 |
+
|
117 |
+
### Version 2.0.1 - November 23, 2011
|
118 |
+
|
119 |
+
* Fixed keyboard events inside form elements
|
120 |
+
* Fixed manual usage
|
121 |
+
|
122 |
+
|
123 |
+
### Version 2.0.0 - November 21, 2011
|
124 |
+
|
125 |
+
First release - completely rewritten, many new features and updated graphics.
|
vendor/fancybox-2.1.7/README.md
ADDED
@@ -0,0 +1,244 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
fancyBox
|
2 |
+
========
|
3 |
+
|
4 |
+
fancyBox is a tool that offers a nice and elegant way to add zooming functionality for images, html content and multi-media on your webpages.
|
5 |
+
|
6 |
+
More information and examples: http://www.fancyapps.com/fancybox/
|
7 |
+
|
8 |
+
License: http://www.fancyapps.com/fancybox/#license
|
9 |
+
|
10 |
+
Copyright (c) 2017 fancyapps.com
|
11 |
+
|
12 |
+
|
13 |
+
How to use
|
14 |
+
----------
|
15 |
+
|
16 |
+
To get started, download the plugin, unzip it and copy files to your website/application directory.
|
17 |
+
Load files in the <head> section of your HTML document. Make sure you also add the jQuery library.
|
18 |
+
|
19 |
+
```html
|
20 |
+
<head>
|
21 |
+
<script type="text/javascript" src="http://ajax.googleapis.com/ajax/libs/jquery/1.7/jquery.min.js"></script>
|
22 |
+
<link rel="stylesheet" href="/fancybox/jquery.fancybox.css" type="text/css" media="screen" />
|
23 |
+
<script type="text/javascript" src="/fancybox/jquery.fancybox.pack.js"></script>
|
24 |
+
</head>
|
25 |
+
```
|
26 |
+
|
27 |
+
Create your links with a `title` (or `data-fancybox-title`) if you want a title to be shown, and add a class:
|
28 |
+
|
29 |
+
```html
|
30 |
+
<a href="large_image.jpg" class="fancybox" title="Sample title"><img src="small_image.jpg" /></a>
|
31 |
+
```
|
32 |
+
|
33 |
+
If you have a set of related items that you would like to group,
|
34 |
+
additionally include a group name in the `rel` (or `data-fancybox-group`) attribute:
|
35 |
+
|
36 |
+
```html
|
37 |
+
<a href="large_1.jpg" class="fancybox" rel="gallery" title="Sample title 1"><img src="small_1.jpg" /></a>
|
38 |
+
<a href="large_2.jpg" class="fancybox" rel="gallery" title="Sample title 1"><img src="small_2.jpg" /></a>
|
39 |
+
```
|
40 |
+
|
41 |
+
Initialise the script like this:
|
42 |
+
|
43 |
+
```html
|
44 |
+
<script>
|
45 |
+
$(document).ready(function() {
|
46 |
+
$('.fancybox').fancybox();
|
47 |
+
});
|
48 |
+
</script>
|
49 |
+
```
|
50 |
+
|
51 |
+
May also be passed an optional options object which will extend the default values. Example:
|
52 |
+
|
53 |
+
```html
|
54 |
+
<script>
|
55 |
+
$(document).ready(function() {
|
56 |
+
$('.fancybox').fancybox({
|
57 |
+
padding : 0,
|
58 |
+
openEffect : 'elastic',
|
59 |
+
closeBtn: false
|
60 |
+
});
|
61 |
+
});
|
62 |
+
</script>
|
63 |
+
```
|
64 |
+
|
65 |
+
Tip: Automatically group and apply fancyBox to all images:
|
66 |
+
|
67 |
+
```js
|
68 |
+
$("a[href$='.jpg'],a[href$='.jpeg'],a[href$='.png'],a[href$='.gif']").attr('rel', 'gallery').fancybox();
|
69 |
+
```
|
70 |
+
|
71 |
+
Script uses the `href` attribute of the matched elements to obtain the location of the content and to figure out content type you want to display.
|
72 |
+
You can specify type directly by adding classname (fancybox.image, fancybox.iframe, etc) or `data-fancybox-type` attribute:
|
73 |
+
|
74 |
+
```html
|
75 |
+
//Ajax:
|
76 |
+
<a href="/example.html" class="fancybox fancybox.ajax">Example</a>
|
77 |
+
//or
|
78 |
+
<a href="/example.html" class="fancybox" data-fancybox-type="ajax">Example</a>
|
79 |
+
|
80 |
+
//Iframe:
|
81 |
+
<a href="example.html" class="fancybox fancybox.iframe">Example</a>
|
82 |
+
|
83 |
+
//Inline (will display an element with `id="example"`)
|
84 |
+
<a href="#example" class="fancybox">Example</a>
|
85 |
+
|
86 |
+
//SWF:
|
87 |
+
<a href="example.swf" class="fancybox">Example</a>
|
88 |
+
|
89 |
+
//Image:
|
90 |
+
<a href="example.jpg" class="fancybox">Example</a>
|
91 |
+
```
|
92 |
+
|
93 |
+
Note, ajax requests are subject to the [same origin policy](http://en.wikipedia.org/wiki/Same_origin_policy).
|
94 |
+
If fancyBox will not be able to get content type, it will try to guess based on 'href' and will quit silently if would not succeed.
|
95 |
+
(this is different from previsous versions where 'ajax' was used as default type or an error message was displayed).
|
96 |
+
|
97 |
+
Advanced
|
98 |
+
--------
|
99 |
+
|
100 |
+
### Helpers
|
101 |
+
|
102 |
+
Helpers provide a simple mechanism to extend the capabilities of fancyBox. There are two built-in helpers - 'overlay' and 'title'.
|
103 |
+
You can disable them, set custom options or enable other helpers. Examples:
|
104 |
+
|
105 |
+
```js
|
106 |
+
//Disable title helper
|
107 |
+
$(".fancybox").fancybox({
|
108 |
+
helpers: {
|
109 |
+
title: null
|
110 |
+
}
|
111 |
+
});
|
112 |
+
|
113 |
+
//Disable overlay helper
|
114 |
+
$(".fancybox").fancybox({
|
115 |
+
helpers: {
|
116 |
+
overlay : null
|
117 |
+
}
|
118 |
+
});
|
119 |
+
|
120 |
+
//Change title position and overlay color
|
121 |
+
$(".fancybox").fancybox({
|
122 |
+
helpers: {
|
123 |
+
title : {
|
124 |
+
type : 'inside'
|
125 |
+
},
|
126 |
+
overlay : {
|
127 |
+
css : {
|
128 |
+
'background' : 'rgba(255,255,255,0.5)'
|
129 |
+
}
|
130 |
+
}
|
131 |
+
}
|
132 |
+
});
|
133 |
+
|
134 |
+
//Enable thumbnail helper and set custom options
|
135 |
+
$(".fancybox").fancybox({
|
136 |
+
helpers: {
|
137 |
+
thumbs : {
|
138 |
+
width: 50,
|
139 |
+
height: 50
|
140 |
+
}
|
141 |
+
}
|
142 |
+
});
|
143 |
+
```
|
144 |
+
|
145 |
+
### API
|
146 |
+
|
147 |
+
Also available are event driven callback methods. The `this` keyword refers to the current or upcoming object (depends on callback method). Here is how you can change title:
|
148 |
+
|
149 |
+
```js
|
150 |
+
$(".fancybox").fancybox({
|
151 |
+
beforeLoad : function() {
|
152 |
+
this.title = 'Image ' + (this.index + 1) + ' of ' + this.group.length + (this.title ? ' - ' + this.title : '');
|
153 |
+
|
154 |
+
/*
|
155 |
+
"this.element" refers to current element, so you can, for example, use the "alt" attribute of the image to store the title:
|
156 |
+
this.title = $(this.element).find('img').attr('alt');
|
157 |
+
*/
|
158 |
+
}
|
159 |
+
});
|
160 |
+
```
|
161 |
+
|
162 |
+
It`s possible to open fancyBox programmatically in various ways:
|
163 |
+
|
164 |
+
```js
|
165 |
+
//HTML content:
|
166 |
+
$.fancybox( '<div><h1>Lorem Lipsum</h1><p>Lorem lipsum</p></div>', {
|
167 |
+
title : 'Custom Title'
|
168 |
+
});
|
169 |
+
|
170 |
+
//DOM element:
|
171 |
+
$.fancybox( $("#inline"), {
|
172 |
+
title : 'Custom Title'
|
173 |
+
});
|
174 |
+
|
175 |
+
//Custom object:
|
176 |
+
$.fancybox({
|
177 |
+
href: 'example.jpg',
|
178 |
+
title : 'Custom Title'
|
179 |
+
});
|
180 |
+
|
181 |
+
//Array of objects:
|
182 |
+
$.fancybox([
|
183 |
+
{
|
184 |
+
href: 'example1.jpg',
|
185 |
+
title : 'Custom Title 1'
|
186 |
+
},
|
187 |
+
{
|
188 |
+
href: 'example2.jpg',
|
189 |
+
title : 'Custom Title 2'
|
190 |
+
}
|
191 |
+
], {
|
192 |
+
padding: 0
|
193 |
+
});
|
194 |
+
```
|
195 |
+
|
196 |
+
There are several methods that allow you to interact with and manipulate fancyBox, example:
|
197 |
+
|
198 |
+
```js
|
199 |
+
//Close fancybox:
|
200 |
+
$.fancybox.close();
|
201 |
+
```
|
202 |
+
|
203 |
+
There is a simply way to access wrapping elements using JS:
|
204 |
+
|
205 |
+
```js
|
206 |
+
$.fancybox.wrap
|
207 |
+
$.fancybox.skin
|
208 |
+
$.fancybox.outer
|
209 |
+
$.fancybox.inner
|
210 |
+
```
|
211 |
+
|
212 |
+
You can override CSS to customize the look. For example, make navigation arrows always visible,
|
213 |
+
change width and move them outside of area (use this snippet after including fancybox.css):
|
214 |
+
|
215 |
+
```css
|
216 |
+
.fancybox-nav span {
|
217 |
+
visibility: visible;
|
218 |
+
}
|
219 |
+
|
220 |
+
.fancybox-nav {
|
221 |
+
width: 80px;
|
222 |
+
}
|
223 |
+
|
224 |
+
.fancybox-prev {
|
225 |
+
left: -80px;
|
226 |
+
}
|
227 |
+
|
228 |
+
.fancybox-next {
|
229 |
+
right: -80px;
|
230 |
+
}
|
231 |
+
```
|
232 |
+
|
233 |
+
In that case, you might want to increase space around box:
|
234 |
+
|
235 |
+
```js
|
236 |
+
$(".fancybox").fancybox({
|
237 |
+
margin : [20, 60, 20, 60]
|
238 |
+
});
|
239 |
+
```
|
240 |
+
|
241 |
+
Bug tracker
|
242 |
+
-----------
|
243 |
+
|
244 |
+
Have a bug? Please create an issue on GitHub at https://github.com/fancyapps/fancyBox/issues
|
vendor/fancybox-2.1.7/bower.json
ADDED
@@ -0,0 +1,35 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"name": "fancybox",
|
3 |
+
"title": "fancyBox",
|
4 |
+
"version": "2.1.7",
|
5 |
+
"description": "fancyBox offers an elegant way to present images, html content and multimedia for webpages",
|
6 |
+
"keywords": [
|
7 |
+
"lightbox",
|
8 |
+
"effect",
|
9 |
+
"responsive",
|
10 |
+
"modal",
|
11 |
+
"window",
|
12 |
+
"ui"
|
13 |
+
],
|
14 |
+
"license": "GPLv3",
|
15 |
+
"homepage": "http://fancyapps.com/fancybox/",
|
16 |
+
"main": [
|
17 |
+
"source/jquery.fancybox.css",
|
18 |
+
"source/jquery.fancybox.pack.js",
|
19 |
+
"source/blank.gif",
|
20 |
+
"source/fancybox_loading.gif",
|
21 |
+
"source/fancybox_loading@2x.gif",
|
22 |
+
"source/fancybox_overlay.png",
|
23 |
+
"source/fancybox_sprite.png",
|
24 |
+
"source/fancybox_sprite@2x.png"
|
25 |
+
],
|
26 |
+
"ignore": [
|
27 |
+
"**/.*",
|
28 |
+
"fancybox.jquery.json",
|
29 |
+
"demo"
|
30 |
+
],
|
31 |
+
"dependencies": {
|
32 |
+
"jquery": ">=1.10",
|
33 |
+
"jquery-mousewheel": "~3.1.3"
|
34 |
+
}
|
35 |
+
}
|
vendor/fancybox-2.1.7/composer.json
ADDED
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"name": "fancyapps/fancybox",
|
3 |
+
"type": "component",
|
4 |
+
"require": {
|
5 |
+
"robloach/component-installer": "*"
|
6 |
+
},
|
7 |
+
"extra": {
|
8 |
+
"component": {
|
9 |
+
"files": [
|
10 |
+
"source/*"
|
11 |
+
]
|
12 |
+
}
|
13 |
+
}
|
14 |
+
}
|
vendor/fancybox-2.1.7/demo/1_b.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/1_s.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/2_b.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/2_s.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/3_b.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/3_s.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/4_b.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/4_s.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/5_b.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/5_s.jpg
ADDED
Binary file
|
vendor/fancybox-2.1.7/demo/ajax.txt
ADDED
@@ -0,0 +1,15 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<div style="max-width:700px;min-width:200px;">
|
2 |
+
<h2>Lorem ipsum dolor sit amet3</h2>
|
3 |
+
<p>
|
4 |
+
<a href="javascript:jQuery.fancybox.close();">Close me</a>
|
5 |
+
</p>
|
6 |
+
<p>
|
7 |
+
Lorem ipsum dolor sit amet, consectetur adipiscing elit. Maecenas fermentum ante et sapien dignissim in viverra magna feugiat. Donec tempus ipsum nec neque dignissim quis eleifend eros gravida. Praesent nisi massa, sodales quis tincidunt ac, semper quis risus. In suscipit nisl sed leo aliquet consequat. Integer vitae augue in risus porttitor pellentesque eu eget odio. Fusce ut sagittis quam. Morbi aliquam interdum blandit. Integer pharetra tempor velit, aliquam dictum justo tempus sed. Morbi congue fringilla justo a feugiat. Lorem ipsum dolor sit amet, consectetur adipiscing elit. Praesent quis metus et nisl consectetur pharetra. Nam bibendum turpis eu metus luctus eu volutpat sem molestie. Nam sollicitudin porttitor lorem, ac ultricies est venenatis eu. Ut dignissim elit et orci feugiat ac placerat purus euismod. Ut mi lorem, cursus et sagittis elementum, luctus ac massa.
|
8 |
+
</p>
|
9 |
+
<p>
|
10 |
+
Phasellus et ligula vel diam ullamcorper volutpat. Integer rhoncus rhoncus aliquam. Aliquam erat volutpat. Aenean luctus vestibulum placerat. Quisque quam neque, lacinia aliquet eleifend ac, aliquet blandit felis. Curabitur porta ultricies dui, sit amet mattis quam euismod a. Ut eleifend scelerisque neque, sit amet accumsan odio consequat ut. Proin facilisis auctor elit sed accumsan. Cras dapibus nisl in nisi rhoncus laoreet. Nullam pellentesque tortor libero, eget facilisis ipsum. Donec ultricies tellus tellus, in tincidunt purus. Nullam in est aliquam velit scelerisque blandit. In tincidunt, magna a dapibus imperdiet, quam urna elementum leo, vitae rhoncus nisl velit cursus velit. In dignissim sem ac mauris rhoncus ornare.
|
11 |
+
</p>
|
12 |
+
<p>
|
13 |
+
Duis imperdiet velit vel quam malesuada suscipit imperdiet tellus hendrerit. Mauris vestibulum odio mauris, ut placerat leo. Mauris quis neque at tellus feugiat congue id non enim. Nam vehicula posuere nulla eget vehicula. Donec pretium purus nec ligula porta eu laoreet sapien venenatis. Nulla facilisi. Phasellus eget mi enim. Phasellus molestie tincidunt ultrices. Aenean id sem a tellus lobortis tincidunt. Nam laoreet nulla vel velit tincidunt ac rutrum libero malesuada. Nulla consequat dolor quis nisl tempor fermentum. Integer sodales pretium varius. Aenean a leo vitae odio dictum dignissim malesuada nec dolor. Phasellus adipiscing viverra est, ac sagittis libero sagittis quis. Sed interdum dapibus nunc et fringilla. Nunc vel velit et urna laoreet bibendum.
|
14 |
+
</p>
|
15 |
+
</div>
|
vendor/fancybox-2.1.7/demo/iframe.html
ADDED
@@ -0,0 +1,26 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<!DOCTYPE html>
|
2 |
+
<html>
|
3 |
+
<head>
|
4 |
+
<title>fancyBox - iframe demo</title>
|
5 |
+
<meta http-equiv="Content-Type" content="text/html; charset=UTF-8" />
|
6 |
+
</head>
|
7 |
+
<body>
|
8 |
+
<h1>fancyBox - iframe demo</h1>
|
9 |
+
|
10 |
+
<p>
|
11 |
+
<a href="javascript:parent.jQuery.fancybox.close();">Close iframe parent</a>
|
12 |
+
|
13 |
+
|
|
14 |
+
|
15 |
+
<a href="javascript:parent.jQuery.fancybox.open({href : '1_b.jpg', title : 'My title'});">Change content</a>
|
16 |
+
</p>
|
17 |
+
|
18 |
+
<p>
|
19 |
+
Lorem ipsum dolor sit amet, consectetur adipiscing elit. Nullam scelerisque justo ac eros consectetur bibendum. In hac habitasse platea dictumst. Nulla aliquam turpis et tellus elementum luctus. Duis sit amet rhoncus velit. Duis nisl ligula, mattis interdum blandit laoreet, mattis id ante. Cras pulvinar lacus vitae nisi egestas non euismod neque bibendum. Vestibulum faucibus libero id ante molestie ultricies. Vestibulum quis nibh felis. Vestibulum libero nisl, vehicula vel ullamcorper sit amet, tristique sit amet augue. Etiam urna neque, porttitor sed sodales lacinia, posuere a nisl. Vestibulum blandit neque in sapien volutpat ac condimentum sapien auctor. Ut imperdiet venenatis ultricies. Phasellus accumsan, sem eu placerat commodo, felis purus commodo ipsum, sit amet vulputate orci est viverra est.
|
20 |
+
</p>
|
21 |
+
|
22 |
+
<p>
|
23 |
+
Aenean velit est, condimentum ut iaculis ut, accumsan at mi. Maecenas velit mi, venenatis ut condimentum at, ultrices vel tortor. Curabitur pharetra ornare dapibus. Ut volutpat cursus semper. In hac habitasse platea dictumst. Donec eu iaculis ipsum. Morbi eu dolor velit, a semper nunc.
|
24 |
+
</p>
|
25 |
+
</body>
|
26 |
+
</html>
|
vendor/fancybox-2.1.7/demo/index.html
ADDED
@@ -0,0 +1,312 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
<!DOCTYPE html>
|
2 |
+
<html>
|
3 |
+
<head>
|
4 |
+
<title>fancyBox - Fancy jQuery Lightbox Alternative | Demonstration</title>
|
5 |
+
<meta http-equiv="Content-Type" content="text/html; charset=UTF-8" />
|
6 |
+
|
7 |
+
<!-- Add jQuery library -->
|
8 |
+
<script type="text/javascript" src="../lib/jquery-1.10.2.min.js"></script>
|
9 |
+
|
10 |
+
<!-- Add mousewheel plugin (this is optional) -->
|
11 |
+
<script type="text/javascript" src="../lib/jquery.mousewheel.pack.js?v=3.1.3"></script>
|
12 |
+
|
13 |
+
<!-- Add fancyBox main JS and CSS files -->
|
14 |
+
<script type="text/javascript" src="../source/jquery.fancybox.pack.js?v=2.1.5"></script>
|
15 |
+
<link rel="stylesheet" type="text/css" href="../source/jquery.fancybox.css?v=2.1.5" media="screen" />
|
16 |
+
|
17 |
+
<!-- Add Button helper (this is optional) -->
|
18 |
+
<link rel="stylesheet" type="text/css" href="../source/helpers/jquery.fancybox-buttons.css?v=1.0.5" />
|
19 |
+
<script type="text/javascript" src="../source/helpers/jquery.fancybox-buttons.js?v=1.0.5"></script>
|
20 |
+
|
21 |
+
<!-- Add Thumbnail helper (this is optional) -->
|
22 |
+
<link rel="stylesheet" type="text/css" href="../source/helpers/jquery.fancybox-thumbs.css?v=1.0.7" />
|
23 |
+
<script type="text/javascript" src="../source/helpers/jquery.fancybox-thumbs.js?v=1.0.7"></script>
|
24 |
+
|
25 |
+
<!-- Add Media helper (this is optional) -->
|
26 |
+
<script type="text/javascript" src="../source/helpers/jquery.fancybox-media.js?v=1.0.6"></script>
|
27 |
+
|
28 |
+
<script type="text/javascript">
|
29 |
+
$(document).ready(function() {
|
30 |
+
/*
|
31 |
+
* Simple image gallery. Uses default settings
|
32 |
+
*/
|
33 |
+
|
34 |
+
$('.fancybox').fancybox();
|
35 |
+
|
36 |
+
/*
|
37 |
+
* Different effects
|
38 |
+
*/
|
39 |
+
|
40 |
+
// Change title type, overlay closing speed
|
41 |
+
$(".fancybox-effects-a").fancybox({
|
42 |
+
helpers: {
|
43 |
+
title : {
|
44 |
+
type : 'outside'
|
45 |
+
},
|
46 |
+
overlay : {
|
47 |
+
speedOut : 0
|
48 |
+
}
|
49 |
+
}
|
50 |
+
});
|
51 |
+
|
52 |
+
// Disable opening and closing animations, change title type
|
53 |
+
$(".fancybox-effects-b").fancybox({
|
54 |
+
openEffect : 'none',
|
55 |
+
closeEffect : 'none',
|
56 |
+
|
57 |
+
helpers : {
|
58 |
+
title : {
|
59 |
+
type : 'over'
|
60 |
+
}
|
61 |
+
}
|
62 |
+
});
|
63 |
+
|
64 |
+
// Set custom style, close if clicked, change title type and overlay color
|
65 |
+
$(".fancybox-effects-c").fancybox({
|
66 |
+
wrapCSS : 'fancybox-custom',
|
67 |
+
closeClick : true,
|
68 |
+
|
69 |
+
openEffect : 'none',
|
70 |
+
|
71 |
+
helpers : {
|
72 |
+
title : {
|
73 |
+
type : 'inside'
|
74 |
+
},
|
75 |
+
overlay : {
|
76 |
+
css : {
|
77 |
+
'background' : 'rgba(238,238,238,0.85)'
|
78 |
+
}
|
79 |
+
}
|
80 |
+
}
|
81 |
+
});
|
82 |
+
|
83 |
+
// Remove padding, set opening and closing animations, close if clicked and disable overlay
|
84 |
+
$(".fancybox-effects-d").fancybox({
|
85 |
+
padding: 0,
|
86 |
+
|
87 |
+
openEffect : 'elastic',
|
88 |
+
openSpeed : 150,
|
89 |
+
|
90 |
+
closeEffect : 'elastic',
|
91 |
+
closeSpeed : 150,
|
92 |
+
|
93 |
+
closeClick : true,
|
94 |
+
|
95 |
+
helpers : {
|
96 |
+
overlay : null
|
97 |
+
}
|
98 |
+
});
|
99 |
+
|
100 |
+
/*
|
101 |
+
* Button helper. Disable animations, hide close button, change title type and content
|
102 |
+
*/
|
103 |
+
|
104 |
+
$('.fancybox-buttons').fancybox({
|
105 |
+
openEffect : 'none',
|
106 |
+
closeEffect : 'none',
|
107 |
+
|
108 |
+
prevEffect : 'none',
|
109 |
+
nextEffect : 'none',
|
110 |
+
|
111 |
+
closeBtn : false,
|
112 |
+
|
113 |
+
helpers : {
|
114 |
+
title : {
|
115 |
+
type : 'inside'
|
116 |
+
},
|
117 |
+
buttons : {}
|
118 |
+
},
|
119 |
+
|
120 |
+
afterLoad : function() {
|
121 |
+
this.title = 'Image ' + (this.index + 1) + ' of ' + this.group.length + (this.title ? ' - ' + this.title : '');
|
122 |
+
}
|
123 |
+
});
|
124 |
+
|
125 |
+
|
126 |
+
/*
|
127 |
+
* Thumbnail helper. Disable animations, hide close button, arrows and slide to next gallery item if clicked
|
128 |
+
*/
|
129 |
+
|
130 |
+
$('.fancybox-thumbs').fancybox({
|
131 |
+
prevEffect : 'none',
|
132 |
+
nextEffect : 'none',
|
133 |
+
|
134 |
+
closeBtn : false,
|
135 |
+
arrows : false,
|
136 |
+
nextClick : true,
|
137 |
+
|
138 |
+
helpers : {
|
139 |
+
thumbs : {
|
140 |
+
width : 50,
|
141 |
+
height : 50
|
142 |
+
}
|
143 |
+
}
|
144 |
+
});
|
145 |
+
|
146 |
+
/*
|
147 |
+
* Media helper. Group items, disable animations, hide arrows, enable media and button helpers.
|
148 |
+
*/
|
149 |
+
$('.fancybox-media')
|
150 |
+
.attr('rel', 'media-gallery')
|
151 |
+
.fancybox({
|
152 |
+
openEffect : 'none',
|
153 |
+
closeEffect : 'none',
|
154 |
+
prevEffect : 'none',
|
155 |
+
nextEffect : 'none',
|
156 |
+
|
157 |
+
arrows : false,
|
158 |
+
helpers : {
|
159 |
+
media : {},
|
160 |
+
buttons : {}
|
161 |
+
}
|
162 |
+
});
|
163 |
+
|
164 |
+
/*
|
165 |
+
* Open manually
|
166 |
+
*/
|
167 |
+
|
168 |
+
$("#fancybox-manual-a").click(function() {
|
169 |
+
$.fancybox.open('1_b.jpg');
|
170 |
+
});
|
171 |
+
|
172 |
+
$("#fancybox-manual-b").click(function() {
|
173 |
+
$.fancybox.open({
|
174 |
+
href : 'iframe.html',
|
175 |
+
type : 'iframe',
|
176 |
+
padding : 5
|
177 |
+
});
|
178 |
+
});
|
179 |
+
|
180 |
+
$("#fancybox-manual-c").click(function() {
|
181 |
+
$.fancybox.open([
|
182 |
+
{
|
183 |
+
href : '1_b.jpg',
|
184 |
+
title : 'My title'
|
185 |
+
}, {
|
186 |
+
href : '2_b.jpg',
|
187 |
+
title : '2nd title'
|
188 |
+
}, {
|
189 |
+
href : '3_b.jpg'
|
190 |
+
}
|
191 |
+
], {
|
192 |
+
helpers : {
|
193 |
+
thumbs : {
|
194 |
+
width: 75,
|
195 |
+
height: 50
|
196 |
+
}
|
197 |
+
}
|
198 |
+
});
|
199 |
+
});
|
200 |
+
|
201 |
+
|
202 |
+
});
|
203 |
+
</script>
|
204 |
+
<style type="text/css">
|
205 |
+
.fancybox-custom .fancybox-skin {
|
206 |
+
box-shadow: 0 0 50px #222;
|
207 |
+
}
|
208 |
+
|
209 |
+
body {
|
210 |
+
max-width: 700px;
|
211 |
+
margin: 0 auto;
|
212 |
+
}
|
213 |
+
</style>
|
214 |
+
</head>
|
215 |
+
<body>
|
216 |
+
<h1>fancyBox</h1>
|
217 |
+
|
218 |
+
<p>This is a demonstration. More information and examples: <a href="http://fancyapps.com/fancybox/">www.fancyapps.com/fancybox/</a></p>
|
219 |
+
|
220 |
+
<h3>Simple image gallery</h3>
|
221 |
+
<p>
|
222 |
+
<a class="fancybox" href="1_b.jpg" data-fancybox-group="gallery" title="Lorem ipsum dolor sit amet"><img src="1_s.jpg" alt="" /></a>
|
223 |
+
|
224 |
+
<a class="fancybox" href="2_b.jpg" data-fancybox-group="gallery" title="Etiam quis mi eu elit temp"><img src="2_s.jpg" alt="" /></a>
|
225 |
+
|
226 |
+
<a class="fancybox" href="3_b.jpg" data-fancybox-group="gallery" title="Cras neque mi, semper leon"><img src="3_s.jpg" alt="" /></a>
|
227 |
+
|
228 |
+
<a class="fancybox" href="4_b.jpg" data-fancybox-group="gallery" title="Sed vel sapien vel sem uno"><img src="4_s.jpg" alt="" /></a>
|
229 |
+
</p>
|
230 |
+
|
231 |
+
<h3>Different effects</h3>
|
232 |
+
<p>
|
233 |
+
<a class="fancybox-effects-a" href="5_b.jpg" title="Lorem ipsum dolor sit amet, consectetur adipiscing elit"><img src="5_s.jpg" alt="" /></a>
|
234 |
+
|
235 |
+
<a class="fancybox-effects-b" href="5_b.jpg" title="Lorem ipsum dolor sit amet, consectetur adipiscing elit"><img src="5_s.jpg" alt="" /></a>
|
236 |
+
|
237 |
+
<a class="fancybox-effects-c" href="5_b.jpg" title="Lorem ipsum dolor sit amet, consectetur adipiscing elit"><img src="5_s.jpg" alt="" /></a>
|
238 |
+
|
239 |
+
<a class="fancybox-effects-d" href="5_b.jpg" title="Lorem ipsum dolor sit amet, consectetur adipiscing elit"><img src="5_s.jpg" alt="" /></a>
|
240 |
+
</p>
|
241 |
+
|
242 |
+
<h3>Various types</h3>
|
243 |
+
<p>
|
244 |
+
fancyBox will try to guess content type from href attribute but you can specify it directly by adding classname (fancybox.image, fancybox.iframe, etc).
|
245 |
+
</p>
|
246 |
+
<ul>
|
247 |
+
<li><a class="fancybox" href="#inline1" title="Lorem ipsum dolor sit amet">Inline</a></li>
|
248 |
+
<li><a class="fancybox fancybox.ajax" href="ajax.txt">Ajax</a></li>
|
249 |
+
<li><a class="fancybox fancybox.iframe" href="iframe.html">Iframe</a></li>
|
250 |
+
<li><a class="fancybox" href="http://www.adobe.com/jp/events/cs3_web_edition_tour/swfs/perform.swf">Swf</a></li>
|
251 |
+
</ul>
|
252 |
+
|
253 |
+
<div id="inline1" style="width:400px;display: none;">
|
254 |
+
<h3>Etiam quis mi eu elit</h3>
|
255 |
+
<p>
|
256 |
+
Lorem ipsum dolor sit amet, consectetur adipiscing elit. Etiam quis mi eu elit tempor facilisis id et neque. Nulla sit amet sem sapien. Vestibulum imperdiet porta ante ac ornare. Nulla et lorem eu nibh adipiscing ultricies nec at lacus. Cras laoreet ultricies sem, at blandit mi eleifend aliquam. Nunc enim ipsum, vehicula non pretium varius, cursus ac tortor. Vivamus fringilla congue laoreet. Quisque ultrices sodales orci, quis rhoncus justo auctor in. Phasellus dui eros, bibendum eu feugiat ornare, faucibus eu mi. Nunc aliquet tempus sem, id aliquam diam varius ac. Maecenas nisl nunc, molestie vitae eleifend vel, iaculis sed magna. Aenean tempus lacus vitae orci posuere porttitor eget non felis. Donec lectus elit, aliquam nec eleifend sit amet, vestibulum sed nunc.
|
257 |
+
</p>
|
258 |
+
</div>
|
259 |
+
|
260 |
+
<p>
|
261 |
+
Ajax example will not run from your local computer and requires a server to run.
|
262 |
+
</p>
|
263 |
+
|
264 |
+
<h3>Button helper</h3>
|
265 |
+
<p>
|
266 |
+
<a class="fancybox-buttons" data-fancybox-group="button" href="1_b.jpg"><img src="1_s.jpg" alt="" /></a>
|
267 |
+
|
268 |
+
<a class="fancybox-buttons" data-fancybox-group="button" href="2_b.jpg"><img src="2_s.jpg" alt="" /></a>
|
269 |
+
|
270 |
+
<a class="fancybox-buttons" data-fancybox-group="button" href="3_b.jpg"><img src="3_s.jpg" alt="" /></a>
|
271 |
+
|
272 |
+
<a class="fancybox-buttons" data-fancybox-group="button" href="4_b.jpg"><img src="4_s.jpg" alt="" /></a>
|
273 |
+
</p>
|
274 |
+
|
275 |
+
<h3>Thumbnail helper</h3>
|
276 |
+
<p>
|
277 |
+
<a class="fancybox-thumbs" data-fancybox-group="thumb" href="4_b.jpg"><img src="4_s.jpg" alt="" /></a>
|
278 |
+
|
279 |
+
<a class="fancybox-thumbs" data-fancybox-group="thumb" href="3_b.jpg"><img src="3_s.jpg" alt="" /></a>
|
280 |
+
|
281 |
+
<a class="fancybox-thumbs" data-fancybox-group="thumb" href="2_b.jpg"><img src="2_s.jpg" alt="" /></a>
|
282 |
+
|
283 |
+
<a class="fancybox-thumbs" data-fancybox-group="thumb" href="1_b.jpg"><img src="1_s.jpg" alt="" /></a>
|
284 |
+
</p>
|
285 |
+
|
286 |
+
<h3>Media helper</h3>
|
287 |
+
<p>
|
288 |
+
Will not run from your local computer, requires a server to run.
|
289 |
+
</p>
|
290 |
+
|
291 |
+
<ul>
|
292 |
+
<li><a class="fancybox-media" href="http://www.youtube.com/watch?v=opj24KnzrWo">Youtube</a></li>
|
293 |
+
<li><a class="fancybox-media" href="http://vimeo.com/47480346">Vimeo</a></li>
|
294 |
+
<li><a class="fancybox-media" href="http://www.metacafe.com/watch/7635964/">Metacafe</a></li>
|
295 |
+
<li><a class="fancybox-media" href="http://www.dailymotion.com/video/xoeylt_electric-guest-this-head-i-hold_music">Dailymotion</a></li>
|
296 |
+
<li><a class="fancybox-media" href="http://twitvid.com/QY7MD">Twitvid</a></li>
|
297 |
+
<li><a class="fancybox-media" href="http://twitpic.com/7p93st">Twitpic</a></li>
|
298 |
+
<li><a class="fancybox-media" href="http://instagr.am/p/IejkuUGxQn">Instagram</a></li>
|
299 |
+
</ul>
|
300 |
+
|
301 |
+
<h3>Open manually</h3>
|
302 |
+
<ul>
|
303 |
+
<li><a id="fancybox-manual-a" href="javascript:;">Open single item</a></li>
|
304 |
+
<li><a id="fancybox-manual-b" href="javascript:;">Open single item, custom options</a></li>
|
305 |
+
<li><a id="fancybox-manual-c" href="javascript:;">Open gallery</a></li>
|
306 |
+
</ul>
|
307 |
+
|
308 |
+
<p>
|
309 |
+
Photo Credit: Instagrammer @whitjohns
|
310 |
+
</p>
|
311 |
+
</body>
|
312 |
+
</html>
|
vendor/fancybox-2.1.7/fancybox.jquery.json
ADDED
@@ -0,0 +1,31 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"name": "fancybox",
|
3 |
+
"title": "fancyBox",
|
4 |
+
"description": "fancyBox offers an elegant way to present images, html content and multimedia for webpages",
|
5 |
+
"keywords": [
|
6 |
+
"lightbox",
|
7 |
+
"effect",
|
8 |
+
"responsive",
|
9 |
+
"modal",
|
10 |
+
"window",
|
11 |
+
"ui"
|
12 |
+
],
|
13 |
+
"version": "2.1.5",
|
14 |
+
"author": {
|
15 |
+
"name": "Janis Skarnelis",
|
16 |
+
"url": "http://fancyapps.com/contact/"
|
17 |
+
},
|
18 |
+
"licenses": [
|
19 |
+
{
|
20 |
+
"type": "fancyBox",
|
21 |
+
"url": "http://fancyapps.com/fancybox/#license"
|
22 |
+
}
|
23 |
+
],
|
24 |
+
"homepage": "http://fancyapps.com/fancybox/",
|
25 |
+
"docs": "http://fancyapps.com/fancybox/#docs",
|
26 |
+
"download": "http://fancyapps.com/fancybox/#license",
|
27 |
+
"bugs": "https://github.com/fancyapps/fancyBox/issues",
|
28 |
+
"dependencies": {
|
29 |
+
"jquery": ">=1.7"
|
30 |
+
}
|
31 |
+
}
|
vendor/fancybox-2.1.7/gulpfile.js
ADDED
@@ -0,0 +1,76 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/* jshint node: true */
|
2 |
+
/* global $: true */
|
3 |
+
"use strict";
|
4 |
+
|
5 |
+
var gulp = require("gulp"),
|
6 |
+
$ = require("gulp-load-plugins")();
|
7 |
+
var config = {
|
8 |
+
js: [
|
9 |
+
"lib/jquery.mousewheel.pack.js",
|
10 |
+
"source/jquery.fancybox.pack.js",
|
11 |
+
"source/helpers/jquery.fancybox-buttons.js",
|
12 |
+
"source/helpers/jquery.fancybox-thumbs.js",
|
13 |
+
"source/helpers/jquery.fancybox-media.js"
|
14 |
+
],
|
15 |
+
css: [
|
16 |
+
"source/jquery.fancybox.css",
|
17 |
+
"source/helpers/jquery.fancybox-buttons.css",
|
18 |
+
"source/helpers/jquery.fancybox-thumbs.css"
|
19 |
+
],
|
20 |
+
images: [
|
21 |
+
"source/helpers/**/*.{jpg,png,svg,gif,webp,ico}",
|
22 |
+
"source/*.{jpg,png,svg,gif,webp,ico}"
|
23 |
+
]
|
24 |
+
},
|
25 |
+
dist = {
|
26 |
+
images: "dist/images/fancybox",
|
27 |
+
css: "dist/css",
|
28 |
+
js: "dist/js"
|
29 |
+
};
|
30 |
+
|
31 |
+
|
32 |
+
/*
|
33 |
+
- |--------------------------------------------------------------------------
|
34 |
+
- | Gulp Front Tasks
|
35 |
+
- |--------------------------------------------------------------------------
|
36 |
+
- |
|
37 |
+
+ *
|
38 |
+
+ *
|
39 |
+
*/
|
40 |
+
|
41 |
+
gulp.task("clean", function () {
|
42 |
+
return gulp.src("dist", {read: false})
|
43 |
+
.pipe($.clean());
|
44 |
+
});
|
45 |
+
|
46 |
+
gulp.task("scripts", function () {
|
47 |
+
return gulp.src(config.js)
|
48 |
+
.pipe($.plumberNotifier())
|
49 |
+
.pipe($.concat("jquery.fancybox.min.js"))
|
50 |
+
.pipe($.uglify())
|
51 |
+
.pipe(gulp.dest(dist.js));
|
52 |
+
});
|
53 |
+
|
54 |
+
gulp.task("styles", function () {
|
55 |
+
return gulp.src(config.css)
|
56 |
+
.pipe($.plumberNotifier())
|
57 |
+
.pipe($.concat("jquery.fancybox.min.css"))
|
58 |
+
.pipe($.autoprefixer("last 5 version"))
|
59 |
+
.pipe($.replace(/url\('?(.*)'?\)/g, "url('../images/fancybox/$1')"))
|
60 |
+
.pipe($.replace("''", "'"))
|
61 |
+
.pipe($.cleanCss({compatibility: 'ie8'}))
|
62 |
+
.pipe(gulp.dest(dist.css))
|
63 |
+
});
|
64 |
+
|
65 |
+
gulp.task("images", function () {
|
66 |
+
return gulp.src(config.images)
|
67 |
+
.pipe($.newer(dist.images))
|
68 |
+
.pipe(gulp.dest(dist.images));
|
69 |
+
});
|
70 |
+
|
71 |
+
|
72 |
+
gulp.task('default', ["images", "styles", "scripts"]);
|
73 |
+
|
74 |
+
|
75 |
+
|
76 |
+
|
vendor/fancybox-2.1.7/lib/jquery-1.10.2.min.js
ADDED
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
/*! jQuery v1.10.2 | (c) 2005, 2013 jQuery Foundation, Inc. | jquery.org/license
|
2 |
+
//@ sourceMappingURL=jquery-1.10.2.min.map
|
3 |
+
*/
|
4 |
+
(function(e,t){var n,r,i=typeof t,o=e.location,a=e.document,s=a.documentElement,l=e.jQuery,u=e.$,c={},p=[],f="1.10.2",d=p.concat,h=p.push,g=p.slice,m=p.indexOf,y=c.toString,v=c.hasOwnProperty,b=f.trim,x=function(e,t){return new x.fn.init(e,t,r)},w=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,T=/\S+/g,C=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,N=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,k=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,E=/^[\],:{}\s]*$/,S=/(?:^|:|,)(?:\s*\[)+/g,A=/\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g,j=/"[^"\\\r\n]*"|true|false|null|-?(?:\d+\.|)\d+(?:[eE][+-]?\d+|)/g,D=/^-ms-/,L=/-([\da-z])/gi,H=function(e,t){return t.toUpperCase()},q=function(e){(a.addEventListener||"load"===e.type||"complete"===a.readyState)&&(_(),x.ready())},_=function(){a.addEventListener?(a.removeEventListener("DOMContentLoaded",q,!1),e.removeEventListener("load",q,!1)):(a.detachEvent("onreadystatechange",q),e.detachEvent("onload",q))};x.fn=x.prototype={jquery:f,constructor:x,init:function(e,n,r){var i,o;if(!e)return this;if("string"==typeof e){if(i="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&e.length>=3?[null,e,null]:N.exec(e),!i||!i[1]&&n)return!n||n.jquery?(n||r).find(e):this.constructor(n).find(e);if(i[1]){if(n=n instanceof x?n[0]:n,x.merge(this,x.parseHTML(i[1],n&&n.nodeType?n.ownerDocument||n:a,!0)),k.test(i[1])&&x.isPlainObject(n))for(i in n)x.isFunction(this[i])?this[i](n[i]):this.attr(i,n[i]);return this}if(o=a.getElementById(i[2]),o&&o.parentNode){if(o.id!==i[2])return r.find(e);this.length=1,this[0]=o}return this.context=a,this.selector=e,this}return e.nodeType?(this.context=this[0]=e,this.length=1,this):x.isFunction(e)?r.ready(e):(e.selector!==t&&(this.selector=e.selector,this.context=e.context),x.makeArray(e,this))},selector:"",length:0,toArray:function(){return g.call(this)},get:function(e){return null==e?this.toArray():0>e?this[this.length+e]:this[e]},pushStack:function(e){var t=x.merge(this.constructor(),e);return t.prevObject=this,t.context=this.context,t},each:function(e,t){return x.each(this,e,t)},ready:function(e){return x.ready.promise().done(e),this},slice:function(){return this.pushStack(g.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(0>e?t:0);return this.pushStack(n>=0&&t>n?[this[n]]:[])},map:function(e){return this.pushStack(x.map(this,function(t,n){return e.call(t,n,t)}))},end:function(){return this.prevObject||this.constructor(null)},push:h,sort:[].sort,splice:[].splice},x.fn.init.prototype=x.fn,x.extend=x.fn.extend=function(){var e,n,r,i,o,a,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[1]||{},l=2),"object"==typeof s||x.isFunction(s)||(s={}),u===l&&(s=this,--l);u>l;l++)if(null!=(o=arguments[l]))for(i in o)e=s[i],r=o[i],s!==r&&(c&&r&&(x.isPlainObject(r)||(n=x.isArray(r)))?(n?(n=!1,a=e&&x.isArray(e)?e:[]):a=e&&x.isPlainObject(e)?e:{},s[i]=x.extend(c,a,r)):r!==t&&(s[i]=r));return s},x.extend({expando:"jQuery"+(f+Math.random()).replace(/\D/g,""),noConflict:function(t){return e.$===x&&(e.$=u),t&&e.jQuery===x&&(e.jQuery=l),x},isReady:!1,readyWait:1,holdReady:function(e){e?x.readyWait++:x.ready(!0)},ready:function(e){if(e===!0?!--x.readyWait:!x.isReady){if(!a.body)return setTimeout(x.ready);x.isReady=!0,e!==!0&&--x.readyWait>0||(n.resolveWith(a,[x]),x.fn.trigger&&x(a).trigger("ready").off("ready"))}},isFunction:function(e){return"function"===x.type(e)},isArray:Array.isArray||function(e){return"array"===x.type(e)},isWindow:function(e){return null!=e&&e==e.window},isNumeric:function(e){return!isNaN(parseFloat(e))&&isFinite(e)},type:function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?c[y.call(e)]||"object":typeof e},isPlainObject:function(e){var n;if(!e||"object"!==x.type(e)||e.nodeType||x.isWindow(e))return!1;try{if(e.constructor&&!v.call(e,"constructor")&&!v.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(r){return!1}if(x.support.ownLast)for(n in e)return v.call(e,n);for(n in e);return n===t||v.call(e,n)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},error:function(e){throw Error(e)},parseHTML:function(e,t,n){if(!e||"string"!=typeof e)return null;"boolean"==typeof t&&(n=t,t=!1),t=t||a;var r=k.exec(e),i=!n&&[];return r?[t.createElement(r[1])]:(r=x.buildFragment([e],t,i),i&&x(i).remove(),x.merge([],r.childNodes))},parseJSON:function(n){return e.JSON&&e.JSON.parse?e.JSON.parse(n):null===n?n:"string"==typeof n&&(n=x.trim(n),n&&E.test(n.replace(A,"@").replace(j,"]").replace(S,"")))?Function("return "+n)():(x.error("Invalid JSON: "+n),t)},parseXML:function(n){var r,i;if(!n||"string"!=typeof n)return null;try{e.DOMParser?(i=new DOMParser,r=i.parseFromString(n,"text/xml")):(r=new ActiveXObject("Microsoft.XMLDOM"),r.async="false",r.loadXML(n))}catch(o){r=t}return r&&r.documentElement&&!r.getElementsByTagName("parsererror").length||x.error("Invalid XML: "+n),r},noop:function(){},globalEval:function(t){t&&x.trim(t)&&(e.execScript||function(t){e.eval.call(e,t)})(t)},camelCase:function(e){return e.replace(D,"ms-").replace(L,H)},nodeName:function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},each:function(e,t,n){var r,i=0,o=e.length,a=M(e);if(n){if(a){for(;o>i;i++)if(r=t.apply(e[i],n),r===!1)break}else for(i in e)if(r=t.apply(e[i],n),r===!1)break}else if(a){for(;o>i;i++)if(r=t.call(e[i],i,e[i]),r===!1)break}else for(i in e)if(r=t.call(e[i],i,e[i]),r===!1)break;return e},trim:b&&!b.call("\ufeff\u00a0")?function(e){return null==e?"":b.call(e)}:function(e){return null==e?"":(e+"").replace(C,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(M(Object(e))?x.merge(n,"string"==typeof e?[e]:e):h.call(n,e)),n},inArray:function(e,t,n){var r;if(t){if(m)return m.call(t,e,n);for(r=t.length,n=n?0>n?Math.max(0,r+n):n:0;r>n;n++)if(n in t&&t[n]===e)return n}return-1},merge:function(e,n){var r=n.length,i=e.length,o=0;if("number"==typeof r)for(;r>o;o++)e[i++]=n[o];else while(n[o]!==t)e[i++]=n[o++];return e.length=i,e},grep:function(e,t,n){var r,i=[],o=0,a=e.length;for(n=!!n;a>o;o++)r=!!t(e[o],o),n!==r&&i.push(e[o]);return i},map:function(e,t,n){var r,i=0,o=e.length,a=M(e),s=[];if(a)for(;o>i;i++)r=t(e[i],i,n),null!=r&&(s[s.length]=r);else for(i in e)r=t(e[i],i,n),null!=r&&(s[s.length]=r);return d.apply([],s)},guid:1,proxy:function(e,n){var r,i,o;return"string"==typeof n&&(o=e[n],n=e,e=o),x.isFunction(e)?(r=g.call(arguments,2),i=function(){return e.apply(n||this,r.concat(g.call(arguments)))},i.guid=e.guid=e.guid||x.guid++,i):t},access:function(e,n,r,i,o,a,s){var l=0,u=e.length,c=null==r;if("object"===x.type(r)){o=!0;for(l in r)x.access(e,n,l,r[l],!0,a,s)}else if(i!==t&&(o=!0,x.isFunction(i)||(s=!0),c&&(s?(n.call(e,i),n=null):(c=n,n=function(e,t,n){return c.call(x(e),n)})),n))for(;u>l;l++)n(e[l],r,s?i:i.call(e[l],l,n(e[l],r)));return o?e:c?n.call(e):u?n(e[0],r):a},now:function(){return(new Date).getTime()},swap:function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];i=n.apply(e,r||[]);for(o in t)e.style[o]=a[o];return i}}),x.ready.promise=function(t){if(!n)if(n=x.Deferred(),"complete"===a.readyState)setTimeout(x.ready);else if(a.addEventListener)a.addEventListener("DOMContentLoaded",q,!1),e.addEventListener("load",q,!1);else{a.attachEvent("onreadystatechange",q),e.attachEvent("onload",q);var r=!1;try{r=null==e.frameElement&&a.documentElement}catch(i){}r&&r.doScroll&&function o(){if(!x.isReady){try{r.doScroll("left")}catch(e){return setTimeout(o,50)}_(),x.ready()}}()}return n.promise(t)},x.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(e,t){c["[object "+t+"]"]=t.toLowerCase()});function M(e){var t=e.length,n=x.type(e);return x.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===n||"function"!==n&&(0===t||"number"==typeof t&&t>0&&t-1 in e)}r=x(a),function(e,t){var n,r,i,o,a,s,l,u,c,p,f,d,h,g,m,y,v,b="sizzle"+-new Date,w=e.document,T=0,C=0,N=st(),k=st(),E=st(),S=!1,A=function(e,t){return e===t?(S=!0,0):0},j=typeof t,D=1<<31,L={}.hasOwnProperty,H=[],q=H.pop,_=H.push,M=H.push,O=H.slice,F=H.indexOf||function(e){var t=0,n=this.length;for(;n>t;t++)if(this[t]===e)return t;return-1},B="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",P="[\\x20\\t\\r\\n\\f]",R="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",W=R.replace("w","w#"),$="\\["+P+"*("+R+")"+P+"*(?:([*^$|!~]?=)"+P+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+W+")|)|)"+P+"*\\]",I=":("+R+")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|"+$.replace(3,8)+")*)|.*)\\)|)",z=RegExp("^"+P+"+|((?:^|[^\\\\])(?:\\\\.)*)"+P+"+$","g"),X=RegExp("^"+P+"*,"+P+"*"),U=RegExp("^"+P+"*([>+~]|"+P+")"+P+"*"),V=RegExp(P+"*[+~]"),Y=RegExp("="+P+"*([^\\]'\"]*)"+P+"*\\]","g"),J=RegExp(I),G=RegExp("^"+W+"$"),Q={ID:RegExp("^#("+R+")"),CLASS:RegExp("^\\.("+R+")"),TAG:RegExp("^("+R.replace("w","w*")+")"),ATTR:RegExp("^"+$),PSEUDO:RegExp("^"+I),CHILD:RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+P+"*(even|odd|(([+-]|)(\\d*)n|)"+P+"*(?:([+-]|)"+P+"*(\\d+)|))"+P+"*\\)|)","i"),bool:RegExp("^(?:"+B+")$","i"),needsContext:RegExp("^"+P+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+P+"*((?:-\\d)?\\d*)"+P+"*\\)|)(?=[^-]|$)","i")},K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,et=/^(?:input|select|textarea|button)$/i,tt=/^h\d$/i,nt=/'|\\/g,rt=RegExp("\\\\([\\da-f]{1,6}"+P+"?|("+P+")|.)","ig"),it=function(e,t,n){var r="0x"+t-65536;return r!==r||n?t:0>r?String.fromCharCode(r+65536):String.fromCharCode(55296|r>>10,56320|1023&r)};try{M.apply(H=O.call(w.childNodes),w.childNodes),H[w.childNodes.length].nodeType}catch(ot){M={apply:H.length?function(e,t){_.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function at(e,t,n,i){var o,a,s,l,u,c,d,m,y,x;if((t?t.ownerDocument||t:w)!==f&&p(t),t=t||f,n=n||[],!e||"string"!=typeof e)return n;if(1!==(l=t.nodeType)&&9!==l)return[];if(h&&!i){if(o=Z.exec(e))if(s=o[1]){if(9===l){if(a=t.getElementById(s),!a||!a.parentNode)return n;if(a.id===s)return n.push(a),n}else if(t.ownerDocument&&(a=t.ownerDocument.getElementById(s))&&v(t,a)&&a.id===s)return n.push(a),n}else{if(o[2])return M.apply(n,t.getElementsByTagName(e)),n;if((s=o[3])&&r.getElementsByClassName&&t.getElementsByClassName)return M.apply(n,t.getElementsByClassName(s)),n}if(r.qsa&&(!g||!g.test(e))){if(m=d=b,y=t,x=9===l&&e,1===l&&"object"!==t.nodeName.toLowerCase()){c=mt(e),(d=t.getAttribute("id"))?m=d.replace(nt,"\\$&"):t.setAttribute("id",m),m="[id='"+m+"'] ",u=c.length;while(u--)c[u]=m+yt(c[u]);y=V.test(e)&&t.parentNode||t,x=c.join(",")}if(x)try{return M.apply(n,y.querySelectorAll(x)),n}catch(T){}finally{d||t.removeAttribute("id")}}}return kt(e.replace(z,"$1"),t,n,i)}function st(){var e=[];function t(n,r){return e.push(n+=" ")>o.cacheLength&&delete t[e.shift()],t[n]=r}return t}function lt(e){return e[b]=!0,e}function ut(e){var t=f.createElement("div");try{return!!e(t)}catch(n){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function ct(e,t){var n=e.split("|"),r=e.length;while(r--)o.attrHandle[n[r]]=t}function pt(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&(~t.sourceIndex||D)-(~e.sourceIndex||D);if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function ft(e){return function(t){var n=t.nodeName.toLowerCase();return"input"===n&&t.type===e}}function dt(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function ht(e){return lt(function(t){return t=+t,lt(function(n,r){var i,o=e([],n.length,t),a=o.length;while(a--)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}s=at.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return t?"HTML"!==t.nodeName:!1},r=at.support={},p=at.setDocument=function(e){var n=e?e.ownerDocument||e:w,i=n.defaultView;return n!==f&&9===n.nodeType&&n.documentElement?(f=n,d=n.documentElement,h=!s(n),i&&i.attachEvent&&i!==i.top&&i.attachEvent("onbeforeunload",function(){p()}),r.attributes=ut(function(e){return e.className="i",!e.getAttribute("className")}),r.getElementsByTagName=ut(function(e){return e.appendChild(n.createComment("")),!e.getElementsByTagName("*").length}),r.getElementsByClassName=ut(function(e){return e.innerHTML="<div class='a'></div><div class='a i'></div>",e.firstChild.className="i",2===e.getElementsByClassName("i").length}),r.getById=ut(function(e){return d.appendChild(e).id=b,!n.getElementsByName||!n.getElementsByName(b).length}),r.getById?(o.find.ID=function(e,t){if(typeof t.getElementById!==j&&h){var n=t.getElementById(e);return n&&n.parentNode?[n]:[]}},o.filter.ID=function(e){var t=e.replace(rt,it);return function(e){return e.getAttribute("id")===t}}):(delete o.find.ID,o.filter.ID=function(e){var t=e.replace(rt,it);return function(e){var n=typeof e.getAttributeNode!==j&&e.getAttributeNode("id");return n&&n.value===t}}),o.find.TAG=r.getElementsByTagName?function(e,n){return typeof n.getElementsByTagName!==j?n.getElementsByTagName(e):t}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},o.find.CLASS=r.getElementsByClassName&&function(e,n){return typeof n.getElementsByClassName!==j&&h?n.getElementsByClassName(e):t},m=[],g=[],(r.qsa=K.test(n.querySelectorAll))&&(ut(function(e){e.innerHTML="<select><option selected=''></option></select>",e.querySelectorAll("[selected]").length||g.push("\\["+P+"*(?:value|"+B+")"),e.querySelectorAll(":checked").length||g.push(":checked")}),ut(function(e){var t=n.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("t",""),e.querySelectorAll("[t^='']").length&&g.push("[*^$]="+P+"*(?:''|\"\")"),e.querySelectorAll(":enabled").length||g.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),g.push(",.*:")})),(r.matchesSelector=K.test(y=d.webkitMatchesSelector||d.mozMatchesSelector||d.oMatchesSelector||d.msMatchesSelector))&&ut(function(e){r.disconnectedMatch=y.call(e,"div"),y.call(e,"[s!='']:x"),m.push("!=",I)}),g=g.length&&RegExp(g.join("|")),m=m.length&&RegExp(m.join("|")),v=K.test(d.contains)||d.compareDocumentPosition?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},A=d.compareDocumentPosition?function(e,t){if(e===t)return S=!0,0;var i=t.compareDocumentPosition&&e.compareDocumentPosition&&e.compareDocumentPosition(t);return i?1&i||!r.sortDetached&&t.compareDocumentPosition(e)===i?e===n||v(w,e)?-1:t===n||v(w,t)?1:c?F.call(c,e)-F.call(c,t):0:4&i?-1:1:e.compareDocumentPosition?-1:1}:function(e,t){var r,i=0,o=e.parentNode,a=t.parentNode,s=[e],l=[t];if(e===t)return S=!0,0;if(!o||!a)return e===n?-1:t===n?1:o?-1:a?1:c?F.call(c,e)-F.call(c,t):0;if(o===a)return pt(e,t);r=e;while(r=r.parentNode)s.unshift(r);r=t;while(r=r.parentNode)l.unshift(r);while(s[i]===l[i])i++;return i?pt(s[i],l[i]):s[i]===w?-1:l[i]===w?1:0},n):f},at.matches=function(e,t){return at(e,null,null,t)},at.matchesSelector=function(e,t){if((e.ownerDocument||e)!==f&&p(e),t=t.replace(Y,"='$1']"),!(!r.matchesSelector||!h||m&&m.test(t)||g&&g.test(t)))try{var n=y.call(e,t);if(n||r.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(i){}return at(t,f,null,[e]).length>0},at.contains=function(e,t){return(e.ownerDocument||e)!==f&&p(e),v(e,t)},at.attr=function(e,n){(e.ownerDocument||e)!==f&&p(e);var i=o.attrHandle[n.toLowerCase()],a=i&&L.call(o.attrHandle,n.toLowerCase())?i(e,n,!h):t;return a===t?r.attributes||!h?e.getAttribute(n):(a=e.getAttributeNode(n))&&a.specified?a.value:null:a},at.error=function(e){throw Error("Syntax error, unrecognized expression: "+e)},at.uniqueSort=function(e){var t,n=[],i=0,o=0;if(S=!r.detectDuplicates,c=!r.sortStable&&e.slice(0),e.sort(A),S){while(t=e[o++])t===e[o]&&(i=n.push(o));while(i--)e.splice(n[i],1)}return e},a=at.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=a(e)}else if(3===i||4===i)return e.nodeValue}else for(;t=e[r];r++)n+=a(t);return n},o=at.selectors={cacheLength:50,createPseudo:lt,match:Q,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(rt,it),e[3]=(e[4]||e[5]||"").replace(rt,it),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||at.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&at.error(e[0]),e},PSEUDO:function(e){var n,r=!e[5]&&e[2];return Q.CHILD.test(e[0])?null:(e[3]&&e[4]!==t?e[2]=e[4]:r&&J.test(r)&&(n=mt(r,!0))&&(n=r.indexOf(")",r.length-n)-r.length)&&(e[0]=e[0].slice(0,n),e[2]=r.slice(0,n)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(rt,it).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=N[e+" "];return t||(t=RegExp("(^|"+P+")"+e+"("+P+"|$)"))&&N(e,function(e){return t.test("string"==typeof e.className&&e.className||typeof e.getAttribute!==j&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=at.attr(r,e);return null==i?"!="===t:t?(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i+" ").indexOf(n)>-1:"|="===t?i===n||i.slice(0,n.length+1)===n+"-":!1):!0}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,l){var u,c,p,f,d,h,g=o!==a?"nextSibling":"previousSibling",m=t.parentNode,y=s&&t.nodeName.toLowerCase(),v=!l&&!s;if(m){if(o){while(g){p=t;while(p=p[g])if(s?p.nodeName.toLowerCase()===y:1===p.nodeType)return!1;h=g="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?m.firstChild:m.lastChild],a&&v){c=m[b]||(m[b]={}),u=c[e]||[],d=u[0]===T&&u[1],f=u[0]===T&&u[2],p=d&&m.childNodes[d];while(p=++d&&p&&p[g]||(f=d=0)||h.pop())if(1===p.nodeType&&++f&&p===t){c[e]=[T,d,f];break}}else if(v&&(u=(t[b]||(t[b]={}))[e])&&u[0]===T)f=u[1];else while(p=++d&&p&&p[g]||(f=d=0)||h.pop())if((s?p.nodeName.toLowerCase()===y:1===p.nodeType)&&++f&&(v&&((p[b]||(p[b]={}))[e]=[T,f]),p===t))break;return f-=i,f===r||0===f%r&&f/r>=0}}},PSEUDO:function(e,t){var n,r=o.pseudos[e]||o.setFilters[e.toLowerCase()]||at.error("unsupported pseudo: "+e);return r[b]?r(t):r.length>1?(n=[e,e,"",t],o.setFilters.hasOwnProperty(e.toLowerCase())?lt(function(e,n){var i,o=r(e,t),a=o.length;while(a--)i=F.call(e,o[a]),e[i]=!(n[i]=o[a])}):function(e){return r(e,0,n)}):r}},pseudos:{not:lt(function(e){var t=[],n=[],r=l(e.replace(z,"$1"));return r[b]?lt(function(e,t,n,i){var o,a=r(e,null,i,[]),s=e.length;while(s--)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),!n.pop()}}),has:lt(function(e){return function(t){return at(e,t).length>0}}),contains:lt(function(e){return function(t){return(t.textContent||t.innerText||a(t)).indexOf(e)>-1}}),lang:lt(function(e){return G.test(e||"")||at.error("unsupported lang: "+e),e=e.replace(rt,it).toLowerCase(),function(t){var n;do if(n=h?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return n=n.toLowerCase(),n===e||0===n.indexOf(e+"-");while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===d},focus:function(e){return e===f.activeElement&&(!f.hasFocus||f.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:function(e){return e.disabled===!1},disabled:function(e){return e.disabled===!0},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,e.selected===!0},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeName>"@"||3===e.nodeType||4===e.nodeType)return!1;return!0},parent:function(e){return!o.pseudos.empty(e)},header:function(e){return tt.test(e.nodeName)},input:function(e){return et.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||t.toLowerCase()===e.type)},first:ht(function(){return[0]}),last:ht(function(e,t){return[t-1]}),eq:ht(function(e,t,n){return[0>n?n+t:n]}),even:ht(function(e,t){var n=0;for(;t>n;n+=2)e.push(n);return e}),odd:ht(function(e,t){var n=1;for(;t>n;n+=2)e.push(n);return e}),lt:ht(function(e,t,n){var r=0>n?n+t:n;for(;--r>=0;)e.push(r);return e}),gt:ht(function(e,t,n){var r=0>n?n+t:n;for(;t>++r;)e.push(r);return e})}},o.pseudos.nth=o.pseudos.eq;for(n in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})o.pseudos[n]=ft(n);for(n in{submit:!0,reset:!0})o.pseudos[n]=dt(n);function gt(){}gt.prototype=o.filters=o.pseudos,o.setFilters=new gt;function mt(e,t){var n,r,i,a,s,l,u,c=k[e+" "];if(c)return t?0:c.slice(0);s=e,l=[],u=o.preFilter;while(s){(!n||(r=X.exec(s)))&&(r&&(s=s.slice(r[0].length)||s),l.push(i=[])),n=!1,(r=U.exec(s))&&(n=r.shift(),i.push({value:n,type:r[0].replace(z," ")}),s=s.slice(n.length));for(a in o.filter)!(r=Q[a].exec(s))||u[a]&&!(r=u[a](r))||(n=r.shift(),i.push({value:n,type:a,matches:r}),s=s.slice(n.length));if(!n)break}return t?s.length:s?at.error(e):k(e,l).slice(0)}function yt(e){var t=0,n=e.length,r="";for(;n>t;t++)r+=e[t].value;return r}function vt(e,t,n){var r=t.dir,o=n&&"parentNode"===r,a=C++;return t.first?function(t,n,i){while(t=t[r])if(1===t.nodeType||o)return e(t,n,i)}:function(t,n,s){var l,u,c,p=T+" "+a;if(s){while(t=t[r])if((1===t.nodeType||o)&&e(t,n,s))return!0}else while(t=t[r])if(1===t.nodeType||o)if(c=t[b]||(t[b]={}),(u=c[r])&&u[0]===p){if((l=u[1])===!0||l===i)return l===!0}else if(u=c[r]=[p],u[1]=e(t,n,s)||i,u[1]===!0)return!0}}function bt(e){return e.length>1?function(t,n,r){var i=e.length;while(i--)if(!e[i](t,n,r))return!1;return!0}:e[0]}function xt(e,t,n,r,i){var o,a=[],s=0,l=e.length,u=null!=t;for(;l>s;s++)(o=e[s])&&(!n||n(o,r,i))&&(a.push(o),u&&t.push(s));return a}function wt(e,t,n,r,i,o){return r&&!r[b]&&(r=wt(r)),i&&!i[b]&&(i=wt(i,o)),lt(function(o,a,s,l){var u,c,p,f=[],d=[],h=a.length,g=o||Nt(t||"*",s.nodeType?[s]:s,[]),m=!e||!o&&t?g:xt(g,f,e,s,l),y=n?i||(o?e:h||r)?[]:a:m;if(n&&n(m,y,s,l),r){u=xt(y,d),r(u,[],s,l),c=u.length;while(c--)(p=u[c])&&(y[d[c]]=!(m[d[c]]=p))}if(o){if(i||e){if(i){u=[],c=y.length;while(c--)(p=y[c])&&u.push(m[c]=p);i(null,y=[],u,l)}c=y.length;while(c--)(p=y[c])&&(u=i?F.call(o,p):f[c])>-1&&(o[u]=!(a[u]=p))}}else y=xt(y===a?y.splice(h,y.length):y),i?i(null,a,y,l):M.apply(a,y)})}function Tt(e){var t,n,r,i=e.length,a=o.relative[e[0].type],s=a||o.relative[" "],l=a?1:0,c=vt(function(e){return e===t},s,!0),p=vt(function(e){return F.call(t,e)>-1},s,!0),f=[function(e,n,r){return!a&&(r||n!==u)||((t=n).nodeType?c(e,n,r):p(e,n,r))}];for(;i>l;l++)if(n=o.relative[e[l].type])f=[vt(bt(f),n)];else{if(n=o.filter[e[l].type].apply(null,e[l].matches),n[b]){for(r=++l;i>r;r++)if(o.relative[e[r].type])break;return wt(l>1&&bt(f),l>1&&yt(e.slice(0,l-1).concat({value:" "===e[l-2].type?"*":""})).replace(z,"$1"),n,r>l&&Tt(e.slice(l,r)),i>r&&Tt(e=e.slice(r)),i>r&&yt(e))}f.push(n)}return bt(f)}function Ct(e,t){var n=0,r=t.length>0,a=e.length>0,s=function(s,l,c,p,d){var h,g,m,y=[],v=0,b="0",x=s&&[],w=null!=d,C=u,N=s||a&&o.find.TAG("*",d&&l.parentNode||l),k=T+=null==C?1:Math.random()||.1;for(w&&(u=l!==f&&l,i=n);null!=(h=N[b]);b++){if(a&&h){g=0;while(m=e[g++])if(m(h,l,c)){p.push(h);break}w&&(T=k,i=++n)}r&&((h=!m&&h)&&v--,s&&x.push(h))}if(v+=b,r&&b!==v){g=0;while(m=t[g++])m(x,y,l,c);if(s){if(v>0)while(b--)x[b]||y[b]||(y[b]=q.call(p));y=xt(y)}M.apply(p,y),w&&!s&&y.length>0&&v+t.length>1&&at.uniqueSort(p)}return w&&(T=k,u=C),x};return r?lt(s):s}l=at.compile=function(e,t){var n,r=[],i=[],o=E[e+" "];if(!o){t||(t=mt(e)),n=t.length;while(n--)o=Tt(t[n]),o[b]?r.push(o):i.push(o);o=E(e,Ct(i,r))}return o};function Nt(e,t,n){var r=0,i=t.length;for(;i>r;r++)at(e,t[r],n);return n}function kt(e,t,n,i){var a,s,u,c,p,f=mt(e);if(!i&&1===f.length){if(s=f[0]=f[0].slice(0),s.length>2&&"ID"===(u=s[0]).type&&r.getById&&9===t.nodeType&&h&&o.relative[s[1].type]){if(t=(o.find.ID(u.matches[0].replace(rt,it),t)||[])[0],!t)return n;e=e.slice(s.shift().value.length)}a=Q.needsContext.test(e)?0:s.length;while(a--){if(u=s[a],o.relative[c=u.type])break;if((p=o.find[c])&&(i=p(u.matches[0].replace(rt,it),V.test(s[0].type)&&t.parentNode||t))){if(s.splice(a,1),e=i.length&&yt(s),!e)return M.apply(n,i),n;break}}}return l(e,f)(i,t,!h,n,V.test(e)),n}r.sortStable=b.split("").sort(A).join("")===b,r.detectDuplicates=S,p(),r.sortDetached=ut(function(e){return 1&e.compareDocumentPosition(f.createElement("div"))}),ut(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||ct("type|href|height|width",function(e,n,r){return r?t:e.getAttribute(n,"type"===n.toLowerCase()?1:2)}),r.attributes&&ut(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||ct("value",function(e,n,r){return r||"input"!==e.nodeName.toLowerCase()?t:e.defaultValue}),ut(function(e){return null==e.getAttribute("disabled")})||ct(B,function(e,n,r){var i;return r?t:(i=e.getAttributeNode(n))&&i.specified?i.value:e[n]===!0?n.toLowerCase():null}),x.find=at,x.expr=at.selectors,x.expr[":"]=x.expr.pseudos,x.unique=at.uniqueSort,x.text=at.getText,x.isXMLDoc=at.isXML,x.contains=at.contains}(e);var O={};function F(e){var t=O[e]={};return x.each(e.match(T)||[],function(e,n){t[n]=!0}),t}x.Callbacks=function(e){e="string"==typeof e?O[e]||F(e):x.extend({},e);var n,r,i,o,a,s,l=[],u=!e.once&&[],c=function(t){for(r=e.memory&&t,i=!0,a=s||0,s=0,o=l.length,n=!0;l&&o>a;a++)if(l[a].apply(t[0],t[1])===!1&&e.stopOnFalse){r=!1;break}n=!1,l&&(u?u.length&&c(u.shift()):r?l=[]:p.disable())},p={add:function(){if(l){var t=l.length;(function i(t){x.each(t,function(t,n){var r=x.type(n);"function"===r?e.unique&&p.has(n)||l.push(n):n&&n.length&&"string"!==r&&i(n)})})(arguments),n?o=l.length:r&&(s=t,c(r))}return this},remove:function(){return l&&x.each(arguments,function(e,t){var r;while((r=x.inArray(t,l,r))>-1)l.splice(r,1),n&&(o>=r&&o--,a>=r&&a--)}),this},has:function(e){return e?x.inArray(e,l)>-1:!(!l||!l.length)},empty:function(){return l=[],o=0,this},disable:function(){return l=u=r=t,this},disabled:function(){return!l},lock:function(){return u=t,r||p.disable(),this},locked:function(){return!u},fireWith:function(e,t){return!l||i&&!u||(t=t||[],t=[e,t.slice?t.slice():t],n?u.push(t):c(t)),this},fire:function(){return p.fireWith(this,arguments),this},fired:function(){return!!i}};return p},x.extend({Deferred:function(e){var t=[["resolve","done",x.Callbacks("once memory"),"resolved"],["reject","fail",x.Callbacks("once memory"),"rejected"],["notify","progress",x.Callbacks("memory")]],n="pending",r={state:function(){return n},always:function(){return i.done(arguments).fail(arguments),this},then:function(){var e=arguments;return x.Deferred(function(n){x.each(t,function(t,o){var a=o[0],s=x.isFunction(e[t])&&e[t];i[o[1]](function(){var e=s&&s.apply(this,arguments);e&&x.isFunction(e.promise)?e.promise().done(n.resolve).fail(n.reject).progress(n.notify):n[a+"With"](this===r?n.promise():this,s?[e]:arguments)})}),e=null}).promise()},promise:function(e){return null!=e?x.extend(e,r):r}},i={};return r.pipe=r.then,x.each(t,function(e,o){var a=o[2],s=o[3];r[o[1]]=a.add,s&&a.add(function(){n=s},t[1^e][2].disable,t[2][2].lock),i[o[0]]=function(){return i[o[0]+"With"](this===i?r:this,arguments),this},i[o[0]+"With"]=a.fireWith}),r.promise(i),e&&e.call(i,i),i},when:function(e){var t=0,n=g.call(arguments),r=n.length,i=1!==r||e&&x.isFunction(e.promise)?r:0,o=1===i?e:x.Deferred(),a=function(e,t,n){return function(r){t[e]=this,n[e]=arguments.length>1?g.call(arguments):r,n===s?o.notifyWith(t,n):--i||o.resolveWith(t,n)}},s,l,u;if(r>1)for(s=Array(r),l=Array(r),u=Array(r);r>t;t++)n[t]&&x.isFunction(n[t].promise)?n[t].promise().done(a(t,u,n)).fail(o.reject).progress(a(t,l,s)):--i;return i||o.resolveWith(u,n),o.promise()}}),x.support=function(t){var n,r,o,s,l,u,c,p,f,d=a.createElement("div");if(d.setAttribute("className","t"),d.innerHTML=" <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",n=d.getElementsByTagName("*")||[],r=d.getElementsByTagName("a")[0],!r||!r.style||!n.length)return t;s=a.createElement("select"),u=s.appendChild(a.createElement("option")),o=d.getElementsByTagName("input")[0],r.style.cssText="top:1px;float:left;opacity:.5",t.getSetAttribute="t"!==d.className,t.leadingWhitespace=3===d.firstChild.nodeType,t.tbody=!d.getElementsByTagName("tbody").length,t.htmlSerialize=!!d.getElementsByTagName("link").length,t.style=/top/.test(r.getAttribute("style")),t.hrefNormalized="/a"===r.getAttribute("href"),t.opacity=/^0.5/.test(r.style.opacity),t.cssFloat=!!r.style.cssFloat,t.checkOn=!!o.value,t.optSelected=u.selected,t.enctype=!!a.createElement("form").enctype,t.html5Clone="<:nav></:nav>"!==a.createElement("nav").cloneNode(!0).outerHTML,t.inlineBlockNeedsLayout=!1,t.shrinkWrapBlocks=!1,t.pixelPosition=!1,t.deleteExpando=!0,t.noCloneEvent=!0,t.reliableMarginRight=!0,t.boxSizingReliable=!0,o.checked=!0,t.noCloneChecked=o.cloneNode(!0).checked,s.disabled=!0,t.optDisabled=!u.disabled;try{delete d.test}catch(h){t.deleteExpando=!1}o=a.createElement("input"),o.setAttribute("value",""),t.input=""===o.getAttribute("value"),o.value="t",o.setAttribute("type","radio"),t.radioValue="t"===o.value,o.setAttribute("checked","t"),o.setAttribute("name","t"),l=a.createDocumentFragment(),l.appendChild(o),t.appendChecked=o.checked,t.checkClone=l.cloneNode(!0).cloneNode(!0).lastChild.checked,d.attachEvent&&(d.attachEvent("onclick",function(){t.noCloneEvent=!1}),d.cloneNode(!0).click());for(f in{submit:!0,change:!0,focusin:!0})d.setAttribute(c="on"+f,"t"),t[f+"Bubbles"]=c in e||d.attributes[c].expando===!1;d.style.backgroundClip="content-box",d.cloneNode(!0).style.backgroundClip="",t.clearCloneStyle="content-box"===d.style.backgroundClip;for(f in x(t))break;return t.ownLast="0"!==f,x(function(){var n,r,o,s="padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;",l=a.getElementsByTagName("body")[0];l&&(n=a.createElement("div"),n.style.cssText="border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px",l.appendChild(n).appendChild(d),d.innerHTML="<table><tr><td></td><td>t</td></tr></table>",o=d.getElementsByTagName("td"),o[0].style.cssText="padding:0;margin:0;border:0;display:none",p=0===o[0].offsetHeight,o[0].style.display="",o[1].style.display="none",t.reliableHiddenOffsets=p&&0===o[0].offsetHeight,d.innerHTML="",d.style.cssText="box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;",x.swap(l,null!=l.style.zoom?{zoom:1}:{},function(){t.boxSizing=4===d.offsetWidth}),e.getComputedStyle&&(t.pixelPosition="1%"!==(e.getComputedStyle(d,null)||{}).top,t.boxSizingReliable="4px"===(e.getComputedStyle(d,null)||{width:"4px"}).width,r=d.appendChild(a.createElement("div")),r.style.cssText=d.style.cssText=s,r.style.marginRight=r.style.width="0",d.style.width="1px",t.reliableMarginRight=!parseFloat((e.getComputedStyle(r,null)||{}).marginRight)),typeof d.style.zoom!==i&&(d.innerHTML="",d.style.cssText=s+"width:1px;padding:1px;display:inline;zoom:1",t.inlineBlockNeedsLayout=3===d.offsetWidth,d.style.display="block",d.innerHTML="<div></div>",d.firstChild.style.width="5px",t.shrinkWrapBlocks=3!==d.offsetWidth,t.inlineBlockNeedsLayout&&(l.style.zoom=1)),l.removeChild(n),n=d=o=r=null)}),n=s=l=u=r=o=null,t
|
5 |
+
}({});var B=/(?:\{[\s\S]*\}|\[[\s\S]*\])$/,P=/([A-Z])/g;function R(e,n,r,i){if(x.acceptData(e)){var o,a,s=x.expando,l=e.nodeType,u=l?x.cache:e,c=l?e[s]:e[s]&&s;if(c&&u[c]&&(i||u[c].data)||r!==t||"string"!=typeof n)return c||(c=l?e[s]=p.pop()||x.guid++:s),u[c]||(u[c]=l?{}:{toJSON:x.noop}),("object"==typeof n||"function"==typeof n)&&(i?u[c]=x.extend(u[c],n):u[c].data=x.extend(u[c].data,n)),a=u[c],i||(a.data||(a.data={}),a=a.data),r!==t&&(a[x.camelCase(n)]=r),"string"==typeof n?(o=a[n],null==o&&(o=a[x.camelCase(n)])):o=a,o}}function W(e,t,n){if(x.acceptData(e)){var r,i,o=e.nodeType,a=o?x.cache:e,s=o?e[x.expando]:x.expando;if(a[s]){if(t&&(r=n?a[s]:a[s].data)){x.isArray(t)?t=t.concat(x.map(t,x.camelCase)):t in r?t=[t]:(t=x.camelCase(t),t=t in r?[t]:t.split(" ")),i=t.length;while(i--)delete r[t[i]];if(n?!I(r):!x.isEmptyObject(r))return}(n||(delete a[s].data,I(a[s])))&&(o?x.cleanData([e],!0):x.support.deleteExpando||a!=a.window?delete a[s]:a[s]=null)}}}x.extend({cache:{},noData:{applet:!0,embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(e){return e=e.nodeType?x.cache[e[x.expando]]:e[x.expando],!!e&&!I(e)},data:function(e,t,n){return R(e,t,n)},removeData:function(e,t){return W(e,t)},_data:function(e,t,n){return R(e,t,n,!0)},_removeData:function(e,t){return W(e,t,!0)},acceptData:function(e){if(e.nodeType&&1!==e.nodeType&&9!==e.nodeType)return!1;var t=e.nodeName&&x.noData[e.nodeName.toLowerCase()];return!t||t!==!0&&e.getAttribute("classid")===t}}),x.fn.extend({data:function(e,n){var r,i,o=null,a=0,s=this[0];if(e===t){if(this.length&&(o=x.data(s),1===s.nodeType&&!x._data(s,"parsedAttrs"))){for(r=s.attributes;r.length>a;a++)i=r[a].name,0===i.indexOf("data-")&&(i=x.camelCase(i.slice(5)),$(s,i,o[i]));x._data(s,"parsedAttrs",!0)}return o}return"object"==typeof e?this.each(function(){x.data(this,e)}):arguments.length>1?this.each(function(){x.data(this,e,n)}):s?$(s,e,x.data(s,e)):null},removeData:function(e){return this.each(function(){x.removeData(this,e)})}});function $(e,n,r){if(r===t&&1===e.nodeType){var i="data-"+n.replace(P,"-$1").toLowerCase();if(r=e.getAttribute(i),"string"==typeof r){try{r="true"===r?!0:"false"===r?!1:"null"===r?null:+r+""===r?+r:B.test(r)?x.parseJSON(r):r}catch(o){}x.data(e,n,r)}else r=t}return r}function I(e){var t;for(t in e)if(("data"!==t||!x.isEmptyObject(e[t]))&&"toJSON"!==t)return!1;return!0}x.extend({queue:function(e,n,r){var i;return e?(n=(n||"fx")+"queue",i=x._data(e,n),r&&(!i||x.isArray(r)?i=x._data(e,n,x.makeArray(r)):i.push(r)),i||[]):t},dequeue:function(e,t){t=t||"fx";var n=x.queue(e,t),r=n.length,i=n.shift(),o=x._queueHooks(e,t),a=function(){x.dequeue(e,t)};"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,a,o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return x._data(e,n)||x._data(e,n,{empty:x.Callbacks("once memory").add(function(){x._removeData(e,t+"queue"),x._removeData(e,n)})})}}),x.fn.extend({queue:function(e,n){var r=2;return"string"!=typeof e&&(n=e,e="fx",r--),r>arguments.length?x.queue(this[0],e):n===t?this:this.each(function(){var t=x.queue(this,e,n);x._queueHooks(this,e),"fx"===e&&"inprogress"!==t[0]&&x.dequeue(this,e)})},dequeue:function(e){return this.each(function(){x.dequeue(this,e)})},delay:function(e,t){return e=x.fx?x.fx.speeds[e]||e:e,t=t||"fx",this.queue(t,function(t,n){var r=setTimeout(t,e);n.stop=function(){clearTimeout(r)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,n){var r,i=1,o=x.Deferred(),a=this,s=this.length,l=function(){--i||o.resolveWith(a,[a])};"string"!=typeof e&&(n=e,e=t),e=e||"fx";while(s--)r=x._data(a[s],e+"queueHooks"),r&&r.empty&&(i++,r.empty.add(l));return l(),o.promise(n)}});var z,X,U=/[\t\r\n\f]/g,V=/\r/g,Y=/^(?:input|select|textarea|button|object)$/i,J=/^(?:a|area)$/i,G=/^(?:checked|selected)$/i,Q=x.support.getSetAttribute,K=x.support.input;x.fn.extend({attr:function(e,t){return x.access(this,x.attr,e,t,arguments.length>1)},removeAttr:function(e){return this.each(function(){x.removeAttr(this,e)})},prop:function(e,t){return x.access(this,x.prop,e,t,arguments.length>1)},removeProp:function(e){return e=x.propFix[e]||e,this.each(function(){try{this[e]=t,delete this[e]}catch(n){}})},addClass:function(e){var t,n,r,i,o,a=0,s=this.length,l="string"==typeof e&&e;if(x.isFunction(e))return this.each(function(t){x(this).addClass(e.call(this,t,this.className))});if(l)for(t=(e||"").match(T)||[];s>a;a++)if(n=this[a],r=1===n.nodeType&&(n.className?(" "+n.className+" ").replace(U," "):" ")){o=0;while(i=t[o++])0>r.indexOf(" "+i+" ")&&(r+=i+" ");n.className=x.trim(r)}return this},removeClass:function(e){var t,n,r,i,o,a=0,s=this.length,l=0===arguments.length||"string"==typeof e&&e;if(x.isFunction(e))return this.each(function(t){x(this).removeClass(e.call(this,t,this.className))});if(l)for(t=(e||"").match(T)||[];s>a;a++)if(n=this[a],r=1===n.nodeType&&(n.className?(" "+n.className+" ").replace(U," "):"")){o=0;while(i=t[o++])while(r.indexOf(" "+i+" ")>=0)r=r.replace(" "+i+" "," ");n.className=e?x.trim(r):""}return this},toggleClass:function(e,t){var n=typeof e;return"boolean"==typeof t&&"string"===n?t?this.addClass(e):this.removeClass(e):x.isFunction(e)?this.each(function(n){x(this).toggleClass(e.call(this,n,this.className,t),t)}):this.each(function(){if("string"===n){var t,r=0,o=x(this),a=e.match(T)||[];while(t=a[r++])o.hasClass(t)?o.removeClass(t):o.addClass(t)}else(n===i||"boolean"===n)&&(this.className&&x._data(this,"__className__",this.className),this.className=this.className||e===!1?"":x._data(this,"__className__")||"")})},hasClass:function(e){var t=" "+e+" ",n=0,r=this.length;for(;r>n;n++)if(1===this[n].nodeType&&(" "+this[n].className+" ").replace(U," ").indexOf(t)>=0)return!0;return!1},val:function(e){var n,r,i,o=this[0];{if(arguments.length)return i=x.isFunction(e),this.each(function(n){var o;1===this.nodeType&&(o=i?e.call(this,n,x(this).val()):e,null==o?o="":"number"==typeof o?o+="":x.isArray(o)&&(o=x.map(o,function(e){return null==e?"":e+""})),r=x.valHooks[this.type]||x.valHooks[this.nodeName.toLowerCase()],r&&"set"in r&&r.set(this,o,"value")!==t||(this.value=o))});if(o)return r=x.valHooks[o.type]||x.valHooks[o.nodeName.toLowerCase()],r&&"get"in r&&(n=r.get(o,"value"))!==t?n:(n=o.value,"string"==typeof n?n.replace(V,""):null==n?"":n)}}}),x.extend({valHooks:{option:{get:function(e){var t=x.find.attr(e,"value");return null!=t?t:e.text}},select:{get:function(e){var t,n,r=e.options,i=e.selectedIndex,o="select-one"===e.type||0>i,a=o?null:[],s=o?i+1:r.length,l=0>i?s:o?i:0;for(;s>l;l++)if(n=r[l],!(!n.selected&&l!==i||(x.support.optDisabled?n.disabled:null!==n.getAttribute("disabled"))||n.parentNode.disabled&&x.nodeName(n.parentNode,"optgroup"))){if(t=x(n).val(),o)return t;a.push(t)}return a},set:function(e,t){var n,r,i=e.options,o=x.makeArray(t),a=i.length;while(a--)r=i[a],(r.selected=x.inArray(x(r).val(),o)>=0)&&(n=!0);return n||(e.selectedIndex=-1),o}}},attr:function(e,n,r){var o,a,s=e.nodeType;if(e&&3!==s&&8!==s&&2!==s)return typeof e.getAttribute===i?x.prop(e,n,r):(1===s&&x.isXMLDoc(e)||(n=n.toLowerCase(),o=x.attrHooks[n]||(x.expr.match.bool.test(n)?X:z)),r===t?o&&"get"in o&&null!==(a=o.get(e,n))?a:(a=x.find.attr(e,n),null==a?t:a):null!==r?o&&"set"in o&&(a=o.set(e,r,n))!==t?a:(e.setAttribute(n,r+""),r):(x.removeAttr(e,n),t))},removeAttr:function(e,t){var n,r,i=0,o=t&&t.match(T);if(o&&1===e.nodeType)while(n=o[i++])r=x.propFix[n]||n,x.expr.match.bool.test(n)?K&&Q||!G.test(n)?e[r]=!1:e[x.camelCase("default-"+n)]=e[r]=!1:x.attr(e,n,""),e.removeAttribute(Q?n:r)},attrHooks:{type:{set:function(e,t){if(!x.support.radioValue&&"radio"===t&&x.nodeName(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},propFix:{"for":"htmlFor","class":"className"},prop:function(e,n,r){var i,o,a,s=e.nodeType;if(e&&3!==s&&8!==s&&2!==s)return a=1!==s||!x.isXMLDoc(e),a&&(n=x.propFix[n]||n,o=x.propHooks[n]),r!==t?o&&"set"in o&&(i=o.set(e,r,n))!==t?i:e[n]=r:o&&"get"in o&&null!==(i=o.get(e,n))?i:e[n]},propHooks:{tabIndex:{get:function(e){var t=x.find.attr(e,"tabindex");return t?parseInt(t,10):Y.test(e.nodeName)||J.test(e.nodeName)&&e.href?0:-1}}}}),X={set:function(e,t,n){return t===!1?x.removeAttr(e,n):K&&Q||!G.test(n)?e.setAttribute(!Q&&x.propFix[n]||n,n):e[x.camelCase("default-"+n)]=e[n]=!0,n}},x.each(x.expr.match.bool.source.match(/\w+/g),function(e,n){var r=x.expr.attrHandle[n]||x.find.attr;x.expr.attrHandle[n]=K&&Q||!G.test(n)?function(e,n,i){var o=x.expr.attrHandle[n],a=i?t:(x.expr.attrHandle[n]=t)!=r(e,n,i)?n.toLowerCase():null;return x.expr.attrHandle[n]=o,a}:function(e,n,r){return r?t:e[x.camelCase("default-"+n)]?n.toLowerCase():null}}),K&&Q||(x.attrHooks.value={set:function(e,n,r){return x.nodeName(e,"input")?(e.defaultValue=n,t):z&&z.set(e,n,r)}}),Q||(z={set:function(e,n,r){var i=e.getAttributeNode(r);return i||e.setAttributeNode(i=e.ownerDocument.createAttribute(r)),i.value=n+="","value"===r||n===e.getAttribute(r)?n:t}},x.expr.attrHandle.id=x.expr.attrHandle.name=x.expr.attrHandle.coords=function(e,n,r){var i;return r?t:(i=e.getAttributeNode(n))&&""!==i.value?i.value:null},x.valHooks.button={get:function(e,n){var r=e.getAttributeNode(n);return r&&r.specified?r.value:t},set:z.set},x.attrHooks.contenteditable={set:function(e,t,n){z.set(e,""===t?!1:t,n)}},x.each(["width","height"],function(e,n){x.attrHooks[n]={set:function(e,r){return""===r?(e.setAttribute(n,"auto"),r):t}}})),x.support.hrefNormalized||x.each(["href","src"],function(e,t){x.propHooks[t]={get:function(e){return e.getAttribute(t,4)}}}),x.support.style||(x.attrHooks.style={get:function(e){return e.style.cssText||t},set:function(e,t){return e.style.cssText=t+""}}),x.support.optSelected||(x.propHooks.selected={get:function(e){var t=e.parentNode;return t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex),null}}),x.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){x.propFix[this.toLowerCase()]=this}),x.support.enctype||(x.propFix.enctype="encoding"),x.each(["radio","checkbox"],function(){x.valHooks[this]={set:function(e,n){return x.isArray(n)?e.checked=x.inArray(x(e).val(),n)>=0:t}},x.support.checkOn||(x.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})});var Z=/^(?:input|select|textarea)$/i,et=/^key/,tt=/^(?:mouse|contextmenu)|click/,nt=/^(?:focusinfocus|focusoutblur)$/,rt=/^([^.]*)(?:\.(.+)|)$/;function it(){return!0}function ot(){return!1}function at(){try{return a.activeElement}catch(e){}}x.event={global:{},add:function(e,n,r,o,a){var s,l,u,c,p,f,d,h,g,m,y,v=x._data(e);if(v){r.handler&&(c=r,r=c.handler,a=c.selector),r.guid||(r.guid=x.guid++),(l=v.events)||(l=v.events={}),(f=v.handle)||(f=v.handle=function(e){return typeof x===i||e&&x.event.triggered===e.type?t:x.event.dispatch.apply(f.elem,arguments)},f.elem=e),n=(n||"").match(T)||[""],u=n.length;while(u--)s=rt.exec(n[u])||[],g=y=s[1],m=(s[2]||"").split(".").sort(),g&&(p=x.event.special[g]||{},g=(a?p.delegateType:p.bindType)||g,p=x.event.special[g]||{},d=x.extend({type:g,origType:y,data:o,handler:r,guid:r.guid,selector:a,needsContext:a&&x.expr.match.needsContext.test(a),namespace:m.join(".")},c),(h=l[g])||(h=l[g]=[],h.delegateCount=0,p.setup&&p.setup.call(e,o,m,f)!==!1||(e.addEventListener?e.addEventListener(g,f,!1):e.attachEvent&&e.attachEvent("on"+g,f))),p.add&&(p.add.call(e,d),d.handler.guid||(d.handler.guid=r.guid)),a?h.splice(h.delegateCount++,0,d):h.push(d),x.event.global[g]=!0);e=null}},remove:function(e,t,n,r,i){var o,a,s,l,u,c,p,f,d,h,g,m=x.hasData(e)&&x._data(e);if(m&&(c=m.events)){t=(t||"").match(T)||[""],u=t.length;while(u--)if(s=rt.exec(t[u])||[],d=g=s[1],h=(s[2]||"").split(".").sort(),d){p=x.event.special[d]||{},d=(r?p.delegateType:p.bindType)||d,f=c[d]||[],s=s[2]&&RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),l=o=f.length;while(o--)a=f[o],!i&&g!==a.origType||n&&n.guid!==a.guid||s&&!s.test(a.namespace)||r&&r!==a.selector&&("**"!==r||!a.selector)||(f.splice(o,1),a.selector&&f.delegateCount--,p.remove&&p.remove.call(e,a));l&&!f.length&&(p.teardown&&p.teardown.call(e,h,m.handle)!==!1||x.removeEvent(e,d,m.handle),delete c[d])}else for(d in c)x.event.remove(e,d+t[u],n,r,!0);x.isEmptyObject(c)&&(delete m.handle,x._removeData(e,"events"))}},trigger:function(n,r,i,o){var s,l,u,c,p,f,d,h=[i||a],g=v.call(n,"type")?n.type:n,m=v.call(n,"namespace")?n.namespace.split("."):[];if(u=f=i=i||a,3!==i.nodeType&&8!==i.nodeType&&!nt.test(g+x.event.triggered)&&(g.indexOf(".")>=0&&(m=g.split("."),g=m.shift(),m.sort()),l=0>g.indexOf(":")&&"on"+g,n=n[x.expando]?n:new x.Event(g,"object"==typeof n&&n),n.isTrigger=o?2:3,n.namespace=m.join("."),n.namespace_re=n.namespace?RegExp("(^|\\.)"+m.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,n.result=t,n.target||(n.target=i),r=null==r?[n]:x.makeArray(r,[n]),p=x.event.special[g]||{},o||!p.trigger||p.trigger.apply(i,r)!==!1)){if(!o&&!p.noBubble&&!x.isWindow(i)){for(c=p.delegateType||g,nt.test(c+g)||(u=u.parentNode);u;u=u.parentNode)h.push(u),f=u;f===(i.ownerDocument||a)&&h.push(f.defaultView||f.parentWindow||e)}d=0;while((u=h[d++])&&!n.isPropagationStopped())n.type=d>1?c:p.bindType||g,s=(x._data(u,"events")||{})[n.type]&&x._data(u,"handle"),s&&s.apply(u,r),s=l&&u[l],s&&x.acceptData(u)&&s.apply&&s.apply(u,r)===!1&&n.preventDefault();if(n.type=g,!o&&!n.isDefaultPrevented()&&(!p._default||p._default.apply(h.pop(),r)===!1)&&x.acceptData(i)&&l&&i[g]&&!x.isWindow(i)){f=i[l],f&&(i[l]=null),x.event.triggered=g;try{i[g]()}catch(y){}x.event.triggered=t,f&&(i[l]=f)}return n.result}},dispatch:function(e){e=x.event.fix(e);var n,r,i,o,a,s=[],l=g.call(arguments),u=(x._data(this,"events")||{})[e.type]||[],c=x.event.special[e.type]||{};if(l[0]=e,e.delegateTarget=this,!c.preDispatch||c.preDispatch.call(this,e)!==!1){s=x.event.handlers.call(this,e,u),n=0;while((o=s[n++])&&!e.isPropagationStopped()){e.currentTarget=o.elem,a=0;while((i=o.handlers[a++])&&!e.isImmediatePropagationStopped())(!e.namespace_re||e.namespace_re.test(i.namespace))&&(e.handleObj=i,e.data=i.data,r=((x.event.special[i.origType]||{}).handle||i.handler).apply(o.elem,l),r!==t&&(e.result=r)===!1&&(e.preventDefault(),e.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,e),e.result}},handlers:function(e,n){var r,i,o,a,s=[],l=n.delegateCount,u=e.target;if(l&&u.nodeType&&(!e.button||"click"!==e.type))for(;u!=this;u=u.parentNode||this)if(1===u.nodeType&&(u.disabled!==!0||"click"!==e.type)){for(o=[],a=0;l>a;a++)i=n[a],r=i.selector+" ",o[r]===t&&(o[r]=i.needsContext?x(r,this).index(u)>=0:x.find(r,this,null,[u]).length),o[r]&&o.push(i);o.length&&s.push({elem:u,handlers:o})}return n.length>l&&s.push({elem:this,handlers:n.slice(l)}),s},fix:function(e){if(e[x.expando])return e;var t,n,r,i=e.type,o=e,s=this.fixHooks[i];s||(this.fixHooks[i]=s=tt.test(i)?this.mouseHooks:et.test(i)?this.keyHooks:{}),r=s.props?this.props.concat(s.props):this.props,e=new x.Event(o),t=r.length;while(t--)n=r[t],e[n]=o[n];return e.target||(e.target=o.srcElement||a),3===e.target.nodeType&&(e.target=e.target.parentNode),e.metaKey=!!e.metaKey,s.filter?s.filter(e,o):e},props:"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(e,t){return null==e.which&&(e.which=null!=t.charCode?t.charCode:t.keyCode),e}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(e,n){var r,i,o,s=n.button,l=n.fromElement;return null==e.pageX&&null!=n.clientX&&(i=e.target.ownerDocument||a,o=i.documentElement,r=i.body,e.pageX=n.clientX+(o&&o.scrollLeft||r&&r.scrollLeft||0)-(o&&o.clientLeft||r&&r.clientLeft||0),e.pageY=n.clientY+(o&&o.scrollTop||r&&r.scrollTop||0)-(o&&o.clientTop||r&&r.clientTop||0)),!e.relatedTarget&&l&&(e.relatedTarget=l===e.target?n.toElement:l),e.which||s===t||(e.which=1&s?1:2&s?3:4&s?2:0),e}},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==at()&&this.focus)try{return this.focus(),!1}catch(e){}},delegateType:"focusin"},blur:{trigger:function(){return this===at()&&this.blur?(this.blur(),!1):t},delegateType:"focusout"},click:{trigger:function(){return x.nodeName(this,"input")&&"checkbox"===this.type&&this.click?(this.click(),!1):t},_default:function(e){return x.nodeName(e.target,"a")}},beforeunload:{postDispatch:function(e){e.result!==t&&(e.originalEvent.returnValue=e.result)}}},simulate:function(e,t,n,r){var i=x.extend(new x.Event,n,{type:e,isSimulated:!0,originalEvent:{}});r?x.event.trigger(i,null,t):x.event.dispatch.call(t,i),i.isDefaultPrevented()&&n.preventDefault()}},x.removeEvent=a.removeEventListener?function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n,!1)}:function(e,t,n){var r="on"+t;e.detachEvent&&(typeof e[r]===i&&(e[r]=null),e.detachEvent(r,n))},x.Event=function(e,n){return this instanceof x.Event?(e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||e.returnValue===!1||e.getPreventDefault&&e.getPreventDefault()?it:ot):this.type=e,n&&x.extend(this,n),this.timeStamp=e&&e.timeStamp||x.now(),this[x.expando]=!0,t):new x.Event(e,n)},x.Event.prototype={isDefaultPrevented:ot,isPropagationStopped:ot,isImmediatePropagationStopped:ot,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=it,e&&(e.preventDefault?e.preventDefault():e.returnValue=!1)},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=it,e&&(e.stopPropagation&&e.stopPropagation(),e.cancelBubble=!0)},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=it,this.stopPropagation()}},x.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(e,t){x.event.special[e]={delegateType:t,bindType:t,handle:function(e){var n,r=this,i=e.relatedTarget,o=e.handleObj;return(!i||i!==r&&!x.contains(r,i))&&(e.type=o.origType,n=o.handler.apply(this,arguments),e.type=t),n}}}),x.support.submitBubbles||(x.event.special.submit={setup:function(){return x.nodeName(this,"form")?!1:(x.event.add(this,"click._submit keypress._submit",function(e){var n=e.target,r=x.nodeName(n,"input")||x.nodeName(n,"button")?n.form:t;r&&!x._data(r,"submitBubbles")&&(x.event.add(r,"submit._submit",function(e){e._submit_bubble=!0}),x._data(r,"submitBubbles",!0))}),t)},postDispatch:function(e){e._submit_bubble&&(delete e._submit_bubble,this.parentNode&&!e.isTrigger&&x.event.simulate("submit",this.parentNode,e,!0))},teardown:function(){return x.nodeName(this,"form")?!1:(x.event.remove(this,"._submit"),t)}}),x.support.changeBubbles||(x.event.special.change={setup:function(){return Z.test(this.nodeName)?(("checkbox"===this.type||"radio"===this.type)&&(x.event.add(this,"propertychange._change",function(e){"checked"===e.originalEvent.propertyName&&(this._just_changed=!0)}),x.event.add(this,"click._change",function(e){this._just_changed&&!e.isTrigger&&(this._just_changed=!1),x.event.simulate("change",this,e,!0)})),!1):(x.event.add(this,"beforeactivate._change",function(e){var t=e.target;Z.test(t.nodeName)&&!x._data(t,"changeBubbles")&&(x.event.add(t,"change._change",function(e){!this.parentNode||e.isSimulated||e.isTrigger||x.event.simulate("change",this.parentNode,e,!0)}),x._data(t,"changeBubbles",!0))}),t)},handle:function(e){var n=e.target;return this!==n||e.isSimulated||e.isTrigger||"radio"!==n.type&&"checkbox"!==n.type?e.handleObj.handler.apply(this,arguments):t},teardown:function(){return x.event.remove(this,"._change"),!Z.test(this.nodeName)}}),x.support.focusinBubbles||x.each({focus:"focusin",blur:"focusout"},function(e,t){var n=0,r=function(e){x.event.simulate(t,e.target,x.event.fix(e),!0)};x.event.special[t]={setup:function(){0===n++&&a.addEventListener(e,r,!0)},teardown:function(){0===--n&&a.removeEventListener(e,r,!0)}}}),x.fn.extend({on:function(e,n,r,i,o){var a,s;if("object"==typeof e){"string"!=typeof n&&(r=r||n,n=t);for(a in e)this.on(a,n,r,e[a],o);return this}if(null==r&&null==i?(i=n,r=n=t):null==i&&("string"==typeof n?(i=r,r=t):(i=r,r=n,n=t)),i===!1)i=ot;else if(!i)return this;return 1===o&&(s=i,i=function(e){return x().off(e),s.apply(this,arguments)},i.guid=s.guid||(s.guid=x.guid++)),this.each(function(){x.event.add(this,e,i,r,n)})},one:function(e,t,n,r){return this.on(e,t,n,r,1)},off:function(e,n,r){var i,o;if(e&&e.preventDefault&&e.handleObj)return i=e.handleObj,x(e.delegateTarget).off(i.namespace?i.origType+"."+i.namespace:i.origType,i.selector,i.handler),this;if("object"==typeof e){for(o in e)this.off(o,n,e[o]);return this}return(n===!1||"function"==typeof n)&&(r=n,n=t),r===!1&&(r=ot),this.each(function(){x.event.remove(this,e,r,n)})},trigger:function(e,t){return this.each(function(){x.event.trigger(e,t,this)})},triggerHandler:function(e,n){var r=this[0];return r?x.event.trigger(e,n,r,!0):t}});var st=/^.[^:#\[\.,]*$/,lt=/^(?:parents|prev(?:Until|All))/,ut=x.expr.match.needsContext,ct={children:!0,contents:!0,next:!0,prev:!0};x.fn.extend({find:function(e){var t,n=[],r=this,i=r.length;if("string"!=typeof e)return this.pushStack(x(e).filter(function(){for(t=0;i>t;t++)if(x.contains(r[t],this))return!0}));for(t=0;i>t;t++)x.find(e,r[t],n);return n=this.pushStack(i>1?x.unique(n):n),n.selector=this.selector?this.selector+" "+e:e,n},has:function(e){var t,n=x(e,this),r=n.length;return this.filter(function(){for(t=0;r>t;t++)if(x.contains(this,n[t]))return!0})},not:function(e){return this.pushStack(ft(this,e||[],!0))},filter:function(e){return this.pushStack(ft(this,e||[],!1))},is:function(e){return!!ft(this,"string"==typeof e&&ut.test(e)?x(e):e||[],!1).length},closest:function(e,t){var n,r=0,i=this.length,o=[],a=ut.test(e)||"string"!=typeof e?x(e,t||this.context):0;for(;i>r;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(11>n.nodeType&&(a?a.index(n)>-1:1===n.nodeType&&x.find.matchesSelector(n,e))){n=o.push(n);break}return this.pushStack(o.length>1?x.unique(o):o)},index:function(e){return e?"string"==typeof e?x.inArray(this[0],x(e)):x.inArray(e.jquery?e[0]:e,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){var n="string"==typeof e?x(e,t):x.makeArray(e&&e.nodeType?[e]:e),r=x.merge(this.get(),n);return this.pushStack(x.unique(r))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}});function pt(e,t){do e=e[t];while(e&&1!==e.nodeType);return e}x.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return x.dir(e,"parentNode")},parentsUntil:function(e,t,n){return x.dir(e,"parentNode",n)},next:function(e){return pt(e,"nextSibling")},prev:function(e){return pt(e,"previousSibling")},nextAll:function(e){return x.dir(e,"nextSibling")},prevAll:function(e){return x.dir(e,"previousSibling")},nextUntil:function(e,t,n){return x.dir(e,"nextSibling",n)},prevUntil:function(e,t,n){return x.dir(e,"previousSibling",n)},siblings:function(e){return x.sibling((e.parentNode||{}).firstChild,e)},children:function(e){return x.sibling(e.firstChild)},contents:function(e){return x.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:x.merge([],e.childNodes)}},function(e,t){x.fn[e]=function(n,r){var i=x.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=x.filter(r,i)),this.length>1&&(ct[e]||(i=x.unique(i)),lt.test(e)&&(i=i.reverse())),this.pushStack(i)}}),x.extend({filter:function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?x.find.matchesSelector(r,e)?[r]:[]:x.find.matches(e,x.grep(t,function(e){return 1===e.nodeType}))},dir:function(e,n,r){var i=[],o=e[n];while(o&&9!==o.nodeType&&(r===t||1!==o.nodeType||!x(o).is(r)))1===o.nodeType&&i.push(o),o=o[n];return i},sibling:function(e,t){var n=[];for(;e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n}});function ft(e,t,n){if(x.isFunction(t))return x.grep(e,function(e,r){return!!t.call(e,r,e)!==n});if(t.nodeType)return x.grep(e,function(e){return e===t!==n});if("string"==typeof t){if(st.test(t))return x.filter(t,e,n);t=x.filter(t,e)}return x.grep(e,function(e){return x.inArray(e,t)>=0!==n})}function dt(e){var t=ht.split("|"),n=e.createDocumentFragment();if(n.createElement)while(t.length)n.createElement(t.pop());return n}var ht="abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",gt=/ jQuery\d+="(?:null|\d+)"/g,mt=RegExp("<(?:"+ht+")[\\s/>]","i"),yt=/^\s+/,vt=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,bt=/<([\w:]+)/,xt=/<tbody/i,wt=/<|&#?\w+;/,Tt=/<(?:script|style|link)/i,Ct=/^(?:checkbox|radio)$/i,Nt=/checked\s*(?:[^=]|=\s*.checked.)/i,kt=/^$|\/(?:java|ecma)script/i,Et=/^true\/(.*)/,St=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,At={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],area:[1,"<map>","</map>"],param:[1,"<object>","</object>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:x.support.htmlSerialize?[0,"",""]:[1,"X<div>","</div>"]},jt=dt(a),Dt=jt.appendChild(a.createElement("div"));At.optgroup=At.option,At.tbody=At.tfoot=At.colgroup=At.caption=At.thead,At.th=At.td,x.fn.extend({text:function(e){return x.access(this,function(e){return e===t?x.text(this):this.empty().append((this[0]&&this[0].ownerDocument||a).createTextNode(e))},null,e,arguments.length)},append:function(){return this.domManip(arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Lt(this,e);t.appendChild(e)}})},prepend:function(){return this.domManip(arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Lt(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return this.domManip(arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return this.domManip(arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},remove:function(e,t){var n,r=e?x.filter(e,this):this,i=0;for(;null!=(n=r[i]);i++)t||1!==n.nodeType||x.cleanData(Ft(n)),n.parentNode&&(t&&x.contains(n.ownerDocument,n)&&_t(Ft(n,"script")),n.parentNode.removeChild(n));return this},empty:function(){var e,t=0;for(;null!=(e=this[t]);t++){1===e.nodeType&&x.cleanData(Ft(e,!1));while(e.firstChild)e.removeChild(e.firstChild);e.options&&x.nodeName(e,"select")&&(e.options.length=0)}return this},clone:function(e,t){return e=null==e?!1:e,t=null==t?e:t,this.map(function(){return x.clone(this,e,t)})},html:function(e){return x.access(this,function(e){var n=this[0]||{},r=0,i=this.length;if(e===t)return 1===n.nodeType?n.innerHTML.replace(gt,""):t;if(!("string"!=typeof e||Tt.test(e)||!x.support.htmlSerialize&&mt.test(e)||!x.support.leadingWhitespace&&yt.test(e)||At[(bt.exec(e)||["",""])[1].toLowerCase()])){e=e.replace(vt,"<$1></$2>");try{for(;i>r;r++)n=this[r]||{},1===n.nodeType&&(x.cleanData(Ft(n,!1)),n.innerHTML=e);n=0}catch(o){}}n&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var e=x.map(this,function(e){return[e.nextSibling,e.parentNode]}),t=0;return this.domManip(arguments,function(n){var r=e[t++],i=e[t++];i&&(r&&r.parentNode!==i&&(r=this.nextSibling),x(this).remove(),i.insertBefore(n,r))},!0),t?this:this.remove()},detach:function(e){return this.remove(e,!0)},domManip:function(e,t,n){e=d.apply([],e);var r,i,o,a,s,l,u=0,c=this.length,p=this,f=c-1,h=e[0],g=x.isFunction(h);if(g||!(1>=c||"string"!=typeof h||x.support.checkClone)&&Nt.test(h))return this.each(function(r){var i=p.eq(r);g&&(e[0]=h.call(this,r,i.html())),i.domManip(e,t,n)});if(c&&(l=x.buildFragment(e,this[0].ownerDocument,!1,!n&&this),r=l.firstChild,1===l.childNodes.length&&(l=r),r)){for(a=x.map(Ft(l,"script"),Ht),o=a.length;c>u;u++)i=l,u!==f&&(i=x.clone(i,!0,!0),o&&x.merge(a,Ft(i,"script"))),t.call(this[u],i,u);if(o)for(s=a[a.length-1].ownerDocument,x.map(a,qt),u=0;o>u;u++)i=a[u],kt.test(i.type||"")&&!x._data(i,"globalEval")&&x.contains(s,i)&&(i.src?x._evalUrl(i.src):x.globalEval((i.text||i.textContent||i.innerHTML||"").replace(St,"")));l=r=null}return this}});function Lt(e,t){return x.nodeName(e,"table")&&x.nodeName(1===t.nodeType?t:t.firstChild,"tr")?e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody")):e}function Ht(e){return e.type=(null!==x.find.attr(e,"type"))+"/"+e.type,e}function qt(e){var t=Et.exec(e.type);return t?e.type=t[1]:e.removeAttribute("type"),e}function _t(e,t){var n,r=0;for(;null!=(n=e[r]);r++)x._data(n,"globalEval",!t||x._data(t[r],"globalEval"))}function Mt(e,t){if(1===t.nodeType&&x.hasData(e)){var n,r,i,o=x._data(e),a=x._data(t,o),s=o.events;if(s){delete a.handle,a.events={};for(n in s)for(r=0,i=s[n].length;i>r;r++)x.event.add(t,n,s[n][r])}a.data&&(a.data=x.extend({},a.data))}}function Ot(e,t){var n,r,i;if(1===t.nodeType){if(n=t.nodeName.toLowerCase(),!x.support.noCloneEvent&&t[x.expando]){i=x._data(t);for(r in i.events)x.removeEvent(t,r,i.handle);t.removeAttribute(x.expando)}"script"===n&&t.text!==e.text?(Ht(t).text=e.text,qt(t)):"object"===n?(t.parentNode&&(t.outerHTML=e.outerHTML),x.support.html5Clone&&e.innerHTML&&!x.trim(t.innerHTML)&&(t.innerHTML=e.innerHTML)):"input"===n&&Ct.test(e.type)?(t.defaultChecked=t.checked=e.checked,t.value!==e.value&&(t.value=e.value)):"option"===n?t.defaultSelected=t.selected=e.defaultSelected:("input"===n||"textarea"===n)&&(t.defaultValue=e.defaultValue)}}x.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,t){x.fn[e]=function(e){var n,r=0,i=[],o=x(e),a=o.length-1;for(;a>=r;r++)n=r===a?this:this.clone(!0),x(o[r])[t](n),h.apply(i,n.get());return this.pushStack(i)}});function Ft(e,n){var r,o,a=0,s=typeof e.getElementsByTagName!==i?e.getElementsByTagName(n||"*"):typeof e.querySelectorAll!==i?e.querySelectorAll(n||"*"):t;if(!s)for(s=[],r=e.childNodes||e;null!=(o=r[a]);a++)!n||x.nodeName(o,n)?s.push(o):x.merge(s,Ft(o,n));return n===t||n&&x.nodeName(e,n)?x.merge([e],s):s}function Bt(e){Ct.test(e.type)&&(e.defaultChecked=e.checked)}x.extend({clone:function(e,t,n){var r,i,o,a,s,l=x.contains(e.ownerDocument,e);if(x.support.html5Clone||x.isXMLDoc(e)||!mt.test("<"+e.nodeName+">")?o=e.cloneNode(!0):(Dt.innerHTML=e.outerHTML,Dt.removeChild(o=Dt.firstChild)),!(x.support.noCloneEvent&&x.support.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||x.isXMLDoc(e)))for(r=Ft(o),s=Ft(e),a=0;null!=(i=s[a]);++a)r[a]&&Ot(i,r[a]);if(t)if(n)for(s=s||Ft(e),r=r||Ft(o),a=0;null!=(i=s[a]);a++)Mt(i,r[a]);else Mt(e,o);return r=Ft(o,"script"),r.length>0&&_t(r,!l&&Ft(e,"script")),r=s=i=null,o},buildFragment:function(e,t,n,r){var i,o,a,s,l,u,c,p=e.length,f=dt(t),d=[],h=0;for(;p>h;h++)if(o=e[h],o||0===o)if("object"===x.type(o))x.merge(d,o.nodeType?[o]:o);else if(wt.test(o)){s=s||f.appendChild(t.createElement("div")),l=(bt.exec(o)||["",""])[1].toLowerCase(),c=At[l]||At._default,s.innerHTML=c[1]+o.replace(vt,"<$1></$2>")+c[2],i=c[0];while(i--)s=s.lastChild;if(!x.support.leadingWhitespace&&yt.test(o)&&d.push(t.createTextNode(yt.exec(o)[0])),!x.support.tbody){o="table"!==l||xt.test(o)?"<table>"!==c[1]||xt.test(o)?0:s:s.firstChild,i=o&&o.childNodes.length;while(i--)x.nodeName(u=o.childNodes[i],"tbody")&&!u.childNodes.length&&o.removeChild(u)}x.merge(d,s.childNodes),s.textContent="";while(s.firstChild)s.removeChild(s.firstChild);s=f.lastChild}else d.push(t.createTextNode(o));s&&f.removeChild(s),x.support.appendChecked||x.grep(Ft(d,"input"),Bt),h=0;while(o=d[h++])if((!r||-1===x.inArray(o,r))&&(a=x.contains(o.ownerDocument,o),s=Ft(f.appendChild(o),"script"),a&&_t(s),n)){i=0;while(o=s[i++])kt.test(o.type||"")&&n.push(o)}return s=null,f},cleanData:function(e,t){var n,r,o,a,s=0,l=x.expando,u=x.cache,c=x.support.deleteExpando,f=x.event.special;for(;null!=(n=e[s]);s++)if((t||x.acceptData(n))&&(o=n[l],a=o&&u[o])){if(a.events)for(r in a.events)f[r]?x.event.remove(n,r):x.removeEvent(n,r,a.handle);
|
6 |
+
u[o]&&(delete u[o],c?delete n[l]:typeof n.removeAttribute!==i?n.removeAttribute(l):n[l]=null,p.push(o))}},_evalUrl:function(e){return x.ajax({url:e,type:"GET",dataType:"script",async:!1,global:!1,"throws":!0})}}),x.fn.extend({wrapAll:function(e){if(x.isFunction(e))return this.each(function(t){x(this).wrapAll(e.call(this,t))});if(this[0]){var t=x(e,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstChild&&1===e.firstChild.nodeType)e=e.firstChild;return e}).append(this)}return this},wrapInner:function(e){return x.isFunction(e)?this.each(function(t){x(this).wrapInner(e.call(this,t))}):this.each(function(){var t=x(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=x.isFunction(e);return this.each(function(n){x(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(){return this.parent().each(function(){x.nodeName(this,"body")||x(this).replaceWith(this.childNodes)}).end()}});var Pt,Rt,Wt,$t=/alpha\([^)]*\)/i,It=/opacity\s*=\s*([^)]*)/,zt=/^(top|right|bottom|left)$/,Xt=/^(none|table(?!-c[ea]).+)/,Ut=/^margin/,Vt=RegExp("^("+w+")(.*)$","i"),Yt=RegExp("^("+w+")(?!px)[a-z%]+$","i"),Jt=RegExp("^([+-])=("+w+")","i"),Gt={BODY:"block"},Qt={position:"absolute",visibility:"hidden",display:"block"},Kt={letterSpacing:0,fontWeight:400},Zt=["Top","Right","Bottom","Left"],en=["Webkit","O","Moz","ms"];function tn(e,t){if(t in e)return t;var n=t.charAt(0).toUpperCase()+t.slice(1),r=t,i=en.length;while(i--)if(t=en[i]+n,t in e)return t;return r}function nn(e,t){return e=t||e,"none"===x.css(e,"display")||!x.contains(e.ownerDocument,e)}function rn(e,t){var n,r,i,o=[],a=0,s=e.length;for(;s>a;a++)r=e[a],r.style&&(o[a]=x._data(r,"olddisplay"),n=r.style.display,t?(o[a]||"none"!==n||(r.style.display=""),""===r.style.display&&nn(r)&&(o[a]=x._data(r,"olddisplay",ln(r.nodeName)))):o[a]||(i=nn(r),(n&&"none"!==n||!i)&&x._data(r,"olddisplay",i?n:x.css(r,"display"))));for(a=0;s>a;a++)r=e[a],r.style&&(t&&"none"!==r.style.display&&""!==r.style.display||(r.style.display=t?o[a]||"":"none"));return e}x.fn.extend({css:function(e,n){return x.access(this,function(e,n,r){var i,o,a={},s=0;if(x.isArray(n)){for(o=Rt(e),i=n.length;i>s;s++)a[n[s]]=x.css(e,n[s],!1,o);return a}return r!==t?x.style(e,n,r):x.css(e,n)},e,n,arguments.length>1)},show:function(){return rn(this,!0)},hide:function(){return rn(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){nn(this)?x(this).show():x(this).hide()})}}),x.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Wt(e,"opacity");return""===n?"1":n}}}},cssNumber:{columnCount:!0,fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":x.support.cssFloat?"cssFloat":"styleFloat"},style:function(e,n,r,i){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var o,a,s,l=x.camelCase(n),u=e.style;if(n=x.cssProps[l]||(x.cssProps[l]=tn(u,l)),s=x.cssHooks[n]||x.cssHooks[l],r===t)return s&&"get"in s&&(o=s.get(e,!1,i))!==t?o:u[n];if(a=typeof r,"string"===a&&(o=Jt.exec(r))&&(r=(o[1]+1)*o[2]+parseFloat(x.css(e,n)),a="number"),!(null==r||"number"===a&&isNaN(r)||("number"!==a||x.cssNumber[l]||(r+="px"),x.support.clearCloneStyle||""!==r||0!==n.indexOf("background")||(u[n]="inherit"),s&&"set"in s&&(r=s.set(e,r,i))===t)))try{u[n]=r}catch(c){}}},css:function(e,n,r,i){var o,a,s,l=x.camelCase(n);return n=x.cssProps[l]||(x.cssProps[l]=tn(e.style,l)),s=x.cssHooks[n]||x.cssHooks[l],s&&"get"in s&&(a=s.get(e,!0,r)),a===t&&(a=Wt(e,n,i)),"normal"===a&&n in Kt&&(a=Kt[n]),""===r||r?(o=parseFloat(a),r===!0||x.isNumeric(o)?o||0:a):a}}),e.getComputedStyle?(Rt=function(t){return e.getComputedStyle(t,null)},Wt=function(e,n,r){var i,o,a,s=r||Rt(e),l=s?s.getPropertyValue(n)||s[n]:t,u=e.style;return s&&(""!==l||x.contains(e.ownerDocument,e)||(l=x.style(e,n)),Yt.test(l)&&Ut.test(n)&&(i=u.width,o=u.minWidth,a=u.maxWidth,u.minWidth=u.maxWidth=u.width=l,l=s.width,u.width=i,u.minWidth=o,u.maxWidth=a)),l}):a.documentElement.currentStyle&&(Rt=function(e){return e.currentStyle},Wt=function(e,n,r){var i,o,a,s=r||Rt(e),l=s?s[n]:t,u=e.style;return null==l&&u&&u[n]&&(l=u[n]),Yt.test(l)&&!zt.test(n)&&(i=u.left,o=e.runtimeStyle,a=o&&o.left,a&&(o.left=e.currentStyle.left),u.left="fontSize"===n?"1em":l,l=u.pixelLeft+"px",u.left=i,a&&(o.left=a)),""===l?"auto":l});function on(e,t,n){var r=Vt.exec(t);return r?Math.max(0,r[1]-(n||0))+(r[2]||"px"):t}function an(e,t,n,r,i){var o=n===(r?"border":"content")?4:"width"===t?1:0,a=0;for(;4>o;o+=2)"margin"===n&&(a+=x.css(e,n+Zt[o],!0,i)),r?("content"===n&&(a-=x.css(e,"padding"+Zt[o],!0,i)),"margin"!==n&&(a-=x.css(e,"border"+Zt[o]+"Width",!0,i))):(a+=x.css(e,"padding"+Zt[o],!0,i),"padding"!==n&&(a+=x.css(e,"border"+Zt[o]+"Width",!0,i)));return a}function sn(e,t,n){var r=!0,i="width"===t?e.offsetWidth:e.offsetHeight,o=Rt(e),a=x.support.boxSizing&&"border-box"===x.css(e,"boxSizing",!1,o);if(0>=i||null==i){if(i=Wt(e,t,o),(0>i||null==i)&&(i=e.style[t]),Yt.test(i))return i;r=a&&(x.support.boxSizingReliable||i===e.style[t]),i=parseFloat(i)||0}return i+an(e,t,n||(a?"border":"content"),r,o)+"px"}function ln(e){var t=a,n=Gt[e];return n||(n=un(e,t),"none"!==n&&n||(Pt=(Pt||x("<iframe frameborder='0' width='0' height='0'/>").css("cssText","display:block !important")).appendTo(t.documentElement),t=(Pt[0].contentWindow||Pt[0].contentDocument).document,t.write("<!doctype html><html><body>"),t.close(),n=un(e,t),Pt.detach()),Gt[e]=n),n}function un(e,t){var n=x(t.createElement(e)).appendTo(t.body),r=x.css(n[0],"display");return n.remove(),r}x.each(["height","width"],function(e,n){x.cssHooks[n]={get:function(e,r,i){return r?0===e.offsetWidth&&Xt.test(x.css(e,"display"))?x.swap(e,Qt,function(){return sn(e,n,i)}):sn(e,n,i):t},set:function(e,t,r){var i=r&&Rt(e);return on(e,t,r?an(e,n,r,x.support.boxSizing&&"border-box"===x.css(e,"boxSizing",!1,i),i):0)}}}),x.support.opacity||(x.cssHooks.opacity={get:function(e,t){return It.test((t&&e.currentStyle?e.currentStyle.filter:e.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":t?"1":""},set:function(e,t){var n=e.style,r=e.currentStyle,i=x.isNumeric(t)?"alpha(opacity="+100*t+")":"",o=r&&r.filter||n.filter||"";n.zoom=1,(t>=1||""===t)&&""===x.trim(o.replace($t,""))&&n.removeAttribute&&(n.removeAttribute("filter"),""===t||r&&!r.filter)||(n.filter=$t.test(o)?o.replace($t,i):o+" "+i)}}),x(function(){x.support.reliableMarginRight||(x.cssHooks.marginRight={get:function(e,n){return n?x.swap(e,{display:"inline-block"},Wt,[e,"marginRight"]):t}}),!x.support.pixelPosition&&x.fn.position&&x.each(["top","left"],function(e,n){x.cssHooks[n]={get:function(e,r){return r?(r=Wt(e,n),Yt.test(r)?x(e).position()[n]+"px":r):t}}})}),x.expr&&x.expr.filters&&(x.expr.filters.hidden=function(e){return 0>=e.offsetWidth&&0>=e.offsetHeight||!x.support.reliableHiddenOffsets&&"none"===(e.style&&e.style.display||x.css(e,"display"))},x.expr.filters.visible=function(e){return!x.expr.filters.hidden(e)}),x.each({margin:"",padding:"",border:"Width"},function(e,t){x.cssHooks[e+t]={expand:function(n){var r=0,i={},o="string"==typeof n?n.split(" "):[n];for(;4>r;r++)i[e+Zt[r]+t]=o[r]||o[r-2]||o[0];return i}},Ut.test(e)||(x.cssHooks[e+t].set=on)});var cn=/%20/g,pn=/\[\]$/,fn=/\r?\n/g,dn=/^(?:submit|button|image|reset|file)$/i,hn=/^(?:input|select|textarea|keygen)/i;x.fn.extend({serialize:function(){return x.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=x.prop(this,"elements");return e?x.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!x(this).is(":disabled")&&hn.test(this.nodeName)&&!dn.test(e)&&(this.checked||!Ct.test(e))}).map(function(e,t){var n=x(this).val();return null==n?null:x.isArray(n)?x.map(n,function(e){return{name:t.name,value:e.replace(fn,"\r\n")}}):{name:t.name,value:n.replace(fn,"\r\n")}}).get()}}),x.param=function(e,n){var r,i=[],o=function(e,t){t=x.isFunction(t)?t():null==t?"":t,i[i.length]=encodeURIComponent(e)+"="+encodeURIComponent(t)};if(n===t&&(n=x.ajaxSettings&&x.ajaxSettings.traditional),x.isArray(e)||e.jquery&&!x.isPlainObject(e))x.each(e,function(){o(this.name,this.value)});else for(r in e)gn(r,e[r],n,o);return i.join("&").replace(cn,"+")};function gn(e,t,n,r){var i;if(x.isArray(t))x.each(t,function(t,i){n||pn.test(e)?r(e,i):gn(e+"["+("object"==typeof i?t:"")+"]",i,n,r)});else if(n||"object"!==x.type(t))r(e,t);else for(i in t)gn(e+"["+i+"]",t[i],n,r)}x.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(e,t){x.fn[t]=function(e,n){return arguments.length>0?this.on(t,null,e,n):this.trigger(t)}}),x.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)},bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}});var mn,yn,vn=x.now(),bn=/\?/,xn=/#.*$/,wn=/([?&])_=[^&]*/,Tn=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,Cn=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Nn=/^(?:GET|HEAD)$/,kn=/^\/\//,En=/^([\w.+-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/,Sn=x.fn.load,An={},jn={},Dn="*/".concat("*");try{yn=o.href}catch(Ln){yn=a.createElement("a"),yn.href="",yn=yn.href}mn=En.exec(yn.toLowerCase())||[];function Hn(e){return function(t,n){"string"!=typeof t&&(n=t,t="*");var r,i=0,o=t.toLowerCase().match(T)||[];if(x.isFunction(n))while(r=o[i++])"+"===r[0]?(r=r.slice(1)||"*",(e[r]=e[r]||[]).unshift(n)):(e[r]=e[r]||[]).push(n)}}function qn(e,n,r,i){var o={},a=e===jn;function s(l){var u;return o[l]=!0,x.each(e[l]||[],function(e,l){var c=l(n,r,i);return"string"!=typeof c||a||o[c]?a?!(u=c):t:(n.dataTypes.unshift(c),s(c),!1)}),u}return s(n.dataTypes[0])||!o["*"]&&s("*")}function _n(e,n){var r,i,o=x.ajaxSettings.flatOptions||{};for(i in n)n[i]!==t&&((o[i]?e:r||(r={}))[i]=n[i]);return r&&x.extend(!0,e,r),e}x.fn.load=function(e,n,r){if("string"!=typeof e&&Sn)return Sn.apply(this,arguments);var i,o,a,s=this,l=e.indexOf(" ");return l>=0&&(i=e.slice(l,e.length),e=e.slice(0,l)),x.isFunction(n)?(r=n,n=t):n&&"object"==typeof n&&(a="POST"),s.length>0&&x.ajax({url:e,type:a,dataType:"html",data:n}).done(function(e){o=arguments,s.html(i?x("<div>").append(x.parseHTML(e)).find(i):e)}).complete(r&&function(e,t){s.each(r,o||[e.responseText,t,e])}),this},x.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){x.fn[t]=function(e){return this.on(t,e)}}),x.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:yn,type:"GET",isLocal:Cn.test(mn[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Dn,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":x.parseJSON,"text xml":x.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?_n(_n(e,x.ajaxSettings),t):_n(x.ajaxSettings,e)},ajaxPrefilter:Hn(An),ajaxTransport:Hn(jn),ajax:function(e,n){"object"==typeof e&&(n=e,e=t),n=n||{};var r,i,o,a,s,l,u,c,p=x.ajaxSetup({},n),f=p.context||p,d=p.context&&(f.nodeType||f.jquery)?x(f):x.event,h=x.Deferred(),g=x.Callbacks("once memory"),m=p.statusCode||{},y={},v={},b=0,w="canceled",C={readyState:0,getResponseHeader:function(e){var t;if(2===b){if(!c){c={};while(t=Tn.exec(a))c[t[1].toLowerCase()]=t[2]}t=c[e.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return 2===b?a:null},setRequestHeader:function(e,t){var n=e.toLowerCase();return b||(e=v[n]=v[n]||e,y[e]=t),this},overrideMimeType:function(e){return b||(p.mimeType=e),this},statusCode:function(e){var t;if(e)if(2>b)for(t in e)m[t]=[m[t],e[t]];else C.always(e[C.status]);return this},abort:function(e){var t=e||w;return u&&u.abort(t),k(0,t),this}};if(h.promise(C).complete=g.add,C.success=C.done,C.error=C.fail,p.url=((e||p.url||yn)+"").replace(xn,"").replace(kn,mn[1]+"//"),p.type=n.method||n.type||p.method||p.type,p.dataTypes=x.trim(p.dataType||"*").toLowerCase().match(T)||[""],null==p.crossDomain&&(r=En.exec(p.url.toLowerCase()),p.crossDomain=!(!r||r[1]===mn[1]&&r[2]===mn[2]&&(r[3]||("http:"===r[1]?"80":"443"))===(mn[3]||("http:"===mn[1]?"80":"443")))),p.data&&p.processData&&"string"!=typeof p.data&&(p.data=x.param(p.data,p.traditional)),qn(An,p,n,C),2===b)return C;l=p.global,l&&0===x.active++&&x.event.trigger("ajaxStart"),p.type=p.type.toUpperCase(),p.hasContent=!Nn.test(p.type),o=p.url,p.hasContent||(p.data&&(o=p.url+=(bn.test(o)?"&":"?")+p.data,delete p.data),p.cache===!1&&(p.url=wn.test(o)?o.replace(wn,"$1_="+vn++):o+(bn.test(o)?"&":"?")+"_="+vn++)),p.ifModified&&(x.lastModified[o]&&C.setRequestHeader("If-Modified-Since",x.lastModified[o]),x.etag[o]&&C.setRequestHeader("If-None-Match",x.etag[o])),(p.data&&p.hasContent&&p.contentType!==!1||n.contentType)&&C.setRequestHeader("Content-Type",p.contentType),C.setRequestHeader("Accept",p.dataTypes[0]&&p.accepts[p.dataTypes[0]]?p.accepts[p.dataTypes[0]]+("*"!==p.dataTypes[0]?", "+Dn+"; q=0.01":""):p.accepts["*"]);for(i in p.headers)C.setRequestHeader(i,p.headers[i]);if(p.beforeSend&&(p.beforeSend.call(f,C,p)===!1||2===b))return C.abort();w="abort";for(i in{success:1,error:1,complete:1})C[i](p[i]);if(u=qn(jn,p,n,C)){C.readyState=1,l&&d.trigger("ajaxSend",[C,p]),p.async&&p.timeout>0&&(s=setTimeout(function(){C.abort("timeout")},p.timeout));try{b=1,u.send(y,k)}catch(N){if(!(2>b))throw N;k(-1,N)}}else k(-1,"No Transport");function k(e,n,r,i){var c,y,v,w,T,N=n;2!==b&&(b=2,s&&clearTimeout(s),u=t,a=i||"",C.readyState=e>0?4:0,c=e>=200&&300>e||304===e,r&&(w=Mn(p,C,r)),w=On(p,w,C,c),c?(p.ifModified&&(T=C.getResponseHeader("Last-Modified"),T&&(x.lastModified[o]=T),T=C.getResponseHeader("etag"),T&&(x.etag[o]=T)),204===e||"HEAD"===p.type?N="nocontent":304===e?N="notmodified":(N=w.state,y=w.data,v=w.error,c=!v)):(v=N,(e||!N)&&(N="error",0>e&&(e=0))),C.status=e,C.statusText=(n||N)+"",c?h.resolveWith(f,[y,N,C]):h.rejectWith(f,[C,N,v]),C.statusCode(m),m=t,l&&d.trigger(c?"ajaxSuccess":"ajaxError",[C,p,c?y:v]),g.fireWith(f,[C,N]),l&&(d.trigger("ajaxComplete",[C,p]),--x.active||x.event.trigger("ajaxStop")))}return C},getJSON:function(e,t,n){return x.get(e,t,n,"json")},getScript:function(e,n){return x.get(e,t,n,"script")}}),x.each(["get","post"],function(e,n){x[n]=function(e,r,i,o){return x.isFunction(r)&&(o=o||i,i=r,r=t),x.ajax({url:e,type:n,dataType:o,data:r,success:i})}});function Mn(e,n,r){var i,o,a,s,l=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),o===t&&(o=e.mimeType||n.getResponseHeader("Content-Type"));if(o)for(s in l)if(l[s]&&l[s].test(o)){u.unshift(s);break}if(u[0]in r)a=u[0];else{for(s in r){if(!u[0]||e.converters[s+" "+u[0]]){a=s;break}i||(i=s)}a=a||i}return a?(a!==u[0]&&u.unshift(a),r[a]):t}function On(e,t,n,r){var i,o,a,s,l,u={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)u[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!l&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),l=o,o=c.shift())if("*"===o)o=l;else if("*"!==l&&l!==o){if(a=u[l+" "+o]||u["* "+o],!a)for(i in u)if(s=i.split(" "),s[1]===o&&(a=u[l+" "+s[0]]||u["* "+s[0]])){a===!0?a=u[i]:u[i]!==!0&&(o=s[0],c.unshift(s[1]));break}if(a!==!0)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(p){return{state:"parsererror",error:a?p:"No conversion from "+l+" to "+o}}}return{state:"success",data:t}}x.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/(?:java|ecma)script/},converters:{"text script":function(e){return x.globalEval(e),e}}}),x.ajaxPrefilter("script",function(e){e.cache===t&&(e.cache=!1),e.crossDomain&&(e.type="GET",e.global=!1)}),x.ajaxTransport("script",function(e){if(e.crossDomain){var n,r=a.head||x("head")[0]||a.documentElement;return{send:function(t,i){n=a.createElement("script"),n.async=!0,e.scriptCharset&&(n.charset=e.scriptCharset),n.src=e.url,n.onload=n.onreadystatechange=function(e,t){(t||!n.readyState||/loaded|complete/.test(n.readyState))&&(n.onload=n.onreadystatechange=null,n.parentNode&&n.parentNode.removeChild(n),n=null,t||i(200,"success"))},r.insertBefore(n,r.firstChild)},abort:function(){n&&n.onload(t,!0)}}}});var Fn=[],Bn=/(=)\?(?=&|$)|\?\?/;x.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Fn.pop()||x.expando+"_"+vn++;return this[e]=!0,e}}),x.ajaxPrefilter("json jsonp",function(n,r,i){var o,a,s,l=n.jsonp!==!1&&(Bn.test(n.url)?"url":"string"==typeof n.data&&!(n.contentType||"").indexOf("application/x-www-form-urlencoded")&&Bn.test(n.data)&&"data");return l||"jsonp"===n.dataTypes[0]?(o=n.jsonpCallback=x.isFunction(n.jsonpCallback)?n.jsonpCallback():n.jsonpCallback,l?n[l]=n[l].replace(Bn,"$1"+o):n.jsonp!==!1&&(n.url+=(bn.test(n.url)?"&":"?")+n.jsonp+"="+o),n.converters["script json"]=function(){return s||x.error(o+" was not called"),s[0]},n.dataTypes[0]="json",a=e[o],e[o]=function(){s=arguments},i.always(function(){e[o]=a,n[o]&&(n.jsonpCallback=r.jsonpCallback,Fn.push(o)),s&&x.isFunction(a)&&a(s[0]),s=a=t}),"script"):t});var Pn,Rn,Wn=0,$n=e.ActiveXObject&&function(){var e;for(e in Pn)Pn[e](t,!0)};function In(){try{return new e.XMLHttpRequest}catch(t){}}function zn(){try{return new e.ActiveXObject("Microsoft.XMLHTTP")}catch(t){}}x.ajaxSettings.xhr=e.ActiveXObject?function(){return!this.isLocal&&In()||zn()}:In,Rn=x.ajaxSettings.xhr(),x.support.cors=!!Rn&&"withCredentials"in Rn,Rn=x.support.ajax=!!Rn,Rn&&x.ajaxTransport(function(n){if(!n.crossDomain||x.support.cors){var r;return{send:function(i,o){var a,s,l=n.xhr();if(n.username?l.open(n.type,n.url,n.async,n.username,n.password):l.open(n.type,n.url,n.async),n.xhrFields)for(s in n.xhrFields)l[s]=n.xhrFields[s];n.mimeType&&l.overrideMimeType&&l.overrideMimeType(n.mimeType),n.crossDomain||i["X-Requested-With"]||(i["X-Requested-With"]="XMLHttpRequest");try{for(s in i)l.setRequestHeader(s,i[s])}catch(u){}l.send(n.hasContent&&n.data||null),r=function(e,i){var s,u,c,p;try{if(r&&(i||4===l.readyState))if(r=t,a&&(l.onreadystatechange=x.noop,$n&&delete Pn[a]),i)4!==l.readyState&&l.abort();else{p={},s=l.status,u=l.getAllResponseHeaders(),"string"==typeof l.responseText&&(p.text=l.responseText);try{c=l.statusText}catch(f){c=""}s||!n.isLocal||n.crossDomain?1223===s&&(s=204):s=p.text?200:404}}catch(d){i||o(-1,d)}p&&o(s,c,p,u)},n.async?4===l.readyState?setTimeout(r):(a=++Wn,$n&&(Pn||(Pn={},x(e).unload($n)),Pn[a]=r),l.onreadystatechange=r):r()},abort:function(){r&&r(t,!0)}}}});var Xn,Un,Vn=/^(?:toggle|show|hide)$/,Yn=RegExp("^(?:([+-])=|)("+w+")([a-z%]*)$","i"),Jn=/queueHooks$/,Gn=[nr],Qn={"*":[function(e,t){var n=this.createTween(e,t),r=n.cur(),i=Yn.exec(t),o=i&&i[3]||(x.cssNumber[e]?"":"px"),a=(x.cssNumber[e]||"px"!==o&&+r)&&Yn.exec(x.css(n.elem,e)),s=1,l=20;if(a&&a[3]!==o){o=o||a[3],i=i||[],a=+r||1;do s=s||".5",a/=s,x.style(n.elem,e,a+o);while(s!==(s=n.cur()/r)&&1!==s&&--l)}return i&&(a=n.start=+a||+r||0,n.unit=o,n.end=i[1]?a+(i[1]+1)*i[2]:+i[2]),n}]};function Kn(){return setTimeout(function(){Xn=t}),Xn=x.now()}function
|