Editorial Calendar - Version 3.7.8

Version Description

This version fixes a CSS layout issue so the calendar works with WordPress 5.6.

Release Info

Developer	zgrossbart
Plugin	Editorial Calendar
Version	3.7.8
Comparing to
See all releases

Code changes from version 3.7.7 to 3.7.8

Files changed (87) hide show

3.7.8/.jshintrc +25 -0
3.7.8/LICENSE.txt +236 -0
3.7.8/closure.sh +3 -0
3.7.8/edcal.css +633 -0
3.7.8/edcal.js +2733 -0
3.7.8/edcal.min.js +71 -0
3.7.8/edcal.php +1420 -0
3.7.8/edcal_rtl.css +60 -0
3.7.8/edcal_test.js +587 -0
3.7.8/images/month-present_bk.gif +0 -0
3.7.8/images/tip_close.png +0 -0
3.7.8/images/today_bk.gif +0 -0
3.7.8/languages/editorial-calendar-cs_CZ.mo +0 -0
3.7.8/languages/editorial-calendar-cs_CZ.po +192 -0
3.7.8/languages/editorial-calendar-da_DK.mo +0 -0
3.7.8/languages/editorial-calendar-da_DK.po +279 -0
3.7.8/languages/editorial-calendar-de_DE.mo +0 -0
3.7.8/languages/editorial-calendar-de_DE.po +307 -0
3.7.8/languages/editorial-calendar-el.mo +0 -0
3.7.8/languages/editorial-calendar-el.po +199 -0
3.7.8/languages/editorial-calendar-es_ES.mo +0 -0
3.7.8/languages/editorial-calendar-es_ES.po +279 -0
3.7.8/languages/editorial-calendar-fr_FR.mo +0 -0
3.7.8/languages/editorial-calendar-fr_FR.po +189 -0
3.7.8/languages/editorial-calendar-he_IL.mo +0 -0
3.7.8/languages/editorial-calendar-he_IL.po +247 -0
3.7.8/languages/editorial-calendar-hr.mo +0 -0
3.7.8/languages/editorial-calendar-hr.po +146 -0
3.7.8/languages/editorial-calendar-it_IT.mo +0 -0
3.7.8/languages/editorial-calendar-it_IT.po +279 -0
3.7.8/languages/editorial-calendar-ja.mo +0 -0
3.7.8/languages/editorial-calendar-ja.po +247 -0
3.7.8/languages/editorial-calendar-lt_LT.mo +0 -0
3.7.8/languages/editorial-calendar-lt_LT.po +311 -0
3.7.8/languages/editorial-calendar-nb_NO.mo +0 -0
3.7.8/languages/editorial-calendar-nb_NO.po +245 -0
3.7.8/languages/editorial-calendar-nl_NL.mo +0 -0
3.7.8/languages/editorial-calendar-nl_NL.po +239 -0
3.7.8/languages/editorial-calendar-pl_PL.mo +0 -0
3.7.8/languages/editorial-calendar-pl_PL.po +198 -0
3.7.8/languages/editorial-calendar-pt_BR.mo +0 -0
3.7.8/languages/editorial-calendar-pt_BR.po +189 -0
3.7.8/languages/editorial-calendar-ru_RU.mo +0 -0
3.7.8/languages/editorial-calendar-ru_RU.po +189 -0
3.7.8/languages/editorial-calendar-sv_SE.mo +0 -0
3.7.8/languages/editorial-calendar-sv_SE.po +313 -0
3.7.8/languages/editorial-calendar-template.pot +182 -0
3.7.8/languages/editorial-calendar-tr_TR.mo +0 -0
3.7.8/languages/editorial-calendar-tr_TR.po +331 -0
3.7.8/lib/date.extras.js +332 -0
3.7.8/lib/edcallib.min.js +78 -0
3.7.8/lib/humanmsg.css +40 -0
3.7.8/lib/humanmsg.js +190 -0
3.7.8/lib/jquery.bgiframe.js +104 -0
3.7.8/lib/jquery.cookie.js +96 -0
3.7.8/lib/jquery.delegate.js +56 -0
3.7.8/lib/jquery.mousewheel.js +84 -0
3.7.8/lib/jquery.timepicker.js +309 -0
3.7.8/lib/jquery.tools.min.js +27 -0
3.7.8/lib/json2.js +480 -0
3.7.8/lib/languages/date-cs-CZ.js +104 -0
3.7.8/lib/languages/date-da-DK.js +104 -0
3.7.8/lib/languages/date-de-DE.js +104 -0
3.7.8/lib/languages/date-el-GR.js +104 -0
3.7.8/lib/languages/date-en-US.js +104 -0
3.7.8/lib/languages/date-es-ES.js +104 -0
3.7.8/lib/languages/date-fr-FR.js +104 -0
3.7.8/lib/languages/date-he-IL.js +104 -0
3.7.8/lib/languages/date-hr-HR.js +104 -0
3.7.8/lib/languages/date-it-IT.js +104 -0
3.7.8/lib/languages/date-ja-JP.js +104 -0
3.7.8/lib/languages/date-lt-LT.js +104 -0
3.7.8/lib/languages/date-nb-NO.js +104 -0
3.7.8/lib/languages/date-nl-NL.js +104 -0
3.7.8/lib/languages/date-pl-PL.js +104 -0
3.7.8/lib/languages/date-pt-BR.js +104 -0
3.7.8/lib/languages/date-ru-RU.js +104 -0
3.7.8/lib/languages/date-sv-SE.js +104 -0
3.7.8/lib/languages/date-tr-TR.js +104 -0
3.7.8/lib/lib.txt +58 -0
3.7.8/lib/qunit.css +196 -0
3.7.8/lib/qunit.js +1341 -0
3.7.8/lib/sprintf-0.7-beta1.js +183 -0
3.7.8/lib/timePicker.css +26 -0
3.7.8/lib/tools.scrollable-1.1.2.js +439 -0
3.7.8/lib/tools.scrollable.mousewheel-1.0.1.js +103 -0
3.7.8/readme.txt +369 -0

3.7.8/.jshintrc ADDED Viewed

	@@ -0,0 +1,25 @@


1	+ {
2	+ "curly": true,
3	+ "bitwise": true,
4	+ "eqeqeq": true,
5	+ "es3": true,
6	+ "forin": true,
7	+ "freeze": true,
8	+ "immed": true,
9	+ "indent": 4,
10	+ "latedef": true,
11	+ "newcap": true,
12	+ "noarg": true,
13	+ "noempty": true,
14	+ "nonbsp": true,
15	+ "nonew": true,
16	+ "quotmark": true,
17	+ "undef": true,
18	+ "browser": true,
19	+ "jquery": true,
20	+ "devel": true,
21	+ "predef": [ "sprintf", "ajaxurl", "humanMsg", "edcal_test" ],
22	+ "maxparams": 7,
23	+ "maxdepth": 7,
24	+ "maxcomplexity": 14
25	+ }

3.7.8/LICENSE.txt ADDED Viewed

	@@ -0,0 +1,236 @@


1	+ Apache License
2	+ Version 2.0, January 2004
3	+ http://www.apache.org/licenses/
4	+
5	+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
6	+
7	+ 1. Definitions.
8	+
9	+ "License" shall mean the terms and conditions for use, reproduction,
10	+ and distribution as defined by Sections 1 through 9 of this document.
11	+
12	+ "Licensor" shall mean the copyright owner or entity authorized by
13	+ the copyright owner that is granting the License.
14	+
15	+ "Legal Entity" shall mean the union of the acting entity and all
16	+ other entities that control, are controlled by, or are under common
17	+ control with that entity. For the purposes of this definition,
18	+ "control" means (i) the power, direct or indirect, to cause the
19	+ direction or management of such entity, whether by contract or
20	+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
21	+ outstanding shares, or (iii) beneficial ownership of such entity.
22	+
23	+ "You" (or "Your") shall mean an individual or Legal Entity
24	+ exercising permissions granted by this License.
25	+
26	+ "Source" form shall mean the preferred form for making modifications,
27	+ including but not limited to software source code, documentation
28	+ source, and configuration files.
29	+
30	+ "Object" form shall mean any form resulting from mechanical
31	+ transformation or translation of a Source form, including but
32	+ not limited to compiled object code, generated documentation,
33	+ and conversions to other media types.
34	+
35	+ "Work" shall mean the work of authorship, whether in Source or
36	+ Object form, made available under the License, as indicated by a
37	+ copyright notice that is included in or attached to the work
38	+ (an example is provided in the Appendix below).
39	+
40	+ "Derivative Works" shall mean any work, whether in Source or Object
41	+ form, that is based on (or derived from) the Work and for which the
42	+ editorial revisions, annotations, elaborations, or other modifications
43	+ represent, as a whole, an original work of authorship. For the purposes
44	+ of this License, Derivative Works shall not include works that remain
45	+ separable from, or merely link (or bind by name) to the interfaces of,
46	+ the Work and Derivative Works thereof.
47	+
48	+ "Contribution" shall mean any work of authorship, including
49	+ the original version of the Work and any modifications or additions
50	+ to that Work or Derivative Works thereof, that is intentionally
51	+ submitted to Licensor for inclusion in the Work by the copyright owner
52	+ or by an individual or Legal Entity authorized to submit on behalf of
53	+ the copyright owner. For the purposes of this definition, "submitted"
54	+ means any form of electronic, verbal, or written communication sent
55	+ to the Licensor or its representatives, including but not limited to
56	+ communication on electronic mailing lists, source code control systems,
57	+ and issue tracking systems that are managed by, or on behalf of, the
58	+ Licensor for the purpose of discussing and improving the Work, but
59	+ excluding communication that is conspicuously marked or otherwise
60	+ designated in writing by the copyright owner as "Not a Contribution."
61	+
62	+ "Contributor" shall mean Licensor and any individual or Legal Entity
63	+ on behalf of whom a Contribution has been received by Licensor and
64	+ subsequently incorporated within the Work.
65	+
66	+ 2. Grant of Copyright License. Subject to the terms and conditions of
67	+ this License, each Contributor hereby grants to You a perpetual,
68	+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
69	+ copyright license to reproduce, prepare Derivative Works of,
70	+ publicly display, publicly perform, sublicense, and distribute the
71	+ Work and such Derivative Works in Source or Object form.
72	+
73	+ 3. Grant of Patent License. Subject to the terms and conditions of
74	+ this License, each Contributor hereby grants to You a perpetual,
75	+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
76	+ (except as stated in this section) patent license to make, have made,
77	+ use, offer to sell, sell, import, and otherwise transfer the Work,
78	+ where such license applies only to those patent claims licensable
79	+ by such Contributor that are necessarily infringed by their
80	+ Contribution(s) alone or by combination of their Contribution(s)
81	+ with the Work to which such Contribution(s) was submitted. If You
82	+ institute patent litigation against any entity (including a
83	+ cross-claim or counterclaim in a lawsuit) alleging that the Work
84	+ or a Contribution incorporated within the Work constitutes direct
85	+ or contributory patent infringement, then any patent licenses
86	+ granted to You under this License for that Work shall terminate
87	+ as of the date such litigation is filed.
88	+
89	+ 4. Redistribution. You may reproduce and distribute copies of the
90	+ Work or Derivative Works thereof in any medium, with or without
91	+ modifications, and in Source or Object form, provided that You
92	+ meet the following conditions:
93	+
94	+ (a) You must give any other recipients of the Work or
95	+ Derivative Works a copy of this License; and
96	+
97	+ (b) You must cause any modified files to carry prominent notices
98	+ stating that You changed the files; and
99	+
100	+ (c) You must retain, in the Source form of any Derivative Works
101	+ that You distribute, all copyright, patent, trademark, and
102	+ attribution notices from the Source form of the Work,
103	+ excluding those notices that do not pertain to any part of
104	+ the Derivative Works; and
105	+
106	+ (d) If the Work includes a "NOTICE" text file as part of its
107	+ distribution, then any Derivative Works that You distribute must
108	+ include a readable copy of the attribution notices contained
109	+ within such NOTICE file, excluding those notices that do not
110	+ pertain to any part of the Derivative Works, in at least one
111	+ of the following places: within a NOTICE text file distributed
112	+ as part of the Derivative Works; within the Source form or
113	+ documentation, if provided along with the Derivative Works; or,
114	+ within a display generated by the Derivative Works, if and
115	+ wherever such third-party notices normally appear. The contents
116	+ of the NOTICE file are for informational purposes only and
117	+ do not modify the License. You may add Your own attribution
118	+ notices within Derivative Works that You distribute, alongside
119	+ or as an addendum to the NOTICE text from the Work, provided
120	+ that such additional attribution notices cannot be construed
121	+ as modifying the License.
122	+
123	+ You may add Your own copyright statement to Your modifications and
124	+ may provide additional or different license terms and conditions
125	+ for use, reproduction, or distribution of Your modifications, or
126	+ for any such Derivative Works as a whole, provided Your use,
127	+ reproduction, and distribution of the Work otherwise complies with
128	+ the conditions stated in this License.
129	+
130	+ 5. Submission of Contributions. Unless You explicitly state otherwise,
131	+ any Contribution intentionally submitted for inclusion in the Work
132	+ by You to the Licensor shall be under the terms and conditions of
133	+ this License, without any additional terms or conditions.
134	+ Notwithstanding the above, nothing herein shall supersede or modify
135	+ the terms of any separate license agreement you may have executed
136	+ with Licensor regarding such Contributions.
137	+
138	+ 6. Trademarks. This License does not grant permission to use the trade
139	+ names, trademarks, service marks, or product names of the Licensor,
140	+ except as required for reasonable and customary use in describing the
141	+ origin of the Work and reproducing the content of the NOTICE file.
142	+
143	+ 7. Disclaimer of Warranty. Unless required by applicable law or
144	+ agreed to in writing, Licensor provides the Work (and each
145	+ Contributor provides its Contributions) on an "AS IS" BASIS,
146	+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
147	+ implied, including, without limitation, any warranties or conditions
148	+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
149	+ PARTICULAR PURPOSE. You are solely responsible for determining the
150	+ appropriateness of using or redistributing the Work and assume any
151	+ risks associated with Your exercise of permissions under this License.
152	+
153	+ 8. Limitation of Liability. In no event and under no legal theory,
154	+ whether in tort (including negligence), contract, or otherwise,
155	+ unless required by applicable law (such as deliberate and grossly
156	+ negligent acts) or agreed to in writing, shall any Contributor be
157	+ liable to You for damages, including any direct, indirect, special,
158	+ incidental, or consequential damages of any character arising as a
159	+ result of this License or out of the use or inability to use the
160	+ Work (including but not limited to damages for loss of goodwill,
161	+ work stoppage, computer failure or malfunction, or any and all
162	+ other commercial damages or losses), even if such Contributor
163	+ has been advised of the possibility of such damages.
164	+
165	+ 9. Accepting Warranty or Additional Liability. While redistributing
166	+ the Work or Derivative Works thereof, You may choose to offer,
167	+ and charge a fee for, acceptance of support, warranty, indemnity,
168	+ or other liability obligations and/or rights consistent with this
169	+ License. However, in accepting such obligations, You may act only
170	+ on Your own behalf and on Your sole responsibility, not on behalf
171	+ of any other Contributor, and only if You agree to indemnify,
172	+ defend, and hold each Contributor harmless for any liability
173	+ incurred by, or claims asserted against, such Contributor by reason
174	+ of your accepting any such warranty or additional liability.
175	+
176	+ END OF TERMS AND CONDITIONS
177	+
178	+ APPENDIX: How to apply the Apache License to your work.
179	+
180	+ To apply the Apache License to your work, attach the following
181	+ boilerplate notice, with the fields enclosed by brackets "[]"
182	+ replaced with your own identifying information. (Don't include
183	+ the brackets!) The text should be enclosed in the appropriate
184	+ comment syntax for the file format. We also recommend that a
185	+ file or class name and description of purpose be included on the
186	+ same "printed page" as the copyright notice for easier
187	+ identification within third-party archives.
188	+
189	+ Copyright [yyyy] [name of copyright owner]
190	+
191	+ Licensed under the Apache License, Version 2.0 (the "License");
192	+ you may not use this file except in compliance with the License.
193	+ You may obtain a copy of the License at
194	+
195	+ http://www.apache.org/licenses/LICENSE-2.0
196	+
197	+ Unless required by applicable law or agreed to in writing, software
198	+ distributed under the License is distributed on an "AS IS" BASIS,
199	+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
200	+ See the License for the specific language governing permissions and
201	+ limitations under the License.
202	+
203	+
204	+ /*
205	+ * One-JAR� (http://www.simontuffs.com/one-jar). Copyright (c) 2004-2007,
206	+ * P. Simon Tuffs (simon@simontuffs.com). All rights reserved.
207	+ *
208	+ * Redistribution and use in source and binary forms, with or without
209	+ * modification, are permitted provided that the following conditions are met:
210	+ *
211	+ * Redistributions of source code must retain the above copyright notice, this
212	+ * list of conditions and the following disclaimer.
213	+ *
214	+ * Redistributions in binary form must reproduce the above copyright notice,
215	+ * this list of conditions and the following disclaimer in the documentation
216	+ * and/or other materials provided with the distribution.
217	+ *
218	+ * Neither the name of P. Simon Tuffs, nor the names of any contributors,
219	+ * nor the name One-JAR may be used to endorse or promote products derived
220	+ * from this software without specific prior written permission.
221	+ *
222	+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
223	+ * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
224	+ * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
225	+ * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE
226	+ * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
227	+ * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
228	+ * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
229	+ * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
230	+ * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
231	+ * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
232	+ * POSSIBILITY OF SUCH DAMAGE.
233	+ *
234	+ * Including this file inside the built One-JAR file conforms with these terms.
235	+ */
236	+

3.7.8/closure.sh ADDED Viewed

	@@ -0,0 +1,3 @@


1	+ java -jar closure/compiler.jar --js_output_file lib/edcallib.min.js --js lib/humanmsg.js --js lib/jquery.mousewheel.js --js lib/sprintf-0.7-beta1.js --js lib/jquery.cookie.js --js lib/jquery.bgiframe.js --js lib/jquery.delegate.js --js lib/jquery.tools.min.js --js lib/jquery.timepicker.js --js lib/json2.js --js lib/tools.scrollable-1.1.2.js --js lib/tools.scrollable.mousewheel-1.0.1.js --js lib/date.extras.js
2	+
3	+ java -jar closure/compiler.jar --js_output_file edcal.min.js --js edcal.js

3.7.8/edcal.css ADDED Viewed

	@@ -0,0 +1,633 @@


1	+ /*******************************************************************************
2	+ *
3	+ * Licensed under the Apache License, Version 2.0 (the "License");
4	+ * you may not use this file except in compliance with the License.
5	+ * You may obtain a copy of the License at
6	+ *
7	+ * http://www.apache.org/licenses/LICENSE-2.0
8	+ *
9	+ * Unless required by applicable law or agreed to in writing, software
10	+ * distributed under the License is distributed on an "AS IS" BASIS,
11	+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
12	+ * See the License for the specific language governing permissions and
13	+ * limitations under the License.
14	+ *
15	+ ******************************************************************************/
16	+
17	+ /*
18	+ Table of Contents
19	+ - Reset
20	+ - Loading section
21	+ - Top bar #topbar, including prev/next month arrows at left and Show Today at right
22	+ - Drafts Drawer
23	+ - the Calendar Content #calcont
24	+ - day head container #dayheadcont [Monday, Tuesday etc]
25	+ - edcal scrollable area #edcal_scrollable [the main calendar pane]
26	+ - calendar #cal container
27	+ - day label table head
28	+ - row container .rowcont [absolutely positioned, top adjusted by js]
29	+ - row inner .row [positioned relative, within the rowcont
30	+ - days
31	+ - posts
32	+ - edcal_quickedit [new/edit posts popover]
33	+ - Screen options
34	+ - Feedback section [appears once after using the calendar 3 times]
35	+ */
36	+
37	+ /*.row .day:first-child, .dayheadcont .dayhead:first-child {
38	+ margin-left:0 !important;
39	+ }
40	+ .rowcont { margin:0 !important; }
41	+ .day { float:left; }
42	+ */
43	+
44	+
45	+ /* Reset & Utility */
46	+
47	+ html, body, div, span, applet, object, iframe, h1, h2, h3, h4, h5, h6, p, blockquote, pre, a, abbr, acronym, address, big, cite, code, del, dfn, em, font, img, ins, kbd, q, s, samp, small, strike, strong, sub, sup, tt, var, b, u, i, center, dl, dt, dd, ol, ul, li, fieldset, form, label, legend, table, caption, tbody, tfoot, thead, tr, th, td {
48	+ background: none repeat scroll 0 0 transparent;
49	+ border: 0 none;
50	+ margin: 0;
51	+ outline: 0 none;
52	+ padding: 0;
53	+ }
54	+ .clearfix:before, .clearfix:after { content:'\0020'; display:block; height:0; visibility:hidden; }
55	+ .clearfix:after { clear:both; }
56	+ .clearfix { zoom:1; }
57	+
58	+
59	+
60	+ /* Loading section */
61	+
62	+ #loadingcont {
63	+ position: relative;
64	+ }
65	+
66	+ #loading, #draftsdrawer_loading {
67	+ background-image: url('images/loading.gif');
68	+ background-repeat: no-repeat;
69	+ position: absolute;
70	+ width: 43px;
71	+ height: 43px;
72	+ display: block;
73	+ left: 20em;
74	+ top: -1.5em;
75	+ }
76	+
77	+ .loadingclass > .postlink, .tiploading, .loadingclass:hover > .postlink {
78	+ background-image: url('images/loading_post.gif');
79	+ background-position: top right;
80	+ background-repeat: no-repeat;
81	+ cursor: auto;
82	+ }
83	+
84	+
85	+
86	+ /* Top bar */
87	+
88	+ #topbar {
89	+ margin-bottom: 1em;
90	+ margin-top: 1em;
91	+ height:2em;
92	+ }
93	+ #topbar .tablenav-pages a {
94	+ font-weight:normal;
95	+ }
96	+ #topleft.tablenav-pages {
97	+ float:left;
98	+ }
99	+ #nextmonth, #prevmonth {
100	+ font-size:12px;
101	+ }
102	+ #topright button {
103	+ margin-left: 2em;
104	+ margin-right: 6px;
105	+ text-decoration: none;
106	+ }
107	+
108	+
109	+
110	+ /* Drafts Drawer */
111	+
112	+ #draftsdrawer_cont {
113	+ height:100%;
114	+ float:right;
115	+ display:none;
116	+ }
117	+ #draftsdrawer {
118	+ font-family:"Lucida Grande",Verdana,Arial,"Bitstream Vera Sans",sans-serif;
119	+ border:1px solid #dfdfdf;
120	+ padding-bottom:1px;
121	+ -moz-border-radius:4px;
122	+ -webkit-border-radius:4px;
123	+ -o-border-radius:4px;
124	+ border-radius:4px;
125	+ }
126	+ #draftsdrawer .dayheadcont { }
127	+ #draftsdrawer .dayhead {
128	+ float:none;
129	+ white-space: nowrap;
130	+ width: 100%;
131	+ overflow: hidden;
132	+ text-overflow: ellipsis;
133	+ min-width: 0px;
134	+ }
135	+ #draftsdrawer .day { border:0; }
136	+ #draftsdrawer .dayobj { height:auto; }
137	+ #draftsdrawer .postlist {
138	+ top:26px;
139	+ padding-left: 5px;
140	+ }
141	+ #draftsdrawer .posttime { display:none; }
142	+ #draftsdrawer_loading {
143	+ position:relative;
144	+ margin:2em 2em 0 2em;
145	+ top:0;
146	+ left:0;
147	+ }
148	+
149	+
150	+ /* Calendar container */
151	+
152	+ #cal_cont, #edcal_scrollable {
153	+ -x-system-font:none;
154	+ font-family:"Lucida Grande",Verdana,Arial,"Bitstream Vera Sans",sans-serif;
155	+ font-size:11px;
156	+ font-size-adjust:none;
157	+ font-stretch:normal;
158	+ font-style:normal;
159	+ font-variant:normal;
160	+ font-weight:normal;
161	+ }
162	+
163	+ #cal_cont {
164	+ border:1px solid #dfdfdf;
165	+ padding-bottom:1px;
166	+ -moz-border-radius:4px;
167	+ -webkit-border-radius:4px;
168	+ -o-border-radius:4px;
169	+ border-radius:4px;
170	+ }
171	+
172	+ #edcal_scrollable {
173	+ /* required settings */
174	+ position:relative;
175	+ overflow:hidden;
176	+
177	+ /* This height will be reset with JavaScript */
178	+ height: 80vh;
179	+ margin-top: 5px;
180	+ margin-left: 4px;
181	+ margin-right: 2px;
182	+ }
183	+
184	+ #cal {
185	+ position:absolute;
186	+
187	+ /* this time we have very large space for the height */
188	+ height:100%;
189	+ margin-right: 10px;
190	+ }
191	+
192	+
193	+
194	+ /* Day label table head */
195	+
196	+ .dayheadcont, .draftsdrawerheadcont {
197	+ position: relative;
198	+ height: 34px;
199	+ top: 0px;
200	+ background:#e9e9e9;
201	+ background-image:-moz-linear-gradient(top,#f4f4f4,#e9e9e9);
202	+ background-image:-o-linear-gradient(top,#f4f4f4,#e9e9e9);
203	+ background-image:-webkit-gradient(linear,left top,left bottom,from(#f4f4f4),to(#e9e9e9));
204	+ background-image:-webkit-linear-gradient(top,#f4f4f4,#e9e9e9);
205	+ background-image:linear-gradient(top,#f4f4f4,#e9e9e9);
206	+ font-family:Georgia,"Times New Roman","Bitstream Charter",Times,serif;
207	+ font-size:14px;
208	+ border-top:1px solid #fff;
209	+ border-bottom:1px solid #dfdfdf;
210	+ -moz-border-radius:3px 3px 0 0;
211	+ -webkit-border-radius:3px 3px 0 0
212	+ -o-border-radius:3px 3px 0 0
213	+ border-radius:3px 3px 0 0
214	+ }
215	+
216	+ .dayhead {
217	+ text-align: left;
218	+ text-indent: 5px;
219	+ text-shadow: 0 1px 0 rgba(255, 255, 255, 0.8);
220	+ color: #000;
221	+ line-height: 2.4em;
222	+ min-width: 10em;
223	+ float:left;
224	+ }
225	+
226	+ .dayhead.firstday {
227	+ margin-left: 5px;
228	+ }
229	+
230	+ .dayhead.lastday {
231	+ }
232	+
233	+
234	+
235	+ /* Rows */
236	+
237	+ .edcal_row {
238	+ height: 100%;
239	+ }
240	+
241	+
242	+
243	+ /* Days */
244	+
245	+ .day {
246	+ border: 1px solid #ccc; /* this will add to total height in IE. So, 100% + 2px */
247	+ -moz-border-radius:3px;
248	+ -webkit-border-radius:3px;
249	+ -o-border-radius:3px;
250	+ border-radius:3px;
251	+ background: white;
252	+ }
253	+
254	+ .day.beforeToday {
255	+ background: #ececec;
256	+ /* background: #f9f9f9;*/
257	+ }
258	+
259	+ .day.todayAndAfter {
260	+ background: #fff;
261	+ }
262	+
263	+ .day.day-active {
264	+ background-color: lightyellow;
265	+ }
266	+
267	+ .scrollHover {
268	+ background: lightblue;
269	+ }
270	+
271	+ .dayobj {
272	+ position: relative;
273	+ width: 100%;
274	+ height: 100%;
275	+ }
276	+
277	+ .firstOfMonth .dayobj {
278	+ background-color: #eaf2fb;
279	+ -moz-border-radius:2px;
280	+ -webkit-border-radius:2px;
281	+ -o-border-radius:2px;
282	+ border-radius:2px;
283	+ }
284	+
285	+ .daylabel {
286	+ position: absolute;
287	+ top: 0px;
288	+ right: 0px;
289	+ left: 0px;
290	+ font-weight:bold;
291	+ text-align: right;
292	+ padding-right: 10px;
293	+ line-height:1.8em;
294	+ -moz-border-radius:2px 2px 0 0;
295	+ -webkit-border-radius:2px 2px 0 0;
296	+ -o-border-radius:2px 2px 0 0;
297	+ border-radius:2px 2px 0 0;
298	+ }
299	+
300	+ .day.month-present .daylabel {
301	+ border-bottom:1px solid #dfdfdf;
302	+ background:#e9e9e9;
303	+ background-image:-moz-linear-gradient(top,#f4f4f4,#e9e9e9);
304	+ background-image:-o-linear-gradient(top,#f4f4f4,#e9e9e9);
305	+ background-image:-webkit-gradient(linear,left top,left bottom,from(#f4f4f4),to(#e9e9e9));
306	+ background-image:-webkit-linear-gradient(top,#f4f4f4,#e9e9e9);
307	+ background-image:linear-gradient(top,#f4f4f4,#e9e9e9);
308	+ }
309	+
310	+ .daynewlink {
311	+ position: absolute;
312	+ top: 0px;
313	+ left: 0px;
314	+ display: none;
315	+ padding-left: 0.5em;
316	+ padding-right: 0em;
317	+ text-decoration: none;
318	+ font-size:10px;
319	+ z-index: 10;
320	+ overflow: hidden;
321	+ height: 1.5em;
322	+ white-space: nowrap;
323	+ text-overflow: ellipsis;
324	+ width: 70%;
325	+ }
326	+
327	+ .day.today .daylabel {
328	+ color: white;
329	+ text-shadow:0 -1px 0 rgba(0,0,0,0.3);
330	+ background:#8cc1e9;
331	+ background-image:-webkit-gradient(linear,left bottom,left top,from(#72a7cf),to(#8cc1e9));
332	+ background-image:-webkit-linear-gradient(bottom,#72a7cf,#8cc1e9);
333	+ background-image:-moz-linear-gradient(bottom,#72a7cf,#8cc1e9);
334	+ background-image:-o-linear-gradient(bottom,#72a7cf,#8cc1e9);
335	+ background-image:linear-gradient(to top,#72a7cf,#8cc1e9);
336	+ }
337	+
338	+ .today .daynewlink {
339	+ color: white;
340	+ }
341	+
342	+
343	+
344	+ /* Posts */
345	+
346	+ .post {
347	+ display: block;
348	+ list-style-type: none;
349	+ z-index: 10;
350	+ margin-left: 2px;
351	+ margin-right: 2px;
352	+ font-size: 10px;
353	+ padding: 0px;
354	+ }
355	+
356	+ .posttime {
357	+ font-weight: bold;
358	+ }
359	+
360	+ .post.draggable .postlink {
361	+ cursor: move;
362	+ }
363	+
364	+ .post .postactions {
365	+ display: none;
366	+ }
367	+
368	+ .postactions a {
369	+ text-decoration:none;
370	+ }
371	+
372	+ .post .postlink:hover {
373	+ color: #d54e21;
374	+ background-color: #f5f5f5;
375	+ }
376	+
377	+ .publish, .post.readonly {
378	+ color: #a4a4a4;
379	+ font-weight:normal;
380	+ }
381	+
382	+ .postlist {
383	+ position: relative;
384	+ top:24px; /* 1.5em; */
385	+ overflow: auto;
386	+ }
387	+
388	+ .postlist li {
389	+ margin-bottom: 8px;
390	+ }
391	+
392	+ /*.page-numbers {
393	+ text-decoration: none;
394	+ border-bottom-style: none;
395	+ border: none;
396	+ background: white;
397	+ color: #21759B;
398	+ }*/
399	+
400	+
401	+
402	+ /* Quick Add/Edit Tooltip */
403	+
404	+ #edcal_quickedit {
405	+ background: #f4f4f4;
406	+ width:500px;
407	+ border:1px solid #dfdfdf;
408	+ -moz-border-radius:3px;
409	+ -webkit-border-radius:3px;
410	+ -o-border-radius:3px;
411	+ border-radius:3px;
412	+ -moz-box-shadow:0 4px 8px #c8c8c8, 0 1px 0 #FFFFFF inset;
413	+ -webkit-box-shadow:0 4px 8px #c8c8c8, 0 1px 0 #FFFFFF inset;
414	+ -o-box-shadow:0 4px 8px #c8c8c8, 0 1px 0 #FFFFFF inset;
415	+ box-shadow:0 4px 8px #c8c8c8, 0 1px 0 #FFFFFF inset;
416	+ position: relative;
417	+ z-index: 25;
418	+ }
419	+
420	+ .edcal_quickedit {
421	+ padding: 10px;
422	+ position: relative;
423	+ border-top:1px solid #fff;
424	+ }
425	+
426	+ #tooltiphead {
427	+ background: #e9e9e9;
428	+ background-image:-moz-linear-gradient(top,#f4f4f4,#e9e9e9);
429	+ background-image:-o-linear-gradient(top,#f4f4f4,#e9e9e9);
430	+ background-image:-webkit-gradient(linear,left top,left bottom,from(#f4f4f4),to(#e9e9e9));
431	+ background-image:-webkit-linear-gradient(top,#f4f4f4,#e9e9e9);
432	+ background-image:linear-gradient(top,#f4f4f4,#e9e9e9);
433	+ }
434	+
435	+ #tooltiptitle {
436	+ border-bottom:1px solid #dfdfdf;
437	+ color:#464646;
438	+ font-family:Georgia,"Times New Roman","Bitstream Charter",Times,serif;
439	+ font-size:15px;
440	+ font-weight:normal;
441	+ line-height:1;
442	+ position:relative;
443	+ text-shadow: #fff 0px 1px 0px;
444	+ padding:7px 10px;
445	+ margin:1px 0 0;
446	+ }
447	+
448	+ #tipclose {
449	+ width: 15px;
450	+ height: 15px;
451	+ position: absolute;
452	+ top:8px;
453	+ right:10px;
454	+ }
455	+
456	+ #edcal_quickedit .inline-edit-row fieldset {
457	+ padding-bottom:1.2em;
458	+ }
459	+
460	+ #edcal-title { /* not sure this is being used */
461	+ padding-top: 0.5em;
462	+ padding-bottom: 0.5em;
463	+ }
464	+
465	+ /*
466	+ TinyMCE Rich Editor and Media buttons are not currently used
467	+ #edcal_quickedit .mceEditor,*/
468	+ #edcal_quickedit textarea {
469	+ height: 15em;
470	+ }
471	+
472	+ /*
473	+ #edcal_quickedit #cal_mediabar {
474	+ font-size: 11px;
475	+ }
476	+
477	+ #edcal_quickedit #media-buttons {
478	+ padding: 5px 0;
479	+ }*/
480	+
481	+ #edcal_quickedit #edcal-time {
482	+ width: 9em;
483	+ background-color: white;
484	+ }
485	+
486	+ #edcal-author-p {
487	+ line-height:1.8em;
488	+ padding-left:0.2em;
489	+ }
490	+
491	+ #edit-slug-buttons {
492	+ position: relative;
493	+ margin:0;
494	+ padding:0 0 0.5em 0;
495	+ }
496	+
497	+ #edit-slug-buttons a {
498	+ }
499	+
500	+ #newPostScheduleButton {
501	+ position: absolute;
502	+ right: 0;
503	+ top: -5px;
504	+ }
505	+
506	+ #newPostScheduleButton.disabled {
507	+ color:#9FD0D5!important;
508	+ background:#298CBA!important;
509	+ }
510	+
511	+ /* End Add/Edit Tooltip */
512	+
513	+
514	+
515	+ /* Screen Options */
516	+
517	+ #edcal_weeks_pref {
518	+ width: 4em;
519	+ }
520	+
521	+ div.calendar-fields-prefs {
522	+ margin-bottom: 1em;
523	+ }
524	+
525	+ div.calendar-fields-prefs label {
526	+ margin-left: 1em;
527	+ line-height: normal;
528	+ vertical-align: baseline;
529	+ }
530	+
531	+ #edcal-qunit {
532	+ margin-top: 2em;
533	+ }
534	+
535	+ .optionscolorrow {
536	+ position: relative;
537	+ height: 20px;
538	+ }
539	+
540	+ .optionscolor {
541	+ width: 16px;
542	+ height: 16px;
543	+ margin-left: 1em;
544	+ display: block;
545	+ position: absolute;
546	+ top: 2px;
547	+ -moz-border-radius: 3px;
548	+ -webkit-border-radius: 3px;
549	+ opacity: 0.5;
550	+
551	+ }
552	+
553	+ .optionscolor:hover {
554	+ opacity: 1;
555	+ }
556	+
557	+ .colorselected {
558	+ opacity: 1;
559	+ }
560	+
561	+ .colorlabel {
562	+ -moz-border-radius: 4px;
563	+ -webkit-border-radius: 4px;
564	+ }
565	+
566	+ #screen-meta #show-edcal-settings-link.show-settings {
567	+ background-position: right -1px;
568	+ }
569	+
570	+ div.metabox-prefs {
571	+ padding-left: 10px;
572	+ }
573	+
574	+ #contextual-help-wrap {
575	+ margin-left: 8px;
576	+ padding: 0 0 10px;
577	+ }
578	+
579	+
580	+
581	+ /* Feedback section */
582	+
583	+ #feedbacksection {
584	+ margin-top: 15px;
585	+ padding: 1em;
586	+ -moz-border-radius: 3px;
587	+ -webkit-border-radius: 3px;
588	+ width: 55%;
589	+ min-width: 500px;
590	+ background-color: #eaf2fb;
591	+ font-family:"Lucida Grande",Verdana,Arial,"Bitstream Vera Sans",sans-serif;
592	+ font-size:11px;
593	+ }
594	+
595	+ #feedbacksection h2 {
596	+ font-family:"Lucida Grande",Verdana,Arial,"Bitstream Vera Sans",sans-serif;
597	+ font-size: 14.3px;
598	+ font-style: normal;
599	+ font-weight: bold;
600	+ color: #333333;
601	+ padding: 0px;
602	+ margin: 0px;
603	+ margin-top: -10px;
604	+ }
605	+
606	+ #nofeedbacklink {
607	+ margin-left: 1em;
608	+ }
609	+
610	+
611	+ #moveToToday {
612	+ margin-left: 1.5em;
613	+ }
614	+
615	+ .tablenav .tablenav-pages a {
616	+ background-position-y: -380px;
617	+ }
618	+
619	+ .postlist::-webkit-scrollbar {
620	+ -webkit-appearance: none;
621	+ width: 7px;
622	+ }
623	+ .postlist::-webkit-scrollbar-thumb {
624	+ border-radius: 4px;
625	+ background-color: rgba(0, 0, 0, .5);
626	+ -webkit-box-shadow: 0 0 1px rgba(255, 255, 255, .5);
627	+ }
628	+
629	+ #currentRange {
630	+ min-width: 17em;
631	+ display: inline-block;
632	+ text-align: center;
633	+ }

3.7.8/edcal.js ADDED Viewed

	@@ -0,0 +1,2733 @@


1	+ /*******************************************************************************
2	+ *
3	+ * Licensed under the Apache License, Version 2.0 (the "License");
4	+ * you may not use this file except in compliance with the License.
5	+ * You may obtain a copy of the License at
6	+ *
7	+ * http://www.apache.org/licenses/LICENSE-2.0
8	+ *
9	+ * Unless required by applicable law or agreed to in writing, software
10	+ * distributed under the License is distributed on an "AS IS" BASIS,
11	+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
12	+ * See the License for the specific language governing permissions and
13	+ * limitations under the License.
14	+ *
15	+ ******************************************************************************/
16	+
17	+ /*
18	+ This is the WordPress editorial calendar. It is a continuous
19	+ calendar in both directions. That means instead of showing only
20	+ one month at a time it shows the months running together. Users
21	+ can scroll from one month to the next using the up and down
22	+ arrow keys, the page up and page down keys, the next and previous
23	+ month buttons, and their mouse wheel.
24	+
25	+ The calendar shows five weeks visible at a time and maintains 11
26	+ weeks of rendered HTML. Only the middle weeks are visible.
27	+
28	+ Week 1
29	+ Week 2
30	+ Week 3
31	+ - Week 4 -
32	+ \| Week 5 \|
33	+ \| Week 6 \|
34	+ \| Week 7 \|
35	+ - Week 8 -
36	+ Week 9
37	+ Week 10
38	+ Week 11
39	+
40	+ When the user scrolls down one week the new week is added at the
41	+ end of the calendar and the first week is removed. In this way
42	+ the calendar will only ever have 11 weeks total and won't use up
43	+ excessive memory.
44	+
45	+ This calendar uses AJAX to call into the functions defined in
46	+ edcal.php. These functions get posts and change post dates.
47	+
48	+ The HTML structure of the calendar is:
49	+
50	+ <div id="cal">
51	+ <div id="row08Nov2009">
52	+ <div id="row08Nov2009row">
53	+ <div class="day sunday nov" id="08Nov2009">
54	+ <div class="dayobj">
55	+ <div class="daylabel">8</div>
56	+ <ul class="postlist">
57	+ </ul>
58	+ </div>
59	+ </div>
60	+ </div>
61	+ </div>
62	+ </div>
63	+ */
64	+ var edcal = {
65	+
66	+ /*
67	+ This final string represents the date which indicates to WordPress
68	+ that a post doesn't have a date.
69	+ */
70	+ NO_DATE: '00000000',
71	+
72	+ /*
73	+ This value is the number of weeks the user wants to see at one time
74	+ in the calendar.
75	+ */
76	+ weeksPref: 3,
77	+
78	+ /*
79	+ This is a preference value indicating if you see the post status
80	+ */
81	+ statusPref: true,
82	+
83	+ /*
84	+ This is a preference value indicating if you see the post author
85	+ */
86	+ authorPref: false,
87	+
88	+ /*
89	+ This is a preference value indicating if you see the post time
90	+ */
91	+ timePref: true,
92	+
93	+ /*
94	+ This is a preference value indiciating if we should scroll the calendar with mouse wheel scrolls
95	+ */
96	+ wheelScrollPref: true,
97	+
98	+ /*
99	+ This is a preference value indicating if we should prompt for feeback
100	+ */
101	+ doFeedbackPref: true,
102	+
103	+ /*
104	+ * True if the calendar is in the process of moving
105	+ */
106	+ isMoving: false,
107	+
108	+ /*
109	+ * True if we are in the middle of dragging a post
110	+ */
111	+ inDrag: false,
112	+
113	+ /*
114	+ True if the calendar is in the process of queueing scrolling
115	+ during a drag.
116	+ */
117	+ isDragScrolling: false,
118	+
119	+ /*
120	+ * This is the format we use to dates that we use as IDs in the
121	+ * calendar. It is independant of the visible date which is
122	+ * formatted based on the user's locale.
123	+ */
124	+ internalDateFormat: 'ddMMyyyy',
125	+
126	+ /*
127	+ This is the position of the calendar on the screen in pixels.
128	+ It is an array with two fields: top and bottom.
129	+ */
130	+ position: null,
131	+
132	+ /*
133	+ * This is the first date of the current month
134	+ */
135	+ firstDayOfMonth: null,
136	+
137	+ /*
138	+ * This is the first day of the next month
139	+ */
140	+ firstDayOfNextMonth: null,
141	+
142	+ /*
143	+ * The date format used by wordpress
144	+ */
145	+ wp_dateFormat: 'yyyy-MM-dd',
146	+
147	+ /*
148	+ * The cache of dates we have already loaded posts for.
149	+ */
150	+ cacheDates: [],
151	+
152	+ /*
153	+ * The ID of the timer we use to batch new post requests
154	+ */
155	+ tID: null,
156	+
157	+ /*
158	+ * The number of steps moving for this timer.
159	+ */
160	+ steps: 0,
161	+
162	+ /*
163	+ * The constant for the concurrency error.
164	+ */
165	+ CONCURRENCY_ERROR: 4,
166	+
167	+ /*
168	+ * The constant for the user permission error
169	+ */
170	+ PERMISSION_ERROR: 5,
171	+
172	+ /*
173	+ * The constant for the nonce error
174	+ */
175	+ NONCE_ERROR: 6,
176	+
177	+ /*
178	+ The direction the calendar last moved.
179	+ true = down = to the future
180	+ false = up = to the past
181	+
182	+ */
183	+ currentDirection: true,
184	+
185	+ /*
186	+ This date is our index. When the calendar moves we
187	+ update this date to indicate the next rows we need
188	+ to add.
189	+ */
190	+ _wDate: Date.today(),
191	+
192	+ /*
193	+ * The date since the previous move
194	+ */
195	+ moveDate: null,
196	+
197	+ /*
198	+ * This is a number from 0-6 indicating when the start
199	+ * of the week is. The user sets this in the Settings >
200	+ * General page and it is a single value for the entire
201	+ * server. We are setting this value in edcal.php
202	+ */
203	+ startOfWeek: null,
204	+
205	+ /*
206	+ A cache of all the posts we have loaded so far. The
207	+ data structure is:
208	+
209	+ posts [date - ddMMMyyyy][posts array - post object from JSON data]
210	+ */
211	+ posts: [],
212	+
213	+ /*
214	+ IE will sometimes fire the resize event twice for the same resize
215	+ action. We save it so we only resize the calendar once and avoid
216	+ any flickering.
217	+ */
218	+ windowHeight: 0,
219	+
220	+
221	+ /*
222	+ This variable indicates if the calendar is in left to right or right to
223	+ left display mode.
224	+ */
225	+ ltr: 'ltr',
226	+
227	+ /*
228	+ This variable indicates if the drafts drawer is visible or not.
229	+ */
230	+ isDraftsDrawerVisible: false,
231	+
232	+ enableMouseWheel: function() {
233	+ if (edcal.wheelScrollPref) {
234	+ jQuery('#edcal_scrollable').bind('mousewheel', function(event, delta) {
235	+ var dir = delta > 0 ? false : true, vel = Math.abs(delta);
236	+ //edcal.output(dir + ' at a velocity of ' + vel);
237	+
238	+ if (!edcal.isMoving && vel > 0.2) {
239	+ edcal.move(1, dir);
240	+ }
241	+
242	+ return false;
243	+ });
244	+ } else {
245	+ jQuery('#edcal_scrollable').unbind('mousewheel');
246	+ }
247	+ },
248	+
249	+ /*
250	+ * Initializes the calendar
251	+ */
252	+ init: function() {
253	+ if (jQuery('#edcal_scrollable').length === 0) {
254	+ /*
255	+ * This means we are on a page without the editorial
256	+ * calendar
257	+ */
258	+ return;
259	+ }
260	+
261	+ //edcal.addFeedbackSection();
262	+
263	+ var draftsDrawerVisible = jQuery.cookie('edcal_drafts_drawer');
264	+ if (draftsDrawerVisible === 'true') {
265	+ edcal.isDraftsDrawerVisible = true;
266	+ edcal.setDraftsDrawerVisible(edcal.isDraftsDrawerVisible);
267	+ }
268	+
269	+ jQuery('#loading').hide();
270	+
271	+ jQuery('#edcal_scrollable').css('height', edcal.getCalHeight() + 'px');
272	+ edcal.windowHeight = jQuery(window).height();
273	+
274	+ /*
275	+ * Add the days of the week
276	+ */
277	+ edcal.createDaysHeader();
278	+
279	+ /*
280	+ * We start by initializting the scrollable. We use this to manage the
281	+ * scrolling of the calendar, but don't actually call it to animate the
282	+ * scrolling. We specify an easing here because the default is "swing"
283	+ * and that has a conflict with JavaScript used in the BuddyPress plugin/
284	+ *
285	+ * This doesn't really change anything since the animation happens offscreen.
286	+ */
287	+ jQuery('#edcal_scrollable').scrollable({
288	+ vertical: true,
289	+ size: edcal.weeksPref,
290	+ keyboard: false,
291	+ keyboardSteps: 1,
292	+ speed: 100,
293	+ easing: 'linear'
294	+ });
295	+
296	+ var api = jQuery('#edcal_scrollable').scrollable();
297	+
298	+ api.getConf().keyboard = false;
299	+
300	+ /*
301	+ When the user moves the calendar around we remember their
302	+ date and save it in a cookie. Then we read the cookie back
303	+ when we reload so the calendar stays where the user left
304	+ it last.
305	+ */
306	+ var curDate = jQuery.cookie('edcal_date');
307	+
308	+ if (curDate) {
309	+ curDate = Date.parseExact(curDate, 'yyyy-dd-MM');
310	+ edcal.output('Resetting to date from the edcal_Date cookie: ' + curDate);
311	+ } else {
312	+ curDate = Date.today();
313	+ }
314	+
315	+ edcal.moveTo(curDate.clone());
316	+
317	+ /*
318	+ We are handling all of our own events so we just cancel all events from
319	+ the scrollable.
320	+ */
321	+ api.onBeforeSeek(function(evt, direction) {
322	+ return false;
323	+ });
324	+
325	+ edcal.enableMouseWheel();
326	+
327	+ /*
328	+ * We also want to listen for a few other key events
329	+ */
330	+ jQuery(document).bind('keydown', function(evt) {
331	+ //if (evt.altKey \|\| evt.ctrlKey) { return; }
332	+ //edcal.output("evt.altKey: " + evt.altKey);
333	+ //edcal.output("evt.keyCode: " + evt.keyCode);
334	+ //edcal.output("evt.ctrlKey: " + evt.ctrlKey);
335	+
336	+ if (evt.keyCode === 27) { //escape key
337	+ return false;
338	+ }
339	+
340	+ if (jQuery('#edcal_quickedit').is(':visible')) {
341	+ return;
342	+ }
343	+
344	+ if ((evt.keyCode === 40 && !(evt.altKey \|\| evt.ctrlKey))) { // down arrow key
345	+ edcal.move(1, true);
346	+ return false;
347	+ } else if ((evt.keyCode === 38 && !(evt.altKey \|\| evt.ctrlKey))) { // up arrow key
348	+ edcal.move(1, false);
349	+ return false;
350	+ } else if ((evt.keyCode === 34 && !(evt.altKey \|\| evt.ctrlKey)) \|\| //page down
351	+ evt.keyCode === 40 && evt.ctrlKey) { // Ctrl+down down arrow
352	+ edcal.move(edcal.weeksPref, true);
353	+ return false;
354	+ } else if ((evt.keyCode === 33 && !(evt.altKey \|\| evt.ctrlKey)) \|\| //page up
355	+ evt.keyCode === 38 && evt.ctrlKey) { // Ctrl+up up arrow
356	+ edcal.move(edcal.weeksPref, false);
357	+ return false;
358	+ }
359	+ });
360	+
361	+ edcal.getPosts(edcal.nextStartOfWeek(curDate).add(-3).weeks(),
362	+ edcal.nextStartOfWeek(curDate).add(edcal.weeksPref + 3).weeks());
363	+
364	+ /*
365	+ Now we bind the listeners for all of our links and the window
366	+ resize.
367	+ */
368	+ jQuery('#moveToToday').click(function() {
369	+ edcal.moveTo(Date.today());
370	+ edcal.getPosts(edcal.nextStartOfWeek(Date.today()).add(-3).weeks(),
371	+ edcal.nextStartOfWeek(Date.today()).add(edcal.weeksPref + 3).weeks());
372	+ return false;
373	+ });
374	+
375	+ jQuery('#moveToLast').click(function() {
376	+ if (edcal.lastPostDate === '-1') {
377	+ /*
378	+ * This happens when the blog doesn't have any posts
379	+ */
380	+ return;
381	+ }
382	+
383	+ var d = Date.parseExact(edcal.lastPostDate, 'ddMMyyyy');
384	+ edcal.moveTo(d);
385	+ edcal.getPosts(edcal.nextStartOfWeek(d).add(-3).weeks(),
386	+ edcal.nextStartOfWeek(d).add(edcal.weeksPref + 3).weeks());
387	+ return false;
388	+ });
389	+
390	+ jQuery('#prevmonth').click(function() {
391	+ edcal.move(edcal.weeksPref, false);
392	+ return false;
393	+ });
394	+
395	+ jQuery('#nextmonth').click(function() {
396	+ edcal.move(edcal.weeksPref, true);
397	+ return false;
398	+ });
399	+
400	+ /*
401	+ We used to listen to resize events so we could make the calendar the right size
402	+ for the current window when it changed size, but this was causing a problem with
403	+ WordPress 3.3 and it never worked properly because the scroll position was a little
404	+ off so we are just skipping it.
405	+ */
406	+ /*function resizeWindow(e) {
407	+ if (edcal.windowHeight != jQuery(window).height()) {
408	+ jQuery('#edcal_scrollable').css('height', edcal.getCalHeight() + 'px');
409	+ edcal.windowHeight = jQuery(window).height();
410	+ edcal.savePosition();
411	+ }
412	+ }
413	+ jQuery(window).bind('resize', resizeWindow);*/
414	+
415	+ jQuery('#newPostScheduleButton').on('click', function(evt) {
416	+ // if the button is disabled, don't do anything
417	+ if (jQuery(this).hasClass('disabled')) {
418	+ return false;
419	+ }
420	+ // Otherwise,
421	+ // make sure we can't make duplicate posts by clicking twice quickly
422	+ jQuery(this).addClass('disabled');
423	+ // and save the post
424	+ return edcal.savePost(null, false, true);
425	+ });
426	+
427	+ jQuery('#edcal-title-new-field').bind('input', function(evt) {
428	+ if ((jQuery('#edcal-title-new-field').val().length > 0 \|\| jQuery('#content').val().length > 0) &&
429	+ (!jQuery('#edcal-time').is(':visible') \|\| jQuery('#edcal-time').val().length > 0)) {
430	+ jQuery('#newPostScheduleButton').removeClass('disabled');
431	+ } else {
432	+ jQuery('#newPostScheduleButton').addClass('disabled');
433	+ }
434	+
435	+ if (evt.keyCode === 13) { // enter key
436	+ /*
437	+ * If the user presses enter we want to save the draft.
438	+ */
439	+ return edcal.savePost(null, true);
440	+ }
441	+ });
442	+
443	+ jQuery('#content').bind('input', function(evt) {
444	+ if ((jQuery('#edcal-title-new-field').val().length > 0 \|\| jQuery('#content').val().length > 0) &&
445	+ (!jQuery('#edcal-time').is(':visible') \|\| jQuery('#edcal-time').val().length > 0)) {
446	+ jQuery('#newPostScheduleButton').removeClass('disabled');
447	+ } else {
448	+ jQuery('#newPostScheduleButton').addClass('disabled');
449	+ }
450	+
451	+ if (evt.keyCode === 13) { // enter key
452	+ /*
453	+ * If the user presses enter we want to save the draft.
454	+ */
455	+ return edcal.savePost(null, true);
456	+ }
457	+ });
458	+
459	+ jQuery('#edcal-status').bind('change', function(evt) {
460	+ edcal.updatePublishButton();
461	+ });
462	+
463	+ jQuery('#edcal_weeks_pref').on('keyup', function(evt) {
464	+ if (jQuery('#edcal_weeks_pref').val().length > 0) {
465	+ jQuery('#edcal_applyoptions').removeClass('disabled');
466	+ } else {
467	+ jQuery('#edcal_applyoptions').addClass('disabled');
468	+ }
469	+
470	+ if (evt.keyCode === 13) { // enter key
471	+ edcal.saveOptions();
472	+ }
473	+
474	+ });
475	+
476	+ edcal.savePosition();
477	+
478	+ edcal.addOptionsSection();
479	+
480	+ jQuery('#edcal-time').timePicker({
481	+ show24Hours: edcal.timeFormat === 'H:i',
482	+ separator: ':',
483	+ step: 30
484	+ });
485	+
486	+ jQuery('#showdraftsdrawer').click(function() {
487	+ edcal.setDraftsDrawerVisible(!edcal.isDraftsDrawerVisible);
488	+ });
489	+ },
490	+
491	+ /*
492	+ * This function shows and hides the drafts drawer. Kind of clunky right now.
493	+ * Inits [loads content] only once.
494	+ */
495	+ setDraftsDrawerVisible: function(/boolean/ visible, /function/ callback) {
496	+ var drawerwidth = '13%';
497	+ var drawerwidthmargin = '13.5%';
498	+ var showhideElement = jQuery('#showdraftsdrawer');
499	+ /* tells us if the drafts have been loaded for the first time */
500	+ if (!showhideElement.hasClass('isLoaded')) {
501	+ showhideElement.addClass('isLoaded');
502	+ edcal.setupDraftsdrawer(callback);
503	+ } else if (callback) {
504	+ /*
505	+ * If the drawer was already open we just call the callback
506	+ */
507	+ callback();
508	+ }
509	+
510	+ if (visible) {
511	+ // edcal.output('showing draftsdrawer');
512	+ jQuery('#cal_cont').css({ 'margin-right': drawerwidthmargin });
513	+ jQuery('#draftsdrawer_cont').css({ display:'block', width:drawerwidth });
514	+ showhideElement.html(edcal.str_hidedrafts);
515	+ } else {
516	+ // edcal.output('hiding draftsdrawer');
517	+ jQuery('#cal_cont').css({ 'margin-right': '0' });
518	+ jQuery('#draftsdrawer_cont').css({ display:'none', width:'0' });
519	+ showhideElement.html(edcal.str_showdrafts);
520	+ }
521	+
522	+ edcal.isDraftsDrawerVisible = visible;
523	+
524	+ jQuery.cookie('edcal_drafts_drawer', visible, {expires: 2060});
525	+ },
526	+
527	+ /*
528	+ * Sets up the drafts drawer.
529	+ */
530	+ setupDraftsdrawer: function(/function/ callback) {
531	+ jQuery('#draftsdrawer_loading').css({display:'block'});
532	+ edcal.getPosts(edcal.NO_DATE, null, function() {
533	+ edcal.initDraftsdrawer();
534	+ if (callback) {
535	+ callback();
536	+ }
537	+ });
538	+ },
539	+
540	+ /*
541	+ * Inits the drafts drawer, much like edcal.createRow()
542	+ * We could paginate this but right now we're just loading them all.
543	+ */
544	+ initDraftsdrawer: function() {
545	+ var newrow = '';
546	+
547	+ newrow += '<a href="#" adddate="' + edcal.NO_DATE + '" class="daynewlink" style="margin-top: 5px;"' +
548	+ 'title="' + edcal.str_newdraft + '" id="unscheduledNewLink" ' +
549	+ 'onclick="edcal.addDraft(); return false;">' + edcal.str_addDraftLink + '</a>';
550	+
551	+ newrow += '<ul class="postlist">';
552	+
553	+ newrow += edcal.getPostItems(edcal.NO_DATE);
554	+
555	+ newrow += '</ul>';
556	+
557	+ edcal.draggablePost('#row' + edcal._wDate.toString(edcal.internalDateFormat) + ' li.post');
558	+
559	+ edcal.makeDroppable(jQuery('#draftsdrawer div.day'));
560	+
561	+ jQuery('#unscheduled').append(newrow);
562	+ jQuery('#draftsdrawer_loading').css({display:'none'});
563	+
564	+ var cal_cont = jQuery('#cal_cont');
565	+
566	+ jQuery('#unscheduled ul.postlist').css('min-height', ((cal_cont.height() - 10) -
567	+ jQuery('#draftsdrawer .draftsdrawerheadcont').height()) -
568	+ jQuery('#unscheduledNewLink').outerHeight());
569	+
570	+ jQuery('#unscheduled').mouseout(function() {
571	+ jQuery('#unscheduledNewLink').hide();
572	+ }).mouseover(function() {
573	+ jQuery('#unscheduledNewLink').show();
574	+ });
575	+ },
576	+
577	+ /*
578	+ This function aligns the grid in two directions. There
579	+ is a vertical grid with a row of each week and a horizontal
580	+ grid for each week with a list of days.
581	+ */
582	+ alignGrid: function(/string/ gridid, /int/ cols, /int/ cellWidth, /int/ cellHeight, /int/ padding) {
583	+ if (jQuery(gridid).parent().attr('id') === 'draftsdrawer') {
584	+ return;
585	+ }
586	+
587	+ var x = 0;
588	+ var y = 0;
589	+ var count = 1;
590	+
591	+ jQuery(gridid).each(function() {
592	+ jQuery(this).css('position', 'relative');
593	+
594	+ var children = jQuery(this).children('div');
595	+
596	+ /*
597	+ In left to right languages the first day of the week shows
598	+ up on the left side of the calendar. In right to left languages
599	+ the first day of the week shows up on the right. We handle
600	+ this by changing the order of the cells in the layout code.
601	+
602	+ We only want to do this for the days of the week so we skip it
603	+ if we're dealing with just one column for the rows in the calendar.
604	+ */
605	+ if (cols === 1 \|\| edcal.ltr !== 'rtl') {
606	+ for (var i = 0; i < children.length; i++) {
607	+ children.eq(i).css({
608	+ width: cellWidth + '%',
609	+ height: cellHeight + '%',
610	+ position: 'absolute',
611	+ left: x + '%',
612	+ top: y + '%'
613	+ });
614	+
615	+ if ((count % cols) === 0) {
616	+ x = 0;
617	+ y += cellHeight + padding;
618	+ } else {
619	+ x += cellWidth + padding;
620	+ }
621	+
622	+ count++;
623	+ }
624	+ } else {
625	+ for (var j = children.length - 1; j > -1; j--) {
626	+ children.eq(j).css({
627	+ width: cellWidth + '%',
628	+ height: cellHeight + '%',
629	+ position: 'absolute',
630	+ left: x + '%',
631	+ top: y + '%'
632	+ });
633	+
634	+ if ((count % cols) === 0) {
635	+ x = 0;
636	+ y += cellHeight + padding;
637	+ } else {
638	+ x += cellWidth + padding;
639	+ }
640	+
641	+ count++;
642	+ }
643	+ }
644	+
645	+ });
646	+ },
647	+
648	+ /*
649	+ This is a helper function to align the calendar so we don't
650	+ have to change the cell sizes in multiple places.
651	+ */
652	+ alignCal: function() {
653	+ edcal.alignGrid('#cal', 1, 100, (100 / edcal.weeksPref) - 1, 1);
654	+ },
655	+
656	+
657	+ /*
658	+ This function creates the days header at the top of the
659	+ calendar.
660	+ */
661	+ createDaysHeader: function() {
662	+ /*
663	+ * The first day of the week in the calendar depends on
664	+ * a wordpress setting and maybe the server locale. This
665	+ * means we need to determine the days of the week dynamically.
666	+ * Luckily the Date.js library already has these strings
667	+ * localized for us. All we need to do is figure out the
668	+ * first day of the week and then we can add a day from there.
669	+ */
670	+
671	+ var date = Date.today().next().sunday();
672	+
673	+ /*
674	+ * We need to call nextStartOfWeek to make sure the
675	+ * edcal.startOfWeek variable gets initialized.
676	+ */
677	+ edcal.nextStartOfWeek(date);
678	+
679	+
680	+ var html = '<div class="dayheadcont"><div class="dayhead firstday">' +
681	+ date.add(edcal.startOfWeek).days().toString('dddd') +
682	+ '</div>';
683	+
684	+ html += '<div class="dayhead">' + date.add(1).days().toString('dddd') + '</div>';
685	+ html += '<div class="dayhead">' + date.add(1).days().toString('dddd') + '</div>';
686	+ html += '<div class="dayhead">' + date.add(1).days().toString('dddd') + '</div>';
687	+ html += '<div class="dayhead">' + date.add(1).days().toString('dddd') + '</div>';
688	+ html += '<div class="dayhead">' + date.add(1).days().toString('dddd') + '</div>';
689	+ html += '<div class="dayhead lastday">' + date.add(1).days().toString('dddd') + '</div>';
690	+
691	+ jQuery('#cal_cont').prepend(html);
692	+
693	+ edcal.alignGrid('.dayheadcont', 7, 13.8, 100, 0.5);
694	+ },
695	+
696	+ /*
697	+ We have different styles for days in previous months,
698	+ the current month, and future months. This function
699	+ figures out the right class based on the date.
700	+ */
701	+ getDateClass: function(/Date/ date) {
702	+
703	+ var monthstyle;
704	+ var daystyle;
705	+
706	+ if (date.compareTo(Date.today()) === -1) {
707	+ /*
708	+ * Date is before today
709	+ */
710	+ daystyle = 'beforeToday';
711	+ } else {
712	+ /*
713	+ * Date is after today
714	+ */
715	+ daystyle = 'todayAndAfter';
716	+ }
717	+ if (!edcal.firstDayOfMonth) {
718	+ /*
719	+ * We only need to figure out the first and last day
720	+ * of the month once
721	+ */
722	+ edcal.firstDayOfMonth = Date.today().moveToFirstDayOfMonth().clearTime();
723	+ edcal.firstDayOfNextMonth = Date.today().moveToLastDayOfMonth().clearTime();
724	+ }
725	+ if (date.between(edcal.firstDayOfMonth, edcal.firstDayOfNextMonth)) {
726	+ /*
727	+ * If the date isn't before the first of the
728	+ * month and it isn't after the last of the
729	+ * month then it is in the current month.
730	+ */
731	+ monthstyle = 'month-present';
732	+ } else if (date.compareTo(edcal.firstDayOfMonth) === 1) {
733	+ /*
734	+ * Then the date is after the current month
735	+ */
736	+ monthstyle = 'month-future';
737	+ } else if (date.compareTo(edcal.firstDayOfNextMonth) === -1) {
738	+ /*
739	+ * Then the date is before the current month
740	+ */
741	+ monthstyle = 'month-past';
742	+ }
743	+
744	+ if (date.toString('dd') === '01') {
745	+ /*
746	+ * This this date is the first day of the month
747	+ */
748	+ daystyle += ' firstOfMonth';
749	+ }
750	+
751	+
752	+ return monthstyle + ' ' + daystyle;
753	+ },
754	+
755	+ /*
756	+ Show the add post link. This gets called when the mouse
757	+ is over a specific day.
758	+ */
759	+ showAddPostLink: function(/string/ dayid) {
760	+ if (edcal.inDrag) {
761	+ return;
762	+ }
763	+
764	+ var createLink = jQuery('#' + dayid + ' a.daynewlink');
765	+ createLink.css('display', 'block');
766	+ createLink.bind('click', edcal.addPost);
767	+ },
768	+
769	+ /*
770	+ Hides the add new post link it is called when the mouse moves
771	+ outside of the calendar day.
772	+ */
773	+ hideAddPostLink: function(/string/ dayid) {
774	+ var link = jQuery('#' + dayid + ' a.daynewlink').hide();
775	+ link.unbind('click', edcal.addPost);
776	+ },
777	+
778	+ /*
779	+ Creates a row of the calendar and adds all of the CSS classes
780	+ and listeners for each calendar day.
781	+ */
782	+ createRow: function(/jQuery/ parent, /bool/ append) {
783	+ var _date = edcal._wDate.clone();
784	+
785	+ var newrow = '<div class="rowcont" id="' + 'row' + edcal._wDate.toString(edcal.internalDateFormat) + '">' +
786	+ '<div id="' + 'row' + edcal._wDate.toString(edcal.internalDateFormat) + 'row" class="edcal_row">';
787	+ for (var i = 0; i < 7; i++) {
788	+ /*
789	+ * Adding all of these calls in the string is kind of messy. We
790	+ * could do this with the JQuery live function, but there are a lot
791	+ * of days in the calendar and the live function gets a little slow.
792	+ */
793	+ newrow += '<div onmouseover="edcal.showAddPostLink(\'' + _date.toString(edcal.internalDateFormat) + '\');" ' +
794	+ 'onmouseout="edcal.hideAddPostLink(\'' + _date.toString(edcal.internalDateFormat) + '\');" ' +
795	+ 'id="' + _date.toString(edcal.internalDateFormat) + '" class="day ' +
796	+ edcal.getDateClass(_date) + ' ' +
797	+ _date.toString('dddd').toLowerCase() + ' month-' +
798	+ _date.toString('MM').toLowerCase() + '">';
799	+
800	+ newrow += '<div class="dayobj">';
801	+
802	+ newrow += '<a href="#" adddate="' + _date.toString('MMMM d') + '" class="daynewlink" title="' +
803	+ sprintf(edcal.str_newpost, edcal.chineseAposWorkaround(_date.toString(Date.CultureInfo.formatPatterns.monthDay))) + '" ' +
804	+ 'onclick="return false;">' + edcal.str_addPostLink + '</a>';
805	+
806	+ if (_date.toString('dd') === '01') {
807	+ newrow += '<div class="daylabel">' + _date.toString('MMM d');
808	+ } else {
809	+ newrow += '<div class="daylabel">' + _date.toString('d');
810	+ }
811	+
812	+
813	+ newrow += '</div>';
814	+
815	+ newrow += '<ul class="postlist">';
816	+
817	+ newrow += edcal.getPostItems(_date.toString(edcal.internalDateFormat));
818	+
819	+ newrow += '</ul>';
820	+
821	+ newrow += '</div>';
822	+ newrow += '</div>';
823	+ _date.add(1).days();
824	+ }
825	+
826	+ newrow += '</div></div>';
827	+
828	+ if (append) {
829	+ parent.append(newrow);
830	+
831	+ } else {
832	+ parent.prepend(newrow);
833	+ }
834	+
835	+ /*
836	+ * This is the horizontal alignment of an individual week
837	+ */
838	+ edcal.alignGrid('#row' + edcal._wDate.toString(edcal.internalDateFormat) + 'row', 7, 13.9, 100, 0.5);
839	+
840	+ edcal.draggablePost('#row' + edcal._wDate.toString(edcal.internalDateFormat) + ' li.post');
841	+
842	+ edcal.makeDroppable(jQuery('#row' + edcal._wDate.toString(edcal.internalDateFormat) + ' > div > div.day'));
843	+
844	+ return jQuery('row' + edcal._wDate.toString(edcal.internalDateFormat));
845	+ },
846	+
847	+ /*
848	+ * Make a specific post droppable
849	+ */
850	+ makeDroppable: function(/jQuery/ day) {
851	+ day.droppable({
852	+ hoverClass: 'day-active',
853	+ accept: function(ui) {
854	+ /*
855	+ We only let them drag draft posts into the past. If
856	+ they try to drag and scheduled post into the past we
857	+ reject the drag. Using the class here is a little
858	+ fragile, but it is much faster than doing date
859	+ arithmetic every time the mouse twitches.
860	+ */
861	+ if (jQuery(this).hasClass('beforeToday')) {
862	+ if (ui.hasClass('draft')) {
863	+ return true;
864	+ } else {
865	+ return false;
866	+ }
867	+ } else {
868	+ return true;
869	+ }
870	+ },
871	+ greedy: true,
872	+ tolerance: 'pointer',
873	+ drop: function(event, ui) {
874	+ //edcal.output('dropped ui.draggable.attr("id"): ' + ui.draggable.attr("id"));
875	+ //edcal.output('dropped on jQuery(this).attr("id"): ' + jQuery(this).attr("id"));
876	+ //edcal.output('ui.draggable.html(): ' + ui.draggable.html());
877	+ var dayId = ui.draggable.parent().parent().parent().attr('id');
878	+ //edcal.output('dayId: ' + dayId);
879	+ edcal.doDrop(dayId, ui.draggable.attr('id'), jQuery(this).attr('id'));
880	+ }
881	+ });
882	+ },
883	+
884	+ /*
885	+ * Handle the drop when a user drags and drops a post.
886	+ */
887	+ doDrop: function(/string/ parentId, /string/ postId, /string/ newDate, /function/ callback) {
888	+ //edcal.output('doDrop(' + parentId + ', ' + postId + ', ' + newDate + ')');
889	+ var dayId = parentId;
890	+
891	+
892	+ // Step 0. Get the post object from the map
893	+ var post = edcal.findPostForId(parentId, postId);
894	+
895	+ // Step 1. Remove the post from the posts map
896	+ edcal.removePostFromMap(parentId, postId);
897	+
898	+ /*
899	+ Step 2. Remove the old element from the old parent.
900	+
901	+ We would like to just remove the item right away,
902	+ but on IE with JQuery UI 1.8 that causes an error
903	+ because it tries to access the properties of the
904	+ object to reset the cursor and it can't since the
905	+ object is not longer part of the DOM. That is why
906	+ we detach it instead of removing it.
907	+
908	+ However, this causes a small memory leak since every
909	+ drag will detach an element and never remove it. To
910	+ clean up we wait half a second until the drag is done
911	+ and then remove the item. Hacky, but it works.
912	+ */
913	+ var oldPost = jQuery('#' + postId);
914	+ oldPost.detach();
915	+
916	+ setTimeout(function() {
917	+ oldPost.remove();
918	+ }, 500);
919	+
920	+ // Step 3. Add the item to the new DOM parent
921	+ // Step 3a. Check whether we dropped it on a day or on the Drafts Drawer
922	+ jQuery('#' + newDate + ' .postlist').append(edcal.createPostItem(post, newDate));
923	+
924	+
925	+ if (dayId === newDate) {
926	+ /*
927	+ If they dropped back on to the day they started with we
928	+ don't want to go back to the server.
929	+ */
930	+ edcal.draggablePost('#' + newDate + ' .post');
931	+ } else {
932	+ // Step6. Update the date on the server
933	+ edcal.changeDate(newDate, post, callback);
934	+ }
935	+ },
936	+
937	+ /*
938	+ * This is a helper method to make an individual post item draggable.
939	+ */
940	+ draggablePost: function(/post selector/ post) {
941	+ jQuery(post).each(function() {
942	+ var postObj = edcal.findPostForId(jQuery(this).parent().parent().parent().attr('id'),
943	+ jQuery(this).attr('id'));
944	+ if (edcal.isPostMovable(postObj)) {
945	+ jQuery(this).draggable({
946	+ revert: 'invalid',
947	+ appendTo: 'body',
948	+ helper: 'clone',
949	+ distance: 1,
950	+ addClasses: false,
951	+ start: function() {
952	+ edcal.inDrag = true;
953	+ },
954	+ stop: function() {
955	+ edcal.inDrag = false;
956	+ },
957	+ drag: function(event, ui) {
958	+ edcal.handleDrag(event, ui);
959	+ },
960	+ scroll: false,
961	+ refreshPositions: true
962	+ });
963	+ jQuery(this).addClass('draggable');
964	+ }
965	+ });
966	+ },
967	+
968	+ /*
969	+ When the user is dragging we scroll the calendar when they get
970	+ close to the top or bottom of the calendar. This function handles
971	+ scrolling the calendar when that happens.
972	+ */
973	+ handleDrag: function(event, ui) {
974	+ if (edcal.isMoving \|\| edcal.isDragScrolling
975	+ /*
976	+ TODO: make sure that if we are on top of the drafts drawer
977	+ we don't dragScroll.
978	+ */
979	+ ) {
980	+ return;
981	+ }
982	+
983	+ edcal.isDragScrolling = true;
984	+
985	+ if (event.pageY < (edcal.position.top + 10)) {
986	+ /*
987	+ This means we're close enough to the top of the calendar to
988	+ start scrolling up.
989	+ */
990	+ edcal.move(1, false);
991	+ } else if (event.pageY > (edcal.position.bottom - 10)) {
992	+ /*
993	+ This means we're close enough to the bottom of the calendar
994	+ to start scrolling down.
995	+ */
996	+ edcal.move(1, true);
997	+ }
998	+
999	+ /*
1000	+ We want to start scrolling as soon as the user gets their mouse
1001	+ close to the top, but if we just scrolle with every event then
1002	+ the screen flies by way too fast. We wait here so we scroll one
1003	+ row and wait three quarters of a second. That way it gives a
1004	+ smooth scroll that doesn't go too fast to track.
1005	+ */
1006	+ setTimeout(function() {
1007	+ edcal.isDragScrolling = false;
1008	+ }, 300);
1009	+ },
1010	+
1011	+ /*
1012	+ This is a utility method to find a post and remove it
1013	+ from the cache map.
1014	+ */
1015	+ removePostFromMap: function(/string/ dayobjId, /string/ postId) {
1016	+ if (edcal.posts[dayobjId]) {
1017	+ for (var i = 0; i < edcal.posts[dayobjId].length; i++) {
1018	+ if (edcal.posts[dayobjId][i] &&
1019	+ 'post-' + edcal.posts[dayobjId][i].id === postId) {
1020	+ edcal.posts[dayobjId][i] = null;
1021	+ return true;
1022	+ }
1023	+ }
1024	+ }
1025	+
1026	+ return false;
1027	+ },
1028	+
1029	+ /*
1030	+ * Adds a post to an already existing calendar day.
1031	+ */
1032	+ addPostItem: function(/post/ post, /string/ dayobjId) {
1033	+ /*
1034	+ * We are trying to select the .postlist item under this div. It would
1035	+ * be much more adaptable to reference the class by name, but this is
1036	+ * significantly faster. Especially on IE.
1037	+ */
1038	+ // edcal.output('post.id: '+post.id+'\ndayobjId: '+dayobjId);
1039	+ jQuery('#' + dayobjId + ' > div > ul').append(edcal.createPostItem(post, dayobjId));
1040	+ },
1041	+
1042	+ /*
1043	+ Makes all the posts in the specified day draggable
1044	+ and adds the edcal_quickedit.
1045	+ */
1046	+ addPostItemDragAndToolltip: function(/string/ dayobjId) {
1047	+ edcal.draggablePost('#' + dayobjId + ' > div > ul > li');
1048	+ },
1049	+
1050	+
1051	+ /*
1052	+ Deletes the post specified. Will only be executed once the user clicks the confirm link to proceed.
1053	+ */
1054	+ deletePost: function(/Post ID/ postId, /function/ callback) {
1055	+
1056	+ var url = edcal.ajax_url() + '&action=edcal_deletepost&postid=' + postId;
1057	+
1058	+ jQuery.ajax({
1059	+ url: url,
1060	+ type: 'POST',
1061	+ processData: false,
1062	+ timeout: 100000,
1063	+ dataType: 'json',
1064	+ success: function(res) {
1065	+ if (res.post.date_gmt === edcal.NO_DATE) {
1066	+ edcal.removePostItem(res.post.date_gmt, 'post-' + res.post.id);
1067	+ } else {
1068	+ edcal.removePostItem(res.post.date, 'post-' + res.post.id);
1069	+ }
1070	+
1071	+ if (res.error) {
1072	+ /*
1073	+ * If there was an error we need to remove the dropped
1074	+ * post item.
1075	+ */
1076	+ if (res.error === edcal.NONCE_ERROR) {
1077	+ edcal.showError(edcal.checksum_error);
1078	+ }
1079	+ } else {
1080	+ edcal.output('Finished deleting the post: "' + res.post.title + '" with id:' + res.post.id);
1081	+ }
1082	+
1083	+ if (callback) {
1084	+ callback(res);
1085	+ }
1086	+ },
1087	+ error: function(xhr) {
1088	+ edcal.showError(edcal.general_error);
1089	+ if (xhr.responseText) {
1090	+ edcal.output('deletePost xhr.responseText: ' + xhr.responseText);
1091	+ }
1092	+ }
1093	+ });
1094	+ },
1095	+
1096	+
1097	+ /*
1098	+ * Confirms if you want to delete the specified post
1099	+ */
1100	+ confirmDelete: function(/string/ posttitle) {
1101	+ if (confirm(edcal.str_del_msg1 + posttitle + edcal.str_del_msg2)) {
1102	+ return true;
1103	+ // [wes] might be better to call deletePost from here directly, rather than return control back to the agent... which will then follow the link and call deletePost
1104	+ } else {
1105	+ return false;
1106	+ }
1107	+ },
1108	+
1109	+ /*
1110	+ This is a simple function that creates the AJAX URL with the
1111	+ nonce value generated in edcal.php. The ajaxurl variable is
1112	+ defined by WordPress in all of the admin pages.
1113	+ */
1114	+ ajax_url: function() {
1115	+ return ajaxurl + '?_wpnonce=' + edcal.wp_nonce;
1116	+ },
1117	+
1118	+ /*
1119	+ NOT USED
1120	+ */
1121	+ getMediaBar: function() {
1122	+ return jQuery('#cal_mediabar').html();
1123	+ },
1124	+
1125	+ /*
1126	+ * Called when the "Add a post" link is clicked.
1127	+ * Sets up a post object and displays the add form
1128	+ */
1129	+ addPost: function() {
1130	+ jQuery('#newPostScheduleButton').addClass('disabled');
1131	+
1132	+ var date = jQuery(this).parent().parent().attr('id');
1133	+
1134	+ var formattedtime = edcal.defaultTime;
1135	+ if (edcal.timeFormat !== 'H:i' && edcal.timeFormat !== 'G:i') {
1136	+ formattedtime += ' AM';
1137	+ }
1138	+
1139	+ var post = {
1140	+ id: 0,
1141	+ date: date,
1142	+ formatteddate: edcal.getDayFromDayId(date).toString(edcal.previewDateFormat),
1143	+ time: formattedtime
1144	+ };
1145	+ edcal.showForm(post);
1146	+ return false;
1147	+ },
1148	+
1149	+ /*
1150	+ * Called when the "Add a draft" link is clicked.
1151	+ * Sets up a post object and displays the add form
1152	+ */
1153	+ addDraft: function() {
1154	+ jQuery('#newPostScheduleButton').addClass('disabled');
1155	+
1156	+ var post = {
1157	+ id: 0,
1158	+ date: Date.today(),
1159	+ formatteddate: edcal.NO_DATE,
1160	+ time: edcal.NO_DATE,
1161	+ status: 'draft'
1162	+ };
1163	+ edcal.showForm(post);
1164	+ return false;
1165	+ },
1166	+
1167	+ /*
1168	+ * Called when the Edit link for a post is clicked.
1169	+ * Gets post details via an AJAX call and displays the edit form
1170	+ * with the fields populated.
1171	+ */
1172	+ editPost: function(/int/ post_id) {
1173	+ // Un-disable the save buttons because we're editing
1174	+ jQuery('#newPostScheduleButton').removeClass('disabled');
1175	+
1176	+ // Editing, so we need to make an ajax call to get body of post
1177	+ edcal.getPost(post_id, edcal.showForm);
1178	+ return false;
1179	+ },
1180	+
1181	+
1182	+ /*
1183	+ * When the user presses the new post link on each calendar cell they get
1184	+ * a tooltip which prompts them to add or edit a post. Once
1185	+ * they hit save we call this function.
1186	+ *
1187	+ * post - post object containing data for the post
1188	+ * doEdit - should we edit the post immediately? if true we send the user
1189	+ * to the edit screen for their new post.
1190	+ */
1191	+ savePost: function(/object/ post, /boolean/ doEdit, /boolean/ doPublish, /function/ callback) {
1192	+ if (typeof(post) === 'undefined' \|\| post === null) {
1193	+ post = edcal.serializePost();
1194	+ }
1195	+
1196	+ //edcal.output('savePost(' + post.date + ', ' + post.title + ')');
1197	+
1198	+ jQuery('#edit-slug-buttons').addClass('tiploading');
1199	+
1200	+ /*
1201	+ The date.js library has a bug where it gives the wrong
1202	+ 24 hour value for 12AM and 12PM. I've filed a bug report,
1203	+ but we still need to work aorund the issue. Hackito
1204	+ ergo sum.
1205	+ */
1206	+ var postTimeUpper = post.time.toUpperCase();
1207	+ if (postTimeUpper.slice(0, 2) === '12' &&
1208	+ postTimeUpper.slice(postTimeUpper.length - 2, postTimeUpper.length) === 'PM') {
1209	+ post.time = '12:' + postTimeUpper.slice(3, 5);
1210	+ } else if (postTimeUpper.slice(0, 2) === '12' &&
1211	+ postTimeUpper.slice(post.time.length - 2, post.time.length) === 'AM') {
1212	+ post.time = '00:' + postTimeUpper.slice(3, 5);
1213	+ }
1214	+
1215	+ var time;
1216	+ if (post.time !== '') {
1217	+ time = Date.parse(post.time);
1218	+ } else {
1219	+ time = Date.parse(edcal.defaultTime); // If we don't have a time set, default it to 10am
1220	+ }
1221	+
1222	+ var formattedDate;
1223	+
1224	+ if (time !== null && time !== edcal.NO_DATE) {
1225	+ var formattedtime = time.format('H:i:s');
1226	+ formattedDate = encodeURIComponent(edcal.getDayFromDayId(post.date).toString(edcal.wp_dateFormat) + ' ' + formattedtime);
1227	+ } else {
1228	+ formattedDate = encodeURIComponent(post.date.toString(edcal.wp_dateFormat + ' H:i:s'));
1229	+ }
1230	+
1231	+ var url = edcal.ajax_url() + '&action=edcal_savepost';
1232	+ var postData = 'date=' + formattedDate +
1233	+ '&title=' + encodeURIComponent(post.title) +
1234	+ '&content=' + encodeURIComponent(post.content) +
1235	+ '&id=' + encodeURIComponent(post.id) +
1236	+ '&status=' + encodeURIComponent(post.status) +
1237	+ '&orig_status=' + encodeURIComponent(post.orig_status);
1238	+
1239	+ if (time === null \|\| time === edcal.NO_DATE) {
1240	+ postData += '&date_gmt=' + encodeURIComponent('0000-00-00 00:00:00');
1241	+ }
1242	+
1243	+ if (edcal.getUrlVars().post_type) {
1244	+ postData += '&post_type=' + encodeURIComponent(edcal.getUrlVars().post_type);
1245	+ }
1246	+
1247	+ if (doPublish) {
1248	+ postData += '&dopublish=' + encodeURIComponent('future');
1249	+ }
1250	+
1251	+ jQuery.ajax({
1252	+ url: url,
1253	+ type: 'POST',
1254	+ processData: false,
1255	+ data: postData,
1256	+ timeout: 100000,
1257	+ dataType: 'json',
1258	+ success: function(res) {
1259	+ jQuery('#edit-slug-buttons').removeClass('tiploading');
1260	+ jQuery('#edcal_quickedit').hide();
1261	+ jQuery('#edcal_scrollable').data('scrollable').getConf().keyboard = true;
1262	+ if (res.error) {
1263	+ /*
1264	+ * If there was an error we need to remove the dropped
1265	+ * post item.
1266	+ */
1267	+ if (res.error === edcal.NONCE_ERROR) {
1268	+ edcal.showError(edcal.checksum_error);
1269	+ }
1270	+ return false;
1271	+ }
1272	+
1273	+ if (!res.post) {
1274	+ edcal.showError('There was an error creating a new post for your blog.');
1275	+ } else {
1276	+ if (doEdit) {
1277	+ /*
1278	+ * If the user wanted to edit the post then we redirect
1279	+ * them to the edit page.
1280	+ */
1281	+ window.location = res.post.editlink.replace('&', '&');
1282	+ } else {
1283	+
1284	+ var date = res.post.date;
1285	+
1286	+ if (res.post.date_gmt === edcal.NO_DATE) {
1287	+ date = res.post.date_gmt;
1288	+ }
1289	+
1290	+ if (res.post.id) {
1291	+ edcal.removePostItem(date, 'post-' + res.post.id);
1292	+ }
1293	+
1294	+ edcal.addPostItem(res.post, date);
1295	+ edcal.addPostItemDragAndToolltip(date);
1296	+ }
1297	+ }
1298	+
1299	+ if (callback) {
1300	+ callback(res);
1301	+ }
1302	+
1303	+ return true;
1304	+ },
1305	+ error: function(xhr) {
1306	+ jQuery('#edit-slug-buttons').removeClass('tiploading');
1307	+ jQuery('#edcal_quickedit').hide();
1308	+ jQuery('#edcal_scrollable').data('scrollable').getConf().keyboard = true;
1309	+ edcal.showError(edcal.general_error);
1310	+ if (xhr.responseText) {
1311	+ edcal.output('savePost xhr.responseText: ' + xhr.responseText);
1312	+ }
1313	+ }
1314	+ });
1315	+ return false;
1316	+ },
1317	+
1318	+ /*
1319	+ * Collects form values for the post inputted by the user into an object
1320	+ */
1321	+ serializePost: function() {
1322	+ var post = {};
1323	+
1324	+ jQuery('#edcal_quickedit').find('input, textarea, select').each(function() {
1325	+ post[this.name] = this.value;
1326	+ });
1327	+ return post;
1328	+ },
1329	+
1330	+ /*
1331	+ * Accepts new or existing post data and then populates text fields as necessary
1332	+ */
1333	+ showForm: function(post) {
1334	+ edcal.resetForm();
1335	+
1336	+ if (post.formatteddate === edcal.NO_DATE \|\| post.date_gmt === edcal.NO_DATE) {
1337	+ jQuery('#timeEditControls').hide();
1338	+ } else {
1339	+ jQuery('#timeEditControls').show();
1340	+ }
1341	+
1342	+ // show tooltip
1343	+ jQuery('#edcal_quickedit').center().show();
1344	+ jQuery('#edcal_scrollable').data('scrollable').getConf().keyboard = false;
1345	+
1346	+ if (!post.id) {
1347	+ if (post.formatteddate === edcal.NO_DATE) {
1348	+ jQuery('#tooltiptitle').text(edcal.str_newdraft_title);
1349	+ } else {
1350	+ jQuery('#tooltiptitle').text(edcal.str_newpost_title + post.formatteddate);
1351	+ }
1352	+ } else {
1353	+ jQuery('#tooltiptitle').text(sprintf(edcal.str_edit_post_title, post.typeTitle, edcal.getDayFromDayId(post.date).toString(edcal.previewDateFormat)));
1354	+
1355	+ // sets the read-only author field
1356	+ //jQuery('#edcal-author-p').html(post.author);
1357	+
1358	+ // add post info to form
1359	+ jQuery('#edcal-title-new-field').val(post.title);
1360	+ jQuery('#content').val(post.content);
1361	+ }
1362	+
1363	+ if (post.status === 'future') {
1364	+ jQuery('#newPostScheduleButton').text(edcal.str_update);
1365	+ }
1366	+
1367	+ if (post.status) {
1368	+ jQuery('#edcal-status').val(post.status);
1369	+ edcal.updatePublishButton();
1370	+ } else {
1371	+ if (0 !== jQuery('#edcal-status option[value=' + edcal.defaultStatus + ']').length) {
1372	+ /*
1373	+ * We want to use the default status if it exists in the list and we'll
1374	+ * default to the draft status if the default one is in the list.
1375	+ */
1376	+ jQuery('#edcal-status').val(edcal.defaultStatus);
1377	+ } else {
1378	+ jQuery('#edcal-status').val('draft');
1379	+ }
1380	+
1381	+ jQuery('#newPostScheduleButton').text(edcal.str_save);
1382	+ }
1383	+
1384	+ /*
1385	+ If you have a status that isn't draft or future we
1386	+ just make it read only.
1387	+ */
1388	+ if (post.status && post.status !== 'draft' && post.status !== 'future' && post.status !== 'pending') {
1389	+ jQuery('#edcal-status').attr('disabled', 'true');
1390	+ jQuery('#edcal-status').append('<option class="temp" value="' + post.status + '">' + post.status + '</option>');
1391	+ jQuery('#edcal-status').val(post.status);
1392	+ }
1393	+
1394	+
1395	+
1396	+ if (post.formatteddate !== edcal.NO_DATE &&
1397	+ edcal.getDayFromDayId(post.date).compareTo(Date.today()) === -1) {
1398	+ /*
1399	+ * We only allow drafts in the past
1400	+ */
1401	+ jQuery('#edcal-status').attr('disabled', 'true');
1402	+ }
1403	+
1404	+ var time = post.time;
1405	+ jQuery('#edcal-time').val(time);
1406	+
1407	+ // set hidden fields: post.date, post.id
1408	+ jQuery('#edcal-date').val(post.date);
1409	+ jQuery('#edcal-id').val(post.id);
1410	+
1411	+ /*
1412	+ * Put the focus in the post title field when the tooltip opens.
1413	+ */
1414	+
1415	+ jQuery('#edcal-title-new-field').focus();
1416	+ jQuery('#edcal-title-new-field').select();
1417	+ },
1418	+
1419	+ /*
1420	+ * Hides the add/edit form
1421	+ */
1422	+ hideForm: function() {
1423	+ jQuery('#edcal_quickedit').hide();
1424	+ jQuery('#edcal_scrollable').data('scrollable').getConf().keyboard = true;
1425	+ edcal.resetForm();
1426	+ },
1427	+
1428	+ /*
1429	+ * Clears all the input values in the add/edit form
1430	+ */
1431	+ resetForm: function() {
1432	+ jQuery('#edcal_quickedit').find('input, textarea, select').each(function() {
1433	+ this.value = '';
1434	+ });
1435	+
1436	+ jQuery('#edcal-status').removeAttr('disabled');
1437	+
1438	+ jQuery('#newPostScheduleButton').text(edcal.str_publish);
1439	+
1440	+ jQuery('#tooltiptitle').text('');
1441	+ //jQuery('#edcal-author-p').html('');
1442	+
1443	+ jQuery('#edcal-status').removeAttr('disabled');
1444	+
1445	+ jQuery('#edcal-status .temp').remove();
1446	+ },
1447	+
1448	+ /*
1449	+ Creates the HTML for a post item and adds the data for
1450	+ the post to the posts cache.
1451	+ */
1452	+ createPostItem: function(/post/ post, /string/ dayobjId) {
1453	+ if (!edcal.posts[dayobjId]) {
1454	+ edcal.posts[dayobjId] = [];
1455	+ }
1456	+
1457	+ edcal.posts[dayobjId][edcal.posts[dayobjId].length] = post;
1458	+
1459	+ return edcal.getPostItemString(post);
1460	+ },
1461	+
1462	+ /*
1463	+ Finds the post object for the specified post ID in the
1464	+ specified day.
1465	+ */
1466	+ findPostForId: function(/string/ dayobjId, /string/ postId) {
1467	+ if (edcal.posts[dayobjId]) {
1468	+ for (var i = 0; i < edcal.posts[dayobjId].length; i++) {
1469	+ if (edcal.posts[dayobjId][i] &&
1470	+ 'post-' + edcal.posts[dayobjId][i].id === postId) {
1471	+ return edcal.posts[dayobjId][i];
1472	+ }
1473	+ }
1474	+ }
1475	+
1476	+ return null;
1477	+ },
1478	+
1479	+ /*
1480	+ * Removes a post from the HTML and the posts cache.
1481	+ */
1482	+ removePostItem: function(/string/ dayobjId, /string/ postId) {
1483	+ //edcal.output('removePostItem(' + dayobjId + ', ' + postId + ')');
1484	+ if (edcal.findPostForId(dayobjId, postId)) {
1485	+ for (var i = 0; i < edcal.posts[dayobjId].length; i++) {
1486	+ if (edcal.posts[dayobjId][i] && 'post-' + edcal.posts[dayobjId][i].id === postId) {
1487	+ edcal.posts[dayobjId][i] = null;
1488	+ }
1489	+ }
1490	+ }
1491	+
1492	+ jQuery('#' + postId).remove();
1493	+ },
1494	+
1495	+ /*
1496	+ Gets all the post items for the specified day from
1497	+ the post cache.
1498	+ */
1499	+ getPostItems: function(/string/ dayobjId) {
1500	+ var postsString = '';
1501	+
1502	+ if (edcal.posts[dayobjId]) {
1503	+ var posts = edcal.posts[dayobjId];
1504	+ if (posts.length < 50) {
1505	+ /*
1506	+ * If there are fewer than 50 posts then we just load them
1507	+ */
1508	+ for (var i = 0; i < posts.length; i++) {
1509	+ if (posts[i]) {
1510	+ postsString += edcal.getPostItemString(posts[i]);
1511	+ }
1512	+ }
1513	+ } else {
1514	+ /*
1515	+ If there are more than 50 posts then we want to batch
1516	+ the load so it doesn't slow down the browser.
1517	+ */
1518	+ edcal.addPostItems(dayobjId, 0, 50);
1519	+ }
1520	+ }
1521	+
1522	+ return postsString;
1523	+ },
1524	+
1525	+ addPostItems: function(/string/ dayobjId, /int/ index, /int/ length) {
1526	+ var posts = edcal.posts[dayobjId];
1527	+ var postsString = '';
1528	+ setTimeout(function() {
1529	+ for (var i = index; i < index + length && i < posts.length; i++) {
1530	+ if (posts[i]) {
1531	+ postsString += edcal.getPostItemString(posts[i]);
1532	+ }
1533	+ }
1534	+
1535	+ jQuery('#' + dayobjId + ' ul').append(postsString);
1536	+
1537	+ if (index + length < posts.length) {
1538	+ edcal.addPostItems(dayobjId, index + length, 50);
1539	+ }
1540	+ }, 100);
1541	+ },
1542	+
1543	+ /*
1544	+ This function shows the action links for the post with the
1545	+ specified ID.
1546	+ */
1547	+ showActionLinks: function(/string/ postid) {
1548	+ if (edcal.actionTimer) {
1549	+ clearTimeout(edcal.actionTimer);
1550	+ }
1551	+
1552	+ var timeout = 250;
1553	+
1554	+ var post = edcal.findPostForId(jQuery('#' + postid).parent().parent().parent().attr('id'), postid);
1555	+
1556	+ if (edcal.inDrag \|\| !edcal.isPostEditable(post)) {
1557	+ return;
1558	+ }
1559	+
1560	+ var elem = jQuery('#' + postid + ' > div.postactions');
1561	+
1562	+ if (edcal.actionLinksElem && edcal.actionLinksElem.get(0) !== elem.get(0)) {
1563	+ edcal.actionLinksElem.slideUp();
1564	+ }
1565	+
1566	+ edcal.actionLinksElem = elem;
1567	+
1568	+ edcal.actionTimer = setTimeout(function() {
1569	+ elem.slideDown();
1570	+
1571	+
1572	+ if (elem.parent().position().top + elem.parent().height() > elem.parent().parent().height()) {
1573	+ /*
1574	+ This means the action links probably won't be visible and we need to
1575	+ scroll to make sure the users can see it.
1576	+ */
1577	+ var p = jQuery('#' + postid + ' > div.postactions').parent().parent();
1578	+ p.scrollTop(p.scrollTop() + 45);
1579	+ }
1580	+ }, timeout);
1581	+ },
1582	+
1583	+ /*
1584	+ Hides the action links for the post with the specified
1585	+ post ID.
1586	+ */
1587	+ hideActionLinks: function(/string/ postid) {
1588	+ if (edcal.actionTimer) {
1589	+ clearTimeout(edcal.actionTimer);
1590	+ }
1591	+
1592	+ edcal.actionTimer = setTimeout(function() {
1593	+ var elem = jQuery('#' + postid + ' > div.postactions');
1594	+ elem.slideUp();
1595	+ edcal.actionLinksElem = null;
1596	+ }, 1000);
1597	+ },
1598	+
1599	+ /*
1600	+ Returns true if the post is movable and false otherwise.
1601	+ This is based on the post date
1602	+ */
1603	+ isPostMovable: function(/post/ post) {
1604	+ return post.editlink && post.status !== 'publish';
1605	+ },
1606	+
1607	+ /*
1608	+ Returns true if the post is editable and false otherwise.
1609	+ This is based on user permissions
1610	+ */
1611	+ isPostEditable: function(/post/ post) {
1612	+ return post.editlink;
1613	+ },
1614	+
1615	+ /*
1616	+ Returns readonly if the post isn't editable
1617	+ */
1618	+ getPostEditableClass: function(/post/ post) {
1619	+ if (post.editlink) {
1620	+ return '';
1621	+ } else {
1622	+ return 'readonly';
1623	+ }
1624	+ },
1625	+
1626	+ /*
1627	+ * Gets the HTML string for a post.
1628	+ */
1629	+ getPostItemString: function(/post/ post) {
1630	+ var posttitle = post.title;
1631	+
1632	+ if (posttitle === '') {
1633	+ posttitle = '[No Title]';
1634	+ }
1635	+
1636	+ if (edcal.statusPref) {
1637	+ if (post.status === 'draft' &&
1638	+ post.sticky === '1') {
1639	+ /*
1640	+ * Then this post is a sticky draft
1641	+ */
1642	+ posttitle += edcal.str_draft_sticky;
1643	+ } else if (post.status === 'pending' &&
1644	+ post.sticky === '1') {
1645	+ /*
1646	+ * Then this post is a sticky pending post
1647	+ */
1648	+ posttitle += edcal.str_pending_sticky;
1649	+ } else if (post.sticky === '1') {
1650	+ posttitle += edcal.str_sticky;
1651	+ } else if (post.status === 'pending') {
1652	+ posttitle += edcal.str_pending;
1653	+ } else if (post.status === 'draft') {
1654	+ posttitle += edcal.str_draft;
1655	+ } else if (post.status !== 'publish' &&
1656	+ post.status !== 'future' &&
1657	+ post.status !== 'pending') {
1658	+ /*
1659	+ There are some WordPress plugins that let you specify
1660	+ custom post status. In that case we just want to show
1661	+ you the status.
1662	+ */
1663	+ posttitle += ' [' + post.status + ']';
1664	+ }
1665	+ }
1666	+
1667	+ if (edcal.timePref) {
1668	+ posttitle = '<span class="posttime">' + post.formattedtime + '</span> ' + posttitle;
1669	+ }
1670	+
1671	+ if (edcal.authorPref) {
1672	+ posttitle = sprintf(edcal.str_by, posttitle, '<span class="postauthor">' + post.author + '</span>');
1673	+ }
1674	+
1675	+
1676	+ var classString = '';
1677	+
1678	+ if (edcal.isPostMovable(post)) {
1679	+ return '<li onmouseover="edcal.showActionLinks(\'post-' + post.id + '\');" ' +
1680	+ 'onmouseout="edcal.hideActionLinks(\'post-' + post.id + '\');" ' +
1681	+ 'id="post-' + post.id + '" class="post ' + post.status + ' ' + edcal.getPostEditableClass(post) + post.slugs + '"><div class="postlink ' + classString + '">' +
1682	+ '<span>' + posttitle + '</span>' +
1683	+ '</div>' +
1684	+ '<div class="postactions">' +
1685	+ '<a href="' + post.editlink + '">' + edcal.str_edit + '</a> \| ' +
1686	+ '<a href="#" onclick="edcal.editPost(' + post.id + '); return false;">' + edcal.str_quick_edit + '</a> \| ' +
1687	+ '<a href="' + post.dellink + '" onclick="return edcal.confirmDelete(\'' + post.title + '\');">' + edcal.str_del + '</a> \| ' +
1688	+ '<a href="' + post.permalink + '"' +
1689	+ // ' onclick="edcal.getPost('+post.id+',function(r){ edcal.output(r) }); return false;"' + // for debugging
1690	+ '>' + edcal.str_view + '</a>' +
1691	+ '</div></li>';
1692	+ } else {
1693	+ return '<li onmouseover="edcal.showActionLinks(\'post-' + post.id + '\');" ' +
1694	+ 'onmouseout="edcal.hideActionLinks(\'post-' + post.id + '\');" ' +
1695	+ 'id="post-' + post.id + '" class="post ' + post.status + ' ' + edcal.getPostEditableClass(post) + '"><div class="postlink ' + classString + '">' +
1696	+ '<span>' + posttitle + '</span>' +
1697	+ '</div>' +
1698	+ '<div class="postactions">' +
1699	+ '<a href="' + post.editlink + '">' + edcal.str_republish + '</a> \| ' +
1700	+ '<a href="' + post.permalink + '">' + edcal.str_view + '</a>' +
1701	+ '</div></li>';
1702	+ }
1703	+ },
1704	+
1705	+ /*
1706	+ Finds the calendar cell for the current day and adds the
1707	+ class "today" to that cell.
1708	+ */
1709	+ setClassforToday: function() {
1710	+ /*
1711	+ We want to set a class for the cell that represents the current day so we can
1712	+ give it a background color.
1713	+ */
1714	+ jQuery('#' + Date.today().toString(edcal.internalDateFormat)).addClass('today');
1715	+ },
1716	+
1717	+ /*
1718	+ Most browsers need us to set a calendar height in pixels instead
1719	+ of percent. This function get the correct pixel height for the
1720	+ calendar based on the window height.
1721	+ */
1722	+ getCalHeight: function() {
1723	+ var myHeight = jQuery(window).height() - jQuery('#footer').height() - jQuery('#wphead').height() - 150;
1724	+
1725	+ /*
1726	+ We don't want to make the calendar too short even if the
1727	+ user's screen is super short.
1728	+ */
1729	+ return Math.max(myHeight, 500);
1730	+ },
1731	+
1732	+ /*
1733	+ Moves the calendar a certain number of steps in the specified direction.
1734	+ True moves the calendar down into the future and false moves the calendar
1735	+ up into the past.
1736	+ */
1737	+ move: function(/int/ steps, /boolean/ direction, /function/ callback) {
1738	+ /*
1739	+ * If the add/edit post form is visible, don't go anywhere.
1740	+ */
1741	+ if (jQuery('#edcal_quickedit').is(':visible')) {
1742	+ return;
1743	+ }
1744	+
1745	+ /*
1746	+ The working date is a marker for the last calendar row we created.
1747	+ If we are moving forward that will be the last row, if we are moving
1748	+ backward it will be the first row. If we switch direction we need
1749	+ to bump up our date by 11 rows times 7 days a week or 77 days.
1750	+ */
1751	+ if (edcal.currentDirection !== direction) {
1752	+ if (direction) { // into the future
1753	+ edcal._wDate = edcal._wDate.add((edcal.weeksPref + 7) * 7).days();
1754	+ } else { // into the past
1755	+ edcal._wDate = edcal._wDate.add(-((edcal.weeksPref + 7) * 7)).days();
1756	+ }
1757	+
1758	+ edcal.steps = 0;
1759	+ edcal.moveDate = edcal._wDate;
1760	+ }
1761	+
1762	+ edcal.currentDirection = direction;
1763	+
1764	+ var i;
1765	+
1766	+
1767	+ if (direction) {
1768	+ for (i = 0; i < steps; i++) {
1769	+ jQuery('#cal > div:first').remove();
1770	+ edcal.createRow(jQuery('#cal'), true);
1771	+ edcal._wDate.add(7).days();
1772	+ }
1773	+ edcal.alignCal();
1774	+ } else {
1775	+ for (i = 0; i < steps; i++) {
1776	+ jQuery('#cal > div:last').remove();
1777	+ edcal.createRow(jQuery('#cal'), false);
1778	+ edcal._wDate.add(-7).days();
1779	+ }
1780	+ edcal.alignCal();
1781	+ }
1782	+
1783	+ edcal.setClassforToday();
1784	+ edcal.setDateLabel();
1785	+
1786	+ /*
1787	+ * If the user clicks quickly or uses the mouse wheel they can
1788	+ * get a lot of move events very quickly and we need to batch
1789	+ * them up together. We set a timeout and clear it if there is
1790	+ * another move before the timeout happens.
1791	+ */
1792	+ edcal.steps += steps;
1793	+ if (edcal.tID) {
1794	+ clearTimeout(edcal.tID);
1795	+ } else {
1796	+ edcal.moveDate = edcal._wDate;
1797	+ }
1798	+
1799	+ edcal.tID = setTimeout(function() {
1800	+
1801	+ /*
1802	+ * Now that we are done moving the calendar we need to get the posts for the
1803	+ * new dates. We want to load the posts between the place the calendar was
1804	+ * at when the user started moving it and the place the calendar is at now.
1805	+ */
1806	+ if (!direction) {
1807	+ edcal.getPosts(edcal._wDate.clone(),
1808	+ edcal._wDate.clone().add(7 * (edcal.steps + 1)).days(),
1809	+ callback);
1810	+ } else {
1811	+ edcal.getPosts(edcal._wDate.clone().add(-7 * (edcal.steps + 1)).days(),
1812	+ edcal._wDate.clone(),
1813	+ callback);
1814	+ }
1815	+
1816	+ edcal.steps = 0;
1817	+ edcal.tID = null;
1818	+ edcal.moveDate = edcal._wDate;
1819	+ }, 1000);
1820	+
1821	+ if (direction) {
1822	+ /*
1823	+ If we are going into the future then wDate is way in the
1824	+ future so we need to get the current date which is four weeks
1825	+ plus the number of visible weeks before the end of the current _wDate.
1826	+ */
1827	+ jQuery.cookie('edcal_date', edcal._wDate.clone().add(-(edcal.weeksPref + 4)).weeks().toString('yyyy-dd-MM'));
1828	+ } else {
1829	+ /*
1830	+ If we are going into the past then the current date is two
1831	+ weeks after the current _wDate
1832	+ */
1833	+ jQuery.cookie('edcal_date', edcal._wDate.clone().add(3).weeks().toString('yyyy-dd-MM'));
1834	+ }
1835	+ },
1836	+
1837	+ /*
1838	+ We use the date as the ID for day elements, but the Date
1839	+ library can't parse the date without spaces and using
1840	+ spaces in IDs can cause problems. We work around the
1841	+ issue by adding the spaces back before we parse.
1842	+ */
1843	+ getDayFromDayId: function(/dayId/ day) {
1844	+ return Date.parseExact(day.substring(2, 4) + '/' + day.substring(0, 2) + '/' + day.substring(4), 'MM/dd/yyyy');
1845	+ },
1846	+
1847	+ /*
1848	+ This is a helper method to set the date label on the top of
1849	+ the calendar. It looks like November 2009-December2009
1850	+ */
1851	+ setDateLabel: function(year) {
1852	+ var api = jQuery('#edcal_scrollable').scrollable();
1853	+ var items = api.getVisibleItems();
1854	+
1855	+ /*
1856	+ We need to get the first day in the first week and the
1857	+ last day in the last week. We call children twice to
1858	+ work around a small JQuery issue.
1859	+ */
1860	+ var firstDate = edcal.getDayFromDayId(items.eq(0).children('.edcal_row').children('.day:first').attr('id'));
1861	+ var lastDate = edcal.getDayFromDayId(items.eq(edcal.weeksPref - 1).children('.edcal_row').children('.day:last').attr('id'));
1862	+
1863	+ jQuery('#currentRange').text(edcal.chineseAposWorkaround(firstDate.toString(Date.CultureInfo.formatPatterns.yearMonth)) + ' - ' +
1864	+ edcal.chineseAposWorkaround(lastDate.toString(Date.CultureInfo.formatPatterns.yearMonth)));
1865	+ },
1866	+
1867	+ /*
1868	+ * We want the calendar to start on the day of the week that matches the country
1869	+ * code in the locale. If their full locale is en-US, that means the country
1870	+ * code is US.
1871	+ *
1872	+ * This is the full list of start of the week days from unicode.org
1873	+ * http://unicode.org/repos/cldr/trunk/common/supplemental/supplementalData.xml
1874	+ */
1875	+ /* jshint maxcomplexity: 80 */
1876	+ nextStartOfWeek: function(/date/ date) {
1877	+ date = date.clone();
1878	+ if (edcal.startOfWeek === null) {
1879	+ if (edcal.locale) {
1880	+ var local = edcal.locale.toUpperCase();
1881	+
1882	+ if (edcal.endsWith(local, 'AS') \|\|
1883	+ edcal.endsWith(local, 'AZ') \|\|
1884	+ edcal.endsWith(local, 'BW') \|\|
1885	+ edcal.endsWith(local, 'CA') \|\|
1886	+ edcal.endsWith(local, 'CN') \|\|
1887	+ edcal.endsWith(local, 'FO') \|\|
1888	+ edcal.endsWith(local, 'GB') \|\|
1889	+ edcal.endsWith(local, 'GE') \|\|
1890	+ edcal.endsWith(local, 'GL') \|\|
1891	+ edcal.endsWith(local, 'GU') \|\|
1892	+ edcal.endsWith(local, 'HK') \|\|
1893	+ edcal.endsWith(local, 'IE') \|\|
1894	+ edcal.endsWith(local, 'IL') \|\|
1895	+ edcal.endsWith(local, 'IN') \|\|
1896	+ edcal.endsWith(local, 'IS') \|\|
1897	+ edcal.endsWith(local, 'JM') \|\|
1898	+ edcal.endsWith(local, 'JP') \|\|
1899	+ edcal.endsWith(local, 'KG') \|\|
1900	+ edcal.endsWith(local, 'KR') \|\|
1901	+ edcal.endsWith(local, 'LA') \|\|
1902	+ edcal.endsWith(local, 'MH') \|\|
1903	+ edcal.endsWith(local, 'MN') \|\|
1904	+ edcal.endsWith(local, 'MO') \|\|
1905	+ edcal.endsWith(local, 'MP') \|\|
1906	+ edcal.endsWith(local, 'MT') \|\|
1907	+ edcal.endsWith(local, 'NZ') \|\|
1908	+ edcal.endsWith(local, 'PH') \|\|
1909	+ edcal.endsWith(local, 'PK') \|\|
1910	+ edcal.endsWith(local, 'SG') \|\|
1911	+ edcal.endsWith(local, 'SY') \|\|
1912	+ edcal.endsWith(local, 'TH') \|\|
1913	+ edcal.endsWith(local, 'TT') \|\|
1914	+ edcal.endsWith(local, 'TW') \|\|
1915	+ edcal.endsWith(local, 'UM') \|\|
1916	+ edcal.endsWith(local, 'US') \|\|
1917	+ edcal.endsWith(local, 'UZ') \|\|
1918	+ edcal.endsWith(local, 'VI') \|\|
1919	+ edcal.endsWith(local, 'ZW')) {
1920	+
1921	+ /*
1922	+ * Sunday
1923	+ */
1924	+ edcal.startOfWeek = 0;
1925	+ } else if (edcal.endsWith(local, 'MV')) {
1926	+ /*
1927	+ * Friday
1928	+ */
1929	+ edcal.startOfWeek = 5;
1930	+ } else if (edcal.endsWith(local, 'AF') \|\|
1931	+ edcal.endsWith(local, 'BH') \|\|
1932	+ edcal.endsWith(local, 'DJ') \|\|
1933	+ edcal.endsWith(local, 'DZ') \|\|
1934	+ edcal.endsWith(local, 'EG') \|\|
1935	+ edcal.endsWith(local, 'ER') \|\|
1936	+ edcal.endsWith(local, 'ET') \|\|
1937	+ edcal.endsWith(local, 'IQ') \|\|
1938	+ edcal.endsWith(local, 'IR') \|\|
1939	+ edcal.endsWith(local, 'JO') \|\|
1940	+ edcal.endsWith(local, 'KE') \|\|
1941	+ edcal.endsWith(local, 'KW') \|\|
1942	+ edcal.endsWith(local, 'LY') \|\|
1943	+ edcal.endsWith(local, 'MA') \|\|
1944	+ edcal.endsWith(local, 'OM') \|\|
1945	+ edcal.endsWith(local, 'QA') \|\|
1946	+ edcal.endsWith(local, 'SA') \|\|
1947	+ edcal.endsWith(local, 'SD') \|\|
1948	+ edcal.endsWith(local, 'SO') \|\|
1949	+ edcal.endsWith(local, 'TN') \|\|
1950	+ edcal.endsWith(local, 'YE')) {
1951	+ /*
1952	+ * Sunday
1953	+ */
1954	+ edcal.startOfWeek = 6;
1955	+ } else {
1956	+ /*
1957	+ * Monday
1958	+ */
1959	+ edcal.startOfWeek = 1;
1960	+ }
1961	+ } else {
1962	+ /*
1963	+ * If we have no locale set we'll assume American style and
1964	+ * make it Sunday.
1965	+ */
1966	+ edcal.startOfWeek = 0;
1967	+ }
1968	+ }
1969	+
1970	+ return date.next().sunday().add(edcal.startOfWeek).days();
1971	+ },
1972	+
1973	+ /* jshint maxcomplexity: 14 */
1974	+
1975	+ /*
1976	+ * Just a little helper function to tell if a given string (str)
1977	+ * ends with the given expression (expr). I could adding this
1978	+ * function to the JavaScript string object, but I don't want to
1979	+ * risk conflicts with other plugins.
1980	+ */
1981	+ endsWith: function(/string/ str, /string/ expr) {
1982	+ return (str.match(expr + '$') === expr);
1983	+ },
1984	+
1985	+ /*
1986	+ * Moves the calendar to the specified date.
1987	+ */
1988	+ moveTo: function(/Date/ date) {
1989	+ edcal.isMoving = true;
1990	+ jQuery('#cal').empty();
1991	+
1992	+ jQuery.cookie('edcal_date', date.toString('yyyy-dd-MM'));
1993	+
1994	+ /*
1995	+ When we first start up our working date is 4 weeks before
1996	+ the next Sunday.
1997	+ */
1998	+ edcal._wDate = edcal.nextStartOfWeek(date).add(-21).days();
1999	+
2000	+ /*
2001	+ After we remove and redo all the rows we are back to
2002	+ moving in a going down direction.
2003	+ */
2004	+
2005	+ edcal.currentDirection = true;
2006	+
2007	+ var count = edcal.weeksPref + 6;
2008	+
2009	+ for (var i = 0; i < count; i++) {
2010	+ edcal.createRow(jQuery('#cal'), true);
2011	+ edcal._wDate.add(7).days();
2012	+ }
2013	+
2014	+ edcal.alignCal();
2015	+
2016	+ var api = jQuery('#edcal_scrollable').scrollable();
2017	+
2018	+ api.move(2);
2019	+
2020	+ edcal.setDateLabel();
2021	+ edcal.setClassforToday();
2022	+ edcal.isMoving = false;
2023	+ },
2024	+
2025	+ /*
2026	+ When we handle dragging posts we need to know the size
2027	+ of the calendar so we figure it out ahead of time and
2028	+ save it.
2029	+ */
2030	+ savePosition: function() {
2031	+ var cal = jQuery('#edcal_scrollable');
2032	+ var cal_cont = jQuery('#cal_cont');
2033	+ edcal.position = {
2034	+ top: cal.offset().top,
2035	+ bottom: cal.offset().top + cal.height()
2036	+ };
2037	+
2038	+ /*
2039	+ When the user drags a post they get a "helper" element that clones
2040	+ the post and displays it during the drag. This means they get all
2041	+ the same classes and styles. However, the width of a post is based
2042	+ on the width of a day in the calendar and not anything in a style.
2043	+ That works well for the posts in the calendar, but it means we need
2044	+ to dynamically determine the width of the post when dragging.
2045	+
2046	+ This value will remain the same until the calendar resizes. That is
2047	+ why we do it here. We need to get the width of the first visible day
2048	+ in the calendar which is why we use the complicated selector. We also
2049	+ need to generate a style for it since the drag element doesn't exist
2050	+ yet and using the live function would really slow down the drag operation.
2051	+
2052	+ We base this on the width of a way since they might not have any posts
2053	+ yet.
2054	+ */
2055	+ jQuery('#edcal_poststyle').remove();
2056	+
2057	+ /*
2058	+ We need to figure out the height of each post list. They all have the same
2059	+ height so we just look at the first visible list and set some styles on the
2060	+ page to set the post list height based on that. We reset the value every
2061	+ time the page refreshes.
2062	+ */
2063	+ var dayHeight = jQuery('.rowcont:eq(2) .dayobj:first').height() - jQuery('.rowcont:eq(2) .daylabel:first').height() - 6;
2064	+ jQuery('head').append('<style id="edcal_poststyle" type="text/css">.ui-draggable-dragging {' +
2065	+ 'width: ' + (jQuery('.rowcont:eq(2) .day:first').width() - 5) + 'px;' +
2066	+ '}' +
2067	+ '.postlist {' +
2068	+ 'height: ' + dayHeight + 'px;' +
2069	+ '}' +
2070	+ '</style>');
2071	+
2072	+
2073	+ jQuery('#draftsdrawer').css('height', cal_cont.height());
2074	+ jQuery('#draftsdrawer .day').css('min-height', (cal_cont.height() - 10) - jQuery('#draftsdrawer .draftsdrawerheadcont').height());
2075	+ },
2076	+
2077	+ /*
2078	+ * Adds the feedback section
2079	+ */
2080	+ addFeedbackSection: function() {
2081	+ if (edcal.visitCount > 3 && edcal.doFeedbackPref) {
2082	+ jQuery('#edcal_main_title').after(edcal.str_feedbackmsg);
2083	+ }
2084	+ },
2085	+
2086	+ /*
2087	+ * Does the data collection. This uses Mint to collect data about the way
2088	+ * the calendar is being used.
2089	+ */
2090	+ doFeedback: function() {
2091	+ jQuery.getScript('http://www.zackgrossbart.com/edcal/mint/?js', function() {
2092	+ edcal.saveFeedbackPref();
2093	+ });
2094	+ },
2095	+
2096	+ /*
2097	+ * Sends no feedback and hides the section
2098	+ */
2099	+ noFeedback: function() {
2100	+ jQuery('#feedbacksection').hide('fast');
2101	+ edcal.saveFeedbackPref();
2102	+ },
2103	+
2104	+ /*
2105	+ * Saves the feedback preference to the server
2106	+ */
2107	+ saveFeedbackPref: function() {
2108	+ var url = edcal.ajax_url() + '&action=edcal_saveoptions&dofeedback=' + encodeURIComponent('done');
2109	+
2110	+ jQuery.ajax({
2111	+ url: url,
2112	+ type: 'POST',
2113	+ processData: false,
2114	+ timeout: 100000,
2115	+ dataType: 'text',
2116	+ success: function(res) {
2117	+ jQuery('#feedbacksection').html(edcal.str_feedbackdone);
2118	+ setTimeout(function() {
2119	+ jQuery('#feedbacksection').hide('slow');
2120	+ }, 5000);
2121	+ },
2122	+ error: function(xhr) {
2123	+ edcal.showError(edcal.general_error);
2124	+ if (xhr.responseText) {
2125	+ edcal.output('saveOptions xhr.responseText: ' + xhr.responseText);
2126	+ }
2127	+ }
2128	+ });
2129	+
2130	+ },
2131	+
2132	+ /*
2133	+ This function updates the text of te publish button in the quick
2134	+ edit dialog to match the current operation.
2135	+ */
2136	+ updatePublishButton: function() {
2137	+ if (jQuery('#edcal-status').val() === 'future') {
2138	+ jQuery('#newPostScheduleButton').text(edcal.str_publish);
2139	+ } if (jQuery('#edcal-status').val() === 'pending') {
2140	+ jQuery('#newPostScheduleButton').text(edcal.str_review);
2141	+ } else {
2142	+ jQuery('#newPostScheduleButton').text(edcal.str_save);
2143	+ }
2144	+ },
2145	+
2146	+ /*
2147	+ This function makes an AJAX call and changes the date of
2148	+ the specified post on the server.
2149	+ */
2150	+ changeDate: function(/string/ newdate, /Post/ post, /function/ callback) {
2151	+ //edcal.output('changeDate(' + newdate + ', ' + post + ')');
2152	+ var move_to_drawer = newdate === edcal.NO_DATE;
2153	+ var move_from_drawer = post.date_gmt === edcal.NO_DATE;
2154	+ var newdateFormatted = move_to_drawer ? '0000-00-00' : edcal.getDayFromDayId(newdate).toString(edcal.wp_dateFormat);
2155	+ // edcal.output('newdate='+newdate+'\nnewdateFormatted='+newdateFormatted);
2156	+
2157	+ var olddate = move_from_drawer ? post.date_gmt : edcal.getDayFromDayId(post.date).toString(edcal.wp_dateFormat);
2158	+
2159	+
2160	+ if (move_to_drawer) {
2161	+ /*
2162	+ * If the post is going into the drafts drawer then it must be a draft
2163	+ */
2164	+ post.status = 'draft';
2165	+ }
2166	+
2167	+ var url = edcal.ajax_url() + '&action=edcal_changedate&postid=' + post.id +
2168	+ '&postStatus=' + post.status +
2169	+ '&newdate=' + newdateFormatted + '&olddate=' + olddate;
2170	+
2171	+ jQuery('#post-' + post.id).addClass('loadingclass');
2172	+
2173	+ jQuery.ajax({
2174	+ url: url,
2175	+ type: 'POST',
2176	+ processData: false,
2177	+ timeout: 100000,
2178	+ // dataType: 'text',
2179	+ dataType: 'json',
2180	+ success: function(res) {
2181	+ //edcal.output('res.post.date='+res.post.date);
2182	+ //edcal.output(res.post);
2183	+ // console.log(res.post);
2184	+ if (res.error) {
2185	+ /*
2186	+ * If there was an error we need to remove the dropped
2187	+ * post item.
2188	+ */
2189	+ edcal.removePostItem(newdate, 'post-' + res.post.id);
2190	+ if (res.error === edcal.CONCURRENCY_ERROR) {
2191	+ edcal.displayMessage(edcal.concurrency_error + '<br />' + res.post.title);
2192	+ } else if (res.error === edcal.PERMISSION_ERROR) {
2193	+ edcal.displayMessage(edcal.permission_error);
2194	+ } else if (res.error === edcal.NONCE_ERROR) {
2195	+ edcal.displayMessage(edcal.checksum_error);
2196	+ }
2197	+ }
2198	+
2199	+ // edcal.output(res.post.date);
2200	+ // var container = newdateFormatted == '0000-00-00' ?
2201	+
2202	+ var removecont = move_to_drawer ? '00000000' : res.post.date;
2203	+ var addcont = move_from_drawer ? newdate : removecont;
2204	+
2205	+ edcal.removePostItem(removecont, 'post-' + res.post.id);
2206	+ // edcal.output('remove post from: '+removecont+', add post to: '+addcont);
2207	+ edcal.addPostItem(res.post, addcont);
2208	+ edcal.addPostItemDragAndToolltip(addcont);
2209	+
2210	+ if (callback) {
2211	+ callback(res);
2212	+ }
2213	+ },
2214	+ error: function(xhr, textStatus, error) {
2215	+ edcal.showError(edcal.general_error);
2216	+
2217	+ edcal.output('textStatus: ' + textStatus);
2218	+ edcal.output('error: ' + error);
2219	+ if (xhr.responseText) {
2220	+ edcal.output('changeDate xhr.responseText: ' + xhr.responseText);
2221	+ }
2222	+ }
2223	+ });
2224	+
2225	+ },
2226	+
2227	+ /*
2228	+ Makes an AJAX call to get the posts from the server within the
2229	+ specified dates.
2230	+ */
2231	+ getPosts: function(/Date/ from, /Date/ to, /function/ callback) {
2232	+ if (!to) {
2233	+ to = '';
2234	+ }
2235	+
2236	+ var shouldGet = edcal.cacheDates[from];
2237	+
2238	+ if (shouldGet) {
2239	+ /*
2240	+ * TODO: We don't want to make extra AJAX calls for dates
2241	+ * that we have already covered. This is cutting down on
2242	+ * it somewhat, but we could get much better about this.
2243	+ */
2244	+ // edcal.output('Using cached results for posts from ' + from.toString('dd-MMM-yyyy') + ' to ' + to.toString('dd-MMM-yyyy'));
2245	+
2246	+ if (callback) {
2247	+ callback();
2248	+ }
2249	+ return;
2250	+ }
2251	+
2252	+ edcal.cacheDates[from] = true;
2253	+
2254	+ var url = edcal.ajax_url() + '&action=edcal_posts&from=' + from.toString('yyyy-MM-dd') + '&to=' + to.toString('yyyy-MM-dd');
2255	+
2256	+ if (edcal.getUrlVars().post_type) {
2257	+ url += '&post_type=' + encodeURIComponent(edcal.getUrlVars().post_type);
2258	+ }
2259	+
2260	+ jQuery('#loading').show();
2261	+
2262	+ jQuery.ajax({
2263	+ url: url,
2264	+ type: 'GET',
2265	+ processData: false,
2266	+ timeout: 100000,
2267	+ dataType: 'text',
2268	+ success: function(res) {
2269	+ // edcal.output(res);
2270	+ jQuery('#loading').hide();
2271	+ /*
2272	+ * These result here can get pretty large on a busy blog and
2273	+ * the JSON parser from JSON.org works faster than the native
2274	+ * one used by JQuery.
2275	+ */
2276	+ var parsedRes = null;
2277	+
2278	+ try {
2279	+ parsedRes = JSON.parseIt(res);
2280	+ } catch (e) {
2281	+ edcal.showFatalError(edcal.str_fatal_parse_error + e.message);
2282	+ if (window.console) {
2283	+ console.error(e);
2284	+ }
2285	+ return;
2286	+ }
2287	+
2288	+ if (parsedRes.error) {
2289	+ /*
2290	+ * If there was an error we need to remove the dropped
2291	+ * post item.
2292	+ */
2293	+ if (parsedRes.error === edcal.NONCE_ERROR) {
2294	+ edcal.showError(edcal.checksum_error);
2295	+ }
2296	+ return;
2297	+ }
2298	+ var postDates = [];
2299	+
2300	+ /*
2301	+ We get the posts back with the most recent post first. That
2302	+ is what most blogs want. However, we want them in the other
2303	+ order so we can show the earliest post in a given day first.
2304	+ */
2305	+ for (var i = parsedRes.length; i >= 0; i--) {
2306	+ var post = parsedRes[i];
2307	+ if (post) {
2308	+ if (post.status === 'trash') {
2309	+ continue;
2310	+ }
2311	+
2312	+ /*
2313	+ * In some non-English locales the date comes back as all lower case.
2314	+ * This is a problem since we use the date as the ID so we replace
2315	+ * the first letter of the month name with the same letter in upper
2316	+ * case to make sure we don't get into trouble.
2317	+ */
2318	+ post.date = post.date.replace(post.date.substring(2, 3), post.date.substring(2, 3).toUpperCase());
2319	+ if (from === '00000000') {
2320	+ post.date = from;
2321	+ }
2322	+
2323	+ // edcal.output(post.date + ', post-' + post.id);
2324	+ edcal.removePostItem(post.date, 'post-' + post.id);
2325	+ edcal.addPostItem(post, post.date);
2326	+ // edcal.output(post.id + ', ' + post.date);
2327	+ postDates[postDates.length] = post.date;
2328	+ }
2329	+ }
2330	+
2331	+ /*
2332	+ * If the blog has a very larger number of posts then adding
2333	+ * them all can make the UI a little slow. Particularly IE
2334	+ * pops up a warning giving the user a chance to abort the
2335	+ * script. Adding tooltips and making the items draggable is
2336	+ * a lot of what makes things slow. Delaying those two operations
2337	+ * makes the UI show up much faster and the user has to wait
2338	+ * three seconds before they can drag. It also makes IE
2339	+ * stop complaining.
2340	+ */
2341	+ setTimeout(function() {
2342	+ // edcal.output('Finished adding draggable support to ' + postDates.length + ' posts.');
2343	+ jQuery.each(postDates, function(i, postDate) {
2344	+ edcal.addPostItemDragAndToolltip(postDate);
2345	+ });
2346	+ }, 300);
2347	+
2348	+ if (callback) {
2349	+ callback(res);
2350	+ }
2351	+
2352	+ },
2353	+ error: function(xhr) {
2354	+ edcal.showError(edcal.general_error);
2355	+ if (xhr.responseText) {
2356	+ edcal.output('getPosts xhr.responseText: ' + xhr.responseText);
2357	+ }
2358	+ }
2359	+ });
2360	+ },
2361	+
2362	+ /*
2363	+ * Retreives a single post item based on the id
2364	+ * Can optionally pass a callback function that is triggered
2365	+ * when the call successfully completes. The post object is passed
2366	+ * as a parameter for the callback.
2367	+ */
2368	+ getPost: function(/int/ postid, /function/ callback) {
2369	+
2370	+ if (postid === 0) {
2371	+ return false;
2372	+ }
2373	+
2374	+ // show loading
2375	+ jQuery('#loading').show();
2376	+
2377	+ var url = edcal.ajax_url() + '&action=edcal_getpost&postid=' + postid;
2378	+
2379	+ if (edcal.getUrlVars().post_type) {
2380	+ url += '&post_type=' + encodeURIComponent(edcal.getUrlVars().post_type);
2381	+ }
2382	+
2383	+ jQuery.ajax({
2384	+ url: url,
2385	+ type: 'GET',
2386	+ processData: false,
2387	+ timeout: 100000,
2388	+ dataType: 'json',
2389	+ success: function(res) {
2390	+ // hide loading
2391	+ jQuery('#loading').hide();
2392	+
2393	+ edcal.output('xhr for getPost returned: ' + res);
2394	+ if (res.error) {
2395	+ if (res.error === edcal.NONCE_ERROR) {
2396	+ edcal.showError(edcal.checksum_error);
2397	+ }
2398	+ return false;
2399	+ }
2400	+ if (typeof callback === 'function') {
2401	+ callback(res.post);
2402	+ }
2403	+ return res.post;
2404	+ },
2405	+ error: function(xhr) {
2406	+ // hide loading
2407	+ jQuery('#loading').hide();
2408	+
2409	+ edcal.showError(edcal.general_error);
2410	+ if (xhr.responseText) {
2411	+ edcal.output('getPost xhr.responseText: ' + xhr.responseText);
2412	+ }
2413	+ return false;
2414	+ }
2415	+ });
2416	+
2417	+ return true;
2418	+ },
2419	+
2420	+ /*
2421	+ This function adds the screen options tab to the top of the screen. I wish
2422	+ WordPress had a hook so I could provide this in PHP, but as of version 2.9.1
2423	+ they just have an internal loop for their own screen options tabs so we're
2424	+ doing this in JavaScript.
2425	+ */
2426	+ addOptionsSection: function() {
2427	+ var html =
2428	+ '<div class="hide-if-no-js screen-meta-toggle" id="screen-options-link-wrap">' +
2429	+ '<a class="show-settings" ' +
2430	+ 'id="show-edcal-settings-link" ' +
2431	+ 'onclick="edcal.toggleOptions(); return false;" ' +
2432	+ 'href="#" ' +
2433	+ '>' +
2434	+ edcal.str_screenoptions +
2435	+ '</a>' +
2436	+ '</div>';
2437	+
2438	+ if (jQuery('#screen-meta-links').length === 0) {
2439	+ /*
2440	+ * Wordpress 3.3 stopped adding the screen meta section to all the admin pages
2441	+ */
2442	+ jQuery('#screen-meta').after('<div id="screen-meta-links"></div>');
2443	+ }
2444	+
2445	+ jQuery('#screen-meta-links').append(html);
2446	+ },
2447	+
2448	+ /*
2449	+ Respond to clicks on the Screen Options tab by sliding it down when it
2450	+ is up and sliding it up when it is down.
2451	+ */
2452	+ toggleOptions: function() {
2453	+ if (!edcal.helpMeta) {
2454	+ /*
2455	+ Show the screen options section. We start by saving off the old HTML
2456	+ */
2457	+ edcal.helpMeta = jQuery('#contextual-help-wrap').html();
2458	+
2459	+ /*
2460	+ * Set up the visible fields option
2461	+ */
2462	+ var optionsHtml = '<div class="metabox-prefs calendar-fields-prefs">' +
2463	+ '<h5>' + edcal.str_show_opts + '</h5>' +
2464	+ '<label for="author-hide">' +
2465	+ '<input type="checkbox" ' + edcal.isPrefChecked(edcal.authorPref) + 'value="true" id="author-hide" ' +
2466	+ 'name="author-hide" class="hide-column-tog" />' + edcal.str_opt_author +
2467	+ '</label>' +
2468	+ '<label for="status-hide">' +
2469	+ '<input type="checkbox" ' + edcal.isPrefChecked(edcal.statusPref) + 'value="true" id="status-hide" ' +
2470	+ 'name="status-hide" class="hide-column-tog" />' + edcal.str_opt_status +
2471	+ '</label>' +
2472	+ '<label for="time-hide">' +
2473	+ '<input type="checkbox" ' + edcal.isPrefChecked(edcal.timePref) + 'value="true" id="time-hide" ' +
2474	+ 'name="time-hide" class="hide-column-tog" />' + edcal.str_opt_time +
2475	+ '</label>' +
2476	+ '</div>' +
2477	+ '<div class="metabox-prefs calendar-fields-prefs">' +
2478	+ '<h5>' + edcal.str_show_wheel_opts + '</h5>' +
2479	+ '<label for="wheel-support">' +
2480	+ '<input type="checkbox" ' + edcal.isPrefChecked(edcal.wheelScrollPref) + 'value="true" id="wheel-support" ' +
2481	+ 'name="wheel-support" class="hide-column-tog" />' + edcal.str_opt_wheel +
2482	+ '</label>' +
2483	+ '</div>';
2484	+
2485	+ /*
2486	+ * Set up the number of posts option
2487	+ */
2488	+ optionsHtml += '<div class="metabox-prefs">' +
2489	+ '<h5>' + edcal.str_show_title + '</h5>' +
2490	+ '<select id="edcal_weeks_pref" ' + 'class="screen-per-page" title="' + edcal.str_weekstt + '"> ';
2491	+
2492	+ var weeks = parseInt(edcal.weeksPref, 10);
2493	+ for (var i = 1; i < 9; i++) {
2494	+ if (i === weeks) {
2495	+ optionsHtml += '<option selected="true">' + i + '</option>';
2496	+ } else {
2497	+ optionsHtml += '<option>' + i + '</option>';
2498	+ }
2499	+ }
2500	+
2501	+ optionsHtml += '</select>' +
2502	+ edcal.str_opt_weeks +
2503	+ '</div>';
2504	+
2505	+ /*
2506	+ I started work on adding a color picker so you could choose the color for
2507	+ drafts, published posts, and scheduled posts. However, that makes the settings
2508	+ a lot more complicated and I'm not sure it is worth it.
2509	+ */
2510	+ //optionsHtml += '<h5>' + edcal.str_optionscolors + '</h5>';
2511	+ //optionsHtml += edcal.generateColorPicker(edcal.str_optionsdraftcolor, 'draft-color', 'lightgreen');
2512	+
2513	+
2514	+ optionsHtml += '<br /><button id="edcal_applyoptions" onclick="edcal.saveOptions(); return false;" class="save button">' + edcal.str_apply + '</button>';
2515	+
2516	+ jQuery('#contextual-help-wrap').html(optionsHtml);
2517	+
2518	+ jQuery('#contextual-help-link-wrap').css('visibility', 'hidden');
2519	+
2520	+ jQuery('#contextual-help-wrap').slideDown('normal');
2521	+
2522	+ jQuery('#screen-meta').show();
2523	+
2524	+ jQuery('#show-edcal-settings-link').addClass('screen-meta-active');
2525	+ } else {
2526	+ jQuery('#contextual-help-wrap').slideUp('fast');
2527	+
2528	+ /*
2529	+ * restore the old HTML
2530	+ */
2531	+ jQuery('#contextual-help-wrap').html(edcal.helpMeta);
2532	+
2533	+ edcal.helpMeta = null;
2534	+
2535	+ jQuery('#show-edcal-settings-link').removeClass('screen-meta-active');
2536	+ jQuery('#contextual-help-link-wrap').css('visibility', '');
2537	+ }
2538	+ },
2539	+
2540	+ generateColorPicker: function(/String/ title, /string/ id, /string/ value) {
2541	+ var html = '<div id="' + id + '" class="optionscolorrow">';
2542	+
2543	+ html += '<span style="background-color: ' + value + ';" class="colorlabel"> ' + title + '</span> ';
2544	+
2545	+ var colors = ['lightred', 'orange', 'yellow', 'lightgreen', 'lightblue', 'purple', 'lightgray'];
2546	+
2547	+ edcal.output('colors.length: ' + colors.length);
2548	+ for (var i = 0; i < colors.length; i++) {
2549	+ html += '<a href="#" class="optionscolor ';
2550	+
2551	+ if (colors[i] === value) {
2552	+ html += 'colorselected';
2553	+
2554	+ }
2555	+
2556	+ html += '" class=' + id + colors[i] + '" style="background-color: ' + colors[i] + '; left: ' + ((i * 20) + 50) + 'px" ' +
2557	+ 'onclick="edcal.selectColor(\'' + id + '\', \'' + colors[i] + '\'); return false;"></a>';
2558	+
2559	+ }
2560	+
2561	+ html += '</div>';
2562	+
2563	+ return html;
2564	+
2565	+ },
2566	+
2567	+ selectColor: function(/string/ id, /string/ value) {
2568	+ edcal.output('selectColor(' + id + ', ' + value + ')');
2569	+ jQuery('#' + id + ' .colorlabel').css('background-color', value);
2570	+
2571	+ jQuery('#' + id + ' .colorselected').removeClass('colorselected');
2572	+
2573	+ jQuery('#' + id + 'value').addClass('colorselected');
2574	+
2575	+ },
2576	+
2577	+ isPrefChecked: function(/boolean/ prefVal) {
2578	+ if (prefVal) {
2579	+ return ' checked="checked" ';
2580	+ } else {
2581	+ return '';
2582	+ }
2583	+ },
2584	+
2585	+ /*
2586	+ Save the number of weeks options with an AJAX call. This happens
2587	+ when you press the apply button.
2588	+ */
2589	+ saveOptions: function() {
2590	+ /*
2591	+ We start by validating the number of weeks. We only allow
2592	+ 1, 2, 3, 4, or 5 weeks at a time.
2593	+ */
2594	+ var weeks = parseInt(jQuery('#edcal_weeks_pref').val(), 10);
2595	+ if (weeks < 1 \|\| weeks > 8) {
2596	+ humanMsg.displayMsg(edcal.str_weekserror);
2597	+ return;
2598	+ }
2599	+
2600	+ edcal.enableMouseWheel();
2601	+
2602	+ var url = edcal.ajax_url() + '&action=edcal_saveoptions&weeks=' +
2603	+ encodeURIComponent(jQuery('#edcal_weeks_pref').val());
2604	+
2605	+ jQuery('div.calendar-fields-prefs').find('input, textarea, select').each(function() {
2606	+ url += '&' + encodeURIComponent(this.name) + '=' + encodeURIComponent(this.checked);
2607	+ });
2608	+
2609	+ jQuery.ajax({
2610	+ url: url,
2611	+ type: 'POST',
2612	+ processData: false,
2613	+ timeout: 100000,
2614	+ dataType: 'text',
2615	+ success: function(res) {
2616	+ /*
2617	+ Now we refresh the page because I'm too lazy to
2618	+ make changing the weeks work inline.
2619	+ */
2620	+ window.location.href = window.location.href;
2621	+ },
2622	+ error: function(xhr) {
2623	+ edcal.showError(edcal.general_error);
2624	+ if (xhr.responseText) {
2625	+ edcal.output('saveOptions xhr.responseText: ' + xhr.responseText);
2626	+ }
2627	+ }
2628	+ });
2629	+ },
2630	+
2631	+ /**
2632	+ * Outputs info messages to the Firebug console if it is available.
2633	+ *
2634	+ * msg the message to write.
2635	+ */
2636	+ output: function(msg) {
2637	+ if (window.console) {
2638	+ console.log(msg);
2639	+ }
2640	+ },
2641	+
2642	+ /*
2643	+ * Shows an error message and sends the message as an error to the
2644	+ * Firebug console if it is available.
2645	+ */
2646	+ showError: function(/string/ msg) {
2647	+ if (window.console) {
2648	+ console.error(msg);
2649	+ }
2650	+
2651	+ edcal.displayMessage(msg);
2652	+
2653	+ },
2654	+
2655	+ /*
2656	+ * Display an error message to the user
2657	+ */
2658	+ displayMessage: function(/string/ msg) {
2659	+ humanMsg.displayMsg(msg);
2660	+ },
2661	+
2662	+ /*
2663	+ * A helper function to get the parameters from the
2664	+ * current URL.
2665	+ */
2666	+ getUrlVars: function() {
2667	+ var vars = [], hash;
2668	+ var hashes = window.location.href.slice(window.location.href.indexOf('?') + 1).split('&');
2669	+ for (var i = 0; i < hashes.length; i++) {
2670	+ hash = hashes[i].split('=');
2671	+ vars.push(hash[0]);
2672	+ vars[hash[0]] = hash[1];
2673	+ }
2674	+
2675	+ return vars;
2676	+ },
2677	+
2678	+ /*
2679	+ * Show an error indicating the calendar couldn't be loaded
2680	+ */
2681	+ showFatalError: function(message) {
2682	+ jQuery('#edcal_main_title').after(
2683	+ '<div class="error below-h2" id="message"><p>' +
2684	+ edcal.str_fatal_error + message + '<br></p></div>');
2685	+
2686	+ if (window.console) {
2687	+ console.error(message);
2688	+ }
2689	+ },
2690	+
2691	+ chineseAposWorkaround: function(/String/ dateString) {
2692	+ if (Date.CultureInfo.name.indexOf('zh') === 0 \|\|
2693	+ Date.CultureInfo.name.indexOf('ja') === 0) {
2694	+ return dateString.replace(/'/g, '');
2695	+ }
2696	+ return dateString;
2697	+ }
2698	+ };
2699	+
2700	+ /*
2701	+ * Helper function for jQuery to center a div
2702	+ */
2703	+ jQuery.fn.center = function() {
2704	+ this.css('position', 'absolute');
2705	+ this.css('top', (jQuery(window).height() - this.outerHeight()) / 2 + jQuery(window).scrollTop() + 'px');
2706	+ this.css('left', (jQuery(window).width() - this.outerWidth()) / 2 + jQuery(window).scrollLeft() + 'px');
2707	+ return this;
2708	+ };
2709	+
2710	+
2711	+ jQuery(document).ready(function() {
2712	+ try {
2713	+ edcal.init();
2714	+ } catch (e) {
2715	+ /*
2716	+ * These kinds of errors often happen when there is a
2717	+ * conflict with a JavaScript library imported by
2718	+ * another plugin.
2719	+ */
2720	+ edcal.output('Error loading calendar: ' + e);
2721	+ edcal.showFatalError(e.description);
2722	+ }
2723	+
2724	+ /*
2725	+ * The calendar supports unit tests through the QUnit framework,
2726	+ * but we don't want to load the extra files when we aren't running
2727	+ * tests so we load them dynamically. Add the qunit=true parameter
2728	+ * to run the tests.
2729	+ */
2730	+ if (edcal.getUrlVars().qunit) {
2731	+ edcal_test.runTests();
2732	+ }
2733	+ });

3.7.8/edcal.min.js ADDED Viewed

	@@ -0,0 +1,71 @@


1	+ var $jscomp=$jscomp\|\|{};$jscomp.scope={};$jscomp.findInternal=function(a,b,c){a instanceof String&&(a=String(a));for(var d=a.length,e=0;e<d;e++){var f=a[e];if(b.call(c,f,e,a))return{i:e,v:f}}return{i:-1,v:void 0}};$jscomp.ASSUME_ES5=!1;$jscomp.ASSUME_NO_NATIVE_MAP=!1;$jscomp.ASSUME_NO_NATIVE_SET=!1;$jscomp.defineProperty=$jscomp.ASSUME_ES5\|\|"function"==typeof Object.defineProperties?Object.defineProperty:function(a,b,c){a!=Array.prototype&&a!=Object.prototype&&(a[b]=c.value)};
2	+ $jscomp.getGlobal=function(a){return"undefined"!=typeof window&&window===a?a:"undefined"!=typeof global&&null!=global?global:a};$jscomp.global=$jscomp.getGlobal(this);$jscomp.polyfill=function(a,b,c,d){if(b){c=$jscomp.global;a=a.split(".");for(d=0;d<a.length-1;d++){var e=a[d];e in c\|\|(c[e]={});c=c[e]}a=a[a.length-1];d=c[a];b=b(d);b!=d&&null!=b&&$jscomp.defineProperty(c,a,{configurable:!0,writable:!0,value:b})}};
3	+ $jscomp.polyfill("Array.prototype.find",function(a){return a?a:function(a,c){return $jscomp.findInternal(this,a,c).v}},"es6-impl","es3");$jscomp.checkStringArgs=function(a,b,c){if(null==a)throw new TypeError("The 'this' value for String.prototype."+c+" must not be null or undefined");if(b instanceof RegExp)throw new TypeError("First argument to String.prototype."+c+" must not be a regular expression");return a+""};
4	+ $jscomp.polyfill("String.prototype.endsWith",function(a){return a?a:function(a,c){var b=$jscomp.checkStringArgs(this,a,"endsWith");a+="";void 0===c&&(c=b.length);c=Math.max(0,Math.min(c\|0,b.length));for(var e=a.length;0<e&&0<c;)if(b[--c]!=a[--e])return!1;return 0>=e}},"es6-impl","es3");
5	+ var edcal={NO_DATE:"00000000",weeksPref:3,statusPref:!0,authorPref:!1,timePref:!0,wheelScrollPref:!0,doFeedbackPref:!0,isMoving:!1,inDrag:!1,isDragScrolling:!1,internalDateFormat:"ddMMyyyy",position:null,firstDayOfMonth:null,firstDayOfNextMonth:null,wp_dateFormat:"yyyy-MM-dd",cacheDates:[],tID:null,steps:0,CONCURRENCY_ERROR:4,PERMISSION_ERROR:5,NONCE_ERROR:6,currentDirection:!0,_wDate:Date.today(),moveDate:null,startOfWeek:null,posts:[],windowHeight:0,ltr:"ltr",isDraftsDrawerVisible:!1,enableMouseWheel:function(){edcal.wheelScrollPref?
6	+ jQuery("#edcal_scrollable").bind("mousewheel",function(a,b){a=Math.abs(b);!edcal.isMoving&&.2<a&&edcal.move(1,0<b?!1:!0);return!1}):jQuery("#edcal_scrollable").unbind("mousewheel")},init:function(){if(0!==jQuery("#edcal_scrollable").length){"true"===jQuery.cookie("edcal_drafts_drawer")&&(edcal.isDraftsDrawerVisible=!0,edcal.setDraftsDrawerVisible(edcal.isDraftsDrawerVisible));jQuery("#loading").hide();jQuery("#edcal_scrollable").css("height",edcal.getCalHeight()+"px");edcal.windowHeight=jQuery(window).height();
7	+ edcal.createDaysHeader();jQuery("#edcal_scrollable").scrollable({vertical:!0,size:edcal.weeksPref,keyboard:!1,keyboardSteps:1,speed:100,easing:"linear"});var a=jQuery("#edcal_scrollable").scrollable();a.getConf().keyboard=!1;var b=jQuery.cookie("edcal_date");b?(b=Date.parseExact(b,"yyyy-dd-MM"),edcal.output("Resetting to date from the edcal_Date cookie: "+b)):b=Date.today();edcal.moveTo(b.clone());a.onBeforeSeek(function(a,b){return!1});edcal.enableMouseWheel();jQuery(document).bind("keydown",function(a){if(27===
8	+ a.keyCode)return!1;if(!jQuery("#edcal_quickedit").is(":visible"))if(40!==a.keyCode\|\|a.altKey\|\|a.ctrlKey)if(38!==a.keyCode\|\|a.altKey\|\|a.ctrlKey){if(34===a.keyCode&&!a.altKey&&!a.ctrlKey\|\|40===a.keyCode&&a.ctrlKey)return edcal.move(edcal.weeksPref,!0),!1;if(33===a.keyCode&&!a.altKey&&!a.ctrlKey\|\|38===a.keyCode&&a.ctrlKey)return edcal.move(edcal.weeksPref,!1),!1}else return edcal.move(1,!1),!1;else return edcal.move(1,!0),!1});edcal.getPosts(edcal.nextStartOfWeek(b).add(-3).weeks(),edcal.nextStartOfWeek(b).add(edcal.weeksPref+
9	+ 3).weeks());jQuery("#moveToToday").click(function(){edcal.moveTo(Date.today());edcal.getPosts(edcal.nextStartOfWeek(Date.today()).add(-3).weeks(),edcal.nextStartOfWeek(Date.today()).add(edcal.weeksPref+3).weeks());return!1});jQuery("#moveToLast").click(function(){if("-1"!==edcal.lastPostDate){var a=Date.parseExact(edcal.lastPostDate,"ddMMyyyy");edcal.moveTo(a);edcal.getPosts(edcal.nextStartOfWeek(a).add(-3).weeks(),edcal.nextStartOfWeek(a).add(edcal.weeksPref+3).weeks());return!1}});jQuery("#prevmonth").click(function(){edcal.move(edcal.weeksPref,
10	+ !1);return!1});jQuery("#nextmonth").click(function(){edcal.move(edcal.weeksPref,!0);return!1});jQuery("#newPostScheduleButton").on("click",function(a){if(jQuery(this).hasClass("disabled"))return!1;jQuery(this).addClass("disabled");return edcal.savePost(null,!1,!0)});jQuery("#edcal-title-new-field").bind("input",function(a){(0<jQuery("#edcal-title-new-field").val().length\|\|0<jQuery("#content").val().length)&&(!jQuery("#edcal-time").is(":visible")\|\|0<jQuery("#edcal-time").val().length)?jQuery("#newPostScheduleButton").removeClass("disabled"):
11	+ jQuery("#newPostScheduleButton").addClass("disabled");if(13===a.keyCode)return edcal.savePost(null,!0)});jQuery("#content").bind("input",function(a){(0<jQuery("#edcal-title-new-field").val().length\|\|0<jQuery("#content").val().length)&&(!jQuery("#edcal-time").is(":visible")\|\|0<jQuery("#edcal-time").val().length)?jQuery("#newPostScheduleButton").removeClass("disabled"):jQuery("#newPostScheduleButton").addClass("disabled");if(13===a.keyCode)return edcal.savePost(null,!0)});jQuery("#edcal-status").bind("change",
12	+ function(a){edcal.updatePublishButton()});jQuery("#edcal_weeks_pref").on("keyup",function(a){0<jQuery("#edcal_weeks_pref").val().length?jQuery("#edcal_applyoptions").removeClass("disabled"):jQuery("#edcal_applyoptions").addClass("disabled");13===a.keyCode&&edcal.saveOptions()});edcal.savePosition();edcal.addOptionsSection();jQuery("#edcal-time").timePicker({show24Hours:"H:i"===edcal.timeFormat,separator:":",step:30});jQuery("#showdraftsdrawer").click(function(){edcal.setDraftsDrawerVisible(!edcal.isDraftsDrawerVisible)})}},
13	+ setDraftsDrawerVisible:function(a,b){var c=jQuery("#showdraftsdrawer");c.hasClass("isLoaded")?b&&b():(c.addClass("isLoaded"),edcal.setupDraftsdrawer(b));a?(jQuery("#cal_cont").css({"margin-right":"13.5%"}),jQuery("#draftsdrawer_cont").css({display:"block",width:"13%"}),c.html(edcal.str_hidedrafts)):(jQuery("#cal_cont").css({"margin-right":"0"}),jQuery("#draftsdrawer_cont").css({display:"none",width:"0"}),c.html(edcal.str_showdrafts));edcal.isDraftsDrawerVisible=a;jQuery.cookie("edcal_drafts_drawer",
14	+ a,{expires:2060})},setupDraftsdrawer:function(a){jQuery("#draftsdrawer_loading").css({display:"block"});edcal.getPosts(edcal.NO_DATE,null,function(){edcal.initDraftsdrawer();a&&a()})},initDraftsdrawer:function(){var a=""+('<a href="#" adddate="'+edcal.NO_DATE+'" class="daynewlink" style="margin-top: 5px;"title="'+edcal.str_newdraft+'" id="unscheduledNewLink" onclick="edcal.addDraft(); return false;">'+edcal.str_addDraftLink+"</a>");a=a+'<ul class="postlist">'+edcal.getPostItems(edcal.NO_DATE);a+=
15	+ "</ul>";edcal.draggablePost("#row"+edcal._wDate.toString(edcal.internalDateFormat)+" li.post");edcal.makeDroppable(jQuery("#draftsdrawer div.day"));jQuery("#unscheduled").append(a);jQuery("#draftsdrawer_loading").css({display:"none"});a=jQuery("#cal_cont");jQuery("#unscheduled ul.postlist").css("min-height",a.height()-10-jQuery("#draftsdrawer .draftsdrawerheadcont").height()-jQuery("#unscheduledNewLink").outerHeight());jQuery("#unscheduled").mouseout(function(){jQuery("#unscheduledNewLink").hide()}).mouseover(function(){jQuery("#unscheduledNewLink").show()})},
16	+ alignGrid:function(a,b,c,d,e){if("draftsdrawer"!==jQuery(a).parent().attr("id")){var f=0,h=0,g=1;jQuery(a).each(function(){jQuery(this).css("position","relative");var a=jQuery(this).children("div");if(1===b\|\|"rtl"!==edcal.ltr)for(var k=0;k<a.length;k++)a.eq(k).css({width:c+"%",height:d+"%",position:"absolute",left:f+"%",top:h+"%"}),0===g%b?(f=0,h+=d+e):f+=c+e,g++;else for(k=a.length-1;-1<k;k--)a.eq(k).css({width:c+"%",height:d+"%",position:"absolute",left:f+"%",top:h+"%"}),0===g%b?(f=0,h+=d+e):f+=
17	+ c+e,g++})}},alignCal:function(){edcal.alignGrid("#cal",1,100,100/edcal.weeksPref-1,1)},createDaysHeader:function(){var a=Date.today().next().sunday();edcal.nextStartOfWeek(a);var b='<div class="dayheadcont"><div class="dayhead firstday">'+a.add(edcal.startOfWeek).days().toString("dddd")+"</div>",b=b+('<div class="dayhead">'+a.add(1).days().toString("dddd")+"</div>"),b=b+('<div class="dayhead">'+a.add(1).days().toString("dddd")+"</div>"),b=b+('<div class="dayhead">'+a.add(1).days().toString("dddd")+
18	+ "</div>"),b=b+('<div class="dayhead">'+a.add(1).days().toString("dddd")+"</div>"),b=b+('<div class="dayhead">'+a.add(1).days().toString("dddd")+"</div>"),b=b+('<div class="dayhead lastday">'+a.add(1).days().toString("dddd")+"</div>");jQuery("#cal_cont").prepend(b);edcal.alignGrid(".dayheadcont",7,13.8,100,.5)},getDateClass:function(a){var b;var c=-1===a.compareTo(Date.today())?"beforeToday":"todayAndAfter";edcal.firstDayOfMonth\|\|(edcal.firstDayOfMonth=Date.today().moveToFirstDayOfMonth().clearTime(),
19	+ edcal.firstDayOfNextMonth=Date.today().moveToLastDayOfMonth().clearTime());a.between(edcal.firstDayOfMonth,edcal.firstDayOfNextMonth)?b="month-present":1===a.compareTo(edcal.firstDayOfMonth)?b="month-future":-1===a.compareTo(edcal.firstDayOfNextMonth)&&(b="month-past");"01"===a.toString("dd")&&(c+=" firstOfMonth");return b+" "+c},showAddPostLink:function(a){edcal.inDrag\|\|(a=jQuery("#"+a+" a.daynewlink"),a.css("display","block"),a.bind("click",edcal.addPost))},hideAddPostLink:function(a){jQuery("#"+
20	+ a+" a.daynewlink").hide().unbind("click",edcal.addPost)},createRow:function(a,b){for(var c=edcal._wDate.clone(),d='<div class="rowcont" id="row'+edcal._wDate.toString(edcal.internalDateFormat)+'"><div id="row'+edcal._wDate.toString(edcal.internalDateFormat)+'row" class="edcal_row">',e=0;7>e;e++)d+="<div onmouseover=\"edcal.showAddPostLink('"+c.toString(edcal.internalDateFormat)+"');\" onmouseout=\"edcal.hideAddPostLink('"+c.toString(edcal.internalDateFormat)+'\');" id="'+c.toString(edcal.internalDateFormat)+
21	+ '" class="day '+edcal.getDateClass(c)+" "+c.toString("dddd").toLowerCase()+" month-"+c.toString("MM").toLowerCase()+'">',d+='<div class="dayobj">',d+='<a href="#" adddate="'+c.toString("MMMM d")+'" class="daynewlink" title="'+sprintf(edcal.str_newpost,edcal.chineseAposWorkaround(c.toString(Date.CultureInfo.formatPatterns.monthDay)))+'" onclick="return false;">'+edcal.str_addPostLink+"</a>",d="01"===c.toString("dd")?d+('<div class="daylabel">'+c.toString("MMM d")):d+('<div class="daylabel">'+c.toString("d")),
22	+ d+="</div>",d+='<ul class="postlist">',d+=edcal.getPostItems(c.toString(edcal.internalDateFormat)),d+="</ul>",d+="</div>",d+="</div>",c.add(1).days();d+="</div></div>";b?a.append(d):a.prepend(d);edcal.alignGrid("#row"+edcal._wDate.toString(edcal.internalDateFormat)+"row",7,13.9,100,.5);edcal.draggablePost("#row"+edcal._wDate.toString(edcal.internalDateFormat)+" li.post");edcal.makeDroppable(jQuery("#row"+edcal._wDate.toString(edcal.internalDateFormat)+" > div > div.day"));return jQuery("row"+edcal._wDate.toString(edcal.internalDateFormat))},
23	+ makeDroppable:function(a){a.droppable({hoverClass:"day-active",accept:function(a){return jQuery(this).hasClass("beforeToday")?a.hasClass("draft")?!0:!1:!0},greedy:!0,tolerance:"pointer",drop:function(a,c){a=c.draggable.parent().parent().parent().attr("id");edcal.doDrop(a,c.draggable.attr("id"),jQuery(this).attr("id"))}})},doDrop:function(a,b,c,d){var e=edcal.findPostForId(a,b);edcal.removePostFromMap(a,b);var f=jQuery("#"+b);f.detach();setTimeout(function(){f.remove()},500);jQuery("#"+c+" .postlist").append(edcal.createPostItem(e,
24	+ c));a===c?edcal.draggablePost("#"+c+" .post"):edcal.changeDate(c,e,d)},draggablePost:function(a){jQuery(a).each(function(){var a=edcal.findPostForId(jQuery(this).parent().parent().parent().attr("id"),jQuery(this).attr("id"));edcal.isPostMovable(a)&&(jQuery(this).draggable({revert:"invalid",appendTo:"body",helper:"clone",distance:1,addClasses:!1,start:function(){edcal.inDrag=!0},stop:function(){edcal.inDrag=!1},drag:function(a,b){edcal.handleDrag(a,b)},scroll:!1,refreshPositions:!0}),jQuery(this).addClass("draggable"))})},
25	+ handleDrag:function(a,b){edcal.isMoving\|\|edcal.isDragScrolling\|\|(edcal.isDragScrolling=!0,a.pageY<edcal.position.top+10?edcal.move(1,!1):a.pageY>edcal.position.bottom-10&&edcal.move(1,!0),setTimeout(function(){edcal.isDragScrolling=!1},300))},removePostFromMap:function(a,b){if(edcal.posts[a])for(var c=0;c<edcal.posts[a].length;c++)if(edcal.posts[a][c]&&"post-"+edcal.posts[a][c].id===b)return edcal.posts[a][c]=null,!0;return!1},addPostItem:function(a,b){jQuery("#"+b+" > div > ul").append(edcal.createPostItem(a,
26	+ b))},addPostItemDragAndToolltip:function(a){edcal.draggablePost("#"+a+" > div > ul > li")},deletePost:function(a,b){a=edcal.ajax_url()+"&action=edcal_deletepost&postid="+a;jQuery.ajax({url:a,type:"POST",processData:!1,timeout:1E5,dataType:"json",success:function(a){a.post.date_gmt===edcal.NO_DATE?edcal.removePostItem(a.post.date_gmt,"post-"+a.post.id):edcal.removePostItem(a.post.date,"post-"+a.post.id);a.error?a.error===edcal.NONCE_ERROR&&edcal.showError(edcal.checksum_error):edcal.output('Finished deleting the post: "'+
27	+ a.post.title+'" with id:'+a.post.id);b&&b(a)},error:function(a){edcal.showError(edcal.general_error);a.responseText&&edcal.output("deletePost xhr.responseText: "+a.responseText)}})},confirmDelete:function(a){return confirm(edcal.str_del_msg1+a+edcal.str_del_msg2)?!0:!1},ajax_url:function(){return ajaxurl+"?_wpnonce="+edcal.wp_nonce},getMediaBar:function(){return jQuery("#cal_mediabar").html()},addPost:function(){jQuery("#newPostScheduleButton").addClass("disabled");var a=jQuery(this).parent().parent().attr("id"),
28	+ b=edcal.defaultTime;"H:i"!==edcal.timeFormat&&"G:i"!==edcal.timeFormat&&(b+=" AM");a={id:0,date:a,formatteddate:edcal.getDayFromDayId(a).toString(edcal.previewDateFormat),time:b};edcal.showForm(a);return!1},addDraft:function(){jQuery("#newPostScheduleButton").addClass("disabled");var a={id:0,date:Date.today(),formatteddate:edcal.NO_DATE,time:edcal.NO_DATE,status:"draft"};edcal.showForm(a);return!1},editPost:function(a){jQuery("#newPostScheduleButton").removeClass("disabled");edcal.getPost(a,edcal.showForm);
29	+ return!1},savePost:function(a,b,c,d){if("undefined"===typeof a\|\|null===a)a=edcal.serializePost();jQuery("#edit-slug-buttons").addClass("tiploading");var e=a.time.toUpperCase();"12"===e.slice(0,2)&&"PM"===e.slice(e.length-2,e.length)?a.time="12:"+e.slice(3,5):"12"===e.slice(0,2)&&"AM"===e.slice(a.time.length-2,a.time.length)&&(a.time="00:"+e.slice(3,5));var e=""!==a.time?Date.parse(a.time):Date.parse(edcal.defaultTime);if(null!==e&&e!==edcal.NO_DATE){var f=e.format("H:i:s");var h=encodeURIComponent(edcal.getDayFromDayId(a.date).toString(edcal.wp_dateFormat)+
30	+ " "+f)}else h=encodeURIComponent(a.date.toString(edcal.wp_dateFormat+" H:i:s"));f=edcal.ajax_url()+"&action=edcal_savepost";a="date="+h+"&title="+encodeURIComponent(a.title)+"&content="+encodeURIComponent(a.content)+"&id="+encodeURIComponent(a.id)+"&status="+encodeURIComponent(a.status)+"&orig_status="+encodeURIComponent(a.orig_status);if(null===e\|\|e===edcal.NO_DATE)a+="&date_gmt="+encodeURIComponent("0000-00-00 00:00:00");edcal.getUrlVars().post_type&&(a+="&post_type="+encodeURIComponent(edcal.getUrlVars().post_type));
31	+ c&&(a+="&dopublish="+encodeURIComponent("future"));jQuery.ajax({url:f,type:"POST",processData:!1,data:a,timeout:1E5,dataType:"json",success:function(a){jQuery("#edit-slug-buttons").removeClass("tiploading");jQuery("#edcal_quickedit").hide();jQuery("#edcal_scrollable").data("scrollable").getConf().keyboard=!0;if(a.error)return a.error===edcal.NONCE_ERROR&&edcal.showError(edcal.checksum_error),!1;if(a.post)if(b)window.location=a.post.editlink.replace("&","&");else{var c=a.post.date;a.post.date_gmt===
32	+ edcal.NO_DATE&&(c=a.post.date_gmt);a.post.id&&edcal.removePostItem(c,"post-"+a.post.id);edcal.addPostItem(a.post,c);edcal.addPostItemDragAndToolltip(c)}else edcal.showError("There was an error creating a new post for your blog.");d&&d(a);return!0},error:function(a){jQuery("#edit-slug-buttons").removeClass("tiploading");jQuery("#edcal_quickedit").hide();jQuery("#edcal_scrollable").data("scrollable").getConf().keyboard=!0;edcal.showError(edcal.general_error);a.responseText&&edcal.output("savePost xhr.responseText: "+
33	+ a.responseText)}});return!1},serializePost:function(){var a={};jQuery("#edcal_quickedit").find("input, textarea, select").each(function(){a[this.name]=this.value});return a},showForm:function(a){edcal.resetForm();a.formatteddate===edcal.NO_DATE\|\|a.date_gmt===edcal.NO_DATE?jQuery("#timeEditControls").hide():jQuery("#timeEditControls").show();jQuery("#edcal_quickedit").center().show();jQuery("#edcal_scrollable").data("scrollable").getConf().keyboard=!1;a.id?(jQuery("#tooltiptitle").text(sprintf(edcal.str_edit_post_title,
34	+ a.typeTitle,edcal.getDayFromDayId(a.date).toString(edcal.previewDateFormat))),jQuery("#edcal-title-new-field").val(a.title),jQuery("#content").val(a.content)):a.formatteddate===edcal.NO_DATE?jQuery("#tooltiptitle").text(edcal.str_newdraft_title):jQuery("#tooltiptitle").text(edcal.str_newpost_title+a.formatteddate);"future"===a.status&&jQuery("#newPostScheduleButton").text(edcal.str_update);a.status?(jQuery("#edcal-status").val(a.status),edcal.updatePublishButton()):(0!==jQuery("#edcal-status option[value="+
35	+ edcal.defaultStatus+"]").length?jQuery("#edcal-status").val(edcal.defaultStatus):jQuery("#edcal-status").val("draft"),jQuery("#newPostScheduleButton").text(edcal.str_save));a.status&&"draft"!==a.status&&"future"!==a.status&&"pending"!==a.status&&(jQuery("#edcal-status").attr("disabled","true"),jQuery("#edcal-status").append('<option class="temp" value="'+a.status+'">'+a.status+"</option>"),jQuery("#edcal-status").val(a.status));a.formatteddate!==edcal.NO_DATE&&-1===edcal.getDayFromDayId(a.date).compareTo(Date.today())&&
36	+ jQuery("#edcal-status").attr("disabled","true");var b=a.time;jQuery("#edcal-time").val(b);jQuery("#edcal-date").val(a.date);jQuery("#edcal-id").val(a.id);jQuery("#edcal-title-new-field").focus();jQuery("#edcal-title-new-field").select()},hideForm:function(){jQuery("#edcal_quickedit").hide();jQuery("#edcal_scrollable").data("scrollable").getConf().keyboard=!0;edcal.resetForm()},resetForm:function(){jQuery("#edcal_quickedit").find("input, textarea, select").each(function(){this.value=""});jQuery("#edcal-status").removeAttr("disabled");
37	+ jQuery("#newPostScheduleButton").text(edcal.str_publish);jQuery("#tooltiptitle").text("");jQuery("#edcal-status").removeAttr("disabled");jQuery("#edcal-status .temp").remove()},createPostItem:function(a,b){edcal.posts[b]\|\|(edcal.posts[b]=[]);edcal.posts[b][edcal.posts[b].length]=a;return edcal.getPostItemString(a)},findPostForId:function(a,b){if(edcal.posts[a])for(var c=0;c<edcal.posts[a].length;c++)if(edcal.posts[a][c]&&"post-"+edcal.posts[a][c].id===b)return edcal.posts[a][c];return null},removePostItem:function(a,
38	+ b){if(edcal.findPostForId(a,b))for(var c=0;c<edcal.posts[a].length;c++)edcal.posts[a][c]&&"post-"+edcal.posts[a][c].id===b&&(edcal.posts[a][c]=null);jQuery("#"+b).remove()},getPostItems:function(a){var b="";if(edcal.posts[a]){var c=edcal.posts[a];if(50>c.length)for(a=0;a<c.length;a++)c[a]&&(b+=edcal.getPostItemString(c[a]));else edcal.addPostItems(a,0,50)}return b},addPostItems:function(a,b,c){var d=edcal.posts[a],e="";setTimeout(function(){for(var f=b;f<b+c&&f<d.length;f++)d[f]&&(e+=edcal.getPostItemString(d[f]));
39	+ jQuery("#"+a+" ul").append(e);b+c<d.length&&edcal.addPostItems(a,b+c,50)},100)},showActionLinks:function(a){edcal.actionTimer&&clearTimeout(edcal.actionTimer);var b=edcal.findPostForId(jQuery("#"+a).parent().parent().parent().attr("id"),a);if(!edcal.inDrag&&edcal.isPostEditable(b)){var c=jQuery("#"+a+" > div.postactions");edcal.actionLinksElem&&edcal.actionLinksElem.get(0)!==c.get(0)&&edcal.actionLinksElem.slideUp();edcal.actionLinksElem=c;edcal.actionTimer=setTimeout(function(){c.slideDown();if(c.parent().position().top+
40	+ c.parent().height()>c.parent().parent().height()){var b=jQuery("#"+a+" > div.postactions").parent().parent();b.scrollTop(b.scrollTop()+45)}},250)}},hideActionLinks:function(a){edcal.actionTimer&&clearTimeout(edcal.actionTimer);edcal.actionTimer=setTimeout(function(){jQuery("#"+a+" > div.postactions").slideUp();edcal.actionLinksElem=null},1E3)},isPostMovable:function(a){return a.editlink&&"publish"!==a.status},isPostEditable:function(a){return a.editlink},getPostEditableClass:function(a){return a.editlink?
41	+ "":"readonly"},getPostItemString:function(a){var b=a.title;""===b&&(b="[No Title]");edcal.statusPref&&("draft"===a.status&&"1"===a.sticky?b+=edcal.str_draft_sticky:"pending"===a.status&&"1"===a.sticky?b+=edcal.str_pending_sticky:"1"===a.sticky?b+=edcal.str_sticky:"pending"===a.status?b+=edcal.str_pending:"draft"===a.status?b+=edcal.str_draft:"publish"!==a.status&&"future"!==a.status&&"pending"!==a.status&&(b+=" ["+a.status+"]"));edcal.timePref&&(b='<span class="posttime">'+a.formattedtime+"</span> "+
42	+ b);edcal.authorPref&&(b=sprintf(edcal.str_by,b,'<span class="postauthor">'+a.author+"</span>"));return edcal.isPostMovable(a)?"<li onmouseover=\"edcal.showActionLinks('post-"+a.id+"');\" onmouseout=\"edcal.hideActionLinks('post-"+a.id+'\');" id="post-'+a.id+'" class="post '+a.status+" "+edcal.getPostEditableClass(a)+a.slugs+'"><div class="postlink "><span>'+b+'</span></div><div class="postactions"><a href="'+a.editlink+'">'+edcal.str_edit+'</a> \| <a href="#" onclick="edcal.editPost('+a.id+'); return false;">'+
43	+ edcal.str_quick_edit+'</a> \| <a href="'+a.dellink+'" onclick="return edcal.confirmDelete(\''+a.title+"');\">"+edcal.str_del+'</a> \| <a href="'+a.permalink+'">'+edcal.str_view+"</a></div></li>":"<li onmouseover=\"edcal.showActionLinks('post-"+a.id+"');\" onmouseout=\"edcal.hideActionLinks('post-"+a.id+'\');" id="post-'+a.id+'" class="post '+a.status+" "+edcal.getPostEditableClass(a)+'"><div class="postlink "><span>'+b+'</span></div><div class="postactions"><a href="'+a.editlink+'">'+edcal.str_republish+
44	+ '</a> \| <a href="'+a.permalink+'">'+edcal.str_view+"</a></div></li>"},setClassforToday:function(){jQuery("#"+Date.today().toString(edcal.internalDateFormat)).addClass("today")},getCalHeight:function(){var a=jQuery(window).height()-jQuery("#footer").height()-jQuery("#wphead").height()-150;return Math.max(a,500)},move:function(a,b,c){if(!jQuery("#edcal_quickedit").is(":visible")){edcal.currentDirection!==b&&(edcal._wDate=b?edcal._wDate.add(7(edcal.weeksPref+7)).days():edcal._wDate.add(-(7(edcal.weeksPref+
45	+ 7))).days(),edcal.steps=0,edcal.moveDate=edcal._wDate);edcal.currentDirection=b;var d;if(b)for(d=0;d<a;d++)jQuery("#cal > div:first").remove(),edcal.createRow(jQuery("#cal"),!0),edcal._wDate.add(7).days();else for(d=0;d<a;d++)jQuery("#cal > div:last").remove(),edcal.createRow(jQuery("#cal"),!1),edcal._wDate.add(-7).days();edcal.alignCal();edcal.setClassforToday();edcal.setDateLabel();edcal.steps+=a;edcal.tID?clearTimeout(edcal.tID):edcal.moveDate=edcal._wDate;edcal.tID=setTimeout(function(){b?edcal.getPosts(edcal._wDate.clone().add(-7*
46	+ (edcal.steps+1)).days(),edcal._wDate.clone(),c):edcal.getPosts(edcal._wDate.clone(),edcal._wDate.clone().add(7*(edcal.steps+1)).days(),c);edcal.steps=0;edcal.tID=null;edcal.moveDate=edcal._wDate},1E3);b?jQuery.cookie("edcal_date",edcal._wDate.clone().add(-(edcal.weeksPref+4)).weeks().toString("yyyy-dd-MM")):jQuery.cookie("edcal_date",edcal._wDate.clone().add(3).weeks().toString("yyyy-dd-MM"))}},getDayFromDayId:function(a){return Date.parseExact(a.substring(2,4)+"/"+a.substring(0,2)+"/"+a.substring(4),
47	+ "MM/dd/yyyy")},setDateLabel:function(a){var b=jQuery("#edcal_scrollable").scrollable().getVisibleItems();a=edcal.getDayFromDayId(b.eq(0).children(".edcal_row").children(".day:first").attr("id"));b=edcal.getDayFromDayId(b.eq(edcal.weeksPref-1).children(".edcal_row").children(".day:last").attr("id"));jQuery("#currentRange").text(edcal.chineseAposWorkaround(a.toString(Date.CultureInfo.formatPatterns.yearMonth))+" - "+edcal.chineseAposWorkaround(b.toString(Date.CultureInfo.formatPatterns.yearMonth)))},
48	+ nextStartOfWeek:function(a){a=a.clone();if(null===edcal.startOfWeek)if(edcal.locale){var b=edcal.locale.toUpperCase();edcal.endsWith(b,"AS")\|\|edcal.endsWith(b,"AZ")\|\|edcal.endsWith(b,"BW")\|\|edcal.endsWith(b,"CA")\|\|edcal.endsWith(b,"CN")\|\|edcal.endsWith(b,"FO")\|\|edcal.endsWith(b,"GB")\|\|edcal.endsWith(b,"GE")\|\|edcal.endsWith(b,"GL")\|\|edcal.endsWith(b,"GU")\|\|edcal.endsWith(b,"HK")\|\|edcal.endsWith(b,"IE")\|\|edcal.endsWith(b,"IL")\|\|edcal.endsWith(b,"IN")\|\|edcal.endsWith(b,"IS")\|\|edcal.endsWith(b,"JM")\|\|
49	+ edcal.endsWith(b,"JP")\|\|edcal.endsWith(b,"KG")\|\|edcal.endsWith(b,"KR")\|\|edcal.endsWith(b,"LA")\|\|edcal.endsWith(b,"MH")\|\|edcal.endsWith(b,"MN")\|\|edcal.endsWith(b,"MO")\|\|edcal.endsWith(b,"MP")\|\|edcal.endsWith(b,"MT")\|\|edcal.endsWith(b,"NZ")\|\|edcal.endsWith(b,"PH")\|\|edcal.endsWith(b,"PK")\|\|edcal.endsWith(b,"SG")\|\|edcal.endsWith(b,"SY")\|\|edcal.endsWith(b,"TH")\|\|edcal.endsWith(b,"TT")\|\|edcal.endsWith(b,"TW")\|\|edcal.endsWith(b,"UM")\|\|edcal.endsWith(b,"US")\|\|edcal.endsWith(b,"UZ")\|\|edcal.endsWith(b,"VI")\|\|
50	+ edcal.endsWith(b,"ZW")?edcal.startOfWeek=0:edcal.endsWith(b,"MV")?edcal.startOfWeek=5:edcal.endsWith(b,"AF")\|\|edcal.endsWith(b,"BH")\|\|edcal.endsWith(b,"DJ")\|\|edcal.endsWith(b,"DZ")\|\|edcal.endsWith(b,"EG")\|\|edcal.endsWith(b,"ER")\|\|edcal.endsWith(b,"ET")\|\|edcal.endsWith(b,"IQ")\|\|edcal.endsWith(b,"IR")\|\|edcal.endsWith(b,"JO")\|\|edcal.endsWith(b,"KE")\|\|edcal.endsWith(b,"KW")\|\|edcal.endsWith(b,"LY")\|\|edcal.endsWith(b,"MA")\|\|edcal.endsWith(b,"OM")\|\|edcal.endsWith(b,"QA")\|\|edcal.endsWith(b,"SA")\|\|edcal.endsWith(b,
51	+ "SD")\|\|edcal.endsWith(b,"SO")\|\|edcal.endsWith(b,"TN")\|\|edcal.endsWith(b,"YE")?edcal.startOfWeek=6:edcal.startOfWeek=1}else edcal.startOfWeek=0;return a.next().sunday().add(edcal.startOfWeek).days()},endsWith:function(a,b){return a.match(b+"$")===b},moveTo:function(a){edcal.isMoving=!0;jQuery("#cal").empty();jQuery.cookie("edcal_date",a.toString("yyyy-dd-MM"));edcal._wDate=edcal.nextStartOfWeek(a).add(-21).days();edcal.currentDirection=!0;a=edcal.weeksPref+6;for(var b=0;b<a;b++)edcal.createRow(jQuery("#cal"),
52	+ !0),edcal._wDate.add(7).days();edcal.alignCal();jQuery("#edcal_scrollable").scrollable().move(2);edcal.setDateLabel();edcal.setClassforToday();edcal.isMoving=!1},savePosition:function(){var a=jQuery("#edcal_scrollable"),b=jQuery("#cal_cont");edcal.position={top:a.offset().top,bottom:a.offset().top+a.height()};jQuery("#edcal_poststyle").remove();a=jQuery(".rowcont:eq(2) .dayobj:first").height()-jQuery(".rowcont:eq(2) .daylabel:first").height()-6;jQuery("head").append('<style id="edcal_poststyle" type="text/css">.ui-draggable-dragging {width: '+
53	+ (jQuery(".rowcont:eq(2) .day:first").width()-5)+"px;}.postlist {height: "+a+"px;}</style>");jQuery("#draftsdrawer").css("height",b.height());jQuery("#draftsdrawer .day").css("min-height",b.height()-10-jQuery("#draftsdrawer .draftsdrawerheadcont").height())},addFeedbackSection:function(){3<edcal.visitCount&&edcal.doFeedbackPref&&jQuery("#edcal_main_title").after(edcal.str_feedbackmsg)},doFeedback:function(){jQuery.getScript("http://www.zackgrossbart.com/edcal/mint/?js",function(){edcal.saveFeedbackPref()})},
54	+ noFeedback:function(){jQuery("#feedbacksection").hide("fast");edcal.saveFeedbackPref()},saveFeedbackPref:function(){var a=edcal.ajax_url()+"&action=edcal_saveoptions&dofeedback="+encodeURIComponent("done");jQuery.ajax({url:a,type:"POST",processData:!1,timeout:1E5,dataType:"text",success:function(a){jQuery("#feedbacksection").html(edcal.str_feedbackdone);setTimeout(function(){jQuery("#feedbacksection").hide("slow")},5E3)},error:function(a){edcal.showError(edcal.general_error);a.responseText&&edcal.output("saveOptions xhr.responseText: "+
55	+ a.responseText)}})},updatePublishButton:function(){"future"===jQuery("#edcal-status").val()&&jQuery("#newPostScheduleButton").text(edcal.str_publish);"pending"===jQuery("#edcal-status").val()?jQuery("#newPostScheduleButton").text(edcal.str_review):jQuery("#newPostScheduleButton").text(edcal.str_save)},changeDate:function(a,b,c){var d=a===edcal.NO_DATE,e=b.date_gmt===edcal.NO_DATE,f=d?"0000-00-00":edcal.getDayFromDayId(a).toString(edcal.wp_dateFormat),h=e?b.date_gmt:edcal.getDayFromDayId(b.date).toString(edcal.wp_dateFormat);
56	+ d&&(b.status="draft");f=edcal.ajax_url()+"&action=edcal_changedate&postid="+b.id+"&postStatus="+b.status+"&newdate="+f+"&olddate="+h;jQuery("#post-"+b.id).addClass("loadingclass");jQuery.ajax({url:f,type:"POST",processData:!1,timeout:1E5,dataType:"json",success:function(b){b.error&&(edcal.removePostItem(a,"post-"+b.post.id),b.error===edcal.CONCURRENCY_ERROR?edcal.displayMessage(edcal.concurrency_error+"<br />"+b.post.title):b.error===edcal.PERMISSION_ERROR?edcal.displayMessage(edcal.permission_error):
57	+ b.error===edcal.NONCE_ERROR&&edcal.displayMessage(edcal.checksum_error));var f=d?"00000000":b.post.date,g=e?a:f;edcal.removePostItem(f,"post-"+b.post.id);edcal.addPostItem(b.post,g);edcal.addPostItemDragAndToolltip(g);c&&c(b)},error:function(a,b,c){edcal.showError(edcal.general_error);edcal.output("textStatus: "+b);edcal.output("error: "+c);a.responseText&&edcal.output("changeDate xhr.responseText: "+a.responseText)}})},getPosts:function(a,b,c){b\|\|(b="");edcal.cacheDates[a]?c&&c():(edcal.cacheDates[a]=
58	+ !0,b=edcal.ajax_url()+"&action=edcal_posts&from="+a.toString("yyyy-MM-dd")+"&to="+b.toString("yyyy-MM-dd"),edcal.getUrlVars().post_type&&(b+="&post_type="+encodeURIComponent(edcal.getUrlVars().post_type)),jQuery("#loading").show(),jQuery.ajax({url:b,type:"GET",processData:!1,timeout:1E5,dataType:"text",success:function(b){jQuery("#loading").hide();var d=null;try{d=JSON.parseIt(b)}catch(l){edcal.showFatalError(edcal.str_fatal_parse_error+l.message);window.console&&console.error(l);return}if(d.error)d.error===
59	+ edcal.NONCE_ERROR&&edcal.showError(edcal.checksum_error);else{for(var f=[],h=d.length;0<=h;h--){var g=d[h];g&&"trash"!==g.status&&(g.date=g.date.replace(g.date.substring(2,3),g.date.substring(2,3).toUpperCase()),"00000000"===a&&(g.date=a),edcal.removePostItem(g.date,"post-"+g.id),edcal.addPostItem(g,g.date),f[f.length]=g.date)}setTimeout(function(){jQuery.each(f,function(a,b){edcal.addPostItemDragAndToolltip(b)})},300);c&&c(b)}},error:function(a){edcal.showError(edcal.general_error);a.responseText&&
60	+ edcal.output("getPosts xhr.responseText: "+a.responseText)}}))},getPost:function(a,b){if(0===a)return!1;jQuery("#loading").show();a=edcal.ajax_url()+"&action=edcal_getpost&postid="+a;edcal.getUrlVars().post_type&&(a+="&post_type="+encodeURIComponent(edcal.getUrlVars().post_type));jQuery.ajax({url:a,type:"GET",processData:!1,timeout:1E5,dataType:"json",success:function(a){jQuery("#loading").hide();edcal.output("xhr for getPost returned: "+a);if(a.error)return a.error===edcal.NONCE_ERROR&&edcal.showError(edcal.checksum_error),
61	+ !1;"function"===typeof b&&b(a.post);return a.post},error:function(a){jQuery("#loading").hide();edcal.showError(edcal.general_error);a.responseText&&edcal.output("getPost xhr.responseText: "+a.responseText);return!1}});return!0},addOptionsSection:function(){var a='<div class="hide-if-no-js screen-meta-toggle" id="screen-options-link-wrap"><a class="show-settings" id="show-edcal-settings-link" onclick="edcal.toggleOptions(); return false;" href="#" >'+edcal.str_screenoptions+"</a></div>";0===jQuery("#screen-meta-links").length&&
62	+ jQuery("#screen-meta").after('<div id="screen-meta-links"></div>');jQuery("#screen-meta-links").append(a)},toggleOptions:function(){if(edcal.helpMeta)jQuery("#contextual-help-wrap").slideUp("fast"),jQuery("#contextual-help-wrap").html(edcal.helpMeta),edcal.helpMeta=null,jQuery("#show-edcal-settings-link").removeClass("screen-meta-active"),jQuery("#contextual-help-link-wrap").css("visibility","");else{edcal.helpMeta=jQuery("#contextual-help-wrap").html();for(var a='<div class="metabox-prefs calendar-fields-prefs"><h5>'+
63	+ edcal.str_show_opts+'</h5><label for="author-hide"><input type="checkbox" '+edcal.isPrefChecked(edcal.authorPref)+'value="true" id="author-hide" name="author-hide" class="hide-column-tog" />'+edcal.str_opt_author+'</label><label for="status-hide"><input type="checkbox" '+edcal.isPrefChecked(edcal.statusPref)+'value="true" id="status-hide" name="status-hide" class="hide-column-tog" />'+edcal.str_opt_status+'</label><label for="time-hide"><input type="checkbox" '+edcal.isPrefChecked(edcal.timePref)+
64	+ 'value="true" id="time-hide" name="time-hide" class="hide-column-tog" />'+edcal.str_opt_time+'</label></div><div class="metabox-prefs calendar-fields-prefs"><h5>'+edcal.str_show_wheel_opts+'</h5><label for="wheel-support"><input type="checkbox" '+edcal.isPrefChecked(edcal.wheelScrollPref)+'value="true" id="wheel-support" name="wheel-support" class="hide-column-tog" />'+edcal.str_opt_wheel+"</label></div>",a=a+('<div class="metabox-prefs"><h5>'+edcal.str_show_title+'</h5><select id="edcal_weeks_pref" class="screen-per-page" title="'+
65	+ edcal.str_weekstt+'"> '),b=parseInt(edcal.weeksPref,10),c=1;9>c;c++)a=c===b?a+('<option selected="true">'+c+"</option>"):a+("<option>"+c+"</option>");a+="</select>"+edcal.str_opt_weeks+"</div>";a+='<br /><button id="edcal_applyoptions" onclick="edcal.saveOptions(); return false;" class="save button">'+edcal.str_apply+"</button>";jQuery("#contextual-help-wrap").html(a);jQuery("#contextual-help-link-wrap").css("visibility","hidden");jQuery("#contextual-help-wrap").slideDown("normal");jQuery("#screen-meta").show();
66	+ jQuery("#show-edcal-settings-link").addClass("screen-meta-active")}},generateColorPicker:function(a,b,c){a='<div id="'+b+'" class="optionscolorrow">'+('<span style="background-color: '+c+';" class="colorlabel"> '+a+"</span> ");var d="lightred orange yellow lightgreen lightblue purple lightgray".split(" ");edcal.output("colors.length: "+d.length);for(var e=0;e<d.length;e++)a+='<a href="#" class="optionscolor ',d[e]===c&&(a+="colorselected"),a+='" class='+b+d[e]+'" style="background-color: '+d[e]+"; left: "+
67	+ (20*e+50)+'px" onclick="edcal.selectColor(\''+b+"', '"+d[e]+"'); return false;\"></a>";return a+"</div>"},selectColor:function(a,b){edcal.output("selectColor("+a+", "+b+")");jQuery("#"+a+" .colorlabel").css("background-color",b);jQuery("#"+a+" .colorselected").removeClass("colorselected");jQuery("#"+a+"value").addClass("colorselected")},isPrefChecked:function(a){return a?' checked="checked" ':""},saveOptions:function(){var a=parseInt(jQuery("#edcal_weeks_pref").val(),10);if(1>a\|\|8<a)humanMsg.displayMsg(edcal.str_weekserror);
68	+ else{edcal.enableMouseWheel();var b=edcal.ajax_url()+"&action=edcal_saveoptions&weeks="+encodeURIComponent(jQuery("#edcal_weeks_pref").val());jQuery("div.calendar-fields-prefs").find("input, textarea, select").each(function(){b+="&"+encodeURIComponent(this.name)+"="+encodeURIComponent(this.checked)});jQuery.ajax({url:b,type:"POST",processData:!1,timeout:1E5,dataType:"text",success:function(a){window.location.href=window.location.href},error:function(a){edcal.showError(edcal.general_error);a.responseText&&
69	+ edcal.output("saveOptions xhr.responseText: "+a.responseText)}})}},output:function(a){window.console&&console.log(a)},showError:function(a){window.console&&console.error(a);edcal.displayMessage(a)},displayMessage:function(a){humanMsg.displayMsg(a)},getUrlVars:function(){for(var a=[],b,c=window.location.href.slice(window.location.href.indexOf("?")+1).split("&"),d=0;d<c.length;d++)b=c[d].split("="),a.push(b[0]),a[b[0]]=b[1];return a},showFatalError:function(a){jQuery("#edcal_main_title").after('<div class="error below-h2" id="message"><p>'+
70	+ edcal.str_fatal_error+a+"<br></p></div>");window.console&&console.error(a)},chineseAposWorkaround:function(a){return 0===Date.CultureInfo.name.indexOf("zh")\|\|0===Date.CultureInfo.name.indexOf("ja")?a.replace(/'/g,""):a}};jQuery.fn.center=function(){this.css("position","absolute");this.css("top",(jQuery(window).height()-this.outerHeight())/2+jQuery(window).scrollTop()+"px");this.css("left",(jQuery(window).width()-this.outerWidth())/2+jQuery(window).scrollLeft()+"px");return this};
71	+ jQuery(document).ready(function(){try{edcal.init()}catch(a){edcal.output("Error loading calendar: "+a),edcal.showFatalError(a.description)}edcal.getUrlVars().qunit&&edcal_test.runTests()});

3.7.8/edcal.php ADDED Viewed

	@@ -0,0 +1,1420 @@


1	+ <?php
2	+ /*******************************************************************************
3	+ *
4	+ * Licensed under the Apache License, Version 2.0 (the "License");
5	+ * you may not use this file except in compliance with the License.
6	+ * You may obtain a copy of the License at
7	+ *
8	+ * http://www.apache.org/licenses/LICENSE-2.0
9	+ *
10	+ * Unless required by applicable law or agreed to in writing, software
11	+ * distributed under the License is distributed on an "AS IS" BASIS,
12	+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
13	+ * See the License for the specific language governing permissions and
14	+ * limitations under the License.
15	+ *
16	+ ******************************************************************************/
17	+
18	+ /*
19	+ Plugin Name: WordPress Editorial Calendar
20	+ Description: The Editorial Calendar makes it possible to see all your posts and drag and drop them to manage your blog.
21	+ Version: 3.7.8
22	+ Author: Colin Vernon, Justin Evans, Joachim Kudish, Mary Vogt, and Zack Grossbart
23	+ Author URI: http://www.zackgrossbart.com
24	+ Plugin URI: http://stresslimitdesign.com/editorial-calendar-plugin
25	+ */
26	+
27	+
28	+ if ( is_admin() ) {
29	+ global $edcal;
30	+ if ( empty($edcal) )
31	+ $edcal = new EdCal();
32	+ }
33	+
34	+
35	+ /*
36	+ * This error code matches CONCURRENCY_ERROR from edcal.js
37	+ */
38	+ define( 'EDCAL_CONCURRENCY_ERROR', 4 );
39	+
40	+ /*
41	+ * This error code matches PERMISSION_ERROR from edcal.js
42	+ */
43	+ define( 'EDCAL_PERMISSION_ERROR', 5 );
44	+
45	+ /*
46	+ * This error code matches NONCE_ERROR from edcal.js
47	+ */
48	+ define( 'EDCAL_NONCE_ERROR', 6 );
49	+
50	+ class EdCal {
51	+
52	+ protected $supports_custom_types;
53	+ protected $default_time;
54	+
55	+ function __construct() {
56	+ add_action('wp_ajax_edcal_saveoptions', array(&$this, 'edcal_saveoptions'));
57	+ add_action('wp_ajax_edcal_changedate', array(&$this, 'edcal_changedate'));
58	+ add_action('wp_ajax_edcal_savepost', array(&$this, 'edcal_savepost'));
59	+ add_action('wp_ajax_edcal_changetitle', array(&$this, 'edcal_changetitle'));
60	+ add_action('admin_menu', array(&$this, 'edcal_list_add_management_page'));
61	+ add_action('wp_ajax_edcal_posts', array(&$this, 'edcal_posts'));
62	+ add_action('wp_ajax_edcal_getpost', array(&$this, 'edcal_getpost'));
63	+ add_action('wp_ajax_edcal_deletepost', array(&$this, 'edcal_deletepost'));
64	+ add_action("init", array(&$this, 'edcal_load_language'));
65	+
66	+ /*
67	+ * This boolean variable will be used to check whether this
68	+ * installation of WordPress supports custom post types.
69	+ */
70	+ $this->supports_custom_types = function_exists('get_post_types') && function_exists('get_post_type_object');
71	+
72	+ /*
73	+ * This is the default time that posts get created at, for now
74	+ * we are using 10am, but this could become an option later.
75	+ */
76	+ $this->default_time = get_option("edcal_default_time") != "" ? get_option("edcal_default_time") : '10:00';
77	+
78	+ /*
79	+ * This is the default status used for creating new posts.
80	+ */
81	+ $this->default_status = get_option("edcal_default_status") != "" ? get_option("edcal_default_status") : 'draft';
82	+
83	+ /*
84	+ * We use these variables to hold the post dates for the filter when
85	+ * we do our post query.
86	+ */
87	+ //$edcal_startDate;
88	+ //$edcal_endDate;
89	+ }
90	+
91	+ function edcal_load_language() {
92	+ $plugin_dir = basename(dirname(__FILE__));
93	+ load_plugin_textdomain( 'editorial-calendar', 'wp-content/plugins/' . $plugin_dir . '/languages/', $plugin_dir . '/languages/' );
94	+ }
95	+
96	+ /*
97	+ * This function adds our calendar page to the admin UI
98	+ */
99	+ function edcal_list_add_management_page() {
100	+ if (function_exists('add_management_page') ) {
101	+ $page = add_posts_page( __('Calendar', 'editorial-calendar'), __('Calendar', 'editorial-calendar'), 'edit_posts', 'cal', array(&$this, 'edcal_list_admin'));
102	+ add_action( "admin_print_scripts-$page", array(&$this, 'edcal_scripts'));
103	+
104	+ if ($this->supports_custom_types) {
105	+
106	+
107	+ /*
108	+ * We add one calendar for Posts and then we add a separate calendar for each
109	+ * custom post type. This calendar will have an URL like this:
110	+ * /wp-admin/edit.php?post_type=podcasts&page=cal_podcasts
111	+ *
112	+ * We can then use the post_type parameter to show the posts of just that custom
113	+ * type and update the labels for each post type.
114	+ */
115	+ $args = array(
116	+ 'public' => get_option("edcal_custom_posts_public") != "" ? get_option("edcal_custom_posts_public") : true,
117	+ '_builtin' => false
118	+ );
119	+ $output = 'names'; // names or objects
120	+ $operator = 'and'; // 'and' or 'or'
121	+ $post_types = get_post_types($args,$output,$operator);
122	+
123	+ foreach ($post_types as $post_type) {
124	+ $show_this_post_type = apply_filters("edcal_show_calendar_$post_type", true);
125	+ if ($show_this_post_type) {
126	+ $page = add_submenu_page('edit.php?post_type=' . $post_type, __('Calendar', 'editorial-calendar'), __('Calendar', 'editorial-calendar'), 'edit_posts', 'cal_' . $post_type, array(&$this, 'edcal_list_admin'));
127	+ add_action( "admin_print_scripts-$page", array(&$this, 'edcal_scripts'));
128	+ }
129	+ }
130	+ }
131	+ }
132	+ }
133	+
134	+ /*
135	+ * This is a utility function to open a file add it to our
136	+ * output stream. We use this to embed JavaScript and CSS
137	+ * files and cut down on the number of HTTP requests.
138	+ */
139	+ function edcal_echoFile($myFile) {
140	+ $fh = fopen($myFile, 'r');
141	+ $theData = fread($fh, filesize($myFile));
142	+ fclose($fh);
143	+ echo $theData;
144	+ }
145	+
146	+ /*
147	+ * This is the function that generates our admin page. It adds the CSS files and
148	+ * generates the divs that we need for the JavaScript to work.
149	+ */
150	+ function edcal_list_admin() {
151	+
152	+ /*
153	+ * We want to count the number of times they load the calendar
154	+ * so we only show the feedback after they have been using it
155	+ * for a little while.
156	+ */
157	+ $edcal_count = get_option("edcal_count");
158	+ if ($edcal_count == '') {
159	+ $edcal_count = 0;
160	+ add_option("edcal_count", $edcal_count, "", "yes");
161	+ }
162	+
163	+ if (get_option("edcal_do_feedback") != "done") {
164	+ $edcal_count++;
165	+ update_option("edcal_count", $edcal_count);
166	+ }
167	+
168	+ /*
169	+ * This section of code embeds certain CSS and
170	+ * JavaScript files into the HTML. This has the
171	+ * advantage of fewer HTTP requests, but the
172	+ * disadvantage that the browser can't cache the
173	+ * results. We only do this for files that will
174	+ * be used on this page and nowhere else.
175	+ */
176	+
177	+ echo '<!-- This is the styles from time picker.css -->';
178	+ echo '<style type="text/css">';
179	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/lib/timePicker.css");
180	+ echo '</style>';
181	+
182	+ echo '<!-- This is the styles from humanmsg.css -->';
183	+ echo '<style type="text/css">';
184	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/lib/humanmsg.css");
185	+ echo '</style>';
186	+
187	+ echo '<!-- This is the styles from edcal.css -->';
188	+ echo '<style type="text/css">';
189	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/edcal.css");
190	+ echo '</style>';
191	+
192	+ /*
193	+ * We want to add the right to left stylesheet if
194	+ * we're in a right to left language.
195	+ */
196	+ if (__('ltr', 'editorial-calendar') == 'rtl') {
197	+ echo '<!-- This is the styles from edcal_rtl.css -->';
198	+ echo '<style type="text/css">';
199	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/edcal_rtl.css");
200	+ echo '</style>';
201	+ }
202	+
203	+
204	+ ?>
205	+
206	+ <!-- This is just a little script so we can pass the AJAX URL and some localized strings -->
207	+ <script type="text/javascript">
208	+ jQuery(document).ready(function(){
209	+ edcal.plugin_url = '<?php echo(plugins_url("/", __FILE__ )); ?>';
210	+ edcal.wp_nonce = '<?php echo wp_create_nonce("edit-calendar"); ?>';
211	+ <?php
212	+ if (get_option("edcal_weeks_pref") != "") {
213	+ ?>
214	+ edcal.weeksPref = <?php echo(get_option("edcal_weeks_pref")); ?>;
215	+ <?php
216	+ }
217	+ ?>
218	+
219	+ <?php
220	+ if (get_option("edcal_author_pref") != "") {
221	+ ?>
222	+ edcal.authorPref = <?php echo(get_option("edcal_author_pref")); ?>;
223	+ <?php
224	+ }
225	+ ?>
226	+
227	+ <?php
228	+ if (get_option("edcal_time_pref") != "") {
229	+ ?>
230	+ edcal.timePref = <?php echo(get_option("edcal_time_pref")); ?>;
231	+ <?php
232	+ }
233	+ ?>
234	+
235	+ <?php
236	+ if (get_option("edcal_wheelscroll_pref") != "") {
237	+ ?>
238	+ edcal.wheelScrollPref = <?php echo(get_option("edcal_wheelscroll_pref")); ?>;
239	+ <?php
240	+ }
241	+ ?>
242	+
243	+ <?php
244	+ if (get_option("edcal_status_pref") != "") {
245	+ ?>
246	+ edcal.statusPref = <?php echo(get_option("edcal_status_pref")); ?>;
247	+ <?php
248	+ }
249	+ ?>
250	+
251	+ <?php
252	+ if (get_option("edcal_do_feedback") != "done") {
253	+ ?>
254	+ edcal.doFeedbackPref = true;
255	+ edcal.visitCount = <?php echo(get_option("edcal_count")); ?>;
256	+ <?php
257	+ }
258	+ ?>
259	+
260	+ <?php $this->edcal_getLastPost(); ?>
261	+
262	+ edcal.startOfWeek = <?php echo(get_option("start_of_week")); ?>;
263	+ edcal.timeFormat = "<?php echo(get_option("time_format")); ?>";
264	+ edcal.previewDateFormat = "MMMM d";
265	+ edcal.defaultTime = "<?php echo $this->default_time; ?>";
266	+ edcal.defaultStatus = "<?php echo $this->default_status; ?>";
267	+
268	+ /*
269	+ * We want to show the day of the first day of the week to match the user's
270	+ * country code. The problem is that we can't just use the WordPress locale.
271	+ * If the locale was fr-FR so we started the week on Monday it would still
272	+ * say Sunday was the first day if we didn't have a proper language bundle
273	+ * for French. Therefore we must depend on the language bundle writers to
274	+ * specify the locale for the language they are adding.
275	+ *
276	+ */
277	+ edcal.locale = '<?php echo(__('en-US', 'editorial-calendar')) ?>';
278	+
279	+ /*
280	+ * These strings are all localized values. The WordPress localization mechanism
281	+ * doesn't really extend to JavaScript so we localize the strings in PHP and then
282	+ * pass the values to JavaScript.
283	+ */
284	+
285	+ edcal.str_by = <?php echo($this->edcal_json_encode(__('%1$s by %2$s', 'editorial-calendar'))) ?>;
286	+
287	+ edcal.str_addPostLink = <?php echo($this->edcal_json_encode(__('New Post', 'editorial-calendar'))) ?>;
288	+ edcal.str_addDraftLink = <?php echo($this->edcal_json_encode(__('New Draft', 'editorial-calendar'))) ?>;
289	+ edcal.ltr = <?php echo($this->edcal_json_encode(strtolower(__('ltr', 'editorial-calendar')))) ?>;
290	+
291	+ edcal.str_draft = <?php echo($this->edcal_json_encode(__(' [DRAFT]', 'editorial-calendar'))) ?>;
292	+ edcal.str_pending = <?php echo($this->edcal_json_encode(__(' [PENDING]', 'editorial-calendar'))) ?>;
293	+ edcal.str_sticky = <?php echo($this->edcal_json_encode(__(' [STICKY]', 'editorial-calendar'))) ?>;
294	+ edcal.str_draft_sticky = <?php echo($this->edcal_json_encode(__(' [DRAFT, STICKY]', 'editorial-calendar'))) ?>;
295	+ edcal.str_pending_sticky = <?php echo($this->edcal_json_encode(__(' [PENDING, STICKY]', 'editorial-calendar'))) ?>;
296	+ edcal.str_edit = <?php echo($this->edcal_json_encode(__('Edit', 'editorial-calendar'))) ?>;
297	+ edcal.str_quick_edit = <?php echo($this->edcal_json_encode(__('Quick Edit', 'editorial-calendar'))) ?>;
298	+ edcal.str_del = <?php echo($this->edcal_json_encode(__('Delete', 'editorial-calendar'))) ?>;
299	+ edcal.str_view = <?php echo($this->edcal_json_encode(__('View', 'editorial-calendar'))) ?>;
300	+ edcal.str_republish = <?php echo($this->edcal_json_encode(__('Edit', 'editorial-calendar'))) ?>;
301	+ edcal.str_status = <?php echo($this->edcal_json_encode(__('Status:', 'editorial-calendar'))) ?>;
302	+ edcal.str_cancel = <?php echo($this->edcal_json_encode(__('Cancel', 'editorial-calendar'))) ?>;
303	+ edcal.str_posttitle = <?php echo($this->edcal_json_encode(__('Title', 'editorial-calendar'))) ?>;
304	+ edcal.str_postcontent = <?php echo($this->edcal_json_encode(__('Content', 'editorial-calendar'))) ?>;
305	+ edcal.str_newpost = <?php echo($this->edcal_json_encode(__('Add a new post on %s', 'editorial-calendar'))) ?>;
306	+ edcal.str_newdraft = <?php echo($this->edcal_json_encode(__('Add a new draft', 'editorial-calendar'))) ?>;
307	+ edcal.str_newpost_title = <?php echo($this->edcal_json_encode(sprintf(__('New %s - ', 'editorial-calendar'), $this->edcal_get_posttype_singlename()))) ?> ;
308	+ edcal.str_newdraft_title = <?php echo($this->edcal_json_encode(__('New Draft', 'editorial-calendar'))) ?>;
309	+ edcal.str_update = <?php echo($this->edcal_json_encode(__('Update', 'editorial-calendar'))) ?>;
310	+ edcal.str_publish = <?php echo($this->edcal_json_encode(__('Schedule', 'editorial-calendar'))) ?>;
311	+ edcal.str_review = <?php echo($this->edcal_json_encode(__('Submit for Review', 'editorial-calendar'))) ?>;
312	+ edcal.str_save = <?php echo($this->edcal_json_encode(__('Save', 'editorial-calendar'))) ?>;
313	+ edcal.str_edit_post_title = <?php echo($this->edcal_json_encode(__('Edit %1$s - %2$s', 'editorial-calendar'))) ?>;
314	+ edcal.str_scheduled = <?php echo($this->edcal_json_encode(__('Scheduled', 'editorial-calendar'))) ?>;
315	+
316	+ edcal.str_del_msg1 = <?php echo($this->edcal_json_encode(__('You are about to delete the post "', 'editorial-calendar'))) ?>;
317	+ edcal.str_del_msg2 = <?php echo($this->edcal_json_encode(__('". Press Cancel to stop, OK to delete.', 'editorial-calendar'))) ?>;
318	+
319	+ edcal.concurrency_error = <?php echo($this->edcal_json_encode(__('Looks like someone else already moved this post.', 'editorial-calendar'))) ?>;
320	+ edcal.permission_error = <?php echo($this->edcal_json_encode(__('You do not have permission to edit posts.', 'editorial-calendar'))) ?>;
321	+ edcal.checksum_error = <?php echo($this->edcal_json_encode(__('Invalid checksum for post. This is commonly a cross-site scripting error.', 'editorial-calendar'))) ?>;
322	+ edcal.general_error = <?php echo($this->edcal_json_encode(__('There was an error contacting your blog.', 'editorial-calendar'))) ?>;
323	+
324	+ edcal.str_screenoptions = <?php echo($this->edcal_json_encode(__('Screen Options', 'editorial-calendar'))) ?>;
325	+ edcal.str_optionscolors = <?php echo($this->edcal_json_encode(__('Colors', 'editorial-calendar'))) ?>;
326	+ edcal.str_optionsdraftcolor = <?php echo($this->edcal_json_encode(__('Drafts: ', 'editorial-calendar'))) ?>;
327	+ edcal.str_apply = <?php echo($this->edcal_json_encode(__('Apply', 'editorial-calendar'))) ?>;
328	+ edcal.str_show_title = <?php echo($this->edcal_json_encode(__('Show on screen', 'editorial-calendar'))) ?>;
329	+ edcal.str_opt_weeks = <?php echo($this->edcal_json_encode(__(' weeks at a time', 'editorial-calendar'))) ?>;
330	+ edcal.str_show_opts = <?php echo($this->edcal_json_encode(__('Show in Calendar Cell', 'editorial-calendar'))) ?>;
331	+ edcal.str_show_wheel_opts = <?php echo($this->edcal_json_encode(__('Mouse Wheel', 'editorial-calendar'))) ?>;
332	+ edcal.str_opt_author = <?php echo($this->edcal_json_encode(__('Author', 'editorial-calendar'))) ?>;
333	+ edcal.str_opt_status = <?php echo($this->edcal_json_encode(__('Status', 'editorial-calendar'))) ?>;
334	+ edcal.str_opt_time = <?php echo($this->edcal_json_encode(__('Time of day', 'editorial-calendar'))) ?>;
335	+ edcal.str_opt_wheel = <?php echo($this->edcal_json_encode(__('Scroll the calendar with the mouse wheel', 'editorial-calendar'))) ?>;
336	+ edcal.str_fatal_error = <?php echo($this->edcal_json_encode(__('An error occurred while loading the calendar: ', 'editorial-calendar'))) ?>;
337	+ edcal.str_fatal_parse_error = <?php echo($this->edcal_json_encode(__('<br /><br />The calendar was not able to parse the data your blog returned about the posts. This error is most likely caused by a conflict with another plugin on your blog. The actual parse error was:<br/><br/> ', 'editorial-calendar'))) ?>;
338	+
339	+ edcal.str_weekserror = <?php echo($this->edcal_json_encode(__('The calendar can only show between 1 and 8 weeks at a time.', 'editorial-calendar'))) ?>;
340	+ edcal.str_weekstt = <?php echo($this->edcal_json_encode(__('Select the number of weeks for the calendar to show.', 'editorial-calendar'))) ?>;
341	+
342	+ edcal.str_showdrafts = <?php echo($this->edcal_json_encode(__('Show Unscheduled Drafts'))) ?>;
343	+ edcal.str_hidedrafts = <?php echo($this->edcal_json_encode(__('Hide Unscheduled Drafts'))) ?>;
344	+
345	+ edcal.str_feedbackmsg = <?php echo($this->edcal_json_encode(__('<div id="feedbacksection">' .
346	+ '<h2>Help us Make the Editorial Calendar Better</h2>' .
347	+ 'We are always trying to improve the Editorial Calendar and you can help. May we collect some data about your blog and browser settings to help us improve this plugin? We\'ll only do it once and your blog will show up on our <a target="_blank" href="http://www.zackgrossbart.com/edcal/mint/">Editorial Calendar Statistics page</a>.<br /><br />' .
348	+ '<button class="button-secondary" onclick="edcal.doFeedback();">Collect Data</button> ' .
349	+ '<a href="#" id="nofeedbacklink" onclick="edcal.noFeedback(); return false;">No thank you</a></div>', 'editorial-calendar'))) ?>;
350	+
351	+ edcal.str_feedbackdone = <?php echo($this->edcal_json_encode(__('<h2>We\'re done</h2>We\'ve finished collecting data. Thank you for helping us make the calendar better.', 'editorial-calendar'))) ?>;
352	+ });
353	+ </script>
354	+
355	+ <?php
356	+ /*
357	+ * There are a few images we want to reference where we need the full path to the image
358	+ * since we don't want to make assumptions about the plugin file structure. We need to
359	+ * set those here since we need PHP to get the full path.
360	+ */
361	+ ?>
362	+
363	+ <style type="text/css">
364	+ .loadingclass > .postlink, .loadingclass:hover > .postlink, .tiploading {
365	+ background-image: url('<?php echo(admin_url("images/loading.gif", __FILE__ )); ?>');
366	+ }
367	+
368	+ #loading {
369	+ background-image: url('<?php echo(admin_url("images/loading.gif", __FILE__ )); ?>');
370	+ }
371	+
372	+ #tipclose {
373	+ background-image: url('<?php echo(plugins_url("images/tip_close.png", __FILE__ )); ?>');
374	+ }
375	+
376	+ </style>
377	+
378	+ <?php
379	+ echo '<!-- This is the code from edcal.js -->';
380	+ echo '<script type="text/javascript">';
381	+ if (isset($_GET['debug'])) {
382	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/edcal.js");
383	+ } else {
384	+ $this->edcal_echoFile(dirname( __FILE__ ) . "/edcal.min.js");
385	+ }
386	+ echo '</script>';
387	+
388	+ ?>
389	+
390	+ <div class="wrap">
391	+ <div class="icon32" id="icon-edit"><br/></div>
392	+ <h2 id="edcal_main_title"><?php echo sprintf( __('%1$s Calendar', 'editorial-calendar'), $this->edcal_get_posttype_multiplename() ) ?></h2>
393	+
394	+ <div id="loadingcont">
395	+ <div id="loading"> </div>
396	+ </div>
397	+
398	+ <div id="topbar" class="tablenav clearfix">
399	+ <div id="topleft" class="tablenav-pages alignleft">
400	+ <h3>
401	+ <a href="#" title="<?php echo(__('Jump back', 'editorial-calendar')) ?>" class="prev page-numbers" id="prevmonth">&lsaquo;</a>
402	+ <span id="currentRange"></span>
403	+ <a href="#" title="<?php echo(__('Skip ahead', 'editorial-calendar')) ?>" class="next page-numbers" id="nextmonth">&rsaquo;</a>
404	+ <a class="next page-numbers" title="<?php echo(__('Scroll the calendar and make the last post visible', 'editorial-calendar')) ?>" id="moveToLast">»</a>
405	+
406	+ <a class="next page-numbers" title="<?php echo(__('Scroll the calendar and make the today visible', 'editorial-calendar')) ?>" id="moveToToday"><?php echo(__('Show Today', 'editorial-calendar')) ?></a>
407	+
408	+
409	+ </h3>
410	+ </div>
411	+
412	+ <div id="topright" class="tablenav-pages alignright">
413	+ <a class="next page-numbers" title="<?php echo(__('Show unscheduled posts', 'editorial-calendar')) ?>" id="showdraftsdrawer"><?php echo(__('Show Unscheduled Drafts', 'editorial-calendar')) ?></a>
414	+ </div>
415	+ </div>
416	+
417	+ <div id="draftsdrawer_cont">
418	+ <div id="draftsdrawer">
419	+ <div class="draftsdrawerheadcont" title="<?php echo(__('Unscheduled draft posts', 'editorial-calendar')) ?>"><div class="dayhead"><?php echo(__('Unscheduled', 'editorial-calendar')) ?></div></div>
420	+ <div class="day" id="00000000">
421	+ <div id="draftsdrawer_loading"></div>
422	+ <div id="unscheduled" class="dayobj"></div>
423	+ </div>
424	+ </div>
425	+ </div>
426	+
427	+ <div id="cal_cont">
428	+ <div id="edcal_scrollable" class="edcal_scrollable vertical">
429	+ <div id="cal"></div>
430	+ </div>
431	+ </div>
432	+
433	+ <?php $this->edcal_edit_popup(); ?>
434	+
435	+ </div><?php // end .wrap ?>
436	+
437	+ <?php
438	+ }
439	+
440	+ /*
441	+ * Generate the DOM elements for the quick edit popup from
442	+ * within the calendar.
443	+ */
444	+ function edcal_edit_popup() {
445	+
446	+ ?>
447	+ <div id="edcal_quickedit" style="display:none;">
448	+ <div id="tooltiphead">
449	+ <h3 id="tooltiptitle"><?php _e('Edit Post', 'editorial-calendar') ?></h3>
450	+ <a href="#" id="tipclose" onclick="edcal.hideForm(); return false;" title="close"> </a>
451	+ </div>
452	+
453	+ <div class="edcal_quickedit inline-edit-row">
454	+
455	+ <fieldset>
456	+
457	+ <label>
458	+ <span class="title"><?php _e('Title', 'editorial-calendar') ?></span>
459	+ <span class="input-text-wrap"><input type="text" class="ptitle" id="edcal-title-new-field" name="title" /></span>
460	+ </label>
461	+
462	+ <label>
463	+ <span class="title"><?php _e('Content', 'editorial-calendar') ?></span>
464	+ <span class="input-text-wrap"><textarea cols="15" rows="7" id="content" name="content"></textarea></span>
465	+ </label>
466	+
467	+ <div id="timeEditControls">
468	+ <label>
469	+ <span class="title"><?php _e('Time', 'editorial-calendar') ?></span>
470	+ <span class="input-text-wrap"><input type="text" class="ptitle" id="edcal-time" name="time" value="" size="8" maxlength="8" autocomplete="off" /></span>
471	+ </label>
472	+
473	+ <label>
474	+ <span class="title"><?php _e('Status', 'editorial-calendar') ?></span>
475	+ <span class="input-text-wrap">
476	+ <select name="status" id="edcal-status">
477	+ <option value="draft"><?php _e('Draft', 'editorial-calendar') ?></option>
478	+ <option value="pending"><?php _e('Pending Review', 'editorial-calendar') ?></option>
479	+ <?php if ( current_user_can('publish_posts') ) {?>
480	+ <option id="futureoption" value="future"><?php _e('Scheduled', 'editorial-calendar') ?></option>
481	+ <?php } ?>
482	+ </select>
483	+ </span>
484	+ </label>
485	+ </div>
486	+
487	+ <?php /* <label>
488	+ <span class="title"><?php _e('Author', 'editorial-calendar') ?></span>
489	+ <span id="edcal-author-p"><!-- Placeholder for the author's name, added dynamically --></span>
490	+ </label>
491	+ */ ?>
492	+ </fieldset>
493	+
494	+ <p class="submit inline-edit-save" id="edit-slug-buttons">
495	+ <a class="button-primary disabled" id="newPostScheduleButton" href="#"><?php _e('Schedule', 'editorial-calendar') ?></a>
496	+ <a href="#" onclick="edcal.hideForm(); return false;" class="button-secondary cancel"><?php _e('Cancel', 'editorial-calendar') ?></a>
497	+ </p>
498	+
499	+ <input type="hidden" id="edcal-date" name="date" value="" />
500	+ <input type="hidden" id="edcal-id" name="id" value="" />
501	+
502	+ </div><?php // end .tooltip ?>
503	+ </div><?php // end #tooltip
504	+ }
505	+
506	+ /*
507	+ * When we get a set of posts to populate the calendar we don't want
508	+ * to get all of the posts. This filter allows us to specify the dates
509	+ * we want. We also exclude posts that have not been set to a specific date.
510	+ */
511	+ function edcal_filter_where($where = '') {
512	+ global $edcal_startDate, $edcal_endDate;
513	+ if ($edcal_startDate == '00000000') {
514	+ $where .= " AND post_date_gmt LIKE '0000%'";
515	+ } else {
516	+ /*
517	+ * The start date and end date come from the client and we want to make
518	+ * sure there's no SQL injection attack here. We know these values must
519	+ * be dates in a format like 2013-02-03. Date parsing is complex and PHP
520	+ * dates allow a lot of different formats. The simplest way to make sure
521	+ * this isn't a SQL injection attack is to remove the dashes and check if
522	+ * the result is numeric. If it is then this can't be a SQL injection attack.
523	+ */
524	+ if (!is_numeric(str_replace("-", "", $edcal_startDate)) \|\| !is_numeric(str_replace("-", "", $edcal_endDate))) {
525	+ die("The specified start date and end date for the posts query must be numeric.");
526	+ }
527	+
528	+ $where .= " AND post_date >= '" . $edcal_startDate . "' AND post_date < '" . $edcal_endDate . "' AND post_date_gmt NOT LIKE '0000%'";
529	+ }
530	+ return $where;
531	+ }
532	+
533	+ /*
534	+ * This function adds all of the JavaScript files we need.
535	+ *
536	+ */
537	+ function edcal_scripts() {
538	+ /*
539	+ * To get proper localization for dates we need to include the correct JavaScript file for the current
540	+ * locale. We can do this based on the locale in the localized bundle to make sure the date locale matches
541	+ * the locale for the other strings.
542	+ */
543	+ wp_enqueue_script('jquery');
544	+ wp_enqueue_script('jquery-ui-draggable');
545	+ wp_enqueue_script('jquery-ui-droppable');
546	+
547	+ //wp_enqueue_script("date-extras", plugins_url("lib/date.extras.js", __FILE__ ), array( 'jquery' ));
548	+
549	+ wp_enqueue_script("edcal-date", plugins_url("lib/languages/date-".__('en-US', 'editorial-calendar').".js", __FILE__ ));
550	+ wp_enqueue_script("edcal-lib", plugins_url("lib/edcallib.min.js", __FILE__ ), array( 'jquery' ));
551	+
552	+ if (isset($_GET['qunit'])) {
553	+ wp_enqueue_script("qunit", plugins_url("lib/qunit.js", __FILE__ ), array( 'jquery' ));
554	+ wp_enqueue_script("edcal-test", plugins_url("edcal_test.js", __FILE__ ), array( 'jquery' ));
555	+ }
556	+
557	+ return;
558	+
559	+ /*
560	+ * If you're using one of the specific libraries you should comment out the two lines
561	+ * above this comment.
562	+ */
563	+ wp_enqueue_script("bgiframe", plugins_url("lib/jquery.bgiframe.js", __FILE__ ), array( 'jquery' ));
564	+ wp_enqueue_script("humanMsg", plugins_url("lib/humanmsg.js", __FILE__ ), array( 'jquery' ));
565	+ wp_enqueue_script("jquery-timepicker", plugins_url("lib/jquery.timepicker.js", __FILE__ ), array( 'jquery' ));
566	+
567	+ wp_enqueue_script("scrollable", plugins_url("lib/tools.scrollable-1.1.2.js", __FILE__ ), array( 'jquery' ));
568	+ wp_enqueue_script("mouse-wheel", plugins_url("lib/lib/tools.scrollable.mousewheel-1.0.1.js", __FILE__ ), array( 'jquery' ));
569	+
570	+ wp_enqueue_script("json-parse2", plugins_url("lib/json2.js", __FILE__ ), array( 'jquery' ));
571	+ }
572	+
573	+ /*
574	+ * This is an AJAX call that gets the posts between the from date
575	+ * and the to date.
576	+ */
577	+ function edcal_posts() {
578	+ header("Content-Type: application/json");
579	+ $this->edcal_addNoCacheHeaders();
580	+ if (!$this->edcal_checknonce()) {
581	+ die();
582	+ }
583	+
584	+ global $edcal_startDate, $edcal_endDate;
585	+
586	+ $edcal_startDate = isset($_GET['from']) ? $_GET['from'] : null;
587	+ $edcal_endDate = isset($_GET['to']) ? $_GET['to'] : null;
588	+ global $post;
589	+ $args = array(
590	+ 'posts_per_page' => -1,
591	+ 'post_status' => "publish&future&draft",
592	+ 'post_parent' => null // any parent
593	+ );
594	+
595	+ /*
596	+ * If we're in the specific post type case we need to add
597	+ * the post type to our query.
598	+ */
599	+ $post_type = isset($_GET['post_type'])?$_GET['post_type']:null;
600	+ if ($post_type) {
601	+ $args['post_type'] = $post_type;
602	+ }
603	+
604	+ /*
605	+ * If we're getting the list of posts for the drafts drawer we
606	+ * want to sort them by the post title.
607	+ */
608	+ if ($edcal_startDate == '00000000') {
609	+ $args['orderby'] = 'title';
610	+ }
611	+
612	+ /*
613	+ * We add a WHERE clause to filter by calendar date and/or by whether
614	+ * or not the posts have been scheduled to a specific date:
615	+ * WHERE `post_date_gmt` = '0000-00-00 00:00:00'
616	+ */
617	+ add_filter( 'posts_where', array(&$this, 'edcal_filter_where' ));
618	+ $myposts = query_posts($args);
619	+ remove_filter( 'posts_where', array(&$this, 'edcal_filter_where' ));
620	+
621	+ ?>[
622	+ <?php
623	+ $size = sizeof($myposts);
624	+
625	+ for($i = 0; $i < $size; $i++) {
626	+ $post = $myposts[$i];
627	+ $this->edcal_postJSON($post, $i < $size - 1);
628	+ }
629	+
630	+ ?> ]
631	+ <?php
632	+
633	+ die();
634	+ }
635	+
636	+ /*
637	+ * This filter specifies a special WHERE clause so we just get the posts we're
638	+ * interested in for the last post.
639	+ */
640	+ function edcal_lastpost_filter_where($where = '') {
641	+ $where .= " AND (`post_status` = 'draft' OR `post_status` = 'publish' OR `post_status` = 'future')";
642	+ return $where;
643	+ }
644	+
645	+ /*
646	+ * Get information about the last post (the one furthest in the future) and make
647	+ * that information available to the JavaScript code so it can make the last post
648	+ * button work.
649	+ */
650	+ function edcal_getLastPost() {
651	+ $args = array(
652	+ 'posts_per_page' => 1,
653	+ 'post_parent' => null,
654	+ 'order' => 'DESC'
655	+ );
656	+
657	+ add_filter( 'posts_where', array(&$this, 'edcal_lastpost_filter_where' ));
658	+ $myposts = query_posts($args);
659	+ remove_filter( 'posts_where', array(&$this, 'edcal_lastpost_filter_where' ));
660	+
661	+ if (sizeof($myposts) > 0) {
662	+ $post = $myposts[0];
663	+ setup_postdata($post);
664	+ ?>
665	+ edcal.lastPostDate = '<?php echo(date('dmY',strtotime($post->post_date))); ?>';
666	+ edcal.lastPostId = '<?php echo($post->ID); ?>';
667	+ <?php
668	+ } else {
669	+ ?>
670	+ edcal.lastPostDate = '-1';
671	+ edcal.lastPostId = '-1';
672	+ <?php
673	+ }
674	+ }
675	+
676	+ /*
677	+ * This is for an AJAX call that returns a post with the specified ID
678	+ */
679	+ function edcal_getpost() {
680	+
681	+ header("Content-Type: application/json");
682	+ $this->edcal_addNoCacheHeaders();
683	+
684	+ // If nonce fails, return
685	+ if (!$this->edcal_checknonce()) {
686	+ die();
687	+ }
688	+
689	+ $post_id = isset($_GET['postid'])?intval($_GET['postid']):-1;
690	+
691	+ // If a proper post_id wasn't passed, return
692	+ if(!$post_id) die();
693	+
694	+ $args = array(
695	+ 'post__in' => array($post_id)
696	+ );
697	+
698	+ /*
699	+ * If we're in the specific post type case we need to add
700	+ * the post type to our query.
701	+ */
702	+ $post_type = isset($_GET['post_type'])?$_GET['post_type']:null;
703	+ if ($post_type) {
704	+ $args['post_type'] = $post_type;
705	+ }
706	+
707	+ $post = query_posts($args);
708	+
709	+ // get_post and setup_postdata don't get along, so we're doing a mini-loop
710	+ if(have_posts()) :
711	+ while(have_posts()) : the_post();
712	+ ?>
713	+ {
714	+ "post" :
715	+ <?php
716	+ $this->edcal_postJSON($post[0], false, true);
717	+ ?>
718	+ }
719	+ <?php
720	+ endwhile;
721	+ endif;
722	+ die();
723	+ }
724	+
725	+ /*
726	+ * Wrap php's json_encode() for a WP-specific apostrophe bug
727	+ */
728	+ function edcal_json_encode($string) {
729	+ /*
730	+ * WordPress escapes apostrophe's when they show up in post titles as '
731	+ * This is the HTML ASCII code for a straight apostrophe. This works well
732	+ * with Firefox, but IE complains with a very unhelpful error message. We
733	+ * can replace them with a right curly apostrophe since that works in IE
734	+ * and Firefox. It is also a little nicer typographically.
735	+ *
736	+ */
737	+ return json_encode(str_replace("'", "", $string));
738	+ }
739	+
740	+ /*
741	+ * This helper functions gets the plural name of the post
742	+ * type specified by the post_type parameter.
743	+ */
744	+ function edcal_get_posttype_multiplename() {
745	+
746	+ $post_type = isset($_GET['post_type'])?$_GET['post_type']:null;
747	+ if (!$post_type) {
748	+ return __('Posts ', 'editorial-calendar');
749	+ }
750	+
751	+ $postTypeObj = get_post_type_object($post_type);
752	+ return $postTypeObj->labels->name;
753	+ }
754	+
755	+ /*
756	+ * This helper functions gets the singular name of the post
757	+ * type specified by the post_type parameter.
758	+ */
759	+
760	+ function edcal_get_posttype_singlename() {
761	+
762	+ $post_type = isset($_GET['post_type'])?$_GET['post_type']:null;
763	+ if (!$post_type) {
764	+ return __('Post ', 'editorial-calendar');
765	+ }
766	+
767	+ $postTypeObj = get_post_type_object($post_type);
768	+ return $postTypeObj->labels->singular_name;
769	+ }
770	+
771	+ /*
772	+ * This function sets up the post data and prints out the values we
773	+ * care about in a JSON data structure. This prints out just the
774	+ * value part. If $fullPost is set to true, post_content is also returned.
775	+ */
776	+ function edcal_postJSON($post, $addComma = true, $fullPost = false) {
777	+ $timeFormat = get_option("time_format");
778	+ if ($timeFormat == "g:i a") {
779	+ $timeFormat = "ga";
780	+ } else if ($timeFormat == "g:i A") {
781	+ $timeFormat = "gA";
782	+ } else if ($timeFormat == "H:i") {
783	+ $timeFormat = "H";
784	+ }
785	+
786	+ setup_postdata($post);
787	+
788	+ if (get_post_status() == 'auto-draft' \|\| get_post_status() == 'inherit' \|\| get_post_status() == 'trash' ) {
789	+ /*
790	+ * WordPress 3 added a new post status of auto-draft so
791	+ * we want to hide them from the calendar.
792	+ * We also want to hide posts with type 'inherit'
793	+ */
794	+ return;
795	+ }
796	+
797	+ /*
798	+ * We want to return the type of each post as part of the
799	+ * JSON data about that post. Right now this will always
800	+ * match the post_type parameter for the calendar, but in
801	+ * the future we might support a mixed post type calendar
802	+ * and this extra data will become useful. Right now we
803	+ * are using this data for the title on the quick edit form.
804	+ */
805	+ if( $this->supports_custom_types ) {
806	+ $postTypeObj = get_post_type_object(get_post_type( $post ));
807	+ $postTypeTitle = $postTypeObj->labels->singular_name;
808	+ } else {
809	+ $postTypeTitle = 'post';
810	+ }
811	+
812	+ $post_date_gmt = date('dmY',strtotime($post->post_date_gmt));
813	+ if ($post_date_gmt == '01011970') {
814	+ $post_date_gmt = '00000000';
815	+ }
816	+
817	+ /*
818	+ * The date function in PHP isn't consistent in the way it handles
819	+ * formatting dates that are all zeros. In that case we can manually
820	+ * format the all zeros date so it shows up properly.
821	+ */
822	+ if ($post->post_date_gmt == '0000-00-00 00:00:00') {
823	+ $post_date_gmt = '00000000';
824	+ }
825	+
826	+ $slugs = '';
827	+ foreach(get_the_category() as $category) {
828	+ $slugs .= $category->slug . ' ';
829	+ }
830	+
831	+ ?>
832	+ {
833	+ "date" : "<?php the_time('d') ?><?php the_time('m') ?><?php the_time('Y') ?>",
834	+ "date_gmt" : "<?php echo $post_date_gmt; ?>",
835	+ "time" : "<?php echo trim(get_the_time()) ?>",
836	+ "formattedtime" : "<?php $this->edcal_json_encode(the_time($timeFormat)) ?>",
837	+ "sticky" : "<?php echo is_sticky($post->ID) ?>",
838	+ "url" : "<?php $this->edcal_json_encode(the_permalink()) ?>",
839	+ "status" : "<?php echo get_post_status() ?>",
840	+ "orig_status" : "<?php echo get_post_status() ?>",
841	+ "title" : <?php echo $this->edcal_json_encode(isset( $post->post_title ) ? $post->post_title : '') ?>,
842	+ "author" : <?php echo $this->edcal_json_encode(get_the_author()) ?>,
843	+ "type" : "<?php echo get_post_type( $post ) ?>",
844	+ "typeTitle" : "<?php echo $postTypeTitle ?>",
845	+ "slugs" : <?php echo $this->edcal_json_encode($slugs) ?>,
846	+
847	+ <?php if ( current_user_can('edit_post', $post->ID) ) {?>
848	+ "editlink" : "<?php echo get_edit_post_link($post->ID) ?>",
849	+ <?php } ?>
850	+
851	+ <?php if ( current_user_can('delete_post', $post->ID) ) {?>
852	+ "dellink" : "javascript:edcal.deletePost(<?php echo $post->ID ?>)",
853	+ <?php } ?>
854	+
855	+ "permalink" : "<?php echo get_permalink($post->ID) ?>",
856	+ "id" : "<?php the_ID(); ?>"
857	+
858	+ <?php if($fullPost) : ?>
859	+ , "content" : <?php echo $this->edcal_json_encode($post->post_content) ?>
860	+
861	+ <?php endif; ?>
862	+ }
863	+ <?php
864	+ if ($addComma) {
865	+ ?>,<?php
866	+ }
867	+ }
868	+
869	+ /*
870	+ * This is a helper AJAX function to delete a post. It gets called
871	+ * when a user clicks the delete button, and allows the user to
872	+ * retain their position within the calendar without a page refresh.
873	+ * It is not called unless the user has permission to delete the post.
874	+ */
875	+ function edcal_deletepost() {
876	+ if (!$this->edcal_checknonce()) {
877	+ die();
878	+ }
879	+
880	+ header("Content-Type: application/json");
881	+ $this->edcal_addNoCacheHeaders();
882	+
883	+ $edcal_postid = isset($_GET['postid'])?$_GET['postid']:null;
884	+
885	+ if (!current_user_can('delete_post', $edcal_postid)) {
886	+ die("You don't have permission to delete this post");
887	+ }
888	+
889	+ $post = get_post($edcal_postid, ARRAY_A);
890	+ $title = $post['post_title'];
891	+ $date = date('dmY', strtotime($post['post_date'])); // [TODO] : is there a better way to generate the date string ... ??
892	+ $date_gmt = date('dmY',strtotime($post['post_date_gmt']));
893	+ if ($date_gmt == '01011970') {
894	+ $date_gmt = '00000000';
895	+ }
896	+
897	+ $force = !EMPTY_TRASH_DAYS; // wordpress 2.9 thing. deleted post hangs around (ie in a recycle bin) after deleted for this # of days
898	+ if ( isset($post->post_type) && ($post->post_type == 'attachment' )) {
899	+ $force = ( $force \|\| !MEDIA_TRASH );
900	+ if ( ! wp_delete_attachment($edcal_postid, $force) )
901	+ wp_die( __('Error in deleting...') );
902	+ } else {
903	+ if ( !wp_delete_post($edcal_postid, $force) )
904	+ wp_die( __('Error in deleting...') );
905	+ }
906	+
907	+ // return the following info so that jQuery can then remove post from edcal display :
908	+ ?>
909	+ {
910	+ "post" :
911	+ {
912	+ "date" : "<?php echo $date ?>",
913	+ "title" : "<?php echo $title ?>",
914	+ "id" : "<?php echo $edcal_postid ?>",
915	+ "date_gmt" : "<?php echo $date_gmt; ?>"
916	+ }
917	+ }
918	+ <?php
919	+
920	+ die();
921	+ }
922	+
923	+ /*
924	+ * This is a helper AJAX function to change the title of a post. It
925	+ * gets called from the save button in the tooltip when you change a
926	+ * post title in a calendar.
927	+ */
928	+ function edcal_changetitle() {
929	+ if (!$this->edcal_checknonce()) {
930	+ die();
931	+ }
932	+
933	+ header("Content-Type: application/json");
934	+ $this->edcal_addNoCacheHeaders();
935	+
936	+ $edcal_postid = isset($_GET['postid'])?$_GET['postid']:null;
937	+ $edcal_newTitle = isset($_GET['title'])?$_GET['title']:null;
938	+
939	+ $post = get_post($edcal_postid, ARRAY_A);
940	+ setup_postdata($post);
941	+
942	+ $post['post_title'] = wp_strip_all_tags($edcal_newTitle);
943	+
944	+ /*
945	+ * Now we finally update the post into the database
946	+ */
947	+ wp_update_post( $post );
948	+
949	+ /*
950	+ * We finish by returning the latest data for the post in the JSON
951	+ */
952	+ global $post;
953	+ $args = array(
954	+ 'posts_id' => $edcal_postid,
955	+ );
956	+
957	+ $post = get_post($edcal_postid);
958	+
959	+ ?>{
960	+ "post" :
961	+ <?php
962	+
963	+ $this->edcal_postJSON($post);
964	+
965	+ ?>
966	+ }
967	+ <?php
968	+
969	+
970	+ die();
971	+ }
972	+
973	+ /*
974	+ * This is a helper function to create a new blank draft
975	+ * post on a specified date.
976	+ */
977	+ function edcal_newdraft() {
978	+ if (!$this->edcal_checknonce()) {
979	+ die();
980	+ }
981	+
982	+ header("Content-Type: application/json");
983	+ $this->edcal_addNoCacheHeaders();
984	+
985	+ $edcal_date = isset($_POST["date"])?$_POST["date"]:null;
986	+
987	+ $my_post = array();
988	+ $my_post['post_title'] = isset($_POST["title"])?wp_strip_all_tags($_POST["title"]):null;
989	+ $my_post['post_content'] = isset($_POST["content"])?$_POST["content"]:null;
990	+ $my_post['post_status'] = 'draft';
991	+
992	+ $my_post['post_date'] = $edcal_date;
993	+ $my_post['post_date_gmt'] = get_gmt_from_date($edcal_date);
994	+ $my_post['post_modified'] = $edcal_date;
995	+ $my_post['post_modified_gmt'] = get_gmt_from_date($edcal_date);
996	+
997	+ // Insert the post into the database
998	+ $my_post_id = wp_insert_post( $my_post );
999	+
1000	+ /*
1001	+ * We finish by returning the latest data for the post in the JSON
1002	+ */
1003	+ global $post;
1004	+ $post = get_post($my_post_id);
1005	+
1006	+ ?>{
1007	+ "post" :
1008	+ <?php
1009	+
1010	+ $this->edcal_postJSON($post, false);
1011	+
1012	+ ?>
1013	+ }
1014	+ <?php
1015	+
1016	+ die();
1017	+ }
1018	+
1019	+ /*
1020	+ * This is a helper function to create a new draft post on a specified date
1021	+ * or update an existing post.
1022	+ */
1023	+ function edcal_savepost() {
1024	+
1025	+ if (!$this->edcal_checknonce()) {
1026	+ die();
1027	+ }
1028	+
1029	+ // Most blogs have warnings turned off by default, but if they're
1030	+ // turned on the warnings can cause errors in the JSON data when
1031	+ // we change the post status so we set the warning level to hide
1032	+ // warnings and then reset it at the end of this function.
1033	+ $my_error_level = error_reporting();
1034	+ error_reporting(E_ERROR);
1035	+
1036	+ header("Content-Type: application/json");
1037	+ $this->edcal_addNoCacheHeaders();
1038	+
1039	+ $edcal_date = isset($_POST["date"])?$_POST["date"]:null;
1040	+ $edcal_date_gmt = isset($_POST["date_gmt"])?$_POST["date_gmt"]:get_gmt_from_date($edcal_date);
1041	+
1042	+ $my_post = array();
1043	+
1044	+ // If the post id is not specified, we're creating a new post
1045	+ if($_POST['id'] && intval($_POST['id']) > 0) {
1046	+ $my_post['ID'] = intval($_POST['id']);
1047	+ } else {
1048	+ // We have a new post
1049	+ //$my_post['ID'] = 0; // and the post ID to 0
1050	+
1051	+ // Set the status to draft unless the user otherwise specifies
1052	+ if ($_POST['status']) {
1053	+ $my_post['post_status'] = $_POST['status'];
1054	+ } else {
1055	+ $my_post['post_status'] = 'draft';
1056	+ }
1057	+ }
1058	+
1059	+ $my_post['post_title'] = isset($_POST["title"])?wp_strip_all_tags($_POST["title"]):null;
1060	+ $my_post['post_content'] = isset($_POST["content"])?$_POST["content"]:null;
1061	+
1062	+ if ($edcal_date_gmt != '0000-00-00 00:00:00') {
1063	+ /*
1064	+ * We don't want to set a date if this a new post in the drafts
1065	+ * drawer since WordPress 3.5 will reject new posts with a 0000
1066	+ * GMT date.
1067	+ */
1068	+ $my_post['post_date'] = $edcal_date;
1069	+ $my_post['post_date_gmt'] = $edcal_date_gmt;
1070	+ $my_post['post_modified'] = $edcal_date;
1071	+ $my_post['post_modified_gmt'] = $edcal_date_gmt;
1072	+ }
1073	+
1074	+ $my_post['post_status'] = $_POST['status'];
1075	+
1076	+ /*
1077	+ * When we create a new post we need to specify the post type
1078	+ * passed in from the JavaScript.
1079	+ */
1080	+ $post_type = isset($_POST["post_type"])?$_POST["post_type"]:null;
1081	+ if ($post_type) {
1082	+ $my_post['post_type'] = $post_type;
1083	+ }
1084	+
1085	+ // If we are updating a post
1086	+ if($_POST['id']) {
1087	+ if ($_POST['status'] != $_POST['orig_status']) {
1088	+ wp_transition_post_status($_POST['status'], $_POST['orig_status'], $my_post);
1089	+ $my_post['post_status'] = $_POST['status'];
1090	+ }
1091	+ $my_post_id = wp_update_post($my_post);
1092	+ } else {
1093	+ // We have a new post, insert the post into the database
1094	+ $my_post_id = wp_insert_post($my_post, true);
1095	+ }
1096	+
1097	+ // TODO: throw error if update/insert or getsinglepost fails
1098	+ /*
1099	+ * We finish by returning the latest data for the post in the JSON
1100	+ */
1101	+ $args = array(
1102	+ 'post__in' => array($my_post_id)
1103	+ );
1104	+
1105	+ if ($post_type) {
1106	+ $args['post_type'] = $post_type;
1107	+ }
1108	+ $post = query_posts($args);
1109	+
1110	+ // get_post and setup_postdata don't get along, so we're doing a mini-loop
1111	+ if(have_posts()) :
1112	+ while(have_posts()) : the_post();
1113	+ ?>
1114	+ {
1115	+ "post" :
1116	+ <?php
1117	+ $this->edcal_postJSON($post[0], false);
1118	+ ?>
1119	+ }
1120	+ <?php
1121	+ endwhile;
1122	+ endif;
1123	+
1124	+ error_reporting($my_error_level);
1125	+
1126	+ die();
1127	+ }
1128	+
1129	+ /*
1130	+ * This function checks the nonce for the URL. It returns
1131	+ * true if the nonce checks out and outputs a JSON error
1132	+ * and returns false otherwise.
1133	+ */
1134	+ function edcal_checknonce() {
1135	+ header("Content-Type: application/json");
1136	+ $this->edcal_addNoCacheHeaders();
1137	+
1138	+ if (!wp_verify_nonce($_REQUEST['_wpnonce'], 'edit-calendar')) {
1139	+ /*
1140	+ * This is just a sanity check to make sure
1141	+ * this isn't a CSRF attack. Most of the time this
1142	+ * will never be run because you can't see the calendar unless
1143	+ * you are at least an editor
1144	+ */
1145	+ ?>
1146	+ {
1147	+ "error": <?php echo(EDCAL_NONCE_ERROR); ?>
1148	+ }
1149	+ <?php
1150	+ return false;
1151	+ }
1152	+ return true;
1153	+ }
1154	+
1155	+ /*
1156	+ * This function changes the date on a post. It does optimistic
1157	+ * concurrency checking by comparing the original post date from
1158	+ * the browser with the one from the database. If they don't match
1159	+ * then it returns an error code and the updated post data.
1160	+ *
1161	+ * If the call is successful then it returns the updated post data.
1162	+ */
1163	+ function edcal_changedate() {
1164	+ if (!$this->edcal_checknonce()) {
1165	+ die();
1166	+ }
1167	+ header("Content-Type: application/json");
1168	+ $this->edcal_addNoCacheHeaders();
1169	+
1170	+ $edcal_postid = isset($_GET['postid'])?$_GET['postid']:null;
1171	+ $edcal_newDate = isset($_GET['newdate'])?$_GET['newdate']:null;
1172	+ $edcal_oldDate = isset($_GET['olddate'])?$_GET['olddate']:null;
1173	+ $edcal_postStatus = isset($_GET['postStatus'])?$_GET['postStatus']:null;
1174	+ $move_to_drawer = $edcal_newDate == '0000-00-00';
1175	+ $move_from_drawer = $edcal_oldDate == '00000000';
1176	+
1177	+ global $post;
1178	+ $args = array(
1179	+ 'posts_id' => $edcal_postid,
1180	+ );
1181	+ $post = get_post($edcal_postid);
1182	+ setup_postdata($post);
1183	+
1184	+ /*
1185	+ * Posts in WordPress have more than one date. There is the GMT date,
1186	+ * the date in the local time zone, the modified date in GMT and the
1187	+ * modified date in the local time zone. We update all of them.
1188	+ */
1189	+ if ( $move_from_drawer ) {
1190	+ /*
1191	+ * Set the date to 'unscheduled' [ie. 0]. We use this date
1192	+ * further down in the concurrency check, and this will make the dates
1193	+ * technically off by 10 hours, but it's still the same day. We only do
1194	+ * this for posts that were created as drafts. Works for now, but
1195	+ * we would have to revamp this if we use an actual timestamp check.
1196	+ */
1197	+ $post->post_date = '0000-00-00 ' . date('H:i:s', strtotime($post->post_date));
1198	+ } else if ( $move_to_drawer ) {
1199	+ // echo ( "\r\npost->post_date_gmt=".$post->post_date_gmt);
1200	+ $post->post_date_gmt = $post->post_date;
1201	+ } else {
1202	+ // set the scheduled time as our original time
1203	+ $post->post_date_gmt = $post->post_date;
1204	+ }
1205	+ // echo ( "\r\npost->post_date_gmt = $post->post_date_gmt \r\npost->post_date = $post->post_date");
1206	+
1207	+ /*
1208	+ * Error-checking:
1209	+ */
1210	+ $error = false;
1211	+ if (!current_user_can('edit_post', $edcal_postid)) {
1212	+ /*
1213	+ * This is just a sanity check to make sure that the current
1214	+ * user has permission to edit posts. Most of the time this
1215	+ * will never be run because you can't see the calendar unless
1216	+ * you are at least an editor.
1217	+ */
1218	+ $error = EDCAL_PERMISSION_ERROR;
1219	+ } else if ( date('Y-m-d', strtotime($post->post_date)) != date('Y-m-d', strtotime($edcal_oldDate)) ) {
1220	+ /*
1221	+ * We are doing optimistic concurrency checking on the dates. If
1222	+ * the user tries to move a post we want to make sure nobody else
1223	+ * has moved that post since the page was last updated. If the
1224	+ * old date in the database doesn't match the old date from the
1225	+ * browser then we return an error to the browser along with the
1226	+ * updated post data.
1227	+ */
1228	+ $error = EDCAL_CONCURRENCY_ERROR;
1229	+ }
1230	+
1231	+ if ( $error ) {
1232	+ // die('error= '.$error);
1233	+ ?>
1234	+ {
1235	+ "error": <?php echo $error; ?>,
1236	+ "post" :
1237	+ <?php
1238	+ $this->edcal_postJSON($post, false, true);
1239	+ ?> }
1240	+
1241	+ <?php
1242	+ die();
1243	+ }
1244	+
1245	+
1246	+ /*
1247	+ * No errors, so let's go create our new post parameters to update
1248	+ */
1249	+
1250	+ $updated_post = array();
1251	+ $updated_post['ID'] = $edcal_postid;
1252	+
1253	+ if ( !$move_to_drawer ) {
1254	+ $updated_post['post_date'] = $edcal_newDate . substr($post->post_date, strlen($edcal_newDate));
1255	+ }
1256	+
1257	+ /*
1258	+ * When a user creates a draft and never sets a date or publishes it
1259	+ * then the GMT date will have a timestamp of 00:00:00 to indicate
1260	+ * that the date hasn't been set. In that case we need to specify
1261	+ * an edit date or the wp_update_post function will strip our new
1262	+ * date out and leave the post as publish immediately.
1263	+ */
1264	+ $needsEditDate = preg_match( '/^0000/', $post->post_date_gmt );
1265	+
1266	+ if ( $needsEditDate ) {
1267	+ // echo "\r\nneeds edit date\r\n";
1268	+ $updated_post['edit_date'] = $edcal_newDate . substr($post->post_date, strlen($edcal_newDate));
1269	+ }
1270	+
1271	+ if ( $move_to_drawer ) {
1272	+ $updated_post['post_date_gmt'] = "0000-00-00 00:00:00";
1273	+ $updated_post['edit_date'] = $post->post_date;
1274	+ } else if ( $move_from_drawer ) {
1275	+ $updated_post['post_date_gmt'] = get_gmt_from_date($post->post_date);
1276	+ $updated_post['post_modified_gmt'] = get_gmt_from_date($post->post_date);
1277	+ }
1278	+
1279	+ /*
1280	+ * We need to make sure to use the GMT formatting for the date.
1281	+ */
1282	+ if ( !$move_to_drawer ) {
1283	+ $updated_post['post_date_gmt'] = get_gmt_from_date($updated_post['post_date']);
1284	+ $updated_post['post_modified'] = $edcal_newDate . substr($post->post_modified, strlen($edcal_newDate));
1285	+ $updated_post['post_modified_gmt'] = get_gmt_from_date($updated_post['post_date']);
1286	+ }
1287	+
1288	+ if ($edcal_postStatus != $post->post_status) {
1289	+ /*
1290	+ * We only want to update the post status if it has changed.
1291	+ * If the post status has changed that takes a few more steps
1292	+ */
1293	+ wp_transition_post_status($edcal_postStatus, $post->post_status, $post);
1294	+ $updated_post['post_status'] = $edcal_postStatus;
1295	+
1296	+ // Update counts for the post's terms.
1297	+ foreach ( (array) get_object_taxonomies('post') as $taxonomy ) {
1298	+ $tt_ids = wp_get_object_terms($post_id, $taxonomy, 'fields=tt_ids');
1299	+ wp_update_term_count($tt_ids, $taxonomy);
1300	+ }
1301	+
1302	+ do_action('edit_post', $edcal_postid, $post);
1303	+ do_action('save_post', $edcal_postid, $post);
1304	+ do_action('wp_insert_post', $edcal_postid, $post);
1305	+ }
1306	+
1307	+ // die(var_dump($updated_post).'success!');
1308	+ /*
1309	+ * Now we finally update the post into the database
1310	+ */
1311	+ wp_update_post( $updated_post );
1312	+
1313	+ /*
1314	+ * We finish by returning the latest data for the post in the JSON
1315	+ */
1316	+ global $post;
1317	+ $args = array(
1318	+ 'posts_id' => $edcal_postid,
1319	+ );
1320	+
1321	+ $post = get_post($edcal_postid);
1322	+ ?>{
1323	+ "post" :
1324	+
1325	+ <?php
1326	+ $this->edcal_postJSON($post, false, true);
1327	+ ?>}
1328	+ <?php
1329	+
1330	+ die();
1331	+ }
1332	+
1333	+ /*
1334	+ * This function saves the preferences
1335	+ */
1336	+ function edcal_saveoptions() {
1337	+ if (!$this->edcal_checknonce()) {
1338	+ die();
1339	+ }
1340	+
1341	+ header("Content-Type: application/json");
1342	+ $this->edcal_addNoCacheHeaders();
1343	+
1344	+ /*
1345	+ * The number of weeks preference
1346	+ */
1347	+ $edcal_weeks = isset($_GET['weeks'])?$_GET['weeks']:null;
1348	+ if ($edcal_weeks != null) {
1349	+ add_option("edcal_weeks_pref", $edcal_weeks, "", "yes");
1350	+ update_option("edcal_weeks_pref", $edcal_weeks);
1351	+ }
1352	+
1353	+ /*
1354	+ * The show author preference
1355	+ */
1356	+ $edcal_author = isset($_GET['author-hide'])?$_GET['author-hide']:null;
1357	+ if ($edcal_author != null) {
1358	+ add_option("edcal_author_pref", $edcal_author, "", "yes");
1359	+ update_option("edcal_author_pref", $edcal_author);
1360	+ }
1361	+
1362	+ /*
1363	+ * The show status preference
1364	+ */
1365	+ $edcal_status = isset($_GET['status-hide'])?$_GET['status-hide']:null;
1366	+ if ($edcal_status != null) {
1367	+ add_option("edcal_status_pref", $edcal_status, "", "yes");
1368	+ update_option("edcal_status_pref", $edcal_status);
1369	+ }
1370	+
1371	+ /*
1372	+ * The show time preference
1373	+ */
1374	+ $edcal_time = isset($_GET['time-hide'])?$_GET['time-hide']:null;
1375	+ if ($edcal_time != null) {
1376	+ add_option("edcal_time_pref", $edcal_time, "", "yes");
1377	+ update_option("edcal_time_pref", $edcal_time);
1378	+ }
1379	+
1380	+ /*
1381	+ * The show mouse wheel preference
1382	+ */
1383	+ $edcal_wheel = isset($_GET['wheel-support'])?$_GET['wheel-support']:null;
1384	+ if ($edcal_wheel != null) {
1385	+ add_option("edcal_wheelscroll_pref", $edcal_time, "", "yes");
1386	+ update_option("edcal_wheelscroll_pref", $edcal_wheel);
1387	+ }
1388	+
1389	+ /*
1390	+ * The edcal feedback preference
1391	+ */
1392	+ $edcal_feedback = isset($_GET['dofeedback'])?$_GET['dofeedback']:null;
1393	+ if ($edcal_feedback != null) {
1394	+ add_option("edcal_do_feedback", $edcal_feedback, "", "yes");
1395	+ update_option("edcal_do_feedback", $edcal_feedback);
1396	+ }
1397	+
1398	+ /*
1399	+ * We finish by returning the latest data for the post in the JSON
1400	+ */
1401	+ ?>{
1402	+ "update" : "success"
1403	+ }
1404	+ <?php
1405	+
1406	+ die();
1407	+ }
1408	+
1409	+ /*
1410	+ * Add the no cache headers to make sure that our responses aren't
1411	+ * cached by the browser.
1412	+ */
1413	+ function edcal_addNoCacheHeaders() {
1414	+ header("Cache-Control: no-cache, must-revalidate"); // HTTP/1.1
1415	+ header("Expires: Sat, 26 Jul 1997 05:00:00 GMT"); // Date in the past
1416	+ }
1417	+
1418	+ }
1419	+
1420	+ ?>

3.7.8/edcal_rtl.css ADDED Viewed

	@@ -0,0 +1,60 @@


1	+ .inline-edit-row fieldset label span.title {
2	+ width: 7em;
3	+ float: right;
4	+ text-align: right;
5	+ direction: rtl;
6	+ }
7	+
8	+ .inline-edit-row fieldset label span.input-text-wrap {
9	+ margin-left: 0;
10	+ margin-right: 7em;
11	+ }
12	+
13	+ .inline-edit-row fieldset label span.input-text-wrap {
14	+ text-align: right;
15	+ direction: rtl;
16	+ }
17	+
18	+ #topleft {
19	+ left: auto;
20	+ right: 0px;
21	+ }
22	+
23	+ #topright {
24	+ right: auto;
25	+ left: 0px;
26	+ }
27	+
28	+ #screen-options-link-wrap, #contextual-help-link-wrap {
29	+ float: left;
30	+ }
31	+
32	+ .wrap h2 {
33	+ text-align: right;
34	+ direction: rtl;
35	+ }
36	+
37	+ .icon32 {
38	+ float: right;
39	+ }
40	+
41	+ .post {
42	+ text-align: right;
43	+ direction: rtl;
44	+ }
45	+
46	+ .dayhead {
47	+ min-width: 0;
48	+ text-align: right;
49	+ direction: rtl;
50	+ }
51	+
52	+ #contextual-help-wrap {
53	+ text-align: right;
54	+ direction: rtl;
55	+ }
56	+
57	+ #tooltiptitle {
58	+ direction: rtl;
59	+ padding-right: 35px;
60	+ }

3.7.8/edcal_test.js ADDED Viewed

	@@ -0,0 +1,587 @@


1	+ /*******************************************************************************
2	+ *
3	+ * Licensed under the Apache License, Version 2.0 (the "License");
4	+ * you may not use this file except in compliance with the License.
5	+ * You may obtain a copy of the License at
6	+ *
7	+ * http://www.apache.org/licenses/LICENSE-2.0
8	+ *
9	+ * Unless required by applicable law or agreed to in writing, software
10	+ * distributed under the License is distributed on an "AS IS" BASIS,
11	+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
12	+ * See the License for the specific language governing permissions and
13	+ * limitations under the License.
14	+ *
15	+ ******************************************************************************/
16	+ /*
17	+ * This file contains unit tests for the editorial calendar. It is only loaded
18	+ * if you add the qunit=true parameter to the URL for the calendar.
19	+ */
20	+
21	+ var edcal_test = {
22	+
23	+ post: {},
24	+
25	+ testContent: 'This is the content of the <b>unit test &#8211 post</b>. <!--more--> This is content after the more tag to make sure we a reading it.',
26	+ testContent2: 'This is the content of the <b>unit test &#8211 post</b>. <!--more--> This is content after the more tag to make sure we a reading it. - CHANGED',
27	+ testContent3: 'This is the content of the <b>unit test &#8211 post</b>. <!--more--> This is content after the more tag to make sure we a reading it. - CHANGED DRAFT',
28	+
29	+ runTests: function() {
30	+ edcal_test.isDraftsDrawerVisible = edcal.isDraftsDrawerVisible;
31	+
32	+ edcal.setDraftsDrawerVisible(true, function() {
33	+ edcal_test.startTests();
34	+ });
35	+ },
36	+
37	+ startTests: function() {
38	+ jQuery('head').append('<link>');
39	+ css = jQuery('head').children(':last');
40	+ css.attr({
41	+ rel: 'stylesheet',
42	+ type: 'text/css',
43	+ href: edcal.plugin_url + '/lib/qunit.css'
44	+ });
45	+
46	+ jQuery('#wpbody-content .wrap').append('<div id="edcal-qunit"></div>');
47	+
48	+ jQuery('#edcal-qunit').append('<h1 id="qunit-header">WordPress Editorial Calendar Unit Tests</h1>' +
49	+ '<h2 id="qunit-banner"></h2>' +
50	+ '<div id="qunit-testrunner-toolbar"></div>' +
51	+ '<h2 id="qunit-userAgent"></h2>' +
52	+ '<ol id="qunit-tests"></ol>' +
53	+ '<div id="qunit-fixture">test markup</div>');
54	+
55	+
56	+ edcal_test.moveTests();
57	+ },
58	+
59	+ getFirstDate: function() {
60	+ var api = jQuery('#edcal_scrollable').scrollable();
61	+ var items = api.getVisibleItems();
62	+
63	+ return edcal.getDayFromDayId(items.eq(0).children('.edcal_row').children('.day:first').attr('id'));
64	+ },
65	+
66	+ getLastDate: function() {
67	+ var api = jQuery('#edcal_scrollable').scrollable();
68	+ var items = api.getVisibleItems();
69	+
70	+ return edcal.getDayFromDayId(items.eq(edcal.weeksPref - 1).children('.edcal_row').children('.day:last').attr('id'));
71	+ },
72	+
73	+ moveTests: function() {
74	+ var curSunday = edcal.nextStartOfWeek(Date.today()).add(-1).weeks();
75	+
76	+ edcal.moveTo(Date.today());
77	+
78	+ /*
79	+ * We'll start of with a series of tests about moving the calendar around
80	+ */
81	+ test('Move to today and check visible dates', function() {
82	+ expect(2);
83	+ ok(edcal_test.getFirstDate().equals(curSunday.clone()), 'firstDate should match ' + curSunday);
84	+
85	+ ok(edcal_test.getLastDate().equals(curSunday.clone().add(edcal.weeksPref).weeks().add(-1).days()),
86	+ 'lastDate should match ' + curSunday);
87	+ });
88	+
89	+ asyncTest('Move 1 week in the future and check visible dates', function() {
90	+ expect(2);
91	+ edcal.move(1, true, function() {
92	+ ok(edcal_test.getFirstDate().equals(curSunday.clone().add(1).weeks()), 'firstDate should match ' + curSunday);
93	+
94	+ ok(edcal_test.getLastDate().equals(curSunday.clone().add(edcal.weeksPref).weeks().add(-1).days().add(1).weeks()),
95	+ 'lastDate should match ' + curSunday);
96	+
97	+ edcal.move(1, false, function() {
98	+ start();
99	+ edcal_test.testMoveFourWeeks();
100	+ });
101	+ });
102	+ });
103	+
104	+ return;
105	+
106	+ },
107	+
108	+ testMoveFourWeeks: function() {
109	+ var curSunday = edcal.nextStartOfWeek(Date.today()).add(-1).weeks();
110	+
111	+ /*
112	+ * Now we'll move 4 weeks into the future
113	+ */
114	+ asyncTest('Move 4 weeks in the future and check visible dates', function() {
115	+ expect(2);
116	+
117	+ edcal.move(4, true, function() {
118	+ ok(edcal_test.getFirstDate().equals(curSunday.clone().add(4).weeks()), 'firstDate should match ' + curSunday);
119	+
120	+ ok(edcal_test.getLastDate().equals(curSunday.clone().add(edcal.weeksPref).weeks().add(-1).days().add(4).weeks()),
121	+ 'lastDate should match ' + curSunday);
122	+
123	+ edcal.move(4, false, function() {
124	+ start();
125	+ edcal_test.testMoveEightWeeks();
126	+ });
127	+ });
128	+
129	+
130	+ });
131	+ },
132	+
133	+ testMoveEightWeeks: function() {
134	+ var curSunday = edcal.nextStartOfWeek(Date.today()).add(-1).weeks();
135	+
136	+ /*
137	+ * Now 8 weeks into the past
138	+ */
139	+ asyncTest('Move 8 weeks in the past and check visible dates', function() {
140	+ expect(2);
141	+
142	+ edcal.move(8, false, function() {
143	+ ok(edcal_test.getFirstDate().equals(curSunday.clone().add(-8).weeks()), 'firstDate should match ' + curSunday);
144	+
145	+ ok(edcal_test.getLastDate().equals(curSunday.clone().add(edcal.weeksPref).weeks().add(-1).days().add(-8).weeks()),
146	+ 'lastDate should match ' + curSunday);
147	+
148	+ edcal.move(8, true, function() {
149	+ start();
150	+ edcal_test.testMoveToLast();
151	+ });
152	+ });
153	+
154	+
155	+ });
156	+ },
157	+
158	+ testMoveToLast: function() {
159	+ if (edcal.lastPostDate === '-1') {
160	+ /*
161	+ * Then there aren't any posts and we can't go
162	+ * to the last one so we just skip this test.
163	+ */
164	+ edcal_test.testCreatePost();
165	+ return;
166	+ }
167	+
168	+ var d = Date.parseExact(edcal.lastPostDate, 'ddMMyyyy');
169	+ var curSunday = edcal.nextStartOfWeek(d).add(-1).weeks();
170	+
171	+ /*
172	+ * Now move to the last post, get the post date, and make sure the post
173	+ * is there with the correct ID.
174	+ */
175	+ asyncTest('Move to the last post', function() {
176	+ expect(1);
177	+
178	+ edcal.moveTo(d);
179	+ edcal.getPosts(edcal.nextStartOfWeek(d).add(-3).weeks(),
180	+ edcal.nextStartOfWeek(d).add(edcal.weeksPref + 3).weeks(), function() {
181	+
182	+ equals(jQuery('#post-' + edcal.lastPostId).length, 1, 'The post should be added at ' +
183	+ d.toString(Date.CultureInfo.formatPatterns.longDate));
184	+
185	+ edcal.moveTo(Date.today());
186	+ start();
187	+ edcal_test.testCreatePost();
188	+ });
189	+
190	+
191	+ });
192	+ },
193	+
194	+ testCreatePost: function() {
195	+ /*
196	+ * Now we'll do a few tests about creating, modifying, and deleting posts.
197	+ */
198	+
199	+ asyncTest('Create a new post', function() {
200	+ expect(3);
201	+
202	+ edcal_test.post.title = 'Unit Test Post';
203	+ edcal_test.post.content = edcal_test.testContent;
204	+ edcal_test.post.status = 'draft';
205	+ edcal_test.post.time = '10:00 AM';
206	+ edcal_test.post.date = Date.today().add(7).days().toString(edcal.internalDateFormat);
207	+ edcal_test.post.id = '0';
208	+
209	+ edcal.savePost(edcal_test.post, false, false, function(res) {
210	+ if (!res.post) {
211	+ ok(false, 'There was an error creating the new post.');
212	+ start();
213	+ return;
214	+ }
215	+
216	+ equals(res.post.date, edcal_test.post.date, 'The resulting post should have the same date as the request');
217	+ equals(res.post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
218	+
219	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
220	+
221	+ edcal_test.post = res.post;
222	+
223	+ start();
224	+
225	+ edcal_test.testGetPost();
226	+ });
227	+ });
228	+
229	+ },
230	+
231	+ testGetPost: function() {
232	+ /*
233	+ * We'll start by getting data about the post we've just created
234	+ */
235	+
236	+ asyncTest('Get post information', function() {
237	+ expect(3);
238	+
239	+ edcal.getPost(edcal_test.post.id, function(post) {
240	+ equals(post.date, edcal_test.post.date, 'The resulting post should have the same date as the request');
241	+ equals(post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
242	+ equals(post.content, edcal_test.testContent, 'The resulting post content should be the same as the test post content');
243	+
244	+ edcal_test.post = post;
245	+
246	+ start();
247	+
248	+ edcal_test.testMovePost();
249	+ });
250	+ });
251	+
252	+ },
253	+
254	+ testMovePost: function() {
255	+
256	+ asyncTest('Change the date of an existing post', function() {
257	+ expect(2);
258	+
259	+ // We added the post one week in the future, now we will move it
260	+ // one day after that.
261	+ var newDate = Date.today().add(8).days().toString(edcal.internalDateFormat);
262	+
263	+ edcal.doDrop(edcal_test.post.date, 'post-' + edcal_test.post.id, newDate, function(res) {
264	+
265	+ if (!res.post) {
266	+ ok(false, 'There was an error creating the new post.');
267	+ return;
268	+ }
269	+
270	+ equals(res.post.date, newDate, 'The resulting post should have the same date as the request');
271	+
272	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
273	+
274	+ edcal_test.post = res.post;
275	+
276	+ start();
277	+
278	+ edcal_test.testMovePostOneWeek();
279	+ });
280	+ });
281	+
282	+ },
283	+
284	+ testMovePostOneWeek: function() {
285	+
286	+ asyncTest('Make a second change to the date of an existing post', function() {
287	+ expect(2);
288	+
289	+ // We added the post one week in the future, now we will move it
290	+ // one day after that.
291	+ var newDate = Date.today().add(22).days().toString(edcal.internalDateFormat);
292	+
293	+ edcal.doDrop(edcal_test.post.date, 'post-' + edcal_test.post.id, newDate, function(res) {
294	+
295	+ if (!res.post) {
296	+ ok(false, 'There was an error creating the new post.');
297	+ return;
298	+ }
299	+
300	+ equals(res.post.date, newDate, 'The resulting post should have the same date as the request');
301	+
302	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
303	+
304	+ edcal_test.post = res.post;
305	+
306	+ start();
307	+
308	+ edcal_test.testMovePostDraft();
309	+ });
310	+ });
311	+
312	+ },
313	+
314	+ testMovePostDraft: function() {
315	+
316	+ asyncTest('Move an existing post to the drafts drawer', function() {
317	+ expect(2);
318	+
319	+ edcal.doDrop(edcal_test.post.date, 'post-' + edcal_test.post.id, edcal.NO_DATE, function(res) {
320	+
321	+ if (!res.post) {
322	+ ok(false, 'There was an error creating the new post.');
323	+ return;
324	+ }
325	+
326	+ equals(res.post.date_gmt, edcal.NO_DATE, 'The resulting post should have the same date as the request and it was ' + res.post.date);
327	+
328	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
329	+
330	+ edcal_test.post = res.post;
331	+
332	+ start();
333	+
334	+ edcal_test.testEditPostDraft();
335	+ });
336	+ });
337	+
338	+ },
339	+
340	+ testEditPostDraft: function() {
341	+
342	+ asyncTest('Edit the content of a draft post', function() {
343	+ expect(2);
344	+
345	+ edcal_test.post.title = 'Unit Test Draft Post &#8211 Changed';
346	+ edcal_test.post.content = edcal_test.testContent3;
347	+
348	+ edcal.savePost(edcal_test.post, false, false, function(res)
349	+ {
350	+ if (!res.post) {
351	+ ok(false, 'There was an error editing the post.');
352	+ start();
353	+ return;
354	+ }
355	+
356	+ equals(res.post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
357	+
358	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
359	+
360	+ edcal_test.post = res.post;
361	+
362	+ start();
363	+
364	+ edcal_test.testMovePostDraftSchedule();
365	+
366	+ });
367	+ });
368	+ },
369	+
370	+ testMovePostDraftSchedule: function() {
371	+
372	+ asyncTest('Move a post from the drafts drawer back to the calendar', function() {
373	+ expect(2);
374	+
375	+ // We added the post one week in the future, now we will move it
376	+ // two days after that.
377	+ var newDate = Date.today().add(23).days().toString(edcal.internalDateFormat);
378	+
379	+ edcal.doDrop(edcal.NO_DATE, 'post-' + edcal_test.post.id, newDate, function(res) {
380	+
381	+ if (!res.post) {
382	+ ok(false, 'There was an error creating the new post.');
383	+ return;
384	+ }
385	+
386	+ equals(res.post.date, newDate, 'The resulting post should have the same date as the request and it was ' + res.post.date);
387	+
388	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
389	+
390	+ edcal_test.post = res.post;
391	+
392	+ start();
393	+
394	+ edcal_test.testEditPost();
395	+ });
396	+ });
397	+
398	+ },
399	+
400	+ testEditPost: function() {
401	+
402	+ asyncTest('Edit the content of an existing post and mark it as scheduled', function() {
403	+ expect(2);
404	+
405	+ edcal_test.post.title = 'Unit Test Post &#8211 Changed';
406	+ edcal_test.post.content = edcal_test.testContent2;
407	+
408	+ edcal.savePost(edcal_test.post, false, true, function(res)
409	+ {
410	+ if (!res.post) {
411	+ ok(false, 'There was an error editing the post.');
412	+ start();
413	+ return;
414	+ }
415	+
416	+ equals(res.post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
417	+
418	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
419	+
420	+ edcal_test.post = res.post;
421	+
422	+ start();
423	+
424	+ edcal_test.testGetAfterEdit();
425	+
426	+ });
427	+ });
428	+
429	+ },
430	+
431	+ testGetAfterEdit: function() {
432	+ /*
433	+ * Now we'll test to make sure our new post data still matches what we think it should
434	+ */
435	+
436	+ asyncTest('Get post information after editing', function() {
437	+ expect(3);
438	+
439	+ edcal.getPost(edcal_test.post.id, function(post) {
440	+ equals(post.date, edcal_test.post.date, 'The resulting post should have the same date as the request');
441	+ equals(post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
442	+ equals(post.content, edcal_test.testContent2, 'The resulting post content should be the same as the test post content');
443	+
444	+ edcal_test.post = post;
445	+
446	+ start();
447	+
448	+ edcal_test.testDateConflict();
449	+ });
450	+ });
451	+
452	+ },
453	+
454	+ testDateConflict: function() {
455	+ asyncTest('Try to change a post date and fail because of a concurrency conflict', function() {
456	+ expect(2);
457	+
458	+ edcal_test.post.date = Date.today().add(-1).days().toString(edcal.internalDateFormat);
459	+
460	+ /*
461	+ * We added the post one week in the future, now we will move it
462	+ * one day after that.
463	+ */
464	+ var newDate = Date.today().add(8).days().toString(edcal.internalDateFormat);
465	+
466	+ edcal.changeDate(newDate, edcal_test.post, function(res)
467	+ {
468	+ if (!res.post) {
469	+ ok(false, 'There was an error with the change date conflict.');
470	+ return;
471	+ }
472	+
473	+ equals(res.error, edcal.CONCURRENCY_ERROR, 'This move should show an exception because it is in conflict.');
474	+
475	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
476	+
477	+ edcal_test.post = res.post;
478	+
479	+ start();
480	+
481	+ edcal_test.testDeletePost();
482	+
483	+ });
484	+ });
485	+
486	+ },
487	+
488	+ testDeletePost: function() {
489	+
490	+ /*
491	+ * The last step is to delete the post we made so
492	+ * the test cleans up after itself.
493	+ */
494	+ asyncTest('Delete the post created for testing', function() {
495	+ expect(1);
496	+
497	+ edcal.deletePost(edcal_test.post.id, function(res)
498	+ {
499	+ if (!res.post) {
500	+ ok(false, 'There was an error creating the new post.');
501	+ start();
502	+ return;
503	+ }
504	+
505	+ equals(jQuery('#post-' + res.post.id).length, 0, 'The post should now be deleted from the calendar.');
506	+ start();
507	+
508	+ edcal_test.testCreateDraftDrawerPost();
509	+
510	+ });
511	+ });
512	+ },
513	+
514	+ testCreateDraftDrawerPost: function() {
515	+ /*
516	+ * Now we'll create a new post in the drafts drawer
517	+ */
518	+
519	+ asyncTest('Create a new drafts drawer post', function() {
520	+ expect(2);
521	+
522	+ edcal_test.post.title = 'Unit Test Drafts Drawer Post';
523	+ edcal_test.post.content = edcal_test.testContent;
524	+ edcal_test.post.status = 'draft';
525	+ edcal_test.post.time = edcal.NO_DATE;
526	+ edcal_test.post.date = edcal.NO_DATE;
527	+ edcal_test.post.id = '0';
528	+
529	+ edcal.savePost(edcal_test.post, false, false, function(res) {
530	+ if (!res.post) {
531	+ ok(false, 'There was an error creating the new post.');
532	+ start();
533	+ return;
534	+ }
535	+
536	+ equals(res.post.title, edcal_test.post.title, 'The resulting post should have the same title as the request');
537	+
538	+ equals(jQuery('#post-' + res.post.id).length, 1, 'The post should be added in only one place in the calendar.');
539	+
540	+ edcal_test.post = res.post;
541	+
542	+ start();
543	+
544	+ edcal_test.testDeleteDraftDrawerPost();
545	+ });
546	+ });
547	+
548	+ },
549	+
550	+ testDeleteDraftDrawerPost: function() {
551	+
552	+ /*
553	+ * The last step is to delete the post we made so
554	+ * the test cleans up after itself.
555	+ */
556	+ asyncTest('Delete the post created for drafts drawer testing', function() {
557	+ expect(1);
558	+
559	+ edcal.deletePost(edcal_test.post.id, function(res)
560	+ {
561	+ if (!res.post) {
562	+ ok(false, 'There was an error creating the new post.');
563	+ start();
564	+ return;
565	+ }
566	+
567	+ equals(jQuery('#post-' + res.post.id).length, 0, 'The post should now be deleted from the calendar.');
568	+ start();
569	+
570	+ edcal_test.finishTests();
571	+
572	+ });
573	+ });
574	+ },
575	+
576	+ finishTests: function() {
577	+ if (!edcal_test.isDraftsDrawerVisible) {
578	+ /*
579	+ * We need to make sure the drafts drawer is open because
580	+ * we can use it in the tests so we open it when the tests
581	+ * start if it isn't open already. We want to close it at
582	+ * the end if we opened it.
583	+ */
584	+ edcal.setDraftsDrawerVisible(false);
585	+ }
586	+ }
587	+ };

3.7.8/images/month-present_bk.gif ADDED Viewed

Binary file

3.7.8/images/tip_close.png ADDED Viewed

Binary file

3.7.8/images/today_bk.gif ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-cs_CZ.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-cs_CZ.po ADDED Viewed

	@@ -0,0 +1,192 @@


1	+ # Translation of the WordPress plugin by .
2	+ # Copyright (C) 2010
3	+ # This file is distributed under the same license as the package.
4	+ # FIRST AUTHOR <EMAIL@ADDRESS>, 2010.
5	+ #
6	+ msgid ""
7	+ msgstr ""
8	+ "Project-Id-Version: Editorial-Calendar-cs_CZ\n"
9	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
10	+ "POT-Creation-Date: 2010-01-02 21:49+0000\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Road runner <roadrunner@ufoni.cz>\n"
13	+ "Language-Team: Lakva <lakva@volny.cz>\n"
14	+ "MIME-Version: 1.0\n"
15	+ "Content-Type: text/plain; charset=utf-8\n"
16	+ "Content-Transfer-Encoding: 8bit\n"
17	+ "Plural-Forms: Y;\n"
18	+ "X-Poedit-SourceCharset: utf-8\n"
19	+ "Language: cs_CZ\n"
20	+ "X-Generator: Poedit 2.2.3\n"
21	+
22	+ #: edcal.php:53
23	+ msgid "Calendar"
24	+ msgstr "Kalendář"
25	+
26	+ #: edcal.php:116
27	+ msgid "en-US"
28	+ msgstr "cs-CZ"
29	+
30	+ #: edcal.php:124
31	+ msgid "on"
32	+ msgstr "na"
33	+
34	+ #: edcal.php:125
35	+ msgid "by"
36	+ msgstr "do"
37	+
38	+ #: edcal.php:126
39	+ msgid "at"
40	+ msgstr "v"
41	+
42	+ #: edcal.php:128
43	+ msgid "Sunday"
44	+ msgstr "Pondělí"
45	+
46	+ #: edcal.php:129
47	+ msgid "Monday"
48	+ msgstr "Úterý"
49	+
50	+ #: edcal.php:130
51	+ msgid "Tuesday"
52	+ msgstr "Středa"
53	+
54	+ #: edcal.php:131
55	+ msgid "Wednesday"
56	+ msgstr "Čtvrtek"
57	+
58	+ #: edcal.php:132
59	+ msgid "Thursday"
60	+ msgstr "Pátek"
61	+
62	+ #: edcal.php:133
63	+ msgid "Friday"
64	+ msgstr "Sobota"
65	+
66	+ #: edcal.php:134
67	+ msgid "Saturday"
68	+ msgstr "Neděle"
69	+
70	+ #: edcal.php:153
71	+ msgid " [DRAFT]"
72	+ msgstr "[KONCEPT]"
73	+
74	+ #: edcal.php:136
75	+ msgid "Edit"
76	+ msgstr "Upravit"
77	+
78	+ #: edcal.php:137
79	+ msgid "Delete"
80	+ msgstr "Smazat"
81	+
82	+ #: edcal.php:138
83	+ msgid "View"
84	+ msgstr "Zobrazit"
85	+
86	+ #: edcal.php:139
87	+ msgid "Status:"
88	+ msgstr "Stav:"
89	+
90	+ #: edcal.php:140
91	+ msgid "Cancel"
92	+ msgstr "Storno"
93	+
94	+ #: edcal.php:141
95	+ msgid "Post Title:"
96	+ msgstr "Název příspěvku:"
97	+
98	+ #: edcal.php:161
99	+ msgid "Post Content:"
100	+ msgstr "Příspěvek obashuje:"
101	+
102	+ #: edcal.php:142
103	+ msgid "Save Draft"
104	+ msgstr "Uložit koncept"
105	+
106	+ #: edcal.php:143
107	+ msgid "Save and Edit Draft"
108	+ msgstr "Uložit a upravit koncept"
109	+
110	+ #: edcal.php:144
111	+ msgid "Add a new post on "
112	+ msgstr "Přidat nový příspěvek na "
113	+
114	+ #: edcal.php:146
115	+ msgid "You are about to delete this post "
116	+ msgstr "Chystáte se SMAZAT tento příspěvek "
117	+
118	+ #: edcal.php:147
119	+ msgid "Press cancel to stop, OK to delete."
120	+ msgstr "Stisknutím \"Storno\" akci zrušíte, \"Ok\" příspěvek smaže."
121	+
122	+ #: edcal.php:149
123	+ msgid "Looks like someone else already moved this post."
124	+ msgstr "Zdá se že příspěvek už někdo přesunul."
125	+
126	+ #: edcal.php:150
127	+ msgid "You do not have permission to edit posts."
128	+ msgstr "Nemáte oprávnění změnit příspěvek."
129	+
130	+ #: edcal.php:151
131	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
132	+ msgstr "Neplatný kontrolní součet příspěvku. To je obvykle chyba při mezi-sitové scriptování."
133	+
134	+ #: edcal.php:152
135	+ msgid "There was an error contacting your blog."
136	+ msgstr "Došlo k chybě při spojení s vaším blogem."
137	+
138	+ #: edcal.php:174
139	+ msgid "Screen Options"
140	+ msgstr "Možnosti zobrazení"
141	+
142	+ #: edcal.php:175
143	+ msgid "Calendar Options"
144	+ msgstr "Možnosti kalendáře"
145	+
146	+ #: edcal.php:176
147	+ msgid "Apply"
148	+ msgstr "Použít"
149	+
150	+ #: edcal.php:177
151	+ msgid "Show "
152	+ msgstr "Zobrazit"
153	+
154	+ #: edcal.php:178
155	+ msgid "weeks at a time"
156	+ msgstr "týdnů naráz"
157	+
158	+ #: edcal.php:179
159	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
160	+ msgstr "Kalendář může zobrazit 1 až 5 týdnů nazáz."
161	+
162	+ #: edcal.php:180
163	+ msgid "Enter the number of weeks, between 1 and 5, for the calendar to show."
164	+ msgstr "Vložte počet týdnů, které má kalendář zobrazit, od 1 do 5."
165	+
166	+ #: edcal.php:184
167	+ msgid "Posts Calendar"
168	+ msgstr "Kalendář článků."
169	+
170	+ #: edcal.php:193
171	+ msgid "Go back four weeks."
172	+ msgstr "Zpět o čtyři týdny."
173	+
174	+ #: edcal.php:195
175	+ msgid "Skip ahead four weeks."
176	+ msgstr "Vpřed o čtyři týdny."
177	+
178	+ #: edcal.php:250
179	+ msgid "Jump to today"
180	+ msgstr "Přejít na dnešek"
181	+
182	+ #: edcal.php:200
183	+ msgid "Today"
184	+ msgstr "Dnes"
185	+
186	+ #: edcal.php:457 edcal.php:460
187	+ msgid "Error in deleting..."
188	+ msgstr "Chyba při mazání..."
189	+
190	+ #: edcal.php:190 edcal.php:274
191	+ msgid "ltr"
192	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-da_DK.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-da_DK.po ADDED Viewed

	@@ -0,0 +1,279 @@


1	+ # Translation of WordPress Editorial Calendar in Danish
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language-Team: \n"
15	+ "Language: da_DK\n"
16	+
17	+ #: edcal.php:273 edcal.php:293
18	+ msgid "New Draft"
19	+ msgstr "Ny kladde"
20	+
21	+ #: edcal.php:291
22	+ msgid "Add a new draft"
23	+ msgstr "Tilføj en ny kladde"
24	+
25	+ #: edcal.php:321
26	+ msgid "The calendar can only show between 1 and 8 weeks at a time."
27	+ msgstr "Kalenderen kan kun vise mellem 1 og 8 uger ad gangen."
28	+
29	+ #: edcal.php:324 edcal.php:395
30	+ msgid "Show Unscheduled Drafts"
31	+ msgstr "Vis ikke planlagte kladder"
32	+
33	+ #: edcal.php:325
34	+ msgid "Hide Unscheduled Drafts"
35	+ msgstr "Skjul ikke planlagte kladder"
36	+
37	+ #: edcal.php:386
38	+ msgid "Scroll the calendar and make the last post visible"
39	+ msgstr "Gå til det sidste indlæg på kalenderen"
40	+
41	+ #: edcal.php:395
42	+ msgid "Show unscheduled posts"
43	+ msgstr "Vis ikke udgivne indlæg"
44	+
45	+ #: edcal.php:401
46	+ msgid "Unscheduled draft posts"
47	+ msgstr "Ikke planlagte indlægskladder"
48	+
49	+ #: edcal.php:401
50	+ msgid "Unscheduled"
51	+ msgstr "Ikke udgivet"
52	+
53	+ #: edcal.php:374
54	+ msgid "%1$s Calendar"
55	+ msgstr "%1$s kalender"
56	+
57	+ #: edcal.php:96 edcal.php:120
58	+ msgid "Calendar"
59	+ msgstr "Kalender"
60	+
61	+ #: edcal.php:262 edcal.php:531
62	+ msgid "en-US"
63	+ msgstr "da-DK"
64	+
65	+ #: edcal.php:270
66	+ msgid "%1$s by %2$s"
67	+ msgstr "%1$s af %2$s"
68	+
69	+ #: edcal.php:272
70	+ msgid "New Post"
71	+ msgstr "Nyt indlæg"
72	+
73	+ #: edcal.php:276
74	+ msgid " [DRAFT]"
75	+ msgstr "[KLADDE]"
76	+
77	+ #: edcal.php:277
78	+ msgid " [PENDING]"
79	+ msgstr "[AFVENTER]"
80	+
81	+ #: edcal.php:278
82	+ msgid " [STICKY]"
83	+ msgstr "[STICKY]"
84	+
85	+ #: edcal.php:279
86	+ msgid " [DRAFT, STICKY]"
87	+ msgstr "[KLADDE, STICKY]"
88	+
89	+ #: edcal.php:280
90	+ msgid " [PENDING, STICKY]"
91	+ msgstr "[AFVENTER, STICKY]"
92	+
93	+ #: edcal.php:281 edcal.php:285
94	+ msgid "Edit"
95	+ msgstr "Rediger"
96	+
97	+ #: edcal.php:282
98	+ msgid "Quick Edit"
99	+ msgstr "Lynrediger"
100	+
101	+ #: edcal.php:283
102	+ msgid "Delete"
103	+ msgstr "Slet"
104	+
105	+ #: edcal.php:284
106	+ msgid "View"
107	+ msgstr "Vis"
108	+
109	+ #: edcal.php:286
110	+ msgid "Status:"
111	+ msgstr "Status:"
112	+
113	+ #: edcal.php:287 edcal.php:478
114	+ msgid "Cancel"
115	+ msgstr "Annuller"
116	+
117	+ #: edcal.php:288 edcal.php:440
118	+ msgid "Title"
119	+ msgstr "Titel"
120	+
121	+ #: edcal.php:289 edcal.php:445
122	+ msgid "Content"
123	+ msgstr "Indhold"
124	+
125	+ #: edcal.php:290
126	+ msgid "Add a new post on %s"
127	+ msgstr "Tilføj et nyt indlæg den %s"
128	+
129	+ #: edcal.php:292
130	+ msgid "New %s - "
131	+ msgstr "Nyt %s -"
132	+
133	+ #: edcal.php:294
134	+ msgid "Update"
135	+ msgstr "Opdater"
136	+
137	+ #: edcal.php:295 edcal.php:477
138	+ msgid "Schedule"
139	+ msgstr "Udgiv"
140	+
141	+ #: edcal.php:296
142	+ msgid "Submit for Review"
143	+ msgstr "Send til gennemlæsning"
144	+
145	+ #: edcal.php:297
146	+ msgid "Save"
147	+ msgstr "Gem"
148	+
149	+ #: edcal.php:298
150	+ msgid "Edit %1$s - %2$s"
151	+ msgstr "Rediger %1$s - %2$s"
152	+
153	+ #: edcal.php:299 edcal.php:462
154	+ msgid "Scheduled"
155	+ msgstr "Udgivet"
156	+
157	+ #: edcal.php:301
158	+ msgid "You are about to delete the post \""
159	+ msgstr "Du er ved at slette indlægget \""
160	+
161	+ #: edcal.php:302
162	+ msgid "\". Press Cancel to stop, OK to delete."
163	+ msgstr "\". Tryk Annuller for at stoppe, OK for at slette."
164	+
165	+ #: edcal.php:304
166	+ msgid "Looks like someone else already moved this post."
167	+ msgstr "Det ser ud til at en anden allerede har flyttet dette indlæg."
168	+
169	+ #: edcal.php:305
170	+ msgid "You do not have permission to edit posts."
171	+ msgstr "Du har ikke adgang til at redigere indlæg."
172	+
173	+ #: edcal.php:306
174	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
175	+ msgstr "Ugyldig checksum for indlæg. Dette er oftest en cross-site script fejl."
176	+
177	+ #: edcal.php:307
178	+ msgid "There was an error contacting your blog."
179	+ msgstr "Der opstod en fejl under forbindelse til din blog."
180	+
181	+ #: edcal.php:309
182	+ msgid "Screen Options"
183	+ msgstr "Indstillinger for visning"
184	+
185	+ #: edcal.php:310
186	+ msgid "Colors"
187	+ msgstr "Farver"
188	+
189	+ #: edcal.php:311
190	+ msgid "Drafts: "
191	+ msgstr "Kladder:"
192	+
193	+ #: edcal.php:312
194	+ msgid "Apply"
195	+ msgstr "OK"
196	+
197	+ #: edcal.php:313
198	+ msgid "Show on screen"
199	+ msgstr "Vis på skærm"
200	+
201	+ #: edcal.php:314
202	+ msgid " weeks at a time"
203	+ msgstr " uger på en gang"
204	+
205	+ #: edcal.php:315
206	+ msgid "Show in Calendar Cell"
207	+ msgstr "Vis i kalender"
208	+
209	+ #: edcal.php:316
210	+ msgid "Author"
211	+ msgstr "Forfatter"
212	+
213	+ #: edcal.php:317 edcal.php:456
214	+ msgid "Status"
215	+ msgstr "Status"
216	+
217	+ #: edcal.php:318
218	+ msgid "Time of day"
219	+ msgstr "Tidspunkt"
220	+
221	+ #: edcal.php:319
222	+ msgid "An error occurred while loading the calendar: "
223	+ msgstr "Der skete en fejl under åbning af kalenderen:"
224	+
225	+ #: edcal.php:322
226	+ msgid "Select the number of weeks for the calendar to show."
227	+ msgstr "Vælg antal uger der skal vises i kalenderen."
228	+
229	+ #: edcal.php:333
230	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
231	+ msgstr "<h2>Vi er færdige</h2>Vi har nu indsamlet de nødvendige data. Tak fordi du hjalp os med at forbedre kalenderen."
232	+
233	+ #: edcal.php:383
234	+ msgid "Jump back"
235	+ msgstr "Tilbage"
236	+
237	+ #: edcal.php:385
238	+ msgid "Skip ahead"
239	+ msgstr "Frem"
240	+
241	+ #: edcal.php:388
242	+ msgid "Scroll the calendar and make the today visible"
243	+ msgstr "Gå til i dag"
244	+
245	+ #: edcal.php:388
246	+ msgid "Show Today"
247	+ msgstr "Vis i dag"
248	+
249	+ #: edcal.php:431
250	+ msgid "Edit Post"
251	+ msgstr "Rediger indlæg"
252	+
253	+ #: edcal.php:451
254	+ msgid "Time"
255	+ msgstr "Tidspunkt"
256	+
257	+ #: edcal.php:459
258	+ msgid "Draft"
259	+ msgstr "Kladde"
260	+
261	+ #: edcal.php:460
262	+ msgid "Pending Review"
263	+ msgstr "Afventer gennemlæsning"
264	+
265	+ #: edcal.php:729
266	+ msgid "Posts "
267	+ msgstr "Indlæg"
268	+
269	+ #: edcal.php:745
270	+ msgid "Post "
271	+ msgstr "Indlæg"
272	+
273	+ #: edcal.php:877 edcal.php:880
274	+ msgid "Error in deleting..."
275	+ msgstr "Fejl ved sletning..."
276	+
277	+ #: edcal.php:190 edcal.php:274
278	+ msgid "ltr"
279	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-de_DE.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-de_DE.po ADDED Viewed

	@@ -0,0 +1,307 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: WordPress Editorial Calendar v1.4\n"
4	+ "Report-Msgid-Bugs-To: \n"
5	+ "POT-Creation-Date: \n"
6	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
7	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
8	+ "Language-Team: \n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
13	+ "X-Poedit-SourceCharset: utf-8\n"
14	+ "X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2\n"
15	+ "X-Poedit-Basepath: ..\n"
16	+ "X-Textdomain-Support: yes\n"
17	+ "Language: de_DE\n"
18	+ "X-Generator: Poedit 2.2.3\n"
19	+ "X-Poedit-SearchPath-0: .\n"
20	+
21	+ # @ editorial-calendar
22	+ #: edcal.php:90 edcal.php:112
23	+ msgid "Calendar"
24	+ msgstr "Kalender"
25	+
26	+ # @ editorial-calendar
27	+ #: edcal.php:240 edcal.php:464
28	+ msgid "en-US"
29	+ msgstr "de-DE"
30	+
31	+ # @ editorial-calendar
32	+ #: edcal.php:248
33	+ #, php-format
34	+ msgid "%1$s by %2$s"
35	+ msgstr "%1$s von %2$s"
36	+
37	+ # @ editorial-calendar
38	+ #: edcal.php:250
39	+ msgid "New Post"
40	+ msgstr "Neuer Beitrag"
41	+
42	+ # @ editorial-calendar
43	+ #: edcal.php:252
44	+ msgid " [DRAFT]"
45	+ msgstr "[ENTWURF]"
46	+
47	+ # @ editorial-calendar
48	+ #: edcal.php:253
49	+ msgid " [PENDING]"
50	+ msgstr "[AUSSTEHEND]"
51	+
52	+ # @ editorial-calendar
53	+ #: edcal.php:254
54	+ msgid " [STICKY]"
55	+ msgstr "[STICKY]"
56	+
57	+ # @ editorial-calendar
58	+ #: edcal.php:255
59	+ msgid " [DRAFT, STICKY]"
60	+ msgstr "[Entwurf, STICKY]"
61	+
62	+ # @ editorial-calendar
63	+ #: edcal.php:256
64	+ msgid " [PENDING, STICKY]"
65	+ msgstr "[AUSSTEHEND, STICKY]"
66	+
67	+ # @ editorial-calendar
68	+ #: edcal.php:257 edcal.php:261
69	+ msgid "Edit"
70	+ msgstr "Bearbeiten"
71	+
72	+ # @ editorial-calendar
73	+ #: edcal.php:258
74	+ msgid "Quick Edit"
75	+ msgstr "Quick Edit"
76	+
77	+ # @ editorial-calendar
78	+ #: edcal.php:259
79	+ msgid "Delete"
80	+ msgstr "Löschen"
81	+
82	+ # @ editorial-calendar
83	+ #: edcal.php:260
84	+ msgid "View"
85	+ msgstr "anschauen"
86	+
87	+ # @ editorial-calendar
88	+ #: edcal.php:262
89	+ msgid "Status:"
90	+ msgstr "Status:"
91	+
92	+ # @ editorial-calendar
93	+ #: edcal.php:263 edcal.php:433
94	+ msgid "Cancel"
95	+ msgstr "abbrechen"
96	+
97	+ # @ editorial-calendar
98	+ #: edcal.php:264 edcal.php:396
99	+ msgid "Title"
100	+ msgstr "Titel"
101	+
102	+ # @ editorial-calendar
103	+ #: edcal.php:265 edcal.php:401
104	+ msgid "Content"
105	+ msgstr "Inhalt"
106	+
107	+ # @ editorial-calendar
108	+ #: edcal.php:266
109	+ #, php-format
110	+ msgid "Add a new post on %s"
111	+ msgstr "Einen neuen Beitrag am %s hinzufügen"
112	+
113	+ # @ editorial-calendar
114	+ #: edcal.php:267
115	+ #, php-format
116	+ msgid "New %s - "
117	+ msgstr "Neu %s - "
118	+
119	+ # @ editorial-calendar
120	+ #: edcal.php:268
121	+ msgid "Update"
122	+ msgstr "Update"
123	+
124	+ # @ editorial-calendar
125	+ #: edcal.php:269 edcal.php:432
126	+ msgid "Schedule"
127	+ msgstr "planen"
128	+
129	+ # @ editorial-calendar
130	+ #: edcal.php:270
131	+ msgid "Submit for Review"
132	+ msgstr "Fertig"
133	+
134	+ # @ editorial-calendar
135	+ #: edcal.php:271
136	+ msgid "Save"
137	+ msgstr "Speichern"
138	+
139	+ # @ editorial-calendar
140	+ #: edcal.php:272
141	+ #, php-format
142	+ msgid "Edit %1$s - %2$s"
143	+ msgstr "Ändere von %1$s - %2$s"
144	+
145	+ # @ editorial-calendar
146	+ #: edcal.php:273 edcal.php:418
147	+ msgid "Scheduled"
148	+ msgstr "Geplant"
149	+
150	+ # @ editorial-calendar
151	+ #: edcal.php:275
152	+ msgid "You are about to delete the post \""
153	+ msgstr "Wirklich löschen? \""
154	+
155	+ # @ editorial-calendar
156	+ #: edcal.php:276
157	+ msgid "\". Press Cancel to stop, OK to delete."
158	+ msgstr "\" Klicke abbrechen oder okay um fortzufahren"
159	+
160	+ # @ editorial-calendar
161	+ #: edcal.php:278
162	+ msgid "Looks like someone else already moved this post."
163	+ msgstr "Jemand hat den Artikel verschoben"
164	+
165	+ # @ editorial-calendar
166	+ #: edcal.php:279
167	+ msgid "You do not have permission to edit posts."
168	+ msgstr "Du hast nicht die Rechte, um Artikel zu editieren"
169	+
170	+ # @ editorial-calendar
171	+ #: edcal.php:280
172	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
173	+ msgstr "Falsche Checksumme. Möglicherweise ein cross-site-Fehler"
174	+
175	+ # @ editorial-calendar
176	+ #: edcal.php:281
177	+ msgid "There was an error contacting your blog."
178	+ msgstr "Verbindungsfehler"
179	+
180	+ # @ editorial-calendar
181	+ #: edcal.php:283
182	+ msgid "Screen Options"
183	+ msgstr "Ansichtsoptionen"
184	+
185	+ # @ editorial-calendar
186	+ #: edcal.php:284
187	+ msgid "Colors"
188	+ msgstr "Farben"
189	+
190	+ # @ editorial-calendar
191	+ #: edcal.php:285
192	+ msgid "Drafts: "
193	+ msgstr "Entwürfe:"
194	+
195	+ # @ editorial-calendar
196	+ #: edcal.php:286
197	+ msgid "Apply"
198	+ msgstr "Anwenden"
199	+
200	+ # @ editorial-calendar
201	+ #: edcal.php:287
202	+ msgid "Show on screen"
203	+ msgstr "Auf dem Bildschirm anzeigen"
204	+
205	+ # @ editorial-calendar
206	+ #: edcal.php:288
207	+ msgid " weeks at a time"
208	+ msgstr "Wochen"
209	+
210	+ # @ editorial-calendar
211	+ #: edcal.php:289
212	+ msgid "Show in Calendar Cell"
213	+ msgstr "In Kalenderbox anzeigen"
214	+
215	+ # @ editorial-calendar
216	+ #: edcal.php:290
217	+ msgid "Author"
218	+ msgstr "Autor"
219	+
220	+ # @ editorial-calendar
221	+ #: edcal.php:291 edcal.php:412
222	+ msgid "Status"
223	+ msgstr "Status"
224	+
225	+ # @ editorial-calendar
226	+ #: edcal.php:292
227	+ msgid "Time of day"
228	+ msgstr "Uhrzeit"
229	+
230	+ # @ editorial-calendar
231	+ #: edcal.php:293
232	+ msgid "An error occurred while loading the calendar: "
233	+ msgstr "Ein Fehler beim Laden des Kalenders:"
234	+
235	+ # @ editorial-calendar
236	+ #: edcal.php:295
237	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
238	+ msgstr "Der Kalender zeigt zwischen einer und fünf Wochen an."
239	+
240	+ # @ editorial-calendar
241	+ #: edcal.php:296
242	+ msgid "Select the number of weeks for the calendar to show."
243	+ msgstr "Wochen"
244	+
245	+ # @ editorial-calendar
246	+ #: edcal.php:302
247	+ msgid "<div id=\"feedbacksection\"><h2>Help us Make the Editorial Calendar Better</h2>We are always trying to improve the Editorial Calendar and you can help. May we collect some data about your blog and browser settings to help us improve this plugin? We'll only do it once and your blog will show up on our <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar Statistics page</a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Collect Anonymous Data</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">No thank you</a></div>"
248	+ msgstr "<div id=\"feedbacksection\"><h2>Hilf uns Editorial Calendar zu verbessern</h2>Wir sind bestrebt, Editoral Calender zu verbessern. Dabei kannst du uns helfen. Sende uns einige Daten über deinen Blog und deinen Browser. Das passiert einmalig und du stehst auf unserer <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar Statistics Seite</a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Daten anonym senden</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">Nein, lieber nicht.</a></div>"
249	+
250	+ # @ editorial-calendar
251	+ #: edcal.php:304
252	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
253	+ msgstr "<h2>Erledigt!</h2>Die Daten wurden übertragen. Vielen Dank für deine Hilfe. "
254	+
255	+ # @ editorial-calendar
256	+ #: edcal.php:345
257	+ msgid " Calendar"
258	+ msgstr "Kalender"
259	+
260	+ # @ editorial-calendar
261	+ #: edcal.php:354
262	+ msgid "Jump back"
263	+ msgstr "Zurück"
264	+
265	+ # @ editorial-calendar
266	+ #: edcal.php:356
267	+ msgid "Skip ahead"
268	+ msgstr "Vor"
269	+
270	+ # @ editorial-calendar
271	+ #: edcal.php:361
272	+ msgid "Scroll the calendar and make the today visible"
273	+ msgstr "Zum heutigen Tag springen"
274	+
275	+ # @ editorial-calendar
276	+ #: edcal.php:361
277	+ msgid "Show Today"
278	+ msgstr "Heute"
279	+
280	+ # @ editorial-calendar
281	+ #: edcal.php:387
282	+ msgid "Edit Post"
283	+ msgstr "Edit Post"
284	+
285	+ # @ editorial-calendar
286	+ #: edcal.php:407
287	+ msgid "Time"
288	+ msgstr "Zeit"
289	+
290	+ # @ editorial-calendar
291	+ #: edcal.php:415
292	+ msgid "Draft"
293	+ msgstr "Entwurf"
294	+
295	+ # @ editorial-calendar
296	+ #: edcal.php:416
297	+ msgid "Pending Review"
298	+ msgstr "fertig"
299	+
300	+ # @ default
301	+ #: edcal.php:735 edcal.php:738
302	+ msgid "Error in deleting..."
303	+ msgstr "Fehler beim Löschen ..."
304	+
305	+ #: edcal.php:190 edcal.php:274
306	+ msgid "ltr"
307	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-el.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-el.po ADDED Viewed

	@@ -0,0 +1,199 @@


1	+ # Translation of the WordPress plugin by .
2	+ # Copyright (C) 2010
3	+ # This file is distributed under the same license as the package.
4	+ # FIRST AUTHOR <EMAIL@ADDRESS>, 2010.
5	+ #
6	+ msgid ""
7	+ msgstr ""
8	+ "Project-Id-Version: editorial-calendar-el\n"
9	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
10	+ "POT-Creation-Date: 2010-04-13 21:19+0000\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "Language-Team: Mihalis Papanousis - http://aenaon.biz <fotonews@aenaon.biz>\n"
14	+ "MIME-Version: 1.0\n"
15	+ "Content-Type: text/plain; charset=utf-8\n"
16	+ "Content-Transfer-Encoding: 8bit\n"
17	+ "X-Poedit-SourceCharset: utf-8\n"
18	+ "Language: el_GR\n"
19	+ "X-Generator: Poedit 2.2.3\n"
20	+
21	+ #: edcal.php:63
22	+ msgid "Calendar"
23	+ msgstr "Ημερολόγιο άρθρων"
24	+
25	+ #: edcal.php:137 edcal.php:349
26	+ msgid "en-US"
27	+ msgstr "el-GR"
28	+
29	+ #: edcal.php:145
30	+ msgid "on"
31	+ msgstr "στις"
32	+
33	+ #: edcal.php:146
34	+ msgid "by"
35	+ msgstr "by-μέχρι"
36	+
37	+ #: edcal.php:147
38	+ msgid "at"
39	+ msgstr "στις"
40	+
41	+ #: edcal.php:149
42	+ msgid "New Post"
43	+ msgstr "Νέο άρθρο"
44	+
45	+ #: edcal.php:151
46	+ msgid " [DRAFT]"
47	+ msgstr " [ΠΡΟΣΧΕΔΙΟ]"
48	+
49	+ #: edcal.php:152
50	+ msgid "Edit"
51	+ msgstr "Επεξεργασία"
52	+
53	+ #: edcal.php:153
54	+ msgid "Delete"
55	+ msgstr "Διαγραφή"
56	+
57	+ #: edcal.php:154
58	+ msgid "View"
59	+ msgstr "Προβολή"
60	+
61	+ #: edcal.php:155
62	+ msgid "Republish"
63	+ msgstr "Επαναδημοσίευση"
64	+
65	+ #: edcal.php:156
66	+ msgid "Status:"
67	+ msgstr "Κατάσταση"
68	+
69	+ #: edcal.php:157 edcal.php:295
70	+ msgid "Cancel"
71	+ msgstr "Ακύρωση"
72	+
73	+ #: edcal.php:158 edcal.php:261
74	+ msgid "Title"
75	+ msgstr "Τίτλος"
76	+
77	+ #: edcal.php:159 edcal.php:266
78	+ msgid "Content"
79	+ msgstr "Κείμενο"
80	+
81	+ #: edcal.php:160
82	+ msgid "Add a new post on "
83	+ msgstr "Προσθήκη νέου άρθρου στις"
84	+
85	+ #: edcal.php:161
86	+ msgid "New Post - "
87	+ msgstr "Νέο άρθρο -"
88	+
89	+ #: edcal.php:162
90	+ msgid "Update"
91	+ msgstr "Ενημέρωση"
92	+
93	+ #: edcal.php:163 edcal.php:294
94	+ msgid "Schedule"
95	+ msgstr "Προγραμματισμός δημοσίευσης"
96	+
97	+ #: edcal.php:164
98	+ msgid "Save"
99	+ msgstr "Αποθήκευση"
100	+
101	+ #: edcal.php:165 edcal.php:255
102	+ msgid "Edit Post"
103	+ msgstr "Επεξεργασία άρθρου"
104	+
105	+ #: edcal.php:166 edcal.php:287
106	+ msgid "Scheduled"
107	+ msgstr "Να δημοσιευθεί στις"
108	+
109	+ #: edcal.php:168
110	+ msgid "You are about to delete the post \""
111	+ msgstr "Πρόκειται να διαγράψετε το άρθρο \""
112	+
113	+ #: edcal.php:169
114	+ msgid "\". Press Cancel to stop, OK to delete."
115	+ msgstr "\". Πατήστε Ακύρωση για να σταματήσετε, OK για διαγραφή."
116	+
117	+ #: edcal.php:171
118	+ msgid "Looks like someone else already moved this post."
119	+ msgstr "Φαίνεται πως κάποιος άλλος ήδη μετακίνησε αυτό το άρθρο."
120	+
121	+ #: edcal.php:172
122	+ msgid "You do not have permission to edit posts."
123	+ msgstr "Δεν έχετε δικαιώματα επεξεργασίας άρθρων."
124	+
125	+ #: edcal.php:173
126	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
127	+ msgstr "Μη έγκυρο άθροισμα μνήμης. Συνήθως οφείλεται σε 'cross-site scripting' (XSS)."
128	+
129	+ #: edcal.php:174
130	+ msgid "There was an error contacting your blog."
131	+ msgstr "Υπήρξε σφάλμα επικοινωνίας με το ιστολόγιο σας."
132	+
133	+ #: edcal.php:176
134	+ msgid "Screen Options"
135	+ msgstr "Επιλογές οθόνης"
136	+
137	+ #: edcal.php:177
138	+ msgid "Calendar Options"
139	+ msgstr "Επιλογές ημερολογίου"
140	+
141	+ #: edcal.php:178
142	+ msgid "Apply"
143	+ msgstr "Εφαρμογή"
144	+
145	+ #: edcal.php:179
146	+ msgid "Show "
147	+ msgstr "Εμφάνιση"
148	+
149	+ #: edcal.php:180
150	+ msgid "weeks at a time"
151	+ msgstr "εβδομάδων ανα οθόνη"
152	+
153	+ #: edcal.php:181
154	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
155	+ msgstr "Το ημερολόγιο μπορεί να εμφανίσει απο 1 έως και 5 εβδομάδες ανα οθόνη."
156	+
157	+ #: edcal.php:182
158	+ msgid "Select the number of weeks for the calendar to show."
159	+ msgstr "Εισάγετε τον αριθμό των εβδομάδων (1-5) για εμφάνιση στην οθόνη του ημερολογίου."
160	+
161	+ #: edcal.php:226
162	+ msgid "Posts Calendar"
163	+ msgstr "Ημερολόγιο άρθρων"
164	+
165	+ #: edcal.php:235
166	+ msgid "Jump back"
167	+ msgstr "Μετάβαση μια οθόνη πίσω"
168	+
169	+ #: edcal.php:237
170	+ msgid "Skip ahead"
171	+ msgstr "Μετάβαση μια οθόνη μπροστά"
172	+
173	+ #: edcal.php:242
174	+ msgid "Jump to today"
175	+ msgstr "Μετάβαση στη σημερινή ημερομηνία"
176	+
177	+ #: edcal.php:242
178	+ msgid "Today"
179	+ msgstr "Σήμερα"
180	+
181	+ #: edcal.php:281
182	+ msgid "Time"
183	+ msgstr "Ώρα"
184	+
185	+ #: edcal.php:285
186	+ msgid "Status"
187	+ msgstr "Κατάσταση"
188	+
189	+ #: edcal.php:289
190	+ msgid "Draft"
191	+ msgstr "Προσχέδιο"
192	+
193	+ #: edcal.php:544 edcal.php:547
194	+ msgid "Error in deleting..."
195	+ msgstr "Υπήρξε σφάλμα κατα τη διαγραφή..."
196	+
197	+ #: edcal.php:190 edcal.php:274
198	+ msgid "ltr"
199	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-es_ES.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-es_ES.po ADDED Viewed

	@@ -0,0 +1,279 @@


1	+ # Translation of WordPress Editorial Calendar in Spanish (Spain)
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language-Team: \n"
15	+ "Language: es_ES\n"
16	+
17	+ #: edcal.php:273 edcal.php:293
18	+ msgid "New Draft"
19	+ msgstr "Nuevo Borrador"
20	+
21	+ #: edcal.php:291
22	+ msgid "Add a new draft"
23	+ msgstr "Añadir nuevo borrador"
24	+
25	+ #: edcal.php:321
26	+ msgid "The calendar can only show between 1 and 8 weeks at a time."
27	+ msgstr "El calendario sólo puede mostrar entre 1 y 8 semanas a la vez."
28	+
29	+ #: edcal.php:324 edcal.php:395
30	+ msgid "Show Unscheduled Drafts"
31	+ msgstr "Mostrar entradas no programadas"
32	+
33	+ #: edcal.php:325
34	+ msgid "Hide Unscheduled Drafts"
35	+ msgstr "Ocultar entradas no programadas"
36	+
37	+ #: edcal.php:386
38	+ msgid "Scroll the calendar and make the last post visible"
39	+ msgstr "Ver lo último que figura programado"
40	+
41	+ #: edcal.php:395
42	+ msgid "Show unscheduled posts"
43	+ msgstr "Mostrar entradas no programadas"
44	+
45	+ #: edcal.php:401
46	+ msgid "Unscheduled draft posts"
47	+ msgstr "Borradores de Entradas No Programadas"
48	+
49	+ #: edcal.php:401
50	+ msgid "Unscheduled"
51	+ msgstr "No Programado"
52	+
53	+ #: edcal.php:374
54	+ msgid "%1$s Calendar"
55	+ msgstr "Calendario de %1$s"
56	+
57	+ #: edcal.php:96 edcal.php:120
58	+ msgid "Calendar"
59	+ msgstr "Calendario"
60	+
61	+ #: edcal.php:262 edcal.php:531
62	+ msgid "en-US"
63	+ msgstr "es-ES"
64	+
65	+ #: edcal.php:270
66	+ msgid "%1$s by %2$s"
67	+ msgstr "%1$s por %2$s"
68	+
69	+ #: edcal.php:272
70	+ msgid "New Post"
71	+ msgstr "Nueva Entrada"
72	+
73	+ #: edcal.php:276
74	+ msgid " [DRAFT]"
75	+ msgstr " [BORRADOR]"
76	+
77	+ #: edcal.php:277
78	+ msgid " [PENDING]"
79	+ msgstr " [PENDIENTE]"
80	+
81	+ #: edcal.php:278
82	+ msgid " [STICKY]"
83	+ msgstr " [DESTACADO]"
84	+
85	+ #: edcal.php:279
86	+ msgid " [DRAFT, STICKY]"
87	+ msgstr " [BORRADOR, DESTACADO]"
88	+
89	+ #: edcal.php:280
90	+ msgid " [PENDING, STICKY]"
91	+ msgstr " [PENDIENTE, DESTACADO]"
92	+
93	+ #: edcal.php:281 edcal.php:285
94	+ msgid "Edit"
95	+ msgstr "Editar"
96	+
97	+ #: edcal.php:282
98	+ msgid "Quick Edit"
99	+ msgstr "Edición Rápida"
100	+
101	+ #: edcal.php:283
102	+ msgid "Delete"
103	+ msgstr "Eliminar"
104	+
105	+ #: edcal.php:284
106	+ msgid "View"
107	+ msgstr "Ver"
108	+
109	+ #: edcal.php:286
110	+ msgid "Status:"
111	+ msgstr "Estado:"
112	+
113	+ #: edcal.php:287 edcal.php:478
114	+ msgid "Cancel"
115	+ msgstr "Cancelar"
116	+
117	+ #: edcal.php:288 edcal.php:440
118	+ msgid "Title"
119	+ msgstr "Título"
120	+
121	+ #: edcal.php:289 edcal.php:445
122	+ msgid "Content"
123	+ msgstr "Contenido"
124	+
125	+ #: edcal.php:290
126	+ msgid "Add a new post on %s"
127	+ msgstr "Añadir nueva entrada en %s"
128	+
129	+ #: edcal.php:292
130	+ msgid "New %s - "
131	+ msgstr "Nuevo %s - "
132	+
133	+ #: edcal.php:294
134	+ msgid "Update"
135	+ msgstr "Actualizar"
136	+
137	+ #: edcal.php:295 edcal.php:477
138	+ msgid "Schedule"
139	+ msgstr "Programar"
140	+
141	+ #: edcal.php:296
142	+ msgid "Submit for Review"
143	+ msgstr "Enviar para revisión"
144	+
145	+ #: edcal.php:297
146	+ msgid "Save"
147	+ msgstr "Guardar"
148	+
149	+ #: edcal.php:298
150	+ msgid "Edit %1$s - %2$s"
151	+ msgstr "Editar %1$s - %2$s"
152	+
153	+ #: edcal.php:299 edcal.php:462
154	+ msgid "Scheduled"
155	+ msgstr "Programado"
156	+
157	+ #: edcal.php:301
158	+ msgid "You are about to delete the post \""
159	+ msgstr "Va a eliminar la entrada \""
160	+
161	+ #: edcal.php:302
162	+ msgid "\". Press Cancel to stop, OK to delete."
163	+ msgstr "\". Presione Cancelar para detener, OK para eliminar."
164	+
165	+ #: edcal.php:304
166	+ msgid "Looks like someone else already moved this post."
167	+ msgstr "Parece que alguien ya ha movido esta entrada."
168	+
169	+ #: edcal.php:305
170	+ msgid "You do not have permission to edit posts."
171	+ msgstr "No tiene permiso para editar entradas."
172	+
173	+ #: edcal.php:306
174	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
175	+ msgstr "Error de verificación de la entrada. Esto suele ser un error de cross-site scripting."
176	+
177	+ #: edcal.php:307
178	+ msgid "There was an error contacting your blog."
179	+ msgstr "Hubo un error al comunicarse con su blog."
180	+
181	+ #: edcal.php:309
182	+ msgid "Screen Options"
183	+ msgstr "Opciones de pantalla"
184	+
185	+ #: edcal.php:310
186	+ msgid "Colors"
187	+ msgstr "Colores"
188	+
189	+ #: edcal.php:311
190	+ msgid "Drafts: "
191	+ msgstr "Borradores: "
192	+
193	+ #: edcal.php:312
194	+ msgid "Apply"
195	+ msgstr "Aplicar"
196	+
197	+ #: edcal.php:313
198	+ msgid "Show on screen"
199	+ msgstr "Mostrar en pantalla"
200	+
201	+ #: edcal.php:314
202	+ msgid " weeks at a time"
203	+ msgstr " semanas a la vez"
204	+
205	+ #: edcal.php:315
206	+ msgid "Show in Calendar Cell"
207	+ msgstr "Mostrar en la celda del calendario"
208	+
209	+ #: edcal.php:316
210	+ msgid "Author"
211	+ msgstr "Autor"
212	+
213	+ #: edcal.php:317 edcal.php:456
214	+ msgid "Status"
215	+ msgstr "Estado"
216	+
217	+ #: edcal.php:318
218	+ msgid "Time of day"
219	+ msgstr "En el dia"
220	+
221	+ #: edcal.php:319
222	+ msgid "An error occurred while loading the calendar: "
223	+ msgstr "Ha ocurrido un error al cargar el calendario: "
224	+
225	+ #: edcal.php:322
226	+ msgid "Select the number of weeks for the calendar to show."
227	+ msgstr "Seleccione el número de semanas para mostrar en el calendario."
228	+
229	+ #: edcal.php:333
230	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
231	+ msgstr "<h2>Listo!</h2>Hemos terminado de recolectar datos. Gracias por ayudarnos a mejorar este calendario."
232	+
233	+ #: edcal.php:383
234	+ msgid "Jump back"
235	+ msgstr "Atras"
236	+
237	+ #: edcal.php:385
238	+ msgid "Skip ahead"
239	+ msgstr "Adelante"
240	+
241	+ #: edcal.php:388
242	+ msgid "Scroll the calendar and make the today visible"
243	+ msgstr "Mover hasta el día de hoy"
244	+
245	+ #: edcal.php:388
246	+ msgid "Show Today"
247	+ msgstr "Hoy"
248	+
249	+ #: edcal.php:431
250	+ msgid "Edit Post"
251	+ msgstr "Editar Articulo"
252	+
253	+ #: edcal.php:451
254	+ msgid "Time"
255	+ msgstr "Hora"
256	+
257	+ #: edcal.php:459
258	+ msgid "Draft"
259	+ msgstr "Borrador"
260	+
261	+ #: edcal.php:460
262	+ msgid "Pending Review"
263	+ msgstr "Pendiente de revisión"
264	+
265	+ #: edcal.php:729
266	+ msgid "Posts "
267	+ msgstr "Entrada"
268	+
269	+ #: edcal.php:745
270	+ msgid "Post "
271	+ msgstr "Entradas"
272	+
273	+ #: edcal.php:877 edcal.php:880
274	+ msgid "Error in deleting..."
275	+ msgstr "Error al eliminar..."
276	+
277	+ #: edcal.php:190 edcal.php:274
278	+ msgid "ltr"
279	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-fr_FR.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-fr_FR.po ADDED Viewed

	@@ -0,0 +1,189 @@


1	+ # Translation of WordPress Editorial Calendar in French (France)
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=2; plural=n > 1;\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: \n"
14	+ "Language-Team: \n"
15	+ "Language: fr_FR\n"
16	+
17	+ msgid "%1$s Calendar"
18	+ msgstr "Calendrier des %1$s"
19	+
20	+ msgid "Calendar"
21	+ msgstr "Calendrier"
22	+
23	+ msgid "en-US"
24	+ msgstr "fr-FR"
25	+
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s par %2$s"
28	+
29	+ msgid "New Post"
30	+ msgstr "Nouveau post"
31	+
32	+ msgid " [DRAFT]"
33	+ msgstr " [BROUILLON]"
34	+
35	+ msgid " [PENDING]"
36	+ msgstr " [EN ATTENTE]"
37	+
38	+ msgid " [STICKY]"
39	+ msgstr " [EN PRIORITÉ]"
40	+
41	+ msgid " [DRAFT, STICKY]"
42	+ msgstr " [BROUILLON, STICKY]"
43	+
44	+ msgid " [PENDING, STICKY]"
45	+ msgstr " [EN ATTENTE, EN PRIORITÉ]"
46	+
47	+ msgid "Edit"
48	+ msgstr "Éditer"
49	+
50	+ msgid "Quick Edit"
51	+ msgstr "Éditer rapide"
52	+
53	+ msgid "Delete"
54	+ msgstr "Supprimer"
55	+
56	+ msgid "View"
57	+ msgstr "Voir"
58	+
59	+ msgid "Status:"
60	+ msgstr "Statut :"
61	+
62	+ msgid "Cancel"
63	+ msgstr "Annuler"
64	+
65	+ msgid "Title"
66	+ msgstr "Titre"
67	+
68	+ msgid "Content"
69	+ msgstr "Contenu"
70	+
71	+ msgid "Add a new post on %s"
72	+ msgstr "Ajouter un article au %s"
73	+
74	+ msgid "New %s - "
75	+ msgstr "Nouveau %s - "
76	+
77	+ msgid "Update"
78	+ msgstr "Mettre à jour"
79	+
80	+ msgid "Schedule"
81	+ msgstr "Horaire"
82	+
83	+ msgid "Submit for Review"
84	+ msgstr "Soumettre pour revision"
85	+
86	+ msgid "Save"
87	+ msgstr "Sauvegarder"
88	+
89	+ msgid "Edit %1$s - %2$s"
90	+ msgstr "Éditer %1$s - %2$s"
91	+
92	+ msgid "Scheduled"
93	+ msgstr "Planifié"
94	+
95	+ msgid "You are about to delete the post \""
96	+ msgstr "Vous allez supprimer le post \""
97	+
98	+ msgid "\". Press Cancel to stop, OK to delete."
99	+ msgstr "\". Cliquer OK pour confirmer."
100	+
101	+ msgid "Looks like someone else already moved this post."
102	+ msgstr "Quelqu'un d'autre a déjà déplacé ce post."
103	+
104	+ msgid "You do not have permission to edit posts."
105	+ msgstr "Vous n'avez pas les permissions d'éditer les posts."
106	+
107	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
108	+ msgstr "Désolé, les donnés de l'article sont corrompu, il se peut que ce soit une erreur de 'cross-site scripting' (XSS)."
109	+
110	+ msgid "There was an error contacting your blog."
111	+ msgstr "Une erreur est survenue en contactant votre blog."
112	+
113	+ msgid "Screen Options"
114	+ msgstr "Options d'affichage"
115	+
116	+ msgid "Colors"
117	+ msgstr "Couleurs"
118	+
119	+ msgid "Drafts: "
120	+ msgstr "Brouillons:"
121	+
122	+ msgid "Apply"
123	+ msgstr "Appliquer"
124	+
125	+ msgid "Show on screen"
126	+ msgstr "Afficher"
127	+
128	+ msgid " weeks at a time"
129	+ msgstr "semaines à la fois"
130	+
131	+ msgid "Show in Calendar Cell"
132	+ msgstr "Afficher en calendrier"
133	+
134	+ msgid "Author"
135	+ msgstr "Auteur"
136	+
137	+ msgid "Status"
138	+ msgstr "Statut"
139	+
140	+ msgid "Time of day"
141	+ msgstr "Heure"
142	+
143	+ msgid "An error occurred while loading the calendar: "
144	+ msgstr "Il y a eu un erreur en chargement du calendrier : "
145	+
146	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
147	+ msgstr "Le calendrier ne peut afficher qu'une à cinq semaines à la fois."
148	+
149	+ msgid "Select the number of weeks for the calendar to show."
150	+ msgstr "Sélectionner le nombre de semaines à afficher au calendrier."
151	+
152	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
153	+ msgstr "<h2>C'est tout !</h2>On a tout finit. Merci de nous aider à améliorer le calendrier."
154	+
155	+ msgid "Jump back"
156	+ msgstr "Mois précédent"
157	+
158	+ msgid "Skip ahead"
159	+ msgstr "Mois suivant"
160	+
161	+ msgid "Scroll the calendar and make the today visible"
162	+ msgstr "Sauter à aujourd'hui"
163	+
164	+ msgid "Show Today"
165	+ msgstr "Voir aujourd'hui"
166	+
167	+ msgid "Edit Post"
168	+ msgstr "Éditer l'article"
169	+
170	+ msgid "Time"
171	+ msgstr "Heure"
172	+
173	+ msgid "Draft"
174	+ msgstr "Brouillon"
175	+
176	+ msgid "Pending Review"
177	+ msgstr "En attente de relecture"
178	+
179	+ msgid "Posts "
180	+ msgstr "Articles"
181	+
182	+ msgid "Post "
183	+ msgstr "Article"
184	+
185	+ msgid "Error in deleting..."
186	+ msgstr "Erreur en supprimant..."
187	+
188	+ msgid "ltr"
189	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-he_IL.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-he_IL.po ADDED Viewed

	@@ -0,0 +1,247 @@


1	+ # Copyright (C) 2012
2	+ # This file is distributed under the same license as the package.
3	+ msgid ""
4	+ msgstr ""
5	+ "Project-Id-Version: \n"
6	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
7	+ "POT-Creation-Date: 2012-02-07 11:33:49+00:00\n"
8	+ "MIME-Version: 1.0\n"
9	+ "Content-Type: text/plain; charset=UTF-8\n"
10	+ "Content-Transfer-Encoding: 8bit\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "Language-Team: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language: he_IL\n"
15	+ "X-Generator: Poedit 2.2.3\n"
16	+
17	+ #: edcal.php:90 edcal.php:114
18	+ msgid "Calendar"
19	+ msgstr "לוח שנה"
20	+
21	+ #: edcal.php:242 edcal.php:466
22	+ msgid "en-US"
23	+ msgstr "he-IL"
24	+
25	+ #: edcal.php:250
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s פורסם על ידי: %2$s"
28	+
29	+ #: edcal.php:252
30	+ msgid "New Post"
31	+ msgstr "פוסט חדש"
32	+
33	+ #: edcal.php:254
34	+ msgid " [DRAFT]"
35	+ msgstr "[טיוטה]"
36	+
37	+ #: edcal.php:255
38	+ msgid " [PENDING]"
39	+ msgstr "[ממתין לאישור]"
40	+
41	+ #: edcal.php:256
42	+ msgid " [STICKY]"
43	+ msgstr "[דביק]"
44	+
45	+ #: edcal.php:257
46	+ msgid " [DRAFT, STICKY]"
47	+ msgstr "[טיוטה, דביק]"
48	+
49	+ #: edcal.php:258
50	+ msgid " [PENDING, STICKY]"
51	+ msgstr "[ממתין לאישור, דביק]"
52	+
53	+ #: edcal.php:259 edcal.php:263
54	+ msgid "Edit"
55	+ msgstr "עריכה"
56	+
57	+ #: edcal.php:260
58	+ msgid "Quick Edit"
59	+ msgstr "עריכה מהירה"
60	+
61	+ #: edcal.php:261
62	+ msgid "Delete"
63	+ msgstr "מחק"
64	+
65	+ #: edcal.php:262
66	+ msgid "View"
67	+ msgstr "הצג"
68	+
69	+ #: edcal.php:264
70	+ msgid "Status:"
71	+ msgstr "מצב:"
72	+
73	+ #: edcal.php:265 edcal.php:435
74	+ msgid "Cancel"
75	+ msgstr "בטל"
76	+
77	+ #: edcal.php:266 edcal.php:398
78	+ msgid "Title"
79	+ msgstr "כותרת"
80	+
81	+ #: edcal.php:267 edcal.php:403
82	+ msgid "Content"
83	+ msgstr "תוכן"
84	+
85	+ #: edcal.php:268
86	+ msgid "Add a new post on %s"
87	+ msgstr "הוסף פוסט חדש ב %s"
88	+
89	+ #: edcal.php:269
90	+ msgid "New %s - "
91	+ msgstr "%s חדש -"
92	+
93	+ #: edcal.php:270
94	+ msgid "Update"
95	+ msgstr "עדכן"
96	+
97	+ #: edcal.php:271 edcal.php:434
98	+ msgid "Schedule"
99	+ msgstr "מתוזמן"
100	+
101	+ #: edcal.php:272
102	+ msgid "Submit for Review"
103	+ msgstr "הגש לבדיקה"
104	+
105	+ #: edcal.php:273
106	+ msgid "Save"
107	+ msgstr "שמור"
108	+
109	+ #: edcal.php:274
110	+ msgid "Edit %1$s - %2$s"
111	+ msgstr "ערוך %1$s - %2$s"
112	+
113	+ #: edcal.php:275 edcal.php:420
114	+ msgid "Scheduled"
115	+ msgstr "מתוזמן"
116	+
117	+ #: edcal.php:277
118	+ msgid "You are about to delete the post \""
119	+ msgstr "הינך עומד למחוק את הפוסט \""
120	+
121	+ #: edcal.php:278
122	+ msgid "\". Press Cancel to stop, OK to delete."
123	+ msgstr "\". לחץ על ביטול לעצורת אישור למחיקה."
124	+
125	+ #: edcal.php:280
126	+ msgid "Looks like someone else already moved this post."
127	+ msgstr "נראה שמישהו כבר הזיז פוסט זה."
128	+
129	+ #: edcal.php:281
130	+ msgid "You do not have permission to edit posts."
131	+ msgstr "אין לך הרשאה לערוך פוסטים."
132	+
133	+ #: edcal.php:282
134	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
135	+ msgstr "בדיקות שגויות עבור הפוסט. דבר זה קורה לעיתים עקב שגיאה בסקריפט חוצה אתר."
136	+
137	+ #: edcal.php:283
138	+ msgid "There was an error contacting your blog."
139	+ msgstr "אירעה שגיאה בהתחברות לאתר/בלוג שלך."
140	+
141	+ #: edcal.php:285
142	+ msgid "Screen Options"
143	+ msgstr "הצג אפשרויות תצוגה"
144	+
145	+ #: edcal.php:286
146	+ msgid "Colors"
147	+ msgstr "צבעים"
148	+
149	+ #: edcal.php:287
150	+ msgid "Drafts: "
151	+ msgstr "טיוטות:"
152	+
153	+ #: edcal.php:288
154	+ msgid "Apply"
155	+ msgstr "החל שינויים"
156	+
157	+ #: edcal.php:289
158	+ msgid "Show on screen"
159	+ msgstr "הצג על המסך"
160	+
161	+ #: edcal.php:290
162	+ msgid " weeks at a time"
163	+ msgstr "שבועות בכל תצוגה"
164	+
165	+ #: edcal.php:291
166	+ msgid "Show in Calendar Cell"
167	+ msgstr "הצג בתאי לוח שנה"
168	+
169	+ #: edcal.php:292
170	+ msgid "Author"
171	+ msgstr "מחבר הפוסט"
172	+
173	+ #: edcal.php:293 edcal.php:414
174	+ msgid "Status"
175	+ msgstr "סטטוס הפוסט"
176	+
177	+ #: edcal.php:294
178	+ msgid "Time of day"
179	+ msgstr "השעה ביום"
180	+
181	+ #: edcal.php:295
182	+ msgid "An error occurred while loading the calendar: "
183	+ msgstr "אירעה שגיאה בזמן טעינת לוח השנה:"
184	+
185	+ #: edcal.php:297
186	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
187	+ msgstr "לוח השנה יכול להציג בין שבוע ל חמישה שבועות כל פעם."
188	+
189	+ #: edcal.php:298
190	+ msgid "Select the number of weeks for the calendar to show."
191	+ msgstr "בחר את מספר השבועות שיוצגו בלוח השנה."
192	+
193	+ #: edcal.php:306
194	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
195	+ msgstr "<h2>זהו, סיימנו!</h2> סיימנו לאסוף את המידע הדרוש. תודה שעזרת לנו להפוך את לוח השנה ליותר טוב.. "
196	+
197	+ #: edcal.php:347
198	+ msgid " Calendar"
199	+ msgstr "לוח שנה"
200	+
201	+ #: edcal.php:356
202	+ msgid "Jump back"
203	+ msgstr "דלג אחורה"
204	+
205	+ #: edcal.php:358
206	+ msgid "Skip ahead"
207	+ msgstr "דלג קדימה"
208	+
209	+ #: edcal.php:363
210	+ msgid "Scroll the calendar and make the today visible"
211	+ msgstr "גלול את לוח השנה והצג את היום גלוי"
212	+
213	+ #: edcal.php:363
214	+ msgid "Show Today"
215	+ msgstr "הצג את היום"
216	+
217	+ #: edcal.php:389
218	+ msgid "Edit Post"
219	+ msgstr "ערוך פוסט"
220	+
221	+ #: edcal.php:409
222	+ msgid "Time"
223	+ msgstr "זמן פרסום הפוסט"
224	+
225	+ #: edcal.php:417
226	+ msgid "Draft"
227	+ msgstr "טיוטה"
228	+
229	+ #: edcal.php:418
230	+ msgid "Pending Review"
231	+ msgstr "ממתין לאישור"
232	+
233	+ #: edcal.php:617
234	+ msgid "Posts "
235	+ msgstr "פוסטים "
236	+
237	+ #: edcal.php:633
238	+ msgid "Post "
239	+ msgstr "פוסט"
240	+
241	+ #: edcal.php:737 edcal.php:740
242	+ msgid "Error in deleting..."
243	+ msgstr "שגיאה במחיקה..."
244	+
245	+ #: edcal.php:185
246	+ msgid "ltr"
247	+ msgstr "rtl"

3.7.8/languages/editorial-calendar-hr.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-hr.po ADDED Viewed

	@@ -0,0 +1,146 @@


1	+ # Translation of the WordPress plugin by .
2	+ # Copyright (C) 2010
3	+ # This file is distributed under the same license as the package.
4	+ # FIRST AUTHOR <EMAIL@ADDRESS>, 2010.
5	+ #
6	+ msgid ""
7	+ msgstr ""
8	+ "Project-Id-Version: \n"
9	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
10	+ "POT-Creation-Date: 2010-01-02 21:49+0000\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "MIME-Version: 1.0\n"
14	+ "Content-Type: text/plain; charset=utf-8\n"
15	+ "Content-Transfer-Encoding: 8bit\n"
16	+ "Language-Team: \n"
17	+ "Language: hr\n"
18	+ "X-Generator: Poedit 2.2.3\n"
19	+
20	+ #: edcal.php:53
21	+ msgid "Calendar"
22	+ msgstr "Kalendar"
23	+
24	+ #: edcal.php:116
25	+ msgid "en-US"
26	+ msgstr "hr-HR"
27	+
28	+ #: edcal.php:124
29	+ msgid "on"
30	+ msgstr "na"
31	+
32	+ #: edcal.php:125
33	+ msgid "by"
34	+ msgstr "do"
35	+
36	+ #: edcal.php:126
37	+ msgid "at"
38	+ msgstr "u"
39	+
40	+ #: edcal.php:128
41	+ msgid "Sunday"
42	+ msgstr "Nedjelja"
43	+
44	+ #: edcal.php:129
45	+ msgid "Monday"
46	+ msgstr "Ponedjeljak"
47	+
48	+ #: edcal.php:130
49	+ msgid "Tuesday"
50	+ msgstr "Utorak"
51	+
52	+ #: edcal.php:131
53	+ msgid "Wednesday"
54	+ msgstr "Srijeda"
55	+
56	+ #: edcal.php:132
57	+ msgid "Thursday"
58	+ msgstr "Cetvrtak"
59	+
60	+ #: edcal.php:133
61	+ msgid "Friday"
62	+ msgstr "Petar"
63	+
64	+ #: edcal.php:134
65	+ msgid "Saturday"
66	+ msgstr "Subota"
67	+
68	+ #: edcal.php:136
69	+ msgid "Edit"
70	+ msgstr "Uredi"
71	+
72	+ #: edcal.php:137
73	+ msgid "Delete"
74	+ msgstr "Izbrisi"
75	+
76	+ #: edcal.php:138
77	+ msgid "View"
78	+ msgstr "Pregledaj"
79	+
80	+ #: edcal.php:139
81	+ msgid "Status:"
82	+ msgstr "Status:"
83	+
84	+ #: edcal.php:140
85	+ msgid "Cancel"
86	+ msgstr "Prekini"
87	+
88	+ #: edcal.php:141
89	+ msgid "Post Title:"
90	+ msgstr "Naslov clanka:"
91	+
92	+ #: edcal.php:142
93	+ msgid "Save Draft"
94	+ msgstr "Spremite predlozak"
95	+
96	+ #: edcal.php:143
97	+ msgid "Save and Edit Draft"
98	+ msgstr "Spremite predlozak i uredite ga"
99	+
100	+ #: edcal.php:144
101	+ msgid "Add a new post on "
102	+ msgstr "Dodajte novi clanak za "
103	+
104	+ #: edcal.php:146
105	+ msgid "You are about to delete this post "
106	+ msgstr "Izbrisati cete clanak "
107	+
108	+ #: edcal.php:147
109	+ msgid "Press cancel to stop, OK to delete."
110	+ msgstr "Kliknite prekini kako biste zaustavili akciju, Ok kako biste izbrisali."
111	+
112	+ #: edcal.php:149
113	+ msgid "Looks like someone else already moved this post."
114	+ msgstr "Cini se da je netko vec premjestio ovaj clanak."
115	+
116	+ #: edcal.php:150
117	+ msgid "You do not have permission to edit posts."
118	+ msgstr "Niste ovlasteni za uredivanje clanaka."
119	+
120	+ #: edcal.php:151
121	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
122	+ msgstr "Invalid checksum za clanak. Ovo je cesta cross-site scripting greska."
123	+
124	+ #: edcal.php:152
125	+ msgid "There was an error contacting your blog."
126	+ msgstr "Doslo je do greske prilikom kontaktiranja vaseg bloga."
127	+
128	+ #: edcal.php:184
129	+ msgid "Posts Calendar"
130	+ msgstr "Kalendar clanaka."
131	+
132	+ #: edcal.php:193
133	+ msgid "Go back four weeks."
134	+ msgstr "Vratite se 4 tjedna unazad."
135	+
136	+ #: edcal.php:195
137	+ msgid "Skip ahead four weeks."
138	+ msgstr "Preskocite 4 tjedna."
139	+
140	+ #: edcal.php:200
141	+ msgid "Today"
142	+ msgstr "Danas"
143	+
144	+ #: edcal.php:190 edcal.php:274
145	+ msgid "ltr"
146	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-it_IT.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-it_IT.po ADDED Viewed

	@@ -0,0 +1,279 @@


1	+ # Translation of WordPress Editorial Calendar in Italian
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language-Team: \n"
15	+ "Language: it_IT\n"
16	+
17	+ #: edcal.php:274 edcal.php:294
18	+ msgid "New Draft"
19	+ msgstr "Nuova Bozza"
20	+
21	+ #: edcal.php:292
22	+ msgid "Add a new draft"
23	+ msgstr "Aggiungi una nuova bozza"
24	+
25	+ #: edcal.php:322
26	+ msgid "The calendar can only show between 1 and 8 weeks at a time."
27	+ msgstr "Il calendario può mostrare solo tra 1 e 8 settimane alla volta."
28	+
29	+ #: edcal.php:325 edcal.php:400
30	+ msgid "Show Unscheduled Drafts"
31	+ msgstr "Mostra le bozze non programmate"
32	+
33	+ #: edcal.php:326
34	+ msgid "Hide Unscheduled Drafts"
35	+ msgstr "Nascondi le bozze non programmate"
36	+
37	+ #: edcal.php:391
38	+ msgid "Scroll the calendar and make the last post visible"
39	+ msgstr "Scorri il calendario e rendi l'ultimo post visibile"
40	+
41	+ #: edcal.php:400
42	+ msgid "Show unscheduled posts"
43	+ msgstr "Mostra i post non programmati"
44	+
45	+ #: edcal.php:406
46	+ msgid "Unscheduled draft posts"
47	+ msgstr "Post bozza non programmati"
48	+
49	+ #: edcal.php:406
50	+ msgid "Unscheduled"
51	+ msgstr "Non programmati"
52	+
53	+ #: edcal.php:379
54	+ msgid "%1$s Calendar"
55	+ msgstr "Calendario %1$s"
56	+
57	+ #: edcal.php:96 edcal.php:120
58	+ msgid "Calendar"
59	+ msgstr "Calendario"
60	+
61	+ #: edcal.php:263 edcal.php:524
62	+ msgid "en-US"
63	+ msgstr "it-IT"
64	+
65	+ #: edcal.php:271
66	+ msgid "%1$s by %2$s"
67	+ msgstr "%1$s di %2$s"
68	+
69	+ #: edcal.php:273
70	+ msgid "New Post"
71	+ msgstr "Nuovo post"
72	+
73	+ #: edcal.php:277
74	+ msgid " [DRAFT]"
75	+ msgstr "[BOZZA]"
76	+
77	+ #: edcal.php:278
78	+ msgid " [PENDING]"
79	+ msgstr "[IN ATTESA DI REVISIONE]"
80	+
81	+ #: edcal.php:279
82	+ msgid " [STICKY]"
83	+ msgstr "[IN EVIDENZA]"
84	+
85	+ #: edcal.php:280
86	+ msgid " [DRAFT, STICKY]"
87	+ msgstr "[BOZZA, IN EVIDENZA]"
88	+
89	+ #: edcal.php:281
90	+ msgid " [PENDING, STICKY]"
91	+ msgstr "[IN ATTESA DI REVISIONE, IN EVIDENZA]"
92	+
93	+ #: edcal.php:282 edcal.php:286
94	+ msgid "Edit"
95	+ msgstr "Modifica"
96	+
97	+ #: edcal.php:283
98	+ msgid "Quick Edit"
99	+ msgstr "Modifica veloce"
100	+
101	+ #: edcal.php:284
102	+ msgid "Delete"
103	+ msgstr "Cancella"
104	+
105	+ #: edcal.php:285
106	+ msgid "View"
107	+ msgstr "Visualizza"
108	+
109	+ #: edcal.php:287
110	+ msgid "Status:"
111	+ msgstr "Stato:"
112	+
113	+ #: edcal.php:288 edcal.php:483
114	+ msgid "Cancel"
115	+ msgstr "Annulla"
116	+
117	+ #: edcal.php:289 edcal.php:445
118	+ msgid "Title"
119	+ msgstr "Titolo"
120	+
121	+ #: edcal.php:290 edcal.php:450
122	+ msgid "Content"
123	+ msgstr "Contenuto"
124	+
125	+ #: edcal.php:291
126	+ msgid "Add a new post on %s"
127	+ msgstr "Aggiungi un nuovo post al %s"
128	+
129	+ #: edcal.php:293
130	+ msgid "New %s - "
131	+ msgstr "Nuovo %s -"
132	+
133	+ #: edcal.php:295
134	+ msgid "Update"
135	+ msgstr "Aggiorna"
136	+
137	+ #: edcal.php:296 edcal.php:482
138	+ msgid "Schedule"
139	+ msgstr "Programma"
140	+
141	+ #: edcal.php:297
142	+ msgid "Submit for Review"
143	+ msgstr "Invia per revisione"
144	+
145	+ #: edcal.php:298
146	+ msgid "Save"
147	+ msgstr "Salva"
148	+
149	+ #: edcal.php:299
150	+ msgid "Edit %1$s - %2$s"
151	+ msgstr "Modifica %1$s - %2$s"
152	+
153	+ #: edcal.php:300 edcal.php:467
154	+ msgid "Scheduled"
155	+ msgstr "Programmato"
156	+
157	+ #: edcal.php:302
158	+ msgid "You are about to delete the post \""
159	+ msgstr "Stai per cancellare il post \""
160	+
161	+ #: edcal.php:303
162	+ msgid "\". Press Cancel to stop, OK to delete."
163	+ msgstr "\". Premi Annulla per annullate, OK per cancellare."
164	+
165	+ #: edcal.php:305
166	+ msgid "Looks like someone else already moved this post."
167	+ msgstr "Sembra che qualcun altro abbia già spostato questo post."
168	+
169	+ #: edcal.php:306
170	+ msgid "You do not have permission to edit posts."
171	+ msgstr "Non hai i permessi per modificare post."
172	+
173	+ #: edcal.php:307
174	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
175	+ msgstr "Checksum non valido per il post. Questo è un comune errore di cross-site scripting."
176	+
177	+ #: edcal.php:308
178	+ msgid "There was an error contacting your blog."
179	+ msgstr "Si è verificato un errore nel contattare il tuo blog."
180	+
181	+ #: edcal.php:310
182	+ msgid "Screen Options"
183	+ msgstr "Opzioni schermo"
184	+
185	+ #: edcal.php:311
186	+ msgid "Colors"
187	+ msgstr "Colori"
188	+
189	+ #: edcal.php:312
190	+ msgid "Drafts: "
191	+ msgstr "Bozze:"
192	+
193	+ #: edcal.php:313
194	+ msgid "Apply"
195	+ msgstr "Applica"
196	+
197	+ #: edcal.php:314
198	+ msgid "Show on screen"
199	+ msgstr "Mostra sullo schermo"
200	+
201	+ #: edcal.php:315
202	+ msgid " weeks at a time"
203	+ msgstr "settimane per volta"
204	+
205	+ #: edcal.php:316
206	+ msgid "Show in Calendar Cell"
207	+ msgstr "Mostra nella cella del calendario"
208	+
209	+ #: edcal.php:317
210	+ msgid "Author"
211	+ msgstr "Autore"
212	+
213	+ #: edcal.php:318 edcal.php:461
214	+ msgid "Status"
215	+ msgstr "Stato"
216	+
217	+ #: edcal.php:319
218	+ msgid "Time of day"
219	+ msgstr "Ora del giorno"
220	+
221	+ #: edcal.php:320
222	+ msgid "An error occurred while loading the calendar: "
223	+ msgstr "Si è verificato un errore nel caricamento del calendario:"
224	+
225	+ #: edcal.php:323
226	+ msgid "Select the number of weeks for the calendar to show."
227	+ msgstr "Seleziona il numero di settimane da visualizzare nel calendario."
228	+
229	+ #: edcal.php:334
230	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
231	+ msgstr "<h2>Ci siamo</h2>Abbiamo finito di raccogliere i dati. Grazie per aiutarci a rendere il calendario migliore."
232	+
233	+ #: edcal.php:388
234	+ msgid "Jump back"
235	+ msgstr "Torna indietro"
236	+
237	+ #: edcal.php:390
238	+ msgid "Skip ahead"
239	+ msgstr "Salta avanti"
240	+
241	+ #: edcal.php:393
242	+ msgid "Scroll the calendar and make the today visible"
243	+ msgstr "Scorri il calendario e rendi visibile oggi"
244	+
245	+ #: edcal.php:393
246	+ msgid "Show Today"
247	+ msgstr "Mostra oggi"
248	+
249	+ #: edcal.php:436
250	+ msgid "Edit Post"
251	+ msgstr "Modifica post"
252	+
253	+ #: edcal.php:456
254	+ msgid "Time"
255	+ msgstr "Ora"
256	+
257	+ #: edcal.php:464
258	+ msgid "Draft"
259	+ msgstr "Bozza"
260	+
261	+ #: edcal.php:465
262	+ msgid "Pending Review"
263	+ msgstr "In attesa di revisione"
264	+
265	+ #: edcal.php:722
266	+ msgid "Posts "
267	+ msgstr "Post"
268	+
269	+ #: edcal.php:738
270	+ msgid "Post "
271	+ msgstr "Post"
272	+
273	+ #: edcal.php:865 edcal.php:868
274	+ msgid "Error in deleting..."
275	+ msgstr "Errore nel cancellare..."
276	+
277	+ #: edcal.php:191 edcal.php:275
278	+ msgid "ltr"
279	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-ja.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-ja.po ADDED Viewed

	@@ -0,0 +1,247 @@


1	+ # Copyright (C) 2010
2	+ # This file is distributed under the same license as the package.
3	+ msgid ""
4	+ msgstr ""
5	+ "Project-Id-Version: \n"
6	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
7	+ "POT-Creation-Date: 2011-12-26 13:18:14+00:00\n"
8	+ "MIME-Version: 1.0\n"
9	+ "Content-Type: text/plain; charset=UTF-8\n"
10	+ "Content-Transfer-Encoding: 8bit\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "Language-Team: Editorial Calendar\n"
14	+ "Language: ja\n"
15	+ "X-Generator: Poedit 2.2.3\n"
16	+
17	+ #: edcal.php:90 edcal.php:114
18	+ msgid "Calendar"
19	+ msgstr "カレンダー"
20	+
21	+ #: edcal.php:242 edcal.php:466
22	+ msgid "en-US"
23	+ msgstr "ja-JP"
24	+
25	+ #: edcal.php:250
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s by %2$s"
28	+
29	+ #: edcal.php:252
30	+ msgid "New Post"
31	+ msgstr "新規追加"
32	+
33	+ #: edcal.php:254
34	+ msgid " [DRAFT]"
35	+ msgstr " [下書き]"
36	+
37	+ #: edcal.php:255
38	+ msgid " [PENDING]"
39	+ msgstr " [レビュー待ち]"
40	+
41	+ #: edcal.php:256
42	+ msgid " [STICKY]"
43	+ msgstr " [先頭に固定表示]"
44	+
45	+ #: edcal.php:257
46	+ msgid " [DRAFT, STICKY]"
47	+ msgstr " [下書き、先頭に固定表示]"
48	+
49	+ #: edcal.php:258
50	+ msgid " [PENDING, STICKY]"
51	+ msgstr " [レビュー待ち、先頭に固定表示]"
52	+
53	+ #: edcal.php:259 edcal.php:263
54	+ msgid "Edit"
55	+ msgstr "編集"
56	+
57	+ #: edcal.php:260
58	+ msgid "Quick Edit"
59	+ msgstr "クイック編集"
60	+
61	+ #: edcal.php:261
62	+ msgid "Delete"
63	+ msgstr "削除"
64	+
65	+ #: edcal.php:262
66	+ msgid "View"
67	+ msgstr "プレビュー"
68	+
69	+ #: edcal.php:264
70	+ msgid "Status:"
71	+ msgstr "ステータス："
72	+
73	+ #: edcal.php:265 edcal.php:435
74	+ msgid "Cancel"
75	+ msgstr "キャンセル"
76	+
77	+ #: edcal.php:266 edcal.php:398
78	+ msgid "Title"
79	+ msgstr "タイトル"
80	+
81	+ #: edcal.php:267 edcal.php:403
82	+ msgid "Content"
83	+ msgstr "本文"
84	+
85	+ #: edcal.php:268
86	+ msgid "Add a new post on %s"
87	+ msgstr "%s に新規投稿を追加"
88	+
89	+ #: edcal.php:269
90	+ msgid "New %s - "
91	+ msgstr "新規 %s - "
92	+
93	+ #: edcal.php:270
94	+ msgid "Update"
95	+ msgstr "アップデート"
96	+
97	+ #: edcal.php:271 edcal.php:434
98	+ msgid "Schedule"
99	+ msgstr "スケジュール"
100	+
101	+ #: edcal.php:272
102	+ msgid "Submit for Review"
103	+ msgstr "レビュー待ちとして送信"
104	+
105	+ #: edcal.php:273
106	+ msgid "Save"
107	+ msgstr "保存"
108	+
109	+ #: edcal.php:274
110	+ msgid "Edit %1$s - %2$s"
111	+ msgstr "編集 %1$s - %2$s"
112	+
113	+ #: edcal.php:275 edcal.php:420
114	+ msgid "Scheduled"
115	+ msgstr "予約投稿"
116	+
117	+ #: edcal.php:277
118	+ msgid "You are about to delete the post \""
119	+ msgstr "投稿を削除しようとしています \""
120	+
121	+ #: edcal.php:278
122	+ msgid "\". Press Cancel to stop, OK to delete."
123	+ msgstr "\". 中止するにはキャンセルを、削除するならOKを押してください。"
124	+
125	+ #: edcal.php:280
126	+ msgid "Looks like someone else already moved this post."
127	+ msgstr "他の誰かがすでにこの投稿を移動させたようです。"
128	+
129	+ #: edcal.php:281
130	+ msgid "You do not have permission to edit posts."
131	+ msgstr "この投稿を編集する権限がありません。"
132	+
133	+ #: edcal.php:282
134	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
135	+ msgstr "チェックサムが正しくありません。これは一般的にはクロスサイトスクリプティングのエラーです。"
136	+
137	+ #: edcal.php:283
138	+ msgid "There was an error contacting your blog."
139	+ msgstr "あなたのブログとの間でエラーがありました。"
140	+
141	+ #: edcal.php:285
142	+ msgid "Screen Options"
143	+ msgstr "表示オプション"
144	+
145	+ #: edcal.php:286
146	+ msgid "Colors"
147	+ msgstr "色"
148	+
149	+ #: edcal.php:287
150	+ msgid "Drafts: "
151	+ msgstr "下書き："
152	+
153	+ #: edcal.php:288
154	+ msgid "Apply"
155	+ msgstr "適用"
156	+
157	+ #: edcal.php:289
158	+ msgid "Show on screen"
159	+ msgstr "画面への表示"
160	+
161	+ #: edcal.php:290
162	+ msgid " weeks at a time"
163	+ msgstr " 週間"
164	+
165	+ #: edcal.php:291
166	+ msgid "Show in Calendar Cell"
167	+ msgstr "カレンダーのセルへの表示"
168	+
169	+ #: edcal.php:292
170	+ msgid "Author"
171	+ msgstr "作成者"
172	+
173	+ #: edcal.php:293 edcal.php:414
174	+ msgid "Status"
175	+ msgstr "ステータス"
176	+
177	+ #: edcal.php:294
178	+ msgid "Time of day"
179	+ msgstr "時刻"
180	+
181	+ #: edcal.php:295
182	+ msgid "An error occurred while loading the calendar: "
183	+ msgstr "カレンダーを読み込み中にエラーが発生しました："
184	+
185	+ #: edcal.php:297
186	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
187	+ msgstr "カレンダーは1～5週間のみ一度に表示できます。"
188	+
189	+ #: edcal.php:298
190	+ msgid "Select the number of weeks for the calendar to show."
191	+ msgstr "表示させる週数を選んでください。"
192	+
193	+ #: edcal.php:306
194	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
195	+ msgstr "<h2>完了しました</h2>データの収集が完了しました。カレンダーをより良いものにするためのご協力ありがとうございます。"
196	+
197	+ #: edcal.php:347
198	+ msgid " Calendar"
199	+ msgstr " カレンダー"
200	+
201	+ #: edcal.php:356
202	+ msgid "Jump back"
203	+ msgstr "前のページへ"
204	+
205	+ #: edcal.php:358
206	+ msgid "Skip ahead"
207	+ msgstr "次のページへ"
208	+
209	+ #: edcal.php:363
210	+ msgid "Scroll the calendar and make the today visible"
211	+ msgstr "カレンダーをスクロールして今日の日付を表示します"
212	+
213	+ #: edcal.php:363
214	+ msgid "Show Today"
215	+ msgstr "今日"
216	+
217	+ #: edcal.php:389
218	+ msgid "Edit Post"
219	+ msgstr "投稿を編集"
220	+
221	+ #: edcal.php:409
222	+ msgid "Time"
223	+ msgstr "時刻"
224	+
225	+ #: edcal.php:417
226	+ msgid "Draft"
227	+ msgstr "下書き"
228	+
229	+ #: edcal.php:418
230	+ msgid "Pending Review"
231	+ msgstr "レビュー待ち"
232	+
233	+ #: edcal.php:617
234	+ msgid "Posts "
235	+ msgstr "投稿"
236	+
237	+ #: edcal.php:633
238	+ msgid "Post "
239	+ msgstr "投稿"
240	+
241	+ #: edcal.php:737 edcal.php:740
242	+ msgid "Error in deleting..."
243	+ msgstr "削除中にエラーが発生しました..."
244	+
245	+ #: edcal.php:190 edcal.php:274
246	+ msgid "ltr"
247	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-lt_LT.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-lt_LT.po ADDED Viewed

	@@ -0,0 +1,311 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: WordPress Editorial Calendar v1.4\n"
4	+ "Report-Msgid-Bugs-To: \n"
5	+ "POT-Creation-Date: \n"
6	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
7	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
8	+ "Language-Team: \n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
13	+ "X-Poedit-SourceCharset: utf-8\n"
14	+ "X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2\n"
15	+ "X-Poedit-Basepath: ..\n"
16	+ "X-Textdomain-Support: yes\n"
17	+ "Language: de_DE\n"
18	+ "X-Generator: Poedit 2.2.3\n"
19	+ "X-Poedit-SearchPath-0: .\n"
20	+
21	+ # @ editorial-calendar
22	+ #: edcal.php:90 edcal.php:112
23	+ msgid "Calendar"
24	+ msgstr "Kalendorius"
25	+
26	+ # @ editorial-calendar
27	+ #: edcal.php:240 edcal.php:464
28	+ msgid "en-US"
29	+ msgstr "lt-LT"
30	+
31	+ # @ editorial-calendar
32	+ #: edcal.php:248
33	+ #, php-format
34	+ msgid "%1$s by %2$s"
35	+ msgstr "%1$s prie %2$s"
36	+
37	+ # @ editorial-calendar
38	+ #: edcal.php:250
39	+ msgid "New Post"
40	+ msgstr "Naujas Įrašas"
41	+
42	+ # @ editorial-calendar
43	+ #: edcal.php:252
44	+ msgid " [DRAFT]"
45	+ msgstr "[JUODRAŠTIS]"
46	+
47	+ # @ editorial-calendar
48	+ #: edcal.php:253
49	+ msgid " [PENDING]"
50	+ msgstr "[LAUKIAMA]"
51	+
52	+ # @ editorial-calendar
53	+ #: edcal.php:254
54	+ msgid " [STICKY]"
55	+ msgstr "[PAINU]"
56	+
57	+ # @ editorial-calendar
58	+ #: edcal.php:255
59	+ msgid " [DRAFT, STICKY]"
60	+ msgstr "[ĮRAŠAS, PAINU]"
61	+
62	+ # @ editorial-calendar
63	+ #: edcal.php:256
64	+ msgid " [PENDING, STICKY]"
65	+ msgstr "[LAUKIAMA, PAINU]"
66	+
67	+ # @ editorial-calendar
68	+ #: edcal.php:257 edcal.php:261
69	+ msgid "Edit"
70	+ msgstr "Redaguoti"
71	+
72	+ # @ editorial-calendar
73	+ #: edcal.php:258
74	+ msgid "Quick Edit"
75	+ msgstr "Greitasis Redagavimas"
76	+
77	+ # @ editorial-calendar
78	+ #: edcal.php:259
79	+ msgid "Delete"
80	+ msgstr "Ištrinti"
81	+
82	+ # @ editorial-calendar
83	+ #: edcal.php:260
84	+ msgid "View"
85	+ msgstr "Peržiūrėti"
86	+
87	+ # @ editorial-calendar
88	+ #: edcal.php:262
89	+ msgid "Status:"
90	+ msgstr "Būsena:"
91	+
92	+ # @ editorial-calendar
93	+ #: edcal.php:263 edcal.php:433
94	+ msgid "Cancel"
95	+ msgstr "Atšaukti"
96	+
97	+ # @ editorial-calendar
98	+ #: edcal.php:264 edcal.php:396
99	+ msgid "Title"
100	+ msgstr "Antraštė"
101	+
102	+ # @ editorial-calendar
103	+ #: edcal.php:265 edcal.php:401
104	+ msgid "Content"
105	+ msgstr "Turinys"
106	+
107	+ # @ editorial-calendar
108	+ #: edcal.php:266
109	+ #, php-format
110	+ msgid "Add a new post on %s"
111	+ msgstr "Pridėti naują įrašą į %s"
112	+
113	+ # @ editorial-calendar
114	+ #: edcal.php:267
115	+ #, php-format
116	+ msgid "New %s - "
117	+ msgstr "Naujas %s - "
118	+
119	+ # @ editorial-calendar
120	+ #: edcal.php:268
121	+ msgid "Update"
122	+ msgstr "Atnaujinti"
123	+
124	+ # @ editorial-calendar
125	+ #: edcal.php:269 edcal.php:432
126	+ msgid "Schedule"
127	+ msgstr "Planuoti"
128	+
129	+ # @ editorial-calendar
130	+ #: edcal.php:270
131	+ msgid "Submit for Review"
132	+ msgstr "Pateikti Peržiūrai"
133	+
134	+ # @ editorial-calendar
135	+ #: edcal.php:271
136	+ msgid "Save"
137	+ msgstr "Įrašyti"
138	+
139	+ # @ editorial-calendar
140	+ #: edcal.php:272
141	+ #, php-format
142	+ msgid "Edit %1$s - %2$s"
143	+ msgstr "Redaguoti %1$s - %2$s"
144	+
145	+ # @ editorial-calendar
146	+ #: edcal.php:273 edcal.php:418
147	+ msgid "Scheduled"
148	+ msgstr "Suplanuota"
149	+
150	+ # @ editorial-calendar
151	+ #: edcal.php:275
152	+ msgid "You are about to delete the post \""
153	+ msgstr "Ar tikrai norite ištrinti šį įrašą? \""
154	+
155	+ # @ editorial-calendar
156	+ #: edcal.php:276
157	+ msgid "\". Press Cancel to stop, OK to delete."
158	+ msgstr "\" Paspauskite Cancel, norėdamas sustabdyti, Ok - tęsti trynimą"
159	+
160	+ # @ editorial-calendar
161	+ #: edcal.php:278
162	+ msgid "Looks like someone else already moved this post."
163	+ msgstr "Panašu, kad kažkas jau perkelė šį įrašą."
164	+
165	+ # @ editorial-calendar
166	+ #: edcal.php:279
167	+ msgid "You do not have permission to edit posts."
168	+ msgstr "Jūs neturite reikiamų leidimų įrašų redagavimui."
169	+
170	+ # @ editorial-calendar
171	+ #: edcal.php:280
172	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
173	+ msgstr "Klaidinga įrašo kontrolinė suma. Veikiausiai tai kryžminių tinklapių skriptų kalbos klaida."
174	+
175	+ # @ editorial-calendar
176	+ #: edcal.php:281
177	+ msgid "There was an error contacting your blog."
178	+ msgstr "Įvyko Jūsų tinklaraščio veiklą įtakojanti klaida."
179	+
180	+ # @ editorial-calendar
181	+ #: edcal.php:283
182	+ msgid "Screen Options"
183	+ msgstr "Vaizdavimo Parinktys"
184	+
185	+ # @ editorial-calendar
186	+ #: edcal.php:284
187	+ msgid "Colors"
188	+ msgstr "Spalvos"
189	+
190	+ # @ editorial-calendar
191	+ #: edcal.php:285
192	+ msgid "Drafts: "
193	+ msgstr "Juodraščiai:"
194	+
195	+ # @ editorial-calendar
196	+ #: edcal.php:286
197	+ msgid "Apply"
198	+ msgstr "Taikyti"
199	+
200	+ # @ editorial-calendar
201	+ #: edcal.php:287
202	+ msgid "Show on screen"
203	+ msgstr "Rodyti ekrane"
204	+
205	+ # @ editorial-calendar
206	+ #: edcal.php:288
207	+ msgid " weeks at a time"
208	+ msgstr "savaitės vienu metu."
209	+
210	+ # @ editorial-calendar
211	+ #: edcal.php:289
212	+ msgid "Show in Calendar Cell"
213	+ msgstr "Rodyti Kalendoriaus langelyje"
214	+
215	+ # @ editorial-calendar
216	+ #: edcal.php:290
217	+ msgid "Author"
218	+ msgstr "Autorius"
219	+
220	+ # @ editorial-calendar
221	+ #: edcal.php:291 edcal.php:412
222	+ msgid "Status"
223	+ msgstr "Būsena"
224	+
225	+ # @ editorial-calendar
226	+ #: edcal.php:292
227	+ msgid "Time of day"
228	+ msgstr "Dienos laikas"
229	+
230	+ # @ editorial-calendar
231	+ #: edcal.php:293
232	+ msgid "An error occurred while loading the calendar: "
233	+ msgstr "Įkeliant kalendorių įvyko klaida:"
234	+
235	+ # @ editorial-calendar
236	+ #: edcal.php:295
237	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
238	+ msgstr "Kalendorius vienu metu gali rodyti tik tarp 1 ir 5 savaičių."
239	+
240	+ # @ editorial-calendar
241	+ #: edcal.php:296
242	+ msgid "Select the number of weeks for the calendar to show."
243	+ msgstr "Pasinkite kalendoriuje rodomą savaičių skaičių."
244	+
245	+ # @ editorial-calendar
246	+ #: edcal.php:302
247	+ msgid "<div id=\"feedbacksection\"><h2>Help us Make the Editorial Calendar Better</h2>We are always trying to improve the Editorial Calendar and you can help. May we collect some data about your blog and browser settings to help us improve this plugin? We'll only do it once and your blog will show up on our <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar Statistics page</a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Collect Anonymous Data</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">No thank you</a></div>"
248	+ msgstr "<div id=\"feedbacksection\"><h2> Padėkite mums patobulinti šį kalendorių. <h2> Mes visada ieškome būdų kaip tai padaryti ir Jūs tikrai galite padėti. Gal norėtumėte suteikti šiek tiek informacijos apie Jūsų tinklaraštį ir naršyklės parinktis, kad galėtume ir toliau sėkmingai judėti į priekį? Mes tai padarysime tik kartą ir Jūsų tinklaraštis pasirodys mūsų <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar Statistikos puslapyje </a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Suteikti anoniminę informaciją</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">Ne, dekui.</a></div>"
249	+
250	+ # @ editorial-calendar
251	+ #: edcal.php:304
252	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
253	+ msgstr "<h2>Viskas!</h2> Mes baigėmė informacijos rinkimo procedūrą. Ačių, kad padedade mums tobulinti kalendorių."
254	+
255	+ # @ editorial-calendar
256	+ #: edcal.php:345
257	+ msgid " Calendar"
258	+ msgstr " Kalendorius"
259	+
260	+ # @ editorial-calendar
261	+ #: edcal.php:354
262	+ msgid "Jump back"
263	+ msgstr "Grįžti atgal"
264	+
265	+ # @ editorial-calendar
266	+ #: edcal.php:356
267	+ msgid "Skip ahead"
268	+ msgstr "Peršokti į priekį"
269	+
270	+ # @ editorial-calendar
271	+ #: edcal.php:361
272	+ msgid "Scroll the calendar and make the today visible"
273	+ msgstr "Slinkite kalendoriumi ir padarykite šiandienos infromaciją matoma"
274	+
275	+ # @ editorial-calendar
276	+ #: edcal.php:361
277	+ msgid "Show Today"
278	+ msgstr "Rodyti Šiandieną"
279	+
280	+ # @ editorial-calendar
281	+ #: edcal.php:387
282	+ msgid "Edit Post"
283	+ msgstr "Redaguoti Įrašą"
284	+
285	+ # @ editorial-calendar
286	+ #: edcal.php:407
287	+ msgid "Time"
288	+ msgstr "Laikas"
289	+
290	+ # @ editorial-calendar
291	+ #: edcal.php:415
292	+ msgid "Draft"
293	+ msgstr "Juodraštis"
294	+
295	+ # @ editorial-calendar
296	+ #: edcal.php:416
297	+ msgid "Pending Review"
298	+ msgstr "Laukiama Peržiūros"
299	+
300	+ # @ default
301	+ #: edcal.php:735 edcal.php:738
302	+ msgid "Error in deleting..."
303	+ msgstr "Klaida trynimo procese..."
304	+
305	+ #: edcal.php:617
306	+ msgid "Posts "
307	+ msgstr "Pranešimų "
308	+
309	+ #: edcal.php:190 edcal.php:274
310	+ msgid "ltr"
311	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-nb_NO.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-nb_NO.po ADDED Viewed

	@@ -0,0 +1,245 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: \n"
4	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
5	+ "POT-Creation-Date: 2011-12-21 13:34:53+00:00\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
10	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
11	+ "Language-Team: Zack Grossbart <zack@grossbart.com>\n"
12	+ "Language: nb_NO\n"
13	+ "X-Generator: Poedit 2.2.3\n"
14	+
15	+ #: edcal.php:90 edcal.php:114
16	+ msgid "Calendar"
17	+ msgstr "Kalendar"
18	+
19	+ #: edcal.php:242 edcal.php:466
20	+ msgid "en-US"
21	+ msgstr "nb-NO"
22	+
23	+ #: edcal.php:250
24	+ msgid "%1$s by %2$s"
25	+ msgstr "1$s av %2$s"
26	+
27	+ #: edcal.php:252
28	+ msgid "New Post"
29	+ msgstr "Nytt Innlegg"
30	+
31	+ #: edcal.php:254
32	+ msgid " [DRAFT]"
33	+ msgstr " [UTKAST]"
34	+
35	+ #: edcal.php:255
36	+ msgid " [PENDING]"
37	+ msgstr " [PÃ…VENTE]"
38	+
39	+ #: edcal.php:256
40	+ msgid " [STICKY]"
41	+ msgstr " [KLISTRET]"
42	+
43	+ #: edcal.php:257
44	+ msgid " [DRAFT, STICKY]"
45	+ msgstr " [UTKAST KLISTRET]"
46	+
47	+ #: edcal.php:258
48	+ msgid " [PENDING, STICKY]"
49	+ msgstr " [PÃ…VENTE KLISTRET]"
50	+
51	+ #: edcal.php:259 edcal.php:263
52	+ msgid "Edit"
53	+ msgstr "Editer"
54	+
55	+ #: edcal.php:260
56	+ msgid "Quick Edit"
57	+ msgstr "Hurtig Editering"
58	+
59	+ #: edcal.php:261
60	+ msgid "Delete"
61	+ msgstr "Slett"
62	+
63	+ #: edcal.php:262
64	+ msgid "View"
65	+ msgstr "Se"
66	+
67	+ #: edcal.php:264
68	+ msgid "Status:"
69	+ msgstr "Status"
70	+
71	+ #: edcal.php:265 edcal.php:435
72	+ msgid "Cancel"
73	+ msgstr "Avbryt"
74	+
75	+ #: edcal.php:266 edcal.php:398
76	+ msgid "Title"
77	+ msgstr "Tittel"
78	+
79	+ #: edcal.php:267 edcal.php:403
80	+ msgid "Content"
81	+ msgstr "Innhold"
82	+
83	+ #: edcal.php:268
84	+ msgid "Add a new post on %s"
85	+ msgstr "Legg til nytt innlegg pÃ¥ %s"
86	+
87	+ #: edcal.php:269
88	+ msgid "New %s - "
89	+ msgstr "Nytt %s - "
90	+
91	+ #: edcal.php:270
92	+ msgid "Update"
93	+ msgstr "Oppdater"
94	+
95	+ #: edcal.php:271 edcal.php:434
96	+ msgid "Schedule"
97	+ msgstr "Planlegg"
98	+
99	+ #: edcal.php:272
100	+ msgid "Submit for Review"
101	+ msgstr "Send til vurdering"
102	+
103	+ #: edcal.php:273
104	+ msgid "Save"
105	+ msgstr "Lagre"
106	+
107	+ #: edcal.php:274
108	+ msgid "Edit %1$s - %2$s"
109	+ msgstr "Editer %1$ - %2$s"
110	+
111	+ #: edcal.php:275 edcal.php:420
112	+ msgid "Scheduled"
113	+ msgstr "Planlagt"
114	+
115	+ #: edcal.php:277
116	+ msgid "You are about to delete the post \""
117	+ msgstr "Du er i ferd med Ã¥ slette innlegget \""
118	+
119	+ #: edcal.php:278
120	+ msgid "\". Press Cancel to stop, OK to delete."
121	+ msgstr "\". Trykk Avbryt for Ã¥ stoppe, OK for Ã¥ slette."
122	+
123	+ #: edcal.php:280
124	+ msgid "Looks like someone else already moved this post."
125	+ msgstr "Ser ut som noen andre allerede flyttet dette innlegget."
126	+
127	+ #: edcal.php:281
128	+ msgid "You do not have permission to edit posts."
129	+ msgstr "Du har ikke tillatelse til Ã¥ redigere innlegg."
130	+
131	+ #: edcal.php:282
132	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
133	+ msgstr "Ugyldig kontrollsum for post. Dette er vanligvis en cross-site scripting feil."
134	+
135	+ #: edcal.php:283
136	+ msgid "There was an error contacting your blog."
137	+ msgstr "Det oppstod en feil med tilkobling av din blogg."
138	+
139	+ #: edcal.php:285
140	+ msgid "Screen Options"
141	+ msgstr "Skjerm Alternativer"
142	+
143	+ #: edcal.php:286
144	+ msgid "Colors"
145	+ msgstr "Farger"
146	+
147	+ #: edcal.php:287
148	+ msgid "Drafts: "
149	+ msgstr "Utkast: "
150	+
151	+ #: edcal.php:288
152	+ msgid "Apply"
153	+ msgstr "Legg til"
154	+
155	+ #: edcal.php:289
156	+ msgid "Show on screen"
157	+ msgstr "Vis pÃ¥ skjerm"
158	+
159	+ #: edcal.php:290
160	+ msgid " weeks at a time"
161	+ msgstr "Uker"
162	+
163	+ #: edcal.php:291
164	+ msgid "Show in Calendar Cell"
165	+ msgstr "Vis i Kalender celle"
166	+
167	+ #: edcal.php:292
168	+ msgid "Author"
169	+ msgstr "Forfatter"
170	+
171	+ #: edcal.php:293 edcal.php:414
172	+ msgid "Status"
173	+ msgstr "Status"
174	+
175	+ #: edcal.php:294
176	+ msgid "Time of day"
177	+ msgstr "Tid pÃ¥ dagen"
178	+
179	+ #: edcal.php:295
180	+ msgid "An error occurred while loading the calendar: "
181	+ msgstr "Det oppstod en feil under innlasting av kalenderen: "
182	+
183	+ #: edcal.php:297
184	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
185	+ msgstr "Kalenderen kan bare vise mellom 1 og 5 uker av gangen."
186	+
187	+ #: edcal.php:298
188	+ msgid "Select the number of weeks for the calendar to show."
189	+ msgstr "Velg antall uker som kalenderen skal vise"
190	+
191	+ #: edcal.php:306
192	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
193	+ msgstr "<h2>Vi er ferdig</h2> Vi er ferdig med Ã¥ samle data. Takk for at du hjelper oss\" \"med Ã¥ gjÃ¸re kalenderen bedre."
194	+
195	+ #: edcal.php:347
196	+ msgid " Calendar"
197	+ msgstr " Kalendar"
198	+
199	+ #: edcal.php:356
200	+ msgid "Jump back"
201	+ msgstr "GÃ¥ tilbake"
202	+
203	+ #: edcal.php:358
204	+ msgid "Skip ahead"
205	+ msgstr "hopp fremover"
206	+
207	+ #: edcal.php:363
208	+ msgid "Scroll the calendar and make the today visible"
209	+ msgstr "Bla i kalenderen og gjÃ¸r i dag synlig"
210	+
211	+ #: edcal.php:363
212	+ msgid "Show Today"
213	+ msgstr "Vis i dag"
214	+
215	+ #: edcal.php:389
216	+ msgid "Edit Post"
217	+ msgstr "Editer Innlegg"
218	+
219	+ #: edcal.php:409
220	+ msgid "Time"
221	+ msgstr "Tid"
222	+
223	+ #: edcal.php:417
224	+ msgid "Draft"
225	+ msgstr "Utkast"
226	+
227	+ #: edcal.php:418
228	+ msgid "Pending Review"
229	+ msgstr "Send til gjennomgang"
230	+
231	+ #: edcal.php:617
232	+ msgid "Posts "
233	+ msgstr "Innlegg "
234	+
235	+ #: edcal.php:633
236	+ msgid "Post "
237	+ msgstr "Innlegg "
238	+
239	+ #: edcal.php:737 edcal.php:740
240	+ msgid "Error in deleting..."
241	+ msgstr "Feil under sletting..."
242	+
243	+ #: edcal.php:190 edcal.php:274
244	+ msgid "ltr"
245	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-nl_NL.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-nl_NL.po ADDED Viewed

	@@ -0,0 +1,239 @@


1	+ # Copyright (C) 2010
2	+ # This file is distributed under the same license as the package.
3	+ msgid ""
4	+ msgstr ""
5	+ "Project-Id-Version: EditorialCalendar\n"
6	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
7	+ "POT-Creation-Date: 2011-02-01 15:28:07+00:00\n"
8	+ "MIME-Version: 1.0\n"
9	+ "Content-Type: text/plain; charset=UTF-8\n"
10	+ "Content-Transfer-Encoding: 8bit\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "Language-Team: Paternostre <info@paternostre.nl>\n"
14	+ "Language: nl_NL\n"
15	+ "X-Generator: Poedit 2.2.3\n"
16	+
17	+ #: edcal.php:71 edcal.php:93
18	+ msgid "Calendar"
19	+ msgstr "Kalender"
20	+
21	+ #: edcal.php:221 edcal.php:465
22	+ msgid "en-US"
23	+ msgstr "nl-NL"
24	+
25	+ #: edcal.php:229
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s door %2$s"
28	+
29	+ #: edcal.php:231
30	+ msgid "New Post"
31	+ msgstr "Nieuw bericht"
32	+
33	+ #: edcal.php:233
34	+ msgid " [DRAFT]"
35	+ msgstr "[ CONCEPT]"
36	+
37	+ #: edcal.php:234
38	+ msgid " [PENDING]"
39	+ msgstr "[WACHTEND]"
40	+
41	+ #: edcal.php:235
42	+ msgid " [STICKY]"
43	+ msgstr "[STICKY]"
44	+
45	+ #: edcal.php:236
46	+ msgid " [DRAFT, STICKY]"
47	+ msgstr "[CONCEPT, STICKY]"
48	+
49	+ #: edcal.php:237
50	+ msgid " [PENDING, STICKY]"
51	+ msgstr "[WACHTEND, STICKY]"
52	+
53	+ #: edcal.php:238 edcal.php:242
54	+ msgid "Edit"
55	+ msgstr "Bewerken"
56	+
57	+ #: edcal.php:239
58	+ msgid "Quick Edit"
59	+ msgstr "Snel bewerken"
60	+
61	+ #: edcal.php:240
62	+ msgid "Delete"
63	+ msgstr "Verwijderen"
64	+
65	+ #: edcal.php:241
66	+ msgid "View"
67	+ msgstr "Bekijken"
68	+
69	+ #: edcal.php:243
70	+ msgid "Status:"
71	+ msgstr "Status:"
72	+
73	+ #: edcal.php:244 edcal.php:409
74	+ msgid "Cancel"
75	+ msgstr "Annuleren"
76	+
77	+ #: edcal.php:245 edcal.php:363
78	+ msgid "Title"
79	+ msgstr "Titel"
80	+
81	+ #: edcal.php:246 edcal.php:368
82	+ msgid "Content"
83	+ msgstr "Inhoud"
84	+
85	+ #: edcal.php:247
86	+ msgid "Add a new post on %s"
87	+ msgstr "Voeg een nieuwe bericht toe op %s"
88	+
89	+ #: edcal.php:248
90	+ msgid "New %s - "
91	+ msgstr "Nieuwe %s - "
92	+
93	+ #: edcal.php:249
94	+ msgid "Update"
95	+ msgstr "Bijwerken"
96	+
97	+ #: edcal.php:250 edcal.php:408
98	+ msgid "Schedule"
99	+ msgstr "Planning"
100	+
101	+ #: edcal.php:251
102	+ msgid "Submit for Review"
103	+ msgstr "Inzenden voor review"
104	+
105	+ #: edcal.php:252
106	+ msgid "Save"
107	+ msgstr "Opslaan"
108	+
109	+ #: edcal.php:253
110	+ msgid "Edit %1$s - %2$s"
111	+ msgstr "Bewerk %1$s - %2$s"
112	+
113	+ #: edcal.php:254 edcal.php:394
114	+ msgid "Scheduled"
115	+ msgstr "Gepland"
116	+
117	+ #: edcal.php:256
118	+ msgid "You are about to delete the post \""
119	+ msgstr "Je staat op het punt om het bericht te verwijderen \""
120	+
121	+ #: edcal.php:257
122	+ msgid "\". Press Cancel to stop, OK to delete."
123	+ msgstr "\". Klik op Annuleer om te stoppen of op OK om te verwijderen."
124	+
125	+ #: edcal.php:259
126	+ msgid "Looks like someone else already moved this post."
127	+ msgstr "Het lijkt erop dat iemand anders dit bericht al verplaatst heeft."
128	+
129	+ #: edcal.php:260
130	+ msgid "You do not have permission to edit posts."
131	+ msgstr "Je hebt onvoldoende rechten om berichten te mogen bewerken."
132	+
133	+ #: edcal.php:261
134	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
135	+ msgstr "Ongeldige checksum voor bericht. Dit is gebruikelijk bij een cross-site scripting-fout."
136	+
137	+ #: edcal.php:262
138	+ msgid "There was an error contacting your blog."
139	+ msgstr "Er is een fout opgetreden bij de verbinding met je blog."
140	+
141	+ #: edcal.php:264
142	+ msgid "Screen Options"
143	+ msgstr "Schermopties"
144	+
145	+ #: edcal.php:265
146	+ msgid "Colors"
147	+ msgstr "Kleuren"
148	+
149	+ #: edcal.php:266
150	+ msgid "Drafts: "
151	+ msgstr "Concepten:"
152	+
153	+ #: edcal.php:267
154	+ msgid "Apply"
155	+ msgstr "Toepassen"
156	+
157	+ #: edcal.php:268
158	+ msgid "Show on screen"
159	+ msgstr "Toon op scherm"
160	+
161	+ #: edcal.php:269
162	+ msgid " weeks at a time"
163	+ msgstr "weken per keer"
164	+
165	+ #: edcal.php:270
166	+ msgid "Show in Calendar Cell"
167	+ msgstr "Toon in kalendercel"
168	+
169	+ #: edcal.php:271
170	+ msgid "Author"
171	+ msgstr "Auteur"
172	+
173	+ #: edcal.php:272 edcal.php:388
174	+ msgid "Status"
175	+ msgstr "Status"
176	+
177	+ #: edcal.php:273
178	+ msgid "Time of day"
179	+ msgstr "Tijd van de dag"
180	+
181	+ #: edcal.php:274
182	+ msgid "An error occurred while loading the calendar: "
183	+ msgstr "Er is een fout opgetreden tijdens het laden van de kalender:"
184	+
185	+ #: edcal.php:276
186	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
187	+ msgstr "De kalender kan alleen tussen 1 en 5 weken per keer tonen."
188	+
189	+ #: edcal.php:277
190	+ msgid "Select the number of weeks for the calendar to show."
191	+ msgstr "Selecteer het aantal weken dat de kalender moet tonen."
192	+
193	+ #: edcal.php:285
194	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
195	+ msgstr "<h2>We zijn klaar</h2>We zijn klaar met het verzamelen van de data. Dank je wel voor het helpen bij het verbeteren van de kalender."
196	+
197	+ #: edcal.php:326
198	+ msgid " Calendar"
199	+ msgstr "Kalender"
200	+
201	+ #: edcal.php:335
202	+ msgid "Jump back"
203	+ msgstr "Ga terug"
204	+
205	+ #: edcal.php:337
206	+ msgid "Skip ahead"
207	+ msgstr "Ga vooruit"
208	+
209	+ #: edcal.php:342
210	+ msgid "Scroll the calendar and make the today visible"
211	+ msgstr "Verschuif de kalender en maak vandaag zichtbaar"
212	+
213	+ #: edcal.php:342
214	+ msgid "Show Today"
215	+ msgstr "Toon vandaag"
216	+
217	+ #: edcal.php:354
218	+ msgid "Edit Post"
219	+ msgstr "Bericht bewerken"
220	+
221	+ #: edcal.php:383
222	+ msgid "Time"
223	+ msgstr "Tijd"
224	+
225	+ #: edcal.php:391
226	+ msgid "Draft"
227	+ msgstr "Concept"
228	+
229	+ #: edcal.php:392
230	+ msgid "Pending Review"
231	+ msgstr "Wachtend op review"
232	+
233	+ #: edcal.php:734 edcal.php:737
234	+ msgid "Error in deleting..."
235	+ msgstr "Fout bij het verwijderen..."
236	+
237	+ #: edcal.php:190 edcal.php:274
238	+ msgid "ltr"
239	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-pl_PL.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-pl_PL.po ADDED Viewed

	@@ -0,0 +1,198 @@


1	+ # Translation of the WordPress plugin by .
2	+ # Copyright (C) 2010
3	+ # This file is distributed under the same license as the package.
4	+ # FIRST AUTHOR <EMAIL@ADDRESS>, 2010.
5	+ #
6	+ msgid ""
7	+ msgstr ""
8	+ "Project-Id-Version: \n"
9	+ "Report-Msgid-Bugs-To: http://wordpress.org/tag/editorial-calendar\n"
10	+ "POT-Creation-Date: 2010-04-14 14:22+0000\n"
11	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
12	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
13	+ "Language-Team: POLISH <LL@li.org>\n"
14	+ "MIME-Version: 1.0\n"
15	+ "Content-Type: text/plain; charset=utf-8\n"
16	+ "Content-Transfer-Encoding: 8bit\n"
17	+ "Language: pl_PL\n"
18	+ "X-Generator: Poedit 2.2.3\n"
19	+
20	+ #: edcal.php:63
21	+ msgid "Calendar"
22	+ msgstr "Kalendarz"
23	+
24	+ #: edcal.php:137 edcal.php:349
25	+ msgid "en-US"
26	+ msgstr "pl-PL"
27	+
28	+ #: edcal.php:145
29	+ msgid "on"
30	+ msgstr "na"
31	+
32	+ #: edcal.php:146
33	+ msgid "by"
34	+ msgstr "przez"
35	+
36	+ #: edcal.php:147
37	+ msgid "at"
38	+ msgstr "o"
39	+
40	+ #: edcal.php:149
41	+ msgid "New Post"
42	+ msgstr "Nowy wpis"
43	+
44	+ #: edcal.php:151
45	+ msgid " [DRAFT]"
46	+ msgstr "[SZKIC]"
47	+
48	+ #: edcal.php:152
49	+ msgid "Edit"
50	+ msgstr "Edytuj"
51	+
52	+ #: edcal.php:153
53	+ msgid "Delete"
54	+ msgstr "Usuń"
55	+
56	+ #: edcal.php:154
57	+ msgid "View"
58	+ msgstr "Podejrzyj"
59	+
60	+ #: edcal.php:155
61	+ msgid "Republish"
62	+ msgstr "Publikuj ponownie"
63	+
64	+ #: edcal.php:156
65	+ msgid "Status:"
66	+ msgstr "Stan:"
67	+
68	+ #: edcal.php:157 edcal.php:295
69	+ msgid "Cancel"
70	+ msgstr "Anuluj"
71	+
72	+ #: edcal.php:158 edcal.php:261
73	+ msgid "Title"
74	+ msgstr "Tytuł"
75	+
76	+ #: edcal.php:159 edcal.php:266
77	+ msgid "Content"
78	+ msgstr "Treść"
79	+
80	+ #: edcal.php:160
81	+ msgid "Add a new post on "
82	+ msgstr "Dodaj nowy wpis dnia"
83	+
84	+ #: edcal.php:161
85	+ msgid "New Post - "
86	+ msgstr "Nowy wpis -"
87	+
88	+ #: edcal.php:162
89	+ msgid "Update"
90	+ msgstr "Zaktualizuj"
91	+
92	+ #: edcal.php:163 edcal.php:294
93	+ msgid "Schedule"
94	+ msgstr "Zaplanuj"
95	+
96	+ #: edcal.php:164
97	+ msgid "Save"
98	+ msgstr "Zapisz"
99	+
100	+ #: edcal.php:165 edcal.php:255
101	+ msgid "Edit Post"
102	+ msgstr "Edytuj wpis"
103	+
104	+ #: edcal.php:166 edcal.php:287
105	+ msgid "Scheduled"
106	+ msgstr "Zaplanowano"
107	+
108	+ #: edcal.php:168
109	+ msgid "You are about to delete the post \""
110	+ msgstr "Zamierzasz usunąć wpis \""
111	+
112	+ #: edcal.php:169
113	+ msgid "\". Press Cancel to stop, OK to delete."
114	+ msgstr "\". Kliknij Anuluj, aby zatrzymać, OK, aby usunąć"
115	+
116	+ #: edcal.php:171
117	+ msgid "Looks like someone else already moved this post."
118	+ msgstr "Prawdopodobnie ktoś inny przeniósł ten wpis."
119	+
120	+ #: edcal.php:172
121	+ msgid "You do not have permission to edit posts."
122	+ msgstr "Nie masz uprawnień do edycji tego wpisu."
123	+
124	+ #: edcal.php:173
125	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
126	+ msgstr "Niewłaściwa suma kontrolna dla wpisu. Jest to zwykle związane z błędem cross-site scripting. "
127	+
128	+ #: edcal.php:174
129	+ msgid "There was an error contacting your blog."
130	+ msgstr "Nie udało się połączyć z Twoim blogiem."
131	+
132	+ #: edcal.php:176
133	+ msgid "Screen Options"
134	+ msgstr "Opcje ekranu"
135	+
136	+ #: edcal.php:177
137	+ msgid "Calendar Options"
138	+ msgstr "Opcje kalendarza"
139	+
140	+ #: edcal.php:178
141	+ msgid "Apply"
142	+ msgstr "Zatwierdź"
143	+
144	+ #: edcal.php:179
145	+ msgid "Show "
146	+ msgstr "Pokaż"
147	+
148	+ #: edcal.php:180
149	+ msgid "weeks at a time"
150	+ msgstr "tygodni jednocześnie"
151	+
152	+ #: edcal.php:181
153	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
154	+ msgstr "Kalendarz może pokazywać jednocześnie tylko od 1 do 5 tygodni."
155	+
156	+ #: edcal.php:182
157	+ msgid "Select the number of weeks for the calendar to show."
158	+ msgstr "Wybierz liczbę tygodni, które mają się pokazywać w kalendarzu."
159	+
160	+ #: edcal.php:226
161	+ msgid "Posts Calendar"
162	+ msgstr "Kalendarz wpisów"
163	+
164	+ #: edcal.php:235
165	+ msgid "Jump back"
166	+ msgstr "Skocz wstecz"
167	+
168	+ #: edcal.php:237
169	+ msgid "Skip ahead"
170	+ msgstr "Skocz naprzód"
171	+
172	+ #: edcal.php:242
173	+ msgid "Jump to today"
174	+ msgstr "Skocz do dzisiaj"
175	+
176	+ #: edcal.php:242
177	+ msgid "Today"
178	+ msgstr "Dzisiaj"
179	+
180	+ #: edcal.php:281
181	+ msgid "Time"
182	+ msgstr "Czas"
183	+
184	+ #: edcal.php:285
185	+ msgid "Status"
186	+ msgstr "Stan"
187	+
188	+ #: edcal.php:289
189	+ msgid "Draft"
190	+ msgstr "Szkic"
191	+
192	+ #: edcal.php:544 edcal.php:547
193	+ msgid "Error in deleting..."
194	+ msgstr "Błąd podczas usuwania..."
195	+
196	+ #: edcal.php:190 edcal.php:274
197	+ msgid "ltr"
198	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-pt_BR.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-pt_BR.po ADDED Viewed

	@@ -0,0 +1,189 @@


1	+ # Translation of WordPress Editorial Calendar in Portuguese (Brazil)
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=2; plural=(n > 1);\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language-Team: \n"
15	+ "Language: pt_BR\n"
16	+
17	+ msgid "%1$s Calendar"
18	+ msgstr "%1$s Calendário"
19	+
20	+ msgid "Calendar"
21	+ msgstr "Calendário"
22	+
23	+ msgid "en-US"
24	+ msgstr "pt-BR"
25	+
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s por %2$s"
28	+
29	+ msgid "New Post"
30	+ msgstr "Novo Post"
31	+
32	+ msgid " [DRAFT]"
33	+ msgstr "[RASCUNHO]"
34	+
35	+ msgid " [PENDING]"
36	+ msgstr "[PENDENTE]"
37	+
38	+ msgid " [STICKY]"
39	+ msgstr "[FIXO]"
40	+
41	+ msgid " [DRAFT, STICKY]"
42	+ msgstr "[RASCUNHO, FIXO]"
43	+
44	+ msgid " [PENDING, STICKY]"
45	+ msgstr "[PENDENTE, FIXO]"
46	+
47	+ msgid "Edit"
48	+ msgstr "Editar"
49	+
50	+ msgid "Quick Edit"
51	+ msgstr "Ed Rápida"
52	+
53	+ msgid "Delete"
54	+ msgstr "Deletar"
55	+
56	+ msgid "View"
57	+ msgstr "Ver"
58	+
59	+ msgid "Status:"
60	+ msgstr "Estado:"
61	+
62	+ msgid "Cancel"
63	+ msgstr "Cancelar"
64	+
65	+ msgid "Title"
66	+ msgstr "Título"
67	+
68	+ msgid "Content"
69	+ msgstr "Conteúdo"
70	+
71	+ msgid "Add a new post on %s"
72	+ msgstr "Novo post em %s"
73	+
74	+ msgid "New %s - "
75	+ msgstr "Novo %s - "
76	+
77	+ msgid "Update"
78	+ msgstr "Atualizar"
79	+
80	+ msgid "Schedule"
81	+ msgstr "Agendar"
82	+
83	+ msgid "Submit for Review"
84	+ msgstr "Enviar para Revisão"
85	+
86	+ msgid "Save"
87	+ msgstr "Salvar"
88	+
89	+ msgid "Edit %1$s - %2$s"
90	+ msgstr "Editar %1$s - %2$s"
91	+
92	+ msgid "Scheduled"
93	+ msgstr "Agendado"
94	+
95	+ msgid "You are about to delete the post \""
96	+ msgstr "Você está prestes a deletar o post \""
97	+
98	+ msgid "\". Press Cancel to stop, OK to delete."
99	+ msgstr "\". Clique Cancelar para parar, OK para deletar."
100	+
101	+ msgid "Looks like someone else already moved this post."
102	+ msgstr "Parece que alguém já moveu este post."
103	+
104	+ msgid "You do not have permission to edit posts."
105	+ msgstr "Você não tem permissão para editar posts"
106	+
107	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
108	+ msgstr "Soma de verificação inválida para o post. Este é normalmente um erro de cross-site scripting."
109	+
110	+ msgid "There was an error contacting your blog."
111	+ msgstr "Ocorreu um erro contatando seu blog."
112	+
113	+ msgid "Screen Options"
114	+ msgstr "Opções de Tela"
115	+
116	+ msgid "Colors"
117	+ msgstr "Cores"
118	+
119	+ msgid "Drafts: "
120	+ msgstr "Rascunhos: "
121	+
122	+ msgid "Apply"
123	+ msgstr "Aplicar"
124	+
125	+ msgid "Show on screen"
126	+ msgstr "Exibir na tela"
127	+
128	+ msgid " weeks at a time"
129	+ msgstr " semanas de uma vez"
130	+
131	+ msgid "Show in Calendar Cell"
132	+ msgstr "Mostrar na Célula do Calendário"
133	+
134	+ msgid "Author"
135	+ msgstr "Autor"
136	+
137	+ msgid "Status"
138	+ msgstr "Estado"
139	+
140	+ msgid "Time of day"
141	+ msgstr "Hora do dia"
142	+
143	+ msgid "An error occurred while loading the calendar: "
144	+ msgstr "Ocorreu um erro carregando o calendário: "
145	+
146	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
147	+ msgstr "O calendário só pode exibir entre 1 e 5 semanas de uma vez."
148	+
149	+ msgid "Select the number of weeks for the calendar to show."
150	+ msgstr "Selecione o número de semanas a exibir no calendário."
151	+
152	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
153	+ msgstr "<h2>Feito</h2>Acabamos a coleta de dados. Obrigado por nos ajudar a fazer o calendário melhor."
154	+
155	+ msgid "Jump back"
156	+ msgstr "Para trás"
157	+
158	+ msgid "Skip ahead"
159	+ msgstr "Para frente"
160	+
161	+ msgid "Scroll the calendar and make the today visible"
162	+ msgstr "Rolar o calendário e fazer 'hoje' visível"
163	+
164	+ msgid "Show Today"
165	+ msgstr "Mostrar Hoje"
166	+
167	+ msgid "Edit Post"
168	+ msgstr "Editar Post"
169	+
170	+ msgid "Time"
171	+ msgstr "Hora"
172	+
173	+ msgid "Draft"
174	+ msgstr "Rascunho"
175	+
176	+ msgid "Pending Review"
177	+ msgstr "Revisão Pendente"
178	+
179	+ msgid "Posts "
180	+ msgstr "Posts "
181	+
182	+ msgid "Post "
183	+ msgstr "Post "
184	+
185	+ msgid "Error in deleting..."
186	+ msgstr "Erro ao deletar..."
187	+
188	+ msgid "ltr"
189	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-ru_RU.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-ru_RU.po ADDED Viewed

	@@ -0,0 +1,189 @@


1	+ # Translation of WordPress Editorial Calendar in Russian
2	+ # This file is distributed under the same license as the WordPress Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+ "Plural-Forms: nplurals=3; plural=(n%10==1 && n%100!=11 ? 0 : n%10>=2 && n%10<=4 && (n%100<10 \|\| n%100>=20) ? 1 : 2);\n"
10	+ "X-Generator: Poedit 2.2.3\n"
11	+ "Project-Id-Version: WordPress Editorial Calendar\n"
12	+ "POT-Creation-Date: \n"
13	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
14	+ "Language-Team: \n"
15	+ "Language: ru_RU\n"
16	+
17	+ msgid "%1$s Calendar"
18	+ msgstr "%1$s Календарь"
19	+
20	+ msgid "Calendar"
21	+ msgstr "Календарь"
22	+
23	+ msgid "en-US"
24	+ msgstr "ru-RU"
25	+
26	+ msgid "%1$s by %2$s"
27	+ msgstr "%1$s по %2$s"
28	+
29	+ msgid "New Post"
30	+ msgstr "новый публикация"
31	+
32	+ msgid " [DRAFT]"
33	+ msgstr "[черновой вариант]"
34	+
35	+ msgid " [PENDING]"
36	+ msgstr "в ожидании"
37	+
38	+ msgid " [STICKY]"
39	+ msgstr "[Важно]"
40	+
41	+ msgid " [DRAFT, STICKY]"
42	+ msgstr "[черновой вариант, Важно]"
43	+
44	+ msgid " [PENDING, STICKY]"
45	+ msgstr "[в ожидании, Важно]"
46	+
47	+ msgid "Edit"
48	+ msgstr "отредактировать"
49	+
50	+ msgid "Quick Edit"
51	+ msgstr "быстрое редактирование"
52	+
53	+ msgid "Delete"
54	+ msgstr "удалить"
55	+
56	+ msgid "View"
57	+ msgstr "смотреть"
58	+
59	+ msgid "Status:"
60	+ msgstr "статус"
61	+
62	+ msgid "Cancel"
63	+ msgstr "отменить"
64	+
65	+ msgid "Title"
66	+ msgstr "название"
67	+
68	+ msgid "Content"
69	+ msgstr "содержание"
70	+
71	+ msgid "Add a new post on %s"
72	+ msgstr "Добавить новую публикацию на %s"
73	+
74	+ msgid "New %s - "
75	+ msgstr "новая %s"
76	+
77	+ msgid "Update"
78	+ msgstr "обновить"
79	+
80	+ msgid "Schedule"
81	+ msgstr "планировать"
82	+
83	+ msgid "Submit for Review"
84	+ msgstr "Отправить на проверку"
85	+
86	+ msgid "Save"
87	+ msgstr "сохранить"
88	+
89	+ msgid "Edit %1$s - %2$s"
90	+ msgstr "отредактировать %1$s - %2$s"
91	+
92	+ msgid "Scheduled"
93	+ msgstr "Запланированно"
94	+
95	+ msgid "You are about to delete the post \""
96	+ msgstr "Вы собираетесь удалить публикацию \""
97	+
98	+ msgid "\". Press Cancel to stop, OK to delete."
99	+ msgstr "\". Нажмите кнопку Отмена, чтобы остановить, ОК, чтобы удалить."
100	+
101	+ msgid "Looks like someone else already moved this post."
102	+ msgstr "Похоже, кто-то уже переместил этот публикацию."
103	+
104	+ msgid "You do not have permission to edit posts."
105	+ msgstr "У вас нет разрешения редактировать публикацию."
106	+
107	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
108	+ msgstr "Неверная чексам для публикаций. Обычно это межсайтовый скриптинг ошибки."
109	+
110	+ msgid "There was an error contacting your blog."
111	+ msgstr "произошла ошибка соединения с блогом."
112	+
113	+ msgid "Screen Options"
114	+ msgstr "Настройки экрана"
115	+
116	+ msgid "Colors"
117	+ msgstr "Цвета"
118	+
119	+ msgid "Drafts: "
120	+ msgstr "черновики"
121	+
122	+ msgid "Apply"
123	+ msgstr "применить"
124	+
125	+ msgid "Show on screen"
126	+ msgstr "Показать на экране"
127	+
128	+ msgid " weeks at a time"
129	+ msgstr "недели за один раз"
130	+
131	+ msgid "Show in Calendar Cell"
132	+ msgstr "Показать в ячейке календаря"
133	+
134	+ msgid "Author"
135	+ msgstr "автор"
136	+
137	+ msgid "Status"
138	+ msgstr "статус"
139	+
140	+ msgid "Time of day"
141	+ msgstr "Время дня"
142	+
143	+ msgid "An error occurred while loading the calendar: "
144	+ msgstr "Произошла ошибка при загрузке календаря:"
145	+
146	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
147	+ msgstr "Календарь может показывать только от 1 до 5 недель за один раз."
148	+
149	+ msgid "Select the number of weeks for the calendar to show."
150	+ msgstr "Выберите количество недель для календаря, чтобы показать."
151	+
152	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
153	+ msgstr "<h2>Мы закончили</h2> Мы закончили сбор данных. Спасибо за помощь в улучшении календаря."
154	+
155	+ msgid "Jump back"
156	+ msgstr "Перейти обратно"
157	+
158	+ msgid "Skip ahead"
159	+ msgstr "Перейдите"
160	+
161	+ msgid "Scroll the calendar and make the today visible"
162	+ msgstr "перекрутите календарь к сегоднешнему дню "
163	+
164	+ msgid "Show Today"
165	+ msgstr "Покажите сегодня"
166	+
167	+ msgid "Edit Post"
168	+ msgstr "Редактировать публикацию"
169	+
170	+ msgid "Time"
171	+ msgstr "время"
172	+
173	+ msgid "Draft"
174	+ msgstr "черновой вариант"
175	+
176	+ msgid "Pending Review"
177	+ msgstr "ожидает рассмотрения"
178	+
179	+ msgid "Posts "
180	+ msgstr "публикации"
181	+
182	+ msgid "Post "
183	+ msgstr "публикацию"
184	+
185	+ msgid "Error in deleting..."
186	+ msgstr "Ошибка при удалении ..."
187	+
188	+ msgid "ltr"
189	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-sv_SE.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-sv_SE.po ADDED Viewed

	@@ -0,0 +1,313 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: WordPress Editorial Calendar v1.4\n"
4	+ "Report-Msgid-Bugs-To: \n"
5	+ "POT-Creation-Date: \n"
6	+ "PO-Revision-Date: 2019-08-12 06:19-0400\n"
7	+ "Last-Translator: Zack Grossbart <zack@grossbart.com>\n"
8	+ "Language-Team: \n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
13	+ "X-Poedit-SourceCharset: utf-8\n"
14	+ "X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2\n"
15	+ "X-Poedit-Basepath: ..\n"
16	+ "X-Textdomain-Support: yes\n"
17	+ "Language: de_DE\n"
18	+ "X-Generator: Poedit 2.2.3\n"
19	+ "X-Poedit-SearchPath-0: .\n"
20	+
21	+ # @ editorial-calendar
22	+ #: edcal.php:90 edcal.php:112
23	+ msgid "Calendar"
24	+ msgstr "Inläggskalender"
25	+
26	+ # @ editorial-calendar
27	+ #: edcal.php:240 edcal.php:464
28	+ msgid "en-US"
29	+ msgstr "sv-SE"
30	+
31	+ # @ editorial-calendar
32	+ #: edcal.php:248
33	+ #, php-format
34	+ msgid "%1$s by %2$s"
35	+ msgstr "%1$s av %2$s"
36	+
37	+ # @ editorial-calendar
38	+ #: edcal.php:250
39	+ msgid "New Post"
40	+ msgstr "Nytt inlägg"
41	+
42	+ # @ editorial-calendar
43	+ #: edcal.php:252
44	+ msgid " [DRAFT]"
45	+ msgstr " [UTKAST]"
46	+
47	+ # @ editorial-calendar
48	+ #: edcal.php:253
49	+ msgid " [PENDING]"
50	+ msgstr " [VÄNTANDE]"
51	+
52	+ # @ editorial-calendar
53	+ #: edcal.php:254
54	+ msgid " [STICKY]"
55	+ msgstr " [KLISTRAD]"
56	+
57	+ # @ editorial-calendar
58	+ #: edcal.php:255
59	+ msgid " [DRAFT, STICKY]"
60	+ msgstr " [UTKAST, KLISTRAD]"
61	+
62	+ # @ editorial-calendar
63	+ #: edcal.php:256
64	+ msgid " [PENDING, STICKY]"
65	+ msgstr " [VÄNTANDE, KLISTRAD]"
66	+
67	+ # @ editorial-calendar
68	+ #: edcal.php:257 edcal.php:261
69	+ msgid "Edit"
70	+ msgstr "Redigera"
71	+
72	+ # @ editorial-calendar
73	+ #: edcal.php:258
74	+ msgid "Quick Edit"
75	+ msgstr "Snabbredigera"
76	+
77	+ # @ editorial-calendar
78	+ #: edcal.php:259
79	+ msgid "Delete"
80	+ msgstr "Radera"
81	+
82	+ # @ editorial-calendar
83	+ #: edcal.php:260
84	+ msgid "View"
85	+ msgstr "Förhandsgranska"
86	+
87	+ # @ editorial-calendar
88	+ #: edcal.php:262
89	+ msgid "Status:"
90	+ msgstr "Status:"
91	+
92	+ # @ editorial-calendar
93	+ #: edcal.php:263 edcal.php:433
94	+ msgid "Cancel"
95	+ msgstr "Avbryt"
96	+
97	+ # @ editorial-calendar
98	+ #: edcal.php:264 edcal.php:396
99	+ msgid "Title"
100	+ msgstr "Titel"
101	+
102	+ # @ editorial-calendar
103	+ #: edcal.php:265 edcal.php:401
104	+ msgid "Content"
105	+ msgstr "Innehåll"
106	+
107	+ # @ editorial-calendar
108	+ #: edcal.php:266
109	+ #, php-format
110	+ msgid "Add a new post on %s"
111	+ msgstr "Skapa nytt inlägg den %s"
112	+
113	+ # @ editorial-calendar
114	+ #: edcal.php:267
115	+ #, php-format
116	+ msgid "New %s - "
117	+ msgstr "Nytt %s - "
118	+
119	+ # @ editorial-calendar
120	+ #: edcal.php:268
121	+ msgid "Update"
122	+ msgstr "Uppdatera"
123	+
124	+ # @ editorial-calendar
125	+ #: edcal.php:269 edcal.php:432
126	+ msgid "Schedule"
127	+ msgstr "Schemalägg"
128	+
129	+ # @ editorial-calendar
130	+ #: edcal.php:270
131	+ msgid "Submit for Review"
132	+ msgstr "Skicka för godkännande"
133	+
134	+ # @ editorial-calendar
135	+ #: edcal.php:271
136	+ msgid "Save"
137	+ msgstr "Spara"
138	+
139	+ # @ editorial-calendar
140	+ #: edcal.php:272
141	+ #, php-format
142	+ msgid "Edit %1$s - %2$s"
143	+ msgstr "Redigera %1$s - %2$s"
144	+
145	+ # @ editorial-calendar
146	+ #: edcal.php:273 edcal.php:418
147	+ msgid "Scheduled"
148	+ msgstr "Schemalagd"
149	+
150	+ # @ editorial-calendar
151	+ #: edcal.php:275
152	+ msgid "You are about to delete the post \""
153	+ msgstr "Du är på väg att radera inlägget \""
154	+
155	+ # @ editorial-calendar
156	+ #: edcal.php:276
157	+ msgid "\". Press Cancel to stop, OK to delete."
158	+ msgstr "\". Klicka Avbryt för att avbryta, eller OK för att radera."
159	+
160	+ # @ editorial-calendar
161	+ #: edcal.php:278
162	+ msgid "Looks like someone else already moved this post."
163	+ msgstr "Det verkar som om någon annan redan flyttat detta inlägg."
164	+
165	+ # @ editorial-calendar
166	+ #: edcal.php:279
167	+ msgid "You do not have permission to edit posts."
168	+ msgstr "Du har inte rättighet att redigera detta inlägg."
169	+
170	+ # @ editorial-calendar
171	+ #: edcal.php:280
172	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
173	+ msgstr "Ogiltig checksumma för inlägg. Detta brukar vanligtvis uppstå p.g.a. cross-site script-fel."
174	+
175	+ # @ editorial-calendar
176	+ #: edcal.php:281
177	+ msgid "There was an error contacting your blog."
178	+ msgstr "Anslutningsfel."
179	+
180	+ # @ editorial-calendar
181	+ #: edcal.php:283
182	+ msgid "Screen Options"
183	+ msgstr "Visningsalternativ"
184	+
185	+ # @ editorial-calendar
186	+ #: edcal.php:284
187	+ msgid "Colors"
188	+ msgstr "Färger"
189	+
190	+ # @ editorial-calendar
191	+ #: edcal.php:285
192	+ msgid "Drafts: "
193	+ msgstr "Utkast:"
194	+
195	+ # @ editorial-calendar
196	+ #: edcal.php:286
197	+ msgid "Apply"
198	+ msgstr "Verkställ"
199	+
200	+ # @ editorial-calendar
201	+ #: edcal.php:287
202	+ msgid "Show on screen"
203	+ msgstr "Antal veckor att visa på skärmen"
204	+
205	+ # @ editorial-calendar
206	+ #: edcal.php:288
207	+ msgid " weeks at a time"
208	+ msgstr " "
209	+
210	+ # @ editorial-calendar
211	+ #: edcal.php:289
212	+ msgid "Show in Calendar Cell"
213	+ msgstr "Visa i kalendercell"
214	+
215	+ # @ editorial-calendar
216	+ #: edcal.php:290
217	+ msgid "Author"
218	+ msgstr "Författare"
219	+
220	+ # @ editorial-calendar
221	+ #: edcal.php:291 edcal.php:412
222	+ msgid "Status"
223	+ msgstr "Status"
224	+
225	+ # @ editorial-calendar
226	+ #: edcal.php:292
227	+ msgid "Time of day"
228	+ msgstr "Klockslag"
229	+
230	+ # @ editorial-calendar
231	+ #: edcal.php:293
232	+ msgid "An error occurred while loading the calendar: "
233	+ msgstr "Ett fel uppstod när kalendern laddades:"
234	+
235	+ # @ editorial-calendar
236	+ #: edcal.php:295
237	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
238	+ msgstr "Kalendern kan bara visa mellan 1 och 5 veckor samtidigt."
239	+
240	+ # @ editorial-calendar
241	+ #: edcal.php:296
242	+ msgid "Select the number of weeks for the calendar to show."
243	+ msgstr "Välj antal veckor att visa."
244	+
245	+ # @ editorial-calendar
246	+ #: edcal.php:302
247	+ msgid "<div id=\"feedbacksection\"><h2>Help us Make the Editorial Calendar Better</h2>We are always trying to improve the Editorial Calendar and you can help. May we collect some data about your blog and browser settings to help us improve this plugin? We'll only do it once and your blog will show up on our <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar Statistics page</a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Collect Anonymous Data</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">No thank you</a></div>"
248	+ msgstr "<div id=\"feedbacksection\"><h2>Hjälp oss göra Editorial Calendar bättre</h2>Vi försöker hela tiden förbättra Editorial Calendar och du kan hjälpa till. Får vi samla in några data om din blogg och webbläsarinställningar för att hjälpa oss förbättra denna plug-in? Det sker endast en gång och din blogg kommer att dyka upp på vår <a target=\"_blank\" href=\"http://www.zackgrossbart.com/edcal/mint/\">Editorial Calendar statistik-sida</a>.<br /><br /><button class=\"button-secondary\" onclick=\"edcal.doFeedback();\">Skicka anonym data</button> <a href=\"#\" id=\"nofeedbacklink\" onclick=\"edcal.noFeedback(); return false;\">Nej tack</a></div>"
249	+
250	+ # @ editorial-calendar
251	+ #: edcal.php:304
252	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
253	+ msgstr "<h2>Färdigt!</h2>Datainsamlandet är klart. Tack för att du hjälper oss göra kalendern ännu bättre. "
254	+
255	+ # @ editorial-calendar
256	+ #: edcal.php:345
257	+ msgid " Calendar"
258	+ msgstr "kalender"
259	+
260	+ # @ editorial-calendar
261	+ #: edcal.php:354
262	+ msgid "Jump back"
263	+ msgstr "Tillbaka"
264	+
265	+ # @ editorial-calendar
266	+ #: edcal.php:356
267	+ msgid "Skip ahead"
268	+ msgstr "Framåt"
269	+
270	+ # @ editorial-calendar
271	+ #: edcal.php:361
272	+ msgid "Scroll the calendar and make the today visible"
273	+ msgstr "Scrolla kalendern och visa idag."
274	+
275	+ # @ editorial-calendar
276	+ #: edcal.php:361
277	+ msgid "Show Today"
278	+ msgstr "Visa idag"
279	+
280	+ # @ editorial-calendar
281	+ #: edcal.php:387
282	+ msgid "Edit Post"
283	+ msgstr "Redigera inlägg"
284	+
285	+ # @ editorial-calendar
286	+ #: edcal.php:407
287	+ msgid "Time"
288	+ msgstr "Klockan"
289	+
290	+ # @ editorial-calendar
291	+ #: edcal.php:415
292	+ msgid "Draft"
293	+ msgstr "Utkast"
294	+
295	+ # @ editorial-calendar
296	+ #: edcal.php:416
297	+ msgid "Pending Review"
298	+ msgstr "Väntande"
299	+
300	+ # @ default
301	+ #: edcal.php:735 edcal.php:738
302	+ msgid "Error in deleting..."
303	+ msgstr "Fel vid borttagning..."
304	+
305	+ msgid "Post "
306	+ msgstr "inlägg "
307	+
308	+ msgid "Posts "
309	+ msgstr "Inläggs "
310	+
311	+ #: edcal.php:190 edcal.php:274
312	+ msgid "ltr"
313	+ msgstr "ltr"

3.7.8/languages/editorial-calendar-template.pot ADDED Viewed

	@@ -0,0 +1,182 @@


1	+ # Translation of Editorial Calendar
2	+ # This file is distributed under the same license as the Editorial Calendar package.
3	+ msgid ""
4	+ msgstr ""
5	+ "PO-Revision-Date: 2012-02-26 21:34:50+0000\n"
6	+ "MIME-Version: 1.0\n"
7	+ "Content-Type: text/plain; charset=UTF-8\n"
8	+ "Content-Transfer-Encoding: 8bit\n"
9	+
10	+ msgid "Calendar"
11	+ msgstr ""
12	+
13	+ msgid "en-US"
14	+ msgstr ""
15	+
16	+ msgid "%1$s by %2$s"
17	+ msgstr ""
18	+
19	+ msgid "New Post"
20	+ msgstr ""
21	+
22	+ msgid " [DRAFT]"
23	+ msgstr ""
24	+
25	+ msgid " [PENDING]"
26	+ msgstr ""
27	+
28	+ msgid " [STICKY]"
29	+ msgstr ""
30	+
31	+ msgid " [DRAFT, STICKY]"
32	+ msgstr ""
33	+
34	+ msgid " [PENDING, STICKY]"
35	+ msgstr ""
36	+
37	+ msgid "Edit"
38	+ msgstr ""
39	+
40	+ msgid "Quick Edit"
41	+ msgstr ""
42	+
43	+ msgid "Delete"
44	+ msgstr ""
45	+
46	+ msgid "View"
47	+ msgstr ""
48	+
49	+ msgid "Status:"
50	+ msgstr ""
51	+
52	+ msgid "Cancel"
53	+ msgstr ""
54	+
55	+ msgid "Title"
56	+ msgstr ""
57	+
58	+ msgid "Content"
59	+ msgstr ""
60	+
61	+ msgid "Add a new post on %s"
62	+ msgstr ""
63	+
64	+ msgid "New %s - "
65	+ msgstr ""
66	+
67	+ msgid "Update"
68	+ msgstr ""
69	+
70	+ msgid "Schedule"
71	+ msgstr ""
72	+
73	+ msgid "Submit for Review"
74	+ msgstr ""
75	+
76	+ msgid "Save"
77	+ msgstr ""
78	+
79	+ msgid "Edit %1$s - %2$s"
80	+ msgstr ""
81	+
82	+ msgid "Scheduled"
83	+ msgstr ""
84	+
85	+ msgid "You are about to delete the post \""
86	+ msgstr ""
87	+
88	+ msgid "\". Press Cancel to stop, OK to delete."
89	+ msgstr ""
90	+
91	+ msgid "Looks like someone else already moved this post."
92	+ msgstr ""
93	+
94	+ msgid "You do not have permission to edit posts."
95	+ msgstr ""
96	+
97	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
98	+ msgstr ""
99	+
100	+ msgid "There was an error contacting your blog."
101	+ msgstr ""
102	+
103	+ msgid "Screen Options"
104	+ msgstr ""
105	+
106	+ msgid "Colors"
107	+ msgstr ""
108	+
109	+ msgid "Drafts: "
110	+ msgstr ""
111	+
112	+ msgid "Apply"
113	+ msgstr ""
114	+
115	+ msgid "Show on screen"
116	+ msgstr ""
117	+
118	+ msgid " weeks at a time"
119	+ msgstr ""
120	+
121	+ msgid "Show in Calendar Cell"
122	+ msgstr ""
123	+
124	+ msgid "Author"
125	+ msgstr ""
126	+
127	+ msgid "Status"
128	+ msgstr ""
129	+
130	+ msgid "Time of day"
131	+ msgstr ""
132	+
133	+ msgid "An error occurred while loading the calendar: "
134	+ msgstr ""
135	+
136	+ msgid "The calendar can only show between 1 and 5 weeks at a time."
137	+ msgstr ""
138	+
139	+ msgid "Select the number of weeks for the calendar to show."
140	+ msgstr ""
141	+
142	+ msgid "<h2>We're done</h2>We've finished collecting data. Thank you for helping us make the calendar better."
143	+ msgstr ""
144	+
145	+ msgid "%1$s Calendar"
146	+ msgstr ""
147	+
148	+ msgid "Jump back"
149	+ msgstr ""
150	+
151	+ msgid "Skip ahead"
152	+ msgstr ""
153	+
154	+ msgid "Scroll the calendar and make the today visible"
155	+ msgstr ""
156	+
157	+ msgid "Show Today"
158	+ msgstr ""
159	+
160	+ msgid "Edit Post"
161	+ msgstr ""
162	+
163	+ msgid "Time"
164	+ msgstr ""
165	+
166	+ msgid "Draft"
167	+ msgstr ""
168	+
169	+ msgid "Pending Review"
170	+ msgstr ""
171	+
172	+ msgid "Posts "
173	+ msgstr ""
174	+
175	+ msgid "Post "
176	+ msgstr ""
177	+
178	+ msgid "Error in deleting..."
179	+ msgstr ""
180	+
181	+ msgid "ltr"
182	+ msgstr ""

3.7.8/languages/editorial-calendar-tr_TR.mo ADDED Viewed

Binary file

3.7.8/languages/editorial-calendar-tr_TR.po ADDED Viewed

	@@ -0,0 +1,331 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: WordPress Editorial Calendar\n"
4	+ "Report-Msgid-Bugs-To: \n"
5	+ "POT-Creation-Date: \n"
6	+ "PO-Revision-Date: 2018-05-28 08:22-0400\n"
7	+ "Last-Translator: adnan <auludag@mac.com>\n"
8	+ "Language-Team: \n"
9	+ "Language: tr\n"
10	+ "Plural-Forms: nplurals=1; plural=0;\n"
11	+ "MIME-Version: 1.0\n"
12	+ "Content-Type: text/plain; charset=UTF-8\n"
13	+ "Content-Transfer-Encoding: 8bit\n"
14	+ "X-Poedit-SourceCharset: UTF-8\n"
15	+ "X-Generator: Poedit 2.0.7\n"
16	+ "X-Poedit-Basepath: .\n"
17	+ "X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
18	+ "__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
19	+ "_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
20	+ "esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
21	+ "esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
22	+ "X-Loco-Target-Locale: tr_TR\n"
23	+ "X-Poedit-SearchPath-0: ..\n"
24	+
25	+ #. Name of the plugin
26	+ msgid "WordPress Editorial Calendar"
27	+ msgstr "WordPress Yayın Takvimi"
28	+
29	+ #. Description of the plugin
30	+ msgid ""
31	+ "The Editorial Calendar makes it possible to see all your posts and drag and "
32	+ "drop them to manage your blog."
33	+ msgstr ""
34	+ "Yayın takvimi tüm yazılarınızı görmeyi ve blogunuzu yönetmek için onları "
35	+ "sürükleyip bırakmayı sağlar. "
36	+
37	+ #. Author of the plugin
38	+ msgid "Colin Vernon, Justin Evans, Joachim Kudish, Mary Vogt, and Zack Grossbart"
39	+ msgstr "Colin Vernon, Justin Evans, Joachim Kudish, Mary Vogt, ve Zack Grossbart"
40	+
41	+ #. Author URI of the plugin
42	+ msgid "http://www.zackgrossbart.com"
43	+ msgstr "http://www.zackgrossbart.com"
44	+
45	+ #. URI of the plugin
46	+ msgid "http://stresslimitdesign.com/editorial-calendar-plugin"
47	+ msgstr "http://stresslimitdesign.com/editorial-calendar-plugin"
48	+
49	+ #: ../edcal.php:101 ../edcal.php:126
50	+ msgid "Calendar"
51	+ msgstr "Takvim"
52	+
53	+ #: ../edcal.php:196 ../edcal.php:281
54	+ msgid "ltr"
55	+ msgstr "ltr"
56	+
57	+ #: ../edcal.php:269 ../edcal.php:539
58	+ msgid "en-US"
59	+ msgstr "tr-TR"
60	+
61	+ #: ../edcal.php:277
62	+ #, php-format
63	+ msgid "%1$s by %2$s"
64	+ msgstr "%2$s tarafından %1$s"
65	+
66	+ #: ../edcal.php:279
67	+ msgid "New Post"
68	+ msgstr "Yeni Yazı"
69	+
70	+ #: ../edcal.php:280 ../edcal.php:300
71	+ msgid "New Draft"
72	+ msgstr "Yeni taslak"
73	+
74	+ #: ../edcal.php:283
75	+ msgid " [DRAFT]"
76	+ msgstr " [TASLAK]"
77	+
78	+ #: ../edcal.php:284
79	+ msgid " [PENDING]"
80	+ msgstr " [BEKLEMEDE]"
81	+
82	+ #: ../edcal.php:285
83	+ msgid " [STICKY]"
84	+ msgstr " [YAPIŞKAN]"
85	+
86	+ #: ../edcal.php:286
87	+ msgid " [DRAFT, STICKY]"
88	+ msgstr " [TASLAK, YAPIŞKAN]"
89	+
90	+ #: ../edcal.php:287
91	+ msgid " [PENDING, STICKY]"
92	+ msgstr " [BEKLEMEDE, YAPIŞKAN]"
93	+
94	+ #: ../edcal.php:288 ../edcal.php:292
95	+ msgid "Edit"
96	+ msgstr "Düzenle"
97	+
98	+ #: ../edcal.php:289
99	+ msgid "Quick Edit"
100	+ msgstr "Hızlı Düzenle"
101	+
102	+ #: ../edcal.php:290
103	+ msgid "Delete"
104	+ msgstr "Sil"
105	+
106	+ #: ../edcal.php:291
107	+ msgid "View"
108	+ msgstr "Görünüm"
109	+
110	+ #: ../edcal.php:293
111	+ msgid "Status:"
112	+ msgstr "Durum"
113	+
114	+ #: ../edcal.php:294 ../edcal.php:486
115	+ msgid "Cancel"
116	+ msgstr "İptal"
117	+
118	+ #: ../edcal.php:295 ../edcal.php:448
119	+ msgid "Title"
120	+ msgstr "Başlık"
121	+
122	+ #: ../edcal.php:296 ../edcal.php:453
123	+ msgid "Content"
124	+ msgstr "İçerik"
125	+
126	+ #: ../edcal.php:297
127	+ #, php-format
128	+ msgid "Add a new post on %s"
129	+ msgstr " %s üzerinde yeni bir yazı ekle"
130	+
131	+ #: ../edcal.php:298
132	+ msgid "Add a new draft"
133	+ msgstr "Yeni taslak ekle"
134	+
135	+ #: ../edcal.php:299
136	+ #, php-format
137	+ msgid "New %s - "
138	+ msgstr "Yeni %s - "
139	+
140	+ #: ../edcal.php:301
141	+ msgid "Update"
142	+ msgstr "Güncelle"
143	+
144	+ #: ../edcal.php:302 ../edcal.php:485
145	+ msgid "Schedule"
146	+ msgstr "Zamanla"
147	+
148	+ #: ../edcal.php:303
149	+ msgid "Submit for Review"
150	+ msgstr "İncelemeye yolla"
151	+
152	+ #: ../edcal.php:304
153	+ msgid "Save"
154	+ msgstr "Kaydet"
155	+
156	+ #: ../edcal.php:305
157	+ #, php-format
158	+ msgid "Edit %1$s - %2$s"
159	+ msgstr "Düzenle %1$s - %2$s"
160	+
161	+ #: ../edcal.php:306 ../edcal.php:470
162	+ msgid "Scheduled"
163	+ msgstr "Zamanlandı"
164	+
165	+ #: ../edcal.php:308
166	+ msgid "You are about to delete the post \""
167	+ msgstr "Yazıyı silmek üzeresiniz. \""
168	+
169	+ #: ../edcal.php:309
170	+ msgid "\". Press Cancel to stop, OK to delete."
171	+ msgstr "\". Vazgeçmek için İptal e Silmek için OK e basın"
172	+
173	+ #: ../edcal.php:311
174	+ msgid "Looks like someone else already moved this post."
175	+ msgstr "Bu yazı zaten taşınmış görünüyor."
176	+
177	+ #: ../edcal.php:312
178	+ msgid "You do not have permission to edit posts."
179	+ msgstr "Yazıları düzenleme yetkiniz yok"
180	+
181	+ #: ../edcal.php:313
182	+ msgid "Invalid checksum for post. This is commonly a cross-site scripting error."
183	+ msgstr ""
184	+ "Yazı için geçersiz sınama. Bu genelde siteler arası komut çalıştırma hatasıdır."
185	+
186	+ #: ../edcal.php:314
187	+ msgid "There was an error contacting your blog."
188	+ msgstr "Sitenize erişim hatası oldu."
189	+
190	+ #: ../edcal.php:316
191	+ msgid "Screen Options"
192	+ msgstr "Ekran Seçenekleri"
193	+
194	+ #: ../edcal.php:317
195	+ msgid "Colors"
196	+ msgstr "Renkler"
197	+
198	+ #: ../edcal.php:318
199	+ msgid "Drafts: "
200	+ msgstr "Taslaklar"
201	+
202	+ #: ../edcal.php:319
203	+ msgid "Apply"
204	+ msgstr "Uygula"
205	+
206	+ #: ../edcal.php:320
207	+ msgid "Show on screen"
208	+ msgstr "Ekranda göster"
209	+
210	+ #: ../edcal.php:321
211	+ msgid " weeks at a time"
212	+ msgstr "hafta üstüste"
213	+
214	+ #: ../edcal.php:322
215	+ msgid "Show in Calendar Cell"
216	+ msgstr "Takvim Hücresinde Göster"
217	+
218	+ #: ../edcal.php:323
219	+ msgid "Author"
220	+ msgstr "Yazar"
221	+
222	+ #: ../edcal.php:324 ../edcal.php:464
223	+ msgid "Status"
224	+ msgstr "Durum"
225	+
226	+ #: ../edcal.php:325
227	+ msgid "Time of day"
228	+ msgstr "Günün belirli saati"
229	+
230	+ #: ../edcal.php:326
231	+ msgid "An error occurred while loading the calendar: "
232	+ msgstr "Takvim yüklenirken bir hata oluştu"
233	+
234	+ #: ../edcal.php:327
235	+ msgid ""
236	+ "<br /><br />The calendar was not able to parse the data your blog returned "
237	+ "about the posts. This error is most likely caused by a conflict with another "
238	+ "plugin on your blog. The actual parse error was:<br/><br/> "
239	+ msgstr ""
240	+ "<br /><br />Takvim yazılarınız hakkında, blogunuzun gönderdiği veriyi "
241	+ "ayrıştıramadı. Bu genelde blogunuzdaki diğer bir eklentiden kaynaklanır. Esas "
242	+ "ayrıştırma hatası:<br/><br/> "
243	+
244	+ #: ../edcal.php:329
245	+ msgid "The calendar can only show between 1 and 8 weeks at a time."
246	+ msgstr "Takvim aynı anda sadece 1 ve 8 hafta arasını gösterebilir. "
247	+
248	+ #: ../edcal.php:330
249	+ msgid "Select the number of weeks for the calendar to show."
250	+ msgstr "Takvimde gösterilecek hafta sayısını giriniz."
251	+
252	+ #: ../edcal.php:332 ../edcal.php:403
253	+ msgid "Show Unscheduled Drafts"
254	+ msgstr "Zamanlanmamış taslakları göster"
255	+
256	+ #: ../edcal.php:333
257	+ msgid "Hide Unscheduled Drafts"
258	+ msgstr "Zamanlanmamış taslakları sakla"
259	+
260	+ #: ../edcal.php:341
261	+ msgid ""
262	+ "<h2>We're done</h2>We've finished collecting data. Thank you for helping us "
263	+ "make the calendar better."
264	+ msgstr ""
265	+ "<h2>Tamamdır</h2>Veri toplamayı bitirdik. Takvimi daha iyi yapmada yardımcı "
266	+ "olduğunuz için teşekkkür ederiz."
267	+
268	+ #: ../edcal.php:382
269	+ #, php-format
270	+ msgid "%1$s Calendar"
271	+ msgstr "%1$s Takvim"
272	+
273	+ #: ../edcal.php:391
274	+ msgid "Jump back"
275	+ msgstr "Geri git"
276	+
277	+ #: ../edcal.php:393
278	+ msgid "Skip ahead"
279	+ msgstr "İleri atla"
280	+
281	+ #: ../edcal.php:394
282	+ msgid "Scroll the calendar and make the last post visible"
283	+ msgstr "Takvimi kaydır ve son yazıyı görünür kıl"
284	+
285	+ #: ../edcal.php:396
286	+ msgid "Scroll the calendar and make the today visible"
287	+ msgstr "Takvimi kaydır ve bugünü görünür kıl."
288	+
289	+ #: ../edcal.php:396
290	+ msgid "Show Today"
291	+ msgstr "Bugünü göster"
292	+
293	+ #: ../edcal.php:403
294	+ msgid "Show unscheduled posts"
295	+ msgstr "Zamanlanmamış yazıları göster"
296	+
297	+ #: ../edcal.php:409
298	+ msgid "Unscheduled draft posts"
299	+ msgstr "Zamanlanmamış taslak yazılar"
300	+
301	+ #: ../edcal.php:409
302	+ msgid "Unscheduled"
303	+ msgstr "Zamanlanmamış "
304	+
305	+ #: ../edcal.php:439
306	+ msgid "Edit Post"
307	+ msgstr "Yazıyı düzenle"
308	+
309	+ #: ../edcal.php:459
310	+ msgid "Time"
311	+ msgstr "Zaman"
312	+
313	+ #: ../edcal.php:467
314	+ msgid "Draft"
315	+ msgstr "Taslak"
316	+
317	+ #: ../edcal.php:468
318	+ msgid "Pending Review"
319	+ msgstr "Onay Bekliyor"
320	+
321	+ #: ../edcal.php:738
322	+ msgid "Posts "
323	+ msgstr "Yazılar"
324	+
325	+ #: ../edcal.php:754
326	+ msgid "Post "
327	+ msgstr "Yazı"
328	+
329	+ #: ../edcal.php:891 ../edcal.php:894
330	+ msgid "Error in deleting..."
331	+ msgstr "Silme hatası"

3.7.8/lib/date.extras.js ADDED Viewed

	@@ -0,0 +1,332 @@


1	+ /**
2	+ * @version: 1.0 Alpha-1
3	+ * @author: Coolite Inc. http://www.coolite.com/
4	+ * @date: 2008-04-13
5	+ * @copyright: Copyright (c) 2006-2008, Coolite Inc. (http://www.coolite.com/). All rights reserved.
6	+ * @license: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
7	+ * @website: http://www.datejs.com/
8	+ */
9	+
10	+ (function () {
11	+ var $D = Date,
12	+ $P = $D.prototype,
13	+ $C = $D.CultureInfo,
14	+ $f = [],
15	+ p = function (s, l) {
16	+ if (!l) {
17	+ l = 2;
18	+ }
19	+ return ("000" + s).slice(l * -1);
20	+ };
21	+
22	+ /**
23	+ * Converts a PHP format string to Java/.NET format string.
24	+ * A PHP format string can be used with .$format or .format.
25	+ * A Java/.NET format string can be used with .toString().
26	+ * The .parseExact function will only accept a Java/.NET format string
27	+ *
28	+ * Example
29	+ <pre>
30	+ var f1 = "%m/%d/%y"
31	+ var f2 = Date.normalizeFormat(f1); // "MM/dd/yy"
32	+
33	+ new Date().format(f1); // "04/13/08"
34	+ new Date().$format(f1); // "04/13/08"
35	+ new Date().toString(f2); // "04/13/08"
36	+
37	+ var date = Date.parseExact("04/13/08", f2); // Sun Apr 13 2008
38	+ </pre>
39	+ * @param {String} A PHP format string consisting of one or more format spcifiers.
40	+ * @return {String} The PHP format converted to a Java/.NET format string.
41	+ */
42	+ $D.normalizeFormat = function (format) {
43	+ $f = [];
44	+ var t = new Date().$format(format);
45	+ return $f.join("");
46	+ };
47	+
48	+ /**
49	+ * Format a local Unix timestamp according to locale settings
50	+ *
51	+ * Example
52	+ <pre>
53	+ Date.strftime("%m/%d/%y", new Date()); // "04/13/08"
54	+ Date.strftime("c", "2008-04-13T17:52:03Z"); // "04/13/08"
55	+ </pre>
56	+ * @param {String} A format string consisting of one or more format spcifiers [Optional].
57	+ * @param {Number} The number representing the number of seconds that have elapsed since January 1, 1970 (local time).
58	+ * @return {String} A string representation of the current Date object.
59	+ */
60	+ $D.strftime = function (format, time) {
61	+ return new Date(time * 1000).$format(format);
62	+ };
63	+
64	+ /**
65	+ * Parse any textual datetime description into a Unix timestamp.
66	+ * A Unix timestamp is the number of seconds that have elapsed since January 1, 1970 (midnight UTC/GMT).
67	+ *
68	+ * Example
69	+ <pre>
70	+ Date.strtotime("04/13/08"); // 1208044800
71	+ Date.strtotime("1970-01-01T00:00:00Z"); // 0
72	+ </pre>
73	+ * @param {String} A format string consisting of one or more format spcifiers [Optional].
74	+ * @param {Object} A string or date object.
75	+ * @return {String} A string representation of the current Date object.
76	+ */
77	+ $D.strtotime = function (time) {
78	+ var d = $D.parse(time);
79	+ d.addMinutes(d.getTimezoneOffset() * -1);
80	+ return Math.round($D.UTC(d.getUTCFullYear(), d.getUTCMonth(), d.getUTCDate(), d.getUTCHours(), d.getUTCMinutes(), d.getUTCSeconds(), d.getUTCMilliseconds()) / 1000);
81	+ };
82	+
83	+ /**
84	+ * Converts the value of the current Date object to its equivalent string representation using a PHP/Unix style of date format specifiers.
85	+ *
86	+ * The following descriptions are from http://www.php.net/strftime and http://www.php.net/manual/en/function.date.php.
87	+ * Copyright © 2001-2008 The PHP Group
88	+ *
89	+ * Format Specifiers
90	+ <pre>
91	+ Format Description Example
92	+ ------ --------------------------------------------------------------------------- -----------------------
93	+ %a abbreviated weekday name according to the current localed "Mon" through "Sun"
94	+ %A full weekday name according to the current locale "Sunday" through "Saturday"
95	+ %b abbreviated month name according to the current locale "Jan" through "Dec"
96	+ %B full month name according to the current locale "January" through "December"
97	+ %c preferred date and time representation for the current locale "4/13/2008 12:33 PM"
98	+ %C century number (the year divided by 100 and truncated to an integer) "00" to "99"
99	+ %d day of the month as a decimal number "01" to "31"
100	+ %D same as %m/%d/%y "04/13/08"
101	+ %e day of the month as a decimal number, a single digit is preceded by a space "1" to "31"
102	+ %g like %G, but without the century "08"
103	+ %G The 4-digit year corresponding to the ISO week number (see %V). "2008"
104	+ This has the same format and value as %Y, except that if the ISO week number
105	+ belongs to the previous or next year, that year is used instead.
106	+ %h same as %b "Jan" through "Dec"
107	+ %H hour as a decimal number using a 24-hour clock "00" to "23"
108	+ %I hour as a decimal number using a 12-hour clock "01" to "12"
109	+ %j day of the year as a decimal number "001" to "366"
110	+ %m month as a decimal number "01" to "12"
111	+ %M minute as a decimal number "00" to "59"
112	+ %n newline character "\n"
113	+ %p either "am" or "pm" according to the given time value, or the "am" or "pm"
114	+ corresponding strings for the current locale
115	+ %r time in a.m. and p.m. notation "8:44 PM"
116	+ %R time in 24 hour notation "20:44"
117	+ %S second as a decimal number "00" to "59"
118	+ %t tab character "\t"
119	+ %T current time, equal to %H:%M:%S "12:49:11"
120	+ %u weekday as a decimal number ["1", "7"], with "1" representing Monday "1" to "7"
121	+ %U week number of the current year as a decimal number, starting with the "0" to ("52" or "53")
122	+ first Sunday as the first day of the first week
123	+ %V The ISO 8601:1988 week number of the current year as a decimal number, "00" to ("52" or "53")
124	+ range 01 to 53, where week 1 is the first week that has at least 4 days
125	+ in the current year, and with Monday as the first day of the week.
126	+ (Use %G or %g for the year component that corresponds to the week number
127	+ for the specified timestamp.)
128	+ %W week number of the current year as a decimal number, starting with the "00" to ("52" or "53")
129	+ first Monday as the first day of the first week
130	+ %w day of the week as a decimal, Sunday being "0" "0" to "6"
131	+ %x preferred date representation for the current locale without the time "4/13/2008"
132	+ %X preferred time representation for the current locale without the date "12:53:05"
133	+ %y year as a decimal number without a century "00" "99"
134	+ %Y year as a decimal number including the century "2008"
135	+ %Z time zone or name or abbreviation "UTC", "EST", "PST"
136	+ %z same as %Z
137	+ %% a literal "%" character "%"
138	+
139	+ d Day of the month, 2 digits with leading zeros "01" to "31"
140	+ D A textual representation of a day, three letters "Mon" through "Sun"
141	+ j Day of the month without leading zeros "1" to "31"
142	+ l A full textual representation of the day of the week (lowercase "L") "Sunday" through "Saturday"
143	+ N ISO-8601 numeric representation of the day of the week (added in PHP 5.1.0) "1" (for Monday) through "7" (for Sunday)
144	+ S English ordinal suffix for the day of the month, 2 characters "st", "nd", "rd" or "th". Works well with j
145	+ w Numeric representation of the day of the week "0" (for Sunday) through "6" (for Saturday)
146	+ z The day of the year (starting from "0") "0" through "365"
147	+ W ISO-8601 week number of year, weeks starting on Monday "00" to ("52" or "53")
148	+ F A full textual representation of a month, such as January or March "January" through "December"
149	+ m Numeric representation of a month, with leading zeros "01" through "12"
150	+ M A short textual representation of a month, three letters "Jan" through "Dec"
151	+ n Numeric representation of a month, without leading zeros "1" through "12"
152	+ t Number of days in the given month "28" through "31"
153	+ L Whether it's a leap year "1" if it is a leap year, "0" otherwise
154	+ o ISO-8601 year number. This has the same value as Y, except that if the "2008"
155	+ ISO week number (W) belongs to the previous or next year, that year
156	+ is used instead.
157	+ Y A full numeric representation of a year, 4 digits "2008"
158	+ y A two digit representation of a year "08"
159	+ a Lowercase Ante meridiem and Post meridiem "am" or "pm"
160	+ A Uppercase Ante meridiem and Post meridiem "AM" or "PM"
161	+ B Swatch Internet time "000" through "999"
162	+ g 12-hour format of an hour without leading zeros "1" through "12"
163	+ G 24-hour format of an hour without leading zeros "0" through "23"
164	+ h 12-hour format of an hour with leading zeros "01" through "12"
165	+ H 24-hour format of an hour with leading zeros "00" through "23"
166	+ i Minutes with leading zeros "00" to "59"
167	+ s Seconds, with leading zeros "00" through "59"
168	+ u Milliseconds "54321"
169	+ e Timezone identifier "UTC", "EST", "PST"
170	+ I Whether or not the date is in daylight saving time (uppercase i) "1" if Daylight Saving Time, "0" otherwise
171	+ O Difference to Greenwich time (GMT) in hours "+0200", "-0600"
172	+ P Difference to Greenwich time (GMT) with colon between hours and minutes "+02:00", "-06:00"
173	+ T Timezone abbreviation "UTC", "EST", "PST"
174	+ Z Timezone offset in seconds. The offset for timezones west of UTC is "-43200" through "50400"
175	+ always negative, and for those east of UTC is always positive.
176	+ c ISO 8601 date "2004-02-12T15:19:21+00:00"
177	+ r RFC 2822 formatted date "Thu, 21 Dec 2000 16:01:07 +0200"
178	+ U Seconds since the Unix Epoch (January 1 1970 00:00:00 GMT) "0"
179	+ </pre>
180	+ * @param {String} A format string consisting of one or more format spcifiers [Optional].
181	+ * @return {String} A string representation of the current Date object.
182	+ */
183	+ $P.$format = function (format) {
184	+ var x = this,
185	+ y,
186	+ t = function (v) {
187	+ $f.push(v);
188	+ return x.toString(v);
189	+ };
190	+
191	+ return format ? format.replace(/(%\|\\)?.\|%%/g,
192	+ function (m) {
193	+ if (m.charAt(0) === "\\" \|\| m.substring(0, 2) === "%%") {
194	+ return m.replace("\\", "").replace("%%", "%");
195	+ }
196	+ switch (m) {
197	+ case "d":
198	+ case "%d":
199	+ return t("dd");
200	+ case "D":
201	+ case "%a":
202	+ return t("ddd");
203	+ case "j":
204	+ case "%e":
205	+ return t("d");
206	+ case "l":
207	+ case "%A":
208	+ return t("dddd");
209	+ case "N":
210	+ case "%u":
211	+ return x.getDay() + 1;
212	+ case "S":
213	+ return t("S");
214	+ case "w":
215	+ case "%w":
216	+ return x.getDay();
217	+ case "z":
218	+ return x.getOrdinalNumber();
219	+ case "%j":
220	+ return p(x.getOrdinalNumber(), 3);
221	+ case "%U":
222	+ var d1 = x.clone().set({month: 0, day: 1}).addDays(-1).moveToDayOfWeek(0),
223	+ d2 = x.clone().addDays(1).moveToDayOfWeek(0, -1);
224	+ return (d2 < d1) ? "00" : p((d2.getOrdinalNumber() - d1.getOrdinalNumber()) / 7 + 1);
225	+ case "W":
226	+ case "%V":
227	+ return x.getISOWeek();
228	+ case "%W":
229	+ return p(x.getWeek());
230	+ case "F":
231	+ case "%B":
232	+ return t("MMMM");
233	+ case "m":
234	+ case "%m":
235	+ return t("MM");
236	+ case "M":
237	+ case "%b":
238	+ case "%h":
239	+ return t("MMM");
240	+ case "n":
241	+ return t("M");
242	+ case "t":
243	+ return $D.getDaysInMonth(x.getFullYear(), x.getMonth());
244	+ case "L":
245	+ return ($D.isLeapYear(x.getFullYear())) ? 1 : 0;
246	+ case "o":
247	+ case "%G":
248	+ return x.setWeek(x.getISOWeek()).toString("yyyy");
249	+ case "%g":
250	+ return x.$format("%G").slice(-2);
251	+ case "Y":
252	+ case "%Y":
253	+ return t("yyyy");
254	+ case "y":
255	+ case "%y":
256	+ return t("yy");
257	+ case "a":
258	+ case "%p":
259	+ return t("tt").toLowerCase();
260	+ case "A":
261	+ return t("tt").toUpperCase();
262	+ case "g":
263	+ case "%I":
264	+ return t("h");
265	+ case "G":
266	+ return t("H");
267	+ case "h":
268	+ return t("hh");
269	+ case "H":
270	+ case "%H":
271	+ return t("HH");
272	+ case "i":
273	+ case "%M":
274	+ return t("mm");
275	+ case "s":
276	+ case "%S":
277	+ return t("ss");
278	+ case "u":
279	+ return p(x.getMilliseconds(), 3);
280	+ case "I":
281	+ return (x.isDaylightSavingTime()) ? 1 : 0;
282	+ case "O":
283	+ return x.getUTCOffset();
284	+ case "P":
285	+ y = x.getUTCOffset();
286	+ return y.substring(0, y.length - 2) + ":" + y.substring(y.length - 2);
287	+ case "e":
288	+ case "T":
289	+ case "%z":
290	+ case "%Z":
291	+ return x.getTimezone();
292	+ case "Z":
293	+ return x.getTimezoneOffset() * -60;
294	+ case "B":
295	+ var now = new Date();
296	+ return Math.floor(((now.getHours() * 3600) + (now.getMinutes() * 60) + now.getSeconds() + (now.getTimezoneOffset() + 60) * 60) / 86.4);
297	+ case "c":
298	+ return x.toISOString().replace(/\"/g, "");
299	+ case "U":
300	+ return $D.strtotime("now");
301	+ case "%c":
302	+ return t("d") + " " + t("t");
303	+ case "%C":
304	+ return Math.floor(x.getFullYear() / 100 + 1);
305	+ case "%D":
306	+ return t("MM/dd/yy");
307	+ case "%n":
308	+ return "\\n";
309	+ case "%t":
310	+ return "\\t";
311	+ case "%r":
312	+ return t("hh:mm tt");
313	+ case "%R":
314	+ return t("H:mm");
315	+ case "%T":
316	+ return t("H:mm:ss");
317	+ case "%x":
318	+ return t("d");
319	+ case "%X":
320	+ return t("t");
321	+ default:
322	+ $f.push(m);
323	+ return m;
324	+ }
325	+ }
326	+ ) : this._toString();
327	+ };
328	+
329	+ if (!$P.format) {
330	+ $P.format = $P.$format;
331	+ }
332	+ }());

3.7.8/lib/edcallib.min.js ADDED Viewed

	@@ -0,0 +1,78 @@


1	+ var $jscomp=$jscomp\|\|{};$jscomp.scope={};$jscomp.findInternal=function(a,f,g){a instanceof String&&(a=String(a));for(var c=a.length,b=0;b<c;b++){var e=a[b];if(f.call(g,e,b,a))return{i:b,v:e}}return{i:-1,v:void 0}};$jscomp.ASSUME_ES5=!1;$jscomp.ASSUME_NO_NATIVE_MAP=!1;$jscomp.ASSUME_NO_NATIVE_SET=!1;$jscomp.defineProperty=$jscomp.ASSUME_ES5\|\|"function"==typeof Object.defineProperties?Object.defineProperty:function(a,f,g){a!=Array.prototype&&a!=Object.prototype&&(a[f]=g.value)};
2	+ $jscomp.getGlobal=function(a){return"undefined"!=typeof window&&window===a?a:"undefined"!=typeof global&&null!=global?global:a};$jscomp.global=$jscomp.getGlobal(this);$jscomp.polyfill=function(a,f,g,c){if(f){g=$jscomp.global;a=a.split(".");for(c=0;c<a.length-1;c++){var b=a[c];b in g\|\|(g[b]={});g=g[b]}a=a[a.length-1];c=g[a];f=f(c);f!=c&&null!=f&&$jscomp.defineProperty(g,a,{configurable:!0,writable:!0,value:f})}};
3	+ $jscomp.polyfill("Array.prototype.find",function(a){return a?a:function(a,g){return $jscomp.findInternal(this,a,g).v}},"es6-impl","es3");
4	+ var humanMsg={setup:function(a,f,g){humanMsg.msgID="humanMsg";humanMsg.logID="humanMsgLog";a="body";void 0==f&&(f=void 0==humanMsg.logTitle?"Message Log":humanMsg.logTitle);humanMsg.logTop=jQuery("#"+humanMsg.logID).css("top");humanMsg.msgOpacity=.9;void 0!=g&&(humanMsg.msgOpacity=parseFloat(g));jQuery(a).prepend('<div id="'+humanMsg.msgID+'" class="humanMsg"><div class="round"></div><p></p><div class="round"></div></div>');jQuery(a).append('<div id="'+humanMsg.logID+'"><p>'+f+'</p><a href="#" id="humanMsgClose">x</a><ul></ul></div>');
5	+ jQuery("#humanMsgClose").click(function(){jQuery("#"+humanMsg.logID+" p").addClass("minimized");jQuery("#humanMsgClose").hide();return!1});jQuery("#"+humanMsg.logID+" p").click(function(){humanMsg.activateLog();jQuery("#"+humanMsg.logID+" p").hasClass("minimized")?(jQuery("#humanMsgClose").show(),jQuery("#"+humanMsg.logID+" p").removeClass("minimized")):"none"!=jQuery(this).siblings("ul").css("display")?(jQuery("#"+humanMsg.logID).css("top",humanMsg.logTop),jQuery(this).siblings("ul").hide(),jQuery("#humanMsgClose").show()):
6	+ (humanMsg.setLogHeight(),jQuery(this).siblings("ul").slideToggle(),jQuery("#humanMsgClose").slideToggle())})},setLogTitle:function(a){humanMsg.logTitle=a;jQuery("#"+humanMsg.logID+" > p").text(a)},displayMsg:function(a,f){""!=a&&(humanMsg.activateLog(),clearTimeout(humanMsg.t2),jQuery("#"+humanMsg.msgID).css("top",jQuery(window).scrollTop()+75+"px"),jQuery("#"+humanMsg.msgID+" p").html(a),jQuery("#"+humanMsg.msgID+"").show().animate({opacity:humanMsg.msgOpacity},200,function(){f&&humanMsg.log(a)}),
7	+ humanMsg.t1&&clearTimeout(humanMsg.t1),humanMsg.t2&&clearTimeout(humanMsg.t2),humanMsg.t1=setTimeout(function(){humanMsg.bindEvents()},3E3),humanMsg.t2=setTimeout(function(){humanMsg.removeMsg()},5E3))},log:function(a){jQuery("#"+humanMsg.logID).show().children("ul").prepend("<li>"+a+"</li>").children("li:first").slideDown(200);"none"==jQuery("#"+humanMsg.logID+" ul").css("display")?jQuery("#"+humanMsg.logID+" p").animate({bottom:40},200,"linear",function(){jQuery(this).animate({bottom:0},300,"swing",
8	+ function(){jQuery(this).css({bottom:0})})}):humanMsg.setLogHeight();jQuery("#humanMsgClose").show();jQuery("#"+humanMsg.logID+" p").removeClass("minimized")},activateLog:function(){jQuery("#"+humanMsg.logID+" p").removeClass("faded");clearTimeout(humanMsg.t3);humanMsg.t3=setTimeout(humanMsg.fadeLog,15E3)},setLogHeight:function(){if("Microsoft Internet Explorer"===navigator.appName){var a=Math.min(48*jQuery("#"+humanMsg.logID+" ul").children("li").length,112);jQuery("#"+humanMsg.logID+" ul").css("height",
9	+ a+10+"px");jQuery("#"+humanMsg.logID).css("top","-"+(a+56+humanMsg.logTop)+"px")}else a=Math.min(14*jQuery("#"+humanMsg.logID+" ul").children("li").length,56),jQuery("#"+humanMsg.logID+" ul").css("height",a+10+"px"),jQuery("#"+humanMsg.logID).css("top","-"+(a+112+humanMsg.logTop)+"px")},bindEvents:function(){jQuery(window).mousemove(humanMsg.removeMsg).click(humanMsg.removeMsg).keypress(humanMsg.removeMsg)},removeMsg:function(){jQuery(window).unbind("mousemove",humanMsg.removeMsg).unbind("click",
10	+ humanMsg.removeMsg).unbind("keypress",humanMsg.removeMsg);jQuery("#"+humanMsg.msgID).fadeOut()},fadeLog:function(){"none"===jQuery("#"+humanMsg.logID+" ul").css("display")&&jQuery("#"+humanMsg.logID+" p").addClass("faded")}};jQuery(document).ready(function(){humanMsg.setup()});/*
11	+ Copyright (c) 2011 Brandon Aaron (http://brandonaaron.net)
12	+ Licensed under the MIT License (LICENSE.txt).
13	+
14	+ Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
15	+ Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
16	+ Thanks to: Seamus Leahy for adding deltaX and deltaY
17	+
18	+ Version: 3.0.6
19	+
20	+ Requires: 1.2.2+
21	+ */
22	+ (function(a){function f(b){var e=b\|\|window.event,d=[].slice.call(arguments,1),c=0,g=0;b=a.event.fix(e);b.type="mousewheel";e.wheelDelta&&(c=e.wheelDelta/120);e.detail&&(c=-e.detail/3);var h=c;void 0!==e.axis&&e.axis===e.HORIZONTAL_AXIS&&(h=0,g=-1c);void 0!==e.wheelDeltaY&&(h=e.wheelDeltaY/120);void 0!==e.wheelDeltaX&&(g=-1e.wheelDeltaX/120);d.unshift(b,c,g,h);return(a.event.dispatch\|\|a.event.handle).apply(this,d)}var g=["DOMMouseScroll","mousewheel"];if(a.event.fixHooks)for(var c=g.length;c;)a.event.fixHooks[g[--c]]=
23	+ a.event.mouseHooks;a.event.special.mousewheel={setup:function(){if(this.addEventListener)for(var a=g.length;a;)this.addEventListener(g[--a],f,!1);else this.onmousewheel=f},teardown:function(){if(this.removeEventListener)for(var a=g.length;a;)this.removeEventListener(g[--a],f,!1);else this.onmousewheel=null}};a.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}})})(jQuery);var sprintf=function(){function a(a){return Object.prototype.toString.call(a).slice(8,-1).toLowerCase()}var f=function(){f.cache.hasOwnProperty(arguments[0])\|\|(f.cache[arguments[0]]=f.parse(arguments[0]));return f.format.call(null,f.cache[arguments[0]],arguments)};f.format=function(g,c){var b=1,e=g.length,d=[],f,m;for(f=0;f<e;f++){var h=a(g[f]);if("string"===h)d.push(g[f]);else if("array"===h){var k=g[f];if(k[2])for(h=c[b],m=0;m<k[2].length;m++){if(!h.hasOwnProperty(k[2][m]))throw sprintf('[sprintf] property "%s" does not exist',
24	+ k[2][m]);h=h[k[2][m]]}else h=k[1]?c[k[1]]:c[b++];if(/[^s]/.test(k[8])&&"number"!=a(h))throw sprintf("[sprintf] expecting number but found %s",a(h));switch(k[8]){case "b":h=h.toString(2);break;case "c":h=String.fromCharCode(h);break;case "d":h=parseInt(h,10);break;case "e":h=k[7]?h.toExponential(k[7]):h.toExponential();break;case "f":h=k[7]?parseFloat(h).toFixed(k[7]):parseFloat(h);break;case "o":h=h.toString(8);break;case "s":h=(h=String(h))&&k[7]?h.substring(0,k[7]):h;break;case "u":h=Math.abs(h);
25	+ break;case "x":h=h.toString(16);break;case "X":h=h.toString(16).toUpperCase()}h=/[def]/.test(k[8])&&k[3]&&0<=h?"+"+h:h;m=k[4]?"0"==k[4]?"0":k[4].charAt(1):" ";var l=k[6]-String(h).length;if(k[6]){for(var q=[];0<l;q[--l]=m);m=q.join("")}else m="";d.push(k[5]?h+m:m+h)}}return d.join("")};f.cache={};f.parse=function(a){for(var c,b=[],e=0;a;){if(null!==(c=/^[^\x25]+/.exec(a)))b.push(c[0]);else if(null!==(c=/^\x25{2}/.exec(a)))b.push("%");else if(null!==(c=/^\x25(?:([1-9]\d*)\$\|$([^$]+)\))?(\+)?(0\|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(a))){if(c[2]){var e=
26	+ e\|1,d=[],g=c[2],f;if(null!==(f=/^([a-z_][a-z_\d])/i.exec(g)))for(d.push(f[1]);""!==(g=g.substring(f[0].length));)if(null!==(f=/^\.([a-z_][a-z_\d])/i.exec(g)))d.push(f[1]);else if(null!==(f=/^\[(\d+)\]/.exec(g)))d.push(f[1]);else throw"[sprintf] huh?";else throw"[sprintf] huh?";c[2]=d}else e\|=2;if(3===e)throw"[sprintf] mixing positional and named placeholders is not (yet) supported";b.push(c)}else throw"[sprintf] huh?";a=a.substring(c[0].length)}return b};return f}(),vsprintf=function(a,f){f.unshift(a);
27	+ return sprintf.apply(null,f)};jQuery.cookie=function(a,f,g){if("undefined"!=typeof f){g=g\|\|{};null===f&&(f="",g.expires=-1);var c="";g.expires&&("number"==typeof g.expires\|\|g.expires.toUTCString)&&("number"==typeof g.expires?(c=new Date,c.setTime(c.getTime()+864E5*g.expires)):c=g.expires,c="; expires="+c.toUTCString());var b=g.path?"; path="+g.path:"",e=g.domain?"; domain="+g.domain:"";g=g.secure?"; secure":"";document.cookie=[a,"=",encodeURIComponent(f),c,b,e,g].join("")}else{f=null;if(document.cookie&&""!=document.cookie)for(g=
28	+ document.cookie.split(";"),c=0;c<g.length;c++)if(b=jQuery.trim(g[c]),b.substring(0,a.length+1)==a+"="){f=decodeURIComponent(b.substring(a.length+1));break}return f}};(function(a){a.fn.bgIframe=a.fn.bgiframe=function(f){if(a.browser_backward_hack.msie&&6>=parseInt(a.browser_backward_hack.version)){f=a.extend({top:"auto",left:"auto",width:"auto",height:"auto",opacity:!0,src:"javascript:false;"},f\|\|{});var g=function(a){return a&&a.constructor==Number?a+"px":a},c='<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+f.src+'"style="display:block;position:absolute;z-index:-1;'+(!1!==f.opacity?"filter:Alpha(Opacity='0');":"")+"top:"+("auto"==f.top?"expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)\|\|0)*-1)+'px')":
29	+ g(f.top))+";left:"+("auto"==f.left?"expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)\|\|0)*-1)+'px')":g(f.left))+";width:"+("auto"==f.width?"expression(this.parentNode.offsetWidth+'px')":g(f.width))+";height:"+("auto"==f.height?"expression(this.parentNode.offsetHeight+'px')":g(f.height))+';"/>';return this.each(function(){0==a("> iframe.bgiframe",this).length&&this.insertBefore(document.createElement(c),this.firstChild)})}return this};a.browser_backward_hack\|\|(a.browser_backward_hack={});a.browser_backward_hack.version\|\|
30	+ (a.browser_backward_hack.version=navigator.userAgent.toLowerCase().match(/.+(?:rv\|it\|ra\|ie)[\/: ]([\d.]+)/)[1])})(jQuery);(function(a){a.each({focus:"focusin",blur:"focusout"},function(f,g){a.event.special[g]={setup:function(){if(a.browser_backward_hack.msie)return!1;this.addEventListener(f,a.event.special[g].handler,!0)},teardown:function(){if(a.browser_backward_hack.msie)return!1;this.removeEventListener(f,a.event.special[g].handler,!0)},handler:function(c){arguments[0]=a.event.fix(c);arguments[0].type=g;return a.event.handle.apply(this,arguments)}}});a.extend(a.fn,{delegate:function(f,g,c){return this.bind(f,function(b){var e=a(b.target);if(e.is(g))return c.apply(e,
31	+ arguments)})},triggerEvent:function(f,g){return this.triggerHandler(f,[a.event.fix({type:f,target:g})])}})})(jQuery);(function(a){function f(c,b){function e(d){var e=a(d);return b.globalNav?e:c.parent().find(d)}var d=this,f=a(this),m=!b.vertical,h=c.children(),k=0,l;g\|\|(g=d);a.each(b,function(d,b){a.isFunction(b)&&f.bind(d,b)});1<h.length&&(h=a(b.items,c));c.data("finder",e);var q=e(b.prev),n=e(b.next),t=e(b.prevPage),p=e(b.nextPage);a.extend(d,{getIndex:function(){return k},getClickIndex:function(){var a=d.getItems();return a.index(a.filter("."+b.activeClass))},getConf:function(){return b},getSize:function(){return d.getItems().length},
32	+ getPageAmount:function(){return Math.ceil(this.getSize()/b.size)},getPageIndex:function(){return Math.ceil(k/b.size)},getNaviButtons:function(){return q.add(n).add(t).add(p)},getRoot:function(){return c},getItemWrap:function(){return h},getItems:function(){return h.children(b.item)},getVisibleItems:function(){return d.getItems().slice(k,k+b.size)},seekTo:function(e,c,r){function x(){r&&r.call(d,e);f.trigger("onSeek",[e])}0>e&&(e=0);if(k===e)return d;a.isFunction(c)&&(r=c);if(e>d.getSize()-b.size)return b.loop?
33	+ d.begin():this.end();var u=d.getItems().eq(e);if(!u.length)return d;var l=a.Event("onBeforeSeek");f.trigger(l,[e]);if(l.isDefaultPrevented())return d;if(void 0===c\|\|a.isFunction(c))c=b.speed;m?h.animate({left:-u.position().left},c,b.easing,x):h.animate({top:-u.position().top},c,b.easing,x);g=d;k=e;l=a.Event("onStart");f.trigger(l,[e]);if(l.isDefaultPrevented())return d;q.add(t).toggleClass(b.disabledClass,0===e);n.add(p).toggleClass(b.disabledClass,e>=d.getSize()-b.size);return d},move:function(a,
34	+ b,d){l=0<a;return this.seekTo(k+a,b,d)},next:function(a,b){return this.move(1,a,b)},prev:function(a,b){return this.move(-1,a,b)},movePage:function(a,d,e){l=0<a;var c=b.sizea,g=k%b.size;0<g&&(c+=0<a?-g:b.size-g);return this.move(c,d,e)},prevPage:function(a,b){return this.movePage(-1,a,b)},nextPage:function(a,b){return this.movePage(1,a,b)},setPage:function(a,d,e){return this.seekTo(ab.size,d,e)},begin:function(a,b){l=!1;return this.seekTo(0,a,b)},end:function(a,e){l=!0;var c=this.getSize()-b.size;
35	+ return 0<c?this.seekTo(c,a,e):d},reload:function(){f.trigger("onReload");return d},focus:function(){return g=d},click:function(a){var e=d.getItems().eq(a),c=b.activeClass,g=b.size;if(0>a\|\|a>=d.getSize())return d;if(1==g){if(b.loop)return d.next();if(0===a\|\|a==d.getSize()-1)l=void 0===l?!0:!l;return!1===l?d.prev():d.next()}return 2==g?(a==k&&a--,d.getItems().removeClass(c),e.addClass(c),d.seekTo(a,time,fn)):e.hasClass(c)\|\|(d.getItems().removeClass(c),e.addClass(c),e=a-Math.floor(g/2),e>d.getSize()-
36	+ g&&(e=d.getSize()-g),e===a)?d:d.seekTo(e)},bind:function(a,b){f.bind(a,b);return d},unbind:function(a){f.unbind(a);return d}});a.each(["onBeforeSeek","onStart","onSeek","onReload"],function(a,b){d[b]=function(a){return d.bind(b,a)}});q.addClass(b.disabledClass).click(function(){d.prev()});n.click(function(){d.next()});p.click(function(){d.nextPage()});d.getSize()<b.size&&n.add(p).addClass(b.disabledClass);t.addClass(b.disabledClass).click(function(){d.prevPage()});var v=b.hoverClass,w="keydown."+
37	+ Math.random().toString().substring(10);d.onReload(function(){v&&d.getItems().hover(function(){a(this).addClass(v)},function(){a(this).removeClass(v)});b.clickable&&d.getItems().each(function(b){a(this).unbind("click.scrollable").bind("click.scrollable",function(e){if(!a(e.target).is("a"))return d.click(b)})});b.keyboard?a(document).unbind(w).bind(w,function(a){if(!(a.altKey\|\|a.ctrlKey\|\|"static"!=b.keyboard&&g!=d)){var e=b.keyboardSteps;return!m\|\|37!=a.keyCode&&39!=a.keyCode?m\|\|38!=a.keyCode&&40!=
38	+ a.keyCode?!0:(d.move(38==a.keyCode?-e:e),a.preventDefault()):(d.move(37==a.keyCode?-e:e),a.preventDefault())}}):a(document).unbind(w)});d.reload()}a.tools=a.tools\|\|{};a.tools.scrollable={version:"1.1.2",conf:{size:5,vertical:!1,speed:400,keyboard:!0,keyboardSteps:null,disabledClass:"disabled",hoverClass:null,clickable:!0,activeClass:"active",easing:"swing",loop:!1,items:".items",item:null,prev:".prev",next:".next",prevPage:".prevPage",nextPage:".nextPage",api:!1}};var g;a.fn.scrollable=function(c){var b=
39	+ this.eq("number"==typeof c?c:0).data("scrollable");if(b)return b;var e=a.extend({},a.tools.scrollable.conf);c=a.extend(e,c);c.keyboardSteps=c.keyboardSteps\|\|c.size;this.each(function(){b=new f(a(this),c);a(this).data("scrollable",b)});return c.api?b:this}})(jQuery);
40	+ (function(a){var f=a.tools.scrollable;f.plugins=f.plugins\|\|{};f.plugins.autoscroll={version:"1.0.1",conf:{autoplay:!0,interval:3E3,autopause:!0,steps:1,api:!1}};a.fn.autoscroll=function(g){"number"==typeof g&&(g={interval:g});var c=a.extend({},f.plugins.autoscroll.conf),b;a.extend(c,g);this.each(function(){var e=a(this).scrollable();e&&(b=e);var d,g,f=!0;e.play=function(){d\|\|(f=!1,d=setInterval(function(){e.move(c.steps)},c.interval),e.move(c.steps))};e.pause=function(){d=clearInterval(d)};e.stop=
41	+ function(){e.pause();f=!0};c.autopause&&e.getRoot().add(e.getNaviButtons()).hover(function(){e.pause();clearInterval(g)},function(){f\|\|(g=setTimeout(e.play,c.interval))});c.autoplay&&setTimeout(e.play,c.interval)});return c.api?b:this}})(jQuery);
42	+ (function(a){var f=a.tools.scrollable;f.plugins=f.plugins\|\|{};f.plugins.navigator={version:"1.0.2",conf:{navi:".navi",naviItem:null,activeClass:"active",indexed:!1,api:!1,idPrefix:null}};a.fn.navigator=function(g){var c=a.extend({},f.plugins.navigator.conf),b;"string"==typeof g&&(g={navi:g});g=a.extend(c,g);this.each(function(){function e(){if(c.children().length&&c.data("navi")!=d)f=g.naviItem?c.find(g.naviItem):c.children(),f.each(function(b){a(this).click(function(a){d.setPage(b);return a.preventDefault()})});
43	+ else{c.empty();c.data("navi",d);for(var b=0;b<d.getPageAmount();b++)c.append(a("<"+(g.naviItem\|\|"a")+"/>"));f=c.children().each(function(b){var e=a(this);e.click(function(a){d.setPage(b);return a.preventDefault()});g.indexed&&e.text(b);g.idPrefix&&e.attr("id",g.idPrefix+b)})}f.eq(0).addClass(g.activeClass)}var d=a(this).scrollable(),c=d.getRoot().data("finder").call(null,g.navi),f=null,h=d.getNaviButtons();d&&(b=d);d.getNaviButtons=function(){return h.add(c)};d.onStart(function(a,b){a=g.activeClass;
44	+ f.removeClass(a).eq(d.getPageIndex()).addClass(a)});d.onReload(function(){e()});e();var k=f.filter("[href="+location.hash+"]");k.length&&d.move(f.index(k))});return g.api?b:this}})(jQuery);
45	+ (function(a){function f(b){switch(b.type){case "mousemove":return a.extend(b.data,{clientX:b.clientX,clientY:b.clientY,pageX:b.pageX,pageY:b.pageY});case "DOMMouseScroll":a.extend(b,b.data);b.delta=-b.detail/3;break;case "mousewheel":b.delta=b.wheelDelta/120}b.type="wheel";return a.event.handle.call(this,b,b.delta)}a.fn.wheel=function(a){return this[a?"bind":"trigger"]("wheel",a)};a.event.special.wheel={setup:function(){a.event.add(this,g,f,{})},teardown:function(){a.event.remove(this,g,f)}};var g=
46	+ a.browser_backward_hack.mozilla?"DOMMouseScroll"+("1.9">a.browser_backward_hack.version?" mousemove":""):"mousewheel",c=a.tools.scrollable;c.plugins=c.plugins\|\|{};c.plugins.mousewheel={version:"1.0.1",conf:{api:!1,speed:50}};a.fn.mousewheel=function(b){var e=a.extend({},c.plugins.mousewheel.conf),d;"number"==typeof b&&(b={speed:b});b=a.extend(e,b);this.each(function(){var e=a(this).scrollable();e&&(d=e);e.getRoot().wheel(function(a,d){e.move(0>d?1:-1,b.speed\|\|50);return!1})});return b.api?d:this}})(jQuery);(function(a){function f(a,b){var e=a.getHours(),d=b.show24Hours?e:(e+11)%12+1;b.show24Hours&&(d=(10>d?"0":"")+d);var c=a.getMinutes();a=b.timeFormat;a=a.replace("hh",d);a=a.replace("h",d);a=a.replace("mm",(10>c?"0":"")+c);return a=b.show24Hours?a.replace(" tt",""):a.replace("tt",12>e?b.amDesignator:b.pmDesignator)}function g(a,d){return"object"==typeof a?b(a):c(a,d)}function c(a,d){if(a){var e=a.split(d.separator),c=parseFloat(e[0]),e=parseFloat(e[1]);d.show24Hours\|\|(12===c&&-1!==a.substr(d.amDesignator)?
47	+ c=0:12!==c&&-1!==a.indexOf(d.pmDesignator)&&(c+=12));return b(new Date(0,0,0,c,e,0))}return null}function b(a){a.setFullYear(2001);a.setMonth(0);a.setDate(0);return a}a.fn.timePicker=function(b){var d=a.extend({},a.fn.timePicker.defaults,b);return this.each(function(){a.timePicker(this,d)})};a.timePicker=function(b,d){b=a(b)[0];return b.timePicker\|\|(b.timePicker=new jQuery._timePicker(b,d))};a._timePicker=function(e,d){var r=!1,m=!1,h=g(d.startTime,d),k=g(d.endTime,d);a(e).attr("autocomplete","OFF");
48	+ for(var l=[],q=new Date(h);q<=k;)l[l.length]=f(q,d),q=new Date(q.setMinutes(q.getMinutes()+d.step));for(var n=a("<div "+(d.tpDivId?'id="'+d.tpDivId+'" ':"")+'class="time-picker'+(d.show24Hours?"":" time-picker-12hours")+'"></div>'),t=a("<ul></ul>"),q=0;q<l.length;q++)t.append("<li>"+l[q]+"</li>");n.append(t);l=a(e).offset();n.appendTo("body").css({top:l.top-48+"px",left:l.left,width:a(e).width()+5+"px"}).hide();n.mouseover(function(){r=!0}).mouseout(function(){r=!1});a("li",t).mouseover(function(){m\|\|
49	+ (a("li.selected",n).removeClass("selected"),a(this).addClass("selected"))}).mousedown(function(){r=!0}).click(function(){e.value=a(this).text();a(e).change();a.browser_backward_hack.msie\|\|e.focus();n.hide();r=!1});var p=function(){if(n.is(":visible"))return!1;a("li",n).removeClass("selected");var g=a(e).offset();n.css({top:g.top+a(e).height()+10+"px",left:g.left,width:a(e).width()+5+"px"});n.show();var m=e.value?c(e.value,d):h,g=60h.getHours()+h.getMinutes(),m=60m.getHours()+m.getMinutes()-g,g=b(new Date(0,0,
50	+ 0,0,Math.round(m/d.step)*d.step+g,0)),g=h<g&&g<=k?g:h,g=a("li:contains("+f(g,d)+")",n);g.length&&(g.addClass("selected"),n[0].scrollTop=g[0].offsetTop);return!0};a(e).focus(p).click(p);a(e).blur(function(){r\|\|n.hide()});l=a.browser_backward_hack.opera\|\|a.browser_backward_hack.mozilla?"keypress":"keydown";a(e)[l](function(b){m=!0;var d=n[0].scrollTop;switch(b.keyCode){case 38:if(p())return!1;b=a("li.selected",t);var c=b.prev().addClass("selected")[0];c?(b.removeClass("selected"),c.offsetTop<d&&(n[0].scrollTop=d-c.offsetHeight)):
51	+ (b.removeClass("selected"),c=a("li:last",t).addClass("selected")[0],n[0].scrollTop=c.offsetTop-c.offsetHeight);return!1;case 40:if(p())return!1;b=a("li.selected",t);(c=b.next().addClass("selected")[0])?(b.removeClass("selected"),c.offsetTop+c.offsetHeight>d+n[0].offsetHeight&&(n[0].scrollTop=d+c.offsetHeight)):(b.removeClass("selected"),a("li:first",t).addClass("selected"),n[0].scrollTop=0);return!1;case 13:return n.is(":visible")&&(d=a("li.selected",t)[0],e.value=a(d).text(),a(e).change(),a.browser_backward_hack.msie\|\|
52	+ e.focus(),n.hide()),!1;case 27:return n.hide(),!1}return!0});a(e).keyup(function(a){m=!1});this.getTime=function(){return c(e.value,d)};this.setTime=function(c){e.value=f(b(c),d);a(e).change()}};a.fn.timePicker.defaults={step:30,startTime:new Date(0,0,0,0,0,0),endTime:new Date(0,0,0,23,30,0),separator:":",show24Hours:!0,timeFormat:"hh:mm tt",amDesignator:"AM",pmDesignator:"PM"}})(jQuery);this.JSON\|\|(this.JSON={});
53	+ (function(){function a(a){return 10>a?"0"+a:a}function f(a){b.lastIndex=0;return b.test(a)?'"'+a.replace(b,function(a){var b=r[a];return"string"===typeof b?b:"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)})+'"':'"'+a+'"'}function g(a,b){var c=e,h=b[a];h&&"object"===typeof h&&"function"===typeof h.toJSON&&(h=h.toJSON(a));"function"===typeof m&&(h=m.call(b,a,h));switch(typeof h){case "string":return f(h);case "number":return isFinite(h)?String(h):"null";case "boolean":case "null":return String(h);case "object":if(!h)return"null";
54	+ e+=d;var k=[];if("[object Array]"===Object.prototype.toString.apply(h)){var r=h.length;for(a=0;a<r;a+=1)k[a]=g(a,h)\|\|"null";b=0===k.length?"[]":e?"[\n"+e+k.join(",\n"+e)+"\n"+c+"]":"["+k.join(",")+"]";e=c;return b}if(m&&"object"===typeof m)for(r=m.length,a=0;a<r;a+=1){var p=m[a];"string"===typeof p&&(b=g(p,h))&&k.push(f(p)+(e?": ":":")+b)}else for(p in h)Object.hasOwnProperty.call(h,p)&&(b=g(p,h))&&k.push(f(p)+(e?": ":":")+b);b=0===k.length?"{}":e?"{\n"+e+k.join(",\n"+e)+"\n"+c+"}":"{"+k.join(",")+
55	+ "}";e=c;return b}}"function"!==typeof Date.prototype.toJSON&&(Date.prototype.toJSON=function(b){return isFinite(this.valueOf())?this.getUTCFullYear()+"-"+a(this.getUTCMonth()+1)+"-"+a(this.getUTCDate())+"T"+a(this.getUTCHours())+":"+a(this.getUTCMinutes())+":"+a(this.getUTCSeconds())+"Z":null},String.prototype.toJSON=Number.prototype.toJSON=Boolean.prototype.toJSON=function(a){return this.valueOf()});var c=/[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
56	+ b=/[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,e,d,r={"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},m;"function"!==typeof JSON.stringify&&(JSON.stringify=function(a,b,c){var f;d=e="";if("number"===typeof c)for(f=0;f<c;f+=1)d+=" ";else"string"===typeof c&&(d=c);if((m=b)&&"function"!==typeof b&&("object"!==typeof b\|\|"number"!==typeof b.length))throw Error("JSON.stringify");return g("",{"":a})});
57	+ "function"!==typeof JSON.parseIt&&(JSON.parseIt=function(a,b){function d(a,c){var e,g=a[c];if(g&&"object"===typeof g)for(e in g)if(Object.hasOwnProperty.call(g,e)){var f=d(g,e);void 0!==f?g[e]=f:delete g[e]}return b.call(a,c,g)}c.lastIndex=0;c.test(a)&&(a=a.replace(c,function(a){return"\\u"+("0000"+a.charCodeAt(0).toString(16)).slice(-4)}));if(/^[\],:{}\s]$/.test(a.replace(/\\(?:["\\\/bfnrt]\|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]"\|true\|false\|null\|-?\d+(?:\.\d)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^\|:\|,)(?:\s\[)+/g,
58	+ "")))return a=eval("("+a+")"),"function"===typeof b?d({"":a},""):a;throw new SyntaxError("JSON.parseIt");})})();(function(a){function f(c,b){function e(d){var e=a(d);return b.globalNav?e:c.parent().find(d)}var d=this,f=a(this),m=!b.vertical,h=c.children(),k=0,l;g\|\|(g=d);a.each(b,function(b,d){a.isFunction(d)&&f.bind(b,d)});1<h.length&&(h=a(b.items,c));c.data("finder",e);var q=e(b.prev),n=e(b.next),t=e(b.prevPage),p=e(b.nextPage);a.extend(d,{getIndex:function(){return k},getClickIndex:function(){var a=d.getItems();return a.index(a.filter("."+b.activeClass))},getConf:function(){return b},getSize:function(){return d.getItems().length},
59	+ getPageAmount:function(){return Math.ceil(this.getSize()/b.size)},getPageIndex:function(){return Math.ceil(k/b.size)},getNaviButtons:function(){return q.add(n).add(t).add(p)},getRoot:function(){return c},getItemWrap:function(){return h},getItems:function(){return h.children(b.item)},getVisibleItems:function(){return d.getItems().slice(k,k+b.size)},seekTo:function(c,e,r){function x(){r&&r.call(d,c);f.trigger("onSeek",[c])}0>c&&(c=0);if(k===c)return d;a.isFunction(e)&&(r=e);if(c>d.getSize()-b.size)return b.loop?
60	+ d.begin():this.end();var u=d.getItems().eq(c);if(!u.length)return d;var l=a.Event("onBeforeSeek");f.trigger(l,c>k);if(l.isDefaultPrevented())return d;if(void 0===e\|\|a.isFunction(e))e=b.speed;m?h.animate({left:-u.position().left},e,b.easing,x):h.animate({top:-u.position().top},e,b.easing,x);g=d;k=c;l=a.Event("onStart");f.trigger(l,[c]);if(l.isDefaultPrevented())return d;q.add(t).toggleClass(b.disabledClass,0===c);n.add(p).toggleClass(b.disabledClass,c>=d.getSize()-b.size);return d},move:function(a,
61	+ b,c){l=0<a;return this.seekTo(k+a,b,c)},next:function(a,b){return this.move(1,a,b)},prev:function(a,b){return this.move(-1,a,b)},movePage:function(a,c,d){l=0<a;var e=b.sizea,g=k%b.size;0<g&&(e+=0<a?-g:b.size-g);return this.move(e,c,d)},prevPage:function(a,b){return this.movePage(-1,a,b)},nextPage:function(a,b){return this.movePage(1,a,b)},setPage:function(a,c,d){return this.seekTo(ab.size,c,d)},begin:function(a,b){l=!1;return this.seekTo(0,a,b)},end:function(a,c){l=!0;var e=this.getSize()-b.size;
62	+ return 0<e?this.seekTo(e,a,c):d},reload:function(){f.trigger("onReload");return d},focus:function(){return g=d},click:function(a){var c=d.getItems().eq(a),e=b.activeClass,g=b.size;if(0>a\|\|a>=d.getSize())return d;if(1==g){if(b.loop)return d.next();if(0===a\|\|a==d.getSize()-1)l=void 0===l?!0:!l;return!1===l?d.prev():d.next()}return 2==g?(a==k&&a--,d.getItems().removeClass(e),c.addClass(e),d.seekTo(a,time,fn)):c.hasClass(e)\|\|(d.getItems().removeClass(e),c.addClass(e),c=a-Math.floor(g/2),c>d.getSize()-
63	+ g&&(c=d.getSize()-g),c===a)?d:d.seekTo(c)},bind:function(a,b){f.bind(a,b);return d},unbind:function(a){f.unbind(a);return d}});a.each(["onBeforeSeek","onStart","onSeek","onReload"],function(a,b){d[b]=function(a){return d.bind(b,a)}});q.addClass(b.disabledClass).click(function(){d.prev()});n.click(function(){d.next()});p.click(function(){d.nextPage()});d.getSize()<b.size&&n.add(p).addClass(b.disabledClass);t.addClass(b.disabledClass).click(function(){d.prevPage()});var v=b.hoverClass,w="keydown."+
64	+ Math.random().toString().substring(10);d.onReload(function(){v&&d.getItems().hover(function(){a(this).addClass(v)},function(){a(this).removeClass(v)});b.clickable&&d.getItems().each(function(b){a(this).unbind("click.scrollable").bind("click.scrollable",function(c){if(!a(c.target).is("a"))return d.click(b)})});b.keyboard?a(document).unbind(w).bind(w,function(a){if(!(a.altKey\|\|a.ctrlKey\|\|"static"!=b.keyboard&&g!=d)){var c=b.keyboardSteps;return!m\|\|37!=a.keyCode&&39!=a.keyCode?m\|\|38!=a.keyCode&&40!=
65	+ a.keyCode?!0:(d.move(38==a.keyCode?-c:c),a.preventDefault()):(d.move(37==a.keyCode?-c:c),a.preventDefault())}}):a(document).unbind(w)});d.reload()}a.tools=a.tools\|\|{};a.tools.scrollable={version:"1.1.2",conf:{size:5,vertical:!1,speed:400,keyboard:!0,keyboardSteps:null,disabledClass:"disabled",hoverClass:null,clickable:!0,activeClass:"active",easing:"swing",loop:!1,items:".items",item:null,prev:".prev",next:".next",prevPage:".prevPage",nextPage:".nextPage",api:!1}};var g;a.fn.scrollable=function(c){var b=
66	+ this.eq("number"==typeof c?c:0).data("scrollable");if(b)return b;var e=a.extend({},a.tools.scrollable.conf);c=a.extend(e,c);c.keyboardSteps=c.keyboardSteps\|\|c.size;this.each(function(){b=new f(a(this),c);a(this).data("scrollable",b)});return c.api?b:this}})(jQuery);(function(a){function f(c){switch(c.type){case "mousemove":return a.extend(c.data,{clientX:c.clientX,clientY:c.clientY,pageX:c.pageX,pageY:c.pageY});case "DOMMouseScroll":a.extend(c,c.data);c.delta=-c.detail/3;break;case "mousewheel":c.delta=c.wheelDelta/120}var b=a(this).scrollable();c.preventDefault();b.move(0>c.delta?1:-1,50);return!1}a.fn.wheel=function(a){return this[a?"bind":"trigger"]("wheel",a)};a.event.special.wheel={setup:function(){this.addEventListener("DOMMouseScroll",f,!1);this.addEventListener("mousewheel",
67	+ f,!1)},teardown:function(){this.removeEventListener("DOMMouseScroll",f,!1);this.removeEventListener("mousewheel",f,!1)}};var g=a.tools.scrollable;g.plugins=g.plugins\|\|{};g.plugins.mousewheel={version:"1.0.1",conf:{api:!1,speed:50}};a.fn.mousewheel=function(c){var b=a.extend({},g.plugins.mousewheel.conf),e;"number"==typeof c&&(c={speed:c});c=a.extend(b,c);this.each(function(){var b=a(this).scrollable();b&&(e=b);b.getRoot().wheel(function(a,e){b.move(0>e?1:-1,c.speed\|\|50);return!1})});return c.api?
68	+ e:this}})(jQuery);/*
69	+ : Copyright (c) 2006-2008, Coolite Inc. (http://www.coolite.com/). All rights reserved.
70	+ @license: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
71	+ @website: http://www.datejs.com/
72	+ */
73	+ (function(){var a=Date,f=a.prototype,g=[],c=function(a,c){c\|\|(c=2);return("000"+a).slice(-1c)};a.normalizeFormat=function(a){g=[];(new Date).$format(a);return g.join("")};a.strftime=function(a,c){return(new Date(1E3c)).$format(a)};a.strtotime=function(b){b=a.parse(b);b.addMinutes(-1*b.getTimezoneOffset());return Math.round(a.UTC(b.getUTCFullYear(),b.getUTCMonth(),b.getUTCDate(),b.getUTCHours(),b.getUTCMinutes(),b.getUTCSeconds(),b.getUTCMilliseconds())/1E3)};f.$format=function(b){var e=this,d,f=
74	+ function(a){g.push(a);return e.toString(a)};return b?b.replace(/(%\|\\)?.\|%%/g,function(b){if("\\"===b.charAt(0)\|\|"%%"===b.substring(0,2))return b.replace("\\","").replace("%%","%");switch(b){case "d":case "%d":return f("dd");case "D":case "%a":return f("ddd");case "j":case "%e":return f("d");case "l":case "%A":return f("dddd");case "N":case "%u":return e.getDay()+1;case "S":return f("S");case "w":case "%w":return e.getDay();case "z":return e.getOrdinalNumber();case "%j":return c(e.getOrdinalNumber(),
75	+ 3);case "%U":b=e.clone().set({month:0,day:1}).addDays(-1).moveToDayOfWeek(0);var h=e.clone().addDays(1).moveToDayOfWeek(0,-1);return h<b?"00":c((h.getOrdinalNumber()-b.getOrdinalNumber())/7+1);case "W":case "%V":return e.getISOWeek();case "%W":return c(e.getWeek());case "F":case "%B":return f("MMMM");case "m":case "%m":return f("MM");case "M":case "%b":case "%h":return f("MMM");case "n":return f("M");case "t":return a.getDaysInMonth(e.getFullYear(),e.getMonth());case "L":return a.isLeapYear(e.getFullYear())?
76	+ 1:0;case "o":case "%G":return e.setWeek(e.getISOWeek()).toString("yyyy");case "%g":return e.$format("%G").slice(-2);case "Y":case "%Y":return f("yyyy");case "y":case "%y":return f("yy");case "a":case "%p":return f("tt").toLowerCase();case "A":return f("tt").toUpperCase();case "g":case "%I":return f("h");case "G":return f("H");case "h":return f("hh");case "H":case "%H":return f("HH");case "i":case "%M":return f("mm");case "s":case "%S":return f("ss");case "u":return c(e.getMilliseconds(),3);case "I":return e.isDaylightSavingTime()?
77	+ 1:0;case "O":return e.getUTCOffset();case "P":return d=e.getUTCOffset(),d.substring(0,d.length-2)+":"+d.substring(d.length-2);case "e":case "T":case "%z":case "%Z":return e.getTimezone();case "Z":return-60e.getTimezoneOffset();case "B":return b=new Date,Math.floor((3600b.getHours()+60b.getMinutes()+b.getSeconds()+60(b.getTimezoneOffset()+60))/86.4);case "c":return e.toISOString().replace(/\"/g,"");case "U":return a.strtotime("now");case "%c":return f("d")+" "+f("t");case "%C":return Math.floor(e.getFullYear()/
78	+ 100+1);case "%D":return f("MM/dd/yy");case "%n":return"\\n";case "%t":return"\\t";case "%r":return f("hh:mm tt");case "%R":return f("H:mm");case "%T":return f("H:mm:ss");case "%x":return f("d");case "%X":return f("t");default:return g.push(b),b}}):this._toString()};f.format\|\|(f.format=f.$format)})();

3.7.8/lib/humanmsg.css ADDED Viewed

	@@ -0,0 +1,40 @@


1	+ /*
2	+ HUMANIZED MESSAGES 1.0
3	+ idea - http://www.humanized.com/weblog/2006/09/11/monolog_boxes_and_transparent_messages
4	+ home - http://humanmsg.googlecode.com
5	+ */
6	+
7	+ .humanMsg {
8	+ font: normal 2em Helvetica, Arial, Sans-Serif;
9	+ letter-spacing: -1px;
10	+ position: fixed;
11	+ top: 130px;
12	+ left: 25%;
13	+ width: 50%;
14	+ color: white;
15	+ background-color: red;
16	+ text-align: center;
17	+ display: none;
18	+ opacity: 0;
19	+ z-index: 100000;
20	+ }
21	+
22	+ .humanMsg .round {
23	+ border-left: solid 2px white;
24	+ border-right: solid 2px white;
25	+ font-size: 1px; height: 2px;
26	+ }
27	+
28	+ .humanMsg p {
29	+ padding: .3em;
30	+ display: inline;
31	+ font-size: 1.5em;
32	+ }
33	+
34	+ .humanMsg a {
35	+ display: none;
36	+ }
37	+
38	+ #humanMsgLog {
39	+ display: none;
40	+ }

3.7.8/lib/humanmsg.js ADDED Viewed

	@@ -0,0 +1,190 @@


1	+ /*
2	+ HUMANIZED MESSAGES 1.0
3	+ idea - http://www.humanized.com/weblog/2006/09/11/monolog_boxes_and_transparent_messages
4	+ home - http://humanmsg.googlecode.com
5	+ */
6	+
7	+ var humanMsg = {
8	+ setup: function(appendTo, logName, msgOpacity) {
9	+ humanMsg.msgID = 'humanMsg';
10	+ humanMsg.logID = 'humanMsgLog';
11	+
12	+ // appendTo is the element the msg is appended to
13	+ appendTo = 'body';
14	+
15	+ // The text on the Log tab
16	+ if (logName == undefined) {
17	+ if (humanMsg.logTitle == undefined) {
18	+ logName = 'Message Log';
19	+ } else {
20	+ logName = humanMsg.logTitle;
21	+ }
22	+ }
23	+
24	+ humanMsg.logTop = jQuery('#'+humanMsg.logID).css("top");
25	+
26	+ // Opacity of the message
27	+ humanMsg.msgOpacity = 0.9;
28	+
29	+ if (msgOpacity != undefined)
30	+ humanMsg.msgOpacity = parseFloat(msgOpacity);
31	+
32	+ // Inject the message structure
33	+ jQuery(appendTo).prepend('<div id="'+humanMsg.msgID+'" class="humanMsg"><div class="round"></div><p></p><div class="round"></div></div>');
34	+ jQuery(appendTo).append('<div id="'+humanMsg.logID+'"><p>'+logName+'</p><a href="#" id="humanMsgClose">x</a><ul></ul></div>');
35	+
36	+ jQuery('#humanMsgClose').click(
37	+ function() {
38	+ jQuery('#'+humanMsg.logID+' p').addClass('minimized');
39	+ jQuery('#humanMsgClose').hide();
40	+ return false;
41	+ });
42	+
43	+ jQuery('#'+humanMsg.logID+' p').click(
44	+ function() {
45	+ humanMsg.activateLog();
46	+
47	+ if (jQuery('#'+humanMsg.logID+' p').hasClass('minimized')) {
48	+ jQuery('#humanMsgClose').show();
49	+ jQuery('#'+humanMsg.logID+' p').removeClass('minimized');
50	+ return;
51	+ } else if (jQuery(this).siblings('ul').css('display') != 'none') {
52	+ jQuery('#'+humanMsg.logID).css("top", humanMsg.logTop);
53	+ jQuery(this).siblings('ul').hide();
54	+ jQuery('#humanMsgClose').show();
55	+ } else {
56	+ humanMsg.setLogHeight();
57	+ jQuery(this).siblings('ul').slideToggle();
58	+ jQuery('#humanMsgClose').slideToggle();
59	+ }
60	+ }
61	+ )
62	+ },
63	+
64	+ setLogTitle: function(/string/ title) {
65	+ humanMsg.logTitle = title;
66	+ jQuery("#" + humanMsg.logID + " > p").text(title);
67	+ },
68	+
69	+ displayMsg: function(msg, /boolean/doLog) {
70	+ if (msg == '')
71	+ return;
72	+
73	+ humanMsg.activateLog();
74	+
75	+ clearTimeout(humanMsg.t2);
76	+
77	+ /*
78	+ * IE doesn't really support CSS fixed position so we need to set the position manually
79	+ */
80	+ jQuery('#' + humanMsg.msgID).css('top', (jQuery(window).scrollTop() + 75) + 'px');
81	+
82	+ // Inject message
83	+ jQuery('#'+humanMsg.msgID+' p').html(msg)
84	+
85	+ // Show message
86	+ jQuery('#'+humanMsg.msgID+'').show().animate({ opacity: humanMsg.msgOpacity}, 200, function() {
87	+ if (doLog) {
88	+ humanMsg.log(msg);
89	+ }
90	+
91	+ });
92	+
93	+ /*
94	+ * If we are starting a new message and have an existing
95	+ * message then we want to restart the timers so the
96	+ * existing message doesn't get hidden very fast.
97	+ */
98	+ if (humanMsg.t1) {
99	+ clearTimeout(humanMsg.t1);
100	+ }
101	+
102	+ if (humanMsg.t2) {
103	+ clearTimeout(humanMsg.t2);
104	+ }
105	+
106	+ // Watch for mouse & keyboard in .5s
107	+ humanMsg.t1 = setTimeout(function() {humanMsg.bindEvents();}, 3000);
108	+ // Remove message after 5s
109	+ humanMsg.t2 = setTimeout(function() {humanMsg.removeMsg();}, 5000);
110	+ },
111	+
112	+ log: function(msg) {
113	+ jQuery('#'+humanMsg.logID)
114	+ .show().children('ul').prepend('<li>'+msg+'</li>') // Prepend message to log
115	+ .children('li:first').slideDown(200) // Slide it down
116	+
117	+ if (jQuery('#'+humanMsg.logID+' ul').css('display') == 'none') {
118	+ jQuery('#'+humanMsg.logID+' p').animate({ bottom: 40 }, 200, 'linear', function() {
119	+ jQuery(this).animate({ bottom: 0 }, 300, 'swing', function() { jQuery(this).css({ bottom: 0 }) })
120	+ })
121	+ } else {
122	+ humanMsg.setLogHeight();
123	+ }
124	+
125	+ jQuery('#humanMsgClose').show();
126	+ jQuery('#'+humanMsg.logID+' p').removeClass('minimized');
127	+ },
128	+
129	+ activateLog: function() {
130	+ jQuery('#'+humanMsg.logID+' p').removeClass("faded");
131	+
132	+ clearTimeout(humanMsg.t3);
133	+
134	+ //fadeout the error log after 15s
135	+ humanMsg.t3 = setTimeout(humanMsg.fadeLog, 15000)
136	+ },
137	+
138	+ setLogHeight: function() {
139	+ /*
140	+ * When items are added to the log we want to adjust the top of the log (where
141	+ * the pull tab goes) and the height of the log list dynamically so the log is
142	+ * always a reasonable size.
143	+ */
144	+ if (navigator.appName === "Microsoft Internet Explorer") {
145	+ /*
146	+ * IE just calculates the size of these list items differently thn every
147	+ * other browser. There isn't a good cross-browser way to set the height,
148	+ * so we tweak it for IE.
149	+ */
150	+ var height = Math.min(jQuery('#'+humanMsg.logID + ' ul').children('li').length * 48, 112);
151	+ jQuery('#'+humanMsg.logID + ' ul').css("height", (height + 10) + "px");
152	+
153	+ jQuery('#'+humanMsg.logID).css("top", "-" + ((height) + 56 + humanMsg.logTop) + "px");
154	+ } else {
155	+ var height = Math.min(jQuery('#'+humanMsg.logID + ' ul').children('li').length * 14, 56);
156	+ jQuery('#'+humanMsg.logID + ' ul').css("height", (height + 10) + "px");
157	+ jQuery('#'+humanMsg.logID).css("top", "-" + ((height) + 112 + humanMsg.logTop) + "px");
158	+ }
159	+
160	+
161	+ },
162	+
163	+ bindEvents: function() {
164	+ // Remove message if mouse is moved or key is pressed
165	+ jQuery(window)
166	+ .mousemove(humanMsg.removeMsg)
167	+ .click(humanMsg.removeMsg)
168	+ .keypress(humanMsg.removeMsg)
169	+ },
170	+
171	+ removeMsg: function() {
172	+ // Unbind mouse & keyboard
173	+ jQuery(window)
174	+ .unbind('mousemove', humanMsg.removeMsg)
175	+ .unbind('click', humanMsg.removeMsg)
176	+ .unbind('keypress', humanMsg.removeMsg)
177	+
178	+ jQuery('#'+humanMsg.msgID).fadeOut();
179	+ },
180	+
181	+ fadeLog: function() {
182	+ if(jQuery('#'+humanMsg.logID+' ul').css('display') === "none") {
183	+ jQuery('#'+humanMsg.logID+' p').addClass("faded");
184	+ }
185	+ }
186	+ };
187	+
188	+ jQuery(document).ready(function(){
189	+ humanMsg.setup();
190	+ })

3.7.8/lib/jquery.bgiframe.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
2	+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
3	+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
4	+ *
5	+ * jQueryLastChangedDate: 2007-06-20 03:23:36 +0200 (Mi, 20 Jun 2007) jQuery
6	+ * jQueryRev: 2110 jQuery
7	+ *
8	+ * Version 2.1
9	+ */
10	+
11	+ (function(jQuery){
12	+
13	+ /**
14	+ * The bgiframe is chainable and applies the iframe hack to get
15	+ * around zIndex issues in IE6. It will only apply itself in IE
16	+ * and adds a class to the iframe called 'bgiframe'. The iframe
17	+ * is appeneded as the first child of the matched element(s)
18	+ * with a tabIndex and zIndex of -1.
19	+ *
20	+ * By default the plugin will take borders, sized with pixel units,
21	+ * into account. If a different unit is used for the border's width,
22	+ * then you will need to use the top and left settings as explained below.
23	+ *
24	+ * NOTICE: This plugin has been reported to cause perfromance problems
25	+ * when used on elements that change properties (like width, height and
26	+ * opacity) a lot in IE6. Most of these problems have been caused by
27	+ * the expressions used to calculate the elements width, height and
28	+ * borders. Some have reported it is due to the opacity filter. All
29	+ * these settings can be changed if needed as explained below.
30	+ *
31	+ * @example jQuery('div').bgiframe();
32	+ * @before <div><p>Paragraph</p></div>
33	+ * @result <div><iframe class="bgiframe".../><p>Paragraph</p></div>
34	+ *
35	+ * @param Map settings Optional settings to configure the iframe.
36	+ * @option String\|Number top The iframe must be offset to the top
37	+ * by the width of the top border. This should be a negative
38	+ * number representing the border-top-width. If a number is
39	+ * is used here, pixels will be assumed. Otherwise, be sure
40	+ * to specify a unit. An expression could also be used.
41	+ * By default the value is "auto" which will use an expression
42	+ * to get the border-top-width if it is in pixels.
43	+ * @option String\|Number left The iframe must be offset to the left
44	+ * by the width of the left border. This should be a negative
45	+ * number representing the border-left-width. If a number is
46	+ * is used here, pixels will be assumed. Otherwise, be sure
47	+ * to specify a unit. An expression could also be used.
48	+ * By default the value is "auto" which will use an expression
49	+ * to get the border-left-width if it is in pixels.
50	+ * @option String\|Number width This is the width of the iframe. If
51	+ * a number is used here, pixels will be assume. Otherwise, be sure
52	+ * to specify a unit. An experssion could also be used.
53	+ * By default the value is "auto" which will use an experssion
54	+ * to get the offsetWidth.
55	+ * @option String\|Number height This is the height of the iframe. If
56	+ * a number is used here, pixels will be assume. Otherwise, be sure
57	+ * to specify a unit. An experssion could also be used.
58	+ * By default the value is "auto" which will use an experssion
59	+ * to get the offsetHeight.
60	+ * @option Boolean opacity This is a boolean representing whether or not
61	+ * to use opacity. If set to true, the opacity of 0 is applied. If
62	+ * set to false, the opacity filter is not applied. Default: true.
63	+ * @option String src This setting is provided so that one could change
64	+ * the src of the iframe to whatever they need.
65	+ * Default: "javascript:false;"
66	+ *
67	+ * @name bgiframe
68	+ @cat Plugins/bgiframe
69	+ * @author Brandon Aaron (brandon.aaron@gmail.com \|\| http://brandonaaron.net)
70	+ */
71	+ jQuery.fn.bgIframe = jQuery.fn.bgiframe = function(s) {
72	+ // This is only for IE6
73	+ if ( jQuery.browser_backward_hack_backward_hack.msie && parseInt(jQuery.browser_backward_hack_backward_hack.version) <= 6 ) {
74	+ s = jQuery.extend({
75	+ top : 'auto', // auto == .currentStyle.borderTopWidth
76	+ left : 'auto', // auto == .currentStyle.borderLeftWidth
77	+ width : 'auto', // auto == offsetWidth
78	+ height : 'auto', // auto == offsetHeight
79	+ opacity : true,
80	+ src : 'javascript:false;'
81	+ }, s \|\| {});
82	+ var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
83	+ html = '<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+
84	+ 'style="display:block;position:absolute;z-index:-1;'+
85	+ (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
86	+ 'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)\|\|0)*-1)+\'px\')':prop(s.top))+';'+
87	+ 'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)\|\|0)*-1)+\'px\')':prop(s.left))+';'+
88	+ 'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
89	+ 'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
90	+ '"/>';
91	+ return this.each(function() {
92	+ if ( jQuery('> iframe.bgiframe', this).length == 0 )
93	+ this.insertBefore( document.createElement(html), this.firstChild );
94	+ });
95	+ }
96	+ return this;
97	+ };
98	+
99	+ if (!jQuery.browser_backward_hack_backward_hack_backjQuery.browser_backward_hack_backward_hackjQuery.browser_backward_hack = {};
100	+ }
101	+
102	+ // Add browser.version if it doesnjQuery.browser_backward_hack_backward_hackjQuery.browjQuery.browser_backward_hack_backward_hackjQuery.browser_backward_hack.version = navigator.userAgent.toLowerCase().match(/.+(?:rv\|it\|ra\|ie)[\/: ]([\d.]+)/)[1];
103	+
104	+ })(jQuery);

3.7.8/lib/jquery.cookie.js ADDED Viewed

	@@ -0,0 +1,96 @@


1	+ /**
2	+ * Cookie plugin
3	+ *
4	+ * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
5	+ * Dual licensed under the MIT and GPL licenses:
6	+ * http://www.opensource.org/licenses/mit-license.php
7	+ * http://www.gnu.org/licenses/gpl.html
8	+ *
9	+ */
10	+
11	+ /**
12	+ * Create a cookie with the given name and value and other optional parameters.
13	+ *
14	+ * @example $.cookie('the_cookie', 'the_value');
15	+ * @desc Set the value of a cookie.
16	+ * @example $.cookie('the_cookie', 'the_value', { expires: 7, path: '/', domain: 'jquery.com', secure: true });
17	+ * @desc Create a cookie with all available options.
18	+ * @example $.cookie('the_cookie', 'the_value');
19	+ * @desc Create a session cookie.
20	+ * @example $.cookie('the_cookie', null);
21	+ * @desc Delete a cookie by passing null as value. Keep in mind that you have to use the same path and domain
22	+ * used when the cookie was set.
23	+ *
24	+ * @param String name The name of the cookie.
25	+ * @param String value The value of the cookie.
26	+ * @param Object options An object literal containing key/value pairs to provide optional cookie attributes.
27	+ * @option Number\|Date expires Either an integer specifying the expiration date from now on in days or a Date object.
28	+ * If a negative value is specified (e.g. a date in the past), the cookie will be deleted.
29	+ * If set to null or omitted, the cookie will be a session cookie and will not be retained
30	+ * when the the browser exits.
31	+ * @option String path The value of the path atribute of the cookie (default: path of page that created the cookie).
32	+ * @option String domain The value of the domain attribute of the cookie (default: domain of page that created the cookie).
33	+ * @option Boolean secure If true, the secure attribute of the cookie will be set and the cookie transmission will
34	+ * require a secure protocol (like HTTPS).
35	+ * @type undefined
36	+ *
37	+ * @name $.cookie
38	+ * @cat Plugins/Cookie
39	+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
40	+ */
41	+
42	+ /**
43	+ * Get the value of a cookie with the given name.
44	+ *
45	+ * @example $.cookie('the_cookie');
46	+ * @desc Get the value of a cookie.
47	+ *
48	+ * @param String name The name of the cookie.
49	+ * @return The value of the cookie.
50	+ * @type String
51	+ *
52	+ * @name $.cookie
53	+ * @cat Plugins/Cookie
54	+ * @author Klaus Hartl/klaus.hartl@stilbuero.de
55	+ */
56	+ jQuery.cookie = function(name, value, options) {
57	+ if (typeof value != 'undefined') { // name and value given, set cookie
58	+ options = options \|\| {};
59	+ if (value === null) {
60	+ value = '';
61	+ options.expires = -1;
62	+ }
63	+ var expires = '';
64	+ if (options.expires && (typeof options.expires == 'number' \|\| options.expires.toUTCString)) {
65	+ var date;
66	+ if (typeof options.expires == 'number') {
67	+ date = new Date();
68	+ date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000));
69	+ } else {
70	+ date = options.expires;
71	+ }
72	+ expires = '; expires=' + date.toUTCString(); // use expires attribute, max-age is not supported by IE
73	+ }
74	+ // CAUTION: Needed to parenthesize options.path and options.domain
75	+ // in the following expressions, otherwise they evaluate to undefined
76	+ // in the packed version for some reason...
77	+ var path = options.path ? '; path=' + (options.path) : '';
78	+ var domain = options.domain ? '; domain=' + (options.domain) : '';
79	+ var secure = options.secure ? '; secure' : '';
80	+ document.cookie = [name, '=', encodeURIComponent(value), expires, path, domain, secure].join('');
81	+ } else { // only name given, get cookie
82	+ var cookieValue = null;
83	+ if (document.cookie && document.cookie != '') {
84	+ var cookies = document.cookie.split(';');
85	+ for (var i = 0; i < cookies.length; i++) {
86	+ var cookie = jQuery.trim(cookies[i]);
87	+ // Does this cookie string begin with the name we want?
88	+ if (cookie.substring(0, name.length + 1) == (name + '=')) {
89	+ cookieValue = decodeURIComponent(cookie.substring(name.length + 1));
90	+ break;
91	+ }
92	+ }
93	+ }
94	+ return cookieValue;
95	+ }
96	+ };

3.7.8/lib/jquery.delegate.js ADDED Viewed

	@@ -0,0 +1,56 @@


1	+ /*
2	+ * jQuery delegate plug-in v1.0
3	+ *
4	+ * Copyright (c) 2007 Jörn Zaefferer
5	+ *
6	+ * jQueryId: jquery.delegate.js 4786 2008-02-19 20:02:34Z joern.zaefferer jQuery
7	+ *
8	+ * Dual licensed under the MIT and GPL licenses:
9	+ * http://www.opensource.org/licenses/mit-license.php
10	+ * http://www.gnu.org/licenses/gpl.html
11	+ */
12	+
13	+ // provides cross-browser focusin and focusout events
14	+ // IE has native support, in other browsers, use event caputuring (neither bubbles)
15	+
16	+ // provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation
17	+ // handler is only called when jQuery(event.target).is(delegate), in the scope of the jQuery-object for event.target
18	+
19	+ // provides triggerEvent(type: String, target: Element) to trigger delegated events
20	+ ;(function(jQuery) {
21	+ jQuery.each({
22	+ focus: 'focusin',
23	+ blur: 'focusout'
24	+ }, function( original, fix ){
25	+ jQuery.event.special[fix] = {
26	+ setup:function() {
27	+ if ( jQuery.browser_backward_hack_backward_hack.msie ) return false;
28	+ this.addEventListener( original, jQuery.event.special[fix].handler, true );
29	+ },
30	+ teardown:function() {
31	+ if ( jQuery.browser_backward_hack_backward_hack.msie ) return false;
32	+ this.removeEventListener( original,
33	+ jQuery.event.special[fix].handler, true );
34	+ },
35	+ handler: function(e) {
36	+ arguments[0] = jQuery.event.fix(e);
37	+ arguments[0].type = fix;
38	+ return jQuery.event.handle.apply(this, arguments);
39	+ }
40	+ };
41	+ });
42	+
43	+ jQuery.extend(jQuery.fn, {
44	+ delegate: function(type, delegate, handler) {
45	+ return this.bind(type, function(event) {
46	+ var target = jQuery(event.target);
47	+ if (target.is(delegate)) {
48	+ return handler.apply(target, arguments);
49	+ }
50	+ });
51	+ },
52	+ triggerEvent: function(type, target) {
53	+ return this.triggerHandler(type, [jQuery.event.fix({ type: type, target: target })]);
54	+ }
55	+ })
56	+ })(jQuery);

3.7.8/lib/jquery.mousewheel.js ADDED Viewed

	@@ -0,0 +1,84 @@


1	+ /*! Copyright (c) 2011 Brandon Aaron (http://brandonaaron.net)
2	+ * Licensed under the MIT License (LICENSE.txt).
3	+ *
4	+ * Thanks to: http://adomas.org/javascript-mouse-wheel/ for some pointers.
5	+ * Thanks to: Mathias Bank(http://www.mathias-bank.de) for a scope bug fix.
6	+ * Thanks to: Seamus Leahy for adding deltaX and deltaY
7	+ *
8	+ * Version: 3.0.6
9	+ *
10	+ * Requires: 1.2.2+
11	+ */
12	+
13	+ (function($) {
14	+
15	+ var types = ['DOMMouseScroll', 'mousewheel'];
16	+
17	+ if ($.event.fixHooks) {
18	+ for ( var i=types.length; i; ) {
19	+ $.event.fixHooks[ types[--i] ] = $.event.mouseHooks;
20	+ }
21	+ }
22	+
23	+ $.event.special.mousewheel = {
24	+ setup: function() {
25	+ if ( this.addEventListener ) {
26	+ for ( var i=types.length; i; ) {
27	+ this.addEventListener( types[--i], handler, false );
28	+ }
29	+ } else {
30	+ this.onmousewheel = handler;
31	+ }
32	+ },
33	+
34	+ teardown: function() {
35	+ if ( this.removeEventListener ) {
36	+ for ( var i=types.length; i; ) {
37	+ this.removeEventListener( types[--i], handler, false );
38	+ }
39	+ } else {
40	+ this.onmousewheel = null;
41	+ }
42	+ }
43	+ };
44	+
45	+ $.fn.extend({
46	+ mousewheel: function(fn) {
47	+ return fn ? this.bind("mousewheel", fn) : this.trigger("mousewheel");
48	+ },
49	+
50	+ unmousewheel: function(fn) {
51	+ return this.unbind("mousewheel", fn);
52	+ }
53	+ });
54	+
55	+
56	+ function handler(event) {
57	+ var orgEvent = event \|\| window.event, args = [].slice.call( arguments, 1 ), delta = 0, returnValue = true, deltaX = 0, deltaY = 0;
58	+ event = $.event.fix(orgEvent);
59	+ event.type = "mousewheel";
60	+
61	+ // Old school scrollwheel delta
62	+ if ( orgEvent.wheelDelta ) { delta = orgEvent.wheelDelta/120; }
63	+ if ( orgEvent.detail ) { delta = -orgEvent.detail/3; }
64	+
65	+ // New school multidimensional scroll (touchpads) deltas
66	+ deltaY = delta;
67	+
68	+ // Gecko
69	+ if ( orgEvent.axis !== undefined && orgEvent.axis === orgEvent.HORIZONTAL_AXIS ) {
70	+ deltaY = 0;
71	+ deltaX = -1*delta;
72	+ }
73	+
74	+ // Webkit
75	+ if ( orgEvent.wheelDeltaY !== undefined ) { deltaY = orgEvent.wheelDeltaY/120; }
76	+ if ( orgEvent.wheelDeltaX !== undefined ) { deltaX = -1*orgEvent.wheelDeltaX/120; }
77	+
78	+ // Add event and delta to the front of the arguments
79	+ args.unshift(event, delta, deltaX, deltaY);
80	+
81	+ return ($.event.dispatch \|\| $.event.handle).apply(this, args);
82	+ }
83	+
84	+ })(jQuery);

3.7.8/lib/jquery.timepicker.js ADDED Viewed

	@@ -0,0 +1,309 @@


1	+ /*
2	+ * A time picker for jQuery
3	+ * Based on original timePicker by Sam Collet (http://www.texotela.co.uk) -
4	+ * copyright (c) 2006 Sam Collett (http://www.texotela.co.uk)
5	+ *
6	+ * Dual licensed under the MIT and GPL licenses.
7	+ * Copyright (c) 2009 Anders Fajerson
8	+ * @name timePicker
9	+ * @version 0.2
10	+ * @author Anders Fajerson (http://perifer.se)
11	+ * @example $("#mytime").timePicker();
12	+ * @example $("#mytime").timePicker({step:30, startTime:"15:00", endTime:"18:00"});
13	+ */
14	+
15	+ (function($){
16	+ $.fn.timePicker = function(options) {
17	+ // Build main options before element iteration
18	+ var settings = $.extend({}, $.fn.timePicker.defaults, options);
19	+
20	+ return this.each(function() {
21	+ $.timePicker(this, settings);
22	+ });
23	+ };
24	+
25	+ $.timePicker = function (elm, settings) {
26	+ var e = $(elm)[0];
27	+ return e.timePicker \|\| (e.timePicker = new jQuery._timePicker(e, settings));
28	+ };
29	+
30	+ $._timePicker = function(elm, settings) {
31	+
32	+ var tpOver = false;
33	+ var keyDown = false;
34	+ var startTime = timeToDate(settings.startTime, settings);
35	+ var endTime = timeToDate(settings.endTime, settings);
36	+
37	+ $(elm).attr('autocomplete', 'OFF'); // Disable browser autocomplete
38	+
39	+ var times = [];
40	+ var time = new Date(startTime); // Create a new date object.
41	+ while(time <= endTime) {
42	+ times[times.length] = formatTime(time, settings);
43	+ time = new Date(time.setMinutes(time.getMinutes() + settings.step));
44	+ }
45	+
46	+ //A tpDiv is generated for every timepicker, so give it a unique id based settings.id
47	+ //so the GWT TimePickerTextBox can be fully functional.
48	+ //If there is no settings.id then do not bother with an id because it is not being used
49	+ //with GWT TimePickerTextBox.
50	+ var $tpDiv = $('<div ' + (settings.tpDivId ? 'id="' + settings.tpDivId + '" ' : '') + 'class="time-picker'+ (settings.show24Hours ? '' : ' time-picker-12hours') +'"></div>');
51	+ var $tpList = $('<ul></ul>');
52	+
53	+ // Build the list.
54	+ for(var i = 0; i < times.length; i++) {
55	+ $tpList.append("<li>" + times[i] + "</li>");
56	+ }
57	+ $tpDiv.append($tpList);
58	+ // Append the timPicker to the body and position it.
59	+ var elmOffset = $(elm).offset();
60	+
61	+ $tpDiv.appendTo('body').css({
62	+ 'top':(elmOffset.top - 48) + "px",
63	+ 'left':elmOffset.left,
64	+ 'width': ($(elm).width() + 5) + "px"
65	+ }).hide();
66	+
67	+ // Store the mouse state, used by the blur event. Use mouseover instead of
68	+ // mousedown since Opera fires blur before mousedown.
69	+ $tpDiv.mouseover(function() {
70	+ tpOver = true;
71	+ }).mouseout(function() {
72	+ tpOver = false;
73	+ });
74	+
75	+ $("li", $tpList).mouseover(function() {
76	+ if (!keyDown) {
77	+ $("li.selected", $tpDiv).removeClass("selected");
78	+ $(this).addClass("selected");
79	+ }
80	+ }).mousedown(function() {
81	+ tpOver = true;
82	+ }).click(function() {
83	+ setTimeVal(elm, this, $tpDiv, settings);
84	+ tpOver = false;
85	+ });
86	+
87	+ var showPicker = function() {
88	+ if ($tpDiv.is(":visible")) {
89	+ return false;
90	+ }
91	+ $("li", $tpDiv).removeClass("selected");
92	+
93	+ //Reposition the picker in case the page has changed (other things hidden or shown)
94	+ //and the textbox element is no longer where it was when the tpDiv was first appended to the DOM body.
95	+ var elmOffset = $(elm).offset();
96	+
97	+ $tpDiv.css({
98	+ 'top':(elmOffset.top + $(elm).height() + 10) + "px",
99	+ 'left':elmOffset.left,
100	+ 'width': ($(elm).width() + 5) + "px"
101	+ });
102	+
103	+ // Show picker. This has to be done before scrollTop is set since that
104	+ // can't be done on hidden elements.
105	+ $tpDiv.show();
106	+
107	+ // Try to find a time in the list that matches the entered time.
108	+ var time = elm.value ? timeStringToDate(elm.value, settings) : startTime;
109	+ var startMin = startTime.getHours() * 60 + startTime.getMinutes();
110	+ var min = (time.getHours() * 60 + time.getMinutes()) - startMin;
111	+ var steps = Math.round(min / settings.step);
112	+ var roundTime = normaliseTime(new Date(0, 0, 0, 0, (steps * settings.step + startMin), 0));
113	+ roundTime = (startTime < roundTime && roundTime <= endTime) ? roundTime : startTime;
114	+ var $matchedTime = $("li:contains(" + formatTime(roundTime, settings) + ")", $tpDiv);
115	+
116	+ if ($matchedTime.length) {
117	+ $matchedTime.addClass("selected");
118	+ // Scroll to matched time.
119	+ $tpDiv[0].scrollTop = $matchedTime[0].offsetTop;
120	+ }
121	+ return true;
122	+ };
123	+ // Attach to click as well as focus so timePicker can be shown again when
124	+ // clicking on the input when it already has focus.
125	+ $(elm).focus(showPicker).click(showPicker);
126	+ // Hide timepicker on blur
127	+ $(elm).blur(function() {
128	+ if (!tpOver) {
129	+ $tpDiv.hide();
130	+ }
131	+ });
132	+ // Keypress doesn't repeat on Safari for non-text keys.
133	+ // Keydown doesn't repeat on Firefox and Opera on Mac.
134	+ // Using kepress for Opera and Firefox and keydown for the rest seems to
135	+ // work with up/down/enter/esc.
136	+ var event = ($.browser_backward_hack.opera \|\| $.browser_backward_hack.mozilla) ? 'keypress' : 'keydown';
137	+ $(elm)[event](function(e) {
138	+ var $selected;
139	+ keyDown = true;
140	+ var top = $tpDiv[0].scrollTop;
141	+ switch (e.keyCode) {
142	+ case 38: // Up arrow.
143	+ // Just show picker if it's hidden.
144	+ if (showPicker()) {
145	+ return false;
146	+ };
147	+ $selected = $("li.selected", $tpList);
148	+ var prev = $selected.prev().addClass("selected")[0];
149	+ if (prev) {
150	+ $selected.removeClass("selected");
151	+ // Scroll item into view.
152	+ if (prev.offsetTop < top) {
153	+ $tpDiv[0].scrollTop = top - prev.offsetHeight;
154	+ }
155	+ }
156	+ else {
157	+ // Loop to next item.
158	+ $selected.removeClass("selected");
159	+ prev = $("li:last", $tpList).addClass("selected")[0];
160	+ $tpDiv[0].scrollTop = prev.offsetTop - prev.offsetHeight;
161	+ }
162	+ return false;
163	+ break;
164	+ case 40: // Down arrow, similar in behaviour to up arrow.
165	+ if (showPicker()) {
166	+ return false;
167	+ };
168	+ $selected = $("li.selected", $tpList);
169	+ var next = $selected.next().addClass("selected")[0];
170	+ if (next) {
171	+ $selected.removeClass("selected");
172	+ if (next.offsetTop + next.offsetHeight > top + $tpDiv[0].offsetHeight) {
173	+ $tpDiv[0].scrollTop = top + next.offsetHeight;
174	+ }
175	+ }
176	+ else {
177	+ $selected.removeClass("selected");
178	+ next = $("li:first", $tpList).addClass("selected")[0];
179	+ $tpDiv[0].scrollTop = 0;
180	+ }
181	+ return false;
182	+ break;
183	+ case 13: // Enter
184	+ if ($tpDiv.is(":visible")) {
185	+ var sel = $("li.selected", $tpList)[0];
186	+ setTimeVal(elm, sel, $tpDiv, settings);
187	+ }
188	+ return false;
189	+ break;
190	+ case 27: // Esc
191	+ $tpDiv.hide();
192	+ return false;
193	+ break;
194	+ }
195	+ return true;
196	+ });
197	+ $(elm).keyup(function(e) {
198	+ keyDown = false;
199	+ });
200	+ // Helper function to get an inputs current time as Date object.
201	+ // Returns a Date object.
202	+ this.getTime = function() {
203	+ return timeStringToDate(elm.value, settings);
204	+ };
205	+ // Helper function to set a time input.
206	+ // Takes a Date object.
207	+ this.setTime = function(time) {
208	+ elm.value = formatTime(normaliseTime(time), settings);
209	+ // Trigger element's change events.
210	+ $(elm).change();
211	+ };
212	+
213	+ }; // End fn;
214	+
215	+ // Plugin defaults.
216	+ $.fn.timePicker.defaults = {
217	+ step:30,
218	+ startTime: new Date(0, 0, 0, 0, 0, 0),
219	+ endTime: new Date(0, 0, 0, 23, 30, 0),
220	+ separator: ':',
221	+ show24Hours: true,
222	+ timeFormat: 'hh:mm tt',
223	+ amDesignator: 'AM',
224	+ pmDesignator: 'PM'
225	+ };
226	+
227	+ // Private functions.
228	+
229	+ function setTimeVal(elm, sel, $tpDiv, settings) {
230	+ // Update input field
231	+ elm.value = $(sel).text();
232	+ // Trigger element's change events.
233	+ $(elm).change();
234	+ // Keep focus for all but IE (which doesn't like it)
235	+ if (!$.browser_backward_hack.msie) {
236	+ elm.focus();
237	+ }
238	+ // Hide picker
239	+ $tpDiv.hide();
240	+ }
241	+
242	+ function formatTime(time, settings) {
243	+ var h = time.getHours();
244	+ var hours = settings.show24Hours ? h : (((h + 11) % 12) + 1);
245	+ hours = formatHour(hours, settings);
246	+ var minutes = time.getMinutes();
247	+
248	+ // Now that we have the current time we take the time format
249	+ // and replace the time values into that string.
250	+ var time = settings.timeFormat;
251	+ time = time.replace('hh', hours);
252	+ time = time.replace('h', hours);
253	+ time = time.replace('mm', formatNumber(minutes));
254	+ if (settings.show24Hours) {
255	+ time = time.replace(' tt', '');
256	+ } else {
257	+ time = time.replace('tt', (h < 12) ? settings.amDesignator : settings.pmDesignator);
258	+ }
259	+
260	+ return time;
261	+ }
262	+
263	+ function formatNumber(value) {
264	+ return (value < 10 ? '0' : '') + value;
265	+ }
266	+
267	+ function formatHour(value, settings) {
268	+ if (settings.show24Hours) {
269	+ return (value < 10 ? '0' : '') + value;
270	+ } else {
271	+ return value;
272	+ }
273	+ }
274	+
275	+ function timeToDate(input, settings) {
276	+ return (typeof input == 'object') ? normaliseTime(input) : timeStringToDate(input, settings);
277	+ }
278	+
279	+ function timeStringToDate(input, settings) {
280	+ if (input) {
281	+ var array = input.split(settings.separator);
282	+ var hours = parseFloat(array[0]);
283	+ var minutes = parseFloat(array[1]);
284	+
285	+ // Convert AM/PM hour to 24-hour format.
286	+ if (!settings.show24Hours) {
287	+ if (hours === 12 && input.substr(settings.amDesignator) !== -1) {
288	+ hours = 0;
289	+ }
290	+ else if (hours !== 12 && input.indexOf(settings.pmDesignator) !== -1) {
291	+ hours += 12;
292	+ }
293	+ }
294	+ var time = new Date(0, 0, 0, hours, minutes, 0);
295	+ return normaliseTime(time);
296	+ }
297	+ return null;
298	+ }
299	+
300	+ /* Normalise time object to a common date. */
301	+ function normaliseTime(time) {
302	+ time.setFullYear(2001);
303	+ time.setMonth(0);
304	+ time.setDate(0);
305	+ return time;
306	+ }
307	+
308	+ })(jQuery);
309	+

3.7.8/lib/jquery.tools.min.js ADDED Viewed

	@@ -0,0 +1,27 @@


1	+ /*
2	+ * jquery.tools 1.1.2 - The missing UI library for the Web
3	+ *
4	+ * [tools.scrollable-1.1.2, tools.scrollable.autoscroll-1.0.1, tools.scrollable.navigator-1.0.2, tools.scrollable.mousewheel-1.0.1]
5	+ *
6	+ * Copyright (c) 2009 Tero Piirainen
7	+ * http://flowplayer.org/tools/
8	+ *
9	+ * Dual licensed under MIT and GPL 2+ licenses
10	+ * http://www.opensource.org/licenses
11	+ *
12	+ * -----
13	+ *
14	+ * jquery.event.wheel.js - rev 1
15	+ * Copyright (c) 2008, Three Dub Media (http://threedubmedia.com)
16	+ * Liscensed under the MIT License (MIT-LICENSE.txt)
17	+ * http://www.opensource.org/licenses/mit-license.php
18	+ * Created: 2008-07-01 \| Updated: 2008-07-14
19	+ *
20	+ * -----
21	+ *
22	+ * File generated: Wed Oct 07 19:54:35 GMT+00:00 2009
23	+ */
24	+ (function(b){b.tools=b.tools\|\|{};b.tools.scrollable={version:"1.1.2",conf:{size:5,vertical:false,speed:400,keyboard:true,keyboardSteps:null,disabledClass:"disabled",hoverClass:null,clickable:true,activeClass:"active",easing:"swing",loop:false,items:".items",item:null,prev:".prev",next:".next",prevPage:".prevPage",nextPage:".nextPage",api:false}};var c;function a(o,m){var r=this,p=b(this),d=!m.vertical,e=o.children(),k=0,i;if(!c){c=r}b.each(m,function(s,t){if(b.isFunction(t)){p.bind(s,t)}});if(e.length>1){e=b(m.items,o)}function l(t){var s=b(t);return m.globalNav?s:o.parent().find(t)}o.data("finder",l);var f=l(m.prev),h=l(m.next),g=l(m.prevPage),n=l(m.nextPage);b.extend(r,{getIndex:function(){return k},getClickIndex:function(){var s=r.getItems();return s.index(s.filter("."+m.activeClass))},getConf:function(){return m},getSize:function(){return r.getItems().size()},getPageAmount:function(){return Math.ceil(this.getSize()/m.size)},getPageIndex:function(){return Math.ceil(k/m.size)},getNaviButtons:function(){return f.add(h).add(g).add(n)},getRoot:function(){return o},getItemWrap:function(){return e},getItems:function(){return e.children(m.item)},getVisibleItems:function(){return r.getItems().slice(k,k+m.size)},seekTo:function(s,w,t){if(s<0){s=0}if(k===s){return r}if(b.isFunction(w)){t=w}if(s>r.getSize()-m.size){return m.loop?r.begin():this.end()}var u=r.getItems().eq(s);if(!u.length){return r}var v=b.Event("onBeforeSeek");p.trigger(v,[s]);if(v.isDefaultPrevented()){return r}if(w===undefined\|\|b.isFunction(w)){w=m.speed}function x(){if(t){t.call(r,s)}p.trigger("onSeek",[s])}if(d){e.animate({left:-u.position().left},w,m.easing,x)}else{e.animate({top:-u.position().top},w,m.easing,x)}c=r;k=s;v=b.Event("onStart");p.trigger(v,[s]);if(v.isDefaultPrevented()){return r}f.add(g).toggleClass(m.disabledClass,s===0);h.add(n).toggleClass(m.disabledClass,s>=r.getSize()-m.size);return r},move:function(u,t,s){i=u>0;return this.seekTo(k+u,t,s)},next:function(t,s){return this.move(1,t,s)},prev:function(t,s){return this.move(-1,t,s)},movePage:function(w,v,u){i=w>0;var s=m.sizew;var t=k%m.size;if(t>0){s+=(w>0?-t:m.size-t)}return this.move(s,v,u)},prevPage:function(t,s){return this.movePage(-1,t,s)},nextPage:function(t,s){return this.movePage(1,t,s)},setPage:function(t,u,s){return this.seekTo(tm.size,u,s)},begin:function(t,s){i=false;return this.seekTo(0,t,s)},end:function(t,s){i=true;var u=this.getSize()-m.size;return u>0?this.seekTo(u,t,s):r},reload:function(){p.trigger("onReload");return r},focus:function(){c=r;return r},click:function(u){var v=r.getItems().eq(u),s=m.activeClass,t=m.size;if(u<0\|\|u>=r.getSize()){return r}if(t==1){if(m.loop){return r.next()}if(u===0\|\|u==r.getSize()-1){i=(i===undefined)?true:!i}return i===false?r.prev():r.next()}if(t==2){if(u==k){u--}r.getItems().removeClass(s);v.addClass(s);return r.seekTo(u,time,fn)}if(!v.hasClass(s)){r.getItems().removeClass(s);v.addClass(s);var x=Math.floor(t/2);var w=u-x;if(w>r.getSize()-t){w=r.getSize()-t}if(w!==u){return r.seekTo(w)}}return r},bind:function(s,t){p.bind(s,t);return r},unbind:function(s){p.unbind(s);return r}});b.each("onBeforeSeek,onStart,onSeek,onReload".split(","),function(s,t){r[t]=function(u){return r.bind(t,u)}});f.addClass(m.disabledClass).click(function(){r.prev()});h.click(function(){r.next()});n.click(function(){r.nextPage()});if(r.getSize()<m.size){h.add(n).addClass(m.disabledClass)}g.addClass(m.disabledClass).click(function(){r.prevPage()});var j=m.hoverClass,q="keydown."+Math.random().toString().substring(10);r.onReload(function(){if(j){r.getItems().hover(function(){b(this).addClass(j)},function(){b(this).removeClass(j)})}if(m.clickable){r.getItems().each(function(s){b(this).unbind("click.scrollable").bind("click.scrollable",function(t){if(b(t.target).is("a")){return}return r.click(s)})})}if(m.keyboard){b(document).unbind(q).bind(q,function(t){if(t.altKey\|\|t.ctrlKey){return}if(m.keyboard!="static"&&c!=r){return}var u=m.keyboardSteps;if(d&&(t.keyCode==37\|\|t.keyCode==39)){r.move(t.keyCode==37?-u:u);return t.preventDefault()}if(!d&&(t.keyCode==38\|\|t.keyCode==40)){r.move(t.keyCode==38?-u:u);return t.preventDefault()}return true})}else{b(document).unbind(q)}});r.reload()}b.fn.scrollable=function(d){var e=this.eq(typeof d=="number"?d:0).data("scrollable");if(e){return e}var f=b.extend({},b.tools.scrollable.conf);d=b.extend(f,d);d.keyboardSteps=d.keyboardSteps\|\|d.size;this.each(function(){e=new a(b(this),d);b(this).data("scrollable",e)});return d.api?e:this}})(jQuery);
25	+ (function(b){var a=b.tools.scrollable;a.plugins=a.plugins\|\|{};a.plugins.autoscroll={version:"1.0.1",conf:{autoplay:true,interval:3000,autopause:true,steps:1,api:false}};b.fn.autoscroll=function(d){if(typeof d=="number"){d={interval:d}}var e=b.extend({},a.plugins.autoscroll.conf),c;b.extend(e,d);this.each(function(){var g=b(this).scrollable();if(g){c=g}var i,f,h=true;g.play=function(){if(i){return}h=false;i=setInterval(function(){g.move(e.steps)},e.interval);g.move(e.steps)};g.pause=function(){i=clearInterval(i)};g.stop=function(){g.pause();h=true};if(e.autopause){g.getRoot().add(g.getNaviButtons()).hover(function(){g.pause();clearInterval(f)},function(){if(!h){f=setTimeout(g.play,e.interval)}})}if(e.autoplay){setTimeout(g.play,e.interval)}});return e.api?c:this}})(jQuery);
26	+ (function(b){var a=b.tools.scrollable;a.plugins=a.plugins\|\|{};a.plugins.navigator={version:"1.0.2",conf:{navi:".navi",naviItem:null,activeClass:"active",indexed:false,api:false,idPrefix:null}};b.fn.navigator=function(d){var e=b.extend({},a.plugins.navigator.conf),c;if(typeof d=="string"){d={navi:d}}d=b.extend(e,d);this.each(function(){var i=b(this).scrollable(),f=i.getRoot(),l=f.data("finder").call(null,d.navi),g=null,k=i.getNaviButtons();if(i){c=i}i.getNaviButtons=function(){return k.add(l)};function j(){if(!l.children().length\|\|l.data("navi")==i){l.empty();l.data("navi",i);for(var m=0;m<i.getPageAmount();m++){l.append(b("<"+(d.naviItem\|\|"a")+"/>"))}g=l.children().each(function(n){var o=b(this);o.click(function(p){i.setPage(n);return p.preventDefault()});if(d.indexed){o.text(n)}if(d.idPrefix){o.attr("id",d.idPrefix+n)}})}else{g=d.naviItem?l.find(d.naviItem):l.children();g.each(function(n){var o=b(this);o.click(function(p){i.setPage(n);return p.preventDefault()})})}g.eq(0).addClass(d.activeClass)}i.onStart(function(o,n){var m=d.activeClass;g.removeClass(m).eq(i.getPageIndex()).addClass(m)});i.onReload(function(){j()});j();var h=g.filter("[href="+location.hash+"]");if(h.length){i.move(g.index(h))}});return d.api?c:this}})(jQuery);
27	+ (function(b){b.fn.wheel=function(e){return this[e?"bind":"trigger"]("wheel",e)};b.event.special.wheel={setup:function(){b.event.add(this,d,c,{})},teardown:function(){b.event.remove(this,d,c)}};var d=!b.browser_backward_hack.mozilla?"mousewheel":"DOMMouseScroll"+(b.browser_backward_hack.version<"1.9"?" mousemove":"");function c(e){switch(e.type){case"mousemove":return b.extend(e.data,{clientX:e.clientX,clientY:e.clientY,pageX:e.pageX,pageY:e.pageY});case"DOMMouseScroll":b.extend(e,e.data);e.delta=-e.detail/3;break;case"mousewheel":e.delta=e.wheelDelta/120;break}e.type="wheel";return b.event.handle.call(this,e,e.delta)}var a=b.tools.scrollable;a.plugins=a.plugins\|\|{};a.plugins.mousewheel={version:"1.0.1",conf:{api:false,speed:50}};b.fn.mousewheel=function(f){var g=b.extend({},a.plugins.mousewheel.conf),e;if(typeof f=="number"){f={speed:f}}f=b.extend(g,f);this.each(function(){var h=b(this).scrollable();if(h){e=h}h.getRoot().wheel(function(i,j){h.move(j<0?1:-1,f.speed\|\|50);return false})});return f.api?e:this}})(jQuery);

3.7.8/lib/json2.js ADDED Viewed

	@@ -0,0 +1,480 @@


1	+ /*
2	+ http://www.JSON.org/json2.js
3	+ 2009-09-29
4	+
5	+ Public Domain.
6	+
7	+ NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
8	+
9	+ See http://www.JSON.org/js.html
10	+
11	+ This file creates a global JSON object containing two methods: stringify
12	+ and parse.
13	+
14	+ JSON.stringify(value, replacer, space)
15	+ value any JavaScript value, usually an object or array.
16	+
17	+ replacer an optional parameter that determines how object
18	+ values are stringified for objects. It can be a
19	+ function or an array of strings.
20	+
21	+ space an optional parameter that specifies the indentation
22	+ of nested structures. If it is omitted, the text will
23	+ be packed without extra whitespace. If it is a number,
24	+ it will specify the number of spaces to indent at each
25	+ level. If it is a string (such as '\t' or ' '),
26	+ it contains the characters used to indent at each level.
27	+
28	+ This method produces a JSON text from a JavaScript value.
29	+
30	+ When an object value is found, if the object contains a toJSON
31	+ method, its toJSON method will be called and the result will be
32	+ stringified. A toJSON method does not serialize: it returns the
33	+ value represented by the name/value pair that should be serialized,
34	+ or undefined if nothing should be serialized. The toJSON method
35	+ will be passed the key associated with the value, and this will be
36	+ bound to the value
37	+
38	+ For example, this would serialize Dates as ISO strings.
39	+
40	+ Date.prototype.toJSON = function (key) {
41	+ function f(n) {
42	+ // Format integers to have at least two digits.
43	+ return n < 10 ? '0' + n : n;
44	+ }
45	+
46	+ return this.getUTCFullYear() + '-' +
47	+ f(this.getUTCMonth() + 1) + '-' +
48	+ f(this.getUTCDate()) + 'T' +
49	+ f(this.getUTCHours()) + ':' +
50	+ f(this.getUTCMinutes()) + ':' +
51	+ f(this.getUTCSeconds()) + 'Z';
52	+ };
53	+
54	+ You can provide an optional replacer method. It will be passed the
55	+ key and value of each member, with this bound to the containing
56	+ object. The value that is returned from your method will be
57	+ serialized. If your method returns undefined, then the member will
58	+ be excluded from the serialization.
59	+
60	+ If the replacer parameter is an array of strings, then it will be
61	+ used to select the members to be serialized. It filters the results
62	+ such that only members with keys listed in the replacer array are
63	+ stringified.
64	+
65	+ Values that do not have JSON representations, such as undefined or
66	+ functions, will not be serialized. Such values in objects will be
67	+ dropped; in arrays they will be replaced with null. You can use
68	+ a replacer function to replace those with JSON values.
69	+ JSON.stringify(undefined) returns undefined.
70	+
71	+ The optional space parameter produces a stringification of the
72	+ value that is filled with line breaks and indentation to make it
73	+ easier to read.
74	+
75	+ If the space parameter is a non-empty string, then that string will
76	+ be used for indentation. If the space parameter is a number, then
77	+ the indentation will be that many spaces.
78	+
79	+ Example:
80	+
81	+ text = JSON.stringify(['e', {pluribus: 'unum'}]);
82	+ // text is '["e",{"pluribus":"unum"}]'
83	+
84	+
85	+ text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t');
86	+ // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]'
87	+
88	+ text = JSON.stringify([new Date()], function (key, value) {
89	+ return this[key] instanceof Date ?
90	+ 'Date(' + this[key] + ')' : value;
91	+ });
92	+ // text is '["Date(---current time---)"]'
93	+
94	+
95	+ JSON.parse(text, reviver)
96	+ This method parses a JSON text to produce an object or array.
97	+ It can throw a SyntaxError exception.
98	+
99	+ The optional reviver parameter is a function that can filter and
100	+ transform the results. It receives each of the keys and values,
101	+ and its return value is used instead of the original value.
102	+ If it returns what it received, then the structure is not modified.
103	+ If it returns undefined then the member is deleted.
104	+
105	+ Example:
106	+
107	+ // Parse the text. Values that look like ISO date strings will
108	+ // be converted to Date objects.
109	+
110	+ myData = JSON.parse(text, function (key, value) {
111	+ var a;
112	+ if (typeof value === 'string') {
113	+ a =
114	+ /^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
115	+ if (a) {
116	+ return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
117	+ +a[5], +a[6]));
118	+ }
119	+ }
120	+ return value;
121	+ });
122	+
123	+ myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) {
124	+ var d;
125	+ if (typeof value === 'string' &&
126	+ value.slice(0, 5) === 'Date(' &&
127	+ value.slice(-1) === ')') {
128	+ d = new Date(value.slice(5, -1));
129	+ if (d) {
130	+ return d;
131	+ }
132	+ }
133	+ return value;
134	+ });
135	+
136	+
137	+ This is a reference implementation. You are free to copy, modify, or
138	+ redistribute.
139	+
140	+ This code should be minified before deployment.
141	+ See http://javascript.crockford.com/jsmin.html
142	+
143	+ USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
144	+ NOT CONTROL.
145	+ */
146	+
147	+ /jslint evil: true, strict: false /
148	+
149	+ /*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply,
150	+ call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours,
151	+ getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join,
152	+ lastIndex, length, parse, prototype, push, replace, slice, stringify,
153	+ test, toJSON, toString, valueOf
154	+ */
155	+
156	+
157	+ // Create a JSON object only if one does not already exist. We create the
158	+ // methods in a closure to avoid creating global variables.
159	+
160	+ if (!this.JSON) {
161	+ this.JSON = {};
162	+ }
163	+
164	+ (function () {
165	+
166	+ function f(n) {
167	+ // Format integers to have at least two digits.
168	+ return n < 10 ? '0' + n : n;
169	+ }
170	+
171	+ if (typeof Date.prototype.toJSON !== 'function') {
172	+
173	+ Date.prototype.toJSON = function (key) {
174	+
175	+ return isFinite(this.valueOf()) ?
176	+ this.getUTCFullYear() + '-' +
177	+ f(this.getUTCMonth() + 1) + '-' +
178	+ f(this.getUTCDate()) + 'T' +
179	+ f(this.getUTCHours()) + ':' +
180	+ f(this.getUTCMinutes()) + ':' +
181	+ f(this.getUTCSeconds()) + 'Z' : null;
182	+ };
183	+
184	+ String.prototype.toJSON =
185	+ Number.prototype.toJSON =
186	+ Boolean.prototype.toJSON = function (key) {
187	+ return this.valueOf();
188	+ };
189	+ }
190	+
191	+ var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
192	+ escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
193	+ gap,
194	+ indent,
195	+ meta = { // table of character substitutions
196	+ '\b': '\\b',
197	+ '\t': '\\t',
198	+ '\n': '\\n',
199	+ '\f': '\\f',
200	+ '\r': '\\r',
201	+ '"' : '\\"',
202	+ '\\': '\\\\'
203	+ },
204	+ rep;
205	+
206	+
207	+ function quote(string) {
208	+
209	+ // If the string contains no control characters, no quote characters, and no
210	+ // backslash characters, then we can safely slap some quotes around it.
211	+ // Otherwise we must also replace the offending characters with safe escape
212	+ // sequences.
213	+
214	+ escapable.lastIndex = 0;
215	+ return escapable.test(string) ?
216	+ '"' + string.replace(escapable, function (a) {
217	+ var c = meta[a];
218	+ return typeof c === 'string' ? c :
219	+ '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
220	+ }) + '"' :
221	+ '"' + string + '"';
222	+ }
223	+
224	+
225	+ function str(key, holder) {
226	+
227	+ // Produce a string from holder[key].
228	+
229	+ var i, // The loop counter.
230	+ k, // The member key.
231	+ v, // The member value.
232	+ length,
233	+ mind = gap,
234	+ partial,
235	+ value = holder[key];
236	+
237	+ // If the value has a toJSON method, call it to obtain a replacement value.
238	+
239	+ if (value && typeof value === 'object' &&
240	+ typeof value.toJSON === 'function') {
241	+ value = value.toJSON(key);
242	+ }
243	+
244	+ // If we were called with a replacer function, then call the replacer to
245	+ // obtain a replacement value.
246	+
247	+ if (typeof rep === 'function') {
248	+ value = rep.call(holder, key, value);
249	+ }
250	+
251	+ // What happens next depends on the value's type.
252	+
253	+ switch (typeof value) {
254	+ case 'string':
255	+ return quote(value);
256	+
257	+ case 'number':
258	+
259	+ // JSON numbers must be finite. Encode non-finite numbers as null.
260	+
261	+ return isFinite(value) ? String(value) : 'null';
262	+
263	+ case 'boolean':
264	+ case 'null':
265	+
266	+ // If the value is a boolean or null, convert it to a string. Note:
267	+ // typeof null does not produce 'null'. The case is included here in
268	+ // the remote chance that this gets fixed someday.
269	+
270	+ return String(value);
271	+
272	+ // If the type is 'object', we might be dealing with an object or an array or
273	+ // null.
274	+
275	+ case 'object':
276	+
277	+ // Due to a specification blunder in ECMAScript, typeof null is 'object',
278	+ // so watch out for that case.
279	+
280	+ if (!value) {
281	+ return 'null';
282	+ }
283	+
284	+ // Make an array to hold the partial results of stringifying this object value.
285	+
286	+ gap += indent;
287	+ partial = [];
288	+
289	+ // Is the value an array?
290	+
291	+ if (Object.prototype.toString.apply(value) === '[object Array]') {
292	+
293	+ // The value is an array. Stringify every element. Use null as a placeholder
294	+ // for non-JSON values.
295	+
296	+ length = value.length;
297	+ for (i = 0; i < length; i += 1) {
298	+ partial[i] = str(i, value) \|\| 'null';
299	+ }
300	+
301	+ // Join all of the elements together, separated with commas, and wrap them in
302	+ // brackets.
303	+
304	+ v = partial.length === 0 ? '[]' :
305	+ gap ? '[\n' + gap +
306	+ partial.join(',\n' + gap) + '\n' +
307	+ mind + ']' :
308	+ '[' + partial.join(',') + ']';
309	+ gap = mind;
310	+ return v;
311	+ }
312	+
313	+ // If the replacer is an array, use it to select the members to be stringified.
314	+
315	+ if (rep && typeof rep === 'object') {
316	+ length = rep.length;
317	+ for (i = 0; i < length; i += 1) {
318	+ k = rep[i];
319	+ if (typeof k === 'string') {
320	+ v = str(k, value);
321	+ if (v) {
322	+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
323	+ }
324	+ }
325	+ }
326	+ } else {
327	+
328	+ // Otherwise, iterate through all of the keys in the object.
329	+
330	+ for (k in value) {
331	+ if (Object.hasOwnProperty.call(value, k)) {
332	+ v = str(k, value);
333	+ if (v) {
334	+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
335	+ }
336	+ }
337	+ }
338	+ }
339	+
340	+ // Join all of the member texts together, separated with commas,
341	+ // and wrap them in braces.
342	+
343	+ v = partial.length === 0 ? '{}' :
344	+ gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' +
345	+ mind + '}' : '{' + partial.join(',') + '}';
346	+ gap = mind;
347	+ return v;
348	+ }
349	+ }
350	+
351	+ // If the JSON object does not yet have a stringify method, give it one.
352	+
353	+ if (typeof JSON.stringify !== 'function') {
354	+ JSON.stringify = function (value, replacer, space) {
355	+
356	+ // The stringify method takes a value and an optional replacer, and an optional
357	+ // space parameter, and returns a JSON text. The replacer can be a function
358	+ // that can replace values, or an array of strings that will select the keys.
359	+ // A default replacer method can be provided. Use of the space parameter can
360	+ // produce text that is more easily readable.
361	+
362	+ var i;
363	+ gap = '';
364	+ indent = '';
365	+
366	+ // If the space parameter is a number, make an indent string containing that
367	+ // many spaces.
368	+
369	+ if (typeof space === 'number') {
370	+ for (i = 0; i < space; i += 1) {
371	+ indent += ' ';
372	+ }
373	+
374	+ // If the space parameter is a string, it will be used as the indent string.
375	+
376	+ } else if (typeof space === 'string') {
377	+ indent = space;
378	+ }
379	+
380	+ // If there is a replacer, it must be a function or an array.
381	+ // Otherwise, throw an error.
382	+
383	+ rep = replacer;
384	+ if (replacer && typeof replacer !== 'function' &&
385	+ (typeof replacer !== 'object' \|\|
386	+ typeof replacer.length !== 'number')) {
387	+ throw new Error('JSON.stringify');
388	+ }
389	+
390	+ // Make a fake root object containing our value under the key of ''.
391	+ // Return the result of stringifying the value.
392	+
393	+ return str('', {'': value});
394	+ };
395	+ }
396	+
397	+
398	+ // If the JSON object does not yet have a parse method, give it one.
399	+
400	+ if (typeof JSON.parseIt !== 'function') {
401	+ JSON.parseIt = function (text, reviver) {
402	+
403	+ // The parse method takes a text and an optional reviver function, and returns
404	+ // a JavaScript value if the text is a valid JSON text.
405	+
406	+ var j;
407	+
408	+ function walk(holder, key) {
409	+
410	+ // The walk method is used to recursively walk the resulting structure so
411	+ // that modifications can be made.
412	+
413	+ var k, v, value = holder[key];
414	+ if (value && typeof value === 'object') {
415	+ for (k in value) {
416	+ if (Object.hasOwnProperty.call(value, k)) {
417	+ v = walk(value, k);
418	+ if (v !== undefined) {
419	+ value[k] = v;
420	+ } else {
421	+ delete value[k];
422	+ }
423	+ }
424	+ }
425	+ }
426	+ return reviver.call(holder, key, value);
427	+ }
428	+
429	+
430	+ // Parsing happens in four stages. In the first stage, we replace certain
431	+ // Unicode characters with escape sequences. JavaScript handles many characters
432	+ // incorrectly, either silently deleting them, or treating them as line endings.
433	+
434	+ cx.lastIndex = 0;
435	+ if (cx.test(text)) {
436	+ text = text.replace(cx, function (a) {
437	+ return '\\u' +
438	+ ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
439	+ });
440	+ }
441	+
442	+ // In the second stage, we run the text against regular expressions that look
443	+ // for non-JSON patterns. We are especially concerned with '()' and 'new'
444	+ // because they can cause invocation, and '=' because it can cause mutation.
445	+ // But just to be safe, we want to reject all unexpected forms.
446	+
447	+ // We split the second stage into 4 regexp operations in order to work around
448	+ // crippling inefficiencies in IE's and Safari's regexp engines. First we
449	+ // replace the JSON backslash pairs with '@' (a non-JSON character). Second, we
450	+ // replace all simple value tokens with ']' characters. Third, we delete all
451	+ // open brackets that follow a colon or comma or that begin the text. Finally,
452	+ // we look to see that the remaining characters are only whitespace or ']' or
453	+ // ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval.
454	+
455	+ if (/^[\],:{}\s]*$/.
456	+ test(text.replace(/\\(?:["\\\/bfnrt]\|u[0-9a-fA-F]{4})/g, '@').
457	+ replace(/"[^"\\\n\r]"\|true\|false\|null\|-?\d+(?:\.\d)?(?:[eE][+\-]?\d+)?/g, ']').
458	+ replace(/(?:^\|:\|,)(?:\s*\[)+/g, ''))) {
459	+
460	+ // In the third stage we use the eval function to compile the text into a
461	+ // JavaScript structure. The '{' operator is subject to a syntactic ambiguity
462	+ // in JavaScript: it can begin a block or an object literal. We wrap the text
463	+ // in parens to eliminate the ambiguity.
464	+
465	+ j = eval('(' + text + ')');
466	+
467	+ // In the optional fourth stage, we recursively walk the new structure, passing
468	+ // each name/value pair to a reviver function for possible transformation.
469	+
470	+ return typeof reviver === 'function' ?
471	+ walk({'': j}, '') : j;
472	+ }
473	+
474	+ // If the text is not JSON parseable, then a SyntaxError is thrown.
475	+
476	+ throw new SyntaxError('JSON.parseIt');
477	+ };
478	+ }
479	+ }());
480	+

3.7.8/lib/languages/date-cs-CZ.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"cs-CZ",englishName:"Czech (Czech Republic)",nativeName:"čeština (Česká republika)",dayNames:["neděle","pondělí","úterý","středa","čtvrtek","pátek","sobota"],abbreviatedDayNames:["ne","po","út","st","čt","pá","so"],shortestDayNames:["ne","po","út","st","čt","pá","so"],firstLetterDayNames:["n","p","ú","s","č","p","s"],monthNames:["leden","únor","březen","duben","květen","červen","červenec","srpen","září","říjen","listopad","prosinec"],abbreviatedMonthNames:["I","II","III","IV","V","VI","VII","VIII","IX","X","XI","XII"],amDesignator:"dop.",pmDesignator:"odp.",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"d.M.yyyy",longDate:"d. MMMM yyyy",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"d. MMMM yyyy H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^leden/i,feb:/^únor/i,mar:/^březen/i,apr:/^duben/i,may:/^květen/i,jun:/^červen/i,jul:/^červenec/i,aug:/^srpen/i,sep:/^září/i,oct:/^říjen/i,nov:/^listopad/i,dec:/^prosinec/i,sun:/^neděle/i,mon:/^pondělí/i,tue:/^úterý/i,wed:/^středa/i,thu:/^čtvrtek/i,fri:/^pátek/i,sat:/^sobota/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-da-DK.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"da-DK",englishName:"Danish (Denmark)",nativeName:"dansk (Danmark)",dayNames:["søndag","mandag","tirsdag","onsdag","torsdag","fredag","lørdag"],abbreviatedDayNames:["sø","ma","ti","on","to","fr","lø"],shortestDayNames:["sø","ma","ti","on","to","fr","lø"],firstLetterDayNames:["s","m","t","o","t","f","l"],monthNames:["januar","februar","marts","april","maj","juni","juli","august","september","oktober","november","december"],abbreviatedMonthNames:["jan","feb","mar","apr","maj","jun","jul","aug","sep","okt","nov","dec"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd-MM-yyyy",longDate:"d. MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"d. MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d. MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^jan(uar)?/i,feb:/^feb(ruar)?/i,mar:/^mar(ts)?/i,apr:/^apr(il)?/i,may:/^maj/i,jun:/^jun(i)?/i,jul:/^jul(i)?/i,aug:/^aug(ust)?/i,sep:/^sep(t(ember)?)?/i,oct:/^okt(ober)?/i,nov:/^nov(ember)?/i,dec:/^dec(ember)?/i,sun:/^søndag/i,mon:/^mandag/i,tue:/^tirsdag/i,wed:/^onsdag/i,thu:/^torsdag/i,fri:/^fredag/i,sat:/^lørdag/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-de-DE.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"de-DE",englishName:"German (Germany)",nativeName:"Deutsch (Deutschland)",dayNames:["Sonntag","Montag","Dienstag","Mittwoch","Donnerstag","Freitag","Samstag"],abbreviatedDayNames:["So","Mo","Di","Mi","Do","Fr","Sa"],shortestDayNames:["So","Mo","Di","Mi","Do","Fr","Sa"],firstLetterDayNames:["S","M","D","M","D","F","S"],monthNames:["Januar","Februar","März","April","Mai","Juni","Juli","August","September","Oktober","November","Dezember"],abbreviatedMonthNames:["Jan","Feb","Mrz","Apr","Mai","Jun","Jul","Aug","Sep","Okt","Nov","Dez"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd.MM.yyyy",longDate:"dddd, d. MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"dddd, d. MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^jan(uar)?/i,feb:/^feb(ruar)?/i,mar:/^märz/i,apr:/^apr(il)?/i,may:/^mai/i,jun:/^jun(i)?/i,jul:/^jul(i)?/i,aug:/^aug(ust)?/i,sep:/^sep(t(ember)?)?/i,oct:/^okt(ober)?/i,nov:/^nov(ember)?/i,dec:/^dez(ember)?/i,sun:/^sonntag/i,mon:/^montag/i,tue:/^dienstag/i,wed:/^mittwoch/i,thu:/^donnerstag/i,fri:/^freitag/i,sat:/^samstag/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-el-GR.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"el-GR",englishName:"Greek (Greece)",nativeName:"ελληνικά (Ελλάδα)",dayNames:["Κυριακή","Δευτέρα","Τρίτη","Τετάρτη","Πέμπτη","Παρασκευή","Σάββατο"],abbreviatedDayNames:["Κυρ","Δευ","Τρι","Τετ","Πεμ","Παρ","Σαβ"],shortestDayNames:["Κυ","Δε","Τρ","Τε","Πε","Πα","Σά"],firstLetterDayNames:["Κ","Δ","Τ","Τ","Π","Π","Σ"],monthNames:["Ιανουάριος","Φεβρουάριος","Μάρτιος","Απρίλιος","Μάιος","Ιούνιος","Ιούλιος","Αύγουστος","Σεπτέμβριος","Οκτώβριος","Νοέμβριος","Δεκέμβριος"],abbreviatedMonthNames:["Ιαν","Φεβ","Μαρ","Απρ","Μαϊ","Ιουν","Ιουλ","Αυγ","Σεπ","Οκτ","Νοε","Δεκ"],amDesignator:"πμ",pmDesignator:"μμ",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"d/M/yyyy",longDate:"dddd, d MMMM yyyy",shortTime:"h:mm tt",longTime:"h:mm:ss tt",fullDateTime:"dddd, d MMMM yyyy h:mm:ss tt",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^ιαν(ουάριος)?/i,feb:/^φεβ(ρουάριος)?/i,mar:/^μάρτιος/i,apr:/^απρ(ίλιος)?/i,may:/^μάιος/i,jun:/^ιούνιος/i,jul:/^ιούλιος/i,aug:/^αύγουστος/i,sep:/^σεπ(τέμβριος)?/i,oct:/^οκτ(ώβριος)?/i,nov:/^νοέμβριος/i,dec:/^δεκ(έμβριος)?/i,sun:/^κυ(ρ(ιακή)?)?/i,mon:/^δε(υ(τέρα)?)?/i,tue:/^τρ(ι(τη)?)?/i,wed:/^τε(τ(άρτη)?)?/i,thu:/^πε(μ(πτη)?)?/i,fri:/^πα(ρ(ασκευή)?)?/i,sat:/^σά(β(βατο)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-en-US.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"en-US",englishName:"English (United States)",nativeName:"English (United States)",dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],abbreviatedDayNames:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],shortestDayNames:["Su","Mo","Tu","We","Th","Fr","Sa"],firstLetterDayNames:["S","M","T","W","T","F","S"],monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],abbreviatedMonthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],amDesignator:"AM",pmDesignator:"PM",firstDayOfWeek:0,twoDigitYearMax:2029,dateElementOrder:"mdy",formatPatterns:{shortDate:"M/d/yyyy",longDate:"dddd, MMMM dd, yyyy",shortTime:"h:mm tt",longTime:"h:mm:ss tt",fullDateTime:"dddd, MMMM dd, yyyy h:mm:ss tt",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"MMMM dd",yearMonth:"MMMM, yyyy"},regexPatterns:{jan:/^jan(uary)?/i,feb:/^feb(ruary)?/i,mar:/^mar(ch)?/i,apr:/^apr(il)?/i,may:/^may/i,jun:/^jun(e)?/i,jul:/^jul(y)?/i,aug:/^aug(ust)?/i,sep:/^sep(t(ember)?)?/i,oct:/^oct(ober)?/i,nov:/^nov(ember)?/i,dec:/^dec(ember)?/i,sun:/^su(n(day)?)?/i,mon:/^mo(n(day)?)?/i,tue:/^tu(e(s(day)?)?)?/i,wed:/^we(d(nesday)?)?/i,thu:/^th(u(r(s(day)?)?)?)?/i,fri:/^fr(i(day)?)?/i,sat:/^sa(t(urday)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-es-ES.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"es-ES",englishName:"Spanish (Spain)",nativeName:"español (España)",dayNames:["domingo","lunes","martes","miércoles","jueves","viernes","sábado"],abbreviatedDayNames:["dom","lun","mar","mié","jue","vie","sáb"],shortestDayNames:["do","lu","ma","mi","ju","vi","sá"],firstLetterDayNames:["d","l","m","m","j","v","s"],monthNames:["enero","febrero","marzo","abril","mayo","junio","julio","agosto","septiembre","octubre","noviembre","diciembre"],abbreviatedMonthNames:["ene","feb","mar","abr","may","jun","jul","ago","sep","oct","nov","dic"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd/MM/yyyy",longDate:"dddd, dd' de 'MMMM' de 'yyyy",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"dddd, dd' de 'MMMM' de 'yyyy H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM' de 'yyyy"},regexPatterns:{jan:/^ene(ro)?/i,feb:/^feb(rero)?/i,mar:/^mar(zo)?/i,apr:/^abr(il)?/i,may:/^may(o)?/i,jun:/^jun(io)?/i,jul:/^jul(io)?/i,aug:/^ago(sto)?/i,sep:/^sep(tiembre)?/i,oct:/^oct(ubre)?/i,nov:/^nov(iembre)?/i,dec:/^dic(iembre)?/i,sun:/^do(m(ingo)?)?/i,mon:/^lu(n(es)?)?/i,tue:/^ma(r(tes)?)?/i,wed:/^mi(é(rcoles)?)?/i,thu:/^ju(e(ves)?)?/i,fri:/^vi(e(rnes)?)?/i,sat:/^sá(b(ado)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-fr-FR.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"fr-FR",englishName:"French (France)",nativeName:"français (France)",dayNames:["dimanche","lundi","mardi","mercredi","jeudi","vendredi","samedi"],abbreviatedDayNames:["dim.","lun.","mar.","mer.","jeu.","ven.","sam."],shortestDayNames:["di","lu","ma","me","je","ve","sa"],firstLetterDayNames:["d","l","m","m","j","v","s"],monthNames:["janvier","février","mars","avril","mai","juin","juillet","août","septembre","octobre","novembre","décembre"],abbreviatedMonthNames:["janv.","févr.","mars","avr.","mai","juin","juil.","août","sept.","oct.","nov.","déc."],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd/MM/yyyy",longDate:"dddd d MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"dddd d MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^janv(.(ier)?)?/i,feb:/^févr(.(ier)?)?/i,mar:/^mars/i,apr:/^avr(.(il)?)?/i,may:/^mai/i,jun:/^juin/i,jul:/^juil(.(let)?)?/i,aug:/^août/i,sep:/^sept(.(embre)?)?/i,oct:/^oct(.(obre)?)?/i,nov:/^nov(.(embre)?)?/i,dec:/^déc(.(embre)?)?/i,sun:/^di(m(.(anche)?)?)?/i,mon:/^lu(n(.(di)?)?)?/i,tue:/^ma(r(.(di)?)?)?/i,wed:/^me(r(.(credi)?)?)?/i,thu:/^je(u(.(di)?)?)?/i,fri:/^ve(n(.(dredi)?)?)?/i,sat:/^sa(m(.(edi)?)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-he-IL.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"he-IL",englishName:"Hebrew (Israel)",nativeName:"עברית (ישראל)",dayNames:["יום ראשון","יום שני","יום שלישי","יום רביעי","יום חמישי","יום שישי","שבת"],abbreviatedDayNames:["יום א","יום ב","יום ג","יום ד","יום ה","יום ו","שבת"],shortestDayNames:["א","ב","ג","ד","ה","ו","ש"],firstLetterDayNames:["א","ב","ג","ד","ה","ו","ש"],monthNames:["ינואר","פברואר","מרץ","אפריל","מאי","יוני","יולי","אוגוסט","ספטמבר","אוקטובר","נובמבר","דצמבר"],abbreviatedMonthNames:["ינו","פבר","מרץ","אפר","מאי","יונ","יול","אוג","ספט","אוק","נוב","דצמ"],amDesignator:"AM",pmDesignator:"PM",firstDayOfWeek:0,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd/MM/yyyy",longDate:"dddd dd MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"dddd dd MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^ינו(אר)?/i,feb:/^פבר(ואר)?/i,mar:/^מרץ/i,apr:/^אפר(יל)?/i,may:/^מאי/i,jun:/^יונ(י)?/i,jul:/^יול(י)?/i,aug:/^אוג(וסט)?/i,sep:/^ספט(מבר)?/i,oct:/^אוק(טובר)?/i,nov:/^נוב(מבר)?/i,dec:/^דצמ(בר)?/i,sun:/^א(ום א(אשון)?)?/i,mon:/^ב(ום ב(ני)?)?/i,tue:/^ג(ום ג(לישי)?)?/i,wed:/^ד(ום ד(ביעי)?)?/i,thu:/^ה(ום ה(מישי)?)?/i,fri:/^ו(ום ו(ישי)?)?/i,sat:/^ש(1)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-hr-HR.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"hr-HR",englishName:"Croatian (Croatia)",nativeName:"hrvatski (Hrvatska)",dayNames:["nedjelja","ponedjeljak","utorak","srijeda","četvrtak","petak","subota"],abbreviatedDayNames:["ned","pon","uto","sri","čet","pet","sub"],shortestDayNames:["ne","po","ut","sr","če","pe","su"],firstLetterDayNames:["n","p","u","s","č","p","s"],monthNames:["siječanj","veljača","ožujak","travanj","svibanj","lipanj","srpanj","kolovoz","rujan","listopad","studeni","prosinac"],abbreviatedMonthNames:["sij","vlj","ožu","tra","svi","lip","srp","kol","ruj","lis","stu","pro"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"d.M.yyyy",longDate:"d. MMMM yyyy",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"d. MMMM yyyy H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d. MMMM",yearMonth:"MMMM, yyyy"},regexPatterns:{jan:/^sij(ečanj)?/i,feb:/^veljača/i,mar:/^ožu(jak)?/i,apr:/^tra(vanj)?/i,may:/^svi(banj)?/i,jun:/^lip(anj)?/i,jul:/^srp(anj)?/i,aug:/^kol(ovoz)?/i,sep:/^ruj(an)?/i,oct:/^lis(topad)?/i,nov:/^stu(deni)?/i,dec:/^pro(sinac)?/i,sun:/^ne(d(jelja)?)?/i,mon:/^po(n(edjeljak)?)?/i,tue:/^ut(o(rak)?)?/i,wed:/^sr(i(jeda)?)?/i,thu:/^če(t(vrtak)?)?/i,fri:/^pe(t(ak)?)?/i,sat:/^su(b(ota)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-it-IT.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"it-IT",englishName:"Italian (Italy)",nativeName:"italiano (Italia)",dayNames:["domenica","lunedì","martedì","mercoledì","giovedì","venerdì","sabato"],abbreviatedDayNames:["dom","lun","mar","mer","gio","ven","sab"],shortestDayNames:["do","lu","ma","me","gi","ve","sa"],firstLetterDayNames:["d","l","m","m","g","v","s"],monthNames:["gennaio","febbraio","marzo","aprile","maggio","giugno","luglio","agosto","settembre","ottobre","novembre","dicembre"],abbreviatedMonthNames:["gen","feb","mar","apr","mag","giu","lug","ago","set","ott","nov","dic"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd/MM/yyyy",longDate:"dddd d MMMM yyyy",shortTime:"H.mm",longTime:"H.mm.ss",fullDateTime:"dddd d MMMM yyyy H.mm.ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^gen(naio)?/i,feb:/^feb(braio)?/i,mar:/^mar(zo)?/i,apr:/^apr(ile)?/i,may:/^mag(gio)?/i,jun:/^giu(gno)?/i,jul:/^lug(lio)?/i,aug:/^ago(sto)?/i,sep:/^set(tembre)?/i,oct:/^ott(obre)?/i,nov:/^nov(embre)?/i,dec:/^dic(embre)?/i,sun:/^do(m(enica)?)?/i,mon:/^lu(n(edì)?)?/i,tue:/^ma(r(tedì)?)?/i,wed:/^me(r(coledì)?)?/i,thu:/^gi(o(vedì)?)?/i,fri:/^ve(n(erdì)?)?/i,sat:/^sa(b(ato)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-ja-JP.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"ja-JP",englishName:"Japanese (Japan)",nativeName:"日本語 (日本)",dayNames:["日曜日","月曜日","火曜日","水曜日","木曜日","金曜日","土曜日"],abbreviatedDayNames:["日","月","火","水","木","金","土"],shortestDayNames:["日","月","火","水","木","金","土"],firstLetterDayNames:["日","月","火","水","木","金","土"],monthNames:["1月","2月","3月","4月","5月","6月","7月","8月","9月","10月","11月","12月"],abbreviatedMonthNames:["1","2","3","4","5","6","7","8","9","10","11","12"],amDesignator:"午前",pmDesignator:"午後",firstDayOfWeek:0,twoDigitYearMax:2029,dateElementOrder:"ymd",formatPatterns:{shortDate:"yyyy/MM/dd",longDate:"yyyy'年'M'月'd'日'",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"yyyy'年'M'月'd'日' H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"M'月'd'日'",yearMonth:"yyyy'年'M'月'"},regexPatterns:{jan:/^1(月)?/i,feb:/^2(月)?/i,mar:/^3(月)?/i,apr:/^4(月)?/i,may:/^5(月)?/i,jun:/^6(月)?/i,jul:/^7(月)?/i,aug:/^8(月)?/i,sep:/^9(月)?/i,oct:/^10(月)?/i,nov:/^11(月)?/i,dec:/^12(月)?/i,sun:/^日曜日/i,mon:/^月曜日/i,tue:/^火曜日/i,wed:/^水曜日/i,thu:/^木曜日/i,fri:/^金曜日/i,sat:/^土曜日/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-lt-LT.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"lt-LT",englishName:"Lithuanian (Lithuania)",nativeName:"lietuvių (Lietuva)",dayNames:["sekmadienis","pirmadienis","antradienis","trečiadienis","ketvirtadienis","penktadienis","šeštadienis"],abbreviatedDayNames:["Sk","Pr","An","Tr","Kt","Pn","Št"],shortestDayNames:["S","P","A","T","K","Pn","Š"],firstLetterDayNames:["S","P","A","T","K","P","Š"],monthNames:["sausis","vasaris","kovas","balandis","gegužė","birželis","liepa","rugpjūtis","rugsėjis","spalis","lapkritis","gruodis"],abbreviatedMonthNames:["Sau","Vas","Kov","Bal","Geg","Bir","Lie","Rgp","Rgs","Spl","Lap","Grd"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"ymd",formatPatterns:{shortDate:"yyyy.MM.dd",longDate:"yyyy 'm.' MMMM d 'd.'",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"yyyy 'm.' MMMM d 'd.' HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"MMMM d 'd.'",yearMonth:"yyyy MMMM"},regexPatterns:{jan:/^sau(sis)?/i,feb:/^vas(aris)?/i,mar:/^kov(as)?/i,apr:/^bal(andis)?/i,may:/^geg(užė)?/i,jun:/^bir(želis)?/i,jul:/^lie(pa)?/i,aug:/^rugpjūtis/i,sep:/^rugsėjis/i,oct:/^spalis/i,nov:/^lap(kritis)?/i,dec:/^gruodis/i,sun:/^s(k(kmadienis)?)?/i,mon:/^p(r(rmadienis)?)?/i,tue:/^a(n(tradienis)?)?/i,wed:/^t(r(ečiadienis)?)?/i,thu:/^k(t(tvirtadienis)?)?/i,fri:/^penktadienis/i,sat:/^š(t(štadienis)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-nb-NO.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"nb-NO",englishName:"Norwegian, Bokmål (Norway)",nativeName:"norsk, bokmål (Norge)",dayNames:["søndag","mandag","tirsdag","onsdag","torsdag","fredag","lørdag"],abbreviatedDayNames:["sø","ma","ti","on","to","fr","lø"],shortestDayNames:["sø","ma","ti","on","to","fr","lø"],firstLetterDayNames:["s","m","t","o","t","f","l"],monthNames:["januar","februar","mars","april","mai","juni","juli","august","september","oktober","november","desember"],abbreviatedMonthNames:["jan","feb","mar","apr","mai","jun","jul","aug","sep","okt","nov","des"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd.MM.yyyy",longDate:"d. MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"d. MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d. MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^jan(uar)?/i,feb:/^feb(ruar)?/i,mar:/^mar(s)?/i,apr:/^apr(il)?/i,may:/^mai/i,jun:/^jun(i)?/i,jul:/^jul(i)?/i,aug:/^aug(ust)?/i,sep:/^sep(t(ember)?)?/i,oct:/^okt(ober)?/i,nov:/^nov(ember)?/i,dec:/^des(ember)?/i,sun:/^søndag/i,mon:/^mandag/i,tue:/^tirsdag/i,wed:/^onsdag/i,thu:/^torsdag/i,fri:/^fredag/i,sat:/^lørdag/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-nl-NL.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"nl-NL",englishName:"Dutch (Netherlands)",nativeName:"Nederlands (Nederland)",dayNames:["zondag","maandag","dinsdag","woensdag","donderdag","vrijdag","zaterdag"],abbreviatedDayNames:["zo","ma","di","wo","do","vr","za"],shortestDayNames:["zo","ma","di","wo","do","vr","za"],firstLetterDayNames:["z","m","d","w","d","v","z"],monthNames:["januari","februari","maart","april","mei","juni","juli","augustus","september","oktober","november","december"],abbreviatedMonthNames:["jan","feb","mrt","apr","mei","jun","jul","aug","sep","okt","nov","dec"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"d-M-yyyy",longDate:"dddd d MMMM yyyy",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"dddd d MMMM yyyy H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^jan(uari)?/i,feb:/^feb(ruari)?/i,mar:/^maart/i,apr:/^apr(il)?/i,may:/^mei/i,jun:/^jun(i)?/i,jul:/^jul(i)?/i,aug:/^aug(ustus)?/i,sep:/^sep(t(ember)?)?/i,oct:/^okt(ober)?/i,nov:/^nov(ember)?/i,dec:/^dec(ember)?/i,sun:/^zondag/i,mon:/^maandag/i,tue:/^dinsdag/i,wed:/^woensdag/i,thu:/^donderdag/i,fri:/^vrijdag/i,sat:/^zaterdag/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-pl-PL.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"pl-PL",englishName:"Polish (Poland)",nativeName:"polski (Polska)",dayNames:["niedziela","poniedziałek","wtorek","środa","czwartek","piątek","sobota"],abbreviatedDayNames:["N","Pn","Wt","Śr","Cz","Pt","So"],shortestDayNames:["N","Pn","Wt","Śr","Cz","Pt","So"],firstLetterDayNames:["N","P","W","Ś","C","P","S"],monthNames:["styczeń","luty","marzec","kwiecień","maj","czerwiec","lipiec","sierpień","wrzesień","październik","listopad","grudzień"],abbreviatedMonthNames:["sty","lut","mar","kwi","maj","cze","lip","sie","wrz","paź","lis","gru"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"ymd",formatPatterns:{shortDate:"yyyy-MM-dd",longDate:"d MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"d MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^sty(czeń)?/i,feb:/^lut(y)?/i,mar:/^mar(zec)?/i,apr:/^kwi(ecień)?/i,may:/^maj/i,jun:/^cze(rwiec)?/i,jul:/^lip(iec)?/i,aug:/^sie(rpień)?/i,sep:/^wrz(esień)?/i,oct:/^paź(dziernik)?/i,nov:/^lis(topad)?/i,dec:/^gru(dzień)?/i,sun:/^niedziela/i,mon:/^poniedziałek/i,tue:/^wtorek/i,wed:/^środa/i,thu:/^czwartek/i,fri:/^piątek/i,sat:/^sobota/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-pt-BR.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"pt-BR",englishName:"Portuguese (Brazil)",nativeName:"Português (Brasil)",dayNames:["domingo","segunda-feira","terça-feira","quarta-feira","quinta-feira","sexta-feira","sábado"],abbreviatedDayNames:["dom","seg","ter","qua","qui","sex","sáb"],shortestDayNames:["dom","seg","ter","qua","qui","sex","sáb"],firstLetterDayNames:["d","s","t","q","q","s","s"],monthNames:["janeiro","fevereiro","março","abril","maio","junho","julho","agosto","setembro","outubro","novembro","dezembro"],abbreviatedMonthNames:["jan","fev","mar","abr","mai","jun","jul","ago","set","out","nov","dez"],amDesignator:"",pmDesignator:"",firstDayOfWeek:0,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"d/M/yyyy",longDate:"dddd, d' de 'MMMM' de 'yyyy",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"dddd, d' de 'MMMM' de 'yyyy H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd' de 'MMMM",yearMonth:"MMMM' de 'yyyy"},regexPatterns:{jan:/^jan(eiro)?/i,feb:/^fev(ereiro)?/i,mar:/^mar(ço)?/i,apr:/^abr(il)?/i,may:/^mai(o)?/i,jun:/^jun(ho)?/i,jul:/^jul(ho)?/i,aug:/^ago(sto)?/i,sep:/^set(embro)?/i,oct:/^out(ubro)?/i,nov:/^nov(embro)?/i,dec:/^dez(embro)?/i,sun:/^domingo/i,mon:/^segunda-feira/i,tue:/^terça-feira/i,wed:/^quarta-feira/i,thu:/^quinta-feira/i,fri:/^sexta-feira/i,sat:/^sábado/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-ru-RU.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"ru-RU",englishName:"Russian (Russia)",nativeName:"русский (Россия)",dayNames:["воскресенье","понедельник","вторник","среда","четверг","пятница","суббота"],abbreviatedDayNames:["Вс","Пн","Вт","Ср","Чт","Пт","Сб"],shortestDayNames:["Вс","Пн","Вт","Ср","Чт","Пт","Сб"],firstLetterDayNames:["В","П","В","С","Ч","П","С"],monthNames:["Январь","Февраль","Март","Апрель","Май","Июнь","Июль","Август","Сентябрь","Октябрь","Ноябрь","Декабрь"],abbreviatedMonthNames:["янв","фев","мар","апр","май","июн","июл","авг","сен","окт","ноя","дек"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd.MM.yyyy",longDate:"d MMMM yyyy 'г.'",shortTime:"H:mm",longTime:"H:mm:ss",fullDateTime:"d MMMM yyyy 'г.' H:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"MMMM dd",yearMonth:"MMMM yyyy 'г.'"},regexPatterns:{jan:/^янв(арь)?/i,feb:/^фев(раль)?/i,mar:/^мар(т)?/i,apr:/^апр(ель)?/i,may:/^май/i,jun:/^июн(ь)?/i,jul:/^июл(ь)?/i,aug:/^авг(уст)?/i,sep:/^сен(тябрь)?/i,oct:/^окт(ябрь)?/i,nov:/^ноя(брь)?/i,dec:/^дек(абрь)?/i,sun:/^воскресенье/i,mon:/^понедельник/i,tue:/^вторник/i,wed:/^среда/i,thu:/^четверг/i,fri:/^пятница/i,sat:/^суббота/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-sv-SE.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"sv-SE",englishName:"Swedish (Sweden)",nativeName:"svenska (Sverige)",dayNames:["söndag","måndag","tisdag","onsdag","torsdag","fredag","lördag"],abbreviatedDayNames:["sö","må","ti","on","to","fr","lö"],shortestDayNames:["sö","må","ti","on","to","fr","lö"],firstLetterDayNames:["s","m","t","o","t","f","l"],monthNames:["januari","februari","mars","april","maj","juni","juli","augusti","september","oktober","november","december"],abbreviatedMonthNames:["jan","feb","mar","apr","maj","jun","jul","aug","sep","okt","nov","dec"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"ymd",formatPatterns:{shortDate:"yyyy-MM-dd",longDate:"'den 'd MMMM yyyy",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"'den 'd MMMM yyyy HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"d MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^jan(uari)?/i,feb:/^feb(ruari)?/i,mar:/^mar(s)?/i,apr:/^apr(il)?/i,may:/^maj/i,jun:/^jun(i)?/i,jul:/^jul(i)?/i,aug:/^aug(usti)?/i,sep:/^sep(t(ember)?)?/i,oct:/^okt(ober)?/i,nov:/^nov(ember)?/i,dec:/^dec(ember)?/i,sun:/^söndag/i,mon:/^måndag/i,tue:/^tisdag/i,wed:/^onsdag/i,thu:/^torsdag/i,fri:/^fredag/i,sat:/^lördag/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/languages/date-tr-TR.js ADDED Viewed

	@@ -0,0 +1,104 @@


1	+ /**
2	+ * Version: 1.0 Alpha-1
3	+ * Build Date: 13-Nov-2007
4	+ * Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
5	+ * License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
6	+ * Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
7	+ */
8	+ Date.CultureInfo={name:"tr-TR",englishName:"Turkish (Turkey)",nativeName:"Türkçe (Türkiye)",dayNames:["Pazar","Pazartesi","Salı","Çarşamba","Perşembe","Cuma","Cumartesi"],abbreviatedDayNames:["Paz","Pzt","Sal","Çar","Per","Cum","Cmt"],shortestDayNames:["Pz","Pt","Sa","Ça","Pe","Cu","Ct"],firstLetterDayNames:["P","P","S","Ç","P","C","C"],monthNames:["Ocak","Şubat","Mart","Nisan","Mayıs","Haziran","Temmuz","Ağustos","Eylül","Ekim","Kasım","Aralık"],abbreviatedMonthNames:["Oca","Şub","Mar","Nis","May","Haz","Tem","Ağu","Eyl","Eki","Kas","Ara"],amDesignator:"",pmDesignator:"",firstDayOfWeek:1,twoDigitYearMax:2029,dateElementOrder:"dmy",formatPatterns:{shortDate:"dd.MM.yyyy",longDate:"dd MMMM yyyy dddd",shortTime:"HH:mm",longTime:"HH:mm:ss",fullDateTime:"dd MMMM yyyy dddd HH:mm:ss",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"dd MMMM",yearMonth:"MMMM yyyy"},regexPatterns:{jan:/^oca(k)?/i,feb:/^şub(at)?/i,mar:/^mar(t)?/i,apr:/^nis(an)?/i,may:/^may(ıs)?/i,jun:/^haz(iran)?/i,jul:/^tem(muz)?/i,aug:/^ağu(stos)?/i,sep:/^eyl(ül)?/i,oct:/^eki(m)?/i,nov:/^kas(ım)?/i,dec:/^ara(lık)?/i,sun:/^pz(z(ar)?)?/i,mon:/^pt(t(artesi)?)?/i,tue:/^sa(l(ı)?)?/i,wed:/^ça(r(şamba)?)?/i,thu:/^pe(r(şembe)?)?/i,fri:/^cu(m(a)?)?/i,sat:/^ct(t(artesi)?)?/i,future:/^next/i,past:/^last\|past\|prev(ious)?/i,add:/^(\+\|after\|from)/i,subtract:/^(\-\|before\|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms\|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a\|p)/i,longMeridian:/^(a\.?m?\.?\|p\.?m?\.?)/i,timezone:/^((e(s\|d)t\|c(s\|d)t\|m(s\|d)t\|p(s\|d)t)\|((gmt)?\s(\+\|\-)\s\d\d\d\d?)\|gmt)/i,ordinalSuffix:/^\s(st\|nd\|rd\|th)/i,timeContext:/^\s(\:\|a\|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
9	+ Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
10	+ return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s\|\|m[i].toLowerCase()==s){return i;}}
11	+ return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))\|\|(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst\|\|false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
12	+ return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
13	+ if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
14	+ var x=config;if(x.millisecond\|\|x.milliseconds){this.addMilliseconds(x.millisecond\|\|x.milliseconds);}
15	+ if(x.second\|\|x.seconds){this.addSeconds(x.second\|\|x.seconds);}
16	+ if(x.minute\|\|x.minutes){this.addMinutes(x.minute\|\|x.minutes);}
17	+ if(x.hour\|\|x.hours){this.addHours(x.hour\|\|x.hours);}
18	+ if(x.month\|\|x.months){this.addMonths(x.month\|\|x.months);}
19	+ if(x.year\|\|x.years){this.addYears(x.year\|\|x.years);}
20	+ if(x.day\|\|x.days){this.addDays(x.day\|\|x.days);}
21	+ return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min\|\|value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
22	+ return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
23	+ if(!x.second&&x.second!==0){x.second=-1;}
24	+ if(!x.minute&&x.minute!==0){x.minute=-1;}
25	+ if(!x.hour&&x.hour!==0){x.hour=-1;}
26	+ if(!x.day&&x.day!==0){x.day=-1;}
27	+ if(!x.month&&x.month!==0){x.month=-1;}
28	+ if(!x.year&&x.year!==0){x.year=-1;}
29	+ if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
30	+ if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
31	+ if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
32	+ if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
33	+ if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
34	+ if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
35	+ if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
36	+ if(x.timezone){this.setTimezone(x.timezone);}
37	+ if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
38	+ return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))\|\|(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()\|\|this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7(orient\|\|+1))%7;return this.addDays((diff===0)?diff+=7(orient\|\|+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12(orient\|\|+1))%12;return this.addMonths((diff===0)?diff+=12(orient\|\|+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek\|\|Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
39	+ var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2\|\|prevOffset==8){w=53;}else{w=52;}}
40	+ return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E\|C\|M\|P)(S\|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
41	+ Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
42	+ return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
43	+ var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
44	+ return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
45	+ var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
46	+ return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
47	+ (function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s"+s+"\s"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
48	+ break;}
49	+ return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
50	+ rx.push(r[0]);s=r[1];}
51	+ return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
52	+ return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
53	+ throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
54	+ return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]\|\|rule.call(this,s));}catch(e){r=cache[s]=e;}
55	+ if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
56	+ try{r=(px[i].call(this,s));}catch(e){r=null;}
57	+ if(r){return r;}}
58	+ throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
59	+ try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
60	+ rx.push(r[0]);s=r[1];}
61	+ return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d\|\|_.rtoken(/^\s*/);c=c\|\|null;if(px.length==1){return px[0];}
62	+ return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
63	+ rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
64	+ s=q[1];}
65	+ if(!r){throw new $P.Exception(s);}
66	+ if(q){throw new $P.Exception(q[1]);}
67	+ if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
68	+ return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2\|\|d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d\|\|_.rtoken(/^\s/);c=c\|\|null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
69	+ rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
70	+ if(!last&&q[1].length===0){last=true;}
71	+ if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
72	+ p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
73	+ if(rx[1].length<best[1].length){best=rx;}
74	+ if(best[1].length===0){break;}}
75	+ if(best[0].length===0){return best;}
76	+ if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
77	+ best[1]=q[1];}
78	+ return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
79	+ return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
80	+ if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
81	+ var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
82	+ return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
83	+ this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
84	+ var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
85	+ return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
86	+ for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
87	+ if(this.now){return new Date();}
88	+ var today=Date.today();var method=null;var expression=!!(this.days!=null\|\|this.orient\|\|this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"\|\|this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orientmod))%mod):(orientmod);}
89	+ if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orientmod))%mod):(orientmod);this.month=null;}
90	+ if(!this.unit){this.unit="day";}
91	+ if(this[this.unit+"s"]==null\|\|this.operator!=null){if(!this.value){this.value=1;}
92	+ if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
93	+ this[this.unit+"s"]=this.value*orient;}
94	+ return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
95	+ if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
96	+ if(this.month&&!this.day){this.day=1;}
97	+ return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]\|at\|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
98	+ fn=_C[keys]=_.any.apply(null,px);}
99	+ return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2]\|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]\|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3]\|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]\|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]\|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+\|\-)?\s\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+\|\-)\s\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1]\|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d\|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d\|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]\|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st\|nd\|rd\|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]\|\|g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?\|MM?M?M?\|yy?y?y?\|hh?\|HH?\|mm?\|ss?\|tt?\|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]\|\|g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
100	+ return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
101	+ return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
102	+ try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
103	+ return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
104	+ return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};

3.7.8/lib/lib.txt ADDED Viewed

	@@ -0,0 +1,58 @@


1	+ This file lists all of the third-party JavaScript libraries we are using and where they came from. All of these files are compressed and combined into the edcallib.min.js file. This compressed file was made with the Google Closure JavaScript compiler. I haven't checked in that compiler because it is over 4MB and you don't need it for runtime. I haven't been able to figure out a way to make WordPress's Subversion exclude a file when building a plugin.
2	+
3	+ languages/date-*.js
4	+ date.extras.js
5	+ This is an open source JavaScript date library that we use to provide and manipulate dates for the calendar.
6	+ http://www.datejs.com/
7	+ MIT License
8	+
9	+ humanmsg.css
10	+ humanmsg.js
11	+ We use Humanized style error messages when we show concurrency errors and other issues the user might run into when dragging posts.
12	+ http://code.google.com/p/humanmsg/
13	+ Apache License 2.0
14	+
15	+ jquery.bgiframe.js
16	+ jquery.delegate.js
17	+ jquery.tools.min.js
18	+ JQuery tools supports the scrolling.
19	+ http://flowplayer.org/tools/index.html
20	+ MIT license
21	+
22	+ jquery.cookie.js
23	+ A nice utility for setting and reading cookies.
24	+ http://plugins.jquery.com/project/Cookie
25	+ MIT license
26	+
27	+ jquery.mousewheel.js
28	+ This library handles mousewhere integration for the calendar.
29	+ http://brandonaaron.net/code/mousewheel/demos
30	+ MIT License
31	+
32	+ timePicker.css
33	+ jquery.timepicker.js
34	+ The JQuery time picker shows a nice time picker when you edit the post time.
35	+ http://labs.perifer.se/timedatepicker
36	+ MIT License
37	+
38	+ json2.js
39	+ We use this library for faster JSON parsing.
40	+ http://www.json.org/js.html
41	+ It is available under the public domain.
42	+
43	+ sprintf-0.7-beta1.js
44	+ This libraries helps us to PHP style string substitution for localization.
45	+ http://www.diveintojavascript.com/projects/javascript-sprintf
46	+ BSD license
47	+
48	+ tools.scrollable-1.1.2.js
49	+ tools.scrollable.mousewheel-1.0.1.js
50	+ The scrollable library supports the mouse wheel scrolling and manages the calendar's vertical scrolling.
51	+ http://flowplayer.org/tools/scrollable.html
52	+ MIT License
53	+
54	+ qunit.js
55	+ qunit.css
56	+ A unit testing framework for the calendar
57	+ http://docs.jquery.com/QUnit
58	+ MIT License

3.7.8/lib/qunit.css ADDED Viewed

	@@ -0,0 +1,196 @@


1	+ /** Font Family and Sizes */
2	+
3	+ #qunit-tests, #qunit-header, #qunit-banner, #qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult {
4	+ font-family: "Helvetica Neue Light", "HelveticaNeue-Light", "Helvetica Neue", Calibri, Helvetica, Arial;
5	+ }
6	+
7	+ #qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult, #qunit-tests li { font-size: small; }
8	+ #qunit-tests { font-size: smaller; }
9	+
10	+
11	+ /** Resets */
12	+
13	+ #qunit-tests, #qunit-tests ol, #qunit-header, #qunit-banner, #qunit-userAgent, #qunit-testresult {
14	+ margin: 0;
15	+ padding: 0;
16	+ }
17	+
18	+
19	+ /** Header */
20	+
21	+ #qunit-header {
22	+ padding: 0.5em 0 0.5em 1em;
23	+
24	+ color: #8699a4;
25	+ background-color: #0d3349;
26	+
27	+ font-size: 1.5em;
28	+ line-height: 1em;
29	+ font-weight: normal;
30	+
31	+ border-radius: 15px 15px 0 0;
32	+ -moz-border-radius: 15px 15px 0 0;
33	+ -webkit-border-top-right-radius: 15px;
34	+ -webkit-border-top-left-radius: 15px;
35	+ }
36	+
37	+ #qunit-header a {
38	+ text-decoration: none;
39	+ color: #c2ccd1;
40	+ }
41	+
42	+ #qunit-header a:hover,
43	+ #qunit-header a:focus {
44	+ color: #fff;
45	+ }
46	+
47	+ #qunit-banner {
48	+ height: 5px;
49	+ }
50	+
51	+ #qunit-testrunner-toolbar {
52	+ padding: 0em 0 0.5em 2em;
53	+ }
54	+
55	+ #qunit-userAgent {
56	+ padding: 0.5em 0 0.5em 2.5em;
57	+ background-color: #2b81af;
58	+ color: #fff;
59	+ text-shadow: rgba(0, 0, 0, 0.5) 2px 2px 1px;
60	+ }
61	+
62	+
63	+ /** Tests: Pass/Fail */
64	+
65	+ #qunit-tests {
66	+ list-style-position: inside;
67	+ }
68	+
69	+ #qunit-tests li {
70	+ padding: 0.4em 0.5em 0.4em 2.5em;
71	+ border-bottom: 1px solid #fff;
72	+ list-style-position: inside;
73	+ }
74	+
75	+ #qunit-tests li strong {
76	+ cursor: pointer;
77	+ }
78	+
79	+ #qunit-tests ol {
80	+ margin-top: 0.5em;
81	+ padding: 0.5em;
82	+
83	+ background-color: #fff;
84	+
85	+ border-radius: 15px;
86	+ -moz-border-radius: 15px;
87	+ -webkit-border-radius: 15px;
88	+
89	+ box-shadow: inset 0px 2px 13px #999;
90	+ -moz-box-shadow: inset 0px 2px 13px #999;
91	+ -webkit-box-shadow: inset 0px 2px 13px #999;
92	+ }
93	+
94	+ #qunit-tests table {
95	+ border-collapse: collapse;
96	+ margin-top: .2em;
97	+ }
98	+
99	+ #qunit-tests th {
100	+ text-align: right;
101	+ vertical-align: top;
102	+ padding: 0 .5em 0 0;
103	+ }
104	+
105	+ #qunit-tests td {
106	+ vertical-align: top;
107	+ }
108	+
109	+ #qunit-tests pre {
110	+ margin: 0;
111	+ white-space: pre-wrap;
112	+ word-wrap: break-word;
113	+ }
114	+
115	+ #qunit-tests del {
116	+ background-color: #e0f2be;
117	+ color: #374e0c;
118	+ text-decoration: none;
119	+ }
120	+
121	+ #qunit-tests ins {
122	+ background-color: #ffcaca;
123	+ color: #500;
124	+ text-decoration: none;
125	+ }
126	+
127	+ /*** Test Counts */
128	+
129	+ #qunit-tests b.counts { color: black; }
130	+ #qunit-tests b.passed { color: #5E740B; }
131	+ #qunit-tests b.failed { color: #710909; }
132	+
133	+ #qunit-tests li li {
134	+ margin: 0.5em;
135	+ padding: 0.4em 0.5em 0.4em 0.5em;
136	+ background-color: #fff;
137	+ border-bottom: none;
138	+ list-style-position: inside;
139	+ }
140	+
141	+ /*** Passing Styles */
142	+
143	+ #qunit-tests li li.pass {
144	+ color: #5E740B;
145	+ background-color: #fff;
146	+ border-left: 26px solid #C6E746;
147	+ }
148	+
149	+ #qunit-tests .pass { color: #528CE0; background-color: #D2E0E6; }
150	+ #qunit-tests .pass .test-name { color: #366097; }
151	+
152	+ #qunit-tests .pass .test-actual,
153	+ #qunit-tests .pass .test-expected { color: #999999; }
154	+
155	+ #qunit-banner.qunit-pass { background-color: #C6E746; }
156	+
157	+ /*** Failing Styles */
158	+
159	+ #qunit-tests li li.fail {
160	+ color: #710909;
161	+ background-color: #fff;
162	+ border-left: 26px solid #EE5757;
163	+ }
164	+
165	+ #qunit-tests .fail { color: #000000; background-color: #EE5757; }
166	+ #qunit-tests .fail .test-name,
167	+ #qunit-tests .fail .module-name { color: #000000; }
168	+
169	+ #qunit-tests .fail .test-actual { color: #EE5757; }
170	+ #qunit-tests .fail .test-expected { color: green; }
171	+
172	+ #qunit-banner.qunit-fail,
173	+ #qunit-testrunner-toolbar { background-color: #EE5757; }
174	+
175	+
176	+ /** Footer */
177	+
178	+ #qunit-testresult {
179	+ padding: 0.5em 0.5em 0.5em 2.5em;
180	+
181	+ color: #2b81af;
182	+ background-color: #D2E0E6;
183	+
184	+ border-radius: 0 0 15px 15px;
185	+ -moz-border-radius: 0 0 15px 15px;
186	+ -webkit-border-bottom-right-radius: 15px;
187	+ -webkit-border-bottom-left-radius: 15px;
188	+ }
189	+
190	+ /** Fixture */
191	+
192	+ #qunit-fixture {
193	+ position: absolute;
194	+ top: -10000px;
195	+ left: -10000px;
196	+ }

3.7.8/lib/qunit.js ADDED Viewed

	@@ -0,0 +1,1341 @@


1	+ /*
2	+ * QUnit - A JavaScript Unit Testing Framework
3	+ *
4	+ * http://docs.jquery.com/QUnit
5	+ *
6	+ * Copyright (c) 2009 John Resig, Jörn Zaefferer
7	+ * Dual licensed under the MIT (MIT-LICENSE.txt)
8	+ * and GPL (GPL-LICENSE.txt) licenses.
9	+ */
10	+
11	+ (function(window) {
12	+
13	+ var defined = {
14	+ setTimeout: typeof window.setTimeout !== "undefined",
15	+ sessionStorage: (function() {
16	+ try {
17	+ return !!sessionStorage.getItem;
18	+ } catch(e){
19	+ return false;
20	+ }
21	+ })()
22	+ }
23	+
24	+ var testId = 0;
25	+
26	+ var Test = function(name, testName, expected, testEnvironmentArg, async, callback) {
27	+ this.name = name;
28	+ this.testName = testName;
29	+ this.expected = expected;
30	+ this.testEnvironmentArg = testEnvironmentArg;
31	+ this.async = async;
32	+ this.callback = callback;
33	+ this.assertions = [];
34	+ };
35	+ Test.prototype = {
36	+ init: function() {
37	+ var tests = id("qunit-tests");
38	+ if (tests) {
39	+ var b = document.createElement("strong");
40	+ b.innerHTML = "Running " + this.name;
41	+ var li = document.createElement("li");
42	+ li.appendChild( b );
43	+ li.id = this.id = "test-output" + testId++;
44	+ tests.appendChild( li );
45	+ }
46	+ },
47	+ setup: function() {
48	+ if (this.module != config.previousModule) {
49	+ if ( this.previousModule ) {
50	+ QUnit.moduleDone( this.module, config.moduleStats.bad, config.moduleStats.all );
51	+ }
52	+ config.previousModule = this.module;
53	+ config.moduleStats = { all: 0, bad: 0 };
54	+ QUnit.moduleStart( this.module, this.moduleTestEnvironment );
55	+ }
56	+
57	+ config.current = this;
58	+ this.testEnvironment = extend({
59	+ setup: function() {},
60	+ teardown: function() {}
61	+ }, this.moduleTestEnvironment);
62	+ if (this.testEnvironmentArg) {
63	+ extend(this.testEnvironment, this.testEnvironmentArg);
64	+ }
65	+
66	+ QUnit.testStart( this.testName, this.testEnvironment );
67	+
68	+ // allow utility functions to access the current test environment
69	+ // TODO why??
70	+ QUnit.current_testEnvironment = this.testEnvironment;
71	+
72	+ try {
73	+ if ( !config.pollution ) {
74	+ saveGlobal();
75	+ }
76	+
77	+ this.testEnvironment.setup.call(this.testEnvironment);
78	+ } catch(e) {
79	+ // TODO use testName instead of name for no-markup message?
80	+ QUnit.ok( false, "Setup failed on " + this.name + ": " + e.message );
81	+ }
82	+ },
83	+ run: function() {
84	+ if ( this.async ) {
85	+ QUnit.stop();
86	+ }
87	+
88	+ try {
89	+ this.callback.call(this.testEnvironment);
90	+ } catch(e) {
91	+ // TODO use testName instead of name for no-markup message?
92	+ fail("Test " + this.name + " died, exception and test follows", e, this.callback);
93	+ QUnit.ok( false, "Died on test #" + (this.assertions.length + 1) + ": " + e.message + " - " + QUnit.jsDump.parse(e) );
94	+ // else next test will carry the responsibility
95	+ saveGlobal();
96	+
97	+ // Restart the tests if they're blocking
98	+ if ( config.blocking ) {
99	+ start();
100	+ }
101	+ }
102	+ },
103	+ teardown: function() {
104	+ try {
105	+ checkPollution();
106	+ this.testEnvironment.teardown.call(this.testEnvironment);
107	+ } catch(e) {
108	+ // TODO use testName instead of name for no-markup message?
109	+ QUnit.ok( false, "Teardown failed on " + this.name + ": " + e.message );
110	+ }
111	+ },
112	+ finish: function() {
113	+ if ( this.expected && this.expected != this.assertions.length ) {
114	+ QUnit.ok( false, "Expected " + this.expected + " assertions, but " + this.assertions.length + " were run" );
115	+ }
116	+
117	+ var good = 0, bad = 0,
118	+ tests = id("qunit-tests");
119	+
120	+ config.stats.all += this.assertions.length;
121	+ config.moduleStats.all += this.assertions.length;
122	+
123	+ if ( tests ) {
124	+ var ol = document.createElement("ol");
125	+
126	+ for ( var i = 0; i < this.assertions.length; i++ ) {
127	+ var assertion = this.assertions[i];
128	+
129	+ var li = document.createElement("li");
130	+ li.className = assertion.result ? "pass" : "fail";
131	+ li.innerHTML = assertion.message \|\| (assertion.result ? "okay" : "failed");
132	+ ol.appendChild( li );
133	+
134	+ if ( assertion.result ) {
135	+ good++;
136	+ } else {
137	+ bad++;
138	+ config.stats.bad++;
139	+ config.moduleStats.bad++;
140	+ }
141	+ }
142	+
143	+ // store result when possible
144	+ defined.sessionStorage && sessionStorage.setItem("qunit-" + this.testName, bad);
145	+
146	+ if (bad == 0) {
147	+ ol.style.display = "none";
148	+ }
149	+
150	+ var b = document.createElement("strong");
151	+ b.innerHTML = this.name + " <b class='counts'>(<b class='failed'>" + bad + "</b>, <b class='passed'>" + good + "</b>, " + this.assertions.length + ")</b>";
152	+
153	+ addEvent(b, "click", function() {
154	+ var next = b.nextSibling, display = next.style.display;
155	+ next.style.display = display === "none" ? "block" : "none";
156	+ });
157	+
158	+ addEvent(b, "dblclick", function(e) {
159	+ var target = e && e.target ? e.target : window.event.srcElement;
160	+ if ( target.nodeName.toLowerCase() == "span" \|\| target.nodeName.toLowerCase() == "b" ) {
161	+ target = target.parentNode;
162	+ }
163	+ if ( window.location && target.nodeName.toLowerCase() === "strong" ) {
164	+ window.location.search = "?" + encodeURIComponent(getText([target]).replace(/$.+$$/, "").replace(/(^\s\|\s$)/g, ""));
165	+ }
166	+ });
167	+
168	+ var li = id(this.id);
169	+ li.className = bad ? "fail" : "pass";
170	+ li.style.display = resultDisplayStyle(!bad);
171	+ li.removeChild( li.firstChild );
172	+ li.appendChild( b );
173	+ li.appendChild( ol );
174	+
175	+ if ( bad ) {
176	+ var toolbar = id("qunit-testrunner-toolbar");
177	+ if ( toolbar ) {
178	+ toolbar.style.display = "block";
179	+ id("qunit-filter-pass").disabled = null;
180	+ }
181	+ }
182	+
183	+ } else {
184	+ for ( var i = 0; i < this.assertions.length; i++ ) {
185	+ if ( !this.assertions[i].result ) {
186	+ bad++;
187	+ config.stats.bad++;
188	+ config.moduleStats.bad++;
189	+ }
190	+ }
191	+ }
192	+
193	+ try {
194	+ QUnit.reset();
195	+ } catch(e) {
196	+ // TODO use testName instead of name for no-markup message?
197	+ fail("reset() failed, following Test " + this.name + ", exception and reset fn follows", e, QUnit.reset);
198	+ }
199	+
200	+ QUnit.testDone( this.testName, bad, this.assertions.length );
201	+ },
202	+
203	+ queue: function() {
204	+ var test = this;
205	+ synchronize(function() {
206	+ test.init();
207	+ });
208	+ function run() {
209	+ // each of these can by async
210	+ synchronize(function() {
211	+ test.setup();
212	+ });
213	+ synchronize(function() {
214	+ test.run();
215	+ });
216	+ synchronize(function() {
217	+ test.teardown();
218	+ });
219	+ synchronize(function() {
220	+ test.finish();
221	+ });
222	+ }
223	+ // defer when previous test run passed, if storage is available
224	+ var bad = defined.sessionStorage && +sessionStorage.getItem("qunit-" + this.testName);
225	+ if (bad) {
226	+ run();
227	+ } else {
228	+ synchronize(run);
229	+ };
230	+ }
231	+
232	+ }
233	+
234	+ var QUnit = {
235	+
236	+ // call on start of module test to prepend name to all tests
237	+ module: function(name, testEnvironment) {
238	+ config.previousModule = config.currentModule;
239	+ config.currentModule = name;
240	+ config.currentModuleTestEnviroment = testEnvironment;
241	+ },
242	+
243	+ asyncTest: function(testName, expected, callback) {
244	+ if ( arguments.length === 2 ) {
245	+ callback = expected;
246	+ expected = 0;
247	+ }
248	+
249	+ QUnit.test(testName, expected, callback, true);
250	+ },
251	+
252	+ test: function(testName, expected, callback, async) {
253	+ var name = '<span class="test-name">' + testName + '</span>', testEnvironmentArg;
254	+
255	+ if ( arguments.length === 2 ) {
256	+ callback = expected;
257	+ expected = null;
258	+ }
259	+ // is 2nd argument a testEnvironment?
260	+ if ( expected && typeof expected === 'object') {
261	+ testEnvironmentArg = expected;
262	+ expected = null;
263	+ }
264	+
265	+ if ( config.currentModule ) {
266	+ name = '<span class="module-name">' + config.currentModule + "</span>: " + name;
267	+ }
268	+
269	+ if ( !validTest(config.currentModule + ": " + testName) ) {
270	+ return;
271	+ }
272	+
273	+ var test = new Test(name, testName, expected, testEnvironmentArg, async, callback);
274	+ test.previousModule = config.previousModule;
275	+ test.module = config.currentModule;
276	+ test.moduleTestEnvironment = config.currentModuleTestEnviroment;
277	+ test.queue();
278	+ },
279	+
280	+ /**
281	+ * Specify the number of expected assertions to gurantee that failed test (no assertions are run at all) don't slip through.
282	+ */
283	+ expect: function(asserts) {
284	+ config.current.expected = asserts;
285	+ },
286	+
287	+ /**
288	+ * Asserts true.
289	+ * @example ok( "asdfasdf".length > 5, "There must be at least 5 chars" );
290	+ */
291	+ ok: function(a, msg) {
292	+ a = !!a;
293	+ var details = {
294	+ result: a,
295	+ message: msg
296	+ };
297	+ msg = escapeHtml(msg);
298	+ QUnit.log(a, msg, details);
299	+ config.current.assertions.push({
300	+ result: a,
301	+ message: msg
302	+ });
303	+ },
304	+
305	+ /**
306	+ * Checks that the first two arguments are equal, with an optional message.
307	+ * Prints out both actual and expected values.
308	+ *
309	+ * Prefered to ok( actual == expected, message )
310	+ *
311	+ * @example equal( format("Received {0} bytes.", 2), "Received 2 bytes." );
312	+ *
313	+ * @param Object actual
314	+ * @param Object expected
315	+ * @param String message (optional)
316	+ */
317	+ equal: function(actual, expected, message) {
318	+ QUnit.push(expected == actual, actual, expected, message);
319	+ },
320	+
321	+ notEqual: function(actual, expected, message) {
322	+ QUnit.push(expected != actual, actual, expected, message);
323	+ },
324	+
325	+ deepEqual: function(actual, expected, message) {
326	+ QUnit.push(QUnit.equiv(actual, expected), actual, expected, message);
327	+ },
328	+
329	+ notDeepEqual: function(actual, expected, message) {
330	+ QUnit.push(!QUnit.equiv(actual, expected), actual, expected, message);
331	+ },
332	+
333	+ strictEqual: function(actual, expected, message) {
334	+ QUnit.push(expected === actual, actual, expected, message);
335	+ },
336	+
337	+ notStrictEqual: function(actual, expected, message) {
338	+ QUnit.push(expected !== actual, actual, expected, message);
339	+ },
340	+
341	+ raises: function(fn, message) {
342	+ try {
343	+ fn();
344	+ QUnit.ok( false, message );
345	+ }
346	+ catch (e) {
347	+ QUnit.ok( true, message );
348	+ }
349	+ },
350	+
351	+ start: function() {
352	+ // A slight delay, to avoid any current callbacks
353	+ if ( defined.setTimeout ) {
354	+ window.setTimeout(function() {
355	+ if ( config.timeout ) {
356	+ clearTimeout(config.timeout);
357	+ }
358	+
359	+ config.blocking = false;
360	+ process();
361	+ }, 13);
362	+ } else {
363	+ config.blocking = false;
364	+ process();
365	+ }
366	+ },
367	+
368	+ stop: function(timeout) {
369	+ config.blocking = true;
370	+
371	+ if ( timeout && defined.setTimeout ) {
372	+ config.timeout = window.setTimeout(function() {
373	+ QUnit.ok( false, "Test timed out" );
374	+ QUnit.start();
375	+ }, timeout);
376	+ }
377	+ }
378	+
379	+ };
380	+
381	+ // Backwards compatibility, deprecated
382	+ QUnit.equals = QUnit.equal;
383	+ QUnit.same = QUnit.deepEqual;
384	+
385	+ // Maintain internal state
386	+ var config = {
387	+ // The queue of tests to run
388	+ queue: [],
389	+
390	+ // block until document ready
391	+ blocking: true
392	+ };
393	+
394	+ // Load paramaters
395	+ (function() {
396	+ var location = window.location \|\| { search: "", protocol: "file:" },
397	+ GETParams = location.search.slice(1).split('&');
398	+
399	+ for ( var i = 0; i < GETParams.length; i++ ) {
400	+ GETParams[i] = decodeURIComponent( GETParams[i] );
401	+ if ( GETParams[i] === "noglobals" ) {
402	+ GETParams.splice( i, 1 );
403	+ i--;
404	+ config.noglobals = true;
405	+ } else if ( GETParams[i].search('=') > -1 ) {
406	+ GETParams.splice( i, 1 );
407	+ i--;
408	+ }
409	+ }
410	+
411	+ // restrict modules/tests by get parameters
412	+ config.filters = GETParams;
413	+
414	+ // Figure out if we're running the tests from a server or not
415	+ QUnit.isLocal = !!(location.protocol === 'file:');
416	+ })();
417	+
418	+ // Expose the API as global variables, unless an 'exports'
419	+ // object exists, in that case we assume we're in CommonJS
420	+ if ( typeof exports === "undefined" \|\| typeof require === "undefined" ) {
421	+ extend(window, QUnit);
422	+ window.QUnit = QUnit;
423	+ } else {
424	+ extend(exports, QUnit);
425	+ exports.QUnit = QUnit;
426	+ }
427	+
428	+ // define these after exposing globals to keep them in these QUnit namespace only
429	+ extend(QUnit, {
430	+ config: config,
431	+
432	+ // Initialize the configuration options
433	+ init: function() {
434	+ extend(config, {
435	+ stats: { all: 0, bad: 0 },
436	+ moduleStats: { all: 0, bad: 0 },
437	+ started: +new Date,
438	+ updateRate: 1000,
439	+ blocking: false,
440	+ autostart: true,
441	+ autorun: false,
442	+ filters: [],
443	+ queue: []
444	+ });
445	+
446	+ var tests = id("qunit-tests"),
447	+ banner = id("qunit-banner"),
448	+ result = id("qunit-testresult");
449	+
450	+ if ( tests ) {
451	+ tests.innerHTML = "";
452	+ }
453	+
454	+ if ( banner ) {
455	+ banner.className = "";
456	+ }
457	+
458	+ if ( result ) {
459	+ result.parentNode.removeChild( result );
460	+ }
461	+ },
462	+
463	+ /**
464	+ * Resets the test setup. Useful for tests that modify the DOM.
465	+ *
466	+ * If jQuery is available, uses jQuery's html(), otherwise just innerHTML.
467	+ */
468	+ reset: function() {
469	+ if ( window.jQuery ) {
470	+ jQuery( "#main, #qunit-fixture" ).html( config.fixture );
471	+ } else {
472	+ var main = id( 'main' ) \|\| id( 'qunit-fixture' );
473	+ if ( main ) {
474	+ main.innerHTML = config.fixture;
475	+ }
476	+ }
477	+ },
478	+
479	+ /**
480	+ * Trigger an event on an element.
481	+ *
482	+ * @example triggerEvent( document.body, "click" );
483	+ *
484	+ * @param DOMElement elem
485	+ * @param String type
486	+ */
487	+ triggerEvent: function( elem, type, event ) {
488	+ if ( document.createEvent ) {
489	+ event = document.createEvent("MouseEvents");
490	+ event.initMouseEvent(type, true, true, elem.ownerDocument.defaultView,
491	+ 0, 0, 0, 0, 0, false, false, false, false, 0, null);
492	+ elem.dispatchEvent( event );
493	+
494	+ } else if ( elem.fireEvent ) {
495	+ elem.fireEvent("on"+type);
496	+ }
497	+ },
498	+
499	+ // Safe object type checking
500	+ is: function( type, obj ) {
501	+ return QUnit.objectType( obj ) == type;
502	+ },
503	+
504	+ objectType: function( obj ) {
505	+ if (typeof obj === "undefined") {
506	+ return "undefined";
507	+
508	+ // consider: typeof null === object
509	+ }
510	+ if (obj === null) {
511	+ return "null";
512	+ }
513	+
514	+ var type = Object.prototype.toString.call( obj )
515	+ .match(/^\[object\s(.*)\]$/)[1] \|\| '';
516	+
517	+ switch (type) {
518	+ case 'Number':
519	+ if (isNaN(obj)) {
520	+ return "nan";
521	+ } else {
522	+ return "number";
523	+ }
524	+ case 'String':
525	+ case 'Boolean':
526	+ case 'Array':
527	+ case 'Date':
528	+ case 'RegExp':
529	+ case 'Function':
530	+ return type.toLowerCase();
531	+ }
532	+ if (typeof obj === "object") {
533	+ return "object";
534	+ }
535	+ return undefined;
536	+ },
537	+
538	+ push: function(result, actual, expected, message) {
539	+ var details = {
540	+ result: result,
541	+ message: message,
542	+ actual: actual,
543	+ expected: expected
544	+ };
545	+
546	+ message = escapeHtml(message) \|\| (result ? "okay" : "failed");
547	+ message = '<span class="test-message">' + message + "</span>";
548	+ expected = escapeHtml(QUnit.jsDump.parse(expected));
549	+ actual = escapeHtml(QUnit.jsDump.parse(actual));
550	+ var output = message + '<table><tr class="test-expected"><th>Expected: </th><td><pre>' + expected + '</pre></td></tr>';
551	+ if (actual != expected) {
552	+ output += '<tr class="test-actual"><th>Result: </th><td><pre>' + actual + '</pre></td></tr>';
553	+ output += '<tr class="test-diff"><th>Diff: </th><td><pre>' + QUnit.diff(expected, actual) +'</pre></td></tr>';
554	+ }
555	+ if (!result) {
556	+ var source = sourceFromStacktrace();
557	+ if (source) {
558	+ details.source = source;
559	+ output += '<tr class="test-source"><th>Source: </th><td><pre>' + source +'</pre></td></tr>';
560	+ }
561	+ }
562	+ output += "</table>";
563	+
564	+ QUnit.log(result, message, details);
565	+
566	+ config.current.assertions.push({
567	+ result: !!result,
568	+ message: output
569	+ });
570	+ },
571	+
572	+ // Logging callbacks
573	+ begin: function() {},
574	+ done: function(failures, total) {},
575	+ log: function(result, message) {},
576	+ testStart: function(name, testEnvironment) {},
577	+ testDone: function(name, failures, total) {},
578	+ moduleStart: function(name, testEnvironment) {},
579	+ moduleDone: function(name, failures, total) {}
580	+ });
581	+
582	+ if ( typeof document === "undefined" \|\| document.readyState === "complete" ) {
583	+ config.autorun = true;
584	+ }
585	+
586	+ addEvent(window, "load", function() {
587	+ QUnit.begin();
588	+
589	+ // Initialize the config, saving the execution queue
590	+ var oldconfig = extend({}, config);
591	+ QUnit.init();
592	+ extend(config, oldconfig);
593	+
594	+ config.blocking = false;
595	+
596	+ var userAgent = id("qunit-userAgent");
597	+ if ( userAgent ) {
598	+ userAgent.innerHTML = navigator.userAgent;
599	+ }
600	+ var banner = id("qunit-header");
601	+ if ( banner ) {
602	+ var paramsIndex = location.href.lastIndexOf(location.search);
603	+ if ( paramsIndex > -1 ) {
604	+ var mainPageLocation = location.href.slice(0, paramsIndex);
605	+ if ( mainPageLocation == location.href ) {
606	+ banner.innerHTML = '<a href=""> ' + banner.innerHTML + '</a> ';
607	+ } else {
608	+ var testName = decodeURIComponent(location.search.slice(1));
609	+ banner.innerHTML = '<a href="' + mainPageLocation + '">' + banner.innerHTML + '</a> › <a href="">' + testName + '</a>';
610	+ }
611	+ }
612	+ }
613	+
614	+ var toolbar = id("qunit-testrunner-toolbar");
615	+ if ( toolbar ) {
616	+ toolbar.style.display = "none";
617	+
618	+ var filter = document.createElement("input");
619	+ filter.type = "checkbox";
620	+ filter.id = "qunit-filter-pass";
621	+ filter.disabled = true;
622	+ addEvent( filter, "click", function() {
623	+ var li = document.getElementsByTagName("li");
624	+ for ( var i = 0; i < li.length; i++ ) {
625	+ if ( li[i].className.indexOf("pass") > -1 ) {
626	+ li[i].style.display = filter.checked ? "none" : "";
627	+ }
628	+ }
629	+ });
630	+ toolbar.appendChild( filter );
631	+
632	+ var label = document.createElement("label");
633	+ label.setAttribute("for", "qunit-filter-pass");
634	+ label.innerHTML = "Hide passed tests";
635	+ toolbar.appendChild( label );
636	+ }
637	+
638	+ var main = id('main') \|\| id('qunit-fixture');
639	+ if ( main ) {
640	+ config.fixture = main.innerHTML;
641	+ }
642	+
643	+ if (config.autostart) {
644	+ QUnit.start();
645	+ }
646	+ });
647	+
648	+ function done() {
649	+ config.autorun = true;
650	+
651	+ // Log the last module results
652	+ if ( config.currentModule ) {
653	+ QUnit.moduleDone( config.currentModule, config.moduleStats.bad, config.moduleStats.all );
654	+ }
655	+
656	+ var banner = id("qunit-banner"),
657	+ tests = id("qunit-tests"),
658	+ html = ['Tests completed in ',
659	+ +new Date - config.started, ' milliseconds.<br/>',
660	+ '<span class="passed">', config.stats.all - config.stats.bad, '</span> tests of <span class="total">', config.stats.all, '</span> passed, <span class="failed">', config.stats.bad,'</span> failed.'].join('');
661	+
662	+ if ( banner ) {
663	+ banner.className = (config.stats.bad ? "qunit-fail" : "qunit-pass");
664	+ }
665	+
666	+ if ( tests ) {
667	+ var result = id("qunit-testresult");
668	+
669	+ if ( !result ) {
670	+ result = document.createElement("p");
671	+ result.id = "qunit-testresult";
672	+ result.className = "result";
673	+ tests.parentNode.insertBefore( result, tests.nextSibling );
674	+ }
675	+
676	+ result.innerHTML = html;
677	+ }
678	+
679	+ QUnit.done( config.stats.bad, config.stats.all );
680	+ }
681	+
682	+ function validTest( name ) {
683	+ var i = config.filters.length,
684	+ run = false;
685	+
686	+ if ( !i ) {
687	+ return true;
688	+ }
689	+
690	+ while ( i-- ) {
691	+ var filter = config.filters[i],
692	+ not = filter.charAt(0) == '!';
693	+
694	+ if ( not ) {
695	+ filter = filter.slice(1);
696	+ }
697	+
698	+ if ( name.indexOf(filter) !== -1 ) {
699	+ return !not;
700	+ }
701	+
702	+ if ( not ) {
703	+ run = true;
704	+ }
705	+ }
706	+
707	+ return run;
708	+ }
709	+
710	+ // so far supports only Firefox, Chrome and Opera (buggy)
711	+ // could be extended in the future to use something like https://github.com/csnover/TraceKit
712	+ function sourceFromStacktrace() {
713	+ try {
714	+ throw new Error();
715	+ } catch ( e ) {
716	+ if (e.stacktrace) {
717	+ // Opera
718	+ return e.stacktrace.split("\n")[6];
719	+ } else if (e.stack) {
720	+ // Firefox, Chrome
721	+ return e.stack.split("\n")[4];
722	+ }
723	+ }
724	+ }
725	+
726	+ function resultDisplayStyle(passed) {
727	+ return passed && id("qunit-filter-pass") && id("qunit-filter-pass").checked ? 'none' : '';
728	+ }
729	+
730	+ function escapeHtml(s) {
731	+ if (!s) {
732	+ return "";
733	+ }
734	+ s = s + "";
735	+ return s.replace(/[\&"<>\\]/g, function(s) {
736	+ switch(s) {
737	+ case "&": return "&";
738	+ case "\\": return "\\\\";
739	+ case '"': return '\"';
740	+ case "<": return "<";
741	+ case ">": return ">";
742	+ default: return s;
743	+ }
744	+ });
745	+ }
746	+
747	+ function synchronize( callback ) {
748	+ config.queue.push( callback );
749	+
750	+ if ( config.autorun && !config.blocking ) {
751	+ process();
752	+ }
753	+ }
754	+
755	+ function process() {
756	+ var start = (new Date()).getTime();
757	+
758	+ while ( config.queue.length && !config.blocking ) {
759	+ if ( config.updateRate <= 0 \|\| (((new Date()).getTime() - start) < config.updateRate) ) {
760	+ config.queue.shift()();
761	+ } else {
762	+ window.setTimeout( process, 13 );
763	+ break;
764	+ }
765	+ }
766	+ if (!config.blocking && !config.queue.length) {
767	+ done();
768	+ }
769	+ }
770	+
771	+ function saveGlobal() {
772	+ config.pollution = [];
773	+
774	+ if ( config.noglobals ) {
775	+ for ( var key in window ) {
776	+ config.pollution.push( key );
777	+ }
778	+ }
779	+ }
780	+
781	+ function checkPollution( name ) {
782	+ var old = config.pollution;
783	+ saveGlobal();
784	+
785	+ var newGlobals = diff( old, config.pollution );
786	+ if ( newGlobals.length > 0 ) {
787	+ ok( false, "Introduced global variable(s): " + newGlobals.join(", ") );
788	+ config.current.expected++;
789	+ }
790	+
791	+ var deletedGlobals = diff( config.pollution, old );
792	+ if ( deletedGlobals.length > 0 ) {
793	+ ok( false, "Deleted global variable(s): " + deletedGlobals.join(", ") );
794	+ config.current.expected++;
795	+ }
796	+ }
797	+
798	+ // returns a new Array with the elements that are in a but not in b
799	+ function diff( a, b ) {
800	+ var result = a.slice();
801	+ for ( var i = 0; i < result.length; i++ ) {
802	+ for ( var j = 0; j < b.length; j++ ) {
803	+ if ( result[i] === b[j] ) {
804	+ result.splice(i, 1);
805	+ i--;
806	+ break;
807	+ }
808	+ }
809	+ }
810	+ return result;
811	+ }
812	+
813	+ function fail(message, exception, callback) {
814	+ if ( typeof console !== "undefined" && console.error && console.warn ) {
815	+ console.error(message);
816	+ console.error(exception);
817	+ console.warn(callback.toString());
818	+
819	+ } else if ( window.opera && opera.postError ) {
820	+ opera.postError(message, exception, callback.toString);
821	+ }
822	+ }
823	+
824	+ function extend(a, b) {
825	+ for ( var prop in b ) {
826	+ a[prop] = b[prop];
827	+ }
828	+
829	+ return a;
830	+ }
831	+
832	+ function addEvent(elem, type, fn) {
833	+ if ( elem.addEventListener ) {
834	+ elem.addEventListener( type, fn, false );
835	+ } else if ( elem.attachEvent ) {
836	+ elem.attachEvent( "on" + type, fn );
837	+ } else {
838	+ fn();
839	+ }
840	+ }
841	+
842	+ function id(name) {
843	+ return !!(typeof document !== "undefined" && document && document.getElementById) &&
844	+ document.getElementById( name );
845	+ }
846	+
847	+ // Test for equality any JavaScript type.
848	+ // Discussions and reference: http://philrathe.com/articles/equiv
849	+ // Test suites: http://philrathe.com/tests/equiv
850	+ // Author: Philippe Rathé <prathe@gmail.com>
851	+ QUnit.equiv = function () {
852	+
853	+ var innerEquiv; // the real equiv function
854	+ var callers = []; // stack to decide between skip/abort functions
855	+ var parents = []; // stack to avoiding loops from circular referencing
856	+
857	+ // Call the o related callback with the given arguments.
858	+ function bindCallbacks(o, callbacks, args) {
859	+ var prop = QUnit.objectType(o);
860	+ if (prop) {
861	+ if (QUnit.objectType(callbacks[prop]) === "function") {
862	+ return callbacks[prop].apply(callbacks, args);
863	+ } else {
864	+ return callbacks[prop]; // or undefined
865	+ }
866	+ }
867	+ }
868	+
869	+ var callbacks = function () {
870	+
871	+ // for string, boolean, number and null
872	+ function useStrictEquality(b, a) {
873	+ if (b instanceof a.constructor \|\| a instanceof b.constructor) {
874	+ // to catch short annotaion VS 'new' annotation of a declaration
875	+ // e.g. var i = 1;
876	+ // var j = new Number(1);
877	+ return a == b;
878	+ } else {
879	+ return a === b;
880	+ }
881	+ }
882	+
883	+ return {
884	+ "string": useStrictEquality,
885	+ "boolean": useStrictEquality,
886	+ "number": useStrictEquality,
887	+ "null": useStrictEquality,
888	+ "undefined": useStrictEquality,
889	+
890	+ "nan": function (b) {
891	+ return isNaN(b);
892	+ },
893	+
894	+ "date": function (b, a) {
895	+ return QUnit.objectType(b) === "date" && a.valueOf() === b.valueOf();
896	+ },
897	+
898	+ "regexp": function (b, a) {
899	+ return QUnit.objectType(b) === "regexp" &&
900	+ a.source === b.source && // the regex itself
901	+ a.global === b.global && // and its modifers (gmi) ...
902	+ a.ignoreCase === b.ignoreCase &&
903	+ a.multiline === b.multiline;
904	+ },
905	+
906	+ // - skip when the property is a method of an instance (OOP)
907	+ // - abort otherwise,
908	+ // initial === would have catch identical references anyway
909	+ "function": function () {
910	+ var caller = callers[callers.length - 1];
911	+ return caller !== Object &&
912	+ typeof caller !== "undefined";
913	+ },
914	+
915	+ "array": function (b, a) {
916	+ var i, j, loop;
917	+ var len;
918	+
919	+ // b could be an object literal here
920	+ if ( ! (QUnit.objectType(b) === "array")) {
921	+ return false;
922	+ }
923	+
924	+ len = a.length;
925	+ if (len !== b.length) { // safe and faster
926	+ return false;
927	+ }
928	+
929	+ //track reference to avoid circular references
930	+ parents.push(a);
931	+ for (i = 0; i < len; i++) {
932	+ loop = false;
933	+ for(j=0;j<parents.length;j++){
934	+ if(parents[j] === a[i]){
935	+ loop = true;//dont rewalk array
936	+ }
937	+ }
938	+ if (!loop && ! innerEquiv(a[i], b[i])) {
939	+ parents.pop();
940	+ return false;
941	+ }
942	+ }
943	+ parents.pop();
944	+ return true;
945	+ },
946	+
947	+ "object": function (b, a) {
948	+ var i, j, loop;
949	+ var eq = true; // unless we can proove it
950	+ var aProperties = [], bProperties = []; // collection of strings
951	+
952	+ // comparing constructors is more strict than using instanceof
953	+ if ( a.constructor !== b.constructor) {
954	+ return false;
955	+ }
956	+
957	+ // stack constructor before traversing properties
958	+ callers.push(a.constructor);
959	+ //track reference to avoid circular references
960	+ parents.push(a);
961	+
962	+ for (i in a) { // be strict: don't ensures hasOwnProperty and go deep
963	+ loop = false;
964	+ for(j=0;j<parents.length;j++){
965	+ if(parents[j] === a[i])
966	+ loop = true; //don't go down the same path twice
967	+ }
968	+ aProperties.push(i); // collect a's properties
969	+
970	+ if (!loop && ! innerEquiv(a[i], b[i])) {
971	+ eq = false;
972	+ break;
973	+ }
974	+ }
975	+
976	+ callers.pop(); // unstack, we are done
977	+ parents.pop();
978	+
979	+ for (i in b) {
980	+ bProperties.push(i); // collect b's properties
981	+ }
982	+
983	+ // Ensures identical properties name
984	+ return eq && innerEquiv(aProperties.sort(), bProperties.sort());
985	+ }
986	+ };
987	+ }();
988	+
989	+ innerEquiv = function () { // can take multiple arguments
990	+ var args = Array.prototype.slice.apply(arguments);
991	+ if (args.length < 2) {
992	+ return true; // end transition
993	+ }
994	+
995	+ return (function (a, b) {
996	+ if (a === b) {
997	+ return true; // catch the most you can
998	+ } else if (a === null \|\| b === null \|\| typeof a === "undefined" \|\| typeof b === "undefined" \|\| QUnit.objectType(a) !== QUnit.objectType(b)) {
999	+ return false; // don't lose time with error prone cases
1000	+ } else {
1001	+ return bindCallbacks(a, callbacks, [b, a]);
1002	+ }
1003	+
1004	+ // apply transition with (1..n) arguments
1005	+ })(args[0], args[1]) && arguments.callee.apply(this, args.splice(1, args.length -1));
1006	+ };
1007	+
1008	+ return innerEquiv;
1009	+
1010	+ }();
1011	+
1012	+ /**
1013	+ * jsDump
1014	+ * Copyright (c) 2008 Ariel Flesler - aflesler(at)gmail(dot)com \| http://flesler.blogspot.com
1015	+ * Licensed under BSD (http://www.opensource.org/licenses/bsd-license.php)
1016	+ * Date: 5/15/2008
1017	+ * @projectDescription Advanced and extensible data dumping for Javascript.
1018	+ * @version 1.0.0
1019	+ * @author Ariel Flesler
1020	+ * @link {http://flesler.blogspot.com/2008/05/jsdump-pretty-dump-of-any-javascript.html}
1021	+ */
1022	+ QUnit.jsDump = (function() {
1023	+ function quote( str ) {
1024	+ return '"' + str.toString().replace(/"/g, '\\"') + '"';
1025	+ };
1026	+ function literal( o ) {
1027	+ return o + '';
1028	+ };
1029	+ function join( pre, arr, post ) {
1030	+ var s = jsDump.separator(),
1031	+ base = jsDump.indent(),
1032	+ inner = jsDump.indent(1);
1033	+ if ( arr.join )
1034	+ arr = arr.join( ',' + s + inner );
1035	+ if ( !arr )
1036	+ return pre + post;
1037	+ return [ pre, inner + arr, base + post ].join(s);
1038	+ };
1039	+ function array( arr ) {
1040	+ var i = arr.length, ret = Array(i);
1041	+ this.up();
1042	+ while ( i-- )
1043	+ ret[i] = this.parse( arr[i] );
1044	+ this.down();
1045	+ return join( '[', ret, ']' );
1046	+ };
1047	+
1048	+ var reName = /^function (\w+)/;
1049	+
1050	+ var jsDump = {
1051	+ parse:function( obj, type ) { //type is used mostly internally, you can fix a (custom)type in advance
1052	+ var parser = this.parsers[ type \|\| this.typeOf(obj) ];
1053	+ type = typeof parser;
1054	+
1055	+ return type == 'function' ? parser.call( this, obj ) :
1056	+ type == 'string' ? parser :
1057	+ this.parsers.error;
1058	+ },
1059	+ typeOf:function( obj ) {
1060	+ var type;
1061	+ if ( obj === null ) {
1062	+ type = "null";
1063	+ } else if (typeof obj === "undefined") {
1064	+ type = "undefined";
1065	+ } else if (QUnit.is("RegExp", obj)) {
1066	+ type = "regexp";
1067	+ } else if (QUnit.is("Date", obj)) {
1068	+ type = "date";
1069	+ } else if (QUnit.is("Function", obj)) {
1070	+ type = "function";
1071	+ } else if (typeof obj.setInterval !== undefined && typeof obj.document !== "undefined" && typeof obj.nodeType === "undefined") {
1072	+ type = "window";
1073	+ } else if (obj.nodeType === 9) {
1074	+ type = "document";
1075	+ } else if (obj.nodeType) {
1076	+ type = "node";
1077	+ } else if (typeof obj === "object" && typeof obj.length === "number" && obj.length >= 0) {
1078	+ type = "array";
1079	+ } else {
1080	+ type = typeof obj;
1081	+ }
1082	+ return type;
1083	+ },
1084	+ separator:function() {
1085	+ return this.multiline ? this.HTML ? '<br />' : '\n' : this.HTML ? ' ' : ' ';
1086	+ },
1087	+ indent:function( extra ) {// extra can be a number, shortcut for increasing-calling-decreasing
1088	+ if ( !this.multiline )
1089	+ return '';
1090	+ var chr = this.indentChar;
1091	+ if ( this.HTML )
1092	+ chr = chr.replace(/\t/g,' ').replace(/ /g,' ');
1093	+ return Array( this._depth_ + (extra\|\|0) ).join(chr);
1094	+ },
1095	+ up:function( a ) {
1096	+ this._depth_ += a \|\| 1;
1097	+ },
1098	+ down:function( a ) {
1099	+ this._depth_ -= a \|\| 1;
1100	+ },
1101	+ setParser:function( name, parser ) {
1102	+ this.parsers[name] = parser;
1103	+ },
1104	+ // The next 3 are exposed so you can use them
1105	+ quote:quote,
1106	+ literal:literal,
1107	+ join:join,
1108	+ //
1109	+ _depth_: 1,
1110	+ // This is the list of parsers, to modify them, use jsDump.setParser
1111	+ parsers:{
1112	+ window: '[Window]',
1113	+ document: '[Document]',
1114	+ error:'[ERROR]', //when no parser is found, shouldn't happen
1115	+ unknown: '[Unknown]',
1116	+ 'null':'null',
1117	+ undefined:'undefined',
1118	+ 'function':function( fn ) {
1119	+ var ret = 'function',
1120	+ name = 'name' in fn ? fn.name : (reName.exec(fn)\|\|[])[1];//functions never have name in IE
1121	+ if ( name )
1122	+ ret += ' ' + name;
1123	+ ret += '(';
1124	+
1125	+ ret = [ ret, QUnit.jsDump.parse( fn, 'functionArgs' ), '){'].join('');
1126	+ return join( ret, QUnit.jsDump.parse(fn,'functionCode'), '}' );
1127	+ },
1128	+ array: array,
1129	+ nodelist: array,
1130	+ arguments: array,
1131	+ object:function( map ) {
1132	+ var ret = [ ];
1133	+ QUnit.jsDump.up();
1134	+ for ( var key in map )
1135	+ ret.push( QUnit.jsDump.parse(key,'key') + ': ' + QUnit.jsDump.parse(map[key]) );
1136	+ QUnit.jsDump.down();
1137	+ return join( '{', ret, '}' );
1138	+ },
1139	+ node:function( node ) {
1140	+ var open = QUnit.jsDump.HTML ? '<' : '<',
1141	+ close = QUnit.jsDump.HTML ? '>' : '>';
1142	+
1143	+ var tag = node.nodeName.toLowerCase(),
1144	+ ret = open + tag;
1145	+
1146	+ for ( var a in QUnit.jsDump.DOMAttrs ) {
1147	+ var val = node[QUnit.jsDump.DOMAttrs[a]];
1148	+ if ( val )
1149	+ ret += ' ' + a + '=' + QUnit.jsDump.parse( val, 'attribute' );
1150	+ }
1151	+ return ret + close + open + '/' + tag + close;
1152	+ },
1153	+ functionArgs:function( fn ) {//function calls it internally, it's the arguments part of the function
1154	+ var l = fn.length;
1155	+ if ( !l ) return '';
1156	+
1157	+ var args = Array(l);
1158	+ while ( l-- )
1159	+ args[l] = String.fromCharCode(97+l);//97 is 'a'
1160	+ return ' ' + args.join(', ') + ' ';
1161	+ },
1162	+ key:quote, //object calls it internally, the key part of an item in a map
1163	+ functionCode:'[code]', //function calls it internally, it's the content of the function
1164	+ attribute:quote, //node calls it internally, it's an html attribute value
1165	+ string:quote,
1166	+ date:quote,
1167	+ regexp:literal, //regex
1168	+ number:literal,
1169	+ 'boolean':literal
1170	+ },
1171	+ DOMAttrs:{//attributes to dump from nodes, name=>realName
1172	+ id:'id',
1173	+ name:'name',
1174	+ 'class':'className'
1175	+ },
1176	+ HTML:false,//if true, entities are escaped ( <, >, \t, space and \n )
1177	+ indentChar:' ',//indentation unit
1178	+ multiline:true //if true, items in a collection, are separated by a \n, else just a space.
1179	+ };
1180	+
1181	+ return jsDump;
1182	+ })();
1183	+
1184	+ // from Sizzle.js
1185	+ function getText( elems ) {
1186	+ var ret = "", elem;
1187	+
1188	+ for ( var i = 0; elems[i]; i++ ) {
1189	+ elem = elems[i];
1190	+
1191	+ // Get the text from text nodes and CDATA nodes
1192	+ if ( elem.nodeType === 3 \|\| elem.nodeType === 4 ) {
1193	+ ret += elem.nodeValue;
1194	+
1195	+ // Traverse everything else, except comment nodes
1196	+ } else if ( elem.nodeType !== 8 ) {
1197	+ ret += getText( elem.childNodes );
1198	+ }
1199	+ }
1200	+
1201	+ return ret;
1202	+ };
1203	+
1204	+ /*
1205	+ * Javascript Diff Algorithm
1206	+ * By John Resig (http://ejohn.org/)
1207	+ * Modified by Chu Alan "sprite"
1208	+ *
1209	+ * Released under the MIT license.
1210	+ *
1211	+ * More Info:
1212	+ * http://ejohn.org/projects/javascript-diff-algorithm/
1213	+ *
1214	+ * Usage: QUnit.diff(expected, actual)
1215	+ *
1216	+ * QUnit.diff("the quick brown fox jumped over", "the quick fox jumps over") == "the quick <del>brown </del> fox <del>jumped </del><ins>jumps </ins> over"
1217	+ */
1218	+ QUnit.diff = (function() {
1219	+ function diff(o, n){
1220	+ var ns = new Object();
1221	+ var os = new Object();
1222	+
1223	+ for (var i = 0; i < n.length; i++) {
1224	+ if (ns[n[i]] == null)
1225	+ ns[n[i]] = {
1226	+ rows: new Array(),
1227	+ o: null
1228	+ };
1229	+ ns[n[i]].rows.push(i);
1230	+ }
1231	+
1232	+ for (var i = 0; i < o.length; i++) {
1233	+ if (os[o[i]] == null)
1234	+ os[o[i]] = {
1235	+ rows: new Array(),
1236	+ n: null
1237	+ };
1238	+ os[o[i]].rows.push(i);
1239	+ }
1240	+
1241	+ for (var i in ns) {
1242	+ if (ns[i].rows.length == 1 && typeof(os[i]) != "undefined" && os[i].rows.length == 1) {
1243	+ n[ns[i].rows[0]] = {
1244	+ text: n[ns[i].rows[0]],
1245	+ row: os[i].rows[0]
1246	+ };
1247	+ o[os[i].rows[0]] = {
1248	+ text: o[os[i].rows[0]],
1249	+ row: ns[i].rows[0]
1250	+ };
1251	+ }
1252	+ }
1253	+
1254	+ for (var i = 0; i < n.length - 1; i++) {
1255	+ if (n[i].text != null && n[i + 1].text == null && n[i].row + 1 < o.length && o[n[i].row + 1].text == null &&
1256	+ n[i + 1] == o[n[i].row + 1]) {
1257	+ n[i + 1] = {
1258	+ text: n[i + 1],
1259	+ row: n[i].row + 1
1260	+ };
1261	+ o[n[i].row + 1] = {
1262	+ text: o[n[i].row + 1],
1263	+ row: i + 1
1264	+ };
1265	+ }
1266	+ }
1267	+
1268	+ for (var i = n.length - 1; i > 0; i--) {
1269	+ if (n[i].text != null && n[i - 1].text == null && n[i].row > 0 && o[n[i].row - 1].text == null &&
1270	+ n[i - 1] == o[n[i].row - 1]) {
1271	+ n[i - 1] = {
1272	+ text: n[i - 1],
1273	+ row: n[i].row - 1
1274	+ };
1275	+ o[n[i].row - 1] = {
1276	+ text: o[n[i].row - 1],
1277	+ row: i - 1
1278	+ };
1279	+ }
1280	+ }
1281	+
1282	+ return {
1283	+ o: o,
1284	+ n: n
1285	+ };
1286	+ }
1287	+
1288	+ return function(o, n){
1289	+ o = o.replace(/\s+$/, '');
1290	+ n = n.replace(/\s+$/, '');
1291	+ var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/));
1292	+
1293	+ var str = "";
1294	+
1295	+ var oSpace = o.match(/\s+/g);
1296	+ if (oSpace == null) {
1297	+ oSpace = [" "];
1298	+ }
1299	+ else {
1300	+ oSpace.push(" ");
1301	+ }
1302	+ var nSpace = n.match(/\s+/g);
1303	+ if (nSpace == null) {
1304	+ nSpace = [" "];
1305	+ }
1306	+ else {
1307	+ nSpace.push(" ");
1308	+ }
1309	+
1310	+ if (out.n.length == 0) {
1311	+ for (var i = 0; i < out.o.length; i++) {
1312	+ str += '<del>' + out.o[i] + oSpace[i] + "</del>";
1313	+ }
1314	+ }
1315	+ else {
1316	+ if (out.n[0].text == null) {
1317	+ for (n = 0; n < out.o.length && out.o[n].text == null; n++) {
1318	+ str += '<del>' + out.o[n] + oSpace[n] + "</del>";
1319	+ }
1320	+ }
1321	+
1322	+ for (var i = 0; i < out.n.length; i++) {
1323	+ if (out.n[i].text == null) {
1324	+ str += '<ins>' + out.n[i] + nSpace[i] + "</ins>";
1325	+ }
1326	+ else {
1327	+ var pre = "";
1328	+
1329	+ for (n = out.n[i].row + 1; n < out.o.length && out.o[n].text == null; n++) {
1330	+ pre += '<del>' + out.o[n] + oSpace[n] + "</del>";
1331	+ }
1332	+ str += " " + out.n[i].text + nSpace[i] + pre;
1333	+ }
1334	+ }
1335	+ }
1336	+
1337	+ return str;
1338	+ };
1339	+ })();
1340	+
1341	+ })(this);

3.7.8/lib/sprintf-0.7-beta1.js ADDED Viewed

	@@ -0,0 +1,183 @@


1	+ /**
2	+ sprintf() for JavaScript 0.7-beta1
3	+ http://www.diveintojavascript.com/projects/javascript-sprintf
4	+
5	+ Copyright (c) Alexandru Marasteanu <alexaholic [at) gmail (dot] com>
6	+ All rights reserved.
7	+
8	+ Redistribution and use in source and binary forms, with or without
9	+ modification, are permitted provided that the following conditions are met:
10	+ * Redistributions of source code must retain the above copyright
11	+ notice, this list of conditions and the following disclaimer.
12	+ * Redistributions in binary form must reproduce the above copyright
13	+ notice, this list of conditions and the following disclaimer in the
14	+ documentation and/or other materials provided with the distribution.
15	+ * Neither the name of sprintf() for JavaScript nor the
16	+ names of its contributors may be used to endorse or promote products
17	+ derived from this software without specific prior written permission.
18	+
19	+ THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
20	+ ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
21	+ WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
22	+ DISCLAIMED. IN NO EVENT SHALL Alexandru Marasteanu BE LIABLE FOR ANY
23	+ DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
24	+ (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
25	+ LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
26	+ ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
27	+ (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
28	+ SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
29	+
30	+
31	+ Changelog:
32	+ 2010.09.06 - 0.7-beta1
33	+ - features: vsprintf, support for named placeholders
34	+ - enhancements: format cache, reduced global namespace pollution
35	+
36	+ 2010.05.22 - 0.6:
37	+ - reverted to 0.4 and fixed the bug regarding the sign of the number 0
38	+ Note:
39	+ Thanks to Raphael Pigulla <raph (at] n3rd [dot) org> (http://www.n3rd.org/)
40	+ who warned me about a bug in 0.5, I discovered that the last update was
41	+ a regress. I appologize for that.
42	+
43	+ 2010.05.09 - 0.5:
44	+ - bug fix: 0 is now preceeded with a + sign
45	+ - bug fix: the sign was not at the right position on padded results (Kamal Abdali)
46	+ - switched from GPL to BSD license
47	+
48	+ 2007.10.21 - 0.4:
49	+ - unit test and patch (David Baird)
50	+
51	+ 2007.09.17 - 0.3:
52	+ - bug fix: no longer throws exception on empty paramenters (Hans Pufal)
53	+
54	+ 2007.09.11 - 0.2:
55	+ - feature: added argument swapping
56	+
57	+ 2007.04.03 - 0.1:
58	+ - initial release
59	+ **/
60	+
61	+ var sprintf = (function() {
62	+ function get_type(variable) {
63	+ return Object.prototype.toString.call(variable).slice(8, -1).toLowerCase();
64	+ }
65	+ function str_repeat(input, multiplier) {
66	+ for (var output = []; multiplier > 0; output[--multiplier] = input) {/* do nothing */}
67	+ return output.join('');
68	+ }
69	+
70	+ var str_format = function() {
71	+ if (!str_format.cache.hasOwnProperty(arguments[0])) {
72	+ str_format.cache[arguments[0]] = str_format.parse(arguments[0]);
73	+ }
74	+ return str_format.format.call(null, str_format.cache[arguments[0]], arguments);
75	+ };
76	+
77	+ str_format.format = function(parse_tree, argv) {
78	+ var cursor = 1, tree_length = parse_tree.length, node_type = '', arg, output = [], i, k, match, pad, pad_character, pad_length;
79	+ for (i = 0; i < tree_length; i++) {
80	+ node_type = get_type(parse_tree[i]);
81	+ if (node_type === 'string') {
82	+ output.push(parse_tree[i]);
83	+ }
84	+ else if (node_type === 'array') {
85	+ match = parse_tree[i]; // convenience purposes only
86	+ if (match[2]) { // keyword argument
87	+ arg = argv[cursor];
88	+ for (k = 0; k < match[2].length; k++) {
89	+ if (!arg.hasOwnProperty(match[2][k])) {
90	+ throw(sprintf('[sprintf] property "%s" does not exist', match[2][k]));
91	+ }
92	+ arg = arg[match[2][k]];
93	+ }
94	+ }
95	+ else if (match[1]) { // positional argument (explicit)
96	+ arg = argv[match[1]];
97	+ }
98	+ else { // positional argument (implicit)
99	+ arg = argv[cursor++];
100	+ }
101	+
102	+ if (/[^s]/.test(match[8]) && (get_type(arg) != 'number')) {
103	+ throw(sprintf('[sprintf] expecting number but found %s', get_type(arg)));
104	+ }
105	+ switch (match[8]) {
106	+ case 'b': arg = arg.toString(2); break;
107	+ case 'c': arg = String.fromCharCode(arg); break;
108	+ case 'd': arg = parseInt(arg, 10); break;
109	+ case 'e': arg = match[7] ? arg.toExponential(match[7]) : arg.toExponential(); break;
110	+ case 'f': arg = match[7] ? parseFloat(arg).toFixed(match[7]) : parseFloat(arg); break;
111	+ case 'o': arg = arg.toString(8); break;
112	+ case 's': arg = ((arg = String(arg)) && match[7] ? arg.substring(0, match[7]) : arg); break;
113	+ case 'u': arg = Math.abs(arg); break;
114	+ case 'x': arg = arg.toString(16); break;
115	+ case 'X': arg = arg.toString(16).toUpperCase(); break;
116	+ }
117	+ arg = (/[def]/.test(match[8]) && match[3] && arg >= 0 ? '+'+ arg : arg);
118	+ pad_character = match[4] ? match[4] == '0' ? '0' : match[4].charAt(1) : ' ';
119	+ pad_length = match[6] - String(arg).length;
120	+ pad = match[6] ? str_repeat(pad_character, pad_length) : '';
121	+ output.push(match[5] ? arg + pad : pad + arg);
122	+ }
123	+ }
124	+ return output.join('');
125	+ };
126	+
127	+ str_format.cache = {};
128	+
129	+ str_format.parse = function(fmt) {
130	+ var _fmt = fmt, match = [], parse_tree = [], arg_names = 0;
131	+ while (_fmt) {
132	+ if ((match = /^[^\x25]+/.exec(_fmt)) !== null) {
133	+ parse_tree.push(match[0]);
134	+ }
135	+ else if ((match = /^\x25{2}/.exec(_fmt)) !== null) {
136	+ parse_tree.push('%');
137	+ }
138	+ else if ((match = /^\x25(?:([1-9]\d*)\$\|$([^$]+)\))?(\+)?(0\|'[^$])?(-)?(\d+)?(?:\.(\d+))?([b-fosuxX])/.exec(_fmt)) !== null) {
139	+ if (match[2]) {
140	+ arg_names \|= 1;
141	+ var field_list = [], replacement_field = match[2], field_match = [];
142	+ if ((field_match = /^([a-z_][a-z_\d]*)/i.exec(replacement_field)) !== null) {
143	+ field_list.push(field_match[1]);
144	+ while ((replacement_field = replacement_field.substring(field_match[0].length)) !== '') {
145	+ if ((field_match = /^\.([a-z_][a-z_\d]*)/i.exec(replacement_field)) !== null) {
146	+ field_list.push(field_match[1]);
147	+ }
148	+ else if ((field_match = /^\[(\d+)\]/.exec(replacement_field)) !== null) {
149	+ field_list.push(field_match[1]);
150	+ }
151	+ else {
152	+ throw('[sprintf] huh?');
153	+ }
154	+ }
155	+ }
156	+ else {
157	+ throw('[sprintf] huh?');
158	+ }
159	+ match[2] = field_list;
160	+ }
161	+ else {
162	+ arg_names \|= 2;
163	+ }
164	+ if (arg_names === 3) {
165	+ throw('[sprintf] mixing positional and named placeholders is not (yet) supported');
166	+ }
167	+ parse_tree.push(match);
168	+ }
169	+ else {
170	+ throw('[sprintf] huh?');
171	+ }
172	+ _fmt = _fmt.substring(match[0].length);
173	+ }
174	+ return parse_tree;
175	+ };
176	+
177	+ return str_format;
178	+ })();
179	+
180	+ var vsprintf = function(fmt, argv) {
181	+ argv.unshift(fmt);
182	+ return sprintf.apply(null, argv);
183	+ };

3.7.8/lib/timePicker.css ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ div.time-picker {
2	+ position: absolute;
3	+ height: 200px;
4	+ width:6em; /* needed for IE */
5	+ overflow: auto;
6	+ background: #fff;
7	+ border: 1px solid #000;
8	+ z-index: 99;
9	+ }
10	+ div.time-picker-12hours {
11	+ width:8em; /* needed for IE */
12	+ }
13	+
14	+ div.time-picker ul {
15	+ list-style-type: none;
16	+ margin: 0;
17	+ padding: 0;
18	+ }
19	+ div.time-picker li {
20	+ padding: 1px;
21	+ cursor: pointer;
22	+ }
23	+ div.time-picker li.selected {
24	+ background: #316AC5;
25	+ color: #fff;
26	+ }

3.7.8/lib/tools.scrollable-1.1.2.js ADDED Viewed

	@@ -0,0 +1,439 @@


1	+ /**
2	+ * tools.scrollable 1.1.2 - Scroll your HTML with eye candy.
3	+ *
4	+ * Copyright (c) 2009 Tero Piirainen
5	+ * http://flowplayer.org/tools/scrollable.html
6	+ *
7	+ * Dual licensed under MIT and GPL 2+ licenses
8	+ * http://www.opensource.org/licenses
9	+ *
10	+ * Launch : March 2008
11	+ * Date: jQuery{date}
12	+ * Revision: jQuery{revision}
13	+ */
14	+ (function(jQuery) {
15	+
16	+ // static constructs
17	+ jQuery.tools = jQuery.tools \|\| {};
18	+
19	+ jQuery.tools.scrollable = {
20	+ version: '1.1.2',
21	+
22	+ conf: {
23	+
24	+ // basics
25	+ size: 5,
26	+ vertical: false,
27	+ speed: 400,
28	+ keyboard: true,
29	+
30	+ // by default this is the same as size
31	+ keyboardSteps: null,
32	+
33	+ // other
34	+ disabledClass: 'disabled',
35	+ hoverClass: null,
36	+ clickable: true,
37	+ activeClass: 'active',
38	+ easing: 'swing',
39	+ loop: false,
40	+
41	+ items: '.items',
42	+ item: null,
43	+
44	+ // navigational elements
45	+ prev: '.prev',
46	+ next: '.next',
47	+ prevPage: '.prevPage',
48	+ nextPage: '.nextPage',
49	+ api: false
50	+
51	+ // CALLBACKS: onBeforeSeek, onSeek, onReload
52	+ }
53	+ };
54	+
55	+ var current;
56	+
57	+ // constructor
58	+ function Scrollable(root, conf) {
59	+
60	+ // current instance
61	+ var self = this, jQueryself = jQuery(this),
62	+ horizontal = !conf.vertical,
63	+ wrap = root.children(),
64	+ index = 0,
65	+ forward;
66	+
67	+
68	+ if (!current) { current = self; }
69	+
70	+ // bind all callbacks from configuration
71	+ jQuery.each(conf, function(name, fn) {
72	+ if (jQuery.isFunction(fn)) { jQueryself.bind(name, fn); }
73	+ });
74	+
75	+ if (wrap.length > 1) { wrap = jQuery(conf.items, root); }
76	+
77	+ // navigational items can be anywhere when globalNav = true
78	+ function find(query) {
79	+ var els = jQuery(query);
80	+ return conf.globalNav ? els : root.parent().find(query);
81	+ }
82	+
83	+ // to be used by plugins
84	+ root.data("finder", find);
85	+
86	+ // get handle to navigational elements
87	+ var prev = find(conf.prev),
88	+ next = find(conf.next),
89	+ prevPage = find(conf.prevPage),
90	+ nextPage = find(conf.nextPage);
91	+
92	+
93	+ // methods
94	+ jQuery.extend(self, {
95	+
96	+ getIndex: function() {
97	+ return index;
98	+ },
99	+
100	+ getClickIndex: function() {
101	+ var items = self.getItems();
102	+ return items.index(items.filter("." + conf.activeClass));
103	+ },
104	+
105	+ getConf: function() {
106	+ return conf;
107	+ },
108	+
109	+ getSize: function() {
110	+ return self.getItems().length;
111	+ },
112	+
113	+ getPageAmount: function() {
114	+ return Math.ceil(this.getSize() / conf.size);
115	+ },
116	+
117	+ getPageIndex: function() {
118	+ return Math.ceil(index / conf.size);
119	+ },
120	+
121	+ getNaviButtons: function() {
122	+ return prev.add(next).add(prevPage).add(nextPage);
123	+ },
124	+
125	+ getRoot: function() {
126	+ return root;
127	+ },
128	+
129	+ getItemWrap: function() {
130	+ return wrap;
131	+ },
132	+
133	+ getItems: function() {
134	+ return wrap.children(conf.item);
135	+ },
136	+
137	+ getVisibleItems: function() {
138	+ return self.getItems().slice(index, index + conf.size);
139	+ },
140	+
141	+ /* all seeking functions depend on this */
142	+ seekTo: function(i, time, fn) {
143	+
144	+ if (i < 0) { i = 0; }
145	+
146	+ // nothing happens
147	+ if (index === i) { return self; }
148	+
149	+ // function given as second argument
150	+ if (jQuery.isFunction(time)) {
151	+ fn = time;
152	+ }
153	+
154	+ // seeking exceeds the end
155	+ if (i > self.getSize() - conf.size) {
156	+ return conf.loop ? self.begin() : this.end();
157	+ }
158	+
159	+ var item = self.getItems().eq(i);
160	+ if (!item.length) { return self; }
161	+
162	+ // onBeforeSeek
163	+ var e = jQuery.Event("onBeforeSeek");
164	+
165	+ jQueryself.trigger(e, i > index);
166	+ if (e.isDefaultPrevented()) { return self; }
167	+
168	+ // get the (possibly altered) speed
169	+ if (time === undefined \|\| jQuery.isFunction(time)) { time = conf.speed; }
170	+
171	+ function callback() {
172	+ if (fn) { fn.call(self, i); }
173	+ jQueryself.trigger("onSeek", [i]);
174	+ }
175	+
176	+ if (horizontal) {
177	+ wrap.animate({left: -item.position().left}, time, conf.easing, callback);
178	+ } else {
179	+ wrap.animate({top: -item.position().top}, time, conf.easing, callback);
180	+ }
181	+
182	+
183	+ current = self;
184	+ index = i;
185	+
186	+ // onStart
187	+ e = jQuery.Event("onStart");
188	+ jQueryself.trigger(e, [i]);
189	+ if (e.isDefaultPrevented()) { return self; }
190	+
191	+
192	+ /* default behaviour */
193	+
194	+ // prev/next buttons disabled flags
195	+ prev.add(prevPage).toggleClass(conf.disabledClass, i === 0);
196	+ next.add(nextPage).toggleClass(conf.disabledClass, i >= self.getSize() - conf.size);
197	+
198	+ return self;
199	+ },
200	+
201	+
202	+ move: function(offset, time, fn) {
203	+ forward = offset > 0;
204	+ return this.seekTo(index + offset, time, fn);
205	+ },
206	+
207	+ next: function(time, fn) {
208	+ return this.move(1, time, fn);
209	+ },
210	+
211	+ prev: function(time, fn) {
212	+ return this.move(-1, time, fn);
213	+ },
214	+
215	+ movePage: function(offset, time, fn) {
216	+ forward = offset > 0;
217	+ var steps = conf.size * offset;
218	+
219	+ var i = index % conf.size;
220	+ if (i > 0) {
221	+ steps += (offset > 0 ? -i : conf.size - i);
222	+ }
223	+
224	+ return this.move(steps, time, fn);
225	+ },
226	+
227	+ prevPage: function(time, fn) {
228	+ return this.movePage(-1, time, fn);
229	+ },
230	+
231	+ nextPage: function(time, fn) {
232	+ return this.movePage(1, time, fn);
233	+ },
234	+
235	+ setPage: function(page, time, fn) {
236	+ return this.seekTo(page * conf.size, time, fn);
237	+ },
238	+
239	+ begin: function(time, fn) {
240	+ forward = false;
241	+ return this.seekTo(0, time, fn);
242	+ },
243	+
244	+ end: function(time, fn) {
245	+ forward = true;
246	+ var to = this.getSize() - conf.size;
247	+ return to > 0 ? this.seekTo(to, time, fn) : self;
248	+ },
249	+
250	+ reload: function() {
251	+ jQueryself.trigger("onReload");
252	+ return self;
253	+ },
254	+
255	+ focus: function() {
256	+ current = self;
257	+ return self;
258	+ },
259	+
260	+ click: function(i) {
261	+
262	+ var item = self.getItems().eq(i),
263	+ klass = conf.activeClass,
264	+ size = conf.size;
265	+
266	+ // check that i is sane
267	+ if (i < 0 \|\| i >= self.getSize()) { return self; }
268	+
269	+ // size == 1
270	+ if (size == 1) {
271	+ if (conf.loop) { return self.next(); }
272	+
273	+ if (i === 0 \|\| i == self.getSize() -1) {
274	+ forward = (forward === undefined) ? true : !forward;
275	+ }
276	+ return forward === false ? self.prev() : self.next();
277	+ }
278	+
279	+ // size == 2
280	+ if (size == 2) {
281	+ if (i == index) { i--; }
282	+ self.getItems().removeClass(klass);
283	+ item.addClass(klass);
284	+ return self.seekTo(i, time, fn);
285	+ }
286	+
287	+ if (!item.hasClass(klass)) {
288	+ self.getItems().removeClass(klass);
289	+ item.addClass(klass);
290	+ var delta = Math.floor(size / 2);
291	+ var to = i - delta;
292	+
293	+ // next to last item must work
294	+ if (to > self.getSize() - size) {
295	+ to = self.getSize() - size;
296	+ }
297	+
298	+ if (to !== i) {
299	+ return self.seekTo(to);
300	+ }
301	+ }
302	+
303	+ return self;
304	+ },
305	+
306	+ // bind / unbind
307	+ bind: function(name, fn) {
308	+ jQueryself.bind(name, fn);
309	+ return self;
310	+ },
311	+
312	+ unbind: function(name) {
313	+ jQueryself.unbind(name);
314	+ return self;
315	+ }
316	+
317	+ });
318	+
319	+ // callbacks
320	+ jQuery.each("onBeforeSeek,onStart,onSeek,onReload".split(","), function(i, ev) {
321	+ self[ev] = function(fn) {
322	+ return self.bind(ev, fn);
323	+ };
324	+ });
325	+
326	+
327	+ // prev button
328	+ prev.addClass(conf.disabledClass).click(function() {
329	+ self.prev();
330	+ });
331	+
332	+
333	+ // next button
334	+ next.click(function() {
335	+ self.next();
336	+ });
337	+
338	+ // prev page button
339	+ nextPage.click(function() {
340	+ self.nextPage();
341	+ });
342	+
343	+ if (self.getSize() < conf.size) {
344	+ next.add(nextPage).addClass(conf.disabledClass);
345	+ }
346	+
347	+
348	+ // next page button
349	+ prevPage.addClass(conf.disabledClass).click(function() {
350	+ self.prevPage();
351	+ });
352	+
353	+
354	+ // hover
355	+ var hc = conf.hoverClass, keyId = "keydown." + Math.random().toString().substring(10);
356	+
357	+ self.onReload(function() {
358	+
359	+ // hovering
360	+ if (hc) {
361	+ self.getItems().hover(function() {
362	+ jQuery(this).addClass(hc);
363	+ }, function() {
364	+ jQuery(this).removeClass(hc);
365	+ });
366	+ }
367	+
368	+ // clickable
369	+ if (conf.clickable) {
370	+ self.getItems().each(function(i) {
371	+ jQuery(this).unbind("click.scrollable").bind("click.scrollable", function(e) {
372	+ if (jQuery(e.target).is("a")) { return; }
373	+ return self.click(i);
374	+ });
375	+ });
376	+ }
377	+
378	+ // keyboard
379	+ if (conf.keyboard) {
380	+
381	+ // keyboard works on one instance at the time. thus we need to unbind first
382	+ jQuery(document).unbind(keyId).bind(keyId, function(evt) {
383	+
384	+ // do nothing with CTRL / ALT buttons
385	+ if (evt.altKey \|\| evt.ctrlKey) { return; }
386	+
387	+ // do nothing for unstatic and unfocused instances
388	+ if (conf.keyboard != 'static' && current != self) { return; }
389	+
390	+ var s = conf.keyboardSteps;
391	+
392	+ if (horizontal && (evt.keyCode == 37 \|\| evt.keyCode == 39)) {
393	+ self.move(evt.keyCode == 37 ? -s : s);
394	+ return evt.preventDefault();
395	+ }
396	+
397	+ if (!horizontal && (evt.keyCode == 38 \|\| evt.keyCode == 40)) {
398	+ self.move(evt.keyCode == 38 ? -s : s);
399	+ return evt.preventDefault();
400	+ }
401	+
402	+ return true;
403	+
404	+ });
405	+
406	+ } else {
407	+ jQuery(document).unbind(keyId);
408	+ }
409	+
410	+ });
411	+
412	+ self.reload();
413	+
414	+ }
415	+
416	+
417	+ // jQuery plugin implementation
418	+ jQuery.fn.scrollable = function(conf) {
419	+
420	+ // already constructed --> return API
421	+ var el = this.eq(typeof conf == 'number' ? conf : 0).data("scrollable");
422	+ if (el) { return el; }
423	+
424	+ var globals = jQuery.extend({}, jQuery.tools.scrollable.conf);
425	+ conf = jQuery.extend(globals, conf);
426	+
427	+ conf.keyboardSteps = conf.keyboardSteps \|\| conf.size;
428	+
429	+ this.each(function() {
430	+ el = new Scrollable(jQuery(this), conf);
431	+ jQuery(this).data("scrollable", el);
432	+ });
433	+
434	+ return conf.api ? el: this;
435	+
436	+ };
437	+
438	+
439	+ })(jQuery);

3.7.8/lib/tools.scrollable.mousewheel-1.0.1.js ADDED Viewed

	@@ -0,0 +1,103 @@


1	+ /**
2	+ * jQuery TOOLS plugin :: scrollable.mousewheel 1.0.1
3	+ *
4	+ * Copyright (c) 2009 Tero Piirainen
5	+ * http://flowplayer.org/tools/scrollable.html#mousewheel
6	+ *
7	+ * Dual licensed under MIT and GPL 2+ licenses
8	+ * http://www.opensource.org/licenses
9	+ *
10	+ * Launch : September 2009
11	+ * Date: jQuery{date}
12	+ * Revision: jQuery{revision}
13	+ *
14	+ *
15	+ * jquery.event.wheel.js - rev 1
16	+ * Copyright (c) 2008, Three Dub Media (http://threedubmedia.com)
17	+ * Liscensed under the MIT License (MIT-LICENSE.txt)
18	+ * http://www.opensource.org/licenses/mit-license.php
19	+ * Created: 2008-07-01 \| Updated: 2008-07-14
20	+ */
21	+ (function(jQuery) {
22	+
23	+ jQuery.fn.wheel = function( fn ){
24	+ return this[ fn ? "bind" : "trigger" ]( "wheel", fn );
25	+ };
26	+
27	+ // special event config
28	+ jQuery.event.special.wheel = {
29	+ setup: function(){
30	+ this.addEventListener('DOMMouseScroll', wheelHandler, false);
31	+ this.addEventListener('mousewheel', wheelHandler, false);
32	+ },
33	+ teardown: function(){
34	+ this.removeEventListener('DOMMouseScroll', wheelHandler, false);
35	+ this.removeEventListener('mousewheel', wheelHandler, false);
36	+ }
37	+ };
38	+
39	+ // shared event handler
40	+ function wheelHandler( event ) {
41	+
42	+ switch ( event.type ){
43	+
44	+ // FF2 has incorrect event positions
45	+ case "mousemove":
46	+ return jQuery.extend( event.data, { // store the correct properties
47	+ clientX: event.clientX, clientY: event.clientY,
48	+ pageX: event.pageX, pageY: event.pageY
49	+ });
50	+
51	+ // firefox
52	+ case "DOMMouseScroll":
53	+ jQuery.extend( event, event.data ); // fix event properties in FF2
54	+ event.delta = -event.detail / 3; // normalize delta
55	+ break;
56	+
57	+ // IE, opera, safari
58	+ case "mousewheel":
59	+ event.delta = event.wheelDelta / 120;
60	+ break;
61	+ }
62	+
63	+ var api = jQuery(this).scrollable();
64	+ event.preventDefault();
65	+ api.move(event.delta < 0 ? 1 : -1, 50);
66	+ return false;
67	+ }
68	+
69	+
70	+ // version number
71	+ var t = jQuery.tools.scrollable;
72	+ t.plugins = t.plugins \|\| {};
73	+ t.plugins.mousewheel = {
74	+ version: '1.0.1',
75	+ conf: {
76	+ api: false,
77	+ speed: 50
78	+ }
79	+ };
80	+
81	+ // scrollable mousewheel implementation
82	+ jQuery.fn.mousewheel = function(conf) {
83	+
84	+ var globals = jQuery.extend({}, t.plugins.mousewheel.conf), ret;
85	+ if (typeof conf == 'number') { conf = {speed: conf}; }
86	+ conf = jQuery.extend(globals, conf);
87	+
88	+ this.each(function() {
89	+
90	+ var api = jQuery(this).scrollable();
91	+ if (api) { ret = api; }
92	+
93	+ api.getRoot().wheel(function(e, delta) {
94	+ api.move(delta < 0 ? 1 : -1, conf.speed \|\| 50);
95	+ return false;
96	+ });
97	+ });
98	+
99	+ return conf.api ? ret : this;
100	+ };
101	+
102	+ })(jQuery);
103	+

3.7.8/readme.txt ADDED Viewed

	@@ -0,0 +1,552 @@


1	+ === Editorial Calendar ===
2	+ Contributors: cvernon, justinstresslimit, jkudish, MaryVogt, zgrossbart
3	+ Tags: posts, post, calendar, AJAX, admin, administration
4	+ Requires at least: 4.0
5	+ Tested up to: 5.6
6	+ Stable tag: 3.7.8
7	+
8	+ The Editorial Calendar makes it possible to see all your posts and drag and drop them to manage your blog.
9	+
10	+ == Description ==
11	+
12	+ Did you remember to write a post for next Tuesday? What about the Tuesday after that? WordPress doesn't make it easy to see when your posts are scheduled. The editorial calendar gives you an overview of your blog and when each post will be published. You can drag and drop to move posts, edit posts right in the calendar, and manage your entire blog.
13	+
14	+ <h4>Watch the video</h4>
15	+
16	+ [vimeo https://vimeo.com/272028435]
17	+
18	+ <h4>Try it out</h4>
19	+ Try the calendar before you install it. Check out the demo installation at <a href="http://www.zackgrossbart.com/extras/sandbox/wp-admin/edit.php?page=cal">Zack's WordPress Sandbox</a>. You can log in with the username and password test.
20	+
21	+
22	+ <h4>Features</h4>
23	+
24	+ 1. See all of your posts and when they'll be posted.
25	+ 1. Drag and drop to change your post dates.
26	+ 1. Manage your drafts with our new drafts drawer.
27	+ 1. Quickedit post titles, contents, and times.
28	+ 1. Publish posts or manage drafts.
29	+ 1. Easily see the status of your posts.
30	+ 1. Manage posts from multiple authors.
31	+
32	+ <h4>Make it better</h4>
33	+
34	+ Thank you to everyone who has given us feedback and helped us improve this plugin. If you have questions, problems, or ideas for new features please let us know at <a href="mailto:wp-edcal@googlegroups.com">wp-edcal@googlegroups.com</a>.
35	+
36	+ <h4>Translate it</h4>
37	+
38	+ Again, thanks to all who have already helped make the plugin available in so many languages. If you would like to help us translate the plugin into your language, or if you use it in a language other than English already and would like to help us keep it up to date, please write to us at <a href="mailto:wp-edcal@googlegroups.com">wp-edcal@googlegroups.com</a>
39	+
40	+ == Installation ==
41	+
42	+ 1. <b>Backup your WordPress database</b>.
43	+ 1. Upload the plugin directory <code>editorial-calendar</code> to the <code>wp-content/plugins</code> directory.
44	+ 1. Activate the plugin through the 'Plugins' menu in WordPress.
45	+ 1. Click the new 'Calendar' option under the 'Posts' menu or any other custom post types.
46	+
47	+ == Frequently Asked Questions ==
48	+
49	+ = What is an editorial calendar? =
50	+
51	+ An editorial calendar is simply a plan for your blog. It is thinking ahead about what you're going to write. There's a detailed explanation of editorial calendars at <a href="http://www.copyblogger.com/editorial-calendar/">The Easy-to-Use Tool that Helps You Build a Breakthrough Blog</a> from <a href="http://www.copyblogger.com/">Copyblogger</a>.
52	+
53	+ = What are other people saying about the calendar? =
54	+
55	+ From time to time people write articles about the editorial calendar. We appreciate every one.
56	+
57	+ <a href="http://www.dailyblogtips.com/5-reasons-youll-love-the-wordpress-editorial-calendar/">5 Reasons You’ll Love the WordPress Editorial Calendar</a> by <a href="http://www.successfulblogging.com/">Annabel Candy</a>
58	+
59	+ <a href="http://www.chrisbrogan.com/use-an-editorial-calendar/">Use An Editorial Calendar</a> by <a href="http://www.chrisbrogan.com">Chris Brogan</a>
60	+
61	+ <a href="http://www.smashingmagazine.com/2010/08/30/the-importance-of-consistency-using-editorial-calendars-and-style-guides/">Blogging For Web Designers: Editorial Calendars and Style Guides</a> by <a href="http://jessica.smashingmagazine.com/">Jessica Bordeau</a> at <a href="http://www.smashingmagazine.com/">Smashing Magazine</a>
62	+
63	+ <a href="http://mydigitalinternet.com/2010/editorial-calendar-wordpress-plugin-review">
64	+ Editorial Calendar WordPress plugin review</a> by Stephen Duckworth at <a href="http://mydigitalinternet.com/">My Digital Internet</a>
65	+
66	+ <a href="http://www.disruptiveconversations.com/2010/09/brogan-is-right-the-editorial-calendar-wordpress-plugin-truly-rocks.html">Brogan is right - the "Editorial Calendar" WordPress plugin truly rocks!</a> by <a href="http://www.danyork.com/">Dan York</a>
67	+
68	+ <a href="http://www.socialbrandingblog.com/637/editorial-calendar-plugin-for-wordpress/">Editorial Calendar Plugin for WordPress</a> by <a href="http://www.socialbrandingblog.com/">Steve Campbell</a>
69	+
70	+ <a href="http://marketplacemommies.com/2010/an-editorial-calendar-plugin-for-wordpress/">
71	+ An Editorial Calendar Plugin For WordPress</a> by <a href="http://marketplacemommies.com/">Marketplace Mommies</a>
72	+
73	+ <a href="http://www.mequoda.com/articles/editorial-strategy/editorial-calendar-wp-plugin-review/">Great WP Plugin for Online Editors: Editorial Calendar</a> by <a href="http://www.mequoda.com/">Mequoda Daily</a>
74	+
75	+ <a href="http://chrisg.org/drag-and-drop-post-scheduling-with-the-editorial-calendar-wordpress-plugin/">Drag and Drop Post Scheduling with the Editorial Calendar WordPress plugin</a> by <a href="http://chrisg.org/">Chris Garrett</a>
76	+
77	+ <a href="http://theincidentaleconomist.com/wordpress-plug-in-plug-editorial-calendar/">WordPress Plug-In Plug: Editorial Calendar</a> on <a href="http://theincidentaleconomist.com/">The Incidental Economist</a>
78	+
79	+ <a href="http://www.rezdwanhamid.com/tutorials/how-to-use-editorial-calendar-plugin-for-wordpress/">How To Use The Editorial Calendar For WordPress</a> by <a href="http://www.rezdwanhamid.com/">Rezdwan Hamid</a>
80	+
81	+ <a href="http://wordcastnet.com/2010/01/12/visually-manage-your-post-publication-dates-with-the-editorial-calendar-wordpress-plugin/">Visually Manage Your Post Publication Dates with the Editorial Calendar WordPress Plugin</a> on <a href="http://wordcastnet.com/">WordCast</a>
82	+
83	+ <a href="http://askcharlyleetham.com/blog/guest-authors/powerful-plugins-that-keep-you-organized-and-increase-your-productivity/comment-page-1#comment-5791">Powerful Plugins That Keep You Organized and Increase Your Productivity</a> at <a href="http://www.askcharlyleetham.com">askcharlyleetham.com</a>.
84	+
85	+ <a href="http://websuccessdiva.com/seo-copywriting-checklist/">SEO Copywriting Checklist for Wordpress Blogs</a> on <a href="http://websuccessdiva.com/">@WebSuccessDiva</a> is a good article about SEO and using an editorial calendar.
86	+
87	+ = Can I see a demo of the calendar? =
88	+
89	+ Check out our demo installation at <a href="http://www.zackgrossbart.com/extras/sandbox/wp-admin/edit.php?page=cal">Zack's WordPress Sandbox</a>.
90	+
91	+ = How do I get help using the calendar? =
92	+
93	+ The <a href="http://groups.google.com/group/wp-edcal">WordPress Editorial Calendar Google Group</a> is a good place to ask questions, find answers, and post feedback. We also follow the WordPress.org forum <a href="http://wordpress.org/tags/editorial-calendar?forum_id=10">Editorial Calendar discussion</a>.
94	+
95	+ = How do I navigate in the calendar? =
96	+
97	+ You can move around in the calendar using the arrows next to the months at the top or your mouse wheel. You can also move using your keyboard:
98	+
99	+ <ul>
100	+ <li>Move 1 week into the past - Up Arrow</li>
101	+ <li>Move 1 week into the future - Down Arrow</li>
102	+ <li>Jump multiple weeks into the past - Page Up or Ctrl+Up Arrow</li>
103	+ <li>Jump multiple weeks into the future - Page Down or Ctrl+Down Arrow</li>
104	+ </ul>
105	+
106	+ = How do I change the first day of the week? =
107	+
108	+ The editorial calendar follows the Week Starts On preference on the WordPress General Settings page. Choose the day you want and the calendar will use that day as the first day of the week.
109	+
110	+ = What languages does the calendar support? =
111	+
112	+ The calendar is available in Brazilian Portuguese, Croatian, Czech, Danish, Dutch, English, French, German, Greek, Hebrew, Italian, Japanese, Lithuanian, Norwegian, Polish, Russian, Spanish, and Swedish.
113	+
114	+ = Can I add new languages? =
115	+
116	+ Yes please! We are looking for translators. It only takes about 20 minutes. If you're interested please <a href="mailto:wp-edcal@googlegroups.com">contact us</a>.
117	+
118	+ = How does the calendar work =
119	+
120	+ The calendar is written in JavaScript. It contacts your blog when it scrolls to get data about your posts. Just like Google Maps. <a href="http://www.zackgrossbart.com/hackito/edcal/">Creating a JQuery Powered Posts Calendar for WordPress</a> explains a lot of the technical details.
121	+
122	+ = Is the calendar collecting data about my blog? =
123	+
124	+ After you use the calendar a few times we'll prompt you to let us collect a little data about your blog. Information like the size of your browser window and the number of posts you have per day help us make the calendar even better.
125	+
126	+ The collected data is all available to the public. Check out the <a href="http://www.zackgrossbart.com/edcal/mint/">Editorial Calendar Statistics</a>.
127	+
128	+ = What users can use the calendar? =
129	+
130	+ The editorial calendar works differently based on your permissions.
131	+
132	+ * Administrators and Editors can use every feature available in the calendar.
133	+ * Authors can use the calendar to edit, move, and publish their own posts, but other people's posts are read-only.
134	+ * Contributors see everyone's posts and move their own posts, but can only save drafts.
135	+ * Subscribers can't see the calendar.
136	+
137	+ You can see how it looks for different users on our <a href="http://www.zackgrossbart.com/extras/sandbox/wp-admin/edit.php?page=cal">Zack's WordPress Sandbox</a> with the following users:
138	+
139	+ * edgar the Editor
140	+ * alice the Author
141	+ * conrad the Contributor
142	+ * sam the Subscriber
143	+
144	+ Each of these users has the password test.
145	+
146	+ = Can I use the editorial calendar with pages? =
147	+
148	+ Right now the calendar only supports posts. We're considering adding pages. If you would like to see pages show up in the calendar let us know.
149	+
150	+ = Does the calendar support group blogs? =
151	+
152	+ If your blog has multiple authors the calendar will work just fine. You can show author names right in the calendar. Just look under screen options.
153	+
154	+ We are currently working on new features for multi-author blogs. If you have any ideas please <a href="mailto:wp-edcal@googlegroups.com">contact us</a>.
155	+
156	+ = Can my readers tell I'm using the editorial calendar? =
157	+
158	+ No. The calendar is only an administration tool. None of your readers will know you're running it unless you tell them.
159	+
160	+ = Why can't I move published posts? =
161	+
162	+ Moving published posts can cause problems with some RSS feeds and is generally not a very popular thing to do. The calendar only allows you to move scheduled and draft posts.
163	+
164	+ = Can I change post colors or styles in the calendar? =
165	+
166	+ You can style the posts in the calendar with CSS on your blog. The calendar adds a new CSS class to your post for every catalog. The class is based on the slug for the category.
167	+
168	+ For example, if you have a category named "My Category" you might have a slug for it named "my-category". Then you can make all posts with that category show up as red in the calendar with CSS like this:
169	+
170	+ <pre>
171	+ .post.my-category {
172	+ color: red;
173	+ }
174	+ </pre>
175	+
176	+ You can use any CSS properties to change posts in the calendar based on the post category.
177	+
178	+ = Can I change default post time or status when creating new posts? =
179	+
180	+ The calendar allows you to create new posts. The default time for this new posts is 10:00 AM and the default status for this new posts is draft. You can change those values by specifying options in your blog.
181	+
182	+ The `edcal_default_time` property controls the default time for new posts in the calendar. This value is in 24 hour time and you can change it by specifying the time in a format like `11:00`.
183	+
184	+ The `edcal_default_status` property controls the default status for new posts in the calendar. The allowed values are `draft`, `future`, and `pending` for the statuses of `Draft`, `Scheduled`, and `Pending Review` respectively. This value will only be used if the current user doesn't have access to change that status. For example, if you're an author then you can't use a default status of `pending` since you aren't allowed to publish posts.
185	+
186	+ == Screenshots ==
187	+
188	+ 1. The calendar integrates seamlessly into the WordPress administration console
189	+ 2. See the big picture with a view of all your posts and when they'll be published.
190	+ 3. Drag and drop posts to easily change dates and take control of your blog.
191	+ 4. Create, edit, and schedule posts in one simple quickedit dialog.
192	+ 5. Show as much or as little of your blog as you like.
193	+ 6. Use a special calendar for each custom post type on your blog.
194	+ 7. Use the new unscheduled drafts section to manage drafts before you schedule them.
195	+
196	+ == Changelog ==
197	+
198	+
199	+ = 3.7.8 =
200	+
201	+ This version fixes a CSS layout issue so the calendar works with WordPress 5.6.
202	+
203	+ = 3.7.7 =
204	+
205	+ This version tweaks the libraries that support the calendar to avoid warnings from the Enable jQuery Migrate Helper plugin.
206	+
207	+ = 3.7.5 =
208	+
209	+ The calendar now support quick edit when a post has either a title or content instead of requiring a title.
210	+
211	+ = 3.7.4 =
212	+
213	+ Fixed a specific issue which made the calendar show up as right to left instead of left to right in Dutch.
214	+
215	+ = 3.7.3 =
216	+
217	+ We are now making sure to set the correct right to left and left to right orientation in every language file.
218	+
219	+ = 3.7.2 =
220	+
221	+ This version fixes an error with the drafts drawer that broke compatibility with WordPress 5.0.
222	+
223	+ = 3.7.1 =
224	+
225	+ We now have an option so you can choose if you want to scroll the calendar with the mouse wheel or not.
226	+
227	+ = 3.7 =
228	+
229	+ The calendar no longer responds to the mouse wheel. We did some user testing and it was a better experience without having to worry about the mouse wheel.
230	+
231	+ The current date range is now doing a better display job and not jumping around when the date changes.
232	+
233	+ = 3.6.8 =
234	+
235	+ The calendar now properly shows scrollbars for individual days when there are too many posts in a single day.
236	+
237	+ The calendar is now showing the correct left to right orientation in Turkish.
238	+
239	+ = 3.6.7 =
240	+
241	+ The calendar is now showing in the correct left to right orientation in Japanese.
242	+
243	+ = 3.6.6 =
244	+
245	+ Added a new video and did complete testing to make sure the calendar is fully compatible with the latest version of WordPress.
246	+
247	+ = 3.6.5 =
248	+
249	+ The calendar will no longer prompt new users to collect data about how they use the calendar. We have all the data we need for now.
250	+
251	+ The calendar has now been updated and tested for WordPress version 4.9.1.
252	+
253	+ = 3.6.4 =
254	+
255	+ The calendar has now been updated and tested for WordPress version 4.8.
256	+
257	+ = 3.6.3 =
258	+
259	+ The calendar has now been updated and tested for WordPress version 4.7.
260	+
261	+ = 3.6.2 =
262	+
263	+ The calendar has now been updated and tested for WordPress version 4.5.
264	+
265	+ We have a new translation in turkish with updated strings and language fixes.
266	+
267	+ = 3.6.1 =
268	+
269	+ The calendar has now been updated and tested for WordPress version 4.4.
270	+
271	+ = 3.6 =
272	+
273	+ The calendar has now been updated and tested for WordPress version 4.3.1.
274	+
275	+ = 3.5 =
276	+
277	+ The calendar has now been translated into Turkish and updated for WordPress version 4.2.
278	+
279	+ = 3.4 =
280	+
281	+ The calendar has now been translated into Danish. Thank you to our Danish translator Thomas Christensen.
282	+
283	+ = 3.3 =
284	+
285	+ This version fixes an error handling apostrophes and ampersands in post titles in WordPress 4.0.
286	+
287	+ = 3.2 =
288	+
289	+ We now have a new option for specifying the default status of a new post and documented the option for specifying the default time of a post.
290	+
291	+ The calendar is now doing a better job of reporting errors when it can't parse the post information from the blog.
292	+
293	+ = 3.1.1 =
294	+
295	+ This version is exactly the same as version 3.1, but it's been fully tested against WordPress 3.9.
296	+
297	+ = 3.1 =
298	+
299	+ The calendar now adds the category slugs for each post as a class for the line of that post in the calendar.
300	+
301	+ The calendar has a new option called edcal_custom_posts_public to control if the calendar shows for private custom posts or not.
302	+
303	+ = 3.0 =
304	+
305	+ This version makes a few small bug fixes to work well with WordPress 3.8. This includes showing the screen options with some better formatting and deleting posts from the drafts drawer properly.
306	+
307	+ = 2.9 =
308	+
309	+ Version 2.9 is another testing release. This version makes sure everything works great with WordPress 3.7.1.
310	+
311	+ = 2.8 =
312	+
313	+ Version 2.8 is all about testing. This version makes sure everything works great with WordPress 3.6 and jQuery 2.0. It also has a couple of small bug fixes.
314	+
315	+ = 2.7 =
316	+
317	+ The calendar is now available in Italian thanks to Lorenzo Boldorini who blogs at http://www.webqbe.it.
318	+
319	+ Changed all calls of the jQuery live method to use the new on method so the calendar will keep working when WordPress upgrades to jQuery 1.9.
320	+
321	+ The Mozilla team is now using the Editorial Calendar in one of their blogs and performed a security review of the calendar. They found a couple of potential issues which were fixed in this release. https://bugzilla.mozilla.org/show_bug.cgi?id=738112
322	+
323	+ The Editorial Calendar is now stripping all tags out of post titles created from the calendar. This fixes a potential security issue found by the Mozilla security testing team. https://bugzilla.mozilla.org/show_bug.cgi?id=738112
324	+
325	+ We are now preventing a potential SQL injection attack with the start date and end date filter when querying posts. This fixes a potential security issue found by the Mozilla security testing team. https://bugzilla.mozilla.org/show_bug.cgi?id=738112
326	+
327	+ We are adding an extra check to make sure that authors can't delete a post created by another author. This fixes a potential security issue found by the Mozilla security testing team. https://bugzilla.mozilla.org/show_bug.cgi?id=738112
328	+
329	+ = 2.6 =
330	+
331	+ Fixed some layout issues with the previous and next calendar buttons in WordPress 3.5.
332	+
333	+ We are now properly saving new posts in the drafts drawer in WordPress 3.5.
334	+
335	+ Added unit tests to cover creating a new post in the drafts drawer.
336	+
337	+ Added a few performance improvements to the calendar like making sure we only load our code in the admin console.
338	+
339	+ = 2.5 =
340	+
341	+ The calendar is now handling the post ID in the same way for each call it uses to get data about each post when returning post data to the calendar to avoid some PHP warnings.
342	+
343	+ The calendar is now more careful about PHP warnings so it still works if the blog is set to show PHP warnings.
344	+
345	+ The unit tests are now using the correct CSS reference so they show up properly.
346	+
347	+ Moved the setting for the default post time to the edcal.php so it's easier to change without recompiling the JavaScript.
348	+
349	+ The calendar now supports Russian thanks to Danny Zawacki and Lyudmila Kostryka. Danny blogs at http://dannyzawacki.com
350	+
351	+ We have started to namespace css classes to avoid conflicts with other plugins & themes.
352	+
353	+ = 2.4 =
354	+
355	+ Creating a new unscheduled draft is now working properly from the calendar.
356	+
357	+ = 2.3 =
358	+
359	+ The calendar is now loading relative URLs for CSS, JavaScript, and image files using the right API so they load properly when using SSL.
360	+
361	+ = 2.2.1 =
362	+
363	+ Fixed a memory leak in the calendar where the calendar doesn't load if you have too many posts in your blog.
364	+
365	+ = 2.2 =
366	+
367	+ The calendar is using JavaScript compression to load less data and run faster.
368	+
369	+ We've added a new me