Event Tickets - Version 5.3.0

Version Description

Release Info

Developer	bordoni
Plugin	Event Tickets
Version	5.3.0
Comparing to
See all releases

Code changes from version 5.2.4.1 to 5.3.0

Files changed (198) hide show

common/lang/tribe-common.pot +52 -52
common/node_modules/clipboard/dist/clipboard.min.js +7 -0
common/src/Tribe/Admin/Notices.php +1 -1
common/src/Tribe/Assets.php +40 -4
common/src/Tribe/Field.php +8 -7
common/src/Tribe/Main.php +4 -2
common/src/Tribe/PUE/Checker.php +33 -0
common/src/Tribe/Values/Abstract_Value.php +8 -0
common/src/Tribe/Values/Value_Calculation.php +1 -1
common/src/Tribe/Values/Value_Interface.php +9 -0
common/src/resources/images/mascot.png +0 -0
common/src/resources/js/admin/help-page.js +1 -1
common/vendor/autoload.php +1 -1
common/vendor/autoload_52.php +1 -1
common/vendor/clipboard/clipboard.min.js +0 -7
common/vendor/composer/autoload_real.php +4 -4
common/vendor/composer/autoload_real_52.php +3 -3
common/vendor/composer/autoload_static.php +5 -5
common/vendor/ky/ky.min.js +8 -0
common/vendor/ky/tec-ky.js +2 -0
event-tickets.php +1 -1
lang/event-tickets.pot +716 -205
readme.txt +22 -65
src/Tickets/Commerce/Abstract_Order.php +111 -1
src/Tickets/Commerce/Abstract_Settings.php +0 -29
src/Tickets/Commerce/Admin/Featured_Settings.php +65 -0
src/Tickets/Commerce/Admin/Notices.php +0 -61
src/Tickets/Commerce/Assets.php +19 -0
src/Tickets/Commerce/Gateways/Abstract_Gateway.php +0 -80
src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php +305 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_Merchant.php +81 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_REST_Endpoint.php +86 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_Requests.php +172 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_Settings.php +57 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_Signup.php +100 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_Webhooks.php +108 -0
src/Tickets/Commerce/Gateways/Contracts/Abstract_WhoDat.php +127 -0
src/Tickets/Commerce/Gateways/Contracts/Gateway_Interface.php +127 -0
src/Tickets/Commerce/Gateways/Contracts/Merchant_Interface.php +53 -0
src/Tickets/Commerce/Gateways/Contracts/REST_Endpoint_Interface.php +41 -0
src/Tickets/Commerce/Gateways/Contracts/Requests_Interface.php +121 -0
src/Tickets/Commerce/Gateways/Contracts/Signup_Interface.php +64 -0
src/Tickets/Commerce/Gateways/Contracts/Webhook_Event_Interface.php +25 -0
src/Tickets/Commerce/Gateways/Contracts/WhoDat_Interface.php +65 -0
src/Tickets/Commerce/Gateways/Interface_Gateway.php +0 -77
src/Tickets/Commerce/Gateways/Manager.php +10 -2
src/Tickets/Commerce/Gateways/Manual/Gateway.php +10 -1
src/Tickets/Commerce/Gateways/PayPal/Assets.php +4 -1
src/Tickets/Commerce/Gateways/PayPal/Buttons.php +10 -71
src/Tickets/Commerce/Gateways/PayPal/Gateway.php +78 -102
src/Tickets/Commerce/Gateways/PayPal/Hooks.php +1 -43
src/Tickets/Commerce/Gateways/PayPal/Merchant.php +2 -63
src/Tickets/Commerce/Gateways/PayPal/REST/On_Boarding_Endpoint.php +10 -80
src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php +12 -55
src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php +2 -32
src/Tickets/Commerce/Gateways/PayPal/Settings.php +11 -8
src/Tickets/Commerce/Gateways/PayPal/Signup.php +4 -89
src/Tickets/Commerce/Gateways/PayPal/Webhooks.php +11 -66
src/Tickets/Commerce/Gateways/PayPal/WhoDat.php +7 -108
src/Tickets/Commerce/Gateways/Stripe/Application_Fee.php +53 -0
src/Tickets/Commerce/Gateways/Stripe/Assets.php +185 -0
src/Tickets/Commerce/Gateways/Stripe/Gateway.php +128 -0
src/Tickets/Commerce/Gateways/Stripe/Hooks.php +204 -0
src/Tickets/Commerce/Gateways/Stripe/Merchant.php +436 -0
src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php +307 -0
src/Tickets/Commerce/Gateways/Stripe/Payment_Intent_Handler.php +218 -0
src/Tickets/Commerce/Gateways/Stripe/Provider.php +66 -0
src/Tickets/Commerce/Gateways/Stripe/REST.php +33 -0
src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php +346 -0
src/Tickets/Commerce/Gateways/Stripe/REST/Return_Endpoint.php +192 -0
src/Tickets/Commerce/Gateways/Stripe/REST/Webhook_Endpoint.php +156 -0
src/Tickets/Commerce/Gateways/Stripe/Requests.php +64 -0
src/Tickets/Commerce/Gateways/Stripe/Settings.php +489 -0
src/Tickets/Commerce/Gateways/Stripe/Signup.php +108 -0
src/Tickets/Commerce/Gateways/Stripe/Status.php +166 -0
src/Tickets/Commerce/Gateways/Stripe/Stripe_Elements.php +64 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks.php +218 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/Account_Webhook.php +82 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/Charge_Webhook.php +55 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php +283 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php +134 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php +126 -0
src/Tickets/Commerce/Gateways/Stripe/Webhooks/events.json +195 -0
src/Tickets/Commerce/Gateways/Stripe/WhoDat.php +99 -0
src/Tickets/Commerce/Hooks.php +16 -0
src/Tickets/Commerce/Module.php +1 -1
src/Tickets/Commerce/Order.php +63 -29
src/Tickets/Commerce/Payments_Tab.php +323 -45
src/Tickets/Commerce/Provider.php +1 -0
src/Tickets/Commerce/Settings.php +113 -5
src/Tickets/Commerce/Shortcodes/Checkout_Shortcode.php +8 -5
src/Tickets/Commerce/Status/Action_Required.php +2 -2
src/Tickets/Commerce/Status/Denied.php +14 -7
src/Tickets/Commerce/Status/Pending.php +5 -0
src/Tickets/Commerce/Status/Refunded.php +14 -7
src/Tickets/Commerce/Status/Reversed.php +14 -7
src/Tickets/Commerce/Status/Status_Abstract.php +14 -0
src/Tickets/Commerce/Status/Status_Handler.php +1 -0
src/Tickets/Commerce/Status/Status_Interface.php +9 -0
src/Tickets/Commerce/Status/Voided.php +14 -7
src/Tickets/Commerce/Traits/Has_Mode.php +4 -0
src/Tickets/Commerce/Utils/Currency.php +235 -105
src/Tickets/Commerce/Utils/Value.php +1 -1
src/Tribe/Editor/Provider.php +1 -1
src/Tribe/Main.php +1 -1
src/Tribe/Plugin_Register.php +1 -1
src/admin-views/settings/featured/container.php +24 -0
src/admin-views/settings/featured/content.php +18 -0
src/admin-views/settings/featured/description.php +18 -0
src/admin-views/settings/featured/link.php +34 -0
src/admin-views/settings/featured/links.php +23 -0
src/admin-views/settings/featured/title.php +18 -0
src/admin-views/settings/section/link.php +27 -0
src/admin-views/settings/section/menu.php +30 -0
src/admin-views/settings/tickets-commerce/gateways/brand.php +36 -0
src/admin-views/settings/tickets-commerce/gateways/button.php +52 -0
src/admin-views/settings/tickets-commerce/gateways/container.php +26 -0
src/admin-views/settings/tickets-commerce/gateways/item.php +34 -0
src/admin-views/settings/tickets-commerce/gateways/status.php +33 -0
src/admin-views/settings/tickets-commerce/gateways/toggle.php +24 -0
src/admin-views/settings/tickets-commerce/paypal/connect/active.php +3 -2
src/admin-views/settings/tickets-commerce/paypal/connect/active/actions.php +5 -4
src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token.php +12 -3
src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-connection.php +20 -11
src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info.php +12 -3
src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-webhook.php +12 -3
src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php +16 -8
src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php +7 -6
src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php +9 -8
src/admin-views/settings/tickets-commerce/paypal/connect/help-links.php +4 -3
src/admin-views/settings/tickets-commerce/paypal/connect/help-links/configuring.php +2 -2
src/admin-views/settings/tickets-commerce/paypal/connect/help-links/troubleshooting.php +2 -2
src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php +5 -4
src/admin-views/settings/tickets-commerce/paypal/connect/logo.php +3 -2
src/admin-views/settings/tickets-commerce/paypal/connect/logo/image.php +4 -3
src/admin-views/settings/tickets-commerce/paypal/main.php +5 -4
src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete.php +2 -2
src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php +3 -2
src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode.php +4 -3
src/admin-views/settings/tickets-commerce/paypal/signup-link.php +4 -4
src/admin-views/settings/tickets-commerce/stripe/connect/active.php +32 -0
src/admin-views/settings/tickets-commerce/stripe/connect/active/button.php +34 -0
src/admin-views/settings/tickets-commerce/stripe/connect/active/connection.php +38 -0
src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-currency.php +60 -0
src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php +77 -0
src/admin-views/settings/tickets-commerce/stripe/connect/help-links.php +23 -0
src/admin-views/settings/tickets-commerce/stripe/connect/help-links/configuring.php +29 -0
src/admin-views/settings/tickets-commerce/stripe/connect/help-links/troubleshooting.php +24 -0
src/admin-views/settings/tickets-commerce/stripe/connect/inactive.php +35 -0
src/admin-views/settings/tickets-commerce/stripe/connect/logo.php +23 -0
src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php +29 -0
src/admin-views/settings/tickets-commerce/stripe/connect/logo/image.php +24 -0
src/admin-views/settings/tickets-commerce/stripe/main.php +39 -0
src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete.php +42 -0
src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php +72 -0
src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/notice-test-mode.php +25 -0
src/admin-views/settings/tickets-commerce/stripe/signup-link.php +26 -0
src/resources/css/tickets-admin-settings.css +285 -73
src/resources/css/tickets-admin-settings.min.css +1 -1
src/resources/css/tickets-commerce.css +69 -0
src/resources/css/tickets-commerce.min.css +1 -1
src/resources/css/tickets-commerce/admin/gateway/stripe/webhooks.css +30 -0
src/resources/css/tickets-commerce/admin/gateway/stripe/webhooks.min.css +1 -0
src/resources/css/tickets-commerce/gateway/paypal.css +4 -0
src/resources/css/tickets-commerce/gateway/paypal.min.css +1 -1
src/resources/css/tickets-commerce/gateway/stripe.css +717 -0
src/resources/css/tickets-commerce/gateway/stripe.min.css +1 -0
src/resources/images/admin/stripe-logo.png +0 -0
src/resources/images/{background-paypal-connect.png → background-gateway-connect.png} +0 -0
src/resources/js/admin/gateway/stripe/webhooks.js +151 -0
src/resources/js/admin/tickets-commerce-settings.js +10 -3
src/resources/js/commerce/gateway/paypal/checkout.js +47 -29
src/resources/js/commerce/gateway/stripe/checkout.js +621 -0
src/resources/js/commerce/gateway/toggler.js +227 -0
src/resources/js/v2/tickets-commerce.js +26 -0
src/resources/postcss/tickets-admin/settings/_tickets-commerce.pcss +248 -37
src/resources/postcss/tickets-commerce/_checkout.pcss +71 -0
src/resources/postcss/tickets-commerce/admin/gateway/stripe/webhooks.pcss +24 -0
src/resources/postcss/tickets-commerce/gateway/paypal/_advanced-payments.pcss +4 -0
src/resources/postcss/tickets-commerce/gateway/stripe.pcss +8 -0
src/resources/postcss/tickets-commerce/gateway/stripe/_all.pcss +7 -0
src/resources/postcss/tickets-commerce/gateway/stripe/_stripe.pcss +62 -0
src/views/tickets/email.php +3 -1
src/views/v2/commerce/checkout.php +13 -10
src/views/v2/commerce/checkout/cart.php +12 -11
src/views/v2/commerce/checkout/footer/gateway-error.php +2 -1
src/views/v2/commerce/checkout/gateways.php +47 -0
src/views/v2/commerce/checkout/purchaser-info.php +30 -0
src/views/v2/commerce/checkout/purchaser-info/email.php +50 -0
src/views/v2/commerce/checkout/purchaser-info/name.php +45 -0
src/views/v2/commerce/gateway/paypal/container.php +34 -0
src/views/v2/commerce/gateway/stripe/card-element.php +62 -0
src/views/v2/commerce/gateway/stripe/container.php +33 -0
src/views/v2/commerce/gateway/stripe/payment-element.php +40 -0
vendor/autoload.php +1 -1
vendor/composer/autoload_classmap.php +40 -3
vendor/composer/autoload_real.php +4 -4
vendor/composer/autoload_static.php +44 -7

common/lang/tribe-common.pot CHANGED Viewed

	@@ -2,13 +2,13 @@
2	# This file is distributed under the same license as the Tribe Common package.
3	msgid ""
4	msgstr ""
5	- "Project-Id-Version: Tribe Common 4.14.13\n"
6	"Report-Msgid-Bugs-To: http://m.tri.be/191x\n"
7	- "POT-Creation-Date: 2022-02-09 17:15:40+00:00\n"
8	"MIME-Version: 1.0\n"
9	"Content-Type: text/plain; charset=UTF-8\n"
10	"Content-Transfer-Encoding: 8bit\n"
11	- "PO-Revision-Date: 2022-02-09 17:15\n"
12	"Last-Translator: \n"
13	"Language-Team: \n"
14
	@@ -58,7 +58,7 @@ msgctxt "Error status label for system info optin"
58	msgid "Status:"
59	msgstr ""
60
61	- #. #-#-#-#-# tribe-common.pot (Tribe Common 4.14.13) #-#-#-#-#
62	#. Author of the plugin/theme
63	#: src/Tribe/Admin/Help_Page.php:82 src/Tribe/Customizer.php:666
64	#: src/Tribe/Plugins_API.php:25 src/admin-views/help-calendar.php:97
	@@ -1003,19 +1003,19 @@ msgid ""
1003	"and you should likely delete it."
1004	msgstr ""
1005
1006	- #: src/Tribe/Field.php:~~234~~
1007	msgid "Invalid field type specified"
1008	msgstr ""
1009
1010	- #: src/Tribe/Field.php:~~544~~
1011	msgid "No radio options specified"
1012	msgstr ""
1013
1014	- #: src/Tribe/Field.php:~~580~~
1015	msgid "No checkbox options specified"
1016	msgstr ""
1017
1018	- #: src/Tribe/Field.php:~~642~~
1019	msgid "No select options specified"
1020	msgstr ""
1021
	@@ -2239,188 +2239,188 @@ msgstr ""
2239	msgid "Full debug (all events)"
2240	msgstr ""
2241
2242	- #: src/Tribe/Main.php:~~333~~
2243	msgid ": activate to sort column ascending"
2244	msgstr ""
2245
2246	- #: src/Tribe/Main.php:~~334~~
2247	msgid ": activate to sort column descending"
2248	msgstr ""
2249
2250	- #: src/Tribe/Main.php:~~336~~
2251	msgid "Show _MENU_ entries"
2252	msgstr ""
2253
2254	- #: src/Tribe/Main.php:~~337~~
2255	msgid "No data available in table"
2256	msgstr ""
2257
2258	- #: src/Tribe/Main.php:~~338~~
2259	msgid "Showing _START_ to _END_ of _TOTAL_ entries"
2260	msgstr ""
2261
2262	- #: src/Tribe/Main.php:~~339~~
2263	msgid "Showing 0 to 0 of 0 entries"
2264	msgstr ""
2265
2266	- #: src/Tribe/Main.php:~~340~~
2267	msgid "(filtered from _MAX_ total entries)"
2268	msgstr ""
2269
2270	- #: src/Tribe/Main.php:~~341~~
2271	msgid "No matching records found"
2272	msgstr ""
2273
2274	- #: src/Tribe/Main.php:~~342~~
2275	msgid "Search:"
2276	msgstr ""
2277
2278	- #: src/Tribe/Main.php:~~343~~
2279	msgid "All items on this page were selected. "
2280	msgstr ""
2281
2282	- #: src/Tribe/Main.php:~~344~~
2283	msgid "Select all pages"
2284	msgstr ""
2285
2286	- #: src/Tribe/Main.php:~~345~~
2287	msgid "Clear Selection."
2288	msgstr ""
2289
2290	- #: src/Tribe/Main.php:~~347~~
2291	msgid "All"
2292	msgstr ""
2293
2294	- #: src/Tribe/Main.php:~~348~~ src/Tribe/Main.php:~~365~~
2295	msgid "Next"
2296	msgstr ""
2297
2298	- #: src/Tribe/Main.php:~~349~~
2299	msgid "Previous"
2300	msgstr ""
2301
2302	- #: src/Tribe/Main.php:~~354~~
2303	msgid ": Selected %d rows"
2304	msgstr ""
2305
2306	- #: src/Tribe/Main.php:~~355~~
2307	msgid ": Selected 1 row"
2308	msgstr ""
2309
2310	- #: src/Tribe/Main.php:~~366~~
2311	msgid "Prev"
2312	msgstr ""
2313
2314	- #: src/Tribe/Main.php:~~367~~ src/Tribe/Main.php:~~369~~
2315	msgid "Today"
2316	msgstr ""
2317
2318	- #: src/Tribe/Main.php:~~368~~
2319	msgid "Done"
2320	msgstr ""
2321
2322	- #: src/Tribe/Main.php:~~370~~
2323	msgid "Clear"
2324	msgstr ""
2325
2326	- #: src/Tribe/PUE/Checker.php:~~500~~
2327	msgid "A valid license key is required for support and updates"
2328	msgstr ""
2329
2330	- #: src/Tribe/PUE/Checker.php:~~503~~
2331	msgid ""
2332	"%1$sBuy a license%2$s for the Event Aggregator service to access additional "
2333	"import features."
2334	msgstr ""
2335
2336	- #: src/Tribe/PUE/Checker.php:~~515~~ src/Tribe/PUE/Checker.php:~~526~~
2337	#: src/admin-views/troubleshooting/ea-status/license-key.php:44
2338	msgid "License Key"
2339	msgstr ""
2340
2341	- #: src/Tribe/PUE/Checker.php:~~535~~ src/Tribe/PUE/Checker.php:~~569~~
2342	msgid "License Key Status:"
2343	msgstr ""
2344
2345	- #: src/Tribe/PUE/Checker.php:~~544~~
2346	msgid "Override network license key"
2347	msgstr ""
2348
2349	- #: src/Tribe/PUE/Checker.php:~~545~~
2350	msgid ""
2351	"Check this box if you wish to override the network license key with your own"
2352	msgstr ""
2353
2354	- #: src/Tribe/PUE/Checker.php:~~556~~
2355	msgid "Site License Key"
2356	msgstr ""
2357
2358	- #: src/Tribe/PUE/Checker.php:~~656~~
2359	msgid "License key(s) updated."
2360	msgstr ""
2361
2362	- #: src/Tribe/PUE/Checker.php:~~910~~
2363	msgid ""
2364	"Hmmm... something's wrong with this validator. Please contact %ssupport%s."
2365	msgstr ""
2366
2367	- #: src/Tribe/PUE/Checker.php:~~923~~
2368	msgid "unknown date"
2369	msgstr ""
2370
2371	- #: src/Tribe/PUE/Checker.php:~~929~~
2372	msgid "Sorry, key validation server is not available."
2373	msgstr ""
2374
2375	- #: src/Tribe/PUE/Checker.php:~~949~~
2376	msgid "Valid Key! Expires on %s"
2377	msgstr ""
2378
2379	- #: src/Tribe/PUE/Checker.php:~~954~~
2380	msgid "Thanks for setting up a valid key. It will expire on %s"
2381	msgstr ""
2382
2383	- #: src/Tribe/PUE/Checker.php:~~981~~ src/Tribe/PUE/Notices.php:342
2384	msgid "Renew Your License Now"
2385	msgstr ""
2386
2387	- #: src/Tribe/PUE/Checker.php:~~983~~ src/Tribe/PUE/Notices.php:344
2388	msgid " (opens in a new window)"
2389	msgstr ""
2390
2391	- #: src/Tribe/PUE/Checker.php:~~1000~~
2392	msgid "Please refresh the page and try your request again."
2393	msgstr ""
2394
2395	- #: src/Tribe/PUE/Checker.php:~~1020~~
2396	msgid ""
2397	"There is an update for %s. You'll need to %scheck your license%s to have "
2398	"access to updates, downloads, and support."
2399	msgstr ""
2400
2401	- #: src/Tribe/PUE/Checker.php:~~1077~~
2402	msgid ""
2403	"There is an update for %s. %sRenew your license%s to get access to bug "
2404	"fixes, security updates, and new features."
2405	msgstr ""
2406
2407	- #: src/Tribe/PUE/Checker.php:~~1107~~
2408	msgid "Update now to version %s."
2409	msgstr ""
2410
2411	- #: src/Tribe/PUE/Checker.php:~~1118~~
2412	msgid "There is a new version of %1$s available. %2$s"
2413	msgstr ""
2414
2415	- #: src/Tribe/PUE/Checker.php:~~1699~~
2416	msgid "A valid license has been entered by your network administrator."
2417	msgstr ""
2418
2419	- #: src/Tribe/PUE/Checker.php:~~1700~~
2420	msgid "No license entered. Consult your network administrator."
2421	msgstr ""
2422
2423	- #: src/Tribe/PUE/Checker.php:~~1701~~
2424	msgid "Expired license. Consult your network administrator."
2425	msgstr ""
2426


2	# This file is distributed under the same license as the Tribe Common package.
3	msgid ""
4	msgstr ""
5	+ "Project-Id-Version: Tribe Common 4.14.14\n"
6	"Report-Msgid-Bugs-To: http://m.tri.be/191x\n"
7	+ "POT-Creation-Date: 2022-02-23 17:47:45+00:00\n"
8	"MIME-Version: 1.0\n"
9	"Content-Type: text/plain; charset=UTF-8\n"
10	"Content-Transfer-Encoding: 8bit\n"
11	+ "PO-Revision-Date: 2022-02-23 17:47\n"
12	"Last-Translator: \n"
13	"Language-Team: \n"
14

58	msgid "Status:"
59	msgstr ""
60
61	+ #. #-#-#-#-# tribe-common.pot (Tribe Common 4.14.14) #-#-#-#-#
62	#. Author of the plugin/theme
63	#: src/Tribe/Admin/Help_Page.php:82 src/Tribe/Customizer.php:666
64	#: src/Tribe/Plugins_API.php:25 src/admin-views/help-calendar.php:97

1003	"and you should likely delete it."
1004	msgstr ""
1005
1006	+ #: src/Tribe/Field.php:235
1007	msgid "Invalid field type specified"
1008	msgstr ""
1009
1010	+ #: src/Tribe/Field.php:545
1011	msgid "No radio options specified"
1012	msgstr ""
1013
1014	+ #: src/Tribe/Field.php:581
1015	msgid "No checkbox options specified"
1016	msgstr ""
1017
1018	+ #: src/Tribe/Field.php:643
1019	msgid "No select options specified"
1020	msgstr ""
1021

2239	msgid "Full debug (all events)"
2240	msgstr ""
2241
2242	+ #: src/Tribe/Main.php:335
2243	msgid ": activate to sort column ascending"
2244	msgstr ""
2245
2246	+ #: src/Tribe/Main.php:336
2247	msgid ": activate to sort column descending"
2248	msgstr ""
2249
2250	+ #: src/Tribe/Main.php:338
2251	msgid "Show _MENU_ entries"
2252	msgstr ""
2253
2254	+ #: src/Tribe/Main.php:339
2255	msgid "No data available in table"
2256	msgstr ""
2257
2258	+ #: src/Tribe/Main.php:340
2259	msgid "Showing _START_ to _END_ of _TOTAL_ entries"
2260	msgstr ""
2261
2262	+ #: src/Tribe/Main.php:341
2263	msgid "Showing 0 to 0 of 0 entries"
2264	msgstr ""
2265
2266	+ #: src/Tribe/Main.php:342
2267	msgid "(filtered from _MAX_ total entries)"
2268	msgstr ""
2269
2270	+ #: src/Tribe/Main.php:343
2271	msgid "No matching records found"
2272	msgstr ""
2273
2274	+ #: src/Tribe/Main.php:344
2275	msgid "Search:"
2276	msgstr ""
2277
2278	+ #: src/Tribe/Main.php:345
2279	msgid "All items on this page were selected. "
2280	msgstr ""
2281
2282	+ #: src/Tribe/Main.php:346
2283	msgid "Select all pages"
2284	msgstr ""
2285
2286	+ #: src/Tribe/Main.php:347
2287	msgid "Clear Selection."
2288	msgstr ""
2289
2290	+ #: src/Tribe/Main.php:349
2291	msgid "All"
2292	msgstr ""
2293
2294	+ #: src/Tribe/Main.php:350 src/Tribe/Main.php:367
2295	msgid "Next"
2296	msgstr ""
2297
2298	+ #: src/Tribe/Main.php:351
2299	msgid "Previous"
2300	msgstr ""
2301
2302	+ #: src/Tribe/Main.php:356
2303	msgid ": Selected %d rows"
2304	msgstr ""
2305
2306	+ #: src/Tribe/Main.php:357
2307	msgid ": Selected 1 row"
2308	msgstr ""
2309
2310	+ #: src/Tribe/Main.php:368
2311	msgid "Prev"
2312	msgstr ""
2313
2314	+ #: src/Tribe/Main.php:369 src/Tribe/Main.php:371
2315	msgid "Today"
2316	msgstr ""
2317
2318	+ #: src/Tribe/Main.php:370
2319	msgid "Done"
2320	msgstr ""
2321
2322	+ #: src/Tribe/Main.php:372
2323	msgid "Clear"
2324	msgstr ""
2325
2326	+ #: src/Tribe/PUE/Checker.php:531
2327	msgid "A valid license key is required for support and updates"
2328	msgstr ""
2329
2330	+ #: src/Tribe/PUE/Checker.php:534
2331	msgid ""
2332	"%1$sBuy a license%2$s for the Event Aggregator service to access additional "
2333	"import features."
2334	msgstr ""
2335
2336	+ #: src/Tribe/PUE/Checker.php:546 src/Tribe/PUE/Checker.php:557
2337	#: src/admin-views/troubleshooting/ea-status/license-key.php:44
2338	msgid "License Key"
2339	msgstr ""
2340
2341	+ #: src/Tribe/PUE/Checker.php:566 src/Tribe/PUE/Checker.php:600
2342	msgid "License Key Status:"
2343	msgstr ""
2344
2345	+ #: src/Tribe/PUE/Checker.php:575
2346	msgid "Override network license key"
2347	msgstr ""
2348
2349	+ #: src/Tribe/PUE/Checker.php:576
2350	msgid ""
2351	"Check this box if you wish to override the network license key with your own"
2352	msgstr ""
2353
2354	+ #: src/Tribe/PUE/Checker.php:587
2355	msgid "Site License Key"
2356	msgstr ""
2357
2358	+ #: src/Tribe/PUE/Checker.php:687
2359	msgid "License key(s) updated."
2360	msgstr ""
2361
2362	+ #: src/Tribe/PUE/Checker.php:941
2363	msgid ""
2364	"Hmmm... something's wrong with this validator. Please contact %ssupport%s."
2365	msgstr ""
2366
2367	+ #: src/Tribe/PUE/Checker.php:954
2368	msgid "unknown date"
2369	msgstr ""
2370
2371	+ #: src/Tribe/PUE/Checker.php:960
2372	msgid "Sorry, key validation server is not available."
2373	msgstr ""
2374
2375	+ #: src/Tribe/PUE/Checker.php:980
2376	msgid "Valid Key! Expires on %s"
2377	msgstr ""
2378
2379	+ #: src/Tribe/PUE/Checker.php:985
2380	msgid "Thanks for setting up a valid key. It will expire on %s"
2381	msgstr ""
2382
2383	+ #: src/Tribe/PUE/Checker.php:1014 src/Tribe/PUE/Notices.php:342
2384	msgid "Renew Your License Now"
2385	msgstr ""
2386
2387	+ #: src/Tribe/PUE/Checker.php:1016 src/Tribe/PUE/Notices.php:344
2388	msgid " (opens in a new window)"
2389	msgstr ""
2390
2391	+ #: src/Tribe/PUE/Checker.php:1033
2392	msgid "Please refresh the page and try your request again."
2393	msgstr ""
2394
2395	+ #: src/Tribe/PUE/Checker.php:1053
2396	msgid ""
2397	"There is an update for %s. You'll need to %scheck your license%s to have "
2398	"access to updates, downloads, and support."
2399	msgstr ""
2400
2401	+ #: src/Tribe/PUE/Checker.php:1110
2402	msgid ""
2403	"There is an update for %s. %sRenew your license%s to get access to bug "
2404	"fixes, security updates, and new features."
2405	msgstr ""
2406
2407	+ #: src/Tribe/PUE/Checker.php:1140
2408	msgid "Update now to version %s."
2409	msgstr ""
2410
2411	+ #: src/Tribe/PUE/Checker.php:1151
2412	msgid "There is a new version of %1$s available. %2$s"
2413	msgstr ""
2414
2415	+ #: src/Tribe/PUE/Checker.php:1732
2416	msgid "A valid license has been entered by your network administrator."
2417	msgstr ""
2418
2419	+ #: src/Tribe/PUE/Checker.php:1733
2420	msgid "No license entered. Consult your network administrator."
2421	msgstr ""
2422
2423	+ #: src/Tribe/PUE/Checker.php:1734
2424	msgid "Expired license. Consult your network administrator."
2425	msgstr ""
2426

common/node_modules/clipboard/dist/clipboard.min.js ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ /*!
2	+ * clipboard.js v2.0.10
3	+ * https://clipboardjs.com/
4	+ *
5	+ * Licensed MIT © Zeno Rocha
6	+ */
7	+ !function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1<arguments.length&&void 0!==arguments[1]?arguments[1]:{container:document.body},i="";return"string"==typeof t?(e=t,n="rtl"===document.documentElement.getAttribute("dir"),(o=document.createElement("textarea")).style.fontSize="12pt",o.style.border="0",o.style.padding="0",o.style.margin="0",o.style.position="absolute",o.style[n?"right":"left"]="-9999px",n=window.pageYOffset\|\|document.documentElement.scrollTop,o.style.top="".concat(n,"px"),o.setAttribute("readonly",""),o.value=e,o=o,r.container.appendChild(o),i=c()(o),a("copy"),o.remove()):(i=c()(t),a("copy")),i};function r(t){return(r="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(t)}var s=function(){var t=0<arguments.length&&void 0!==arguments[0]?arguments[0]:{},e=t.action,n=void 0===e?"copy":e,o=t.container,e=t.target,t=t.text;if("copy"!==n&&"cut"!==n)throw new Error('Invalid "action" value, use either "copy" or "cut"');if(void 0!==e){if(!e\|\|"object"!==r(e)\|\|1!==e.nodeType)throw new Error('Invalid "target" value, use a valid Element');if("copy"===n&&e.hasAttribute("disabled"))throw new Error('Invalid "target" attribute. Please use "readonly" instead of "disabled" attribute');if("cut"===n&&(e.hasAttribute("readonly")\|\|e.hasAttribute("disabled")))throw new Error('Invalid "target" attribute. You can\'t cut text from elements with "readonly" or "disabled" attributes')}return t?l(t,{container:o}):e?"cut"===n?f(e):l(e,{container:o}):void 0};function p(t){return(p="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol&&t!==Symbol.prototype?"symbol":typeof t})(t)}function d(t,e){for(var n=0;n<e.length;n++){var o=e[n];o.enumerable=o.enumerable\|\|!1,o.configurable=!0,"value"in o&&(o.writable=!0),Object.defineProperty(t,o.key,o)}}function y(t,e){return(y=Object.setPrototypeOf\|\|function(t,e){return t.__proto__=e,t})(t,e)}function h(n){var o=function(){if("undefined"==typeof Reflect\|\|!Reflect.construct)return!1;if(Reflect.construct.sham)return!1;if("function"==typeof Proxy)return!0;try{return Date.prototype.toString.call(Reflect.construct(Date,[],function(){})),!0}catch(t){return!1}}();return function(){var t,e=m(n);return t=o?(t=m(this).constructor,Reflect.construct(e,arguments,t)):e.apply(this,arguments),e=this,!(t=t)\|\|"object"!==p(t)&&"function"!=typeof t?function(t){if(void 0!==t)return t;throw new ReferenceError("this hasn't been initialised - super() hasn't been called")}(e):t}}function m(t){return(m=Object.setPrototypeOf?Object.getPrototypeOf:function(t){return t.__proto__\|\|Object.getPrototypeOf(t)})(t)}function v(t,e){t="data-clipboard-".concat(t);if(e.hasAttribute(t))return e.getAttribute(t)}var o=function(){!function(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function");t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,writable:!0,configurable:!0}}),e&&y(t,e)}(r,i());var t,e,n,o=h(r);function r(t,e){var n;return function(t){if(!(t instanceof r))throw new TypeError("Cannot call a class as a function")}(this),(n=o.call(this)).resolveOptions(e),n.listenClick(t),n}return t=r,n=[{key:"copy",value:function(t){var e=1<arguments.length&&void 0!==arguments[1]?arguments[1]:{container:document.body};return l(t,e)}},{key:"cut",value:function(t){return f(t)}},{key:"isSupported",value:function(){var t=0<arguments.length&&void 0!==arguments[0]?arguments[0]:["copy","cut"],t="string"==typeof t?[t]:t,e=!!document.queryCommandSupported;return t.forEach(function(t){e=e&&!!document.queryCommandSupported(t)}),e}}],(e=[{key:"resolveOptions",value:function(){var t=0<arguments.length&&void 0!==arguments[0]?arguments[0]:{};this.action="function"==typeof t.action?t.action:this.defaultAction,this.target="function"==typeof t.target?t.target:this.defaultTarget,this.text="function"==typeof t.text?t.text:this.defaultText,this.container="object"===p(t.container)?t.container:document.body}},{key:"listenClick",value:function(t){var e=this;this.listener=u()(t,"click",function(t){return e.onClick(t)})}},{key:"onClick",value:function(t){var e=t.delegateTarget\|\|t.currentTarget,n=this.action(e)\|\|"copy",t=s({action:n,container:this.container,target:this.target(e),text:this.text(e)});this.emit(t?"success":"error",{action:n,text:t,trigger:e,clearSelection:function(){e&&e.focus(),document.activeElement.blur(),window.getSelection().removeAllRanges()}})}},{key:"defaultAction",value:function(t){return v("action",t)}},{key:"defaultTarget",value:function(t){t=v("target",t);if(t)return document.querySelector(t)}},{key:"defaultText",value:function(t){return v("text",t)}},{key:"destroy",value:function(){this.listener.destroy()}}])&&d(t.prototype,e),n&&d(t,n),r}()},828:function(t){var e;"undefined"==typeof Element\|\|Element.prototype.matches\|\|((e=Element.prototype).matches=e.matchesSelector\|\|e.mozMatchesSelector\|\|e.msMatchesSelector\|\|e.oMatchesSelector\|\|e.webkitMatchesSelector),t.exports=function(t,e){for(;t&&9!==t.nodeType;){if("function"==typeof t.matches&&t.matches(e))return t;t=t.parentNode}}},438:function(t,e,n){var u=n(828);function i(t,e,n,o,r){var i=function(e,n,t,o){return function(t){t.delegateTarget=u(t.target,n),t.delegateTarget&&o.call(e,t)}}.apply(this,arguments);return t.addEventListener(n,i,r),{destroy:function(){t.removeEventListener(n,i,r)}}}t.exports=function(t,e,n,o,r){return"function"==typeof t.addEventListener?i.apply(null,arguments):"function"==typeof n?i.bind(null,document).apply(null,arguments):("string"==typeof t&&(t=document.querySelectorAll(t)),Array.prototype.map.call(t,function(t){return i(t,e,n,o,r)}))}},879:function(t,n){n.node=function(t){return void 0!==t&&t instanceof HTMLElement&&1===t.nodeType},n.nodeList=function(t){var e=Object.prototype.toString.call(t);return void 0!==t&&("[object NodeList]"===e\|\|"[object HTMLCollection]"===e)&&"length"in t&&(0===t.length\|\|n.node(t[0]))},n.string=function(t){return"string"==typeof t\|\|t instanceof String},n.fn=function(t){return"[object Function]"===Object.prototype.toString.call(t)}},370:function(t,e,n){var f=n(879),l=n(438);t.exports=function(t,e,n){if(!t&&!e&&!n)throw new Error("Missing required arguments");if(!f.string(e))throw new TypeError("Second argument must be a String");if(!f.fn(n))throw new TypeError("Third argument must be a Function");if(f.node(t))return c=e,a=n,(u=t).addEventListener(c,a),{destroy:function(){u.removeEventListener(c,a)}};if(f.nodeList(t))return o=t,r=e,i=n,Array.prototype.forEach.call(o,function(t){t.addEventListener(r,i)}),{destroy:function(){Array.prototype.forEach.call(o,function(t){t.removeEventListener(r,i)})}};if(f.string(t))return t=t,e=e,n=n,l(document.body,t,e,n);throw new TypeError("First argument must be a String, HTMLElement, HTMLCollection, or NodeList");var o,r,i,u,c,a}},817:function(t){t.exports=function(t){var e,n="SELECT"===t.nodeName?(t.focus(),t.value):"INPUT"===t.nodeName\|\|"TEXTAREA"===t.nodeName?((e=t.hasAttribute("readonly"))\|\|t.setAttribute("readonly",""),t.select(),t.setSelectionRange(0,t.value.length),e\|\|t.removeAttribute("readonly"),t.value):(t.hasAttribute("contenteditable")&&t.focus(),n=window.getSelection(),(e=document.createRange()).selectNodeContents(t),n.removeAllRanges(),n.addRange(e),n.toString());return n}},279:function(t){function e(){}e.prototype={on:function(t,e,n){var o=this.e\|\|(this.e={});return(o[t]\|\|(o[t]=[])).push({fn:e,ctx:n}),this},once:function(t,e,n){var o=this;function r(){o.off(t,r),e.apply(n,arguments)}return r._=e,this.on(t,r,n)},emit:function(t){for(var e=[].slice.call(arguments,1),n=((this.e\|\|(this.e={}))[t]\|\|[]).slice(),o=0,r=n.length;o<r;o++)n[o].fn.apply(n[o].ctx,e);return this},off:function(t,e){var n=this.e\|\|(this.e={}),o=n[t],r=[];if(o&&e)for(var i=0,u=o.length;i<u;i++)o[i].fn!==e&&o[i].fn._!==e&&r.push(o[i]);return r.length?n[t]=r:delete n[t],this}},t.exports=e,t.exports.TinyEmitter=e}},r={},o.n=function(t){var e=t&&t.__esModule?function(){return t.default}:function(){return t};return o.d(e,{a:e}),e},o.d=function(t,e){for(var n in e)o.o(e,n)&&!o.o(t,n)&&Object.defineProperty(t,n,{enumerable:!0,get:e[n]})},o.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},o(686).default;function o(t){if(r[t])return r[t].exports;var e=r[t]={exports:{}};return n[t](e,e.exports,o),e.exports}var n,r});

common/src/Tribe/Admin/Notices.php CHANGED Viewed

	@@ -107,7 +107,7 @@ class Tribe__Admin__Notices {
107	[ 'jquery' ],
108	null,
109	[
110	- '~~group~~' => 'tec-admin-notices',
111	]
112	);
113	}


107	[ 'jquery' ],
108	null,
109	[
110	+ 'groups' => 'tec-admin-notices',
111	]
112	);
113	}

common/src/Tribe/Assets.php CHANGED Viewed

	@@ -39,6 +39,7 @@ class Tribe__Assets {
39	// Hook the actual registering of.
40	add_action( 'init', [ $this, 'register_in_wp' ], 1, 0 );
41	add_filter( 'script_loader_tag', [ $this, 'filter_tag_async_defer' ], 50, 2 );

42
43	// Enqueue late.
44	add_filter( 'script_loader_tag', [ $this, 'filter_add_localization_data' ], 500, 2 );
	@@ -149,10 +150,44 @@ class Tribe__Assets {
149	$replacement .= 'defer ';
150	}
151
152	- $replacement_src = $replacement . 'src=';
153	- $replacement_type = $replacement . 'type=';
154
155	- return str_replace( [ '<script ~~src=~~', ~~'<script type=' ], [~~ $~~replacement_src~~, $~~replacement_type ], $~~tag );




































156	}
157
158	/**
	@@ -553,6 +588,7 @@ class Tribe__Assets {
553
554	'async' => false,
555	'defer' => false,

556
557	'in_footer' => true,
558	'is_registered' => false,
	@@ -633,7 +669,7 @@ class Tribe__Assets {
633	if ( filter_var( $asset->file, FILTER_VALIDATE_URL ) ) {
634	$asset->url = $asset->file;
635	} else {
636	- $asset->url = ~~$this->~~maybe_get_min_file( tribe_resource_url( $asset->file, false, ( $is_vendor ? '' : null ), $origin ) );
637	}
638
639	// Parse the Localize asset arguments.


39	// Hook the actual registering of.
40	add_action( 'init', [ $this, 'register_in_wp' ], 1, 0 );
41	add_filter( 'script_loader_tag', [ $this, 'filter_tag_async_defer' ], 50, 2 );
42	+ add_filter( 'script_loader_tag', [ $this, 'filter_modify_to_module' ], 50, 2 );
43
44	// Enqueue late.
45	add_filter( 'script_loader_tag', [ $this, 'filter_add_localization_data' ], 500, 2 );

150	$replacement .= 'defer ';
151	}
152


153
154	+ return str_replace( '<script ', $replacement, $tag );
155	+ }
156	+
157	+ /**
158	+ * Filters the Script tags to attach type=module based on the rules we set in our Asset class.
159	+ *
160	+ * @since 4.14.14
161	+ *
162	+ * @param string $tag Tag we are filtering.
163	+ * @param string $handle Which is the ID/Handle of the tag we are about to print.
164	+ *
165	+ * @return string Script tag with the type=module
166	+ */
167	+ public function filter_modify_to_module( $tag, $handle ) {
168	+ // Only filter for own own filters.
169	+ if ( ! $asset = $this->get( $handle ) ) {
170	+ return $tag;
171	+ }
172	+
173	+ // Bail when not dealing with JS assets.
174	+ if ( 'js' !== $asset->type ) {
175	+ return $tag;
176	+ }
177	+
178	+ // When not module we bail with the tag.
179	+ if ( ! $asset->module ) {
180	+ return $tag;
181	+ }
182	+
183	+ // Do not add Module to a Script that already has a type.
184	+ if ( false !== strpos( $tag, ' type=' ) ) {
185	+ return $tag;
186	+ }
187	+
188	+ $replacement = '<script type="module" ';
189	+
190	+ return str_replace( '<script ', $replacement, $tag );
191	}
192
193	/**

588
589	'async' => false,
590	'defer' => false,
591	+ 'module' => false,
592
593	'in_footer' => true,
594	'is_registered' => false,

669	if ( filter_var( $asset->file, FILTER_VALIDATE_URL ) ) {
670	$asset->url = $asset->file;
671	} else {
672	+ $asset->url = static::maybe_get_min_file( tribe_resource_url( $asset->file, false, ( $is_vendor ? '' : null ), $origin ) );
673	}
674
675	// Parse the Localize asset arguments.

common/src/Tribe/Field.php CHANGED Viewed

	@@ -143,20 +143,21 @@ if ( ! class_exists( 'Tribe__Field' ) ) {
143	$label_attributes = $args['label_attributes'];
144	$tooltip = wp_kses(
145	$args['tooltip'], [
146	- 'a' => [ 'href' => [], 'title' => [], 'target' => [] ],
147	'br' => [],
148	- 'em' => [],
149	- 'strong' => [],
150	- 'b' => [],
151	- 'i' => [],
152	- 'u' => [],
153	'img' => [

154	'title' => [],
155	'src' => [],
156	'alt' => [],
157	],
158	'code' => [ 'span' => [] ],
159	- 'span' => [],
160	]
161	);
162	$fieldset_attributes = [];


143	$label_attributes = $args['label_attributes'];
144	$tooltip = wp_kses(
145	$args['tooltip'], [
146	+ 'a' => [ 'class' => [], 'href' => [], 'title' => [], 'target' => [] ],
147	'br' => [],
148	+ 'em' => [ 'class' => [] ],
149	+ 'strong' => [ 'class' => [] ],
150	+ 'b' => [ 'class' => [] ],
151	+ 'i' => [ 'class' => [] ],
152	+ 'u' => [ 'class' => [] ],
153	'img' => [
154	+ 'class' => [],
155	'title' => [],
156	'src' => [],
157	'alt' => [],
158	],
159	'code' => [ 'span' => [] ],
160	+ 'span' => [ 'class' => [] ],
161	]
162	);
163	$fieldset_attributes = [];

common/src/Tribe/Main.php CHANGED Viewed

	@@ -20,7 +20,7 @@ class Tribe__Main {
20	const OPTIONNAME = 'tribe_events_calendar_options';
21	const OPTIONNAMENETWORK = 'tribe_events_calendar_network_options';
22
23	- const VERSION = '4.14.13';
24
25	const FEED_URL = 'https://theeventscalendar.com/feed/';
26
	@@ -188,7 +188,7 @@ class Tribe__Main {
188	[
189	[ 'tribe-accessibility-css', 'accessibility.css' ],
190	[ 'tribe-query-string', 'utils/query-string.js' ],
191	- [ 'tribe-clipboard', '~~vendor~~/clipboard/clipboard.js' ],
192	[ 'datatables', 'vendor/datatables/datatables.js', [ 'jquery' ] ],
193	[ 'tribe-select2', 'vendor/tribe-selectWoo/dist/js/selectWoo.full.js', [ 'jquery' ] ],
194	[ 'tribe-select2-css', 'vendor/tribe-selectWoo/dist/css/selectWoo.css' ],
	@@ -207,6 +207,8 @@ class Tribe__Main {
207	[ 'tribe-jquery-timepicker-css', 'vendor/jquery-tribe-timepicker/jquery.timepicker.css' ],
208	[ 'tribe-timepicker', 'timepicker.js', [ 'jquery', 'tribe-jquery-timepicker' ] ],
209	[ 'tribe-attrchange', 'vendor/attrchange/js/attrchange.js' ],


210	]
211	);
212


20	const OPTIONNAME = 'tribe_events_calendar_options';
21	const OPTIONNAMENETWORK = 'tribe_events_calendar_network_options';
22
23	+ const VERSION = '4.14.14';
24
25	const FEED_URL = 'https://theeventscalendar.com/feed/';
26

188	[
189	[ 'tribe-accessibility-css', 'accessibility.css' ],
190	[ 'tribe-query-string', 'utils/query-string.js' ],
191	+ [ 'tribe-clipboard', 'node_modules/clipboard/dist/clipboard.min.js' ],
192	[ 'datatables', 'vendor/datatables/datatables.js', [ 'jquery' ] ],
193	[ 'tribe-select2', 'vendor/tribe-selectWoo/dist/js/selectWoo.full.js', [ 'jquery' ] ],
194	[ 'tribe-select2-css', 'vendor/tribe-selectWoo/dist/css/selectWoo.css' ],

207	[ 'tribe-jquery-timepicker-css', 'vendor/jquery-tribe-timepicker/jquery.timepicker.css' ],
208	[ 'tribe-timepicker', 'timepicker.js', [ 'jquery', 'tribe-jquery-timepicker' ] ],
209	[ 'tribe-attrchange', 'vendor/attrchange/js/attrchange.js' ],
210	+ [ 'tec-ky-module', 'vendor/ky/ky.js', [], null, [ 'module' => true ] ],
211	+ [ 'tec-ky', 'vendor/ky/tec-ky.js', [ 'tec-ky-module' ], null, [ 'module' => true ] ],
212	]
213	);
214

common/src/Tribe/PUE/Checker.php CHANGED Viewed

@@ -87,6 +87,15 @@ if ( ! class_exists( 'Tribe__PUE__Checker' ) ) {
             		 */
             		public $pue_option_name = '';
             		/**
             		 * used to hold the install_key if set (included here for addons that will extend PUE to use install key checks)
+            		 *
@@ -171,6 +180,28 @@ if ( ! class_exists( 'Tribe__PUE__Checker' ) ) {
             			$this->set_plugin_file( $plugin_file );
             			$this->set_options( $options );
             			$this->hooks();
+            		}
             		/**
@@ -973,6 +1004,8 @@ if ( ! class_exists( 'Tribe__PUE__Checker' ) ) {
             			$response['message'] = wp_kses( $response['message'], 'data' );
             			return $response;
+            		}


87	*/
88	public $pue_option_name = '';
89
90	+ /**
91	+ * Where to store the temporary status info.
92	+ *
93	+ * @since 4.14.14
94	+ *
95	+ * @var string
96	+ */
97	+ public $pue_key_status_transient_name;
98	+
99	/**
100	* used to hold the install_key if set (included here for addons that will extend PUE to use install key checks)
101	*

180	$this->set_plugin_file( $plugin_file );
181	$this->set_options( $options );
182	$this->hooks();
183	+ $this->set_key_status_transient_name();
184	+ }
185	+
186	+ /**
187	+ * Creates a hash for the transient name that holds the current key status.
188	+ *
189	+ * @since 4.14.14
190	+ */
191	+ public function set_key_status_transient_name() {
192	+ $this->pue_key_status_transient_name = md5( $this->get_slug() . $this->get_site_domain() );
193	+ }
194	+
195	+ /**
196	+ * Sets the key status transient based on the key validation check results.
197	+ *
198	+ * @since 4.14.14
199	+ *
200	+ * @param int $valid 0 for invalid, 1 or 2 for valid.
201	+ */
202	+ public function set_key_status_transient( $valid ) {
203	+ $status = tribe_is_truthy( $valid ) ? 'valid' : 'invalid';
204	+ set_transient( $this->pue_key_status_transient_name, $status, $this->check_period * HOUR_IN_SECONDS );
205	}
206
207	/**

1004
1005	$response['message'] = wp_kses( $response['message'], 'data' );
1006
1007	+ $this->set_key_status_transient( $response['status'] );
1008	+
1009	return $response;
1010	}
1011

common/src/Tribe/Values/Abstract_Value.php CHANGED Viewed

	@@ -91,6 +91,14 @@ abstract class Abstract_Value implements Value_Interface {
91	$this->update();
92	}
93








94	/**
95	* @inheritDoc
96	*/


91	$this->update();
92	}
93
94	+ /**
95	+ * @inheritDoc
96	+ */
97	+ public function set_precision( $amount ) {
98	+ $this->precision = $amount;
99	+ }
100	+
101	+
102	/**
103	* @inheritDoc
104	*/

common/src/Tribe/Values/Value_Calculation.php CHANGED Viewed

	@@ -66,6 +66,6 @@ trait Value_Calculation {
66	* @return int
67	*/
68	public function to_integer( $value ) {
69	- return (int) ( round( $value, $this->~~precision~~ ) * pow( 10, $this->~~precision~~ ) );
70	}
71	}


66	* @return int
67	*/
68	public function to_integer( $value ) {
69	+ return (int) ( round( $value, $this->get_precision() ) * pow( 10, $this->get_precision() ) );
70	}
71	}

common/src/Tribe/Values/Value_Interface.php CHANGED Viewed

	@@ -101,6 +101,15 @@ interface Value_Interface {
101	*/
102	public function set_value( $amount );
103









104	/**
105	* Get all valid setters registered to this object instance, up the inheritance chain.
106	*


101	*/
102	public function set_value( $amount );
103
104	+ /**
105	+ * Public setter to use for any object.
106	+ *
107	+ * @since 4.14.14
108	+ *
109	+ * @param int $amount the precision value to set
110	+ */
111	+ public function set_precision( $amount );
112	+
113	/**
114	* Get all valid setters registered to this object instance, up the inheritance chain.
115	*

common/src/resources/images/mascot.png CHANGED Viewed

Binary file

common/src/resources/js/admin/help-page.js CHANGED Viewed

	@@ -22,7 +22,7 @@ tribe.helpPage = tribe.helpPage \|\| {};
22	return;
23	}
24
25	- var clipboard = new ~~Clipboard~~( obj.selectors.copyButton );
26	var button_icon = '<span class="dashicons dashicons-clipboard license-btn"></span>';
27	var button_text = tribe_system_info.clipboard_btn_text;
28


22	return;
23	}
24
25	+ var clipboard = new ClipboardJS( obj.selectors.copyButton );
26	var button_icon = '<span class="dashicons dashicons-clipboard license-btn"></span>';
27	var button_text = tribe_system_info.clipboard_btn_text;
28

common/vendor/autoload.php CHANGED Viewed

	@@ -4,4 +4,4 @@
4
5	require_once __DIR__ . '/composer/autoload_real.php';
6
7	- return ~~ComposerAutoloaderInitf5432e92183aa2f0253e2dcd3dad3536~~::getLoader();


4
5	require_once __DIR__ . '/composer/autoload_real.php';
6
7	+ return ComposerAutoloaderInit6fbe49c8f8ab7e51dd699e84a42d9f95::getLoader();

common/vendor/autoload_52.php CHANGED Viewed

	@@ -4,4 +4,4 @@
4
5	require_once dirname(__FILE__) . '/composer'.'/autoload_real_52.php';
6
7	- return ~~ComposerAutoloaderInitee1cf866a1e66cea373cd52c095b2bac~~::getLoader();


4
5	require_once dirname(__FILE__) . '/composer'.'/autoload_real_52.php';
6
7	+ return ComposerAutoloaderInit4e547433824e3937f7d66f668eca5550::getLoader();

common/vendor/clipboard/clipboard.min.js DELETED Viewed

@@ -1,7 +0,0 @@
-            -
            /*!
-            -
             * clipboard.js v1.5.12
-            -
             * https://zenorocha.github.io/clipboard.js
-            -
             *
-            -
             * Licensed MIT � Zeno Rocha
-            -
             */
-            -
            !function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;e="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this,e.Clipboard=t()}}(function(){var t,e,n;return function t(e,n,o){function i(a,c){if(!n[a]){if(!e[a]){var s="function"==typeof require&&require;if(!c&&s)return s(a,!0);if(r)return r(a,!0);var l=new Error("Cannot find module '"+a+"'");throw l.code="MODULE_NOT_FOUND",l}var u=n[a]={exports:{}};e[a][0].call(u.exports,function(t){var n=e[a][1][t];return i(n?n:t)},u,u.exports,t,e,n,o)}return n[a].exports}for(var r="function"==typeof require&&require,a=0;a<o.length;a++)i(o[a]);return i}({1:[function(t,e,n){var o=t("matches-selector");e.exports=function(t,e,n){for(var i=n?t:t.parentNode;i&&i!==document;){if(o(i,e))return i;i=i.parentNode}}},{"matches-selector":5}],2:[function(t,e,n){function o(t,e,n,o,r){var a=i.apply(this,arguments);return t.addEventListener(n,a,r),{destroy:function(){t.removeEventListener(n,a,r)}}}function i(t,e,n,o){return function(n){n.delegateTarget=r(n.target,e,!0),n.delegateTarget&&o.call(t,n)}}var r=t("closest");e.exports=o},{closest:1}],3:[function(t,e,n){n.node=function(t){return void 0!==t&&t instanceof HTMLElement&&1===t.nodeType},n.nodeList=function(t){var e=Object.prototype.toString.call(t);return void 0!==t&&("[object NodeList]"===e||"[object HTMLCollection]"===e)&&"length"in t&&(0===t.length||n.node(t[0]))},n.string=function(t){return"string"==typeof t||t instanceof String},n.fn=function(t){var e=Object.prototype.toString.call(t);return"[object Function]"===e}},{}],4:[function(t,e,n){function o(t,e,n){if(!t&&!e&&!n)throw new Error("Missing required arguments");if(!c.string(e))throw new TypeError("Second argument must be a String");if(!c.fn(n))throw new TypeError("Third argument must be a Function");if(c.node(t))return i(t,e,n);if(c.nodeList(t))return r(t,e,n);if(c.string(t))return a(t,e,n);throw new TypeError("First argument must be a String, HTMLElement, HTMLCollection, or NodeList")}function i(t,e,n){return t.addEventListener(e,n),{destroy:function(){t.removeEventListener(e,n)}}}function r(t,e,n){return Array.prototype.forEach.call(t,function(t){t.addEventListener(e,n)}),{destroy:function(){Array.prototype.forEach.call(t,function(t){t.removeEventListener(e,n)})}}}function a(t,e,n){return s(document.body,t,e,n)}var c=t("./is"),s=t("delegate");e.exports=o},{"./is":3,delegate:2}],5:[function(t,e,n){function o(t,e){if(r)return r.call(t,e);for(var n=t.parentNode.querySelectorAll(e),o=0;o<n.length;++o)if(n[o]==t)return!0;return!1}var i=Element.prototype,r=i.matchesSelector||i.webkitMatchesSelector||i.mozMatchesSelector||i.msMatchesSelector||i.oMatchesSelector;e.exports=o},{}],6:[function(t,e,n){function o(t){var e;if("INPUT"===t.nodeName||"TEXTAREA"===t.nodeName)t.focus(),t.setSelectionRange(0,t.value.length),e=t.value;else{t.hasAttribute("contenteditable")&&t.focus();var n=window.getSelection(),o=document.createRange();o.selectNodeContents(t),n.removeAllRanges(),n.addRange(o),e=n.toString()}return e}e.exports=o},{}],7:[function(t,e,n){function o(){}o.prototype={on:function(t,e,n){var o=this.e||(this.e={});return(o[t]||(o[t]=[])).push({fn:e,ctx:n}),this},once:function(t,e,n){function o(){i.off(t,o),e.apply(n,arguments)}var i=this;return o._=e,this.on(t,o,n)},emit:function(t){var e=[].slice.call(arguments,1),n=((this.e||(this.e={}))[t]||[]).slice(),o=0,i=n.length;for(o;i>o;o++)n[o].fn.apply(n[o].ctx,e);return this},off:function(t,e){var n=this.e||(this.e={}),o=n[t],i=[];if(o&&e)for(var r=0,a=o.length;a>r;r++)o[r].fn!==e&&o[r].fn._!==e&&i.push(o[r]);return i.length?n[t]=i:delete n[t],this}},e.exports=o},{}],8:[function(e,n,o){!function(i,r){if("function"==typeof t&&t.amd)t(["module","select"],r);else if("undefined"!=typeof o)r(n,e("select"));else{var a={exports:{}};r(a,i.select),i.clipboardAction=a.exports}}(this,function(t,e){"use strict";function n(t){return t&&t.__esModule?t:{"default":t}}function o(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var i=n(e),r="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(t){return typeof t}:function(t){return t&&"function"==typeof Symbol&&t.constructor===Symbol?"symbol":typeof t},a=function(){function t(t,e){for(var n=0;n<e.length;n++){var o=e[n];o.enumerable=o.enumerable||!1,o.configurable=!0,"value"in o&&(o.writable=!0),Object.defineProperty(t,o.key,o)}}return function(e,n,o){return n&&t(e.prototype,n),o&&t(e,o),e}}(),c=function(){function t(e){o(this,t),this.resolveOptions(e),this.initSelection()}return t.prototype.resolveOptions=function t(){var e=arguments.length<=0||void 0===arguments[0]?{}:arguments[0];this.action=e.action,this.emitter=e.emitter,this.target=e.target,this.text=e.text,this.trigger=e.trigger,this.selectedText=""},t.prototype.initSelection=function t(){this.text?this.selectFake():this.target&&this.selectTarget()},t.prototype.selectFake=function t(){var e=this,n="rtl"==document.documentElement.getAttribute("dir");this.removeFake(),this.fakeHandlerCallback=function(){return e.removeFake()},this.fakeHandler=document.body.addEventListener("click",this.fakeHandlerCallback)||!0,this.fakeElem=document.createElement("textarea"),this.fakeElem.style.fontSize="12pt",this.fakeElem.style.border="0",this.fakeElem.style.padding="0",this.fakeElem.style.margin="0",this.fakeElem.style.position="absolute",this.fakeElem.style[n?"right":"left"]="-9999px",this.fakeElem.style.top=(window.pageYOffset||document.documentElement.scrollTop)+"px",this.fakeElem.setAttribute("readonly",""),this.fakeElem.value=this.text,document.body.appendChild(this.fakeElem),this.selectedText=(0,i.default)(this.fakeElem),this.copyText()},t.prototype.removeFake=function t(){this.fakeHandler&&(document.body.removeEventListener("click",this.fakeHandlerCallback),this.fakeHandler=null,this.fakeHandlerCallback=null),this.fakeElem&&(document.body.removeChild(this.fakeElem),this.fakeElem=null)},t.prototype.selectTarget=function t(){this.selectedText=(0,i.default)(this.target),this.copyText()},t.prototype.copyText=function t(){var e=void 0;try{e=document.execCommand(this.action)}catch(n){e=!1}this.handleResult(e)},t.prototype.handleResult=function t(e){e?this.emitter.emit("success",{action:this.action,text:this.selectedText,trigger:this.trigger,clearSelection:this.clearSelection.bind(this)}):this.emitter.emit("error",{action:this.action,trigger:this.trigger,clearSelection:this.clearSelection.bind(this)})},t.prototype.clearSelection=function t(){this.target&&this.target.blur(),window.getSelection().removeAllRanges()},t.prototype.destroy=function t(){this.removeFake()},a(t,[{key:"action",set:function t(){var e=arguments.length<=0||void 0===arguments[0]?"copy":arguments[0];if(this._action=e,"copy"!==this._action&&"cut"!==this._action)throw new Error('Invalid "action" value, use either "copy" or "cut"')},get:function t(){return this._action}},{key:"target",set:function t(e){if(void 0!==e){if(!e||"object"!==("undefined"==typeof e?"undefined":r(e))||1!==e.nodeType)throw new Error('Invalid "target" value, use a valid Element');if("copy"===this.action&&e.hasAttribute("disabled"))throw new Error('Invalid "target" attribute. Please use "readonly" instead of "disabled" attribute');if("cut"===this.action&&(e.hasAttribute("readonly")||e.hasAttribute("disabled")))throw new Error('Invalid "target" attribute. You can\'t cut text from elements with "readonly" or "disabled" attributes');this._target=e}},get:function t(){return this._target}}]),t}();t.exports=c})},{select:6}],9:[function(e,n,o){!function(i,r){if("function"==typeof t&&t.amd)t(["module","./clipboard-action","tiny-emitter","good-listener"],r);else if("undefined"!=typeof o)r(n,e("./clipboard-action"),e("tiny-emitter"),e("good-listener"));else{var a={exports:{}};r(a,i.clipboardAction,i.tinyEmitter,i.goodListener),i.clipboard=a.exports}}(this,function(t,e,n,o){"use strict";function i(t){return t&&t.__esModule?t:{"default":t}}function r(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}function a(t,e){if(!t)throw new ReferenceError("this hasn't been initialised - super() hasn't been called");return!e||"object"!=typeof e&&"function"!=typeof e?t:e}function c(t,e){if("function"!=typeof e&&null!==e)throw new TypeError("Super expression must either be null or a function, not "+typeof e);t.prototype=Object.create(e&&e.prototype,{constructor:{value:t,enumerable:!1,writable:!0,configurable:!0}}),e&&(Object.setPrototypeOf?Object.setPrototypeOf(t,e):t.__proto__=e)}function s(t,e){var n="data-clipboard-"+t;if(e.hasAttribute(n))return e.getAttribute(n)}var l=i(e),u=i(n),f=i(o),d=function(t){function e(n,o){r(this,e);var i=a(this,t.call(this));return i.resolveOptions(o),i.listenClick(n),i}return c(e,t),e.prototype.resolveOptions=function t(){var e=arguments.length<=0||void 0===arguments[0]?{}:arguments[0];this.action="function"==typeof e.action?e.action:this.defaultAction,this.target="function"==typeof e.target?e.target:this.defaultTarget,this.text="function"==typeof e.text?e.text:this.defaultText},e.prototype.listenClick=function t(e){var n=this;this.listener=(0,f.default)(e,"click",function(t){return n.onClick(t)})},e.prototype.onClick=function t(e){var n=e.delegateTarget||e.currentTarget;this.clipboardAction&&(this.clipboardAction=null),this.clipboardAction=new l.default({action:this.action(n),target:this.target(n),text:this.text(n),trigger:n,emitter:this})},e.prototype.defaultAction=function t(e){return s("action",e)},e.prototype.defaultTarget=function t(e){var n=s("target",e);return n?document.querySelector(n):void 0},e.prototype.defaultText=function t(e){return s("text",e)},e.prototype.destroy=function t(){this.listener.destroy(),this.clipboardAction&&(this.clipboardAction.destroy(),this.clipboardAction=null)},e}(u.default);t.exports=d})},{"./clipboard-action":8,"good-listener":4,"tiny-emitter":7}]},{},[9])(9)});

common/vendor/composer/autoload_real.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	// autoload_real.php @generated by Composer
4
5	- class ~~ComposerAutoloaderInitf5432e92183aa2f0253e2dcd3dad3536~~
6	{
7	private static $loader;
8
	@@ -19,15 +19,15 @@ class ComposerAutoloaderInitf5432e92183aa2f0253e2dcd3dad3536
19	return self::$loader;
20	}
21
22	- spl_autoload_register(array('~~ComposerAutoloaderInitf5432e92183aa2f0253e2dcd3dad3536~~', 'loadClassLoader'), true, true);
23	self::$loader = $loader = new \Composer\Autoload\ClassLoader();
24	- spl_autoload_unregister(array('~~ComposerAutoloaderInitf5432e92183aa2f0253e2dcd3dad3536~~', 'loadClassLoader'));
25
26	$useStaticLoader = PHP_VERSION_ID >= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') \|\| !zend_loader_file_encoded());
27	if ($useStaticLoader) {
28	require_once __DIR__ . '/autoload_static.php';
29
30	- call_user_func(\Composer\Autoload\~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~::getInitializer($loader));
31	} else {
32	$map = require __DIR__ . '/autoload_namespaces.php';
33	foreach ($map as $namespace => $path) {


2
3	// autoload_real.php @generated by Composer
4
5	+ class ComposerAutoloaderInit6fbe49c8f8ab7e51dd699e84a42d9f95
6	{
7	private static $loader;
8

19	return self::$loader;
20	}
21
22	+ spl_autoload_register(array('ComposerAutoloaderInit6fbe49c8f8ab7e51dd699e84a42d9f95', 'loadClassLoader'), true, true);
23	self::$loader = $loader = new \Composer\Autoload\ClassLoader();
24	+ spl_autoload_unregister(array('ComposerAutoloaderInit6fbe49c8f8ab7e51dd699e84a42d9f95', 'loadClassLoader'));
25
26	$useStaticLoader = PHP_VERSION_ID >= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') \|\| !zend_loader_file_encoded());
27	if ($useStaticLoader) {
28	require_once __DIR__ . '/autoload_static.php';
29
30	+ call_user_func(\Composer\Autoload\ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95::getInitializer($loader));
31	} else {
32	$map = require __DIR__ . '/autoload_namespaces.php';
33	foreach ($map as $namespace => $path) {

common/vendor/composer/autoload_real_52.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	// autoload_real_52.php generated by xrstf/composer-php52
4
5	- class ~~ComposerAutoloaderInitee1cf866a1e66cea373cd52c095b2bac~~ {
6	private static $loader;
7
8	public static function loadClassLoader($class) {
	@@ -19,9 +19,9 @@ class ComposerAutoloaderInitee1cf866a1e66cea373cd52c095b2bac {
19	return self::$loader;
20	}
21
22	- spl_autoload_register(array('~~ComposerAutoloaderInitee1cf866a1e66cea373cd52c095b2bac~~', 'loadClassLoader'), true /, true /);
23	self::$loader = $loader = new xrstf_Composer52_ClassLoader();
24	- spl_autoload_unregister(array('~~ComposerAutoloaderInitee1cf866a1e66cea373cd52c095b2bac~~', 'loadClassLoader'));
25
26	$vendorDir = dirname(dirname(__FILE__));
27	$baseDir = dirname($vendorDir);


2
3	// autoload_real_52.php generated by xrstf/composer-php52
4
5	+ class ComposerAutoloaderInit4e547433824e3937f7d66f668eca5550 {
6	private static $loader;
7
8	public static function loadClassLoader($class) {

19	return self::$loader;
20	}
21
22	+ spl_autoload_register(array('ComposerAutoloaderInit4e547433824e3937f7d66f668eca5550', 'loadClassLoader'), true /, true /);
23	self::$loader = $loader = new xrstf_Composer52_ClassLoader();
24	+ spl_autoload_unregister(array('ComposerAutoloaderInit4e547433824e3937f7d66f668eca5550', 'loadClassLoader'));
25
26	$vendorDir = dirname(dirname(__FILE__));
27	$baseDir = dirname($vendorDir);

common/vendor/composer/autoload_static.php CHANGED Viewed

	@@ -4,7 +4,7 @@
4
5	namespace Composer\Autoload;
6
7	- class ~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~
8	{
9	public static $prefixLengthsPsr4 = array (
10	'T' =>
	@@ -261,10 +261,10 @@ class ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536
261	public static function getInitializer(ClassLoader $loader)
262	{
263	return \Closure::bind(function () use ($loader) {
264	- $loader->prefixLengthsPsr4 = ~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~::$prefixLengthsPsr4;
265	- $loader->prefixDirsPsr4 = ~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~::$prefixDirsPsr4;
266	- $loader->prefixesPsr0 = ~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~::$prefixesPsr0;
267	- $loader->classMap = ~~ComposerStaticInitf5432e92183aa2f0253e2dcd3dad3536~~::$classMap;
268
269	}, null, ClassLoader::class);
270	}


4
5	namespace Composer\Autoload;
6
7	+ class ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95
8	{
9	public static $prefixLengthsPsr4 = array (
10	'T' =>

261	public static function getInitializer(ClassLoader $loader)
262	{
263	return \Closure::bind(function () use ($loader) {
264	+ $loader->prefixLengthsPsr4 = ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95::$prefixLengthsPsr4;
265	+ $loader->prefixDirsPsr4 = ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95::$prefixDirsPsr4;
266	+ $loader->prefixesPsr0 = ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95::$prefixesPsr0;
267	+ $loader->classMap = ComposerStaticInit6fbe49c8f8ab7e51dd699e84a42d9f95::$classMap;
268
269	}, null, ClassLoader::class);
270	}

common/vendor/ky/ky.min.js ADDED Viewed

	@@ -0,0 +1,8 @@


1	+ /**
2	+ * Bundled by jsDelivr using Rollup v2.60.2 and Terser v5.10.0.
3	+ * Original file: /npm/ky@0.29.0/distribution/index.js
4	+ *
5	+ * Do NOT use SRI with dynamically generated files! More information: https://www.jsdelivr.com/using-sri-with-dynamic-files
6	+ */
7	+ class t extends Error{constructor(t,e,s){const o=`${t.status\|\|0===t.status?t.status:""} ${t.statusText\|\|""}`.trim();super(`Request failed with ${o?`status code ${o}`:"an unknown error"}`),this.name="HTTPError",this.response=t,this.request=e,this.options=s}}class e extends Error{constructor(t){super("Request timed out"),this.name="TimeoutError",this.request=t}}const s=t=>null!==t&&"object"==typeof t,o=(...t)=>{for(const e of t)if((!s(e)\|\|Array.isArray(e))&&void 0!==e)throw new TypeError("The `options` argument must be an object");return n({},...t)},r=(t={},e={})=>{const s=new globalThis.Headers(t),o=e instanceof globalThis.Headers,r=new globalThis.Headers(e);for(const[t,e]of r.entries())o&&"undefined"===e\|\|void 0===e?s.delete(t):s.set(t,e);return s},n=(...t)=>{let e={},o={};for(const i of t)if(Array.isArray(i))Array.isArray(e)\|\|(e=[]),e=[...e,...i];else if(s(i)){for(let[t,o]of Object.entries(i))s(o)&&t in e&&(o=n(e[t],o)),e={...e,[t]:o};s(i.headers)&&(o=r(o,i.headers),e.headers=o)}return e},i="function"==typeof globalThis.AbortController,a="function"==typeof globalThis.ReadableStream,h="function"==typeof globalThis.FormData,u=["get","post","put","patch","head","delete"],p={json:"application/json",text:"text/",formData:"multipart/form-data",arrayBuffer:"/",blob:"/"},l=Symbol("stop"),c=t=>u.includes(t)?t.toUpperCase():t,f=[413,429,503],d={limit:2,methods:["get","put","head","delete","options","trace"],statusCodes:[408,413,429,500,502,503,504],afterStatusCodes:f,maxRetryAfter:Number.POSITIVE_INFINITY},y=(t={})=>{if("number"==typeof t)return{...d,limit:t};if(t.methods&&!Array.isArray(t.methods))throw new Error("retry.methods must be an array");if(t.statusCodes&&!Array.isArray(t.statusCodes))throw new Error("retry.statusCodes must be an array");return{...d,...t,afterStatusCodes:f}};class _{constructor(t,e={}){var s,o;if(this._retryCount=0,this._input=t,this._options={credentials:this._input.credentials\|\|"same-origin",...e,headers:r(this._input.headers,e.headers),hooks:n({beforeRequest:[],beforeRetry:[],beforeError:[],afterResponse:[]},e.hooks),method:c(null!==(s=e.method)&&void 0!==s?s:this._input.method),prefixUrl:String(e.prefixUrl\|\|""),retry:y(e.retry),throwHttpErrors:!1!==e.throwHttpErrors,timeout:void 0===e.timeout?1e4:e.timeout,fetch:null!==(o=e.fetch)&&void 0!==o?o:globalThis.fetch.bind(globalThis)},"string"!=typeof this._input&&!(this._input instanceof URL\|\|this._input instanceof globalThis.Request))throw new TypeError("`input` must be a string, URL, or Request");if(this._options.prefixUrl&&"string"==typeof this._input){if(this._input.startsWith("/"))throw new Error("`input` must not begin with a slash when using `prefixUrl`");this._options.prefixUrl.endsWith("/")\|\|(this._options.prefixUrl+="/"),this._input=this._options.prefixUrl+this._input}if(i&&(this.abortController=new globalThis.AbortController,this._options.signal&&this._options.signal.addEventListener("abort",(()=>{this.abortController.abort()})),this._options.signal=this.abortController.signal),this.request=new globalThis.Request(this._input,this._options),this._options.searchParams){const t="?"+("string"==typeof this._options.searchParams?this._options.searchParams.replace(/^\?/,""):new URLSearchParams(this._options.searchParams).toString()),e=this.request.url.replace(/(?:\?.?)?(?=#\|$)/,t);!(h&&this._options.body instanceof globalThis.FormData\|\|this._options.body instanceof URLSearchParams)\|\|this._options.headers&&this._options.headers["content-type"]\|\|this.request.headers.delete("content-type"),this.request=new globalThis.Request(new globalThis.Request(e,this.request),this._options)}void 0!==this._options.json&&(this._options.body=JSON.stringify(this._options.json),this.request.headers.set("content-type","application/json"),this.request=new globalThis.Request(this.request,{body:this._options.body}))}static create(e,s){const o=new _(e,s),r=async()=>{if(o._options.timeout>2147483647)throw new RangeError("The `timeout` option cannot be greater than 2147483647");await Promise.resolve();let e=await o._fetch();for(const t of o._options.hooks.afterResponse){const s=await t(o.request,o._options,o._decorateResponse(e.clone()));s instanceof globalThis.Response&&(e=s)}if(o._decorateResponse(e),!e.ok&&o._options.throwHttpErrors){let s=new t(e,o.request,o._options);for(const t of o._options.hooks.beforeError)s=await t(s);throw s}if(o._options.onDownloadProgress){if("function"!=typeof o._options.onDownloadProgress)throw new TypeError("The `onDownloadProgress` option must be a function");if(!a)throw new Error("Streams are not supported in your environment. `ReadableStream` is missing.");return o._stream(e.clone(),o._options.onDownloadProgress)}return e},n=o._options.retry.methods.includes(o.request.method.toLowerCase())?o._retry(r):r();for(const[t,e]of Object.entries(p))n[t]=async()=>{o.request.headers.set("accept",o.request.headers.get("accept")\|\|e);const r=(await n).clone();if("json"===t){if(204===r.status)return"";if(s.parseJson)return s.parseJson(await r.text())}return r[t]()};return n}_calculateRetryDelay(s){if(this._retryCount++,this._retryCount<this._options.retry.limit&&!(s instanceof e)){if(s instanceof t){if(!this._options.retry.statusCodes.includes(s.response.status))return 0;const t=s.response.headers.get("Retry-After");if(t&&this._options.retry.afterStatusCodes.includes(s.response.status)){let e=Number(t);return Number.isNaN(e)?e=Date.parse(t)-Date.now():e=1e3,void 0!==this._options.retry.maxRetryAfter&&e>this._options.retry.maxRetryAfter?0:e}if(413===s.response.status)return 0}return.32*(this._retryCount-1)1e3}return 0}_decorateResponse(t){return this._options.parseJson&&(t.json=async()=>this._options.parseJson(await t.text())),t}async _retry(t){try{return await t()}catch(e){const s=Math.min(this._calculateRetryDelay(e),2147483647);if(0!==s&&this._retryCount>0){await(async t=>new Promise((e=>{setTimeout(e,t)})))(s);for(const t of this._options.hooks.beforeRetry){if(await t({request:this.request,options:this._options,error:e,retryCount:this._retryCount})===l)return}return this._retry(t)}throw e}}async _fetch(){for(const t of this._options.hooks.beforeRequest){const e=await t(this.request,this._options);if(e instanceof Request){this.request=e;break}if(e instanceof Response)return e}return!1===this._options.timeout?this._options.fetch(this.request.clone()):(async(t,s,o)=>new Promise(((r,n)=>{const i=setTimeout((()=>{s&&s.abort(),n(new e(t))}),o.timeout);o.fetch(t).then(r).catch(n).then((()=>{clearTimeout(i)}))})))(this.request.clone(),this.abortController,this._options)}_stream(t,e){const s=Number(t.headers.get("content-length"))\|\|0;let o=0;return new globalThis.Response(new globalThis.ReadableStream({async start(r){const n=t.body.getReader();e&&e({percent:0,transferredBytes:0,totalBytes:s},new Uint8Array),await async function t(){const{done:i,value:a}=await n.read();if(i)r.close();else{if(e){o+=a.byteLength;e({percent:0===s?0:o/s,transferredBytes:o,totalBytes:s},a)}r.enqueue(a),await t()}}()}}))}}
8	+ /! MIT License © Sindre Sorhus /const m=t=>{const e=(e,s)=>_.create(e,o(t,s));for(const s of u)e[s]=(e,r)=>_.create(e,o(t,r,{method:s}));return e.create=t=>m(o(t)),e.extend=e=>m(o(t,e)),e.stop=l,e},b=m();export{t as HTTPError,e as TimeoutError,b as default};

common/vendor/ky/tec-ky.js ADDED Viewed

	@@ -0,0 +1,2 @@


1	+ import ky from './ky.min.js';
2	+ tribe.ky = ky;

event-tickets.php CHANGED Viewed

	@@ -3,7 +3,7 @@
3	Plugin Name: Event Tickets
4	Plugin URI: https://evnt.is/1acb
5	Description: Event Tickets allows you to sell basic tickets and collect RSVPs from any post, page, or event.
6	- Version: 5.2.~~4.1~~
7	Author: The Events Calendar
8	Author URI: https://evnt.is/1aor
9	License: GPLv2 or later


3	Plugin Name: Event Tickets
4	Plugin URI: https://evnt.is/1acb
5	Description: Event Tickets allows you to sell basic tickets and collect RSVPs from any post, page, or event.
6	+ Version: 5.3.0
7	Author: The Events Calendar
8	Author URI: https://evnt.is/1aor
9	License: GPLv2 or later

lang/event-tickets.pot CHANGED Viewed

	@@ -2,59 +2,58 @@
2	# This file is distributed under the same license as the Event Tickets package.
3	msgid ""
4	msgstr ""
5	- "Project-Id-Version: Event Tickets 5.2.4\n"
6	"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/event-tickets\n"
7	- "POT-Creation-Date: 2022-02-09 17:16:04+00:00\n"
8	"MIME-Version: 1.0\n"
9	"Content-Type: text/plain; charset=UTF-8\n"
10	"Content-Transfer-Encoding: 8bit\n"
11	- "PO-Revision-Date: 2022-02-09 17:16\n"
12	"Last-Translator: \n"
13	"Language-Team: \n"
14
15	- #. #-#-#-#-# event-tickets.pot (Event Tickets 5.2.4) #-#-#-#-#
16	#. Plugin Name of the plugin/theme
17	#: event-tickets.php:61 src/Tribe/Admin/Notices.php:92 src/Tribe/Main.php:691
18	#: src/Tribe/Privacy.php:59 src/admin-views/admin-welcome-message.php:58
19	msgid "Event Tickets"
20	msgstr ""
21
22	- #: src/Tickets/Commerce/~~Admin/Notices~~.php:84
23	- #: ~~src/Tickets/Commerce/Admin/Notices~~.~~php:131~~
24	- #: src/Tickets/Commerce/Admin/Notices.php:176
25	- msgid "Learn More"
26	msgstr ""
27
28	- #: src/Tickets/Commerce/~~Admin/Notices~~.php:86
29	- msgid "~~Anonymous~~ ~~purchases~~ ~~are~~ ~~enabled~~"
30	msgstr ""
31
32	- #. ~~translators~~: ~~%1$s: Link to knowledgebase article.~~
33	- #: ~~src/Tickets/Commerce/Admin/Notices~~.~~php:89~~
34	- ~~msgid~~ ""
35	- ~~"It is recommended that you require users to log in before purchasing tickets "~~
36	- ~~"on~~ ~~the Settings >~~ Tickets ~~page~~. ~~Otherwise, it is possible for users to "~~
37	- ~~"purchase~~ ~~a ticket and never receive the tickets via email~~. ~~%1$s"~~

38	msgstr ""
39
40	- #: src/Tickets/Commerce/Admin/Notices.php:~~133~~
41	msgid "Set up your checkout page"
42	msgstr ""
43
44	#. translators: %1$s: Link to knowledgebase article.
45	- #: src/Tickets/Commerce/Admin/Notices.php:~~136~~
46	msgid ""
47	"In order to start selling with Tickets Commerce, you'll need to set up your "
48	"checkout page. Please configure the setting on Settings > Payments and "
49	"confirm that the page you have selected has the proper shortcode. %1$s"
50	msgstr ""
51
52	- #: src/Tickets/Commerce/Admin/Notices.php:~~178~~
53	msgid "Set up your order success page"
54	msgstr ""
55
56	#. translators: %1$s: Link to knowledgebase article.
57	- #: src/Tickets/Commerce/Admin/Notices.php:~~181~~
58	msgid ""
59	"In order to start selling with Tickets Commerce, you'll need to set up your "
60	"order success page. Please configure the setting on Settings > Payments and "
	@@ -121,7 +120,7 @@ msgid "Details"
121	msgstr ""
122
123	#: src/Tickets/Commerce/Admin_Tables/Attendees.php:219
124	- #: src/views/tickets/email.php:~~456~~
125	msgid "Security Code"
126	msgstr ""
127
	@@ -279,6 +278,14 @@ msgstr ""
279	msgid "%1$s"
280	msgstr ""
281








282	#: src/Tickets/Commerce/Attendee.php:200 src/Tribe/Admin/Columns/Tickets.php:56
283	#: src/Tribe/Admin/Manager/Service_Provider.php:173 src/Tribe/Attendees.php:207
284	#: src/Tribe/Commerce/PayPal/Main.php:456
	@@ -298,23 +305,36 @@ msgstr ""
298	msgid "Tickets Commerce Checkout Page"
299	msgstr ""
300













301	#: src/Tickets/Commerce/Gateways/Manual/Gateway.php:27
302	msgid "Manually Generated"
303	msgstr ""
304
305	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:43
306	msgid "Disconnect PayPal Account"
307	msgstr ""
308
309	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:44
310	msgid "Are you sure you want to disconnect your PayPal account?"
311	msgstr ""
312
313	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:45
314	msgid "You’re connected to PayPal! Here’s what’s next..."
315	msgstr ""
316
317	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:47
318	msgid ""
319	"PayPal allows you to accept credit or debit cards directly on your website. "
320	"Because of\n"
	@@ -326,47 +346,47 @@ msgid ""
326	"comprised of, but not limited to:"
327	msgstr ""
328
329	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:57
330	msgid ""
331	"Using a trusted, secure hosting provider – preferably one which claims and "
332	"actively promotes PCI compliance."
333	msgstr ""
334
335	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:58
336	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:35
337	msgid ""
338	"Maintain security best practices when setting passwords and limit access to "
339	"your server."
340	msgstr ""
341
342	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:59
343	msgid "Implement an SSL certificate to keep your payments secure."
344	msgstr ""
345
346	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:60
347	msgid "Keep plugins up to date to ensure latest security fixes are present."
348	msgstr ""
349
350	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:63
351	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode.php:23
352	msgid ""
353	"You have connected your account for test mode. You will need to connect "
354	"again once you are in live mode."
355	msgstr ""
356
357	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:~~108~~
358	msgid "E.g.: 123"
359	msgstr ""
360
361	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:~~109~~
362	msgid "E.g.: 03/26"
363	msgstr ""
364
365	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:~~110~~
366	msgid "E.g.: 4111 1111 1111 1111"
367	msgstr ""
368
369	- #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:~~111~~
370	msgid "E.g.: 01020"
371	msgstr ""
372
	@@ -392,59 +412,54 @@ msgstr ""
392	msgid "Unexpected PayPal response when updating webhook"
393	msgstr ""
394
395	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:44
396	msgid "PayPal"
397	msgstr ""
398
399	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~104~~
400	msgid "PayPal is now connected."
401	msgstr ""
402
403	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~109~~
404	msgid "Failed to disconnect PayPal account."
405	msgstr ""
406
407	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~114~~
408	msgid "Disconnected PayPal account."
409	msgstr ""
410
411	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~119~~
412	msgid "Failed to refresh PayPal access token."
413	msgstr ""
414
415	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~124~~
416	msgid "PayPal access token was refreshed successfully."
417	msgstr ""
418
419	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~129~~
420	msgid "Failed to refresh PayPal user info."
421	msgstr ""
422
423	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~134~~
424	msgid "PayPal user info was refreshed successfully."
425	msgstr ""
426
427	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~139~~
428	msgid "Failed to refresh PayPal webhooks."
429	msgstr ""
430
431	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~144~~
432	msgid "PayPal webhooks refreshed successfully."
433	msgstr ""
434
435	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~149~~
436	msgid ""
437	"A valid SSL certificate is required to set up your PayPal account and accept "
438	"payments"
439	msgstr ""
440
441	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:~~171~~
442	- #: ~~src/views/v2/commerce/checkout~~.~~php:54~~
443	- msgid "Something went wrong!"
444	- msgstr ""
445	-
446	- #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:172
447	- msgid "Unexpected response recieved."
448	msgstr ""
449
450	#: src/Tickets/Commerce/Gateways/PayPal/Location/Country.php:95
	@@ -4441,108 +4456,112 @@ msgstr ""
4441	msgid "Zaragoza"
4442	msgstr ""
4443
4444	- #: src/Tickets/Commerce/Gateways/PayPal/REST/On_Boarding_Endpoint.php:~~141~~
4445	msgid "Unexpected response from PayPal when on boarding"
4446	msgstr ""
4447
4448	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~341~~
4449	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~379~~
4450	msgid "Order ID in PayPal"
4451	msgstr ""
4452
4453	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~354~~
4454	msgid "Payer ID token from PayPal"
4455	msgstr ""
4456
4457	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~392~~

4458	msgid "To which status the failing should change this order to"
4459	msgstr ""
4460
4461	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~405~~

4462	msgid "Why this particular order has failed."
4463	msgstr ""
4464
4465	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~459~~
4466	msgid "Creating new PayPal order failed. Please try again."
4467	msgstr ""
4468
4469	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~460~~
4470	msgid "Your PayPal order was cancelled."
4471	msgstr ""
4472
4473	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~461~~
4474	msgid "Provided Order id is not valid."
4475	msgstr ""
4476
4477	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~462~~
4478	msgid "There was a problem while processing your payment, please try again."
4479	msgstr ""
4480
4481	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:~~463~~
4482	msgid "There was a problem with the Order status change, please try again."
4483	msgstr ""
4484
4485	#. Translators: %s: The event type.
4486	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:~~150~~
4487	msgid "Received PayPal webhook event for type: %s"
4488	msgstr ""
4489
4490	#. Translators: %s: The PayPal payment event.
4491	- #: ~~src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint~~.~~php:161~~

4492	#: src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php:53

4493	msgid "Invalid event type for webhook event: %s"
4494	msgstr ""
4495
4496	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:~~174~~
4497	msgid "Failed PayPal webhook event verification"
4498	msgstr ""
4499
4500	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:~~223~~
4501	msgid "Processes the Webhook as long as it includes valid Payment Event data"
4502	msgstr ""
4503
4504	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:~~230~~
4505	msgid "Whether the processing was successful"
4506	msgstr ""
4507
4508	- #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:~~239~~
4509	msgid "The webhook was invalid and was not processed"
4510	msgstr ""
4511
4512	- #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:33
4513	msgid "-- Please select a country --"
4514	msgstr ""
4515
4516	#. Translators: %s: The PayPal telephone number.
4517	- #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:86
4518	msgid "Please call a PayPal support representative at %s"
4519	msgstr ""
4520
4521	- #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:90
4522	msgid ""
4523	"Please reach out to PayPal support from your PayPal account Resolution Center"
4524	msgstr ""
4525
4526	- #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:93
4527	msgid " and relay the following message:"
4528	msgstr ""
4529
4530	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~301~~
4531	msgid ""
4532	"There was a problem with the status check for your account. Please try "
4533	"disconnecting and connecting again. If the problem persists, please contact "
4534	"support."
4535	msgstr ""
4536
4537	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~311~~
4538	msgid "Set up an account to receive payment from PayPal"
4539	msgstr ""
4540
4541	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~315~~
4542	msgid "Confirm your primary email address"
4543	msgstr ""
4544
4545	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~326~~
4546	msgid ""
4547	"Your account was expected to be able to accept custom payments, but is not. "
4548	"Please make sure your\n"
	@@ -4550,11 +4569,11 @@ msgid ""
4550	"persists, please contact PayPal."
4551	msgstr ""
4552
4553	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~345~~
4554	msgid "Reach out to PayPal to enable PPCP_CUSTOM for your account"
4555	msgstr ""
4556
4557	- #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:~~357~~
4558	msgid "Reach out to PayPal to resolve the following capabilities:"
4559	msgstr ""
4560
	@@ -4608,7 +4627,7 @@ msgid "Refunds"
4608	msgstr ""
4609
4610	#: src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php:79
4611	- #: src/Tickets/Commerce/Status/Reversed.php:27
4612	msgid "Reversed"
4613	msgstr ""
4614
	@@ -4632,6 +4651,326 @@ msgstr ""
4632	msgid "Change %1$s in PayPal from webhook: %2$s"
4633	msgstr ""
4634
































































































































































































































































































































4635	#: src/Tickets/Commerce/Legacy_Compat.php:86
4636	msgid "Tribe Commerce ( Legacy PayPal, not recommended )"
4637	msgstr ""
	@@ -4641,7 +4980,7 @@ msgstr ""
4641	msgid "(deleted)"
4642	msgstr ""
4643
4644	- #: src/Tickets/Commerce/Module.php:20
4645	msgid "Tickets Commerce"
4646	msgstr ""
4647
	@@ -4651,43 +4990,41 @@ msgstr ""
4651	msgid "Orders"
4652	msgstr ""
4653
4654	- #: src/Tickets/Commerce/Payments_Tab.php:58
4655	msgid "Payments"
4656	msgstr ""
4657
4658	- #: src/Tickets/Commerce/Payments_Tab.php:73 src/Tribe/Admin/Notices.php:214
4659	#: src/Tribe/Main.php:666 src/admin-views/admin-welcome-message.php:56
4660	#: src/admin-views/tribe-commerce-settings.php:4
4661	msgid "Event Tickets Plus"
4662	msgstr ""
4663
4664	- #: ~~src/~~Tickets~~/Commerce/Payments_Tab~~.~~php:77~~
4665	- #: src/~~admin-views~~/~~tribe-commerce-settings~~.php:9
4666	- msgid "Check it out!"
4667	- msgstr ""
4668	-
4669	- #. Translators: %1$s: The Event Tickets Plus link, %2$s: The word "ticket" in
4670	- #. lowercase, %3$s: The "Check it out!" link.
4671	- #: src/Tickets/Commerce/Payments_Tab.php:81
4672	msgctxt "about Tickets Commerce"
4673	msgid ""
4674	- "Tickets Commerce is a ~~light~~ ~~implementation~~ of a ~~commerce~~ ~~gateway~~ ~~using~~ "
4675	- "~~PayPal~~ ~~and~~ ~~simplified~~ ~~stock~~ ~~handling.~~ If ~~you~~ ~~need~~ ~~more~~ ~~advanced~~ ~~features,~~ "
4676	- "~~take~~ a ~~look~~ at ~~%1$s~~. In ~~addition~~ to ~~integrating~~ ~~with~~ ~~your~~ ~~favorite~~ ~~ecommerce~~ "
4677	- "~~provider~~, ~~Event~~ ~~Tickets~~ ~~Plus~~ ~~includes~~ ~~options~~ to ~~collect~~ ~~custom~~ ~~information~~ "
4678	- "~~for~~ ~~attendees,~~ ~~check~~ ~~attendees~~ in ~~via~~ QR ~~codes,~~ and ~~share stock between~~ "
4679	- "%2$s. %3$s"
4680	msgstr ""
4681
4682	- #: src/Tickets/Commerce/Payments_Tab.php:~~105~~
4683	msgid "Enable Tickets Commerce"
4684	msgstr ""
4685
4686	- #: ~~src/Tickets/Commerce/Payments_Tab~~.~~php:166~~





4687	msgid "Tickets Checkout"
4688	msgstr ""
4689
4690	- #: src/Tickets/Commerce/Payments_Tab.php:~~195~~
4691	msgid "Order Completed"
4692	msgstr ""
4693
	@@ -4798,44 +5135,44 @@ msgctxt "Browser title"
4798	msgid "%s - Tickets Commerce Orders"
4799	msgstr ""
4800
4801	- #: src/Tickets/Commerce/Settings.php:~~138~~
4802	msgid "Tickets Commerce Test Mode Active"
4803	msgstr ""
4804
4805	- #: src/Tickets/Commerce/Settings.php:~~174~~
4806	msgid "-- No page set --"
4807	msgstr ""
4808
4809	- #: src/Tickets/Commerce/Settings.php:~~189~~
4810	msgid "Tickets Commerce Settings"
4811	msgstr ""
4812
4813	- #: src/Tickets/Commerce/Settings.php:~~193~~
4814	msgid "Enable Test Mode"
4815	msgstr ""
4816
4817	- #: src/Tickets/Commerce/Settings.php:~~194~~
4818	msgid ""
4819	"Enables Test mode for testing payments. Any payments made will be done on "
4820	"\"sandbox\" accounts."
4821	msgstr ""
4822
4823	- #: src/Tickets/Commerce/Settings.php:~~200~~
4824	#: src/admin-views/tribe-commerce-settings.php:136
4825	msgid "Currency Code"
4826	msgstr ""
4827
4828	- #: src/Tickets/Commerce/Settings.php:~~201~~
4829	msgid "The currency that will be used for Tickets Commerce transactions."
4830	msgstr ""
4831
4832	- #: src/Tickets/Commerce/Settings.php:~~208~~
4833	#: src/admin-views/tribe-commerce-settings.php:144
4834	msgid "Stock Handling"
4835	msgstr ""
4836
4837	#. Translators: %s: The word "ticket" in lowercase.
4838	- #: src/Tickets/Commerce/Settings.php:~~212~~
4839	msgctxt "tickets fields settings paypal stock handling"
4840	msgid ""
4841	"When a customer purchases a %s, the payment gateway might flag the order as "
	@@ -4845,62 +5182,62 @@ msgstr ""
4845
4846	#. Translators: %1$s: The word "ticket" in lowercase. %2$s: `<strong>` opening
4847	#. tag. %3$s: `</strong>` closing tag.
4848	- #: src/Tickets/Commerce/Settings.php:~~221~~
4849	msgid ""
4850	"Decrease available %1$s stock as soon as a %2$sPending%3$s order is created."
4851	msgstr ""
4852
4853	#. Translators: %1$s: The word "ticket" in lowercase. %2$s: `<strong>` opening
4854	#. tag. %3$s: `</strong>` closing tag.
4855	- #: src/Tickets/Commerce/Settings.php:~~228~~
4856	msgid ""
4857	"Only decrease available %1$s stock if an order is confirmed as %2$sCompleted"
4858	"%3$s by the payment gateway."
4859	msgstr ""
4860
4861	- #: src/Tickets/Commerce/Settings.php:~~238~~
4862	msgid "Checkout page"
4863	msgstr ""
4864
4865	#. Translators: %s: The [shortcode] for the success page.
4866	- #: src/Tickets/Commerce/Settings.php:~~242~~
4867	msgid ""
4868	"This is the page where customers go to complete their purchase. Use the %s "
4869	"shortcode to display the checkout experience in the page content."
4870	msgstr ""
4871
4872	- #: src/Tickets/Commerce/Settings.php:~~253~~
4873	#: src/admin-views/tribe-commerce-settings.php:162
4874	msgid "Success page"
4875	msgstr ""
4876
4877	#. Translators: %s: The [shortcode] for the success page.
4878	- #: src/Tickets/Commerce/Settings.php:~~257~~
4879	msgid ""
4880	"After a successful order, users will be redirected to this page. Use the %s "
4881	"shortcode to display the order confirmation to the user in the page content."
4882	msgstr ""
4883
4884	- #: src/Tickets/Commerce/Settings.php:~~268~~
4885	#: src/admin-views/tribe-commerce-settings.php:176
4886	msgid "Confirmation email sender address"
4887	msgstr ""
4888
4889	#. Translators: %s: The word "tickets" in lowercase.
4890	- #: src/Tickets/Commerce/Settings.php:~~272~~
4891	msgctxt "tickets fields settings confirmation email"
4892	msgid ""
4893	"Email address that %s customers will receive confirmation from. Leave empty "
4894	"to use the default WordPress site email address."
4895	msgstr ""
4896
4897	- #: src/Tickets/Commerce/Settings.php:~~283~~
4898	#: src/admin-views/tribe-commerce-settings.php:185
4899	msgid "Confirmation email sender name"
4900	msgstr ""
4901
4902	#. Translators: %s: The word "ticket" in lowercase.
4903	- #: src/Tickets/Commerce/Settings.php:~~287~~
4904	#: src/admin-views/tribe-commerce-settings.php:186
4905	msgctxt "tickets fields settings paypal email sender"
4906	msgid ""
	@@ -4908,13 +5245,13 @@ msgid ""
4908	"purchase."
4909	msgstr ""
4910
4911	- #: src/Tickets/Commerce/Settings.php:~~298~~
4912	#: src/admin-views/tribe-commerce-settings.php:194
4913	msgid "Confirmation email subject"
4914	msgstr ""
4915
4916	#. Translators: %s: The word "ticket" in lowercase.
4917	- #: src/Tickets/Commerce/Settings.php:~~302~~
4918	#: src/admin-views/tribe-commerce-settings.php:195
4919	msgctxt "tickets fields settings paypal email subject"
4920	msgid ""
	@@ -4923,12 +5260,21 @@ msgid ""
4923	msgstr ""
4924
4925	#. Translators: %s: The word "tickets" in lowercase.
4926	- #: src/Tickets/Commerce/Settings.php:~~310~~
4927	#: src/admin-views/tribe-commerce-settings.php:197
4928	msgctxt "tickets fields settings paypal email subject"
4929	msgid "You have %s!"
4930	msgstr ""
4931









4932	#: src/Tickets/Commerce/Status/Action_Required.php:29
4933	msgid "Action Required"
4934	msgstr ""
	@@ -4947,7 +5293,7 @@ msgstr ""
4947	msgid "Created"
4948	msgstr ""
4949
4950	- #: src/Tickets/Commerce/Status/Denied.php:28
4951	msgid "Denied"
4952	msgstr ""
4953
	@@ -4959,35 +5305,35 @@ msgstr ""
4959	msgid "Pending"
4960	msgstr ""
4961
4962	- #: src/Tickets/Commerce/Status/Pending.php:94
4963	msgid "This order contained an invalid Ticket (ID: %1$d)"
4964	msgstr ""
4965
4966	- #: src/Tickets/Commerce/Status/Pending.php:~~109~~
4967	msgid "This order contained a Ticket with an invalid Event (Event ID: %1$d)"
4968	msgstr ""
4969
4970	- #: src/Tickets/Commerce/Status/Pending.php:~~123~~
4971	msgid "Cannot purchase zero of \"%1$s\""
4972	msgstr ""
4973
4974	- #: src/Tickets/Commerce/Status/Pending.php:~~140~~
4975	msgid "Insufficient stock for \"%1$s\""
4976	msgstr ""
4977
4978	- #: src/Tickets/Commerce/Status/Pending.php:~~156~~
4979	msgid "%s will be available on %s at %s"
4980	msgstr ""
4981
4982	- #: src/Tickets/Commerce/Status/Pending.php:~~158~~ src/Tribe/Tickets.php:3195
4983	msgid "%s are no longer available."
4984	msgstr ""
4985
4986	- #: src/Tickets/Commerce/Status/Pending.php:~~160~~ src/Tribe/Tickets.php:3197
4987	msgid "There are no %s available at this time."
4988	msgstr ""
4989
4990	- #: src/Tickets/Commerce/Status/Refunded.php:27
4991	msgid "Refunded"
4992	msgstr ""
4993
	@@ -4995,7 +5341,7 @@ msgstr ""
4995	msgid "Undefined"
4996	msgstr ""
4997
4998	- #: src/Tickets/Commerce/Status/Voided.php:29
4999	msgid "Voided"
5000	msgstr ""
5001
	@@ -5025,127 +5371,127 @@ msgstr ""
5025	msgid "unavailable"
5026	msgstr ""
5027
5028	- #: src/Tickets/Commerce/Utils/Currency.php:~~264~~
5029	#: src/Tribe/Commerce/Currency.php:197
5030	msgid "Australian Dollar (AUD)"
5031	msgstr ""
5032
5033	- #: src/Tickets/Commerce/Utils/Currency.php:~~270~~
5034	#: src/Tribe/Commerce/Currency.php:203
5035	msgid "Brazilian Real (BRL)"
5036	msgstr ""
5037
5038	- #: src/Tickets/Commerce/Utils/Currency.php:~~276~~
5039	#: src/Tribe/Commerce/Currency.php:209
5040	msgid "Canadian Dollar (CAD)"
5041	msgstr ""
5042
5043	- #: src/Tickets/Commerce/Utils/Currency.php:~~282~~
5044	#: src/Tribe/Commerce/Currency.php:215
5045	msgid "Swiss Franc (CHF)"
5046	msgstr ""
5047
5048	- #: src/Tickets/Commerce/Utils/Currency.php:~~288~~
5049	#: src/Tribe/Commerce/Currency.php:221
5050	msgid "Czech Koruna (CZK)"
5051	msgstr ""
5052
5053	- #: src/Tickets/Commerce/Utils/Currency.php:~~295~~
5054	#: src/Tribe/Commerce/Currency.php:228
5055	msgid "Danish Krone (DKK)"
5056	msgstr ""
5057
5058	- #: src/Tickets/Commerce/Utils/Currency.php:~~301~~
5059	#: src/Tribe/Commerce/Currency.php:234
5060	msgid "Euro (EUR)"
5061	msgstr ""
5062
5063	- #: src/Tickets/Commerce/Utils/Currency.php:~~307~~
5064	#: src/Tribe/Commerce/Currency.php:240
5065	msgid "Pound Sterling (GBP)"
5066	msgstr ""
5067
5068	- #: src/Tickets/Commerce/Utils/Currency.php:~~313~~
5069	#: src/Tribe/Commerce/Currency.php:246
5070	msgid "Hong Kong Dollar (HKD)"
5071	msgstr ""
5072
5073	- #: src/Tickets/Commerce/Utils/Currency.php:~~319~~
5074	#: src/Tribe/Commerce/Currency.php:252
5075	msgid "Hungarian Forint (HUF)"
5076	msgstr ""
5077
5078	- #: src/Tickets/Commerce/Utils/Currency.php:~~325~~
5079	#: src/Tribe/Commerce/Currency.php:258
5080	msgid "Israeli New Sheqel (ILS)"
5081	msgstr ""
5082
5083	- #: src/Tickets/Commerce/Utils/Currency.php:~~331~~
5084	#: src/Tribe/Commerce/Currency.php:264
5085	msgid "Indian Rupee (INR)"
5086	msgstr ""
5087
5088	- #: src/Tickets/Commerce/Utils/Currency.php:~~337~~
5089	#: src/Tribe/Commerce/Currency.php:270
5090	msgid "Japanese Yen (JPY)"
5091	msgstr ""
5092
5093	- #: src/Tickets/Commerce/Utils/Currency.php:~~343~~
5094	#: src/Tribe/Commerce/Currency.php:276
5095	msgid "Malaysian Ringgit (MYR)"
5096	msgstr ""
5097
5098	- #: src/Tickets/Commerce/Utils/Currency.php:~~349~~
5099	#: src/Tribe/Commerce/Currency.php:282
5100	msgid "Mexican Peso (MXN)"
5101	msgstr ""
5102
5103	- #: src/Tickets/Commerce/Utils/Currency.php:~~355~~
5104	#: src/Tribe/Commerce/Currency.php:288
5105	msgid "Norwegian Krone (NOK)"
5106	msgstr ""
5107
5108	- #: src/Tickets/Commerce/Utils/Currency.php:~~361~~
5109	#: src/Tribe/Commerce/Currency.php:294
5110	msgid "New Zealand Dollar (NZD)"
5111	msgstr ""
5112
5113	- #: src/Tickets/Commerce/Utils/Currency.php:~~367~~
5114	#: src/Tribe/Commerce/Currency.php:300
5115	msgid "Philippine Peso (PHP)"
5116	msgstr ""
5117
5118	- #: src/Tickets/Commerce/Utils/Currency.php:~~373~~
5119	#: src/Tribe/Commerce/Currency.php:306
5120	msgid "Polish Zloty (PLN)"
5121	msgstr ""
5122
5123	- #: src/Tickets/Commerce/Utils/Currency.php:~~379~~
5124	#: src/Tribe/Commerce/Currency.php:312
5125	msgid "Russian Ruble (RUB)"
5126	msgstr ""
5127
5128	- #: src/Tickets/Commerce/Utils/Currency.php:~~385~~
5129	#: src/Tribe/Commerce/Currency.php:318
5130	msgid "Swedish Krona (SEK)"
5131	msgstr ""
5132
5133	- #: src/Tickets/Commerce/Utils/Currency.php:~~391~~
5134	#: src/Tribe/Commerce/Currency.php:324
5135	msgid "Singapore Dollar (SGD)"
5136	msgstr ""
5137
5138	- #: src/Tickets/Commerce/Utils/Currency.php:~~397~~
5139	#: src/Tribe/Commerce/Currency.php:330
5140	msgid "Thai Baht (THB)"
5141	msgstr ""
5142
5143	- #: src/Tickets/Commerce/Utils/Currency.php:~~403~~
5144	#: src/Tribe/Commerce/Currency.php:336
5145	msgid "Taiwan New Dollar (TWD)"
5146	msgstr ""
5147
5148	- #: src/Tickets/Commerce/Utils/Currency.php:~~409~~
5149	#: src/Tribe/Commerce/Currency.php:342
5150	msgid "U.S. Dollar (USD)"
5151	msgstr ""
	@@ -5398,14 +5744,6 @@ msgstr ""
5398	msgid "Get started"
5399	msgstr ""
5400
5401	- #: src/Tribe/Admin/Settings/Service_Provider.php:146
5402	- #: src/Tribe/Admin/Settings/Service_Provider.php:194
5403	- #: src/admin-views/admin-welcome-message.php:157
5404	- #: src/admin-views/admin-welcome-message.php:179
5405	- #: src/admin-views/admin-welcome-message.php:199
5406	- msgid "Learn more"
5407	- msgstr ""
5408	-
5409	#: src/Tribe/Admin/Settings/Service_Provider.php:191
5410	msgid ""
5411	"Tribe Commerce has been replaced by our new payments system, Tickets "
	@@ -5839,28 +6177,28 @@ msgstr ""
5839	msgid "Are you sure you want to cancel?"
5840	msgstr ""
5841
5842	- #: src/Tribe/Editor/Blocks/Tickets.php:~~300~~ src/Tribe/Tickets.php:4329
5843	msgctxt "Error message title, will be followed by the error code."
5844	msgid "API Error"
5845	msgstr ""
5846
5847	- #: src/Tribe/Editor/Blocks/Tickets.php:~~301~~ src/Tribe/Tickets.php:4330
5848	msgid ""
5849	"Refresh this page or wait a few minutes before trying again. If this happens "
5850	"repeatedly, please contact the Site Admin."
5851	msgstr ""
5852
5853	- #: src/Tribe/Editor/Blocks/Tickets.php:~~302~~ src/Tribe/Tickets.php:4331
5854	msgid ""
5855	"The ticket for this event has sold out and has been removed from your cart."
5856	msgstr ""
5857
5858	- #: src/Tribe/Editor/Blocks/Tickets.php:~~303~~ src/Tribe/Tickets.php:4332
5859	#: src/views/v2/commerce/order/header/title-empty.php:28
5860	msgid "Whoops!"
5861	msgstr ""
5862
5863	- #: src/Tribe/Editor/Blocks/Tickets.php:~~304~~ src/Tribe/Tickets.php:4333
5864	msgctxt "The %s will change based on the error produced."
5865	msgid "You have %s ticket(s) with a field that requires information."
5866	msgstr ""
	@@ -8081,43 +8419,55 @@ msgstr ""
8081	msgid "New!"
8082	msgstr ""
8083
8084	- #: ~~src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token~~.~~php:28~~










8085	msgid "Refresh Access Token"
8086	msgstr ""
8087
8088	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-connection.php:31
8089	msgid "Resync payment connection"
8090	msgstr ""
8091
8092	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info.php:29
8093	msgid "Refresh User Info"
8094	msgstr ""
8095
8096	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-webhook.php:29
8097	msgid "Refresh Webhook"
8098	msgstr ""
8099
8100	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php:27

8101	msgid "Connected as:"
8102	msgstr ""
8103
8104	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php:37

8105	msgid "Disconnect"
8106	msgstr ""
8107
8108	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php:25
8109	msgid "PayPal Status:"
8110	msgstr ""
8111
8112	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php:29
8113	msgid "Connected"
8114	msgstr ""
8115
8116	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php:34
8117	msgid "Webhooks:"
8118	msgstr ""
8119
8120	- #: src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php:51
8121	msgid "payment connection error"
8122	msgstr ""
8123
	@@ -8126,14 +8476,15 @@ msgid "Learn more about configuring PayPal payments"
8126	msgstr ""
8127
8128	#: src/admin-views/settings/tickets-commerce/paypal/connect/help-links/troubleshooting.php:24

8129	msgid "Get troubleshooting help"
8130	msgstr ""
8131
8132	- #: src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php:24
8133	msgid "Accept online payments with PayPal!"
8134	msgstr ""
8135
8136	- #: src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php:29
8137	msgid ""
8138	"Start selling tickets to your events today with PayPal. Attendees can "
8139	"purchase tickets directly on your site using debit or credit cards with no "
	@@ -8149,56 +8500,60 @@ msgid "Easy no-API key connection"
8149	msgstr ""
8150
8151	#: src/admin-views/settings/tickets-commerce/paypal/connect/logo/features.php:25

8152	msgid "Accept payments from around the world"
8153	msgstr ""
8154
8155	#: src/admin-views/settings/tickets-commerce/paypal/connect/logo/features.php:28

8156	msgid "Supports 3D Secure payments"
8157	msgstr ""
8158
8159	- #: src/admin-views/settings/tickets-commerce/paypal/connect/logo/image.php:22
8160	msgid "PayPal Logo Image"
8161	msgstr ""
8162
8163	#. Translators: %1$s: opening `a` tag to the knowledge base article. %2$s:
8164	#. closing `a` tag to the knowledge base article.
8165	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:19
8166	msgid ""
8167	"PayPal allows you to accept credit or debit cards directly on your website. "
8168	"Because of this, your site needs to maintain %1$sPCI-DSS compliance%2$s."
8169	msgstr ""
8170
8171	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:26
8172	msgid ""
8173	"Event Tickets never stores sensitive information like card details to your "
8174	"server and works seamlessly with SSL certificates."
8175	msgstr ""
8176
8177	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:28
8178	msgid "Compliance is comprised of, but not limited to:"
8179	msgstr ""
8180
8181	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:32
8182	msgid ""
8183	"Using a trusted, secure hosting provider — preferably one which claims "
8184	"and actively promotes PCI compliance."
8185	msgstr ""
8186
8187	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:38
8188	msgid "Implement an SSL certificate to keep your ticket sales secure."
8189	msgstr ""
8190
8191	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:41
8192	msgid ""
8193	"Keep WordPress and plugins up to date to ensure latest security fixes are "
8194	"present."
8195	msgstr ""
8196
8197	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:51

8198	msgid "Close this modal window"
8199	msgstr ""
8200
8201	- #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:53

8202	msgid "Got it, thanks!"
8203	msgstr ""
8204
	@@ -8214,6 +8569,136 @@ msgstr ""
8214	msgid "Connect Automatically with <i>PayPal</i>"
8215	msgstr ""
8216


































































































































8217	#: src/admin-views/ticket-type-history.php:13
8218	msgctxt "ticket type history"
8219	msgid "%s history:"
	@@ -8227,6 +8712,10 @@ msgstr ""
8227	msgid "Click to hide history"
8228	msgstr ""
8229




8230	#: src/admin-views/tribe-commerce-settings.php:13
8231	msgctxt "about Tribe Commerce"
8232	msgid ""
	@@ -8972,7 +9461,7 @@ msgstr ""
8972
8973	#: src/views/registration/attendees/fields.php:15
8974	#: src/views/registration-js/attendees/fields.php:19
8975	- #: src/views/tickets/email.php:~~452~~
8976	msgid "Attendee"
8977	msgstr ""
8978
	@@ -8984,10 +9473,6 @@ msgstr ""
8984	msgid "Back to cart"
8985	msgstr ""
8986
8987	- #: src/views/registration/button-checkout.php:31
8988	- msgid "Checkout"
8989	- msgstr ""
8990	-
8991	#: src/views/registration/cart-empty.php:15
8992	msgid "You currently have no events awaiting registration"
8993	msgstr ""
	@@ -9097,11 +9582,11 @@ msgid_plural ""
9097	msgstr[0] ""
9098	msgstr[1] ""
9099
9100	- #: src/views/tickets/email.php:~~437~~
9101	msgid "Ticket #"
9102	msgstr ""
9103
9104	- #: src/views/tickets/email.php:~~444~~
9105	msgctxt "ticket type email heading"
9106	msgid "%s Type"
9107	msgstr ""
	@@ -9304,17 +9789,21 @@ msgctxt "Closes the ticket description"
9304	msgid "Less info"
9305	msgstr ""
9306
9307	- #: src/views/v2/commerce/checkout/footer/gateway-error.php:42
9308	- #: src/views/v2/commerce/checkout.php:28
9309	msgid "Checkout Unavailable!"
9310	msgstr ""
9311
9312	- #: src/views/v2/commerce/checkout/footer/gateway-error.php:43
9313	msgid ""
9314	"Checkout is not available at this time because a payment method has not been "
9315	"set up. Please notify the site administrator."
9316	msgstr ""
9317




9318	#. Translators: %1$s: Singular `event` in lowercase.
9319	#: src/views/v2/commerce/checkout/header/links/back.php:36
9320	msgid "back to %1$s"
	@@ -9326,6 +9815,8 @@ msgstr ""
9326
9327	#. Translators: %1$s: Plural `Tickets` label.
9328	#: src/views/v2/commerce/checkout/header/title.php:31


9329	msgid "Purchase %1$s"
9330	msgstr ""
9331
	@@ -9342,13 +9833,29 @@ msgstr ""
9342	msgid "create a new account"
9343	msgstr ""
9344
9345	- #: src/views/v2/commerce/checkout.php:29
















9346	msgid ""
9347	"Checkout is not available at this time because a payment method has not been "
9348	"set up for this event. Please notify the site administrator."
9349	msgstr ""
9350
9351	- #: src/views/v2/commerce/checkout.php:53
9352	msgid "Checkout Error!"
9353	msgstr ""
9354
	@@ -9381,6 +9888,10 @@ msgstr ""
9381	msgid "PayPal Capture ID:"
9382	msgstr ""
9383




9384	#: src/views/v2/commerce/order/description/order-empty.php:28
9385	msgid "No order information is available because no purchase was made."
9386	msgstr ""


2	# This file is distributed under the same license as the Event Tickets package.
3	msgid ""
4	msgstr ""
5	+ "Project-Id-Version: Event Tickets 5.3.0\n"
6	"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/event-tickets\n"
7	+ "POT-Creation-Date: 2022-02-24 17:47:54+00:00\n"
8	"MIME-Version: 1.0\n"
9	"Content-Type: text/plain; charset=UTF-8\n"
10	"Content-Transfer-Encoding: 8bit\n"
11	+ "PO-Revision-Date: 2022-02-24 17:47\n"
12	"Last-Translator: \n"
13	"Language-Team: \n"
14
15	+ #. #-#-#-#-# event-tickets.pot (Event Tickets 5.3.0) #-#-#-#-#
16	#. Plugin Name of the plugin/theme
17	#: event-tickets.php:61 src/Tribe/Admin/Notices.php:92 src/Tribe/Main.php:691
18	#: src/Tribe/Privacy.php:59 src/admin-views/admin-welcome-message.php:58
19	msgid "Event Tickets"
20	msgstr ""
21
22	+ #: src/Tickets/Commerce/Abstract_Order.php:105
23	+ msgid "Please provide a valid purchaser name and email."


24	msgstr ""
25
26	+ #: src/Tickets/Commerce/Abstract_Order.php:111
27	+ msgid "Please provide a valid purchaser name."
28	msgstr ""
29
30	+ #: src/Tickets/Commerce/Abstract_Order.php:115
31	+ msgid "Please provide a valid purchaser email."
32	+ msgstr ""
33	+
34	+ #: src/Tickets/Commerce/Admin/Notices.php:70
35	+ #: src/Tickets/Commerce/Admin/Notices.php:115
36	+ msgid "Learn More"
37	msgstr ""
38
39	+ #: src/Tickets/Commerce/Admin/Notices.php:72
40	msgid "Set up your checkout page"
41	msgstr ""
42
43	#. translators: %1$s: Link to knowledgebase article.
44	+ #: src/Tickets/Commerce/Admin/Notices.php:75
45	msgid ""
46	"In order to start selling with Tickets Commerce, you'll need to set up your "
47	"checkout page. Please configure the setting on Settings > Payments and "
48	"confirm that the page you have selected has the proper shortcode. %1$s"
49	msgstr ""
50
51	+ #: src/Tickets/Commerce/Admin/Notices.php:117
52	msgid "Set up your order success page"
53	msgstr ""
54
55	#. translators: %1$s: Link to knowledgebase article.
56	+ #: src/Tickets/Commerce/Admin/Notices.php:120
57	msgid ""
58	"In order to start selling with Tickets Commerce, you'll need to set up your "
59	"order success page. Please configure the setting on Settings > Payments and "

120	msgstr ""
121
122	#: src/Tickets/Commerce/Admin_Tables/Attendees.php:219
123	+ #: src/views/tickets/email.php:458
124	msgid "Security Code"
125	msgstr ""
126

278	msgid "%1$s"
279	msgstr ""
280
281	+ #: src/Tickets/Commerce/Assets.php:101
282	+ msgid "Default checkout"
283	+ msgstr ""
284	+
285	+ #: src/Tickets/Commerce/Assets.php:102
286	+ msgid "Additional payment options"
287	+ msgstr ""
288	+
289	#: src/Tickets/Commerce/Attendee.php:200 src/Tribe/Admin/Columns/Tickets.php:56
290	#: src/Tribe/Admin/Manager/Service_Provider.php:173 src/Tribe/Attendees.php:207
291	#: src/Tribe/Commerce/PayPal/Main.php:456

305	msgid "Tickets Commerce Checkout Page"
306	msgstr ""
307
308	+ #: src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php:166
309	+ #: src/views/v2/commerce/checkout.php:55
310	+ msgid "Something went wrong!"
311	+ msgstr ""
312	+
313	+ #: src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php:167
314	+ msgid "Unexpected response recieved."
315	+ msgstr ""
316	+
317	+ #: src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php:263
318	+ msgid "Enabled for Checkout"
319	+ msgstr ""
320	+
321	#: src/Tickets/Commerce/Gateways/Manual/Gateway.php:27
322	msgid "Manually Generated"
323	msgstr ""
324
325	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:44
326	msgid "Disconnect PayPal Account"
327	msgstr ""
328
329	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:45
330	msgid "Are you sure you want to disconnect your PayPal account?"
331	msgstr ""
332
333	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:46
334	msgid "You’re connected to PayPal! Here’s what’s next..."
335	msgstr ""
336
337	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:48
338	msgid ""
339	"PayPal allows you to accept credit or debit cards directly on your website. "
340	"Because of\n"

346	"comprised of, but not limited to:"
347	msgstr ""
348
349	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:58
350	msgid ""
351	"Using a trusted, secure hosting provider – preferably one which claims and "
352	"actively promotes PCI compliance."
353	msgstr ""
354
355	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:59
356	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:36
357	msgid ""
358	"Maintain security best practices when setting passwords and limit access to "
359	"your server."
360	msgstr ""
361
362	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:60
363	msgid "Implement an SSL certificate to keep your payments secure."
364	msgstr ""
365
366	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:61
367	msgid "Keep plugins up to date to ensure latest security fixes are present."
368	msgstr ""
369
370	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:64
371	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode.php:24
372	msgid ""
373	"You have connected your account for test mode. You will need to connect "
374	"again once you are in live mode."
375	msgstr ""
376
377	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:111
378	msgid "E.g.: 123"
379	msgstr ""
380
381	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:112
382	msgid "E.g.: 03/26"
383	msgstr ""
384
385	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:113
386	msgid "E.g.: 4111 1111 1111 1111"
387	msgstr ""
388
389	+ #: src/Tickets/Commerce/Gateways/PayPal/Assets.php:114
390	msgid "E.g.: 01020"
391	msgstr ""
392

412	msgid "Unexpected PayPal response when updating webhook"
413	msgstr ""
414
415	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:55
416	msgid "PayPal"
417	msgstr ""
418
419	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:65
420	msgid "PayPal is now connected."
421	msgstr ""
422
423	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:70
424	msgid "Failed to disconnect PayPal account."
425	msgstr ""
426
427	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:75
428	msgid "Disconnected PayPal account."
429	msgstr ""
430
431	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:80
432	msgid "Failed to refresh PayPal access token."
433	msgstr ""
434
435	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:85
436	msgid "PayPal access token was refreshed successfully."
437	msgstr ""
438
439	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:90
440	msgid "Failed to refresh PayPal user info."
441	msgstr ""
442
443	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:95
444	msgid "PayPal user info was refreshed successfully."
445	msgstr ""
446
447	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:100
448	msgid "Failed to refresh PayPal webhooks."
449	msgstr ""
450
451	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:105
452	msgid "PayPal webhooks refreshed successfully."
453	msgstr ""
454
455	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:110
456	msgid ""
457	"A valid SSL certificate is required to set up your PayPal account and accept "
458	"payments"
459	msgstr ""
460
461	+ #: src/Tickets/Commerce/Gateways/PayPal/Gateway.php:129
462	+ msgid "Enable payments through PayPal, Venmo, and credit card."





463	msgstr ""
464
465	#: src/Tickets/Commerce/Gateways/PayPal/Location/Country.php:95

4456	msgid "Zaragoza"
4457	msgstr ""
4458
4459	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/On_Boarding_Endpoint.php:98
4460	msgid "Unexpected response from PayPal when on boarding"
4461	msgstr ""
4462
4463	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:311
4464	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:349
4465	msgid "Order ID in PayPal"
4466	msgstr ""
4467
4468	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:324
4469	msgid "Payer ID token from PayPal"
4470	msgstr ""
4471
4472	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:362
4473	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:282
4474	msgid "To which status the failing should change this order to"
4475	msgstr ""
4476
4477	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:375
4478	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:295
4479	msgid "Why this particular order has failed."
4480	msgstr ""
4481
4482	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:416
4483	msgid "Creating new PayPal order failed. Please try again."
4484	msgstr ""
4485
4486	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:417
4487	msgid "Your PayPal order was cancelled."
4488	msgstr ""
4489
4490	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:418
4491	msgid "Provided Order id is not valid."
4492	msgstr ""
4493
4494	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:419
4495	msgid "There was a problem while processing your payment, please try again."
4496	msgstr ""
4497
4498	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php:420
4499	msgid "There was a problem with the Order status change, please try again."
4500	msgstr ""
4501
4502	#. Translators: %s: The event type.
4503	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:120
4504	msgid "Received PayPal webhook event for type: %s"
4505	msgstr ""
4506
4507	#. Translators: %s: The PayPal payment event.
4508	+ #. Translators: %s: The Stripe payment event.
4509	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:131
4510	#: src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php:53
4511	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php:51
4512	msgid "Invalid event type for webhook event: %s"
4513	msgstr ""
4514
4515	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:144
4516	msgid "Failed PayPal webhook event verification"
4517	msgstr ""
4518
4519	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:193
4520	msgid "Processes the Webhook as long as it includes valid Payment Event data"
4521	msgstr ""
4522
4523	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:200
4524	msgid "Whether the processing was successful"
4525	msgstr ""
4526
4527	+ #: src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php:209
4528	msgid "The webhook was invalid and was not processed"
4529	msgstr ""
4530
4531	+ #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:35
4532	msgid "-- Please select a country --"
4533	msgstr ""
4534
4535	#. Translators: %s: The PayPal telephone number.
4536	+ #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:89
4537	msgid "Please call a PayPal support representative at %s"
4538	msgstr ""
4539
4540	+ #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:93
4541	msgid ""
4542	"Please reach out to PayPal support from your PayPal account Resolution Center"
4543	msgstr ""
4544
4545	+ #: src/Tickets/Commerce/Gateways/PayPal/Settings.php:96
4546	msgid " and relay the following message:"
4547	msgstr ""
4548
4549	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:216
4550	msgid ""
4551	"There was a problem with the status check for your account. Please try "
4552	"disconnecting and connecting again. If the problem persists, please contact "
4553	"support."
4554	msgstr ""
4555
4556	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:226
4557	msgid "Set up an account to receive payment from PayPal"
4558	msgstr ""
4559
4560	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:230
4561	msgid "Confirm your primary email address"
4562	msgstr ""
4563
4564	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:241
4565	msgid ""
4566	"Your account was expected to be able to accept custom payments, but is not. "
4567	"Please make sure your\n"

4569	"persists, please contact PayPal."
4570	msgstr ""
4571
4572	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:260
4573	msgid "Reach out to PayPal to enable PPCP_CUSTOM for your account"
4574	msgstr ""
4575
4576	+ #: src/Tickets/Commerce/Gateways/PayPal/Signup.php:272
4577	msgid "Reach out to PayPal to resolve the following capabilities:"
4578	msgstr ""
4579

4627	msgstr ""
4628
4629	#: src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php:79
4630	+ #: src/Tickets/Commerce/Status/Reversed.php:46
4631	msgid "Reversed"
4632	msgstr ""
4633

4651	msgid "Change %1$s in PayPal from webhook: %2$s"
4652	msgstr ""
4653
4654	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:50
4655	+ msgid "Stripe"
4656	+ msgstr ""
4657	+
4658	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:60
4659	+ msgid "Stripe wasn't able to complete your connection request. Try again."
4660	+ msgstr ""
4661	+
4662	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:65
4663	+ msgid ""
4664	+ "Stripe signup was successful but the authentication tokens could not be "
4665	+ "retrieved. Try refreshing the tokens."
4666	+ msgstr ""
4667	+
4668	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:70
4669	+ msgid "Disconnecting from Stripe failed. Please try again."
4670	+ msgstr ""
4671	+
4672	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:80
4673	+ msgid ""
4674	+ "Due to Regulatory Issues between Stripe and the country listed in your "
4675	+ "Stripe account, the free version of Event Tickets cannot accept connections "
4676	+ "from accounts in your country. Please use a Stripe account from a different "
4677	+ "country or purchase Event Tickets Plus to continue."
4678	+ msgstr ""
4679	+
4680	+ #. Translators: %1$s is the opening <a> tag for the Payments Tab page link.
4681	+ #. %2$s is the closing <a> tag.
4682	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:87
4683	+ msgid ""
4684	+ "Your stripe account was disconnected from the Stripe dashboard. If you "
4685	+ "believe this is an error, you can re-connect in the %1$sPayments Tab of the "
4686	+ "Settings Page%2$s."
4687	+ msgstr ""
4688	+
4689	+ #: src/Tickets/Commerce/Gateways/Stripe/Gateway.php:109
4690	+ msgid ""
4691	+ "Enable credit card payments, Afterpay, AliPay, Giropay, Klarna and more."
4692	+ msgstr ""
4693	+
4694	+ #. Translators: %s is the html-formatted response from Stripe servers
4695	+ #. containing the error messages.
4696	+ #: src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php:81
4697	+ msgid ""
4698	+ "Stripe reports that it is unable to process charges with the selected "
4699	+ "Payment Methods. Usually this means that one of the methods selected is not "
4700	+ "available or not configured in your Stripe account. The errors you see below "
4701	+ "were returned from Stripe, please correct any inconsistencies or contact "
4702	+ "Stripe support, then try again: <div class=\"stripe-errors\">%s</div>"
4703	+ msgstr ""
4704	+
4705	+ #: src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php:278
4706	+ msgid "Payment methods accepted cannot be empty"
4707	+ msgstr ""
4708	+
4709	+ #: src/Tickets/Commerce/Gateways/Stripe/Payment_Intent_Handler.php:92
4710	+ msgid ""
4711	+ "There was an error enabling Stripe on your cart. More information is "
4712	+ "available in the Event Tickets settings dashboard. Please contact the site "
4713	+ "administrator for support."
4714	+ msgstr ""
4715	+
4716	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:160
4717	+ msgid "Order ID (Payment Intent ID) in Stripe"
4718	+ msgstr ""
4719	+
4720	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:173
4721	+ msgid "Client Secret from Stripe"
4722	+ msgstr ""
4723	+
4724	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:269
4725	+ msgid "Order ID in Stripe"
4726	+ msgstr ""
4727	+
4728	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:332
4729	+ msgid "Completing the Stripe PaymentIntent failed. Please try again."
4730	+ msgstr ""
4731	+
4732	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:333
4733	+ msgid "Creating new Stripe PaymentIntent failed. Please try again."
4734	+ msgstr ""
4735	+
4736	+ #: src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php:334
4737	+ msgid "Creating new Stripe order failed. Please try again."
4738	+ msgstr ""
4739	+
4740	+ #. Translators: %1$s The tickets commerce currency. %2$s: The currency from the
4741	+ #. Stripe account.
4742	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:178
4743	+ msgid ""
4744	+ "Tickets Commerce is configured to use %1$s as its currency but the default "
4745	+ "currency for the connected stripe account is %2$s. Using different "
4746	+ "currencies for Tickets Commerce and Stripe may not be supported by all "
4747	+ "payment methods available in %1$s, and may result in exchange rates and "
4748	+ "conversions from %1$s to %2$s being handled by Stripe. If you believe this "
4749	+ "is an error, you can modify the Tickets Commerce currency in the main "
4750	+ "Payments tab."
4751	+ msgstr ""
4752	+
4753	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:194
4754	+ #: src/Tribe/Admin/Settings/Service_Provider.php:146
4755	+ #: src/Tribe/Admin/Settings/Service_Provider.php:194
4756	+ #: src/admin-views/admin-welcome-message.php:157
4757	+ #: src/admin-views/admin-welcome-message.php:179
4758	+ #: src/admin-views/admin-welcome-message.php:199
4759	+ msgid "Learn more"
4760	+ msgstr ""
4761	+
4762	+ #. Translators: %1$s: Opening `<a>` tag for KB article link. %2$s: Closing
4763	+ #. `<a>` tag.
4764	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:199
4765	+ msgid ""
4766	+ "Additional payment methods are available based on currency and location and "
4767	+ "must be enabled individually within your Stripe account. %1$sLearn more%2$s"
4768	+ msgstr ""
4769	+
4770	+ #. Translators: %1$s: Opening `<span>` tag. %2$s: The currency name. %3$s:
4771	+ #. Closing `</span>` tag. %4$s: Opening `<a>` tag for Stripe link. %5$s:
4772	+ #. Closing `</a>` tag.
4773	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:206
4774	+ msgid ""
4775	+ "%1$sPayment methods available for %2$s%3$s.<br /><br /> The payment methods "
4776	+ "listed here are dependent on the currency selected for Tickets Commerce and "
4777	+ "the currency each payment method support. You can review the payment methods "
4778	+ "and their availablity for each currency on %4$sStripe's documentation%5$s."
4779	+ "<br /><br />"
4780	+ msgstr ""
4781	+
4782	+ #. Translators: %1$s: The Event Tickets Plus link.
4783	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:216
4784	+ msgid ""
4785	+ "You are using the free Stripe payment gateway integration. This includes an "
4786	+ "additional 2%% fee for processing ticket sales. This fee is removed if you "
4787	+ "have an active subscription to Event Tickets Plus. %1$s."
4788	+ msgstr ""
4789	+
4790	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:248
4791	+ msgid "Stripe Settings"
4792	+ msgstr ""
4793	+
4794	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:252
4795	+ msgid "General"
4796	+ msgstr ""
4797	+
4798	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:256
4799	+ msgid "Statement Descriptor"
4800	+ msgstr ""
4801	+
4802	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:257
4803	+ msgid ""
4804	+ "This is the text that appears on the ticket purchaser bank statements. If "
4805	+ "left blank, the descriptor set in Stripe will be used."
4806	+ msgstr ""
4807	+
4808	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:266
4809	+ msgid "Enable Stripe Receipt Emails"
4810	+ msgstr ""
4811	+
4812	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:267
4813	+ msgid ""
4814	+ "If this option is selected, ticket buyers will get stripe receipts, as well "
4815	+ "as Event Tickets confirmation emails."
4816	+ msgstr ""
4817	+
4818	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:273
4819	+ msgid "Checkout Settings"
4820	+ msgstr ""
4821	+
4822	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:278
4823	+ #: src/views/registration/button-checkout.php:31
4824	+ msgid "Checkout"
4825	+ msgstr ""
4826	+
4827	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:282
4828	+ msgid "Checkout Type"
4829	+ msgstr ""
4830	+
4831	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:287
4832	+ msgid "Accept only credit card payments."
4833	+ msgstr ""
4834	+
4835	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:288
4836	+ msgid ""
4837	+ "Accept credit card payments and additional payment methods configured in "
4838	+ "Stripe."
4839	+ msgstr ""
4840	+
4841	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:293
4842	+ msgid "Credit Card field format"
4843	+ msgstr ""
4844	+
4845	+ #. Translators: %1$s: Opening `<span>` tag. %2$s: Closing `</span>` tag.
4846	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:304
4847	+ msgid "Single field. %1$sFor streamlined checkout.%2$s"
4848	+ msgstr ""
4849	+
4850	+ #. Translators: %1$s: Opening `<span>` tag. %2$s: Closing `</span>` tag.
4851	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:310
4852	+ msgid "Multiple fields. %1$sFor standard checkout.%2$s"
4853	+ msgstr ""
4854	+
4855	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:318
4856	+ msgid "Payment methods accepted"
4857	+ msgstr ""
4858	+
4859	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:355
4860	+ msgid "Credit Cards"
4861	+ msgstr ""
4862	+
4863	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:392
4864	+ msgid "AfterPay and ClearPay"
4865	+ msgstr ""
4866	+
4867	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:396
4868	+ msgid "Alipay"
4869	+ msgstr ""
4870	+
4871	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:400
4872	+ msgid "Giropay"
4873	+ msgstr ""
4874	+
4875	+ #: src/Tickets/Commerce/Gateways/Stripe/Settings.php:404
4876	+ msgid "Klarna"
4877	+ msgstr ""
4878	+
4879	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Account_Webhook.php:72
4880	+ msgid "Account deauthorized is not the same as account connected."
4881	+ msgstr ""
4882	+
4883	+ #. Translators: %s is the payment intent id.
4884	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Charge_Webhook.php:30
4885	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php:48
4886	+ msgid "Payment Intent %s does not correspond to a known order."
4887	+ msgstr ""
4888	+
4889	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:216
4890	+ msgid "Canceled payments"
4891	+ msgstr ""
4892	+
4893	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:217
4894	+ msgid "Created payments"
4895	+ msgstr ""
4896	+
4897	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:218
4898	+ msgid "Failed payments"
4899	+ msgstr ""
4900	+
4901	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:219
4902	+ msgid "Pending payments"
4903	+ msgstr ""
4904	+
4905	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:220
4906	+ msgid "Action required payments"
4907	+ msgstr ""
4908	+
4909	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php:221
4910	+ msgid "Successful payments"
4911	+ msgstr ""
4912	+
4913	+ #. Translators: %1$s is the event id and %2$s is the event type name.
4914	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php:61
4915	+ msgid ""
4916	+ "Event %1$s was received but events of type %2$s are not currently handled."
4917	+ msgstr ""
4918	+
4919	+ #. Translators: %1$s is the event type name.
4920	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php:107
4921	+ msgid "Event was received but events of type %1$s are not currently handled."
4922	+ msgstr ""
4923	+
4924	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php:40
4925	+ msgid "Payment Intent Test Successful"
4926	+ msgstr ""
4927	+
4928	+ #. Translators: %s is the payment intent id
4929	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php:58
4930	+ msgid ""
4931	+ "Payment Intent %s does not require an update or is a duplicate of a past "
4932	+ "event."
4933	+ msgstr ""
4934	+
4935	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:78
4936	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:156
4937	+ msgid "Webhooks not validated yet."
4938	+ msgstr ""
4939	+
4940	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:116
4941	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:158
4942	+ msgid "Webhooks were properly validated for sales."
4943	+ msgstr ""
4944	+
4945	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:162
4946	+ msgid "Webhook validation will not work in Tickets Commerce test mode."
4947	+ msgstr ""
4948	+
4949	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:172
4950	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:35
4951	+ msgid "Webhooks"
4952	+ msgstr ""
4953	+
4954	+ #. Translators: %1$s A link to the KB article. %2$s closing `</a>` link.
4955	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:180
4956	+ msgid ""
4957	+ "Setting up webhooks will enable you to receive notifications on charge "
4958	+ "statuses and keep order information up to date for asynchronous payments. "
4959	+ "%1$sLearn more%2$s"
4960	+ msgstr ""
4961	+
4962	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:189
4963	+ msgid "Webhooks URL"
4964	+ msgstr ""
4965	+
4966	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:200
4967	+ msgid "Signing Secret"
4968	+ msgstr ""
4969	+
4970	+ #: src/Tickets/Commerce/Gateways/Stripe/Webhooks.php:208
4971	+ msgid "Validating signing key with Stripe, please wait."
4972	+ msgstr ""
4973	+
4974	#: src/Tickets/Commerce/Legacy_Compat.php:86
4975	msgid "Tribe Commerce ( Legacy PayPal, not recommended )"
4976	msgstr ""

4980	msgid "(deleted)"
4981	msgstr ""
4982
4983	+ #: src/Tickets/Commerce/Module.php:20 src/Tickets/Commerce/Payments_Tab.php:181
4984	msgid "Tickets Commerce"
4985	msgstr ""
4986

4990	msgid "Orders"
4991	msgstr ""
4992
4993	+ #: src/Tickets/Commerce/Payments_Tab.php:109
4994	msgid "Payments"
4995	msgstr ""
4996
4997	+ #: src/Tickets/Commerce/Payments_Tab.php:281 src/Tribe/Admin/Notices.php:214
4998	#: src/Tribe/Main.php:666 src/admin-views/admin-welcome-message.php:56
4999	#: src/admin-views/tribe-commerce-settings.php:4
5000	msgid "Event Tickets Plus"
5001	msgstr ""
5002
5003	+ #. Translators: %1$s: The Event Tickets Plus link.
5004	+ #: src/Tickets/Commerce/Payments_Tab.php:286






5005	msgctxt "about Tickets Commerce"
5006	msgid ""
5007	+ "Tickets Commerce provides a simple and flexible ecommerce checkout for "
5008	+ "purchasing tickets. Just choose your payment gateway and configure checkout "
5009	+ "options and you're all set. If you need more advanced features like custom "
5010	+ "attendee information, QR code check in, and stock sharing between tickets, "
5011	+ "take a look at %1$s for these features and more."

5012	msgstr ""
5013
5014	+ #: src/Tickets/Commerce/Payments_Tab.php:303
5015	msgid "Enable Tickets Commerce"
5016	msgstr ""
5017
5018	+ #. Translators: %s: Name of payment gateway.
5019	+ #: src/Tickets/Commerce/Payments_Tab.php:338
5020	+ msgid "Enable %s"
5021	+ msgstr ""
5022	+
5023	+ #: src/Tickets/Commerce/Payments_Tab.php:444
5024	msgid "Tickets Checkout"
5025	msgstr ""
5026
5027	+ #: src/Tickets/Commerce/Payments_Tab.php:473
5028	msgid "Order Completed"
5029	msgstr ""
5030

5135	msgid "%s - Tickets Commerce Orders"
5136	msgstr ""
5137
5138	+ #: src/Tickets/Commerce/Settings.php:181
5139	msgid "Tickets Commerce Test Mode Active"
5140	msgstr ""
5141
5142	+ #: src/Tickets/Commerce/Settings.php:221
5143	msgid "-- No page set --"
5144	msgstr ""
5145
5146	+ #: src/Tickets/Commerce/Settings.php:236
5147	msgid "Tickets Commerce Settings"
5148	msgstr ""
5149
5150	+ #: src/Tickets/Commerce/Settings.php:240
5151	msgid "Enable Test Mode"
5152	msgstr ""
5153
5154	+ #: src/Tickets/Commerce/Settings.php:241
5155	msgid ""
5156	"Enables Test mode for testing payments. Any payments made will be done on "
5157	"\"sandbox\" accounts."
5158	msgstr ""
5159
5160	+ #: src/Tickets/Commerce/Settings.php:247
5161	#: src/admin-views/tribe-commerce-settings.php:136
5162	msgid "Currency Code"
5163	msgstr ""
5164
5165	+ #: src/Tickets/Commerce/Settings.php:248
5166	msgid "The currency that will be used for Tickets Commerce transactions."
5167	msgstr ""
5168
5169	+ #: src/Tickets/Commerce/Settings.php:255
5170	#: src/admin-views/tribe-commerce-settings.php:144
5171	msgid "Stock Handling"
5172	msgstr ""
5173
5174	#. Translators: %s: The word "ticket" in lowercase.
5175	+ #: src/Tickets/Commerce/Settings.php:259
5176	msgctxt "tickets fields settings paypal stock handling"
5177	msgid ""
5178	"When a customer purchases a %s, the payment gateway might flag the order as "

5182
5183	#. Translators: %1$s: The word "ticket" in lowercase. %2$s: `<strong>` opening
5184	#. tag. %3$s: `</strong>` closing tag.
5185	+ #: src/Tickets/Commerce/Settings.php:268
5186	msgid ""
5187	"Decrease available %1$s stock as soon as a %2$sPending%3$s order is created."
5188	msgstr ""
5189
5190	#. Translators: %1$s: The word "ticket" in lowercase. %2$s: `<strong>` opening
5191	#. tag. %3$s: `</strong>` closing tag.
5192	+ #: src/Tickets/Commerce/Settings.php:275
5193	msgid ""
5194	"Only decrease available %1$s stock if an order is confirmed as %2$sCompleted"
5195	"%3$s by the payment gateway."
5196	msgstr ""
5197
5198	+ #: src/Tickets/Commerce/Settings.php:285
5199	msgid "Checkout page"
5200	msgstr ""
5201
5202	#. Translators: %s: The [shortcode] for the success page.
5203	+ #: src/Tickets/Commerce/Settings.php:289
5204	msgid ""
5205	"This is the page where customers go to complete their purchase. Use the %s "
5206	"shortcode to display the checkout experience in the page content."
5207	msgstr ""
5208
5209	+ #: src/Tickets/Commerce/Settings.php:300
5210	#: src/admin-views/tribe-commerce-settings.php:162
5211	msgid "Success page"
5212	msgstr ""
5213
5214	#. Translators: %s: The [shortcode] for the success page.
5215	+ #: src/Tickets/Commerce/Settings.php:304
5216	msgid ""
5217	"After a successful order, users will be redirected to this page. Use the %s "
5218	"shortcode to display the order confirmation to the user in the page content."
5219	msgstr ""
5220
5221	+ #: src/Tickets/Commerce/Settings.php:315
5222	#: src/admin-views/tribe-commerce-settings.php:176
5223	msgid "Confirmation email sender address"
5224	msgstr ""
5225
5226	#. Translators: %s: The word "tickets" in lowercase.
5227	+ #: src/Tickets/Commerce/Settings.php:319
5228	msgctxt "tickets fields settings confirmation email"
5229	msgid ""
5230	"Email address that %s customers will receive confirmation from. Leave empty "
5231	"to use the default WordPress site email address."
5232	msgstr ""
5233
5234	+ #: src/Tickets/Commerce/Settings.php:330
5235	#: src/admin-views/tribe-commerce-settings.php:185
5236	msgid "Confirmation email sender name"
5237	msgstr ""
5238
5239	#. Translators: %s: The word "ticket" in lowercase.
5240	+ #: src/Tickets/Commerce/Settings.php:334
5241	#: src/admin-views/tribe-commerce-settings.php:186
5242	msgctxt "tickets fields settings paypal email sender"
5243	msgid ""

5245	"purchase."
5246	msgstr ""
5247
5248	+ #: src/Tickets/Commerce/Settings.php:345
5249	#: src/admin-views/tribe-commerce-settings.php:194
5250	msgid "Confirmation email subject"
5251	msgstr ""
5252
5253	#. Translators: %s: The word "ticket" in lowercase.
5254	+ #: src/Tickets/Commerce/Settings.php:349
5255	#: src/admin-views/tribe-commerce-settings.php:195
5256	msgctxt "tickets fields settings paypal email subject"
5257	msgid ""

5260	msgstr ""
5261
5262	#. Translators: %s: The word "tickets" in lowercase.
5263	+ #: src/Tickets/Commerce/Settings.php:357
5264	#: src/admin-views/tribe-commerce-settings.php:197
5265	msgctxt "tickets fields settings paypal email subject"
5266	msgid "You have %s!"
5267	msgstr ""
5268
5269	+ #: src/Tickets/Commerce/Settings.php:372
5270	+ msgid "Payment Gateways"
5271	+ msgstr ""
5272	+
5273	+ #: src/Tickets/Commerce/Settings.php:384
5274	+ #: src/admin-views/settings/featured/link.php:33
5275	+ msgid "Learn more about configuring payment options with Tickets Commerce"
5276	+ msgstr ""
5277	+
5278	#: src/Tickets/Commerce/Status/Action_Required.php:29
5279	msgid "Action Required"
5280	msgstr ""

5293	msgid "Created"
5294	msgstr ""
5295
5296	+ #: src/Tickets/Commerce/Status/Denied.php:48
5297	msgid "Denied"
5298	msgstr ""
5299

5305	msgid "Pending"
5306	msgstr ""
5307
5308	+ #: src/Tickets/Commerce/Status/Pending.php:99
5309	msgid "This order contained an invalid Ticket (ID: %1$d)"
5310	msgstr ""
5311
5312	+ #: src/Tickets/Commerce/Status/Pending.php:114
5313	msgid "This order contained a Ticket with an invalid Event (Event ID: %1$d)"
5314	msgstr ""
5315
5316	+ #: src/Tickets/Commerce/Status/Pending.php:128
5317	msgid "Cannot purchase zero of \"%1$s\""
5318	msgstr ""
5319
5320	+ #: src/Tickets/Commerce/Status/Pending.php:145
5321	msgid "Insufficient stock for \"%1$s\""
5322	msgstr ""
5323
5324	+ #: src/Tickets/Commerce/Status/Pending.php:161
5325	msgid "%s will be available on %s at %s"
5326	msgstr ""
5327
5328	+ #: src/Tickets/Commerce/Status/Pending.php:163 src/Tribe/Tickets.php:3195
5329	msgid "%s are no longer available."
5330	msgstr ""
5331
5332	+ #: src/Tickets/Commerce/Status/Pending.php:165 src/Tribe/Tickets.php:3197
5333	msgid "There are no %s available at this time."
5334	msgstr ""
5335
5336	+ #: src/Tickets/Commerce/Status/Refunded.php:46
5337	msgid "Refunded"
5338	msgstr ""
5339

5341	msgid "Undefined"
5342	msgstr ""
5343
5344	+ #: src/Tickets/Commerce/Status/Voided.php:48
5345	msgid "Voided"
5346	msgstr ""
5347

5371	msgid "unavailable"
5372	msgstr ""
5373
5374	+ #: src/Tickets/Commerce/Utils/Currency.php:344
5375	#: src/Tribe/Commerce/Currency.php:197
5376	msgid "Australian Dollar (AUD)"
5377	msgstr ""
5378
5379	+ #: src/Tickets/Commerce/Utils/Currency.php:352
5380	#: src/Tribe/Commerce/Currency.php:203
5381	msgid "Brazilian Real (BRL)"
5382	msgstr ""
5383
5384	+ #: src/Tickets/Commerce/Utils/Currency.php:360
5385	#: src/Tribe/Commerce/Currency.php:209
5386	msgid "Canadian Dollar (CAD)"
5387	msgstr ""
5388
5389	+ #: src/Tickets/Commerce/Utils/Currency.php:368
5390	#: src/Tribe/Commerce/Currency.php:215
5391	msgid "Swiss Franc (CHF)"
5392	msgstr ""
5393
5394	+ #: src/Tickets/Commerce/Utils/Currency.php:376
5395	#: src/Tribe/Commerce/Currency.php:221
5396	msgid "Czech Koruna (CZK)"
5397	msgstr ""
5398
5399	+ #: src/Tickets/Commerce/Utils/Currency.php:385
5400	#: src/Tribe/Commerce/Currency.php:228
5401	msgid "Danish Krone (DKK)"
5402	msgstr ""
5403
5404	+ #: src/Tickets/Commerce/Utils/Currency.php:393
5405	#: src/Tribe/Commerce/Currency.php:234
5406	msgid "Euro (EUR)"
5407	msgstr ""
5408
5409	+ #: src/Tickets/Commerce/Utils/Currency.php:401
5410	#: src/Tribe/Commerce/Currency.php:240
5411	msgid "Pound Sterling (GBP)"
5412	msgstr ""
5413
5414	+ #: src/Tickets/Commerce/Utils/Currency.php:409
5415	#: src/Tribe/Commerce/Currency.php:246
5416	msgid "Hong Kong Dollar (HKD)"
5417	msgstr ""
5418
5419	+ #: src/Tickets/Commerce/Utils/Currency.php:417
5420	#: src/Tribe/Commerce/Currency.php:252
5421	msgid "Hungarian Forint (HUF)"
5422	msgstr ""
5423
5424	+ #: src/Tickets/Commerce/Utils/Currency.php:425
5425	#: src/Tribe/Commerce/Currency.php:258
5426	msgid "Israeli New Sheqel (ILS)"
5427	msgstr ""
5428
5429	+ #: src/Tickets/Commerce/Utils/Currency.php:433
5430	#: src/Tribe/Commerce/Currency.php:264
5431	msgid "Indian Rupee (INR)"
5432	msgstr ""
5433
5434	+ #: src/Tickets/Commerce/Utils/Currency.php:441
5435	#: src/Tribe/Commerce/Currency.php:270
5436	msgid "Japanese Yen (JPY)"
5437	msgstr ""
5438
5439	+ #: src/Tickets/Commerce/Utils/Currency.php:449
5440	#: src/Tribe/Commerce/Currency.php:276
5441	msgid "Malaysian Ringgit (MYR)"
5442	msgstr ""
5443
5444	+ #: src/Tickets/Commerce/Utils/Currency.php:457
5445	#: src/Tribe/Commerce/Currency.php:282
5446	msgid "Mexican Peso (MXN)"
5447	msgstr ""
5448
5449	+ #: src/Tickets/Commerce/Utils/Currency.php:465
5450	#: src/Tribe/Commerce/Currency.php:288
5451	msgid "Norwegian Krone (NOK)"
5452	msgstr ""
5453
5454	+ #: src/Tickets/Commerce/Utils/Currency.php:473
5455	#: src/Tribe/Commerce/Currency.php:294
5456	msgid "New Zealand Dollar (NZD)"
5457	msgstr ""
5458
5459	+ #: src/Tickets/Commerce/Utils/Currency.php:481
5460	#: src/Tribe/Commerce/Currency.php:300
5461	msgid "Philippine Peso (PHP)"
5462	msgstr ""
5463
5464	+ #: src/Tickets/Commerce/Utils/Currency.php:489
5465	#: src/Tribe/Commerce/Currency.php:306
5466	msgid "Polish Zloty (PLN)"
5467	msgstr ""
5468
5469	+ #: src/Tickets/Commerce/Utils/Currency.php:497
5470	#: src/Tribe/Commerce/Currency.php:312
5471	msgid "Russian Ruble (RUB)"
5472	msgstr ""
5473
5474	+ #: src/Tickets/Commerce/Utils/Currency.php:505
5475	#: src/Tribe/Commerce/Currency.php:318
5476	msgid "Swedish Krona (SEK)"
5477	msgstr ""
5478
5479	+ #: src/Tickets/Commerce/Utils/Currency.php:513
5480	#: src/Tribe/Commerce/Currency.php:324
5481	msgid "Singapore Dollar (SGD)"
5482	msgstr ""
5483
5484	+ #: src/Tickets/Commerce/Utils/Currency.php:521
5485	#: src/Tribe/Commerce/Currency.php:330
5486	msgid "Thai Baht (THB)"
5487	msgstr ""
5488
5489	+ #: src/Tickets/Commerce/Utils/Currency.php:529
5490	#: src/Tribe/Commerce/Currency.php:336
5491	msgid "Taiwan New Dollar (TWD)"
5492	msgstr ""
5493
5494	+ #: src/Tickets/Commerce/Utils/Currency.php:537
5495	#: src/Tribe/Commerce/Currency.php:342
5496	msgid "U.S. Dollar (USD)"
5497	msgstr ""

5744	msgid "Get started"
5745	msgstr ""
5746








5747	#: src/Tribe/Admin/Settings/Service_Provider.php:191
5748	msgid ""
5749	"Tribe Commerce has been replaced by our new payments system, Tickets "

6177	msgid "Are you sure you want to cancel?"
6178	msgstr ""
6179
6180	+ #: src/Tribe/Editor/Blocks/Tickets.php:282 src/Tribe/Tickets.php:4329
6181	msgctxt "Error message title, will be followed by the error code."
6182	msgid "API Error"
6183	msgstr ""
6184
6185	+ #: src/Tribe/Editor/Blocks/Tickets.php:283 src/Tribe/Tickets.php:4330
6186	msgid ""
6187	"Refresh this page or wait a few minutes before trying again. If this happens "
6188	"repeatedly, please contact the Site Admin."
6189	msgstr ""
6190
6191	+ #: src/Tribe/Editor/Blocks/Tickets.php:284 src/Tribe/Tickets.php:4331
6192	msgid ""
6193	"The ticket for this event has sold out and has been removed from your cart."
6194	msgstr ""
6195
6196	+ #: src/Tribe/Editor/Blocks/Tickets.php:285 src/Tribe/Tickets.php:4332
6197	#: src/views/v2/commerce/order/header/title-empty.php:28
6198	msgid "Whoops!"
6199	msgstr ""
6200
6201	+ #: src/Tribe/Editor/Blocks/Tickets.php:286 src/Tribe/Tickets.php:4333
6202	msgctxt "The %s will change based on the error produced."
6203	msgid "You have %s ticket(s) with a field that requires information."
6204	msgstr ""

8419	msgid "New!"
8420	msgstr ""
8421
8422	+ #. Translators: %s: Name of payment gateway.
8423	+ #: src/admin-views/settings/tickets-commerce/gateways/button.php:32
8424	+ msgid "Connect to %s"
8425	+ msgstr ""
8426	+
8427	+ #. Translators: %s: Name of payment gateway.
8428	+ #: src/admin-views/settings/tickets-commerce/gateways/button.php:39
8429	+ msgid "Edit %s Connection"
8430	+ msgstr ""
8431	+
8432	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token.php:37
8433	msgid "Refresh Access Token"
8434	msgstr ""
8435
8436	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-connection.php:40
8437	msgid "Resync payment connection"
8438	msgstr ""
8439
8440	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info.php:38
8441	msgid "Refresh User Info"
8442	msgstr ""
8443
8444	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-webhook.php:38
8445	msgid "Refresh Webhook"
8446	msgstr ""
8447
8448	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php:35
8449	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/connection.php:25
8450	msgid "Connected as:"
8451	msgstr ""
8452
8453	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php:45
8454	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/connection.php:35
8455	msgid "Disconnect"
8456	msgstr ""
8457
8458	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php:26
8459	msgid "PayPal Status:"
8460	msgstr ""
8461
8462	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php:30
8463	msgid "Connected"
8464	msgstr ""
8465
8466	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php:35
8467	msgid "Webhooks:"
8468	msgstr ""
8469
8470	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php:52
8471	msgid "payment connection error"
8472	msgstr ""
8473

8476	msgstr ""
8477
8478	#: src/admin-views/settings/tickets-commerce/paypal/connect/help-links/troubleshooting.php:24
8479	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/help-links/troubleshooting.php:23
8480	msgid "Get troubleshooting help"
8481	msgstr ""
8482
8483	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php:25
8484	msgid "Accept online payments with PayPal!"
8485	msgstr ""
8486
8487	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php:30
8488	msgid ""
8489	"Start selling tickets to your events today with PayPal. Attendees can "
8490	"purchase tickets directly on your site using debit or credit cards with no "

8500	msgstr ""
8501
8502	#: src/admin-views/settings/tickets-commerce/paypal/connect/logo/features.php:25
8503	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php:24
8504	msgid "Accept payments from around the world"
8505	msgstr ""
8506
8507	#: src/admin-views/settings/tickets-commerce/paypal/connect/logo/features.php:28
8508	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php:27
8509	msgid "Supports 3D Secure payments"
8510	msgstr ""
8511
8512	+ #: src/admin-views/settings/tickets-commerce/paypal/connect/logo/image.php:23
8513	msgid "PayPal Logo Image"
8514	msgstr ""
8515
8516	#. Translators: %1$s: opening `a` tag to the knowledge base article. %2$s:
8517	#. closing `a` tag to the knowledge base article.
8518	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:20
8519	msgid ""
8520	"PayPal allows you to accept credit or debit cards directly on your website. "
8521	"Because of this, your site needs to maintain %1$sPCI-DSS compliance%2$s."
8522	msgstr ""
8523
8524	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:27
8525	msgid ""
8526	"Event Tickets never stores sensitive information like card details to your "
8527	"server and works seamlessly with SSL certificates."
8528	msgstr ""
8529
8530	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:29
8531	msgid "Compliance is comprised of, but not limited to:"
8532	msgstr ""
8533
8534	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:33
8535	msgid ""
8536	"Using a trusted, secure hosting provider — preferably one which claims "
8537	"and actively promotes PCI compliance."
8538	msgstr ""
8539
8540	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:39
8541	msgid "Implement an SSL certificate to keep your ticket sales secure."
8542	msgstr ""
8543
8544	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:42
8545	msgid ""
8546	"Keep WordPress and plugins up to date to ensure latest security fixes are "
8547	"present."
8548	msgstr ""
8549
8550	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:52
8551	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:65
8552	msgid "Close this modal window"
8553	msgstr ""
8554
8555	+ #: src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php:54
8556	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:67
8557	msgid "Got it, thanks!"
8558	msgstr ""
8559

8569	msgid "Connect Automatically with <i>PayPal</i>"
8570	msgstr ""
8571
8572	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/button.php:30
8573	+ msgid "Edit Your Stripe Settings"
8574	+ msgstr ""
8575	+
8576	+ #. Translators: %1$s is the Stripe currency, %2$s is the Tickets Commerce
8577	+ #. currency symbol.
8578	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-currency.php:31
8579	+ msgid ""
8580	+ "Your Stripe account is set to %1$s, but your Tickets Commerce site is set to "
8581	+ "%2$s. Using different currencies for Tickets Commerce and Stripe may not be "
8582	+ "supported by all payment methods available in %2$s, and may result in "
8583	+ "exchange rates and conversions from %2$s to %1$s being handled by Stripe."
8584	+ msgstr ""
8585	+
8586	+ #. Translators: %1$s The opening `<a>` tag with the stripe link, %2$s The
8587	+ #. closing `</a>` tag.
8588	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-currency.php:38
8589	+ msgid ""
8590	+ "Please be sure to enable all the payment methods you want to use for this "
8591	+ "currency on your %1$sstripe dashboard%2$s."
8592	+ msgstr ""
8593	+
8594	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-currency.php:51
8595	+ msgid "Stripe currency:"
8596	+ msgstr ""
8597	+
8598	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php:25
8599	+ msgid "Payments status:"
8600	+ msgstr ""
8601	+
8602	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php:40
8603	+ msgid "Disabled"
8604	+ msgstr ""
8605	+
8606	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php:40
8607	+ msgid "Enabled"
8608	+ msgstr ""
8609	+
8610	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php:51
8611	+ msgid "Requirements"
8612	+ msgstr ""
8613	+
8614	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php:64
8615	+ msgid "Future Requirements"
8616	+ msgstr ""
8617	+
8618	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/help-links/configuring.php:28
8619	+ msgid "Learn more about configuring Stripe payments"
8620	+ msgstr ""
8621	+
8622	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/inactive.php:22
8623	+ msgid "Accept online payments with Stripe!"
8624	+ msgstr ""
8625	+
8626	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/inactive.php:27
8627	+ msgid ""
8628	+ "Start selling tickets to your events today with Stripe integration for "
8629	+ "Tickets Commerce. Enable highly-configurable credit and debit card checkout "
8630	+ "with enhanced features like Afterpay, AliPay, Degiro, Klarna and more.<br>"
8631	+ msgstr ""
8632	+
8633	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php:18
8634	+ msgid "Credit, debit card payments and more!"
8635	+ msgstr ""
8636	+
8637	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php:21
8638	+ msgid "Easy, streamlined connection"
8639	+ msgstr ""
8640	+
8641	+ #: src/admin-views/settings/tickets-commerce/stripe/connect/logo/image.php:22
8642	+ msgid "Stripe Logo Image"
8643	+ msgstr ""
8644	+
8645	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:16
8646	+ msgid "Currency"
8647	+ msgstr ""
8648	+
8649	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:18
8650	+ msgid ""
8651	+ "Be sure that your Stripe currency matches the currency you have configured "
8652	+ "for Tickets Commerce, to avoid any issues or unexpected conversion fees."
8653	+ msgstr ""
8654	+
8655	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:23
8656	+ msgid "Payment methods"
8657	+ msgstr ""
8658	+
8659	+ #. Translators: %1$s: opening `a` tag to stripe's dashboard. %2$s: closing `a`
8660	+ #. tag.
8661	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:27
8662	+ msgid ""
8663	+ "You will have to confirm that the payments methods you have selected to sell "
8664	+ "tickets are enabled on the %1$sStripe payment methods section%2$s."
8665	+ msgstr ""
8666	+
8667	+ #. Translators: %1$s: opening `a` tag to the knowledge base article. %2$s:
8668	+ #. closing `a` tag.
8669	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:39
8670	+ msgid ""
8671	+ "In order for ticket sales to be marked as complete for some payment methods "
8672	+ "on your Stripe gateway for your Event Tickets site, you must configure the "
8673	+ "webhook at Stripe. %1$sLearn how to set up webhooks here%2$s."
8674	+ msgstr ""
8675	+
8676	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:47
8677	+ msgid "PCI Compliance"
8678	+ msgstr ""
8679	+
8680	+ #. Translators: %1$s: opening `a` tag to the knowledge base article. %2$s:
8681	+ #. closing `a` tag.
8682	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php:51
8683	+ msgid ""
8684	+ "Stripe allows you to accept credit or debit cards directly on your website. "
8685	+ "Because of this, your site needs to maintain %1$sPCI-DSS compliance%2$s."
8686	+ msgstr ""
8687	+
8688	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/notice-test-mode.php:23
8689	+ msgid ""
8690	+ "Your connection is active, but Tickets Commerce is set to test mode. While "
8691	+ "in test mode no live transactions are processed."
8692	+ msgstr ""
8693	+
8694	+ #: src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete.php:24
8695	+ msgid "You are now connected to Stripe! What's next?"
8696	+ msgstr ""
8697	+
8698	+ #: src/admin-views/settings/tickets-commerce/stripe/signup-link.php:23
8699	+ msgid "Get Connected with <i>Stripe</i>"
8700	+ msgstr ""
8701	+
8702	#: src/admin-views/ticket-type-history.php:13
8703	msgctxt "ticket type history"
8704	msgid "%s history:"

8712	msgid "Click to hide history"
8713	msgstr ""
8714
8715	+ #: src/admin-views/tribe-commerce-settings.php:9
8716	+ msgid "Check it out!"
8717	+ msgstr ""
8718	+
8719	#: src/admin-views/tribe-commerce-settings.php:13
8720	msgctxt "about Tribe Commerce"
8721	msgid ""

9461
9462	#: src/views/registration/attendees/fields.php:15
9463	#: src/views/registration-js/attendees/fields.php:19
9464	+ #: src/views/tickets/email.php:454
9465	msgid "Attendee"
9466	msgstr ""
9467

9473	msgid "Back to cart"
9474	msgstr ""
9475




9476	#: src/views/registration/cart-empty.php:15
9477	msgid "You currently have no events awaiting registration"
9478	msgstr ""

9582	msgstr[0] ""
9583	msgstr[1] ""
9584
9585	+ #: src/views/tickets/email.php:439
9586	msgid "Ticket #"
9587	msgstr ""
9588
9589	+ #: src/views/tickets/email.php:446
9590	msgctxt "ticket type email heading"
9591	msgid "%s Type"
9592	msgstr ""

9789	msgid "Less info"
9790	msgstr ""
9791
9792	+ #: src/views/v2/commerce/checkout/footer/gateway-error.php:43
9793	+ #: src/views/v2/commerce/checkout.php:29
9794	msgid "Checkout Unavailable!"
9795	msgstr ""
9796
9797	+ #: src/views/v2/commerce/checkout/footer/gateway-error.php:44
9798	msgid ""
9799	"Checkout is not available at this time because a payment method has not been "
9800	"set up. Please notify the site administrator."
9801	msgstr ""
9802
9803	+ #: src/views/v2/commerce/checkout/gateways.php:37
9804	+ msgid "Payment"
9805	+ msgstr ""
9806	+
9807	#. Translators: %1$s: Singular `event` in lowercase.
9808	#: src/views/v2/commerce/checkout/header/links/back.php:36
9809	msgid "back to %1$s"

9815
9816	#. Translators: %1$s: Plural `Tickets` label.
9817	#: src/views/v2/commerce/checkout/header/title.php:31
9818	+ #: src/views/v2/commerce/gateway/stripe/card-element.php:58
9819	+ #: src/views/v2/commerce/gateway/stripe/payment-element.php:30
9820	msgid "Purchase %1$s"
9821	msgstr ""
9822

9833	msgid "create a new account"
9834	msgstr ""
9835
9836	+ #: src/views/v2/commerce/checkout/purchaser-info/email.php:34
9837	+ msgid "Email address:"
9838	+ msgstr ""
9839	+
9840	+ #: src/views/v2/commerce/checkout/purchaser-info/email.php:47
9841	+ msgid "Your tickets will be sent to this address"
9842	+ msgstr ""
9843	+
9844	+ #: src/views/v2/commerce/checkout/purchaser-info/name.php:33
9845	+ msgid "Person purchasing tickets:"
9846	+ msgstr ""
9847	+
9848	+ #: src/views/v2/commerce/checkout/purchaser-info.php:27
9849	+ msgid "Purchaser info"
9850	+ msgstr ""
9851	+
9852	+ #: src/views/v2/commerce/checkout.php:30
9853	msgid ""
9854	"Checkout is not available at this time because a payment method has not been "
9855	"set up for this event. Please notify the site administrator."
9856	msgstr ""
9857
9858	+ #: src/views/v2/commerce/checkout.php:54
9859	msgid "Checkout Error!"
9860	msgstr ""
9861

9888	msgid "PayPal Capture ID:"
9889	msgstr ""
9890
9891	+ #: src/views/v2/commerce/gateway/stripe/card-element.php:40
9892	+ msgid "Zip Code"
9893	+ msgstr ""
9894	+
9895	#: src/views/v2/commerce/order/description/order-empty.php:28
9896	msgid "No order information is available because no purchase was made."
9897	msgstr ""

readme.txt CHANGED Viewed

	@@ -1,10 +1,10 @@
1	=== Event Tickets ===
2
3	- Contributors: theeventscalendar, brianjessee, camwynsp, ~~paulkim,~~ aguseo, bordoni, borkweb, GeoffBel, ~~geoffgraham,~~ jentheo, leahkoerper, lucatume, neillmcshea, vicskf, zbtirrell, juanfra
4	Tags: tickets, registration, The Events Calendar, RSVP, ticket sales, attendee management
5	Requires at least: 5.6
6	- Tested up to: 5.9.0
7	- Stable tag: 5.2.~~4.1~~
8	Requires PHP: 7.1
9	License: GPLv2 or later
10	License URI: http://www.gnu.org/licenses/gpl-2.0.html
	@@ -17,6 +17,8 @@ Manage tickets and RSVPs for free with [Event Tickets](https://evnt.is/1ao8), fr
17
18	This plugin makes it easy to sell tickets and collect registration for in-person or virtual events. Plus, it comes with features backed by our world-class team of developers and designers. Integrate Event Tickets with your PayPal business account and manage attendees from your WordPress dashboard.
19


20	https://vimeo.com/480516958
21
22	= 🎟️ Ticketing and Registration for WordPress =
	@@ -37,6 +39,7 @@ Whether your vision is big or small, you're in good company. Thousands of small
37
38	✔️ Attendees can RSVP to events
39	✔️ Attendees can purchase tickets to events

40	✔️ Add RSVPs and tickets to posts, pages, or custom post types
41	✔️ Collect ticket fees by connecting your PayPal business account
42	✔️ Generate sales and attendee reports
	@@ -44,7 +47,7 @@ Whether your vision is big or small, you're in good company. Thousands of small
44	✔️ Automatic ticket confirmation emails
45	✔️ Works out of the box with [The Events Calendar](https://wordpress.org/plugins/the-events-calendar/)
46	✔️ Responsive design works on all devices
47	- ✔️ Tested on the major theme frameworks such as Avada, Genesis, ~~Woo Themes~~, Thesis and many more.
48	✔️ Internationalized & translated
49	✔️ Extensive template tags for customization
50	✔️ Hooks & filters galore
	@@ -60,7 +63,8 @@ Additional helpful links:
60
61	* [Guide: Getting Started with Event Tickets](https://theeventscalendar.com/knowledgebase/guide/event-tickets/)
62	* [Installing Event Tickets Video](https://evnt.is/1ao9)
63	- * [Do I ~~need~~ ~~Event TIckets or Event Tickets Plus?~~](https://~~evnt~~.is/~~1aoa~~)

64	* [How to Make Money with Virtual Events](https://evnt.is/1aob)
65
66	If you have any questions about this plugin, you can post a thread in the WordPress.org forum. Please search existing threads before starting a new on
	@@ -143,7 +147,7 @@ If you're already an [Event Tickets Plus](https://evnt.is/18wk) subscriber, you'
143
144	Event Tickets is our free ticketing plugin that has all the basics you need to sell tickets and collect RSVPs on your website. You can use Event Tickets with or without The Events Calendar.
145
146	- [Event Tickets Plus](https://evnt.is/18wk) is a premium plugin that runs alongside Event Tickets and enhances it with extra features, including custom registration fields, shortcodes, WooCommerce integration, our [mobile ticketing app](https://evnt.is/1aof) and more.
147
148	[Read more to learn which plugin is right for you.](https://evnt.is/1aoa)
149
	@@ -179,6 +183,18 @@ Check out our extensive [knowledgebase](https://evnt.is/18wm) for articles on us
179
180	== Changelog ==
181












182	= [5.2.4.1] 2022-02-17 =
183
184	* Fix - Classic Editor compatibility problems with the Ticket Form resolved [GTRIA-738]
	@@ -207,63 +223,4 @@ Check out our extensive [knowledgebase](https://evnt.is/18wm) for articles on us
207	* Fix - Fixed toggling of shared capacity data for tickets. [ETP-497]
208	* Language - 7 new strings added, 99 updated, 0 fuzzied, and 0 obsoleted
209
210	- = [5.2.2] 2021-12-15 =
211	-
212	- * Feature - Included Price, Currency and Value classes to improve monetary handling for Tickets Commerce [ET-1331]
213	- * Enhancement - Allow for filtering of tickets within the RSVP template block handler. [ETP-763]
214	- * Fix - Remove use of `wp_cache_flush()` and use conditional when using an external object cache. (props to @r-a-y for this change!) [ET-1343]
215	- * Fix - Fixes error being caused by an endless loop when currency settings are saved. [ET-1344]
216	- * Fix - Fixed an issue where shared capacity on the ticket block page wasn't calculated correctly. [ET-1291]
217	- * Fix - Fixed the `Add Attendee` modal from generating a 500 error when two or more tickets have been enabled for an event. [ETP-764]
218	- * Language - 0 new strings added, 50 updated, 0 fuzzied, and 0 obsoleted
219	-
220	- = [5.2.1] 2021-11-17 =
221	-
222	- * Enhancement - Auto generate checkout page when enabling Tickets Commerce. [ET-1232]
223	- * Enhancement - Auto generate order success page when enabling Tickets Commerce. [ET-1233]
224	- * Enhancement - Added filter `tribe_tickets_manual_attendee_allow_email_resend` to allow customization of email resending via Manual Attendees depending on status. [ETP-703]
225	- * Enhancement - Add `getPrice` method to utilities JS object to centralize the way we get ticket prices. [ET-1238]
226	- * Enhancement - Add a modal with more information about the PayPal connection after connecting with PayPal via Tickets Commerce. [ET-1321]
227	- * Fix - Fixes error being caused when trying to load attendee information. [ET-1320]
228	- * Fix - Added `allow_resending_email` method which can be used to enable or disable resending email. [ETP-703]
229	- * Fix - Fixed ticket total formatting within the attendee registration modal when using custom thousands and decimal separators. [ET-1216]
230	- * Fix - QR Code API generation settings not working if `The Events Calendar` plugin was not active. [ETP-754]
231	- * Fix - Fixed the event cost formatting issues showing the wrong currency symbol, symbol location and separators. [ET-1251]
232	- * Fix - Disable "Connect to PayPal" button while a new URL is not available, after changing countries. [ET-1318]
233	- * Fix - Searching Ticket Holder Email / Ticket Holder Name through the Attendee page now functions as expected. [ET-1171]\
234	- * Fix - Working with PayPal accounts in currencies other than USD now works as expected. [ET-1330]
235	- * Language - 17 new strings added, 41 updated, 0 fuzzied, and 0 obsoleted
236	-
237	- = [5.2.0.1] 2021-11-10 =
238	-
239	- * Fix - Ensures that Tickets Commerce attendees get archived properly when an order is canceled or not completed. [ET-1322]
240	-
241	- = [5.2.0] 2021-11-04 =
242	-
243	- * Feature - Introduction of Tickets Commerce, the new and improved solution you can set up to sell tickets with Event Tickets.
244	- * Language - 840 new strings added, 432 updated, 26 fuzzied, and 16 obsoleted
245	-
246	- = [5.1.10] 2021-09-27 =
247	-
248	- * Enhancement - When editing an RSVP or ticket in the block editor, allow title to wrap to multiple lines. [ET-1089]
249	- * Enhancement - Ensure that text for the RSVP going/not going dropdown on front end isn't cut off and arrows aren't hidden. [ET-1169]
250	- * Tweak - Added a new filter `tribe_tickets_get_provider_query_slug` to allow customization of the provider URL variable name. [ET-543]
251	- * Tweak - Changed the `provider` URL variable name to `tickets_provider`. The filter `tribe_tickets_get_provider_query_slug` allows for customization. [ET-543]
252	- * Fix - Fixed ticket total formatting when using custom thousands and decimal separators. [ET-1197]
253	- * Fix - Show warning while creating new tickets with `0` price for TribeCommerce. [ET-1201]
254	- * Fix - Prevent text overlapping description in the ticket AR modal. [ET-1179]
255	- * Fix - Removed the ability to resend tickets from the Attendees page to Attendees who cancelled or refunded their ticket. [ETP-703]
256	- * Language - 26 new strings added, 116 updated, 2 fuzzied, and 35 obsoleted
257	-
258	- = [5.1.9.1] 2021-09-08 =
259	-
260	- * Fix - Fixed conflict with WooCommerce Payments plugin showing error on Ticket Form. [ET-1174]
261	-
262	- = [5.1.9] 2021-08-31 =
263	-
264	- * Fix - Fixed cart calculation inconsistency with WooCommerce when the "Number of decimals" setting was set to `0`. [ETP-324]
265	- * Fix - Removed RSVP V2 preview templates and functionality. [ET-1162]
266	- * Fix - Updated deprecated hook `block_categories` to use `block_categories_all`. [ET-1156]
267	- * Language - 37 new strings added, 162 updated, 6 fuzzied, and 20 obsoleted
268	-
269	[See changelog for all versions](https://raw.githubusercontent.com/the-events-calendar/event-tickets/master/changelog.txt)


1	=== Event Tickets ===
2
3	+ Contributors: theeventscalendar, brianjessee, camwynsp, aguseo, bordoni, borkweb, GeoffBel, jentheo, leahkoerper, lucatume, neillmcshea, vicskf, zbtirrell, juanfra, moraleida.me
4	Tags: tickets, registration, The Events Calendar, RSVP, ticket sales, attendee management
5	Requires at least: 5.6
6	+ Tested up to: 5.9.1
7	+ Stable tag: 5.3.0
8	Requires PHP: 7.1
9	License: GPLv2 or later
10	License URI: http://www.gnu.org/licenses/gpl-2.0.html

17
18	This plugin makes it easy to sell tickets and collect registration for in-person or virtual events. Plus, it comes with features backed by our world-class team of developers and designers. Integrate Event Tickets with your PayPal business account and manage attendees from your WordPress dashboard.
19
20	+ Use our free commerce solution, Tickets Commerce, to sell tickets with PayPal and/or Stripe.
21	+
22	https://vimeo.com/480516958
23
24	= 🎟️ Ticketing and Registration for WordPress =

39
40	✔️ Attendees can RSVP to events
41	✔️ Attendees can purchase tickets to events
42	+ ✔️ Sell tickets with PayPal and/or Stripe using our free commerce solution, Tickets Commerce.
43	✔️ Add RSVPs and tickets to posts, pages, or custom post types
44	✔️ Collect ticket fees by connecting your PayPal business account
45	✔️ Generate sales and attendee reports

47	✔️ Automatic ticket confirmation emails
48	✔️ Works out of the box with [The Events Calendar](https://wordpress.org/plugins/the-events-calendar/)
49	✔️ Responsive design works on all devices
50	+ ✔️ Tested on the major theme frameworks such as Avada, Genesis, Kadence, Thesis and many more.
51	✔️ Internationalized & translated
52	✔️ Extensive template tags for customization
53	✔️ Hooks & filters galore

63
64	* [Guide: Getting Started with Event Tickets](https://theeventscalendar.com/knowledgebase/guide/event-tickets/)
65	* [Installing Event Tickets Video](https://evnt.is/1ao9)
66	+ * [Using Tickets Commerce Video](https://www.youtube.com/watch?v=2MZnZDMjpCk)
67	+ * [Do I need Event Tickets or Event Tickets Plus?](https://evnt.is/1aoa)
68	* [How to Make Money with Virtual Events](https://evnt.is/1aob)
69
70	If you have any questions about this plugin, you can post a thread in the WordPress.org forum. Please search existing threads before starting a new on

147
148	Event Tickets is our free ticketing plugin that has all the basics you need to sell tickets and collect RSVPs on your website. You can use Event Tickets with or without The Events Calendar.
149
150	+ [Event Tickets Plus](https://evnt.is/18wk) is a premium plugin that runs alongside Event Tickets and enhances it with extra features, including custom registration fields, shortcodes, WooCommerce integration, enhanced Stripe functionality for Stripe for Tickets Commerce, our [mobile ticketing app](https://evnt.is/1aof) and more.
151
152	[Read more to learn which plugin is right for you.](https://evnt.is/1aoa)
153

183
184	== Changelog ==
185
186	+ = [5.3.0] 2022-02-24 =
187	+
188	+ * Version - Event Tickets 5.3.0 is only compatible with Event Tickets Plus 5.4.0 and higher
189	+ * Feature - Introduction of Stripe for Tickets Commerce. [ET-1342]
190	+ * Feature - Collect purchaser name and email for anonymous purchases using Tickets Commerce. [ET-1378]
191	+ * Feature - Introduce automatic handling of zero-decimal currencies in Tickets Commerce [ET-1414][ET-1420]
192	+ * Fix - Remove anonymous purchase notice for Tickets Commerce after ET-1378 was implemented. [ET-1379]
193	+ * Tweak - Added filters: `tec_tickets_commerce_order_purchaser_data`, `tec_tickets_commerce_order_purchaser_data`, `tec_tickets_commerce_stripe_checkout_localized_data`, `tec_tickets_commerce_stripe_order_endpoint_error_messages`, `tec_tickets_commerce_stripe_settings`, `tec_tickets_commerce_stripe_settings`, `tec_tickets_commerce_stripe_payment_methods_by_currency`, `tec_tickets_commerce_stripe_payment_methods_available`, `tec_tickets_commerce_stripe_fee_is_applied_notice`, `tec_tickets_commerce_gateway_stripe_webhook_event_handlers`, `tec_tickets_commerce_gateway_stripe_webhook_status`, `tec_tickets_commerce_gateway_stripe_webhook_events_labels_map`, `tec_tickets_commerce_payments_tab_sections`, `tec_tickets_commerce_currency_{$code}_name`, `tec_tickets_commerce_currency_name`, `tec_tickets_commerce_currency_{$code}_precision`, `tec_tickets_commerce_currency_precision`
194	+ * Tweak - Removed filters: `tec_tickets_commerce_gateway_paypal_tracking_id`
195	+ * Tweak - Changed views: `tickets/email`, `v2/commerce/checkout`, `v2/commerce/checkout/cart`, `v2/commerce/checkout/footer/gateway-error`, `v2/commerce/checkout/gateways`, `v2/commerce/checkout/purchaser-info`, `v2/commerce/checkout/purchaser-info/email`, `v2/commerce/checkout/purchaser-info/name`, `v2/commerce/gateway/paypal/container`, `v2/commerce/gateway/stripe/card-element`, `v2/commerce/gateway/stripe/container`, `v2/commerce/gateway/stripe/payment-element`
196	+ * Language - 102 new strings added, 164 updated, 0 fuzzied, and 3 obsoleted
197	+
198	= [5.2.4.1] 2022-02-17 =
199
200	* Fix - Classic Editor compatibility problems with the Ticket Form resolved [GTRIA-738]

223	* Fix - Fixed toggling of shared capacity data for tickets. [ETP-497]
224	* Language - 7 new strings added, 99 updated, 0 fuzzied, and 0 obsoleted
225



























































226	[See changelog for all versions](https://raw.githubusercontent.com/the-events-calendar/event-tickets/master/changelog.txt)

src/Tickets/Commerce/Abstract_Order.php CHANGED Viewed

@@ -19,8 +19,118 @@ abstract class Abstract_Order {
             	 * @return Value;
             	 */
             	public function get_value_total( $items ) {
-            -
            		$sub_totals = Value::build_list( array_filter( wp_list_pluck( $items, 'sub_total' ) ) );
             		$total_value = Value::create();
             		return $total_value->total( $sub_totals );
+            	}
+            }


19	* @return Value;
20	*/
21	public function get_value_total( $items ) {
22	+ $sub_totals = Value::build_list( array_filter( wp_list_pluck( $items, 'sub_total' ) ) );
23	$total_value = Value::create();
24	+
25	return $total_value->total( $sub_totals );
26	}
27	+
28	+ /**
29	+ * Prepare purchaser data received from the checkout page to include in orders.
30	+ *
31	+ * @since 5.3.0
32	+ *
33	+ * @param array $data user data input in the checkout page
34	+ *
35	+ * @return array
36	+ */
37	+ public function prepare_purchaser_data( $data ) {
38	+ $purchaser = [
39	+ 'purchaser_user_id' => 0,
40	+ 'purchaser_full_name' => static::$placeholder_name,
41	+ 'purchaser_first_name' => static::$placeholder_name,
42	+ 'purchaser_last_name' => static::$placeholder_name,
43	+ 'purchaser_email' => '',
44	+ ];
45	+
46	+ if ( empty( $data['billing_details'] ) && is_user_logged_in() ) {
47	+ $user = wp_get_current_user();
48	+ $purchaser['purchaser_user_id'] = $user->ID;
49	+ $purchaser['purchaser_full_name'] = $user->first_name . ' ' . $user->last_name;
50	+ $purchaser['purchaser_first_name'] = $user->first_name;
51	+ $purchaser['purchaser_last_name'] = $user->last_name;
52	+ $purchaser['purchaser_email'] = $user->user_email;
53	+
54	+ return $purchaser;
55	+ }
56	+
57	+ if ( ! empty( $data['billing_details']['first_name'] ) ) {
58	+ $purchaser['purchaser_first_name'] = sanitize_text_field( $data['billing_details']['first_name'] );
59	+ }
60	+ if ( ! empty( $data['billing_details']['last_name'] ) ) {
61	+ $purchaser['purchaser_last_name'] = sanitize_text_field( $data['billing_details']['last_name'] );
62	+ }
63	+ if ( ! empty( $data['billing_details']['name'] ) ) {
64	+ $purchaser['purchaser_full_name'] = sanitize_text_field( $data['billing_details']['name'] );
65	+ }
66	+ if ( ! empty( $data['billing_details']['email'] ) ) {
67	+ $purchaser['purchaser_email'] = sanitize_email( $data['billing_details']['email'] );
68	+ }
69	+
70	+ /**
71	+ * Allows filtering the billing details gathered before creating an order
72	+ *
73	+ * @since 5.3.0
74	+ *
75	+ * @param array $purchaser the list of billing details gathered from the front-end and/or logged-in users
76	+ * @param array $data the entire data array received from the checkout page
77	+ */
78	+ return apply_filters( 'tec_tickets_commerce_order_purchaser_data', $purchaser, $data );
79	+ }
80	+
81	+ /**
82	+ * Prepare purchaser data received from the checkout page to include in orders.
83	+ *
84	+ * @since 5.3.0
85	+ *
86	+ * @param array $data user data input in the checkout page.
87	+ *
88	+ * @return array \| \WP_Error
89	+ *
90	+ */
91	+ public function get_purchaser_data( $data ) {
92	+
93	+ if ( is_user_logged_in() ) {
94	+ $user = wp_get_current_user();
95	+ $purchaser['purchaser_user_id'] = $user->ID;
96	+ $purchaser['purchaser_full_name'] = $user->first_name . ' ' . $user->last_name;
97	+ $purchaser['purchaser_first_name'] = $user->first_name;
98	+ $purchaser['purchaser_last_name'] = $user->last_name;
99	+ $purchaser['purchaser_email'] = $user->user_email;
100	+
101	+ return $purchaser;
102	+ }
103	+
104	+ if ( ! isset( $data['purchaser'] ) \|\| empty( $data['purchaser'] ) ) {
105	+ return new \WP_Error( 'invalid-purchaser-info', __( 'Please provide a valid purchaser name and email.', 'event-tickets' ), [ 'status' => 400 ] );
106	+ }
107	+
108	+ $purchaser_data = array_map( 'sanitize_text_field', $data['purchaser'] );
109	+
110	+ if ( ! isset( $purchaser_data['name'] ) \|\| empty( $purchaser_data['name'] ) ) {
111	+ return new \WP_Error( 'invalid-purchaser-info', __( 'Please provide a valid purchaser name.', 'event-tickets' ), [ 'status' => 400 ] );
112	+ }
113	+
114	+ if ( ! isset( $purchaser_data['email'] ) \|\| empty( $purchaser_data['email'] ) \|\| ! is_email( $purchaser_data['email'] ) ) {
115	+ return new \WP_Error( 'invalid-purchaser-info', __( 'Please provide a valid purchaser email.', 'event-tickets' ), [ 'status' => 400 ] );
116	+ }
117	+
118	+ $purchaser = [
119	+ 'purchaser_user_id' => 0,
120	+ 'purchaser_full_name' => $purchaser_data['name'],
121	+ 'purchaser_first_name' => $purchaser_data['name'],
122	+ 'purchaser_last_name' => '',
123	+ 'purchaser_email' => sanitize_email( $purchaser_data['email'] ),
124	+ ];
125	+
126	+ /**
127	+ * Filter the purchaser details for creating an order.
128	+ *
129	+ * @since 5.3.0
130	+ *
131	+ * @param array $purchaser the list of purchaser info gathered from the front-end and/or logged-in users.
132	+ * @param array $data the entire data array received from the checkout page.
133	+ */
134	+ return apply_filters( 'tec_tickets_commerce_order_purchaser_data', $purchaser, $data );
135	+ }
136	}

src/Tickets/Commerce/Abstract_Settings.php DELETED Viewed

@@ -1,29 +0,0 @@
-            -
            <?php
-            -
            /**
-            -
             *
-            -
             * @since 5.1.6
-            -
             *
-            -
             * @package TEC\Tickets\Commerce
-            -
             */
-            -
-            -
            namespace TEC\Tickets\Commerce;
-            -
-            -
            /**
-            -
             * The gateway settings related functionality.
-            -
             *
-            -
             * @since   5.1.6
-            -
             * @package Tribe\Tickets\Commerce\Tickets_Commerce\Gateways
-            -
             *
-            -
             */
-            -
            abstract class Abstract_Settings {
-            -
-            -
            	/**
-            -
            	 * Get the list of settings for the gateway.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return array The list of settings for the gateway.
-            -
            	 */
-            -
            	abstract public function get_settings();
-            -
-            -
            }

src/Tickets/Commerce/Admin/Featured_Settings.php ADDED Viewed

	@@ -0,0 +1,65 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Admin;
4	+
5	+ use \Tribe__Template;
6	+
7	+ /**
8	+ * Featured Settings for TC Payments Tab.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Admin
13	+ */
14	+ class Featured_Settings {
15	+
16	+ /**
17	+ * Stores the instance of the template engine that we will use for rendering the elements.
18	+ *
19	+ * @since 5.3.0
20	+ *
21	+ * @var Tribe__Template
22	+ */
23	+ protected $template;
24	+
25	+ /**
26	+ * Gets the template instance used to setup the rendering html.
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @return Tribe__Template
31	+ */
32	+ public function get_template() {
33	+ if ( empty( $this->template ) ) {
34	+ $this->template = new \Tribe__Template();
35	+ $this->template->set_template_origin( \Tribe__Tickets__Main::instance() );
36	+ $this->template->set_template_folder( 'src/admin-views/settings/featured' );
37	+ $this->template->set_template_context_extract( true );
38	+ }
39	+
40	+ return $this->template;
41	+ }
42	+
43	+ /**
44	+ * Returns html of the featured settings block.
45	+ *
46	+ * @since 5.3.0
47	+ *
48	+ * @param array $context Context of template.
49	+ * @param boolean $echo Whether or not to output the HTML or just return it.
50	+ *
51	+ * @return Tribe__Template
52	+ */
53	+ public function get_html( $context = [], $echo = false ) {
54	+ $defaults = [
55	+ 'title' => '',
56	+ 'description' => '',
57	+ 'links' => [],
58	+ 'content_template' => '',
59	+ 'classes' => [],
60	+ ];
61	+ $template = $this->get_template();
62	+
63	+ return $template->template( 'container', wp_parse_args( $context, $defaults ), $echo );
64	+ }
65	+ }

src/Tickets/Commerce/Admin/Notices.php CHANGED Viewed

@@ -6,7 +6,6 @@ use \tad_DI52_ServiceProvider;
             use TEC\Tickets\Commerce\Checkout;
             use TEC\Tickets\Commerce\Success;
             use \Tribe__Settings;
-            -
            use \Tribe__Main;
             /**
              * Class Notices
@@ -35,66 +34,6 @@ class Notices extends tad_DI52_ServiceProvider {
             			[ 'dismiss' => false, 'type' => 'error' ],
             			[ $this, 'should_render_success_notice' ]
             		);
-            -
-            -
            		tribe_notice(
-            -
            			'event-tickets-tickets-commerce-anonymous-purchases',
-            -
            			[ $this, 'render_anonymous_purchases_notice' ],
-            -
            			[ 'dismiss' => false, 'type' => 'error' ],
-            -
            			[ $this, 'should_render_anonymous_purchases_notice' ]
-            -
            		);
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Display a notice when Tickets Commerce is enabled, but users aren't required to log in.
-            -
            	 *
-            -
            	 * @since 5.2.3
-            -
            	 *
-            -
            	 * @return bool
-            -
            	 */
-            -
            	public function should_render_anonymous_purchases_notice() {
-            -
            		// If we're not on our own settings page, bail.
-            -
            		if ( Tribe__Settings::$parent_slug !== tribe_get_request_var( 'page' ) ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		$options = get_option( Tribe__Main::OPTIONNAME, [] );
-            -
-            -
            		if (
-            -
            			empty( $options[ 'ticket-authentication-requirements' ] ) ||
-            -
            			! is_array( $options[ 'ticket-authentication-requirements' ] ) ||
-            -
            			! in_array( 'event-tickets_all', $options[ 'ticket-authentication-requirements' ] )
-            -
            		) {
-            -
            			return true;
-            -
            		}
-            -
-            -
            		return false;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Gets the HTML for the notice that is shown when users aren't required to log in.
-            -
            	 *
-            -
            	 * @since 5.2.3
-            -
            	 *
-            -
            	 * @return string Notice HTML.
-            -
            	 */
-            -
            	public function render_anonymous_purchases_notice() {
-            -
            		$notice_link = sprintf(
-            -
            			'<a href="%1$s" target="_blank" rel="noopener noreferrer">%2$s</a>',
-            -
            			esc_url( 'https://evnt.is/1b1t' ),
-            -
            			esc_html__( 'Learn More', 'event-tickets' )
-            -
            		);
-            -
            		$notice_header = esc_html__( 'Anonymous purchases are enabled', 'event-tickets' );
-            -
            		$notice_text = sprintf(
-            -
            			// translators: %1$s: Link to knowledgebase article.
-            -
            			esc_html__( 'It is recommended that you require users to log in before purchasing tickets on the Settings > Tickets page. Otherwise, it is possible for users to purchase a ticket and never receive the tickets via email. %1$s', 'event-tickets' ),
-            -
            			$notice_link
-            -
            		);
-            -
-            -
            		return sprintf(
-            -
            			'<p><strong>%1$s</strong></p><p>%2$s</p>',
-            -
            			$notice_header,
-            -
            			$notice_text
-            -
            		);
+            	}
             	/**

             use TEC\Tickets\Commerce\Checkout;
             use TEC\Tickets\Commerce\Success;
             use \Tribe__Settings;
             /**
              * Class Notices
             			[ 'dismiss' => false, 'type' => 'error' ],
             			[ $this, 'should_render_success_notice' ]
             		);
+            	}
             	/**

src/Tickets/Commerce/Assets.php CHANGED Viewed

@@ -86,5 +86,24 @@ class Assets extends tad_DI52_ServiceProvider {
             			],
             			null
             		);
+            	}
+            }


86	],
87	null
88	);
89	+
90	+ tribe_asset(
91	+ $tickets_main,
92	+ 'tribe-tickets-commerce-base-gateway-checkout-toggler',
93	+ 'commerce/gateway/toggler.js',
94	+ [],
95	+ null,
96	+ [
97	+ 'localize' => [
98	+ 'name' => 'tecTicketsCommerceCheckoutToggleText',
99	+ 'data' => static function () {
100	+ return [
101	+ 'default' => __( 'Default checkout', 'event-tickets' ),
102	+ 'additional' => __( 'Additional payment options', 'event-tickets' ),
103	+ ];
104	+ }
105	+ ]
106	+ ]
107	+ );
108	}
109	}

src/Tickets/Commerce/Gateways/Abstract_Gateway.php DELETED Viewed

@@ -1,80 +0,0 @@
-            -
            <?php
-            -
            /**
-            -
             *
-            -
             * @since 5.1.6
-            -
             *
-            -
             * @package TEC\Tickets\Commerce\Gateways
-            -
             */
-            -
-            -
            namespace TEC\Tickets\Commerce\Gateways;
-            -
-            -
            use TEC\Tickets\Commerce;
-            -
-            -
            /**
-            -
             * The gateway related functionality.
-            -
             *
-            -
             * @since   5.1.6
-            -
             * @package TEC\Tickets\Commerce\Gateways
-            -
             *
-            -
             */
-            -
            abstract class Abstract_Gateway implements Interface_Gateway {
-            -
-            -
            	/**
-            -
            	 * The Gateway key.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 */
-            -
            	protected static $key;
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function get_key() {
-            -
            		return static::$key;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function get_provider_key() {
-            -
            		return Commerce::PROVIDER . '-' . static::get_key();
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public function register_gateway( array $gateways ) {
-            -
            		$gateways[ static::get_key() ] = $this;
-            -
-            -
            		return $gateways;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function is_connected() {
-            -
            		return false;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function is_active() {
-            -
            		return false;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function should_show() {
-            -
            		return true;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public function get_settings() {
-            -
            		return [];
-            -
            	}
-            -
-            -
            }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php ADDED Viewed

	@@ -0,0 +1,305 @@


1	+ <?php
2	+ /**
3	+ *
4	+ * @since 5.3.0
5	+ *
6	+ * @package TEC\Tickets\Commerce\Gateways
7	+ */
8	+
9	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
10	+
11	+ use TEC\Tickets\Commerce;
12	+ use TEC\Tickets\Commerce\Gateways\Manager;
13	+ use TEC\Tickets\Commerce\Payments_Tab;
14	+ use Tribe__Settings;
15	+ use Tribe__Utils__Array as Arr;
16	+
17	+ /**
18	+ * Abstract Gateway Contract.
19	+ *
20	+ * @since 5.3.0
21	+ *
22	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
23	+ */
24	+ abstract class Abstract_Gateway implements Gateway_Interface {
25	+
26	+ /**
27	+ * The Gateway key.
28	+ *
29	+ * @since 5.3.0
30	+ */
31	+ protected static $key;
32	+
33	+ /**
34	+ * The Gateway settings class
35	+ *
36	+ * @since 5.3.0
37	+ *
38	+ * @var string
39	+ */
40	+ protected static $settings;
41	+
42	+ /**
43	+ * The Gateway merchant class
44	+ *
45	+ * @since 5.3.0
46	+ *
47	+ * @var string
48	+ */
49	+ protected static $merchant;
50	+
51	+ /**
52	+ * The option name prefix that configured whether or not a gateway is enabled.
53	+ * It is followed by the gateway 'key'
54	+ *
55	+ * @since 5.3.0
56	+ *
57	+ * @var string
58	+ */
59	+ public static $option_enabled_prefix = '_tickets_commerce_gateway_enabled_';
60	+
61	+ /**
62	+ * Default name for the checkout template.
63	+ *
64	+ * @since 5.3.0
65	+ *
66	+ * @var string
67	+ */
68	+ public static $checkout_container_template_name = 'container';
69	+
70	+ /**
71	+ * @inheritDoc
72	+ */
73	+ public static function get_key() {
74	+ return static::$key;
75	+ }
76	+
77	+ /**
78	+ * @inheritDoc
79	+ */
80	+ public static function get_provider_key() {
81	+ return Commerce::PROVIDER . '-' . static::get_key();
82	+ }
83	+
84	+ /**
85	+ * @inheritDoc
86	+ */
87	+ public function register_gateway( array $gateways ) {
88	+ $gateways[ static::get_key() ] = $this;
89	+
90	+ return $gateways;
91	+ }
92	+
93	+ /**
94	+ * @inheritDoc
95	+ */
96	+ public static function is_connected() {
97	+ // If this gateway shouldn't be shown, then don't change the active status.
98	+ if ( ! static::should_show() ) {
99	+ return false;
100	+ }
101	+
102	+ return tribe( static::$merchant )->is_connected();
103	+ }
104	+
105	+ /**
106	+ * @inheritDoc
107	+ */
108	+ public static function is_active() {
109	+ // If this gateway shouldn't be shown, then don't change the active status.
110	+ if ( ! static::should_show() ) {
111	+ return false;
112	+ }
113	+
114	+ return tribe( static::$merchant )->is_active();
115	+ }
116	+
117	+ /**
118	+ * Determine whether Tickets Commerce is in test mode.
119	+ *
120	+ * @since 5.1.6
121	+ *
122	+ * @return bool Whether Tickets Commerce is in test mode.
123	+ */
124	+ public static function is_test_mode() {
125	+
126	+ if ( Commerce\Settings::is_test_mode() ) {
127	+ return true;
128	+ }
129	+
130	+ return tribe_is_truthy( tribe( static::$settings )->is_gateway_test_mode() );
131	+ }
132	+
133	+ /**
134	+ * @inheritDoc
135	+ */
136	+ public static function should_show() {
137	+ return true;
138	+ }
139	+
140	+ /**
141	+ * @inheritDoc
142	+ */
143	+ public function get_settings() {
144	+ return tribe( static::$settings )->get_settings();
145	+ }
146	+
147	+ /**
148	+ * @inheritDoc
149	+ */
150	+ public static function get_settings_url( array $args = [] ) {
151	+ // Force the Tickets Commerce section to be this gateway.
152	+ $args[ Payments_Tab::$key_current_section_get_var ] = static::get_key();
153	+
154	+ // Pass it to the get_url of the payments tab.
155	+ return tribe( Payments_Tab::class )->get_url( $args );
156	+ }
157	+
158	+ /**
159	+ * @inheritDoc
160	+ */
161	+ public function handle_invalid_response( $response, $message, $slug = 'error' ) {
162	+
163	+ $notices = tribe( Commerce\Notice_Handler::class );
164	+ $body = (array) json_decode( wp_remote_retrieve_body( $response ) );
165	+
166	+ $error = isset( $body['error'] ) ? $body['error'] : __( 'Something went wrong!', 'event-tickets' );
167	+ $error_message = isset( $body['error_description'] ) ? $body['error_description'] : __( 'Unexpected response recieved.', 'event-tickets' );
168	+
169	+ $notices->trigger_admin(
170	+ $slug,
171	+ [
172	+ 'content' => sprintf( 'Error - %s : %s - %s', $error, $error_message, $message ),
173	+ 'type' => 'error',
174	+ ]
175	+ );
176	+ }
177	+
178	+ /**
179	+ * Generates a Tracking ID for this website.
180	+ *
181	+ * The Tracking ID is a site-specific identifier that links the client and platform accounts in the Payment Gateway
182	+ * without exposing sensitive data. By default, the identifier generated is a URL in the format:
183	+ *
184	+ * {SITE_URL}?v={GATEWAY_VERSION}-{RANDOM_6_CHAR_HASH}
185	+ *
186	+ * @since 5.3.0 moved to Abstract_Gateway
187	+ * @since 5.1.9
188	+ *
189	+ * @return string
190	+ */
191	+ public function generate_unique_tracking_id() {
192	+ $id = wp_generate_password( 6, false, false );;
193	+ $url_frags = wp_parse_url( home_url() );
194	+ $url = Arr::get( $url_frags, 'host' ) . Arr::get( $url_frags, 'path' );
195	+ $url = add_query_arg( [
196	+ 'v' => static::VERSION . '-' . $id,
197	+ ], $url );
198	+
199	+ // Always limit it to 127 chars.
200	+ return substr( $url, 0, 127 );
201	+ }
202	+
203	+ /**
204	+ * Get URL for the display logo.
205	+ *
206	+ * @since 5.3.0
207	+ *
208	+ * @return string
209	+ */
210	+ public function get_logo_url(): string {
211	+ return '';
212	+ }
213	+
214	+ /**
215	+ * Get text to use a subtitle when listing gateways.
216	+ *
217	+ * @since 5.3.0
218	+ *
219	+ * @return string
220	+ */
221	+ public function get_subtitle(): string {
222	+ return '';
223	+ }
224	+
225	+ /**
226	+ * Returns the enabled option key.
227	+ *
228	+ * @since 5.3.0
229	+ *
230	+ * @return string
231	+ */
232	+ public static function get_enabled_option_key(): string {
233	+ return static::$option_enabled_prefix . self::get_key();
234	+ }
235	+
236	+ /**
237	+ * Returns if gateway is enabled.
238	+ *
239	+ * @since 5.3.0
240	+ *
241	+ * @return boolean
242	+ */
243	+ public static function is_enabled(): bool {
244	+ if ( ! static::should_show() ) {
245	+ return false;
246	+ }
247	+
248	+ return tribe_is_truthy( tribe_get_option( static::get_enabled_option_key() ) );
249	+ }
250	+
251	+ /**
252	+ * Returns status text.
253	+ *
254	+ * @since 5.3.0
255	+ *
256	+ * @return string
257	+ */
258	+ public static function get_status_text(): string {
259	+ if ( ! static::is_enabled() \|\| ! static::is_active() ) {
260	+ return '';
261	+ }
262	+
263	+ return __( 'Enabled for Checkout', 'event-tickets' );
264	+ }
265	+
266	+ /**
267	+ * Returns name of the container template within the `views/v2/commerce/gateway/{key}/` folder.
268	+ *
269	+ * @since 5.3.0
270	+ *
271	+ * @return string
272	+ */
273	+ public static function get_checkout_container_template_name() {
274	+ return self::$checkout_container_template_name;
275	+ }
276	+
277	+ /**
278	+ * @inheritDoc
279	+ */
280	+ public static function get_checkout_template_vars() {
281	+ return [];
282	+ }
283	+
284	+ /**
285	+ * @inheritDoc
286	+ */
287	+ public function render_checkout_template( \Tribe__Template $template ): string {
288	+ return '';
289	+ }
290	+
291	+ /**
292	+ * Disable the gateway toggle.
293	+ *
294	+ * @since 5.3.0
295	+ *
296	+ * @return bool
297	+ */
298	+ public static function disable() {
299	+ if ( ! static::is_enabled() ) {
300	+ return true;
301	+ }
302	+
303	+ return tribe_remove_option( static::get_enabled_option_key() );
304	+ }
305	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Merchant.php ADDED Viewed

	@@ -0,0 +1,81 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ use TEC\Tickets\Commerce\Traits\Has_Mode;
6	+
7	+ /**
8	+ * Abstract Merchant Contract.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
13	+ */
14	+ abstract class Abstract_Merchant implements Merchant_Interface {
15	+
16	+ use Has_Mode;
17	+
18	+ /**
19	+ * Handle initial setup for the object singleton.
20	+ *
21	+ * @since 5.1.9
22	+ */
23	+ public function init() {
24	+ $this->from_array( $this->get_details_data(), false );
25	+ }
26	+
27	+ /**
28	+ * Make Merchant object from array.
29	+ *
30	+ * @since 5.1.9
31	+ *
32	+ * @param array $data Which values need to .
33	+ * @param boolean $needs_save Determines if the proprieties saved need to save to the DB.
34	+ *
35	+ * @return boolean
36	+ */
37	+ public function from_array( array $data, $needs_save = true ) {
38	+ if ( ! $this->validate( $data ) ) {
39	+ return false;
40	+ }
41	+
42	+ $this->setup_properties( $data, $needs_save );
43	+
44	+ return true;
45	+ }
46	+
47	+ /**
48	+ * Gets the value stored for the Client ID.
49	+ *
50	+ * @since 5.3.0 moved to Abstract_Merchant
51	+ * @since 5.1.9
52	+ *
53	+ * @return string
54	+ */
55	+ public function get_client_id() {
56	+ return $this->client_id;
57	+ }
58	+
59	+ /**
60	+ * Save merchant details.
61	+ *
62	+ * @since 5.3.0 moved to Abstract_Merchant
63	+ * @since 5.1.9
64	+ *
65	+ * @return bool
66	+ */
67	+ public function save() {
68	+ if ( false === $this->needs_save() ) {
69	+ return false;
70	+ }
71	+
72	+ $saved = update_option( $this->get_account_key(), $this->to_array() );
73	+
74	+ // If we were able to save, we reset the needs save.
75	+ if ( $saved ) {
76	+ $this->needs_save = false;
77	+ }
78	+
79	+ return $saved;
80	+ }
81	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_REST_Endpoint.php ADDED Viewed

	@@ -0,0 +1,86 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Abstract REST Endpoint Contract
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ abstract class Abstract_REST_Endpoint implements REST_Endpoint_Interface, \Tribe__Documentation__Swagger__Provider_Interface {
13	+
14	+ /**
15	+ * The REST API endpoint path.
16	+ *
17	+ * @since 5.3.0
18	+ *
19	+ * @var string
20	+ */
21	+ protected $path;
22	+
23	+ /**
24	+ * @inheritDoc
25	+ */
26	+ public function get_endpoint_path() {
27	+ return $this->path;
28	+ }
29	+
30	+ /**
31	+ * @inheritDoc
32	+ */
33	+ public function get_route_url() {
34	+ $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
35	+
36	+ return rest_url( '/' . $namespace . $this->get_endpoint_path(), 'https' );
37	+ }
38	+
39	+ /**
40	+ * Gets the Return URL pointing to this on boarding route.
41	+ *
42	+ * @since 5.3.0 moved to Abstract_REST_Endpoint
43	+ * @since 5.1.9
44	+ *
45	+ * @return string
46	+ */
47	+ public function get_return_url( $hash = null ) {
48	+ $arguments = [
49	+ 'hash' => $hash,
50	+ ];
51	+
52	+ return add_query_arg( $arguments, $this->get_route_url() );
53	+ }
54	+
55	+ /**
56	+ * Sanitize a request argument based on details registered to the route.
57	+ *
58	+ * @since 5.3.0 moved to Abstract_REST_Endpoint
59	+ * @since 5.1.9
60	+ *
61	+ * @param mixed $value Value of the 'filter' argument.
62	+ *
63	+ * @return string\|array
64	+ */
65	+ public function sanitize_callback( $value ) {
66	+ if ( is_array( $value ) ) {
67	+ return array_map( 'sanitize_text_field', $value );
68	+ }
69	+
70	+ return sanitize_text_field( $value );
71	+ }
72	+
73	+ /**
74	+ * {@inheritDoc}
75	+ *
76	+ * @TODO We need to make sure Swagger documentation is present.
77	+ *
78	+ * @since 5.3.0 moved to Abstract_REST_Endpoint
79	+ * @since 5.1.9
80	+ *
81	+ * @return array
82	+ */
83	+ public function get_documentation() {
84	+ return [];
85	+ }
86	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Requests.php ADDED Viewed

	@@ -0,0 +1,172 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ use Tribe__Utils__Array as Arr;
6	+
7	+ /**
8	+ * Abstract Requests Contract.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
13	+ */
14	+ abstract class Abstract_Requests implements Requests_Interface {
15	+
16	+ /**
17	+ * @inheritDoc
18	+ */
19	+ public static function post( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false ) {
20	+ return static::request( 'POST', $endpoint, $query_args, $request_arguments, $raw );
21	+ }
22	+
23	+ /**
24	+ * @inheritDoc
25	+ */
26	+ public static function get( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false ) {
27	+ return static::request( 'GET', $endpoint, $query_args, $request_arguments, $raw );
28	+ }
29	+
30	+ /**
31	+ * @inheritDoc
32	+ */
33	+ public static function patch( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false ) {
34	+ return static::request( 'PATCH', $endpoint, $query_args, $request_arguments, $raw );
35	+ }
36	+
37	+ /**
38	+ * @inheritDoc
39	+ */
40	+ public static function delete( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false ) {
41	+ return static::request( 'DELETE', $endpoint, $query_args, $request_arguments, $raw );
42	+ }
43	+
44	+ /**
45	+ * @inheritDoc
46	+ */
47	+ public static function request( $method, $url, array $query_args = [], array $request_arguments = [], $raw = false, $retries = 0 ) {
48	+ $method = strtoupper( $method );
49	+
50	+ // If the endpoint passed is a full URL don't try to append anything.
51	+ $url = 0 !== strpos( $url, 'https://' )
52	+ ? static::get_api_url( $url, $query_args )
53	+ : add_query_arg( $query_args, $url );
54	+
55	+ $default_arguments = [
56	+ 'headers' => [
57	+ 'Authorization' => 'Bearer ' . tribe( static::$merchant )->get_client_secret(),
58	+ ],
59	+ ];
60	+
61	+ // By default, it's important that we have a body set for any method that is not the GET method.
62	+ if ( 'GET' !== $method ) {
63	+ $default_arguments['body'] = [];
64	+ }
65	+
66	+ foreach ( $default_arguments as $key => $default_argument ) {
67	+ $request_arguments[ $key ] = array_merge( $default_argument, Arr::get( $request_arguments, $key, [] ) );
68	+ }
69	+
70	+ if ( 'GET' !== $method ) {
71	+ $content_type = Arr::get( $request_arguments, [ 'headers', 'Content-Type' ] );
72	+ if ( empty( $content_type ) ) {
73	+ $content_type = Arr::get( $request_arguments, [ 'headers', 'content-type' ] );
74	+ }
75	+
76	+ // For all other methods we try to make the body into the correct type.
77	+ if (
78	+ ! empty( $request_arguments['body'] )
79	+ && 'application/json' === strtolower( $content_type )
80	+ ) {
81	+ $request_arguments['body'] = wp_json_encode( $request_arguments[ $key ] );
82	+ }
83	+ }
84	+
85	+ if ( 'GET' === $method ) {
86	+ $response = wp_remote_get( $url, $request_arguments );
87	+ } elseif ( 'POST' === $method ) {
88	+ $response = wp_remote_post( $url, $request_arguments );
89	+ } else {
90	+ $request_arguments['method'] = $method;
91	+ $response = wp_remote_request( $url, $request_arguments );
92	+ }
93	+
94	+ $response = static::process_response( $response );
95	+
96	+ if ( is_wp_error( $response ) ) {
97	+ return static::prepare_errors_to_display( $response );
98	+ }
99	+
100	+ // When raw is true means we dont do any logic.
101	+ if ( true === $raw ) {
102	+ return $response;
103	+ }
104	+
105	+ /**
106	+ * @todo Determine if Stripe might need a retry pattern like PayPal.
107	+ */
108	+
109	+ /**
110	+ * @todo we need to log and be more verbose about the responses. Specially around failed JSON strings.
111	+ */
112	+ $response_body = wp_remote_retrieve_body( $response );
113	+ $response_body = @json_decode( $response_body, true );
114	+ if ( empty( $response_body ) ) {
115	+ return $response;
116	+ }
117	+
118	+ if ( ! is_array( $response_body ) ) {
119	+ tribe( 'logger' )->log_error( sprintf( '[%s] Unexpected Gateway %s response', $url, $method ), 'tickets-commerce' );
120	+
121	+ return new \WP_Error( 'tec-tickets-commerce-gateway-client-unexpected', null, [
122	+ 'method' => $method,
123	+ 'url' => $url,
124	+ 'query_args' => $query_args,
125	+ 'request_arguments' => $request_arguments,
126	+ 'response' => $response,
127	+ 'gateway' => static::$gateway::$key,
128	+ ] );
129	+ }
130	+
131	+ return $response_body;
132	+ }
133	+
134	+ /**
135	+ * @inheritDoc
136	+ */
137	+ public static function process_response( $response ) {
138	+
139	+ if ( is_wp_error( $response ) ) {
140	+ return $response;
141	+ }
142	+
143	+ if ( ! empty( $response['response']['code'] ) && 200 !== $response['response']['code'] && ! empty( $response['body'] ) ) {
144	+ $body = json_decode( $response['body'] );
145	+
146	+ if ( ! empty( $body->error ) ) {
147	+ return new \WP_Error( $response['response']['code'], $body->error->message, $body->error );
148	+ }
149	+ }
150	+
151	+ return $response;
152	+ }
153	+
154	+ /**
155	+ * @inheritDoc
156	+ */
157	+ public static function prepare_errors_to_display( \WP_Error $errors ) {
158	+ $error = $errors->get_error_data();
159	+
160	+ if ( ! $error ) {
161	+ $return[] = [ $errors->get_error_code(), $errors->get_error_message() ];
162	+ } elseif ( isset( $error->type ) && isset( $error->message ) ) {
163	+ $return[] = [ $error->type, $error->message ];
164	+ } elseif ( isset( $error->code ) && isset( $error->message ) ) {
165	+ $return[] = [ $error->code, $error->message ];
166	+ } else {
167	+ $return[] = $error;
168	+ }
169	+
170	+ return [ 'errors' => $return ];
171	+ }
172	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Settings.php ADDED Viewed

	@@ -0,0 +1,57 @@


1	+ <?php
2	+ /**
3	+ *
4	+ * @since 5.1.6
5	+ *
6	+ * @package TEC\Tickets\Commerce
7	+ */
8	+
9	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
10	+
11	+ /**
12	+ * Abstract Settings
13	+ *
14	+ * @since 5.3.0
15	+ *
16	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
17	+ */
18	+ abstract class Abstract_Settings {
19	+
20	+ /**
21	+ * The option key for the gateway-specific sandbox.
22	+ *
23	+ * @since 5.3.0
24	+ *
25	+ * @var string
26	+ */
27	+ public static $option_sandbox;
28	+
29	+ /**
30	+ * Get the list of settings for the gateway.
31	+ *
32	+ * @since 5.1.6
33	+ *
34	+ * @return array The list of settings for the gateway.
35	+ */
36	+ abstract public function get_settings();
37	+
38	+ /**
39	+ * Get the HTML for the connection box in the admin
40	+ *
41	+ * @since 5.3.0
42	+ *
43	+ * @return string
44	+ */
45	+ abstract function get_connection_settings_html();
46	+
47	+ /**
48	+ * Check if this gateway is currently in test mode.
49	+ *
50	+ * @since 5.3.0
51	+ *
52	+ * @return bool
53	+ */
54	+ public function is_gateway_test_mode() {
55	+ return tribe_is_truthy( tribe_get_option( static::$option_sandbox ) );
56	+ }
57	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Signup.php ADDED Viewed

	@@ -0,0 +1,100 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Abstract Signup Contract
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ abstract class Abstract_Signup implements Signup_Interface {
13	+
14	+ /**
15	+ * Holds the transient key used to store hash passed to PayPal.
16	+ *
17	+ * @since 5.3.0 moved to Abstract_Signup
18	+ * @since 5.1.9
19	+ *
20	+ * @var string
21	+ */
22	+ public static $signup_hash_meta_key;
23	+
24	+ /**
25	+ * Holds the transient key used to link PayPal to this site.
26	+ *
27	+ * @since 5.3.0 moved to Abstract_Signup
28	+ * @since 5.1.9
29	+ *
30	+ * @var string
31	+ */
32	+ public static $signup_data_meta_key;
33	+
34	+ /**
35	+ * Must be implemented in each Signup class, represents the folder from which to load the
36	+ * templates.
37	+ *
38	+ * @since 5.3.0
39	+ *
40	+ * @var string
41	+ */
42	+ public $template_folder;
43	+
44	+ /**
45	+ * Stores the instance of the template engine that we will use for rendering the page.
46	+ *
47	+ * @since 5.3.0 moved to Abstract_Signup
48	+ * @since 5.1.9
49	+ *
50	+ * @var \Tribe__Template
51	+ */
52	+ protected $template;
53	+
54	+ /**
55	+ * @inheritDoc
56	+ */
57	+ public function get_template() {
58	+ if ( empty( $this->template ) ) {
59	+ $this->template = new \Tribe__Template();
60	+ $this->template->set_template_origin( \Tribe__Tickets__Main::instance() );
61	+ $this->template->set_template_folder( $this->template_folder );
62	+ $this->template->set_template_context_extract( true );
63	+ }
64	+
65	+ return $this->template;
66	+ }
67	+
68	+ /**
69	+ * @inheritDoc
70	+ */
71	+ public function get_transient_data() {
72	+ return get_transient( static::$signup_data_meta_key );
73	+ }
74	+
75	+ /**
76	+ * @inheritDoc
77	+ */
78	+ public function update_transient_data( $value ) {
79	+ return set_transient( static::$signup_data_meta_key, $value, DAY_IN_SECONDS );
80	+ }
81	+
82	+ /**
83	+ * @inheritDoc
84	+ */
85	+ public function delete_transient_data() {
86	+ return delete_transient( static::$signup_data_meta_key );
87	+ }
88	+
89	+ /**
90	+ * @inheritDoc
91	+ */
92	+ public function get_link_html() {
93	+ $template_vars = [
94	+ 'url' => $this->generate_url(),
95	+ ];
96	+
97	+ return $this->get_template()->template( 'signup-link', $template_vars, false );
98	+ }
99	+
100	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_Webhooks.php ADDED Viewed

	@@ -0,0 +1,108 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ use Tribe__Utils__Array as Arr;
6	+
7	+ /**
8	+ * Class Abstract_Webhooks.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
13	+ */
14	+ abstract class Abstract_Webhooks {
15	+
16	+ /**
17	+ * Gets the gateway for this webhook.
18	+ *
19	+ * @since 5.3.0
20	+ *
21	+ * @return Abstract_Gateway
22	+ */
23	+ abstract public function get_gateway() : Abstract_Gateway;
24	+
25	+ /**
26	+ * Gets the merchant for this webhook.
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @return Abstract_Merchant
31	+ */
32	+ abstract public function get_merchant() : Abstract_Merchant;
33	+
34	+ /**
35	+ * Returns the options key for webhook settings in the merchant mode.
36	+ *
37	+ * @since 5.3.0
38	+ *
39	+ * @return string
40	+ */
41	+ public function get_settings_key() : string {
42	+ $gateway = $this->get_gateway();
43	+ $gateway_key = $gateway::get_key();
44	+ $merchant_mode = $this->get_merchant()->get_mode();
45	+
46	+ return "tec_tickets_commerce_{$gateway_key}_{$merchant_mode}_webhooks_settings";
47	+ }
48	+
49	+ /**
50	+ * Retrieves the settings for the webhooks from the database.
51	+ *
52	+ * @since 5.3.0
53	+ *
54	+ * @param array\|string $key Specify each nested index in order.
55	+ * Example: array( 'lvl1', 'lvl2' );
56	+ * @param mixed $default Default value if the search finds nothing.
57	+ *
58	+ * @return mixed
59	+ */
60	+ public function get_setting( $key, $default = null ) {
61	+ $settings = get_option( $this->get_settings_key(), null );
62	+
63	+ return Arr::get( $settings, $key, $default );
64	+ }
65	+
66	+ /**
67	+ * Saves the webhook settings in the database.
68	+ *
69	+ * @since 5.3.0
70	+ *
71	+ * @param array $settings []
72	+ *
73	+ * @return bool
74	+ */
75	+ public function update_settings( array $settings = [] ) {
76	+ return update_option( $this->get_settings_key(), $settings );
77	+ }
78	+
79	+ /**
80	+ * Retrieves the settings for the webhooks from the database.
81	+ *
82	+ * @since 5.3.0
83	+ *
84	+ * @return array\|null
85	+ */
86	+ public function get_settings() {
87	+ $settings = get_option( $this->get_settings_key(), null );
88	+
89	+ // Without an ID, the webhook settings are invalid.
90	+ if ( empty( $settings['id'] ) ) {
91	+ return null;
92	+ }
93	+
94	+ return $settings;
95	+ }
96	+
97	+ /**
98	+ * Deletes the stored webhook settings.
99	+ *
100	+ * @since 5.3.0
101	+ *
102	+ * @return bool
103	+ */
104	+ public function delete_settings() {
105	+ return delete_option( $this->get_settings_key() );
106	+ }
107	+
108	+ }

src/Tickets/Commerce/Gateways/Contracts/Abstract_WhoDat.php ADDED Viewed

	@@ -0,0 +1,127 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ use Tribe__Utils__Array as Arr;
6	+
7	+ /**
8	+ * Abstract class to handle WhoDat connections
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\PayPal
13	+ */
14	+ abstract class Abstract_WhoDat implements WhoDat_Interface {
15	+
16	+ /**
17	+ * Public WhoDat URL, used to authenticate accounts with gateway payment providers
18	+ *
19	+ * @since 5.3.0
20	+ *
21	+ * @var string
22	+ */
23	+ private $api_base_url = 'https://whodat.theeventscalendar.com/commerce/v1';
24	+
25	+ /**
26	+ * Returns the gateway-specific endpoint to use
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @return string
31	+ */
32	+ private function get_gateway_endpoint() {
33	+ return $this->api_endpoint;
34	+ }
35	+
36	+ /**
37	+ * Returns the WhoDat URL to use.
38	+ *
39	+ * @since 5.3.0
40	+ *
41	+ * @return string
42	+ */
43	+ private function get_api_base_url() {
44	+
45	+ if ( defined( 'TEC_TC_WHODAT_DEV_URL' ) && TEC_TC_WHODAT_DEV_URL ) {
46	+ return TEC_TC_WHODAT_DEV_URL;
47	+ }
48	+
49	+ return $this->api_base_url;
50	+ }
51	+
52	+ /**
53	+ * @inheritDoc
54	+ */
55	+ public function get_api_url( $endpoint, array $query_args = [] ) {
56	+ return add_query_arg( $query_args, "{$this->get_api_base_url()}/{$this->get_gateway_endpoint()}/{$endpoint}" );
57	+ }
58	+
59	+ /**
60	+ * @inheritDoc
61	+ */
62	+ public function get( $endpoint, array $query_args ) {
63	+ $url = $this->get_api_url( $endpoint, $query_args );
64	+
65	+ $request = wp_remote_get( $url );
66	+
67	+ if ( is_wp_error( $request ) ) {
68	+ $this->log_error( 'WhoDat request error:', $request->get_error_message(), $url );
69	+
70	+ return null;
71	+ }
72	+
73	+ $body = wp_remote_retrieve_body( $request );
74	+ $body = json_decode( $body, true );
75	+
76	+ return $body;
77	+ }
78	+
79	+ /**
80	+ * @inheritDoc
81	+ */
82	+ public function post( $endpoint, array $query_args = [], array $request_arguments = [] ) {
83	+ $url = $this->get_api_url( $endpoint, $query_args );
84	+
85	+ $default_arguments = [
86	+ 'body' => [],
87	+ ];
88	+
89	+ foreach ( $default_arguments as $key => $default_argument ) {
90	+ $request_arguments[ $key ] = array_merge( $default_argument, Arr::get( $request_arguments, $key, [] ) );
91	+ }
92	+ $request_arguments = array_filter( $request_arguments );
93	+ $request = wp_remote_post( $url, $request_arguments );
94	+
95	+ if ( is_wp_error( $request ) ) {
96	+ $this->log_error( 'WhoDat request error:', $request->get_error_message(), $url );
97	+
98	+ return null;
99	+ }
100	+
101	+ $body = wp_remote_retrieve_body( $request );
102	+ $body = json_decode( $body, true );
103	+
104	+ if ( ! is_array( $body ) ) {
105	+ $this->log_error( 'WhoDat unexpected response:', $body, $url );
106	+ $this->log_error( 'Response:', print_r( $request, true ), '--->' );
107	+
108	+ return null;
109	+ }
110	+
111	+ return $body;
112	+ }
113	+
114	+ /**
115	+ * @inheritDoc
116	+ */
117	+ public function log_error( $type, $message, $url ) {
118	+ $log = sprintf(
119	+ '[%s] %s %s',
120	+ $url,
121	+ $type,
122	+ $message
123	+ );
124	+ tribe( 'logger' )->log_error( $log, 'whodat-connection' );
125	+ }
126	+
127	+ }

src/Tickets/Commerce/Gateways/Contracts/Gateway_Interface.php ADDED Viewed

	@@ -0,0 +1,127 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Gateway Interface
7	+ *
8	+ * @since 5.1.6
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ interface Gateway_Interface {
13	+
14	+ /**
15	+ * Get's the key for this Commerce Gateway.
16	+ *
17	+ * @since 5.1.6
18	+ *
19	+ * @return string What is the Key used.
20	+ */
21	+ public static function get_key();
22	+
23	+ /**
24	+ * Get the provider key for this Commerce Gateway.
25	+ *
26	+ * @since 5.1.9
27	+ *
28	+ * @return string What is the ORM Provider Key used.
29	+ */
30	+ public static function get_provider_key();
31	+
32	+ /**
33	+ * Get the label for this Commerce Gateway.
34	+ *
35	+ * @since 5.1.6
36	+ *
37	+ * @return string What label we are using for this gateway.
38	+ */
39	+ public static function get_label();
40	+
41	+ /**
42	+ * Get the settings url for this Commerce Gateway section.
43	+ *
44	+ * @since 5.3.0
45	+ *
46	+ * @return string
47	+ */
48	+ public static function get_settings_url();
49	+
50	+ /**
51	+ * Get the list of settings for the gateway.
52	+ *
53	+ * @since 5.1.6
54	+ *
55	+ * @return array The list of settings for the gateway.
56	+ */
57	+ public function get_settings();
58	+
59	+ /**
60	+ * Determine whether the gateway is active.
61	+ *
62	+ * @since 5.1.6
63	+ *
64	+ * @return bool Whether the gateway is active.
65	+ */
66	+ public static function is_active();
67	+
68	+ /**
69	+ * Determine whether the gateway is connected.
70	+ *
71	+ * @since 5.2.0
72	+ *
73	+ * @return bool Whether the gateway is connected.
74	+ */
75	+ public static function is_connected();
76	+
77	+ /**
78	+ * Determine whether the gateway should be shown as an available gateway.
79	+ *
80	+ * @since 5.1.6
81	+ *
82	+ * @return bool Whether the gateway should be shown as an available gateway.
83	+ */
84	+ public static function should_show();
85	+
86	+ /**
87	+ * Register the gateway for Tickets Commerce.
88	+ *
89	+ * @since 5.1.6
90	+ *
91	+ * @param array $gateways The list of registered Tickets Commerce gateways.
92	+ *
93	+ * @return Abstract_Gateway[] The list of registered Tickets Commerce gateways.
94	+ */
95	+ public function register_gateway( array $gateways );
96	+
97	+ /**
98	+ * Get all the admin notices.
99	+ *
100	+ * @since 5.2.0.
101	+ *
102	+ * @return array
103	+ */
104	+ public function get_admin_notices();
105	+
106	+ /**
107	+ * Displays error notice for invalid API responses, with error message from API response data.
108	+ *
109	+ * @since 5.2.0
110	+ *
111	+ * @param array $response Raw Response data.
112	+ * @param string $message Additional message to show with error message.
113	+ * @param string $slug Slug for notice container.
114	+ */
115	+ public function handle_invalid_response( $response, $message, $slug = 'error' );
116	+
117	+ /**
118	+ * Renders the template for the checkout.
119	+ *
120	+ * @since 5.3.0
121	+ *
122	+ * @param \Tribe__Template $template Template used to render the checkout.
123	+ *
124	+ * @return string
125	+ */
126	+ public function render_checkout_template( \Tribe__Template $template ): string;
127	+ }

src/Tickets/Commerce/Gateways/Contracts/Merchant_Interface.php ADDED Viewed

	@@ -0,0 +1,53 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Merchant Interface
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ interface Merchant_Interface {
13	+
14	+ /**
15	+ * Gets the account key.
16	+ *
17	+ * @since 5.3.0
18	+ *
19	+ * @return string
20	+ */
21	+ public function get_account_key();
22	+
23	+ /**
24	+ * Save merchant data.
25	+ *
26	+ * @since 5.3.0
27	+ *
28	+ * @return boolean
29	+ */
30	+ public function save();
31	+
32	+ /**
33	+ * Transforms the Merchant data into an array.
34	+ *
35	+ * @since 5.3.0
36	+ *
37	+ * @return array
38	+ */
39	+ public function to_array();
40	+
41	+ /**
42	+ * Creates this object from an array.
43	+ *
44	+ * @since 5.3.0
45	+ *
46	+ * @param array $data
47	+ * @param boolean $needs_save
48	+ *
49	+ * @return boolean
50	+ */
51	+ public function from_array( array $data, $needs_save = true );
52	+
53	+ }

src/Tickets/Commerce/Gateways/Contracts/REST_Endpoint_Interface.php ADDED Viewed

	@@ -0,0 +1,41 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * REST Endpoint Interface.
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ interface REST_Endpoint_Interface {
13	+
14	+ /**
15	+ * Register the actual endpoint on WP Rest API.
16	+ *
17	+ * @since 5.3.0 made part of the REST_Endpoint_Interface
18	+ * @since 5.1.9
19	+ */
20	+ public function register();
21	+
22	+ /**
23	+ * Gets the Endpoint path for this route.
24	+ *
25	+ * @since 5.3.0 moved to Abstract_REST_Endpoint
26	+ * @since 5.1.9
27	+ *
28	+ * @return string
29	+ */
30	+ public function get_endpoint_path();
31	+
32	+ /**
33	+ * Get the REST API route URL.
34	+ *
35	+ * @since 5.3.0 moved to Abstract_REST_Endpoint
36	+ * @since 5.1.9
37	+ *
38	+ * @return string The REST API route URL.
39	+ */
40	+ public function get_route_url();
41	+ }

src/Tickets/Commerce/Gateways/Contracts/Requests_Interface.php ADDED Viewed

	@@ -0,0 +1,121 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Requests Interface for gateways.
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts;
11	+ */
12	+ interface Requests_Interface {
13	+
14	+ /**
15	+ * Send a GET request to the Stripe API.
16	+ *
17	+ * @since 5.3.0
18	+ *
19	+ * @param string $endpoint
20	+ * @param array $query_args
21	+ * @param array $request_arguments
22	+ * @param bool $raw
23	+ *
24	+ * @return array\|null
25	+ */
26	+ public static function get( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false );
27	+
28	+ /**
29	+ * Send a POST request.
30	+ *
31	+ * @since 5.3.0
32	+ *
33	+ * @param string $endpoint
34	+ * @param array $query_args
35	+ * @param array $request_arguments
36	+ * @param bool $raw
37	+ *
38	+ * @return array\|null
39	+ */
40	+ public static function post( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false );
41	+
42	+ /**
43	+ * Send a PATCH request to the Stripe API.
44	+ *
45	+ * @since 5.3.0
46	+ *
47	+ * @param string $endpoint
48	+ * @param array $query_args
49	+ * @param array $request_arguments
50	+ * @param bool $raw
51	+ *
52	+ * @return array\|null
53	+ */
54	+ public static function patch( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false );
55	+
56	+ /**
57	+ * Send a DELETE request to the Stripe API.
58	+ *
59	+ * @since 5.3.0
60	+ *
61	+ * @param string $endpoint
62	+ * @param array $query_args
63	+ * @param array $request_arguments
64	+ * @param bool $raw
65	+ *
66	+ * @return array\|null
67	+ */
68	+ public static function delete( $endpoint, array $query_args = [], array $request_arguments = [], $raw = false );
69	+
70	+ /**
71	+ * Send a given method request to a given URL in the Stripe API.
72	+ *
73	+ * @since 5.3.0
74	+ *
75	+ * @param string $method
76	+ * @param string $url
77	+ * @param array $query_args
78	+ * @param array $request_arguments
79	+ * @param bool $raw
80	+ * @param int $retries Param used to determine the amount of time this particular request was retried.
81	+ *
82	+ * @return array\|\WP_Error
83	+ */
84	+ public static function request( $method, $url, array $query_args = [], array $request_arguments = [], $raw = false, $retries = 0 );
85	+
86	+ /**
87	+ * Process Request responses to catch any error code and transform in a WP_Error.
88	+ * Returns the request array if no errors are found. Or a WP_Error object.
89	+ *
90	+ * @since 5.3.0
91	+ *
92	+ * @param array\|\WP_Error $response Array of server data.
93	+ *
94	+ * @return array\|\WP_Error
95	+ */
96	+ public static function process_response( $response );
97	+
98	+ /**
99	+ * Format user-facing errors to the list structure expected in the checkout script.
100	+ *
101	+ * @since 5.3.0
102	+ *
103	+ * @param \WP_Error $errors WP_Error instance.
104	+ *
105	+ * @return array[]
106	+ */
107	+ public static function prepare_errors_to_display( \WP_Error $errors );
108	+
109	+ /**
110	+ * Get REST API endpoint URL for requests.
111	+ *
112	+ * @since 5.3.0
113	+ *
114	+ * @param string $endpoint The endpoint path.
115	+ * @param array $query_args Query args appended to the URL.
116	+ *
117	+ * @return string The API URL.
118	+ *
119	+ */
120	+ public static function get_api_url( $endpoint, array $query_args = [] );
121	+ }

src/Tickets/Commerce/Gateways/Contracts/Signup_Interface.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * Signup Interface.
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ interface Signup_Interface {
13	+
14	+ /**
15	+ * Gets the content for the template used for the sign-up link.
16	+ *
17	+ * @since 5.3.0
18	+ *
19	+ * @return false\|string
20	+ */
21	+ public function get_link_html();
22	+
23	+ /**
24	+ * Gets the template instance used to setup the rendering of the page.
25	+ *
26	+ * @since 5.3.0 moved to Abstract_Signup
27	+ * @since 5.1.9
28	+ *
29	+ * @return \Tribe__Template
30	+ */
31	+ public function get_template();
32	+
33	+ /**
34	+ * Gets the saved hash for a given user, empty when non-existent.
35	+ *
36	+ * @since 5.3.0 moved to Abstract_Signup
37	+ * @since 5.1.9
38	+ *
39	+ * @return array
40	+ */
41	+ public function get_transient_data();
42	+
43	+ /**
44	+ * Saves the URL in a transient for later use.
45	+ *
46	+ * @since 5.3.0 moved to Abstract_Signup
47	+ * @since 5.1.9
48	+ *
49	+ * @param string $value URL for signup.
50	+ *
51	+ * @return bool
52	+ */
53	+ public function update_transient_data( $value );
54	+
55	+ /**
56	+ * Delete url transient from the DB.
57	+ *
58	+ * @since 5.3.0 moved to Abstract_Signup
59	+ * @since 5.1.9
60	+ *
61	+ * @return bool
62	+ */
63	+ public function delete_transient_data();
64	+ }

src/Tickets/Commerce/Gateways/Contracts/Webhook_Event_Interface.php ADDED Viewed

	@@ -0,0 +1,25 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ use TEC\Tickets\Commerce\Status\Status_Interface;
6	+
7	+ /**
8	+ * Interface for Webhook Event handler classes.
9	+ */
10	+ interface Webhook_Event_Interface {
11	+
12	+ /**
13	+ * Generic handler for webhook events.
14	+ *
15	+ * @since 5.3.0
16	+ *
17	+ * @param array $event
18	+ * @param Status_Interface $new_status
19	+ * @param \WP_REST_Request $request
20	+ * @param \WP_REST_Response $response
21	+ *
22	+ * @return \WP_REST_Response\|\WP_Error
23	+ */
24	+ public static function handle( array $event, Status_Interface $new_status, \WP_REST_Request $request, \WP_REST_Response $response );
25	+ }

src/Tickets/Commerce/Gateways/Contracts/WhoDat_Interface.php ADDED Viewed

	@@ -0,0 +1,65 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Contracts;
4	+
5	+ /**
6	+ * WhoDat Interface
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Contracts
11	+ */
12	+ interface WhoDat_Interface {
13	+
14	+ /**
15	+ * Send a GET request to WhoDat.
16	+ *
17	+ * @since 5.3.0 moved to Abstract_WhoDat.
18	+ * @since 5.1.9
19	+ *
20	+ * @param string $endpoint
21	+ * @param array $query_args
22	+ *
23	+ * @return mixed\|null
24	+ */
25	+ public function get( $endpoint, array $query_args );
26	+
27	+ /**
28	+ * Get REST API endpoint URL for requests.
29	+ *
30	+ * @since 5.3.0 moved to Abstract_WhoDat.
31	+ * @since 5.1.9
32	+ *
33	+ * @param string $endpoint The endpoint path.
34	+ * @param array $query_args Query args appended to the URL.
35	+ *
36	+ * @return string The API URL.
37	+ */
38	+ public function get_api_url( $endpoint, array $query_args = [] );
39	+
40	+ /**
41	+ * Log WhoDat errors.
42	+ *
43	+ * @since 5.3.0 moved to Abstract_WhoDat and made public.
44	+ * @since 5.1.9
45	+ *
46	+ * @param string $type
47	+ * @param string $message
48	+ * @param string $url
49	+ */
50	+ public function log_error( $type, $message, $url );
51	+
52	+ /**
53	+ * Send a POST request to WhoDat.
54	+ *
55	+ * @since 5.3.0 moved to Abstract_WhoDat.
56	+ * @since 5.1.9
57	+ *
58	+ * @param string $endpoint
59	+ * @param array $query_args
60	+ * @param array $request_arguments
61	+ *
62	+ * @return array\|null
63	+ */
64	+ public function post( $endpoint, array $query_args = [], array $request_arguments = [] );
65	+ }

src/Tickets/Commerce/Gateways/Interface_Gateway.php DELETED Viewed

@@ -1,77 +0,0 @@
-            -
            <?php
-            -
-            -
            namespace TEC\Tickets\Commerce\Gateways;
-            -
-            -
            /**
-            -
             * Class Interface_Gateway
-            -
             *
-            -
             * @since   5.1.6
-            -
             *
-            -
             * @package TEC\Tickets\Commerce\Gateways
-            -
             */
-            -
            interface Interface_Gateway {
-            -
            	/**
-            -
            	 * Get's the key for this Commerce Gateway.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return string What is the Key used.
-            -
            	 */
-            -
            	public static function get_key();
-            -
-            -
            	/**
-            -
            	 * Get's the provider key for this Commerce Gateway.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string What is the ORM Provider Key used.
-            -
            	 */
-            -
            	public static function get_provider_key();
-            -
-            -
            	/**
-            -
            	 * Get's the label for this Commerce Gateway.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return string What label we are using for this gateway.
-            -
            	 */
-            -
            	public static function get_label();
-            -
-            -
            	/**
-            -
            	 * Determine whether the gateway is active.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return bool Whether the gateway is active.
-            -
            	 */
-            -
            	public static function is_active();
-            -
-            -
            	/**
-            -
            	 * Determine whether the gateway is connected.
-            -
            	 *
-            -
            	 * @since 5.2.0
-            -
            	 *
-            -
            	 * @return bool Whether the gateway is connected.
-            -
            	 */
-            -
            	public static function is_connected();
-            -
-            -
            	/**
-            -
            	 * Determine whether the gateway should be shown as an available gateway.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return bool Whether the gateway should be shown as an available gateway.
-            -
            	 */
-            -
            	public static function should_show();
-            -
-            -
            	/**
-            -
            	 * Register the gateway for Tickets Commerce.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @param array       $gateways The list of registered Tickets Commerce gateways.
-            -
            	 *
-            -
            	 * @return Abstract_Gateway[] The list of registered Tickets Commerce gateways.
-            -
            	 */
-            -
            	public function register_gateway( array $gateways );
-            -
            }

src/Tickets/Commerce/Gateways/Manager.php CHANGED Viewed

	@@ -2,6 +2,7 @@
2
3	namespace TEC\Tickets\Commerce\Gateways;
4

5	use TEC\Tickets\Settings;
6
7	/**
	@@ -20,7 +21,7 @@ class Manager {
20	* @var string
21	*/
22	public static $option_gateway = '_tickets_commerce_gateway';
23	-
24	/**
25	* Get the list of registered Tickets Commerce gateways.
26	*
	@@ -96,8 +97,15 @@ class Manager {
96	* @return Abstract_Gateway
97	*/
98	public function get_gateway_by_key( $key ) {




99	$gateways = $this->get_gateways();



100
101	- return ~~isset(~~ $gateways[ $key ] ~~) ? $gateways[ $key ] : null~~;
102	}
103	}


2
3	namespace TEC\Tickets\Commerce\Gateways;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
6	use TEC\Tickets\Settings;
7
8	/**

21	* @var string
22	*/
23	public static $option_gateway = '_tickets_commerce_gateway';
24	+
25	/**
26	* Get the list of registered Tickets Commerce gateways.
27	*

97	* @return Abstract_Gateway
98	*/
99	public function get_gateway_by_key( $key ) {
100	+ if ( empty( $key ) ) {
101	+ return;
102	+ }
103	+
104	$gateways = $this->get_gateways();
105	+ if ( ! isset( $gateways[ $key ] ) ) {
106	+ return;
107	+ }
108
109	+ return $gateways[ $key ];
110	}
111	}

src/Tickets/Commerce/Gateways/Manual/Gateway.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	namespace TEC\Tickets\Commerce\Gateways\Manual;
4
5	- use TEC\Tickets\Commerce\Gateways\Abstract_Gateway;
6
7	/**
8	* Class Manual Gateway.
	@@ -53,4 +53,13 @@ class Gateway extends Abstract_Gateway {
53	public static function should_show() {
54	return false;
55	}









56	}


2
3	namespace TEC\Tickets\Commerce\Gateways\Manual;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
6
7	/**
8	* Class Manual Gateway.

53	public static function should_show() {
54	return false;
55	}
56	+
57	+ /**
58	+ * @inheritDoc
59	+ *
60	+ * @since 5.3.0
61	+ */
62	+ public function get_admin_notices() {
63	+ return [];
64	+ }
65	}

src/Tickets/Commerce/Gateways/PayPal/Assets.php CHANGED Viewed

	@@ -9,6 +9,7 @@
9
10	namespace TEC\Tickets\Commerce\Gateways\PayPal;
11

12	use TEC\Tickets\Commerce\Gateways\PayPal\REST\On_Boarding_Endpoint;
13	use TEC\Tickets\Commerce\Gateways\PayPal\REST\Order_Endpoint;
14
	@@ -91,10 +92,12 @@ class Assets extends \tad_DI52_ServiceProvider {
91	'tribe-tickets-loader',
92	'tribe-tickets-commerce-js',
93	'tribe-tickets-commerce-notice-js',

94	],
95	null,
96	[
97	'groups' => [

98	'tec-tickets-commerce-gateway-paypal',
99	],
100	'conditionals' => [ $this, 'should_enqueue_assets' ],
	@@ -187,7 +190,7 @@ class Assets extends \tad_DI52_ServiceProvider {
187	* @return bool If the `PayPal` assets should be enqueued or not.
188	*/
189	public function should_enqueue_assets() {
190	- return tribe( Gateway::class )->is_active();
191	}
192
193	/**


9
10	namespace TEC\Tickets\Commerce\Gateways\PayPal;
11
12	+ use TEC\Tickets\Commerce\Checkout;
13	use TEC\Tickets\Commerce\Gateways\PayPal\REST\On_Boarding_Endpoint;
14	use TEC\Tickets\Commerce\Gateways\PayPal\REST\Order_Endpoint;
15

92	'tribe-tickets-loader',
93	'tribe-tickets-commerce-js',
94	'tribe-tickets-commerce-notice-js',
95	+ 'tribe-tickets-commerce-base-gateway-checkout-toggler',
96	],
97	null,
98	[
99	'groups' => [
100	+ 'tribe-tickets-commerce-checkout',
101	'tec-tickets-commerce-gateway-paypal',
102	],
103	'conditionals' => [ $this, 'should_enqueue_assets' ],

190	* @return bool If the `PayPal` assets should be enqueued or not.
191	*/
192	public function should_enqueue_assets() {
193	+ return tribe( Checkout::class )->is_current_page() && tribe( Gateway::class )->is_active();
194	}
195
196	/**

src/Tickets/Commerce/Gateways/PayPal/Buttons.php CHANGED Viewed

@@ -43,32 +43,20 @@ class Buttons {
             		return $this->template;
+            	}
             	/**
-            -
            	 * Get the checkout script tag for PayPal buttons.
+            	 *
-            -
            	 * @since 5.1.10
+            	 *
-            -
            	 * @return string
             	 */
-            -
            	public function get_checkout_script() {
-            -
            		// Bail if PayPal is not configured and active.
-            -
            		if ( ! tribe( Merchant::class )->is_active() ) {
-            -
            			return;
-            -
            		}
-            -
-            -
            		$items = tribe( Cart::class )->get_items_in_cart( true );
-            -
-            -
            		// Bail if there are no tickets in cart.
-            -
            		if ( empty( $items ) ) {
-            -
            			return;
-            -
            		}
-            -
             		$client        = tribe( Client::class );
-            -
            		$must_login    = ! is_user_logged_in() && tribe( Module::class )->login_required();
             		$template_vars = [
             			'url'            => $client->get_js_sdk_url(),
             			'attribution_id' => Gateway::ATTRIBUTION_ID,
-            -
            			'must_login'     => $must_login,
             		];
             		$client_token_data       = $client->get_client_token();
@@ -79,59 +67,10 @@ class Buttons {
             			$template_vars['client_token_expires_in'] = $client_token_expires_in - 60;
+            		}
-            -
            		$html = $this->get_template()->template( 'checkout-script', $template_vars, false );
-            -
-            -
            		tribe_asset_enqueue( 'tec-tickets-commerce-gateway-paypal-checkout' );
-            -
-            -
            		return $html;
-            -
            	}
-            -
-            -
-            -
            	/**
-            -
            	 * Include the payment buttons from PayPal into the Checkout page.
-            -
            	 *
-            -
            	 * @since 5.2.0
-            -
            	 *
-            -
            	 * @param string           $file     Which file we are loading.
-            -
            	 * @param string           $name     Name of file file
-            -
            	 * @param \Tribe__Template $template Which Template object is being used.
-            -
            	 *
-            -
            	 */
-            -
            	public function include_payment_buttons( $file, $name, $template ) {
-            -
            		$must_login = ! is_user_logged_in() && tribe( Module::class )->login_required();
-            -
-            -
            		$template->template( 'gateway/paypal/buttons', [ 'must_login' => $must_login ] );
-            -
            	}
-            -
-            -
-            -
            	/**
-            -
            	 * Include the advanced payment fields from PayPal into the Checkout page.
-            -
            	 *
-            -
            	 * @since 5.2.0
-            -
            	 *
-            -
            	 * @param string           $file     Which file we are loading.
-            -
            	 * @param string           $name     Name of file file
-            -
            	 * @param \Tribe__Template $template Which Template object is being used.
-            -
            	 *
-            -
            	 */
-            -
            	public function include_advanced_payments( $file, $name, $template ) {
-            -
            		$items = tribe( Cart::class )->get_items_in_cart( true );
-            -
-            -
            		// Bail if there are no tickets in cart.
-            -
            		if ( empty( $items ) ) {
-            -
            			return;
-            -
            		}
-            -
-            -
            		$must_login = ! is_user_logged_in() && tribe( Module::class )->login_required();
-            -
            		$merchant   = tribe( Merchant::class );
-            -
            		$template->template(
-            -
            			'gateway/paypal/advanced-payments',
-            -
            			[
-            -
            				'supports_custom_payments' => $merchant->get_supports_custom_payments(),
-            -
            				'active_custom_payments'   => $merchant->get_active_custom_payments(),
-            -
            				'must_login'               => $must_login,
-            -
            			]
-            -
            		);
+            	}
+            }

             		return $this->template;
+            	}
+            +
             	/**
+            +
            	 * Returns the variables for gateway's checkout template.
+            	 *
+            +
            	 * @since 5.3.0
+            	 *
+            +
            	 * @return []
             	 */
+            +
            	public function get_checkout_template_vars() {
             		$client        = tribe( Client::class );
+            +
             		$template_vars = [
             			'url'            => $client->get_js_sdk_url(),
             			'attribution_id' => Gateway::ATTRIBUTION_ID,
             		];
             		$client_token_data       = $client->get_client_token();
             			$template_vars['client_token_expires_in'] = $client_token_expires_in - 60;
+            		}
+            +
            		$merchant = tribe( Merchant::class );
+            +
            		$template_vars['supports_custom_payments'] = $merchant->get_supports_custom_payments();
+            +
            		$template_vars['active_custom_payments']   = $merchant->get_active_custom_payments();
+            +
            		return $template_vars;
+            	}
+            }

src/Tickets/Commerce/Gateways/PayPal/Gateway.php CHANGED Viewed

@@ -2,8 +2,9 @@
             namespace TEC\Tickets\Commerce\Gateways\PayPal;
-            -
            use TEC\Tickets\Commerce\Gateways\Abstract_Gateway;
             use TEC\Tickets\Commerce\Notice_Handler;
             /**
              * Class Gateway
@@ -18,7 +19,17 @@ class Gateway extends Abstract_Gateway {
             	protected static $key = 'paypal';
             	/**
-            -
            	 * PayPal attribution ID for requests.
+            	 *
             	 * @since 5.1.6
+            	 *
@@ -47,136 +58,101 @@ class Gateway extends Abstract_Gateway {
             	/**
             	 * @inheritDoc
             	 */
-            -
            	public static function is_connected() {
-            -
            		// If this gateway shouldn't be shown, then don't change the active status.
-            -
            		if ( ! static::should_show() ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		return tribe( Merchant::class )->is_connected();
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * @inheritDoc
-            -
            	 */
-            -
            	public static function is_active() {
-            -
            		// If this gateway shouldn't be shown, then don't change the active status.
-            -
            		if ( ! static::should_show() ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		return tribe( Merchant::class )->is_active();
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Get the list of settings for the gateway.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return array The list of settings for the gateway.
-            -
            	 */
-            -
            	public function get_settings() {
-            -
            		return tribe( Settings::class )->get_settings();
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Determine whether Tickets Commerce is in test mode.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @return bool Whether Tickets Commerce is in test mode.
-            -
            	 */
-            -
            	public static function is_test_mode() {
-            -
            		return tribe_is_truthy( tribe_get_option( \TEC\Tickets\Commerce\Settings::$option_sandbox ) );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Get all the admin notices.
-            -
            	 *
-            -
            	 * @since 5.2.0.
-            -
            	 *
-            -
            	 * @return array
-            -
            	 */
             	public function get_admin_notices() {
             		$notices = [
+            			[
-            -
            				'slug'     => 'tc-paypal-signup-complete',
-            -
            				'content'  => __( 'PayPal is now connected.', 'event-tickets' ),
-            -
            				'type'     => 'info',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-disconnect-failed',
-            -
            				'content'  => __( 'Failed to disconnect PayPal account.', 'event-tickets' ),
-            -
            				'type'     => 'error',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-disconnected',
-            -
            				'content'  => __( 'Disconnected PayPal account.', 'event-tickets' ),
-            -
            				'type'     => 'info',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-token-failed',
-            -
            				'content'  => __( 'Failed to refresh PayPal access token.', 'event-tickets' ),
-            -
            				'type'     => 'error',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-token',
-            -
            				'content'  => __( 'PayPal access token was refreshed successfully.', 'event-tickets' ),
-            -
            				'type'     => 'info',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-user-info-failed',
-            -
            				'content'  => __( 'Failed to refresh PayPal user info.', 'event-tickets' ),
-            -
            				'type'     => 'error',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-user-info',
-            -
            				'content'  => __( 'PayPal user info was refreshed successfully.', 'event-tickets' ),
-            -
            				'type'     => 'info',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-webhook-failed',
-            -
            				'content'  => __( 'Failed to refresh PayPal webhooks.', 'event-tickets' ),
-            -
            				'type'     => 'error',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-refresh-webhook-success',
-            -
            				'content'  => __( 'PayPal webhooks refreshed successfully.', 'event-tickets' ),
-            -
            				'type'     => 'info',
             			],
+            			[
-            -
            				'slug'     => 'tc-paypal-ssl-not-available',
-            -
            				'content'  => __( 'A valid SSL certificate is required to set up your PayPal account and accept payments', 'event-tickets' ),
-            -
            				'type'     => 'error',
             			],
             		];
-            -
            		 return $notices;
+            	}
             	/**
-            -
            	 * Displays error notice for invalid API responses, with error message from API response data.
-            -
            	 *
-            -
            	 * @since 5.2.0
-            -
            	 *
-            -
            	 * @param array  $response Raw Response data.
-            -
            	 * @param string $message  Additional message to show with error message.
-            -
            	 * @param string $slug     Slug for notice container.
             	 */
-            -
            	public function handle_invalid_response( $response, $message, $slug = 'error' ) {
-            -
            		$notices = tribe( Notice_Handler::class );
-            -
            		$body    = (array) json_decode( wp_remote_retrieve_body( $response ) );
-            -
            		$error = isset( $body['error'] ) ? $body['error'] : __( 'Something went wrong!' , 'event-tickets' );
-            -
            		$error_message = isset( $body['error_description'] ) ? $body['error_description'] : __( 'Unexpected response recieved.' , 'event-tickets' );
-            -
            		$notices->trigger_admin(
-            -
            			$slug,
-            -
            			[
-            -
            				'content' => sprintf( 'Error - %s : %s - %s', $error, $error_message, $message ),
-            -
            				'type'    => 'error',
-            -
            			]
-            -
            		);
+            	}
+            }


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
6	use TEC\Tickets\Commerce\Notice_Handler;
7	+ use \Tribe__Tickets__Main;
8
9	/**
10	* Class Gateway

19	protected static $key = 'paypal';
20
21	/**
22	+ * @inheritDoc
23	+ */
24	+ protected static $settings = Settings::class;
25	+
26	+ /**
27	+ * @inheritDoc
28	+ */
29	+ protected static $merchant = Merchant::class;
30	+
31	+ /**
32	+ * PayPal's attribution ID for requests.
33	*
34	* @since 5.1.6
35	*

58	/**
59	* @inheritDoc
60	*/


















































61	public function get_admin_notices() {
62	$notices = [
63	[
64	+ 'slug' => 'tc-paypal-signup-complete',
65	+ 'content' => __( 'PayPal is now connected.', 'event-tickets' ),
66	+ 'type' => 'info',
67	],
68	[
69	+ 'slug' => 'tc-paypal-disconnect-failed',
70	+ 'content' => __( 'Failed to disconnect PayPal account.', 'event-tickets' ),
71	+ 'type' => 'error',
72	],
73	[
74	+ 'slug' => 'tc-paypal-disconnected',
75	+ 'content' => __( 'Disconnected PayPal account.', 'event-tickets' ),
76	+ 'type' => 'info',
77	],
78	[
79	+ 'slug' => 'tc-paypal-refresh-token-failed',
80	+ 'content' => __( 'Failed to refresh PayPal access token.', 'event-tickets' ),
81	+ 'type' => 'error',
82	],
83	[
84	+ 'slug' => 'tc-paypal-refresh-token',
85	+ 'content' => __( 'PayPal access token was refreshed successfully.', 'event-tickets' ),
86	+ 'type' => 'info',
87	],
88	[
89	+ 'slug' => 'tc-paypal-refresh-user-info-failed',
90	+ 'content' => __( 'Failed to refresh PayPal user info.', 'event-tickets' ),
91	+ 'type' => 'error',
92	],
93	[
94	+ 'slug' => 'tc-paypal-refresh-user-info',
95	+ 'content' => __( 'PayPal user info was refreshed successfully.', 'event-tickets' ),
96	+ 'type' => 'info',
97	],
98	[
99	+ 'slug' => 'tc-paypal-refresh-webhook-failed',
100	+ 'content' => __( 'Failed to refresh PayPal webhooks.', 'event-tickets' ),
101	+ 'type' => 'error',
102	],
103	[
104	+ 'slug' => 'tc-paypal-refresh-webhook-success',
105	+ 'content' => __( 'PayPal webhooks refreshed successfully.', 'event-tickets' ),
106	+ 'type' => 'info',
107	],
108	[
109	+ 'slug' => 'tc-paypal-ssl-not-available',
110	+ 'content' => __( 'A valid SSL certificate is required to set up your PayPal account and accept payments', 'event-tickets' ),
111	+ 'type' => 'error',
112	],
113	];
114
115	+ return $notices;
116	}
117
118	/**
119	+ * @inheritDoc






120	*/
121	+ public function get_logo_url(): string {
122	+ return Tribe__Tickets__Main::instance()->plugin_url . 'src/resources/images/admin/paypal_logo.png';
123	+ }
124
125	+ /**
126	+ * @inheritDoc
127	+ */
128	+ public function get_subtitle(): string {
129	+ return __( 'Enable payments through PayPal, Venmo, and credit card.', 'event-tickets' );
130	+ }
131
132	+ /**
133	+ * @inheritDoc
134	+ */
135	+ public static function is_enabled(): bool {
136	+ if ( ! static::should_show() ) {
137	+ return false;
138	+ }
139
140	+ $option_value = tribe_get_option( static::get_enabled_option_key() );
141	+ if ( '' !== $option_value ) {
142	+ return (bool) $option_value;
143	+ }
144	+
145	+ // If option is not explicitly set, the default will be if PayPal is connected.
146	+ return static::is_connected();
147	+ }
148	+
149	+ /**
150	+ * @inheritDoc
151	+ */
152	+ public function render_checkout_template( \Tribe__Template $template ): string {
153	+ $gateway_key = static::get_key();
154	+ $template_path = "gateway/{$gateway_key}/container";
155	+
156	+ return $template->template( $template_path, tribe( Buttons::class )->get_checkout_template_vars() );
157	}
158	}

src/Tickets/Commerce/Gateways/PayPal/Hooks.php CHANGED Viewed

@@ -60,9 +60,6 @@ class Hooks extends \tad_DI52_ServiceProvider {
             		add_action( 'tec_tickets_commerce_admin_process_action:paypal-refresh-webhook', [ $this, 'handle_action_refresh_webhook' ] );
             		add_action( 'tec_tickets_commerce_admin_process_action:paypal-resync-connection', [ $this, 'handle_action_refresh_connection' ] );
-            -
            		add_action( 'tribe_template_after_include:tickets/v2/commerce/checkout/footer', [ $this, 'include_payment_buttons' ], 15, 3 );
-            -
            		add_action( 'tribe_template_after_include:tickets/v2/commerce/checkout/footer', [ $this, 'include_advanced_payments' ], 20, 3 );
-            -
            		add_action( 'tribe_template_after_include:tickets/v2/commerce/checkout/footer', [ $this, 'include_client_js_sdk_script' ], 30, 3 );
             		add_action( 'wp_ajax_tec_tickets_commerce_gateway_paypal_refresh_connect_url', [ $this, 'ajax_refresh_connect_url' ] );
             		add_action( 'admin_init', [ $this, 'render_ssl_notice' ] );
@@ -126,46 +123,6 @@ class Hooks extends \tad_DI52_ServiceProvider {
             		return $template_vars;
+            	}
-            -
            	/**
-            -
            	 * Include the Client JS SDK script into checkout.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string           $file     Which file we are loading.
-            -
            	 * @param string           $name     Name of file file
-            -
            	 * @param \Tribe__Template $template Which Template object is being used.
-            -
            	 *
-            -
            	 */
-            -
            	public function include_client_js_sdk_script( $file, $name, $template ) {
-            -
            		echo tribe( Buttons::class )->get_checkout_script();
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Include the payment buttons from PayPal into the Checkout page.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string           $file     Which file we are loading.
-            -
            	 * @param string           $name     Name of file file
-            -
            	 * @param \Tribe__Template $template Which Template object is being used.
-            -
            	 */
-            -
            	public function include_payment_buttons( $file, $name, $template ) {
-            -
            		$this->container->make( Buttons::class )->include_payment_buttons( $file, $name, $template );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Include the advanced payment fields from PayPal in the Checkout page.
-            -
            	 *
-            -
            	 * @since 5.2.0
-            -
            	 *
-            -
            	 * @param string           $file     Which file we are loading.
-            -
            	 * @param string           $name     Name of file file
-            -
            	 * @param \Tribe__Template $template Which Template object is being used.
-            -
            	 */
-            -
            	public function include_advanced_payments( $file, $name, $template ) {
-            -
            		$this->container->make( Buttons::class )->include_advanced_payments( $file, $name, $template );
-            -
            	}
-            -
             	/**
             	 * Handles the disconnecting of the merchant.
+            	 *
@@ -183,6 +140,7 @@ class Hooks extends \tad_DI52_ServiceProvider {
             			return;
+            		}
             		$notices->trigger_admin( 'tc-paypal-disconnected' );
+            	}

             		add_action( 'tec_tickets_commerce_admin_process_action:paypal-refresh-webhook', [ $this, 'handle_action_refresh_webhook' ] );
             		add_action( 'tec_tickets_commerce_admin_process_action:paypal-resync-connection', [ $this, 'handle_action_refresh_connection' ] );
             		add_action( 'wp_ajax_tec_tickets_commerce_gateway_paypal_refresh_connect_url', [ $this, 'ajax_refresh_connect_url' ] );
             		add_action( 'admin_init', [ $this, 'render_ssl_notice' ] );
             		return $template_vars;
+            	}
             	/**
             	 * Handles the disconnecting of the merchant.
+            	 *
             			return;
+            		}
+            +
            		Gateway::disable();
             		$notices->trigger_admin( 'tc-paypal-disconnected' );
+            	}

src/Tickets/Commerce/Gateways/PayPal/Merchant.php CHANGED Viewed

@@ -2,6 +2,7 @@
             namespace TEC\Tickets\Commerce\Gateways\PayPal;
             use Tribe__Utils__Array as Arr;
             use Tribe__Date_Utils as Dates;
             use TEC\Tickets\Commerce\Traits\Has_Mode;
@@ -13,8 +14,7 @@ use TEC\Tickets\Commerce\Traits\Has_Mode;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
-            -
            class Merchant {
-            -
            	use Has_Mode;
             	/**
             	 * All account Props we use for the merchant
@@ -233,17 +233,6 @@ class Merchant {
             		$this->set_value( 'merchant_id_in_paypal', $value, $needs_save );
+            	}
-            -
            	/**
-            -
            	 * Gets the value stored for the Client ID.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string
-            -
            	 */
-            -
            	public function get_client_id() {
-            -
            		return $this->client_id;
-            -
            	}
-            -
             	/**
             	 * Sets the value for Merchant ID locally, in this instance of the Merchant.
+            	 *
@@ -501,15 +490,6 @@ class Merchant {
             		return "tec_tickets_commerce_{$gateway_key}_{$merchant_mode}_user_info";
+            	}
-            -
            	/**
-            -
            	 * Handle initial setup for the object singleton.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 */
-            -
            	public function init() {
-            -
            		$this->set_mode( tec_tickets_commerce_is_sandbox_mode() ? 'sandbox' : 'live' );
-            -
            		$this->from_array( $this->get_details_data(), false );
-            -
            	}
             	/**
             	 * Return array of merchant details.
@@ -534,25 +514,6 @@ class Merchant {
             		];
+            	}
-            -
            	/**
-            -
            	 * Make Merchant object from array.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param array   $data       Which values need to .
-            -
            	 * @param boolean $needs_save Determines if the proprieties saved need to save to the DB.
-            -
            	 *
-            -
            	 * @return boolean
-            -
            	 */
-            -
            	public function from_array( array $data, $needs_save = true ) {
-            -
            		if ( ! $this->validate( $data ) ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		$this->setup_properties( $data, $needs_save );
-            -
-            -
            		return true;
-            -
            	}
             	/**
             	 * Saves a given base value into the class props.
@@ -634,28 +595,6 @@ class Merchant {
             		return true;
+            	}
-            -
            	/**
-            -
            	 * Save merchant details.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return bool
-            -
            	 */
-            -
            	public function save() {
-            -
            		if ( false === $this->needs_save() ) {
-            -
            			return false;
-            -
            		}
-            -
-            -
            		$saved = update_option( $this->get_account_key(), $this->to_array() );
-            -
-            -
            		// If we were able to save, we reset the needs save.
-            -
            		if ( $saved ) {
-            -
            			$this->needs_save = false;
-            -
            		}
-            -
-            -
            		return $saved;
-            -
            	}
-            -
             	/**
             	 * Get the merchant details data.
+            	 *


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Merchant;
6	use Tribe__Utils__Array as Arr;
7	use Tribe__Date_Utils as Dates;
8	use TEC\Tickets\Commerce\Traits\Has_Mode;

14	*
15	* @package TEC\Tickets\Commerce\Gateways\PayPal
16	*/
17	+ class Merchant extends Abstract_Merchant {

18
19	/**
20	* All account Props we use for the merchant

233	$this->set_value( 'merchant_id_in_paypal', $value, $needs_save );
234	}
235











236	/**
237	* Sets the value for Merchant ID locally, in this instance of the Merchant.
238	*

490	return "tec_tickets_commerce_{$gateway_key}_{$merchant_mode}_user_info";
491	}
492









493
494	/**
495	* Return array of merchant details.

514	];
515	}
516



















517
518	/**
519	* Saves a given base value into the class props.

595	return true;
596	}
597






















598	/**
599	* Get the merchant details data.
600	*

src/Tickets/Commerce/Gateways/PayPal/REST/On_Boarding_Endpoint.php CHANGED Viewed

@@ -2,7 +2,9 @@
             namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
             use TEC\Tickets\Commerce\Gateways\PayPal\Client;
             use TEC\Tickets\Commerce\Gateways\PayPal\Merchant;
             use TEC\Tickets\Commerce\Gateways\PayPal\Refresh_Token;
@@ -10,7 +12,7 @@ use TEC\Tickets\Commerce\Gateways\PayPal\Signup;
             use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks;
             use TEC\Tickets\Commerce\Gateways\PayPal\WhoDat;
             use TEC\Tickets\Commerce\Notice_Handler;
-            -
            use Tribe__Documentation__Swagger__Provider_Interface;
             use Tribe__Settings;
             use Tribe__Utils__Array as Arr;
@@ -27,21 +29,15 @@ use WP_REST_Server;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal\REST
              */
-            -
            class On_Boarding_Endpoint implements Tribe__Documentation__Swagger__Provider_Interface {
             	/**
-            -
            	 * The REST API endpoint path.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @var string
             	 */
             	protected $path = '/commerce/paypal/on-boarding';
             	/**
-            -
            	 * Register the actual endpoint on WP Rest API.
-            -
            	 *
-            -
            	 * @since 5.1.9
             	 */
             	public function register() {
             		$namespace     = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
@@ -72,45 +68,6 @@ class On_Boarding_Endpoint implements Tribe__Documentation__Swagger__Provider_In
             		$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
+            	}
-            -
            	/**
-            -
            	 * Gets the Endpoint path for the on boarding process.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string
-            -
            	 */
-            -
            	public function get_endpoint_path() {
-            -
            		return $this->path;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Get the REST API route URL.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string The REST API route URL.
-            -
            	 */
-            -
            	public function get_route_url() {
-            -
            		$namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
-            -
-            -
            		return rest_url( '/' . $namespace . $this->get_endpoint_path(), 'https' );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Gets the Return URL pointing to this on boarding route.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string
-            -
            	 */
-            -
            	public function get_return_url( $hash = null ) {
-            -
            		$arguments = [
-            -
            			'hash' => $hash,
-            -
            		];
-            -
-            -
            		return add_query_arg( $arguments, $this->get_route_url() );
-            -
            	}
-            -
             	/**
             	 * Handles the request that happens in parallel to the User Signup on PayPal but before we redirect the user from
             	 * the mini browser. So when passing error messages, they need to be registered to be fetched in the FE.
@@ -167,7 +124,10 @@ class On_Boarding_Endpoint implements Tribe__Documentation__Swagger__Provider_In
             		$signup        = tribe( Signup::class );
             		$existing_hash = $signup->get_transient_hash();
             		$request_hash  = $request->get_param( 'hash' );
-            -
            		$return_url    = Tribe__Settings::instance()->get_url( [ 'tab' => 'payments' ] );
             		if ( $request_hash !== $existing_hash ) {
             			$this->redirect_with( 'invalid-paypal-signup-hash', $return_url );
@@ -415,34 +375,4 @@ class On_Boarding_Endpoint implements Tribe__Documentation__Swagger__Provider_In
             			],
             		];
+            	}
-            -
-            -
            	/**
-            -
            	 * Sanitize a request argument based on details registered to the route.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param mixed $value Value of the 'filter' argument.
-            -
            	 *
-            -
            	 * @return string|array
-            -
            	 */
-            -
            	public function sanitize_callback( $value ) {
-            -
            		if ( is_array( $value ) ) {
-            -
            			return array_map( 'sanitize_text_field', $value );
-            -
            		}
-            -
-            -
            		return sanitize_text_field( $value );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * {@inheritDoc}
-            -
            	 *
-            -
            	 * @TODO  We need to make sure Swagger documentation is present.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return array
-            -
            	 */
-            -
            	public function get_documentation() {
-            -
            		return [];
-            -
            	}
+            }


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
6	use TEC\Tickets\Commerce\Gateways\PayPal\Client;
7	+ use TEC\Tickets\Commerce\Gateways\PayPal\Gateway;
8	use TEC\Tickets\Commerce\Gateways\PayPal\Merchant;
9	use TEC\Tickets\Commerce\Gateways\PayPal\Refresh_Token;
10

12	use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks;
13	use TEC\Tickets\Commerce\Gateways\PayPal\WhoDat;
14	use TEC\Tickets\Commerce\Notice_Handler;
15	+ use TEC\Tickets\Commerce\Payments_Tab;
16	use Tribe__Settings;
17	use Tribe__Utils__Array as Arr;
18

29	*
30	* @package TEC\Tickets\Commerce\Gateways\PayPal\REST
31	*/
32	+ class On_Boarding_Endpoint extends Abstract_REST_Endpoint {
33
34	/**
35	+ * @inheritDoc




36	*/
37	protected $path = '/commerce/paypal/on-boarding';
38
39	/**
40	+ * @inheritDoc


41	*/
42	public function register() {
43	$namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();

68	$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
69	}
70







































71	/**
72	* Handles the request that happens in parallel to the User Signup on PayPal but before we redirect the user from
73	* the mini browser. So when passing error messages, they need to be registered to be fetched in the FE.

124	$signup = tribe( Signup::class );
125	$existing_hash = $signup->get_transient_hash();
126	$request_hash = $request->get_param( 'hash' );
127	+ $return_url = Tribe__Settings::instance()->get_url( [
128	+ 'tab' => Payments_Tab::$slug,
129	+ tribe( Payments_Tab::class)::$key_current_section_get_var => tribe( Gateway::class )->get_key(),
130	+ ] );
131
132	if ( $request_hash !== $existing_hash ) {
133	$this->redirect_with( 'invalid-paypal-signup-hash', $return_url );

375	],
376	];
377	}






























378	}

src/Tickets/Commerce/Gateways/PayPal/REST/Order_Endpoint.php CHANGED Viewed

	@@ -2,29 +2,17 @@
2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
4
5	- use tad\WPBrowser\Adapters\WP;
6	use TEC\Tickets\Commerce\Cart;

7	use TEC\Tickets\Commerce\Gateways\PayPal\Gateway;
8	use TEC\Tickets\Commerce\Gateways\PayPal\Status;
9	use TEC\Tickets\Commerce\Order;
10
11	use TEC\Tickets\Commerce\Gateways\PayPal\Client;
12	- use TEC\Tickets\Commerce\Gateways\PayPal\Merchant;
13	- use TEC\Tickets\Commerce\Gateways\PayPal\Refresh_Token;
14	-
15	- use TEC\Tickets\Commerce\Gateways\PayPal\Signup;
16	- use TEC\Tickets\Commerce\Gateways\PayPal\WhoDat;
17	-
18	-
19	- use TEC\Tickets\Commerce\Module;
20	use TEC\Tickets\Commerce\Status\Denied;
21	use TEC\Tickets\Commerce\Status\Pending;
22	- use TEC\Tickets\Commerce\Status\Completed;
23	- use TEC\Tickets\Commerce\Status\Created;
24	use TEC\Tickets\Commerce\Status\Status_Handler;
25	use TEC\Tickets\Commerce\Success;
26	- use Tribe__Documentation__Swagger__Provider_Interface;
27	- use Tribe__Settings;
28	use Tribe__Utils__Array as Arr;
29
30	use WP_Error;
	@@ -40,7 +28,7 @@ use WP_REST_Server;
40	*
41	* @package TEC\Tickets\Commerce\Gateways\PayPal\REST
42	*/
43	- class Order_Endpoint ~~implements~~ ~~Tribe__Documentation__Swagger__Provider_Interface~~ {
44
45	/**
46	* The REST API endpoint path.
	@@ -96,30 +84,6 @@ class Order_Endpoint implements Tribe__Documentation__Swagger__Provider_Interfac
96	$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
97	}
98
99	- /**
100	- * Gets the Endpoint path for the on boarding process.
101	- *
102	- * @since 5.1.9
103	- *
104	- * @return string
105	- */
106	- public function get_endpoint_path() {
107	- return $this->path;
108	- }
109	-
110	- /**
111	- * Get the REST API route URL.
112	- *
113	- * @since 5.1.9
114	- *
115	- * @return string The REST API route URL.
116	- */
117	- public function get_route_url() {
118	- $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
119	-
120	- return rest_url( '/' . $namespace . $this->get_endpoint_path(), 'https' );
121	- }
122	-
123	/**
124	* Handles the request that creates an order with Tickets Commerce and the PayPal gateway.
125	*
	@@ -135,12 +99,18 @@ class Order_Endpoint implements Tribe__Documentation__Swagger__Provider_Interfac
135	];
136
137	$messages = $this->get_error_messages();






138
139	- $order = tribe( Order::class )->create_from_cart( tribe( Gateway::class ) );
140
141	$unit = [
142	'reference_id' => $order->ID,
143	- 'value' => $order->total_value->get_decimal(),
144	'currency' => $order->currency,
145	'first_name' => $order->purchaser['first_name'],
146	'last_name' => $order->purchaser['last_name'],
	@@ -151,9 +121,9 @@ class Order_Endpoint implements Tribe__Documentation__Swagger__Provider_Interfac
151	$ticket = \Tribe__Tickets__Tickets::load_ticket_object( $item['ticket_id'] );
152	$unit['items'][] = [
153	'name' => $ticket->name,
154	- 'unit_amount' => [ 'value' => $item['price'], 'currency_code' => $order->currency ],
155	'quantity' => $item['quantity'],
156	- 'item_total' => [ 'value' => $item['sub_total'], 'currency_code' => $order->currency ],
157	'sku' => $ticket->sku,
158	];
159	}
	@@ -434,19 +404,6 @@ class Order_Endpoint implements Tribe__Documentation__Swagger__Provider_Interfac
434	return sanitize_text_field( $value );
435	}
436
437	- /**
438	- * {@inheritDoc}
439	- *
440	- * @TODO We need to make sure Swagger documentation is present.
441	- *
442	- * @since 5.1.9
443	- *
444	- * @return array
445	- */
446	- public function get_documentation() {
447	- return [];
448	- }
449	-
450	/**
451	* Returns an array of error messages that are used by the API responses.
452	*


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
4

5	use TEC\Tickets\Commerce\Cart;
6	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
7	use TEC\Tickets\Commerce\Gateways\PayPal\Gateway;
8	use TEC\Tickets\Commerce\Gateways\PayPal\Status;
9	use TEC\Tickets\Commerce\Order;
10
11	use TEC\Tickets\Commerce\Gateways\PayPal\Client;








12	use TEC\Tickets\Commerce\Status\Denied;
13	use TEC\Tickets\Commerce\Status\Pending;


14	use TEC\Tickets\Commerce\Status\Status_Handler;
15	use TEC\Tickets\Commerce\Success;


16	use Tribe__Utils__Array as Arr;
17
18	use WP_Error;

28	*
29	* @package TEC\Tickets\Commerce\Gateways\PayPal\REST
30	*/
31	+ class Order_Endpoint extends Abstract_REST_Endpoint {
32
33	/**
34	* The REST API endpoint path.

84	$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
85	}
86
























87	/**
88	* Handles the request that creates an order with Tickets Commerce and the PayPal gateway.
89	*

99	];
100
101	$messages = $this->get_error_messages();
102	+ $data = $request->get_json_params();
103	+ $purchaser = tribe( Order::class )->get_purchaser_data( $data );
104	+
105	+ if ( is_wp_error( $purchaser ) ) {
106	+ return $purchaser;
107	+ }
108
109	+ $order = tribe( Order::class )->create_from_cart( tribe( Gateway::class ), $purchaser );
110
111	$unit = [
112	'reference_id' => $order->ID,
113	+ 'value' => (string) $order->total_value->get_decimal(),
114	'currency' => $order->currency,
115	'first_name' => $order->purchaser['first_name'],
116	'last_name' => $order->purchaser['last_name'],

121	$ticket = \Tribe__Tickets__Tickets::load_ticket_object( $item['ticket_id'] );
122	$unit['items'][] = [
123	'name' => $ticket->name,
124	+ 'unit_amount' => [ 'value' => (string) $item['price'], 'currency_code' => $order->currency ],
125	'quantity' => $item['quantity'],
126	+ 'item_total' => [ 'value' => (string) $item['sub_total'], 'currency_code' => $order->currency ],
127	'sku' => $ticket->sku,
128	];
129	}

404	return sanitize_text_field( $value );
405	}
406













407	/**
408	* Returns an array of error messages that are used by the API responses.
409	*

src/Tickets/Commerce/Gateways/PayPal/REST/Webhook_Endpoint.php CHANGED Viewed

	@@ -2,16 +2,10 @@
2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
4

5	use TEC\Tickets\Commerce\Gateways\PayPal\Client;
6	use TEC\Tickets\Commerce\Gateways\PayPal\Merchant;
7	- use TEC\Tickets\Commerce\Gateways\PayPal\REST;
8	use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks;
9	- use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks\Headers;
10	- use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks\Listeners\Payment_Capture_Completed;
11	- use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks\Validation;
12	- use Tribe__Documentation__Swagger__Provider_Interface;
13	- use Tribe__REST__Endpoints__CREATE_Endpoint_Interface;
14	- use Tribe__Tickets__REST__V1__Endpoints__Base;
15	use WP_Error;
16	use WP_REST_Request;
17	use WP_REST_Response;
	@@ -23,7 +17,7 @@ use WP_REST_Server;
23	* @since 5.1.6
24	* @package TEC\Tickets\Commerce\Gateways\PayPal\REST
25	*/
26	- class Webhook_Endpoint ~~implements~~ ~~Tribe__Documentation__Swagger__Provider_Interface~~ {
27
28	/**
29	* The REST API endpoint path.
	@@ -57,30 +51,6 @@ class Webhook_Endpoint implements Tribe__Documentation__Swagger__Provider_Interf
57	$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
58	}
59
60	- /**
61	- * Gets the Endpoint path for the on boarding process.
62	- *
63	- * @since 5.1.9
64	- *
65	- * @return string
66	- */
67	- public function get_endpoint_path() {
68	- return $this->path;
69	- }
70	-
71	- /**
72	- * Get the REST API route URL.
73	- *
74	- * @since 5.1.9
75	- *
76	- * @return string The REST API route URL.
77	- */
78	- public function get_route_url() {
79	- $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
80	-
81	- return rest_url( '/' . $namespace . $this->get_endpoint_path(), 'https' );
82	- }
83	-
84	/**
85	* This grabs the headers from the webhook request to be used in the signature verification
86	*


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal\REST;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
6	use TEC\Tickets\Commerce\Gateways\PayPal\Client;
7	use TEC\Tickets\Commerce\Gateways\PayPal\Merchant;

8	use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks;






9	use WP_Error;
10	use WP_REST_Request;
11	use WP_REST_Response;

17	* @since 5.1.6
18	* @package TEC\Tickets\Commerce\Gateways\PayPal\REST
19	*/
20	+ class Webhook_Endpoint extends Abstract_REST_Endpoint {
21
22	/**
23	* The REST API endpoint path.

51	$documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
52	}
53
























54	/**
55	* This grabs the headers from the webhook request to be used in the signature verification
56	*

src/Tickets/Commerce/Gateways/PayPal/Settings.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal;
4
5	- use TEC\Tickets\Commerce\Abstract_Settings;
6
7	use Tribe__Languages__Locations;
8	use Tribe__Tickets__Admin__Views;
	@@ -15,12 +15,14 @@ use Tribe__Tickets__Main;
15	* @package TEC\Tickets\Commerce\Gateways\PayPal
16	*/
17	class Settings extends Abstract_Settings {

18	/**
19	- * ~~Get the list of settings for the gateway.~~
20	- *
21	- * ~~@since~~ ~~5.1.6~~
22	- *
23	- * @return array The list of settings for the gateway.

24	*/
25	public function get_settings() {
26	$home_url = home_url();
	@@ -52,7 +54,7 @@ class Settings extends Abstract_Settings {
52	/** @var Tribe__Tickets__Admin__Views $admin_views */
53	$admin_views = tribe( 'tickets.admin.views' );
54	$merchant = tribe( Merchant::class );
55	- $signup = tribe( ~~SignUp~~::class );
56
57	$context = [
58	'plugin_url' => Tribe__Tickets__Main::instance()->plugin_url,
	@@ -60,11 +62,12 @@ class Settings extends Abstract_Settings {
60	'is_merchant_connected' => $merchant->is_connected(),
61	'is_merchant_active' => $merchant->is_active(),
62	'signup' => $signup,

63	];
64
65	$admin_views->add_template_globals( $context );
66
67	- return $admin_views->template( 'settings/tickets-commerce/paypal/main', [], false );
68	}
69
70	/**


2
3	namespace TEC\Tickets\Commerce\Gateways\PayPal;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Settings;
6
7	use Tribe__Languages__Locations;
8	use Tribe__Tickets__Admin__Views;

15	* @package TEC\Tickets\Commerce\Gateways\PayPal
16	*/
17	class Settings extends Abstract_Settings {
18	+
19	/**
20	+ * @inheritDoc
21	+ */
22	+ public static $option_sandbox = 'tickets-commerce-paypal-sandbox';
23	+
24	+ /**
25	+ * @inheritDoc
26	*/
27	public function get_settings() {
28	$home_url = home_url();

54	/** @var Tribe__Tickets__Admin__Views $admin_views */
55	$admin_views = tribe( 'tickets.admin.views' );
56	$merchant = tribe( Merchant::class );
57	+ $signup = tribe( Signup::class );
58
59	$context = [
60	'plugin_url' => Tribe__Tickets__Main::instance()->plugin_url,

62	'is_merchant_connected' => $merchant->is_connected(),
63	'is_merchant_active' => $merchant->is_active(),
64	'signup' => $signup,
65	+ 'gateway_key' => tribe( Gateway::class )->get_key(),
66	];
67
68	$admin_views->add_template_globals( $context );
69
70	+ return $admin_views->template( 'settings/tickets-commerce/paypal/main', $context, false );
71	}
72
73	/**

src/Tickets/Commerce/Gateways/PayPal/Signup.php CHANGED Viewed

@@ -2,8 +2,8 @@
             namespace TEC\Tickets\Commerce\Gateways\PayPal;
             use TEC\Tickets\Commerce\Gateways\PayPal\Location\Country;
-            -
            use TEC\Tickets\Commerce\Gateways\PayPal\REST\On_Boarding_Endpoint;
             use TEC\Tickets\Commerce\Settings;
             use Tribe__Utils__Array as Arr;
@@ -14,7 +14,7 @@ use Tribe__Utils__Array as Arr;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
-            -
            class Signup {
             	/**
             	 * Holds the transient key used to store hash passed to PayPal.
@@ -35,31 +35,9 @@ class Signup {
             	public static $signup_data_meta_key = 'tec_tc_paypal_signup_data';
             	/**
-            -
            	 * Stores the instance of the template engine that we will use for rendering the page.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @var \Tribe__Template
-            -
            	 */
-            -
            	protected $template;
-            -
-            -
            	/**
-            -
            	 * Gets the template instance used to setup the rendering of the page.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return \Tribe__Template
             	 */
-            -
            	public function get_template() {
-            -
            		if ( empty( $this->template ) ) {
-            -
            			$this->template = new \Tribe__Template();
-            -
            			$this->template->set_template_origin( \Tribe__Tickets__Main::instance() );
-            -
            			$this->template->set_template_folder( 'src/admin-views/settings/tickets-commerce/paypal' );
-            -
            			$this->template->set_template_context_extract( true );
-            -
            		}
-            -
-            -
            		return $this->template;
-            -
            	}
             	/**
             	 * Gets the saved hash for a given user, empty when non-existent.
@@ -96,41 +74,6 @@ class Signup {
             		return delete_transient( static::$signup_hash_meta_key );
+            	}
-            -
            	/**
-            -
            	 * Gets the saved hash for a given user, empty when non-existent.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return array
-            -
            	 */
-            -
            	public function get_transient_data() {
-            -
            		return get_transient( static::$signup_data_meta_key );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Saves the URL in a transient for later use.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string $value URL for signup.
-            -
            	 *
-            -
            	 * @return bool
-            -
            	 */
-            -
            	public function update_transient_data( $value ) {
-            -
            		return set_transient( static::$signup_data_meta_key, $value, DAY_IN_SECONDS );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Delete url transient from the DB.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return bool
-            -
            	 */
-            -
            	public function delete_transient_data() {
-            -
            		return delete_transient( static::$signup_data_meta_key );
-            -
            	}
-            -
             	/**
             	 * Generate a Unique Hash for signup. It will always be 20 characters long.
+            	 *
@@ -150,34 +93,6 @@ class Signup {
             		return substr( str_shuffle( implode( '-', $keys ) ), 0, 45 );
+            	}
-            -
            	/**
-            -
            	 * Generates a Tracking it for this website.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @return string
-            -
            	 */
-            -
            	public function generate_unique_tracking_id() {
-            -
            		$id = wp_generate_password( 6, false, false );;
-            -
            		$url_frags = wp_parse_url( home_url() );
-            -
            		$url       = Arr::get( $url_frags, 'host' ) . Arr::get( $url_frags, 'path' );
-            -
            		$url       = add_query_arg( [
-            -
            			'v' => Gateway::VERSION . '-' . $id,
-            -
            		], $url );
-            -
-            -
            		/**
-            -
            		 * Tracking ID sent to PayPal.
-            -
            		 *
-            -
            		 * @since 5.1.9
-            -
            		 *
-            -
            		 * @param string $url Which ID we are using normally a URL, cannot be longer than 127 chars.
-            -
            		 */
-            -
            		$url = apply_filters( 'tec_tickets_commerce_gateway_paypal_tracking_id', $url );
-            -
-            -
            		// Always limit it to 127 chars.
-            -
            		return substr( (string) $url, 0, 127 );
-            -
            	}
-            -
             	/**
             	 * Request the signup link that redirects the seller to PayPal.
+            	 *

             namespace TEC\Tickets\Commerce\Gateways\PayPal;
+            +
            use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Signup;
             use TEC\Tickets\Commerce\Gateways\PayPal\Location\Country;
             use TEC\Tickets\Commerce\Settings;
             use Tribe__Utils__Array as Arr;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
+            +
            class Signup extends Abstract_Signup {
             	/**
             	 * Holds the transient key used to store hash passed to PayPal.
             	public static $signup_data_meta_key = 'tec_tc_paypal_signup_data';
             	/**
+            +
            	 * @inheritDoc
             	 */
+            +
            	public $template_folder = 'src/admin-views/settings/tickets-commerce/paypal';
             	/**
             	 * Gets the saved hash for a given user, empty when non-existent.
             		return delete_transient( static::$signup_hash_meta_key );
+            	}
             	/**
             	 * Generate a Unique Hash for signup. It will always be 20 characters long.
+            	 *
             		return substr( str_shuffle( implode( '-', $keys ) ), 0, 45 );
+            	}
             	/**
             	 * Request the signup link that redirects the seller to PayPal.
+            	 *

src/Tickets/Commerce/Gateways/PayPal/Webhooks.php CHANGED Viewed

@@ -4,6 +4,10 @@ namespace TEC\Tickets\Commerce\Gateways\PayPal;
             use TEC\Tickets\Commerce\Gateways\PayPal\REST\Webhook_Endpoint;
             use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks\Events;
             use Tribe__Utils__Array as Arr;
             /**
@@ -13,79 +17,20 @@ use Tribe__Utils__Array as Arr;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
-            -
            class Webhooks {
             	/**
-            -
            	 * Returns the options key for webhook settings in the merchant mode.
-            -
            	 *
-            -
            	 * @since 5.1.10
-            -
            	 *
-            -
            	 * @return string
             	 */
-            -
            	public function get_settings_key() {
-            -
            		$gateway_key   = Gateway::get_key();
-            -
            		$merchant_mode = tribe( Merchant::class )->get_mode();
-            -
-            -
            		return "tec_tickets_commerce_{$gateway_key}_{$merchant_mode}_webhooks_settings";
+            	}
             	/**
-            -
            	 * Retrieves the settings for the webhooks from the database.
-            -
            	 *
-            -
            	 * @since 5.1.10
-            -
            	 *
-            -
            	 * @param array|string $key       Specify each nested index in order.
-            -
            	 *                                Example: array( 'lvl1', 'lvl2' );
-            -
            	 * @param mixed        $default   Default value if the search finds nothing.
-            -
            	 *
-            -
            	 * @return mixed
-            -
            	 */
-            -
            	public function get_setting( $key, $default = null ) {
-            -
            		$settings = get_option( $this->get_settings_key(), null );
-            -
-            -
            		return Arr::get( $settings, $key, $default );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Saves the webhook settings in the database.
-            -
            	 *
-            -
            	 * @since 5.1.10
-            -
            	 *
-            -
            	 * @param array $settings []
-            -
            	 *
-            -
            	 * @return bool
-            -
            	 */
-            -
            	public function update_settings( array $settings = [] ) {
-            -
            		return update_option( $this->get_settings_key(), $settings );
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Retrieves the settings for the webhooks from the database.
-            -
            	 *
-            -
            	 * @since 5.1.10
-            -
            	 *
-            -
            	 * @return array|null
-            -
            	 */
-            -
            	public function get_settings() {
-            -
            		$settings = get_option( $this->get_settings_key(), null );
-            -
-            -
            		// Without an ID, the webhook settings are invalid.
-            -
            		if ( empty( $settings['id'] ) ) {
-            -
            			return null;
-            -
            		}
-            -
-            -
            		return $settings;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Deletes the stored webhook settings.
-            -
            	 *
-            -
            	 * @since 5.1.10
-            -
            	 *
-            -
            	 * @return bool
             	 */
-            -
            	public function delete_settings() {
-            -
            		return delete_option( $this->get_settings_key() );
+            	}
             	/**

             use TEC\Tickets\Commerce\Gateways\PayPal\REST\Webhook_Endpoint;
             use TEC\Tickets\Commerce\Gateways\PayPal\Webhooks\Events;
+            +
            use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
+            +
            use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Merchant;
+            +
            use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Webhooks;
+            +
             use Tribe__Utils__Array as Arr;
             /**
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
+            +
            class Webhooks extends Abstract_Webhooks {
             	/**
+            +
            	 * @inheritDoc
             	 */
+            +
            	public function get_gateway(): Abstract_Gateway {
+            +
            		return tribe( Gateway::class );
+            	}
             	/**
+            +
            	 * @inheritDoc
             	 */
+            +
            	public function get_merchant(): Abstract_Merchant {
+            +
            		return tribe( Merchant::class );
+            	}
             	/**

src/Tickets/Commerce/Gateways/PayPal/WhoDat.php CHANGED Viewed

@@ -2,8 +2,8 @@
             namespace TEC\Tickets\Commerce\Gateways\PayPal;
             use TEC\Tickets\Commerce\Gateways\PayPal\REST\On_Boarding_Endpoint;
-            -
            use Tribe__Utils__Array as Arr;
             /**
              * Class Connect_Client
@@ -12,29 +12,16 @@ use Tribe__Utils__Array as Arr;
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
-            -
            class WhoDat {
-            -
            	/**
-            -
            	 * The API URL.
-            -
            	 *
-            -
            	 * @since 5.1.6
-            -
            	 *
-            -
            	 * @var string
-            -
            	 */
-            -
            	protected $api_url = 'https://whodat.theeventscalendar.com/commerce/v1/paypal';
             	/**
-            -
            	 * Get REST API endpoint URL for requests.
-            -
            	 *
-            -
            	 * @since 5.1.9
+            	 *
-            -
            	 * @param string $endpoint   The endpoint path.
-            -
            	 * @param array  $query_args Query args appended to the URL.
+            	 *
-            -
            	 * @return string The API URL.
             	 */
-            -
            	public function get_api_url( $endpoint, array $query_args = [] ) {
-            -
            		return add_query_arg( $query_args, "{$this->api_url}/{$endpoint}" );
-            -
            	}
             	/**
             	 * Fetch the signup link from PayPal.
@@ -55,7 +42,7 @@ class WhoDat {
             		$query_args = [
             			'mode'        => tribe( Merchant::class )->get_mode(),
             			'nonce'       => $hash,
-            -
            			'tracking_id' => urlencode( tribe( Signup::class )->generate_unique_tracking_id() ),
             			'return_url'  => esc_url( $return_url ),
             			'country'     => $country,
             		];
@@ -117,92 +104,4 @@ class WhoDat {
             		return $this->post( 'seller/credentials', $query_args );
+            	}
-            -
            	/**
-            -
            	 * Send a GET request to WhoDat.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string $endpoint
-            -
            	 * @param array  $query_args
-            -
            	 *
-            -
            	 * @return mixed|null
-            -
            	 */
-            -
            	public function get( $endpoint, array $query_args ) {
-            -
            		$url = $this->get_api_url( $endpoint, $query_args );
-            -
-            -
            		$request = wp_remote_get( $url );
-            -
-            -
            		if ( is_wp_error( $request ) ) {
-            -
            			$this->log_error( 'WhoDat request error:', $request->get_error_message(), $url );
-            -
-            -
            			return null;
-            -
            		}
-            -
-            -
            		$body = wp_remote_retrieve_body( $request );
-            -
            		$body = json_decode( $body, true );
-            -
-            -
            		return $body;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Send a POST request to WhoDat.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string $endpoint
-            -
            	 * @param array  $query_args
-            -
            	 * @param array  $request_arguments
-            -
            	 *
-            -
            	 * @return array|null
-            -
            	 */
-            -
            	public function post( $endpoint, array $query_args = [], array $request_arguments = [] ) {
-            -
            		$url = $this->get_api_url( $endpoint, $query_args );
-            -
-            -
            		$default_arguments = [
-            -
            			'body' => [],
-            -
            		];
-            -
-            -
            		foreach ( $default_arguments as $key => $default_argument ) {
-            -
            			$request_arguments[ $key ] = array_merge( $default_argument, Arr::get( $request_arguments, $key, [] ) );
-            -
            		}
-            -
            		$request_arguments = array_filter( $request_arguments );
-            -
            		$request = wp_remote_post( $url, $request_arguments );
-            -
-            -
            		if ( is_wp_error( $request ) ) {
-            -
            			$this->log_error( 'WhoDat request error:', $request->get_error_message(), $url );
-            -
-            -
            			return null;
-            -
            		}
-            -
-            -
            		$body = wp_remote_retrieve_body( $request );
-            -
            		$body = json_decode( $body, true );
-            -
-            -
            		if ( ! is_array( $body ) ) {
-            -
            			$this->log_error( 'WhoDat unexpected response:', $body, $url );
-            -
            			$this->log_error( 'Response:', print_r( $request, true ), '--->' );
-            -
-            -
            			return null;
-            -
            		}
-            -
-            -
            		return $body;
-            -
            	}
-            -
-            -
            	/**
-            -
            	 * Log WhoDat errors.
-            -
            	 *
-            -
            	 * @since 5.1.9
-            -
            	 *
-            -
            	 * @param string $type
-            -
            	 * @param string $message
-            -
            	 * @param string $url
-            -
            	 */
-            -
            	protected function log_error( $type, $message, $url ) {
-            -
            		$log = sprintf(
-            -
            			'[%s] %s %s',
-            -
            			$url,
-            -
            			$type,
-            -
            			$message
-            -
            		);
-            -
            		tribe( 'logger' )->log_error( $log, 'whodat-connection' );
-            -
            	}
+            }

             namespace TEC\Tickets\Commerce\Gateways\PayPal;
+            +
            use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_WhoDat;
             use TEC\Tickets\Commerce\Gateways\PayPal\REST\On_Boarding_Endpoint;
             /**
              * Class Connect_Client
+             *
              * @package TEC\Tickets\Commerce\Gateways\PayPal
              */
+            +
            class WhoDat extends Abstract_WhoDat {
             	/**
+            +
            	 * The API Path.
+            	 *
+            +
            	 * @since 5.3.0
+            	 *
+            +
            	 * @var string
             	 */
+            +
            	public $api_endpoint = 'paypal';
             	/**
             	 * Fetch the signup link from PayPal.
             		$query_args = [
             			'mode'        => tribe( Merchant::class )->get_mode(),
             			'nonce'       => $hash,
+            +
            			'tracking_id' => urlencode( tribe( Gateway::class )->generate_unique_tracking_id() ),
             			'return_url'  => esc_url( $return_url ),
             			'country'     => $country,
             		];
             		return $this->post( 'seller/credentials', $query_args );
+            	}
+            }

src/Tickets/Commerce/Gateways/Stripe/Application_Fee.php ADDED Viewed

	@@ -0,0 +1,53 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Settings;
6	+ use TEC\Tickets\Commerce\Utils\Value;
7	+
8	+ /**
9	+ * The Stripe Application_Fee class
10	+ *
11	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
12	+ */
13	+ class Application_Fee {
14	+
15	+ /**
16	+ * The percentage applied to Stripe transactions. Currently set at 2%.
17	+ *
18	+ * @since 5.3.0
19	+ *
20	+ * @var float
21	+ */
22	+ const FIXED_FEE = 0.02;
23	+
24	+ /**
25	+ * Calculate the fee value that needs to be applied to the PaymentIntent.
26	+ *
27	+ * @since 5.3.0
28	+ *
29	+ * @param Value $value the value over which to calculate the fee.
30	+ *
31	+ * @return Value;
32	+ */
33	+ public static function calculate( Value $value ) {
34	+
35	+ if ( Settings::is_licensed_plugin() ) {
36	+ return Value::create();
37	+ }
38	+
39	+ // Otherwise, calculate it over the total value.
40	+ return Value::create( $value->get_decimal() * static::get_application_fee_percentage() );
41	+ }
42	+
43	+ /**
44	+ * Returns the application fee percentage value.
45	+ *
46	+ * @since 5.3.0
47	+ *
48	+ * @return float
49	+ */
50	+ private static function get_application_fee_percentage() {
51	+ return static::FIXED_FEE;
52	+ }
53	+ }

src/Tickets/Commerce/Gateways/Stripe/Assets.php ADDED Viewed

	@@ -0,0 +1,185 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Checkout;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\Order_Endpoint;
7	+ use TEC\Tickets\Commerce\Payments_Tab;
8	+
9	+ /**
10	+ * Class Assets.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
15	+ */
16	+ class Assets extends \tad_DI52_ServiceProvider {
17	+
18	+ /**
19	+ * The nonce action to use when requesting the creation of a new order
20	+ *
21	+ * @since 5.3.0
22	+ *
23	+ * @var string
24	+ */
25	+ const ORDER_NONCE_ACTION = 'tec_stripe_order';
26	+
27	+ /**
28	+ * @inheritDoc
29	+ */
30	+ public function register() {
31	+ $plugin = \Tribe__Tickets__Main::instance();
32	+
33	+ tribe_asset(
34	+ $plugin,
35	+ 'tec-tickets-commerce-gateway-stripe-base',
36	+ 'https://js.stripe.com/v3/',
37	+ [],
38	+ null,
39	+ [
40	+ 'type' => 'js',
41	+ ]
42	+ );
43	+
44	+ tribe_asset(
45	+ $plugin,
46	+ 'tec-tickets-commerce-gateway-stripe-checkout',
47	+ 'commerce/gateway/stripe/checkout.js',
48	+ [
49	+ 'jquery',
50	+ 'tribe-common',
51	+ 'tec-ky',
52	+ 'tribe-query-string',
53	+ 'tec-tickets-commerce-gateway-stripe-base',
54	+ 'tribe-tickets-loader',
55	+ 'tribe-tickets-commerce-js',
56	+ 'tribe-tickets-commerce-notice-js',
57	+ 'tribe-tickets-commerce-base-gateway-checkout-toggler',
58	+ ],
59	+ null,
60	+ [
61	+ 'module' => true,
62	+ 'groups' => [
63	+ 'tribe-tickets-commerce-checkout',
64	+ 'tec-tickets-commerce-gateway-stripe',
65	+ ],
66	+ 'conditionals' => [ $this, 'should_enqueue_assets' ],
67	+ 'localize' => [
68	+ 'name' => 'tecTicketsCommerceGatewayStripeCheckout',
69	+ 'data' => static function () {
70	+ return apply_filters( 'tec_tickets_commerce_stripe_checkout_localized_data', [
71	+ 'nonce' => wp_create_nonce( 'wp_rest' ),
72	+ 'orderEndpoint' => tribe( Order_Endpoint::class )->get_route_url(),
73	+ 'paymentElement' => tribe( Stripe_Elements::class )->include_payment_element(),
74	+ 'cardElementType' => tribe( Stripe_Elements::class )->card_element_type(),
75	+ 'publishableKey' => tribe( Merchant::class )->get_publishable_key(),
76	+ 'paymentIntentData' => tribe( Payment_Intent_Handler::class )->get_publishable_payment_intent_data(),
77	+ 'elementsAppearance' => [
78	+ 'variables' => [
79	+ 'borderRadius' => '4px',
80	+ 'colorPrimary' => '#334aff',
81	+ 'fontFamily' => 'Helvetica Neue, Helvetica, -apple-system, BlinkMacSystemFont, Roboto, Arial, sans-serif',
82	+ ],
83	+ 'rules' => [
84	+ '.Tab' => [
85	+ 'borderColor' => '#d5d5d5',
86	+ 'boxShadow' => 'none'
87	+ ],
88	+ '.Tab--selected' => [
89	+ 'borderWidth' => '2px'
90	+ ],
91	+ '.TabLabel' => [
92	+ 'paddingTop' => '6px'
93	+ ],
94	+ '.Input' => [
95	+ 'boxShadow' => 'none',
96	+ 'fontSize' => '14px',
97	+ ],
98	+ '.Label' => [
99	+ 'fontSize' => '14px',
100	+ 'marginBotton' => '4px',
101	+ ]
102	+ ]
103	+ ],
104	+ 'cardElementStyle' => [
105	+ 'base' => [
106	+ 'color' => '#23282d'
107	+ ]
108	+ ]
109	+ ] );
110	+ },
111	+ ],
112	+ ]
113	+ );
114	+
115	+ // Tickets Commerce Stripe main frontend styles.
116	+ tribe_asset(
117	+ $plugin,
118	+ 'tribe-tickets-commerce-stripe-style',
119	+ 'tickets-commerce/gateway/stripe.css',
120	+ [
121	+ 'tribe-common-skeleton-style',
122	+ 'tribe-common-full-style',
123	+ ],
124	+ null,
125	+ [
126	+ 'groups' => [
127	+ 'tribe-tickets-commerce',
128	+ 'tribe-tickets-commerce-checkout',
129	+ ],
130	+ 'print' => true,
131	+ ]
132	+ );
133	+
134	+ // Administration JS for Webhooks.
135	+ tribe_asset(
136	+ $plugin,
137	+ 'tec-tickets-commerce-gateway-stripe-admin-webhooks',
138	+ 'admin/gateway/stripe/webhooks.js',
139	+ [
140	+ 'tribe-clipboard',
141	+ 'tribe-common',
142	+ 'tec-ky',
143	+ ],
144	+ 'admin_enqueue_scripts',
145	+ [
146	+ 'conditionals' => [ $this, 'is_stripe_section' ]
147	+ ]
148	+ );
149	+
150	+ // Administration JS for Webhooks.
151	+ tribe_asset(
152	+ $plugin,
153	+ 'tec-tickets-commerce-gateway-stripe-admin-webhooks-styles',
154	+ 'tickets-commerce/admin/gateway/stripe/webhooks.css',
155	+ [
156	+ ],
157	+ 'admin_enqueue_scripts',
158	+ [
159	+ 'conditionals' => [ $this, 'is_stripe_section' ]
160	+ ]
161	+ );
162	+ }
163	+
164	+ /**
165	+ * Determines if we are currently on the stripe section of the settings.
166	+ *
167	+ * @since 5.3.0
168	+ *
169	+ * @return bool
170	+ */
171	+ public function is_stripe_section() : bool {
172	+ return Gateway::get_key() === tribe_get_request_var( Payments_Tab::$key_current_section_get_var );
173	+ }
174	+
175	+ /**
176	+ * Define if the assets for `Stripe` should be enqueued or not.
177	+ *
178	+ * @since 5.3.0
179	+ *
180	+ * @return bool If the `Stripe` assets should be enqueued or not.
181	+ */
182	+ public function should_enqueue_assets() {
183	+ return tribe( Gateway::class )->is_active() && tribe( Checkout::class )->is_current_page();
184	+ }
185	+ }

src/Tickets/Commerce/Gateways/Stripe/Gateway.php ADDED Viewed

	@@ -0,0 +1,128 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\Return_Endpoint;
7	+ use TEC\Tickets\Commerce\Payments_Tab;
8	+ use \Tribe__Tickets__Main;
9	+ use Tribe__Utils__Array as Arr;
10	+
11	+ /**
12	+ * Class Gateway
13	+ *
14	+ * @since 5.3.0
15	+ *
16	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
17	+ */
18	+ class Gateway extends Abstract_Gateway {
19	+
20	+ /**
21	+ * @inheritDoc
22	+ */
23	+ protected static $key = 'stripe';
24	+
25	+ /**
26	+ * @inheritDoc
27	+ */
28	+ protected static $settings = Settings::class;
29	+
30	+ /**
31	+ * @inheritDoc
32	+ */
33	+ protected static $merchant = Merchant::class;
34	+
35	+ /**
36	+ * Stripe tracking ID version.
37	+ *
38	+ * This shouldn't be updated unless we are modifying something on the Stripe user level.
39	+ *
40	+ * @since 5.3.0
41	+ *
42	+ * @var string
43	+ */
44	+ const VERSION = '1.0.0';
45	+
46	+ /**
47	+ * @inheritDoc
48	+ */
49	+ public static function get_label() {
50	+ return __( 'Stripe', 'event-tickets' );
51	+ }
52	+
53	+ /**
54	+ * @inheritDoc
55	+ */
56	+ public function get_admin_notices() {
57	+ $notices = [
58	+ [
59	+ 'slug' => 'tc-stripe-signup-error',
60	+ 'content' => __( "Stripe wasn't able to complete your connection request. Try again.", 'event-tickets' ),
61	+ 'type' => 'error',
62	+ ],
63	+ [
64	+ 'slug' => 'tc-stripe-token-error',
65	+ 'content' => __( 'Stripe signup was successful but the authentication tokens could not be retrieved. Try refreshing the tokens.', 'event-tickets' ),
66	+ 'type' => 'error',
67	+ ],
68	+ [
69	+ 'slug' => 'tc-stripe-disconnect-error',
70	+ 'content' => __( 'Disconnecting from Stripe failed. Please try again.', 'event-tickets' ),
71	+ 'type' => 'error',
72	+ ],
73	+ [
74	+ 'slug' => 'tc-stripe-currency-mismatch',
75	+ 'type' => 'notice',
76	+ 'dismiss' => true,
77	+ ],
78	+ [
79	+ 'slug' => 'tc-stripe-country-denied',
80	+ 'content' => __( 'Due to Regulatory Issues between Stripe and the country listed in your Stripe account, the free version of Event Tickets cannot accept connections from accounts in your country. Please use a Stripe account from a different country or purchase Event Tickets Plus to continue.', 'event-tickets' ),
81	+ 'type' => 'error',
82	+ ],
83	+ [
84	+ 'slug' => 'tc-stripe-account-disconnected',
85	+ 'content' => sprintf(
86	+ // Translators: %1$s is the opening <a> tag for the Payments Tab page link. %2$s is the closing <a> tag.
87	+ __( 'Your stripe account was disconnected from the Stripe dashboard. If you believe this is an error, you can re-connect in the %1$sPayments Tab of the Settings Page%2$s.', 'event-tickets' ),
88	+ '<a href="' . tribe( Payments_Tab::class )->get_url( [ 'tc-section' => Gateway::get_key() ] ) . '">',
89	+ '</a>' ),
90	+ 'type' => 'error',
91	+ 'dismiss' => true,
92	+ ],
93	+ ];
94	+
95	+ return $notices;
96	+ }
97	+
98	+ /**
99	+ * @inheritDoc
100	+ */
101	+ public function get_logo_url(): string {
102	+ return Tribe__Tickets__Main::instance()->plugin_url . 'src/resources/images/admin/stripe-logo.png';
103	+ }
104	+
105	+ /**
106	+ * @inheritDoc
107	+ */
108	+ public function get_subtitle(): string {
109	+ return __( 'Enable credit card payments, Afterpay, AliPay, Giropay, Klarna and more.', 'event-tickets' );
110	+ }
111	+
112	+ /**
113	+ * @inheritDoc
114	+ */
115	+ public function generate_unique_tracking_id() {
116	+ return tribe( Return_Endpoint::class )->get_route_url();
117	+ }
118	+
119	+ /**
120	+ * @inheritDoc
121	+ */
122	+ public function render_checkout_template( \Tribe__Template $template ): string {
123	+ $gateway_key = static::get_key();
124	+ $template_path = "gateway/{$gateway_key}/container";
125	+
126	+ return $template->template( $template_path, tribe( Stripe_Elements::class )->get_checkout_template_vars() );
127	+ }
128	+ }

src/Tickets/Commerce/Gateways/Stripe/Hooks.php ADDED Viewed

	@@ -0,0 +1,204 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Module;
6	+ use TEC\Tickets\Commerce\Notice_Handler;
7	+
8	+ /**
9	+ * Class Hooks
10	+ *
11	+ * @since 5.3.0
12	+ *
13	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
14	+ */
15	+ class Hooks extends \tad_DI52_ServiceProvider {
16	+
17	+ /**
18	+ * @inheritDoc
19	+ */
20	+ public function register() {
21	+ $this->add_actions();
22	+ $this->add_filters();
23	+ }
24	+
25	+ /**
26	+ * Adds the actions required by each Stripe component.
27	+ *
28	+ * @since 5.3.0
29	+ */
30	+ protected function add_actions() {
31	+ add_action( 'rest_api_init', [ $this, 'register_endpoints' ] );
32	+ add_action( 'wp', [ $this, 'maybe_create_stripe_payment_intent' ] );
33	+
34	+ add_action( 'admin_init', [ $this, 'handle_stripe_errors' ] );
35	+
36	+ add_action( 'wp_ajax_tec_tickets_commerce_gateway_stripe_test_webhooks', [ $this, 'action_handle_testing_webhooks_field' ] );
37	+ }
38	+
39	+ /**
40	+ * Adds the filters required by each Stripe component.
41	+ *
42	+ * @since 5.3.0
43	+ */
44	+ protected function add_filters() {
45	+ add_filter( 'tec_tickets_commerce_gateways', [ $this, 'filter_add_gateway' ], 5, 2 );
46	+ add_filter( 'tec_tickets_commerce_notice_messages', [ $this, 'include_admin_notices' ] );
47	+ add_filter( 'tec_tickets_commerce_stripe_settings', [ $this, 'include_webhook_settings' ], 20 );
48	+ add_filter( 'tribe_field_div_end', [ $this, 'filter_include_webhooks_copy' ], 10, 2 );
49	+ add_filter( 'tribe_settings_save_field_value', [ $this, 'validate_payment_methods' ], 10, 2 );
50	+ add_filter( 'tribe_settings_validate_field_value', [ $this, 'provide_defaults_for_hidden_fields'], 10, 3 );
51	+ }
52	+
53	+ /**
54	+ * Add this gateway to the list of available.
55	+ *
56	+ * @since 5.3.0
57	+ *
58	+ * @param array $gateways List of available gateways.
59	+ *
60	+ * @return array
61	+ */
62	+ public function filter_add_gateway( array $gateways = [] ) : array {
63	+ return $this->container->make( Gateway::class )->register_gateway( $gateways );
64	+ }
65	+
66	+ /**
67	+ * Modify the HTML of the Webhooks field to include a copy button.
68	+ *
69	+ * @since 5.3.0
70	+ *
71	+ * @param string $html
72	+ * @param \Tribe__Field $field
73	+ *
74	+ * @return string
75	+ */
76	+ public function filter_include_webhooks_copy( string $html, \Tribe__Field $field ) : string {
77	+ return $this->container->make( Webhooks::class )->include_webhooks_copy_button( $html, $field );
78	+ }
79	+
80	+ /**
81	+ * Register the Endpoints from Stripe.
82	+ *
83	+ * @since 5.3.0
84	+ */
85	+ public function register_endpoints() : void {
86	+ $this->container->make( REST::class )->register_endpoints();
87	+ }
88	+
89	+ /**
90	+ * Handles the validation of the signing key on the settings page.
91	+ *
92	+ * @since 5.3.0
93	+ */
94	+ public function action_handle_testing_webhooks_field() : void {
95	+ $this->container->make( Webhooks::class )->handle_validation();
96	+ }
97	+
98	+ /**
99	+ * Handle stripe errors into the admin UI.
100	+ *
101	+ * @since 5.3.0
102	+ */
103	+ public function handle_stripe_errors() {
104	+
105	+ $merchant_denied = tribe( Merchant::class )->is_merchant_unauthorized();
106	+
107	+ if ( $merchant_denied ) {
108	+ return tribe( Notice_Handler::class )->trigger_admin( $merchant_denied );
109	+ }
110	+
111	+ $merchant_disconnected = tribe( Merchant::class )->is_merchant_deauthorized();
112	+
113	+ if ( $merchant_disconnected ) {
114	+ return tribe( Notice_Handler::class )->trigger_admin( $merchant_disconnected );
115	+ }
116	+
117	+ tribe( Settings::class )->alert_currency_mismatch();
118	+
119	+ if ( empty( tribe_get_request_var( 'tc-stripe-error' ) ) ) {
120	+ return;
121	+ }
122	+
123	+ return tribe( Notice_Handler::class )->trigger_admin( tribe_get_request_var( 'tc-stripe-error' ) );
124	+ }
125	+
126	+ /**
127	+ * Include Stripe admin notices for Ticket Commerce.
128	+ *
129	+ * @since 5.3.0
130	+ *
131	+ * @param array $messages Array of messages.
132	+ *
133	+ * @return array
134	+ */
135	+ public function include_admin_notices( $messages ) {
136	+ return array_merge( $messages, $this->container->make( Gateway::class )->get_admin_notices() );
137	+ }
138	+
139	+ /**
140	+ * Checks if Stripe is active and can be used to check out in the current cart and, if so,
141	+ * generates a payment intent
142	+ *
143	+ * @since 5.3.0
144	+ */
145	+ public function maybe_create_stripe_payment_intent() {
146	+
147	+ if ( ! tribe( Merchant::class )->is_connected() \|\| ! tribe( Module::class )->is_checkout_page() ) {
148	+ return;
149	+ }
150	+
151	+ tribe( Payment_Intent_Handler::class )->create_payment_intent_for_cart();
152	+ }
153	+
154	+ /**
155	+ * Intercept saving settings to check if any new payment methods would break Stripe payment intents.
156	+ *
157	+ * @since 5.3.0
158	+ *
159	+ * @param mixed $value The new value.
160	+ * @param string $field_id The field id in the options.
161	+ *
162	+ * @return mixed
163	+ */
164	+ public function validate_payment_methods( $value, $field_id ) {
165	+
166	+ if ( $field_id !== Settings::$option_checkout_element_payment_methods ) {
167	+ return $value;
168	+ }
169	+
170	+ return Payment_Intent::validate_payment_methods( $value, $field_id );
171	+ }
172	+
173	+ /**
174	+ * Add Webhook settings fields
175	+ *
176	+ * @since 5.3.0
177	+ *
178	+ * @param array $settings Array of settings for the Stripe gateway.
179	+ *
180	+ * @return mixed
181	+ */
182	+ public function include_webhook_settings( $settings ) {
183	+ if ( ! tribe( Merchant::class )->is_connected() ) {
184	+ return $settings;
185	+ }
186	+
187	+ return array_merge( $settings, tribe( Webhooks::class )->get_fields() );
188	+ }
189	+
190	+ /**
191	+ * Makes sure mandatory fields have values when hidden.
192	+ *
193	+ * @since 5.3.0
194	+ *
195	+ * @param mixed $value Field value submitted.
196	+ * @param string $field_id Field key in the settings array.
197	+ * @param array $field Entire field array.
198	+ *
199	+ * @return mixed
200	+ */
201	+ public function provide_defaults_for_hidden_fields( $value, $field_id, $field ) {
202	+ return tribe( Settings::class )->reset_hidden_field_values( $value, $field_id, $field );
203	+ }
204	+ }

src/Tickets/Commerce/Gateways/Stripe/Merchant.php ADDED Viewed

	@@ -0,0 +1,436 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Merchant;
6	+ use Tribe__Utils__Array as Arr;
7	+
8	+ /**
9	+ * Class Merchant
10	+ *
11	+ * @since 5.3.0
12	+ *
13	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
14	+ */
15	+ class Merchant extends Abstract_Merchant {
16	+
17	+ /**
18	+ * List of countries that are unauthorized to work with the TEC Provider for regulatory reasons.
19	+ *
20	+ * @var array
21	+ */
22	+ const UNAUTHORIZED_COUNTRIES = [
23	+ 'BR',
24	+ ];
25	+
26	+ /**
27	+ * Option key to save the information regarding merchant status.
28	+ *
29	+ * @since 5.3.0
30	+ *
31	+ * @var string
32	+ */
33	+ public static $merchant_unauthorized_option_key = 'tickets-commerce-merchant-unauthorized';
34	+
35	+ /**
36	+ * Option key to save the information regarding merchant authorization.
37	+ *
38	+ * @since 5.3.0
39	+ *
40	+ * @var string
41	+ */
42	+ public static $merchant_deauthorized_option_key = 'tickets-commerce-merchant-deauthorized';
43	+
44	+ /**
45	+ * Option key to save the information regarding merchant default currency.
46	+ *
47	+ * @since 5.3.0
48	+ *
49	+ * @var string
50	+ */
51	+ public static $merchant_default_currency_option_key = 'tickets-commerce-merchant-currency';
52	+
53	+ /**
54	+ * Determines if Merchant is active. For Stripe this is the same as being connected.
55	+ *
56	+ * @since 5.3.0
57	+ *
58	+ * @return bool
59	+ */
60	+ public function is_active( $recheck = false ) {
61	+ return $this->is_connected( $recheck );
62	+ }
63	+
64	+ /**
65	+ * Determines if the Merchant is connected.
66	+ *
67	+ * @since 5.3.0
68	+ *
69	+ * @return bool
70	+ */
71	+ public function is_connected( $recheck = false ) {
72	+ $client_data = $this->to_array();
73	+
74	+ if ( empty( $client_data['client_id'] )
75	+ \|\| empty( $client_data['client_secret'] )
76	+ \|\| empty( $client_data['publishable_key'] )
77	+ ) {
78	+ return false;
79	+ }
80	+
81	+ if ( $recheck ) {
82	+ $status = $this->check_account_status( $client_data );
83	+
84	+ if ( false === $status['connected'] ) {
85	+ return false;
86	+ }
87	+ }
88	+
89	+ return true;
90	+ }
91	+
92	+ /**
93	+ * Returns the options key for the account in the merchant mode.
94	+ *
95	+ * @since 5.3.0
96	+ *
97	+ * @return string
98	+ */
99	+ public function get_account_key() {
100	+ $gateway_key = Gateway::get_key();
101	+
102	+ return "tec_tickets_commerce_{$gateway_key}_account";
103	+ }
104	+
105	+ /**
106	+ * Returns the data retrieved from the signup process.
107	+ *
108	+ * Uses normal WP options to be saved, instead of the normal tribe_update_option.
109	+ *
110	+ * @since 5.3.0
111	+ *
112	+ * @return string
113	+ */
114	+ public function get_signup_data_key() {
115	+ $gateway_key = Gateway::get_key();
116	+
117	+ return "tec_tickets_commerce_{$gateway_key}_signup_data";
118	+ }
119	+
120	+ /**
121	+ * Returns the stripe client secret stored for server-side transactions.
122	+ *
123	+ * @since 5.3.0
124	+ *
125	+ * @return string
126	+ */
127	+ public function get_client_secret() {
128	+ $keys = get_option( $this->get_signup_data_key() );
129	+
130	+ if ( empty( $keys[ $this->get_mode() ]->access_token ) ) {
131	+ return '';
132	+ }
133	+
134	+ return $keys[ $this->get_mode() ]->access_token;
135	+ }
136	+
137	+ /**
138	+ * Fetch the Publishable key for the user.
139	+ *
140	+ * @since 5.3.0
141	+ *
142	+ * @return string
143	+ */
144	+ public function get_publishable_key() {
145	+ $keys = get_option( $this->get_signup_data_key() );
146	+
147	+ if ( empty( $keys[ $this->get_mode() ]->publishable_key ) ) {
148	+ return '';
149	+ }
150	+
151	+ return $keys[ $this->get_mode() ]->publishable_key;
152	+ }
153	+
154	+ /**
155	+ * Returns the stripe client id stored for server-side transactions.
156	+ *
157	+ * @since 5.3.0
158	+ *
159	+ * @return string
160	+ */
161	+ public function get_client_id() {
162	+ $keys = get_option( $this->get_signup_data_key() );
163	+
164	+ if ( empty( $keys['stripe_user_id'] ) ) {
165	+ return '';
166	+ }
167	+
168	+ return $keys['stripe_user_id'];
169	+ }
170	+
171	+ /**
172	+ * Return array of merchant details.
173	+ *
174	+ * @since 5.3.0
175	+ *
176	+ * @return array
177	+ */
178	+ public function to_array() {
179	+ return [
180	+ 'client_id' => $this->get_client_id(),
181	+ 'client_secret' => $this->get_client_secret(),
182	+ 'publishable_key' => $this->get_client_id(),
183	+ ];
184	+ }
185	+
186	+ /**
187	+ * Saves signup data from the redirect into permanent option.
188	+ *
189	+ * @since 5.3.0
190	+ *
191	+ * @param array $signup_data
192	+ *
193	+ * @return bool
194	+ */
195	+ public function save_signup_data( array $signup_data ) {
196	+ unset( $signup_data['whodat'] );
197	+ unset( $signup_data['state'] );
198	+
199	+ return update_option( $this->get_signup_data_key(), $signup_data );
200	+ }
201	+
202	+ /**
203	+ * Returns the list of enabled payment method types for the Payment Element, or the Card type
204	+ * for the Card Element.
205	+ *
206	+ * @since 5.3.0
207	+ *
208	+ * @return string[]
209	+ */
210	+ public function get_payment_method_types( $fallback = false ) {
211	+
212	+ if ( $fallback \|\| Settings::CARD_ELEMENT_SLUG === tribe_get_option( Settings::$option_checkout_element ) ) {
213	+ return [ 'card' ];
214	+ }
215	+
216	+ return tribe_get_option( Settings::$option_checkout_element_payment_methods, [ 'card' ] );
217	+ }
218	+
219	+ /**
220	+ * Query the Stripe API to gather information about the current connected account.
221	+ *
222	+ * @since 5.3.0
223	+ *
224	+ * @param array $client_data Connection data from the database.
225	+ *
226	+ * @return array
227	+ */
228	+ public function check_account_status( $client_data = [] ) {
229	+
230	+ if ( empty( $client_data ) ) {
231	+ $client_data = $this->to_array();
232	+ }
233	+
234	+ $return = [
235	+ 'connected' => false,
236	+ 'charges_enabled' => false,
237	+ 'errors' => [],
238	+ 'capabilities' => [],
239	+ ];
240	+
241	+ if ( empty( $client_data['client_id'] )
242	+ \|\| empty( $client_data['client_secret'] )
243	+ \|\| empty( $client_data['publishable_key'] )
244	+ ) {
245	+ return $return;
246	+ }
247	+
248	+ $url = sprintf( '/accounts/%s', urlencode( $client_data['client_id'] ) );
249	+
250	+ $response = Requests::get( $url, [], [] );
251	+
252	+ if ( ! empty( $response['object'] ) && 'account' === $response['object'] ) {
253	+ $return['connected'] = true;
254	+ $return['charges_enabled'] = tribe_is_truthy( Arr::get( $response, 'charges_enabled', false ) );
255	+ $return['country'] = Arr::get( $response, 'country', false );
256	+ $return['default_currency'] = Arr::get( $response, 'default_currency', false );
257	+ $return['capabilities'] = Arr::get( $response, 'capabilities', false );
258	+ $return['statement_descriptor'] = Arr::get( $response, 'statement_descriptor', false );
259	+
260	+ if ( empty( $return['statement_descriptor'] ) && ! empty( $response['settings']['payments']['statement_descriptor'] ) ) {
261	+ $return['statement_descriptor'] = $response['settings']['payments']['statement_descriptor'];
262	+ }
263	+
264	+ if ( ! empty( $response['requirements']['errors'] ) ) {
265	+ $return['errors']['requirements'] = $response['requirements']['errors'];
266	+ }
267	+
268	+ if ( ! empty( $response['future_requirements']['errors'] ) ) {
269	+ $return['errors']['future_requirements'] = $response['future_requirements']['errors'];
270	+ }
271	+ }
272	+
273	+ if ( ! empty( $response['type'] ) && in_array( $response['type'], [
274	+ 'api_error',
275	+ 'card_error',
276	+ 'idempotency_error',
277	+ 'invalid_request_error',
278	+ ], true ) ) {
279	+
280	+ $return['request_error'] = $response;
281	+ }
282	+
283	+ return $return;
284	+ }
285	+
286	+ /**
287	+ * Empty the signup data option and void the connection.
288	+ *
289	+ * @since 5.3.0
290	+ *
291	+ * @return bool
292	+ */
293	+ public function delete_signup_data() {
294	+ return update_option( $this->get_signup_data_key(), [] );
295	+ }
296	+
297	+ /**
298	+ * Validate if this Merchant is allowed to connect to the TEC Provider.
299	+ *
300	+ * @since 5.3.0
301	+ *
302	+ * @return string 'valid' if the account is permitted, or a string with the notice slug if not.
303	+ */
304	+ public function validate_account_is_permitted() {
305	+ $status = tribe( Settings::class )->connection_status;
306	+ if ( empty( $status ) ) {
307	+ tribe( Settings::class )->set_connection_status();
308	+ $status = tribe( Settings::class )->connection_status;
309	+ }
310	+
311	+ $is_licensed = \TEC\Tickets\Commerce\Settings::is_licensed_plugin();
312	+
313	+ if ( $is_licensed ) {
314	+ return 'valid';
315	+ }
316	+
317	+ if ( $this->country_is_unauthorized( $status ) ) {
318	+ return 'tc-stripe-country-denied';
319	+ }
320	+
321	+ return 'valid';
322	+ }
323	+
324	+ /**
325	+ * Determine if a stripe account is listed in an unauthorized country.
326	+ *
327	+ * @since 5.3.0
328	+ *
329	+ * @param array $status The connection status array.
330	+ *
331	+ * @return bool
332	+ */
333	+ public function country_is_unauthorized( $status ) {
334	+ return in_array( $status['country'], static::UNAUTHORIZED_COUNTRIES, true );
335	+ }
336	+
337	+ /**
338	+ * Check if merchant is set as unauthorized.
339	+ *
340	+ * Unauthorized accounts are accounts that cannot be authorized to connect, usually due to regulatory reasons.
341	+ *
342	+ * @since 5.3.0
343	+ *
344	+ * @return bool
345	+ */
346	+ public function is_merchant_unauthorized() {
347	+ return get_option( static::$merchant_unauthorized_option_key, false );
348	+ }
349	+
350	+ /**
351	+ * Set merchant as unauthorized.
352	+ *
353	+ * @since 5.3.0
354	+ *
355	+ * @param string $validation_key Refusal reason, must be the same as the notice slug for the corresponding error.
356	+ */
357	+ public function set_merchant_unauthorized( $validation_key ) {
358	+ \Tribe__Admin__Notices::instance()->undismiss_for_all( $validation_key );
359	+ update_option( static::$merchant_unauthorized_option_key, $validation_key );
360	+ }
361	+
362	+ /**
363	+ * Unset merchant as unauthorized.
364	+ *
365	+ * @since 5.3.0
366	+ */
367	+ public function unset_merchant_unauthorized() {
368	+ delete_option( static::$merchant_unauthorized_option_key );
369	+ }
370	+
371	+ /**
372	+ * Check if merchant is set as de-authorized.
373	+ *
374	+ * De-authorized accounts are accounts that were previously connected and whose connection has been revoked in the
375	+ * Stripe Dashboard. These accounts can be re-connected with the proper credentials.
376	+ *
377	+ * @since 5.3.0
378	+ *
379	+ * @return bool
380	+ */
381	+ public function is_merchant_deauthorized() {
382	+ return get_option( static::$merchant_deauthorized_option_key, false );
383	+ }
384	+
385	+ /**
386	+ * Set merchant as de-authorized.
387	+ *
388	+ * @since 5.3.0
389	+ *
390	+ * @param string $validation_key De-authorization reason, must be the same as the notice slug for the corresponding error.
391	+ */
392	+ public function set_merchant_deauthorized( $validation_key ) {
393	+ \Tribe__Admin__Notices::instance()->undismiss_for_all( $validation_key );
394	+ update_option( static::$merchant_deauthorized_option_key, $validation_key );
395	+ }
396	+
397	+ /**
398	+ * Unset merchant as de-authorized.
399	+ *
400	+ * @since 5.3.0
401	+ */
402	+ public function unset_merchant_deauthorized() {
403	+ delete_option( static::$merchant_deauthorized_option_key );
404	+ }
405	+
406	+ /**
407	+ * Get the merchant default currency.
408	+ *
409	+ * @since 5.3.0
410	+ *
411	+ * @return string
412	+ */
413	+ public function get_merchant_currency() {
414	+ return get_option( static::$merchant_default_currency_option_key );
415	+ }
416	+
417	+ /**
418	+ * Updates an existing merchant account.
419	+ *
420	+ * @since 5.3.0
421	+ *
422	+ * @param array $data Array of data to be passed directly to the body of the update request.
423	+ *
424	+ * @return array\|\WP_Error\|null
425	+ */
426	+ public function update( $data ) {
427	+ $query_args = [];
428	+ $args = [
429	+ 'body' => $data,
430	+ ];
431	+
432	+ $url = sprintf( '/accounts/%s', urlencode( $this->get_client_id() ) );
433	+
434	+ return Requests::post( $url, $query_args, $args );
435	+ }
436	+ }

src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php ADDED Viewed

	@@ -0,0 +1,307 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Cart;
6	+ use TEC\Tickets\Commerce\Order;
7	+ use TEC\Tickets\Commerce\Utils\Currency;
8	+ use TEC\Tickets\Commerce\Utils\Value;
9	+
10	+ /**
11	+ * Stripe orders aka Payment Intents class.
12	+ *
13	+ * @since 5.3.0
14	+ *
15	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
16	+ */
17	+ class Payment_Intent {
18	+
19	+ /**
20	+ * The minimum amount to charge for the current currency is multiplied by this value to produce the test creation amount.
21	+ *
22	+ * @since 5.3.0
23	+ *
24	+ * @var float
25	+ */
26	+ const TEST_MULTIPLIER = 3.14;
27	+
28	+ /**
29	+ * The key used to identify payment intents created to validate configurations.
30	+ *
31	+ * @since 5.3.0
32	+ *
33	+ * @var string
34	+ */
35	+ public static $test_metadata_key = 'payment_intent_validation_test';
36	+
37	+ /**
38	+ * Create a simple payment intent with the designated payment methods to check for errors.
39	+ *
40	+ * If the payment intent succeeds it is cancelled. If it fails we display a notice to the user and not apply their
41	+ * settings.
42	+ *
43	+ * @since 5.3.0
44	+ *
45	+ * @param array $payment_methods a list of payment_methods to allow in the Payment Intent.
46	+ *
47	+ * @return bool\|\WP_Error
48	+ */
49	+ public static function test_creation( $payment_methods, $retry = false ) {
50	+ // Payment Intents for cards only are always valid.
51	+ if ( 1 === count( $payment_methods ) && in_array( 'card', $payment_methods, true ) ) {
52	+ return true;
53	+ }
54	+
55	+ $value = Value::create( static::get_charge_amount() );
56	+ $fee = Application_Fee::calculate( $value );
57	+
58	+ $query_args = [];
59	+ $body = [
60	+ 'currency' => $value->get_currency_code(),
61	+ 'amount' => (string) $value->get_integer(),
62	+ 'payment_method_types' => $payment_methods,
63	+ 'application_fee_amount' => (string) $fee->get_integer(),
64	+ 'metadata' => [ static::$test_metadata_key => true ],
65	+ ];
66	+
67	+ $args = [
68	+ 'body' => $body,
69	+ ];
70	+
71	+ $url = 'payment_intents';
72	+
73	+ $payment_intent = Requests::post( $url, $query_args, $args );
74	+
75	+ if ( ! isset( $payment_intent['id'] ) && ! empty( $payment_intent['errors'] ) ) {
76	+ $compiled_errors = static::compile_errors( $payment_intent );
77	+
78	+ return new \WP_Error(
79	+ 'tec-tc-stripe-test-payment-intent-failed',
80	+ // Translators: %s is the html-formatted response from Stripe servers containing the error messages.
81	+ sprintf( __( 'Stripe reports that it is unable to process charges with the selected Payment Methods. Usually this means that one of the methods selected is not available or not configured in your Stripe account. The errors you see below were returned from Stripe, please correct any inconsistencies or contact Stripe support, then try again: <div class="stripe-errors">%s</div>', 'event-tickets' ), $compiled_errors )
82	+ );
83	+ }
84	+
85	+ static::cancel( $payment_intent['id'] );
86	+
87	+ return true;
88	+ }
89	+
90	+ /**
91	+ * Calls the Stripe API and returns a new PaymentIntent object, used to authenticate
92	+ * front-end payment requests.
93	+ *
94	+ * @since 5.3.0
95	+ *
96	+ * @param Value $value The value object to create a payment intent for.
97	+ * @param bool $retry Is this a retry?
98	+ *
99	+ * @return mixed
100	+ */
101	+ public static function create( Value $value, $retry = false ) {
102	+ $fee = Application_Fee::calculate( $value );
103	+
104	+ $query_args = [];
105	+ $body = [
106	+ 'currency' => $value->get_currency_code(),
107	+ 'amount' => (string) $value->get_integer(),
108	+ 'payment_method_types' => tribe( Merchant::class )->get_payment_method_types( $retry ),
109	+ 'application_fee_amount' => (string) $fee->get_integer(),
110	+ ];
111	+
112	+ $stripe_statement_descriptor = tribe_get_option( Settings::$option_statement_descriptor );
113	+
114	+ if ( ! empty( $stripe_statement_descriptor ) ) {
115	+ $body['statement_descriptor'] = substr( $stripe_statement_descriptor, 0, 22 );
116	+ }
117	+
118	+ $args = [
119	+ 'body' => $body,
120	+ ];
121	+
122	+ $url = 'payment_intents';
123	+
124	+ return Requests::post( $url, $query_args, $args );
125	+ }
126	+
127	+ /**
128	+ * Creates a Payment Intent from cart.
129	+ *
130	+ * @since 5.3.0
131	+ *
132	+ * @param Cart $cart
133	+ * @param bool $retry
134	+ *
135	+ * @return array
136	+ */
137	+ public static function create_from_cart( Cart $cart, $retry = false ) {
138	+ $items = tribe( Order::class )->prepare_cart_items_for_order( $cart );
139	+
140	+ if ( empty( $items ) ) {
141	+ return [];
142	+ }
143	+
144	+ $value = tribe( Order::class )->get_value_total( array_filter( $items ) );
145	+
146	+ return static::create( $value, $retry );
147	+ }
148	+
149	+ /**
150	+ * Calls the Stripe API and returns an existing Payment Intent.
151	+ *
152	+ * @since 5.3.0
153	+ *
154	+ * @param string $payment_intent_id Payment Intent ID.
155	+ *
156	+ * @return array\|\WP_Error
157	+ */
158	+ public static function get( $payment_intent_id ) {
159	+ $query_args = [];
160	+ $body = [
161	+ ];
162	+ $args = [
163	+ 'body' => $body,
164	+ ];
165	+
166	+ $url = sprintf( '/payment_intents/%s', urlencode( $payment_intent_id ) );
167	+
168	+ return Requests::get( $url, $query_args, $args );
169	+ }
170	+
171	+ /**
172	+ * Updates an existing payment intent to add any necessary data before confirming the purchase.
173	+ *
174	+ * @since 5.3.0
175	+ *
176	+ * @param array $data The purchase data received from the front-end.
177	+ *
178	+ * @return array\|\WP_Error\|null
179	+ */
180	+ public static function update( $payment_intent_id, $data ) {
181	+ $query_args = [];
182	+ $args = [
183	+ 'body' => $data,
184	+ ];
185	+
186	+ $url = sprintf( '/payment_intents/%s', urlencode( $payment_intent_id ) );
187	+
188	+ return Requests::post( $url, $query_args, $args );
189	+ }
190	+
191	+ /**
192	+ * Issue an API request to cancel a Payment Intent.
193	+ *
194	+ * @since 5.3.0
195	+ *
196	+ * @param string $payment_intent_id the payment intent to cancel.
197	+ */
198	+ public static function cancel( $payment_intent_id ) {
199	+ $query_args = [];
200	+ $body = [];
201	+ $args = [
202	+ 'body' => $body,
203	+ ];
204	+
205	+ $url = sprintf( '/payment_intents/%s/cancel', urlencode( $payment_intent_id ) );
206	+
207	+ Requests::post( $url, $query_args, $args );
208	+ }
209	+
210	+ /**
211	+ * Compile errors caught when creating a Payment Intent into a proper html notice for the admin.
212	+ *
213	+ * @since 5.3.0
214	+ *
215	+ * @param array $errors List of errors returned from Stripe.
216	+ *
217	+ * @return string
218	+ */
219	+ public static function compile_errors( $errors ) {
220	+ $compiled = '';
221	+
222	+ if ( empty( $errors['errors'] ) ) {
223	+ return $compiled;
224	+ }
225	+
226	+ if ( ! is_array( $errors['errors'] ) ) {
227	+ return $errors['errors'];
228	+ }
229	+
230	+ foreach ( $errors['errors'] as $error ) {
231	+ $compiled .= sprintf( '<p><em>%s</em></p>', esc_html( $error[1] ) );
232	+ }
233	+
234	+ return $compiled;
235	+ }
236	+
237	+ /**
238	+ * Calculates the minimum charge amount allowed for the current currency
239	+ *
240	+ * @since 5.3.0
241	+ *
242	+ * @return int\|float\|null returns an int or float with the minimum value allowed, null if Stripe does not support
243	+ * the currency.
244	+ */
245	+ public static function get_charge_amount() {
246	+ $currency = Currency::get_currency_code();
247	+ $currency_map = Currency::get_default_currency_map();
248	+
249	+ return static::TEST_MULTIPLIER * $currency_map[ $currency ]['stripe_minimum_charge'];
250	+ }
251	+
252	+ /**
253	+ * Intercept saving settings to check if any new payment methods would break Stripe payment intents.
254	+ *
255	+ * @since 5.3.0
256	+ *
257	+ * @param mixed $value The new value.
258	+ * @param string $field_id The field id in the options.
259	+ *
260	+ * @return array
261	+ */
262	+ public static function validate_payment_methods( $value, $field_id ) {
263	+
264	+ if ( ! tribe( Merchant::class )->is_connected() ) {
265	+ return $value;
266	+ }
267	+
268	+ if ( ! isset( $_POST['tribeSaveSettings'] ) \|\| ! isset( $_POST['current-settings-tab'] ) ) {
269	+ return $value;
270	+ }
271	+
272	+ $checkout_type = tribe_get_request_var( Settings::$option_checkout_element );
273	+ $payment_methods = tribe_get_request_var( $field_id );
274	+ $current_methods = tribe_get_option( $field_id, [] );
275	+
276	+ if ( empty( $payment_methods ) ) {
277	+ if ( $checkout_type === Settings::PAYMENT_ELEMENT_SLUG ) {
278	+ \Tribe__Settings::instance()->errors[] = esc_html__( 'Payment methods accepted cannot be empty', 'event-tickets' );
279	+ }
280	+
281	+ // Revert value to the previous configuration.
282	+ return $current_methods;
283	+ }
284	+
285	+ sort( $payment_methods );
286	+ sort( $current_methods );
287	+
288	+ // If the two arrays are equal, there's no need to create a new test.
289	+ if ( $payment_methods === $current_methods ) {
290	+ return $current_methods;
291	+ }
292	+
293	+ $payment_intent_test = static::test_creation( $payment_methods );
294	+
295	+ if ( ! is_wp_error( $payment_intent_test ) ) {
296	+ // Payment Settings are working, great!
297	+ return $value;
298	+ }
299	+
300	+ // Payment attempt failed. Provide an alert in the Dashboard.
301	+ \Tribe__Settings::instance()->errors[] = $payment_intent_test->get_error_message();
302	+
303	+ // Revert value to the previous configuration.
304	+ return tribe_get_option( $field_id, [] );
305	+ }
306	+
307	+ }

src/Tickets/Commerce/Gateways/Stripe/Payment_Intent_Handler.php ADDED Viewed

	@@ -0,0 +1,218 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Cart;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\Webhook_Endpoint;
7	+
8	+ /**
9	+ * Class Payment Intent Handler
10	+ *
11	+ * @since 5.3.0
12	+ *
13	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
14	+ */
15	+ class Payment_Intent_Handler {
16	+
17	+ /**
18	+ * Base string to use when composing payment intent transient names.
19	+ *
20	+ * @since 5.3.0
21	+ *
22	+ * @var string
23	+ */
24	+ public $payment_intent_transient_prefix = 'paymentintent-';
25	+
26	+ /**
27	+ * Transient name to store payment intents.
28	+ *
29	+ * @since 5.3.0
30	+ *
31	+ * @var string
32	+ */
33	+ public $payment_intent_transient_name;
34	+
35	+ /**
36	+ * Counter for how many times we've re-tried creating a PaymentIntent.
37	+ *
38	+ * @since 5.3.0
39	+ *
40	+ * @var int
41	+ */
42	+ protected $payment_element_fallback_retries = 0;
43	+
44	+ /**
45	+ * Max number of retries to create a PaymentIntent.
46	+ *
47	+ * @since 5.3.0
48	+ *
49	+ * @var int
50	+ */
51	+ protected $payment_intent_max_retries = 2;
52	+
53	+ /**
54	+ * Increment the retry counter if under max_retries.
55	+ *
56	+ * @return bool True if incremented, false if no more retries are allowed.
57	+ */
58	+ public function count_retries() {
59	+ if ( $this->payment_intent_max_retries <= $this->payment_element_fallback_retries ) {
60	+ return false;
61	+ }
62	+
63	+ $this->payment_element_fallback_retries ++;
64	+
65	+ return true;
66	+ }
67	+
68	+ /**
69	+ * Calls the Stripe API and returns a new PaymentIntent object, used to authenticate
70	+ * front-end payment requests.
71	+ *
72	+ * @since 5.3.0
73	+ *
74	+ * @param string $currency 3-letter ISO code for the desired currency. Not all currencies are supported.
75	+ * @param int $value The payment value in the smallest currency unit (e.g: cents, if the purchase is in USD).
76	+ */
77	+ public function create_payment_intent_for_cart( $retry = false ) {
78	+ $this->set_payment_intent_transient_name();
79	+ $payment_intent = Payment_Intent::create_from_cart( tribe( Cart::class ), $retry );
80	+
81	+ if ( ! isset( $payment_intent['id'] ) && ! empty( $payment_intent['errors'] ) ) {
82	+
83	+ if ( $this->count_retries() ) {
84	+ $this->delete_payment_intent_transient();
85	+
86	+ return $this->create_payment_intent_for_cart( true );
87	+ }
88	+
89	+ // We're over the max retries, display an error to the end user and move on.
90	+ $payment_intent['errors'][0] = [
91	+ 'et_could_not_create_stripe_order',
92	+ __( 'There was an error enabling Stripe on your cart. More information is available in the Event Tickets settings dashboard. Please contact the site administrator for support.', 'event-tickets' ),
93	+ ];
94	+ }
95	+
96	+ return $this->store_payment_intent( $payment_intent );
97	+ }
98	+
99	+ /**
100	+ * Updates an existing payment intent to add any necessary data before confirming the purchase.
101	+ *
102	+ * @since 5.3.0
103	+ *
104	+ * @param array $data The purchase data received from the front-end.
105	+ * @param \WP_Post $order The order object.
106	+ *
107	+ * @return array\|\WP_Error\|null
108	+ */
109	+ public function update_payment_intent( $data, \WP_Post $order ) {
110	+ $body = [];
111	+ $payment_intent_id = $data['payment_intent']['id'];
112	+
113	+ $stripe_receipt_emails = tribe_get_option( Settings::$option_stripe_receipt_emails );
114	+ $payment_intent = Payment_Intent::get( $payment_intent_id );
115	+
116	+ // Add the Order ID as metadata to the Payment Intent
117	+ $metadata = $payment_intent['metadata'];
118	+ $metadata['order_id'] = $order->ID;
119	+ $metadata['return_url'] = tribe( Webhook_Endpoint::class )->get_route_url();
120	+ $body['metadata'] = $metadata;
121	+
122	+ if ( $stripe_receipt_emails ) {
123	+ if ( is_user_logged_in() ) {
124	+ $user = wp_get_current_user();
125	+ $body['receipt_email'] = $user->get( 'user_email' );
126	+ }
127	+
128	+ if ( ! empty( $data['purchaser']['email'] ) ) {
129	+ $body['receipt_email'] = $data['purchaser']['email'];
130	+ }
131	+ }
132	+
133	+ return Payment_Intent::update( $payment_intent_id, $body );
134	+ }
135	+
136	+ /**
137	+ * Assembles basic data about the payment intent created at page-load to use in javascript.
138	+ *
139	+ * @since 5.3.0
140	+ *
141	+ * @return array
142	+ */
143	+ public function get_publishable_payment_intent_data() {
144	+ $pi = $this->get_payment_intent_transient();
145	+
146	+ if ( empty( $pi ) ) {
147	+ return [];
148	+ }
149	+
150	+ if ( ! empty( $pi['errors'] ) ) {
151	+ return $pi;
152	+ }
153	+
154	+ return [
155	+ 'id' => $pi['id'],
156	+ 'key' => $pi['client_secret'],
157	+ 'name' => $this->get_payment_intent_transient_name(),
158	+ ];
159	+ }
160	+
161	+ /**
162	+ * Compose the transient name used for payment intent transients.
163	+ *
164	+ * @since 5.3.0
165	+ */
166	+ public function set_payment_intent_transient_name() {
167	+ $this->payment_intent_transient_name = $this->payment_intent_transient_prefix . md5( tribe( Cart::class )->get_cart_hash() );
168	+ }
169	+
170	+ /**
171	+ * Returns the transient name used for payment intent transients.
172	+ *
173	+ * @since 5.3.0
174	+ *
175	+ * @return string
176	+ */
177	+ public function get_payment_intent_transient_name() {
178	+
179	+ if ( empty( $this->payment_intent_transient_name ) ) {
180	+ $this->set_payment_intent_transient_name();
181	+ }
182	+
183	+ return $this->payment_intent_transient_name;
184	+ }
185	+
186	+ /**
187	+ * Retrieve a stored payment intent referring to the current cart.
188	+ *
189	+ * @since 5.3.0
190	+ *
191	+ * @return array\|false
192	+ */
193	+ public function get_payment_intent_transient() {
194	+ return get_transient( $this->get_payment_intent_transient_name() );
195	+ }
196	+
197	+ /**
198	+ * Delete the payment intent transient.
199	+ *
200	+ * @since 5.3.0
201	+ *
202	+ * @return bool
203	+ */
204	+ public function delete_payment_intent_transient() {
205	+ return delete_transient( $this->get_payment_intent_transient_name() );
206	+ }
207	+
208	+ /**
209	+ * Store a payment intent array in a transient.
210	+ *
211	+ * @since 5.3.0
212	+ *
213	+ * @param array $payment_intent Payment intent data from Stripe.
214	+ */
215	+ public function store_payment_intent( $payment_intent ) {
216	+ set_transient( $this->get_payment_intent_transient_name(), $payment_intent, 6 * HOUR_IN_SECONDS );
217	+ }
218	+ }

src/Tickets/Commerce/Gateways/Stripe/Provider.php ADDED Viewed

	@@ -0,0 +1,66 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Stripe\Webhooks\Account_Webhook;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\Webhooks\Charge_Webhook;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\Webhooks\Payment_Intent_Webhook;
8	+
9	+ /**
10	+ * Class Provider
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
15	+ */
16	+ class Provider extends \tad_DI52_ServiceProvider {
17	+
18	+ /**
19	+ * @inheritDoc
20	+ */
21	+ public function register() {
22	+ $this->container->singleton( Gateway::class );
23	+ $this->container->singleton( Merchant::class );
24	+ $this->container->singleton( REST::class );
25	+ $this->container->singleton( Settings::class );
26	+ $this->container->singleton( Signup::class );
27	+ $this->container->singleton( Stripe_Elements::class );
28	+ $this->container->singleton( Status::class );
29	+ $this->container->singleton( WhoDat::class );
30	+ $this->container->singleton( Webhooks::class );
31	+ $this->container->singleton( Payment_Intent_Handler::class );
32	+
33	+ // Webhooks.
34	+ $this->container->singleton( Account_Webhook::class );
35	+ $this->container->singleton( Charge_Webhook::class );
36	+ $this->container->singleton( Payment_Intent_Webhook::class );
37	+
38	+ $this->register_hooks();
39	+ $this->register_assets();
40	+ }
41	+
42	+ /**
43	+ * Registers the provider handling all the 1st level filters and actions for this Service Provider.
44	+ *
45	+ * @since 5.3.0
46	+ */
47	+ protected function register_hooks() {
48	+ $hooks = new Hooks( $this->container );
49	+ $hooks->register();
50	+
51	+ // Allow Hooks to be removed, by having the them registered to the container
52	+ $this->container->singleton( Hooks::class, $hooks );
53	+ }
54	+
55	+ /**
56	+ * Registers the provider handling all the 1st level filters and actions for this Service Provider
57	+ *
58	+ * @since 5.3.0
59	+ */
60	+ protected function register_assets() {
61	+ $assets = new Assets( $this->container );
62	+ $assets->register();
63	+
64	+ $this->container->singleton( Assets::class, $assets );
65	+ }
66	+ }

src/Tickets/Commerce/Gateways/Stripe/REST.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ /**
6	+ * Class REST
7	+ *
8	+ * @since 5.3.0
9	+ *
10	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
11	+ */
12	+ class REST extends \tad_DI52_ServiceProvider {
13	+
14	+ /**
15	+ * @inheritDoc
16	+ */
17	+ public function register() {
18	+ $this->container->singleton( REST\Order_Endpoint::class );
19	+ $this->container->singleton( REST\Return_Endpoint::class );
20	+ $this->container->singleton( REST\Webhook_Endpoint::class );
21	+ }
22	+
23	+ /**
24	+ * Register the endpoints for handling webhooks.
25	+ *
26	+ * @since 5.3.0
27	+ */
28	+ public function register_endpoints() {
29	+ $this->container->make( REST\Order_Endpoint::class )->register();
30	+ $this->container->make( REST\Return_Endpoint::class )->register();
31	+ $this->container->make( REST\Webhook_Endpoint::class )->register();
32	+ }
33	+ }

src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php ADDED Viewed

	@@ -0,0 +1,346 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\REST;
4	+
5	+ use TEC\Tickets\Commerce\Cart;
6	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\Gateway;
8	+ use TEC\Tickets\Commerce\Gateways\Stripe\Payment_Intent;
9	+ use TEC\Tickets\Commerce\Gateways\Stripe\Payment_Intent_Handler;
10	+ use TEC\Tickets\Commerce\Gateways\Stripe\Status;
11	+ use TEC\Tickets\Commerce\Order;
12	+
13	+ use TEC\Tickets\Commerce\Status\Pending;
14	+ use TEC\Tickets\Commerce\Success;
15	+
16	+ use Tribe__Utils__Array as Arr;
17	+
18	+ use WP_Error;
19	+ use WP_REST_Request;
20	+ use WP_REST_Response;
21	+ use WP_REST_Server;
22	+
23	+ /**
24	+ * Class Order Endpoint.
25	+ *
26	+ * @since 5.3.0
27	+ *
28	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\REST
29	+ */
30	+ class Order_Endpoint extends Abstract_REST_Endpoint {
31	+
32	+ /**
33	+ * The REST API endpoint path.
34	+ *
35	+ * @since 5.3.0
36	+ *
37	+ * @var string
38	+ */
39	+ protected $path = '/commerce/stripe/order';
40	+
41	+ /**
42	+ * Register the actual endpoint on WP Rest API.
43	+ *
44	+ * @since 5.3.0
45	+ */
46	+ public function register() {
47	+ $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
48	+ $documentation = tribe( 'tickets.rest-v1.endpoints.documentation' );
49	+
50	+ register_rest_route(
51	+ $namespace,
52	+ $this->get_endpoint_path(),
53	+ [
54	+ 'methods' => WP_REST_Server::CREATABLE,
55	+ 'args' => $this->create_order_args(),
56	+ 'callback' => [ $this, 'handle_create_order' ],
57	+ 'permission_callback' => '__return_true',
58	+ ]
59	+ );
60	+
61	+ register_rest_route(
62	+ $namespace,
63	+ $this->get_endpoint_path() . '/(?P<order_id>[0-9a-zA-Z_-]+)',
64	+ [
65	+ 'methods' => WP_REST_Server::CREATABLE,
66	+ 'args' => $this->update_order_args(),
67	+ 'callback' => [ $this, 'handle_update_order' ],
68	+ 'permission_callback' => '__return_true',
69	+ ]
70	+ );
71	+
72	+ register_rest_route(
73	+ $namespace,
74	+ $this->get_endpoint_path() . '/(?P<order_id>[0-9a-zA-Z_-]+)',
75	+ [
76	+ 'methods' => WP_REST_Server::DELETABLE,
77	+ 'args' => $this->fail_order_args(),
78	+ 'callback' => [ $this, 'handle_fail_order' ],
79	+ 'permission_callback' => '__return_true',
80	+ ]
81	+ );
82	+
83	+ $documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
84	+ }
85	+
86	+ /**
87	+ * Arguments used for the endpoint.
88	+ *
89	+ * @since 5.3.0
90	+ *
91	+ * @return array
92	+ */
93	+ public function create_order_args() {
94	+ return [];
95	+ }
96	+
97	+ /**
98	+ * Handles the request that creates an order with Tickets Commerce and the Stripe gateway.
99	+ *
100	+ * @since 5.3.0
101	+ *
102	+ * @param WP_REST_Request $request The request object.
103	+ *
104	+ * @return WP_Error\|WP_REST_Response An array containing the data on success or a WP_Error instance on failure.
105	+ */
106	+ public function handle_create_order( WP_REST_Request $request ) {
107	+ $response = [
108	+ 'success' => false,
109	+ ];
110	+
111	+ $messages = $this->get_error_messages();
112	+ $data = $request->get_json_params();
113	+ $purchaser = tribe( Order::class )->get_purchaser_data( $data );
114	+
115	+ if ( is_wp_error( $purchaser ) ) {
116	+ return $purchaser;
117	+ }
118	+
119	+ $order = tribe( Order::class )->create_from_cart( tribe( Gateway::class ), $purchaser );
120	+
121	+ $payment_intent = tribe( Payment_Intent_Handler::class )->update_payment_intent( $data, $order );
122	+
123	+ if ( is_wp_error( $payment_intent ) ) {
124	+ return new WP_Error( 'tec-tc-gateway-stripe-failed-creating-payment-intent', $messages['failed-creating-payment-intent'], $order );
125	+ }
126	+
127	+ if ( empty( $payment_intent['id'] ) \|\| empty( $payment_intent['created'] ) ) {
128	+ return new WP_Error( 'tec-tc-gateway-stripe-failed-creating-order', $messages['failed-creating-order'], $order );
129	+ }
130	+
131	+ // Orders need to pass the Pending status always.
132	+ $updated = tribe( Order::class )->modify_status( $order->ID, Pending::SLUG, [
133	+ 'gateway_payload' => $payment_intent,
134	+ 'gateway_order_id' => $payment_intent['id'],
135	+ ] );
136	+
137	+ if ( is_wp_error( $updated ) ) {
138	+ return $updated;
139	+ }
140	+
141	+ // Respond with the client_secret for Stripe Usage.
142	+ $response['success'] = true;
143	+ $response['order_id'] = $order->ID;
144	+ $response['client_secret'] = $payment_intent['client_secret'];
145	+ $response['redirect_url'] = add_query_arg( [ 'tc-order-id' => $payment_intent['id'] ], tribe( Success::class )->get_url() );
146	+
147	+ return new WP_REST_Response( $response );
148	+ }
149	+
150	+ /**
151	+ * Arguments used for the updating order endpoint.
152	+ *
153	+ * @since 5.3.0
154	+ *
155	+ * @return array
156	+ */
157	+ public function update_order_args() {
158	+ return [
159	+ 'order_id' => [
160	+ 'description' => __( 'Order ID (Payment Intent ID) in Stripe', 'event-tickets' ),
161	+ 'required' => true,
162	+ 'type' => 'string',
163	+ 'validate_callback' => static function ( $value ) {
164	+ if ( ! is_string( $value ) ) {
165	+ return new WP_Error( 'rest_invalid_param', 'The Order ID (Payment Intent ID) argument must be a string.', [ 'status' => 400 ] );
166	+ }
167	+
168	+ return $value;
169	+ },
170	+ 'sanitize_callback' => [ $this, 'sanitize_callback' ],
171	+ ],
172	+ 'client_secret' => [
173	+ 'description' => __( 'Client Secret from Stripe', 'event-tickets' ),
174	+ 'required' => false,
175	+ 'type' => 'string',
176	+ 'validate_callback' => static function ( $value ) {
177	+ if ( ! is_string( $value ) ) {
178	+ return new WP_Error( 'rest_invalid_param', 'The Client Secret argument must be a string.', [ 'status' => 400 ] );
179	+ }
180	+
181	+ return $value;
182	+ },
183	+ 'sanitize_callback' => [ $this, 'sanitize_callback' ],
184	+ ],
185	+ ];
186	+ }
187	+
188	+ /**
189	+ * Handles the request that creates an order with Tickets Commerce and the Stripe gateway.
190	+ *
191	+ * @since 5.3.0
192	+ *
193	+ * @param WP_REST_Request $request The request object.
194	+ *
195	+ * @return WP_Error\|WP_REST_Response An array containing the data on success or a WP_Error instance on failure.
196	+ */
197	+ public function handle_update_order( WP_REST_Request $request ) {
198	+ $response = [
199	+ 'success' => false,
200	+ ];
201	+
202	+ $messages = $this->get_error_messages();
203	+ $gateway_order_id = $request->get_param( 'order_id' );
204	+
205	+ $order = tec_tc_orders()->by_args( [
206	+ 'status' => 'any',
207	+ 'gateway_order_id' => $gateway_order_id,
208	+ ] )->first();
209	+
210	+ if ( is_wp_error( $order ) \|\| empty( $order ) ) {
211	+ return new WP_Error( 'tec-tc-gateway-stripe-order-not-found', $messages['order-not-found'], $order );
212	+ }
213	+
214	+ $client_secret = $request->get_param( 'client_secret' );
215	+ $payment_intent = Payment_Intent::get( $gateway_order_id );
216	+
217	+ if ( is_wp_error( $payment_intent ) ) {
218	+ return new WP_Error( 'tec-tc-gateway-stripe-failed-getting-payment-intent', $messages['failed-getting-payment-intent'], $order );
219	+ }
220	+
221	+ if ( empty( $payment_intent['id'] ) \|\| $payment_intent['id'] !== $gateway_order_id ) {
222	+ return new WP_Error( 'tec-tc-gateway-stripe-failed-payment-intent-id', $messages['failed-payment-intent-id'], $order );
223	+ }
224	+
225	+ if ( $payment_intent['client_secret'] !== $client_secret ) {
226	+ return new WP_Error( 'tec-tc-gateway-stripe-failed-payment-intent-secret', $messages['failed-payment-intent-secret'], $order );
227	+ }
228	+
229	+ $payment_intent_status = Arr::get( $payment_intent, [ 'status' ] );
230	+ $status = tribe( Status::class )->convert_to_commerce_status( $payment_intent_status );
231	+
232	+ if ( ! $status ) {
233	+ return new WP_Error( 'tec-tc-gateway-stripe-invalid-payment-intent-status', $messages['invalid-payment-intent-status'], $payment_intent_status );
234	+ }
235	+
236	+ $updated = tribe( Order::class )->modify_status( $order->ID, $status->get_slug(), [
237	+ 'gateway_payload' => $payment_intent,
238	+ 'gateway_order_id' => $payment_intent['id'],
239	+ ] );
240	+
241	+ if ( is_wp_error( $updated ) ) {
242	+ return $updated;
243	+ }
244	+
245	+ // Respond with the client_secret for Stripe Usage.
246	+ $response['success'] = true;
247	+ $response['status'] = $status->get_slug();
248	+ $response['order_id'] = $order->ID;
249	+ $response['gateway_order_id'] = $gateway_order_id;
250	+
251	+ // When we have success we clear the cart.
252	+ tribe( Cart::class )->clear_cart();
253	+
254	+ $response['redirect_url'] = add_query_arg( [ 'tc-order-id' => $gateway_order_id ], tribe( Success::class )->get_url() );
255	+
256	+ return new WP_REST_Response( $response );
257	+ }
258	+
259	+ /**
260	+ * Arguments used for the fail order endpoint.e
261	+ *
262	+ * @since 5.3.0
263	+ *
264	+ * @return array
265	+ */
266	+ public function fail_order_args() {
267	+ return [
268	+ 'order_id' => [
269	+ 'description' => __( 'Order ID in Stripe', 'event-tickets' ),
270	+ 'required' => true,
271	+ 'type' => 'string',
272	+ 'validate_callback' => static function ( $value ) {
273	+ if ( ! is_string( $value ) ) {
274	+ return new WP_Error( 'rest_invalid_param', 'The order ID argument must be a string.', [ 'status' => 400 ] );
275	+ }
276	+
277	+ return $value;
278	+ },
279	+ 'sanitize_callback' => [ $this, 'sanitize_callback' ],
280	+ ],
281	+ 'failed_status' => [
282	+ 'description' => __( 'To which status the failing should change this order to', 'event-tickets' ),
283	+ 'required' => false,
284	+ 'type' => 'string',
285	+ 'validate_callback' => static function ( $value ) {
286	+ if ( ! is_string( $value ) ) {
287	+ return new WP_Error( 'rest_invalid_param', 'The failed status argument must be a string.', [ 'status' => 400 ] );
288	+ }
289	+
290	+ return $value;
291	+ },
292	+ 'sanitize_callback' => [ $this, 'sanitize_callback' ],
293	+ ],
294	+ 'failed_reason' => [
295	+ 'description' => __( 'Why this particular order has failed.', 'event-tickets' ),
296	+ 'required' => false,
297	+ 'type' => 'string',
298	+ 'validate_callback' => static function ( $value ) {
299	+ if ( ! is_string( $value ) ) {
300	+ return new WP_Error( 'rest_invalid_param', 'The failed reason argument must be a string.', [ 'status' => 400 ] );
301	+ }
302	+
303	+ return $value;
304	+ },
305	+ 'sanitize_callback' => [ $this, 'sanitize_callback' ],
306	+ ],
307	+ ];
308	+ }
309	+
310	+ /**
311	+ * Handles the request that creates an order with Tickets Commerce and the Stripe gateway.
312	+ *
313	+ * @since 5.3.0
314	+ *
315	+ * @param WP_REST_Request $request The request object.
316	+ *
317	+ * @return WP_Error\|WP_REST_Response An array containing the data on success or a WP_Error instance on failure.
318	+ */
319	+ public function handle_fail_order( WP_REST_Request $request ) {
320	+
321	+ }
322	+
323	+ /**
324	+ * Returns an array of error messages that are used by the API responses.
325	+ *
326	+ * @since 5.3.0
327	+ *
328	+ * @return array $messages Array of error messages.
329	+ */
330	+ public function get_error_messages() {
331	+ $messages = [
332	+ 'failed-completing-payment-intent' => __( 'Completing the Stripe PaymentIntent failed. Please try again.', 'event-tickets' ),
333	+ 'failed-creating-payment-intent' => __( 'Creating new Stripe PaymentIntent failed. Please try again.', 'event-tickets' ),
334	+ 'failed-creating-order' => __( 'Creating new Stripe order failed. Please try again.', 'event-tickets' ),
335	+ ];
336	+
337	+ /**
338	+ * Filter the error messages for Stripe checkout.
339	+ *
340	+ * @since 5.3.0
341	+ *
342	+ * @param array $messages Array of error messages.
343	+ */
344	+ return apply_filters( 'tec_tickets_commerce_stripe_order_endpoint_error_messages', $messages );
345	+ }
346	+ }

src/Tickets/Commerce/Gateways/Stripe/REST/Return_Endpoint.php ADDED Viewed

	@@ -0,0 +1,192 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\REST;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\Gateway;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\Merchant;
8	+ use TEC\Tickets\Commerce\Gateways\Stripe\Settings;
9	+ use TEC\Tickets\Commerce\Gateways\Stripe\Signup;
10	+ use TEC\Tickets\Commerce\Payments_Tab;
11	+ use Tribe__Settings;
12	+
13	+ use WP_REST_Server;
14	+ use WP_REST_Request;
15	+
16	+ /**
17	+ * Class Return Endpoint.
18	+ *
19	+ * @since 5.3.0
20	+ *
21	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\REST
22	+ */
23	+ class Return_Endpoint extends Abstract_REST_Endpoint {
24	+
25	+ /**
26	+ * The REST API endpoint path.
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @var string
31	+ */
32	+ protected $path = '/commerce/stripe/return';
33	+
34	+ /**
35	+ * Register the actual endpoint on WP Rest API.
36	+ *
37	+ * @since 5.3.0
38	+ */
39	+ public function register() {
40	+ $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
41	+ $documentation = tribe( 'tickets.rest-v1.endpoints.documentation' );
42	+
43	+ register_rest_route(
44	+ $namespace,
45	+ $this->get_endpoint_path(),
46	+ [
47	+ 'methods' => WP_REST_Server::READABLE,
48	+ 'args' => $this->create_order_args(),
49	+ 'callback' => [ $this, 'handle_stripe_return' ],
50	+ 'permission_callback' => '__return_true',
51	+ ]
52	+ );
53	+
54	+ $documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
55	+ }
56	+
57	+ /**
58	+ * Arguments used for the endpoint.
59	+ *
60	+ * @since 5.3.0
61	+ *
62	+ * @return array
63	+ */
64	+ public function create_order_args() {
65	+ return [];
66	+ }
67	+
68	+ /**
69	+ * Handles the request that creates an order with Tickets Commerce and the Stripe gateway.
70	+ *
71	+ * @since 5.3.0
72	+ *
73	+ * @param WP_REST_Request $request The request object.
74	+ */
75	+ public function handle_stripe_return( WP_REST_Request $request ) {
76	+ $stripe_obj = tribe_get_request_var( 'stripe' );
77	+ $disconnected = tribe_get_request_var( 'stripe_disconnected' );
78	+
79	+ if ( ! empty( $stripe_obj ) ) {
80	+ $response = $this->decode_payload( $stripe_obj );
81	+
82	+ if ( ! empty( $response->{'tc-stripe-error'} ) ) {
83	+ $this->handle_connection_error( $response );
84	+ }
85	+
86	+ if ( ! empty( $response->stripe_disconnected ) && $response->stripe_disconnected ) {
87	+ $this->handle_connection_terminated();
88	+ }
89	+
90	+ $this->handle_connection_established( $response );
91	+ }
92	+
93	+ if ( ! empty( $disconnected ) ) {
94	+ $this->handle_connection_terminated();
95	+ }
96	+ }
97	+
98	+ /**
99	+ * Decode the payload received from WhoDat.
100	+ *
101	+ * @since 5.3.0
102	+ *
103	+ * @param string $payload json payload.
104	+ *
105	+ * @return object
106	+ */
107	+ public function decode_payload( $payload ) {
108	+
109	+ if ( empty( $payload ) ) {
110	+ return;
111	+ }
112	+
113	+ return json_decode( base64_decode( $payload ) );
114	+ }
115	+
116	+ /**
117	+ * Handle successful account connections.
118	+ *
119	+ * @since 5.3.0
120	+ *
121	+ * @param object $payload data returned from WhoDat.
122	+ */
123	+ public function handle_connection_established( $payload ) {
124	+
125	+ tribe( Merchant::class )->save_signup_data( (array) $payload );
126	+ tribe( Settings::class )->setup_account_defaults();
127	+
128	+ $validate = tribe( Merchant::class )->validate_account_is_permitted();
129	+
130	+ if ( 'valid' !== $validate ) {
131	+ tribe( Merchant::class )->set_merchant_unauthorized( $validate );
132	+ $disconnect_url = tribe( Signup::class )->generate_disconnect_url();
133	+
134	+ tribe( Merchant::class )->delete_signup_data();
135	+ wp_redirect( $disconnect_url );
136	+ exit();
137	+ }
138	+
139	+ tribe( Merchant::class )->unset_merchant_unauthorized();
140	+ $url = Tribe__Settings::instance()->get_url(
141	+ [
142	+ 'tab' => Payments_Tab::$slug,
143	+ 'tc-section' => Gateway::get_key(),
144	+ 'tc-status' => 'stripe-signup-complete',
145	+ ]
146	+ );
147	+
148	+ wp_safe_redirect( $url );
149	+ exit();
150	+ }
151	+
152	+ /**
153	+ * Handle unsuccessful account connections.
154	+ *
155	+ * @since 5.3.0
156	+ *
157	+ * @param object $payload data returned from WhoDat.
158	+ */
159	+ public function handle_connection_error( $payload ) {
160	+ $url = Tribe__Settings::instance()->get_url( [
161	+ 'tab' => Payments_Tab::$slug,
162	+ 'tc-section' => Gateway::get_key(),
163	+ 'tc-stripe-error' => $payload->{'tc-stripe-error'},
164	+ ] );
165	+
166	+ wp_safe_redirect( $url );
167	+ exit();
168	+ }
169	+
170	+ /**
171	+ * Handle account disconnections.
172	+ *
173	+ * @since 5.3.0
174	+ */
175	+ public function handle_connection_terminated( $reason = [] ) {
176	+ tribe( Merchant::class )->delete_signup_data();
177	+ Gateway::disable();
178	+
179	+ $query_args = [
180	+ 'tab' => Payments_Tab::$slug,
181	+ 'tc-section' => Gateway::get_key(),
182	+ 'stripe_disconnected' => 1,
183	+ ];
184	+
185	+ $url_args = array_merge( $query_args, $reason );
186	+
187	+ $url = Tribe__Settings::instance()->get_url( $url_args );
188	+
189	+ wp_safe_redirect( $url );
190	+ exit();
191	+ }
192	+ }

src/Tickets/Commerce/Gateways/Stripe/REST/Webhook_Endpoint.php ADDED Viewed

	@@ -0,0 +1,156 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\REST;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_REST_Endpoint;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
7	+ use WP_REST_Server;
8	+ use WP_REST_Request;
9	+ use WP_REST_Response;
10	+
11	+ use Tribe__Utils__Array as Arr;
12	+
13	+ /**
14	+ * Class Webhook Endpoint.
15	+ *
16	+ * @since 5.3.0
17	+ *
18	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\REST
19	+ */
20	+ class Webhook_Endpoint extends Abstract_REST_Endpoint {
21	+
22	+ /**
23	+ * The REST API endpoint path.
24	+ *
25	+ * @since 5.3.0
26	+ *
27	+ * @var string
28	+ */
29	+ protected $path = '/commerce/stripe/webhook';
30	+
31	+ /**
32	+ * Register the actual endpoint on WP Rest API.
33	+ *
34	+ * @since 5.3.0
35	+ */
36	+ public function register(): void {
37	+ $namespace = tribe( 'tickets.rest-v1.main' )->get_events_route_namespace();
38	+ $documentation = tribe( 'tickets.rest-v1.endpoints.documentation' );
39	+
40	+ register_rest_route(
41	+ $namespace,
42	+ $this->get_endpoint_path(),
43	+ [
44	+ 'methods' => WP_REST_Server::CREATABLE,
45	+ 'args' => $this->incoming_request_args(),
46	+ 'callback' => [ $this, 'handle_incoming_request' ],
47	+ 'permission_callback' => [ $this, 'verify_incoming_request_permission' ],
48	+ ]
49	+ );
50	+
51	+ $documentation->register_documentation_provider( $this->get_endpoint_path(), $this );
52	+ }
53	+
54	+ /**
55	+ * Arguments for the incoming request endpoint.
56	+ *
57	+ * @since 5.3.0
58	+ *
59	+ * @return array
60	+ */
61	+ public function incoming_request_args(): array {
62	+ return [];
63	+ }
64	+
65	+ /**
66	+ * Handles the request that creates an order with Tickets Commerce and the Stripe gateway.
67	+ *
68	+ * If there is any request related error handling it should happen here, webhook related ones should go in
69	+ * the Handler methods.
70	+ *
71	+ * @since 5.3.0
72	+ *
73	+ * @param WP_REST_Request $request The request object.
74	+ *
75	+ * @return WP_REST_Response\|\WP_Error
76	+ */
77	+ public function handle_incoming_request( WP_REST_Request $request ) {
78	+ // Setup a base response.
79	+ $response = new WP_REST_Response( null, 200 );
80	+
81	+ // Flag that the webhooks are working as expected.
82	+ tribe_update_option( Webhooks::$option_is_valid_webhooks, true );
83	+
84	+ // After this point we are ready to do individual modifications based on the Webhook value.
85	+ return Webhooks\Handler::process_webhook_response( $request, $response );
86	+ }
87	+
88	+ /**
89	+ * Given a WP Rest request we determine if it has the correct Stripe signature.
90	+ *
91	+ * @since 5.3.0
92	+ *
93	+ * @param WP_REST_Request $request Which request we are validating.
94	+ *
95	+ * @return bool
96	+ */
97	+ public function verify_incoming_request_permission( WP_REST_Request $request ): bool {
98	+ return $this->signature_is_valid( $request->get_header( 'Stripe-Signature' ), $request->get_body() );
99	+ }
100	+
101	+ /**
102	+ * Verifies the Stripe-Signature against the stored Webhook Signing Secret to make sure it's authentic.
103	+ *
104	+ * @link https://stripe.com/docs/webhooks/signatures
105	+ *
106	+ * @since 5.3.0
107	+ *
108	+ * @param string $header the Stripe-Signature request header
109	+ * @param string $body the raw json request body
110	+ *
111	+ * @return bool
112	+ */
113	+ protected function signature_is_valid( string $header, string $body ): bool {
114	+ if ( ! $header \|\| ! $body ) {
115	+ return false;
116	+ }
117	+
118	+ if ( defined( 'TEC_TC_STRIPE_SIGNING_SECRET' ) && TEC_TC_STRIPE_SIGNING_SECRET ) {
119	+ $signing_secret = TEC_TC_STRIPE_SIGNING_SECRET;
120	+ }
121	+
122	+ if ( empty ( $signing_secret ) ) {
123	+ $signing_secret = tribe_get_option( Webhooks::$option_webhooks_signing_key );
124	+ }
125	+
126	+ if ( empty( $signing_secret ) ) {
127	+ return false;
128	+ }
129	+
130	+ $time = time();
131	+ $header_parts = explode( ',', $header );
132	+ $signature_parts = [];
133	+
134	+ foreach ( $header_parts as $part ) {
135	+ $pair = explode( '=', $part );
136	+
137	+ if ( in_array( $pair[0], [ 't', 'v1' ], true ) ) {
138	+ $signature_parts[ $pair[0] ] = $pair[1];
139	+ }
140	+ }
141	+
142	+ if ( empty( $signature_parts['t'] ) \|\| empty( $signature_parts['v1'] ) ) {
143	+ return false;
144	+ }
145	+
146	+ // By default, we are using the same 5 minutes threshold that the official Stripe libs do.
147	+ if ( ( $time - (int) $signature_parts['t'] ) > 5 * MINUTE_IN_SECONDS ) {
148	+ return false;
149	+ }
150	+
151	+ $signed_payload = implode( '', [ $signature_parts['t'], '.', $body ] );
152	+ $hmac_signature = hash_hmac( 'sha256', $signed_payload, $signing_secret );
153	+
154	+ return hash_equals( $signature_parts['v1'], $hmac_signature );
155	+ }
156	+ }

src/Tickets/Commerce/Gateways/Stripe/Requests.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Requests;
6	+
7	+ /**
8	+ * Stripe Requests.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\Stripe;
13	+ */
14	+ class Requests extends Abstract_Requests {
15	+
16	+ /**
17	+ * The Merchant class reference to use.
18	+ *
19	+ * @since 5.3.0
20	+ *
21	+ * @var string
22	+ */
23	+ public static $merchant = Merchant::class;
24	+
25	+ /**
26	+ * The Gateway class reference to use.
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @var string
31	+ */
32	+ public static $gateway = Gateway::class;
33	+
34	+ /**
35	+ * The Stripe API base URL.
36	+ *
37	+ * @since 5.3.0
38	+ *
39	+ * @var string
40	+ */
41	+ private static $api_base_url = 'https://api.stripe.com/v1';
42	+
43	+ /**
44	+ * @inheritDoc
45	+ */
46	+ public static function get_api_url( $endpoint, array $query_args = [] ) {
47	+ $base_url = static::get_environment_url();
48	+ $endpoint = ltrim( $endpoint, '/' );
49	+
50	+ return add_query_arg( $query_args, "{$base_url}/{$endpoint}" );
51	+ }
52	+
53	+ /**
54	+ * Get environment base URL.
55	+ *
56	+ * @since 5.3.0
57	+ *
58	+ * @return string
59	+ */
60	+ public static function get_environment_url() {
61	+ return static::$api_base_url;
62	+ }
63	+
64	+ }

src/Tickets/Commerce/Gateways/Stripe/Settings.php ADDED Viewed

	@@ -0,0 +1,489 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Settings;
6	+ use TEC\Tickets\Commerce\Notice_Handler;
7	+ use TEC\Tickets\Commerce\Utils\Currency;
8	+ use Tribe__Tickets__Main;
9	+
10	+ /**
11	+ * The Stripe specific settings.
12	+ *
13	+ * @since 5.3.0
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
15	+ */
16	+ class Settings extends Abstract_Settings {
17	+
18	+ /**
19	+ * DB identifier for the Payment Element selection
20	+ *
21	+ * @since 5.3.0
22	+ *
23	+ * @var string
24	+ */
25	+ const PAYMENT_ELEMENT_SLUG = 'payment';
26	+
27	+ /**
28	+ * DB identifier for the Card Element selection
29	+ *
30	+ * @since 5.3.0
31	+ *
32	+ * @var string
33	+ */
34	+ const CARD_ELEMENT_SLUG = 'card';
35	+
36	+ /**
37	+ * DB identifier for the Card Element Compact Layout
38	+ *
39	+ * @since 5.3.0
40	+ *
41	+ * @var string
42	+ */
43	+ const COMPACT_CARD_ELEMENT_SLUG = 'compact';
44	+
45	+ /**
46	+ * DB identifier for the Card Element Separate Layout
47	+ *
48	+ * @since 5.3.0
49	+ *
50	+ * @var string
51	+ */
52	+ const SEPARATE_CARD_ELEMENT_SLUG = 'separate';
53	+
54	+ /**
55	+ * DB identifier for the default methods set for the Payment Element
56	+ *
57	+ * @since 5.3.0
58	+ *
59	+ * @var array
60	+ */
61	+ const DEFAULT_PAYMENT_ELEMENT_METHODS = [ 'card' ];
62	+
63	+ /**
64	+ * Connection details fetched from the Stripe API on page-load
65	+ *
66	+ * @since 5.3.0
67	+ *
68	+ * @var array
69	+ */
70	+ public $connection_status;
71	+
72	+ /**
73	+ * @inheritDoc
74	+ */
75	+ public static $option_sandbox = 'tickets-commerce-stripe-sandbox';
76	+
77	+ /**
78	+ * Option name for the statement descriptor field
79	+ *
80	+ * @since 5.3.0
81	+ *
82	+ * @var string
83	+ */
84	+ public static $option_statement_descriptor = 'tickets-commerce-stripe-statement-descriptor';
85	+
86	+ /**
87	+ * Option name for the collect billing details field
88	+ *
89	+ * @since 5.3.0
90	+ *
91	+ * @var string
92	+ */
93	+ public static $option_collect_billing_details = 'tickets-commerce-stripe-billing-details';
94	+
95	+ /**
96	+ * Option name for the stripe receipt emails field
97	+ *
98	+ * @since 5.3.0
99	+ *
100	+ * @var string
101	+ */
102	+ public static $option_stripe_receipt_emails = 'tickets-commerce-stripe-receipt-emails';
103	+
104	+ /**
105	+ * Option name for the stripe checkout element field
106	+ *
107	+ * @since 5.3.0
108	+ *
109	+ * @var string
110	+ */
111	+ public static $option_checkout_element = 'tickets-commerce-stripe-checkout-element';
112	+
113	+ /**
114	+ * Option name for the card element credit card fields to use
115	+ *
116	+ * @since 5.3.0
117	+ *
118	+ * @var string
119	+ */
120	+ public static $option_checkout_element_card_fields = 'tickets-commerce-stripe-checkout-element-card-fields';
121	+
122	+ /**
123	+ * Option name for the payment element payment methods allowed
124	+ *
125	+ * @since 5.3.0
126	+ *
127	+ * @var string
128	+ */
129	+ public static $option_checkout_element_payment_methods = 'tickets-commerce-stripe-checkout-element-payment-methods';
130	+
131	+ /**
132	+ * Constructor
133	+ */
134	+ public function __construct() {
135	+ $this->set_connection_status();
136	+ }
137	+
138	+ /**
139	+ * Set the internal parameter w/ account details received from the Stripe API
140	+ *
141	+ * @since 5.3.0
142	+ */
143	+ public function set_connection_status() {
144	+ $this->connection_status = tribe( Merchant::class )->check_account_status();
145	+ }
146	+
147	+ /**
148	+ * Trigger a dismissible admin notice if Tickets Commerce and Stripe currencies are not the same.
149	+ *
150	+ * @since 5.3.0
151	+ */
152	+ public function alert_currency_mismatch() {
153	+ $merchant = tribe( Merchant::class );
154	+
155	+ // Bail if merchant is not connected.
156	+ if ( ! $merchant->is_connected() ) {
157	+ return;
158	+ }
159	+
160	+ $stripe_currency = strtoupper( $merchant->get_merchant_currency() );
161	+ $site_currency = strtoupper( Currency::get_currency_code() );
162	+
163	+ // Bail if no currency is set for the Stripe connection.
164	+ if ( empty( $stripe_currency ) ) {
165	+ return;
166	+ }
167	+
168	+ if ( $site_currency === $stripe_currency ) {
169	+ return;
170	+ }
171	+
172	+ tribe( Notice_Handler::class )->trigger_admin(
173	+ 'tc-stripe-currency-mismatch',
174	+ [
175	+ 'content' =>
176	+ sprintf(
177	+ // Translators: %1$s The tickets commerce currency. %2$s: The currency from the Stripe account.
178	+ __( 'Tickets Commerce is configured to use %1$s as its currency but the default currency for the connected stripe account is %2$s. Using different currencies for Tickets Commerce and Stripe may not be supported by all payment methods available in %1$s, and may result in exchange rates and conversions from %1$s to %2$s being handled by Stripe. If you believe this is an error, you can modify the Tickets Commerce currency in the main Payments tab.', 'event-tickets' ),
179	+ $site_currency,
180	+ $stripe_currency
181	+ ),
182	+ ]
183	+ );
184	+ }
185	+
186	+ /**
187	+ * @inheritDoc
188	+ */
189	+ public function get_settings() {
190	+ $currency_code = Currency::get_currency_code();
191	+ $currency_name = Currency::get_currency_name( $currency_code );
192	+ $plus_link_faq = sprintf(
193	+ '<a href="https://evnt.is/1b3u" target="_blank" rel="noopener noreferrer">%s</a>',
194	+ esc_html__( 'Learn more', 'event-tickets' )
195	+ );
196	+
197	+ $checkout_type_tooltip = sprintf(
198	+ // Translators: %1$s: Opening `<a>` tag for KB article link. %2$s: Closing `<a>` tag.
199	+ __( 'Additional payment methods are available based on currency and location and must be enabled individually within your Stripe account. %1$sLearn more%2$s', 'event-tickets' ),
200	+ '<a href="https://evnt.is/1axw" target="_blank" rel="noopener noreferrer">',
201	+ '</a>'
202	+ );
203	+
204	+ $payment_methods_tooltip = sprintf(
205	+ // Translators: %1$s: Opening `<span>` tag. %2$s: The currency name. %3$s: Closing `</span>` tag. %4$s: Opening `<a>` tag for Stripe link. %5$s: Closing `</a>` tag.
206	+ __( '%1$sPayment methods available for %2$s%3$s.<br /><br /> The payment methods listed here are dependent on the currency selected for Tickets Commerce and the currency each payment method support. You can review the payment methods and their availablity for each currency on %4$sStripe\'s documentation%5$s.<br /><br />', 'event-tickets' ),
207	+ '<span class="tec-tickets__admin-settings-tickets-commerce-gateway-currency">',
208	+ $currency_name,
209	+ '</span>',
210	+ '<a href="https://stripe.com/docs/payments/payment-methods/integration-options" target="_blank" rel="noopener noreferrer">',
211	+ '</a>'
212	+ );
213	+
214	+ $stripe_message = sprintf(
215	+ // Translators: %1$s: The Event Tickets Plus link.
216	+ esc_html__( 'You are using the free Stripe payment gateway integration. This includes an additional 2%% fee for processing ticket sales. This fee is removed if you have an active subscription to Event Tickets Plus. %1$s.', 'event-tickets' ),
217	+ $plus_link_faq
218	+ );
219	+ $main_settings = [
220	+ 'tickets-commerce-stripe-commerce-description' => [
221	+ 'type' => 'html',
222	+ 'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-description">' . $stripe_message . '</div>',
223	+ ],
224	+ 'tickets-commerce-stripe-commerce-configure' => [
225	+ 'type' => 'wrapped_html',
226	+ 'html' => $this->get_connection_settings_html(),
227	+ 'validation_type' => 'html',
228	+ ],
229	+ ];
230	+
231	+ // If gateway isn't connected/active, only show the connection settings.
232	+ $is_connected = tribe( Merchant::class )->is_connected();
233	+ if ( ! $is_connected ) {
234	+ /**
235	+ * Allow filtering the list of Stripe settings.
236	+ *
237	+ * @since 5.3.0
238	+ *
239	+ * @param array $settings The list of Stripe Commerce settings.
240	+ * @param bool $is_connected Whether or not gateway is connected.
241	+ */
242	+ return apply_filters( 'tec_tickets_commerce_stripe_settings', $main_settings, $is_connected );
243	+ }
244	+
245	+ $connected_settings = [
246	+ 'tickets-commerce-stripe-settings-heading' => [
247	+ 'type' => 'html',
248	+ 'html' => '<h3 class="tribe-dependent -input">' . __( 'Stripe Settings', 'event-tickets' ) . '</h3><div class="clear"></div>',
249	+ ],
250	+ 'tickets-commerce-gateway-settings-group-header-general' => [
251	+ 'type' => 'html',
252	+ 'html' => '<h4 class="tec-tickets__admin-settings-tickets-commerce-gateway-group-header">' . __( 'General', 'event-tickets' ) . '</h4><div class="clear"></div>',
253	+ ],
254	+ static::$option_statement_descriptor => [
255	+ 'type' => 'text',
256	+ 'label' => esc_html__( 'Statement Descriptor', 'event-tickets' ),
257	+ 'tooltip' => esc_html__( 'This is the text that appears on the ticket purchaser bank statements. If left blank, the descriptor set in Stripe will be used.', 'event-tickets' ),
258	+ 'size' => 'medium',
259	+ 'default' => '',
260	+ 'validation_callback' => 'is_string',
261	+ 'validation_type' => 'textarea',
262	+ 'placeholder' => ! empty( $this->connection_status['statement_descriptor'] ) ? esc_textarea( $this->connection_status['statement_descriptor'] ) : '',
263	+ ],
264	+ static::$option_stripe_receipt_emails => [
265	+ 'type' => 'checkbox_bool',
266	+ 'label' => esc_html__( 'Enable Stripe Receipt Emails', 'event-tickets' ),
267	+ 'tooltip' => esc_html__( 'If this option is selected, ticket buyers will get stripe receipts, as well as Event Tickets confirmation emails.', 'event-tickets' ),
268	+ 'default' => false,
269	+ 'validation_type' => 'boolean',
270	+ ],
271	+ 'tickets-commerce-stripe-checkout-settings-heading' => [
272	+ 'type' => 'html',
273	+ 'html' => '<h3 class="tribe-dependent -input">' . __( 'Checkout Settings', 'event-tickets' ) . '</h3><div class="clear"></div>',
274	+ ],
275	+
276	+ 'tickets-commerce-gateway-settings-group-header-checkout' => [
277	+ 'type' => 'html',
278	+ 'html' => '<h4 class="tec-tickets__admin-settings-tickets-commerce-gateway-group-header">' . __( 'Checkout', 'event-tickets' ) . '</h4><div class="clear"></div>',
279	+ ],
280	+ static::$option_checkout_element => [
281	+ 'type' => 'radio',
282	+ 'label' => esc_html__( 'Checkout Type', 'event-tickets' ),
283	+ 'tooltip' => $checkout_type_tooltip,
284	+ 'default' => self::CARD_ELEMENT_SLUG,
285	+ 'validation_type' => 'options',
286	+ 'options' => [
287	+ self::CARD_ELEMENT_SLUG => esc_html__( 'Accept only credit card payments.', 'event-tickets' ),
288	+ self::PAYMENT_ELEMENT_SLUG => esc_html__( 'Accept credit card payments and additional payment methods configured in Stripe.', 'event-tickets' ),
289	+ ],
290	+ ],
291	+ static::$option_checkout_element_card_fields => [
292	+ 'type' => 'radio',
293	+ 'label' => esc_html__( 'Credit Card field format', 'event-tickets' ),
294	+ 'default' => self::COMPACT_CARD_ELEMENT_SLUG,
295	+ 'fieldset_attributes' => [
296	+ 'data-depends' => '#tribe-field-' . static::$option_checkout_element . '-' . self::CARD_ELEMENT_SLUG,
297	+ 'data-condition-is-checked' => true,
298	+ ],
299	+ 'class' => 'tribe-dependent',
300	+ 'validation_type' => 'options',
301	+ 'options' => [
302	+ self::COMPACT_CARD_ELEMENT_SLUG => sprintf(
303	+ // Translators: %1$s: Opening `<span>` tag. %2$s: Closing `</span>` tag.
304	+ __( 'Single field. %1$sFor streamlined checkout.%2$s', 'event-tickets' ),
305	+ '<span class="tribe_soft_note">',
306	+ '</span>'
307	+ ),
308	+ self::SEPARATE_CARD_ELEMENT_SLUG => sprintf(
309	+ // Translators: %1$s: Opening `<span>` tag. %2$s: Closing `</span>` tag.
310	+ __( 'Multiple fields. %1$sFor standard checkout.%2$s', 'event-tickets' ),
311	+ '<span class="tribe_soft_note">',
312	+ '</span>'
313	+ ),
314	+ ],
315	+ ],
316	+ static::$option_checkout_element_payment_methods => [
317	+ 'type' => 'checkbox_list',
318	+ 'label' => esc_html__( 'Payment methods accepted', 'event-tickets' ),
319	+ 'tooltip' => $payment_methods_tooltip,
320	+ 'default' => self::DEFAULT_PAYMENT_ELEMENT_METHODS,
321	+ 'can_be_empty' => false,
322	+ 'fieldset_attributes' => [
323	+ 'data-depends' => '#tribe-field-' . static::$option_checkout_element . '-' . self::PAYMENT_ELEMENT_SLUG,
324	+ 'data-condition-is-checked' => true,
325	+ ],
326	+ 'class' => 'tribe-dependent',
327	+ 'validation_type' => 'options_multi',
328	+ 'options' => $this->get_payment_methods_available_by_currency(),
329	+ ],
330	+ ];
331	+
332	+ /**
333	+ * Allow filtering the list of Stripe settings.
334	+ *
335	+ * @since 5.3.0
336	+ *
337	+ * @param array $settings The list of Stripe Commerce settings.
338	+ * @param bool $is_connected Whether or not gateway is connected.
339	+ */
340	+ return apply_filters( 'tec_tickets_commerce_stripe_settings', array_merge( $main_settings, $connected_settings ), $is_connected );
341	+ }
342	+
343	+ /**
344	+ * Filters the general list of payment methods to grab only those available to the currency configured in Tickets
345	+ * Commerce.
346	+ *
347	+ * @since 5.3.0
348	+ *
349	+ * @return array
350	+ */
351	+ public function get_payment_methods_available_by_currency() {
352	+ $currency = Currency::get_currency_code();
353	+ $payment_methods = $this->get_payment_methods_available();
354	+ $available_methods = [
355	+ 'card' => esc_html__( 'Credit Cards', 'event-tickets' ),
356	+ ];
357	+
358	+ foreach ( $payment_methods as $method => $configs ) {
359	+ if ( ! in_array( $currency, $configs['currencies'], true ) ) {
360	+ continue;
361	+ }
362	+
363	+ $available_methods[ $method ] = $configs['label'];
364	+ }
365	+
366	+
367	+ /**
368	+ * Allows filtering the list of available Payment Methods
369	+ *
370	+ * @since 5.3.0
371	+ *
372	+ * @param array $available_methods the list of payment methods available to the current currency
373	+ * @param string $currency the currency configured for Tickets Commerce
374	+ * @param array[] $payment_methods the complete list of available Payment Methods in Stripe
375	+ */
376	+ return apply_filters( 'tec_tickets_commerce_stripe_payment_methods_by_currency', $available_methods, $currency, $payment_methods );
377	+ }
378	+
379	+ /**
380	+ * Returns the list of available Payment Methods.
381	+ *
382	+ * @link https://stripe.com/docs/payments/payment-methods/integration-options#payment-method-product-support
383	+ *
384	+ * @since 5.3.0
385	+ *
386	+ * @return array[]
387	+ */
388	+ private function get_payment_methods_available() {
389	+ $available_methods = [
390	+ 'afterpay_clearpay' => [
391	+ 'currencies' => [ 'AUD', 'CAD', 'GBP', 'NZD', 'USD' ],
392	+ 'label' => esc_html__( 'AfterPay and ClearPay', 'event-tickets' ),
393	+ ],
394	+ 'alipay' => [
395	+ 'currencies' => [ 'AUD', 'CAD', 'CNY', 'EUR', 'GBP', 'HKD', 'JPY', 'MYR', 'NZD', 'SGD', 'USD' ],
396	+ 'label' => esc_html__( 'Alipay', 'event-tickets' ),
397	+ ],
398	+ 'giropay' => [
399	+ 'currencies' => [ 'EUR' ],
400	+ 'label' => esc_html__( 'Giropay', 'event-tickets' ),
401	+ ],
402	+ 'klarna' => [
403	+ 'currencies' => [ 'DKK', 'EUR', 'GBP', 'NOK', 'SEK', 'USD' ],
404	+ 'label' => esc_html__( 'Klarna', 'event-tickets' ),
405	+ ],
406	+ ];
407	+
408	+ /**
409	+ * Allows for filtering the list of available payment methods.
410	+ *
411	+ * @since 5.3.0
412	+ *
413	+ * @param array $available_methods the list of payment methods available.
414	+ */
415	+ return apply_filters( 'tec_tickets_commerce_stripe_payment_methods_available', $available_methods );
416	+ }
417	+
418	+ /**
419	+ * Setup basic defaults once a new account is onboarded.
420	+ *
421	+ * @since 5.3.0
422	+ */
423	+ public function setup_account_defaults() {
424	+ if ( empty( $this->connection_status ) ) {
425	+ $this->set_connection_status();
426	+ }
427	+
428	+ update_option( Merchant::$merchant_default_currency_option_key, $this->connection_status['default_currency'] );
429	+
430	+ if ( empty( tribe_get_option( static::$option_checkout_element ) ) ) {
431	+ tribe_update_option( static::$option_checkout_element, static::PAYMENT_ELEMENT_SLUG );
432	+ }
433	+
434	+ if ( empty( tribe_get_option( static::$option_checkout_element_card_fields ) ) ) {
435	+ tribe_update_option( static::$option_checkout_element_card_fields, static::COMPACT_CARD_ELEMENT_SLUG );
436	+ }
437	+
438	+ if ( empty( tribe_get_option( static::$option_checkout_element_payment_methods ) ) ) {
439	+ tribe_update_option( static::$option_checkout_element_payment_methods, static::DEFAULT_PAYMENT_ELEMENT_METHODS );
440	+ }
441	+ }
442	+
443	+ /**
444	+ * @inheritDoc
445	+ */
446	+ public function get_connection_settings_html() {
447	+ /** @var \Tribe__Tickets__Admin__Views $admin_views */
448	+ $admin_views = tribe( 'tickets.admin.views' );
449	+
450	+ $context = [
451	+ 'plugin_url' => Tribe__Tickets__Main::instance()->plugin_url,
452	+ 'merchant_status' => $this->connection_status,
453	+ 'signup' => tribe( Signup::class ),
454	+ 'merchant' => tribe( Merchant::class ),
455	+ 'fee_is_applied' => apply_filters( 'tec_tickets_commerce_stripe_fee_is_applied_notice', true ),
456	+ ];
457	+
458	+ return $admin_views->template( 'settings/tickets-commerce/stripe/main', $context, false );
459	+ }
460	+
461	+ /**
462	+ * Resets the values of payment methods and card options if they are no longer in use and avoid a settings
463	+ * notice for empty values.
464	+ *
465	+ * @since 5.3.0
466	+ *
467	+ * @param mixed $value Field value submitted.
468	+ * @param string $field_id Field key in the settings array.
469	+ * @param array $field Entire field array.
470	+ *
471	+ * @return mixed
472	+ */
473	+ public function reset_hidden_field_values( $value, $field_id, $field ) {
474	+
475	+ if ( $value ) {
476	+ return $value;
477	+ }
478	+
479	+ if ( $field_id === static::$option_checkout_element_payment_methods ) {
480	+ return tribe_get_option( static::$option_checkout_element_payment_methods, self::DEFAULT_PAYMENT_ELEMENT_METHODS );
481	+ }
482	+
483	+ if ( $field_id === static::$option_checkout_element_card_fields ) {
484	+ return tribe_get_option( static::$option_checkout_element_card_fields, self::COMPACT_CARD_ELEMENT_SLUG );
485	+ }
486	+
487	+ return $value;
488	+ }
489	+ }

src/Tickets/Commerce/Gateways/Stripe/Signup.php ADDED Viewed

	@@ -0,0 +1,108 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Signup;
6	+
7	+ /**
8	+ * Class Signup.
9	+ *
10	+ * @since 5.3.0
11	+ *
12	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
13	+ */
14	+ class Signup extends Abstract_Signup {
15	+
16	+ /**
17	+ * @inheritDoc
18	+ */
19	+ public static $signup_data_meta_key = 'tec_tc_stripe_signup_data';
20	+
21	+ /**
22	+ * The return path the user will be redirected to after signing up or disconnecting.
23	+ *
24	+ * @since 5.3.0
25	+ *
26	+ * @var string
27	+ */
28	+ public $signup_return_path = '/tribe/tickets/v1/commerce/stripe/return';
29	+
30	+ /**
31	+ * @inheritDoc
32	+ */
33	+ public $template_folder = 'src/admin-views/settings/tickets-commerce/stripe';
34	+
35	+ /**
36	+ * Generates a stripe connection URL from WhoDat.
37	+ *
38	+ * @since 5.3.0
39	+ *
40	+ * @return string
41	+ */
42	+ public function generate_signup_url() {
43	+
44	+ return tribe( WhoDat::class )->get_api_url(
45	+ 'connect',
46	+ [
47	+ 'token' => $this->get_client_id(),
48	+ 'return_url' => tribe( WhoDat::class )->get_api_url( 'connected' ),
49	+ ] );
50	+
51	+ }
52	+
53	+ /**
54	+ * Generates a stripe disconnection URL from WhoDat
55	+ *
56	+ * @since 5.3.0
57	+ *
58	+ * @return string
59	+ */
60	+ public function generate_disconnect_url() {
61	+
62	+ return tribe( WhoDat::class )->get_api_url(
63	+ 'disconnect',
64	+ [
65	+ 'stripe_user_id' => tribe( Merchant::class )->get_client_id(),
66	+ 'return_url' => rest_url( $this->signup_return_path ),
67	+ ]
68	+ );
69	+ }
70	+
71	+ /**
72	+ * @inheritDoc
73	+ */
74	+ public function get_link_html() {
75	+ $template_vars = [
76	+ 'url' => $this->generate_signup_url(),
77	+ ];
78	+
79	+ $this->get_template()->template( 'signup-link', $template_vars );
80	+ }
81	+
82	+ /**
83	+ * Get a unique tracking ID to identify this client on stripe.
84	+ *
85	+ * @since 5.3.0
86	+ *
87	+ * @return string
88	+ */
89	+ public function get_client_id() {
90	+ return tribe( Gateway::class )->generate_unique_tracking_id();
91	+ }
92	+
93	+ /**
94	+ * Determines if the signup was successful.
95	+ *
96	+ * @since 5.3.0
97	+ *
98	+ * @param array $data
99	+ *
100	+ * @return bool
101	+ */
102	+ public function is_success( $data ) {
103	+
104	+ return ! empty( $data->stripe_user_id )
105	+ && ! empty( $data->live->access_token )
106	+ && ! empty( $data->sandbox->access_token );
107	+ }
108	+ }

src/Tickets/Commerce/Gateways/Stripe/Status.php ADDED Viewed

	@@ -0,0 +1,166 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Status as Commerce_Status;
6	+
7	+ /**
8	+ * Class Status.
9	+ *
10	+ * @todo Create a Contract between this and PayPal.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
15	+ */
16	+ class Status {
17	+
18	+ /**
19	+ * Order Status in Stripe for when the payment intent is first created or when payment is denied.
20	+ *
21	+ * @since 5.3.0
22	+ *
23	+ * @var string
24	+ */
25	+ const REQUIRES_PAYMENT_METHOD = 'requires_payment_method';
26	+
27	+ /**
28	+ * Order Status in Stripe for when the payment intent is first created or when payment is denied.
29	+ *
30	+ * @since 5.3.0
31	+ *
32	+ * @var string
33	+ */
34	+ const REQUIRES_SOURCE = 'requires_source';
35	+
36	+ /**
37	+ * Order Status in Stripe for created and waiting for automatic confirmation to start processing.
38	+ *
39	+ * @since 5.3.0
40	+ *
41	+ * @var string
42	+ */
43	+ const REQUIRES_CONFIRMATION = 'requires_confirmation';
44	+
45	+ /**
46	+ * Order Status in Stripe for created and waiting for user confirmation to start processing.
47	+ *
48	+ * @since 5.3.0
49	+ *
50	+ * @var string
51	+ */
52	+ const REQUIRES_ACTION = 'requires_action';
53	+
54	+ /**
55	+ * Order Status in Stripe for created and waiting for user confirmation to start processing.
56	+ *
57	+ * @since 5.3.0
58	+ *
59	+ * @var string
60	+ */
61	+ const REQUIRES_SOURCE_ACTION = 'requires_source_action';
62	+
63	+ /**
64	+ * Order Status in Stripe for processing.
65	+ *
66	+ * @since 5.3.0
67	+ *
68	+ * @var string
69	+ */
70	+ const PROCESSING = 'processing';
71	+
72	+ /**
73	+ * Order Status in Stripe for a successful hold on funds, waiting for settlement.
74	+ *
75	+ * @since 5.3.0
76	+ *
77	+ * @var string
78	+ */
79	+ const REQUIRES_CAPTURE = 'requires_capture';
80	+
81	+ /**
82	+ * Order Status in Stripe for completed with success.
83	+ *
84	+ * @since 5.3.0
85	+ *
86	+ * @var string
87	+ */
88	+ const SUCCEEDED = 'succeeded';
89	+
90	+ /**
91	+ * Order Status in Stripe for manually cancelled and invalidated.
92	+ *
93	+ * @since 5.3.0
94	+ *
95	+ * @var string
96	+ */
97	+ const CANCELED = 'canceled';
98	+
99	+ /**
100	+ * Default mapping from Stripe Status to Tickets Commerce
101	+ *
102	+ * This list MUST be kept in order of order stripe status progression, from creation to completion/refusal, as
103	+ * described in the link below:
104	+ *
105	+ * @link https://stripe.com/docs/payments/intents
106	+ *
107	+ * @since 5.3.0
108	+ *
109	+ * @var array
110	+ */
111	+ protected $default_map = [
112	+ self::REQUIRES_PAYMENT_METHOD => Commerce_Status\Created::SLUG,
113	+ self::REQUIRES_SOURCE => Commerce_Status\Created::SLUG,
114	+ self::REQUIRES_CONFIRMATION => Commerce_Status\Action_Required::SLUG,
115	+ self::REQUIRES_ACTION => Commerce_Status\Action_Required::SLUG,
116	+ self::REQUIRES_SOURCE_ACTION => Commerce_Status\Action_Required::SLUG,
117	+ self::REQUIRES_CAPTURE => Commerce_Status\Action_Required::SLUG,
118	+ self::PROCESSING => Commerce_Status\Pending::SLUG,
119	+ self::SUCCEEDED => Commerce_Status\Completed::SLUG,
120	+ self::CANCELED => Commerce_Status\Denied::SLUG,
121	+ ];
122	+
123	+ /**
124	+ * Gets the valid mapping of the statuses.
125	+ *
126	+ * @since 5.3.0
127	+ *
128	+ * @return array
129	+ */
130	+ public function get_valid_statuses() {
131	+ return $this->default_map;
132	+ }
133	+
134	+ /**
135	+ * Checks if a given Stripe status is valid.
136	+ *
137	+ * @since 5.3.0
138	+ *
139	+ * @param string $status Status from Stripe.
140	+ *
141	+ * @return bool
142	+ */
143	+ public function is_valid_status( $status ) {
144	+ $statuses = $this->get_valid_statuses();
145	+
146	+ return isset( $statuses[ $status ] );
147	+ }
148	+
149	+ /**
150	+ * Converts a valid Stripe status into a commerce status object.
151	+ *
152	+ * @since 5.3.0
153	+ *
154	+ * @param string $stripe_status A Stripe status string.
155	+ *
156	+ * @return false\|Commerce_Status\Status_Interface\|null
157	+ */
158	+ public function convert_to_commerce_status( $stripe_status ) {
159	+ if ( ! $this->is_valid_status( $stripe_status ) ) {
160	+ return false;
161	+ }
162	+ $statuses = $this->get_valid_statuses();
163	+
164	+ return tribe( Commerce_Status\Status_Handler::class )->get_by_slug( $statuses[ $stripe_status ] );
165	+ }
166	+ }

src/Tickets/Commerce/Gateways/Stripe/Stripe_Elements.php ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Cart;
6	+ use TEC\Tickets\Commerce\Module;
7	+
8	+ /**
9	+ * Class Payment_Element
10	+ *
11	+ * @since 5.3.0
12	+ *
13	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
14	+ */
15	+ class Stripe_Elements {
16	+
17	+ /**
18	+ * Are we forcing users to log in before checking out?
19	+ *
20	+ * @since 5.3.0
21	+ *
22	+ * @return bool
23	+ */
24	+ public function must_login() {
25	+ return ! is_user_logged_in() && tribe( Module::class )->login_required();
26	+ }
27	+
28	+ /**
29	+ * Returns the variables for gateway's checkout template.
30	+ *
31	+ * @since 5.3.0
32	+ *
33	+ * @return []
34	+ */
35	+ public function get_checkout_template_vars() {
36	+ return [
37	+ 'payment_element' => $this->include_payment_element(),
38	+ 'card_element_type' => $this->card_element_type(),
39	+ ];
40	+ }
41	+
42	+ /**
43	+ * Include the Stripe Payment Element form.
44	+ *
45	+ * @since 5.3.0
46	+ *
47	+ * @return bool
48	+ */
49	+ public function include_payment_element() {
50	+ return tribe_get_option( Settings::$option_checkout_element ) === Settings::PAYMENT_ELEMENT_SLUG;
51	+ }
52	+
53	+ /**
54	+ * Include the Stripe Card Element form.
55	+ *
56	+ * @since 5.3.0
57	+ *
58	+ * @return string
59	+ */
60	+ public function card_element_type() {
61	+ return tribe_get_option( Settings::$option_checkout_element_card_fields );
62	+ }
63	+
64	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks.php ADDED Viewed

	@@ -0,0 +1,218 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
6	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Merchant;
7	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Webhooks;
8	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\Webhook_Endpoint;
9	+
10	+ /**
11	+ * Class Webhooks
12	+ *
13	+ * @since 5.3.0
14	+ *
15	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
16	+ */
17	+ class Webhooks extends Abstract_Webhooks {
18	+
19	+ /**
20	+ * Option key that determines if the webhooks are valid.
21	+ *
22	+ * @since 5.3.0
23	+ *
24	+ * @var string
25	+ */
26	+ public static $option_is_valid_webhooks = 'tickets-commerce-stripe-is-valid-webhooks';
27	+
28	+ /**
29	+ * Option key that determines if the webhooks are valid.
30	+ *
31	+ * @since 5.3.0
32	+ *
33	+ * @var string
34	+ */
35	+ public static $nonce_key_handle_validation = 'tickets-commerce-stripe-webhook-handle_validation';
36	+
37	+ /**
38	+ * Option key that we use to allow customers to copy.
39	+ *
40	+ * @since 5.3.0
41	+ *
42	+ * @var string
43	+ */
44	+ public static $option_webhooks_value = 'tickets-commerce-stripe-webhooks-value';
45	+
46	+ /**
47	+ * Option name for the option to store the webhook signing key
48	+ *
49	+ * @since 5.3.0
50	+ *
51	+ * @var string
52	+ */
53	+ public static $option_webhooks_signing_key = 'tickets-commerce-stripe-webhooks-signing-key';
54	+
55	+ /**
56	+ * @inheritDoc
57	+ */
58	+ public function get_gateway(): Abstract_Gateway {
59	+ return tribe( Gateway::class );
60	+ }
61	+
62	+ /**
63	+ * @inheritDoc
64	+ */
65	+ public function get_merchant(): Abstract_Merchant {
66	+ return tribe( Merchant::class );
67	+ }
68	+
69	+ /**
70	+ * Testing if given Signing Key is valid on an AJAX request.
71	+ *
72	+ * @since 5.3.0
73	+ *
74	+ * @return void
75	+ */
76	+ public function handle_validation(): void {
77	+ $nonce = tribe_get_request_var( 'tc_nonce' );
78	+ $status = esc_html__( 'Webhooks not validated yet.', 'event-tickets' );
79	+
80	+ if ( ! wp_verify_nonce( $nonce, static::$nonce_key_handle_validation ) ) {
81	+ wp_send_json_error( [ 'updated' => false, 'status' => $status ] );
82	+ exit;
83	+ }
84	+
85	+ $signing_key = tribe_get_request_var( 'signing_key' );
86	+ $updated = tribe_update_option( static::$option_webhooks_signing_key, $signing_key );
87	+
88	+ if ( empty( $signing_key ) ) {
89	+ // If we updated and the value was empty we need to reset the validity of the key.
90	+ if ( $updated ) {
91	+ tribe_update_option( static::$option_is_valid_webhooks, false );
92	+ }
93	+
94	+ wp_send_json_error( [ 'updated' => $updated, 'status' => $status ] );
95	+ exit;
96	+ }
97	+
98	+ $account_data_update = [
99	+ 'metadata' => [
100	+ 'tec_tc_enabled_webhooks' => 1,
101	+ ],
102	+ ];
103	+
104	+ // This doesn't work on a Sandbox account, so we might need to add some text about .
105	+ $response = tribe( Merchant::class )->update( $account_data_update );
106	+
107	+ // We sleep for 5 seconds to allow the API to reach the website after the update.
108	+ sleep( 10 );
109	+
110	+ // Reset cache so it fetches from DB again.
111	+ wp_cache_init();
112	+ tribe_unset_var( \Tribe__Settings_Manager::OPTION_CACHE_VAR_NAME );
113	+
114	+ $is_valid = tribe_get_option( static::$option_is_valid_webhooks, false );
115	+ if ( $is_valid ) {
116	+ $status = esc_html__( 'Webhooks were properly validated for sales.', 'event-tickets' );
117	+ }
118	+
119	+ wp_send_json_success( [ 'is_valid_webhook' => $is_valid, 'updated' => $updated, 'status' => $status ] );
120	+ exit;
121	+ }
122	+
123	+ /**
124	+ * Includes a Copy button to the webhook UI.
125	+ *
126	+ * @since 5.3.0
127	+ *
128	+ * @param string $html
129	+ * @param \Tribe__Field $field
130	+ *
131	+ * @return string
132	+ */
133	+ public function include_webhooks_copy_button( string $html, \Tribe__Field $field ): string {
134	+ if ( static::$option_webhooks_value !== $field->id ) {
135	+ return $html;
136	+ }
137	+ $copy_button = '<button class="tribe-field-tickets-commerce-stripe-webhooks-copy button-secondary" data-clipboard-target=".tribe-field-tickets-commerce-stripe-webhooks-copy-value"><span class="dashicons dashicons-clipboard"></span></button>';
138	+
139	+ return $copy_button . $html;
140	+ }
141	+
142	+ /**
143	+ * Return the fields related to webhooks.
144	+ *
145	+ * @since 5.3.0
146	+ *
147	+ * @return array
148	+ */
149	+ public function get_fields(): array {
150	+ // The webhook value should always be empty.
151	+ tribe_remove_option( static::$option_webhooks_value );
152	+ $has_singing_key = tribe_get_option( static::$option_webhooks_signing_key );
153	+ $is_valid_signing_key = tribe_get_option( static::$option_is_valid_webhooks, false );
154	+
155	+ if ( ! $has_singing_key \|\| ! $is_valid_signing_key ) {
156	+ $signing_key_tooltip = '<span class="dashicons dashicons-no"></span><span class="tribe-field-tickets-commerce-stripe-webhooks-signing-key-status">' . esc_html__( 'Webhooks not validated yet.', 'event-tickets' ) . '</span>';
157	+ } else {
158	+ $signing_key_tooltip = '<span class="dashicons dashicons-yes"></span><span class="tribe-field-tickets-commerce-stripe-webhooks-signing-key-status">' . esc_html__( 'Webhooks were properly validated for sales.', 'event-tickets' ) . '</span>';
159	+ }
160	+
161	+ if ( tribe( Merchant::class )->is_sandbox() ) {
162	+ $signing_key_tooltip .= '<br /><b>' . esc_html__( 'Webhook validation will not work in Tickets Commerce test mode.', 'event-tickets' ) . '</b>';
163	+ }
164	+
165	+ return [
166	+ 'tickets-commerce-gateway-settings-group-start-webhook' => [
167	+ 'type' => 'html',
168	+ 'html' => '<div class="tribe-settings-form-wrap">',
169	+ ],
170	+ 'tickets-commerce-gateway-settings-group-header-webhook' => [
171	+ 'type' => 'html',
172	+ 'html' => '<h4 class="tec-tickets__admin-settings-tickets-commerce-gateway-group-header">' . esc_html__( 'Webhooks', 'event-tickets' ) . '</h4><div class="clear"></div>',
173	+ ],
174	+ 'tickets-commerce-gateway-settings-group-description-webhook' => [
175	+ 'type' => 'html',
176	+ 'html' => '<p class="tec-tickets__admin-settings-tickets-commerce-gateway-group-description-stripe-webhooks contained">' .
177	+ wp_kses_post(
178	+ sprintf(
179	+ // Translators: %1$s A link to the KB article. %2$s closing `</a>` link.
180	+ __( 'Setting up webhooks will enable you to receive notifications on charge statuses and keep order information up to date for asynchronous payments. %1$sLearn more%2$s', 'event-tickets' ),
181	+ '<a target="_blank" rel="noopener noreferrer" href="https://evnt.is/1b3p">',
182	+ '</a>'
183	+ )
184	+ )
185	+ . '</p><div class="clear"></div>',
186	+ ],
187	+ static::$option_webhooks_value => [
188	+ 'type' => 'text',
189	+ 'label' => esc_html__( 'Webhooks URL', 'event-tickets' ),
190	+ 'tooltip' => '',
191	+ 'size' => 'large',
192	+ 'default' => tribe( Webhook_Endpoint::class )->get_route_url(),
193	+ 'attributes' => [
194	+ 'readonly' => 'readonly',
195	+ 'class' => 'tribe-field-tickets-commerce-stripe-webhooks-copy-value',
196	+ ],
197	+ ],
198	+ static::$option_webhooks_signing_key => [
199	+ 'type' => 'text',
200	+ 'label' => esc_html__( 'Signing Secret', 'event-tickets' ),
201	+ 'tooltip' => $signing_key_tooltip,
202	+ 'size' => 'large',
203	+ 'default' => '',
204	+ 'validation_callback' => 'is_string',
205	+ 'validation_type' => 'textarea',
206	+ 'attributes' => [
207	+ 'data-ajax-nonce' => wp_create_nonce( static::$nonce_key_handle_validation ),
208	+ 'data-loading-text' => esc_attr__( 'Validating signing key with Stripe, please wait.', 'event-tickets' ),
209	+ 'data-ajax-action' => 'tec_tickets_commerce_gateway_stripe_test_webhooks',
210	+ ],
211	+ ],
212	+ 'tickets-commerce-gateway-settings-group-end-webhook' => [
213	+ 'type' => 'html',
214	+ 'html' => '<div class="clear"></div></div>',
215	+ ],
216	+ ];
217	+ }
218	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/Account_Webhook.php ADDED Viewed

	@@ -0,0 +1,82 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Webhook_Event_Interface;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\Gateway;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\Merchant;
8	+ use TEC\Tickets\Commerce\Status\Status_Interface;
9	+
10	+ use WP_REST_Request;
11	+ use WP_REST_Response;
12	+
13	+ /**
14	+ * Webhook for Account operations
15	+ *
16	+ * @since 5.3.0
17	+ *
18	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\Webhooks
19	+ */
20	+ class Account_Webhook implements Webhook_Event_Interface {
21	+
22	+ /**
23	+ * Handler for Stripe webhook events in the payment_intent family.
24	+ *
25	+ * @since 5.3.0
26	+ *
27	+ * @param array $event
28	+ * @param Status_Interface $new_status
29	+ * @param WP_REST_Request $request
30	+ *
31	+ * @return bool
32	+ */
33	+ public static function handle( array $event, Status_Interface $new_status, WP_REST_Request $request, WP_REST_Response $response ): bool {
34	+ return true;
35	+ }
36	+
37	+ /**
38	+ * Process the webhook and just return a valid WP_REST_Response.
39	+ *
40	+ * These will be directly sent to the Rest API.
41	+ *
42	+ * @since 5.3.0
43	+ *
44	+ * @param WP_REST_Request $request
45	+ * @param WP_REST_Response $response
46	+ *
47	+ * @return WP_REST_Response
48	+ */
49	+ public static function handle_account_updated( WP_REST_Request $request, WP_REST_Response $response ): WP_REST_Response {
50	+ return $response;
51	+ }
52	+
53	+ /**
54	+ * @todo We need to figure out what happens when this is the case.
55	+ *
56	+ * These will be directly sent to the Rest API.
57	+ *
58	+ * @since 5.3.0
59	+ *
60	+ * @param WP_REST_Request $request
61	+ * @param WP_REST_Response $response
62	+ *
63	+ * @return \WP_REST_Response\|\WP_Error
64	+ */
65	+ public static function handle_account_deauthorized( WP_REST_Request $request, WP_REST_Response $response ) {
66	+
67	+ $params = $request->get_json_params();
68	+ $account_id = $params['account'];
69	+ $current_id = tribe( Merchant::class )->get_client_id();
70	+
71	+ if ( $account_id !== $current_id ) {
72	+ return new \WP_Error( '400', __( 'Account deauthorized is not the same as account connected.', 'event-tickets' ) );
73	+ }
74	+
75	+
76	+ tribe( Merchant::class )->set_merchant_deauthorized( 'tc-stripe-account-disconnected' );
77	+ tribe( Merchant::class )->delete_signup_data();
78	+ Gateway::disable();
79	+
80	+ return $response;
81	+ }
82	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/Charge_Webhook.php ADDED Viewed

	@@ -0,0 +1,55 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
4	+
5	+ use TEC\Tickets\Commerce\Order;
6	+ use TEC\Tickets\Commerce\Status\Status_Interface;
7	+ use TEC\Tickets\Commerce\Gateways\Contracts\Webhook_Event_Interface;
8	+
9	+ /**
10	+ * Webhook for Charge operations.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\Webhooks
15	+ */
16	+ class Charge_Webhook implements Webhook_Event_Interface {
17	+
18	+ /**
19	+ * @inheritDoc
20	+ */
21	+ public static function handle( array $event, Status_Interface $new_status, \WP_REST_Request $request, \WP_REST_Response $response ) {
22	+ $charge_data = static::get_charge_data( $event );
23	+ $payment_intent_id = $charge_data['payment_intent'];
24	+
25	+ $order = tribe( Order::class )->get_from_gateway_order_id( $payment_intent_id );
26	+
27	+ if ( empty( $order ) ) {
28	+ return new \WP_Error( 200, sprintf(
29	+ // Translators: %s is the payment intent id.
30	+ __( 'Payment Intent %s does not correspond to a known order.', 'event-tickets' ),
31	+ esc_html( $payment_intent_id )
32	+ ) );
33	+ }
34	+
35	+ $meta = [
36	+ 'gateway_payload' => $charge_data,
37	+ 'gateway_order_id' => $payment_intent_id,
38	+ ];
39	+
40	+ return Handler::update_order_status( $order, $new_status, $meta );
41	+ }
42	+
43	+ /**
44	+ * Get the charge object array from the webhook event data.
45	+ *
46	+ * @since 5.3.0
47	+ *
48	+ * @param array $event Event data coming from the Webhook.
49	+ *
50	+ * @return string
51	+ */
52	+ protected static function get_charge_data( array $event ): array {
53	+ return $event['data']['object'];
54	+ }
55	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php ADDED Viewed

	@@ -0,0 +1,283 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
4	+
5	+ use TEC\Tickets\Commerce\Status as Commerce_Status;
6	+
7	+ /**
8	+ * Class Webhook Events.
9	+ *
10	+ * @link https://stripe.com/docs/api/webhook_endpoints/create#create_webhook_endpoint-enabled_events
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\Webhooks
15	+ */
16	+ class Events {
17	+
18	+ /**
19	+ * Webhook Event name for when an application is deauthorized from the dashboard.
20	+ *
21	+ * @link https://stripe.com/docs/api/payment_intents/object
22	+ * @link https://stripe.com/docs/api/events/types#event_types-account.application.deauthorized
23	+ *
24	+ * @since 5.3.0
25	+ *
26	+ * @var string
27	+ */
28	+ public const ACCOUNT_APPLICATION_DEAUTHORIZED = 'account.application.deauthorized';
29	+
30	+ /**
31	+ * Webhook Event name when the account was updated.
32	+ *
33	+ * @since 5.3.0
34	+ *
35	+ * @var string
36	+ */
37	+ public const ACCOUNT_UPDATED = 'account.updated';
38	+
39	+ /**
40	+ * Webhook Event name for when a charge expires before being captured.
41	+ *
42	+ * @since 5.3.0
43	+ *
44	+ * @var string
45	+ */
46	+ public const CHARGE_EXPIRED = 'charge.expired';
47	+
48	+ /**
49	+ * Webhook Event name for when a charge capture fails.
50	+ *
51	+ * @since 5.3.0
52	+ *
53	+ * @var string
54	+ */
55	+ public const CHARGE_FAILED = 'charge.failed';
56	+
57	+ /**
58	+ * Webhook Event name for when a charge is refunded.
59	+ *
60	+ * @since 5.3.0
61	+ *
62	+ * @var string
63	+ */
64	+ public const CHARGE_REFUNDED = 'charge.refunded';
65	+
66	+ /**
67	+ * Webhook Event name for when a charge is completed.
68	+ *
69	+ * @since 5.3.0
70	+ *
71	+ * @var string
72	+ */
73	+ public const CHARGE_SUCCEEDED = 'charge.succeeded';
74	+
75	+ /**
76	+ * Webhook Event name for a payment intent that was canceled.
77	+ *
78	+ * @link https://stripe.com/docs/api/payment_intents/object
79	+ *
80	+ * @since 5.3.0
81	+ *
82	+ * @var string
83	+ */
84	+ public const PAYMENT_INTENT_CANCELED = 'payment_intent.canceled';
85	+
86	+ /**
87	+ * Webhook Event name for a payment intent that was created.
88	+ *
89	+ * @link https://stripe.com/docs/api/payment_intents/object
90	+ *
91	+ * @since 5.3.0
92	+ *
93	+ * @var string
94	+ */
95	+ public const PAYMENT_INTENT_CREATED = 'payment_intent.created';
96	+
97	+ /**
98	+ * Webhook Event name for a payment intent that failed to create a charge.
99	+ *
100	+ * @link https://stripe.com/docs/api/payment_intents/object
101	+ *
102	+ * @since 5.3.0
103	+ *
104	+ * @var string
105	+ */
106	+ public const PAYMENT_INTENT_PAYMENT_FAILED = 'payment_intent.payment_failed';
107	+
108	+ /**
109	+ * Webhook Event name for a payment intent that is in process.
110	+ *
111	+ * @link https://stripe.com/docs/api/payment_intents/object
112	+ *
113	+ * @since 5.3.0
114	+ *
115	+ * @var string
116	+ */
117	+ public const PAYMENT_INTENT_PROCESSING = 'payment_intent.processing';
118	+
119	+ /**
120	+ * Webhook Event name for a payment intent that requires user action to complete a charge.
121	+ *
122	+ * @link https://stripe.com/docs/api/payment_intents/object
123	+ *
124	+ * @since 5.3.0
125	+ *
126	+ * @var string
127	+ */
128	+ public const PAYMENT_INTENT_REQUIRES_ACTION = 'payment_intent.requires_action';
129	+
130	+ /**
131	+ * Webhook Event name for a payment intent that has successfully completed.
132	+ *
133	+ * @link https://stripe.com/docs/api/payment_intents/object
134	+ *
135	+ * @since 5.3.0
136	+ *
137	+ * @var string
138	+ */
139	+ public const PAYMENT_INTENT_SUCCEEDED = 'payment_intent.succeeded';
140	+
141	+ /**
142	+ * Returns the handle to be used for each webhook event.
143	+ *
144	+ * @since 5.3.0
145	+ *
146	+ * @return array
147	+ */
148	+ public static function get_event_handlers(): array {
149	+ $handlers = [
150	+ static::ACCOUNT_UPDATED => [ Account_Webhook::class, 'handle_account_updated' ],
151	+ static::ACCOUNT_APPLICATION_DEAUTHORIZED => [ Account_Webhook::class, 'handle_account_deauthorized' ],
152	+ static::CHARGE_EXPIRED => [ Charge_Webhook::class, 'handle' ],
153	+ static::CHARGE_FAILED => [ Charge_Webhook::class, 'handle' ],
154	+ static::CHARGE_REFUNDED => [ Charge_Webhook::class, 'handle' ],
155	+ static::CHARGE_SUCCEEDED => [ Charge_Webhook::class, 'handle' ],
156	+ static::PAYMENT_INTENT_PROCESSING => [ Payment_Intent_Webhook::class, 'handle' ],
157	+ static::PAYMENT_INTENT_REQUIRES_ACTION => [ Payment_Intent_Webhook::class, 'handle' ],
158	+ static::PAYMENT_INTENT_SUCCEEDED => [ Payment_Intent_Webhook::class, 'handle' ],
159	+ static::PAYMENT_INTENT_PAYMENT_FAILED => [ Payment_Intent_Webhook::class, 'handle' ],
160	+ static::PAYMENT_INTENT_CANCELED => [ Payment_Intent_Webhook::class, 'handle' ],
161	+ ];
162	+
163	+ /**
164	+ * Allows filtering of the Webhook map of events-to-handler-functions for each one of the types we listen for.
165	+ *
166	+ * @since 5.3.0
167	+ *
168	+ * @param array $events The default map of event handler functions.
169	+ */
170	+ return (array) apply_filters( 'tec_tickets_commerce_gateway_stripe_webhook_event_handlers', $handlers );
171	+ }
172	+
173	+ /**
174	+ * Returns a list of all valid webhook events.
175	+ * If it converts directly to a TC status it will be the status Class name, otherwise it will be callable.
176	+ *
177	+ * @since 5.3.0
178	+ *
179	+ * @return callable[]\|Commerce_Status\Status_Interface[]
180	+ */
181	+ public static function get_event_transition_status(): array {
182	+ $events = [
183	+ static::CHARGE_EXPIRED => Commerce_Status\Not_Completed::class,
184	+ static::CHARGE_FAILED => Commerce_Status\Denied::class,
185	+ static::CHARGE_REFUNDED => Commerce_Status\Refunded::class,
186	+ static::CHARGE_SUCCEEDED => Commerce_Status\Completed::class,
187	+ static::PAYMENT_INTENT_CANCELED => Commerce_Status\Denied::class,
188	+ static::PAYMENT_INTENT_CREATED => Commerce_Status\Created::class,
189	+ static::PAYMENT_INTENT_PAYMENT_FAILED => Commerce_Status\Not_Completed::class,
190	+ static::PAYMENT_INTENT_PROCESSING => Commerce_Status\Pending::class,
191	+ static::PAYMENT_INTENT_REQUIRES_ACTION => Commerce_Status\Action_Required::class,
192	+ static::PAYMENT_INTENT_SUCCEEDED => Commerce_Status\Completed::class,
193	+ ];
194	+
195	+ /**
196	+ * Allows filtering of the Webhook map of events-to-statuses for each one of the types we listen for.
197	+ *
198	+ * @since 5.3.0
199	+ *
200	+ * @param array $events The default map of which event statuses.
201	+ */
202	+ return (array) apply_filters( 'tec_tickets_commerce_gateway_stripe_webhook_status', $events );
203	+ }
204	+
205	+ /**
206	+ * Return webhook label's "Nice name", it's only applicable if the webhook converts to a status.
207	+ *
208	+ * @since 5.3.0
209	+ *
210	+ * @param string $event_name A Stripe Event String.
211	+ *
212	+ * @return string The Webhook label, false on error.
213	+ */
214	+ public function get_webhook_label( string $event_name ): string {
215	+ $labels = [
216	+ static::PAYMENT_INTENT_CANCELED => __( 'Canceled payments', 'event-tickets' ),
217	+ static::PAYMENT_INTENT_CREATED => __( 'Created payments', 'event-tickets' ),
218	+ static::PAYMENT_INTENT_PAYMENT_FAILED => __( 'Failed payments', 'event-tickets' ),
219	+ static::PAYMENT_INTENT_PROCESSING => __( 'Pending payments', 'event-tickets' ),
220	+ static::PAYMENT_INTENT_REQUIRES_ACTION => __( 'Action required payments', 'event-tickets' ),
221	+ static::PAYMENT_INTENT_SUCCEEDED => __( 'Successful payments', 'event-tickets' ),
222	+ ];
223	+
224	+ /**
225	+ * Allows filtering of the Webhook map of events for each one of the types we listen for.
226	+ *
227	+ * @since 5.3.0
228	+ *
229	+ * @param array $labels The default map of which event types that translate to a given label string.
230	+ * @param string $event_name Which event name we are looking for.
231	+ */
232	+ $labels = apply_filters( 'tec_tickets_commerce_gateway_stripe_webhook_events_labels_map', $labels, $event_name );
233	+
234	+ if ( ! static::is_valid( $event_name ) ) {
235	+ return '';
236	+ }
237	+
238	+ if ( isset( $labels[ $event_name ] ) ) {
239	+ return $labels[ $event_name ];
240	+ }
241	+
242	+ return '';
243	+ }
244	+
245	+ /**
246	+ * Checks if a given Stripe webhook event name is valid.
247	+ *
248	+ * @since 5.3.0
249	+ *
250	+ * @param string $event_name A Stripe Event String.
251	+ *
252	+ * @return bool
253	+ */
254	+ public static function is_valid( string $event_name ): bool {
255	+ $events_map = static::get_event_handlers();
256	+
257	+ return isset( $events_map[ $event_name ] );
258	+ }
259	+
260	+ /**
261	+ * Converts a valid Stripe webhook event name into a commerce status object.
262	+ *
263	+ * @since 5.3.0
264	+ *
265	+ * @param string $event_name A Stripe Event String.
266	+ *
267	+ * @return false\|Commerce_Status\Status_Interface\|null
268	+ */
269	+ public function convert_to_commerce_status( string $event_name ) {
270	+ if ( ! static::is_valid( $event_name ) ) {
271	+ return false;
272	+ }
273	+
274	+ $events = static::get_event_transition_status();
275	+
276	+ if ( ! isset( $events[ $event_name ] ) ) {
277	+ return false;
278	+ }
279	+
280	+ return tribe( Commerce_Status\Status_Handler::class )->get_by_class( $events[ $event_name ] );
281	+ }
282	+
283	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php ADDED Viewed

	@@ -0,0 +1,134 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
4	+
5	+ use TEC\Tickets\Commerce\Status as Commerce_Status;
6	+ use TEC\Tickets\Commerce\Order;
7	+
8	+ use Tribe__Utils__Array as Arr;
9	+
10	+ use WP_Error;
11	+ use WP_REST_Request;
12	+ use WP_REST_Response;
13	+
14	+ /**
15	+ * Class Handler
16	+ *
17	+ * @since 5.3.0
18	+ *
19	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\Webhooks
20	+ */
21	+ class Handler {
22	+
23	+ /**
24	+ * Process a given Stripe Webhook event, possibly updating the local order with the status sent by the request.
25	+ *
26	+ * These will be directly sent to the Rest API.
27	+ *
28	+ * @since 5.3.0
29	+ *
30	+ * @param WP_REST_Request $request
31	+ * @param WP_REST_Response $response
32	+ *
33	+ * @return WP_REST_Response\|WP_Error
34	+ */
35	+ public static function process_webhook_response( WP_REST_Request $request, WP_REST_Response $response ) {
36	+ $event = $request->get_json_params();
37	+ $object = Arr::get( $event, 'object' );
38	+ $type = Arr::get( $event, 'type' );
39	+ $id = Arr::get( $event, 'id' );
40	+
41	+ // Invalid event.
42	+ if ( empty( $type ) \|\| 'event' !== $object ) {
43	+ return new WP_Error( 'tec-tickets-commerce-stripe-webhook-invalid-payload', null, [ 'event' => $event ] );
44	+ }
45	+
46	+ // Check if the event type matches.
47	+ if ( ! Events::is_valid( $type ) ) {
48	+ tribe( 'logger' )->log_debug(
49	+ sprintf(
50	+ // Translators: %s: The Stripe payment event.
51	+ __( 'Invalid event type for webhook event: %s', 'event-tickets' ),
52	+ json_encode( $event )
53	+ ),
54	+ 'tickets-commerce-gateway-stripe'
55	+ );
56	+
57	+ $response->set_status( 200 );
58	+ $response->set_data(
59	+ sprintf(
60	+ // Translators: %1$s is the event id and %2$s is the event type name.
61	+ __( 'Event %1$s was received but events of type %2$s are not currently handled.', 'event-tickets' ),
62	+ esc_html( $id ),
63	+ esc_html( $type )
64	+ )
65	+ );
66	+
67	+ return $response;
68	+ }
69	+
70	+ $new_status = tribe( Events::class )->convert_to_commerce_status( $type );
71	+
72	+ // When it's not a status we return with the callback.
73	+ if ( ! $new_status instanceof Commerce_Status\Status_Interface ) {
74	+ $handlers_map = Events::get_event_handlers();
75	+
76	+ return $handlers_map[ $type ]( $request, $response );
77	+ }
78	+
79	+ // Define where this request should be processed and call that method.
80	+ $event_handler = static::get_handler_method_for_event( $type );
81	+
82	+ // Stripe webhooks don't care for anything other than our response codes
83	+ // 200 we're good. Anything else we're not.
84	+ if ( is_wp_error( $event_handler ) ) {
85	+ return $event_handler;
86	+ }
87	+
88	+ return call_user_func_array( $event_handler, [ $event, $new_status, $request, $response ] );
89	+ }
90	+
91	+ /**
92	+ * Get the class and method to call to handle this event.
93	+ *
94	+ * @since 5.3.0
95	+ *
96	+ * @param string $type The event type from Stripe.
97	+ *
98	+ * @return string\|WP_REST_Response
99	+ */
100	+ public static function get_handler_method_for_event( $type ) {
101	+ $handlers = Events::get_event_handlers();
102	+
103	+ if ( ! isset( $handlers[ $type ] ) ) {
104	+ return new WP_REST_Response(
105	+ sprintf(
106	+ // Translators: %1$s is the event type name.
107	+ __( 'Event was received but events of type %1$s are not currently handled.', 'event-tickets' ),
108	+ esc_html( $type )
109	+ ),
110	+ 200
111	+ );
112	+ }
113	+
114	+ return $handlers[ $type ];
115	+ }
116	+
117	+
118	+ /**
119	+ * Generic handler to update order statuses to a defined Status.
120	+ *
121	+ * @since 5.3.0
122	+ *
123	+ * @param \WP_Post $order The order to update.
124	+ * @param Commerce_Status\Status_Interface $status The new status to use.
125	+ * @param array $metadata Any new meta to save with the order.
126	+ *
127	+ * @throws \Tribe__Repository__Usage_Error
128	+ *
129	+ * @return bool\|WP_Error\|null
130	+ */
131	+ public static function update_order_status( \WP_Post $order, Commerce_Status\Status_Interface $status, array $metadata = [] ) {
132	+ return tribe( Order::class )->modify_status( $order->ID, $status->get_slug(), $metadata );
133	+ }
134	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php ADDED Viewed

	@@ -0,0 +1,126 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe\Webhooks;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Webhook_Event_Interface;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\Payment_Intent;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\Status;
8	+ use TEC\Tickets\Commerce\Order;
9	+ use TEC\Tickets\Commerce\Status\Status_Interface;
10	+
11	+ /**
12	+ * Webhook for Payment_Intent operations
13	+ *
14	+ * @since 5.3.0
15	+ *
16	+ * @package TEC\Tickets\Commerce\Gateways\Stripe\Webhooks
17	+ */
18	+ class Payment_Intent_Webhook implements Webhook_Event_Interface {
19	+
20	+ /**
21	+ * @inheritDoc
22	+ */
23	+ public static function handle( array $event, Status_Interface $new_status, \WP_REST_Request $request, \WP_REST_Response $response ) {
24	+ $payment_intent = static::get_payment_intent_data( $event );
25	+ $payment_intent_id = $payment_intent['id'];
26	+
27	+ if ( ! empty( $payment_intent['metadata']['order_id'] ) ) {
28	+ $order = tec_tc_get_order( $payment_intent['metadata']['order_id'] );
29	+ }
30	+
31	+ if ( empty( $order ) ) {
32	+ $order = tribe( Order::class )->get_from_gateway_order_id( $payment_intent_id );
33	+ }
34	+
35	+ if ( empty( $order ) ) {
36	+
37	+ if ( ! empty( $payment_intent['metadata'][ Payment_Intent::$test_metadata_key ] ) ) {
38	+ $response->set_status( 200 );
39	+ $response->set_data(
40	+ __( 'Payment Intent Test Successful', 'event-tickets' )
41	+ );
42	+
43	+ return $response;
44	+ }
45	+
46	+ return new \WP_Error( 400, sprintf(
47	+ // Translators: %s is the payment intent id.
48	+ __( 'Payment Intent %s does not correspond to a known order.', 'event-tickets' ),
49	+ esc_html( $payment_intent_id )
50	+ ) );
51	+ }
52	+
53	+ if ( ! static::should_payment_intent_be_updated( $payment_intent, $order->gateway_payload ) ) {
54	+ $response->set_status( 200 );
55	+ $response->set_data(
56	+ sprintf(
57	+ // Translators: %s is the payment intent id
58	+ __( 'Payment Intent %s does not require an update or is a duplicate of a past event.', 'event-tickets' ),
59	+ esc_html( $payment_intent_id )
60	+ )
61	+ );
62	+ }
63	+
64	+ $meta = [
65	+ 'gateway_payload' => $payment_intent,
66	+ 'gateway_order_id' => $payment_intent_id,
67	+ ];
68	+
69	+ return Handler::update_order_status( $order, $new_status, $meta );
70	+ }
71	+
72	+
73	+ /**
74	+ * Get the payment intent id from the webhook event data.
75	+ *
76	+ * @since 5.3.0
77	+ *
78	+ * @param array $event Event data coming from the Webhook.
79	+ *
80	+ * @return string
81	+ */
82	+ protected static function get_payment_intent_id( array $event ): string {
83	+ $payment_intent = static::get_payment_intent_data( $event );
84	+
85	+ return $payment_intent['id'];
86	+ }
87	+
88	+ /**
89	+ * Get the payment intent object array from the webhook event data.
90	+ *
91	+ * @since 5.3.0
92	+ *
93	+ * @param array $event Event data coming from the Webhook.
94	+ *
95	+ * @return string
96	+ */
97	+ protected static function get_payment_intent_data( array $event ): array {
98	+ return $event['data']['object'];
99	+ }
100	+
101	+ /**
102	+ * Checks if the payment intent contained in the event received has already been processed.
103	+ *
104	+ * @since 5.3.0
105	+ *
106	+ * @param array $payment_intent_received The payment intent data received
107	+ * @param array[] $payment_intents_stored The payment intent data stored from each update, keyed by status.
108	+ *
109	+ * @return bool
110	+ */
111	+ public static function should_payment_intent_be_updated( $payment_intent_received, $payment_intents_stored ) {
112	+ // This payment intent was reset, or processing has re-started without invalidating.
113	+ if ( 1 < count( $payment_intents_stored ) && $payment_intent_received['status'] === Status::REQUIRES_PAYMENT_METHOD ) {
114	+ return true;
115	+ }
116	+
117	+ foreach ( $payment_intents_stored as $intent ) {
118	+ // This payment intent has already been processed and updated.
119	+ if ( $payment_intent_received['id'] === $intent['id'] ) {
120	+ return false;
121	+ }
122	+ }
123	+
124	+ return true;
125	+ }
126	+ }

src/Tickets/Commerce/Gateways/Stripe/Webhooks/events.json ADDED Viewed

	@@ -0,0 +1,195 @@


1	+ {
2	+ "date_updated": "2022-02-11",
3	+ "from": "https://stripe.com/docs/api/webhook_endpoints/create#create_webhook_endpoint-enabled_events",
4	+ "status_enabled": [
5	+ "account.updated",
6	+ "payment_intent.amount_capturable_updated",
7	+ "payment_intent.canceled",
8	+ "payment_intent.created",
9	+ "payment_intent.payment_failed",
10	+ "payment_intent.processing",
11	+ "payment_intent.requires_action",
12	+ "payment_intent.succeeded"
13	+ ],
14	+ "status_available": {
15	+ "account.updated": "Occurs whenever an account status or property has changed.",
16	+ "account.application.authorized": "Occurs whenever a user authorizes an application. Sent to the related application only.",
17	+ "account.application.deauthorized": "Occurs whenever a user deauthorizes an application. Sent to the related application only.",
18	+ "account.external_account.created": "Occurs whenever an external account is created.",
19	+ "account.external_account.deleted": "Occurs whenever an external account is deleted.",
20	+ "account.external_account.updated": "Occurs whenever an external account is updated.",
21	+ "application_fee.created": "Occurs whenever an application fee is created on a charge.",
22	+ "application_fee.refunded": "Occurs whenever an application fee is refunded, whether from refunding a charge or from refunding the application fee directly. This includes partial refunds.",
23	+ "application_fee.refund.updated": "Occurs whenever an application fee refund is updated.",
24	+ "balance.available": "Occurs whenever your Stripe balance has been updated (e.g., when a charge is available to be paid out). By default, Stripe automatically transfers funds in your balance to your bank account on a daily basis.",
25	+ "billing_portal.configuration.created": "Occurs whenever a portal configuration is created.",
26	+ "billing_portal.configuration.updated": "Occurs whenever a portal configuration is updated.",
27	+ "capability.updated": "Occurs whenever a capability has new requirements or a new status.",
28	+ "charge.captured": "Occurs whenever a previously uncaptured charge is captured.",
29	+ "charge.expired": "Occurs whenever an uncaptured charge expires.",
30	+ "charge.failed": "Occurs whenever a failed charge attempt occurs.",
31	+ "charge.pending": "Occurs whenever a pending charge is created.",
32	+ "charge.refunded": "Occurs whenever a charge is refunded, including partial refunds.",
33	+ "charge.succeeded": "Occurs whenever a charge is successful.",
34	+ "charge.updated": "Occurs whenever a charge description or metadata is updated.",
35	+ "charge.dispute.closed": "Occurs when a dispute is closed and the dispute status changes to lost, warning_closed, or won.",
36	+ "charge.dispute.created": "Occurs whenever a customer disputes a charge with their bank.",
37	+ "charge.dispute.funds_reinstated": "Occurs when funds are reinstated to your account after a dispute is closed. This includes partially refunded payments.",
38	+ "charge.dispute.funds_withdrawn": "Occurs when funds are removed from your account due to a dispute.",
39	+ "charge.dispute.updated": "Occurs when the dispute is updated (usually with evidence).",
40	+ "charge.refund.updated": "Occurs whenever a refund is updated, on selected payment methods.",
41	+ "checkout.session.async_payment_failed": "Occurs when a payment intent using a delayed payment method fails.",
42	+ "checkout.session.async_payment_succeeded": "Occurs when a payment intent using a delayed payment method finally succeeds.",
43	+ "checkout.session.completed": "Occurs when a Checkout Session has been successfully completed.",
44	+ "checkout.session.expired": "Occurs when a Checkout Session is expired.",
45	+ "coupon.created": "Occurs whenever a coupon is created.",
46	+ "coupon.deleted": "Occurs whenever a coupon is deleted.",
47	+ "coupon.updated": "Occurs whenever a coupon is updated.",
48	+ "credit_note.created": "Occurs whenever a credit note is created.",
49	+ "credit_note.updated": "Occurs whenever a credit note is updated.",
50	+ "credit_note.voided": "Occurs whenever a credit note is voided.",
51	+ "customer.created": "Occurs whenever a new customer is created.",
52	+ "customer.deleted": "Occurs whenever a customer is deleted.",
53	+ "customer.updated": "Occurs whenever any property of a customer changes.",
54	+ "customer.discount.created": "Occurs whenever a coupon is attached to a customer.",
55	+ "customer.discount.deleted": "Occurs whenever a coupon is removed from a customer.",
56	+ "customer.discount.updated": "Occurs whenever a customer is switched from one coupon to another.",
57	+ "customer.source.created": "Occurs whenever a new source is created for a customer.",
58	+ "customer.source.deleted": "Occurs whenever a source is removed from a customer.",
59	+ "customer.source.expiring": "Occurs whenever a card or source will expire at the end of the month.",
60	+ "customer.source.updated": "Occurs whenever a source’s details are changed.",
61	+ "customer.subscription.created": "Occurs whenever a customer is signed up for a new plan.",
62	+ "customer.subscription.deleted": "Occurs whenever a customer’s subscription ends.",
63	+ "customer.subscription.pending_update_applied": "Occurs whenever a customer’s subscription’s pending update is applied, and the subscription is updated.",
64	+ "customer.subscription.pending_update_expired": "Occurs whenever a customer’s subscription’s pending update expires before the related invoice is paid.",
65	+ "customer.subscription.trial_will_end": "Occurs three days before a subscription’s trial period is scheduled to end, or when a trial is ended immediately (using trial_end=now).",
66	+ "customer.subscription.updated": "Occurs whenever a subscription changes (e.g., switching from one plan to another, or changing the status from trial to active).",
67	+ "customer.tax_id.created": "Occurs whenever a tax ID is created for a customer.",
68	+ "customer.tax_id.deleted": "Occurs whenever a tax ID is deleted from a customer.",
69	+ "customer.tax_id.updated": "Occurs whenever a customer’s tax ID is updated.",
70	+ "file.created": "Occurs whenever a new Stripe-generated file is available for your account.",
71	+ "identity.verification_session.canceled": "Occurs whenever a VerificationSession is canceled.",
72	+ "identity.verification_session.created": "Occurs whenever a VerificationSession is created.",
73	+ "identity.verification_session.processing": "Occurs whenever a VerificationSession transitions to processing.",
74	+ "identity.verification_session.redacted": "Occurs whenever a VerificationSession is redacted.",
75	+ "identity.verification_session.requires_input": "Occurs whenever a VerificationSession transitions to require user input.",
76	+ "identity.verification_session.verified": "Occurs whenever a VerificationSession transitions to verified.",
77	+ "invoice.created": "Occurs whenever a new invoice is created. To learn how webhooks can be used with this event, and how they can affect it, see Using Webhooks with Subscriptions.",
78	+ "invoice.deleted": "Occurs whenever a draft invoice is deleted.",
79	+ "invoice.finalization_failed": "Occurs whenever a draft invoice cannot be finalized. See the invoice’s last finalization error for details.",
80	+ "invoice.finalized": "Occurs whenever a draft invoice is finalized and updated to be an open invoice.",
81	+ "invoice.marked_uncollectible": "Occurs whenever an invoice is marked uncollectible.",
82	+ "invoice.paid": "Occurs whenever an invoice payment attempt succeeds or an invoice is marked as paid out-of-band.",
83	+ "invoice.payment_action_required": "Occurs whenever an invoice payment attempt requires further user action to complete.",
84	+ "invoice.payment_failed": "Occurs whenever an invoice payment attempt fails, due either to a declined payment or to the lack of a stored payment method.",
85	+ "invoice.payment_succeeded": "Occurs whenever an invoice payment attempt succeeds.",
86	+ "invoice.sent": "Occurs whenever an invoice email is sent out.",
87	+ "invoice.upcoming": "Occurs X number of days before a subscription is scheduled to create an invoice that is automatically charged—where X is determined by your subscriptions settings. Note: The received Invoice object will not have an invoice ID.",
88	+ "invoice.updated": "Occurs whenever an invoice changes (e.g., the invoice amount).",
89	+ "invoice.voided": "Occurs whenever an invoice is voided.",
90	+ "invoiceitem.created": "Occurs whenever an invoice item is created.",
91	+ "invoiceitem.deleted": "Occurs whenever an invoice item is deleted.",
92	+ "invoiceitem.updated": "Occurs whenever an invoice item is updated.",
93	+ "issuing_authorization.created": "Occurs whenever an authorization is created.",
94	+ "issuing_authorization.request": "Represents a synchronous request for authorization, see Using your integration to handle authorization requests.",
95	+ "issuing_authorization.updated": "Occurs whenever an authorization is updated.",
96	+ "issuing_card.created": "Occurs whenever a card is created.",
97	+ "issuing_card.updated": "Occurs whenever a card is updated.",
98	+ "issuing_cardholder.created": "Occurs whenever a cardholder is created.",
99	+ "issuing_cardholder.updated": "Occurs whenever a cardholder is updated.",
100	+ "issuing_dispute.closed": "Occurs whenever a dispute is won, lost or expired.",
101	+ "issuing_dispute.created": "Occurs whenever a dispute is created.",
102	+ "issuing_dispute.funds_reinstated": "Occurs whenever funds are reinstated to your account for an Issuing dispute.",
103	+ "issuing_dispute.submitted": "Occurs whenever a dispute is submitted.",
104	+ "issuing_dispute.updated": "Occurs whenever a dispute is updated.",
105	+ "issuing_transaction.created": "Occurs whenever an issuing transaction is created.",
106	+ "issuing_transaction.updated": "Occurs whenever an issuing transaction is updated.",
107	+ "mandate.updated": "Occurs whenever a Mandate is updated.",
108	+ "order.created": "Occurs whenever an order is created.",
109	+ "order.payment_failed": "Occurs whenever an order payment attempt fails.",
110	+ "order.payment_succeeded": "Occurs whenever an order payment attempt succeeds.",
111	+ "order.updated": "Occurs whenever an order is updated.",
112	+ "order_return.created": "Occurs whenever an order return is created.",
113	+ "payment_intent.amount_capturable_updated": "Occurs when a PaymentIntent has funds to be captured. Check the amount_capturable property on the PaymentIntent to determine the amount that can be captured. You may capture the PaymentIntent with an amount_to_capture value up to the specified amount. Learn more about capturing PaymentIntents.",
114	+ "payment_intent.canceled": "Occurs when a PaymentIntent is canceled.",
115	+ "payment_intent.created": "Occurs when a new PaymentIntent is created.",
116	+ "payment_intent.payment_failed": "Occurs when a PaymentIntent has failed the attempt to create a payment method or a payment.",
117	+ "payment_intent.processing": "Occurs when a PaymentIntent has started processing.",
118	+ "payment_intent.requires_action": "Occurs when a PaymentIntent transitions to requires_action state",
119	+ "payment_intent.succeeded": "Occurs when a PaymentIntent has successfully completed payment.",
120	+ "payment_link.created": "Occurs when a payment link is created.",
121	+ "payment_link.updated": "Occurs when a payment link is updated.",
122	+ "payment_method.attached": "Occurs whenever a new payment method is attached to a customer.",
123	+ "payment_method.automatically_updated": "Occurs whenever a payment method’s details are automatically updated by the network.",
124	+ "payment_method.detached": "Occurs whenever a payment method is detached from a customer.",
125	+ "payment_method.updated": "Occurs whenever a payment method is updated via the PaymentMethod update API.",
126	+ "payout.canceled": "Occurs whenever a payout is canceled.",
127	+ "payout.created": "Occurs whenever a payout is created.",
128	+ "payout.failed": "Occurs whenever a payout attempt fails.",
129	+ "payout.paid": "Occurs whenever a payout is expected to be available in the destination account. If the payout fails, a payout.failed notification is also sent, at a later time.",
130	+ "payout.updated": "Occurs whenever a payout is updated.",
131	+ "person.created": "Occurs whenever a person associated with an account is created.",
132	+ "person.deleted": "Occurs whenever a person associated with an account is deleted.",
133	+ "person.updated": "Occurs whenever a person associated with an account is updated.",
134	+ "plan.created": "Occurs whenever a plan is created.",
135	+ "plan.deleted": "Occurs whenever a plan is deleted.",
136	+ "plan.updated": "Occurs whenever a plan is updated.",
137	+ "price.created": "Occurs whenever a price is created.",
138	+ "price.deleted": "Occurs whenever a price is deleted.",
139	+ "price.updated": "Occurs whenever a price is updated.",
140	+ "product.created": "Occurs whenever a product is created.",
141	+ "product.deleted": "Occurs whenever a product is deleted.",
142	+ "product.updated": "Occurs whenever a product is updated.",
143	+ "promotion_code.created": "Occurs whenever a promotion code is created.",
144	+ "promotion_code.updated": "Occurs whenever a promotion code is updated.",
145	+ "quote.accepted": "Occurs whenever a quote is accepted.",
146	+ "quote.canceled": "Occurs whenever a quote is canceled.",
147	+ "quote.created": "Occurs whenever a quote is created.",
148	+ "quote.finalized": "Occurs whenever a quote is finalized.",
149	+ "radar.early_fraud_warning.created": "Occurs whenever an early fraud warning is created.",
150	+ "radar.early_fraud_warning.updated": "Occurs whenever an early fraud warning is updated.",
151	+ "recipient.created": "Occurs whenever a recipient is created.",
152	+ "recipient.deleted": "Occurs whenever a recipient is deleted.",
153	+ "recipient.updated": "Occurs whenever a recipient is updated.",
154	+ "reporting.report_run.failed": "Occurs whenever a requested ReportRun failed to complete.",
155	+ "reporting.report_run.succeeded": "Occurs whenever a requested ReportRun completed succesfully.",
156	+ "reporting.report_type.updated": "Occurs whenever a ReportType is updated (typically to indicate that a new day’s data has come available).",
157	+ "review.closed": "Occurs whenever a review is closed. The review’s reason field indicates why: approved, disputed, refunded, or refunded_as_fraud.",
158	+ "review.opened": "Occurs whenever a review is opened.",
159	+ "setup_intent.canceled": "Occurs when a SetupIntent is canceled.",
160	+ "setup_intent.created": "Occurs when a new SetupIntent is created.",
161	+ "setup_intent.requires_action": "Occurs when a SetupIntent is in requires_action state.",
162	+ "setup_intent.setup_failed": "Occurs when a SetupIntent has failed the attempt to setup a payment method.",
163	+ "setup_intent.succeeded": "Occurs when an SetupIntent has successfully setup a payment method.",
164	+ "sigma.scheduled_query_run.created": "Occurs whenever a Sigma scheduled query run finishes.",
165	+ "sku.created": "Occurs whenever a SKU is created.",
166	+ "sku.deleted": "Occurs whenever a SKU is deleted.",
167	+ "sku.updated": "Occurs whenever a SKU is updated.",
168	+ "source.canceled": "Occurs whenever a source is canceled.",
169	+ "source.chargeable": "Occurs whenever a source transitions to chargeable.",
170	+ "source.failed": "Occurs whenever a source fails.",
171	+ "source.mandate_notification": "Occurs whenever a source mandate notification method is set to manual.",
172	+ "source.refund_attributes_required": "Occurs whenever the refund attributes are required on a receiver source to process a refund or a mispayment.",
173	+ "source.transaction.created": "Occurs whenever a source transaction is created.",
174	+ "source.transaction.updated": "Occurs whenever a source transaction is updated.",
175	+ "subscription_schedule.aborted": "Occurs whenever a subscription schedule is canceled due to the underlying subscription being canceled because of delinquency.",
176	+ "subscription_schedule.canceled": "Occurs whenever a subscription schedule is canceled.",
177	+ "subscription_schedule.completed": "Occurs whenever a new subscription schedule is completed.",
178	+ "subscription_schedule.created": "Occurs whenever a new subscription schedule is created.",
179	+ "subscription_schedule.expiring": "Occurs 7 days before a subscription schedule will expire.",
180	+ "subscription_schedule.released": "Occurs whenever a new subscription schedule is released.",
181	+ "subscription_schedule.updated": "Occurs whenever a subscription schedule is updated.",
182	+ "tax_rate.created": "Occurs whenever a new tax rate is created.",
183	+ "tax_rate.updated": "Occurs whenever a tax rate is updated.",
184	+ "topup.canceled": "Occurs whenever a top-up is canceled.",
185	+ "topup.created": "Occurs whenever a top-up is created.",
186	+ "topup.failed": "Occurs whenever a top-up fails.",
187	+ "topup.reversed": "Occurs whenever a top-up is reversed.",
188	+ "topup.succeeded": "Occurs whenever a top-up succeeds.",
189	+ "transfer.created": "Occurs whenever a transfer is created.",
190	+ "transfer.failed": "Occurs whenever a transfer failed.",
191	+ "transfer.paid": "Occurs after a transfer is paid. For Instant Payouts, the event will typically be sent within 30 minutes.",
192	+ "transfer.reversed": "Occurs whenever a transfer is reversed, including partial reversals.",
193	+ "transfer.updated": "Occurs whenever a transfer’s description or metadata is updated."
194	+ }
195	+ }

src/Tickets/Commerce/Gateways/Stripe/WhoDat.php ADDED Viewed

	@@ -0,0 +1,99 @@


1	+ <?php
2	+
3	+ namespace TEC\Tickets\Commerce\Gateways\Stripe;
4	+
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_WhoDat;
6	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\On_Boarding_Endpoint;
7	+ use TEC\Tickets\Commerce\Gateways\Stripe\REST\Webhook_Endpoint;
8	+
9	+ /**
10	+ * Class WhoDat. Handles connection to Stripe when the platform keys are needed.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @package TEC\Tickets\Commerce\Gateways\Stripe
15	+ */
16	+ class WhoDat extends Abstract_WhoDat {
17	+
18	+ /**
19	+ * The API Path.
20	+ *
21	+ * @since 5.3.0
22	+ *
23	+ * @var string
24	+ */
25	+ public $api_endpoint = 'stripe';
26	+
27	+ /**
28	+ * Creates a new account link for the client and redirects the user to setup the account details.
29	+ *
30	+ * @since 5.3.0
31	+ *
32	+ * @return string
33	+ */
34	+ public function connect_account() {
35	+ $query_args = [
36	+ 'token' => urlencode( tribe( Gateway::class )->generate_unique_tracking_id() ),
37	+ 'return_url' => tribe( On_Boarding_Endpoint::class )->get_return_url(),
38	+ ];
39	+
40	+ $connection_url = $this->get( 'connect', $query_args );
41	+
42	+ wp_safe_redirect( $connection_url );
43	+ exit();
44	+ }
45	+
46	+ /**
47	+ * De-authorize the current seller account in Stripe oAuth.
48	+ *
49	+ * @since 5.3.0
50	+ *
51	+ * @return string
52	+ */
53	+ public function disconnect_account() {
54	+ $account_id = tribe( Merchant::class )->get_account_id();
55	+
56	+ $return_url = tribe( On_Boarding_Endpoint::class )->get_return_url();
57	+ $query_args = [
58	+ 'stripe_user_id' => $account_id,
59	+ 'return_url' => esc_url( $return_url ),
60	+ ];
61	+
62	+ return $this->get( 'disconnect', $query_args );
63	+ }
64	+
65	+ /**
66	+ * Register a newly connected stripe account to the website.
67	+ *
68	+ * @since 5.3.0
69	+ *
70	+ * @param array $account_data array of data returned from stripe after a successful connection.
71	+ */
72	+ public function onboard_account( $account_data ) {
73	+
74	+ $query_args = [
75	+ 'grant_type' => 'authorization_code',
76	+ 'code' => $account_data['code'],
77	+ ];
78	+
79	+ return $this->get( 'token', $query_args );
80	+ }
81	+
82	+ /**
83	+ * Requests WhoDat to refresh the oAuth tokens.
84	+ *
85	+ * @since 5.3.0
86	+ *
87	+ * @return string
88	+ */
89	+ public function refresh_token() {
90	+ $refresh_token = tribe( Gateway::class )->get_current_refresh_token();
91	+
92	+ $query_args = [
93	+ 'grant_type' => 'refresh_token',
94	+ 'refresh_token' => $refresh_token,
95	+ ];
96	+
97	+ return $this->get( 'token', $query_args );
98	+ }
99	+ }

src/Tickets/Commerce/Hooks.php CHANGED Viewed

	@@ -22,6 +22,7 @@ use TEC\Tickets\Commerce as Base_Commerce;
22	use TEC\Tickets\Commerce\Reports\Orders;
23	use TEC\Tickets\Commerce\Status\Completed;
24	use TEC\Tickets\Commerce\Status\Status_Interface;

25	use WP_Admin_Bar;
26
27	/**
	@@ -123,6 +124,21 @@ class Hooks extends tad_DI52_ServiceProvider {
123	add_filter( 'tribe_template_context:tickets-plus/v2/tickets/submit/button-modal', [ $this, 'filter_showing_cart_button' ] );
124
125	add_filter( 'tec_tickets_commerce_payments_tab_settings', [ $this, 'filter_payments_tab_settings' ] );















126	}
127
128	/**


22	use TEC\Tickets\Commerce\Reports\Orders;
23	use TEC\Tickets\Commerce\Status\Completed;
24	use TEC\Tickets\Commerce\Status\Status_Interface;
25	+ use TEC\Tickets\Commerce\Payments_Tab;
26	use WP_Admin_Bar;
27
28	/**

124	add_filter( 'tribe_template_context:tickets-plus/v2/tickets/submit/button-modal', [ $this, 'filter_showing_cart_button' ] );
125
126	add_filter( 'tec_tickets_commerce_payments_tab_settings', [ $this, 'filter_payments_tab_settings' ] );
127	+
128	+ add_filter( 'wp_redirect', [ $this, 'filter_redirect_url' ] );
129	+ }
130	+
131	+ /**
132	+ * Filters the redirect URL to determine whether or not section key needs to be added.
133	+ *
134	+ * @since 5.3.0
135	+ *
136	+ * @param string $url Redirect URL.
137	+ *
138	+ * @return string
139	+ */
140	+ public function filter_redirect_url( $url ) {
141	+ return $this->container->make( Payments_Tab::class )->filter_redirect_url( $url );
142	}
143
144	/**

src/Tickets/Commerce/Module.php CHANGED Viewed

	@@ -11,7 +11,7 @@ use Tribe__Utils__Array as Arr;
11	*
12	* @since 5.1.9
13	*
14	- * @package TEC\Tickets\Commerce~~\Gateways\PayPal~~
15	*/
16	class Module extends \Tribe__Tickets__Tickets {
17


11	*
12	* @since 5.1.9
13	*
14	+ * @package TEC\Tickets\Commerce
15	*/
16	class Module extends \Tribe__Tickets__Tickets {
17

src/Tickets/Commerce/Order.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	namespace TEC\Tickets\Commerce;
4
5	- use TEC\Tickets\Commerce\Gateways\~~Interface_Gateway~~;
6	use TEC\Tickets\Commerce\Utils\Value;
7	use Tribe__Date_Utils as Dates;
8
	@@ -298,6 +298,34 @@ class Order extends Abstract_Order {
298	return (bool) $updated;
299	}
300




























301	/**
302	* Creates a order from the items in the cart.
303	*
	@@ -307,7 +335,7 @@ class Order extends Abstract_Order {
307	*
308	* @return false\|\WP_Post
309	*/
310	- public function create_from_cart( ~~Interface_Gateway~~ $gateway, $purchaser = null ) {
311	$cart = tribe( Cart::class );
312
313	$items = $cart->get_items_in_cart();
	@@ -330,29 +358,19 @@ class Order extends Abstract_Order {
330	$total = $this->get_value_total( array_filter( $items ) );
331
332	$order_args = [
333	- 'title' => $this->generate_order_title( $items, $cart->get_cart_hash() ),
334	- 'total_value' => $total->get_decimal(),
335	- 'items' => $items,
336	- 'gateway' => $gateway::get_key(),
337	- 'hash' => $cart->get_cart_hash(),
338	- 'currency' => Utils\Currency::get_currency_code(),





339	];
340
341	- // When purchaser data-set is not passed we pull from the current user.
342	- if ( empty( $purchaser ) && is_user_logged_in() && $user = wp_get_current_user() ) {
343	- $order_args['purchaser_user_id'] = $user->ID;
344	- $order_args['purchaser_full_name'] = $user->first_name . ' ' . $user->last_name;
345	- $order_args['purchaser_first_name'] = $user->first_name;
346	- $order_args['purchaser_last_name'] = $user->last_name;
347	- $order_args['purchaser_email'] = $user->user_email;
348	- } elseif ( empty( $purchaser ) ) {
349	- $order_args['purchaser_user_id'] = 0;
350	- $order_args['purchaser_full_name'] = static::$placeholder_name;
351	- $order_args['purchaser_first_name'] = static::$placeholder_name;
352	- $order_args['purchaser_last_name'] = static::$placeholder_name;
353	- $order_args['purchaser_email'] = '';
354	- }
355	-
356	$order = $this->create( $gateway, $order_args );
357
358	// We were unable to create the order bail from here.
	@@ -368,14 +386,14 @@ class Order extends Abstract_Order {
368	*
369	* @since 5.2.0
370	*
371	- * @~~throws~~ ~~\Tribe__Repository__Usage_Error~~
372	- *
373	- * @param Interface_Gateway $gateway
374	* @param array $args
375	*


376	* @return false\|\WP_Post
377	*/
378	- public function create( ~~Interface_Gateway~~ $gateway, $args ) {
379	$gateway_key = $gateway::get_key();
380
381	/**
	@@ -384,7 +402,7 @@ class Order extends Abstract_Order {
384	* @since 5.2.0
385	*
386	* @param array $args
387	- * @param ~~Interface_Gateway~~ $gateway
388	*/
389	$args = apply_filters( "tec_tickets_commerce_order_{$gateway_key}_create_args", $args, $gateway );
390
	@@ -394,7 +412,7 @@ class Order extends Abstract_Order {
394	* @since 5.2.0
395	*
396	* @param array $args
397	- * @param ~~Interface_Gateway~~ $gateway
398	*/
399	$args = apply_filters( 'tec_tickets_commerce_order_create_args', $args, $gateway );
400
	@@ -526,4 +544,20 @@ class Order extends Abstract_Order {
526
527	return static::POSTTYPE === $order->post_type;
528	}
















529	}


2
3	namespace TEC\Tickets\Commerce;
4
5	+ use TEC\Tickets\Commerce\Gateways\Contracts\Gateway_Interface;
6	use TEC\Tickets\Commerce\Utils\Value;
7	use Tribe__Date_Utils as Dates;
8

298	return (bool) $updated;
299	}
300
301	+ /**
302	+ * Prepares an array of cart items ready to go into an Order.
303	+ *
304	+ * @since 5.3.0
305	+ *
306	+ * @param Cart $cart The cart instance to get items from.
307	+ *
308	+ * @return array
309	+ */
310	+ public function prepare_cart_items_for_order( Cart $cart ) {
311	+ return array_map(
312	+ static function ( $item ) {
313	+ /** @var Value $ticket_value */
314	+ $ticket_value = tribe( Ticket::class )->get_price_value( $item['ticket_id'] );
315	+
316	+ if ( null === $ticket_value ) {
317	+ return null;
318	+ }
319	+
320	+ $item['price'] = (string) $ticket_value->get_decimal();
321	+ $item['sub_total'] = (string) $ticket_value->sub_total( $item['quantity'] )->get_decimal();
322	+
323	+ return $item;
324	+ },
325	+ $cart->get_items_in_cart()
326	+ );
327	+ }
328	+
329	/**
330	* Creates a order from the items in the cart.
331	*

335	*
336	* @return false\|\WP_Post
337	*/
338	+ public function create_from_cart( Gateway_Interface $gateway, $purchaser = null ) {
339	$cart = tribe( Cart::class );
340
341	$items = $cart->get_items_in_cart();

358	$total = $this->get_value_total( array_filter( $items ) );
359
360	$order_args = [
361	+ 'title' => $this->generate_order_title( $items, $cart->get_cart_hash() ),
362	+ 'total_value' => $total->get_decimal(),
363	+ 'items' => $items,
364	+ 'gateway' => $gateway::get_key(),
365	+ 'hash' => $cart->get_cart_hash(),
366	+ 'currency' => Utils\Currency::get_currency_code(),
367	+ 'purchaser_user_id' => $purchaser['purchaser_user_id'],
368	+ 'purchaser_full_name' => $purchaser['purchaser_full_name'],
369	+ 'purchaser_first_name' => $purchaser['purchaser_first_name'],
370	+ 'purchaser_last_name' => $purchaser['purchaser_last_name'],
371	+ 'purchaser_email' => $purchaser['purchaser_email'],
372	];
373















374	$order = $this->create( $gateway, $order_args );
375
376	// We were unable to create the order bail from here.

386	*
387	* @since 5.2.0
388	*
389	+ * @param Gateway_Interface $gateway


390	* @param array $args
391	*
392	+ * @throws \Tribe__Repository__Usage_Error
393	+ *
394	* @return false\|\WP_Post
395	*/
396	+ public function create( Gateway_Interface $gateway, $args ) {
397	$gateway_key = $gateway::get_key();
398
399	/**

402	* @since 5.2.0
403	*
404	* @param array $args
405	+ * @param Gateway_Interface $gateway
406	*/
407	$args = apply_filters( "tec_tickets_commerce_order_{$gateway_key}_create_args", $args, $gateway );
408

412	* @since 5.2.0
413	*
414	* @param array $args
415	+ * @param Gateway_Interface $gateway
416	*/
417	$args = apply_filters( 'tec_tickets_commerce_order_create_args', $args, $gateway );
418

544
545	return static::POSTTYPE === $order->post_type;
546	}
547	+
548	+ /**
549	+ * Get the order associated with a given gateway order id.
550	+ *
551	+ * @since 5.3.0
552	+ *
553	+ * @param string $gateway_order_id The gateway order id.
554	+ *
555	+ * @return mixed\|\WP_Post\|null
556	+ */
557	+ public function get_from_gateway_order_id( string $gateway_order_id ) {
558	+ return tec_tc_orders()->by_args( [
559	+ 'status' => 'any',
560	+ 'gateway_order_id' => $gateway_order_id,
561	+ ] )->first();
562	+ }
563	}

src/Tickets/Commerce/Payments_Tab.php CHANGED Viewed

@@ -4,13 +4,18 @@ namespace TEC\Tickets\Commerce;
             use TEC\Tickets\Commerce\Shortcodes\Checkout_Shortcode;
             use TEC\Tickets\Commerce\Shortcodes\Success_Shortcode;
             use TEC\Tickets\Settings as Tickets_Settings;
             use \tad_DI52_ServiceProvider;
             /**
              * Class Payments_Tab
+             *
-            -
             * @since 5.2.0
+             *
              * @package TEC\Tickets\Commerce
              */
@@ -34,6 +39,52 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
             	 */
             	public static $option_page_created_meta_key = 'tec_tc_payments_page_created';
             	/**
             	 * @inheritdoc
             	 */
@@ -49,7 +100,7 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
             	public function register_tab() {
             		$tab_settings = [
             			'priority'  => 25,
-            -
            			'fields'    => $this->get_top_level_settings(),
             			'show_save' => true,
             		];
@@ -58,65 +109,292 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
             		new \Tribe__Settings_Tab( static::$slug, esc_html__( 'Payments', 'event-tickets' ), $tab_settings );
+            	}
             	/**
-            -
            	 * Gets the top level settings for Tickets Commerce.
+            	 *
-            -
            	 * @since 5.2.0
+            	 *
             	 * @return array[]
             	 */
-            -
            	public function get_top_level_settings() {
-            -
            		$plus_link    = sprintf(
             			'<a href="https://evnt.is/19zl" target="_blank" rel="noopener noreferrer">%s</a>',
             			esc_html__( 'Event Tickets Plus', 'event-tickets' )
             		);
-            -
            		$plus_link_2  = sprintf(
-            -
            			'<a href="https://evnt.is/19zl" target="_blank" rel="noopener noreferrer">%s</a>',
-            -
            			esc_html__( 'Check it out!', 'event-tickets' )
-            -
            		);
             		$plus_message = sprintf(
-            -
            		// Translators: %1$s: The Event Tickets Plus link, %2$s: The word "ticket" in lowercase, %3$s: The "Check it out!" link.
-            -
            			esc_html_x( 'Tickets Commerce is a light implementation of a commerce gateway using PayPal and simplified stock handling. If you need more advanced features, take a look at %1$s. In addition to integrating with your favorite ecommerce provider, Event Tickets Plus includes options to collect custom information for attendees, check attendees in via QR codes, and share stock between %2$s. %3$s', 'about Tickets Commerce', 'event-tickets' ),
-            -
            			$plus_link,
-            -
            			esc_html( tribe_get_ticket_label_singular_lowercase( 'tickets_fields_settings_about_tribe_commerce' ) ),
-            -
            			$plus_link_2
             		);
             		$is_tickets_commerce_enabled = tec_tickets_commerce_is_enabled();
-            -
            		$top_level_settings = [
-            -
            			'tribe-form-content-start'     => [
-            -
            				'type' => 'html',
-            -
            				'html' => '<div class="tribe-settings-form-wrap">',
-            -
            			],
-            -
            			'tickets-commerce-header'      => [
-            -
            				'type' => 'html',
-            -
            				'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-toggle-wrapper">
-            -
            								<label class="tec-tickets__admin-settings-tickets-commerce-toggle">
-            -
            									<input
-            -
            										type="checkbox"
-            -
            										name="' . Tickets_Settings::$tickets_commerce_enabled . '"
-            -
            										' . checked( $is_tickets_commerce_enabled, true, false ) . '
-            -
            										id="tickets-commerce-enable-input"
-            -
            										class="tec-tickets__admin-settings-tickets-commerce-toggle-checkbox tribe-dependency tribe-dependency-verified">
-            -
            										<span class="tec-tickets__admin-settings-tickets-commerce-toggle-switch"></span>
-            -
            										<span class="tec-tickets__admin-settings-tickets-commerce-toggle-label">' . esc_html__( 'Enable Tickets Commerce', 'event-tickets' ) . '</span>
-            -
            								</label>
-            -
            							</div>',
-            -
            			],
-            -
            			'tickets-commerce-description' => [
             				'type' => 'html',
-            -
            				'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-description">' . $plus_message . '</div>',
-            -
            			],
-            -
            			Tickets_Settings::$tickets_commerce_enabled => [
-            -
            				'type'            => 'hidden',
-            -
            				'validation_type' => 'boolean',
             			],
             		];
             		/**
             		 * Hook to modify the top level settings for Tickets Commerce.
+            		 *
@@ -124,7 +402,7 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
+            		 *
             		 * @param array[] $top_level_settings Top level settings.
             		 */
-            -
            		return apply_filters( 'tec_tickets_commerce_settings_top_level', $top_level_settings );
+            	}
             	/**
@@ -207,8 +485,8 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
+            	 *
             	 * @since 5.2.1
+            	 *
-            -
            	 * @param string $page_slug URL slug of the page.
-            -
            	 * @param string $page_name Name for page title.
             	 * @param string $shortcode_name Shortcode name that needs to be inserted in page content.
+            	 *
             	 * @return int|bool|\WP_Error
@@ -257,4 +535,4 @@ class Payments_Tab extends tad_DI52_ServiceProvider {
             		return (bool) $query->post_count;
+            	}
-            -
            }


4
5	use TEC\Tickets\Commerce\Shortcodes\Checkout_Shortcode;
6	use TEC\Tickets\Commerce\Shortcodes\Success_Shortcode;
7	+ use TEC\Tickets\Commerce\Gateways\Manager;
8	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway as Gateway;
9	use TEC\Tickets\Settings as Tickets_Settings;
10	+ use \Tribe__Settings;
11	use \tad_DI52_ServiceProvider;
12	+ use \Tribe__Template;
13	+ use Tribe__Tickets__Main;
14
15	/**
16	* Class Payments_Tab
17	*
18	+ * @since 5.2.0
19	*
20	* @package TEC\Tickets\Commerce
21	*/

39	*/
40	public static $option_page_created_meta_key = 'tec_tc_payments_page_created';
41
42	+ /**
43	+ * Meta key for page creation flag.
44	+ *
45	+ * @since 5.3.0
46	+ *
47	+ * @var string
48	+ */
49	+ public static $option_gateway_enabled_prefix = 'tec_tc_payments_gateway_enabled_';
50	+
51	+ /**
52	+ * Key to determine current section.
53	+ *
54	+ * @since 5.3.0
55	+ *
56	+ * @var string
57	+ */
58	+ public static $key_current_section = 'tec_tc_payments_current_section';
59	+
60	+ /**
61	+ * Key to use in GET variable for currently selected section.
62	+ *
63	+ * @since 5.3.0
64	+ *
65	+ * @var string
66	+ */
67	+ public static $key_current_section_get_var = 'tc-section';
68	+
69	+ /**
70	+ * Key to use for section menu.
71	+ *
72	+ * @since 5.3.0
73	+ *
74	+ * @var string
75	+ */
76	+ public static $key_section_menu = 'tec_tc_section_menu';
77	+
78	+ /**
79	+ * Stores the instance of the template engine that we will use for rendering differentelements.
80	+ *
81	+ * @since 5.3.0
82	+ *
83	+ * @var Tribe__Template
84	+ */
85	+ protected $template;
86	+
87	+
88	/**
89	* @inheritdoc
90	*/

100	public function register_tab() {
101	$tab_settings = [
102	'priority' => 25,
103	+ 'fields' => $this->get_fields(),
104	'show_save' => true,
105	];
106

109	new \Tribe__Settings_Tab( static::$slug, esc_html__( 'Payments', 'event-tickets' ), $tab_settings );
110	}
111
112	+ /**
113	+ * Gets the template instance used to setup the rendering html.
114	+ *
115	+ * @since 5.3.0
116	+ *
117	+ * @return Tribe__Template
118	+ */
119	+ public function get_template() {
120	+ if ( empty( $this->template ) ) {
121	+ $this->template = new Tribe__Template();
122	+ $this->template->set_template_origin( Tribe__Tickets__Main::instance() );
123	+ $this->template->set_template_folder( 'src/admin-views/settings' );
124	+ $this->template->set_template_context_extract( true );
125	+ }
126	+
127	+ return $this->template;
128	+ }
129	+
130	+ /**
131	+ * Gets the URL for the Payment Tab.
132	+ *
133	+ * @since 5.3.0
134	+ *
135	+ * @param array $args Which query args we are adding.
136	+ *
137	+ * @return string
138	+ */
139	+ public function get_url( array $args = [] ): string {
140	+ // Force the payment tab.
141	+ $args['tab'] = static::$slug;
142	+
143	+ // Use the settings page get_url to build the URL.
144	+ return Tribe__Settings::instance()->get_url( $args );
145	+ }
146
147	/**
148	+ * Returns the settings item for the section menu at the top of the Payments settings tab.
149	*
150	+ * @since 5.3.0
151	+ *
152	+ * @return array[]
153	+ */
154	+ public function get_section_menu(): array {
155	+ $template_vars = [
156	+ 'sections' => $this->get_sections(),
157	+ 'selected_section' => tribe_get_request_var( static::$key_current_section_get_var, '' ),
158	+ ];
159	+
160	+ return [
161	+ static::$key_section_menu => [
162	+ 'type' => 'html',
163	+ 'html' => $this->get_template()->template( 'section/menu', $template_vars, false ),
164	+ ],
165	+ ];
166	+ }
167	+
168	+ /**
169	+ * Gets an array of all the sections, based on the active Gateways.
170	+ *
171	+ * @since 5.3.0
172	*
173	* @return array[]
174	*/
175	+ public function get_sections(): array {
176	+ $sections = [
177	+ [
178	+ 'slug' => '',
179	+ 'classes' => [],
180	+ 'url' => $this->get_url(),
181	+ 'text' => __( 'Tickets Commerce', 'event-tickets' ),
182	+ ],
183	+ ];
184
185	+ $gateways = tribe( Manager::class )->get_gateways();
186	+ $gateways = array_filter( $gateways, static function ( $gateway ) {
187	+ return $gateway::should_show();
188	+ } );
189	+
190	+ foreach ( $gateways as $gateway_key => $gateway ) {
191	+ $sections[] = [
192	+ 'classes' => [],
193	+ 'slug' => $gateway_key,
194	+ 'url' => $gateway::get_settings_url(),
195	+ 'text' => $gateway::get_label(),
196	+ ];
197	+ }
198	+
199	+ /**
200	+ * Filters the sections available on the Payment Tab.
201	+ *
202	+ * @since 5.3.0
203	+ *
204	+ * @param array[] $sections Current sections.
205	+ */
206	+ return (array) apply_filters( 'tec_tickets_commerce_payments_tab_sections', $sections );
207	+ }
208	+
209	+ /**
210	+ * Filters the redirect URL to include section, if applicable.
211	+ *
212	+ * @since 5.3.0
213	+ *
214	+ * @param string $url URL of redirection.
215	+ *
216	+ * @return string
217	+ */
218	+ public function filter_redirect_url( $url ) {
219	+ if ( ! is_admin() ) {
220	+ return $url;
221	+ }
222	+
223	+ $tab = tribe_get_request_var( 'tab' );
224	+ $page = tribe_get_request_var( 'page' );
225	+
226	+ if ( empty( $tab ) \|\| empty( $page ) ) {
227	+ return $url;
228	+ }
229	+
230	+ if ( empty( $_SERVER['REQUEST_METHOD'] ) \|\| 'POST' !== strtoupper( $_SERVER['REQUEST_METHOD'] ) ) {
231	+ return $url;
232	+ }
233	+
234	+ if ( Tribe__Settings::$parent_slug !== $page ) {
235	+ return $url;
236	+ }
237	+
238	+ if ( static::$slug !== $tab ) {
239	+ return $url;
240	+ }
241	+
242	+ $section = tribe_get_request_var( static::$key_current_section );
243	+ if ( empty( $section ) ) {
244	+ $section = tribe_get_request_var( static::$key_current_section_get_var );
245	+ }
246	+
247	+ // In the main section we don't need to do anything.
248	+ if ( empty( $section ) \|\| 'main' === $section ) {
249	+ return $url;
250	+ }
251	+
252	+ return add_query_arg( static::$key_current_section_get_var, esc_attr( $section ), $url );
253	+ }
254	+
255	+ /**
256	+ * Returns the settings item for the section menu at the top of the Payments settings tab.
257	+ *
258	+ * @since 5.3.0
259	+ *
260	+ * @return Gateway\|null
261	+ */
262	+ public function get_section_gateway() {
263	+ $selected_section = tribe_get_request_var( static::$key_current_section_get_var );
264	+
265	+ return tribe( Manager::class )->get_gateway_by_key( $selected_section );
266	+ }
267	+
268	+ /**
269	+ * Gets the fields for the Tickets Commerce top level fields.
270	+ *
271	+ * @since 5.3.0
272	+ *
273	+ * @return array[]
274	+ */
275	+ public function get_tickets_commerce_section_fields() {
276	+ $fields = [];
277	+
278	+ // If no gateway section is selected, show main settings.
279	+ $plus_link = sprintf(
280	'<a href="https://evnt.is/19zl" target="_blank" rel="noopener noreferrer">%s</a>',
281	esc_html__( 'Event Tickets Plus', 'event-tickets' )
282	);
283	+



284	$plus_message = sprintf(
285	+ // Translators: %1$s: The Event Tickets Plus link.
286	+ esc_html_x( 'Tickets Commerce provides a simple and flexible ecommerce checkout for purchasing tickets. Just choose your payment gateway and configure checkout options and you\'re all set. If you need more advanced features like custom attendee information, QR code check in, and stock sharing between tickets, take a look at %1$s for these features and more.', 'about Tickets Commerce', 'event-tickets' ),
287	+ $plus_link


288	);
289
290	$is_tickets_commerce_enabled = tec_tickets_commerce_is_enabled();
291
292	+ $fields['tickets-commerce-header'] = [
293	+ 'type' => 'html',
294	+ 'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-toggle-wrapper">
295	+ <label class="tec-tickets__admin-settings-tickets-commerce-toggle">
296	+ <input
297	+ type="checkbox"
298	+ name="' . Tickets_Settings::$tickets_commerce_enabled . '"
299	+ ' . checked( $is_tickets_commerce_enabled, true, false ) . '
300	+ id="tickets-commerce-enable-input"
301	+ class="tec-tickets__admin-settings-tickets-commerce-toggle-checkbox tribe-dependency tribe-dependency-verified">
302	+ <span class="tec-tickets__admin-settings-tickets-commerce-toggle-switch"></span>
303	+ <span class="tec-tickets__admin-settings-tickets-commerce-toggle-label">' . esc_html__( 'Enable Tickets Commerce', 'event-tickets' ) . '</span>
304	+ </label>
305	+ </div>',





306
307	+ ];
308	+
309	+ $fields['tickets-commerce-description'] = [
310	+ 'type' => 'html',
311	+ 'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-description">' . $plus_message . '</div>',
312	+ ];
313	+
314	+ $fields[ Tickets_Settings::$tickets_commerce_enabled ] = [
315	+ 'type' => 'hidden',
316	+ 'validation_type' => 'boolean',
317	+ ];
318	+
319	+ return $fields;
320	+ }
321	+
322	+ /**
323	+ * Get selected section top level menu.
324	+ *
325	+ * @since 5.3.0
326	+ *
327	+ * @param Gateway $section_gateway Gateway class.
328	+ *
329	+ * @return array[]
330	+ */
331	+ public function get_gateway_section_fields( $section_gateway ): array {
332	+ $fields = [];
333	+
334	+ // Show the switch to enable/disable gateway at the top.
335	+ $option_key = $section_gateway::get_enabled_option_key();
336	+ $enable_label = sprintf(
337	+ // Translators: %s: Name of payment gateway.
338	+ esc_html__( 'Enable %s', 'event-tickets' ),
339	+ $section_gateway::get_label()
340	+ );
341	+
342	+ $attributes = tribe_get_attributes( [
343	+ 'type' => 'checkbox',
344	+ 'name' => $option_key,
345	+ 'id' => 'tickets-commerce-enable-input',
346	+ 'class' => 'tec-tickets__admin-settings-tickets-commerce-toggle-checkbox tribe-dependency tribe-dependency-verified',
347	+ 'disabled' => ! $section_gateway::is_connected(),
348	+ 'checked' => $section_gateway::is_enabled(),
349	+ ] );
350	+
351	+ /**
352	+ * @todo this needs to move into a template
353	+ */
354	+ $fields['tickets-commerce-header'] = [
355	+ 'type' => 'html',
356	+ 'html' => '<div class="tec-tickets__admin-settings-tickets-commerce-toggle-wrapper">
357	+ <label class="tec-tickets__admin-settings-tickets-commerce-toggle">
358	+ <input ' . implode( ' ', $attributes ) . ' />
359	+ <span class="tec-tickets__admin-settings-tickets-commerce-toggle-switch"></span>
360	+ <span class="tec-tickets__admin-settings-tickets-commerce-toggle-label">' . $enable_label . '</span>
361	+ </label>
362	+ </div>',
363	+
364	+ ];
365	+
366	+ $fields[ $option_key ] = [
367	+ 'type' => 'hidden',
368	+ 'validation_type' => 'boolean',
369	+ ];
370	+
371	+ return $fields;
372	+ }
373	+
374	+
375	+ /**
376	+ * Gets the top level settings for Tickets Commerce.
377	+ *
378	+ * @since 5.3.0
379	+ *
380	+ * @return array[]
381	+ */
382	+ public function get_fields(): array {
383	+ $section_gateway = $this->get_section_gateway();
384	+
385	+ $fields = [
386	+ 'tribe-form-content-start' => [
387	'type' => 'html',
388	+ 'html' => '<div class="tribe-settings-form-wrap">',




389	],
390	];
391
392	+ if ( empty( $section_gateway ) ) {
393	+ $fields = array_merge( $fields, $this->get_tickets_commerce_section_fields() );
394	+ } else {
395	+ $fields = array_merge( $fields, $this->get_gateway_section_fields( $section_gateway ) );
396	+ }
397	+
398	/**
399	* Hook to modify the top level settings for Tickets Commerce.
400	*

402	*
403	* @param array[] $top_level_settings Top level settings.
404	*/
405	+ return apply_filters( 'tec_tickets_commerce_settings_top_level', array_merge( $this->get_section_menu(), $fields ) );
406	}
407
408	/**

485	*
486	* @since 5.2.1
487	*
488	+ * @param string $page_slug URL slug of the page.
489	+ * @param string $page_name Name for page title.
490	* @param string $shortcode_name Shortcode name that needs to be inserted in page content.
491	*
492	* @return int\|bool\|\WP_Error

535
536	return (bool) $query->post_count;
537	}
538	+ }

src/Tickets/Commerce/Provider.php CHANGED Viewed

	@@ -76,6 +76,7 @@ class Provider extends tad_DI52_ServiceProvider {
76	$this->container->singleton( Compatibility\Events::class );
77
78	// Load any external SPs we might need.

79	$this->container->register( Gateways\PayPal\Provider::class );
80	$this->container->register( Gateways\Manual\Provider::class );
81


76	$this->container->singleton( Compatibility\Events::class );
77
78	// Load any external SPs we might need.
79	+ $this->container->register( Gateways\Stripe\Provider::class );
80	$this->container->register( Gateways\PayPal\Provider::class );
81	$this->container->register( Gateways\Manual\Provider::class );
82

src/Tickets/Commerce/Settings.php CHANGED Viewed

@@ -8,17 +8,20 @@
             namespace TEC\Tickets\Commerce;
             use TEC\Tickets\Commerce\Gateways\Abstract_Gateway;
             use TEC\Tickets\Commerce\Gateways\Manager;
             use TEC\Tickets\Commerce\Status\Completed;
             use TEC\Tickets\Commerce\Status\Pending;
             use TEC\Tickets\Commerce\Traits\Has_Mode;
             use TEC\Tickets\Settings as Tickets_Settings;
             use Tribe__Field_Conditional;
             use WP_Admin_Bar;
             /**
-            -
             * The Tickets Commerce settings.
+             *
              * This class will contain all of the settings handling and admin settings config implementation from
              * Tribe__Tickets__Commerce__PayPal__Main that is gateway-agnostic.
@@ -26,7 +29,8 @@ use WP_Admin_Bar;
              * @since   5.1.6
              * @package Tribe\Tickets\Commerce\Tickets_Commerce
              */
-            -
            class Settings extends Abstract_Settings {
             	use Has_Mode;
             	/**
@@ -101,6 +105,15 @@ class Settings extends Abstract_Settings {
             	 */
             	public static $option_confirmation_email_subject = 'tickets-commerce-confirmation-email-subject';
             	/**
             	 * Settings constructor.
+            	 *
@@ -111,6 +124,36 @@ class Settings extends Abstract_Settings {
             		$this->set_mode( tec_tickets_commerce_is_sandbox_mode() ? 'sandbox' : 'live' );
+            	}
             	/**
             	 * Display admin bar when using the Test Mode for payments.
+            	 *
@@ -156,7 +199,11 @@ class Settings extends Abstract_Settings {
             	 * @return array The list of settings for Tickets Commerce.
             	 */
             	public function get_settings() {
-            -
            		$gateways_manager = tribe( Manager::class );
             		// @todo Replace this with a better and more performant REST API based solution.
             		$page_args = [
@@ -316,7 +363,36 @@ class Settings extends Abstract_Settings {
             			],
             		];
-            -
            		$settings = array_merge( $gateways_manager->get_gateway_settings(), $settings );
             		/**
             		 * Allow filtering the list of Tickets Commerce settings.
@@ -327,8 +403,23 @@ class Settings extends Abstract_Settings {
             		 */
             		$settings = apply_filters( 'tribe_tickets_commerce_settings', $settings );
-            -
            		return array_merge( tribe( Payments_Tab::class )->get_top_level_settings(), $this->apply_commerce_enabled_conditional( $settings ) );
+            	}
             	/**
@@ -383,4 +474,21 @@ class Settings extends Abstract_Settings {
             		return $meta_value;
+            	}
+            }


8
9	namespace TEC\Tickets\Commerce;
10
11	+ use TEC\Tickets\Commerce\Admin\Featured_Settings;
12	use TEC\Tickets\Commerce\Gateways\Abstract_Gateway;
13	use TEC\Tickets\Commerce\Gateways\Manager;
14	use TEC\Tickets\Commerce\Status\Completed;
15	use TEC\Tickets\Commerce\Status\Pending;
16	use TEC\Tickets\Commerce\Traits\Has_Mode;
17	use TEC\Tickets\Settings as Tickets_Settings;
18	+ use \Tribe__Template;
19	use Tribe__Field_Conditional;
20	+ use Tribe__Tickets__Main;
21	use WP_Admin_Bar;
22
23	/**
24	+ * The Tickets Commerce Global settings.
25	*
26	* This class will contain all of the settings handling and admin settings config implementation from
27	* Tribe__Tickets__Commerce__PayPal__Main that is gateway-agnostic.

29	* @since 5.1.6
30	* @package Tribe\Tickets\Commerce\Tickets_Commerce
31	*/
32	+ class Settings {
33	+
34	use Has_Mode;
35
36	/**

105	*/
106	public static $option_confirmation_email_subject = 'tickets-commerce-confirmation-email-subject';
107
108	+ /**
109	+ * Stores the instance of the template engine that we will use for rendering differentelements.
110	+ *
111	+ * @since 5.3.0
112	+ *
113	+ * @var Tribe__Template
114	+ */
115	+ protected $template;
116	+
117	/**
118	* Settings constructor.
119	*

124	$this->set_mode( tec_tickets_commerce_is_sandbox_mode() ? 'sandbox' : 'live' );
125	}
126
127	+ /**
128	+ * Gets the template instance used to setup the rendering html.
129	+ *
130	+ * @since 5.3.0
131	+ *
132	+ * @return Tribe__Template
133	+ */
134	+ public function get_template() {
135	+ if ( empty( $this->template ) ) {
136	+ $this->template = new Tribe__Template();
137	+ $this->template->set_template_origin( Tribe__Tickets__Main::instance() );
138	+ $this->template->set_template_folder( 'src/admin-views/settings/tickets-commerce' );
139	+ $this->template->set_template_context_extract( true );
140	+ }
141	+
142	+ return $this->template;
143	+ }
144	+
145	+ /**
146	+ * Determine whether Tickets Commerce is in test mode.
147	+ *
148	+ * @since 5.3.0 moved to Settings class
149	+ * @since 5.1.6
150	+ *
151	+ * @return bool Whether Tickets Commerce is in test mode.
152	+ */
153	+ public static function is_test_mode() {
154	+ return tribe_is_truthy( tribe_get_option( static::$option_sandbox ) );
155	+ }
156	+
157	/**
158	* Display admin bar when using the Test Mode for payments.
159	*

199	* @return array The list of settings for Tickets Commerce.
200	*/
201	public function get_settings() {
202	+
203	+ $section_gateway = tribe( Payments_Tab::class )->get_section_gateway();
204	+ if ( ! empty( $section_gateway ) ) {
205	+ return $section_gateway->get_settings();
206	+ }
207
208	// @todo Replace this with a better and more performant REST API based solution.
209	$page_args = [

363	],
364	];
365
366	+ // Add featured settings to top of other settings.
367	+ $featured_settings = [
368	+ 'tc_featured_settings' => [
369	+ 'type' => 'html',
370	+ 'html' => tribe( Featured_Settings::class )->get_html(
371	+ [
372	+ 'title' => __( 'Payment Gateways', 'event-tickets' ),
373	+ 'description' => __(
374	+ 'Set up a payment gateway to get started with Tickets Commerce. Enable multiple ' .
375	+ 'gateways for providing users additional options for users when purchasing tickets.',
376	+ 'event-tickets'
377	+ ),
378	+ 'content_template' => $this->get_featured_gateways_html(),
379	+ 'links' => [
380	+ [
381	+ 'slug' => 'help-1',
382	+ 'priority' => 10,
383	+ 'link' => 'https://evnt.is/1axt',
384	+ 'html' => __( 'Learn more about configuring payment options with Tickets Commerce', 'event-tickets' ),
385	+ 'target' => '_blank',
386	+ 'classes' => [],
387	+ ],
388	+ ],
389	+ 'classes' => [],
390	+ ]
391	+ ),
392	+ ],
393	+ ];
394	+
395	+ $settings = array_merge( $featured_settings, $settings );
396
397	/**
398	* Allow filtering the list of Tickets Commerce settings.

403	*/
404	$settings = apply_filters( 'tribe_tickets_commerce_settings', $settings );
405
406	+ return array_merge( tribe( Payments_Tab::class )->get_fields(), $this->apply_commerce_enabled_conditional( $settings ) );
407	+ }
408	+
409	+ /**
410	+ * Returns the content for the main featured settings which displays the list of gateways.
411	+ *
412	+ * @since 5.3.0
413	+ *
414	+ * @return string
415	+ */
416	+ public function get_featured_gateways_html() {
417	+ $manager = tribe( Manager::class );
418	+ $gateways = $manager->get_gateways();
419	+
420	+ $template = $this->get_template();
421
422	+ return $template->template( 'gateways/container', [ 'gateways' => $gateways, 'manager' => $manager ], false );
423	}
424
425	/**

474	return $meta_value;
475	}
476
477	+ /**
478	+ * Is a valid license of Event Tickets Plus available?
479	+ *
480	+ * @since 5.3.0
481	+ *
482	+ * @param bool $revalidate whether to submit a new validation API request
483	+ *
484	+ * @return bool
485	+ */
486	+ public static function is_licensed_plugin( $revalidate = false ) {
487	+
488	+ if ( ! class_exists( 'Tribe__Tickets_Plus__PUE' ) ) {
489	+ return false;
490	+ }
491	+
492	+ return tribe( \Tribe__Tickets_Plus__PUE::class )->is_current_license_valid( $revalidate );
493	+ }
494	}

src/Tickets/Commerce/Shortcodes/Checkout_Shortcode.php CHANGED Viewed

	@@ -41,11 +41,13 @@ class Checkout_Shortcode extends Shortcode_Abstract {
41	* {@inheritDoc}
42	*/
43	public function setup_template_vars() {
44	- $items = tribe( Cart::class )->get_items_in_cart( true );
45	- $sections = array_unique( array_filter( wp_list_pluck( $items, 'event_id' ) ) );
46	- $sub_totals = Value::build_list( array_filter( wp_list_pluck( $items, 'sub_total' ) ) );
47	$total_value = Value::create();
48


49	$args = [
50	'provider_id' => Module::class,
51	'provider' => tribe( Module::class ),
	@@ -56,7 +58,7 @@ class Checkout_Shortcode extends Shortcode_Abstract {
56	'login_url' => tribe( Checkout::class )->get_login_url(),
57	'registration_url' => tribe( Checkout::class )->get_registration_url(),
58	'is_tec_active' => defined( 'TRIBE_EVENTS_FILE' ) && class_exists( 'Tribe__Events__Main' ),
59	- 'gateways' => ~~tribe( Manager::class )->get_gateways()~~,
60	'gateways_active' => $this->get_gateways_active(),
61	'gateways_connected' => $this->get_gateways_connected(),
62	];
	@@ -92,7 +94,7 @@ class Checkout_Shortcode extends Shortcode_Abstract {
92	public function get_gateways_active() {
93	$gateways = tribe( Manager::class )->get_gateways();
94	$gateways_active = array_filter( array_map( static function ( $gateway ) {
95	- return $gateway::is_active() && $gateway::should_show() ? $gateway : null;
96	}, $gateways ) );
97
98	return count( $gateways_active );
	@@ -123,6 +125,7 @@ class Checkout_Shortcode extends Shortcode_Abstract {
123	public static function enqueue_assets() {
124	// Enqueue assets.
125	tribe_asset_enqueue_group( 'tribe-tickets-commerce-checkout' );

126	}
127
128	}


41	* {@inheritDoc}
42	*/
43	public function setup_template_vars() {
44	+ $items = tribe( Cart::class )->get_items_in_cart( true );
45	+ $sections = array_unique( array_filter( wp_list_pluck( $items, 'event_id' ) ) );
46	+ $sub_totals = Value::build_list( array_filter( wp_list_pluck( $items, 'sub_total' ) ) );
47	$total_value = Value::create();
48
49	+ $gateways = tribe( Manager::class )->get_gateways();
50	+
51	$args = [
52	'provider_id' => Module::class,
53	'provider' => tribe( Module::class ),

58	'login_url' => tribe( Checkout::class )->get_login_url(),
59	'registration_url' => tribe( Checkout::class )->get_registration_url(),
60	'is_tec_active' => defined( 'TRIBE_EVENTS_FILE' ) && class_exists( 'Tribe__Events__Main' ),
61	+ 'gateways' => $gateways,
62	'gateways_active' => $this->get_gateways_active(),
63	'gateways_connected' => $this->get_gateways_connected(),
64	];

94	public function get_gateways_active() {
95	$gateways = tribe( Manager::class )->get_gateways();
96	$gateways_active = array_filter( array_map( static function ( $gateway ) {
97	+ return $gateway::is_active() && $gateway::is_enabled() && $gateway::should_show() ? $gateway : null;
98	}, $gateways ) );
99
100	return count( $gateways_active );

125	public static function enqueue_assets() {
126	// Enqueue assets.
127	tribe_asset_enqueue_group( 'tribe-tickets-commerce-checkout' );
128	+ tribe_asset_enqueue( 'tribe-tickets-forms-style' );
129	}
130
131	}

src/Tickets/Commerce/Status/Action_Required.php CHANGED Viewed

	@@ -3,7 +3,7 @@
3	namespace TEC\Tickets\Commerce\Status;
4
5	/**
6	- * Class ~~Pending~~.
7	*
8	* This is a payment that has begun, but is not complete. An example of this is someone who has filled out the checkout
9	* form and then gone to Gateway for payment. We have the record of sale, but they haven't completed their payment yet.
	@@ -20,7 +20,7 @@ class Action_Required extends Status_Abstract {
20	*
21	* @var string
22	*/
23	- const SLUG = 'action-~~required~~';
24
25	/**
26	* {@inheritdoc}


3	namespace TEC\Tickets\Commerce\Status;
4
5	/**
6	+ * Class Action_Required.
7	*
8	* This is a payment that has begun, but is not complete. An example of this is someone who has filled out the checkout
9	* form and then gone to Gateway for payment. We have the record of sale, but they haven't completed their payment yet.

20	*
21	* @var string
22	*/
23	+ const SLUG = 'action-req'; // max-length = 13 bytes/chars
24
25	/**
26	* {@inheritdoc}

src/Tickets/Commerce/Status/Denied.php CHANGED Viewed

@@ -21,13 +21,6 @@ class Denied extends Status_Abstract {
             	 */
             	const SLUG = 'denied';
-            -
            	/**
-            -
            	 * {@inheritdoc}
-            -
            	 */
-            -
            	public function get_name() {
-            -
            		return __( 'Denied', 'event-tickets' );
-            -
            	}
-            -
             	/**
             	 * {@inheritdoc}
             	 */
@@ -47,4 +40,18 @@ class Denied extends Status_Abstract {
             		'show_in_admin_all_list'    => true,
             		'show_in_admin_status_list' => true,
             	];
+            }


21	*/
22	const SLUG = 'denied';
23







24	/**
25	* {@inheritdoc}
26	*/

40	'show_in_admin_all_list' => true,
41	'show_in_admin_status_list' => true,
42	];
43	+
44	+ /**
45	+ * {@inheritdoc}
46	+ */
47	+ public function get_name() {
48	+ return __( 'Denied', 'event-tickets' );
49	+ }
50	+
51	+ /**
52	+ * {@inheritdoc}
53	+ */
54	+ public function is_final() {
55	+ return true;
56	+ }
57	}

src/Tickets/Commerce/Status/Pending.php CHANGED Viewed

	@@ -62,6 +62,11 @@ class Pending extends Status_Abstract {
62	public function can_apply_to( $order ) {
63	$status = parent::can_apply_to( $order );
64





65	// If the parent status or abstract has an error already we dont even run.
66	if ( is_wp_error( $status ) ) {
67	return $status;


62	public function can_apply_to( $order ) {
63	$status = parent::can_apply_to( $order );
64
65	+ // If the parent status is final, don't run.
66	+ if ( ! $status ) {
67	+ return $status;
68	+ }
69	+
70	// If the parent status or abstract has an error already we dont even run.
71	if ( is_wp_error( $status ) ) {
72	return $status;

src/Tickets/Commerce/Status/Refunded.php CHANGED Viewed

@@ -20,13 +20,6 @@ class Refunded extends Status_Abstract {
             	 */
             	const SLUG = 'refunded';
-            -
            	/**
-            -
            	 * {@inheritdoc}
-            -
            	 */
-            -
            	public function get_name() {
-            -
            		return __( 'Refunded', 'event-tickets' );
-            -
            	}
-            -
             	/**
             	 * {@inheritdoc}
             	 */
@@ -45,4 +38,18 @@ class Refunded extends Status_Abstract {
             		'show_in_admin_all_list'    => true,
             		'show_in_admin_status_list' => true,
             	];
+            }


20	*/
21	const SLUG = 'refunded';
22







23	/**
24	* {@inheritdoc}
25	*/

38	'show_in_admin_all_list' => true,
39	'show_in_admin_status_list' => true,
40	];
41	+
42	+ /**
43	+ * {@inheritdoc}
44	+ */
45	+ public function get_name() {
46	+ return __( 'Refunded', 'event-tickets' );
47	+ }
48	+
49	+ /**
50	+ * {@inheritdoc}
51	+ */
52	+ public function is_final() {
53	+ return true;
54	+ }
55	}

src/Tickets/Commerce/Status/Reversed.php CHANGED Viewed

@@ -20,13 +20,6 @@ class Reversed extends Status_Abstract {
             	 */
             	const SLUG = 'reversed';
-            -
            	/**
-            -
            	 * {@inheritdoc}
-            -
            	 */
-            -
            	public function get_name() {
-            -
            		return __( 'Reversed', 'event-tickets' );
-            -
            	}
-            -
             	/**
             	 * {@inheritdoc}
             	 */
@@ -45,4 +38,18 @@ class Reversed extends Status_Abstract {
             		'show_in_admin_all_list'    => true,
             		'show_in_admin_status_list' => true,
             	];
+            }


20	*/
21	const SLUG = 'reversed';
22







23	/**
24	* {@inheritdoc}
25	*/

38	'show_in_admin_all_list' => true,
39	'show_in_admin_status_list' => true,
40	];
41	+
42	+ /**
43	+ * {@inheritdoc}
44	+ */
45	+ public function get_name() {
46	+ return __( 'Reversed', 'event-tickets' );
47	+ }
48	+
49	+ /**
50	+ * {@inheritdoc}
51	+ */
52	+ public function is_final() {
53	+ return true;
54	+ }
55	}

src/Tickets/Commerce/Status/Status_Abstract.php CHANGED Viewed

	@@ -129,9 +129,23 @@ abstract class Status_Abstract implements Status_Interface {
129	* {@inheritdoc}
130	*/
131	public function can_apply_to( $order ) {







132	return true;
133	}
134







135	/**
136	* {@inheritdoc}
137	*/


129	* {@inheritdoc}
130	*/
131	public function can_apply_to( $order ) {
132	+ $order = tec_tc_get_order( $order );
133	+ $current_status = tribe( Status_Handler::class )->get_by_wp_slug( $order->post_status );
134	+
135	+ if ( $current_status->is_final() ) {
136	+ return false;
137	+ }
138	+
139	return true;
140	}
141
142	+ /**
143	+ * @inheritDoc
144	+ */
145	+ public function is_final() {
146	+ return false;
147	+ }
148	+
149	/**
150	* {@inheritdoc}
151	*/

src/Tickets/Commerce/Status/Status_Handler.php CHANGED Viewed

	@@ -30,6 +30,7 @@ class Status_Handler extends \tad_DI52_ServiceProvider {
30	* @var string[]
31	*/
32	protected $default_statuses = [

33	Created::class,
34	Completed::class,
35	Denied::class,


30	* @var string[]
31	*/
32	protected $default_statuses = [
33	+ Action_Required::class,
34	Created::class,
35	Completed::class,
36	Denied::class,

src/Tickets/Commerce/Status/Status_Interface.php CHANGED Viewed

@@ -103,4 +103,13 @@ interface Status_Interface {
             	 * @return array
             	 */
             	public function get_wp_arguments();
+            }


103	* @return array
104	*/
105	public function get_wp_arguments();
106	+
107	+ /**
108	+ * Whether an order in this status can be transitioned away from it.
109	+ *
110	+ * @since 5.3.0
111	+ *
112	+ * @return bool
113	+ */
114	+ public function is_final();
115	}

src/Tickets/Commerce/Status/Voided.php CHANGED Viewed

@@ -22,13 +22,6 @@ class Voided extends Status_Abstract {
             	 */
             	const SLUG = 'voided';
-            -
            	/**
-            -
            	 * {@inheritdoc}
-            -
            	 */
-            -
            	public function get_name() {
-            -
            		return __( 'Voided', 'event-tickets' );
-            -
            	}
-            -
             	/**
             	 * {@inheritdoc}
             	 */
@@ -47,5 +40,19 @@ class Voided extends Status_Abstract {
             		'show_in_admin_all_list'    => true,
             		'show_in_admin_status_list' => true,
             	];
+            }


22	*/
23	const SLUG = 'voided';
24







25	/**
26	* {@inheritdoc}
27	*/

40	'show_in_admin_all_list' => true,
41	'show_in_admin_status_list' => true,
42	];
43	+
44	+ /**
45	+ * {@inheritdoc}
46	+ */
47	+ public function get_name() {
48	+ return __( 'Voided', 'event-tickets' );
49	+ }
50	+
51	+ /**
52	+ * {@inheritdoc}
53	+ */
54	+ public function is_final() {
55	+ return true;
56	+ }
57	}
58

src/Tickets/Commerce/Traits/Has_Mode.php CHANGED Viewed

	@@ -59,6 +59,10 @@ trait Has_Mode {
59	* @return string Which mode we are using the Merchant.
60	*/
61	public function get_mode() {




62	return $this->mode;
63	}
64


59	* @return string Which mode we are using the Merchant.
60	*/
61	public function get_mode() {
62	+ if ( null === $this->mode ) {
63	+ $this->set_mode( tec_tickets_commerce_is_sandbox_mode() ? 'sandbox' : 'live' );
64	+ }
65	+
66	return $this->mode;
67	}
68

src/Tickets/Commerce/Utils/Currency.php CHANGED Viewed

@@ -80,7 +80,7 @@ class Currency {
             	 * @return string
             	 */
             	public static function get_currency_symbol( $code ) {
-            -
            		$map = static::get_default_currency_map();
             		$symbol = '';
             		if ( isset( $map[ $code ] ) ) {
@@ -110,6 +110,86 @@ class Currency {
             		return apply_filters( 'tec_tickets_commerce_currency_symbol', $symbol );
+            	}
             	/**
             	 * Return the currency decimal separator character to use as defined in the currency map.
+            	 *
@@ -120,7 +200,7 @@ class Currency {
             	 * @return string
             	 */
             	public static function get_currency_separator_decimal( $code ) {
-            -
            		$map = static::get_default_currency_map();
             		$separator = '';
             		if ( isset( $map[ $code ] ) ) {
@@ -160,7 +240,7 @@ class Currency {
             	 * @return string
             	 */
             	public static function get_currency_separator_thousands( $code ) {
-            -
            		$map = static::get_default_currency_map();
             		$separator = '';
             		if ( isset( $map[ $code ] ) ) {
@@ -226,7 +306,7 @@ class Currency {
+            		 *
             		 * @since 5.2.3
+            		 *
-            -
            		 * @param string   $currency_position The currency position string.
+            		 *
             		 * @return string
             		 */
@@ -261,155 +341,205 @@ class Currency {
             		 */
             		return apply_filters( 'tec_tickets_commerce_default_currency_map', [
             			'AUD' => [
-            -
            				'name'          => __( 'Australian Dollar (AUD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x41;&#x24;',
-            -
            				'thousands_sep' => ',',
-            -
            				'decimal_point' => '.',
             			],
             			'BRL' => [
-            -
            				'name'          => __( 'Brazilian Real  (BRL)', 'event-tickets' ),
-            -
            				'symbol'        => '&#82;&#x24;',
-            -
            				'thousands_sep' => '.',
-            -
            				'decimal_point' => ',',
             			],
             			'CAD' => [
-            -
            				'name'          => __( 'Canadian Dollar (CAD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x24;',
-            -
            				'thousands_sep' => ',',
-            -
            				'decimal_point' => '.',
             			],
             			'CHF' => [
-            -
            				'name'          => __( 'Swiss Franc (CHF)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x43;&#x48;&#x46;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'CZK' => [
-            -
            				'name'          => __( 'Czech Koruna (CZK)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x4b;&#x10d;',
-            -
            				'position'      => 'postfix',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'DKK' => [
-            -
            				'name'          => __( 'Danish Krone (DKK)', 'event-tickets' ),
-            -
            				'symbol'        => '&#107;&#114;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'EUR' => [
-            -
            				'name'          => __( 'Euro (EUR)', 'event-tickets' ),
-            -
            				'symbol'        => '&#8364;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'GBP' => [
-            -
            				'name'          => __( 'Pound Sterling (GBP)', 'event-tickets' ),
-            -
            				'symbol'        => '&#163;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'HKD' => [
-            -
            				'name'          => __( 'Hong Kong Dollar (HKD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'HUF' => [
-            -
            				'name'          => __( 'Hungarian Forint (HUF)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x46;&#x74;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'ILS' => [
-            -
            				'name'          => __( 'Israeli New Sheqel (ILS)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x20aa;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'INR' => [
-            -
            				'name'          => __( 'Indian Rupee (INR)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x20B9;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'JPY' => [
-            -
            				'name'          => __( 'Japanese Yen (JPY)', 'event-tickets' ),
-            -
            				'symbol'        => '&#165;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'MYR' => [
-            -
            				'name'          => __( 'Malaysian Ringgit (MYR)', 'event-tickets' ),
-            -
            				'symbol'        => '&#82;&#77;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'MXN' => [
-            -
            				'name'          => __( 'Mexican Peso (MXN)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'NOK' => [
-            -
            				'name'          => __( 'Norwegian Krone (NOK)', 'event-tickets' ),
-            -
            				'symbol'        => '',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'NZD' => [
-            -
            				'name'          => __( 'New Zealand Dollar (NZD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'PHP' => [
-            -
            				'name'          => __( 'Philippine Peso (PHP)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x20b1;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'PLN' => [
-            -
            				'name'          => __( 'Polish Zloty (PLN)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x7a;&#x142;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'RUB' => [
-            -
            				'name'          => __( 'Russian Ruble (RUB)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x20BD;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'SEK' => [
-            -
            				'name'          => __( 'Swedish Krona (SEK)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x6b;&#x72;',
-            -
            				'decimal_point' => ',',
-            -
            				'thousands_sep' => '.',
             			],
             			'SGD' => [
-            -
            				'name'          => __( 'Singapore Dollar (SGD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x53;&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'THB' => [
-            -
            				'name'          => __( 'Thai Baht (THB)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x0e3f;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'TWD' => [
-            -
            				'name'          => __( 'Taiwan New Dollar (TWD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x4e;&#x54;&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             			'USD' => [
-            -
            				'name'          => __( 'U.S. Dollar (USD)', 'event-tickets' ),
-            -
            				'symbol'        => '&#x24;',
-            -
            				'decimal_point' => '.',
-            -
            				'thousands_sep' => ',',
             			],
             		] );
+            	}


80	* @return string
81	*/
82	public static function get_currency_symbol( $code ) {
83	+ $map = static::get_default_currency_map();
84	$symbol = '';
85
86	if ( isset( $map[ $code ] ) ) {

110	return apply_filters( 'tec_tickets_commerce_currency_symbol', $symbol );
111	}
112
113	+ /**
114	+ * Return the currency name to use as defined in the currency map.
115	+ *
116	+ * @since 5.3.0
117	+ *
118	+ * @param string $code The currency 3-letter code.
119	+ *
120	+ * @return string
121	+ */
122	+ public static function get_currency_name( $code ) {
123	+ $map = static::get_default_currency_map();
124	+ $name = '';
125	+
126	+ if ( isset( $map[ $code ] ) ) {
127	+ $name = $map[ $code ]['name'];
128	+ }
129	+
130	+ /**
131	+ * Filter the specific currency name before returning. $code is the 3-letter currency code.
132	+ *
133	+ * @since 5.3.0
134	+ *
135	+ * @param string $name The currency name.
136	+ *
137	+ * @return string
138	+ */
139	+ $name = apply_filters( "tec_tickets_commerce_currency_{$code}_name", $name );
140	+
141	+ /**
142	+ * Filter all currency symbols before returning.
143	+ *
144	+ * @since 5.3.0
145	+ *
146	+ * @param string $name The currency name.
147	+ *
148	+ * @return string
149	+ */
150	+ return apply_filters( 'tec_tickets_commerce_currency_name', $name );
151	+ }
152	+
153	+ /**
154	+ * Return the currency precision to use as the number of decimals allowed.
155	+ *
156	+ * @since 5.3.0
157	+ *
158	+ * @param string $code The currency 3-letter code.
159	+ *
160	+ * @return string
161	+ */
162	+ public static function get_currency_precision( $code ) {
163	+ $map = static::get_default_currency_map();
164	+ $precision = 2;
165	+
166	+ if ( isset( $map[ $code ] ) ) {
167	+ $precision = $map[ $code ]['decimal_precision'];
168	+ }
169	+
170	+ /**
171	+ * Filter the specific currency precision before returning. $code is the 3-letter currency code.
172	+ *
173	+ * @since 5.3.0
174	+ *
175	+ * @param int $precision The currency precision.
176	+ *
177	+ * @return int
178	+ */
179	+ $precision = apply_filters( "tec_tickets_commerce_currency_{$code}_precision", $precision );
180	+
181	+ /**
182	+ * Filter all currency symbols before returning.
183	+ *
184	+ * @since 5.3.0
185	+ *
186	+ * @param int $precision The currency precision.
187	+ *
188	+ * @return int
189	+ */
190	+ return apply_filters( 'tec_tickets_commerce_currency_precision', $precision );
191	+ }
192	+
193	/**
194	* Return the currency decimal separator character to use as defined in the currency map.
195	*

200	* @return string
201	*/
202	public static function get_currency_separator_decimal( $code ) {
203	+ $map = static::get_default_currency_map();
204	$separator = '';
205
206	if ( isset( $map[ $code ] ) ) {

240	* @return string
241	*/
242	public static function get_currency_separator_thousands( $code ) {
243	+ $map = static::get_default_currency_map();
244	$separator = '';
245
246	if ( isset( $map[ $code ] ) ) {

306	*
307	* @since 5.2.3
308	*
309	+ * @param string $currency_position The currency position string.
310	*
311	* @return string
312	*/

341	*/
342	return apply_filters( 'tec_tickets_commerce_default_currency_map', [
343	'AUD' => [
344	+ 'name' => __( 'Australian Dollar (AUD)', 'event-tickets' ),
345	+ 'symbol' => 'A$',
346	+ 'thousands_sep' => ',',
347	+ 'decimal_point' => '.',
348	+ 'decimal_precision' => 2,
349	+ 'stripe_minimum_charge' => 0.50,
350	],
351	'BRL' => [
352	+ 'name' => __( 'Brazilian Real (BRL)', 'event-tickets' ),
353	+ 'symbol' => 'R$',
354	+ 'thousands_sep' => '.',
355	+ 'decimal_point' => ',',
356	+ 'decimal_precision' => 2,
357	+ 'stripe_minimum_charge' => 5.00, // minimum charge is 0.50, but boleto requires 5.00
358	],
359	'CAD' => [
360	+ 'name' => __( 'Canadian Dollar (CAD)', 'event-tickets' ),
361	+ 'symbol' => '$',
362	+ 'thousands_sep' => ',',
363	+ 'decimal_point' => '.',
364	+ 'decimal_precision' => 2,
365	+ 'stripe_minimum_charge' => 0.50,
366	],
367	'CHF' => [
368	+ 'name' => __( 'Swiss Franc (CHF)', 'event-tickets' ),
369	+ 'symbol' => 'CHF',
370	+ 'decimal_point' => ',',
371	+ 'thousands_sep' => '.',
372	+ 'decimal_precision' => 2,
373	+ 'stripe_minimum_charge' => 0.50,
374	],
375	'CZK' => [
376	+ 'name' => __( 'Czech Koruna (CZK)', 'event-tickets' ),
377	+ 'symbol' => 'Kč',
378	+ 'position' => 'postfix',
379	+ 'decimal_point' => ',',
380	+ 'thousands_sep' => '.',
381	+ 'decimal_precision' => 2,
382	+ 'stripe_minimum_charge' => 15.00,
383	],
384	'DKK' => [
385	+ 'name' => __( 'Danish Krone (DKK)', 'event-tickets' ),
386	+ 'symbol' => 'kr',
387	+ 'decimal_point' => ',',
388	+ 'thousands_sep' => '.',
389	+ 'decimal_precision' => 2,
390	+ 'stripe_minimum_charge' => 2.50,
391	],
392	'EUR' => [
393	+ 'name' => __( 'Euro (EUR)', 'event-tickets' ),
394	+ 'symbol' => '€',
395	+ 'decimal_point' => ',',
396	+ 'thousands_sep' => '.',
397	+ 'decimal_precision' => 2,
398	+ 'stripe_minimum_charge' => 0.50,
399	],
400	'GBP' => [
401	+ 'name' => __( 'Pound Sterling (GBP)', 'event-tickets' ),
402	+ 'symbol' => '£',
403	+ 'decimal_point' => '.',
404	+ 'thousands_sep' => ',',
405	+ 'decimal_precision' => 2,
406	+ 'stripe_minimum_charge' => 0.30,
407	],
408	'HKD' => [
409	+ 'name' => __( 'Hong Kong Dollar (HKD)', 'event-tickets' ),
410	+ 'symbol' => '$',
411	+ 'decimal_point' => '.',
412	+ 'thousands_sep' => ',',
413	+ 'decimal_precision' => 2,
414	+ 'stripe_minimum_charge' => 4.00,
415	],
416	'HUF' => [
417	+ 'name' => __( 'Hungarian Forint (HUF)', 'event-tickets' ),
418	+ 'symbol' => 'Ft',
419	+ 'decimal_point' => ',',
420	+ 'thousands_sep' => '.',
421	+ 'decimal_precision' => 2,
422	+ 'stripe_minimum_charge' => 175.00,
423	],
424	'ILS' => [
425	+ 'name' => __( 'Israeli New Sheqel (ILS)', 'event-tickets' ),
426	+ 'symbol' => '₪',
427	+ 'decimal_point' => ',',
428	+ 'thousands_sep' => '.',
429	+ 'decimal_precision' => 2,
430	+ 'stripe_minimum_charge' => null,
431	],
432	'INR' => [
433	+ 'name' => __( 'Indian Rupee (INR)', 'event-tickets' ),
434	+ 'symbol' => '₹',
435	+ 'decimal_point' => '.',
436	+ 'thousands_sep' => ',',
437	+ 'decimal_precision' => 2,
438	+ 'stripe_minimum_charge' => 0.50,
439	],
440	'JPY' => [
441	+ 'name' => __( 'Japanese Yen (JPY)', 'event-tickets' ),
442	+ 'symbol' => '¥',
443	+ 'decimal_point' => '.',
444	+ 'thousands_sep' => ',',
445	+ 'decimal_precision' => 0,
446	+ 'stripe_minimum_charge' => 50,
447	],
448	'MYR' => [
449	+ 'name' => __( 'Malaysian Ringgit (MYR)', 'event-tickets' ),
450	+ 'symbol' => 'RM',
451	+ 'decimal_point' => '.',
452	+ 'thousands_sep' => ',',
453	+ 'decimal_precision' => 2,
454	+ 'stripe_minimum_charge' => 2.00,
455	],
456	'MXN' => [
457	+ 'name' => __( 'Mexican Peso (MXN)', 'event-tickets' ),
458	+ 'symbol' => '$',
459	+ 'decimal_point' => '.',
460	+ 'thousands_sep' => ',',
461	+ 'decimal_precision' => 2,
462	+ 'stripe_minimum_charge' => 10.00,
463	],
464	'NOK' => [
465	+ 'name' => __( 'Norwegian Krone (NOK)', 'event-tickets' ),
466	+ 'symbol' => '',
467	+ 'decimal_point' => ',',
468	+ 'thousands_sep' => '.',
469	+ 'decimal_precision' => 2,
470	+ 'stripe_minimum_charge' => 3.00,
471	],
472	'NZD' => [
473	+ 'name' => __( 'New Zealand Dollar (NZD)', 'event-tickets' ),
474	+ 'symbol' => '$',
475	+ 'decimal_point' => '.',
476	+ 'thousands_sep' => ',',
477	+ 'decimal_precision' => 2,
478	+ 'stripe_minimum_charge' => 0.50,
479	],
480	'PHP' => [
481	+ 'name' => __( 'Philippine Peso (PHP)', 'event-tickets' ),
482	+ 'symbol' => '₱',
483	+ 'decimal_point' => '.',
484	+ 'thousands_sep' => ',',
485	+ 'decimal_precision' => 2,
486	+ 'stripe_minimum_charge' => null,
487	],
488	'PLN' => [
489	+ 'name' => __( 'Polish Zloty (PLN)', 'event-tickets' ),
490	+ 'symbol' => 'zł',
491	+ 'decimal_point' => ',',
492	+ 'thousands_sep' => '.',
493	+ 'decimal_precision' => 2,
494	+ 'stripe_minimum_charge' => 2.00,
495	],
496	'RUB' => [
497	+ 'name' => __( 'Russian Ruble (RUB)', 'event-tickets' ),
498	+ 'symbol' => '₽',
499	+ 'decimal_point' => '.',
500	+ 'thousands_sep' => ',',
501	+ 'decimal_precision' => 2,
502	+ 'stripe_minimum_charge' => null,
503	],
504	'SEK' => [
505	+ 'name' => __( 'Swedish Krona (SEK)', 'event-tickets' ),
506	+ 'symbol' => 'kr',
507	+ 'decimal_point' => ',',
508	+ 'thousands_sep' => '.',
509	+ 'decimal_precision' => 2,
510	+ 'stripe_minimum_charge' => 3.00,
511	],
512	'SGD' => [
513	+ 'name' => __( 'Singapore Dollar (SGD)', 'event-tickets' ),
514	+ 'symbol' => 'S$',
515	+ 'decimal_point' => '.',
516	+ 'thousands_sep' => ',',
517	+ 'decimal_precision' => 2,
518	+ 'stripe_minimum_charge' => 0.50,
519	],
520	'THB' => [
521	+ 'name' => __( 'Thai Baht (THB)', 'event-tickets' ),
522	+ 'symbol' => '฿',
523	+ 'decimal_point' => '.',
524	+ 'thousands_sep' => ',',
525	+ 'decimal_precision' => 2,
526	+ 'stripe_minimum_charge' => null,
527	],
528	'TWD' => [
529	+ 'name' => __( 'Taiwan New Dollar (TWD)', 'event-tickets' ),
530	+ 'symbol' => 'NT$',
531	+ 'decimal_point' => '.',
532	+ 'thousands_sep' => ',',
533	+ 'decimal_precision' => 2,
534	+ 'stripe_minimum_charge' => null,
535	],
536	'USD' => [
537	+ 'name' => __( 'U.S. Dollar (USD)', 'event-tickets' ),
538	+ 'symbol' => '$',
539	+ 'decimal_point' => '.',
540	+ 'thousands_sep' => ',',
541	+ 'decimal_precision' => 2,
542	+ 'stripe_minimum_charge' => 0.50,
543	],
544	] );
545	}

src/Tickets/Commerce/Utils/Value.php CHANGED Viewed

	@@ -23,6 +23,7 @@ class Value extends Abstract_Currency {
23	$this->currency_symbol_position = Currency::get_currency_symbol_position( $this->get_currency_code() );
24	$this->currency_separator_decimal = Currency::get_currency_separator_decimal( $this->get_currency_code() );
25	$this->currency_separator_thousands = Currency::get_currency_separator_thousands( $this->get_currency_code() );

26	}
27
28	/**
	@@ -74,5 +75,4 @@ class Value extends Abstract_Currency {
74	);
75
76	}
77	-
78	}


23	$this->currency_symbol_position = Currency::get_currency_symbol_position( $this->get_currency_code() );
24	$this->currency_separator_decimal = Currency::get_currency_separator_decimal( $this->get_currency_code() );
25	$this->currency_separator_thousands = Currency::get_currency_separator_thousands( $this->get_currency_code() );
26	+ $this->set_precision( Currency::get_currency_precision( $this->get_currency_code() ) );
27	}
28
29	/**

75	);
76
77	}

78	}

src/Tribe/Editor/Provider.php CHANGED Viewed

	@@ -79,7 +79,7 @@ class Tribe__Tickets__Editor__Provider extends tad_DI52_ServiceProvider {
79	/**
80	* Register the blocks after plugins are fully loaded.
81	*
82	- * @since ~~TBD~~
83	*/
84	public function register_blocks() {
85	// Register blocks.


79	/**
80	* Register the blocks after plugins are fully loaded.
81	*
82	+ * @since 5.3.0
83	*/
84	public function register_blocks() {
85	// Register blocks.

src/Tribe/Main.php CHANGED Viewed

	@@ -7,7 +7,7 @@ class Tribe__Tickets__Main {
7	/**
8	* Current version of this plugin
9	*/
10	- const VERSION = '5.2.~~4.1~~';
11
12	/**
13	* Used to store the version history.


7	/**
8	* Current version of this plugin
9	*/
10	+ const VERSION = '5.3.0';
11
12	/**
13	* Used to store the version history.

src/Tribe/Plugin_Register.php CHANGED Viewed

	@@ -8,7 +8,7 @@ class Tribe__Tickets__Plugin_Register extends Tribe__Abstract_Plugin_Register {
8	protected $main_class = 'Tribe__Tickets__Main';
9	protected $dependencies = array(
10	'addon-dependencies' => array(
11	- 'Tribe__Tickets_Plus__Main' => '5.3.0-dev',
12	'Tribe__Events__Community__Tickets__Main' => '4.7.2-dev',
13	),
14	);


8	protected $main_class = 'Tribe__Tickets__Main';
9	protected $dependencies = array(
10	'addon-dependencies' => array(
11	+ 'Tribe__Tickets_Plus__Main' => '5.4.0-dev',
12	'Tribe__Events__Community__Tickets__Main' => '4.7.2-dev',
13	),
14	);

src/admin-views/settings/featured/container.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * Featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var string $title Featured settings title.
9	+ * @var string $description Featured settings description/HTML.
10	+ * @var string $content_template Template used for the content section.
11	+ * @var array $content_context Context for template used for content.
12	+ * @var string[] $classes Array of classes.
13	+ * @var array $links Array of arrays for links.
14	+ */
15	+
16	+ $classes[] = 'tec-tickets__admin-settings-featured';
17	+
18	+ ?>
19	+ <div <?php tribe_classes( $classes ); ?> >
20	+ <?php $this->template( 'title' ); ?>
21	+ <?php $this->template( 'description' ); ?>
22	+ <?php $this->template( 'content' ); ?>
23	+ <?php $this->template( 'links' ); ?>
24	+ </div>

src/admin-views/settings/featured/content.php ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ <?php
2	+ /**
3	+ * Featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var string $content_template Template used for the content section.
9	+ */
10	+
11	+ if ( empty( $content_template ) ) {
12	+ return;
13	+ }
14	+
15	+ ?>
16	+ <div class="tec-tickets__admin-settings-featured-content">
17	+ <?php echo $content_template; // phpcs:ignore ?>
18	+ </div>

src/admin-views/settings/featured/description.php ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ <?php
2	+ /**
3	+ * Title for featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var string $description Featured settings description.
9	+ */
10	+
11	+ if ( empty( $description ) ) {
12	+ return;
13	+ }
14	+
15	+ ?>
16	+ <div class="tec-tickets__admin-settings-featured-description">
17	+ <?php echo $description; // phpcs:ignore ?>
18	+ </div>

src/admin-views/settings/featured/link.php ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ <?php
2	+ /**
3	+ * Help link for featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var array $link Array of link arguments.
9	+ */
10	+
11	+ $defaults = [
12	+ 'slug' => 'help-1',
13	+ 'priority' => 10,
14	+ 'link' => 'https://evnt.is/1axt',
15	+ 'html' => '',
16	+ 'target' => '_blank',
17	+ 'classes' => [],
18	+ ];
19	+
20	+ $link = wp_parse_args( $link, $defaults );
21	+ $link['classes'][] = 'tec-tickets__admin-settings-featured-link';
22	+
23	+ $admin_views = tribe( Tribe__Tickets__Admin__Views::class );
24	+
25	+ ?>
26	+ <div <?php tribe_classes( $link['classes'] ); ?> >
27	+ <?php $admin_views->template( 'components/icons/lightbulb' ); ?>
28	+ <a
29	+ href="<?php echo esc_url( $link['link'] ); ?>"
30	+ target="<?php echo esc_attr( $link['target'] ); ?>"
31	+ rel="noopener noreferrer"
32	+ class="tec-tickets__admin-settings-featured-link-url"
33	+ ><?php esc_html_e( 'Learn more about configuring payment options with Tickets Commerce', 'event-tickets' ); ?></a>
34	+ </div>

src/admin-views/settings/featured/links.php ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ <?php
2	+ /**
3	+ * Help links for featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var array $links Array of links.
9	+ */
10	+
11	+ if ( empty( $links ) ) {
12	+ return;
13	+ }
14	+
15	+ ?>
16	+
17	+ <div class="tec-tickets__admin-settings-featured-links">
18	+ <?php
19	+ foreach ( $links as $link ) {
20	+ $this->template( 'link', [ 'link' => $link ] );
21	+ }
22	+ ?>
23	+ </div>

src/admin-views/settings/featured/title.php ADDED Viewed

	@@ -0,0 +1,18 @@


1	+ <?php
2	+ /**
3	+ * Title for featured settings box.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var string $title Featured settings title.
9	+ */
10	+
11	+ if ( empty( $title ) ) {
12	+ return;
13	+ }
14	+
15	+ ?>
16	+ <div class="tec-tickets__admin-settings-featured-title">
17	+ <?php echo esc_html( $title ); ?>
18	+ </div>

src/admin-views/settings/section/link.php ADDED Viewed

	@@ -0,0 +1,27 @@


1	+ <?php
2	+ /**
3	+ * Template to display a list of featured gateways.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var string $selected_section Slug of the currently selected section.
9	+ * @var array $classes Array of classes.
10	+ * @var string $url Link URL.
11	+ * @var string $slug Slug of the section.
12	+ * @var string $text Link text.
13	+ */
14	+
15	+ if ( empty( $text ) \|\| empty( $url ) ) {
16	+ return;
17	+ }
18	+
19	+ $classes[] = 'tec-tickets__admin-settings-tickets-commerce-section-menu-link';
20	+
21	+ // Determines if this is an active section
22	+ $classes['tec-tickets__admin-settings-tickets-commerce-section-menu-link--active'] = $selected_section === $slug;
23	+
24	+ ?>
25	+ <a <?php tribe_classes( $classes ); ?> href="<?php echo esc_attr( $url ); ?>">
26	+ <?php echo esc_html( $text ); ?>
27	+ </a>

src/admin-views/settings/section/menu.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+ /**
3	+ * Template to display a list of featured gateways.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var array[] $sections Array of section settings.
9	+ */
10	+
11	+ use \TEC\Tickets\Commerce\Payments_Tab;
12	+
13	+ if ( empty( $sections ) ) {
14	+ return;
15	+ }
16	+ ?>
17	+ <div class="tec-tickets__admin-settings-tickets-commerce-section-menu">
18	+ <?php foreach ( $sections as $section ) {
19	+ $this->template( 'section/link', $section );
20	+ }
21	+ ?>
22	+ </div>
23	+ <?php if ( ! empty( $selected_section ) ) : ?>
24	+ <input
25	+ type="hidden"
26	+ name="<?php echo esc_attr( Payments_Tab::$key_current_section ); ?>"
27	+ id="<?php echo esc_attr( Payments_Tab::$key_current_section ); ?>"
28	+ value="<?php echo esc_attr( $selected_section ); ?>"
29	+ />
30	+ <?php endif; ?>

src/admin-views/settings/tickets-commerce/gateways/brand.php ADDED Viewed

	@@ -0,0 +1,36 @@


1	+ <?php
2	+ /**
3	+ * Template to display a featured gateway.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var Gateway_Abstract $gateway Gateway object.
9	+ */
10	+
11	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
12	+
13	+ if ( empty( $gateway ) ) {
14	+ return;
15	+ }
16	+
17	+ if ( ! ( $gateway instanceof Abstract_Gateway ) ) {
18	+ return;
19	+ }
20	+
21	+ if ( ! $gateway::should_show() ) {
22	+ return;
23	+ }
24	+
25	+ ?>
26	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-brand">
27	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-logo">
28	+ <img
29	+ class="tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-logo-image"
30	+ src="<?php echo esc_url( $gateway->get_logo_url() ); ?>"
31	+ alt="<?php echo esc_attr( $gateway::get_label() ); ?>" />
32	+ </div>
33	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-subtitle">
34	+ <?php echo $gateway->get_subtitle(); ?>
35	+ </div>
36	+ </div>

src/admin-views/settings/tickets-commerce/gateways/button.php ADDED Viewed

	@@ -0,0 +1,52 @@


1	+ <?php
2	+ /**
3	+ * Template to display a featured gateway.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var Gateway_Abstract $gateway Gateway object.
9	+ */
10	+
11	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
12	+
13	+ if ( empty( $gateway ) ) {
14	+ return;
15	+ }
16	+
17	+ if ( ! ( $gateway instanceof Abstract_Gateway ) ) {
18	+ return;
19	+ }
20	+
21	+ if ( ! $gateway::should_show() ) {
22	+ return;
23	+ }
24	+
25	+ $classes = [
26	+ 'tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link',
27	+ 'tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active' => $gateway->is_active(),
28	+ ];
29	+
30	+ $button_text = sprintf(
31	+ // Translators: %s: Name of payment gateway.
32	+ __( 'Connect to %s', 'event-tickets' ),
33	+ $gateway->get_label()
34	+ );
35	+
36	+ if ( $gateway->is_active() ) {
37	+ $button_text = sprintf(
38	+ // Translators: %s: Name of payment gateway.
39	+ __( 'Edit %s Connection', 'event-tickets' ),
40	+ $gateway->get_label()
41	+ );
42	+ }
43	+
44	+ ?>
45	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-button">
46	+ <a
47	+ <?php tribe_classes( $classes ); ?>
48	+ href="<?php echo esc_url( $gateway->get_settings_url() ); ?>"
49	+ >
50	+ <?php echo esc_html( $button_text ); ?>
51	+ </a>
52	+ </div>

src/admin-views/settings/tickets-commerce/gateways/container.php ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ <?php
2	+ /**
3	+ * Template to display a list of featured gateways.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var Abstract_Gateway[] $gateways Array of gateway objects.
9	+ * @var Manager $manager Gateway Manager object.
10	+ */
11	+
12	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
13	+ use TEC\Tickets\Commerce\Gateways\Manager;
14	+
15	+ if ( empty( $gateways ) ) {
16	+ return;
17	+ }
18	+
19	+ ?>
20	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways">
21	+ <?php
22	+ foreach ( $gateways as $gateway ) {
23	+ $this->template( 'gateways/item', [ 'gateway' => $gateway ] );
24	+ }
25	+ ?>
26	+ </div>

src/admin-views/settings/tickets-commerce/gateways/item.php ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ <?php
2	+ /**
3	+ * Template to display a featured gateway.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var Gateway_Abstract $gateway Gateway object.
9	+ * @var Manager $manager Gateway Manager object.
10	+ */
11	+
12	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
13	+ use TEC\Tickets\Commerce\Gateways\Manager;
14	+
15	+ if ( empty( $gateway ) ) {
16	+ return;
17	+ }
18	+
19	+ if ( ! ( $gateway instanceof Abstract_Gateway ) ) {
20	+ return;
21	+ }
22	+
23	+ if ( ! $gateway::should_show() ) {
24	+ return;
25	+ }
26	+
27	+ $key = $gateway->get_key();
28	+
29	+ ?>
30	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item">
31	+ <?php $this->template( 'gateways/brand' ); ?>
32	+ <?php $this->template( 'gateways/status' ); ?>
33	+ <?php $this->template( 'gateways/button' ); ?>
34	+ </div>

src/admin-views/settings/tickets-commerce/gateways/status.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * Template to display a featured gateway.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var Gateway_Abstract $gateway Gateway object.
9	+ */
10	+
11	+ use TEC\Tickets\Commerce\Gateways\Contracts\Abstract_Gateway;
12	+
13	+ if ( empty( $gateway ) ) {
14	+ return;
15	+ }
16	+
17	+ if ( ! ( $gateway instanceof Abstract_Gateway ) ) {
18	+ return;
19	+ }
20	+
21	+ if ( ! $gateway::should_show() ) {
22	+ return;
23	+ }
24	+
25	+ $classes = [
26	+ 'tec-tickets__admin-settings-tickets-commerce-gateways-item-status',
27	+ 'tec-tickets__admin-settings-tickets-commerce-gateways-item-status--enabled' => $gateway->is_enabled() && $gateway->is_connected(),
28	+ ];
29	+
30	+ ?>
31	+ <div <?php tribe_classes( $classes ); ?>>
32	+ <?php echo $gateway->get_status_text(); // phpcs:ignore ?>
33	+ </div>

src/admin-views/settings/tickets-commerce/gateways/toggle.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * Template to display a featured gateway.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Template $this Template object.
8	+ * @var boolean $checked Toggle checked or not.
9	+ */
10	+
11	+ ?>
12	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle">
13	+ <label class="tec-tickets__admin-settings-tickets-commerce-toggle">
14	+ <input
15	+ type="checkbox"
16	+ disabled="disabled"
17	+ name="tickets_commerce_enabled"
18	+ <?php checked( $checked, true ); ?>
19	+ id="tickets-commerce-enable-input"
20	+ class="tec-tickets__admin-settings-tickets-commerce-toggle-checkbox"
21	+ />
22	+ <span class="tec-tickets__admin-settings-tickets-commerce-toggle-switch"></span>
23	+ </label>
24	+ </div>

src/admin-views/settings/tickets-commerce/paypal/connect/active.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings when connected.
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -20,7 +21,7 @@ if ( empty( $is_merchant_connected ) ) {
20
21	?>
22
23	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected">
24
25	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/paypal-status' ); ?>
26


2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings when connected.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

21
22	?>
23
24	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected">
25
26	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/paypal-status' ); ?>
27

src/admin-views/settings/tickets-commerce/paypal/connect/active/actions.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	- * @version 5.2.0
6	*
7	- * @since 5.2.0

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -19,10 +20,10 @@ if ( empty( $is_merchant_connected ) ) {
19	}
20	?>
21
22	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-actions">
23	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-connection' ); ?>
24
25	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-actions-debug">
26	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token' ); ?>
27
28	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info' ); ?>


2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	+ * @version 5.3.0
6	*
7	+ * @since 5.2.0
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

20	}
21	?>
22
23	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-actions">
24	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-connection' ); ?>
25
26	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-actions-debug">
27	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token' ); ?>
28
29	<?php $this->template( 'settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info' ); ?>

src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-access-token.php CHANGED Viewed

	@@ -2,27 +2,36 @@
2	/**
3	* The Template for displaying the Tickets Commerce refresh access token action button.
4	*
5	- * @version 5.2.0
6	*
7	* @since 5.2.0


8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
11	* @var TEC\Tickets\Commerce\Gateways\PayPal\Merchant $merchant [Global] The merchant class.
12	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
13	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.

14	*/
15


16	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
17
18	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
19	return;
20	}
21
22	- $url = Tribe__Settings::instance()->get_url( [ ~~'tab' => 'payments', 'tc-action' => 'paypal-refresh-access-token' ] );~~




23	?>
24
25	<a
26	href="<?php echo esc_url( $url ); ?>"
27	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link"
28	><?php esc_html_e( 'Refresh Access Token', 'event-tickets' ); ?></a>


2	/**
3	* The Template for displaying the Tickets Commerce refresh access token action button.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.0
8	+ * @since 5.3.0 Added section param to URL.
9	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
10	*
11	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
12	* @var string $plugin_url [Global] The plugin URL.
13	* @var TEC\Tickets\Commerce\Gateways\PayPal\Merchant $merchant [Global] The merchant class.
14	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
15	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
16	+ * @var string $gateway_key [Global] Key for gateway.
17	*/
18
19	+ use TEC\Tickets\Commerce\Payments_Tab;
20	+
21	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
22
23	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
24	return;
25	}
26
27	+ $url = Tribe__Settings::instance()->get_url( [
28	+ 'tab' => Payments_Tab::$slug,
29	+ tribe( Payments_Tab::class )::$key_current_section_get_var => $gateway_key,
30	+ 'tc-action' => 'paypal-refresh-access-token',
31	+ ] );
32	?>
33
34	<a
35	href="<?php echo esc_url( $url ); ?>"
36	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link"
37	><?php esc_html_e( 'Refresh Access Token', 'event-tickets' ); ?></a>

src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-connection.php CHANGED Viewed

	@@ -2,32 +2,41 @@
2	/**
3	* The Template for displaying the Tickets Commerce refresh connection action button.
4	*
5	- * @version 5.2.0
6	*
7	* @since 5.2.0


8	*
9	- * @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	- * @var string $plugin_url [Global] The plugin URL.
11	- * @var TEC\Tickets\Commerce\Gateways\PayPal\Merchant $merchant [Global] The merchant class.
12	- * @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
13	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
14	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.

15	*/
16


17	if ( empty( $is_merchant_connected ) ) {
18	return;
19	}
20
21	- $resync_connection_url = Tribe__Settings::instance()->get_url( [ ~~'tab' => 'payments', 'tc-action' => 'paypal-resync-connection' ] );~~




22	?>
23	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row">
24	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1"></div>
25	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2">
26	<a
27	href="<?php echo esc_url( $resync_connection_url ); ?>"
28	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button"
29	>
30	- <?php tribe( 'tickets.editor.template' )->template( 'v2/components/icons/reset', [ 'classes' => [ 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button-icon' ] ] ); ?>
31	<?php esc_html_e( 'Resync payment connection', 'event-tickets' ); ?>
32	</a>
33	</div>


2	/**
3	* The Template for displaying the Tickets Commerce refresh connection action button.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.0
8	+ * @since 5.3.0 Added section param to URL.
9	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
10	*
11	+ * @var Tribe__Tickets__Admin__Views $this [Global] Template object.
12	+ * @var string $plugin_url [Global] The plugin URL.
13	+ * @var TEC\Tickets\Commerce\Gateways\PayPal\Merchant $merchant [Global] The merchant class.
14	+ * @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
15	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
16	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
17	+ * @var string $gateway_key [Global] Key for gateway.
18	*/
19
20	+ use TEC\Tickets\Commerce\Payments_Tab;
21	+
22	if ( empty( $is_merchant_connected ) ) {
23	return;
24	}
25
26	+ $resync_connection_url = Tribe__Settings::instance()->get_url( [
27	+ 'tab' => Payments_Tab::$slug,
28	+ tribe( Payments_Tab::class )::$key_current_section_get_var => $gateway_key,
29	+ 'tc-action' => 'paypal-resync-connection',
30	+ ] );
31	?>
32	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
33	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1"></div>
34	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
35	<a
36	href="<?php echo esc_url( $resync_connection_url ); ?>"
37	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button"
38	>
39	+ <?php tribe( 'tickets.editor.template' )->template( 'v2/components/icons/reset', [ 'classes' => [ 'tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon' ] ] ); ?>
40	<?php esc_html_e( 'Resync payment connection', 'event-tickets' ); ?>
41	</a>
42	</div>

src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-user-info.php CHANGED Viewed

	@@ -2,9 +2,11 @@
2	/**
3	* The Template for displaying the Tickets Commerce refresh user info action button.
4	*
5	- * @version 5.2.0
6	*
7	* @since 5.2.0


8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -12,18 +14,25 @@
12	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
13	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
14	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.

15	*/
16


17	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
18
19	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
20	return;
21	}
22
23	- $url = Tribe__Settings::instance()->get_url( [ ~~'tab' => 'payments', 'tc-action' => 'paypal-refresh-user-info' ] );~~




24	?>
25
26	<a
27	href="<?php echo esc_url( $url ); ?>"
28	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link"
29	><?php esc_html_e( 'Refresh User Info', 'event-tickets' ); ?></a>


2	/**
3	* The Template for displaying the Tickets Commerce refresh user info action button.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.0
8	+ * @since 5.3.0 Added section param to URL.
9	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
10	*
11	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
12	* @var string $plugin_url [Global] The plugin URL.

14	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
15	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
16	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
17	+ * @var string $gateway_key [Global] Key for gateway.
18	*/
19
20	+ use TEC\Tickets\Commerce\Payments_Tab;
21	+
22	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
23
24	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
25	return;
26	}
27
28	+ $url = Tribe__Settings::instance()->get_url( [
29	+ 'tab' => Payments_Tab::$slug,
30	+ tribe( Payments_Tab::class )::$key_current_section_get_var => $gateway_key,
31	+ 'tc-action' => 'paypal-refresh-user-info',
32	+ ] );
33	?>
34
35	<a
36	href="<?php echo esc_url( $url ); ?>"
37	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link"
38	><?php esc_html_e( 'Refresh User Info', 'event-tickets' ); ?></a>

src/admin-views/settings/tickets-commerce/paypal/connect/active/actions/refresh-webhook.php CHANGED Viewed

	@@ -2,9 +2,11 @@
2	/**
3	* The Template for displaying the Tickets Commerce refresh webhook action button.
4	*
5	- * @version 5.2.0
6	*
7	* @since 5.2.0


8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -12,18 +14,25 @@
12	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
13	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
14	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.

15	*/
16


17	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
18
19	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
20	return;
21	}
22
23	- $url = Tribe__Settings::instance()->get_url( [ ~~'tab' => 'payments', 'tc-action' => 'paypal-refresh-webhook' ] );~~




24	?>
25
26	<a
27	href="<?php echo esc_url( $url ); ?>"
28	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link"
29	><?php esc_html_e( 'Refresh Webhook', 'event-tickets' ); ?></a>


2	/**
3	* The Template for displaying the Tickets Commerce refresh webhook action button.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.0
8	+ * @since 5.3.0 Added section param to URL.
9	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
10	*
11	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
12	* @var string $plugin_url [Global] The plugin URL.

14	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
15	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
16	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
17	+ * @var string $gateway_key [Global] Key for gateway.
18	*/
19
20	+ use TEC\Tickets\Commerce\Payments_Tab;
21	+
22	$debug = defined( 'WP_DEBUG' ) && WP_DEBUG;
23
24	if ( empty( $is_merchant_connected ) \|\| ! $debug ) {
25	return;
26	}
27
28	+ $url = Tribe__Settings::instance()->get_url( [
29	+ 'tab' => Payments_Tab::$slug,
30	+ tribe( Payments_Tab::class )::$key_current_section_get_var => $gateway_key,
31	+ 'tc-action' => 'paypal-refresh-webhook',
32	+ ] );
33	?>
34
35	<a
36	href="<?php echo esc_url( $url ); ?>"
37	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link"
38	><?php esc_html_e( 'Refresh Webhook', 'event-tickets' ); ?></a>

src/admin-views/settings/tickets-commerce/paypal/connect/active/connection.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	- * @version 5.1.10
6	*
7	- * @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -12,27 +13,34 @@
12	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
13	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
14	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.

15	*/
16


17	if ( empty( $is_merchant_connected ) ) {
18	return;
19	}
20
21	$name = $merchant->get_merchant_id();
22	- $disconnect_url = Tribe__Settings::instance()->get_url( [ ~~'tab' => 'payments', 'tc-action' => 'paypal-disconnect' ] );~~




23
24	?>
25	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row">
26	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1">
27	<?php esc_html_e( 'Connected as:', 'event-tickets' ); ?>
28	</div>
29	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2">
30	- <span class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-name">
31	<?php echo esc_html( $name ); ?>
32	</span>
33	<a
34	href="<?php echo esc_url( $disconnect_url ); ?>"
35	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link"
36	>
37	<?php esc_html_e( 'Disconnect', 'event-tickets' ); ?>
38	</a>


2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	+ * @version 5.3.0
6	*
7	+ * @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

13	* @var TEC\Tickets\Commerce\Gateways\PayPal\Signup $signup [Global] The Signup class.
14	* @var bool $is_merchant_active [Global] Whether the merchant is active or not.
15	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
16	+ * @var string $gateway_key [Global] Key for gateway.
17	*/
18
19	+ use TEC\Tickets\Commerce\Payments_Tab;
20	+
21	if ( empty( $is_merchant_connected ) ) {
22	return;
23	}
24
25	$name = $merchant->get_merchant_id();
26	+ $disconnect_url = Tribe__Settings::instance()->get_url( [
27	+ 'tab' => Payments_Tab::$slug,
28	+ Payments_Tab::$key_current_section_get_var => $gateway_key,
29	+ 'tc-action' => 'paypal-disconnect'
30	+ ] );
31
32	?>
33	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
34	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
35	<?php esc_html_e( 'Connected as:', 'event-tickets' ); ?>
36	</div>
37	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
38	+ <span class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-name">
39	<?php echo esc_html( $name ); ?>
40	</span>
41	<a
42	href="<?php echo esc_url( $disconnect_url ); ?>"
43	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link"
44	>
45	<?php esc_html_e( 'Disconnect', 'event-tickets' ); ?>
46	</a>

src/admin-views/settings/tickets-commerce/paypal/connect/active/paypal-status.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal status.
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -14,18 +15,18 @@
14	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
15	*/
16
17	- if ( empty( $is_merchant_connected ) ) {
18	return;
19	}
20
21	$errors = $signup->get_errors_from_on_boarded_data();
22	?>
23	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row">
24	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1">
25	<?php esc_html_e( 'PayPal Status:', 'event-tickets' ); ?>
26	</div>
27	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2">
28	- <span class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-text--connected">
29	<?php esc_html_e( 'Connected' ); ?> <span class="dashicons dashicons-saved"></span>
30	</span>
31


2	/**
3	* The Template for displaying the Tickets Commerce PayPal status.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

15	* @var bool $is_merchant_connected [Global] Whether the merchant is connected or not.
16	*/
17
18	+ if ( ! empty( $is_merchant_connected ) ) {
19	return;
20	}
21
22	$errors = $signup->get_errors_from_on_boarded_data();
23	?>
24	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
25	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
26	<?php esc_html_e( 'PayPal Status:', 'event-tickets' ); ?>
27	</div>
28	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
29	+ <span class="tec-tickets__admin-settings-tickets-commerce-gateway-connect-text--connected">
30	<?php esc_html_e( 'Connected' ); ?> <span class="dashicons dashicons-saved"></span>
31	</span>
32

src/admin-views/settings/tickets-commerce/paypal/connect/active/webhooks.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -29,25 +30,25 @@ if ( ! empty( $webhook_data['event_types'] ) ) {
29	}
30
31	?>
32	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row">
33	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1">
34	<?php esc_html_e( 'Webhooks:', 'event-tickets' ); ?>
35	</div>
36	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2">
37	<?php
38	foreach ( $webhooks_events->get_registered_events() as $event_name ) :
39	$webhook_label = $webhooks_events->get_webhook_label( $event_name );
40	$is_active = in_array( $event_name, $event_types_active, true );
41	$classes = [
42	- 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook',
43	- 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook--active' => $is_active,
44	]
45	?>
46	<div <?php tribe_classes( $classes ); ?>>
47	- <span class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook-name">
48	<?php echo esc_html( $webhook_label ); ?>
49	</span>
50	- <span class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook-error">
51	<?php esc_html_e( 'payment connection error', 'event-tickets' ); ?>
52	</span>
53	</div>


2	/**
3	* The Template for displaying the Tickets Commerce PayPal connection details.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

30	}
31
32	?>
33	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
34	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
35	<?php esc_html_e( 'Webhooks:', 'event-tickets' ); ?>
36	</div>
37	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
38	<?php
39	foreach ( $webhooks_events->get_registered_events() as $event_name ) :
40	$webhook_label = $webhooks_events->get_webhook_label( $event_name );
41	$is_active = in_array( $event_name, $event_types_active, true );
42	$classes = [
43	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook',
44	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active' => $is_active,
45	]
46	?>
47	<div <?php tribe_classes( $classes ); ?>>
48	+ <span class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-name">
49	<?php echo esc_html( $webhook_label ); ?>
50	</span>
51	+ <span class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error">
52	<?php esc_html_e( 'payment connection error', 'event-tickets' ); ?>
53	</span>
54	</div>

src/admin-views/settings/tickets-commerce/paypal/connect/help-links.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal help links.
4	*
5	- * @version 5.2.0
6	*
7	- * @since 5.2.0

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -15,7 +16,7 @@
15
16	?>
17
18	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-links">
19
20	<?php $this->template( 'settings/tickets-commerce/paypal/connect/help-links/configuring' ); ?>
21


2	/**
3	* The Template for displaying the Tickets Commerce PayPal help links.
4	*
5	+ * @version 5.3.0
6	*
7	+ * @since 5.2.0
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

16
17	?>
18
19	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-links">
20
21	<?php $this->template( 'settings/tickets-commerce/paypal/connect/help-links/configuring' ); ?>
22

src/admin-views/settings/tickets-commerce/paypal/connect/help-links/configuring.php CHANGED Viewed

	@@ -19,12 +19,12 @@ if ( ! empty( $is_merchant_connected ) ) {
19	}
20
21	?>
22	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link">
23	<?php $this->template( 'components/icons/lightbulb' ); ?>
24	<a
25	href="https://evnt.is/1axt"
26	target="_blank"
27	rel="noopener noreferrer"
28	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url"
29	><?php esc_html_e( 'Learn more about configuring PayPal payments', 'event-tickets' ); ?></a>
30	</div>


19	}
20
21	?>
22	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link">
23	<?php $this->template( 'components/icons/lightbulb' ); ?>
24	<a
25	href="https://evnt.is/1axt"
26	target="_blank"
27	rel="noopener noreferrer"
28	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url"
29	><?php esc_html_e( 'Learn more about configuring PayPal payments', 'event-tickets' ); ?></a>
30	</div>

src/admin-views/settings/tickets-commerce/paypal/connect/help-links/troubleshooting.php CHANGED Viewed

	@@ -14,12 +14,12 @@
14	*/
15
16	?>
17	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link">
18	<?php $this->template( 'components/icons/lightbulb' ); ?>
19	<a
20	href="https://evnt.is/1axw"
21	target="_blank"
22	rel="noopener noreferrer"
23	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url"
24	><?php esc_html_e( 'Get troubleshooting help', 'event-tickets' ); ?></a>
25	</div>


14	*/
15
16	?>
17	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link">
18	<?php $this->template( 'components/icons/lightbulb' ); ?>
19	<a
20	href="https://evnt.is/1axw"
21	target="_blank"
22	rel="noopener noreferrer"
23	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url"
24	><?php esc_html_e( 'Get troubleshooting help', 'event-tickets' ); ?></a>
25	</div>

src/admin-views/settings/tickets-commerce/paypal/connect/inactive.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings when inactive (not connected).
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -20,16 +21,16 @@ if ( ! empty( $is_merchant_connected ) ) {
20
21	?>
22
23	- <h2 class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-title">
24	<?php esc_html_e( 'Accept online payments with PayPal!', 'event-tickets' ); ?>
25	</h2>
26
27	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-description">
28	<p>
29	<?php esc_html_e( 'Start selling tickets to your events today with PayPal. Attendees can purchase tickets directly on your site using debit or credit cards with no additional fees.', 'event-tickets' ); ?>
30	</p>
31
32	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-signup-links">
33	<?php echo $signup->get_link_html(); // phpcs:ignore ?>
34	</div>
35


2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings when inactive (not connected).
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

21
22	?>
23
24	+ <h2 class="tec-tickets__admin-settings-tickets-commerce-gateway-title">
25	<?php esc_html_e( 'Accept online payments with PayPal!', 'event-tickets' ); ?>
26	</h2>
27
28	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-description">
29	<p>
30	<?php esc_html_e( 'Start selling tickets to your events today with PayPal. Attendees can purchase tickets directly on your site using debit or credit cards with no additional fees.', 'event-tickets' ); ?>
31	</p>
32
33	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-signup-links">
34	<?php echo $signup->get_link_html(); // phpcs:ignore ?>
35	</div>
36

src/admin-views/settings/tickets-commerce/paypal/connect/logo.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal logo and features.
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -16,7 +17,7 @@
16
17	?>
18
19	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo">
20
21	<?php $this->template( 'settings/tickets-commerce/paypal/connect/logo/image' ); ?>
22


2	/**
3	* The Template for displaying the Tickets Commerce PayPal logo and features.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

17
18	?>
19
20	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-logo">
21
22	<?php $this->template( 'settings/tickets-commerce/paypal/connect/logo/image' ); ?>
23

src/admin-views/settings/tickets-commerce/paypal/connect/logo/image.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings, the PayPal logo specifically.
4	*
5	- * @version 5.1.10
6	*
7	- * @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -20,5 +21,5 @@ $image_src = tribe_resource_url( 'images/admin/paypal-logo.png', false, null, Tr
20	<img
21	src="<?php echo esc_url( $image_src ); ?>"
22	alt="<?php esc_attr_e( 'PayPal Logo Image', 'event-tickets' ); ?>"
23	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo-image"
24	>


2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings, the PayPal logo specifically.
4	*
5	+ * @version 5.3.0
6	*
7	+ * @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

21	<img
22	src="<?php echo esc_url( $image_src ); ?>"
23	alt="<?php esc_attr_e( 'PayPal Logo Image', 'event-tickets' ); ?>"
24	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-logo-image"
25	>

src/admin-views/settings/tickets-commerce/paypal/main.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings.
4	*
5	- * @version 5.1.10
6	*
7	* @since 5.1.10

8	*
9	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
10	* @var string $plugin_url [Global] The plugin URL.
	@@ -15,13 +16,13 @@
15	*/
16
17	$classes = [
18	- 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~',
19	- 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~--connected' => $is_merchant_connected,
20	]
21	?>
22
23	<div <?php tribe_classes( $classes ); ?>>
24	- <div id="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect" class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect">
25
26	<?php $this->template( 'settings/tickets-commerce/paypal/connect/inactive' ); ?>
27


2	/**
3	* The Template for displaying the Tickets Commerce PayPal Settings.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.1.10
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*
10	* @var Tribe__Tickets__Admin__Views $this [Global] Template object.
11	* @var string $plugin_url [Global] The plugin URL.

16	*/
17
18	$classes = [
19	+ 'tec-tickets__admin-settings-tickets-commerce-gateway',
20	+ 'tec-tickets__admin-settings-tickets-commerce-gateway--connected' => $is_merchant_connected,
21	]
22	?>
23
24	<div <?php tribe_classes( $classes ); ?>>
25	+ <div id="tec-tickets__admin-settings-tickets-commerce-gateway-connect" class="tec-tickets__admin-settings-tickets-commerce-gateway-connect">
26
27	<?php $this->template( 'settings/tickets-commerce/paypal/connect/inactive' ); ?>
28

src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete.php CHANGED Viewed

	@@ -20,13 +20,13 @@ $content = $this->template( 'settings/tickets-commerce/paypal/modal/signup-c
20	$args = [
21	'append_target' => '#paypal-connected-modal-target',
22	'button_id' => 'paypal-connected-modal-button',
23	- 'content_wrapper_classes' => 'tribe-dialog__wrapper tribe-tickets__admin-container event-tickets tribe-common tribe-modal__wrapper--~~paypal~~-connected',
24	'title' => esc_html__( "You are now connected to PayPal, here's what's next...", 'event-tickets' ),
25	'title_classes' => [
26	'tribe-dialog__title',
27	'tribe-modal__title',
28	'tribe-common-h5',
29	- 'tribe-modal__title--~~paypal~~-connected',
30	],
31	];
32


20	$args = [
21	'append_target' => '#paypal-connected-modal-target',
22	'button_id' => 'paypal-connected-modal-button',
23	+ 'content_wrapper_classes' => 'tribe-dialog__wrapper tribe-tickets__admin-container event-tickets tribe-common tribe-modal__wrapper--gateway-connected',
24	'title' => esc_html__( "You are now connected to PayPal, here's what's next...", 'event-tickets' ),
25	'title_classes' => [
26	'tribe-dialog__title',
27	'tribe-modal__title',
28	'tribe-common-h5',
29	+ 'tribe-modal__title--gateway-connected',
30	],
31	];
32

src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/content.php CHANGED Viewed

	@@ -2,13 +2,14 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal modal content when connected.
4	*
5	- * @version 5.2.1
6	*
7	* @since 5.2.1

8	*/
9
10	?>
11	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-modal-content tec-tickets__admin-modal tribe-common-b2">
12
13	<?php $this->template( 'settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode' ); ?>
14


2	/**
3	* The Template for displaying the Tickets Commerce PayPal modal content when connected.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.1
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*/
10
11	?>
12	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-modal-content tec-tickets__admin-modal tribe-common-b2">
13
14	<?php $this->template( 'settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode' ); ?>
15

src/admin-views/settings/tickets-commerce/paypal/modal/signup-complete/notice-test-mode.php CHANGED Viewed

	@@ -2,9 +2,10 @@
2	/**
3	* The Template for displaying the Tickets Commerce PayPal modal notice when connected.
4	*
5	- * @version 5.2.1
6	*
7	* @since 5.2.1

8	*/
9
10	// Bail if not in sandbox mode.
	@@ -15,10 +16,10 @@ if ( empty( tec_tickets_commerce_is_sandbox_mode() ) ) {
15	tribe( 'tickets.editor.template' )->template(
16	'components/notice',
17	[
18	- 'id' => 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~-modal-notice-error',
19	'notice_classes' => [
20	'tribe-tickets__notice--error',
21	- 'tec-tickets__admin-settings-tickets-commerce-~~paypal~~-modal-notice-error',
22	],
23	'content' => __( 'You have connected your account for test mode. You will need to connect again once you are in live mode.', 'event-tickets' ),
24	]


2	/**
3	* The Template for displaying the Tickets Commerce PayPal modal notice when connected.
4	*
5	+ * @version 5.3.0
6	*
7	* @since 5.2.1
8	+ * @since 5.3.0 Using generic CSS classes for gateway instead of PayPal.
9	*/
10
11	// Bail if not in sandbox mode.

16	tribe( 'tickets.editor.template' )->template(
17	'components/notice',
18	[
19	+ 'id' => 'tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error',
20	'notice_classes' => [
21	'tribe-tickets__notice--error',
22	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error',
23	],
24	'content' => __( 'You have connected your account for test mode. You will need to connect again once you are in live mode.', 'event-tickets' ),
25	]

src/admin-views/settings/tickets-commerce/paypal/signup-link.php CHANGED Viewed

	@@ -7,10 +7,10 @@ if ( empty( $selected_country_code ) ) {
7	}
8	?>
9	<div
10	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-signup-settings"
11	>
12	<p
13	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-merchant-country-container"
14	>
15	<select
16	name='tec-tickets-commerce-gateway-paypal-merchant-country'
	@@ -31,14 +31,14 @@ if ( empty( $selected_country_code ) ) {
31	</select>
32	</p>
33
34	- <div class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button">
35	<a
36	target="_blank"
37	data-paypal-onboard-complete="tecTicketsCommerceGatewayPayPalSignupCallback"
38	href="<?php echo esc_url( $url ) ?>&displayMode=minibrowser"
39	data-paypal-button="true"
40	id="connect_to_paypal"
41	- class="tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link"
42	>
43	<?php echo wp_kses( __( 'Connect Automatically with <i>PayPal</i>', 'event-tickets' ), 'post' ); ?>
44	</a>


7	}
8	?>
9	<div
10	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-signup-settings"
11	>
12	<p
13	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container"
14	>
15	<select
16	name='tec-tickets-commerce-gateway-paypal-merchant-country'

31	</select>
32	</p>
33
34	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connect-button">
35	<a
36	target="_blank"
37	data-paypal-onboard-complete="tecTicketsCommerceGatewayPayPalSignupCallback"
38	href="<?php echo esc_url( $url ) ?>&displayMode=minibrowser"
39	data-paypal-button="true"
40	id="connect_to_paypal"
41	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link"
42	>
43	<?php echo wp_kses( __( 'Connect Automatically with <i>PayPal</i>', 'event-tickets' ), 'post' ); ?>
44	</a>

src/admin-views/settings/tickets-commerce/stripe/connect/active.php ADDED Viewed

	@@ -0,0 +1,32 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe Settings when connected.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( false === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+ ?>
19	+
20	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected">
21	+
22	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/active/connection' ); ?>
23	+
24	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/active/stripe-status' ); ?>
25	+
26	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/active/stripe-currency' ); ?>
27	+
28	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/active/button' ); ?>
29	+
30	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/help-links' ); ?>
31	+
32	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/active/button.php ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe connection details.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( false === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+
19	+ ?>
20	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
21	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1"></div>
22	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
23	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateways-item-button">
24	+ <a
25	+ class="tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link"
26	+ href="<?php echo esc_url( 'https://dashboard.stripe.com/settings' ); ?>"
27	+ target="_blank"
28	+ rel="noopener noreferrer"
29	+ >
30	+ <?php esc_html_e( 'Edit Your Stripe Settings', 'event-tickets' ); ?>
31	+ </a>
32	+ </div>
33	+ </div>
34	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/active/connection.php ADDED Viewed

	@@ -0,0 +1,38 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe connection details.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( false === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+
19	+ $name = $merchant->get_client_id();
20	+ $disconnect_url = $signup->generate_disconnect_url();
21	+
22	+ ?>
23	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
24	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
25	+ <?php esc_html_e( 'Connected as:', 'event-tickets' ); ?>
26	+ </div>
27	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
28	+ <span class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-name">
29	+ <?php echo esc_html( $name ); ?>
30	+ </span>
31	+ <a
32	+ href="<?php echo esc_url( $disconnect_url ); ?>"
33	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link"
34	+ >
35	+ <?php esc_html_e( 'Disconnect', 'event-tickets' ); ?>
36	+ </a>
37	+ </div>
38	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-currency.php ADDED Viewed

	@@ -0,0 +1,60 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe currency.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ use TEC\Tickets\Commerce\Utils\Currency;
16	+
17	+ if ( false === $merchant_status['connected'] ) {
18	+ return;
19	+ }
20	+
21	+ if ( empty( $merchant_status['default_currency'] ) ) {
22	+ return;
23	+ }
24	+
25	+ $stripe_currency = strtoupper( $merchant_status['default_currency'] );
26	+ $tc_currency = Currency::get_currency_code();
27	+
28	+ if ( $stripe_currency !== $tc_currency ) {
29	+ $message = sprintf(
30	+ // Translators: %1$s is the Stripe currency, %2$s is the Tickets Commerce currency symbol.
31	+ __( 'Your Stripe account is set to %1$s, but your Tickets Commerce site is set to %2$s. Using different currencies for Tickets Commerce and Stripe may not be supported by all payment methods available in %2$s, and may result in exchange rates and conversions from %2$s to %1$s being handled by Stripe.', 'event-tickets' ),
32	+ '<strong>' . $stripe_currency . '</strong>',
33	+ '<strong>' . $tc_currency . '</strong>'
34	+ );
35	+ } else {
36	+ $message = sprintf(
37	+ // Translators: %1$s The opening `<a>` tag with the stripe link, %2$s The closing `</a>` tag.
38	+ __( 'Please be sure to enable all the payment methods you want to use for this currency on your %1$sstripe dashboard%2$s.', 'event-tickets' ),
39	+ '<a href="https://dashboard.stripe.com/settings/payment_methods" target="_blank" rel="noopener noreferrer">',
40	+ '</a>'
41	+ );
42	+ }
43	+
44	+ $message_classes = [
45	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-currency-message',
46	+ ];
47	+
48	+ ?>
49	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
50	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
51	+ <?php esc_html_e( 'Stripe currency:', 'event-tickets' ); ?>
52	+ </div>
53	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
54	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-currency"><?php echo esc_html( Currency::get_currency_name( $stripe_currency ) ); ?></div>
55	+ <div <?php tribe_classes( $message_classes ); ?>>
56	+ <span class="dashicons dashicons-info-outline"></span>
57	+ <?php echo wp_kses_post( $message ); ?>
58	+ </div>
59	+ </div>
60	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/active/stripe-status.php ADDED Viewed

	@@ -0,0 +1,77 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe status.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( false === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+
19	+ $errors = $merchant_status['errors'];
20	+ $capabilities = $merchant_status['capabilities'];
21	+
22	+ ?>
23	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-row">
24	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1">
25	+ <?php esc_html_e( 'Payments status:', 'event-tickets' ); ?>
26	+ </div>
27	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2">
28	+ <?php if ( ! empty( $capabilities ) && is_array( $capabilities ) ) : ?>
29	+ <ul>
30	+ <?php
31	+ foreach ( $capabilities as $capability => $status ) :
32	+ $capability_classes = [
33	+ 'dashicons',
34	+ 'dashicons-yes' => 'inactive' !== $status,
35	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-capability--yes' => 'inactive' !== $status,
36	+ 'dashicons-no' => 'inactive' === $status,
37	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-capability--no' => 'inactive' === $status,
38	+ ];
39	+
40	+ $capability_title = 'inactive' === $status ? __( 'Disabled', 'event-tickets' ) : __( 'Enabled', 'event-tickets' );
41	+ ?>
42	+ <li>
43	+ <span <?php tribe_classes( $capability_classes ); ?> title="<?php echo esc_attr( $capability_title ); ?>"></span>
44	+ <?php echo esc_html( str_replace( '_payments', '', $capability ) ); ?>
45	+ </li>
46	+ <?php endforeach; ?>
47	+ </ul>
48	+ <?php endif; ?>
49	+
50	+ <?php if ( ! empty( $errors['requirements'] ) && is_array( $errors['requirements'] ) ) : ?>
51	+ <h3><?php echo esc_html_e( 'Requirements', 'event-tickets' ); ?></h3>
52	+ <ul>
53	+ <?php foreach ( $errors['requirements'] as $error ) : ?>
54	+ <li>
55	+ <span class="dashicons dashicons-warning" style="color: red;"></span>
56	+ <span class="error-title"><?php echo esc_html( $error['requirement'] ); ?></span><br>
57	+ <span class="error-description"><?php echo esc_html( $error['reason'] ); ?></span>
58	+ </li>
59	+ <?php endforeach; ?>
60	+ </ul>
61	+ <?php endif; ?>
62	+
63	+ <?php if ( ! empty( $errors['future_requirements'] ) && is_array( $errors['future_requirements'] ) ) : ?>
64	+ <h3><?php echo esc_html_e( 'Future Requirements', 'event-tickets' ); ?></h3>
65	+ <ul>
66	+ <?php foreach ( $errors['future_requirements'] as $error ) : ?>
67	+ <li>
68	+ <span class="dashicons dashicons-warning" style="color: red;"></span>
69	+ <span class="error-title"><?php echo esc_html( $error['requirement'] ); ?></span>
70	+ <span class="error-description"><?php echo esc_html( $error['reason'] ); ?></span>
71	+ </li>
72	+ <?php endforeach; ?>
73	+ </ul>
74	+ <?php endif; ?>
75	+ </div>
76	+
77	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/help-links.php ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe help links.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ ?>
16	+
17	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-links">
18	+
19	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/help-links/configuring' ); ?>
20	+
21	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/help-links/troubleshooting' ); ?>
22	+
23	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/help-links/configuring.php ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe help links (configuring).
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( false === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+
19	+ ?>
20	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link">
21	+ <?php $this->template( 'components/icons/lightbulb' ); ?>
22	+ <!-- @todo: We need to update this link. -->
23	+ <a
24	+ href="https://evnt.is/1axt"
25	+ target="_blank"
26	+ rel="noopener noreferrer"
27	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url"
28	+ ><?php esc_html_e( 'Learn more about configuring Stripe payments', 'event-tickets' ); ?></a>
29	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/help-links/troubleshooting.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe help links (troubleshooting).
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+ ?>
15	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link">
16	+ <?php $this->template( 'components/icons/lightbulb' ); ?>
17	+ <!-- @todo: We need to update this link. -->
18	+ <a
19	+ href="https://evnt.is/1axw"
20	+ target="_blank"
21	+ rel="noopener noreferrer"
22	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url"
23	+ ><?php esc_html_e( 'Get troubleshooting help', 'event-tickets' ); ?></a>
24	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/inactive.php ADDED Viewed

	@@ -0,0 +1,35 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe Settings when inactive (not connected).
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ if ( true === $merchant_status['connected'] ) {
16	+ return;
17	+ }
18	+
19	+ ?>
20	+
21	+ <h2 class="tec-tickets__admin-settings-tickets-commerce-gateway-title">
22	+ <?php esc_html_e( 'Accept online payments with Stripe!', 'event-tickets' ); ?>
23	+ </h2>
24	+
25	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-description">
26	+ <p class="tec-tickets__admin-settings-tickets-commerce-gateway-description-text">
27	+ <?php echo wp_kses( __( 'Start selling tickets to your events today with Stripe integration for Tickets Commerce. Enable highly-configurable credit and debit card checkout with enhanced features like Afterpay, AliPay, Degiro, Klarna and more.<br>', 'event-tickets' ), [ 'br' => [] ] ); ?>
28	+ </p>
29	+
30	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-signup-links">
31	+ <?php $signup->get_link_html(); ?>
32	+ </div>
33	+
34	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/help-links' ); ?>
35	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/logo.php ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe logo and features.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ ?>
16	+
17	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-logo">
18	+
19	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/logo/image' ); ?>
20	+
21	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/logo/features' ); ?>
22	+
23	+ </div>

src/admin-views/settings/tickets-commerce/stripe/connect/logo/features.php ADDED Viewed

	@@ -0,0 +1,29 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe features.
4	+ *
5	+ * @version 5.3.0
6	+ *
7	+ * @since 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ ?>
16	+ <ul>
17	+ <li>
18	+ <?php esc_html_e( 'Credit, debit card payments and more!', 'event-tickets' ); ?>
19	+ </li>
20	+ <li>
21	+ <?php esc_html_e( 'Easy, streamlined connection', 'event-tickets' ); ?>
22	+ </li>
23	+ <li>
24	+ <?php esc_html_e( 'Accept payments from around the world', 'event-tickets' ); ?>
25	+ </li>
26	+ <li>
27	+ <?php esc_html_e( 'Supports 3D Secure payments', 'event-tickets' ); ?>
28	+ </li>
29	+ </ul>

src/admin-views/settings/tickets-commerce/stripe/connect/logo/image.php ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe Settings, the PayPal logo specifically.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @version 5.3.0
8	+ *
9	+ * @var string $plugin_url [Global] The plugin URL.
10	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
11	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
12	+ * @var array $merchant_status [Global] Merchant Status data.
13	+ */
14	+
15	+ $image_src = tribe_resource_url( 'images/admin/stripe-logo.png', false, null, Tribe__Tickets__Main::instance() );
16	+
17	+ ?>
18	+
19	+ <img
20	+ width="200" <?php // @todo remove this to style properly ?>
21	+ src="<?php echo esc_url( $image_src ); ?>"
22	+ alt="<?php esc_attr_e( 'Stripe Logo Image', 'event-tickets' ); ?>"
23	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-logo-image tec-tickets__admin-settings-tickets-commerce-gateway-logo-image--stripe"
24	+ >

src/admin-views/settings/tickets-commerce/stripe/main.php ADDED Viewed

	@@ -0,0 +1,39 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe Settings.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @todo FrontEnd needs to revisit all of these templates to make sure we're not missing anything
8	+ *
9	+ * @version 5.3.0
10	+ *
11	+ * @var string $plugin_url [Global] The plugin URL.
12	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Signup $signup [Global] The Signup class.
13	+ * @var TEC\Tickets\Commerce\Gateways\Stripe\Merchant $merchant [Global] The Signup class.
14	+ * @var array $merchant_status [Global] Merchant Status data.
15	+ */
16	+
17	+ $classes = [
18	+ 'tec-tickets__admin-settings-tickets-commerce-gateway',
19	+ 'tec-tickets__admin-settings-tickets-commerce-gateway--connected' => $merchant_status['connected'],
20	+ ]
21	+ ?>
22	+
23	+ <div <?php tribe_classes( $classes ); ?>>
24	+ <div
25	+ id="tec-tickets__admin-settings-tickets-commerce-gateway-connect"
26	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connect"
27	+ >
28	+
29	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/inactive' ); ?>
30	+
31	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/active' ); ?>
32	+
33	+ </div>
34	+
35	+ <?php $this->template( 'settings/tickets-commerce/stripe/connect/logo' ); ?>
36	+
37	+ </div>
38	+
39	+ <?php $this->template( 'settings/tickets-commerce/stripe/modal/signup-complete' ); ?>

src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete.php ADDED Viewed

	@@ -0,0 +1,42 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe Modal after a successful connection.
4	+ *
5	+ * @version 5.3.0
6	+ *
7	+ * @since 5.3.0
8	+ */
9	+
10	+ $request_vars = tribe_get_request_vars();
11	+
12	+ // Bail if we're not in the correct context, when Stripe was connected.
13	+ if ( empty( $request_vars['tc-status'] ) \|\| 'stripe-signup-complete' !== $request_vars['tc-status'] ) {
14	+ return;
15	+ }
16	+
17	+ $dialog_view = tribe( 'dialog.view' );
18	+ $content = $this->template( 'settings/tickets-commerce/stripe/modal/signup-complete/content', [], false );
19	+
20	+ $args = [
21	+ 'append_target' => '#stripe-connected-modal-target',
22	+ 'button_id' => 'stripe-connected-modal-button',
23	+ 'content_wrapper_classes' => 'tribe-dialog__wrapper tribe-tickets__admin-container event-tickets tribe-common tribe-modal__wrapper--stripe-connected',
24	+ 'title' => esc_html__( "You are now connected to Stripe! What's next?", 'event-tickets' ),
25	+ 'title_classes' => [
26	+ 'tribe-dialog__title',
27	+ 'tribe-modal__title',
28	+ 'tribe-common-h5',
29	+ 'tribe-modal__title--gateway-connected',
30	+ ],
31	+ ];
32	+
33	+ ob_start();
34	+ $dialog_view->render_modal( $content, $args, 'stripe-connected-modal-id' );
35	+ $modal_content = ob_get_clean();
36	+
37	+ $modal = '<div class="tribe-common event-tickets">';
38	+ $modal .= '<span id="stripe-connected-modal-target"></span>';
39	+ $modal .= $modal_content;
40	+ $modal .= '</div>';
41	+
42	+ echo $modal; // phpcs:ignore

src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/content.php ADDED Viewed

	@@ -0,0 +1,72 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe modal content when connected.
4	+ *
5	+ * @version 5.3.0
6	+ *
7	+ * @since 5.3.0
8	+ */
9	+
10	+ ?>
11	+ <div class="tec-tickets__admin-settings-tickets-commerce-stripe-modal-content tec-tickets__admin-modal tribe-common-b2">
12	+
13	+ <?php $this->template( 'settings/tickets-commerce/stripe/modal/signup-complete/notice-test-mode' ); ?>
14	+
15	+ <div class="tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section">
16	+ <strong><?php esc_html_e( 'Currency', 'event-tickets' ); ?></strong> —
17	+ <?php
18	+ esc_html_e( 'Be sure that your Stripe currency matches the currency you have configured for Tickets Commerce, to avoid any issues or unexpected conversion fees.', 'event-tickets' );
19	+ ?>
20	+ </div>
21	+
22	+ <div class="tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section">
23	+ <strong><?php esc_html_e( 'Payment methods', 'event-tickets' ); ?></strong> —
24	+ <?php
25	+ printf(
26	+ // Translators: %1$s: opening `a` tag to stripe's dashboard. %2$s: closing `a` tag.
27	+ esc_html__( 'You will have to confirm that the payments methods you have selected to sell tickets are enabled on the %1$sStripe payment methods section%2$s.', 'event-tickets' ),
28	+ '<a href="https://dashboard.stripe.com/settings/payment_methods" target="_blank" rel="noopener noreferrer" class="tribe-common-anchor-alt">',
29	+ '</a>'
30	+ );
31	+ ?>
32	+ </div>
33	+
34	+ <div class="tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section">
35	+ <strong><?php esc_html_e( 'Webhooks', 'event-tickets' ); ?></strong> —
36	+ <?php
37	+ printf(
38	+ // Translators: %1$s: opening `a` tag to the knowledge base article. %2$s: closing `a` tag.
39	+ esc_html__( 'In order for ticket sales to be marked as complete for some payment methods on your Stripe gateway for your Event Tickets site, you must configure the webhook at Stripe. %1$sLearn how to set up webhooks here%2$s.', 'event-tickets' ),
40	+ '<a href="https://evnt.is/1b3p" target="_blank" rel="noopener noreferrer" class="tribe-common-anchor-alt">',
41	+ '</a>'
42	+ );
43	+ ?>
44	+ </div>
45	+
46	+ <div class="tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section">
47	+ <strong><?php esc_html_e( 'PCI Compliance', 'event-tickets' ); ?></strong> —
48	+ <?php
49	+ printf(
50	+ // Translators: %1$s: opening `a` tag to the knowledge base article. %2$s: closing `a` tag.
51	+ esc_html__( 'Stripe allows you to accept credit or debit cards directly on your website. Because of this, your site needs to maintain %1$sPCI-DSS compliance%2$s.', 'event-tickets' ),
52	+ '<a href="https://theeventscalendar.com/knowledgebase/k/pci-compliance/" target="_blank" rel="noopener noreferrer" class="tribe-common-anchor-alt">',
53	+ '</a>'
54	+ );
55	+ ?>
56	+ </div>
57	+
58	+
59	+ <div class="tec-tickets__admin-modal-buttons">
60	+
61	+ <button
62	+ data-js="a11y-close-button"
63	+ class="tribe-common-c-btn tribe-common-b1 tribe-common-b2--min-medium tribe-modal__close-button"
64	+ type="button"
65	+ aria-label="<?php esc_attr_e( 'Close this modal window', 'event-tickets' ); ?>"
66	+ >
67	+ <?php esc_html_e( 'Got it, thanks!', 'event-tickets' ); ?>
68	+ </button>
69	+
70	+ </div>
71	+
72	+ </div>

src/admin-views/settings/tickets-commerce/stripe/modal/signup-complete/notice-test-mode.php ADDED Viewed

	@@ -0,0 +1,25 @@


1	+ <?php
2	+ /**
3	+ * The Template for displaying the Tickets Commerce Stripe modal notice when connected.
4	+ *
5	+ * @version 5.3.0
6	+ *
7	+ * @since 5.3.0
8	+ */
9	+
10	+ // Bail if not in sandbox mode.
11	+ if ( empty( tec_tickets_commerce_is_sandbox_mode() ) ) {
12	+ return;
13	+ }
14	+
15	+ tribe( 'tickets.editor.template' )->template(
16	+ 'components/notice',
17	+ [
18	+ 'id' => 'tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error',
19	+ 'notice_classes' => [
20	+ 'tribe-tickets__notice--error',
21	+ 'tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error',
22	+ ],
23	+ 'content' => __( 'Your connection is active, but Tickets Commerce is set to test mode. While in test mode no live transactions are processed.', 'event-tickets' ),
24	+ ]
25	+ );

src/admin-views/settings/tickets-commerce/stripe/signup-link.php ADDED Viewed

	@@ -0,0 +1,26 @@


1	+ <?php
2	+ /**
3	+ * Template to display the Stripe signup link.
4	+ *
5	+ * @since 5.3.0
6	+ *
7	+ * @var Tribe__Tickets__Admin__Views $this Template object.
8	+ * @var array $gateways Array of gateway objects.
9	+ */
10	+
11	+ ?>
12	+ <div
13	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-signup-settings"
14	+ >
15	+ <div class="tec-tickets__admin-settings-tickets-commerce-gateway-connect-button">
16	+ <a
17	+ data-gateway-onboard-complete="tecTicketsCommerceGatewayStripeSignupCallback"
18	+ href="<?php echo esc_url( $url ); ?>"
19	+ data-gateway-button="true"
20	+ id="connect_to_stripe"
21	+ class="tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link"
22	+ >
23	+ <?php echo wp_kses( __( 'Get Connected with <i>Stripe</i>', 'event-tickets' ), [ 'i'=> [], 'em' => [], 'strong' => [] ] ); ?>
24	+ </a>
25	+ </div>
26	+ </div>

src/resources/css/tickets-admin-settings.css CHANGED Viewed

	@@ -777,6 +777,7 @@ a.event-tickets__admin-tc-banner-link:active,
777	@todo @juanfra: This was already here, inherited. We need to move to common.
778	*/
779

780	#tribe-field-tickets-commerce-paypal-commerce-configure {
781	padding-left: 0;
782	width: 100%;
	@@ -786,7 +787,7 @@ a.event-tickets__admin-tc-banner-link:active,
786	@todo @juanfra: This was already here, inherited. We need to move to common.
787	*/
788
789	- #tribe-field-tickets-commerce-paypal-commerce-configure .tribe-field-wrap {
790	float: none;
791	max-width: none;
792	}
	@@ -862,7 +863,7 @@ a.event-tickets__admin-tc-banner-link:active,
862	max-width: 84%;
863	}
864
865	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~ {
866	background: #fff;
867	border: 1px solid #ccc;
868	border-radius: 4px;
	@@ -870,67 +871,73 @@ a.event-tickets__admin-tc-banner-link:active,
870	display: flex;
871	flex-direction: row;
872	justify-content: space-around;

873	padding: 45px 32px 20px 32px;
874	}
875
876	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-title {
877	font-size: 20px;
878	}
879
880	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-description {




881	margin-bottom: 20px;
882	}
883
884	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-description p {
885	max-width: 470px;
886	}
887
888	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-signup-links {

889	margin-top: var(--tec-spacer-8);
890	}
891
892	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-links {
893	margin-top: var(--tec-spacer-8);
894	}
895
896	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link {
897	align-items: center;
898	display: flex;
899	}
900
901	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link:not(:last-of-type) {
902	margin-bottom: 8px;
903	}
904
905	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link,
906	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url {
907	margin-left: 8px;
908	}
909
910	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link,
911	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link:hover,
912	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link:active,
913	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link:visited,
914	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link:focus,
915	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url,
916	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url:hover,
917	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url:active,
918	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url:visited,
919	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url:focus {
920	color: #405bfb;
921	}
922
923	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo ul {
924	list-style: none;
925	margin: inherit;
926	}
927
928	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo li {
929	line-height: 1.8;
930	margin-bottom: 16px;
931	}
932
933	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo ul li:before {
934	background-color: #405bfb;
935	border-radius: 100%;
936	content: '';
	@@ -940,7 +947,7 @@ a.event-tickets__admin-tc-banner-link:active,
940	width: 7px;
941	}
942
943	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo {
944	display: none;
945	flex-basis: 290px;
946	font-size: 13px;
	@@ -948,27 +955,28 @@ a.event-tickets__admin-tc-banner-link:active,
948	font-weight: normal;
949	letter-spacing: 0.02em;
950	line-height: 16px;

951	}
952
953	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo-image {
954	height: auto;
955	margin-bottom: 32px;
956	max-width: 232px;
957	width: 100%;
958	}
959
960	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect {
961	display: flex;
962	flex: 1;
963	}
964
965	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-text--connected {
966	color: #1eb056;
967	font-size: 16px;
968	font-weight: 600;
969	}
970
971	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row {
972	display: flex;
973	font-size: 13px;
974	font-weight: normal;
	@@ -976,21 +984,21 @@ a.event-tickets__admin-tc-banner-link:active,
976	text-align: left;
977	}
978
979	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1 {
980	flex-basis: 20%;
981	min-width: 125px;
982	}
983
984	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2 {
985	flex-basis: 80%;
986	}
987
988	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect,
989	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo {
990	flex-direction: column;
991	}
992
993	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link {
994	background: #405bfb;
995	border-radius: 4px;
996	color: #fff;
	@@ -1006,66 +1014,92 @@ a.event-tickets__admin-tc-banner-link:active,
1006	width: 100%;
1007	}
1008
1009	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link:hover,
1010	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link:active,
1011	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link:visited,
1012	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link:focus {
1013	color: #fff;
1014	}
1015
1016	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link.disabled {
1017	background-color: var(--tec-color-button-primary-background);
1018	pointer-events: none;
1019	}
1020
1021	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-name {
1022	font-weight: 700;
1023	}
1024
1025	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link {
1026	border-bottom: 1px solid #405bfb;
1027	font-size: 13px;
1028	margin-left: 10px;
1029	text-transform: lowercase;
1030	}
1031
1032	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link,
1033	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link:hover,
1034	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link:active,
1035	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link:visited,
1036	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link:focus {
1037	color: #405bfb;
1038	}
1039
1040	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-~~signup-settings~~ {
























1041	max-width: 340px;
1042	width: 100%;
1043	}
1044
1045	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook:not(last-of-type) {
1046	margin-bottom: 8px;
1047	}
1048
1049	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error {

1050	display: none !important;
1051	visibility: hidden;
1052	}
1053
1054	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name {

1055	color: var(--tec-color-text-primary-light);
1056	text-decoration: line-through;
1057	}
1058
1059	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook-error {
1060	color: var(--color-icon-error);
1061	margin-left: 8px;
1062	}
1063
1064	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-actions-debug {
1065	margin-top: 20px;
1066	}
1067
1068	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button {
1069	color: var(--tec-color-text-primary);
1070	font-family: var(--tec-font-family-sans-serif);
1071	font-size: var(--tec-font-size-2);
	@@ -1089,21 +1123,21 @@ a.event-tickets__admin-tc-banner-link:active,
1089	width: auto;
1090	}
1091
1092	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button:focus,
1093	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button:hover {
1094	background-color: var(--tec-color-button-primary-hover);
1095	color: white;
1096	}
1097
1098	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button:active {
1099	background-color: var(--tec-color-button-primary-active);
1100	}
1101
1102	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button:disabled {
1103	background-color: var(--tec-color-button-primary-background);
1104	}
1105
1106	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button-icon {
1107	margin-right: 8px;
1108	position: relative;
1109	stroke: white;
	@@ -1111,29 +1145,29 @@ a.event-tickets__admin-tc-banner-link:active,
1111	width: 16px;
1112	}
1113
1114	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button-icon path {
1115	fill: none;
1116	}
1117
1118	- .tribe-common.tribe-modal__wrapper--~~paypal~~-connected .tribe-tickets__notice, .event-tickets.tribe-modal__wrapper--~~paypal~~-connected .tribe-tickets__notice {
1119	display: block;
1120	}
1121
1122	- .tribe-common.tribe-modal__wrapper--~~paypal~~-connected .tribe-common-c-btn, .event-tickets.tribe-modal__wrapper--~~paypal~~-connected .tribe-common-c-btn {
1123	width: auto;
1124	}
1125
1126	- .tribe-common.tribe-modal__wrapper--~~paypal~~-connected .tec-tickets__admin-modal-list, .event-tickets.tribe-modal__wrapper--~~paypal~~-connected .tec-tickets__admin-modal-list {
1127	list-style: initial;
1128	margin: 1em 0;
1129	padding-left: 16px;
1130	}
1131
1132	- .tribe-common.tribe-modal__wrapper--~~paypal~~-connected p, .event-tickets.tribe-modal__wrapper--~~paypal~~-connected p {
1133	margin: 1em 0;
1134	}
1135
1136	- .tribe-common.tribe-modal__wrapper--~~paypal~~-connected .tec-tickets__admin-modal-buttons, .event-tickets.tribe-modal__wrapper--~~paypal~~-connected .tec-tickets__admin-modal-buttons {
1137	display: flex;
1138	justify-content: flex-end;
1139	margin-top: 26px;
	@@ -1143,10 +1177,181 @@ body.events-cal .tribe-common div.tribe-dialog, body.events-cal .event-tickets d
1143	z-index: 99999;
1144	}
1145
1146	- ~~#paypal~~-~~connected~~-modal-~~button~~ {













1147	display: none;
1148	}
1149






























































































































































1150	/* @todo: Check this, see if it goes to common or where should we place it. */
1151
1152	.tribe-settings-form-wrap h3 {
	@@ -1169,33 +1374,40 @@ body.events-cal .tribe-common div.tribe-dialog, body.events-cal .event-tickets d
1169	width: auto
1170	}
1171
1172	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~ {
1173	- background-image: url("../images/background-~~paypal~~-connect.png");
1174	background-position: center right;
1175	- background-repeat: no-repeat

1176	}
1177
1178	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-merchant-country-container .tribe-dropdown .select2-selection--single {
1179	height: 42px;
1180	}
1181
1182	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-merchant-country-container .tribe-dropdown .select2-selection--single .select2-selection__rendered {
1183	line-height: 42px;
1184	padding-left: 16px;
1185	}
1186
1187	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-merchant-country-container .select2-container--default .select2-selection--single .select2-selection__arrow {
1188	height: 42px;
1189	right: 12px;
1190	}
1191
1192	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo {
1193	display: flex
1194	}
1195
1196	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect {
1197	padding-right: 74px
1198	}






1199	}
1200
1201	@media (min-width: 960px) {


777	@todo @juanfra: This was already here, inherited. We need to move to common.
778	*/
779
780	+ #tribe-field-tickets-commerce-stripe-commerce-configure,
781	#tribe-field-tickets-commerce-paypal-commerce-configure {
782	padding-left: 0;
783	width: 100%;

787	@todo @juanfra: This was already here, inherited. We need to move to common.
788	*/
789
790	+ #tribe-field-tickets-commerce-stripe-commerce-configure .tribe-field-wrap, #tribe-field-tickets-commerce-paypal-commerce-configure .tribe-field-wrap {
791	float: none;
792	max-width: none;
793	}

863	max-width: 84%;
864	}
865
866	+ .tec-tickets__admin-settings-tickets-commerce-gateway {
867	background: #fff;
868	border: 1px solid #ccc;
869	border-radius: 4px;

871	display: flex;
872	flex-direction: row;
873	justify-content: space-around;
874	+ margin-bottom: var(--tec-spacer-3);
875	padding: 45px 32px 20px 32px;
876	}
877
878	+ .tec-tickets__admin-settings-tickets-commerce-gateway-title {
879	font-size: 20px;
880	}
881
882	+ .tec-tickets__admin-settings-tickets-commerce-gateway-description {
883	+ align-items: start;
884	+ display: flex;
885	+ flex-direction: column;
886	+ flex-grow: 1;
887	margin-bottom: 20px;
888	}
889
890	+ .tec-tickets__admin-settings-tickets-commerce-gateway-description p {
891	max-width: 470px;
892	}
893
894	+ .tec-tickets__admin-settings-tickets-commerce-gateway-signup-links {
895	+ flex-grow: 1;
896	margin-top: var(--tec-spacer-8);
897	}
898
899	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-links {
900	margin-top: var(--tec-spacer-8);
901	}
902
903	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link {
904	align-items: center;
905	display: flex;
906	}
907
908	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link:not(:last-of-type) {
909	margin-bottom: 8px;
910	}
911
912	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link,
913	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url {
914	margin-left: 8px;
915	}
916
917	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link,
918	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:hover,
919	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:active,
920	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:visited,
921	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:focus,
922	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url,
923	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:hover,
924	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:active,
925	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:visited,
926	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:focus {
927	color: #405bfb;
928	}
929
930	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo ul {
931	list-style: none;
932	margin: inherit;
933	}
934
935	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo li {
936	line-height: 1.8;
937	margin-bottom: 16px;
938	}
939
940	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo ul li:before {
941	background-color: #405bfb;
942	border-radius: 100%;
943	content: '';

947	width: 7px;
948	}
949
950	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo {
951	display: none;
952	flex-basis: 290px;
953	font-size: 13px;

955	font-weight: normal;
956	letter-spacing: 0.02em;
957	line-height: 16px;
958	+ margin-bottom: var(--tec-spacer-4);
959	}
960
961	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo-image {
962	height: auto;
963	margin-bottom: 32px;
964	max-width: 232px;
965	width: 100%;
966	}
967
968	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect {
969	display: flex;
970	flex: 1;
971	}
972
973	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect-text--connected {
974	color: #1eb056;
975	font-size: 16px;
976	font-weight: 600;
977	}
978
979	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-row {
980	display: flex;
981	font-size: 13px;
982	font-weight: normal;

984	text-align: left;
985	}
986
987	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1 {
988	flex-basis: 20%;
989	min-width: 125px;
990	}
991
992	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2 {
993	flex-basis: 80%;
994	}
995
996	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect,
997	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo {
998	flex-direction: column;
999	}
1000
1001	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link {
1002	background: #405bfb;
1003	border-radius: 4px;
1004	color: #fff;

1014	width: 100%;
1015	}
1016
1017	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:hover,
1018	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:active,
1019	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:visited,
1020	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:focus {
1021	color: #fff;
1022	}
1023
1024	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link.disabled {
1025	background-color: var(--tec-color-button-primary-background);
1026	pointer-events: none;
1027	}
1028
1029	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-name {
1030	font-weight: 700;
1031	}
1032
1033	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link {
1034	border-bottom: 1px solid #405bfb;
1035	font-size: 13px;
1036	margin-left: 10px;
1037	text-transform: lowercase;
1038	}
1039
1040	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link,
1041	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:hover,
1042	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:active,
1043	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:visited,
1044	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:focus {
1045	color: #405bfb;
1046	}
1047
1048	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency {
1049	+ color: var(--tec-color-text-primary);
1050	+ font-weight: bold;
1051	+ }
1052	+
1053	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency-message {
1054	+ color: #a3a3a3;
1055	+ margin-top: var(--tec-spacer-1);
1056	+ }
1057	+
1058	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency-message--error {
1059	+ color: var(--tec-color-icon-error);
1060	+ }
1061	+
1062	+ .tec-tickets__admin-settings-tickets-commerce-gateway-capability--no {
1063	+ color: var(--tec-color-icon-error);
1064	+ }
1065	+
1066	+ /* @todo: Add following green color as variable in common? */
1067	+
1068	+ .tec-tickets__admin-settings-tickets-commerce-gateway-capability--yes {
1069	+ color: #1eb056;
1070	+ }
1071	+
1072	+ .tec-tickets__admin-settings-tickets-commerce-gateway-signup-settings {
1073	max-width: 340px;
1074	width: 100%;
1075	}
1076
1077	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(last-of-type) {
1078	margin-bottom: 8px;
1079	}
1080
1081	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error,
1082	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error {
1083	display: none !important;
1084	visibility: hidden;
1085	}
1086
1087	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name,
1088	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-name {
1089	color: var(--tec-color-text-primary-light);
1090	text-decoration: line-through;
1091	}
1092
1093	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error {
1094	color: var(--color-icon-error);
1095	margin-left: 8px;
1096	}
1097
1098	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-actions-debug {
1099	margin-top: 20px;
1100	}
1101
1102	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button {
1103	color: var(--tec-color-text-primary);
1104	font-family: var(--tec-font-family-sans-serif);
1105	font-size: var(--tec-font-size-2);

1123	width: auto;
1124	}
1125
1126	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:focus,
1127	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:hover {
1128	background-color: var(--tec-color-button-primary-hover);
1129	color: white;
1130	}
1131
1132	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:active {
1133	background-color: var(--tec-color-button-primary-active);
1134	}
1135
1136	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:disabled {
1137	background-color: var(--tec-color-button-primary-background);
1138	}
1139
1140	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon {
1141	margin-right: 8px;
1142	position: relative;
1143	stroke: white;

1145	width: 16px;
1146	}
1147
1148	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon path {
1149	fill: none;
1150	}
1151
1152	+ .tribe-common.tribe-modal__wrapper--gateway-connected .tribe-tickets__notice, .event-tickets.tribe-modal__wrapper--gateway-connected .tribe-tickets__notice {
1153	display: block;
1154	}
1155
1156	+ .tribe-common.tribe-modal__wrapper--gateway-connected .tribe-common-c-btn, .event-tickets.tribe-modal__wrapper--gateway-connected .tribe-common-c-btn {
1157	width: auto;
1158	}
1159
1160	+ .tribe-common.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-list, .event-tickets.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-list {
1161	list-style: initial;
1162	margin: 1em 0;
1163	padding-left: 16px;
1164	}
1165
1166	+ .tribe-common.tribe-modal__wrapper--gateway-connected p, .event-tickets.tribe-modal__wrapper--gateway-connected p {
1167	margin: 1em 0;
1168	}
1169
1170	+ .tribe-common.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-buttons, .event-tickets.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-buttons {
1171	display: flex;
1172	justify-content: flex-end;
1173	margin-top: 26px;

1177	z-index: 99999;
1178	}
1179
1180	+ .tribe-common .tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error, .event-tickets .tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error {
1181	+ display: block;
1182	+ }
1183	+
1184	+ .tribe-common .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-title, .event-tickets .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-title {
1185	+ margin-bottom: var(--tec-spacer-3);
1186	+ }
1187	+
1188	+ .tribe-common .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section, .event-tickets .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section {
1189	+ margin-bottom: var(--tec-spacer-3);
1190	+ }
1191	+
1192	+ #paypal-connected-modal-button,
1193	+ #stripe-connected-modal-button {
1194	display: none;
1195	}
1196
1197	+ .tec-tickets__admin-settings-tickets-commerce-section-menu {
1198	+ padding-top: var(--tec-spacer-6);
1199	+ }
1200	+
1201	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link {
1202	+ border-bottom-color: #c4c4c4;
1203	+ border-bottom-style: solid;
1204	+ border-bottom-width: 1px;
1205	+ color: #23282d;
1206	+ display: inline-block;
1207	+ font-size: var(--tec-font-size-2);
1208	+ margin-right: var(--tec-spacer-5);
1209	+ padding-bottom: var(--tec-spacer-1);
1210	+ text-decoration: none;
1211	+ }
1212	+
1213	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link--active {
1214	+ border-bottom-width: var(--tec-spacer-0);
1215	+ font-weight: bold;
1216	+ }
1217	+
1218	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link--active,
1219	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link:hover {
1220	+ border-bottom-color: var(--tec-color-accent-primary);
1221	+ color: #23282d;
1222	+ }
1223	+
1224	+ .tec-tickets__admin-settings-featured {
1225	+ background-color: var(--tec-color-background);
1226	+ border: solid 1px var(--tec-color-border-default);
1227	+ border-radius: 8px;
1228	+ margin-bottom: var(--tec-spacer-7);
1229	+ padding: var(--tec-spacer-8);
1230	+ }
1231	+
1232	+ .tec-tickets__admin-settings-featured-title {
1233	+ background-color: transparent;
1234	+ font-size: var(--tec-font-size-5);
1235	+ font-weight: bold;
1236	+ margin-bottom: var(--tec-spacer-2);
1237	+ padding: var(--tec-spacer-1) 0;
1238	+ }
1239	+
1240	+ .tec-tickets__admin-settings-featured-description {
1241	+ margin-bottom: var(--tec-spacer-4);
1242	+ max-width: 720px;
1243	+ }
1244	+
1245	+ .tec-tickets__admin-settings-featured-link {
1246	+ align-items: center;
1247	+ display: flex;
1248	+ }
1249	+
1250	+ .tec-tickets__admin-settings-featured-link-url {
1251	+ color: var(--tec-color-accent-primary);
1252	+ padding: 0 var(--tec-spacer-1);
1253	+ }
1254	+
1255	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item {
1256	+ margin-bottom: var(--tec-spacer-7);
1257	+ padding-bottom: var(--tec-spacer-0);
1258	+ text-align: center;
1259	+ }
1260	+
1261	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item > div {
1262	+ padding: var(--tec-spacer-0) 0;
1263	+ }
1264	+
1265	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle {
1266	+ margin-right: 35px;
1267	+ }
1268	+
1269	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand {
1270	+ flex-grow: 1;
1271	+ }
1272	+
1273	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-logo-image {
1274	+ max-height: var(--tec-spacer-10);
1275	+ }
1276	+
1277	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-subtitle {
1278	+ font-size: 13px;
1279	+ font-style: italic;
1280	+ }
1281	+
1282	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link {
1283	+ background-color: var(--tec-color-accent-primary);
1284	+ border-radius: var(--tec-border-radius-default);
1285	+ color: #fff;
1286	+ display: inline-block;
1287	+ font-size: var(--tec-font-size-2);
1288	+ font-weight: var(--tec-font-weight-bold);
1289	+ padding: var(--tec-spacer-2) var(--tec-spacer-3);
1290	+ text-align: center;
1291	+ text-decoration: none;
1292	+ width: 180px;
1293	+ }
1294	+
1295	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:active,
1296	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:hover {
1297	+ background-color: var(--tec-color-button-primary-hover);
1298	+ color: #fff;
1299	+ }
1300	+
1301	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:active {
1302	+ background-color: var(--tec-color-button-primary-active);
1303	+ }
1304	+
1305	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active {
1306	+ background-color: var(--tec-color-background);
1307	+ border-color: #3c434a;
1308	+ border-style: solid;
1309	+ border-width: 1px;
1310	+ color: #3c434a;
1311	+ }
1312	+
1313	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:active,
1314	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:hover {
1315	+ background-color: var(--tec-color-button-primary-hover);
1316	+ border-color: var(--tec-color-button-primary-hover);
1317	+ color: #fff;
1318	+ }
1319	+
1320	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:active {
1321	+ background-color: var(--tec-color-button-primary-active);
1322	+ border-color: var(--tec-color-button-primary-active);
1323	+ }
1324	+
1325	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle .tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked + .tec-tickets__admin-settings-tickets-commerce-toggle-switch {
1326	+ background: #50b078;
1327	+ }
1328	+
1329	+ .tec-tickets__admin-settings-tickets-commerce-gateway-group-header {
1330	+ background: #f9f9f9;
1331	+ color: #23282d;
1332	+ font-size: var(--tec-font-size-4);
1333	+ font-weight: var(--tec-font-weight-bold);
1334	+ padding: var(--tec-spacer-1) var(--tec-spacer-2);
1335	+ width: 100%;
1336	+ }
1337	+
1338	+ .tec-tickets__admin-settings-tickets-commerce-gateway-group-header:first-of-type {
1339	+ margin-top: 0;
1340	+ }
1341	+
1342	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-status {
1343	+ color: var(--tec-color-text-disabled);
1344	+ font-size: var(--tec-font-size-2);
1345	+ font-style: italic;
1346	+ font-weight: var(--tec-font-weight-normal);
1347	+ margin: 0 var(--tec-spacer-8);
1348	+ }
1349	+
1350	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-status--enabled {
1351	+ color: #50b078;
1352	+ font-weight: var(--tec-font-weight-bold);
1353	+ }
1354	+
1355	/* @todo: Check this, see if it goes to common or where should we place it. */
1356
1357	.tribe-settings-form-wrap h3 {

1374	width: auto
1375	}
1376
1377	+ .tec-tickets__admin-settings-tickets-commerce-gateway {
1378	+ background-image: url("../images/background-gateway-connect.png");
1379	background-position: center right;
1380	+ background-repeat: no-repeat;
1381	+ background-size: 420px 100%
1382	}
1383
1384	+ .tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .tribe-dropdown .select2-selection--single {
1385	height: 42px;
1386	}
1387
1388	+ .tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .tribe-dropdown .select2-selection--single .select2-selection__rendered {
1389	line-height: 42px;
1390	padding-left: 16px;
1391	}
1392
1393	+ .tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .select2-container--default .select2-selection--single .select2-selection__arrow {
1394	height: 42px;
1395	right: 12px;
1396	}
1397
1398	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo {
1399	display: flex
1400	}
1401
1402	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect {
1403	padding-right: 74px
1404	}
1405	+
1406	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item {
1407	+ align-items: center;
1408	+ display: flex;
1409	+ text-align: left
1410	+ }
1411	}
1412
1413	@media (min-width: 960px) {

src/resources/css/tickets-admin-settings.min.css CHANGED Viewed

@@ -1 +1 @@

- .accordion-header{background:none;border:0;box-sizing:border-box;color:inherit;cursor:pointer;font-size:12px;font-weight:700;padding:10px 20px;position:relative;text-align:left;width:100%}.accordion-header:before{background-color:#000;border-radius:100%;box-sizing:border-box;color:#fff;content:"\f132";font-family:dashicons;font-size:10px;font-weight:400;height:14px;left:0;line-height:17px;padding:0;padding-right:1px;position:absolute;text-align:center;top:12px;width:15px}.accordion-header:after{border-bottom:1px solid #ddd;content:"";position:absolute;right:0;top:50%;transform:translateY(-50%);width:80%}.accordion-header.is-active:before{content:"\f460";line-height:15px}.accordion-header:focus{outline:1px solid #5b9dd9}.accordion-header:hover{background:none}.tribe-tickets-editor-history:after{width:calc(100% - 80px)}.tribe_attendee_meta:after{width:calc(100% - 170px)}.tribe_advanced_meta:after{width:calc(100% - 105px)}.accordion-label:focus{outline:none}.accordion-content{display:none}.ticket_panel .accordion-content{margin:1em 0 2em}.accordion-content.is-active{display:block}.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.tribe-common-c-loader.tribe-tickets-loader__modal{height:100vh;position:fixed;width:100vw}.event-tickets .tribe-common-c-loader{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.event-tickets .tribe-tickets__notice,.tribe-common .tribe-tickets__notice{background-color:var(--tec-color-background-secondary);border-radius:var(--tec-border-radius-default);margin:var(--tec-spacer-4) 0;padding:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice>:last-child,.tribe-common .tribe-tickets__notice>:last-child{margin-bottom:0;padding-bottom:0}.event-tickets .tribe-tickets-notice__title,.tribe-common .tribe-tickets-notice__title{margin:0;position:relative}.event-tickets .tribe-tickets-notice__title:empty,.tribe-common .tribe-tickets-notice__title:empty{display:none}.event-tickets .tribe-tickets__notice--error,.tribe-common .tribe-tickets__notice--error{background-color:var(--tec-color-background-error);display:none;padding-left:50px;position:relative}.event-tickets .tribe-tickets__notice--error:before,.tribe-common .tribe-tickets__notice--error:before{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='18' height='18'%3E%3Cg fill='none' fill-rule='evenodd' transform='translate(1 1)'%3E%3Ccircle cx='8' cy='8' r='7.467' stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5'/%3E%3Ccircle cx='8' cy='11.733' r='1.067' fill='%23141827' fill-rule='nonzero'/%3E%3Cpath stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M8 3.733v4.8' fill='%23141827'/%3E%3C/g%3E%3C/svg%3E");background-size:contain;content:"";height:var(--tec-spacer-3);left:var(--tec-spacer-4);position:absolute;top:var(--tec-spacer-4);width:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice--barred,.tribe-common .tribe-tickets__notice--barred{background-color:var(--tec-color-background);border:var(--tec-spacer-0) solid var(--tec-color-border-secondary);border-bottom:0;border-radius:0;border-top:0;padding:0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-left,.tribe-common .tribe-tickets__notice--barred-left{border-right:0;padding:0 0 0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-right,.tribe-common .tribe-tickets__notice--barred-right{border-left:0;padding:0 var(--tec-spacer-2) 0 0}.event-tickets .tribe-tickets-svgicon{background-repeat:no-repeat;background-size:contain}.tooltipster-base.tribe-tickets-tooltip-theme{background-color:var(--tec-color-background);border:1px solid var(--tec-color-border-default);border-radius:var(--tec-border-radius-default);box-shadow:var(--tec-box-shadow-tooltip);height:auto!important;max-width:254px;padding:var(--tec-spacer-5)}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box{background-color:transparent;border:0;border-radius:0;box-shadow:none;margin:0}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box .tooltipster-content{color:var(--tec-color-text-primary);overflow:inherit;padding:0;word-break:break-word}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-arrow{display:none}.tribe-common a.tribe-common-c-btn--small,.tribe-common button.tribe-common-c-btn--small,.tribe-common input[type=button].tribe-common-c-btn--small,.tribe-common input[type=submit].tribe-common-c-btn--small{background-color:var(--tec-color-accent-primary);padding:11px 14px;width:auto}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;text-align:center;text-decoration:underline;transition:var(--tec-transition-color)}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{background-color:transparent}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;color:var(--tec-color-accent-primary);padding:11px 20px;width:100%}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{color:var(--tec-color-accent-primary-hover)}.tribe-common a.tribe-common-c-btn-link:active,.tribe-common button.tribe-common-c-btn-link:active,.tribe-common input[type=button].tribe-common-c-btn-link:active,.tribe-common input[type=submit].tribe-common-c-btn-link:active{color:var(--tec-color-accent-primary-active)}.tribe-common a.tribe-common-c-btn-link:disabled,.tribe-common button.tribe-common-c-btn-link:disabled,.tribe-common input[type=button].tribe-common-c-btn-link:disabled,.tribe-common input[type=submit].tribe-common-c-btn-link:disabled{color:var(--tec-color-accent-primary-background)}.event-tickets__admin-banner{background-color:#f9f9f9;border:1px solid #ccc;border-left:5px solid #50b078;border-radius:4px;margin:20px 0;padding:8px 24px 12px}.event-tickets__admin-banner a{text-decoration:none}.event-tickets__admin-banner p.event-tickets__admin-banner-help-text{max-width:690px}.event-tickets__admin-banner-help-links-wrapper{display:flex;max-width:690px}.event-tickets__admin-banner-help-links-wrapper div{min-width:50%}.event-tickets__admin-banner-links h3{font-size:14px}.event-tickets__admin-banner-links-link-label--new{background-color:#ffcf48;border-radius:80px;color:#23282d;font-size:10px;font-weight:600;margin-left:8px;padding:3px 5px;text-transform:uppercase}.event-tickets__admin-tc-banner-header-title{font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-5);line-height:var(--tec-line-height-0);margin:0;padding:0}.event-tickets__admin-tc-banner-label--new{background-color:#ffcf48;border-radius:80px;color:#23282d;font-size:10px;font-weight:600;letter-spacing:1px;line-height:1;margin-bottom:3px;margin-left:8px;padding:3px 8px;text-transform:uppercase}.event-tickets__admin-tc-banner-header{align-items:center;display:flex;justify-content:start;padding-top:var(--tec-spacer-4)}.event-tickets__admin-tc-banner-footer{align-items:center;display:flex;justify-content:start;padding-bottom:var(--tec-spacer-4);padding-top:var(--tec-spacer-3)}.event-tickets__admin-tc-banner-button{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);font-weight:var(--tec-font-weight-bold);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;border-radius:var(--tec-border-radius-default);color:var(--tec-color-background);text-align:center;transition:var(--tec-transition-background-color);background-color:#405bfb;color:#fff;margin-right:var(--tec-spacer-5);padding:var(--tec-spacer-1) var(--tec-spacer-5)}.event-tickets__admin-tc-banner-button:active,.event-tickets__admin-tc-banner-button:focus,.event-tickets__admin-tc-banner-button:hover{background-color:var(--tec-color-accent-primary-hover);color:#fff}a.event-tickets__admin-tc-banner-link{color:#405bfb;text-decoration:underline}a.event-tickets__admin-tc-banner-link:active,a.event-tickets__admin-tc-banner-link:focus,a.event-tickets__admin-tc-banner-link:hover{color:var(--tec-color-accent-primary-hover);text-decoration:none}#tribe-field-tickets-commerce-paypal-commerce-configure{padding-left:0;width:100%}#tribe-field-tickets-commerce-paypal-commerce-configure .tribe-field-wrap{float:none;max-width:none}.tec-tickets__admin-settings-tickets-commerce-toggle-wrapper{margin-bottom:20px;margin-top:45px}.tec-tickets__admin-settings-tickets-commerce-toggle{cursor:pointer;display:flex}.tec-tickets__admin-settings-tickets-commerce-toggle-switch{background:#ccc;border-radius:16px;display:inline-block;height:22px;position:relative;transition:background .4s;vertical-align:middle;width:40px}.tec-tickets__admin-settings-tickets-commerce-toggle-switch:after,.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{content:""}.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{background:linear-gradient(180deg,#fff 0,#eee);border-radius:50%;display:block;height:16px;left:3px;position:absolute;top:3px;transition:left .4s;width:16px}.tec-tickets__admin-settings-tickets-commerce-toggle:hover .tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{background:linear-gradient(180deg,#fff 0,#fff)}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked+.tec-tickets__admin-settings-tickets-commerce-toggle-switch{background:#278dbc}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked+.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{left:20px}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox{position:absolute;visibility:hidden}.tec-tickets__admin-settings-tickets-commerce-toggle-label{color:#1d2327;font-size:20px;font-weight:600;line-height:23px;margin-left:15px;position:relative}.tec-tickets__admin-settings-tickets-commerce-description{font-size:13px;font-weight:400;margin-bottom:35px;max-width:84%}.tec-tickets__admin-settings-tickets-commerce-paypal{background:#fff;border:1px solid #ccc;border-radius:4px;box-sizing:border-box;display:flex;flex-direction:row;justify-content:space-around;padding:45px 32px 20px}.tec-tickets__admin-settings-tickets-commerce-paypal-title{font-size:20px}.tec-tickets__admin-settings-tickets-commerce-paypal-description{margin-bottom:20px}.tec-tickets__admin-settings-tickets-commerce-paypal-description p{max-width:470px}.tec-tickets__admin-settings-tickets-commerce-paypal-help-links,.tec-tickets__admin-settings-tickets-commerce-paypal-signup-links{margin-top:var(--tec-spacer-8)}.tec-tickets__admin-settings-tickets-commerce-paypal-help-link{align-items:center;display:flex}.tec-tickets__admin-settings-tickets-commerce-paypal-help-link:not(:last-of-type){margin-bottom:8px}.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link{margin-left:8px}.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url,.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url:active,.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url:focus,.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url:hover,.tec-tickets__admin-settings-tickets-commerce-paypal-help-link-url:visited,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link:active,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link:focus,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link:hover,.tec-tickets__admin-settings-tickets-commerce-paypal-refresh-link:visited{color:#405bfb}.tec-tickets__admin-settings-tickets-commerce-paypal-logo ul{list-style:none;margin:inherit}.tec-tickets__admin-settings-tickets-commerce-paypal-logo li{line-height:1.8;margin-bottom:16px}.tec-tickets__admin-settings-tickets-commerce-paypal-logo ul li:before{background-color:#405bfb;border-radius:100%;content:"";display:inline-block;height:7px;margin-right:7px;width:7px}.tec-tickets__admin-settings-tickets-commerce-paypal-logo{display:none;flex-basis:290px;font-size:13px;font-style:italic;font-weight:400;letter-spacing:.02em;line-height:16px}.tec-tickets__admin-settings-tickets-commerce-paypal-logo-image{height:auto;margin-bottom:32px;max-width:232px;width:100%}.tec-tickets__admin-settings-tickets-commerce-paypal-connect{display:flex;flex:1}.tec-tickets__admin-settings-tickets-commerce-paypal-connect-text--connected{color:#1eb056;font-size:16px;font-weight:600}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-row{display:flex;font-size:13px;font-weight:400;margin:20px 0;text-align:left}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-col1{flex-basis:20%;min-width:125px}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-col2{flex-basis:80%}.tec-tickets__admin-settings-tickets-commerce-paypal-connect,.tec-tickets__admin-settings-tickets-commerce-paypal-logo{flex-direction:column}.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link{background:#405bfb;border-radius:4px;color:#fff;display:inline-block;font-size:16px;font-weight:600;line-height:18px;margin-top:25px;min-width:340px;padding:15px 0;text-align:center;text-decoration:none;width:100%}.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link:active,.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link:focus,.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link:hover,.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link:visited{color:#fff}.tec-tickets__admin-settings-tickets-commerce-paypal-connect-button-link.disabled{background-color:var(--tec-color-button-primary-background);pointer-events:none}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-name{font-weight:700}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link{border-bottom:1px solid #405bfb;font-size:13px;margin-left:10px;text-transform:lowercase}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link,.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link:active,.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link:focus,.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link:hover,.tec-tickets__admin-settings-tickets-commerce-paypal-connected-text-disconnect-link:visited{color:#405bfb}.tec-tickets__admin-settings-tickets-commerce-paypal-signup-settings{max-width:340px;width:100%}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook:not(last-of-type){margin-bottom:8px}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error{display:none!important;visibility:hidden}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name{color:var(--tec-color-text-primary-light);text-decoration:line-through}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error{color:var(--color-icon-error);margin-left:8px}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-actions-debug{margin-top:20px}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);font-weight:var(--tec-font-weight-bold);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;border-radius:var(--tec-border-radius-default);color:var(--tec-color-background);text-align:center;transition:var(--tec-transition-background-color);background-color:var(--tec-color-button-primary);padding:11px 20px;width:auto}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button:focus,.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button:hover{background-color:var(--tec-color-button-primary-hover);color:#fff}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button:active{background-color:var(--tec-color-button-primary-active)}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button:disabled{background-color:var(--tec-color-button-primary-background)}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button-icon{margin-right:8px;position:relative;stroke:#fff;top:3px;width:16px}.tec-tickets__admin-settings-tickets-commerce-paypal-connected-resync-button-icon path{fill:none}.event-tickets.tribe-modal__wrapper--paypal-connected .tribe-tickets__notice,.tribe-common.tribe-modal__wrapper--paypal-connected .tribe-tickets__notice{display:block}.event-tickets.tribe-modal__wrapper--paypal-connected .tribe-common-c-btn,.tribe-common.tribe-modal__wrapper--paypal-connected .tribe-common-c-btn{width:auto}.event-tickets.tribe-modal__wrapper--paypal-connected .tec-tickets__admin-modal-list,.tribe-common.tribe-modal__wrapper--paypal-connected .tec-tickets__admin-modal-list{list-style:initial;margin:1em 0;padding-left:16px}.event-tickets.tribe-modal__wrapper--paypal-connected p,.tribe-common.tribe-modal__wrapper--paypal-connected p{margin:1em 0}.event-tickets.tribe-modal__wrapper--paypal-connected .tec-tickets__admin-modal-buttons,.tribe-common.tribe-modal__wrapper--paypal-connected .tec-tickets__admin-modal-buttons{display:flex;justify-content:flex-end;margin-top:26px}body.events-cal .event-tickets div.tribe-dialog,body.events-cal .tribe-common div.tribe-dialog{z-index:99999}#paypal-connected-modal-button{display:none}.tribe-settings-form-wrap h3{width:100%}@media (min-width:768px){.event-tickets .tribe-common-c-loader,.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{padding:0}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;width:auto}.tec-tickets__admin-settings-tickets-commerce-paypal{background-image:url(../images/background-paypal-connect.png);background-position:100%;background-repeat:no-repeat}.tec-tickets__admin-settings-tickets-commerce-paypal-merchant-country-container .tribe-dropdown .select2-selection--single{height:42px}.tec-tickets__admin-settings-tickets-commerce-paypal-merchant-country-container .tribe-dropdown .select2-selection--single .select2-selection__rendered{line-height:42px;padding-left:16px}.tec-tickets__admin-settings-tickets-commerce-paypal-merchant-country-container .select2-container--default .select2-selection--single .select2-selection__arrow{height:42px;right:12px}.tec-tickets__admin-settings-tickets-commerce-paypal-logo{display:flex}.tec-tickets__admin-settings-tickets-commerce-paypal-connect{padding-right:74px}}@media (min-width:960px){.event-tickets__admin-banner{background-image:url(../images/background-tickets-notice.png);background-position:100% 0;background-repeat:no-repeat;background-size:contain}.event-tickets__admin-tc-banner{background-image:url(../images/background-tc-banner.png)}.event-tickets__admin-tc-banner-content{max-width:calc(100% - 450px)}}

+ .accordion-header{background:none;border:0;box-sizing:border-box;color:inherit;cursor:pointer;font-size:12px;font-weight:700;padding:10px 20px;position:relative;text-align:left;width:100%}.accordion-header:before{background-color:#000;border-radius:100%;box-sizing:border-box;color:#fff;content:"\f132";font-family:dashicons;font-size:10px;font-weight:400;height:14px;left:0;line-height:17px;padding:0;padding-right:1px;position:absolute;text-align:center;top:12px;width:15px}.accordion-header:after{border-bottom:1px solid #ddd;content:"";position:absolute;right:0;top:50%;transform:translateY(-50%);width:80%}.accordion-header.is-active:before{content:"\f460";line-height:15px}.accordion-header:focus{outline:1px solid #5b9dd9}.accordion-header:hover{background:none}.tribe-tickets-editor-history:after{width:calc(100% - 80px)}.tribe_attendee_meta:after{width:calc(100% - 170px)}.tribe_advanced_meta:after{width:calc(100% - 105px)}.accordion-label:focus{outline:none}.accordion-content{display:none}.ticket_panel .accordion-content{margin:1em 0 2em}.accordion-content.is-active{display:block}.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.tribe-common-c-loader.tribe-tickets-loader__modal{height:100vh;position:fixed;width:100vw}.event-tickets .tribe-common-c-loader{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.event-tickets .tribe-tickets__notice,.tribe-common .tribe-tickets__notice{background-color:var(--tec-color-background-secondary);border-radius:var(--tec-border-radius-default);margin:var(--tec-spacer-4) 0;padding:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice>:last-child,.tribe-common .tribe-tickets__notice>:last-child{margin-bottom:0;padding-bottom:0}.event-tickets .tribe-tickets-notice__title,.tribe-common .tribe-tickets-notice__title{margin:0;position:relative}.event-tickets .tribe-tickets-notice__title:empty,.tribe-common .tribe-tickets-notice__title:empty{display:none}.event-tickets .tribe-tickets__notice--error,.tribe-common .tribe-tickets__notice--error{background-color:var(--tec-color-background-error);display:none;padding-left:50px;position:relative}.event-tickets .tribe-tickets__notice--error:before,.tribe-common .tribe-tickets__notice--error:before{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='18' height='18'%3E%3Cg fill='none' fill-rule='evenodd' transform='translate(1 1)'%3E%3Ccircle cx='8' cy='8' r='7.467' stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5'/%3E%3Ccircle cx='8' cy='11.733' r='1.067' fill='%23141827' fill-rule='nonzero'/%3E%3Cpath stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M8 3.733v4.8' fill='%23141827'/%3E%3C/g%3E%3C/svg%3E");background-size:contain;content:"";height:var(--tec-spacer-3);left:var(--tec-spacer-4);position:absolute;top:var(--tec-spacer-4);width:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice--barred,.tribe-common .tribe-tickets__notice--barred{background-color:var(--tec-color-background);border:var(--tec-spacer-0) solid var(--tec-color-border-secondary);border-bottom:0;border-radius:0;border-top:0;padding:0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-left,.tribe-common .tribe-tickets__notice--barred-left{border-right:0;padding:0 0 0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-right,.tribe-common .tribe-tickets__notice--barred-right{border-left:0;padding:0 var(--tec-spacer-2) 0 0}.event-tickets .tribe-tickets-svgicon{background-repeat:no-repeat;background-size:contain}.tooltipster-base.tribe-tickets-tooltip-theme{background-color:var(--tec-color-background);border:1px solid var(--tec-color-border-default);border-radius:var(--tec-border-radius-default);box-shadow:var(--tec-box-shadow-tooltip);height:auto!important;max-width:254px;padding:var(--tec-spacer-5)}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box{background-color:transparent;border:0;border-radius:0;box-shadow:none;margin:0}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box .tooltipster-content{color:var(--tec-color-text-primary);overflow:inherit;padding:0;word-break:break-word}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-arrow{display:none}.tribe-common a.tribe-common-c-btn--small,.tribe-common button.tribe-common-c-btn--small,.tribe-common input[type=button].tribe-common-c-btn--small,.tribe-common input[type=submit].tribe-common-c-btn--small{background-color:var(--tec-color-accent-primary);padding:11px 14px;width:auto}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;text-align:center;text-decoration:underline;transition:var(--tec-transition-color)}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{background-color:transparent}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;color:var(--tec-color-accent-primary);padding:11px 20px;width:100%}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{color:var(--tec-color-accent-primary-hover)}.tribe-common a.tribe-common-c-btn-link:active,.tribe-common button.tribe-common-c-btn-link:active,.tribe-common input[type=button].tribe-common-c-btn-link:active,.tribe-common input[type=submit].tribe-common-c-btn-link:active{color:var(--tec-color-accent-primary-active)}.tribe-common a.tribe-common-c-btn-link:disabled,.tribe-common button.tribe-common-c-btn-link:disabled,.tribe-common input[type=button].tribe-common-c-btn-link:disabled,.tribe-common input[type=submit].tribe-common-c-btn-link:disabled{color:var(--tec-color-accent-primary-background)}.event-tickets__admin-banner{background-color:#f9f9f9;border:1px solid #ccc;border-left:5px solid #50b078;border-radius:4px;margin:20px 0;padding:8px 24px 12px}.event-tickets__admin-banner a{text-decoration:none}.event-tickets__admin-banner p.event-tickets__admin-banner-help-text{max-width:690px}.event-tickets__admin-banner-help-links-wrapper{display:flex;max-width:690px}.event-tickets__admin-banner-help-links-wrapper div{min-width:50%}.event-tickets__admin-banner-links h3{font-size:14px}.event-tickets__admin-banner-links-link-label--new{background-color:#ffcf48;border-radius:80px;color:#23282d;font-size:10px;font-weight:600;margin-left:8px;padding:3px 5px;text-transform:uppercase}.event-tickets__admin-tc-banner-header-title{font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-5);line-height:var(--tec-line-height-0);margin:0;padding:0}.event-tickets__admin-tc-banner-label--new{background-color:#ffcf48;border-radius:80px;color:#23282d;font-size:10px;font-weight:600;letter-spacing:1px;line-height:1;margin-bottom:3px;margin-left:8px;padding:3px 8px;text-transform:uppercase}.event-tickets__admin-tc-banner-header{align-items:center;display:flex;justify-content:start;padding-top:var(--tec-spacer-4)}.event-tickets__admin-tc-banner-footer{align-items:center;display:flex;justify-content:start;padding-bottom:var(--tec-spacer-4);padding-top:var(--tec-spacer-3)}.event-tickets__admin-tc-banner-button{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);font-weight:var(--tec-font-weight-bold);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;border-radius:var(--tec-border-radius-default);color:var(--tec-color-background);text-align:center;transition:var(--tec-transition-background-color);background-color:#405bfb;color:#fff;margin-right:var(--tec-spacer-5);padding:var(--tec-spacer-1) var(--tec-spacer-5)}.event-tickets__admin-tc-banner-button:active,.event-tickets__admin-tc-banner-button:focus,.event-tickets__admin-tc-banner-button:hover{background-color:var(--tec-color-accent-primary-hover);color:#fff}a.event-tickets__admin-tc-banner-link{color:#405bfb;text-decoration:underline}a.event-tickets__admin-tc-banner-link:active,a.event-tickets__admin-tc-banner-link:focus,a.event-tickets__admin-tc-banner-link:hover{color:var(--tec-color-accent-primary-hover);text-decoration:none}#tribe-field-tickets-commerce-paypal-commerce-configure,#tribe-field-tickets-commerce-stripe-commerce-configure{padding-left:0;width:100%}#tribe-field-tickets-commerce-paypal-commerce-configure .tribe-field-wrap,#tribe-field-tickets-commerce-stripe-commerce-configure .tribe-field-wrap{float:none;max-width:none}.tec-tickets__admin-settings-tickets-commerce-toggle-wrapper{margin-bottom:20px;margin-top:45px}.tec-tickets__admin-settings-tickets-commerce-toggle{cursor:pointer;display:flex}.tec-tickets__admin-settings-tickets-commerce-toggle-switch{background:#ccc;border-radius:16px;display:inline-block;height:22px;position:relative;transition:background .4s;vertical-align:middle;width:40px}.tec-tickets__admin-settings-tickets-commerce-toggle-switch:after,.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{content:""}.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{background:linear-gradient(180deg,#fff 0,#eee);border-radius:50%;display:block;height:16px;left:3px;position:absolute;top:3px;transition:left .4s;width:16px}.tec-tickets__admin-settings-tickets-commerce-toggle:hover .tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{background:linear-gradient(180deg,#fff 0,#fff)}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked+.tec-tickets__admin-settings-tickets-commerce-toggle-switch{background:#278dbc}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked+.tec-tickets__admin-settings-tickets-commerce-toggle-switch:before{left:20px}.tec-tickets__admin-settings-tickets-commerce-toggle-checkbox{position:absolute;visibility:hidden}.tec-tickets__admin-settings-tickets-commerce-toggle-label{color:#1d2327;font-size:20px;font-weight:600;line-height:23px;margin-left:15px;position:relative}.tec-tickets__admin-settings-tickets-commerce-description{font-size:13px;font-weight:400;margin-bottom:35px;max-width:84%}.tec-tickets__admin-settings-tickets-commerce-gateway{background:#fff;border:1px solid #ccc;border-radius:4px;box-sizing:border-box;display:flex;flex-direction:row;justify-content:space-around;margin-bottom:var(--tec-spacer-3);padding:45px 32px 20px}.tec-tickets__admin-settings-tickets-commerce-gateway-title{font-size:20px}.tec-tickets__admin-settings-tickets-commerce-gateway-description{align-items:start;display:flex;flex-direction:column;flex-grow:1;margin-bottom:20px}.tec-tickets__admin-settings-tickets-commerce-gateway-description p{max-width:470px}.tec-tickets__admin-settings-tickets-commerce-gateway-signup-links{flex-grow:1;margin-top:var(--tec-spacer-8)}.tec-tickets__admin-settings-tickets-commerce-gateway-help-links{margin-top:var(--tec-spacer-8)}.tec-tickets__admin-settings-tickets-commerce-gateway-help-link{align-items:center;display:flex}.tec-tickets__admin-settings-tickets-commerce-gateway-help-link:not(:last-of-type){margin-bottom:8px}.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link{margin-left:8px}.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url,.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:active,.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:focus,.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:hover,.tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url:visited,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:active,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:focus,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:hover,.tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link:visited{color:#405bfb}.tec-tickets__admin-settings-tickets-commerce-gateway-logo ul{list-style:none;margin:inherit}.tec-tickets__admin-settings-tickets-commerce-gateway-logo li{line-height:1.8;margin-bottom:16px}.tec-tickets__admin-settings-tickets-commerce-gateway-logo ul li:before{background-color:#405bfb;border-radius:100%;content:"";display:inline-block;height:7px;margin-right:7px;width:7px}.tec-tickets__admin-settings-tickets-commerce-gateway-logo{display:none;flex-basis:290px;font-size:13px;font-style:italic;font-weight:400;letter-spacing:.02em;line-height:16px;margin-bottom:var(--tec-spacer-4)}.tec-tickets__admin-settings-tickets-commerce-gateway-logo-image{height:auto;margin-bottom:32px;max-width:232px;width:100%}.tec-tickets__admin-settings-tickets-commerce-gateway-connect{display:flex;flex:1}.tec-tickets__admin-settings-tickets-commerce-gateway-connect-text--connected{color:#1eb056;font-size:16px;font-weight:600}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-row{display:flex;font-size:13px;font-weight:400;margin:20px 0;text-align:left}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1{flex-basis:20%;min-width:125px}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2{flex-basis:80%}.tec-tickets__admin-settings-tickets-commerce-gateway-connect,.tec-tickets__admin-settings-tickets-commerce-gateway-logo{flex-direction:column}a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link{background:#405bfb;border-radius:4px;color:#fff;display:inline-block;font-size:16px;font-weight:600;line-height:18px;margin-top:25px;min-width:340px;padding:15px 0;text-align:center;text-decoration:none;width:100%}a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:active,a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:focus,a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:hover,a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link:visited{color:#fff}a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link.disabled{background-color:var(--tec-color-button-primary-background);pointer-events:none}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-name{font-weight:700}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link{border-bottom:1px solid #405bfb;font-size:13px;margin-left:10px;text-transform:lowercase}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:active,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:focus,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:hover,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link:visited{color:#405bfb}.tec-tickets__admin-settings-tickets-commerce-gateway-currency{color:var(--tec-color-text-primary);font-weight:700}.tec-tickets__admin-settings-tickets-commerce-gateway-currency-message{color:#a3a3a3;margin-top:var(--tec-spacer-1)}.tec-tickets__admin-settings-tickets-commerce-gateway-capability--no,.tec-tickets__admin-settings-tickets-commerce-gateway-currency-message--error{color:var(--tec-color-icon-error)}.tec-tickets__admin-settings-tickets-commerce-gateway-capability--yes{color:#1eb056}.tec-tickets__admin-settings-tickets-commerce-gateway-signup-settings{max-width:340px;width:100%}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(last-of-type){margin-bottom:8px}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error{display:none!important;visibility:hidden}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-name,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active) .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name{color:var(--tec-color-text-primary-light);text-decoration:line-through}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error{color:var(--color-icon-error);margin-left:8px}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-actions-debug{margin-top:20px}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);font-weight:var(--tec-font-weight-bold);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;border-radius:var(--tec-border-radius-default);color:var(--tec-color-background);text-align:center;transition:var(--tec-transition-background-color);background-color:var(--tec-color-button-primary);padding:11px 20px;width:auto}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:focus,.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:hover{background-color:var(--tec-color-button-primary-hover);color:#fff}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:active{background-color:var(--tec-color-button-primary-active)}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button:disabled{background-color:var(--tec-color-button-primary-background)}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon{margin-right:8px;position:relative;stroke:#fff;top:3px;width:16px}.tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon path{fill:none}.event-tickets.tribe-modal__wrapper--gateway-connected .tribe-tickets__notice,.tribe-common.tribe-modal__wrapper--gateway-connected .tribe-tickets__notice{display:block}.event-tickets.tribe-modal__wrapper--gateway-connected .tribe-common-c-btn,.tribe-common.tribe-modal__wrapper--gateway-connected .tribe-common-c-btn{width:auto}.event-tickets.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-list,.tribe-common.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-list{list-style:initial;margin:1em 0;padding-left:16px}.event-tickets.tribe-modal__wrapper--gateway-connected p,.tribe-common.tribe-modal__wrapper--gateway-connected p{margin:1em 0}.event-tickets.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-buttons,.tribe-common.tribe-modal__wrapper--gateway-connected .tec-tickets__admin-modal-buttons{display:flex;justify-content:flex-end;margin-top:26px}body.events-cal .event-tickets div.tribe-dialog,body.events-cal .tribe-common div.tribe-dialog{z-index:99999}.event-tickets .tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error,.tribe-common .tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error{display:block}.event-tickets .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section,.event-tickets .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-title,.tribe-common .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section,.tribe-common .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-title{margin-bottom:var(--tec-spacer-3)}#paypal-connected-modal-button,#stripe-connected-modal-button{display:none}.tec-tickets__admin-settings-tickets-commerce-section-menu{padding-top:var(--tec-spacer-6)}.tec-tickets__admin-settings-tickets-commerce-section-menu-link{border-bottom-color:#c4c4c4;border-bottom-style:solid;border-bottom-width:1px;color:#23282d;display:inline-block;font-size:var(--tec-font-size-2);margin-right:var(--tec-spacer-5);padding-bottom:var(--tec-spacer-1);text-decoration:none}.tec-tickets__admin-settings-tickets-commerce-section-menu-link--active{border-bottom-width:var(--tec-spacer-0);font-weight:700}.tec-tickets__admin-settings-tickets-commerce-section-menu-link--active,.tec-tickets__admin-settings-tickets-commerce-section-menu-link:hover{border-bottom-color:var(--tec-color-accent-primary);color:#23282d}.tec-tickets__admin-settings-featured{background-color:var(--tec-color-background);border:solid 1px var(--tec-color-border-default);border-radius:8px;margin-bottom:var(--tec-spacer-7);padding:var(--tec-spacer-8)}.tec-tickets__admin-settings-featured-title{background-color:transparent;font-size:var(--tec-font-size-5);font-weight:700;margin-bottom:var(--tec-spacer-2);padding:var(--tec-spacer-1) 0}.tec-tickets__admin-settings-featured-description{margin-bottom:var(--tec-spacer-4);max-width:720px}.tec-tickets__admin-settings-featured-link{align-items:center;display:flex}.tec-tickets__admin-settings-featured-link-url{color:var(--tec-color-accent-primary);padding:0 var(--tec-spacer-1)}.tec-tickets__admin-settings-tickets-commerce-gateways-item{margin-bottom:var(--tec-spacer-7);padding-bottom:var(--tec-spacer-0);text-align:center}.tec-tickets__admin-settings-tickets-commerce-gateways-item>div{padding:var(--tec-spacer-0) 0}.tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle{margin-right:35px}.tec-tickets__admin-settings-tickets-commerce-gateways-item-brand{flex-grow:1}.tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-logo-image{max-height:var(--tec-spacer-10)}.tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-subtitle{font-size:13px;font-style:italic}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link{background-color:var(--tec-color-accent-primary);border-radius:var(--tec-border-radius-default);color:#fff;display:inline-block;font-size:var(--tec-font-size-2);font-weight:var(--tec-font-weight-bold);padding:var(--tec-spacer-2) var(--tec-spacer-3);text-align:center;text-decoration:none;width:180px}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:active,.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:hover{background-color:var(--tec-color-button-primary-hover);color:#fff}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link:active{background-color:var(--tec-color-button-primary-active)}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active{background-color:var(--tec-color-background);border:1px solid #3c434a;color:#3c434a}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:active,.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:hover{background-color:var(--tec-color-button-primary-hover);border-color:var(--tec-color-button-primary-hover);color:#fff}.tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active:active{background-color:var(--tec-color-button-primary-active);border-color:var(--tec-color-button-primary-active)}.tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle .tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked+.tec-tickets__admin-settings-tickets-commerce-toggle-switch{background:#50b078}.tec-tickets__admin-settings-tickets-commerce-gateway-group-header{background:#f9f9f9;color:#23282d;font-size:var(--tec-font-size-4);font-weight:var(--tec-font-weight-bold);padding:var(--tec-spacer-1) var(--tec-spacer-2);width:100%}.tec-tickets__admin-settings-tickets-commerce-gateway-group-header:first-of-type{margin-top:0}.tec-tickets__admin-settings-tickets-commerce-gateways-item-status{color:var(--tec-color-text-disabled);font-size:var(--tec-font-size-2);font-style:italic;font-weight:var(--tec-font-weight-normal);margin:0 var(--tec-spacer-8)}.tec-tickets__admin-settings-tickets-commerce-gateways-item-status--enabled{color:#50b078;font-weight:var(--tec-font-weight-bold)}.tribe-settings-form-wrap h3{width:100%}@media (min-width:768px){.event-tickets .tribe-common-c-loader,.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{padding:0}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;width:auto}.tec-tickets__admin-settings-tickets-commerce-gateway{background-image:url(../images/background-gateway-connect.png);background-position:100%;background-repeat:no-repeat;background-size:420px 100%}.tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .tribe-dropdown .select2-selection--single{height:42px}.tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .tribe-dropdown .select2-selection--single .select2-selection__rendered{line-height:42px;padding-left:16px}.tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container .select2-container--default .select2-selection--single .select2-selection__arrow{height:42px;right:12px}.tec-tickets__admin-settings-tickets-commerce-gateway-logo{display:flex}.tec-tickets__admin-settings-tickets-commerce-gateway-connect{padding-right:74px}.tec-tickets__admin-settings-tickets-commerce-gateways-item{align-items:center;display:flex;text-align:left}}@media (min-width:960px){.event-tickets__admin-banner{background-image:url(../images/background-tickets-notice.png);background-position:100% 0;background-repeat:no-repeat;background-size:contain}.event-tickets__admin-tc-banner{background-image:url(../images/background-tc-banner.png)}.event-tickets__admin-tc-banner-content{max-width:calc(100% - 450px)}}

src/resources/css/tickets-commerce.css CHANGED Viewed

@@ -704,6 +704,10 @@
             		padding: var(--tec-spacer-4) 0;
+            	}
             .tribe-common .tribe-tickets__commerce-checkout-cart-item-details, .event-tickets .tribe-tickets__commerce-checkout-cart-item-details {
             		flex: 1;
             		padding-right: var(--tec-spacer-3);
@@ -880,6 +884,67 @@
             			display: block;
+            		}
             /* -------------------------------------------------------------------------
             	 * Theme Overrides - Twenty Twenty
             	 * ------------------------------------------------------------------------- */
@@ -899,6 +964,10 @@
             			padding: initial;
+            		}
             /**
              * Event Tickets - Tickets Commerce - Success/Order
+             *


704	padding: var(--tec-spacer-4) 0;
705	}
706
707	+ .tribe-common .tribe-tickets__commerce-checkout-cart-item.entry, .event-tickets .tribe-tickets__commerce-checkout-cart-item.entry {
708	+ padding: var(--tec-spacer-4) 0;
709	+ }
710	+
711	.tribe-common .tribe-tickets__commerce-checkout-cart-item-details, .event-tickets .tribe-tickets__commerce-checkout-cart-item-details {
712	flex: 1;
713	padding-right: var(--tec-spacer-3);

884	display: block;
885	}
886
887	+ .tribe-common .tribe-tickets__commerce-checkout-section-header, .event-tickets .tribe-tickets__commerce-checkout-section-header {
888	+ font-size: var(--tec-font-size-4);
889	+ font-weight: var(--tec-font-weight-bold);
890	+ margin-bottom: var(--tec-spacer-3);
891	+ }
892	+
893	+ .tribe-common .tribe-tickets__commerce-checkout-gateway, .event-tickets .tribe-tickets__commerce-checkout-gateway {
894	+ display: none;
895	+ }
896	+
897	+ .tribe-common .tribe-tickets__commerce-checkout-gateway-toggle, .event-tickets .tribe-tickets__commerce-checkout-gateway-toggle {
898	+ margin-bottom: var(--tec-spacer-7);
899	+ margin-top: var(--tec-spacer-3);
900	+ }
901	+
902	+ .tribe-common .tribe-tickets__commerce-checkout-gateway-toggle-button, .event-tickets .tribe-tickets__commerce-checkout-gateway-toggle-button {
903	+ color: var(--tec-color-text-primary-light);
904	+ font-family: var(--tec-font-family-sans-serif);
905	+ font-size: var(--tec-font-size-3);
906	+ }
907	+
908	+ .tribe-common .tribe-tickets__commerce-checkout-gateway-toggle-button:after, .event-tickets .tribe-tickets__commerce-checkout-gateway-toggle-button:after {
909	+ border: 7px solid var(--tec-color-background-transparent);
910	+ border-bottom-width: 0;
911	+ border-top-color: var(--tec-color-text-primary-light);
912	+ border-top-width: 10px;
913	+ content: "";
914	+ display: inline-block;
915	+ margin-left: 5px;
916	+ }
917	+
918	+ .tribe-common .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button, .event-tickets .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button {
919	+ color: #23282d;
920	+ }
921	+
922	+ .tribe-common .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button:after, .event-tickets .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button:after {
923	+ border: 7px solid var(--tec-color-background-transparent);
924	+ border-bottom-color: #23282d;
925	+ border-bottom-width: 10px;
926	+ border-top-width: 0;
927	+ }
928	+
929	+ .tribe-common .tribe-tickets__commerce-checkout-purchaser-info-wrapper, .event-tickets .tribe-tickets__commerce-checkout-purchaser-info-wrapper {
930	+ margin-bottom: var(--tec-spacer-9);
931	+ }
932	+
933	+ .tribe-common .tribe-tickets__commerce-checkout-purchaser-info-wrapper .tribe-tickets__form-field-description, .event-tickets .tribe-tickets__commerce-checkout-purchaser-info-wrapper .tribe-tickets__form-field-description {
934	+ color: var(--tec-color-icon-primary-alt);
935	+ margin: var(--tec-spacer-1) 0;
936	+ }
937	+
938	+ .tribe-common .tribe-tickets__commerce-checkout-purchaser-info-title, .event-tickets .tribe-tickets__commerce-checkout-purchaser-info-title {
939	+ margin-bottom: var(--tec-spacer-3);
940	+ }
941	+
942	+ .tribe-common .tribe-tickets__commerce-checkout-form-submit-button, .event-tickets .tribe-tickets__commerce-checkout-form-submit-button {
943	+ height: 55px;
944	+ margin-top: 24px;
945	+ width: 100%;
946	+ }
947	+
948	/* -------------------------------------------------------------------------
949	* Theme Overrides - Twenty Twenty
950	* ------------------------------------------------------------------------- */

964	padding: initial;
965	}
966
967	+ .tribe-theme-twentytwenty .entry-content .tribe-common .tribe-tickets__commerce-checkout-section-header, .tribe-theme-twentytwenty .entry-content .event-tickets .tribe-tickets__commerce-checkout-section-header {
968	+ margin-bottom: var(--tec-spacer-3);
969	+ }
970	+
971	/**
972	* Event Tickets - Tickets Commerce - Success/Order
973	*

src/resources/css/tickets-commerce.min.css CHANGED Viewed

@@ -1 +1 @@

- .accordion-header{background:none;border:0;box-sizing:border-box;color:inherit;cursor:pointer;font-size:12px;font-weight:700;padding:10px 20px;position:relative;text-align:left;width:100%}.accordion-header:before{background-color:#000;border-radius:100%;box-sizing:border-box;color:#fff;content:"\f132";font-family:dashicons;font-size:10px;font-weight:400;height:14px;left:0;line-height:17px;padding:0;padding-right:1px;position:absolute;text-align:center;top:12px;width:15px}.accordion-header:after{border-bottom:1px solid #ddd;content:"";position:absolute;right:0;top:50%;transform:translateY(-50%);width:80%}.accordion-header.is-active:before{content:"\f460";line-height:15px}.accordion-header:focus{outline:1px solid #5b9dd9}.accordion-header:hover{background:none}.tribe-tickets-editor-history:after{width:calc(100% - 80px)}.tribe_attendee_meta:after{width:calc(100% - 170px)}.tribe_advanced_meta:after{width:calc(100% - 105px)}.accordion-label:focus{outline:none}.accordion-content{display:none}.ticket_panel .accordion-content{margin:1em 0 2em}.accordion-content.is-active{display:block}.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.tribe-common-c-loader.tribe-tickets-loader__modal{height:100vh;position:fixed;width:100vw}.event-tickets .tribe-common-c-loader{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.event-tickets .tribe-tickets__notice,.tribe-common .tribe-tickets__notice{background-color:var(--tec-color-background-secondary);border-radius:var(--tec-border-radius-default);margin:var(--tec-spacer-4) 0;padding:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice>:last-child,.tribe-common .tribe-tickets__notice>:last-child{margin-bottom:0;padding-bottom:0}.event-tickets .tribe-tickets-notice__title,.tribe-common .tribe-tickets-notice__title{margin:0;position:relative}.event-tickets .tribe-tickets-notice__title:empty,.tribe-common .tribe-tickets-notice__title:empty{display:none}.event-tickets .tribe-tickets__notice--error,.tribe-common .tribe-tickets__notice--error{background-color:var(--tec-color-background-error);display:none;padding-left:50px;position:relative}.event-tickets .tribe-tickets__notice--error:before,.tribe-common .tribe-tickets__notice--error:before{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='18' height='18'%3E%3Cg fill='none' fill-rule='evenodd' transform='translate(1 1)'%3E%3Ccircle cx='8' cy='8' r='7.467' stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5'/%3E%3Ccircle cx='8' cy='11.733' r='1.067' fill='%23141827' fill-rule='nonzero'/%3E%3Cpath stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M8 3.733v4.8' fill='%23141827'/%3E%3C/g%3E%3C/svg%3E");background-size:contain;content:"";height:var(--tec-spacer-3);left:var(--tec-spacer-4);position:absolute;top:var(--tec-spacer-4);width:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice--barred,.tribe-common .tribe-tickets__notice--barred{background-color:var(--tec-color-background);border:var(--tec-spacer-0) solid var(--tec-color-border-secondary);border-bottom:0;border-radius:0;border-top:0;padding:0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-left,.tribe-common .tribe-tickets__notice--barred-left{border-right:0;padding:0 0 0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-right,.tribe-common .tribe-tickets__notice--barred-right{border-left:0;padding:0 var(--tec-spacer-2) 0 0}.event-tickets .tribe-tickets-svgicon{background-repeat:no-repeat;background-size:contain}.tooltipster-base.tribe-tickets-tooltip-theme{background-color:var(--tec-color-background);border:1px solid var(--tec-color-border-default);border-radius:var(--tec-border-radius-default);box-shadow:var(--tec-box-shadow-tooltip);height:auto!important;max-width:254px;padding:var(--tec-spacer-5)}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box{background-color:transparent;border:0;border-radius:0;box-shadow:none;margin:0}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box .tooltipster-content{color:var(--tec-color-text-primary);overflow:inherit;padding:0;word-break:break-word}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-arrow{display:none}.tribe-common a.tribe-common-c-btn--small,.tribe-common button.tribe-common-c-btn--small,.tribe-common input[type=button].tribe-common-c-btn--small,.tribe-common input[type=submit].tribe-common-c-btn--small{background-color:var(--tec-color-accent-primary);padding:11px 14px;width:auto}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;text-align:center;text-decoration:underline;transition:var(--tec-transition-color)}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{background-color:transparent}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;color:var(--tec-color-accent-primary);padding:11px 20px;width:100%}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{color:var(--tec-color-accent-primary-hover)}.tribe-common a.tribe-common-c-btn-link:active,.tribe-common button.tribe-common-c-btn-link:active,.tribe-common input[type=button].tribe-common-c-btn-link:active,.tribe-common input[type=submit].tribe-common-c-btn-link:active{color:var(--tec-color-accent-primary-active)}.tribe-common a.tribe-common-c-btn-link:disabled,.tribe-common button.tribe-common-c-btn-link:disabled,.tribe-common input[type=button].tribe-common-c-btn-link:disabled,.tribe-common input[type=submit].tribe-common-c-btn-link:disabled{color:var(--tec-color-accent-primary-background)}.event-tickets .tribe-tickets__commerce-checkout,.tribe-common .tribe-tickets__commerce-checkout{max-width:600px;position:relative;width:100%}.event-tickets .tribe-tickets__commerce-checkout-header,.tribe-common .tribe-tickets__commerce-checkout-header{align-items:baseline;display:flex;flex-wrap:wrap}.event-tickets .tribe-tickets__commerce-checkout-header-title,.tribe-common .tribe-tickets__commerce-checkout-header-title{flex:1}.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:focus,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:hover,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:visited,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:focus,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:hover,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:visited,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:focus,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:hover,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:visited,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:focus,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:hover,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:visited{color:var(--tec-color-accent-primary)}.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event{margin-left:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-cart,.tribe-common .tribe-tickets__commerce-checkout-cart{margin:var(--tec-spacer-9) 0;position:relative}.event-tickets .tribe-tickets__commerce-checkout-cart-header,.tribe-common .tribe-tickets__commerce-checkout-cart-header{padding-bottom:var(--tec-spacer-4)}.event-tickets .tribe-tickets__commerce-checkout-cart-header-title,.tribe-common .tribe-tickets__commerce-checkout-cart-header-title{font-size:var(--tec-font-size-5)}.event-tickets .tribe-tickets__commerce-checkout-cart-item,.tribe-common .tribe-tickets__commerce-checkout-cart-item{border-top:1px solid var(--tec-color-border-secondary);display:flex;flex-wrap:wrap;padding:var(--tec-spacer-4) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details{flex:1;padding-right:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description{color:var(--tec-color-text-primary-light);padding-top:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee{margin-top:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-name,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-name{font-weight:700}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-fields,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-fields{font-style:italic}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more{background-color:transparent;color:var(--tec-color-text-primary-light);position:relative;white-space:nowrap}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more:after{border:var(--tec-spacer-0) solid var(--tec-color-background-transparent);content:"";display:inline-block;margin-bottom:1px}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-toggle,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-toggle{display:flex}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more:after{border-bottom:0 none;border-top:var(--tec-spacer-0) solid var(--tec-color-text-secondary)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less{display:none}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less:after{border-bottom:var(--tec-spacer-0) solid var(--tec-color-text-secondary);border-top:0 none}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--more{display:none!important;visibility:hidden}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--less{display:block}.event-tickets .tribe-tickets__commerce-checkout-cart-item-price,.event-tickets .tribe-tickets__commerce-checkout-cart-item-quantity,.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-price,.tribe-common .tribe-tickets__commerce-checkout-cart-item-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{align-self:center;text-align:center}.event-tickets .tribe-tickets__commerce-checkout-cart-item-price,.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-price,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{flex:0 0 85px;max-width:85px}.event-tickets .tribe-tickets__commerce-checkout-cart-item-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-item-quantity{flex:0 0 60px;font-weight:700}.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{text-align:right}.event-tickets .tribe-tickets__commerce-checkout-cart-footer,.tribe-common .tribe-tickets__commerce-checkout-cart-footer{align-items:baseline;border-top:1px solid var(--tec-color-border-secondary);display:flex;flex-flow:row nowrap;justify-content:flex-end;padding:var(--tec-spacer-4) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{color:var(--tec-color-text-primary-light);text-align:center}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{margin-left:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-wrap,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-wrap{color:var(--tec-color-text-primary);font-weight:var(--tec-font-weight-bold)}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-wrap,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-wrap{margin-left:var(--tec-spacer-0)}.event-tickets .tribe-tickets__commerce-checkout-cart-empty,.tribe-common .tribe-tickets__commerce-checkout-cart-empty{margin:var(--tec-spacer-9) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description{margin-top:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:focus,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:hover,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:visited,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:focus,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:hover,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:visited{color:var(--tec-color-accent-primary)}.event-tickets .tribe-tickets__commerce-checkout-must-login,.tribe-common .tribe-tickets__commerce-checkout-must-login{margin-top:var(--tec-spacer-8);text-align:center}.event-tickets a.tribe-tickets__commerce-checkout-must-login-link,.tribe-common a.tribe-tickets__commerce-checkout-must-login-link{font-size:var(--tec-font-size-3);padding-left:var(--tec-spacer-6);padding-right:var(--tec-spacer-6);width:auto}.event-tickets .tribe-tickets__commerce-checkout-must-login-registration,.tribe-common .tribe-tickets__commerce-checkout-must-login-registration{margin-top:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-must-login-registration-link,.tribe-common .tribe-tickets__commerce-checkout-must-login-registration-link{color:var(--tec-color-accent-primary);font-size:var(--tec-font-size-2);font-weight:400}.event-tickets.tribe-common .tribe-tickets__commerce-checkout-footer-notice-error--no-gateway,.tribe-common.tribe-common .tribe-tickets__commerce-checkout-footer-notice-error--no-gateway{display:block}.tribe-theme-twentytwenty .entry-content .event-tickets h1,.tribe-theme-twentytwenty .entry-content .event-tickets h2,.tribe-theme-twentytwenty .entry-content .event-tickets h3,.tribe-theme-twentytwenty .entry-content .event-tickets h4,.tribe-theme-twentytwenty .entry-content .tribe-common h1,.tribe-theme-twentytwenty .entry-content .tribe-common h2,.tribe-theme-twentytwenty .entry-content .tribe-common h3,.tribe-theme-twentytwenty .entry-content .tribe-common h4{margin:initial}.tribe-theme-twentytwenty .entry-content .event-tickets.tribe-tickets__commerce-checkout,.tribe-theme-twentytwenty .entry-content .tribe-common.tribe-tickets__commerce-checkout{padding:initial}.event-tickets .tribe-tickets__commerce-order{max-width:600px;position:relative;width:100%}.event-tickets .tribe-tickets__commerce-order-description,.event-tickets .tribe-tickets__commerce-order-details,.event-tickets .tribe-tickets__commerce-order-footer{margin-top:var(--tec-spacer-7)}.event-tickets .tribe-tickets__commerce-order-details-row{display:flex;margin:var(--tec-spacer-2) 0;text-align:left}.event-tickets .tribe-tickets__commerce-order-details-col1{flex-basis:25%;min-width:160px}.event-tickets .tribe-tickets__commerce-order-details-col2{flex-basis:75%;font-weight:700}.event-tickets .tribe-tickets__commerce-order-footer-link:not(:first-of-type){margin-left:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-order-footer-link,.event-tickets .tribe-tickets__commerce-order-footer-link:focus,.event-tickets .tribe-tickets__commerce-order-footer-link:hover,.event-tickets .tribe-tickets__commerce-order-footer-link:visited{color:var(--tec-color-accent-primary)}.tribe-theme-twentytwenty .entry-content .event-tickets h1,.tribe-theme-twentytwenty .entry-content .event-tickets h2,.tribe-theme-twentytwenty .entry-content .event-tickets h3,.tribe-theme-twentytwenty .entry-content .event-tickets h4{margin:initial}.tribe-theme-twentytwenty .entry-content .event-tickets.tribe-tickets__commerce-order{padding:initial}@media (min-width:768px){.event-tickets .tribe-common-c-loader,.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{padding:0}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;width:auto}.tribe-tickets.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-tickets.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-tickets.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-tickets.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more{display:none!important;visibility:hidden}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{margin-left:var(--tec-spacer-5)}}

+ .accordion-header{background:none;border:0;box-sizing:border-box;color:inherit;cursor:pointer;font-size:12px;font-weight:700;padding:10px 20px;position:relative;text-align:left;width:100%}.accordion-header:before{background-color:#000;border-radius:100%;box-sizing:border-box;color:#fff;content:"\f132";font-family:dashicons;font-size:10px;font-weight:400;height:14px;left:0;line-height:17px;padding:0;padding-right:1px;position:absolute;text-align:center;top:12px;width:15px}.accordion-header:after{border-bottom:1px solid #ddd;content:"";position:absolute;right:0;top:50%;transform:translateY(-50%);width:80%}.accordion-header.is-active:before{content:"\f460";line-height:15px}.accordion-header:focus{outline:1px solid #5b9dd9}.accordion-header:hover{background:none}.tribe-tickets-editor-history:after{width:calc(100% - 80px)}.tribe_attendee_meta:after{width:calc(100% - 170px)}.tribe_advanced_meta:after{width:calc(100% - 105px)}.accordion-label:focus{outline:none}.accordion-content{display:none}.ticket_panel .accordion-content{margin:1em 0 2em}.accordion-content.is-active{display:block}.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.tribe-common-c-loader.tribe-tickets-loader__modal{height:100vh;position:fixed;width:100vw}.event-tickets .tribe-common-c-loader{align-items:center;background:var(--tec-color-background-transparent);display:flex;height:100%;justify-content:center;left:0;padding:0;position:absolute;top:0;width:100%;z-index:var(--tec-z-index-spinner-container)}.event-tickets .tribe-tickets__notice,.tribe-common .tribe-tickets__notice{background-color:var(--tec-color-background-secondary);border-radius:var(--tec-border-radius-default);margin:var(--tec-spacer-4) 0;padding:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice>:last-child,.tribe-common .tribe-tickets__notice>:last-child{margin-bottom:0;padding-bottom:0}.event-tickets .tribe-tickets-notice__title,.tribe-common .tribe-tickets-notice__title{margin:0;position:relative}.event-tickets .tribe-tickets-notice__title:empty,.tribe-common .tribe-tickets-notice__title:empty{display:none}.event-tickets .tribe-tickets__notice--error,.tribe-common .tribe-tickets__notice--error{background-color:var(--tec-color-background-error);display:none;padding-left:50px;position:relative}.event-tickets .tribe-tickets__notice--error:before,.tribe-common .tribe-tickets__notice--error:before{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='18' height='18'%3E%3Cg fill='none' fill-rule='evenodd' transform='translate(1 1)'%3E%3Ccircle cx='8' cy='8' r='7.467' stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5'/%3E%3Ccircle cx='8' cy='11.733' r='1.067' fill='%23141827' fill-rule='nonzero'/%3E%3Cpath stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M8 3.733v4.8' fill='%23141827'/%3E%3C/g%3E%3C/svg%3E");background-size:contain;content:"";height:var(--tec-spacer-3);left:var(--tec-spacer-4);position:absolute;top:var(--tec-spacer-4);width:var(--tec-spacer-3)}.event-tickets .tribe-tickets__notice--barred,.tribe-common .tribe-tickets__notice--barred{background-color:var(--tec-color-background);border:var(--tec-spacer-0) solid var(--tec-color-border-secondary);border-bottom:0;border-radius:0;border-top:0;padding:0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-left,.tribe-common .tribe-tickets__notice--barred-left{border-right:0;padding:0 0 0 var(--tec-spacer-2)}.event-tickets .tribe-tickets__notice--barred-right,.tribe-common .tribe-tickets__notice--barred-right{border-left:0;padding:0 var(--tec-spacer-2) 0 0}.event-tickets .tribe-tickets-svgicon{background-repeat:no-repeat;background-size:contain}.tooltipster-base.tribe-tickets-tooltip-theme{background-color:var(--tec-color-background);border:1px solid var(--tec-color-border-default);border-radius:var(--tec-border-radius-default);box-shadow:var(--tec-box-shadow-tooltip);height:auto!important;max-width:254px;padding:var(--tec-spacer-5)}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box{background-color:transparent;border:0;border-radius:0;box-shadow:none;margin:0}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box .tooltipster-content{color:var(--tec-color-text-primary);overflow:inherit;padding:0;word-break:break-word}.tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-arrow{display:none}.tribe-common a.tribe-common-c-btn--small,.tribe-common button.tribe-common-c-btn--small,.tribe-common input[type=button].tribe-common-c-btn--small,.tribe-common input[type=submit].tribe-common-c-btn--small{background-color:var(--tec-color-accent-primary);padding:11px 14px;width:auto}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{color:var(--tec-color-text-primary);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-2);line-height:var(--tec-line-height-3);font-weight:var(--tec-font-weight-regular);border:0;cursor:pointer;display:inline-block;height:auto;padding:0;text-decoration:none;width:auto;text-align:center;text-decoration:underline;transition:var(--tec-transition-color)}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{background-color:transparent}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;color:var(--tec-color-accent-primary);padding:11px 20px;width:100%}.tribe-common a.tribe-common-c-btn-link:focus,.tribe-common a.tribe-common-c-btn-link:hover,.tribe-common button.tribe-common-c-btn-link:focus,.tribe-common button.tribe-common-c-btn-link:hover,.tribe-common input[type=button].tribe-common-c-btn-link:focus,.tribe-common input[type=button].tribe-common-c-btn-link:hover,.tribe-common input[type=submit].tribe-common-c-btn-link:focus,.tribe-common input[type=submit].tribe-common-c-btn-link:hover{color:var(--tec-color-accent-primary-hover)}.tribe-common a.tribe-common-c-btn-link:active,.tribe-common button.tribe-common-c-btn-link:active,.tribe-common input[type=button].tribe-common-c-btn-link:active,.tribe-common input[type=submit].tribe-common-c-btn-link:active{color:var(--tec-color-accent-primary-active)}.tribe-common a.tribe-common-c-btn-link:disabled,.tribe-common button.tribe-common-c-btn-link:disabled,.tribe-common input[type=button].tribe-common-c-btn-link:disabled,.tribe-common input[type=submit].tribe-common-c-btn-link:disabled{color:var(--tec-color-accent-primary-background)}.event-tickets .tribe-tickets__commerce-checkout,.tribe-common .tribe-tickets__commerce-checkout{max-width:600px;position:relative;width:100%}.event-tickets .tribe-tickets__commerce-checkout-header,.tribe-common .tribe-tickets__commerce-checkout-header{align-items:baseline;display:flex;flex-wrap:wrap}.event-tickets .tribe-tickets__commerce-checkout-header-title,.tribe-common .tribe-tickets__commerce-checkout-header-title{flex:1}.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:focus,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:hover,.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event:visited,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:focus,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:hover,.event-tickets .tribe-tickets__commerce-checkout-header-link-modify-attendees:visited,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:focus,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:hover,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event:visited,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:focus,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:hover,.tribe-common .tribe-tickets__commerce-checkout-header-link-modify-attendees:visited{color:var(--tec-color-accent-primary)}.event-tickets .tribe-tickets__commerce-checkout-header-link-back-to-event,.tribe-common .tribe-tickets__commerce-checkout-header-link-back-to-event{margin-left:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-cart,.tribe-common .tribe-tickets__commerce-checkout-cart{margin:var(--tec-spacer-9) 0;position:relative}.event-tickets .tribe-tickets__commerce-checkout-cart-header,.tribe-common .tribe-tickets__commerce-checkout-cart-header{padding-bottom:var(--tec-spacer-4)}.event-tickets .tribe-tickets__commerce-checkout-cart-header-title,.tribe-common .tribe-tickets__commerce-checkout-cart-header-title{font-size:var(--tec-font-size-5)}.event-tickets .tribe-tickets__commerce-checkout-cart-item,.tribe-common .tribe-tickets__commerce-checkout-cart-item{border-top:1px solid var(--tec-color-border-secondary);display:flex;flex-wrap:wrap;padding:var(--tec-spacer-4) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-item.entry,.tribe-common .tribe-tickets__commerce-checkout-cart-item.entry{padding:var(--tec-spacer-4) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details{flex:1;padding-right:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description{color:var(--tec-color-text-primary-light);padding-top:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee{margin-top:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-name,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-name{font-weight:700}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-fields,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-description-attendee-fields{font-style:italic}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more{background-color:transparent;color:var(--tec-color-text-primary-light);position:relative;white-space:nowrap}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more:after{border:var(--tec-spacer-0) solid var(--tec-color-background-transparent);content:"";display:inline-block;margin-bottom:1px}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-toggle,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-toggle{display:flex}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more:after{border-bottom:0 none;border-top:var(--tec-spacer-0) solid var(--tec-color-text-secondary)}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less{display:none}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less:after,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less:after{border-bottom:var(--tec-spacer-0) solid var(--tec-color-text-secondary);border-top:0 none}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--more{display:none!important;visibility:hidden}.event-tickets .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-common .tribe-tickets__commerce-checkout-cart-item-details--open .tribe-tickets__commerce-checkout-cart-item-details-button--less{display:block}.event-tickets .tribe-tickets__commerce-checkout-cart-item-price,.event-tickets .tribe-tickets__commerce-checkout-cart-item-quantity,.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-price,.tribe-common .tribe-tickets__commerce-checkout-cart-item-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{align-self:center;text-align:center}.event-tickets .tribe-tickets__commerce-checkout-cart-item-price,.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-price,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{flex:0 0 85px;max-width:85px}.event-tickets .tribe-tickets__commerce-checkout-cart-item-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-item-quantity{flex:0 0 60px;font-weight:700}.event-tickets .tribe-tickets__commerce-checkout-cart-item-subtotal,.tribe-common .tribe-tickets__commerce-checkout-cart-item-subtotal{text-align:right}.event-tickets .tribe-tickets__commerce-checkout-cart-footer,.tribe-common .tribe-tickets__commerce-checkout-cart-footer{align-items:baseline;border-top:1px solid var(--tec-color-border-secondary);display:flex;flex-flow:row nowrap;justify-content:flex-end;padding:var(--tec-spacer-4) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{color:var(--tec-color-text-primary-light);text-align:center}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{margin-left:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-wrap,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-wrap{color:var(--tec-color-text-primary);font-weight:var(--tec-font-weight-bold)}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total-wrap,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-quantity-number,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total-wrap{margin-left:var(--tec-spacer-0)}.event-tickets .tribe-tickets__commerce-checkout-cart-empty,.tribe-common .tribe-tickets__commerce-checkout-cart-empty{margin:var(--tec-spacer-9) 0}.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description{margin-top:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:focus,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:hover,.event-tickets .tribe-tickets__commerce-checkout-cart-empty-description-link:visited,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:focus,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:hover,.tribe-common .tribe-tickets__commerce-checkout-cart-empty-description-link:visited{color:var(--tec-color-accent-primary)}.event-tickets .tribe-tickets__commerce-checkout-must-login,.tribe-common .tribe-tickets__commerce-checkout-must-login{margin-top:var(--tec-spacer-8);text-align:center}.event-tickets a.tribe-tickets__commerce-checkout-must-login-link,.tribe-common a.tribe-tickets__commerce-checkout-must-login-link{font-size:var(--tec-font-size-3);padding-left:var(--tec-spacer-6);padding-right:var(--tec-spacer-6);width:auto}.event-tickets .tribe-tickets__commerce-checkout-must-login-registration,.tribe-common .tribe-tickets__commerce-checkout-must-login-registration{margin-top:var(--tec-spacer-1)}.event-tickets .tribe-tickets__commerce-checkout-must-login-registration-link,.tribe-common .tribe-tickets__commerce-checkout-must-login-registration-link{color:var(--tec-color-accent-primary);font-size:var(--tec-font-size-2);font-weight:400}.event-tickets.tribe-common .tribe-tickets__commerce-checkout-footer-notice-error--no-gateway,.tribe-common.tribe-common .tribe-tickets__commerce-checkout-footer-notice-error--no-gateway{display:block}.event-tickets .tribe-tickets__commerce-checkout-section-header,.tribe-common .tribe-tickets__commerce-checkout-section-header{font-size:var(--tec-font-size-4);font-weight:var(--tec-font-weight-bold);margin-bottom:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-gateway,.tribe-common .tribe-tickets__commerce-checkout-gateway{display:none}.event-tickets .tribe-tickets__commerce-checkout-gateway-toggle,.tribe-common .tribe-tickets__commerce-checkout-gateway-toggle{margin-bottom:var(--tec-spacer-7);margin-top:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-gateway-toggle-button,.tribe-common .tribe-tickets__commerce-checkout-gateway-toggle-button{color:var(--tec-color-text-primary-light);font-family:var(--tec-font-family-sans-serif);font-size:var(--tec-font-size-3)}.event-tickets .tribe-tickets__commerce-checkout-gateway-toggle-button:after,.tribe-common .tribe-tickets__commerce-checkout-gateway-toggle-button:after{border:7px solid var(--tec-color-background-transparent);border-bottom-width:0;border-top-color:var(--tec-color-text-primary-light);border-top-width:10px;content:"";display:inline-block;margin-left:5px}.event-tickets .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button,.tribe-common .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button{color:#23282d}.event-tickets .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button:after,.tribe-common .tribe-tickets__commerce-checkout-gateway-toggle--open .tribe-tickets__commerce-checkout-gateway-toggle-button:after{border:7px solid var(--tec-color-background-transparent);border-bottom-color:#23282d;border-bottom-width:10px;border-top-width:0}.event-tickets .tribe-tickets__commerce-checkout-purchaser-info-wrapper,.tribe-common .tribe-tickets__commerce-checkout-purchaser-info-wrapper{margin-bottom:var(--tec-spacer-9)}.event-tickets .tribe-tickets__commerce-checkout-purchaser-info-wrapper .tribe-tickets__form-field-description,.tribe-common .tribe-tickets__commerce-checkout-purchaser-info-wrapper .tribe-tickets__form-field-description{color:var(--tec-color-icon-primary-alt);margin:var(--tec-spacer-1) 0}.event-tickets .tribe-tickets__commerce-checkout-purchaser-info-title,.tribe-common .tribe-tickets__commerce-checkout-purchaser-info-title{margin-bottom:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-checkout-form-submit-button,.tribe-common .tribe-tickets__commerce-checkout-form-submit-button{height:55px;margin-top:24px;width:100%}.tribe-theme-twentytwenty .entry-content .event-tickets h1,.tribe-theme-twentytwenty .entry-content .event-tickets h2,.tribe-theme-twentytwenty .entry-content .event-tickets h3,.tribe-theme-twentytwenty .entry-content .event-tickets h4,.tribe-theme-twentytwenty .entry-content .tribe-common h1,.tribe-theme-twentytwenty .entry-content .tribe-common h2,.tribe-theme-twentytwenty .entry-content .tribe-common h3,.tribe-theme-twentytwenty .entry-content .tribe-common h4{margin:initial}.tribe-theme-twentytwenty .entry-content .event-tickets.tribe-tickets__commerce-checkout,.tribe-theme-twentytwenty .entry-content .tribe-common.tribe-tickets__commerce-checkout{padding:initial}.tribe-theme-twentytwenty .entry-content .event-tickets .tribe-tickets__commerce-checkout-section-header,.tribe-theme-twentytwenty .entry-content .tribe-common .tribe-tickets__commerce-checkout-section-header{margin-bottom:var(--tec-spacer-3)}.event-tickets .tribe-tickets__commerce-order{max-width:600px;position:relative;width:100%}.event-tickets .tribe-tickets__commerce-order-description,.event-tickets .tribe-tickets__commerce-order-details,.event-tickets .tribe-tickets__commerce-order-footer{margin-top:var(--tec-spacer-7)}.event-tickets .tribe-tickets__commerce-order-details-row{display:flex;margin:var(--tec-spacer-2) 0;text-align:left}.event-tickets .tribe-tickets__commerce-order-details-col1{flex-basis:25%;min-width:160px}.event-tickets .tribe-tickets__commerce-order-details-col2{flex-basis:75%;font-weight:700}.event-tickets .tribe-tickets__commerce-order-footer-link:not(:first-of-type){margin-left:var(--tec-spacer-2)}.event-tickets .tribe-tickets__commerce-order-footer-link,.event-tickets .tribe-tickets__commerce-order-footer-link:focus,.event-tickets .tribe-tickets__commerce-order-footer-link:hover,.event-tickets .tribe-tickets__commerce-order-footer-link:visited{color:var(--tec-color-accent-primary)}.tribe-theme-twentytwenty .entry-content .event-tickets h1,.tribe-theme-twentytwenty .entry-content .event-tickets h2,.tribe-theme-twentytwenty .entry-content .event-tickets h3,.tribe-theme-twentytwenty .entry-content .event-tickets h4{margin:initial}.tribe-theme-twentytwenty .entry-content .event-tickets.tribe-tickets__commerce-order{padding:initial}@media (min-width:768px){.event-tickets .tribe-common-c-loader,.tribe-common-c-loader.tribe-tickets-loader__modal,.tribe-common-c-loader.tribe-tickets-loader__tickets-block{padding:0}.tribe-common a.tribe-common-c-btn-link,.tribe-common button.tribe-common-c-btn-link,.tribe-common input[type=button].tribe-common-c-btn-link,.tribe-common input[type=submit].tribe-common-c-btn-link{background-color:transparent;width:auto}.tribe-tickets.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-tickets.event-tickets .tribe-tickets__commerce-checkout-cart-item-details-button--more,.tribe-tickets.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--less,.tribe-tickets.tribe-common .tribe-tickets__commerce-checkout-cart-item-details-button--more{display:none!important;visibility:hidden}.event-tickets .tribe-tickets__commerce-checkout-cart-footer-total,.tribe-common .tribe-tickets__commerce-checkout-cart-footer-total{margin-left:var(--tec-spacer-5)}}

src/resources/css/tickets-commerce/admin/gateway/stripe/webhooks.css ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ /**
2	+ * This CSS file was auto-generated via PostCSS
3	+ *
4	+ * Contributors should avoid editing this file, but instead edit the associated
5	+ * src/resources/postcss/ file. For more information, check out our engineering
6	+ * docs on how we handle CSS in our engineering docs.
7	+ *
8	+ * @see: https://the-events-calendar.github.io/products-engineering/docs/code-standards/css/
9	+ */
10	+
11	+ /**
12	+ * Event Tickets - Admin Styles for Stripe Gateway Webhooks.
13	+ *
14	+ * @since TBD
15	+ */
16	+ #tribe-field-tickets-commerce-stripe-webhooks-value input {
17	+ border-top-right-radius: 0;
18	+ border-bottom-right-radius: 0;
19	+ }
20	+ #tribe-field-tickets-commerce-stripe-webhooks-value .tribe-field-tickets-commerce-stripe-webhooks-copy {
21	+ border-top-left-radius: 0;
22	+ border-bottom-left-radius: 0;
23	+ margin-left: -2px;
24	+ line-height: 24px;
25	+ padding-left: 6px;
26	+ padding-right: 6px;
27	+ }
28	+ #tribe-field-tickets-commerce-stripe-webhooks-value .tribe-field-tickets-commerce-stripe-webhooks-copy span {
29	+ line-height: 24px;
30	+ }

src/resources/css/tickets-commerce/admin/gateway/stripe/webhooks.min.css ADDED Viewed

	@@ -0,0 +1 @@

+ #tribe-field-tickets-commerce-stripe-webhooks-value input{border-top-right-radius:0;border-bottom-right-radius:0}#tribe-field-tickets-commerce-stripe-webhooks-value .tribe-field-tickets-commerce-stripe-webhooks-copy{border-top-left-radius:0;border-bottom-left-radius:0;margin-left:-2px;line-height:24px;padding-left:6px;padding-right:6px}#tribe-field-tickets-commerce-stripe-webhooks-value .tribe-field-tickets-commerce-stripe-webhooks-copy span{line-height:24px}

src/resources/css/tickets-commerce/gateway/paypal.css CHANGED Viewed

	@@ -731,6 +731,10 @@
731	width: 100%;
732	}
733




734	@media (min-width: 768px) {
735
736	.tribe-common-c-loader.tribe-tickets-loader__tickets-block,


731	width: 100%;
732	}
733
734	+ .event-tickets .tribe-tickets__commerce-checkout-paypal-advanced-payments-form-field--card-name {
735	+ width: 100%;
736	+ }
737	+
738	@media (min-width: 768px) {
739
740	.tribe-common-c-loader.tribe-tickets-loader__tickets-block,

src/resources/css/tickets-commerce/gateway/paypal.min.css CHANGED Viewed

@@ -1 +1 @@

src/resources/css/tickets-commerce/gateway/stripe.css ADDED Viewed

	@@ -0,0 +1,717 @@


1	+ /**
2	+ * This CSS file was auto-generated via PostCSS
3	+ *
4	+ * Contributors should avoid editing this file, but instead edit the associated
5	+ * src/resources/postcss/ file. For more information, check out our engineering
6	+ * docs on how we handle CSS in our engineering docs.
7	+ *
8	+ * @see: https://the-events-calendar.github.io/products-engineering/docs/code-standards/css/
9	+ */
10	+
11	+ /**
12	+ * Event Tickets - Tickets Commerce Stripe Stylesheet.
13	+ *
14	+ * @since TBD
15	+ */
16	+
17	+ /*
18	+ * Common CSS
19	+ *
20	+ * DO NOT EDIT THIS CSS FILE DIRECTLY.
21	+ * -------------------------------------------------------------
22	+ * This file is just a clearing-house, see the pcss directory
23	+ *
24	+ and edit the source files found there.
25	+ */
26	+
27	+ /* Event Tickets Utilities */
28	+
29	+ /* -----------------------------------------------------------------------------
30	+ *
31	+ * Utilities
32	+ *
33	+ * This file is just a clearing-house.
34	+ * Make partials (start with an underscore) for any actual css code.
35	+ *
36	+ * ----------------------------------------------------------------------------- */
37	+
38	+ /* Variables - needed everywhere. */
39	+
40	+ /* -----------------------------------------------------------------------------
41	+ * SVG - Arrow Right
42	+ * ----------------------------------------------------------------------------- */
43	+
44	+ /* -----------------------------------------------------------------------------
45	+ * SVG - Arrow (light, left)
46	+ * ----------------------------------------------------------------------------- */
47	+
48	+ /* -----------------------------------------------------------------------------
49	+ * SVG - Caret Down
50	+ * ----------------------------------------------------------------------------- */
51	+
52	+ /* -----------------------------------------------------------------------------
53	+ * SVG - Caret Left
54	+ * ----------------------------------------------------------------------------- */
55	+
56	+ /* -----------------------------------------------------------------------------
57	+ * SVG - Caret Right
58	+ * ----------------------------------------------------------------------------- */
59	+
60	+ /* -----------------------------------------------------------------------------
61	+ * SVG - Caret Up
62	+ * ----------------------------------------------------------------------------- */
63	+
64	+ /* -----------------------------------------------------------------------------
65	+ * SVG - Check
66	+ * ----------------------------------------------------------------------------- */
67	+
68	+ /* -----------------------------------------------------------------------------
69	+ * SVG - Close
70	+ * ----------------------------------------------------------------------------- */
71	+
72	+ /* -----------------------------------------------------------------------------
73	+ * SVG - Day
74	+ * ----------------------------------------------------------------------------- */
75	+
76	+ /* -----------------------------------------------------------------------------
77	+ * SVG - Dropdown
78	+ * ----------------------------------------------------------------------------- */
79	+
80	+ /* -----------------------------------------------------------------------------
81	+ * SVG - Error
82	+ * ----------------------------------------------------------------------------- */
83	+
84	+ /* -----------------------------------------------------------------------------
85	+ * SVG - Featured
86	+ * ----------------------------------------------------------------------------- */
87	+
88	+ /* -----------------------------------------------------------------------------
89	+ * SVG - Filters
90	+ * ----------------------------------------------------------------------------- */
91	+
92	+ /* -----------------------------------------------------------------------------
93	+ * SVG - Link
94	+ * ----------------------------------------------------------------------------- */
95	+
96	+ /* -----------------------------------------------------------------------------
97	+ * SVG - Guest
98	+ * ----------------------------------------------------------------------------- */
99	+
100	+ /* -----------------------------------------------------------------------------
101	+ * SVG - List
102	+ * ----------------------------------------------------------------------------- */
103	+
104	+ /* -----------------------------------------------------------------------------
105	+ * SVG - Location
106	+ * ----------------------------------------------------------------------------- */
107	+
108	+ /* -----------------------------------------------------------------------------
109	+ * SVG - Mail
110	+ * ----------------------------------------------------------------------------- */
111	+
112	+ /* -----------------------------------------------------------------------------
113	+ * SVG - Map
114	+ * ----------------------------------------------------------------------------- */
115	+
116	+ /* -----------------------------------------------------------------------------
117	+ * SVG - Map pin
118	+ * ----------------------------------------------------------------------------- */
119	+
120	+ /* -----------------------------------------------------------------------------
121	+ * SVG - Messages
122	+ * ----------------------------------------------------------------------------- */
123	+
124	+ /* stylelint-disable-line block-no-empty */
125	+
126	+ /* -----------------------------------------------------------------------------
127	+ * SVG - Month
128	+ * ----------------------------------------------------------------------------- */
129	+
130	+ /* -----------------------------------------------------------------------------
131	+ * SVG - No Map
132	+ * ----------------------------------------------------------------------------- */
133	+
134	+ /* stylelint-disable-line block-no-empty */
135	+
136	+ /* -----------------------------------------------------------------------------
137	+ * SVG - Paper Plane
138	+ * ----------------------------------------------------------------------------- */
139	+
140	+ /* -----------------------------------------------------------------------------
141	+ * SVG - Phone
142	+ * ----------------------------------------------------------------------------- */
143	+
144	+ /* -----------------------------------------------------------------------------
145	+ * SVG - Photo
146	+ * ----------------------------------------------------------------------------- */
147	+
148	+ /* -----------------------------------------------------------------------------
149	+ * SVG - Plus
150	+ * ----------------------------------------------------------------------------- */
151	+
152	+ /* -----------------------------------------------------------------------------
153	+ * SVG - Recurring
154	+ * ----------------------------------------------------------------------------- */
155	+
156	+ /* -----------------------------------------------------------------------------
157	+ * SVG - Remove
158	+ * ----------------------------------------------------------------------------- */
159	+
160	+ /* -----------------------------------------------------------------------------
161	+ * SVG - Reset
162	+ * ----------------------------------------------------------------------------- */
163	+
164	+ /* -----------------------------------------------------------------------------
165	+ * SVG - Search
166	+ * ----------------------------------------------------------------------------- */
167	+
168	+ /* -----------------------------------------------------------------------------
169	+ * SVG - Search Filter
170	+ * ----------------------------------------------------------------------------- */
171	+
172	+ /* -----------------------------------------------------------------------------
173	+ * SVG - Week
174	+ * ----------------------------------------------------------------------------- */
175	+
176	+ /* -----------------------------------------------------------------------------
177	+ * SVG - Cal Export
178	+ * ----------------------------------------------------------------------------- */
179	+
180	+ /* stylelint-disable-line block-no-empty */
181	+
182	+ /* Mixins */
183	+
184	+ /* -----------------------------------------------------------------------------
185	+ * Body
186	+ * ----------------------------------------------------------------------------- */
187	+
188	+ /* -----------------------------------------------------------------------------
189	+ * Desktop Body 1
190	+ * ----------------------------------------------------------------------------- */
191	+
192	+ /* -----------------------------------------------------------------------------
193	+ * Desktop Body 2
194	+ * ----------------------------------------------------------------------------- */
195	+
196	+ /* -----------------------------------------------------------------------------
197	+ * Desktop Body 3
198	+ * ----------------------------------------------------------------------------- */
199	+
200	+ /* -----------------------------------------------------------------------------
201	+ * Mobile Body 1
202	+ * ----------------------------------------------------------------------------- */
203	+
204	+ /* -----------------------------------------------------------------------------
205	+ * Mobile Body 2
206	+ * ----------------------------------------------------------------------------- */
207	+
208	+ /* -----------------------------------------------------------------------------
209	+ * Mobile Body 3
210	+ * ----------------------------------------------------------------------------- */
211	+
212	+ /* -----------------------------------------------------------------------------
213	+ * Heading
214	+ * ----------------------------------------------------------------------------- */
215	+
216	+ /* -----------------------------------------------------------------------------
217	+ * Heading 1
218	+ * ----------------------------------------------------------------------------- */
219	+
220	+ /* -----------------------------------------------------------------------------
221	+ * Heading 2
222	+ * ----------------------------------------------------------------------------- */
223	+
224	+ /* -----------------------------------------------------------------------------
225	+ * Heading 3
226	+ * ----------------------------------------------------------------------------- */
227	+
228	+ /* -----------------------------------------------------------------------------
229	+ * Heading 4
230	+ * ----------------------------------------------------------------------------- */
231	+
232	+ /* -----------------------------------------------------------------------------
233	+ * Heading 5
234	+ * ----------------------------------------------------------------------------- */
235	+
236	+ /* -----------------------------------------------------------------------------
237	+ * Heading 6
238	+ * ----------------------------------------------------------------------------- */
239	+
240	+ /* -----------------------------------------------------------------------------
241	+ * Heading 7
242	+ * ----------------------------------------------------------------------------- */
243	+
244	+ /* -----------------------------------------------------------------------------
245	+ * Heading 8
246	+ * ----------------------------------------------------------------------------- */
247	+
248	+ /* -----------------------------------------------------------------------------
249	+ * Anchor - Default
250	+ * ----------------------------------------------------------------------------- */
251	+
252	+ /* -----------------------------------------------------------------------------
253	+ * Anchor - Alt
254	+ * ----------------------------------------------------------------------------- */
255	+
256	+ /* -----------------------------------------------------------------------------
257	+ * Anchor - Thin
258	+ * ----------------------------------------------------------------------------- */
259	+
260	+ /* -----------------------------------------------------------------------------
261	+ * Anchor - Thin
262	+ * ----------------------------------------------------------------------------- */
263	+
264	+ /* -----------------------------------------------------------------------------
265	+ * Anchor - Event Title
266	+ *
267	+ * This mixin intentionally only affects the text and border _colors_
268	+ * to make sure they all follow the Customizer overrides.
269	+ * ----------------------------------------------------------------------------- */
270	+
271	+ /* -----------------------------------------------------------------------------
272	+ * Button - Global
273	+ * ----------------------------------------------------------------------------- */
274	+
275	+ /* -----------------------------------------------------------------------------
276	+ * Button - Solid
277	+ * ----------------------------------------------------------------------------- */
278	+
279	+ /* -----------------------------------------------------------------------------
280	+ * Button - Link
281	+ * ----------------------------------------------------------------------------- */
282	+
283	+ /* -----------------------------------------------------------------------------
284	+ * Button - Border
285	+ * ----------------------------------------------------------------------------- */
286	+
287	+ /* -----------------------------------------------------------------------------
288	+ * Button - Border Small
289	+ * ----------------------------------------------------------------------------- */
290	+
291	+ /* -----------------------------------------------------------------------------
292	+ * Button - Icon Border
293	+ * ----------------------------------------------------------------------------- */
294	+
295	+ /* -----------------------------------------------------------------------------
296	+ * Sliders & Toggles
297	+ * ----------------------------------------------------------------------------- */
298	+
299	+ /* -----------------------------------------------------------------------------
300	+ * Sliders
301	+ * ----------------------------------------------------------------------------- */
302	+
303	+ /* -----------------------------------------------------------------------------
304	+ * Hidden: Hide from both screenreaders and browsers
305	+ * @author: h5bp.com/u
306	+ * ----------------------------------------------------------------------------- */
307	+
308	+ /* -----------------------------------------------------------------------------
309	+ * Visually Hide: Hide only visually, but have it available for screenreaders
310	+ * @author: h5bp.com/v
311	+ * ----------------------------------------------------------------------------- */
312	+
313	+ /* -----------------------------------------------------------------------------
314	+ * Visually Show: Show element after has been hidden with %visually-hide
315	+ * ----------------------------------------------------------------------------- */
316	+
317	+ /* Event Tickets Components */
318	+
319	+ /* Accordion Styles */
320	+
321	+ .accordion-header {
322	+ background: none;
323	+ border: 0;
324	+ box-sizing: border-box;
325	+ color: inherit;
326	+ cursor: pointer;
327	+ font-size: 12px;
328	+ font-weight: bold;
329	+ padding: 10px 20px;
330	+ position: relative;
331	+ text-align: left;
332	+ width: 100%;
333	+ }
334	+
335	+ .accordion-header:before {
336	+ background-color: #000;
337	+ border-radius: 100%;
338	+ box-sizing: border-box;
339	+ color: #fff;
340	+ content: '\f132';
341	+ font-family: 'dashicons';
342	+ font-size: 10px;
343	+ font-weight: 400;
344	+ height: 14px;
345	+ left: 0;
346	+ line-height: 17px;
347	+ padding: 0;
348	+ padding-right: 1px;
349	+ position: absolute;
350	+ text-align: center;
351	+ top: 12px;
352	+ width: 15px;
353	+ }
354	+
355	+ .accordion-header:after {
356	+ border-bottom: 1px solid #ddd;
357	+ content: '';
358	+ position: absolute;
359	+ right: 0;
360	+ top: 50%;
361	+ transform: translateY(-50%);
362	+ width: 80%;
363	+ }
364	+
365	+ .accordion-header.is-active:before {
366	+ content: '\f460';
367	+ line-height: 15px;
368	+ }
369	+
370	+ .accordion-header:focus {
371	+ outline: 1px solid #5b9dd9;
372	+ }
373	+
374	+ .accordion-header:hover {
375	+ background: none;
376	+ }
377	+
378	+ .tribe-tickets-editor-history:after {
379	+ width: calc(100% - 80px);
380	+ }
381	+
382	+ .tribe_attendee_meta:after {
383	+ width: calc(100% - 170px);
384	+ }
385	+
386	+ .tribe_advanced_meta:after {
387	+ width: calc(100% - 105px);
388	+ }
389	+
390	+ .accordion-label:focus {
391	+ outline: none;
392	+ }
393	+
394	+ .accordion-content {
395	+ display: none;
396	+ }
397	+
398	+ .ticket_panel .accordion-content {
399	+ margin: 1em 0 2em;
400	+ }
401	+
402	+ .accordion-content.is-active {
403	+ display: block;
404	+ }
405	+
406	+ .tribe-common-c-loader.tribe-tickets-loader__tickets-block,
407	+ .tribe-common-c-loader.tribe-tickets-loader__modal {
408	+ align-items: center;
409	+ background: var(--tec-color-background-transparent);
410	+ display: flex;
411	+ height: 100%;
412	+ justify-content: center;
413	+ left: 0;
414	+ padding: 0;
415	+ position: absolute;
416	+ top: 0;
417	+ width: 100%;
418	+ z-index: var(--tec-z-index-spinner-container);
419	+ }
420	+
421	+ .tribe-common-c-loader.tribe-tickets-loader__modal {
422	+ height: 100vh;
423	+ position: fixed;
424	+ width: 100vw;
425	+ }
426	+
427	+ .event-tickets .tribe-common-c-loader {
428	+ align-items: center;
429	+ background: var(--tec-color-background-transparent);
430	+ display: flex;
431	+ height: 100%;
432	+ justify-content: center;
433	+ left: 0;
434	+ padding: 0;
435	+ position: absolute;
436	+ top: 0;
437	+ width: 100%;
438	+ z-index: var(--tec-z-index-spinner-container);
439	+ }
440	+
441	+ .tribe-common .tribe-tickets__notice, .event-tickets .tribe-tickets__notice {
442	+ background-color: var(--tec-color-background-secondary);
443	+ border-radius: var(--tec-border-radius-default);
444	+ margin: var(--tec-spacer-4) 0;
445	+ padding: var(--tec-spacer-3);
446	+ }
447	+
448	+ .tribe-common .tribe-tickets__notice > :last-child, .event-tickets .tribe-tickets__notice > :last-child {
449	+ margin-bottom: 0;
450	+ padding-bottom: 0;
451	+ }
452	+
453	+ .tribe-common .tribe-tickets-notice__title, .event-tickets .tribe-tickets-notice__title {
454	+ margin: 0;
455	+ position: relative;
456	+ }
457	+
458	+ .tribe-common .tribe-tickets-notice__title:empty, .event-tickets .tribe-tickets-notice__title:empty {
459	+ display: none;
460	+ }
461	+
462	+ /*
463	+ Error Notices
464	+ */
465	+
466	+ .tribe-common .tribe-tickets__notice--error, .event-tickets .tribe-tickets__notice--error {
467	+ background-color: var(--tec-color-background-error);
468	+ display: none;
469	+ padding-left: 50px;
470	+ position: relative;
471	+ }
472	+
473	+ .tribe-common .tribe-tickets__notice--error:before, .event-tickets .tribe-tickets__notice--error:before {
474	+ background-image: url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='18' height='18'%3E%3Cg fill='none' fill-rule='evenodd' transform='translate(1 1)'%3E%3Ccircle cx='8' cy='8' r='7.467' stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5'/%3E%3Ccircle cx='8' cy='11.733' r='1.067' fill='%23141827' fill-rule='nonzero'/%3E%3Cpath stroke='%23141827' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M8 3.733v4.8' fill='%23141827'/%3E%3C/g%3E%3C/svg%3E");
475	+ background-size: contain;
476	+ content: '';
477	+ height: var(--tec-spacer-3);
478	+ left: var(--tec-spacer-4);
479	+ position: absolute;
480	+ top: var(--tec-spacer-4);
481	+ width: var(--tec-spacer-3);
482	+ }
483	+
484	+ /*
485	+ "Barred" Notices (visible side borders)
486	+ */
487	+
488	+ .tribe-common .tribe-tickets__notice--barred, .event-tickets .tribe-tickets__notice--barred {
489	+ background-color: var(--tec-color-background);
490	+ border: var(--tec-spacer-0) solid var(--tec-color-border-secondary);
491	+ border-bottom: 0;
492	+ border-radius: 0;
493	+ border-top: 0;
494	+ padding: 0 var(--tec-spacer-2);
495	+ }
496	+
497	+ .tribe-common .tribe-tickets__notice--barred-left, .event-tickets .tribe-tickets__notice--barred-left {
498	+ border-right: 0;
499	+ padding: 0 0 0 var(--tec-spacer-2);
500	+ }
501	+
502	+ .tribe-common .tribe-tickets__notice--barred-right, .event-tickets .tribe-tickets__notice--barred-right {
503	+ border-left: 0;
504	+ padding: 0 var(--tec-spacer-2) 0 0;
505	+ }
506	+
507	+ /* -------------------------------------------------------------------------
508	+ * SVG Icons
509	+ * ------------------------------------------------------------------------- */
510	+
511	+ .event-tickets .tribe-tickets-svgicon {
512	+ background-repeat: no-repeat;
513	+ background-size: contain;
514	+ }
515	+
516	+ /* -----------------------------------------------------------------------------
517	+ *
518	+ * Tooltip
519	+ *
520	+ * ----------------------------------------------------------------------------- */
521	+
522	+ /* Defining our tooltipster theme. */
523	+
524	+ .tooltipster-base.tribe-tickets-tooltip-theme {
525	+ background-color: var(--tec-color-background);
526	+ border: 1px solid var(--tec-color-border-default);
527	+ border-radius: var(--tec-border-radius-default);
528	+ box-shadow: var(--tec-box-shadow-tooltip);
529	+ height: auto !important;
530	+ max-width: 254px;
531	+ padding: var(--tec-spacer-5);
532	+ }
533	+
534	+ .tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box {
535	+ background-color: transparent;
536	+ border: 0;
537	+ border-radius: 0;
538	+ box-shadow: none;
539	+ margin: 0;
540	+ }
541	+
542	+ .tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-box .tooltipster-content {
543	+ color: var(--tec-color-text-primary);
544	+ overflow: inherit;
545	+ padding: 0;
546	+ word-break: break-word;
547	+ }
548	+
549	+ .tooltipster-base.tribe-tickets-tooltip-theme .tooltipster-arrow {
550	+ display: none;
551	+ }
552	+
553	+ /* -----------------------------------------------------------------------------
554	+ *
555	+ * Button: Small
556	+ *
557	+ * Example:
558	+ * <button class="tribe-common-c-btn tribe-common-c-btn--small">...</button>
559	+ * <a href="#" class="tribe-common-c-btn tribe-common-c-btn--small">...</a>
560	+ *
561	+ * ----------------------------------------------------------------------------- */
562	+
563	+ .tribe-common button.tribe-common-c-btn--small, .tribe-common input[type="button"].tribe-common-c-btn--small, .tribe-common input[type="submit"].tribe-common-c-btn--small, .tribe-common a.tribe-common-c-btn--small {
564	+ background-color: var(--tec-color-accent-primary);
565	+ padding: 11px 14px;
566	+ width: auto;
567	+ }
568	+
569	+ /* -----------------------------------------------------------------------------
570	+ *
571	+ * Button: Link
572	+ *
573	+ * Example:
574	+ * <button class="tribe-common-c-btn-link">...</button>
575	+ * <a href="#" class="tribe-common-c-btn-link">...</a>
576	+ *
577	+ * ----------------------------------------------------------------------------- */
578	+
579	+ .tribe-common button.tribe-common-c-btn-link, .tribe-common input[type="button"].tribe-common-c-btn-link, .tribe-common input[type="submit"].tribe-common-c-btn-link, .tribe-common a.tribe-common-c-btn-link {
580	+ color: var(--tec-color-text-primary);
581	+ font-family: var(--tec-font-family-sans-serif);
582	+ font-size: var(--tec-font-size-2);
583	+ line-height: var(--tec-line-height-3);
584	+ font-weight: var(--tec-font-weight-regular);
585	+ border: 0;
586	+ cursor: pointer;
587	+ display: inline-block;
588	+ height: auto;
589	+ padding: 0;
590	+ text-decoration: none;
591	+ width: auto;
592	+ background-color: transparent;
593	+ text-align: center;
594	+ text-decoration: underline;
595	+ transition: var(--tec-transition-color);
596	+ }
597	+
598	+ .tribe-common button.tribe-common-c-btn-link:hover,
599	+ .tribe-common button.tribe-common-c-btn-link:focus,
600	+ .tribe-common input[type="button"].tribe-common-c-btn-link:hover,
601	+ .tribe-common input[type="button"].tribe-common-c-btn-link:focus,
602	+ .tribe-common input[type="submit"].tribe-common-c-btn-link:hover,
603	+ .tribe-common input[type="submit"].tribe-common-c-btn-link:focus,
604	+ .tribe-common a.tribe-common-c-btn-link:hover,
605	+ .tribe-common a.tribe-common-c-btn-link:focus {
606	+ background-color: transparent;
607	+ }
608	+
609	+ .tribe-common button.tribe-common-c-btn-link, .tribe-common input[type="button"].tribe-common-c-btn-link, .tribe-common input[type="submit"].tribe-common-c-btn-link, .tribe-common a.tribe-common-c-btn-link {
610	+
611	+ background-color: transparent;
612	+ color: var(--tec-color-accent-primary);
613	+ padding: 11px 20px;
614	+ width: 100%;
615	+ }
616	+
617	+ .tribe-common button.tribe-common-c-btn-link:focus,
618	+ .tribe-common button.tribe-common-c-btn-link:hover,
619	+ .tribe-common input[type="button"].tribe-common-c-btn-link:focus,
620	+ .tribe-common input[type="button"].tribe-common-c-btn-link:hover,
621	+ .tribe-common input[type="submit"].tribe-common-c-btn-link:focus,
622	+ .tribe-common input[type="submit"].tribe-common-c-btn-link:hover,
623	+ .tribe-common a.tribe-common-c-btn-link:focus,
624	+ .tribe-common a.tribe-common-c-btn-link:hover {
625	+ color: var(--tec-color-accent-primary-hover);
626	+ }
627	+
628	+ .tribe-common button.tribe-common-c-btn-link:active, .tribe-common input[type="button"].tribe-common-c-btn-link:active, .tribe-common input[type="submit"].tribe-common-c-btn-link:active, .tribe-common a.tribe-common-c-btn-link:active {
629	+ color: var(--tec-color-accent-primary-active);
630	+ }
631	+
632	+ .tribe-common button.tribe-common-c-btn-link:disabled, .tribe-common input[type="button"].tribe-common-c-btn-link:disabled, .tribe-common input[type="submit"].tribe-common-c-btn-link:disabled, .tribe-common a.tribe-common-c-btn-link:disabled {
633	+ color: var(--tec-color-accent-primary-background);
634	+ }
635	+
636	+ /**
637	+ * Event Tickets - Tickets Commerce Stripe Stylesheet
638	+ *
639	+ * @since TBD
640	+ */
641	+
642	+ /**
643	+ * Event Tickets - Tickets Commerce Stripe Stylesheet
644	+ *
645	+ * @since TBD
646	+ */
647	+
648	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-payment-element {
649	+ margin-bottom: var(--tec-spacer-4);
650	+ }
651	+
652	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element {
653	+ margin-bottom: var(--tec-spacer-4);
654	+ }
655	+
656	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-row {
657	+ display: flex;
658	+ justify-content: stretch;
659	+ }
660	+
661	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element--compact {
662	+ border: 1px solid var(--tec-color-border-default);
663	+ border-radius: var(--tec-border-radius-default);
664	+ padding: var(--tec-spacer-2);
665	+ }
666	+
667	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element--compact .tribe-tickets__commerce-checkout-stripe-card-element-row {
668	+ display: none;
669	+ }
670	+
671	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-number,
672	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-expiry,
673	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-cvc,
674	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-zip {
675	+ border: 1px solid var(--tec-color-border-default);
676	+ border-radius: var(--tec-border-radius-default);
677	+ flex-basis: 67%;
678	+ flex-grow: 1;
679	+ margin-bottom: var(--tec-spacer-2);
680	+ margin-right: var(--tec-spacer-2);
681	+ padding: var(--tec-spacer-2) var(--tec-spacer-3);
682	+ }
683	+
684	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-expiry,
685	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-zip {
686	+ flex-basis: 33%;
687	+ margin-right: 0;
688	+ }
689	+
690	+ .event-tickets .tribe-tickets__commerce-checkout-stripe-card-element-zip-input {
691	+ background-color: var(--tec-color-background-events);
692	+ border: none;
693	+ color: #23282d;
694	+ display: block;
695	+ font-family: sans-serif;
696	+ font-size: var(--tec-font-size-2);
697	+ margin: 0;
698	+ padding: 0;
699	+ width: 100%;
700	+ }
701	+
702	+ @media (min-width: 768px) {
703	+
704	+ .tribe-common-c-loader.tribe-tickets-loader__tickets-block,
705	+ .tribe-common-c-loader.tribe-tickets-loader__modal {
706	+ padding: 0
707	+ }
708	+
709	+ .event-tickets .tribe-common-c-loader {
710	+ padding: 0
711	+ }
712	+
713	+ .tribe-common button.tribe-common-c-btn-link, .tribe-common input[type="button"].tribe-common-c-btn-link, .tribe-common input[type="submit"].tribe-common-c-btn-link, .tribe-common a.tribe-common-c-btn-link {
714	+ background-color: transparent;
715	+ width: auto
716	+ }
717	+ }

src/resources/css/tickets-commerce/gateway/stripe.min.css ADDED Viewed

	@@ -0,0 +1 @@

src/resources/images/admin/stripe-logo.png ADDED Viewed

Binary file

src/resources/images/{background-paypal-connect.png → background-gateway-connect.png} RENAMED Viewed

File without changes

src/resources/js/admin/gateway/stripe/webhooks.js ADDED Viewed

	@@ -0,0 +1,151 @@


1	+ /* global ClipboardJS, URLSearchParams */
2	+ /**
3	+ * Makes sure we have all the required levels on the Tribe Object
4	+ *
5	+ * @since TBD
6	+ *
7	+ * @type {Object}
8	+ */
9	+ tribe.tickets = tribe.tickets \|\| {};
10	+
11	+ /**
12	+ * Path to this script in the global tribe Object.
13	+ *
14	+ * @since TBD
15	+ *
16	+ * @type {Object}
17	+ */
18	+ tribe.tickets.commerce = tribe.tickets.commerce \|\| {};
19	+
20	+ /**
21	+ * Path to this script in the global tribe Object.
22	+ *
23	+ * @since 5.2.0
24	+ *
25	+ * @type {Object}
26	+ */
27	+ tribe.tickets.commerce.gateway = tribe.tickets.commerce.gateway \|\| {};
28	+
29	+ /**
30	+ * Path to this script in the global tribe Object.
31	+ *
32	+ * @since TBD
33	+ *
34	+ * @type {Object}
35	+ */
36	+ tribe.tickets.commerce.gateway.stripe = tribe.tickets.commerce.gateway.stripe \|\| {};
37	+
38	+ /**
39	+ * This script Object for public usage of the methods.
40	+ *
41	+ * @since TBD
42	+ *
43	+ * @type {Object}
44	+ */
45	+ tribe.tickets.commerce.gateway.stripe.webhooks = {};
46	+
47	+ ( ( $, obj, ajaxurl ) => {
48	+ "use strict";
49	+
50	+ /**
51	+ * Stores the all selectors used on this module.
52	+ *
53	+ * @since TBD
54	+ *
55	+ * @type {Object}
56	+ */
57	+ obj.selectors = {
58	+ button: '.tribe-field-tickets-commerce-stripe-webhooks-copy',
59	+ signingKey: '[name="tickets-commerce-stripe-webhooks-signing-key"]',
60	+ statusLabel: '.tribe-field-tickets-commerce-stripe-webhooks-signing-key-status',
61	+ tooltip: '.tooltip' ,
62	+ genericDashicon: '.dashicons',
63	+ };
64	+
65	+ /**
66	+ * Stores the ClipboardJS instance for later reference.
67	+ *
68	+ * @since TBD
69	+ *
70	+ * @type {Object}
71	+ */
72	+ obj.clipboardButton = null;
73	+
74	+ /**
75	+ * Configures the Copy URL UI.
76	+ *
77	+ * @since TBD
78	+ */
79	+ obj.setupCopyUrl = () => {
80	+ obj.clipboardButton = new ClipboardJS( obj.selectors.button );
81	+ $( obj.selectors.button ).on( 'click', event => event.preventDefault() );
82	+ };
83	+
84	+ /**
85	+ * Configures the signing key input events.
86	+ *
87	+ * @since TBD
88	+ */
89	+ obj.setupSigningValidation = () => {
90	+ $( obj.selectors.signingKey ).on( 'change', obj.onSigningFieldChange );
91	+ };
92	+
93	+ /**
94	+ * When the signing field changes.
95	+ *
96	+ * @since TBD
97	+ *
98	+ * @param event {Event}
99	+ *
100	+ * @return {Promise<*>}
101	+ */
102	+ obj.onSigningFieldChange = async ( event ) => {
103	+ const $field = $( event.target );
104	+ const $tooltip = $field.siblings( obj.selectors.tooltip );
105	+ const $statusIcon = $tooltip.find( obj.selectors.genericDashicon );
106	+ const $statusLabel = $tooltip.find( obj.selectors.statusLabel );
107	+
108	+ const params = new URLSearchParams();
109	+ params.set( 'signing_key', $field.val() );
110	+ params.set( 'action', $field.data( 'ajaxAction' ) );
111	+ params.set( 'tc_nonce', $field.data( 'ajaxNonce' ) );
112	+
113	+ $field.prop( 'disabled', true );
114	+
115	+ const args = {
116	+ timeout: 30000,
117	+ body: params,
118	+ hooks: {
119	+ beforeRequest: [
120	+ request => {
121	+ $statusLabel.text( $field.data( 'loadingText' ) );
122	+ $statusIcon.removeClass( [ 'dashicons-no', 'dashicons-yes' ] ).addClass( 'dashicons-update' );
123	+ },
124	+ ],
125	+ },
126	+ };
127	+
128	+ const response = await tribe.ky.post( ajaxurl, args ).json();
129	+
130	+ $field.prop( 'disabled', false );
131	+ if ( response.data.is_valid_webhook ) {
132	+ $statusIcon.removeClass( [ 'dashicons-update' ] ).addClass( 'dashicons-yes' );
133	+ $statusLabel.text( response.data.status );
134	+ } else {
135	+ $statusIcon.removeClass( [ 'dashicons-update' ] ).addClass( 'dashicons-no' );
136	+ $statusLabel.text( response.data.status );
137	+ }
138	+
139	+ return response;
140	+ };
141	+
142	+ /**
143	+ * Runs when jQuery determines that the document is ready.
144	+ */
145	+ obj.ready = () => {
146	+ obj.setupCopyUrl();
147	+ obj.setupSigningValidation();
148	+ };
149	+
150	+ $( document ).ready( obj.ready );
151	+ } )( jQuery, tribe.tickets.commerce.gateway.stripe.webhooks, window.ajaxurl );

src/resources/js/admin/tickets-commerce-settings.js CHANGED Viewed

	@@ -76,9 +76,12 @@ tribe.tickets.admin.commerceSettings = {};
76	} );
77	}
78
79	- obj.~~maybeShowPCINotice~~ = function() {
80
81	- if ( ~~! window.location.search.match( /tc-status=paypal-signup-complete/i ) ) {~~



82	return;
83	}
84
	@@ -87,6 +90,10 @@ tribe.tickets.admin.commerceSettings = {};
87	dialog.a11yInstance.show();
88	}
89




90	dialog.a11yInstance.node.querySelectorAll( '[data-js="a11y-close-button"]' )
91	.forEach( function( closeButton ) {
92	$( closeButton ).on( 'click', function() {
	@@ -253,7 +260,7 @@ tribe.tickets.admin.commerceSettings = {};
253	obj.disconnectButton.on( 'click', obj.handleDisconnectClick );
254	}
255
256	- obj.~~maybeShowPCINotice~~();
257	};
258
259	// Configure on document ready.


76	} );
77	}
78
79	+ obj.maybeShowModalAfterConnection = function() {
80
81	+ if (
82	+ ! window.location.search.match( /tc-status=paypal-signup-complete/i )
83	+ && ! window.location.search.match( /tc-status=stripe-signup-complete/i )
84	+ ) {
85	return;
86	}
87

90	dialog.a11yInstance.show();
91	}
92
93	+ if ( 'stripe-connected-modal-id' === dialog.id ) {
94	+ dialog.a11yInstance.show();
95	+ }
96	+
97	dialog.a11yInstance.node.querySelectorAll( '[data-js="a11y-close-button"]' )
98	.forEach( function( closeButton ) {
99	$( closeButton ).on( 'click', function() {

260	obj.disconnectButton.on( 'click', obj.handleDisconnectClick );
261	}
262
263	+ obj.maybeShowModalAfterConnection();
264	};
265
266	// Configure on document ready.

src/resources/js/commerce/gateway/paypal/checkout.js CHANGED Viewed

	@@ -1,31 +1,4 @@
1	/* global tribe, jQuery, paypal, ajaxurl */
2	- /**
3	- * Makes sure we have all the required levels on the Tribe Object
4	- *
5	- * @since 5.1.9
6	- *
7	- * @type {Object}
8	- */
9	- tribe.tickets = tribe.tickets \|\| {};
10	-
11	- /**
12	- * Path to this script in the global tribe Object.
13	- *
14	- * @since 5.1.9
15	- *
16	- * @type {Object}
17	- */
18	- tribe.tickets.commerce = tribe.tickets.commerce \|\| {};
19	-
20	- /**
21	- * Path to this script in the global tribe Object.
22	- *
23	- * @since 5.1.9
24	- *
25	- * @type {Object}
26	- */
27	- tribe.tickets.commerce.gateway = tribe.tickets.commerce.gateway \|\| {};
28	-
29	/**
30	* Path to this script in the global tribe Object.
31	*
	@@ -56,6 +29,14 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
56	*/
57	( function ( $, obj ) {
58	'use strict';








59	const $document = $( document );
60
61	/**
	@@ -85,6 +66,15 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
85	*/
86	obj.timeouts = [];
87









88	/**
89	* PayPal Checkout Selectors.
90	*
	@@ -93,6 +83,7 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
93	* @type {Object}
94	*/
95	obj.selectors = {

96	checkoutScript: '.tec-tc-gateway-paypal-checkout-script',
97	activePayment: '.tec-tc-gateway-paypal-payment-active',
98	buttons: '#tec-tc-gateway-paypal-checkout-buttons',
	@@ -133,6 +124,13 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
133	* @return {void}
134	*/
135	obj.handleGenericError = function ( error, $container ) {







136	tribe.tickets.debug.log( 'handleGenericError', arguments );
137	$container.removeClass( obj.selectors.activePayment.className() );
138
	@@ -167,12 +165,17 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
167	*/
168	obj.handleCreateOrder = function ( data, actions, $container ) {
169	tribe.tickets.debug.log( 'handleCreateOrder', arguments );

170	return fetch(
171	obj.orderEndpointUrl,
172	{
173	method: 'POST',



174	headers: {
175	'X-WP-Nonce': $container.find( tribe.tickets.commerce.selectors.nonce ).val(),

176	}
177	}
178	)
	@@ -219,7 +222,8 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
219	*/
220	obj.handleCreateOrderFail = function ( $container, data ) {
221	tribe.tickets.debug.log( 'handleCreateOrderFail', arguments );
222	- obj.showNotice( $container, data.~~title~~, ~~data.content~~ );

223	};
224
225	/**
	@@ -557,6 +561,13 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
557	obj.bindScriptLoader = function () {
558
559	const $script = $( obj.selectors.checkoutScript );







560
561	if ( ! $script.length ) {
562	$document.trigger( tribe.tickets.commerce.customEvents.hideLoader );
	@@ -705,6 +716,11 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
705	tribe.tickets.debug.log( 'handleHostedCaptureError', error );
706	tribe.tickets.loader.hide( $container );
707





708	let errorTitle = '';
709	let errorContent = '';
710
	@@ -810,6 +826,8 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
810	} else {
811	obj.showNotice( $container, '', data.message );
812	}


813	}
814
815	tribe.tickets.loader.hide( $container );
	@@ -843,4 +861,4 @@ tribe.tickets.commerce.gateway.paypal.checkout = {};
843
844	$( obj.ready );
845
846	- } )( jQuery, tribe.tickets.commerce.gateway.paypal~~.checkout~~ );


1	/* global tribe, jQuery, paypal, ajaxurl */



























2	/**
3	* Path to this script in the global tribe Object.
4	*

29	*/
30	( function ( $, obj ) {
31	'use strict';
32	+
33	+ /**
34	+ * The document element
35	+ *
36	+ * @since TBD
37	+ *
38	+ * @type {jQuery\|HTMLElement}
39	+ */
40	const $document = $( document );
41
42	/**

66	*/
67	obj.timeouts = [];
68
69	+ /**
70	+ * Flag to check if the current error is generic or not.
71	+ *
72	+ * @since TBD
73	+ *
74	+ * @type {boolean}
75	+ */
76	+ obj.isGenericError = true;
77	+
78	/**
79	* PayPal Checkout Selectors.
80	*

83	* @type {Object}
84	*/
85	obj.selectors = {
86	+ paypalGatewayContainer: '.tribe-tickets__commerce-checkout-paypal',
87	checkoutScript: '.tec-tc-gateway-paypal-checkout-script',
88	activePayment: '.tec-tc-gateway-paypal-payment-active',
89	buttons: '#tec-tc-gateway-paypal-checkout-buttons',

124	* @return {void}
125	*/
126	obj.handleGenericError = function ( error, $container ) {
127	+
128	+ // Bail out if there were other errors.
129	+ if ( ! obj.isGenericError ) {
130	+ // reset the flag.
131	+ obj.isGenericError = true;
132	+ return;
133	+ }
134	tribe.tickets.debug.log( 'handleGenericError', arguments );
135	$container.removeClass( obj.selectors.activePayment.className() );
136

165	*/
166	obj.handleCreateOrder = function ( data, actions, $container ) {
167	tribe.tickets.debug.log( 'handleCreateOrder', arguments );
168	+
169	return fetch(
170	obj.orderEndpointUrl,
171	{
172	method: 'POST',
173	+ body: JSON.stringify( {
174	+ purchaser: tribe.tickets.commerce.getPurchaserData( $container )
175	+ } ),
176	headers: {
177	'X-WP-Nonce': $container.find( tribe.tickets.commerce.selectors.nonce ).val(),
178	+ 'Content-Type': 'application/json',
179	}
180	}
181	)

222	*/
223	obj.handleCreateOrderFail = function ( $container, data ) {
224	tribe.tickets.debug.log( 'handleCreateOrderFail', arguments );
225	+ obj.showNotice( $container, data.message, '' );
226	+ obj.isGenericError = false;
227	};
228
229	/**

561	obj.bindScriptLoader = function () {
562
563	const $script = $( obj.selectors.checkoutScript );
564	+ const $paypalGateway = $( obj.selectors.paypalGatewayContainer );
565	+
566	+ // Check to see if PayPal gateway is present.
567	+ if ( $paypalGateway.length === 0 ) {
568	+ $document.trigger( tribe.tickets.commerce.customEvents.hideLoader );
569	+ return;
570	+ }
571
572	if ( ! $script.length ) {
573	$document.trigger( tribe.tickets.commerce.customEvents.hideLoader );

716	tribe.tickets.debug.log( 'handleHostedCaptureError', error );
717	tribe.tickets.loader.hide( $container );
718
719	+ if ( ! obj.isGenericError ) {
720	+ obj.isGenericError = true;
721	+ return;
722	+ }
723	+
724	let errorTitle = '';
725	let errorContent = '';
726

826	} else {
827	obj.showNotice( $container, '', data.message );
828	}
829	+ } else {
830	+ obj.showNotice( $container, '', data.message );
831	}
832
833	tribe.tickets.loader.hide( $container );

861
862	$( obj.ready );
863
864	+ } )( jQuery, tribe.tickets.commerce.gateway.paypal );

src/resources/js/commerce/gateway/stripe/checkout.js ADDED Viewed

	@@ -0,0 +1,621 @@


1	+ /* global tribe, jQuery, Stripe, tecTicketsCommerceGatewayStripeCheckout */
2	+
3	+ /**
4	+ * Path to this script in the global tribe Object.
5	+ *
6	+ * @since TBD
7	+ *
8	+ * @type {Object}
9	+ */
10	+ tribe.tickets.commerce.gateway.stripe = tribe.tickets.commerce.gateway.stripe \|\| {};
11	+
12	+ /**
13	+ * This script Object for public usage of the methods.
14	+ *
15	+ * @since TBD
16	+ *
17	+ * @type {Object}
18	+ */
19	+ tribe.tickets.commerce.gateway.stripe.checkout = {};
20	+
21	+ ( ( $, obj, Stripe, ky ) => {
22	+ 'use strict';
23	+
24	+ /**
25	+ * Pull the variables from the PHP backend.
26	+ *
27	+ * @since TBD
28	+ *
29	+ * @type {Object}
30	+ */
31	+ obj.checkout = tecTicketsCommerceGatewayStripeCheckout;
32	+
33	+ /**
34	+ * Checkout Selectors.
35	+ *
36	+ * @since TBD
37	+ *
38	+ * @type {Object}
39	+ */
40	+ obj.selectors = {
41	+ cardNumber: '#tec-tc-gateway-stripe-card-number',
42	+ cardExpiry: '#tec-tc-gateway-stripe-card-expiry',
43	+ cardCvc: '#tec-tc-gateway-stripe-card-cvc',
44	+ cardZipWrapper: '#tec-tc-gateway-stripe-card-zip',
45	+ cardElement: '#tec-tc-gateway-stripe-card-element',
46	+ cardErrors: '#tec-tc-gateway-stripe-errors',
47	+ paymentElement: '#tec-tc-gateway-stripe-payment-element',
48	+ paymentMessage: '#tec-tc-gateway-stripe-payment-message',
49	+ submitButton: '#tec-tc-gateway-stripe-checkout-button',
50	+ hiddenElement: '.tribe-common-a11y-hidden'
51	+ };
52	+
53	+ /**
54	+ * Stripe JS library.
55	+ *
56	+ * @since TBD
57	+ *
58	+ * @type {Object\|null}
59	+ */
60	+ obj.stripeLib = Stripe( obj.checkout.publishableKey );
61	+
62	+ /**
63	+ * Stripe Elements API instance.
64	+ *
65	+ * @since TBD
66	+ *
67	+ * @type {Object\|null}
68	+ */
69	+ obj.stripeElements = null;
70	+
71	+ /**
72	+ * Loader container.
73	+ *
74	+ * @since TBD
75	+ *
76	+ * @type {Object\|null}
77	+ */
78	+ obj.checkoutContainer = null;
79	+
80	+ /**
81	+ * Handle displaying errors to the end user in the cardErrors field
82	+ *
83	+ * @param array errors an array of arrays. Each base array is keyed with the error code and cotains a list of error
84	+ * messages.
85	+ */
86	+ obj.handleErrorDisplay = ( errors ) => {
87	+ errors.map( e => obj.showNotice( {}, '', e[ 1 ] ) );
88	+ };
89	+
90	+ /**
91	+ * Get the request arguments to setup the calls.
92	+ *
93	+ * @since TBD
94	+ *
95	+ * @param data
96	+ * @param headers
97	+ *
98	+ * @return {{headers: {"X-WP-Nonce"}, throwHttpErrors: boolean, json, hooks: {beforeError: (function(): )[]}}}
99	+ */
100	+ obj.getRequestArgs = ( data, headers ) => {
101	+ if ( 'undefined' === typeof headers ) {
102	+ headers = {
103	+ 'X-WP-Nonce': obj.checkout.nonce
104	+ };
105	+ }
106	+
107	+ const args = {
108	+ headers: headers,
109	+ hooks: {
110	+ beforeRetry: [
111	+ obj.onBeforeRetry
112	+ ],
113	+ beforeError: [
114	+ obj.onBeforeError
115	+ ]
116	+ },
117	+ timeout: 30000,
118	+ throwHttpErrors: false
119	+ };
120	+
121	+ if ( data ) {
122	+ args.json = data;
123	+ }
124	+
125	+ return args;
126	+ };
127	+
128	+ /**
129	+ * Preventing errors to be thrown when using Ky
130	+ *
131	+ * @since TBD
132	+ *
133	+ * @param {Object} error
134	+ *
135	+ * @return {*}
136	+ */
137	+ obj.onBeforeRetry = async ( error ) => {
138	+ console.log( error );
139	+
140	+ return ky.stop;
141	+ };
142	+
143	+ /**
144	+ * Preventing errors to be thrown when using Ky
145	+ *
146	+ * @since TBD
147	+ *
148	+ * @param {Object} error
149	+ *
150	+ * @return {*}
151	+ */
152	+ obj.onBeforeError = async ( error ) => {
153	+ console.log( error );
154	+
155	+ return ky.stop;
156	+ };
157	+
158	+ /**
159	+ * Builds the wallets object to use when creating a Payment Element
160	+ *
161	+ * @returns {{apple_pay: string, google_pay: string}}
162	+ */
163	+ obj.getWallets = () => {
164	+ const settings = {
165	+ apple_pay: 'never',
166	+ google_pay: 'never',
167	+ };
168	+
169	+ if ( ! obj.checkout.wallet_settings ) {
170	+ return settings;
171	+ }
172	+
173	+ const wallet = obj.checkout.wallet_settings;
174	+
175	+ if ( wallet.apple_pay === true ) {
176	+ settings.apple_pay = 'auto';
177	+ }
178	+
179	+ if ( wallet.google_pay === true ) {
180	+ settings.google_pay = 'auto';
181	+ }
182	+
183	+ return settings;
184	+ };
185	+
186	+ /**
187	+ * Handles the changing of the card field.
188	+ *
189	+ * @since TBD
190	+ *
191	+ * @param {Object} error Which error we are dealing with.
192	+ */
193	+ obj.onCardChange = ( {error} ) => {
194	+ tribe.tickets.debug.log( 'stripe', 'cardChange', error );
195	+ let displayError = $( obj.selectors.cardErrors );
196	+ if ( error ) {
197	+ displayError.text( error.message );
198	+ } else {
199	+ displayError.text( '' );
200	+ }
201	+ };
202	+
203	+ /**
204	+ * Toggle the submit button enabled/disabled
205	+ *
206	+ * @param enable
207	+ */
208	+ obj.submitButton = ( enable ) => {
209	+ $( obj.selectors.submitButton ).prop( 'disabled', ! enable );
210	+ };
211	+
212	+ /**
213	+ * Receive the Payment from Stripe.
214	+ *
215	+ * @since TBD
216	+ *
217	+ * @param {Object} result Result from the payment request.
218	+ *
219	+ * @return {boolean}
220	+ */
221	+ obj.handleReceivePayment = async ( result ) => {
222	+ tribe.tickets.debug.log( 'stripe', 'handleReceivePayment', result );
223	+ if ( result.error ) {
224	+ return obj.handlePaymentError( result );
225	+ }
226	+
227	+ if ( 'succeeded' === result.paymentIntent.status ) {
228	+ return ( obj.handlePaymentSuccess( result ) );
229	+ }
230	+ };
231	+
232	+ /**
233	+ * When a successful request is completed to our Approval endpoint.
234	+ *
235	+ * @since TBD
236	+ *
237	+ * @param {Object} data Data returning from our endpoint.
238	+ *
239	+ * @return {boolean}
240	+ */
241	+ obj.handlePaymentError = ( data ) => {
242	+ $( obj.selectors.cardErrors ).val( data.error.message );
243	+ tribe.tickets.debug.log( 'stripe', 'handlePaymentError', data );
244	+
245	+ tribe.tickets.loader.hide( obj.checkoutContainer );
246	+
247	+ return obj.handleErrorDisplay(
248	+ [
249	+ [ data.error.code, data.error.message ]
250	+ ]
251	+ );
252	+ };
253	+
254	+ /**
255	+ * When a successful request is completed to our Approval endpoint.
256	+ *
257	+ * @since TBD
258	+ *
259	+ * @param {Object} data Data returning from our endpoint.
260	+ *
261	+ * @return {boolean}
262	+ */
263	+ obj.handlePaymentSuccess = async ( data ) => {
264	+ tribe.tickets.debug.log( 'stripe', 'handlePaymentSuccess', data );
265	+
266	+ const response = await obj.handleUpdateOrder( data.paymentIntent );
267	+
268	+ // Redirect the user to the success page.
269	+ window.location.replace( response.redirect_url );
270	+ return true;
271	+ };
272	+
273	+ /**
274	+ * Handle payments in cases other than an automatic confirmation
275	+ *
276	+ * @param data
277	+ *
278	+ * @returns {Promise<boolean>}
279	+ */
280	+ obj.handlePaymentDelayed = async ( data ) => {
281	+ tribe.tickets.debug.log( 'stripe', 'handlePaymentDelayed', data );
282	+
283	+ const response = await obj.handleUpdateOrder( data.paymentIntent );
284	+
285	+ // Redirect the user to the success page.
286	+ window.location.replace( response.redirect_url );
287	+
288	+ return true;
289	+ };
290	+
291	+ /**
292	+ * Updates the Order based on a paymentIntent from Stripe.
293	+ *
294	+ * @since TBD
295	+ *
296	+ * @param {Object} paymentIntent Payment intent Object from Stripe.
297	+ *
298	+ * @return {Promise<*>}
299	+ */
300	+ obj.handleUpdateOrder = async ( paymentIntent ) => {
301	+ const args = obj.getRequestArgs( {
302	+ client_secret: paymentIntent.client_secret
303	+ } );
304	+ let response;
305	+
306	+ try {
307	+ response = await ky.post( `${obj.checkout.orderEndpoint}/${paymentIntent.id}`, args ).json();
308	+ } catch( error ) {
309	+ response = error;
310	+ }
311	+
312	+ tribe.tickets.debug.log( 'stripe', 'updateOrder', response );
313	+
314	+ return response;
315	+ };
316	+
317	+ /**
318	+ * Submit the payment to Stripe for Payment Element.
319	+ *
320	+ * @since TBD
321	+ *
322	+ * @param {String} order The order object returned from the server.
323	+ *
324	+ * @return {Promise<*>}
325	+ */
326	+ obj.submitMultiPayment = async ( order ) => {
327	+
328	+ return obj.stripeLib.confirmPayment( {
329	+ elements: obj.stripeElements,
330	+ redirect: 'if_required',
331	+ confirmParams: {
332	+ return_url: order.redirect_url
333	+ }
334	+ } ).then( obj.handleConfirmPayment );
335	+ };
336	+
337	+ /**
338	+ * Handle the confirmation of the Payment on PaymentElement.
339	+ *
340	+ * @since TBD
341	+ *
342	+ * @param result
343	+ */
344	+ obj.handleConfirmPayment = ( result ) => {
345	+ obj.submitButton( true );
346	+ if ( result.error ) {
347	+ return obj.handlePaymentError( result );
348	+ } else {
349	+
350	+ if ( result.paymentIntent.status === 'succeeded' ) {
351	+ return obj.handlePaymentSuccess( result );
352	+ }
353	+
354	+ return obj.handlePaymentDelayed( result );
355	+ }
356	+ };
357	+
358	+ /**
359	+ * Submit the Card Element payment to Stripe.
360	+ *
361	+ * @since TBD
362	+ *
363	+ * @returns {Promise<*>}
364	+ */
365	+ obj.submitCardPayment = async () => {
366	+
367	+ return obj.stripeLib.confirmCardPayment( obj.checkout.paymentIntentData.key, {
368	+ payment_method: {
369	+ card: obj.cardElement,
370	+ }
371	+ } ).then( obj.handleConfirmCardPayment );
372	+ };
373	+
374	+ /**
375	+ * Handle the confirmation of the Payment on CardElement.
376	+ *
377	+ * @since TBD
378	+ *
379	+ * @param result
380	+ */
381	+ obj.handleConfirmCardPayment = ( result ) => {
382	+ obj.submitButton( true );
383	+ if ( result.error ) {
384	+ obj.handlePaymentError( result );
385	+ } else {
386	+ if ( result.paymentIntent.status === 'succeeded' ) {
387	+ return obj.handlePaymentSuccess( result );
388	+ }
389	+
390	+ return obj.handlePaymentDelayed( result );
391	+ }
392	+ };
393	+
394	+ /**
395	+ * Create an order and start the payment process.
396	+ *
397	+ * @since TBD
398	+ *
399	+ * @return {Promise<*>}
400	+ */
401	+ obj.handleCreateOrder = async () => {
402	+ const args = obj.getRequestArgs( {
403	+ purchaser: obj.getPurchaserData(),
404	+ payment_intent: obj.checkout.paymentIntentData
405	+ } );
406	+ let response;
407	+
408	+ try {
409	+ // Fetch Publishable API Key and Initialize Stripe Elements on Ready
410	+ response = await ky.post( obj.checkout.orderEndpoint, args ).json();
411	+ } catch( error ) {
412	+ response = error;
413	+ }
414	+
415	+ tribe.tickets.debug.log( 'stripe', 'createOrder', response );
416	+
417	+ return response;
418	+ };
419	+
420	+ /**
421	+ * Starts the process to submit a payment.
422	+ *
423	+ * @since TBD
424	+ *
425	+ * @param {Event} event The Click event from the payment.
426	+ */
427	+ obj.handlePayment = async ( event ) => {
428	+ event.preventDefault();
429	+
430	+ obj.checkoutContainer = $( event.target ).closest( tribe.tickets.commerce.selectors.checkoutContainer );
431	+
432	+ obj.hideNotice( obj.checkoutContainer );
433	+
434	+ tribe.tickets.loader.show( obj.checkoutContainer );
435	+
436	+ let order = await obj.handleCreateOrder();
437	+ obj.submitButton( false );
438	+
439	+ if ( order.success ) {
440	+ if ( obj.checkout.paymentElement ) {
441	+ obj.submitMultiPayment( order );
442	+ } else {
443	+ obj.submitCardPayment();
444	+ }
445	+ } else {
446	+ tribe.tickets.loader.hide( obj.checkoutContainer );
447	+ obj.showNotice( {}, order.message, '' );
448	+ }
449	+
450	+ obj.submitButton( true );
451	+ };
452	+
453	+ /**
454	+ * Configure the CardElement with separate fields.
455	+ *
456	+ * @link https://stripe.com/docs/js/elements_object/create_element?type=cardNumber#elements_create-options
457	+ *
458	+ * @since TBD
459	+ */
460	+ obj.setupSeparateCardElement = () => {
461	+ // Instantiate the CardElement with individual fields.
462	+ obj.cardElement = obj.stripeElements.create( 'cardNumber', {
463	+ showIcon: true,
464	+ iconStyle: 'default',
465	+ style: obj.checkout.cardElementStyle,
466	+ } );
467	+ obj.cardElement.mount( obj.selectors.cardNumber );
468	+ obj.cardElement.on( 'change', obj.onCardChange );
469	+
470	+ obj.cardExpiry = obj.stripeElements.create( 'cardExpiry', {
471	+ style: obj.checkout.cardElementStyle,
472	+ } );
473	+ obj.cardExpiry.mount( obj.selectors.cardExpiry );
474	+ obj.cardExpiry.on( 'change', obj.onCardChange );
475	+
476	+ obj.cardCvc = obj.stripeElements.create( 'cardCvc', {
477	+ style: obj.checkout.cardElementStyle,
478	+ } );
479	+ obj.cardCvc.mount( obj.selectors.cardCvc );
480	+ obj.cardCvc.on( 'change', obj.onCardChange );
481	+ };
482	+
483	+ /**
484	+ * Configure the CardElement with compact fields.
485	+ *
486	+ * @link https://stripe.com/docs/js/elements_object/create_element?type=card#elements_create-options
487	+ *
488	+ * @since TBD
489	+ */
490	+ obj.setupCompactCardElement = () => {
491	+ // Instantiate the CardElement with a single field combo.
492	+ obj.cardElement = obj.stripeElements.create( 'card', {
493	+ style: obj.checkout.cardElementStyle,
494	+ } );
495	+ obj.cardElement.mount( obj.selectors.cardElement );
496	+ obj.cardElement.on( 'change', obj.onCardChange );
497	+ };
498	+
499	+ /**
500	+ * Configure the PaymentElement with separate fields.
501	+ *
502	+ * @link https://stripe.com/docs/js/element/payment_element
503	+ *
504	+ * @since TBD
505	+ */
506	+ obj.setupPaymentElement = () => {
507	+ const wallets = obj.getWallets();
508	+ // Instantiate the PaymentElement
509	+ obj.paymentElement = obj.stripeElements.create( 'payment', {
510	+ fields: {
511	+ name: 'auto',
512	+ email: 'auto',
513	+ phone: 'auto',
514	+ address: 'auto'
515	+ },
516	+ wallets
517	+ } );
518	+ obj.paymentElement.mount( obj.selectors.paymentElement );
519	+ };
520	+
521	+ /**
522	+ * Setup and initialize Stripe API.
523	+ *
524	+ * @since TBD
525	+ *
526	+ * @return {Promise<void>}
527	+ */
528	+ obj.setupStripe = async () => {
529	+
530	+ if ( 0 === obj.checkout.paymentIntentData.length ) {
531	+ return;
532	+ }
533	+
534	+ if ( obj.checkout.paymentIntentData.errors ) {
535	+ obj.submitButton( false );
536	+ $( obj.selectors.submitButton ).addClass( obj.selectors.hiddenElement.className() );
537	+ return obj.handleErrorDisplay( obj.checkout.paymentIntentData.errors );
538	+ }
539	+
540	+ obj.stripeElements = obj.stripeLib.elements( {
541	+ clientSecret: obj.checkout.paymentIntentData.key,
542	+ appearance: obj.checkout.elementsAppearance,
543	+ } );
544	+
545	+ if ( obj.checkout.paymentElement ) {
546	+ obj.setupPaymentElement();
547	+ return;
548	+ }
549	+
550	+ if ( 'separate' === obj.checkout.cardElementType ) {
551	+ obj.setupSeparateCardElement();
552	+ } else if ( 'compact' === obj.checkout.cardElementType ) {
553	+ obj.setupCompactCardElement();
554	+ }
555	+ };
556	+
557	+ /**
558	+ * Get purchaser form data.
559	+ *
560	+ * @since TBD
561	+ *
562	+ * @return {Object}
563	+ */
564	+ obj.getPurchaserData = () => tribe.tickets.commerce.getPurchaserData( $( tribe.tickets.commerce.selectors.purchaserFormContainer ) );
565	+
566	+ /**
567	+ * Shows the notice for the checkout container for Stripe.
568	+ *
569	+ * @since TBD
570	+ *
571	+ * @param {jQuery} $container Parent container of notice element.
572	+ * @param {string} title Notice Title.
573	+ * @param {string} content Notice message content.
574	+ */
575	+ obj.showNotice = ( $container, title, content ) => {
576	+ if ( ! $container \|\| ! $container.length ) {
577	+ $container = $( tribe.tickets.commerce.selectors.checkoutContainer );
578	+ }
579	+ const notice = tribe.tickets.commerce.notice;
580	+ const $item = $container.find( notice.selectors.item );
581	+ notice.populate( $item, title, content );
582	+ notice.show( $item );
583	+ };
584	+
585	+ /**
586	+ * Hides the notice for the checkout container for Stripe.
587	+ *
588	+ * @since TBD
589	+ *
590	+ * @param {jQuery} $container Parent container of notice element.
591	+ */
592	+ obj.hideNotice = ( $container ) => {
593	+ if ( ! $container.length ) {
594	+ $container = $( tribe.tickets.commerce.selectors.checkoutContainer );
595	+ }
596	+
597	+ const notice = tribe.tickets.commerce.notice;
598	+ const $item = $container.find( notice.selectors.item );
599	+ notice.hide( $item );
600	+ };
601	+ /**
602	+ * Bind script loader to trigger script dependent methods.
603	+ *
604	+ * @since TBD
605	+ */
606	+ obj.bindEvents = () => {
607	+ $( obj.selectors.submitButton ).on( 'click', obj.handlePayment );
608	+ };
609	+
610	+ /**
611	+ * When the page is ready.
612	+ *
613	+ * @since TBD
614	+ */
615	+ obj.ready = () => {
616	+ obj.setupStripe();
617	+ obj.bindEvents();
618	+ };
619	+
620	+ $( obj.ready );
621	+ } )( jQuery, tribe.tickets.commerce.gateway.stripe, Stripe, tribe.ky );

src/resources/js/commerce/gateway/toggler.js ADDED Viewed

	@@ -0,0 +1,227 @@


1	+ /**
2	+ * Makes sure we have all the required levels on the Tribe Object
3	+ *
4	+ * @since TBD
5	+ *
6	+ * @type {Object}
7	+ */
8	+ tribe.tickets = tribe.tickets \|\| {};
9	+
10	+ /**
11	+ * Path to this script in the global tribe Object.
12	+ *
13	+ * @since TBD
14	+ *
15	+ * @type {Object}
16	+ */
17	+ tribe.tickets.commerce = tribe.tickets.commerce \|\| {};
18	+
19	+ /**
20	+ * Path to this script in the global tribe Object.
21	+ *
22	+ * @since TBD
23	+ *
24	+ * @type {Object}
25	+ */
26	+ tribe.tickets.commerce.gateway = tribe.tickets.commerce.gateway \|\| {};
27	+
28	+ /**
29	+ * Path to this script in the global tribe Object.
30	+ *
31	+ * @since TBD
32	+ *
33	+ * @type {Object}
34	+ */
35	+ tribe.tickets.commerce.gateway.toggler = tribe.tickets.commerce.gateway.toggler \|\| {};
36	+
37	+ /**
38	+ * This script Object for public usage of the methods.
39	+ *
40	+ * @since TBD
41	+ *
42	+ * @type {Object}
43	+ */
44	+ (( $, obj ) => {
45	+
46	+ /**
47	+ * Pull the variables from the PHP backend.
48	+ *
49	+ * @since TBD
50	+ *
51	+ * @type {Object}
52	+ */
53	+ obj.text = tecTicketsCommerceCheckoutToggleText;
54	+
55	+ /**
56	+ * Array of gateway elements.
57	+ *
58	+ * @since TBD
59	+ *
60	+ * @type {Object}
61	+ */
62	+ obj.gateways = [];
63	+
64	+ /**
65	+ * Object to store the toggle elements.
66	+ *
67	+ * @since TBD
68	+ *
69	+ * @type {Object}
70	+ */
71	+ obj.toggles = {};
72	+
73	+ /**
74	+ * Toggler selectors.
75	+ *
76	+ * @since TBD
77	+ *
78	+ * @type {Object}
79	+ */
80	+ obj.selectors = {
81	+ gatewayDiv: '.tribe-tickets__commerce-checkout-gateway',
82	+ toggleButton: '.tribe-tickets__commerce-checkout-gateway-toggle-button',
83	+ toggle: '.tribe-tickets__commerce-checkout-gateway-toggle',
84	+ toggleOpen: '.tribe-tickets__commerce-checkout-gateway-toggle--open',
85	+ toggleHidden: '.tribe-common-a11y-hidden',
86	+ };
87	+
88	+ /**
89	+ * Toggler init method.
90	+ *
91	+ * @since TBD
92	+ *
93	+ * @return
94	+ */
95	+ obj.init = () => {
96	+ obj.gateways = $( obj.selectors.gatewayDiv );
97	+
98	+ // If one or less gateways, go ahead and show and not add toggles.
99	+ if( obj.gateways.length < 2 ){
100	+ obj.gateways.show();
101	+ return;
102	+ }
103	+ obj.addToggles();
104	+ obj.showDefault();
105	+ };
106	+
107	+ /**
108	+ * Shows gateway.
109	+ *
110	+ * @since TBD
111	+ *
112	+ * @param {Element} gateway Gateway element to show.
113	+ */
114	+ obj.showGateway = gateway => {
115	+ $( gateway )
116	+ .show()
117	+ .attr( 'aria-expanded', 'true' )
118	+ .removeClass( obj.selectors.toggleHidden.className() );
119	+ };
120	+
121	+ /**
122	+ * Hides gateway.
123	+ *
124	+ * @since TBD
125	+ *
126	+ * @param {Element} gateway Gateway element to hide.
127	+ */
128	+ obj.hideGateway = gateway => {
129	+ $( gateway )
130	+ .hide()
131	+ .attr( 'aria-expanded', 'false' )
132	+ .addClass( obj.selectors.toggleHidden.className() );
133	+ };
134	+
135	+ /**
136	+ * Show the default/first gateway.
137	+ *
138	+ * @since TBD
139	+ */
140	+ obj.showDefault = () => {
141	+ obj.showGateway( obj.gateways[0] );
142	+ obj.gateways.each( ( x, gateway ) => {
143	+ if( 0 === x ){
144	+ return;
145	+ }
146	+ obj.hideGateway( gateway );
147	+ });
148	+ obj.toggles.default.addClass( obj.selectors.toggleOpen.className() ).hide().attr( 'aria-hidden', 'true' );
149	+ obj.toggles.additional.removeClass( obj.selectors.toggleOpen.className() ).attr( 'aria-selected', 'false' );
150	+ };
151	+
152	+ /**
153	+ * Show the additional (non-default) gateway(s).
154	+ *
155	+ * @since TBD
156	+ */
157	+ obj.showAdditional = () => {
158	+ // If additional options already open, let's close it and show default.
159	+ if ( obj.toggles.additional.hasClass( obj.selectors.toggleOpen.className() ) ) {
160	+ obj.showDefault();
161	+ return;
162	+ }
163	+ obj.hideGateway( obj.gateways[0] );
164	+ obj.gateways.each( ( x, gateway ) => {
165	+ if( 0 === x ){
166	+ return;
167	+ }
168	+ obj.showGateway( gateway );
169	+ });
170	+ obj.toggles.additional.addClass( obj.selectors.toggleOpen.className() ).attr( 'aria-selected', 'true' );
171	+ obj.toggles.default.removeClass( obj.selectors.toggleOpen.className() ).show().attr( 'aria-hidden', 'false' );
172	+ };
173	+
174	+ /**
175	+ * Add toggle elements to DOM.
176	+ *
177	+ * @since TBD
178	+ */
179	+ obj.addToggles = () => {
180	+ obj.toggles.default = $( obj.getDefaultToggleHTML() );
181	+ obj.toggles.additional = $( obj.getAdditionalToggleHTML() );
182	+ obj.toggles.default.insertBefore( obj.gateways[0] );
183	+ obj.toggles.additional.insertBefore( obj.gateways[1] );
184	+ obj.toggleEvents();
185	+ };
186	+
187	+ /**
188	+ * Get HTML for default gateway toggle.
189	+ *
190	+ * @since TBD
191	+ *
192	+ * @return string HTML for toggle.
193	+ */
194	+ obj.getDefaultToggleHTML = () => {
195	+ return `<div class="${obj.selectors.toggle.className()}">` +
196	+ `<button class="${obj.selectors.toggleButton.className()}">` +
197	+ `${obj.text.default}` +
198	+ `</button></div>`;
199	+ };
200	+
201	+ /**
202	+ * Get HTML for additional gateways toggle.
203	+ *
204	+ * @since TBD
205	+ *
206	+ * @return string HTML for toggle.
207	+ */
208	+ obj.getAdditionalToggleHTML = () => {
209	+ return `<div class="${obj.selectors.toggle.className()}">` +
210	+ `<button class="${obj.selectors.toggleButton.className()}">` +
211	+ `${obj.text.additional}` +
212	+ `</button></div>`;
213	+ };
214	+
215	+ /**
216	+ * Create toggle event handlers.
217	+ *
218	+ * @since TBD
219	+ */
220	+ obj.toggleEvents = () => {
221	+ obj.toggles.default.find( 'button' ).on( 'click', obj.showDefault );
222	+ obj.toggles.additional.find( 'button' ).on( 'click', obj.showAdditional );
223	+ }
224	+
225	+ // Initiate the toggles.
226	+ obj.init();
227	+ })( jQuery, tribe.tickets.commerce.gateway.toggler );

src/resources/js/v2/tickets-commerce.js CHANGED Viewed

	@@ -1,3 +1,4 @@

1	/**
2	* Makes sure we have all the required levels on the Tribe Object
3	*
	@@ -54,6 +55,9 @@ tribe.tickets.commerce = {};
54	checkoutItemDescriptionButtonLess: '.tribe-tickets__commerce-checkout-cart-item-details-button--less', // eslint-disable-line max-len
55	hiddenElement: '.tribe-common-a11y-hidden',
56	nonce: '#tec-tc-checkout-nonce',



57	};
58
59	/**
	@@ -180,6 +184,28 @@ tribe.tickets.commerce = {};
180	$document.trigger( 'afterSetup.tecTicketsCommerce', [ $container ] );
181	};
182






















183	/**
184	* Handles the initialization of the tickets commerce events when Document is ready.
185	*


1	+ /* eslint-disable es5/no-arrow-functions */
2	/**
3	* Makes sure we have all the required levels on the Tribe Object
4	*

55	checkoutItemDescriptionButtonLess: '.tribe-tickets__commerce-checkout-cart-item-details-button--less', // eslint-disable-line max-len
56	hiddenElement: '.tribe-common-a11y-hidden',
57	nonce: '#tec-tc-checkout-nonce',
58	+ purchaserFormContainer: '.tribe-tickets__commerce-checkout-purchaser-info-wrapper',
59	+ purchaserName: '.tribe-tickets__commerce-checkout-purchaser-info-form-field-name',
60	+ purchaserEmail: '.tribe-tickets__commerce-checkout-purchaser-info-form-field-email',
61	};
62
63	/**

184	$document.trigger( 'afterSetup.tecTicketsCommerce', [ $container ] );
185	};
186
187	+ /**
188	+ * Get purchaser data if available.
189	+ *
190	+ * @since TBD
191	+ *
192	+ * @param {jQuery} $container Container for the purchaser info fields.
193	+ *
194	+ * @return {Object}
195	+ */
196	+ obj.getPurchaserData = ( $container ) => {
197	+ const purchaser = {};
198	+
199	+ if ( ! $container.length ) {
200	+ return purchaser;
201	+ }
202	+
203	+ purchaser.name = $container.find( obj.selectors.purchaserName ).val();
204	+ purchaser.email = $container.find( obj.selectors.purchaserEmail ).val();
205	+
206	+ return purchaser;
207	+ };
208	+
209	/**
210	* Handles the initialization of the tickets commerce events when Document is ready.
211	*

src/resources/postcss/tickets-admin/settings/_tickets-commerce.pcss CHANGED Viewed

	@@ -8,6 +8,7 @@
8	@todo @juanfra: This was already here, inherited. We need to move to common.
9	*/
10

11	#tribe-field-tickets-commerce-paypal-commerce-configure {
12	padding-left: 0;
13	width: 100%;
	@@ -93,7 +94,7 @@
93	max-width: 84%;
94	}
95
96	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~ {
97	background: #fff;
98	border: 1px solid #ccc;
99	border-radius: 4px;
	@@ -101,20 +102,26 @@
101	display: flex;
102	flex-direction: row;
103	justify-content: space-around;

104	padding: 45px 32px 20px 32px;
105
106	@media (--viewport-medium) {
107	- background-image: url("../images/background-~~paypal~~-connect.png");
108	background-position: center right;
109	background-repeat: no-repeat;

110	}
111	}
112
113	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-title {
114	font-size: 20px;
115	}
116
117	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-description {




118	margin-bottom: 20px;
119
120	p {
	@@ -122,15 +129,16 @@
122	}
123	}
124
125	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-signup-links {

126	margin-top: var(--tec-spacer-8);
127	}
128
129	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-links {
130	margin-top: var(--tec-spacer-8);
131	}
132
133	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link {
134	align-items: center;
135	display: flex;
136
	@@ -139,8 +147,8 @@
139	}
140	}
141
142	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-refresh-link,
143	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-help-link-url {
144	margin-left: 8px;
145
146	&,
	@@ -152,7 +160,7 @@
152	}
153	}
154
155	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-merchant-country-container {
156	@media (--viewport-medium) {
157
158	.tribe-dropdown .select2-selection--single {
	@@ -171,17 +179,17 @@
171	}
172	}
173
174	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo ul {
175	list-style: none;
176	margin: inherit;
177	}
178
179	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo li {
180	line-height: 1.8;
181	margin-bottom: 16px;
182	}
183
184	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo ul li:before {
185	background-color: #405bfb;
186	border-radius: 100%;
187	content: '';
	@@ -191,7 +199,7 @@
191	width: 7px;
192	}
193
194	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo {
195	display: none;
196	flex-basis: 290px;
197	font-size: 13px;
	@@ -199,20 +207,21 @@
199	font-weight: normal;
200	letter-spacing: 0.02em;
201	line-height: 16px;

202
203	@media (--viewport-medium) {
204	display: flex;
205	}
206	}
207
208	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo-image {
209	height: auto;
210	margin-bottom: 32px;
211	max-width: 232px;
212	width: 100%;
213	}
214
215	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect {
216	display: flex;
217	flex: 1;
218
	@@ -221,13 +230,13 @@
221	}
222	}
223
224	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-text--connected {
225	color: #1eb056;
226	font-size: 16px;
227	font-weight: 600;
228	}
229
230	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-row {
231	display: flex;
232	font-size: 13px;
233	font-weight: normal;
	@@ -235,21 +244,21 @@
235	text-align: left;
236	}
237
238	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col1 {
239	flex-basis: 20%;
240	min-width: 125px;
241	}
242
243	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-col2 {
244	flex-basis: 80%;
245	}
246
247	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect,
248	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-logo {
249	flex-direction: column;
250	}
251
252	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connect-button-link {
253	background: #405bfb;
254	border-radius: 4px;
255	color: #fff;
	@@ -277,11 +286,11 @@
277	}
278	}
279
280	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-name {
281	font-weight: 700;
282	}
283
284	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-text-disconnect-link {
285	border-bottom: 1px solid #405bfb;
286	font-size: 13px;
287	margin-left: 10px;
	@@ -296,40 +305,65 @@
296	}
297	}
298
299	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-~~signup-settings~~ {























300	max-width: 340px;
301	width: 100%;
302	}
303
304	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook {
305	&:not(last-of-type) {
306	margin-bottom: 8px;
307	}
308	}
309
310	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook--active {
311	- .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error {

312	@mixin hidden;
313	}
314	}
315
316	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook--active) {
317	- .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name {

318	color: var(--tec-color-text-primary-light);
319	text-decoration: line-through;
320	}
321	}
322
323	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-webhook-error {
324	color: var(--color-icon-error);
325	margin-left: 8px;
326	}
327
328	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-actions-debug {
329	margin-top: 20px;
330	}
331
332	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button {
333	@mixin button-solid;
334
335	background-color: var(--tec-color-button-primary);
	@@ -351,7 +385,7 @@
351	}
352	}
353
354	- .tec-tickets__admin-settings-tickets-commerce-~~paypal~~-connected-resync-button-icon {
355	margin-right: 8px;
356	position: relative;
357	stroke: white;
	@@ -365,7 +399,7 @@
365
366	.tribe-common,
367	.event-tickets {
368	- &.tribe-modal__wrapper--~~paypal~~-connected {
369	.tribe-tickets__notice {
370	display: block;
371	}
	@@ -396,8 +430,185 @@
396	z-index: 99999;
397	}
398	}












399	}
400
401	- #paypal-connected-modal-button {

402	display: none;
403	}


8	@todo @juanfra: This was already here, inherited. We need to move to common.
9	*/
10
11	+ #tribe-field-tickets-commerce-stripe-commerce-configure,
12	#tribe-field-tickets-commerce-paypal-commerce-configure {
13	padding-left: 0;
14	width: 100%;

94	max-width: 84%;
95	}
96
97	+ .tec-tickets__admin-settings-tickets-commerce-gateway {
98	background: #fff;
99	border: 1px solid #ccc;
100	border-radius: 4px;

102	display: flex;
103	flex-direction: row;
104	justify-content: space-around;
105	+ margin-bottom: var(--tec-spacer-3);
106	padding: 45px 32px 20px 32px;
107
108	@media (--viewport-medium) {
109	+ background-image: url("../images/background-gateway-connect.png");
110	background-position: center right;
111	background-repeat: no-repeat;
112	+ background-size: 420px 100%;
113	}
114	}
115
116	+ .tec-tickets__admin-settings-tickets-commerce-gateway-title {
117	font-size: 20px;
118	}
119
120	+ .tec-tickets__admin-settings-tickets-commerce-gateway-description {
121	+ align-items: start;
122	+ display: flex;
123	+ flex-direction: column;
124	+ flex-grow: 1;
125	margin-bottom: 20px;
126
127	p {

129	}
130	}
131
132	+ .tec-tickets__admin-settings-tickets-commerce-gateway-signup-links {
133	+ flex-grow: 1;
134	margin-top: var(--tec-spacer-8);
135	}
136
137	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-links {
138	margin-top: var(--tec-spacer-8);
139	}
140
141	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link {
142	align-items: center;
143	display: flex;
144

147	}
148	}
149
150	+ .tec-tickets__admin-settings-tickets-commerce-gateway-refresh-link,
151	+ .tec-tickets__admin-settings-tickets-commerce-gateway-help-link-url {
152	margin-left: 8px;
153
154	&,

160	}
161	}
162
163	+ .tec-tickets__admin-settings-tickets-commerce-gateway-merchant-country-container {
164	@media (--viewport-medium) {
165
166	.tribe-dropdown .select2-selection--single {

179	}
180	}
181
182	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo ul {
183	list-style: none;
184	margin: inherit;
185	}
186
187	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo li {
188	line-height: 1.8;
189	margin-bottom: 16px;
190	}
191
192	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo ul li:before {
193	background-color: #405bfb;
194	border-radius: 100%;
195	content: '';

199	width: 7px;
200	}
201
202	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo {
203	display: none;
204	flex-basis: 290px;
205	font-size: 13px;

207	font-weight: normal;
208	letter-spacing: 0.02em;
209	line-height: 16px;
210	+ margin-bottom: var(--tec-spacer-4);
211
212	@media (--viewport-medium) {
213	display: flex;
214	}
215	}
216
217	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo-image {
218	height: auto;
219	margin-bottom: 32px;
220	max-width: 232px;
221	width: 100%;
222	}
223
224	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect {
225	display: flex;
226	flex: 1;
227

230	}
231	}
232
233	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect-text--connected {
234	color: #1eb056;
235	font-size: 16px;
236	font-weight: 600;
237	}
238
239	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-row {
240	display: flex;
241	font-size: 13px;
242	font-weight: normal;

244	text-align: left;
245	}
246
247	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-col1 {
248	flex-basis: 20%;
249	min-width: 125px;
250	}
251
252	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-col2 {
253	flex-basis: 80%;
254	}
255
256	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connect,
257	+ .tec-tickets__admin-settings-tickets-commerce-gateway-logo {
258	flex-direction: column;
259	}
260
261	+ a.tec-tickets__admin-settings-tickets-commerce-gateway-connect-button-link {
262	background: #405bfb;
263	border-radius: 4px;
264	color: #fff;

286	}
287	}
288
289	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-name {
290	font-weight: 700;
291	}
292
293	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-text-disconnect-link {
294	border-bottom: 1px solid #405bfb;
295	font-size: 13px;
296	margin-left: 10px;

305	}
306	}
307
308	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency {
309	+ color: var(--tec-color-text-primary);
310	+ font-weight: bold;
311	+ }
312	+
313	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency-message {
314	+ color: #a3a3a3;
315	+ margin-top: var(--tec-spacer-1);
316	+ }
317	+
318	+ .tec-tickets__admin-settings-tickets-commerce-gateway-currency-message--error {
319	+ color: var(--tec-color-icon-error);
320	+ }
321	+
322	+ .tec-tickets__admin-settings-tickets-commerce-gateway-capability--no {
323	+ color: var(--tec-color-icon-error);
324	+ }
325	+
326	+ /* @todo: Add following green color as variable in common? */
327	+ .tec-tickets__admin-settings-tickets-commerce-gateway-capability--yes {
328	+ color: #1eb056;
329	+ }
330	+
331	+ .tec-tickets__admin-settings-tickets-commerce-gateway-signup-settings {
332	max-width: 340px;
333	width: 100%;
334	}
335
336	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook {
337	&:not(last-of-type) {
338	margin-bottom: 8px;
339	}
340	}
341
342	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active {
343	+ .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-error,
344	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error {
345	@mixin hidden;
346	}
347	}
348
349	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook:not(.tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook--active) {
350	+ .tec-tickets__admin-settings-tickets-commerce-paypal-connected-webhook-name,
351	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-name {
352	color: var(--tec-color-text-primary-light);
353	text-decoration: line-through;
354	}
355	}
356
357	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-webhook-error {
358	color: var(--color-icon-error);
359	margin-left: 8px;
360	}
361
362	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-actions-debug {
363	margin-top: 20px;
364	}
365
366	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button {
367	@mixin button-solid;
368
369	background-color: var(--tec-color-button-primary);

385	}
386	}
387
388	+ .tec-tickets__admin-settings-tickets-commerce-gateway-connected-resync-button-icon {
389	margin-right: 8px;
390	position: relative;
391	stroke: white;

399
400	.tribe-common,
401	.event-tickets {
402	+ &.tribe-modal__wrapper--gateway-connected {
403	.tribe-tickets__notice {
404	display: block;
405	}

430	z-index: 99999;
431	}
432	}
433	+
434	+ .tec-tickets__admin-settings-tickets-commerce-gateway-modal-notice-error {
435	+ display: block;
436	+ }
437	+
438	+ .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-title {
439	+ margin-bottom: var(--tec-spacer-3);
440	+ }
441	+
442	+ .tec-tickets__admin-settings-tickets-commerce-stripe-modal-content-section {
443	+ margin-bottom: var(--tec-spacer-3);
444	+ }
445	}
446
447	+ #paypal-connected-modal-button,
448	+ #stripe-connected-modal-button {
449	display: none;
450	}
451	+
452	+ .tec-tickets__admin-settings-tickets-commerce-section-menu {
453	+ padding-top: var(--tec-spacer-6);
454	+ }
455	+
456	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link {
457	+ border-bottom-color: #c4c4c4;
458	+ border-bottom-style: solid;
459	+ border-bottom-width: 1px;
460	+ color: #23282d;
461	+ display: inline-block;
462	+ font-size: var(--tec-font-size-2);
463	+ margin-right: var(--tec-spacer-5);
464	+ padding-bottom: var(--tec-spacer-1);
465	+ text-decoration: none;
466	+ }
467	+
468	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link--active {
469	+ border-bottom-width: var(--tec-spacer-0);
470	+ font-weight: bold;
471	+ }
472	+
473	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link--active,
474	+ .tec-tickets__admin-settings-tickets-commerce-section-menu-link:hover {
475	+ border-bottom-color: var(--tec-color-accent-primary);
476	+ color: #23282d;
477	+ }
478	+
479	+ .tec-tickets__admin-settings-featured {
480	+ background-color: var(--tec-color-background);
481	+ border: solid 1px var(--tec-color-border-default);
482	+ border-radius: 8px;
483	+ margin-bottom: var(--tec-spacer-7);
484	+ padding: var(--tec-spacer-8);
485	+ }
486	+
487	+ .tec-tickets__admin-settings-featured-title {
488	+ background-color: transparent;
489	+ font-size: var(--tec-font-size-5);
490	+ font-weight: bold;
491	+ margin-bottom: var(--tec-spacer-2);
492	+ padding: var(--tec-spacer-1) 0;
493	+ }
494	+
495	+ .tec-tickets__admin-settings-featured-description {
496	+ margin-bottom: var(--tec-spacer-4);
497	+ max-width: 720px;
498	+ }
499	+
500	+ .tec-tickets__admin-settings-featured-link {
501	+ align-items: center;
502	+ display: flex;
503	+ }
504	+
505	+ .tec-tickets__admin-settings-featured-link-url {
506	+ color: var(--tec-color-accent-primary);
507	+ padding: 0 var(--tec-spacer-1);
508	+ }
509	+
510	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item {
511	+ margin-bottom: var(--tec-spacer-7);
512	+ padding-bottom: var(--tec-spacer-0);
513	+ text-align: center;
514	+
515	+ & > div {
516	+ padding: var(--tec-spacer-0) 0;
517	+ }
518	+
519	+ @media (--viewport-medium) {
520	+ align-items: center;
521	+ display: flex;
522	+ text-align: left;
523	+ }
524	+ }
525	+
526	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle {
527	+ margin-right: 35px;
528	+ }
529	+
530	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand {
531	+ flex-grow: 1;
532	+ }
533	+
534	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-logo-image {
535	+ max-height: var(--tec-spacer-10);
536	+ }
537	+
538	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-brand-subtitle {
539	+ font-size: 13px;
540	+ font-style: italic;
541	+ }
542	+
543	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link {
544	+ background-color: var(--tec-color-accent-primary);
545	+ border-radius: var(--tec-border-radius-default);
546	+ color: #fff;
547	+ display: inline-block;
548	+ font-size: var(--tec-font-size-2);
549	+ font-weight: var(--tec-font-weight-bold);
550	+ padding: var(--tec-spacer-2) var(--tec-spacer-3);
551	+ text-align: center;
552	+ text-decoration: none;
553	+ width: 180px;
554	+
555	+ &:active,
556	+ &:hover {
557	+ background-color: var(--tec-color-button-primary-hover);
558	+ color: #fff;
559	+ }
560	+
561	+ &:active {
562	+ background-color: var(--tec-color-button-primary-active);
563	+ }
564	+ }
565	+
566	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-button-link--active {
567	+ background-color: var(--tec-color-background);
568	+ border-color: #3c434a;
569	+ border-style: solid;
570	+ border-width: 1px;
571	+ color: #3c434a;
572	+
573	+ &:active,
574	+ &:hover {
575	+ background-color: var(--tec-color-button-primary-hover);
576	+ border-color: var(--tec-color-button-primary-hover);
577	+ color: #fff;
578	+ }
579	+
580	+ &:active {
581	+ background-color: var(--tec-color-button-primary-active);
582	+ border-color: var(--tec-color-button-primary-active);
583	+ }
584	+ }
585	+
586	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-toggle .tec-tickets__admin-settings-tickets-commerce-toggle-checkbox:checked + .tec-tickets__admin-settings-tickets-commerce-toggle-switch {
587	+ background: #50b078;
588	+ }
589	+
590	+ .tec-tickets__admin-settings-tickets-commerce-gateway-group-header {
591	+ background: #f9f9f9;
592	+ color: #23282d;
593	+ font-size: var(--tec-font-size-4);
594	+ font-weight: var(--tec-font-weight-bold);
595	+ padding: var(--tec-spacer-1) var(--tec-spacer-2);
596	+ width: 100%;
597	+ }
598	+
599	+ .tec-tickets__admin-settings-tickets-commerce-gateway-group-header:first-of-type {
600	+ margin-top: 0;
601	+ }
602	+
603	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-status {
604	+ color: var(--tec-color-text-disabled);
605	+ font-size: var(--tec-font-size-2);
606	+ font-style: italic;
607	+ font-weight: var(--tec-font-weight-normal);
608	+ margin: 0 var(--tec-spacer-8);
609	+ }
610	+
611	+ .tec-tickets__admin-settings-tickets-commerce-gateways-item-status--enabled {
612	+ color: #50b078;
613	+ font-weight: var(--tec-font-weight-bold);
614	+ }

src/resources/postcss/tickets-commerce/_checkout.pcss CHANGED Viewed

@@ -56,6 +56,10 @@
             		display: flex;
             		flex-wrap: wrap;
             		padding: var(--tec-spacer-4) 0;
+            	}
             	.tribe-tickets__commerce-checkout-cart-item-details {
@@ -234,6 +238,69 @@
+            		}
+            	}
             	/* -------------------------------------------------------------------------
             	 * Theme Overrides - Twenty Twenty
             	 * ------------------------------------------------------------------------- */
@@ -250,5 +317,9 @@
             		&.tribe-tickets__commerce-checkout {
             			padding: initial;
+            		}
+            	}
+            }


56	display: flex;
57	flex-wrap: wrap;
58	padding: var(--tec-spacer-4) 0;
59	+
60	+ &.entry {
61	+ padding: var(--tec-spacer-4) 0;
62	+ }
63	}
64
65	.tribe-tickets__commerce-checkout-cart-item-details {

238	}
239	}
240
241	+ .tribe-tickets__commerce-checkout-section-header {
242	+ font-size: var(--tec-font-size-4);
243	+ font-weight: var(--tec-font-weight-bold);
244	+ margin-bottom: var(--tec-spacer-3);
245	+ }
246	+
247	+ .tribe-tickets__commerce-checkout-gateway {
248	+ display: none;
249	+ }
250	+
251	+ .tribe-tickets__commerce-checkout-gateway-toggle {
252	+ margin-bottom: var(--tec-spacer-7);
253	+ margin-top: var(--tec-spacer-3);
254	+ }
255	+
256	+ .tribe-tickets__commerce-checkout-gateway-toggle-button {
257	+ color: var(--tec-color-text-primary-light);
258	+ font-family: var(--tec-font-family-sans-serif);
259	+ font-size: var(--tec-font-size-3);
260	+
261	+ &:after {
262	+ border: 7px solid var(--tec-color-background-transparent);
263	+ border-bottom-width: 0;
264	+ border-top-color: var(--tec-color-text-primary-light);
265	+ border-top-width: 10px;
266	+ content: "";
267	+ display: inline-block;
268	+ margin-left: 5px;
269	+ }
270	+ }
271	+
272	+ .tribe-tickets__commerce-checkout-gateway-toggle--open {
273	+ .tribe-tickets__commerce-checkout-gateway-toggle-button {
274	+ color: #23282d;
275	+
276	+ &:after {
277	+ border: 7px solid var(--tec-color-background-transparent);
278	+ border-bottom-color: #23282d;
279	+ border-bottom-width: 10px;
280	+ border-top-width: 0;
281	+ }
282	+ }
283	+ }
284	+
285	+ .tribe-tickets__commerce-checkout-purchaser-info-wrapper {
286	+ margin-bottom: var(--tec-spacer-9);
287	+
288	+ .tribe-tickets__form-field-description {
289	+ color: var(--tec-color-icon-primary-alt);
290	+ margin: var(--tec-spacer-1) 0;
291	+ }
292	+ }
293	+
294	+ .tribe-tickets__commerce-checkout-purchaser-info-title {
295	+ margin-bottom: var(--tec-spacer-3);
296	+ }
297	+
298	+ .tribe-tickets__commerce-checkout-form-submit-button {
299	+ height: 55px;
300	+ margin-top: 24px;
301	+ width: 100%;
302	+ }
303	+
304	/* -------------------------------------------------------------------------
305	* Theme Overrides - Twenty Twenty
306	* ------------------------------------------------------------------------- */

317	&.tribe-tickets__commerce-checkout {
318	padding: initial;
319	}
320	+
321	+ .tribe-tickets__commerce-checkout-section-header {
322	+ margin-bottom: var(--tec-spacer-3);
323	+ }
324	}
325	}

src/resources/postcss/tickets-commerce/admin/gateway/stripe/webhooks.pcss ADDED Viewed

	@@ -0,0 +1,24 @@


1	+ /**
2	+ * Event Tickets - Admin Styles for Stripe Gateway Webhooks.
3	+ *
4	+ * @since TBD
5	+ */
6	+ #tribe-field-tickets-commerce-stripe-webhooks-value {
7	+ input {
8	+ border-top-right-radius: 0;
9	+ border-bottom-right-radius: 0;
10	+ }
11	+
12	+ .tribe-field-tickets-commerce-stripe-webhooks-copy {
13	+ border-top-left-radius: 0;
14	+ border-bottom-left-radius: 0;
15	+ margin-left: -2px;
16	+ line-height: 24px;
17	+ padding-left: 6px;
18	+ padding-right: 6px;
19	+
20	+ span {
21	+ line-height: 24px;
22	+ }
23	+ }
24	+ }

src/resources/postcss/tickets-commerce/gateway/paypal/_advanced-payments.pcss CHANGED Viewed

	@@ -74,4 +74,8 @@
74	margin-top: 24px;
75	width: 100%;
76	}




77	}


74	margin-top: 24px;
75	width: 100%;
76	}
77	+
78	+ .tribe-tickets__commerce-checkout-paypal-advanced-payments-form-field--card-name {
79	+ width: 100%;
80	+ }
81	}

src/resources/postcss/tickets-commerce/gateway/stripe.pcss ADDED Viewed

	@@ -0,0 +1,8 @@


1	+ /**
2	+ * Event Tickets - Tickets Commerce Stripe Stylesheet.
3	+ *
4	+ * @since TBD
5	+ */
6	+
7	+ @import '../../tickets-common.pcss';
8	+ @import 'stripe/_all.pcss';

src/resources/postcss/tickets-commerce/gateway/stripe/_all.pcss ADDED Viewed

	@@ -0,0 +1,7 @@


1	+ /**
2	+ * Event Tickets - Tickets Commerce Stripe Stylesheet
3	+ *
4	+ * @since TBD
5	+ */
6	+
7	+ @import "_stripe.pcss";

src/resources/postcss/tickets-commerce/gateway/stripe/_stripe.pcss ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ /**
2	+ * Event Tickets - Tickets Commerce Stripe Stylesheet
3	+ *
4	+ * @since TBD
5	+ */
6	+
7	+ .event-tickets {
8	+
9	+ .tribe-tickets__commerce-checkout-stripe-payment-element {
10	+ margin-bottom: var(--tec-spacer-4);
11	+ }
12	+
13	+ .tribe-tickets__commerce-checkout-stripe-card-element {
14	+ margin-bottom: var(--tec-spacer-4);
15	+ }
16	+
17	+ .tribe-tickets__commerce-checkout-stripe-card-element-row {
18	+ display: flex;
19	+ justify-content: stretch;
20	+ }
21	+
22	+ .tribe-tickets__commerce-checkout-stripe-card-element--compact {
23	+ border: 1px solid var(--tec-color-border-default);
24	+ border-radius: var(--tec-border-radius-default);
25	+ padding: var(--tec-spacer-2);
26	+
27	+ .tribe-tickets__commerce-checkout-stripe-card-element-row {
28	+ display: none;
29	+ }
30	+ }
31	+
32	+ .tribe-tickets__commerce-checkout-stripe-card-element-number,
33	+ .tribe-tickets__commerce-checkout-stripe-card-element-expiry,
34	+ .tribe-tickets__commerce-checkout-stripe-card-element-cvc,
35	+ .tribe-tickets__commerce-checkout-stripe-card-element-zip {
36	+ border: 1px solid var(--tec-color-border-default);
37	+ border-radius: var(--tec-border-radius-default);
38	+ flex-basis: 67%;
39	+ flex-grow: 1;
40	+ margin-bottom: var(--tec-spacer-2);
41	+ margin-right: var(--tec-spacer-2);
42	+ padding: var(--tec-spacer-2) var(--tec-spacer-3);
43	+ }
44	+
45	+ .tribe-tickets__commerce-checkout-stripe-card-element-expiry,
46	+ .tribe-tickets__commerce-checkout-stripe-card-element-zip {
47	+ flex-basis: 33%;
48	+ margin-right: 0;
49	+ }
50	+
51	+ .tribe-tickets__commerce-checkout-stripe-card-element-zip-input {
52	+ background-color: var(--tec-color-background-events);
53	+ border: none;
54	+ color: #23282d;
55	+ display: block;
56	+ font-family: sans-serif;
57	+ font-size: var(--tec-font-size-2);
58	+ margin: 0;
59	+ padding: 0;
60	+ width: 100%;
61	+ }
62	+ }

src/views/tickets/email.php CHANGED Viewed

	@@ -414,7 +414,9 @@
414	<tr>
415	<td valign="top" align="center" width="100%" style="padding: 0 !important; margin:0 !important;">
416	<h2 style="color:#0a0a0e; margin:0 0 10px 0 !important; font-family: 'Helvetica Neue', Helvetica, sans-serif; font-style:normal; font-weight:700; font-size:28px; letter-spacing:normal; text-align:left;line-height: 100%;">
417	- <a style="color:#0a0a0e !important" href="<?php echo esc_url( $event_link ); ?>"~~><?php echo $event->post_title; ?></a~~>


418	</h2>
419	<?php if ( ! empty( $event_date ) ) : ?>
420	<h4 style="color:#0a0a0e; margin:0 !important; font-family: 'Helvetica Neue', Helvetica, sans-serif; font-style:normal; font-weight:700; font-size:15px; letter-spacing:normal; text-align:left;line-height: 100%;">


414	<tr>
415	<td valign="top" align="center" width="100%" style="padding: 0 !important; margin:0 !important;">
416	<h2 style="color:#0a0a0e; margin:0 0 10px 0 !important; font-family: 'Helvetica Neue', Helvetica, sans-serif; font-style:normal; font-weight:700; font-size:28px; letter-spacing:normal; text-align:left;line-height: 100%;">
417	+ <a style="color:#0a0a0e !important" href="<?php echo esc_url( $event_link ); ?>">
418	+ <?php echo $event->post_title; ?>
419	+ </a>
420	</h2>
421	<?php if ( ! empty( $event_date ) ) : ?>
422	<h4 style="color:#0a0a0e; margin:0 !important; font-family: 'Helvetica Neue', Helvetica, sans-serif; font-style:normal; font-weight:700; font-size:15px; letter-spacing:normal; text-align:left;line-height: 100%;">

src/views/v2/commerce/checkout.php CHANGED Viewed

	@@ -9,9 +9,10 @@
9	*
10	* @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	*
12	- * @since 5.1.9

13	*
14	- * @version 5.1.9
15	*
16	* @var \Tribe__Template $this [Global] Template object.
17	* @var Module $provider [Global] The tickets provider instance.
	@@ -43,19 +44,21 @@ $attributes = [
43	<?php tribe( 'tickets.editor.template' )->template( 'v2/components/loader/loader' ); ?>
44	<?php
45	tribe( 'tickets.editor.template' )->template(
46	- 'components/notice',
47	- [
48	- 'notice_classes' => [
49	'tribe-tickets__notice--error',
50	'tribe-tickets__commerce-checkout-notice',
51	- ],
52	- 'content_classes' => [ 'tribe-tickets__commerce-checkout-notice-content' ],
53	- 'title' => __( 'Checkout Error!', 'event-tickets' ),
54	- 'content' => __( 'Something went wrong!', 'event-tickets' ),
55	- ]
56	);
57	?>
58	<?php $this->template( 'checkout/cart/empty' ); ?>


59	<?php $this->template( 'checkout/footer' ); ?>
60	<?php $this->template( 'checkout/must-login' ); ?>
61	</section>


9	*
10	* @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	*
12	+ * @since 5.1.9
13	+ * @since 5.3.0 Added purchaser info templates.
14	*
15	+ * @version 5.3.0
16	*
17	* @var \Tribe__Template $this [Global] Template object.
18	* @var Module $provider [Global] The tickets provider instance.

44	<?php tribe( 'tickets.editor.template' )->template( 'v2/components/loader/loader' ); ?>
45	<?php
46	tribe( 'tickets.editor.template' )->template(
47	+ 'components/notice',
48	+ [
49	+ 'notice_classes' => [
50	'tribe-tickets__notice--error',
51	'tribe-tickets__commerce-checkout-notice',
52	+ ],
53	+ 'content_classes' => [ 'tribe-tickets__commerce-checkout-notice-content' ],
54	+ 'title' => __( 'Checkout Error!', 'event-tickets' ),
55	+ 'content' => __( 'Something went wrong!', 'event-tickets' ),
56	+ ]
57	);
58	?>
59	<?php $this->template( 'checkout/cart/empty' ); ?>
60	+ <?php $this->template( 'checkout/purchaser-info' ); ?>
61	+ <?php $this->template( 'checkout/gateways' ); ?>
62	<?php $this->template( 'checkout/footer' ); ?>
63	<?php $this->template( 'checkout/must-login' ); ?>
64	</section>

src/views/v2/commerce/checkout/cart.php CHANGED Viewed

	@@ -13,20 +13,21 @@
13	*
14	* @version 5.1.9
15	*
16	- * @var \Tribe__Template $this [Global] Template object.
17	- * @var Module $provider [Global] The tickets provider instance.
18	- * @var string $provider_id [Global] The tickets provider class name.
19	- * @var array[] $items [Global] List of Items on the cart to be checked out.
20	- * @var bool $must_login [Global] Whether login is required to buy tickets or not.
21	- * @var string $login_url [Global] The site's login URL.
22	- * @var string $registration_url [Global] The site's registration URL.
23	- * @var bool $is_tec_active [Global] Whether `The Events Calendar` is active or not.
24	- * @var int $section Which Section that we are going to render for this table.
25	- * @var array[] $gateways [Global] An array with the gateways.
26	- * @var int $gateways_active [Global] The number of active gateways.
27	*/
28
29	$post = get_post( $section );

30	?>
31
32	<div class="tribe-tickets__commerce-checkout-cart">


13	*
14	* @version 5.1.9
15	*
16	+ * @var \Tribe__Template $this [Global] Template object.
17	+ * @var Module $provider [Global] The tickets provider instance.
18	+ * @var string $provider_id [Global] The tickets provider class name.
19	+ * @var array[] $items [Global] List of Items on the cart to be checked out.
20	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
21	+ * @var string $login_url [Global] The site's login URL.
22	+ * @var string $registration_url [Global] The site's registration URL.
23	+ * @var bool $is_tec_active [Global] Whether `The Events Calendar` is active or not.
24	+ * @var int $section Which Section that we are going to render for this table.
25	+ * @var array[] $gateways [Global] An array with the gateways.
26	+ * @var int $gateways_active [Global] The number of active gateways.
27	*/
28
29	$post = get_post( $section );
30	+
31	?>
32
33	<div class="tribe-tickets__commerce-checkout-cart">

src/views/v2/commerce/checkout/footer/gateway-error.php CHANGED Viewed

	@@ -10,8 +10,9 @@
10	* @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	*
12	* @since 5.1.10

13	*
14	- * @version 5.1.10
15	*
16	* @var \Tribe__Template $this [Global] Template object.
17	* @var Module $provider [Global] The tickets provider instance.


10	* @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	*
12	* @since 5.1.10
13	+ * @since 5.3.0 Improve check for active gateways now that we can enable or disable gateways.
14	*
15	+ * @version 5.3.0
16	*
17	* @var \Tribe__Template $this [Global] Template object.
18	* @var Module $provider [Global] The tickets provider instance.

src/views/v2/commerce/checkout/gateways.php ADDED Viewed

	@@ -0,0 +1,47 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Checkout Page Gateways.
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/checkout/gateways.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ *
16	+ * @var \Tribe__Template $this [Global] Template object.
17	+ * @var Module $provider [Global] The tickets provider instance.
18	+ * @var string $provider_id [Global] The tickets provider class name.
19	+ * @var array[] $items [Global] List of Items on the cart to be checked out.
20	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
21	+ * @var string $login_url [Global] The site's login URL.
22	+ * @var string $registration_url [Global] The site's registration URL.
23	+ * @var bool $is_tec_active [Global] Whether `The Events Calendar` is active or not.
24	+ * @var Abstract_Gateway[] $gateways [Global] An array with the gateways.
25	+ * @var int $gateways_active [Global] The number of active gateways.
26	+ * @var int $gateways_connected [Global] The number of connected gateways.
27	+ */
28	+
29	+ // Bail if user needs to login, the cart is empty or if there are no active gateways.
30	+ if ( $must_login \|\| empty( $items ) \|\| ! tribe_is_truthy( $gateways_active ) ) {
31	+ return;
32	+ }
33	+
34	+ ?>
35	+ <div class="tribe-tickets__commerce-checkout-gateways">
36	+ <h4 class="tribe-common-h5 tribe-tickets__commerce-checkout-section-header">
37	+ <?php esc_html_e( 'Payment', 'event-tickets' ); ?>
38	+ </h4>
39	+ <?php
40	+ foreach ( $gateways as $gateway ) {
41	+ if ( ! $gateway::is_enabled() \|\| ! $gateway::is_active() ) {
42	+ continue;
43	+ }
44	+ $gateway->render_checkout_template( $this );
45	+ }
46	+ ?>
47	+ </div>

src/views/v2/commerce/checkout/purchaser-info.php ADDED Viewed

	@@ -0,0 +1,30 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Checkout Purchaser Info.
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/checkout/purchaser-info.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ *
16	+ * @var \Tribe__Template $this [Global] Template object.
17	+ * @var array[] $items [Global] List of Items on the cart to be checked out.
18	+ * @var bool $must_login Global] Whether login is required to buy tickets or not.
19	+ */
20	+
21	+ if ( is_user_logged_in() \|\| $must_login \|\| empty( $items ) ) {
22	+ return;
23	+ }
24	+ ?>
25	+
26	+ <div class="tribe-tickets__form tribe-tickets__commerce-checkout-purchaser-info-wrapper tribe-common-b2">
27	+ <h4 class="tribe-common-h5 tribe-tickets__commerce-checkout-purchaser-info-title"><?php esc_html_e( 'Purchaser info', 'event-tickets' ); ?></h4>
28	+ <?php $this->template( 'checkout/purchaser-info/name' ); ?>
29	+ <?php $this->template( 'checkout/purchaser-info/email' ); ?>
30	+ </div>

src/views/v2/commerce/checkout/purchaser-info/email.php ADDED Viewed

	@@ -0,0 +1,50 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Checkout Page Purchaser Info Email Field
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/checkout/purchaser-info/email.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ *
16	+ * @var \Tribe__Template $this [Global] Template object.
17	+ */
18	+
19	+ $label_classes = [
20	+ 'tribe-tickets__form-field-label',
21	+ 'tribe-tickets__commerce-checkout-purchaser-info-email-field-label',
22	+ ];
23	+
24	+ $field_classes = [
25	+ 'tribe-common-b2',
26	+ 'tribe-tickets__commerce-checkout-purchaser-info-form-field',
27	+ 'tribe-tickets__commerce-checkout-purchaser-info-form-field-email',
28	+ 'tribe-common-form-control-text__input',
29	+ 'tribe-tickets__form-field-input',
30	+ ];
31	+ ?>
32	+ <div class="tribe-tickets__commerce-checkout-purchaser-info-field tribe-tickets__form-field tribe-tickets__form-field--email">
33	+ <label for="tec-tc-purchaser-email" <?php tribe_classes( $label_classes ); ?>>
34	+ <?php esc_html_e( 'Email address:', 'event-tickets' ); ?>
35	+ </label>
36	+
37	+ <div class="tribe-tickets__form-field-input-wrapper">
38	+ <input
39	+ type="email"
40	+ id="tec-tc-purchaser-email"
41	+ name="purchaser-email"
42	+ autocomplete="off"
43	+ <?php tribe_classes( $field_classes ); ?>
44	+ required
45	+ />
46	+ <div class="tribe-common-b3 tribe-tickets__form-field-description">
47	+ <?php esc_html_e( 'Your tickets will be sent to this address', 'event-tickets' ); ?>
48	+ </div>
49	+ </div>
50	+ </div>

src/views/v2/commerce/checkout/purchaser-info/name.php ADDED Viewed

	@@ -0,0 +1,45 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Checkout Page Purchaser Info Name Field
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/checkout/purchaser-info/name.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ *
16	+ * @var \Tribe__Template $this [Global] Template object.
17	+ */
18	+
19	+ $label_classes = [
20	+ 'tribe-tickets__form-field-label',
21	+ 'tribe-tickets__commerce-checkout-purchaser-info-name-field-label',
22	+ ];
23	+
24	+ $field_classes = [
25	+ 'tribe-tickets__commerce-checkout-purchaser-info-form-field',
26	+ 'tribe-tickets__commerce-checkout-purchaser-info-form-field-name',
27	+ 'tribe-common-form-control-text__input',
28	+ 'tribe-tickets__form-field-input',
29	+ ];
30	+ ?>
31	+ <div class="tribe-tickets__commerce-checkout-purchaser-info-field tribe-tickets__form-field tribe-tickets__form-field--text">
32	+ <label for="tec-tc-purchaser-name" <?php tribe_classes( $label_classes ); ?>>
33	+ <?php esc_html_e( 'Person purchasing tickets:', 'event-tickets' ); ?>
34	+ </label>
35	+ <div class="tribe-tickets__form-field-input-wrapper">
36	+ <input
37	+ type="text"
38	+ id="tec-tc-purchaser-name"
39	+ name="purchaser-name"
40	+ autocomplete="off"
41	+ <?php tribe_classes( $field_classes ); ?>
42	+ required
43	+ />
44	+ </div>
45	+ </div>

src/views/v2/commerce/gateway/paypal/container.php ADDED Viewed

	@@ -0,0 +1,34 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: PayPal Checkout container
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/gateway/paypal/container.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ *
16	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
17	+ * @var bool $supports_custom_payments [Global] Determines if this site supports custom payments.
18	+ * @var bool $active_custom_payments [Global] Determines if this site supports custom payments.
19	+ * @var string $url [Global] Script URL.
20	+ * @var string $client_token [Global] One time use client Token.
21	+ * @var string $client_token_expires_in [Global] How much time to when the Token in this script will take to expire.
22	+ * @var string $attribution_id [Global] What is our PayPal Attribution ID.
23	+ */
24	+
25	+ if ( $must_login ) {
26	+ return;
27	+ }
28	+
29	+ ?>
30	+ <div class="tribe-tickets__commerce-checkout-gateway tribe-tickets__commerce-checkout-paypal">
31	+ <?php $this->template( 'gateway/paypal/buttons' ); ?>
32	+ <?php $this->template( 'gateway/paypal/advanced-payments' ); ?>
33	+ <?php $this->template( 'gateway/paypal/checkout-script' ); ?>
34	+ </div>

src/views/v2/commerce/gateway/stripe/card-element.php ADDED Viewed

	@@ -0,0 +1,62 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Card Element Checkout for Stripe
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/gateway/stripe/card-element.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
16	+ * @var bool $payment_element [Global] Whether to load the Stripe Payment Element.
17	+ * @var string $card_element_type [Global] Card element type. Either 'compact' or 'separate'.
18	+ */
19	+
20	+ if ( $must_login \|\| $payment_element ) {
21	+ return;
22	+ }
23	+
24	+ $classes = [
25	+ 'tribe-tickets__commerce-checkout-stripe-card-element',
26	+ 'tribe-tickets__commerce-checkout-stripe-card-element--' . esc_attr( $card_element_type ),
27	+ ];
28	+
29	+ ?>
30	+ <div id="tec-tc-gateway-stripe-card-element" <?php tribe_classes( $classes ); ?>>
31	+ <div class="tribe-tickets__commerce-checkout-stripe-card-element-row">
32	+ <span id="tec-tc-gateway-stripe-card-number" class="tribe-tickets__commerce-checkout-stripe-card-element-number"></span>
33	+ <span id="tec-tc-gateway-stripe-card-expiry" class="tribe-tickets__commerce-checkout-stripe-card-element-expiry"></span>
34	+ </div>
35	+ <div class="tribe-tickets__commerce-checkout-stripe-card-element-row">
36	+ <span id="tec-tc-gateway-stripe-card-cvc" class="tribe-tickets__commerce-checkout-stripe-card-element-cvc"></span>
37	+ <span id="tec-tc-gateway-stripe-card-zip" class="tribe-tickets__commerce-checkout-stripe-card-element-zip">
38	+ <input
39	+ class="tribe-tickets__commerce-checkout-stripe-card-element-zip-input"
40	+ placeholder="<?php esc_attr_e( 'Zip Code', 'event-tickets' ); ?>"
41	+ />
42	+ </span>
43	+ </div>
44	+ </div>
45	+
46	+ <div
47	+ id="tec-tc-gateway-stripe-errors"
48	+ class="tribe-common-b2"
49	+ role="alert"></div>
50	+
51	+ <button
52	+ id="tec-tc-gateway-stripe-checkout-button"
53	+ class="tribe-common-c-btn tribe-tickets__commerce-checkout-form-submit-button"
54	+ >
55	+ <?php
56	+ printf(
57	+ // Translators: %1$s: Plural `Tickets` label.
58	+ esc_html__( 'Purchase %1$s', 'event-tickets' ),
59	+ tribe_get_ticket_label_plural( 'tickets_commerce_checkout_title' ) // phpcs:ignore
60	+ );
61	+ ?>
62	+ </button>

src/views/v2/commerce/gateway/stripe/container.php ADDED Viewed

	@@ -0,0 +1,33 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Stripe Checkout Form
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/gateway/stripe/container.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @todo FrontEnd needs to revisit all of these templates to make sure we're not missing anything
13	+ *
14	+ * @since 5.3.0
15	+ *
16	+ * @version 5.3.0
17	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
18	+ * @var bool $payment_element [Global] Whether to load the Stripe Payment Element.
19	+ */
20	+
21	+ if ( ! empty( $must_login ) ) {
22	+ return;
23	+ }
24	+ ?>
25	+ <div class="tribe-tickets__commerce-checkout-gateway tribe-tickets__commerce-checkout-stripe">
26	+ <form id="payment-form">
27	+
28	+ <?php $this->template( 'gateway/stripe/payment-element' ); ?>
29	+
30	+ <?php $this->template( 'gateway/stripe/card-element' ); ?>
31	+
32	+ </form>
33	+ </div>

src/views/v2/commerce/gateway/stripe/payment-element.php ADDED Viewed

	@@ -0,0 +1,40 @@


1	+ <?php
2	+ /**
3	+ * Tickets Commerce: Payment Element Checkout for Stripe
4	+ *
5	+ * Override this template in your own theme by creating a file at:
6	+ * [your-theme]/tribe/tickets/v2/commerce/gateway/stripe/payment-element.php
7	+ *
8	+ * See more documentation about our views templating system.
9	+ *
10	+ * @link https://evnt.is/1amp Help article for RSVP & Ticket template files.
11	+ *
12	+ * @since 5.3.0
13	+ *
14	+ * @version 5.3.0
15	+ * @var bool $must_login [Global] Whether login is required to buy tickets or not.
16	+ * @var bool $payment_element [Global] Whether to load the Stripe Payment Element.
17	+ */
18	+
19	+ if ( $must_login \|\| ! $payment_element ) {
20	+ return;
21	+ }
22	+ ?>
23	+ <div id="tec-tc-gateway-stripe-payment-element" class="tribe-tickets__commerce-checkout-stripe-payment-element"></div>
24	+ <button id="tec-tc-gateway-stripe-checkout-button" class="tribe-common-c-btn tribe-tickets__commerce-checkout-form-submit-button">
25	+ <div class="spinner hidden" id="spinner"></div>
26	+ <span id="button-text">
27	+ <?php
28	+ printf(
29	+ // Translators: %1$s: Plural `Tickets` label.
30	+ esc_html__( 'Purchase %1$s', 'event-tickets' ),
31	+ tribe_get_ticket_label_plural( 'tickets_commerce_checkout_title' ) // phpcs:ignore
32	+ );
33	+ ?>
34	+ </span>
35	+ </button>
36	+ <div id="tec-tc-gateway-stripe-payment-message" class="hidden"></div>
37	+ <div
38	+ id="tec-tc-gateway-stripe-errors"
39	+ class="tribe-common-b2"
40	+ role="alert"></div>

vendor/autoload.php CHANGED Viewed

	@@ -4,4 +4,4 @@
4
5	require_once __DIR__ . '/composer/autoload_real.php';
6
7	- return ~~ComposerAutoloaderInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~::getLoader();


4
5	require_once __DIR__ . '/composer/autoload_real.php';
6
7	+ return ComposerAutoloaderInit3debd0547f39ea13f347720ddc69ae0a::getLoader();

vendor/composer/autoload_classmap.php CHANGED Viewed

@@ -9,7 +9,7 @@ return array(
                 'TEC\\Tickets\\Assets' => $baseDir . '/src/Tickets/Assets.php',
                 'TEC\\Tickets\\Commerce' => $baseDir . '/src/Tickets/Commerce.php',
                 'TEC\\Tickets\\Commerce\\Abstract_Order' => $baseDir . '/src/Tickets/Commerce/Abstract_Order.php',
-            -
                'TEC\\Tickets\\Commerce\\Abstract_Settings' => $baseDir . '/src/Tickets/Commerce/Abstract_Settings.php',
                 'TEC\\Tickets\\Commerce\\Admin\\Notices' => $baseDir . '/src/Tickets/Commerce/Admin/Notices.php',
                 'TEC\\Tickets\\Commerce\\Admin_Tables\\Attendees' => $baseDir . '/src/Tickets/Commerce/Admin_Tables/Attendees.php',
                 'TEC\\Tickets\\Commerce\\Admin_Tables\\Orders' => $baseDir . '/src/Tickets/Commerce/Admin_Tables/Orders.php',
@@ -34,8 +34,21 @@ return array(
                 'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Sales' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Increase_Sales.php',
                 'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Stock' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Increase_Stock.php',
                 'TEC\\Tickets\\Commerce\\Flag_Actions\\Send_Email' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Send_Email.php',
-            -
                'TEC\\Tickets\\Commerce\\Gateways\\Abstract_Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Abstract_Gateway.php',
-            -
                'TEC\\Tickets\\Commerce\\Gateways\\Interface_Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Interface_Gateway.php',
                 'TEC\\Tickets\\Commerce\\Gateways\\Manager' => $baseDir . '/src/Tickets/Commerce/Gateways/Manager.php',
                 'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Assets' => $baseDir . '/src/Tickets/Commerce/Gateways/Manual/Assets.php',
                 'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Manual/Gateway.php',
@@ -63,6 +76,30 @@ return array(
                 'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Events' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php',
                 'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Handler' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php',
                 'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\WhoDat' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/WhoDat.php',
                 'TEC\\Tickets\\Commerce\\Hooks' => $baseDir . '/src/Tickets/Commerce/Hooks.php',
                 'TEC\\Tickets\\Commerce\\Legacy_Compat' => $baseDir . '/src/Tickets/Commerce/Legacy_Compat.php',
                 'TEC\\Tickets\\Commerce\\Models\\Attendee_Model' => $baseDir . '/src/Tickets/Commerce/Models/Attendee_Model.php',


9	'TEC\\Tickets\\Assets' => $baseDir . '/src/Tickets/Assets.php',
10	'TEC\\Tickets\\Commerce' => $baseDir . '/src/Tickets/Commerce.php',
11	'TEC\\Tickets\\Commerce\\Abstract_Order' => $baseDir . '/src/Tickets/Commerce/Abstract_Order.php',
12	+ 'TEC\\Tickets\\Commerce\\Admin\\Featured_Settings' => $baseDir . '/src/Tickets/Commerce/Admin/Featured_Settings.php',
13	'TEC\\Tickets\\Commerce\\Admin\\Notices' => $baseDir . '/src/Tickets/Commerce/Admin/Notices.php',
14	'TEC\\Tickets\\Commerce\\Admin_Tables\\Attendees' => $baseDir . '/src/Tickets/Commerce/Admin_Tables/Attendees.php',
15	'TEC\\Tickets\\Commerce\\Admin_Tables\\Orders' => $baseDir . '/src/Tickets/Commerce/Admin_Tables/Orders.php',

34	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Sales' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Increase_Sales.php',
35	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Stock' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Increase_Stock.php',
36	'TEC\\Tickets\\Commerce\\Flag_Actions\\Send_Email' => $baseDir . '/src/Tickets/Commerce/Flag_Actions/Send_Email.php',
37	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php',
38	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Merchant' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Merchant.php',
39	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_REST_Endpoint' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_REST_Endpoint.php',
40	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Requests' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Requests.php',
41	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Settings' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Settings.php',
42	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Signup' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Signup.php',
43	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Webhooks' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Webhooks.php',
44	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_WhoDat' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_WhoDat.php',
45	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Gateway_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Gateway_Interface.php',
46	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Merchant_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Merchant_Interface.php',
47	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\REST_Endpoint_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/REST_Endpoint_Interface.php',
48	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Requests_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Requests_Interface.php',
49	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Signup_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Signup_Interface.php',
50	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Webhook_Event_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/Webhook_Event_Interface.php',
51	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\WhoDat_Interface' => $baseDir . '/src/Tickets/Commerce/Gateways/Contracts/WhoDat_Interface.php',
52	'TEC\\Tickets\\Commerce\\Gateways\\Manager' => $baseDir . '/src/Tickets/Commerce/Gateways/Manager.php',
53	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Assets' => $baseDir . '/src/Tickets/Commerce/Gateways/Manual/Assets.php',
54	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Manual/Gateway.php',

76	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Events' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php',
77	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Handler' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php',
78	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\WhoDat' => $baseDir . '/src/Tickets/Commerce/Gateways/PayPal/WhoDat.php',
79	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Application_Fee' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Application_Fee.php',
80	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Assets' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Assets.php',
81	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Gateway' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Gateway.php',
82	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Hooks' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Hooks.php',
83	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Merchant' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Merchant.php',
84	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Payment_Intent' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php',
85	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Payment_Intent_Handler' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Payment_Intent_Handler.php',
86	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Provider' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Provider.php',
87	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/REST.php',
88	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Order_Endpoint' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php',
89	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Return_Endpoint' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/REST/Return_Endpoint.php',
90	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Webhook_Endpoint' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/REST/Webhook_Endpoint.php',
91	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Requests' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Requests.php',
92	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Settings' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Settings.php',
93	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Signup' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Signup.php',
94	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Status' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Status.php',
95	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Stripe_Elements' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Stripe_Elements.php',
96	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks.php',
97	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Account_Webhook' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Account_Webhook.php',
98	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Charge_Webhook' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Charge_Webhook.php',
99	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Events' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php',
100	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Handler' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php',
101	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Payment_Intent_Webhook' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php',
102	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\WhoDat' => $baseDir . '/src/Tickets/Commerce/Gateways/Stripe/WhoDat.php',
103	'TEC\\Tickets\\Commerce\\Hooks' => $baseDir . '/src/Tickets/Commerce/Hooks.php',
104	'TEC\\Tickets\\Commerce\\Legacy_Compat' => $baseDir . '/src/Tickets/Commerce/Legacy_Compat.php',
105	'TEC\\Tickets\\Commerce\\Models\\Attendee_Model' => $baseDir . '/src/Tickets/Commerce/Models/Attendee_Model.php',

vendor/composer/autoload_real.php CHANGED Viewed

	@@ -2,7 +2,7 @@
2
3	// autoload_real.php @generated by Composer
4
5	- class ~~ComposerAutoloaderInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~
6	{
7	private static $loader;
8
	@@ -19,15 +19,15 @@ class ComposerAutoloaderInit78d3c674fcbbeafb9fc2b9f6dcdd124c
19	return self::$loader;
20	}
21
22	- spl_autoload_register(array('~~ComposerAutoloaderInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~', 'loadClassLoader'), true, true);
23	self::$loader = $loader = new \Composer\Autoload\ClassLoader();
24	- spl_autoload_unregister(array('~~ComposerAutoloaderInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~', 'loadClassLoader'));
25
26	$useStaticLoader = PHP_VERSION_ID >= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') \|\| !zend_loader_file_encoded());
27	if ($useStaticLoader) {
28	require_once __DIR__ . '/autoload_static.php';
29
30	- call_user_func(\Composer\Autoload\~~ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~::getInitializer($loader));
31	} else {
32	$map = require __DIR__ . '/autoload_namespaces.php';
33	foreach ($map as $namespace => $path) {


2
3	// autoload_real.php @generated by Composer
4
5	+ class ComposerAutoloaderInit3debd0547f39ea13f347720ddc69ae0a
6	{
7	private static $loader;
8

19	return self::$loader;
20	}
21
22	+ spl_autoload_register(array('ComposerAutoloaderInit3debd0547f39ea13f347720ddc69ae0a', 'loadClassLoader'), true, true);
23	self::$loader = $loader = new \Composer\Autoload\ClassLoader();
24	+ spl_autoload_unregister(array('ComposerAutoloaderInit3debd0547f39ea13f347720ddc69ae0a', 'loadClassLoader'));
25
26	$useStaticLoader = PHP_VERSION_ID >= 50600 && !defined('HHVM_VERSION') && (!function_exists('zend_loader_file_encoded') \|\| !zend_loader_file_encoded());
27	if ($useStaticLoader) {
28	require_once __DIR__ . '/autoload_static.php';
29
30	+ call_user_func(\Composer\Autoload\ComposerStaticInit3debd0547f39ea13f347720ddc69ae0a::getInitializer($loader));
31	} else {
32	$map = require __DIR__ . '/autoload_namespaces.php';
33	foreach ($map as $namespace => $path) {

vendor/composer/autoload_static.php CHANGED Viewed

	@@ -4,7 +4,7 @@
4
5	namespace Composer\Autoload;
6
7	- class ~~ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~
8	{
9	public static $prefixLengthsPsr4 = array (
10	'T' =>
	@@ -29,7 +29,7 @@ class ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c
29	'TEC\\Tickets\\Assets' => __DIR__ . '/../..' . '/src/Tickets/Assets.php',
30	'TEC\\Tickets\\Commerce' => __DIR__ . '/../..' . '/src/Tickets/Commerce.php',
31	'TEC\\Tickets\\Commerce\\Abstract_Order' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Abstract_Order.php',
32	- 'TEC\\Tickets\\Commerce\\~~Abstract_Settings~~' => __DIR__ . '/../..' . '/src/Tickets/Commerce/~~Abstract_Settings~~.php',
33	'TEC\\Tickets\\Commerce\\Admin\\Notices' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin/Notices.php',
34	'TEC\\Tickets\\Commerce\\Admin_Tables\\Attendees' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin_Tables/Attendees.php',
35	'TEC\\Tickets\\Commerce\\Admin_Tables\\Orders' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin_Tables/Orders.php',
	@@ -54,8 +54,21 @@ class ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c
54	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Sales' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Increase_Sales.php',
55	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Stock' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Increase_Stock.php',
56	'TEC\\Tickets\\Commerce\\Flag_Actions\\Send_Email' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Send_Email.php',
57	- 'TEC\\Tickets\\Commerce\\Gateways\\Abstract_Gateway' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Abstract_Gateway.php',
58	- 'TEC\\Tickets\\Commerce\\Gateways\\~~Interface_Gateway~~' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/~~Interface_Gateway~~.php',













59	'TEC\\Tickets\\Commerce\\Gateways\\Manager' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manager.php',
60	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Assets' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manual/Assets.php',
61	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Gateway' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manual/Gateway.php',
	@@ -83,6 +96,30 @@ class ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c
83	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Events' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php',
84	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Handler' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php',
85	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\WhoDat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/WhoDat.php',
























86	'TEC\\Tickets\\Commerce\\Hooks' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Hooks.php',
87	'TEC\\Tickets\\Commerce\\Legacy_Compat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Legacy_Compat.php',
88	'TEC\\Tickets\\Commerce\\Models\\Attendee_Model' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Models/Attendee_Model.php',
	@@ -162,9 +199,9 @@ class ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c
162	public static function getInitializer(ClassLoader $loader)
163	{
164	return \Closure::bind(function () use ($loader) {
165	- $loader->prefixLengthsPsr4 = ~~ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~::$prefixLengthsPsr4;
166	- $loader->prefixDirsPsr4 = ~~ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~::$prefixDirsPsr4;
167	- $loader->classMap = ~~ComposerStaticInit78d3c674fcbbeafb9fc2b9f6dcdd124c~~::$classMap;
168
169	}, null, ClassLoader::class);
170	}


4
5	namespace Composer\Autoload;
6
7	+ class ComposerStaticInit3debd0547f39ea13f347720ddc69ae0a
8	{
9	public static $prefixLengthsPsr4 = array (
10	'T' =>

29	'TEC\\Tickets\\Assets' => __DIR__ . '/../..' . '/src/Tickets/Assets.php',
30	'TEC\\Tickets\\Commerce' => __DIR__ . '/../..' . '/src/Tickets/Commerce.php',
31	'TEC\\Tickets\\Commerce\\Abstract_Order' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Abstract_Order.php',
32	+ 'TEC\\Tickets\\Commerce\\Admin\\Featured_Settings' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin/Featured_Settings.php',
33	'TEC\\Tickets\\Commerce\\Admin\\Notices' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin/Notices.php',
34	'TEC\\Tickets\\Commerce\\Admin_Tables\\Attendees' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin_Tables/Attendees.php',
35	'TEC\\Tickets\\Commerce\\Admin_Tables\\Orders' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Admin_Tables/Orders.php',

54	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Sales' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Increase_Sales.php',
55	'TEC\\Tickets\\Commerce\\Flag_Actions\\Increase_Stock' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Increase_Stock.php',
56	'TEC\\Tickets\\Commerce\\Flag_Actions\\Send_Email' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Flag_Actions/Send_Email.php',
57	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Gateway' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Gateway.php',
58	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Merchant' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Merchant.php',
59	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_REST_Endpoint' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_REST_Endpoint.php',
60	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Requests' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Requests.php',
61	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Settings' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Settings.php',
62	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Signup' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Signup.php',
63	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_Webhooks' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_Webhooks.php',
64	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Abstract_WhoDat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Abstract_WhoDat.php',
65	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Gateway_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Gateway_Interface.php',
66	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Merchant_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Merchant_Interface.php',
67	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\REST_Endpoint_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/REST_Endpoint_Interface.php',
68	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Requests_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Requests_Interface.php',
69	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Signup_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Signup_Interface.php',
70	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\Webhook_Event_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/Webhook_Event_Interface.php',
71	+ 'TEC\\Tickets\\Commerce\\Gateways\\Contracts\\WhoDat_Interface' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Contracts/WhoDat_Interface.php',
72	'TEC\\Tickets\\Commerce\\Gateways\\Manager' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manager.php',
73	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Assets' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manual/Assets.php',
74	'TEC\\Tickets\\Commerce\\Gateways\\Manual\\Gateway' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Manual/Gateway.php',

96	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Events' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Events.php',
97	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\Webhooks\\Handler' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/Webhooks/Handler.php',
98	'TEC\\Tickets\\Commerce\\Gateways\\PayPal\\WhoDat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/PayPal/WhoDat.php',
99	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Application_Fee' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Application_Fee.php',
100	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Assets' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Assets.php',
101	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Gateway' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Gateway.php',
102	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Hooks' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Hooks.php',
103	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Merchant' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Merchant.php',
104	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Payment_Intent' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Payment_Intent.php',
105	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Payment_Intent_Handler' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Payment_Intent_Handler.php',
106	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Provider' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Provider.php',
107	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/REST.php',
108	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Order_Endpoint' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/REST/Order_Endpoint.php',
109	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Return_Endpoint' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/REST/Return_Endpoint.php',
110	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\REST\\Webhook_Endpoint' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/REST/Webhook_Endpoint.php',
111	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Requests' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Requests.php',
112	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Settings' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Settings.php',
113	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Signup' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Signup.php',
114	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Status' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Status.php',
115	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Stripe_Elements' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Stripe_Elements.php',
116	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks.php',
117	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Account_Webhook' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Account_Webhook.php',
118	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Charge_Webhook' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Charge_Webhook.php',
119	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Events' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Events.php',
120	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Handler' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Handler.php',
121	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\Webhooks\\Payment_Intent_Webhook' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/Webhooks/Payment_Intent_Webhook.php',
122	+ 'TEC\\Tickets\\Commerce\\Gateways\\Stripe\\WhoDat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Gateways/Stripe/WhoDat.php',
123	'TEC\\Tickets\\Commerce\\Hooks' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Hooks.php',
124	'TEC\\Tickets\\Commerce\\Legacy_Compat' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Legacy_Compat.php',
125	'TEC\\Tickets\\Commerce\\Models\\Attendee_Model' => __DIR__ . '/../..' . '/src/Tickets/Commerce/Models/Attendee_Model.php',

199	public static function getInitializer(ClassLoader $loader)
200	{
201	return \Closure::bind(function () use ($loader) {
202	+ $loader->prefixLengthsPsr4 = ComposerStaticInit3debd0547f39ea13f347720ddc69ae0a::$prefixLengthsPsr4;
203	+ $loader->prefixDirsPsr4 = ComposerStaticInit3debd0547f39ea13f347720ddc69ae0a::$prefixDirsPsr4;
204	+ $loader->classMap = ComposerStaticInit3debd0547f39ea13f347720ddc69ae0a::$classMap;
205
206	}, null, ClassLoader::class);
207	}