Version Description
Release Date - 2019-05-18
- Tested with WP 5.2 Plugin updated and supported.
- [Improvement] Prevent the related posts inside specific divs
Download this release
Release Info
| Developer | IntellyWP |
| Plugin |  Inline Related Posts |
| Version | 2.2.4 |
| Comparing to | |
| See all releases | |
Version 2.2.4
- assets/css/style.css +154 -0
- assets/deps/qtip/jquery.qtip.min.js +21 -0
- assets/deps/select2-3.5.2/select2-bootstrap.css +87 -0
- assets/deps/select2-3.5.2/select2-spinner.gif +0 -0
- assets/deps/select2-3.5.2/select2.css +704 -0
- assets/deps/select2-3.5.2/select2.js +3541 -0
- assets/deps/select2-3.5.2/select2.min.js +23 -0
- assets/deps/select2-3.5.2/select2.png +0 -0
- assets/deps/select2-3.5.2/select2_locale_ar.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_az.js +20 -0
- assets/deps/select2-3.5.2/select2_locale_bg.js +20 -0
- assets/deps/select2-3.5.2/select2_locale_ca.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_cs.js +51 -0
- assets/deps/select2-3.5.2/select2_locale_da.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_de.js +18 -0
- assets/deps/select2-3.5.2/select2_locale_el.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_en.js.template +20 -0
- assets/deps/select2-3.5.2/select2_locale_es.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_et.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_eu.js +45 -0
- assets/deps/select2-3.5.2/select2_locale_fa.js +21 -0
- assets/deps/select2-3.5.2/select2_locale_fi.js +30 -0
- assets/deps/select2-3.5.2/select2_locale_fr.js +18 -0
- assets/deps/select2-3.5.2/select2_locale_gl.js +45 -0
- assets/deps/select2-3.5.2/select2_locale_he.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_hr.js +24 -0
- assets/deps/select2-3.5.2/select2_locale_hu.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_id.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_is.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_it.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_ja.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_ka.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_ko.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_lt.js +26 -0
- assets/deps/select2-3.5.2/select2_locale_lv.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_mk.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_ms.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_nb.js +22 -0
- assets/deps/select2-3.5.2/select2_locale_nl.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_pl.js +54 -0
- assets/deps/select2-3.5.2/select2_locale_pt-BR.js +18 -0
- assets/deps/select2-3.5.2/select2_locale_pt-PT.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_ro.js +17 -0
- assets/deps/select2-3.5.2/select2_locale_rs.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_ru.js +23 -0
- assets/deps/select2-3.5.2/select2_locale_sk.js +50 -0
- assets/deps/select2-3.5.2/select2_locale_sv.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_th.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_tr.js +19 -0
- assets/deps/select2-3.5.2/select2_locale_ug-CN.js +16 -0
- assets/deps/select2-3.5.2/select2_locale_uk.js +25 -0
- assets/deps/select2-3.5.2/select2_locale_vi.js +20 -0
- assets/deps/select2-3.5.2/select2_locale_zh-CN.js +16 -0
- assets/deps/select2-3.5.2/select2_locale_zh-TW.js +16 -0
- assets/deps/select2-3.5.2/select2x2.png +0 -0
- assets/deps/starrr/starrr.js +123 -0
- assets/images/button.png +0 -0
- assets/images/email.png +0 -0
- assets/images/heart.png +0 -0
- assets/images/internet.png +0 -0
- assets/images/iwp.png +0 -0
- assets/images/next-arrow.png +0 -0
- assets/images/question-mark.png +0 -0
- assets/images/repeat.png +0 -0
- assets/images/select-all.png +0 -0
- assets/images/simple-arrow.png +0 -0
- assets/images/tick.png +0 -0
- assets/images/twitter.png +0 -0
- assets/js/button-mce.js +45 -0
- assets/js/common.js +174 -0
- assets/landing/img-whatsnew.001.jpg +0 -0
- assets/landing/img-whatsnew.002.jpg +0 -0
- assets/landing/img-whatsnew.003.jpg +0 -0
- assets/landing/mac-irl-wahtsnew.png +0 -0
- assets/templates/preview-button.jpg +0 -0
- assets/templates/preview-kangoo.jpg +0 -0
- assets/templates/preview-ruby.jpg +0 -0
- assets/templates/styles.html +198 -0
- autoload.php +48 -0
- includes/actions.php +67 -0
- includes/admin/about.php +27 -0
- includes/admin/button-mce.php +134 -0
- includes/admin/faq.php +17 -0
- includes/admin/feedback.php +44 -0
- includes/admin/metabox.php +70 -0
- includes/admin/settings.php +417 -0
- includes/admin/whatsnew.php +105 -0
- includes/classes/common/Stack.php +27 -0
- includes/classes/core/HtmlTemplate.php +297 -0
- includes/classes/core/Manager.php +100 -0
- includes/classes/core/Singleton.php +36 -0
- includes/classes/html/BehaviourTag.php +51 -0
- includes/classes/html/HTMLContext.php +564 -0
- includes/classes/html/HTMLTag.php +61 -0
- includes/classes/html/MainTag.php +27 -0
- includes/classes/html/NewLineText.php +18 -0
- includes/classes/html/OtherTag.php +12 -0
- includes/classes/html/SingletonTag.php +15 -0
- includes/classes/html/TextContent.php +53 -0
- includes/classes/ui/Check.php +107 -0
- includes/classes/ui/Form.php +455 -0
- includes/classes/ui/Tabs.php +185 -0
- includes/classes/utils/AppOptions.php +422 -0
- includes/classes/utils/Cron.php +85 -0
- includes/classes/utils/Language.php +121 -0
- includes/classes/utils/Logger.php +119 -0
- includes/classes/utils/Options.php +261 -0
- includes/classes/utils/Plugin.php +263 -0
- includes/classes/utils/Tracking.php +191 -0
- includes/classes/utils/Utils.php +599 -0
- includes/core.php +335 -0
- includes/install.php +29 -0
- includes/uninstall.php +7 -0
- index.php +55 -0
- languages/Lang.txt +170 -0
- readme.txt +210 -0
- screenshot-1.gif +0 -0
- screenshot-2.png +0 -0
- screenshot-3.png +0 -0
- screenshot-4.png +0 -0
- screenshot-5.png +0 -0
- screenshot-6.jpg +0 -0
- screenshot-7.png +0 -0
- screenshot-8.png +0 -0
- screenshot-9.png +0 -0
assets/css/style.css
ADDED
|
@@ -0,0 +1,154 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
._irp {
|
| 2 |
+
background-color: #efc439;
|
| 3 |
+
border-radius: 2px;
|
| 4 |
+
color: #fff;
|
| 5 |
+
display: inline-block;
|
| 6 |
+
font-size: 12px;
|
| 7 |
+
padding: 0 2px;
|
| 8 |
+
line-height: 14px;
|
| 9 |
+
vertical-align: baseline;
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
.irp-tag {
|
| 13 |
+
display: inline-block;
|
| 14 |
+
line-height: 13px;
|
| 15 |
+
padding: 0 3px;
|
| 16 |
+
color: white;
|
| 17 |
+
font-size: 10px;
|
| 18 |
+
font-weight: normal;
|
| 19 |
+
width:25px;
|
| 20 |
+
margin-top:3px;
|
| 21 |
+
margin-right:5px;
|
| 22 |
+
text-align:center;
|
| 23 |
+
-webkit-border-radius: 2px;
|
| 24 |
+
border-radius: 2px;
|
| 25 |
+
vertical-align: baseline;
|
| 26 |
+
}
|
| 27 |
+
.irp-tag-free {
|
| 28 |
+
/*background-color: #edb802;*/
|
| 29 |
+
background-color: #16a765;
|
| 30 |
+
}
|
| 31 |
+
.irp-tag-premium {
|
| 32 |
+
/*background-color: #edb802;*/
|
| 33 |
+
background-color: #4986e7;
|
| 34 |
+
opacity: 0.7;
|
| 35 |
+
filter: alpha(opacity=70);
|
| 36 |
+
}
|
| 37 |
+
.irp-tag-premium a {
|
| 38 |
+
color:white;
|
| 39 |
+
text-decoration:none;
|
| 40 |
+
}
|
| 41 |
+
.irp-button {
|
| 42 |
+
margin-right:5px!important;
|
| 43 |
+
}
|
| 44 |
+
|
| 45 |
+
.irp-textarea {
|
| 46 |
+
font-family:"Courier New", Courier, mono;
|
| 47 |
+
font-size:12px;
|
| 48 |
+
color:#555;
|
| 49 |
+
background-color:#f8f8f8;
|
| 50 |
+
width:550px;
|
| 51 |
+
height:350px;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
.irp-form {
|
| 55 |
+
float:left;
|
| 56 |
+
padding:5px;
|
| 57 |
+
}
|
| 58 |
+
.irp-form input, .irp-form label {
|
| 59 |
+
float:left;
|
| 60 |
+
}
|
| 61 |
+
.irp-text {
|
| 62 |
+
width: 400px;
|
| 63 |
+
}
|
| 64 |
+
.irp-label {
|
| 65 |
+
width: 200px;
|
| 66 |
+
margin: 0px;
|
| 67 |
+
background-color: transparent;
|
| 68 |
+
}
|
| 69 |
+
.irp-label-disabled {
|
| 70 |
+
/*color:#A8A8A8;*/
|
| 71 |
+
opacity: 0.7;
|
| 72 |
+
filter: alpha(opacity=70);
|
| 73 |
+
}
|
| 74 |
+
.irp-checkbox {
|
| 75 |
+
margin:0px;
|
| 76 |
+
}
|
| 77 |
+
.irp-checkbox:disabled {
|
| 78 |
+
background-color: #f8f8f8;
|
| 79 |
+
}
|
| 80 |
+
.irp-select {
|
| 81 |
+
|
| 82 |
+
}
|
| 83 |
+
.irp-form-newline {
|
| 84 |
+
clear:both;
|
| 85 |
+
margin-bottom:5px;
|
| 86 |
+
}
|
| 87 |
+
|
| 88 |
+
img.irp-help {
|
| 89 |
+
cursor: pointer;
|
| 90 |
+
float: left;
|
| 91 |
+
margin-right: 10px;
|
| 92 |
+
}
|
| 93 |
+
|
| 94 |
+
.irp-qtip {
|
| 95 |
+
font-size: 14px !important;
|
| 96 |
+
line-height: 18px !important;
|
| 97 |
+
}
|
| 98 |
+
|
| 99 |
+
i.mce-i-icon {
|
| 100 |
+
font: 400 20px/1 dashicons;
|
| 101 |
+
padding: 0;
|
| 102 |
+
vertical-align: top;
|
| 103 |
+
speak: none;
|
| 104 |
+
-webkit-font-smoothing: antialiased;
|
| 105 |
+
-moz-osx-font-smoothing: grayscale;
|
| 106 |
+
margin-left: -2px;
|
| 107 |
+
padding-right: 2px
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
i.irp-own-icon {
|
| 111 |
+
background-image: url('../images/repeat.png');
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
.irp-box-error {
|
| 115 |
+
background: #fff;
|
| 116 |
+
border-left: 4px solid #dd3d36;
|
| 117 |
+
margin: 5px 0 15px;
|
| 118 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 119 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 120 |
+
padding: 1px 12px;
|
| 121 |
+
}
|
| 122 |
+
.irp-box-warning {
|
| 123 |
+
background: #fff;
|
| 124 |
+
border-left: 4px solid #ffba00;
|
| 125 |
+
margin: 5px 0 15px;
|
| 126 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 127 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 128 |
+
padding: 1px 12px;
|
| 129 |
+
}
|
| 130 |
+
.irp-box-success {
|
| 131 |
+
background: #fff;
|
| 132 |
+
border-left: 4px solid #7ad03a;
|
| 133 |
+
margin: 5px 0 15px;
|
| 134 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 135 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 136 |
+
padding: 1px 12px;
|
| 137 |
+
}
|
| 138 |
+
.irp-box-info {
|
| 139 |
+
background: #fff;
|
| 140 |
+
border-left: 4px solid #00a0d2;
|
| 141 |
+
margin: 5px 0 15px;
|
| 142 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 143 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
| 144 |
+
padding: 1px 12px;
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
.select2-chosen .irpColorSelectItem {
|
| 148 |
+
padding-bottom:0px!important;
|
| 149 |
+
padding-top:0px!important;
|
| 150 |
+
}
|
| 151 |
+
.irpColorSelectItem {
|
| 152 |
+
padding: 5px;
|
| 153 |
+
width: 100%;
|
| 154 |
+
}
|
assets/deps/qtip/jquery.qtip.min.js
ADDED
|
@@ -0,0 +1,21 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* jquery.qtip. The jQuery tooltip plugin
|
| 3 |
+
*
|
| 4 |
+
* Copyright (c) 2009 Craig Thompson
|
| 5 |
+
* http://craigsworks.com
|
| 6 |
+
*
|
| 7 |
+
* Licensed under MIT
|
| 8 |
+
* http://www.opensource.org/licenses/mit-license.php
|
| 9 |
+
*
|
| 10 |
+
* Launch : February 2009
|
| 11 |
+
* Version : 1.0.0-rc3
|
| 12 |
+
* Released: Tuesday 12th May, 2009 - 00:00
|
| 13 |
+
* Debug: jquery.qtip.debug.js
|
| 14 |
+
*/
|
| 15 |
+
(function(f){f.fn.qtip=function(B,u){var y,t,A,s,x,w,v,z;if(typeof B=="string"){if(typeof f(this).data("qtip")!=="object"){f.fn.qtip.log.error.call(self,1,f.fn.qtip.constants.NO_TOOLTIP_PRESENT,false)}if(B=="api"){return f(this).data("qtip").interfaces[f(this).data("qtip").current]}else{if(B=="interfaces"){return f(this).data("qtip").interfaces}}}else{if(!B){B={}}if(typeof B.content!=="object"||(B.content.jquery&&B.content.length>0)){B.content={text:B.content}}if(typeof B.content.title!=="object"){B.content.title={text:B.content.title}}if(typeof B.position!=="object"){B.position={corner:B.position}}if(typeof B.position.corner!=="object"){B.position.corner={target:B.position.corner,tooltip:B.position.corner}}if(typeof B.show!=="object"){B.show={when:B.show}}if(typeof B.show.when!=="object"){B.show.when={event:B.show.when}}if(typeof B.show.effect!=="object"){B.show.effect={type:B.show.effect}}if(typeof B.hide!=="object"){B.hide={when:B.hide}}if(typeof B.hide.when!=="object"){B.hide.when={event:B.hide.when}}if(typeof B.hide.effect!=="object"){B.hide.effect={type:B.hide.effect}}if(typeof B.style!=="object"){B.style={name:B.style}}B.style=c(B.style);s=f.extend(true,{},f.fn.qtip.defaults,B);s.style=a.call({options:s},s.style);s.user=f.extend(true,{},B)}return f(this).each(function(){if(typeof B=="string"){w=B.toLowerCase();A=f(this).qtip("interfaces");if(typeof A=="object"){if(u===true&&w=="destroy"){while(A.length>0){A[A.length-1].destroy()}}else{if(u!==true){A=[f(this).qtip("api")]}for(y=0;y<A.length;y++){if(w=="destroy"){A[y].destroy()}else{if(A[y].status.rendered===true){if(w=="show"){A[y].show()}else{if(w=="hide"){A[y].hide()}else{if(w=="focus"){A[y].focus()}else{if(w=="disable"){A[y].disable(true)}else{if(w=="enable"){A[y].disable(false)}}}}}}}}}}}else{v=f.extend(true,{},s);v.hide.effect.length=s.hide.effect.length;v.show.effect.length=s.show.effect.length;if(v.position.container===false){v.position.container=f(document.body)}if(v.position.target===false){v.position.target=f(this)}if(v.show.when.target===false){v.show.when.target=f(this)}if(v.hide.when.target===false){v.hide.when.target=f(this)}t=f.fn.qtip.interfaces.length;for(y=0;y<t;y++){if(typeof f.fn.qtip.interfaces[y]=="undefined"){t=y;break}}x=new d(f(this),v,t);f.fn.qtip.interfaces[t]=x;if(typeof f(this).data("qtip")=="object"){if(typeof f(this).attr("qtip")==="undefined"){f(this).data("qtip").current=f(this).data("qtip").interfaces.length}f(this).data("qtip").interfaces.push(x)}else{f(this).data("qtip",{current:0,interfaces:[x]})}if(v.content.prerender===false&&v.show.when.event!==false&&v.show.ready!==true){v.show.when.target.bind(v.show.when.event+".qtip-"+t+"-create",{qtip:t},function(C){z=f.fn.qtip.interfaces[C.data.qtip];z.options.show.when.target.unbind(z.options.show.when.event+".qtip-"+C.data.qtip+"-create");z.cache.mouse={x:C.pageX,y:C.pageY};p.call(z);z.options.show.when.target.trigger(z.options.show.when.event)})}else{x.cache.mouse={x:v.show.when.target.offset().left,y:v.show.when.target.offset().top};p.call(x)}}})};function d(u,t,v){var s=this;s.id=v;s.options=t;s.status={animated:false,rendered:false,disabled:false,focused:false};s.elements={target:u.addClass(s.options.style.classes.target),tooltip:null,wrapper:null,content:null,contentWrapper:null,title:null,button:null,tip:null,bgiframe:null};s.cache={mouse:{},position:{},toggle:0};s.timers={};f.extend(s,s.options.api,{show:function(y){var x,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"show")}if(s.elements.tooltip.css("display")!=="none"){return s}s.elements.tooltip.stop(true,false);x=s.beforeShow.call(s,y);if(x===false){return s}function w(){if(s.options.position.type!=="static"){s.focus()}s.onShow.call(s,y);if(f.browser.msie){s.elements.tooltip.get(0).style.removeAttribute("filter")}}s.cache.toggle=1;if(s.options.position.type!=="static"){s.updatePosition(y,(s.options.show.effect.length>0))}if(typeof s.options.show.solo=="object"){z=f(s.options.show.solo)}else{if(s.options.show.solo===true){z=f("div.qtip").not(s.elements.tooltip)}}if(z){z.each(function(){if(f(this).qtip("api").status.rendered===true){f(this).qtip("api").hide()}})}if(typeof s.options.show.effect.type=="function"){s.options.show.effect.type.call(s.elements.tooltip,s.options.show.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.show.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeIn(s.options.show.effect.length,w);break;case"slide":s.elements.tooltip.slideDown(s.options.show.effect.length,function(){w();if(s.options.position.type!=="static"){s.updatePosition(y,true)}});break;case"grow":s.elements.tooltip.show(s.options.show.effect.length,w);break;default:s.elements.tooltip.show(null,w);break}s.elements.tooltip.addClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_SHOWN,"show")},hide:function(y){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"hide")}else{if(s.elements.tooltip.css("display")==="none"){return s}}clearTimeout(s.timers.show);s.elements.tooltip.stop(true,false);x=s.beforeHide.call(s,y);if(x===false){return s}function w(){s.onHide.call(s,y)}s.cache.toggle=0;if(typeof s.options.hide.effect.type=="function"){s.options.hide.effect.type.call(s.elements.tooltip,s.options.hide.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.hide.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeOut(s.options.hide.effect.length,w);break;case"slide":s.elements.tooltip.slideUp(s.options.hide.effect.length,w);break;case"grow":s.elements.tooltip.hide(s.options.hide.effect.length,w);break;default:s.elements.tooltip.hide(null,w);break}s.elements.tooltip.removeClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_HIDDEN,"hide")},updatePosition:function(w,x){var C,G,L,J,H,E,y,I,B,D,K,A,F,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updatePosition")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_POSITION_STATIC,"updatePosition")}}G={position:{left:0,top:0},dimensions:{height:0,width:0},corner:s.options.position.corner.target};L={position:s.getPosition(),dimensions:s.getDimensions(),corner:s.options.position.corner.tooltip};if(s.options.position.target!=="mouse"){if(s.options.position.target.get(0).nodeName.toLowerCase()=="area"){J=s.options.position.target.attr("coords").split(",");for(C=0;C<J.length;C++){J[C]=parseInt(J[C])}H=s.options.position.target.parent("map").attr("name");E=f('img[usemap="#'+H+'"]:first').offset();G.position={left:Math.floor(E.left+J[0]),top:Math.floor(E.top+J[1])};switch(s.options.position.target.attr("shape").toLowerCase()){case"rect":G.dimensions={width:Math.ceil(Math.abs(J[2]-J[0])),height:Math.ceil(Math.abs(J[3]-J[1]))};break;case"circle":G.dimensions={width:J[2]+1,height:J[2]+1};break;case"poly":G.dimensions={width:J[0],height:J[1]};for(C=0;C<J.length;C++){if(C%2==0){if(J[C]>G.dimensions.width){G.dimensions.width=J[C]}if(J[C]<J[0]){G.position.left=Math.floor(E.left+J[C])}}else{if(J[C]>G.dimensions.height){G.dimensions.height=J[C]}if(J[C]<J[1]){G.position.top=Math.floor(E.top+J[C])}}}G.dimensions.width=G.dimensions.width-(G.position.left-E.left);G.dimensions.height=G.dimensions.height-(G.position.top-E.top);break;default:return f.fn.qtip.log.error.call(s,4,f.fn.qtip.constants.INVALID_AREA_SHAPE,"updatePosition");break}G.dimensions.width-=2;G.dimensions.height-=2}else{if(s.options.position.target.add(document.body).length===1){G.position={left:f(document).scrollLeft(),top:f(document).scrollTop()};G.dimensions={height:f(window).height(),width:f(window).width()}}else{if(typeof s.options.position.target.attr("qtip")!=="undefined"){G.position=s.options.position.target.qtip("api").cache.position}else{G.position=s.options.position.target.offset()}G.dimensions={height:s.options.position.target.outerHeight(),width:s.options.position.target.outerWidth()}}}y=f.extend({},G.position);if(G.corner.search(/right/i)!==-1){y.left+=G.dimensions.width}if(G.corner.search(/bottom/i)!==-1){y.top+=G.dimensions.height}if(G.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left+=(G.dimensions.width/2)}if(G.corner.search(/((left|right)Middle)|center/)!==-1){y.top+=(G.dimensions.height/2)}}else{G.position=y={left:s.cache.mouse.x,top:s.cache.mouse.y};G.dimensions={height:1,width:1}}if(L.corner.search(/right/i)!==-1){y.left-=L.dimensions.width}if(L.corner.search(/bottom/i)!==-1){y.top-=L.dimensions.height}if(L.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left-=(L.dimensions.width/2)}if(L.corner.search(/((left|right)Middle)|center/)!==-1){y.top-=(L.dimensions.height/2)}I=(f.browser.msie)?1:0;B=(f.browser.msie&&parseInt(f.browser.version.charAt(0))===6)?1:0;if(s.options.style.border.radius>0){if(L.corner.search(/Left/)!==-1){y.left-=s.options.style.border.radius}else{if(L.corner.search(/Right/)!==-1){y.left+=s.options.style.border.radius}}if(L.corner.search(/Top/)!==-1){y.top-=s.options.style.border.radius}else{if(L.corner.search(/Bottom/)!==-1){y.top+=s.options.style.border.radius}}}if(I){if(L.corner.search(/top/)!==-1){y.top-=I}else{if(L.corner.search(/bottom/)!==-1){y.top+=I}}if(L.corner.search(/left/)!==-1){y.left-=I}else{if(L.corner.search(/right/)!==-1){y.left+=I}}if(L.corner.search(/leftMiddle|rightMiddle/)!==-1){y.top-=1}}if(s.options.position.adjust.screen===true){y=o.call(s,y,G,L)}if(s.options.position.target==="mouse"&&s.options.position.adjust.mouse===true){if(s.options.position.adjust.screen===true&&s.elements.tip){K=s.elements.tip.attr("rel")}else{K=s.options.position.corner.tooltip}y.left+=(K.search(/right/i)!==-1)?-6:6;y.top+=(K.search(/bottom/i)!==-1)?-6:6}if(!s.elements.bgiframe&&f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){f("select, object").each(function(){A=f(this).offset();A.bottom=A.top+f(this).height();A.right=A.left+f(this).width();if(y.top+L.dimensions.height>=A.top&&y.left+L.dimensions.width>=A.left){k.call(s)}})}y.left+=s.options.position.adjust.x;y.top+=s.options.position.adjust.y;F=s.getPosition();if(y.left!=F.left||y.top!=F.top){z=s.beforePositionUpdate.call(s,w);if(z===false){return s}s.cache.position=y;if(x===true){s.status.animated=true;s.elements.tooltip.animate(y,200,"swing",function(){s.status.animated=false})}else{s.elements.tooltip.css(y)}s.onPositionUpdate.call(s,w);if(typeof w!=="undefined"&&w.type&&w.type!=="mousemove"){f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_POSITION_UPDATED,"updatePosition")}}return s},updateWidth:function(w){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateWidth")}else{if(w&&typeof w!=="number"){return f.fn.qtip.log.error.call(s,2,"newWidth must be of type number","updateWidth")}}x=s.elements.contentWrapper.siblings().add(s.elements.tip).add(s.elements.button);if(!w){if(typeof s.options.style.width.value=="number"){w=s.options.style.width.value}else{s.elements.tooltip.css({width:"auto"});x.hide();if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"normal"})}w=s.getDimensions().width+1;if(!s.options.style.width.value){if(w>s.options.style.width.max){w=s.options.style.width.max}if(w<s.options.style.width.min){w=s.options.style.width.min}}}}if(w%2!==0){w-=1}s.elements.tooltip.width(w);x.show();if(s.options.style.border.radius){s.elements.tooltip.find(".qtip-betweenCorners").each(function(y){f(this).width(w-(s.options.style.border.radius*2))})}if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"1"});s.elements.wrapper.width(w);if(s.elements.bgiframe){s.elements.bgiframe.width(w).height(s.getDimensions.height)}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_WIDTH_UPDATED,"updateWidth")},updateStyle:function(w){var z,A,x,y,B;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateStyle")}else{if(typeof w!=="string"||!f.fn.qtip.styles[w]){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.STYLE_NOT_DEFINED,"updateStyle")}}s.options.style=a.call(s,f.fn.qtip.styles[w],s.options.user.style);s.elements.content.css(q(s.options.style));if(s.options.content.title.text!==false){s.elements.title.css(q(s.options.style.title,true))}s.elements.contentWrapper.css({borderColor:s.options.style.border.color});if(s.options.style.tip.corner!==false){if(f("<canvas>").get(0).getContext){z=s.elements.tooltip.find(".qtip-tip canvas:first");x=z.get(0).getContext("2d");x.clearRect(0,0,300,300);y=z.parent("div[rel]:first").attr("rel");B=b(y,s.options.style.tip.size.width,s.options.style.tip.size.height);h.call(s,z,B,s.options.style.tip.color||s.options.style.border.color)}else{if(f.browser.msie){z=s.elements.tooltip.find('.qtip-tip [nodeName="shape"]');z.attr("fillcolor",s.options.style.tip.color||s.options.style.border.color)}}}if(s.options.style.border.radius>0){s.elements.tooltip.find(".qtip-betweenCorners").css({backgroundColor:s.options.style.border.color});if(f("<canvas>").get(0).getContext){A=g(s.options.style.border.radius);s.elements.tooltip.find(".qtip-wrapper canvas").each(function(){x=f(this).get(0).getContext("2d");x.clearRect(0,0,300,300);y=f(this).parent("div[rel]:first").attr("rel");r.call(s,f(this),A[y],s.options.style.border.radius,s.options.style.border.color)})}else{if(f.browser.msie){s.elements.tooltip.find('.qtip-wrapper [nodeName="arc"]').each(function(){f(this).attr("fillcolor",s.options.style.border.color)})}}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_STYLE_UPDATED,"updateStyle")},updateContent:function(A,y){var z,x,w;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateContent")}else{if(!A){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateContent")}}z=s.beforeContentUpdate.call(s,A);if(typeof z=="string"){A=z}else{if(z===false){return}}if(f.browser.msie){s.elements.contentWrapper.children().css({zoom:"normal"})}if(A.jquery&&A.length>0){A.clone(true).appendTo(s.elements.content).show()}else{s.elements.content.html(A)}x=s.elements.content.find("img[complete=false]");if(x.length>0){w=0;x.each(function(C){f('<img src="'+f(this).attr("src")+'" />').load(function(){if(++w==x.length){B()}})})}else{B()}function B(){s.updateWidth();if(y!==false){if(s.options.position.type!=="static"){s.updatePosition(s.elements.tooltip.is(":visible"),true)}if(s.options.style.tip.corner!==false){n.call(s)}}}s.onContentUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_UPDATED,"loadContent")},loadContent:function(w,z,A){var y;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"loadContent")}y=s.beforeContentLoad.call(s);if(y===false){return s}if(A=="post"){f.post(w,z,x)}else{f.get(w,z,x)}function x(B){s.onContentLoad.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_LOADED,"loadContent");s.updateContent(B)}return s},updateTitle:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateTitle")}else{if(!w){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateTitle")}}returned=s.beforeTitleUpdate.call(s);if(returned===false){return s}if(s.elements.button){s.elements.button=s.elements.button.clone(true)}s.elements.title.html(w);if(s.elements.button){s.elements.title.prepend(s.elements.button)}s.onTitleUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_TITLE_UPDATED,"updateTitle")},focus:function(A){var y,x,w,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"focus")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_FOCUS_STATIC,"focus")}}y=parseInt(s.elements.tooltip.css("z-index"));x=6000+f("div.qtip[qtip]").length-1;if(!s.status.focused&&y!==x){z=s.beforeFocus.call(s,A);if(z===false){return s}f("div.qtip[qtip]").not(s.elements.tooltip).each(function(){if(f(this).qtip("api").status.rendered===true){w=parseInt(f(this).css("z-index"));if(typeof w=="number"&&w>-1){f(this).css({zIndex:parseInt(f(this).css("z-index"))-1})}f(this).qtip("api").status.focused=false}});s.elements.tooltip.css({zIndex:x});s.status.focused=true;s.onFocus.call(s,A);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_FOCUSED,"focus")}return s},disable:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"disable")}if(w){if(!s.status.disabled){s.status.disabled=true;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DISABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_DISABLED,"disable")}}else{if(s.status.disabled){s.status.disabled=false;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_ENABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_ENABLED,"disable")}}return s},destroy:function(){var w,x,y;x=s.beforeDestroy.call(s);if(x===false){return s}if(s.status.rendered){s.options.show.when.target.unbind("mousemove.qtip",s.updatePosition);s.options.show.when.target.unbind("mouseout.qtip",s.hide);s.options.show.when.target.unbind(s.options.show.when.event+".qtip");s.options.hide.when.target.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind("mouseover.qtip",s.focus);s.elements.tooltip.remove()}else{s.options.show.when.target.unbind(s.options.show.when.event+".qtip-create")}if(typeof s.elements.target.data("qtip")=="object"){y=s.elements.target.data("qtip").interfaces;if(typeof y=="object"&&y.length>0){for(w=0;w<y.length-1;w++){if(y[w].id==s.id){y.splice(w,1)}}}}delete f.fn.qtip.interfaces[s.id];if(typeof y=="object"&&y.length>0){s.elements.target.data("qtip").current=y.length-1}else{s.elements.target.removeData("qtip")}s.onDestroy.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DESTROYED,"destroy");return s.elements.target},getPosition:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getPosition")}w=(s.elements.tooltip.css("display")!=="none")?false:true;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x=s.elements.tooltip.offset();if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x},getDimensions:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getDimensions")}w=(!s.elements.tooltip.is(":visible"))?true:false;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x={height:s.elements.tooltip.outerHeight(),width:s.elements.tooltip.outerWidth()};if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x}})}function p(){var s,w,u,t,v,y,x;s=this;s.beforeRender.call(s);s.status.rendered=true;s.elements.tooltip='<div qtip="'+s.id+'" class="qtip '+(s.options.style.classes.tooltip||s.options.style)+'"style="display:none; -moz-border-radius:0; -webkit-border-radius:0; border-radius:0;position:'+s.options.position.type+';"> <div class="qtip-wrapper" style="position:relative; overflow:hidden; text-align:left;"> <div class="qtip-contentWrapper" style="overflow:hidden;"> <div class="qtip-content '+s.options.style.classes.content+'"></div></div></div></div>';s.elements.tooltip=f(s.elements.tooltip);s.elements.tooltip.appendTo(s.options.position.container);s.elements.tooltip.data("qtip",{current:0,interfaces:[s]});s.elements.wrapper=s.elements.tooltip.children("div:first");s.elements.contentWrapper=s.elements.wrapper.children("div:first").css({background:s.options.style.background});s.elements.content=s.elements.contentWrapper.children("div:first").css(q(s.options.style));if(f.browser.msie){s.elements.wrapper.add(s.elements.content).css({zoom:1})}if(s.options.hide.when.event=="unfocus"){s.elements.tooltip.attr("unfocus",true)}if(typeof s.options.style.width.value=="number"){s.updateWidth()}if(f("<canvas>").get(0).getContext||f.browser.msie){if(s.options.style.border.radius>0){m.call(s)}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color})}if(s.options.style.tip.corner!==false){e.call(s)}}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color});s.options.style.border.radius=0;s.options.style.tip.corner=false;f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.CANVAS_VML_NOT_SUPPORTED,"render")}if((typeof s.options.content.text=="string"&&s.options.content.text.length>0)||(s.options.content.text.jquery&&s.options.content.text.length>0)){u=s.options.content.text}else{if(typeof s.elements.target.attr("title")=="string"&&s.elements.target.attr("title").length>0){u=s.elements.target.attr("title").replace("\\n","<br />");s.elements.target.attr("title","")}else{if(typeof s.elements.target.attr("alt")=="string"&&s.elements.target.attr("alt").length>0){u=s.elements.target.attr("alt").replace("\\n","<br />");s.elements.target.attr("alt","")}else{u=" ";f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.NO_VALID_CONTENT,"render")}}}if(s.options.content.title.text!==false){j.call(s)}s.updateContent(u);l.call(s);if(s.options.show.ready===true){s.show()}if(s.options.content.url!==false){t=s.options.content.url;v=s.options.content.data;y=s.options.content.method||"get";s.loadContent(t,v,y)}s.onRender.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_RENDERED,"render")}function m(){var F,z,t,B,x,E,u,G,D,y,w,C,A,s,v;F=this;F.elements.wrapper.find(".qtip-borderBottom, .qtip-borderTop").remove();t=F.options.style.border.width;B=F.options.style.border.radius;x=F.options.style.border.color||F.options.style.tip.color;E=g(B);u={};for(z in E){u[z]='<div rel="'+z+'" style="'+((z.search(/Left/)!==-1)?"left":"right")+":0; position:absolute; height:"+B+"px; width:"+B+'px; overflow:hidden; line-height:0.1px; font-size:1px">';if(f("<canvas>").get(0).getContext){u[z]+='<canvas height="'+B+'" width="'+B+'" style="vertical-align: top"></canvas>'}else{if(f.browser.msie){G=B*2+3;u[z]+='<v:arc stroked="false" fillcolor="'+x+'" startangle="'+E[z][0]+'" endangle="'+E[z][1]+'" style="width:'+G+"px; height:"+G+"px; margin-top:"+((z.search(/bottom/)!==-1)?-2:-1)+"px; margin-left:"+((z.search(/Right/)!==-1)?E[z][2]-3.5:-1)+'px; vertical-align:top; display:inline-block; behavior:url(#default#VML)"></v:arc>'}}u[z]+="</div>"}D=F.getDimensions().width-(Math.max(t,B)*2);y='<div class="qtip-betweenCorners" style="height:'+B+"px; width:"+D+"px; overflow:hidden; background-color:"+x+'; line-height:0.1px; font-size:1px;">';w='<div class="qtip-borderTop" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.topLeft+u.topRight+y;F.elements.wrapper.prepend(w);C='<div class="qtip-borderBottom" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.bottomLeft+u.bottomRight+y;F.elements.wrapper.append(C);if(f("<canvas>").get(0).getContext){F.elements.wrapper.find("canvas").each(function(){A=E[f(this).parent("[rel]:first").attr("rel")];r.call(F,f(this),A,B,x)})}else{if(f.browser.msie){F.elements.tooltip.append('<v:image style="behavior:url(#default#VML);"></v:image>')}}s=Math.max(B,(B+(t-B)));v=Math.max(t-B,0);F.elements.contentWrapper.css({border:"0px solid "+x,borderWidth:v+"px "+s+"px"})}function r(u,w,s,t){var v=u.get(0).getContext("2d");v.fillStyle=t;v.beginPath();v.arc(w[0],w[1],s,0,Math.PI*2,false);v.fill()}function e(v){var t,s,x,u,w;t=this;if(t.elements.tip!==null){t.elements.tip.remove()}s=t.options.style.tip.color||t.options.style.border.color;if(t.options.style.tip.corner===false){return}else{if(!v){v=t.options.style.tip.corner}}x=b(v,t.options.style.tip.size.width,t.options.style.tip.size.height);t.elements.tip='<div class="'+t.options.style.classes.tip+'" dir="ltr" rel="'+v+'" style="position:absolute; height:'+t.options.style.tip.size.height+"px; width:"+t.options.style.tip.size.width+'px; margin:0 auto; line-height:0.1px; font-size:1px;">';if(f("<canvas>").get(0).getContext){t.elements.tip+='<canvas height="'+t.options.style.tip.size.height+'" width="'+t.options.style.tip.size.width+'"></canvas>'}else{if(f.browser.msie){u=t.options.style.tip.size.width+","+t.options.style.tip.size.height;w="m"+x[0][0]+","+x[0][1];w+=" l"+x[1][0]+","+x[1][1];w+=" "+x[2][0]+","+x[2][1];w+=" xe";t.elements.tip+='<v:shape fillcolor="'+s+'" stroked="false" filled="true" path="'+w+'" coordsize="'+u+'" style="width:'+t.options.style.tip.size.width+"px; height:"+t.options.style.tip.size.height+"px; line-height:0.1px; display:inline-block; behavior:url(#default#VML); vertical-align:"+((v.search(/top/)!==-1)?"bottom":"top")+'"></v:shape>';t.elements.tip+='<v:image style="behavior:url(#default#VML);"></v:image>';t.elements.contentWrapper.css("position","relative")}}t.elements.tooltip.prepend(t.elements.tip+"</div>");t.elements.tip=t.elements.tooltip.find("."+t.options.style.classes.tip).eq(0);if(f("<canvas>").get(0).getContext){h.call(t,t.elements.tip.find("canvas:first"),x,s)}if(v.search(/top/)!==-1&&f.browser.msie&&parseInt(f.browser.version.charAt(0))===6){t.elements.tip.css({marginTop:-4})}n.call(t,v)}function h(t,v,s){var u=t.get(0).getContext("2d");u.fillStyle=s;u.beginPath();u.moveTo(v[0][0],v[0][1]);u.lineTo(v[1][0],v[1][1]);u.lineTo(v[2][0],v[2][1]);u.fill()}function n(u){var t,w,s,x,v;t=this;if(t.options.style.tip.corner===false||!t.elements.tip){return}if(!u){u=t.elements.tip.attr("rel")}w=positionAdjust=(f.browser.msie)?1:0;t.elements.tip.css(u.match(/left|right|top|bottom/)[0],0);if(u.search(/top|bottom/)!==-1){if(f.browser.msie){if(parseInt(f.browser.version.charAt(0))===6){positionAdjust=(u.search(/top/)!==-1)?-3:1}else{positionAdjust=(u.search(/top/)!==-1)?1:2}}if(u.search(/Middle/)!==-1){t.elements.tip.css({left:"50%",marginLeft:-(t.options.style.tip.size.width/2)})}else{if(u.search(/Left/)!==-1){t.elements.tip.css({left:t.options.style.border.radius-w})}else{if(u.search(/Right/)!==-1){t.elements.tip.css({right:t.options.style.border.radius+w})}}}if(u.search(/top/)!==-1){t.elements.tip.css({top:-positionAdjust})}else{t.elements.tip.css({bottom:positionAdjust})}}else{if(u.search(/left|right/)!==-1){if(f.browser.msie){positionAdjust=(parseInt(f.browser.version.charAt(0))===6)?1:((u.search(/left/)!==-1)?1:2)}if(u.search(/Middle/)!==-1){t.elements.tip.css({top:"50%",marginTop:-(t.options.style.tip.size.height/2)})}else{if(u.search(/Top/)!==-1){t.elements.tip.css({top:t.options.style.border.radius-w})}else{if(u.search(/Bottom/)!==-1){t.elements.tip.css({bottom:t.options.style.border.radius+w})}}}if(u.search(/left/)!==-1){t.elements.tip.css({left:-positionAdjust})}else{t.elements.tip.css({right:positionAdjust})}}}s="padding-"+u.match(/left|right|top|bottom/)[0];x=t.options.style.tip.size[(s.search(/left|right/)!==-1)?"width":"height"];t.elements.tooltip.css("padding",0);t.elements.tooltip.css(s,x);if(f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){v=parseInt(t.elements.tip.css("margin-top"))||0;v+=parseInt(t.elements.content.css("margin-top"))||0;t.elements.tip.css({marginTop:v})}}function j(){var s=this;if(s.elements.title!==null){s.elements.title.remove()}s.elements.title=f('<div class="'+s.options.style.classes.title+'">').css(q(s.options.style.title,true)).css({zoom:(f.browser.msie)?1:0}).prependTo(s.elements.contentWrapper);if(s.options.content.title.text){s.updateTitle.call(s,s.options.content.title.text)}if(s.options.content.title.button!==false&&typeof s.options.content.title.button=="string"){s.elements.button=f('<a class="'+s.options.style.classes.button+'" style="float:right; position: relative"></a>').css(q(s.options.style.button,true)).html(s.options.content.title.button).prependTo(s.elements.title).click(function(t){if(!s.status.disabled){s.hide(t)}})}}function l(){var t,v,u,s;t=this;v=t.options.show.when.target;u=t.options.hide.when.target;if(t.options.hide.fixed){u=u.add(t.elements.tooltip)}if(t.options.hide.when.event=="inactive"){s=["click","dblclick","mousedown","mouseup","mousemove","mouseout","mouseenter","mouseleave","mouseover"];function y(z){if(t.status.disabled===true){return}clearTimeout(t.timers.inactive);t.timers.inactive=setTimeout(function(){f(s).each(function(){u.unbind(this+".qtip-inactive");t.elements.content.unbind(this+".qtip-inactive")});t.hide(z)},t.options.hide.delay)}}else{if(t.options.hide.fixed===true){t.elements.tooltip.bind("mouseover.qtip",function(){if(t.status.disabled===true){return}clearTimeout(t.timers.hide)})}}function x(z){if(t.status.disabled===true){return}if(t.options.hide.when.event=="inactive"){f(s).each(function(){u.bind(this+".qtip-inactive",y);t.elements.content.bind(this+".qtip-inactive",y)});y()}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.timers.show=setTimeout(function(){t.show(z)},t.options.show.delay)}function w(z){if(t.status.disabled===true){return}if(t.options.hide.fixed===true&&t.options.hide.when.event.search(/mouse(out|leave)/i)!==-1&&f(z.relatedTarget).parents("div.qtip[qtip]").length>0){z.stopPropagation();z.preventDefault();clearTimeout(t.timers.hide);return false}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.elements.tooltip.stop(true,true);t.timers.hide=setTimeout(function(){t.hide(z)},t.options.hide.delay)}if((t.options.show.when.target.add(t.options.hide.when.target).length===1&&t.options.show.when.event==t.options.hide.when.event&&t.options.hide.when.event!=="inactive")||t.options.hide.when.event=="unfocus"){t.cache.toggle=0;v.bind(t.options.show.when.event+".qtip",function(z){if(t.cache.toggle==0){x(z)}else{w(z)}})}else{v.bind(t.options.show.when.event+".qtip",x);if(t.options.hide.when.event!=="inactive"){u.bind(t.options.hide.when.event+".qtip",w)}}if(t.options.position.type.search(/(fixed|absolute)/)!==-1){t.elements.tooltip.bind("mouseover.qtip",t.focus)}if(t.options.position.target==="mouse"&&t.options.position.type!=="static"){v.bind("mousemove.qtip",function(z){t.cache.mouse={x:z.pageX,y:z.pageY};if(t.status.disabled===false&&t.options.position.adjust.mouse===true&&t.options.position.type!=="static"&&t.elements.tooltip.css("display")!=="none"){t.updatePosition(z)}})}}function o(u,v,A){var z,s,x,y,t,w;z=this;if(A.corner=="center"){return v.position}s=f.extend({},u);y={x:false,y:false};t={left:(s.left<f.fn.qtip.cache.screen.scroll.left),right:(s.left+A.dimensions.width+2>=f.fn.qtip.cache.screen.width+f.fn.qtip.cache.screen.scroll.left),top:(s.top<f.fn.qtip.cache.screen.scroll.top),bottom:(s.top+A.dimensions.height+2>=f.fn.qtip.cache.screen.height+f.fn.qtip.cache.screen.scroll.top)};x={left:(t.left&&(A.corner.search(/right/i)!=-1||(A.corner.search(/right/i)==-1&&!t.right))),right:(t.right&&(A.corner.search(/left/i)!=-1||(A.corner.search(/left/i)==-1&&!t.left))),top:(t.top&&A.corner.search(/top/i)==-1),bottom:(t.bottom&&A.corner.search(/bottom/i)==-1)};if(x.left){if(z.options.position.target!=="mouse"){s.left=v.position.left+v.dimensions.width}else{s.left=z.cache.mouse.x}y.x="Left"}else{if(x.right){if(z.options.position.target!=="mouse"){s.left=v.position.left-A.dimensions.width}else{s.left=z.cache.mouse.x-A.dimensions.width}y.x="Right"}}if(x.top){if(z.options.position.target!=="mouse"){s.top=v.position.top+v.dimensions.height}else{s.top=z.cache.mouse.y}y.y="top"}else{if(x.bottom){if(z.options.position.target!=="mouse"){s.top=v.position.top-A.dimensions.height}else{s.top=z.cache.mouse.y-A.dimensions.height}y.y="bottom"}}if(s.left<0){s.left=u.left;y.x=false}if(s.top<0){s.top=u.top;y.y=false}if(z.options.style.tip.corner!==false){s.corner=new String(A.corner);if(y.x!==false){s.corner=s.corner.replace(/Left|Right|Middle/,y.x)}if(y.y!==false){s.corner=s.corner.replace(/top|bottom/,y.y)}if(s.corner!==z.elements.tip.attr("rel")){e.call(z,s.corner)}}return s}function q(u,t){var v,s;v=f.extend(true,{},u);for(s in v){if(t===true&&s.search(/(tip|classes)/i)!==-1){delete v[s]}else{if(!t&&s.search(/(width|border|tip|title|classes|user)/i)!==-1){delete v[s]}}}return v}function c(s){if(typeof s.tip!=="object"){s.tip={corner:s.tip}}if(typeof s.tip.size!=="object"){s.tip.size={width:s.tip.size,height:s.tip.size}}if(typeof s.border!=="object"){s.border={width:s.border}}if(typeof s.width!=="object"){s.width={value:s.width}}if(typeof s.width.max=="string"){s.width.max=parseInt(s.width.max.replace(/([0-9]+)/i,"$1"))}if(typeof s.width.min=="string"){s.width.min=parseInt(s.width.min.replace(/([0-9]+)/i,"$1"))}if(typeof s.tip.size.x=="number"){s.tip.size.width=s.tip.size.x;delete s.tip.size.x}if(typeof s.tip.size.y=="number"){s.tip.size.height=s.tip.size.y;delete s.tip.size.y}return s}function a(){var s,t,u,x,v,w;s=this;u=[true,{}];for(t=0;t<arguments.length;t++){u.push(arguments[t])}x=[f.extend.apply(f,u)];while(typeof x[0].name=="string"){x.unshift(c(f.fn.qtip.styles[x[0].name]))}x.unshift(true,{classes:{tooltip:"qtip-"+(arguments[0].name||"defaults")}},f.fn.qtip.styles.defaults);v=f.extend.apply(f,x);w=(f.browser.msie)?1:0;v.tip.size.width+=w;v.tip.size.height+=w;if(v.tip.size.width%2>0){v.tip.size.width+=1}if(v.tip.size.height%2>0){v.tip.size.height+=1}if(v.tip.corner===true){v.tip.corner=(s.options.position.corner.tooltip==="center")?false:s.options.position.corner.tooltip}return v}function b(v,u,t){var s={bottomRight:[[0,0],[u,t],[u,0]],bottomLeft:[[0,0],[u,0],[0,t]],topRight:[[0,t],[u,0],[u,t]],topLeft:[[0,0],[0,t],[u,t]],topMiddle:[[0,t],[u/2,0],[u,t]],bottomMiddle:[[0,0],[u,0],[u/2,t]],rightMiddle:[[0,0],[u,t/2],[0,t]],leftMiddle:[[u,0],[u,t],[0,t/2]]};s.leftTop=s.bottomRight;s.rightTop=s.bottomLeft;s.leftBottom=s.topRight;s.rightBottom=s.topLeft;return s[v]}function g(s){var t;if(f("<canvas>").get(0).getContext){t={topLeft:[s,s],topRight:[0,s],bottomLeft:[s,0],bottomRight:[0,0]}}else{if(f.browser.msie){t={topLeft:[-90,90,0],topRight:[-90,90,-s],bottomLeft:[90,270,0],bottomRight:[90,270,-s]}}}return t}function k(){var s,t,u;s=this;u=s.getDimensions();t='<iframe class="qtip-bgiframe" frameborder="0" tabindex="-1" src="javascript:false" style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=\'0\'); border: 1px solid red; height:'+u.height+"px; width:"+u.width+'px" />';s.elements.bgiframe=s.elements.wrapper.prepend(t).children(".qtip-bgiframe:first")}f(document).ready(function(){f.fn.qtip.cache={screen:{scroll:{left:f(window).scrollLeft(),top:f(window).scrollTop()},width:f(window).width(),height:f(window).height()}};var s;f(window).bind("resize scroll",function(t){clearTimeout(s);s=setTimeout(function(){if(t.type==="scroll"){f.fn.qtip.cache.screen.scroll={left:f(window).scrollLeft(),top:f(window).scrollTop()}}else{f.fn.qtip.cache.screen.width=f(window).width();f.fn.qtip.cache.screen.height=f(window).height()}for(i=0;i<f.fn.qtip.interfaces.length;i++){var u=f.fn.qtip.interfaces[i];if(u.status.rendered===true&&(u.options.position.type!=="static"||u.options.position.adjust.scroll&&t.type==="scroll"||u.options.position.adjust.resize&&t.type==="resize")){u.updatePosition(t,true)}}},100)});f(document).bind("mousedown.qtip",function(t){if(f(t.target).parents("div.qtip").length===0){f(".qtip[unfocus]").each(function(){var u=f(this).qtip("api");if(f(this).is(":visible")&&!u.status.disabled&&f(t.target).add(u.elements.target).length>1){u.hide(t)}})}})});f.fn.qtip.interfaces=[];f.fn.qtip.log={error:function(){return this}};f.fn.qtip.constants={};f.fn.qtip.defaults={content:{prerender:false,text:false,url:false,data:null,title:{text:false,button:false}},position:{target:false,corner:{target:"bottomRight",tooltip:"topLeft"},adjust:{x:0,y:0,mouse:true,screen:false,scroll:true,resize:true},type:"absolute",container:false},show:{when:{target:false,event:"mouseover"},effect:{type:"fade",length:100},delay:140,solo:false,ready:false},hide:{when:{target:false,event:"mouseout"},effect:{type:"fade",length:100},delay:0,fixed:false},api:{beforeRender:function(){},onRender:function(){},beforePositionUpdate:function(){},onPositionUpdate:function(){},beforeShow:function(){},onShow:function(){},beforeHide:function(){},onHide:function(){},beforeContentUpdate:function(){},onContentUpdate:function(){},beforeContentLoad:function(){},onContentLoad:function(){},beforeTitleUpdate:function(){},onTitleUpdate:function(){},beforeDestroy:function(){},onDestroy:function(){},beforeFocus:function(){},onFocus:function(){}}};f.fn.qtip.styles={defaults:{background:"white",color:"#111",overflow:"hidden",textAlign:"left",width:{min:0,max:250},padding:"5px 9px",border:{width:1,radius:0,color:"#d3d3d3"},tip:{corner:false,color:false,size:{width:13,height:13},opacity:1},title:{background:"#e1e1e1",fontWeight:"bold",padding:"7px 12px"},button:{cursor:"pointer"},classes:{target:"",tip:"qtip-tip",title:"qtip-title",button:"qtip-button",content:"qtip-content",active:"qtip-active"}},cream:{border:{width:3,radius:0,color:"#F9E98E"},title:{background:"#F0DE7D",color:"#A27D35"},background:"#FBF7AA",color:"#A27D35",classes:{tooltip:"qtip-cream"}},light:{border:{width:3,radius:0,color:"#E2E2E2"},title:{background:"#f1f1f1",color:"#454545"},background:"white",color:"#454545",classes:{tooltip:"qtip-light"}},dark:{border:{width:3,radius:0,color:"#303030"},title:{background:"#404040",color:"#f3f3f3"},background:"#505050",color:"#f3f3f3",classes:{tooltip:"qtip-dark"}},red:{border:{width:3,radius:0,color:"#CE6F6F"},title:{background:"#f28279",color:"#9C2F2F"},background:"#F79992",color:"#9C2F2F",classes:{tooltip:"qtip-red"}},green:{border:{width:3,radius:0,color:"#A9DB66"},title:{background:"#b9db8c",color:"#58792E"},background:"#CDE6AC",color:"#58792E",classes:{tooltip:"qtip-green"}},blue:{border:{width:3,radius:0,color:"#ADD9ED"},title:{background:"#D0E9F5",color:"#5E99BD"},background:"#E5F6FE",color:"#4D9FBF",classes:{tooltip:"qtip-blue"}}}})(jQuery);
|
| 16 |
+
|
| 17 |
+
|
| 18 |
+
|
| 19 |
+
|
| 20 |
+
|
| 21 |
+
|
assets/deps/select2-3.5.2/select2-bootstrap.css
ADDED
|
@@ -0,0 +1,87 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.form-control .select2-choice {
|
| 2 |
+
border: 0;
|
| 3 |
+
border-radius: 2px;
|
| 4 |
+
}
|
| 5 |
+
|
| 6 |
+
.form-control .select2-choice .select2-arrow {
|
| 7 |
+
border-radius: 0 2px 2px 0;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
.form-control.select2-container {
|
| 11 |
+
height: auto !important;
|
| 12 |
+
padding: 0;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
.form-control.select2-container.select2-dropdown-open {
|
| 16 |
+
border-color: #5897FB;
|
| 17 |
+
border-radius: 3px 3px 0 0;
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
| 21 |
+
border-radius: 3px 3px 0 0;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
.form-control.select2-container .select2-choices {
|
| 25 |
+
border: 0 !important;
|
| 26 |
+
border-radius: 3px;
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
.control-group.warning .select2-container .select2-choice,
|
| 30 |
+
.control-group.warning .select2-container .select2-choices,
|
| 31 |
+
.control-group.warning .select2-container-active .select2-choice,
|
| 32 |
+
.control-group.warning .select2-container-active .select2-choices,
|
| 33 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 34 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 35 |
+
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
| 36 |
+
border: 1px solid #C09853 !important;
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
.control-group.warning .select2-container .select2-choice div {
|
| 40 |
+
border-left: 1px solid #C09853 !important;
|
| 41 |
+
background: #FCF8E3 !important;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
.control-group.error .select2-container .select2-choice,
|
| 45 |
+
.control-group.error .select2-container .select2-choices,
|
| 46 |
+
.control-group.error .select2-container-active .select2-choice,
|
| 47 |
+
.control-group.error .select2-container-active .select2-choices,
|
| 48 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 49 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 50 |
+
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
| 51 |
+
border: 1px solid #B94A48 !important;
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
.control-group.error .select2-container .select2-choice div {
|
| 55 |
+
border-left: 1px solid #B94A48 !important;
|
| 56 |
+
background: #F2DEDE !important;
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
.control-group.info .select2-container .select2-choice,
|
| 60 |
+
.control-group.info .select2-container .select2-choices,
|
| 61 |
+
.control-group.info .select2-container-active .select2-choice,
|
| 62 |
+
.control-group.info .select2-container-active .select2-choices,
|
| 63 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 64 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 65 |
+
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
| 66 |
+
border: 1px solid #3A87AD !important;
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
.control-group.info .select2-container .select2-choice div {
|
| 70 |
+
border-left: 1px solid #3A87AD !important;
|
| 71 |
+
background: #D9EDF7 !important;
|
| 72 |
+
}
|
| 73 |
+
|
| 74 |
+
.control-group.success .select2-container .select2-choice,
|
| 75 |
+
.control-group.success .select2-container .select2-choices,
|
| 76 |
+
.control-group.success .select2-container-active .select2-choice,
|
| 77 |
+
.control-group.success .select2-container-active .select2-choices,
|
| 78 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
| 79 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
| 80 |
+
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
| 81 |
+
border: 1px solid #468847 !important;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
.control-group.success .select2-container .select2-choice div {
|
| 85 |
+
border-left: 1px solid #468847 !important;
|
| 86 |
+
background: #DFF0D8 !important;
|
| 87 |
+
}
|
assets/deps/select2-3.5.2/select2-spinner.gif
ADDED
|
Binary file
|
assets/deps/select2-3.5.2/select2.css
ADDED
|
@@ -0,0 +1,704 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 3 |
+
*/
|
| 4 |
+
.select2-container {
|
| 5 |
+
margin: 0;
|
| 6 |
+
position: relative;
|
| 7 |
+
display: inline-block;
|
| 8 |
+
/* inline-block for ie7 */
|
| 9 |
+
zoom: 1;
|
| 10 |
+
*display: inline;
|
| 11 |
+
vertical-align: middle;
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
.select2-container,
|
| 15 |
+
.select2-drop,
|
| 16 |
+
.select2-search,
|
| 17 |
+
.select2-search input {
|
| 18 |
+
/*
|
| 19 |
+
Force border-box so that % widths fit the parent
|
| 20 |
+
container without overlap because of margin/padding.
|
| 21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
| 22 |
+
*/
|
| 23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
| 24 |
+
-moz-box-sizing: border-box; /* firefox */
|
| 25 |
+
box-sizing: border-box; /* css3 */
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
.select2-container .select2-choice {
|
| 29 |
+
display: block;
|
| 30 |
+
height: 26px;
|
| 31 |
+
padding: 0 0 0 8px;
|
| 32 |
+
overflow: hidden;
|
| 33 |
+
position: relative;
|
| 34 |
+
|
| 35 |
+
border: 1px solid #aaa;
|
| 36 |
+
white-space: nowrap;
|
| 37 |
+
line-height: 26px;
|
| 38 |
+
color: #444;
|
| 39 |
+
text-decoration: none;
|
| 40 |
+
|
| 41 |
+
border-radius: 4px;
|
| 42 |
+
|
| 43 |
+
background-clip: padding-box;
|
| 44 |
+
|
| 45 |
+
-webkit-touch-callout: none;
|
| 46 |
+
-webkit-user-select: none;
|
| 47 |
+
-moz-user-select: none;
|
| 48 |
+
-ms-user-select: none;
|
| 49 |
+
user-select: none;
|
| 50 |
+
|
| 51 |
+
background-color: #fff;
|
| 52 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
| 53 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 54 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
| 55 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
| 56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
| 60 |
+
padding: 0 8px 0 0;
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
.select2-container.select2-drop-above .select2-choice {
|
| 64 |
+
border-bottom-color: #aaa;
|
| 65 |
+
|
| 66 |
+
border-radius: 0 0 4px 4px;
|
| 67 |
+
|
| 68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
| 69 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 70 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
| 71 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
| 72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
| 73 |
+
}
|
| 74 |
+
|
| 75 |
+
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
| 76 |
+
margin-right: 42px;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
.select2-container .select2-choice > .select2-chosen {
|
| 80 |
+
margin-right: 26px;
|
| 81 |
+
display: block;
|
| 82 |
+
overflow: hidden;
|
| 83 |
+
|
| 84 |
+
white-space: nowrap;
|
| 85 |
+
|
| 86 |
+
text-overflow: ellipsis;
|
| 87 |
+
float: none;
|
| 88 |
+
width: auto;
|
| 89 |
+
}
|
| 90 |
+
|
| 91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
| 92 |
+
margin-left: 26px;
|
| 93 |
+
margin-right: 0;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
.select2-container .select2-choice abbr {
|
| 97 |
+
display: none;
|
| 98 |
+
width: 12px;
|
| 99 |
+
height: 12px;
|
| 100 |
+
position: absolute;
|
| 101 |
+
right: 24px;
|
| 102 |
+
top: 8px;
|
| 103 |
+
|
| 104 |
+
font-size: 1px;
|
| 105 |
+
text-decoration: none;
|
| 106 |
+
|
| 107 |
+
border: 0;
|
| 108 |
+
background: url('select2.png') right top no-repeat;
|
| 109 |
+
cursor: pointer;
|
| 110 |
+
outline: 0;
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
.select2-container.select2-allowclear .select2-choice abbr {
|
| 114 |
+
display: inline-block;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
.select2-container .select2-choice abbr:hover {
|
| 118 |
+
background-position: right -11px;
|
| 119 |
+
cursor: pointer;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
.select2-drop-mask {
|
| 123 |
+
border: 0;
|
| 124 |
+
margin: 0;
|
| 125 |
+
padding: 0;
|
| 126 |
+
position: fixed;
|
| 127 |
+
left: 0;
|
| 128 |
+
top: 0;
|
| 129 |
+
min-height: 100%;
|
| 130 |
+
min-width: 100%;
|
| 131 |
+
height: auto;
|
| 132 |
+
width: auto;
|
| 133 |
+
opacity: 0;
|
| 134 |
+
z-index: 9998;
|
| 135 |
+
/* styles required for IE to work */
|
| 136 |
+
background-color: #fff;
|
| 137 |
+
filter: alpha(opacity=0);
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
.select2-drop {
|
| 141 |
+
width: 100%;
|
| 142 |
+
margin-top: -1px;
|
| 143 |
+
position: absolute;
|
| 144 |
+
z-index: 9999;
|
| 145 |
+
top: 100%;
|
| 146 |
+
|
| 147 |
+
background: #fff;
|
| 148 |
+
color: #000;
|
| 149 |
+
border: 1px solid #aaa;
|
| 150 |
+
border-top: 0;
|
| 151 |
+
|
| 152 |
+
border-radius: 0 0 4px 4px;
|
| 153 |
+
|
| 154 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 155 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
.select2-drop.select2-drop-above {
|
| 159 |
+
margin-top: 1px;
|
| 160 |
+
border-top: 1px solid #aaa;
|
| 161 |
+
border-bottom: 0;
|
| 162 |
+
|
| 163 |
+
border-radius: 4px 4px 0 0;
|
| 164 |
+
|
| 165 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 166 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
| 167 |
+
}
|
| 168 |
+
|
| 169 |
+
.select2-drop-active {
|
| 170 |
+
border: 1px solid #5897fb;
|
| 171 |
+
border-top: none;
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
+
.select2-drop.select2-drop-above.select2-drop-active {
|
| 175 |
+
border-top: 1px solid #5897fb;
|
| 176 |
+
}
|
| 177 |
+
|
| 178 |
+
.select2-drop-auto-width {
|
| 179 |
+
border-top: 1px solid #aaa;
|
| 180 |
+
width: auto;
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
.select2-drop-auto-width .select2-search {
|
| 184 |
+
padding-top: 4px;
|
| 185 |
+
}
|
| 186 |
+
|
| 187 |
+
.select2-container .select2-choice .select2-arrow {
|
| 188 |
+
display: inline-block;
|
| 189 |
+
width: 18px;
|
| 190 |
+
height: 100%;
|
| 191 |
+
position: absolute;
|
| 192 |
+
right: 0;
|
| 193 |
+
top: 0;
|
| 194 |
+
|
| 195 |
+
border-left: 1px solid #aaa;
|
| 196 |
+
border-radius: 0 4px 4px 0;
|
| 197 |
+
|
| 198 |
+
background-clip: padding-box;
|
| 199 |
+
|
| 200 |
+
background: #ccc;
|
| 201 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
| 202 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 203 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
| 204 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
| 205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
| 206 |
+
}
|
| 207 |
+
|
| 208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
| 209 |
+
left: 0;
|
| 210 |
+
right: auto;
|
| 211 |
+
|
| 212 |
+
border-left: none;
|
| 213 |
+
border-right: 1px solid #aaa;
|
| 214 |
+
border-radius: 4px 0 0 4px;
|
| 215 |
+
}
|
| 216 |
+
|
| 217 |
+
.select2-container .select2-choice .select2-arrow b {
|
| 218 |
+
display: block;
|
| 219 |
+
width: 100%;
|
| 220 |
+
height: 100%;
|
| 221 |
+
background: url('select2.png') no-repeat 0 1px;
|
| 222 |
+
}
|
| 223 |
+
|
| 224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
| 225 |
+
background-position: 2px 1px;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
.select2-search {
|
| 229 |
+
display: inline-block;
|
| 230 |
+
width: 100%;
|
| 231 |
+
min-height: 26px;
|
| 232 |
+
margin: 0;
|
| 233 |
+
padding-left: 4px;
|
| 234 |
+
padding-right: 4px;
|
| 235 |
+
|
| 236 |
+
position: relative;
|
| 237 |
+
z-index: 10000;
|
| 238 |
+
|
| 239 |
+
white-space: nowrap;
|
| 240 |
+
}
|
| 241 |
+
|
| 242 |
+
.select2-search input {
|
| 243 |
+
width: 100%;
|
| 244 |
+
height: auto !important;
|
| 245 |
+
min-height: 26px;
|
| 246 |
+
padding: 4px 20px 4px 5px;
|
| 247 |
+
margin: 0;
|
| 248 |
+
|
| 249 |
+
outline: 0;
|
| 250 |
+
font-family: sans-serif;
|
| 251 |
+
font-size: 1em;
|
| 252 |
+
|
| 253 |
+
border: 1px solid #aaa;
|
| 254 |
+
border-radius: 0;
|
| 255 |
+
|
| 256 |
+
-webkit-box-shadow: none;
|
| 257 |
+
box-shadow: none;
|
| 258 |
+
|
| 259 |
+
background: #fff url('select2.png') no-repeat 100% -22px;
|
| 260 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 261 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 262 |
+
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
html[dir="rtl"] .select2-search input {
|
| 267 |
+
padding: 4px 5px 4px 20px;
|
| 268 |
+
|
| 269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
| 270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 274 |
+
}
|
| 275 |
+
|
| 276 |
+
.select2-drop.select2-drop-above .select2-search input {
|
| 277 |
+
margin-top: 4px;
|
| 278 |
+
}
|
| 279 |
+
|
| 280 |
+
.select2-search input.select2-active {
|
| 281 |
+
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
| 282 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
| 283 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 284 |
+
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
| 285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
.select2-container-active .select2-choice,
|
| 289 |
+
.select2-container-active .select2-choices {
|
| 290 |
+
border: 1px solid #5897fb;
|
| 291 |
+
outline: none;
|
| 292 |
+
|
| 293 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 294 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
.select2-dropdown-open .select2-choice {
|
| 298 |
+
border-bottom-color: transparent;
|
| 299 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
| 300 |
+
box-shadow: 0 1px 0 #fff inset;
|
| 301 |
+
|
| 302 |
+
border-bottom-left-radius: 0;
|
| 303 |
+
border-bottom-right-radius: 0;
|
| 304 |
+
|
| 305 |
+
background-color: #eee;
|
| 306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 307 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 308 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
| 309 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
| 311 |
+
}
|
| 312 |
+
|
| 313 |
+
.select2-dropdown-open.select2-drop-above .select2-choice,
|
| 314 |
+
.select2-dropdown-open.select2-drop-above .select2-choices {
|
| 315 |
+
border: 1px solid #5897fb;
|
| 316 |
+
border-top-color: transparent;
|
| 317 |
+
|
| 318 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
| 319 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 320 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
| 321 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
| 322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
| 323 |
+
}
|
| 324 |
+
|
| 325 |
+
.select2-dropdown-open .select2-choice .select2-arrow {
|
| 326 |
+
background: transparent;
|
| 327 |
+
border-left: none;
|
| 328 |
+
filter: none;
|
| 329 |
+
}
|
| 330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
| 331 |
+
border-right: none;
|
| 332 |
+
}
|
| 333 |
+
|
| 334 |
+
.select2-dropdown-open .select2-choice .select2-arrow b {
|
| 335 |
+
background-position: -18px 1px;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
| 339 |
+
background-position: -16px 1px;
|
| 340 |
+
}
|
| 341 |
+
|
| 342 |
+
.select2-hidden-accessible {
|
| 343 |
+
border: 0;
|
| 344 |
+
clip: rect(0 0 0 0);
|
| 345 |
+
height: 1px;
|
| 346 |
+
margin: -1px;
|
| 347 |
+
overflow: hidden;
|
| 348 |
+
padding: 0;
|
| 349 |
+
position: absolute;
|
| 350 |
+
width: 1px;
|
| 351 |
+
}
|
| 352 |
+
|
| 353 |
+
/* results */
|
| 354 |
+
.select2-results {
|
| 355 |
+
max-height: 200px;
|
| 356 |
+
padding: 0 0 0 4px;
|
| 357 |
+
margin: 4px 4px 4px 0;
|
| 358 |
+
position: relative;
|
| 359 |
+
overflow-x: hidden;
|
| 360 |
+
overflow-y: auto;
|
| 361 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
html[dir="rtl"] .select2-results {
|
| 365 |
+
padding: 0 4px 0 0;
|
| 366 |
+
margin: 4px 0 4px 4px;
|
| 367 |
+
}
|
| 368 |
+
|
| 369 |
+
.select2-results ul.select2-result-sub {
|
| 370 |
+
margin: 0;
|
| 371 |
+
padding-left: 0;
|
| 372 |
+
}
|
| 373 |
+
|
| 374 |
+
.select2-results li {
|
| 375 |
+
list-style: none;
|
| 376 |
+
display: list-item;
|
| 377 |
+
background-image: none;
|
| 378 |
+
}
|
| 379 |
+
|
| 380 |
+
.select2-results li.select2-result-with-children > .select2-result-label {
|
| 381 |
+
font-weight: bold;
|
| 382 |
+
}
|
| 383 |
+
|
| 384 |
+
.select2-results .select2-result-label {
|
| 385 |
+
padding: 3px 7px 4px;
|
| 386 |
+
margin: 0;
|
| 387 |
+
cursor: pointer;
|
| 388 |
+
|
| 389 |
+
min-height: 1em;
|
| 390 |
+
|
| 391 |
+
-webkit-touch-callout: none;
|
| 392 |
+
-webkit-user-select: none;
|
| 393 |
+
-moz-user-select: none;
|
| 394 |
+
-ms-user-select: none;
|
| 395 |
+
user-select: none;
|
| 396 |
+
}
|
| 397 |
+
|
| 398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
| 399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
| 400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
| 401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
| 402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
| 403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
| 404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
| 405 |
+
|
| 406 |
+
.select2-results .select2-highlighted {
|
| 407 |
+
background: #3875d7;
|
| 408 |
+
color: #fff;
|
| 409 |
+
}
|
| 410 |
+
|
| 411 |
+
.select2-results li em {
|
| 412 |
+
background: #feffde;
|
| 413 |
+
font-style: normal;
|
| 414 |
+
}
|
| 415 |
+
|
| 416 |
+
.select2-results .select2-highlighted em {
|
| 417 |
+
background: transparent;
|
| 418 |
+
}
|
| 419 |
+
|
| 420 |
+
.select2-results .select2-highlighted ul {
|
| 421 |
+
background: #fff;
|
| 422 |
+
color: #000;
|
| 423 |
+
}
|
| 424 |
+
|
| 425 |
+
.select2-results .select2-no-results,
|
| 426 |
+
.select2-results .select2-searching,
|
| 427 |
+
.select2-results .select2-ajax-error,
|
| 428 |
+
.select2-results .select2-selection-limit {
|
| 429 |
+
background: #f4f4f4;
|
| 430 |
+
display: list-item;
|
| 431 |
+
padding-left: 5px;
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
/*
|
| 435 |
+
disabled look for disabled choices in the results dropdown
|
| 436 |
+
*/
|
| 437 |
+
.select2-results .select2-disabled.select2-highlighted {
|
| 438 |
+
color: #666;
|
| 439 |
+
background: #f4f4f4;
|
| 440 |
+
display: list-item;
|
| 441 |
+
cursor: default;
|
| 442 |
+
}
|
| 443 |
+
.select2-results .select2-disabled {
|
| 444 |
+
background: #f4f4f4;
|
| 445 |
+
display: list-item;
|
| 446 |
+
cursor: default;
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
.select2-results .select2-selected {
|
| 450 |
+
display: none;
|
| 451 |
+
}
|
| 452 |
+
|
| 453 |
+
.select2-more-results.select2-active {
|
| 454 |
+
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
| 455 |
+
}
|
| 456 |
+
|
| 457 |
+
.select2-results .select2-ajax-error {
|
| 458 |
+
background: rgba(255, 50, 50, .2);
|
| 459 |
+
}
|
| 460 |
+
|
| 461 |
+
.select2-more-results {
|
| 462 |
+
background: #f4f4f4;
|
| 463 |
+
display: list-item;
|
| 464 |
+
}
|
| 465 |
+
|
| 466 |
+
/* disabled styles */
|
| 467 |
+
|
| 468 |
+
.select2-container.select2-container-disabled .select2-choice {
|
| 469 |
+
background-color: #f4f4f4;
|
| 470 |
+
background-image: none;
|
| 471 |
+
border: 1px solid #ddd;
|
| 472 |
+
cursor: default;
|
| 473 |
+
}
|
| 474 |
+
|
| 475 |
+
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
| 476 |
+
background-color: #f4f4f4;
|
| 477 |
+
background-image: none;
|
| 478 |
+
border-left: 0;
|
| 479 |
+
}
|
| 480 |
+
|
| 481 |
+
.select2-container.select2-container-disabled .select2-choice abbr {
|
| 482 |
+
display: none;
|
| 483 |
+
}
|
| 484 |
+
|
| 485 |
+
|
| 486 |
+
/* multiselect */
|
| 487 |
+
|
| 488 |
+
.select2-container-multi .select2-choices {
|
| 489 |
+
height: auto !important;
|
| 490 |
+
height: 1%;
|
| 491 |
+
margin: 0;
|
| 492 |
+
padding: 0 5px 0 0;
|
| 493 |
+
position: relative;
|
| 494 |
+
|
| 495 |
+
border: 1px solid #aaa;
|
| 496 |
+
cursor: text;
|
| 497 |
+
overflow: hidden;
|
| 498 |
+
|
| 499 |
+
background-color: #fff;
|
| 500 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
| 501 |
+
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
| 502 |
+
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
| 503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
| 504 |
+
}
|
| 505 |
+
|
| 506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
| 507 |
+
padding: 0 0 0 5px;
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
.select2-locked {
|
| 511 |
+
padding: 3px 5px 3px 5px !important;
|
| 512 |
+
}
|
| 513 |
+
|
| 514 |
+
.select2-container-multi .select2-choices {
|
| 515 |
+
min-height: 26px;
|
| 516 |
+
}
|
| 517 |
+
|
| 518 |
+
.select2-container-multi.select2-container-active .select2-choices {
|
| 519 |
+
border: 1px solid #5897fb;
|
| 520 |
+
outline: none;
|
| 521 |
+
|
| 522 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 523 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
| 524 |
+
}
|
| 525 |
+
.select2-container-multi .select2-choices li {
|
| 526 |
+
float: left;
|
| 527 |
+
list-style: none;
|
| 528 |
+
}
|
| 529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
| 530 |
+
{
|
| 531 |
+
float: right;
|
| 532 |
+
}
|
| 533 |
+
.select2-container-multi .select2-choices .select2-search-field {
|
| 534 |
+
margin: 0;
|
| 535 |
+
padding: 0;
|
| 536 |
+
white-space: nowrap;
|
| 537 |
+
}
|
| 538 |
+
|
| 539 |
+
.select2-container-multi .select2-choices .select2-search-field input {
|
| 540 |
+
padding: 5px;
|
| 541 |
+
margin: 1px 0;
|
| 542 |
+
|
| 543 |
+
font-family: sans-serif;
|
| 544 |
+
font-size: 100%;
|
| 545 |
+
color: #666;
|
| 546 |
+
outline: 0;
|
| 547 |
+
border: 0;
|
| 548 |
+
-webkit-box-shadow: none;
|
| 549 |
+
box-shadow: none;
|
| 550 |
+
background: transparent !important;
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
+
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
| 554 |
+
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
| 555 |
+
}
|
| 556 |
+
|
| 557 |
+
.select2-default {
|
| 558 |
+
color: #999 !important;
|
| 559 |
+
}
|
| 560 |
+
|
| 561 |
+
.select2-container-multi .select2-choices .select2-search-choice {
|
| 562 |
+
padding: 3px 5px 3px 18px;
|
| 563 |
+
margin: 3px 0 3px 5px;
|
| 564 |
+
position: relative;
|
| 565 |
+
|
| 566 |
+
line-height: 13px;
|
| 567 |
+
color: #333;
|
| 568 |
+
cursor: default;
|
| 569 |
+
border: 1px solid #aaaaaa;
|
| 570 |
+
|
| 571 |
+
border-radius: 3px;
|
| 572 |
+
|
| 573 |
+
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 574 |
+
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
| 575 |
+
|
| 576 |
+
background-clip: padding-box;
|
| 577 |
+
|
| 578 |
+
-webkit-touch-callout: none;
|
| 579 |
+
-webkit-user-select: none;
|
| 580 |
+
-moz-user-select: none;
|
| 581 |
+
-ms-user-select: none;
|
| 582 |
+
user-select: none;
|
| 583 |
+
|
| 584 |
+
background-color: #e4e4e4;
|
| 585 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
| 586 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
| 587 |
+
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 588 |
+
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
| 590 |
+
}
|
| 591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
| 592 |
+
{
|
| 593 |
+
margin: 3px 5px 3px 0;
|
| 594 |
+
padding: 3px 18px 3px 5px;
|
| 595 |
+
}
|
| 596 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
| 597 |
+
cursor: default;
|
| 598 |
+
}
|
| 599 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
| 600 |
+
background: #d4d4d4;
|
| 601 |
+
}
|
| 602 |
+
|
| 603 |
+
.select2-search-choice-close {
|
| 604 |
+
display: block;
|
| 605 |
+
width: 12px;
|
| 606 |
+
height: 13px;
|
| 607 |
+
position: absolute;
|
| 608 |
+
right: 3px;
|
| 609 |
+
top: 4px;
|
| 610 |
+
|
| 611 |
+
font-size: 1px;
|
| 612 |
+
outline: none;
|
| 613 |
+
background: url('select2.png') right top no-repeat;
|
| 614 |
+
}
|
| 615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
| 616 |
+
right: auto;
|
| 617 |
+
left: 3px;
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
.select2-container-multi .select2-search-choice-close {
|
| 621 |
+
left: 3px;
|
| 622 |
+
}
|
| 623 |
+
|
| 624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
| 625 |
+
left: auto;
|
| 626 |
+
right: 2px;
|
| 627 |
+
}
|
| 628 |
+
|
| 629 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
| 630 |
+
background-position: right -11px;
|
| 631 |
+
}
|
| 632 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
| 633 |
+
background-position: right -11px;
|
| 634 |
+
}
|
| 635 |
+
|
| 636 |
+
/* disabled styles */
|
| 637 |
+
.select2-container-multi.select2-container-disabled .select2-choices {
|
| 638 |
+
background-color: #f4f4f4;
|
| 639 |
+
background-image: none;
|
| 640 |
+
border: 1px solid #ddd;
|
| 641 |
+
cursor: default;
|
| 642 |
+
}
|
| 643 |
+
|
| 644 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
| 645 |
+
padding: 3px 5px 3px 5px;
|
| 646 |
+
border: 1px solid #ddd;
|
| 647 |
+
background-image: none;
|
| 648 |
+
background-color: #f4f4f4;
|
| 649 |
+
}
|
| 650 |
+
|
| 651 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
| 652 |
+
background: none;
|
| 653 |
+
}
|
| 654 |
+
/* end multiselect */
|
| 655 |
+
|
| 656 |
+
|
| 657 |
+
.select2-result-selectable .select2-match,
|
| 658 |
+
.select2-result-unselectable .select2-match {
|
| 659 |
+
text-decoration: underline;
|
| 660 |
+
}
|
| 661 |
+
|
| 662 |
+
.select2-offscreen, .select2-offscreen:focus {
|
| 663 |
+
clip: rect(0 0 0 0) !important;
|
| 664 |
+
width: 1px !important;
|
| 665 |
+
height: 1px !important;
|
| 666 |
+
border: 0 !important;
|
| 667 |
+
margin: 0 !important;
|
| 668 |
+
padding: 0 !important;
|
| 669 |
+
overflow: hidden !important;
|
| 670 |
+
position: absolute !important;
|
| 671 |
+
outline: 0 !important;
|
| 672 |
+
left: 0px !important;
|
| 673 |
+
top: 0px !important;
|
| 674 |
+
}
|
| 675 |
+
|
| 676 |
+
.select2-display-none {
|
| 677 |
+
display: none;
|
| 678 |
+
}
|
| 679 |
+
|
| 680 |
+
.select2-measure-scrollbar {
|
| 681 |
+
position: absolute;
|
| 682 |
+
top: -10000px;
|
| 683 |
+
left: -10000px;
|
| 684 |
+
width: 100px;
|
| 685 |
+
height: 100px;
|
| 686 |
+
overflow: scroll;
|
| 687 |
+
}
|
| 688 |
+
|
| 689 |
+
/* Retina-ize icons */
|
| 690 |
+
|
| 691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
| 692 |
+
.select2-search input,
|
| 693 |
+
.select2-search-choice-close,
|
| 694 |
+
.select2-container .select2-choice abbr,
|
| 695 |
+
.select2-container .select2-choice .select2-arrow b {
|
| 696 |
+
background-image: url('select2x2.png') !important;
|
| 697 |
+
background-repeat: no-repeat !important;
|
| 698 |
+
background-size: 60px 40px !important;
|
| 699 |
+
}
|
| 700 |
+
|
| 701 |
+
.select2-search input {
|
| 702 |
+
background-position: 100% -21px !important;
|
| 703 |
+
}
|
| 704 |
+
}
|
assets/deps/select2-3.5.2/select2.js
ADDED
|
@@ -0,0 +1,3541 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2012 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
+
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
(function ($) {
|
| 22 |
+
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
+
$.extend($.fn, {
|
| 24 |
+
/*
|
| 25 |
+
* 4-10 times faster .each replacement
|
| 26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
+
*/
|
| 28 |
+
each2 : function (c) {
|
| 29 |
+
var j = $([0]), i = -1, l = this.length;
|
| 30 |
+
while (
|
| 31 |
+
++i < l
|
| 32 |
+
&& (j.context = j[0] = this[i])
|
| 33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
+
);
|
| 35 |
+
return this;
|
| 36 |
+
}
|
| 37 |
+
});
|
| 38 |
+
}
|
| 39 |
+
})(jQuery);
|
| 40 |
+
|
| 41 |
+
(function ($, undefined) {
|
| 42 |
+
"use strict";
|
| 43 |
+
/*global document, window, jQuery, console */
|
| 44 |
+
|
| 45 |
+
if (window.Select2 !== undefined) {
|
| 46 |
+
return;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
+
|
| 52 |
+
KEY = {
|
| 53 |
+
TAB: 9,
|
| 54 |
+
ENTER: 13,
|
| 55 |
+
ESC: 27,
|
| 56 |
+
SPACE: 32,
|
| 57 |
+
LEFT: 37,
|
| 58 |
+
UP: 38,
|
| 59 |
+
RIGHT: 39,
|
| 60 |
+
DOWN: 40,
|
| 61 |
+
SHIFT: 16,
|
| 62 |
+
CTRL: 17,
|
| 63 |
+
ALT: 18,
|
| 64 |
+
PAGE_UP: 33,
|
| 65 |
+
PAGE_DOWN: 34,
|
| 66 |
+
HOME: 36,
|
| 67 |
+
END: 35,
|
| 68 |
+
BACKSPACE: 8,
|
| 69 |
+
DELETE: 46,
|
| 70 |
+
isArrow: function (k) {
|
| 71 |
+
k = k.which ? k.which : k;
|
| 72 |
+
switch (k) {
|
| 73 |
+
case KEY.LEFT:
|
| 74 |
+
case KEY.RIGHT:
|
| 75 |
+
case KEY.UP:
|
| 76 |
+
case KEY.DOWN:
|
| 77 |
+
return true;
|
| 78 |
+
}
|
| 79 |
+
return false;
|
| 80 |
+
},
|
| 81 |
+
isControl: function (e) {
|
| 82 |
+
var k = e.which;
|
| 83 |
+
switch (k) {
|
| 84 |
+
case KEY.SHIFT:
|
| 85 |
+
case KEY.CTRL:
|
| 86 |
+
case KEY.ALT:
|
| 87 |
+
return true;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
if (e.metaKey) return true;
|
| 91 |
+
|
| 92 |
+
return false;
|
| 93 |
+
},
|
| 94 |
+
isFunctionKey: function (k) {
|
| 95 |
+
k = k.which ? k.which : k;
|
| 96 |
+
return k >= 112 && k <= 123;
|
| 97 |
+
}
|
| 98 |
+
},
|
| 99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
| 100 |
+
|
| 101 |
+
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
| 102 |
+
|
| 103 |
+
$document = $(document);
|
| 104 |
+
|
| 105 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 106 |
+
|
| 107 |
+
|
| 108 |
+
function reinsertElement(element) {
|
| 109 |
+
var placeholder = $(document.createTextNode(''));
|
| 110 |
+
|
| 111 |
+
element.before(placeholder);
|
| 112 |
+
placeholder.before(element);
|
| 113 |
+
placeholder.remove();
|
| 114 |
+
}
|
| 115 |
+
|
| 116 |
+
function stripDiacritics(str) {
|
| 117 |
+
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
| 118 |
+
function match(a) {
|
| 119 |
+
return DIACRITICS[a] || a;
|
| 120 |
+
}
|
| 121 |
+
|
| 122 |
+
return str.replace(/[^\u0000-\u007E]/g, match);
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
function indexOf(value, array) {
|
| 126 |
+
var i = 0, l = array.length;
|
| 127 |
+
for (; i < l; i = i + 1) {
|
| 128 |
+
if (equal(value, array[i])) return i;
|
| 129 |
+
}
|
| 130 |
+
return -1;
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
function measureScrollbar () {
|
| 134 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 135 |
+
$template.appendTo(document.body);
|
| 136 |
+
|
| 137 |
+
var dim = {
|
| 138 |
+
width: $template.width() - $template[0].clientWidth,
|
| 139 |
+
height: $template.height() - $template[0].clientHeight
|
| 140 |
+
};
|
| 141 |
+
$template.remove();
|
| 142 |
+
|
| 143 |
+
return dim;
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
/**
|
| 147 |
+
* Compares equality of a and b
|
| 148 |
+
* @param a
|
| 149 |
+
* @param b
|
| 150 |
+
*/
|
| 151 |
+
function equal(a, b) {
|
| 152 |
+
if (a === b) return true;
|
| 153 |
+
if (a === undefined || b === undefined) return false;
|
| 154 |
+
if (a === null || b === null) return false;
|
| 155 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 156 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 157 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 158 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 159 |
+
return false;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
/**
|
| 163 |
+
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
| 164 |
+
* strings
|
| 165 |
+
* @param string
|
| 166 |
+
* @param separator
|
| 167 |
+
*/
|
| 168 |
+
function splitVal(string, separator, transform) {
|
| 169 |
+
var val, i, l;
|
| 170 |
+
if (string === null || string.length < 1) return [];
|
| 171 |
+
val = string.split(separator);
|
| 172 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
| 173 |
+
return val;
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
function getSideBorderPadding(element) {
|
| 177 |
+
return element.outerWidth(false) - element.width();
|
| 178 |
+
}
|
| 179 |
+
|
| 180 |
+
function installKeyUpChangeEvent(element) {
|
| 181 |
+
var key="keyup-change-value";
|
| 182 |
+
element.on("keydown", function () {
|
| 183 |
+
if ($.data(element, key) === undefined) {
|
| 184 |
+
$.data(element, key, element.val());
|
| 185 |
+
}
|
| 186 |
+
});
|
| 187 |
+
element.on("keyup", function () {
|
| 188 |
+
var val= $.data(element, key);
|
| 189 |
+
if (val !== undefined && element.val() !== val) {
|
| 190 |
+
$.removeData(element, key);
|
| 191 |
+
element.trigger("keyup-change");
|
| 192 |
+
}
|
| 193 |
+
});
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
|
| 197 |
+
/**
|
| 198 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
| 199 |
+
*
|
| 200 |
+
* filters out mouse events that occur when mouse is stationary but
|
| 201 |
+
* the elements under the pointer are scrolled.
|
| 202 |
+
*/
|
| 203 |
+
function installFilteredMouseMove(element) {
|
| 204 |
+
element.on("mousemove", function (e) {
|
| 205 |
+
var lastpos = lastMousePosition;
|
| 206 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 207 |
+
$(e.target).trigger("mousemove-filtered", e);
|
| 208 |
+
}
|
| 209 |
+
});
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
/**
|
| 213 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 214 |
+
* within the last quietMillis milliseconds.
|
| 215 |
+
*
|
| 216 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 217 |
+
* @param fn function to be debounced
|
| 218 |
+
* @param ctx object to be used as this reference within fn
|
| 219 |
+
* @return debounced version of fn
|
| 220 |
+
*/
|
| 221 |
+
function debounce(quietMillis, fn, ctx) {
|
| 222 |
+
ctx = ctx || undefined;
|
| 223 |
+
var timeout;
|
| 224 |
+
return function () {
|
| 225 |
+
var args = arguments;
|
| 226 |
+
window.clearTimeout(timeout);
|
| 227 |
+
timeout = window.setTimeout(function() {
|
| 228 |
+
fn.apply(ctx, args);
|
| 229 |
+
}, quietMillis);
|
| 230 |
+
};
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
function installDebouncedScroll(threshold, element) {
|
| 234 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 235 |
+
element.on("scroll", function (e) {
|
| 236 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 237 |
+
});
|
| 238 |
+
}
|
| 239 |
+
|
| 240 |
+
function focus($el) {
|
| 241 |
+
if ($el[0] === document.activeElement) return;
|
| 242 |
+
|
| 243 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 244 |
+
of the current event has finished - which seems like the only reliable way
|
| 245 |
+
to set focus */
|
| 246 |
+
window.setTimeout(function() {
|
| 247 |
+
var el=$el[0], pos=$el.val().length, range;
|
| 248 |
+
|
| 249 |
+
$el.focus();
|
| 250 |
+
|
| 251 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 252 |
+
sometimes modals or others listeners may steal it after its set */
|
| 253 |
+
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
| 254 |
+
if (isVisible && el === document.activeElement) {
|
| 255 |
+
|
| 256 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
| 257 |
+
just before setting focus */
|
| 258 |
+
if(el.setSelectionRange)
|
| 259 |
+
{
|
| 260 |
+
el.setSelectionRange(pos, pos);
|
| 261 |
+
}
|
| 262 |
+
else if (el.createTextRange) {
|
| 263 |
+
range = el.createTextRange();
|
| 264 |
+
range.collapse(false);
|
| 265 |
+
range.select();
|
| 266 |
+
}
|
| 267 |
+
}
|
| 268 |
+
}, 0);
|
| 269 |
+
}
|
| 270 |
+
|
| 271 |
+
function getCursorInfo(el) {
|
| 272 |
+
el = $(el)[0];
|
| 273 |
+
var offset = 0;
|
| 274 |
+
var length = 0;
|
| 275 |
+
if ('selectionStart' in el) {
|
| 276 |
+
offset = el.selectionStart;
|
| 277 |
+
length = el.selectionEnd - offset;
|
| 278 |
+
} else if ('selection' in document) {
|
| 279 |
+
el.focus();
|
| 280 |
+
var sel = document.selection.createRange();
|
| 281 |
+
length = document.selection.createRange().text.length;
|
| 282 |
+
sel.moveStart('character', -el.value.length);
|
| 283 |
+
offset = sel.text.length - length;
|
| 284 |
+
}
|
| 285 |
+
return { offset: offset, length: length };
|
| 286 |
+
}
|
| 287 |
+
|
| 288 |
+
function killEvent(event) {
|
| 289 |
+
event.preventDefault();
|
| 290 |
+
event.stopPropagation();
|
| 291 |
+
}
|
| 292 |
+
function killEventImmediately(event) {
|
| 293 |
+
event.preventDefault();
|
| 294 |
+
event.stopImmediatePropagation();
|
| 295 |
+
}
|
| 296 |
+
|
| 297 |
+
function measureTextWidth(e) {
|
| 298 |
+
if (!sizer){
|
| 299 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 300 |
+
sizer = $(document.createElement("div")).css({
|
| 301 |
+
position: "absolute",
|
| 302 |
+
left: "-10000px",
|
| 303 |
+
top: "-10000px",
|
| 304 |
+
display: "none",
|
| 305 |
+
fontSize: style.fontSize,
|
| 306 |
+
fontFamily: style.fontFamily,
|
| 307 |
+
fontStyle: style.fontStyle,
|
| 308 |
+
fontWeight: style.fontWeight,
|
| 309 |
+
letterSpacing: style.letterSpacing,
|
| 310 |
+
textTransform: style.textTransform,
|
| 311 |
+
whiteSpace: "nowrap"
|
| 312 |
+
});
|
| 313 |
+
sizer.attr("class","select2-sizer");
|
| 314 |
+
$(document.body).append(sizer);
|
| 315 |
+
}
|
| 316 |
+
sizer.text(e.val());
|
| 317 |
+
return sizer.width();
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
function syncCssClasses(dest, src, adapter) {
|
| 321 |
+
var classes, replacements = [], adapted;
|
| 322 |
+
|
| 323 |
+
classes = $.trim(dest.attr("class"));
|
| 324 |
+
|
| 325 |
+
if (classes) {
|
| 326 |
+
classes = '' + classes; // for IE which returns object
|
| 327 |
+
|
| 328 |
+
$(classes.split(/\s+/)).each2(function() {
|
| 329 |
+
if (this.indexOf("select2-") === 0) {
|
| 330 |
+
replacements.push(this);
|
| 331 |
+
}
|
| 332 |
+
});
|
| 333 |
+
}
|
| 334 |
+
|
| 335 |
+
classes = $.trim(src.attr("class"));
|
| 336 |
+
|
| 337 |
+
if (classes) {
|
| 338 |
+
classes = '' + classes; // for IE which returns object
|
| 339 |
+
|
| 340 |
+
$(classes.split(/\s+/)).each2(function() {
|
| 341 |
+
if (this.indexOf("select2-") !== 0) {
|
| 342 |
+
adapted = adapter(this);
|
| 343 |
+
|
| 344 |
+
if (adapted) {
|
| 345 |
+
replacements.push(adapted);
|
| 346 |
+
}
|
| 347 |
+
}
|
| 348 |
+
});
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
dest.attr("class", replacements.join(" "));
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
|
| 355 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
| 356 |
+
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
| 357 |
+
tl=term.length;
|
| 358 |
+
|
| 359 |
+
if (match<0) {
|
| 360 |
+
markup.push(escapeMarkup(text));
|
| 361 |
+
return;
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
| 365 |
+
markup.push("<span class='select2-match'>");
|
| 366 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 367 |
+
markup.push("</span>");
|
| 368 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 369 |
+
}
|
| 370 |
+
|
| 371 |
+
function defaultEscapeMarkup(markup) {
|
| 372 |
+
var replace_map = {
|
| 373 |
+
'\\': '\',
|
| 374 |
+
'&': '&',
|
| 375 |
+
'<': '<',
|
| 376 |
+
'>': '>',
|
| 377 |
+
'"': '"',
|
| 378 |
+
"'": ''',
|
| 379 |
+
"/": '/'
|
| 380 |
+
};
|
| 381 |
+
|
| 382 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 383 |
+
return replace_map[match];
|
| 384 |
+
});
|
| 385 |
+
}
|
| 386 |
+
|
| 387 |
+
/**
|
| 388 |
+
* Produces an ajax-based query function
|
| 389 |
+
*
|
| 390 |
+
* @param options object containing configuration parameters
|
| 391 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 392 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 393 |
+
* @param options.url url for the data
|
| 394 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 395 |
+
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 396 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 397 |
+
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
| 398 |
+
* The expected format is an object containing the following keys:
|
| 399 |
+
* results array of objects that will be used as choices
|
| 400 |
+
* more (optional) boolean indicating whether there are more results available
|
| 401 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 402 |
+
*/
|
| 403 |
+
function ajax(options) {
|
| 404 |
+
var timeout, // current scheduled but not yet executed request
|
| 405 |
+
handler = null,
|
| 406 |
+
quietMillis = options.quietMillis || 100,
|
| 407 |
+
ajaxUrl = options.url,
|
| 408 |
+
self = this;
|
| 409 |
+
|
| 410 |
+
return function (query) {
|
| 411 |
+
window.clearTimeout(timeout);
|
| 412 |
+
timeout = window.setTimeout(function () {
|
| 413 |
+
var data = options.data, // ajax data function
|
| 414 |
+
url = ajaxUrl, // ajax url string or function
|
| 415 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 416 |
+
// deprecated - to be removed in 4.0 - use params instead
|
| 417 |
+
deprecated = {
|
| 418 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
| 419 |
+
cache: options.cache || false,
|
| 420 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
| 421 |
+
dataType: options.dataType||"json"
|
| 422 |
+
},
|
| 423 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 424 |
+
|
| 425 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 426 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 427 |
+
|
| 428 |
+
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
| 429 |
+
|
| 430 |
+
if (options.params) {
|
| 431 |
+
if ($.isFunction(options.params)) {
|
| 432 |
+
$.extend(params, options.params.call(self));
|
| 433 |
+
} else {
|
| 434 |
+
$.extend(params, options.params);
|
| 435 |
+
}
|
| 436 |
+
}
|
| 437 |
+
|
| 438 |
+
$.extend(params, {
|
| 439 |
+
url: url,
|
| 440 |
+
dataType: options.dataType,
|
| 441 |
+
data: data,
|
| 442 |
+
success: function (data) {
|
| 443 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 444 |
+
// added query as third paramter to keep backwards compatibility
|
| 445 |
+
var results = options.results(data, query.page, query);
|
| 446 |
+
query.callback(results);
|
| 447 |
+
},
|
| 448 |
+
error: function(jqXHR, textStatus, errorThrown){
|
| 449 |
+
var results = {
|
| 450 |
+
hasError: true,
|
| 451 |
+
jqXHR: jqXHR,
|
| 452 |
+
textStatus: textStatus,
|
| 453 |
+
errorThrown: errorThrown
|
| 454 |
+
};
|
| 455 |
+
|
| 456 |
+
query.callback(results);
|
| 457 |
+
}
|
| 458 |
+
});
|
| 459 |
+
handler = transport.call(self, params);
|
| 460 |
+
}, quietMillis);
|
| 461 |
+
};
|
| 462 |
+
}
|
| 463 |
+
|
| 464 |
+
/**
|
| 465 |
+
* Produces a query function that works with a local array
|
| 466 |
+
*
|
| 467 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 468 |
+
* object.
|
| 469 |
+
*
|
| 470 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 471 |
+
*
|
| 472 |
+
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 473 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 474 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 475 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 476 |
+
* the text.
|
| 477 |
+
*/
|
| 478 |
+
function local(options) {
|
| 479 |
+
var data = options, // data elements
|
| 480 |
+
dataText,
|
| 481 |
+
tmp,
|
| 482 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 483 |
+
|
| 484 |
+
if ($.isArray(data)) {
|
| 485 |
+
tmp = data;
|
| 486 |
+
data = { results: tmp };
|
| 487 |
+
}
|
| 488 |
+
|
| 489 |
+
if ($.isFunction(data) === false) {
|
| 490 |
+
tmp = data;
|
| 491 |
+
data = function() { return tmp; };
|
| 492 |
+
}
|
| 493 |
+
|
| 494 |
+
var dataItem = data();
|
| 495 |
+
if (dataItem.text) {
|
| 496 |
+
text = dataItem.text;
|
| 497 |
+
// if text is not a function we assume it to be a key name
|
| 498 |
+
if (!$.isFunction(text)) {
|
| 499 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 500 |
+
text = function (item) { return item[dataText]; };
|
| 501 |
+
}
|
| 502 |
+
}
|
| 503 |
+
|
| 504 |
+
return function (query) {
|
| 505 |
+
var t = query.term, filtered = { results: [] }, process;
|
| 506 |
+
if (t === "") {
|
| 507 |
+
query.callback(data());
|
| 508 |
+
return;
|
| 509 |
+
}
|
| 510 |
+
|
| 511 |
+
process = function(datum, collection) {
|
| 512 |
+
var group, attr;
|
| 513 |
+
datum = datum[0];
|
| 514 |
+
if (datum.children) {
|
| 515 |
+
group = {};
|
| 516 |
+
for (attr in datum) {
|
| 517 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 518 |
+
}
|
| 519 |
+
group.children=[];
|
| 520 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 521 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 522 |
+
collection.push(group);
|
| 523 |
+
}
|
| 524 |
+
} else {
|
| 525 |
+
if (query.matcher(t, text(datum), datum)) {
|
| 526 |
+
collection.push(datum);
|
| 527 |
+
}
|
| 528 |
+
}
|
| 529 |
+
};
|
| 530 |
+
|
| 531 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 532 |
+
query.callback(filtered);
|
| 533 |
+
};
|
| 534 |
+
}
|
| 535 |
+
|
| 536 |
+
// TODO javadoc
|
| 537 |
+
function tags(data) {
|
| 538 |
+
var isFunc = $.isFunction(data);
|
| 539 |
+
return function (query) {
|
| 540 |
+
var t = query.term, filtered = {results: []};
|
| 541 |
+
var result = isFunc ? data(query) : data;
|
| 542 |
+
if ($.isArray(result)) {
|
| 543 |
+
$(result).each(function () {
|
| 544 |
+
var isObject = this.text !== undefined,
|
| 545 |
+
text = isObject ? this.text : this;
|
| 546 |
+
if (t === "" || query.matcher(t, text)) {
|
| 547 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 548 |
+
}
|
| 549 |
+
});
|
| 550 |
+
query.callback(filtered);
|
| 551 |
+
}
|
| 552 |
+
};
|
| 553 |
+
}
|
| 554 |
+
|
| 555 |
+
/**
|
| 556 |
+
* Checks if the formatter function should be used.
|
| 557 |
+
*
|
| 558 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
| 559 |
+
* false if no formatting should be performed.
|
| 560 |
+
*
|
| 561 |
+
* @param formatter
|
| 562 |
+
*/
|
| 563 |
+
function checkFormatter(formatter, formatterName) {
|
| 564 |
+
if ($.isFunction(formatter)) return true;
|
| 565 |
+
if (!formatter) return false;
|
| 566 |
+
if (typeof(formatter) === 'string') return true;
|
| 567 |
+
throw new Error(formatterName +" must be a string, function, or falsy value");
|
| 568 |
+
}
|
| 569 |
+
|
| 570 |
+
/**
|
| 571 |
+
* Returns a given value
|
| 572 |
+
* If given a function, returns its output
|
| 573 |
+
*
|
| 574 |
+
* @param val string|function
|
| 575 |
+
* @param context value of "this" to be passed to function
|
| 576 |
+
* @returns {*}
|
| 577 |
+
*/
|
| 578 |
+
function evaluate(val, context) {
|
| 579 |
+
if ($.isFunction(val)) {
|
| 580 |
+
var args = Array.prototype.slice.call(arguments, 2);
|
| 581 |
+
return val.apply(context, args);
|
| 582 |
+
}
|
| 583 |
+
return val;
|
| 584 |
+
}
|
| 585 |
+
|
| 586 |
+
function countResults(results) {
|
| 587 |
+
var count = 0;
|
| 588 |
+
$.each(results, function(i, item) {
|
| 589 |
+
if (item.children) {
|
| 590 |
+
count += countResults(item.children);
|
| 591 |
+
} else {
|
| 592 |
+
count++;
|
| 593 |
+
}
|
| 594 |
+
});
|
| 595 |
+
return count;
|
| 596 |
+
}
|
| 597 |
+
|
| 598 |
+
/**
|
| 599 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 600 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 601 |
+
* two options have to be defined in order for the tokenizer to work.
|
| 602 |
+
*
|
| 603 |
+
* @param input text user has typed so far or pasted into the search field
|
| 604 |
+
* @param selection currently selected choices
|
| 605 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 606 |
+
* @param opts select2's opts
|
| 607 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 608 |
+
*/
|
| 609 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 610 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 611 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 612 |
+
token, // token
|
| 613 |
+
index, // position at which the separator was found
|
| 614 |
+
i, l, // looping variables
|
| 615 |
+
separator; // the matched separator
|
| 616 |
+
|
| 617 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 618 |
+
|
| 619 |
+
while (true) {
|
| 620 |
+
index = -1;
|
| 621 |
+
|
| 622 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 623 |
+
separator = opts.tokenSeparators[i];
|
| 624 |
+
index = input.indexOf(separator);
|
| 625 |
+
if (index >= 0) break;
|
| 626 |
+
}
|
| 627 |
+
|
| 628 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 629 |
+
|
| 630 |
+
token = input.substring(0, index);
|
| 631 |
+
input = input.substring(index + separator.length);
|
| 632 |
+
|
| 633 |
+
if (token.length > 0) {
|
| 634 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
| 635 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 636 |
+
dupe = false;
|
| 637 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
| 638 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 639 |
+
dupe = true; break;
|
| 640 |
+
}
|
| 641 |
+
}
|
| 642 |
+
|
| 643 |
+
if (!dupe) selectCallback(token);
|
| 644 |
+
}
|
| 645 |
+
}
|
| 646 |
+
}
|
| 647 |
+
|
| 648 |
+
if (original!==input) return input;
|
| 649 |
+
}
|
| 650 |
+
|
| 651 |
+
function cleanupJQueryElements() {
|
| 652 |
+
var self = this;
|
| 653 |
+
|
| 654 |
+
$.each(arguments, function (i, element) {
|
| 655 |
+
self[element].remove();
|
| 656 |
+
self[element] = null;
|
| 657 |
+
});
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
/**
|
| 661 |
+
* Creates a new class
|
| 662 |
+
*
|
| 663 |
+
* @param superClass
|
| 664 |
+
* @param methods
|
| 665 |
+
*/
|
| 666 |
+
function clazz(SuperClass, methods) {
|
| 667 |
+
var constructor = function () {};
|
| 668 |
+
constructor.prototype = new SuperClass;
|
| 669 |
+
constructor.prototype.constructor = constructor;
|
| 670 |
+
constructor.prototype.parent = SuperClass.prototype;
|
| 671 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 672 |
+
return constructor;
|
| 673 |
+
}
|
| 674 |
+
|
| 675 |
+
AbstractSelect2 = clazz(Object, {
|
| 676 |
+
|
| 677 |
+
// abstract
|
| 678 |
+
bind: function (func) {
|
| 679 |
+
var self = this;
|
| 680 |
+
return function () {
|
| 681 |
+
func.apply(self, arguments);
|
| 682 |
+
};
|
| 683 |
+
},
|
| 684 |
+
|
| 685 |
+
// abstract
|
| 686 |
+
init: function (opts) {
|
| 687 |
+
var results, search, resultsSelector = ".select2-results";
|
| 688 |
+
|
| 689 |
+
// prepare options
|
| 690 |
+
this.opts = opts = this.prepareOpts(opts);
|
| 691 |
+
|
| 692 |
+
this.id=opts.id;
|
| 693 |
+
|
| 694 |
+
// destroy if called on an existing component
|
| 695 |
+
if (opts.element.data("select2") !== undefined &&
|
| 696 |
+
opts.element.data("select2") !== null) {
|
| 697 |
+
opts.element.data("select2").destroy();
|
| 698 |
+
}
|
| 699 |
+
|
| 700 |
+
this.container = this.createContainer();
|
| 701 |
+
|
| 702 |
+
this.liveRegion = $('.select2-hidden-accessible');
|
| 703 |
+
if (this.liveRegion.length == 0) {
|
| 704 |
+
this.liveRegion = $("<span>", {
|
| 705 |
+
role: "status",
|
| 706 |
+
"aria-live": "polite"
|
| 707 |
+
})
|
| 708 |
+
.addClass("select2-hidden-accessible")
|
| 709 |
+
.appendTo(document.body);
|
| 710 |
+
}
|
| 711 |
+
|
| 712 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 713 |
+
this.containerEventName= this.containerId
|
| 714 |
+
.replace(/([.])/g, '_')
|
| 715 |
+
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 716 |
+
this.container.attr("id", this.containerId);
|
| 717 |
+
|
| 718 |
+
this.container.attr("title", opts.element.attr("title"));
|
| 719 |
+
|
| 720 |
+
this.body = $(document.body);
|
| 721 |
+
|
| 722 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 723 |
+
|
| 724 |
+
this.container.attr("style", opts.element.attr("style"));
|
| 725 |
+
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
| 726 |
+
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
| 727 |
+
|
| 728 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 729 |
+
|
| 730 |
+
// swap container for the element
|
| 731 |
+
this.opts.element
|
| 732 |
+
.data("select2", this)
|
| 733 |
+
.attr("tabindex", "-1")
|
| 734 |
+
.before(this.container)
|
| 735 |
+
.on("click.select2", killEvent); // do not leak click events
|
| 736 |
+
|
| 737 |
+
this.container.data("select2", this);
|
| 738 |
+
|
| 739 |
+
this.dropdown = this.container.find(".select2-drop");
|
| 740 |
+
|
| 741 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 742 |
+
|
| 743 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
| 744 |
+
this.dropdown.data("select2", this);
|
| 745 |
+
this.dropdown.on("click", killEvent);
|
| 746 |
+
|
| 747 |
+
this.results = results = this.container.find(resultsSelector);
|
| 748 |
+
this.search = search = this.container.find("input.select2-input");
|
| 749 |
+
|
| 750 |
+
this.queryCount = 0;
|
| 751 |
+
this.resultsPage = 0;
|
| 752 |
+
this.context = null;
|
| 753 |
+
|
| 754 |
+
// initialize the container
|
| 755 |
+
this.initContainer();
|
| 756 |
+
|
| 757 |
+
this.container.on("click", killEvent);
|
| 758 |
+
|
| 759 |
+
installFilteredMouseMove(this.results);
|
| 760 |
+
|
| 761 |
+
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 762 |
+
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
| 763 |
+
this._touchEvent = true;
|
| 764 |
+
this.highlightUnderEvent(event);
|
| 765 |
+
}));
|
| 766 |
+
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
| 767 |
+
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
| 768 |
+
|
| 769 |
+
// Waiting for a click event on touch devices to select option and hide dropdown
|
| 770 |
+
// otherwise click will be triggered on an underlying element
|
| 771 |
+
this.dropdown.on('click', this.bind(function (event) {
|
| 772 |
+
if (this._touchEvent) {
|
| 773 |
+
this._touchEvent = false;
|
| 774 |
+
this.selectHighlighted();
|
| 775 |
+
}
|
| 776 |
+
}));
|
| 777 |
+
|
| 778 |
+
installDebouncedScroll(80, this.results);
|
| 779 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 780 |
+
|
| 781 |
+
// do not propagate change event from the search field out of the component
|
| 782 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 783 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 784 |
+
|
| 785 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 786 |
+
if ($.fn.mousewheel) {
|
| 787 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 788 |
+
var top = results.scrollTop();
|
| 789 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
| 790 |
+
results.scrollTop(0);
|
| 791 |
+
killEvent(e);
|
| 792 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 793 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 794 |
+
killEvent(e);
|
| 795 |
+
}
|
| 796 |
+
});
|
| 797 |
+
}
|
| 798 |
+
|
| 799 |
+
installKeyUpChangeEvent(search);
|
| 800 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 801 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 802 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 803 |
+
|
| 804 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 805 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 806 |
+
this.highlightUnderEvent(e);
|
| 807 |
+
this.selectHighlighted(e);
|
| 808 |
+
}
|
| 809 |
+
}));
|
| 810 |
+
|
| 811 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 812 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 813 |
+
// dom it will trigger the popup close, which is not what we want
|
| 814 |
+
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
| 815 |
+
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
| 816 |
+
|
| 817 |
+
this.nextSearchTerm = undefined;
|
| 818 |
+
|
| 819 |
+
if ($.isFunction(this.opts.initSelection)) {
|
| 820 |
+
// initialize selection based on the current value of the source element
|
| 821 |
+
this.initSelection();
|
| 822 |
+
|
| 823 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
| 824 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 825 |
+
this.monitorSource();
|
| 826 |
+
}
|
| 827 |
+
|
| 828 |
+
if (opts.maximumInputLength !== null) {
|
| 829 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
| 830 |
+
}
|
| 831 |
+
|
| 832 |
+
var disabled = opts.element.prop("disabled");
|
| 833 |
+
if (disabled === undefined) disabled = false;
|
| 834 |
+
this.enable(!disabled);
|
| 835 |
+
|
| 836 |
+
var readonly = opts.element.prop("readonly");
|
| 837 |
+
if (readonly === undefined) readonly = false;
|
| 838 |
+
this.readonly(readonly);
|
| 839 |
+
|
| 840 |
+
// Calculate size of scrollbar
|
| 841 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 842 |
+
|
| 843 |
+
this.autofocus = opts.element.prop("autofocus");
|
| 844 |
+
opts.element.prop("autofocus", false);
|
| 845 |
+
if (this.autofocus) this.focus();
|
| 846 |
+
|
| 847 |
+
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
| 848 |
+
},
|
| 849 |
+
|
| 850 |
+
// abstract
|
| 851 |
+
destroy: function () {
|
| 852 |
+
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
| 853 |
+
|
| 854 |
+
this.close();
|
| 855 |
+
|
| 856 |
+
if (element.length && element[0].detachEvent && self._sync) {
|
| 857 |
+
element.each(function () {
|
| 858 |
+
if (self._sync) {
|
| 859 |
+
this.detachEvent("onpropertychange", self._sync);
|
| 860 |
+
}
|
| 861 |
+
});
|
| 862 |
+
}
|
| 863 |
+
if (this.propertyObserver) {
|
| 864 |
+
this.propertyObserver.disconnect();
|
| 865 |
+
this.propertyObserver = null;
|
| 866 |
+
}
|
| 867 |
+
this._sync = null;
|
| 868 |
+
|
| 869 |
+
if (select2 !== undefined) {
|
| 870 |
+
select2.container.remove();
|
| 871 |
+
select2.liveRegion.remove();
|
| 872 |
+
select2.dropdown.remove();
|
| 873 |
+
element
|
| 874 |
+
.show()
|
| 875 |
+
.removeData("select2")
|
| 876 |
+
.off(".select2")
|
| 877 |
+
.prop("autofocus", this.autofocus || false);
|
| 878 |
+
if (this.elementTabIndex) {
|
| 879 |
+
element.attr({tabindex: this.elementTabIndex});
|
| 880 |
+
} else {
|
| 881 |
+
element.removeAttr("tabindex");
|
| 882 |
+
}
|
| 883 |
+
element.show();
|
| 884 |
+
}
|
| 885 |
+
|
| 886 |
+
cleanupJQueryElements.call(this,
|
| 887 |
+
"container",
|
| 888 |
+
"liveRegion",
|
| 889 |
+
"dropdown",
|
| 890 |
+
"results",
|
| 891 |
+
"search"
|
| 892 |
+
);
|
| 893 |
+
},
|
| 894 |
+
|
| 895 |
+
// abstract
|
| 896 |
+
optionToData: function(element) {
|
| 897 |
+
if (element.is("option")) {
|
| 898 |
+
return {
|
| 899 |
+
id:element.prop("value"),
|
| 900 |
+
text:element.text(),
|
| 901 |
+
element: element.get(),
|
| 902 |
+
css: element.attr("class"),
|
| 903 |
+
disabled: element.prop("disabled"),
|
| 904 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 905 |
+
};
|
| 906 |
+
} else if (element.is("optgroup")) {
|
| 907 |
+
return {
|
| 908 |
+
text:element.attr("label"),
|
| 909 |
+
children:[],
|
| 910 |
+
element: element.get(),
|
| 911 |
+
css: element.attr("class")
|
| 912 |
+
};
|
| 913 |
+
}
|
| 914 |
+
},
|
| 915 |
+
|
| 916 |
+
// abstract
|
| 917 |
+
prepareOpts: function (opts) {
|
| 918 |
+
var element, select, idKey, ajaxUrl, self = this;
|
| 919 |
+
|
| 920 |
+
element = opts.element;
|
| 921 |
+
|
| 922 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 923 |
+
this.select = select = opts.element;
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
if (select) {
|
| 927 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 928 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 929 |
+
if (this in opts) {
|
| 930 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 931 |
+
}
|
| 932 |
+
});
|
| 933 |
+
}
|
| 934 |
+
|
| 935 |
+
opts = $.extend({}, {
|
| 936 |
+
populateResults: function(container, results, query) {
|
| 937 |
+
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
| 938 |
+
|
| 939 |
+
populate=function(results, container, depth) {
|
| 940 |
+
|
| 941 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 942 |
+
|
| 943 |
+
results = opts.sortResults(results, container, query);
|
| 944 |
+
|
| 945 |
+
// collect the created nodes for bulk append
|
| 946 |
+
var nodes = [];
|
| 947 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 948 |
+
|
| 949 |
+
result=results[i];
|
| 950 |
+
|
| 951 |
+
disabled = (result.disabled === true);
|
| 952 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
| 953 |
+
|
| 954 |
+
compound=result.children && result.children.length > 0;
|
| 955 |
+
|
| 956 |
+
node=$("<li></li>");
|
| 957 |
+
node.addClass("select2-results-dept-"+depth);
|
| 958 |
+
node.addClass("select2-result");
|
| 959 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 960 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
| 961 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
| 962 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
| 963 |
+
node.attr("role", "presentation");
|
| 964 |
+
|
| 965 |
+
label=$(document.createElement("div"));
|
| 966 |
+
label.addClass("select2-result-label");
|
| 967 |
+
label.attr("id", "select2-result-label-" + nextUid());
|
| 968 |
+
label.attr("role", "option");
|
| 969 |
+
|
| 970 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 971 |
+
if (formatted!==undefined) {
|
| 972 |
+
label.html(formatted);
|
| 973 |
+
node.append(label);
|
| 974 |
+
}
|
| 975 |
+
|
| 976 |
+
|
| 977 |
+
if (compound) {
|
| 978 |
+
|
| 979 |
+
innerContainer=$("<ul></ul>");
|
| 980 |
+
innerContainer.addClass("select2-result-sub");
|
| 981 |
+
populate(result.children, innerContainer, depth+1);
|
| 982 |
+
node.append(innerContainer);
|
| 983 |
+
}
|
| 984 |
+
|
| 985 |
+
node.data("select2-data", result);
|
| 986 |
+
nodes.push(node[0]);
|
| 987 |
+
}
|
| 988 |
+
|
| 989 |
+
// bulk append the created nodes
|
| 990 |
+
container.append(nodes);
|
| 991 |
+
liveRegion.text(opts.formatMatches(results.length));
|
| 992 |
+
};
|
| 993 |
+
|
| 994 |
+
populate(results, container, 0);
|
| 995 |
+
}
|
| 996 |
+
}, $.fn.select2.defaults, opts);
|
| 997 |
+
|
| 998 |
+
if (typeof(opts.id) !== "function") {
|
| 999 |
+
idKey = opts.id;
|
| 1000 |
+
opts.id = function (e) { return e[idKey]; };
|
| 1001 |
+
}
|
| 1002 |
+
|
| 1003 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 1004 |
+
if ("tags" in opts) {
|
| 1005 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 1006 |
+
}
|
| 1007 |
+
opts.tags=opts.element.data("select2Tags");
|
| 1008 |
+
}
|
| 1009 |
+
|
| 1010 |
+
if (select) {
|
| 1011 |
+
opts.query = this.bind(function (query) {
|
| 1012 |
+
var data = { results: [], more: false },
|
| 1013 |
+
term = query.term,
|
| 1014 |
+
children, placeholderOption, process;
|
| 1015 |
+
|
| 1016 |
+
process=function(element, collection) {
|
| 1017 |
+
var group;
|
| 1018 |
+
if (element.is("option")) {
|
| 1019 |
+
if (query.matcher(term, element.text(), element)) {
|
| 1020 |
+
collection.push(self.optionToData(element));
|
| 1021 |
+
}
|
| 1022 |
+
} else if (element.is("optgroup")) {
|
| 1023 |
+
group=self.optionToData(element);
|
| 1024 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 1025 |
+
if (group.children.length>0) {
|
| 1026 |
+
collection.push(group);
|
| 1027 |
+
}
|
| 1028 |
+
}
|
| 1029 |
+
};
|
| 1030 |
+
|
| 1031 |
+
children=element.children();
|
| 1032 |
+
|
| 1033 |
+
// ignore the placeholder option if there is one
|
| 1034 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 1035 |
+
placeholderOption = this.getPlaceholderOption();
|
| 1036 |
+
if (placeholderOption) {
|
| 1037 |
+
children=children.not(placeholderOption);
|
| 1038 |
+
}
|
| 1039 |
+
}
|
| 1040 |
+
|
| 1041 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
| 1042 |
+
|
| 1043 |
+
query.callback(data);
|
| 1044 |
+
});
|
| 1045 |
+
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
| 1046 |
+
opts.id=function(e) { return e.id; };
|
| 1047 |
+
} else {
|
| 1048 |
+
if (!("query" in opts)) {
|
| 1049 |
+
|
| 1050 |
+
if ("ajax" in opts) {
|
| 1051 |
+
ajaxUrl = opts.element.data("ajax-url");
|
| 1052 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 1053 |
+
opts.ajax.url = ajaxUrl;
|
| 1054 |
+
}
|
| 1055 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
| 1056 |
+
} else if ("data" in opts) {
|
| 1057 |
+
opts.query = local(opts.data);
|
| 1058 |
+
} else if ("tags" in opts) {
|
| 1059 |
+
opts.query = tags(opts.tags);
|
| 1060 |
+
if (opts.createSearchChoice === undefined) {
|
| 1061 |
+
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
| 1062 |
+
}
|
| 1063 |
+
if (opts.initSelection === undefined) {
|
| 1064 |
+
opts.initSelection = function (element, callback) {
|
| 1065 |
+
var data = [];
|
| 1066 |
+
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
| 1067 |
+
var obj = { id: this, text: this },
|
| 1068 |
+
tags = opts.tags;
|
| 1069 |
+
if ($.isFunction(tags)) tags=tags();
|
| 1070 |
+
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
| 1071 |
+
data.push(obj);
|
| 1072 |
+
});
|
| 1073 |
+
|
| 1074 |
+
callback(data);
|
| 1075 |
+
};
|
| 1076 |
+
}
|
| 1077 |
+
}
|
| 1078 |
+
}
|
| 1079 |
+
}
|
| 1080 |
+
if (typeof(opts.query) !== "function") {
|
| 1081 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 1082 |
+
}
|
| 1083 |
+
|
| 1084 |
+
if (opts.createSearchChoicePosition === 'top') {
|
| 1085 |
+
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
| 1086 |
+
}
|
| 1087 |
+
else if (opts.createSearchChoicePosition === 'bottom') {
|
| 1088 |
+
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
| 1089 |
+
}
|
| 1090 |
+
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
| 1091 |
+
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
| 1092 |
+
}
|
| 1093 |
+
|
| 1094 |
+
return opts;
|
| 1095 |
+
},
|
| 1096 |
+
|
| 1097 |
+
/**
|
| 1098 |
+
* Monitor the original element for changes and update select2 accordingly
|
| 1099 |
+
*/
|
| 1100 |
+
// abstract
|
| 1101 |
+
monitorSource: function () {
|
| 1102 |
+
var el = this.opts.element, observer, self = this;
|
| 1103 |
+
|
| 1104 |
+
el.on("change.select2", this.bind(function (e) {
|
| 1105 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 1106 |
+
this.initSelection();
|
| 1107 |
+
}
|
| 1108 |
+
}));
|
| 1109 |
+
|
| 1110 |
+
this._sync = this.bind(function () {
|
| 1111 |
+
|
| 1112 |
+
// sync enabled state
|
| 1113 |
+
var disabled = el.prop("disabled");
|
| 1114 |
+
if (disabled === undefined) disabled = false;
|
| 1115 |
+
this.enable(!disabled);
|
| 1116 |
+
|
| 1117 |
+
var readonly = el.prop("readonly");
|
| 1118 |
+
if (readonly === undefined) readonly = false;
|
| 1119 |
+
this.readonly(readonly);
|
| 1120 |
+
|
| 1121 |
+
if (this.container) {
|
| 1122 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 1123 |
+
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
| 1124 |
+
}
|
| 1125 |
+
|
| 1126 |
+
if (this.dropdown) {
|
| 1127 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1128 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
| 1129 |
+
}
|
| 1130 |
+
|
| 1131 |
+
});
|
| 1132 |
+
|
| 1133 |
+
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
| 1134 |
+
if (el.length && el[0].attachEvent) {
|
| 1135 |
+
el.each(function() {
|
| 1136 |
+
this.attachEvent("onpropertychange", self._sync);
|
| 1137 |
+
});
|
| 1138 |
+
}
|
| 1139 |
+
|
| 1140 |
+
// safari, chrome, firefox, IE11
|
| 1141 |
+
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
| 1142 |
+
if (observer !== undefined) {
|
| 1143 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1144 |
+
this.propertyObserver = new observer(function (mutations) {
|
| 1145 |
+
$.each(mutations, self._sync);
|
| 1146 |
+
});
|
| 1147 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1148 |
+
}
|
| 1149 |
+
},
|
| 1150 |
+
|
| 1151 |
+
// abstract
|
| 1152 |
+
triggerSelect: function(data) {
|
| 1153 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
| 1154 |
+
this.opts.element.trigger(evt);
|
| 1155 |
+
return !evt.isDefaultPrevented();
|
| 1156 |
+
},
|
| 1157 |
+
|
| 1158 |
+
/**
|
| 1159 |
+
* Triggers the change event on the source element
|
| 1160 |
+
*/
|
| 1161 |
+
// abstract
|
| 1162 |
+
triggerChange: function (details) {
|
| 1163 |
+
|
| 1164 |
+
details = details || {};
|
| 1165 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1166 |
+
// prevents recursive triggering
|
| 1167 |
+
this.opts.element.data("select2-change-triggered", true);
|
| 1168 |
+
this.opts.element.trigger(details);
|
| 1169 |
+
this.opts.element.data("select2-change-triggered", false);
|
| 1170 |
+
|
| 1171 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1172 |
+
// so here we trigger the click event manually
|
| 1173 |
+
this.opts.element.click();
|
| 1174 |
+
|
| 1175 |
+
// ValidationEngine ignores the change event and listens instead to blur
|
| 1176 |
+
// so here we trigger the blur event manually if so desired
|
| 1177 |
+
if (this.opts.blurOnChange)
|
| 1178 |
+
this.opts.element.blur();
|
| 1179 |
+
},
|
| 1180 |
+
|
| 1181 |
+
//abstract
|
| 1182 |
+
isInterfaceEnabled: function()
|
| 1183 |
+
{
|
| 1184 |
+
return this.enabledInterface === true;
|
| 1185 |
+
},
|
| 1186 |
+
|
| 1187 |
+
// abstract
|
| 1188 |
+
enableInterface: function() {
|
| 1189 |
+
var enabled = this._enabled && !this._readonly,
|
| 1190 |
+
disabled = !enabled;
|
| 1191 |
+
|
| 1192 |
+
if (enabled === this.enabledInterface) return false;
|
| 1193 |
+
|
| 1194 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1195 |
+
this.close();
|
| 1196 |
+
this.enabledInterface = enabled;
|
| 1197 |
+
|
| 1198 |
+
return true;
|
| 1199 |
+
},
|
| 1200 |
+
|
| 1201 |
+
// abstract
|
| 1202 |
+
enable: function(enabled) {
|
| 1203 |
+
if (enabled === undefined) enabled = true;
|
| 1204 |
+
if (this._enabled === enabled) return;
|
| 1205 |
+
this._enabled = enabled;
|
| 1206 |
+
|
| 1207 |
+
this.opts.element.prop("disabled", !enabled);
|
| 1208 |
+
this.enableInterface();
|
| 1209 |
+
},
|
| 1210 |
+
|
| 1211 |
+
// abstract
|
| 1212 |
+
disable: function() {
|
| 1213 |
+
this.enable(false);
|
| 1214 |
+
},
|
| 1215 |
+
|
| 1216 |
+
// abstract
|
| 1217 |
+
readonly: function(enabled) {
|
| 1218 |
+
if (enabled === undefined) enabled = false;
|
| 1219 |
+
if (this._readonly === enabled) return;
|
| 1220 |
+
this._readonly = enabled;
|
| 1221 |
+
|
| 1222 |
+
this.opts.element.prop("readonly", enabled);
|
| 1223 |
+
this.enableInterface();
|
| 1224 |
+
},
|
| 1225 |
+
|
| 1226 |
+
// abstract
|
| 1227 |
+
opened: function () {
|
| 1228 |
+
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
| 1229 |
+
},
|
| 1230 |
+
|
| 1231 |
+
// abstract
|
| 1232 |
+
positionDropdown: function() {
|
| 1233 |
+
var $dropdown = this.dropdown,
|
| 1234 |
+
container = this.container,
|
| 1235 |
+
offset = container.offset(),
|
| 1236 |
+
height = container.outerHeight(false),
|
| 1237 |
+
width = container.outerWidth(false),
|
| 1238 |
+
dropHeight = $dropdown.outerHeight(false),
|
| 1239 |
+
$window = $(window),
|
| 1240 |
+
windowWidth = $window.width(),
|
| 1241 |
+
windowHeight = $window.height(),
|
| 1242 |
+
viewPortRight = $window.scrollLeft() + windowWidth,
|
| 1243 |
+
viewportBottom = $window.scrollTop() + windowHeight,
|
| 1244 |
+
dropTop = offset.top + height,
|
| 1245 |
+
dropLeft = offset.left,
|
| 1246 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1247 |
+
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
| 1248 |
+
dropWidth = $dropdown.outerWidth(false),
|
| 1249 |
+
enoughRoomOnRight = function() {
|
| 1250 |
+
return dropLeft + dropWidth <= viewPortRight;
|
| 1251 |
+
},
|
| 1252 |
+
enoughRoomOnLeft = function() {
|
| 1253 |
+
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
| 1254 |
+
},
|
| 1255 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1256 |
+
bodyOffset,
|
| 1257 |
+
above,
|
| 1258 |
+
changeDirection,
|
| 1259 |
+
css,
|
| 1260 |
+
resultsListNode;
|
| 1261 |
+
|
| 1262 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
| 1263 |
+
if (aboveNow) {
|
| 1264 |
+
above = true;
|
| 1265 |
+
if (!enoughRoomAbove && enoughRoomBelow) {
|
| 1266 |
+
changeDirection = true;
|
| 1267 |
+
above = false;
|
| 1268 |
+
}
|
| 1269 |
+
} else {
|
| 1270 |
+
above = false;
|
| 1271 |
+
if (!enoughRoomBelow && enoughRoomAbove) {
|
| 1272 |
+
changeDirection = true;
|
| 1273 |
+
above = true;
|
| 1274 |
+
}
|
| 1275 |
+
}
|
| 1276 |
+
|
| 1277 |
+
//if we are changing direction we need to get positions when dropdown is hidden;
|
| 1278 |
+
if (changeDirection) {
|
| 1279 |
+
$dropdown.hide();
|
| 1280 |
+
offset = this.container.offset();
|
| 1281 |
+
height = this.container.outerHeight(false);
|
| 1282 |
+
width = this.container.outerWidth(false);
|
| 1283 |
+
dropHeight = $dropdown.outerHeight(false);
|
| 1284 |
+
viewPortRight = $window.scrollLeft() + windowWidth;
|
| 1285 |
+
viewportBottom = $window.scrollTop() + windowHeight;
|
| 1286 |
+
dropTop = offset.top + height;
|
| 1287 |
+
dropLeft = offset.left;
|
| 1288 |
+
dropWidth = $dropdown.outerWidth(false);
|
| 1289 |
+
$dropdown.show();
|
| 1290 |
+
|
| 1291 |
+
// fix so the cursor does not move to the left within the search-textbox in IE
|
| 1292 |
+
this.focusSearch();
|
| 1293 |
+
}
|
| 1294 |
+
|
| 1295 |
+
if (this.opts.dropdownAutoWidth) {
|
| 1296 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1297 |
+
$dropdown.addClass('select2-drop-auto-width');
|
| 1298 |
+
$dropdown.css('width', '');
|
| 1299 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1300 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1301 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1302 |
+
dropHeight = $dropdown.outerHeight(false);
|
| 1303 |
+
}
|
| 1304 |
+
else {
|
| 1305 |
+
this.container.removeClass('select2-drop-auto-width');
|
| 1306 |
+
}
|
| 1307 |
+
|
| 1308 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1309 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
| 1310 |
+
|
| 1311 |
+
// fix positioning when body has an offset and is not position: static
|
| 1312 |
+
if (this.body.css('position') !== 'static') {
|
| 1313 |
+
bodyOffset = this.body.offset();
|
| 1314 |
+
dropTop -= bodyOffset.top;
|
| 1315 |
+
dropLeft -= bodyOffset.left;
|
| 1316 |
+
}
|
| 1317 |
+
|
| 1318 |
+
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
| 1319 |
+
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
| 1320 |
+
}
|
| 1321 |
+
|
| 1322 |
+
css = {
|
| 1323 |
+
left: dropLeft,
|
| 1324 |
+
width: width
|
| 1325 |
+
};
|
| 1326 |
+
|
| 1327 |
+
if (above) {
|
| 1328 |
+
css.top = offset.top - dropHeight;
|
| 1329 |
+
css.bottom = 'auto';
|
| 1330 |
+
this.container.addClass("select2-drop-above");
|
| 1331 |
+
$dropdown.addClass("select2-drop-above");
|
| 1332 |
+
}
|
| 1333 |
+
else {
|
| 1334 |
+
css.top = dropTop;
|
| 1335 |
+
css.bottom = 'auto';
|
| 1336 |
+
this.container.removeClass("select2-drop-above");
|
| 1337 |
+
$dropdown.removeClass("select2-drop-above");
|
| 1338 |
+
}
|
| 1339 |
+
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
| 1340 |
+
|
| 1341 |
+
$dropdown.css(css);
|
| 1342 |
+
},
|
| 1343 |
+
|
| 1344 |
+
// abstract
|
| 1345 |
+
shouldOpen: function() {
|
| 1346 |
+
var event;
|
| 1347 |
+
|
| 1348 |
+
if (this.opened()) return false;
|
| 1349 |
+
|
| 1350 |
+
if (this._enabled === false || this._readonly === true) return false;
|
| 1351 |
+
|
| 1352 |
+
event = $.Event("select2-opening");
|
| 1353 |
+
this.opts.element.trigger(event);
|
| 1354 |
+
return !event.isDefaultPrevented();
|
| 1355 |
+
},
|
| 1356 |
+
|
| 1357 |
+
// abstract
|
| 1358 |
+
clearDropdownAlignmentPreference: function() {
|
| 1359 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1360 |
+
this.container.removeClass("select2-drop-above");
|
| 1361 |
+
this.dropdown.removeClass("select2-drop-above");
|
| 1362 |
+
},
|
| 1363 |
+
|
| 1364 |
+
/**
|
| 1365 |
+
* Opens the dropdown
|
| 1366 |
+
*
|
| 1367 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1368 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1369 |
+
*/
|
| 1370 |
+
// abstract
|
| 1371 |
+
open: function () {
|
| 1372 |
+
|
| 1373 |
+
if (!this.shouldOpen()) return false;
|
| 1374 |
+
|
| 1375 |
+
this.opening();
|
| 1376 |
+
|
| 1377 |
+
// Only bind the document mousemove when the dropdown is visible
|
| 1378 |
+
$document.on("mousemove.select2Event", function (e) {
|
| 1379 |
+
lastMousePosition.x = e.pageX;
|
| 1380 |
+
lastMousePosition.y = e.pageY;
|
| 1381 |
+
});
|
| 1382 |
+
|
| 1383 |
+
return true;
|
| 1384 |
+
},
|
| 1385 |
+
|
| 1386 |
+
/**
|
| 1387 |
+
* Performs the opening of the dropdown
|
| 1388 |
+
*/
|
| 1389 |
+
// abstract
|
| 1390 |
+
opening: function() {
|
| 1391 |
+
var cid = this.containerEventName,
|
| 1392 |
+
scroll = "scroll." + cid,
|
| 1393 |
+
resize = "resize."+cid,
|
| 1394 |
+
orient = "orientationchange."+cid,
|
| 1395 |
+
mask;
|
| 1396 |
+
|
| 1397 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1398 |
+
|
| 1399 |
+
this.clearDropdownAlignmentPreference();
|
| 1400 |
+
|
| 1401 |
+
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
| 1402 |
+
this.dropdown.detach().appendTo(this.body);
|
| 1403 |
+
}
|
| 1404 |
+
|
| 1405 |
+
// create the dropdown mask if doesn't already exist
|
| 1406 |
+
mask = $("#select2-drop-mask");
|
| 1407 |
+
if (mask.length === 0) {
|
| 1408 |
+
mask = $(document.createElement("div"));
|
| 1409 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1410 |
+
mask.hide();
|
| 1411 |
+
mask.appendTo(this.body);
|
| 1412 |
+
mask.on("mousedown touchstart click", function (e) {
|
| 1413 |
+
// Prevent IE from generating a click event on the body
|
| 1414 |
+
reinsertElement(mask);
|
| 1415 |
+
|
| 1416 |
+
var dropdown = $("#select2-drop"), self;
|
| 1417 |
+
if (dropdown.length > 0) {
|
| 1418 |
+
self=dropdown.data("select2");
|
| 1419 |
+
if (self.opts.selectOnBlur) {
|
| 1420 |
+
self.selectHighlighted({noFocus: true});
|
| 1421 |
+
}
|
| 1422 |
+
self.close();
|
| 1423 |
+
e.preventDefault();
|
| 1424 |
+
e.stopPropagation();
|
| 1425 |
+
}
|
| 1426 |
+
});
|
| 1427 |
+
}
|
| 1428 |
+
|
| 1429 |
+
// ensure the mask is always right before the dropdown
|
| 1430 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1431 |
+
this.dropdown.before(mask);
|
| 1432 |
+
}
|
| 1433 |
+
|
| 1434 |
+
// move the global id to the correct dropdown
|
| 1435 |
+
$("#select2-drop").removeAttr("id");
|
| 1436 |
+
this.dropdown.attr("id", "select2-drop");
|
| 1437 |
+
|
| 1438 |
+
// show the elements
|
| 1439 |
+
mask.show();
|
| 1440 |
+
|
| 1441 |
+
this.positionDropdown();
|
| 1442 |
+
this.dropdown.show();
|
| 1443 |
+
this.positionDropdown();
|
| 1444 |
+
|
| 1445 |
+
this.dropdown.addClass("select2-drop-active");
|
| 1446 |
+
|
| 1447 |
+
// attach listeners to events that can change the position of the container and thus require
|
| 1448 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1449 |
+
var that = this;
|
| 1450 |
+
this.container.parents().add(window).each(function () {
|
| 1451 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1452 |
+
if (that.opened()) that.positionDropdown();
|
| 1453 |
+
});
|
| 1454 |
+
});
|
| 1455 |
+
|
| 1456 |
+
|
| 1457 |
+
},
|
| 1458 |
+
|
| 1459 |
+
// abstract
|
| 1460 |
+
close: function () {
|
| 1461 |
+
if (!this.opened()) return;
|
| 1462 |
+
|
| 1463 |
+
var cid = this.containerEventName,
|
| 1464 |
+
scroll = "scroll." + cid,
|
| 1465 |
+
resize = "resize."+cid,
|
| 1466 |
+
orient = "orientationchange."+cid;
|
| 1467 |
+
|
| 1468 |
+
// unbind event listeners
|
| 1469 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1470 |
+
|
| 1471 |
+
this.clearDropdownAlignmentPreference();
|
| 1472 |
+
|
| 1473 |
+
$("#select2-drop-mask").hide();
|
| 1474 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1475 |
+
this.dropdown.hide();
|
| 1476 |
+
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
| 1477 |
+
this.results.empty();
|
| 1478 |
+
|
| 1479 |
+
// Now that the dropdown is closed, unbind the global document mousemove event
|
| 1480 |
+
$document.off("mousemove.select2Event");
|
| 1481 |
+
|
| 1482 |
+
this.clearSearch();
|
| 1483 |
+
this.search.removeClass("select2-active");
|
| 1484 |
+
this.opts.element.trigger($.Event("select2-close"));
|
| 1485 |
+
},
|
| 1486 |
+
|
| 1487 |
+
/**
|
| 1488 |
+
* Opens control, sets input value, and updates results.
|
| 1489 |
+
*/
|
| 1490 |
+
// abstract
|
| 1491 |
+
externalSearch: function (term) {
|
| 1492 |
+
this.open();
|
| 1493 |
+
this.search.val(term);
|
| 1494 |
+
this.updateResults(false);
|
| 1495 |
+
},
|
| 1496 |
+
|
| 1497 |
+
// abstract
|
| 1498 |
+
clearSearch: function () {
|
| 1499 |
+
|
| 1500 |
+
},
|
| 1501 |
+
|
| 1502 |
+
//abstract
|
| 1503 |
+
getMaximumSelectionSize: function() {
|
| 1504 |
+
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
| 1505 |
+
},
|
| 1506 |
+
|
| 1507 |
+
// abstract
|
| 1508 |
+
ensureHighlightVisible: function () {
|
| 1509 |
+
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
| 1510 |
+
|
| 1511 |
+
index = this.highlight();
|
| 1512 |
+
|
| 1513 |
+
if (index < 0) return;
|
| 1514 |
+
|
| 1515 |
+
if (index == 0) {
|
| 1516 |
+
|
| 1517 |
+
// if the first element is highlighted scroll all the way to the top,
|
| 1518 |
+
// that way any unselectable headers above it will also be scrolled
|
| 1519 |
+
// into view
|
| 1520 |
+
|
| 1521 |
+
results.scrollTop(0);
|
| 1522 |
+
return;
|
| 1523 |
+
}
|
| 1524 |
+
|
| 1525 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1526 |
+
|
| 1527 |
+
child = $(children[index]);
|
| 1528 |
+
|
| 1529 |
+
topOffset = (child.offset() || {}).top || 0;
|
| 1530 |
+
|
| 1531 |
+
hb = topOffset + child.outerHeight(true);
|
| 1532 |
+
|
| 1533 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
| 1534 |
+
if (index === children.length - 1) {
|
| 1535 |
+
more = results.find("li.select2-more-results");
|
| 1536 |
+
if (more.length > 0) {
|
| 1537 |
+
hb = more.offset().top + more.outerHeight(true);
|
| 1538 |
+
}
|
| 1539 |
+
}
|
| 1540 |
+
|
| 1541 |
+
rb = results.offset().top + results.outerHeight(false);
|
| 1542 |
+
if (hb > rb) {
|
| 1543 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1544 |
+
}
|
| 1545 |
+
y = topOffset - results.offset().top;
|
| 1546 |
+
|
| 1547 |
+
// make sure the top of the element is visible
|
| 1548 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
| 1549 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1550 |
+
}
|
| 1551 |
+
},
|
| 1552 |
+
|
| 1553 |
+
// abstract
|
| 1554 |
+
findHighlightableChoices: function() {
|
| 1555 |
+
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
| 1556 |
+
},
|
| 1557 |
+
|
| 1558 |
+
// abstract
|
| 1559 |
+
moveHighlight: function (delta) {
|
| 1560 |
+
var choices = this.findHighlightableChoices(),
|
| 1561 |
+
index = this.highlight();
|
| 1562 |
+
|
| 1563 |
+
while (index > -1 && index < choices.length) {
|
| 1564 |
+
index += delta;
|
| 1565 |
+
var choice = $(choices[index]);
|
| 1566 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1567 |
+
this.highlight(index);
|
| 1568 |
+
break;
|
| 1569 |
+
}
|
| 1570 |
+
}
|
| 1571 |
+
},
|
| 1572 |
+
|
| 1573 |
+
// abstract
|
| 1574 |
+
highlight: function (index) {
|
| 1575 |
+
var choices = this.findHighlightableChoices(),
|
| 1576 |
+
choice,
|
| 1577 |
+
data;
|
| 1578 |
+
|
| 1579 |
+
if (arguments.length === 0) {
|
| 1580 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1581 |
+
}
|
| 1582 |
+
|
| 1583 |
+
if (index >= choices.length) index = choices.length - 1;
|
| 1584 |
+
if (index < 0) index = 0;
|
| 1585 |
+
|
| 1586 |
+
this.removeHighlight();
|
| 1587 |
+
|
| 1588 |
+
choice = $(choices[index]);
|
| 1589 |
+
choice.addClass("select2-highlighted");
|
| 1590 |
+
|
| 1591 |
+
// ensure assistive technology can determine the active choice
|
| 1592 |
+
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
| 1593 |
+
|
| 1594 |
+
this.ensureHighlightVisible();
|
| 1595 |
+
|
| 1596 |
+
this.liveRegion.text(choice.text());
|
| 1597 |
+
|
| 1598 |
+
data = choice.data("select2-data");
|
| 1599 |
+
if (data) {
|
| 1600 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1601 |
+
}
|
| 1602 |
+
},
|
| 1603 |
+
|
| 1604 |
+
removeHighlight: function() {
|
| 1605 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1606 |
+
},
|
| 1607 |
+
|
| 1608 |
+
touchMoved: function() {
|
| 1609 |
+
this._touchMoved = true;
|
| 1610 |
+
},
|
| 1611 |
+
|
| 1612 |
+
clearTouchMoved: function() {
|
| 1613 |
+
this._touchMoved = false;
|
| 1614 |
+
},
|
| 1615 |
+
|
| 1616 |
+
// abstract
|
| 1617 |
+
countSelectableResults: function() {
|
| 1618 |
+
return this.findHighlightableChoices().length;
|
| 1619 |
+
},
|
| 1620 |
+
|
| 1621 |
+
// abstract
|
| 1622 |
+
highlightUnderEvent: function (event) {
|
| 1623 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
| 1624 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1625 |
+
var choices = this.findHighlightableChoices();
|
| 1626 |
+
this.highlight(choices.index(el));
|
| 1627 |
+
} else if (el.length == 0) {
|
| 1628 |
+
// if we are over an unselectable item remove all highlights
|
| 1629 |
+
this.removeHighlight();
|
| 1630 |
+
}
|
| 1631 |
+
},
|
| 1632 |
+
|
| 1633 |
+
// abstract
|
| 1634 |
+
loadMoreIfNeeded: function () {
|
| 1635 |
+
var results = this.results,
|
| 1636 |
+
more = results.find("li.select2-more-results"),
|
| 1637 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1638 |
+
page = this.resultsPage + 1,
|
| 1639 |
+
self=this,
|
| 1640 |
+
term=this.search.val(),
|
| 1641 |
+
context=this.context;
|
| 1642 |
+
|
| 1643 |
+
if (more.length === 0) return;
|
| 1644 |
+
below = more.offset().top - results.offset().top - results.height();
|
| 1645 |
+
|
| 1646 |
+
if (below <= this.opts.loadMorePadding) {
|
| 1647 |
+
more.addClass("select2-active");
|
| 1648 |
+
this.opts.query({
|
| 1649 |
+
element: this.opts.element,
|
| 1650 |
+
term: term,
|
| 1651 |
+
page: page,
|
| 1652 |
+
context: context,
|
| 1653 |
+
matcher: this.opts.matcher,
|
| 1654 |
+
callback: this.bind(function (data) {
|
| 1655 |
+
|
| 1656 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1657 |
+
if (!self.opened()) return;
|
| 1658 |
+
|
| 1659 |
+
|
| 1660 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1661 |
+
self.postprocessResults(data, false, false);
|
| 1662 |
+
|
| 1663 |
+
if (data.more===true) {
|
| 1664 |
+
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
| 1665 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1666 |
+
} else {
|
| 1667 |
+
more.remove();
|
| 1668 |
+
}
|
| 1669 |
+
self.positionDropdown();
|
| 1670 |
+
self.resultsPage = page;
|
| 1671 |
+
self.context = data.context;
|
| 1672 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1673 |
+
})});
|
| 1674 |
+
}
|
| 1675 |
+
},
|
| 1676 |
+
|
| 1677 |
+
/**
|
| 1678 |
+
* Default tokenizer function which does nothing
|
| 1679 |
+
*/
|
| 1680 |
+
tokenize: function() {
|
| 1681 |
+
|
| 1682 |
+
},
|
| 1683 |
+
|
| 1684 |
+
/**
|
| 1685 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1686 |
+
*/
|
| 1687 |
+
// abstract
|
| 1688 |
+
updateResults: function (initial) {
|
| 1689 |
+
var search = this.search,
|
| 1690 |
+
results = this.results,
|
| 1691 |
+
opts = this.opts,
|
| 1692 |
+
data,
|
| 1693 |
+
self = this,
|
| 1694 |
+
input,
|
| 1695 |
+
term = search.val(),
|
| 1696 |
+
lastTerm = $.data(this.container, "select2-last-term"),
|
| 1697 |
+
// sequence number used to drop out-of-order responses
|
| 1698 |
+
queryNumber;
|
| 1699 |
+
|
| 1700 |
+
// prevent duplicate queries against the same term
|
| 1701 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1702 |
+
|
| 1703 |
+
$.data(this.container, "select2-last-term", term);
|
| 1704 |
+
|
| 1705 |
+
// if the search is currently hidden we do not alter the results
|
| 1706 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1707 |
+
return;
|
| 1708 |
+
}
|
| 1709 |
+
|
| 1710 |
+
function postRender() {
|
| 1711 |
+
search.removeClass("select2-active");
|
| 1712 |
+
self.positionDropdown();
|
| 1713 |
+
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
| 1714 |
+
self.liveRegion.text(results.text());
|
| 1715 |
+
}
|
| 1716 |
+
else {
|
| 1717 |
+
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
| 1718 |
+
}
|
| 1719 |
+
}
|
| 1720 |
+
|
| 1721 |
+
function render(html) {
|
| 1722 |
+
results.html(html);
|
| 1723 |
+
postRender();
|
| 1724 |
+
}
|
| 1725 |
+
|
| 1726 |
+
queryNumber = ++this.queryCount;
|
| 1727 |
+
|
| 1728 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
| 1729 |
+
if (maxSelSize >=1) {
|
| 1730 |
+
data = this.data();
|
| 1731 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1732 |
+
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
| 1733 |
+
return;
|
| 1734 |
+
}
|
| 1735 |
+
}
|
| 1736 |
+
|
| 1737 |
+
if (search.val().length < opts.minimumInputLength) {
|
| 1738 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1739 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
| 1740 |
+
} else {
|
| 1741 |
+
render("");
|
| 1742 |
+
}
|
| 1743 |
+
if (initial && this.showSearch) this.showSearch(true);
|
| 1744 |
+
return;
|
| 1745 |
+
}
|
| 1746 |
+
|
| 1747 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1748 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1749 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
| 1750 |
+
} else {
|
| 1751 |
+
render("");
|
| 1752 |
+
}
|
| 1753 |
+
return;
|
| 1754 |
+
}
|
| 1755 |
+
|
| 1756 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1757 |
+
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
| 1758 |
+
}
|
| 1759 |
+
|
| 1760 |
+
search.addClass("select2-active");
|
| 1761 |
+
|
| 1762 |
+
this.removeHighlight();
|
| 1763 |
+
|
| 1764 |
+
// give the tokenizer a chance to pre-process the input
|
| 1765 |
+
input = this.tokenize();
|
| 1766 |
+
if (input != undefined && input != null) {
|
| 1767 |
+
search.val(input);
|
| 1768 |
+
}
|
| 1769 |
+
|
| 1770 |
+
this.resultsPage = 1;
|
| 1771 |
+
|
| 1772 |
+
opts.query({
|
| 1773 |
+
element: opts.element,
|
| 1774 |
+
term: search.val(),
|
| 1775 |
+
page: this.resultsPage,
|
| 1776 |
+
context: null,
|
| 1777 |
+
matcher: opts.matcher,
|
| 1778 |
+
callback: this.bind(function (data) {
|
| 1779 |
+
var def; // default choice
|
| 1780 |
+
|
| 1781 |
+
// ignore old responses
|
| 1782 |
+
if (queryNumber != this.queryCount) {
|
| 1783 |
+
return;
|
| 1784 |
+
}
|
| 1785 |
+
|
| 1786 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1787 |
+
if (!this.opened()) {
|
| 1788 |
+
this.search.removeClass("select2-active");
|
| 1789 |
+
return;
|
| 1790 |
+
}
|
| 1791 |
+
|
| 1792 |
+
// handle ajax error
|
| 1793 |
+
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
| 1794 |
+
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
| 1795 |
+
return;
|
| 1796 |
+
}
|
| 1797 |
+
|
| 1798 |
+
// save context, if any
|
| 1799 |
+
this.context = (data.context===undefined) ? null : data.context;
|
| 1800 |
+
// create a default choice and prepend it to the list
|
| 1801 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1802 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1803 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1804 |
+
if ($(data.results).filter(
|
| 1805 |
+
function () {
|
| 1806 |
+
return equal(self.id(this), self.id(def));
|
| 1807 |
+
}).length === 0) {
|
| 1808 |
+
this.opts.createSearchChoicePosition(data.results, def);
|
| 1809 |
+
}
|
| 1810 |
+
}
|
| 1811 |
+
}
|
| 1812 |
+
|
| 1813 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1814 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
| 1815 |
+
return;
|
| 1816 |
+
}
|
| 1817 |
+
|
| 1818 |
+
results.empty();
|
| 1819 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1820 |
+
|
| 1821 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1822 |
+
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
| 1823 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1824 |
+
}
|
| 1825 |
+
|
| 1826 |
+
this.postprocessResults(data, initial);
|
| 1827 |
+
|
| 1828 |
+
postRender();
|
| 1829 |
+
|
| 1830 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1831 |
+
})});
|
| 1832 |
+
},
|
| 1833 |
+
|
| 1834 |
+
// abstract
|
| 1835 |
+
cancel: function () {
|
| 1836 |
+
this.close();
|
| 1837 |
+
},
|
| 1838 |
+
|
| 1839 |
+
// abstract
|
| 1840 |
+
blur: function () {
|
| 1841 |
+
// if selectOnBlur == true, select the currently highlighted option
|
| 1842 |
+
if (this.opts.selectOnBlur)
|
| 1843 |
+
this.selectHighlighted({noFocus: true});
|
| 1844 |
+
|
| 1845 |
+
this.close();
|
| 1846 |
+
this.container.removeClass("select2-container-active");
|
| 1847 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1848 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1849 |
+
this.clearSearch();
|
| 1850 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1851 |
+
},
|
| 1852 |
+
|
| 1853 |
+
// abstract
|
| 1854 |
+
focusSearch: function () {
|
| 1855 |
+
focus(this.search);
|
| 1856 |
+
},
|
| 1857 |
+
|
| 1858 |
+
// abstract
|
| 1859 |
+
selectHighlighted: function (options) {
|
| 1860 |
+
if (this._touchMoved) {
|
| 1861 |
+
this.clearTouchMoved();
|
| 1862 |
+
return;
|
| 1863 |
+
}
|
| 1864 |
+
var index=this.highlight(),
|
| 1865 |
+
highlighted=this.results.find(".select2-highlighted"),
|
| 1866 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1867 |
+
|
| 1868 |
+
if (data) {
|
| 1869 |
+
this.highlight(index);
|
| 1870 |
+
this.onSelect(data, options);
|
| 1871 |
+
} else if (options && options.noFocus) {
|
| 1872 |
+
this.close();
|
| 1873 |
+
}
|
| 1874 |
+
},
|
| 1875 |
+
|
| 1876 |
+
// abstract
|
| 1877 |
+
getPlaceholder: function () {
|
| 1878 |
+
var placeholderOption;
|
| 1879 |
+
return this.opts.element.attr("placeholder") ||
|
| 1880 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1881 |
+
this.opts.element.data("placeholder") ||
|
| 1882 |
+
this.opts.placeholder ||
|
| 1883 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1884 |
+
},
|
| 1885 |
+
|
| 1886 |
+
// abstract
|
| 1887 |
+
getPlaceholderOption: function() {
|
| 1888 |
+
if (this.select) {
|
| 1889 |
+
var firstOption = this.select.children('option').first();
|
| 1890 |
+
if (this.opts.placeholderOption !== undefined ) {
|
| 1891 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1892 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1893 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1894 |
+
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
| 1895 |
+
//No explicit placeholder option specified, use the first if it's blank
|
| 1896 |
+
return firstOption;
|
| 1897 |
+
}
|
| 1898 |
+
}
|
| 1899 |
+
},
|
| 1900 |
+
|
| 1901 |
+
/**
|
| 1902 |
+
* Get the desired width for the container element. This is
|
| 1903 |
+
* derived first from option `width` passed to select2, then
|
| 1904 |
+
* the inline 'style' on the original element, and finally
|
| 1905 |
+
* falls back to the jQuery calculated element width.
|
| 1906 |
+
*/
|
| 1907 |
+
// abstract
|
| 1908 |
+
initContainerWidth: function () {
|
| 1909 |
+
function resolveContainerWidth() {
|
| 1910 |
+
var style, attrs, matches, i, l, attr;
|
| 1911 |
+
|
| 1912 |
+
if (this.opts.width === "off") {
|
| 1913 |
+
return null;
|
| 1914 |
+
} else if (this.opts.width === "element"){
|
| 1915 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1916 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1917 |
+
// check if there is inline style on the element that contains width
|
| 1918 |
+
style = this.opts.element.attr('style');
|
| 1919 |
+
if (style !== undefined) {
|
| 1920 |
+
attrs = style.split(';');
|
| 1921 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1922 |
+
attr = attrs[i].replace(/\s/g, '');
|
| 1923 |
+
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1924 |
+
if (matches !== null && matches.length >= 1)
|
| 1925 |
+
return matches[1];
|
| 1926 |
+
}
|
| 1927 |
+
}
|
| 1928 |
+
|
| 1929 |
+
if (this.opts.width === "resolve") {
|
| 1930 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1931 |
+
// when attached to input type=hidden or elements hidden via css
|
| 1932 |
+
style = this.opts.element.css('width');
|
| 1933 |
+
if (style.indexOf("%") > 0) return style;
|
| 1934 |
+
|
| 1935 |
+
// finally, fallback on the calculated width of the element
|
| 1936 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1937 |
+
}
|
| 1938 |
+
|
| 1939 |
+
return null;
|
| 1940 |
+
} else if ($.isFunction(this.opts.width)) {
|
| 1941 |
+
return this.opts.width();
|
| 1942 |
+
} else {
|
| 1943 |
+
return this.opts.width;
|
| 1944 |
+
}
|
| 1945 |
+
};
|
| 1946 |
+
|
| 1947 |
+
var width = resolveContainerWidth.call(this);
|
| 1948 |
+
if (width !== null) {
|
| 1949 |
+
this.container.css("width", width);
|
| 1950 |
+
}
|
| 1951 |
+
}
|
| 1952 |
+
});
|
| 1953 |
+
|
| 1954 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1955 |
+
|
| 1956 |
+
// single
|
| 1957 |
+
|
| 1958 |
+
createContainer: function () {
|
| 1959 |
+
var container = $(document.createElement("div")).attr({
|
| 1960 |
+
"class": "select2-container"
|
| 1961 |
+
}).html([
|
| 1962 |
+
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
| 1963 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1964 |
+
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
| 1965 |
+
"</a>",
|
| 1966 |
+
"<label for='' class='select2-offscreen'></label>",
|
| 1967 |
+
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
| 1968 |
+
"<div class='select2-drop select2-display-none'>",
|
| 1969 |
+
" <div class='select2-search'>",
|
| 1970 |
+
" <label for='' class='select2-offscreen'></label>",
|
| 1971 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
| 1972 |
+
" aria-autocomplete='list' />",
|
| 1973 |
+
" </div>",
|
| 1974 |
+
" <ul class='select2-results' role='listbox'>",
|
| 1975 |
+
" </ul>",
|
| 1976 |
+
"</div>"].join(""));
|
| 1977 |
+
return container;
|
| 1978 |
+
},
|
| 1979 |
+
|
| 1980 |
+
// single
|
| 1981 |
+
enableInterface: function() {
|
| 1982 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1983 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1984 |
+
}
|
| 1985 |
+
},
|
| 1986 |
+
|
| 1987 |
+
// single
|
| 1988 |
+
opening: function () {
|
| 1989 |
+
var el, range, len;
|
| 1990 |
+
|
| 1991 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1992 |
+
this.showSearch(true);
|
| 1993 |
+
}
|
| 1994 |
+
|
| 1995 |
+
this.parent.opening.apply(this, arguments);
|
| 1996 |
+
|
| 1997 |
+
if (this.showSearchInput !== false) {
|
| 1998 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1999 |
+
// all other browsers handle this just fine
|
| 2000 |
+
|
| 2001 |
+
this.search.val(this.focusser.val());
|
| 2002 |
+
}
|
| 2003 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2004 |
+
this.search.focus();
|
| 2005 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 2006 |
+
// new text will appear *before* focusser.val()
|
| 2007 |
+
el = this.search.get(0);
|
| 2008 |
+
if (el.createTextRange) {
|
| 2009 |
+
range = el.createTextRange();
|
| 2010 |
+
range.collapse(false);
|
| 2011 |
+
range.select();
|
| 2012 |
+
} else if (el.setSelectionRange) {
|
| 2013 |
+
len = this.search.val().length;
|
| 2014 |
+
el.setSelectionRange(len, len);
|
| 2015 |
+
}
|
| 2016 |
+
}
|
| 2017 |
+
|
| 2018 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2019 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2020 |
+
if(this.search.val() === "") {
|
| 2021 |
+
if(this.nextSearchTerm != undefined){
|
| 2022 |
+
this.search.val(this.nextSearchTerm);
|
| 2023 |
+
this.search.select();
|
| 2024 |
+
}
|
| 2025 |
+
}
|
| 2026 |
+
|
| 2027 |
+
this.focusser.prop("disabled", true).val("");
|
| 2028 |
+
this.updateResults(true);
|
| 2029 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 2030 |
+
},
|
| 2031 |
+
|
| 2032 |
+
// single
|
| 2033 |
+
close: function () {
|
| 2034 |
+
if (!this.opened()) return;
|
| 2035 |
+
this.parent.close.apply(this, arguments);
|
| 2036 |
+
|
| 2037 |
+
this.focusser.prop("disabled", false);
|
| 2038 |
+
|
| 2039 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2040 |
+
this.focusser.focus();
|
| 2041 |
+
}
|
| 2042 |
+
},
|
| 2043 |
+
|
| 2044 |
+
// single
|
| 2045 |
+
focus: function () {
|
| 2046 |
+
if (this.opened()) {
|
| 2047 |
+
this.close();
|
| 2048 |
+
} else {
|
| 2049 |
+
this.focusser.prop("disabled", false);
|
| 2050 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2051 |
+
this.focusser.focus();
|
| 2052 |
+
}
|
| 2053 |
+
}
|
| 2054 |
+
},
|
| 2055 |
+
|
| 2056 |
+
// single
|
| 2057 |
+
isFocused: function () {
|
| 2058 |
+
return this.container.hasClass("select2-container-active");
|
| 2059 |
+
},
|
| 2060 |
+
|
| 2061 |
+
// single
|
| 2062 |
+
cancel: function () {
|
| 2063 |
+
this.parent.cancel.apply(this, arguments);
|
| 2064 |
+
this.focusser.prop("disabled", false);
|
| 2065 |
+
|
| 2066 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2067 |
+
this.focusser.focus();
|
| 2068 |
+
}
|
| 2069 |
+
},
|
| 2070 |
+
|
| 2071 |
+
// single
|
| 2072 |
+
destroy: function() {
|
| 2073 |
+
$("label[for='" + this.focusser.attr('id') + "']")
|
| 2074 |
+
.attr('for', this.opts.element.attr("id"));
|
| 2075 |
+
this.parent.destroy.apply(this, arguments);
|
| 2076 |
+
|
| 2077 |
+
cleanupJQueryElements.call(this,
|
| 2078 |
+
"selection",
|
| 2079 |
+
"focusser"
|
| 2080 |
+
);
|
| 2081 |
+
},
|
| 2082 |
+
|
| 2083 |
+
// single
|
| 2084 |
+
initContainer: function () {
|
| 2085 |
+
|
| 2086 |
+
var selection,
|
| 2087 |
+
container = this.container,
|
| 2088 |
+
dropdown = this.dropdown,
|
| 2089 |
+
idSuffix = nextUid(),
|
| 2090 |
+
elementLabel;
|
| 2091 |
+
|
| 2092 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
| 2093 |
+
this.showSearch(false);
|
| 2094 |
+
} else {
|
| 2095 |
+
this.showSearch(true);
|
| 2096 |
+
}
|
| 2097 |
+
|
| 2098 |
+
this.selection = selection = container.find(".select2-choice");
|
| 2099 |
+
|
| 2100 |
+
this.focusser = container.find(".select2-focusser");
|
| 2101 |
+
|
| 2102 |
+
// add aria associations
|
| 2103 |
+
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
| 2104 |
+
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
| 2105 |
+
this.results.attr("id", "select2-results-"+idSuffix);
|
| 2106 |
+
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
| 2107 |
+
|
| 2108 |
+
// rewrite labels from original element to focusser
|
| 2109 |
+
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
| 2110 |
+
|
| 2111 |
+
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
| 2112 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2113 |
+
|
| 2114 |
+
this.focusser.prev()
|
| 2115 |
+
.text(elementLabel.text())
|
| 2116 |
+
.attr('for', this.focusser.attr('id'));
|
| 2117 |
+
|
| 2118 |
+
// Ensure the original element retains an accessible name
|
| 2119 |
+
var originalTitle = this.opts.element.attr("title");
|
| 2120 |
+
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
| 2121 |
+
|
| 2122 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 2123 |
+
|
| 2124 |
+
// write label for search field using the label from the focusser element
|
| 2125 |
+
this.search.attr("id", this.focusser.attr('id') + '_search');
|
| 2126 |
+
|
| 2127 |
+
this.search.prev()
|
| 2128 |
+
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
| 2129 |
+
.attr('for', this.search.attr('id'));
|
| 2130 |
+
|
| 2131 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 2132 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2133 |
+
|
| 2134 |
+
// filter 229 keyCodes (input method editor is processing key input)
|
| 2135 |
+
if (229 == e.keyCode) return;
|
| 2136 |
+
|
| 2137 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2138 |
+
// prevent the page from scrolling
|
| 2139 |
+
killEvent(e);
|
| 2140 |
+
return;
|
| 2141 |
+
}
|
| 2142 |
+
|
| 2143 |
+
switch (e.which) {
|
| 2144 |
+
case KEY.UP:
|
| 2145 |
+
case KEY.DOWN:
|
| 2146 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2147 |
+
killEvent(e);
|
| 2148 |
+
return;
|
| 2149 |
+
case KEY.ENTER:
|
| 2150 |
+
this.selectHighlighted();
|
| 2151 |
+
killEvent(e);
|
| 2152 |
+
return;
|
| 2153 |
+
case KEY.TAB:
|
| 2154 |
+
this.selectHighlighted({noFocus: true});
|
| 2155 |
+
return;
|
| 2156 |
+
case KEY.ESC:
|
| 2157 |
+
this.cancel(e);
|
| 2158 |
+
killEvent(e);
|
| 2159 |
+
return;
|
| 2160 |
+
}
|
| 2161 |
+
}));
|
| 2162 |
+
|
| 2163 |
+
this.search.on("blur", this.bind(function(e) {
|
| 2164 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 2165 |
+
// without this the search field loses focus which is annoying
|
| 2166 |
+
if (document.activeElement === this.body.get(0)) {
|
| 2167 |
+
window.setTimeout(this.bind(function() {
|
| 2168 |
+
if (this.opened()) {
|
| 2169 |
+
this.search.focus();
|
| 2170 |
+
}
|
| 2171 |
+
}), 0);
|
| 2172 |
+
}
|
| 2173 |
+
}));
|
| 2174 |
+
|
| 2175 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
| 2176 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2177 |
+
|
| 2178 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 2179 |
+
return;
|
| 2180 |
+
}
|
| 2181 |
+
|
| 2182 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 2183 |
+
killEvent(e);
|
| 2184 |
+
return;
|
| 2185 |
+
}
|
| 2186 |
+
|
| 2187 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 2188 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 2189 |
+
|
| 2190 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 2191 |
+
|
| 2192 |
+
this.open();
|
| 2193 |
+
killEvent(e);
|
| 2194 |
+
return;
|
| 2195 |
+
}
|
| 2196 |
+
|
| 2197 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 2198 |
+
if (this.opts.allowClear) {
|
| 2199 |
+
this.clear();
|
| 2200 |
+
}
|
| 2201 |
+
killEvent(e);
|
| 2202 |
+
return;
|
| 2203 |
+
}
|
| 2204 |
+
}));
|
| 2205 |
+
|
| 2206 |
+
|
| 2207 |
+
installKeyUpChangeEvent(this.focusser);
|
| 2208 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 2209 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 2210 |
+
e.stopPropagation();
|
| 2211 |
+
if (this.opened()) return;
|
| 2212 |
+
this.open();
|
| 2213 |
+
}
|
| 2214 |
+
}));
|
| 2215 |
+
|
| 2216 |
+
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
| 2217 |
+
if (!this.isInterfaceEnabled()) {
|
| 2218 |
+
return;
|
| 2219 |
+
}
|
| 2220 |
+
|
| 2221 |
+
this.clear();
|
| 2222 |
+
killEventImmediately(e);
|
| 2223 |
+
this.close();
|
| 2224 |
+
|
| 2225 |
+
if (this.selection) {
|
| 2226 |
+
this.selection.focus();
|
| 2227 |
+
}
|
| 2228 |
+
}));
|
| 2229 |
+
|
| 2230 |
+
selection.on("mousedown touchstart", this.bind(function (e) {
|
| 2231 |
+
// Prevent IE from generating a click event on the body
|
| 2232 |
+
reinsertElement(selection);
|
| 2233 |
+
|
| 2234 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2235 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2236 |
+
}
|
| 2237 |
+
|
| 2238 |
+
if (this.opened()) {
|
| 2239 |
+
this.close();
|
| 2240 |
+
} else if (this.isInterfaceEnabled()) {
|
| 2241 |
+
this.open();
|
| 2242 |
+
}
|
| 2243 |
+
|
| 2244 |
+
killEvent(e);
|
| 2245 |
+
}));
|
| 2246 |
+
|
| 2247 |
+
dropdown.on("mousedown touchstart", this.bind(function() {
|
| 2248 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2249 |
+
this.search.focus();
|
| 2250 |
+
}
|
| 2251 |
+
}));
|
| 2252 |
+
|
| 2253 |
+
selection.on("focus", this.bind(function(e) {
|
| 2254 |
+
killEvent(e);
|
| 2255 |
+
}));
|
| 2256 |
+
|
| 2257 |
+
this.focusser.on("focus", this.bind(function(){
|
| 2258 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2259 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2260 |
+
}
|
| 2261 |
+
this.container.addClass("select2-container-active");
|
| 2262 |
+
})).on("blur", this.bind(function() {
|
| 2263 |
+
if (!this.opened()) {
|
| 2264 |
+
this.container.removeClass("select2-container-active");
|
| 2265 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 2266 |
+
}
|
| 2267 |
+
}));
|
| 2268 |
+
this.search.on("focus", this.bind(function(){
|
| 2269 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2270 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2271 |
+
}
|
| 2272 |
+
this.container.addClass("select2-container-active");
|
| 2273 |
+
}));
|
| 2274 |
+
|
| 2275 |
+
this.initContainerWidth();
|
| 2276 |
+
this.opts.element.hide();
|
| 2277 |
+
this.setPlaceholder();
|
| 2278 |
+
|
| 2279 |
+
},
|
| 2280 |
+
|
| 2281 |
+
// single
|
| 2282 |
+
clear: function(triggerChange) {
|
| 2283 |
+
var data=this.selection.data("select2-data");
|
| 2284 |
+
if (data) { // guard against queued quick consecutive clicks
|
| 2285 |
+
var evt = $.Event("select2-clearing");
|
| 2286 |
+
this.opts.element.trigger(evt);
|
| 2287 |
+
if (evt.isDefaultPrevented()) {
|
| 2288 |
+
return;
|
| 2289 |
+
}
|
| 2290 |
+
var placeholderOption = this.getPlaceholderOption();
|
| 2291 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 2292 |
+
this.selection.find(".select2-chosen").empty();
|
| 2293 |
+
this.selection.removeData("select2-data");
|
| 2294 |
+
this.setPlaceholder();
|
| 2295 |
+
|
| 2296 |
+
if (triggerChange !== false){
|
| 2297 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2298 |
+
this.triggerChange({removed:data});
|
| 2299 |
+
}
|
| 2300 |
+
}
|
| 2301 |
+
},
|
| 2302 |
+
|
| 2303 |
+
/**
|
| 2304 |
+
* Sets selection based on source element's value
|
| 2305 |
+
*/
|
| 2306 |
+
// single
|
| 2307 |
+
initSelection: function () {
|
| 2308 |
+
var selected;
|
| 2309 |
+
if (this.isPlaceholderOptionSelected()) {
|
| 2310 |
+
this.updateSelection(null);
|
| 2311 |
+
this.close();
|
| 2312 |
+
this.setPlaceholder();
|
| 2313 |
+
} else {
|
| 2314 |
+
var self = this;
|
| 2315 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2316 |
+
if (selected !== undefined && selected !== null) {
|
| 2317 |
+
self.updateSelection(selected);
|
| 2318 |
+
self.close();
|
| 2319 |
+
self.setPlaceholder();
|
| 2320 |
+
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
| 2321 |
+
}
|
| 2322 |
+
});
|
| 2323 |
+
}
|
| 2324 |
+
},
|
| 2325 |
+
|
| 2326 |
+
isPlaceholderOptionSelected: function() {
|
| 2327 |
+
var placeholderOption;
|
| 2328 |
+
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
| 2329 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
| 2330 |
+
|| (this.opts.element.val() === "")
|
| 2331 |
+
|| (this.opts.element.val() === undefined)
|
| 2332 |
+
|| (this.opts.element.val() === null);
|
| 2333 |
+
},
|
| 2334 |
+
|
| 2335 |
+
// single
|
| 2336 |
+
prepareOpts: function () {
|
| 2337 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2338 |
+
self=this;
|
| 2339 |
+
|
| 2340 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2341 |
+
// install the selection initializer
|
| 2342 |
+
opts.initSelection = function (element, callback) {
|
| 2343 |
+
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
| 2344 |
+
// a single select box always has a value, no need to null check 'selected'
|
| 2345 |
+
callback(self.optionToData(selected));
|
| 2346 |
+
};
|
| 2347 |
+
} else if ("data" in opts) {
|
| 2348 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2349 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2350 |
+
var id = element.val();
|
| 2351 |
+
//search in data by id, storing the actual matching item
|
| 2352 |
+
var match = null;
|
| 2353 |
+
opts.query({
|
| 2354 |
+
matcher: function(term, text, el){
|
| 2355 |
+
var is_match = equal(id, opts.id(el));
|
| 2356 |
+
if (is_match) {
|
| 2357 |
+
match = el;
|
| 2358 |
+
}
|
| 2359 |
+
return is_match;
|
| 2360 |
+
},
|
| 2361 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2362 |
+
callback(match);
|
| 2363 |
+
}
|
| 2364 |
+
});
|
| 2365 |
+
};
|
| 2366 |
+
}
|
| 2367 |
+
|
| 2368 |
+
return opts;
|
| 2369 |
+
},
|
| 2370 |
+
|
| 2371 |
+
// single
|
| 2372 |
+
getPlaceholder: function() {
|
| 2373 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2374 |
+
if (this.select) {
|
| 2375 |
+
if (this.getPlaceholderOption() === undefined) {
|
| 2376 |
+
return undefined;
|
| 2377 |
+
}
|
| 2378 |
+
}
|
| 2379 |
+
|
| 2380 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2381 |
+
},
|
| 2382 |
+
|
| 2383 |
+
// single
|
| 2384 |
+
setPlaceholder: function () {
|
| 2385 |
+
var placeholder = this.getPlaceholder();
|
| 2386 |
+
|
| 2387 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2388 |
+
|
| 2389 |
+
// check for a placeholder option if attached to a select
|
| 2390 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2391 |
+
|
| 2392 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2393 |
+
|
| 2394 |
+
this.selection.addClass("select2-default");
|
| 2395 |
+
|
| 2396 |
+
this.container.removeClass("select2-allowclear");
|
| 2397 |
+
}
|
| 2398 |
+
},
|
| 2399 |
+
|
| 2400 |
+
// single
|
| 2401 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2402 |
+
var selected = 0, self = this, showSearchInput = true;
|
| 2403 |
+
|
| 2404 |
+
// find the selected element in the result list
|
| 2405 |
+
|
| 2406 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2407 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2408 |
+
selected = i;
|
| 2409 |
+
return false;
|
| 2410 |
+
}
|
| 2411 |
+
});
|
| 2412 |
+
|
| 2413 |
+
// and highlight it
|
| 2414 |
+
if (noHighlightUpdate !== false) {
|
| 2415 |
+
if (initial === true && selected >= 0) {
|
| 2416 |
+
this.highlight(selected);
|
| 2417 |
+
} else {
|
| 2418 |
+
this.highlight(0);
|
| 2419 |
+
}
|
| 2420 |
+
}
|
| 2421 |
+
|
| 2422 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2423 |
+
|
| 2424 |
+
if (initial === true) {
|
| 2425 |
+
var min = this.opts.minimumResultsForSearch;
|
| 2426 |
+
if (min >= 0) {
|
| 2427 |
+
this.showSearch(countResults(data.results) >= min);
|
| 2428 |
+
}
|
| 2429 |
+
}
|
| 2430 |
+
},
|
| 2431 |
+
|
| 2432 |
+
// single
|
| 2433 |
+
showSearch: function(showSearchInput) {
|
| 2434 |
+
if (this.showSearchInput === showSearchInput) return;
|
| 2435 |
+
|
| 2436 |
+
this.showSearchInput = showSearchInput;
|
| 2437 |
+
|
| 2438 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2439 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2440 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
| 2441 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2442 |
+
},
|
| 2443 |
+
|
| 2444 |
+
// single
|
| 2445 |
+
onSelect: function (data, options) {
|
| 2446 |
+
|
| 2447 |
+
if (!this.triggerSelect(data)) { return; }
|
| 2448 |
+
|
| 2449 |
+
var old = this.opts.element.val(),
|
| 2450 |
+
oldData = this.data();
|
| 2451 |
+
|
| 2452 |
+
this.opts.element.val(this.id(data));
|
| 2453 |
+
this.updateSelection(data);
|
| 2454 |
+
|
| 2455 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2456 |
+
|
| 2457 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 2458 |
+
this.close();
|
| 2459 |
+
|
| 2460 |
+
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
| 2461 |
+
this.focusser.focus();
|
| 2462 |
+
}
|
| 2463 |
+
|
| 2464 |
+
if (!equal(old, this.id(data))) {
|
| 2465 |
+
this.triggerChange({ added: data, removed: oldData });
|
| 2466 |
+
}
|
| 2467 |
+
},
|
| 2468 |
+
|
| 2469 |
+
// single
|
| 2470 |
+
updateSelection: function (data) {
|
| 2471 |
+
|
| 2472 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2473 |
+
|
| 2474 |
+
this.selection.data("select2-data", data);
|
| 2475 |
+
|
| 2476 |
+
container.empty();
|
| 2477 |
+
if (data !== null) {
|
| 2478 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2479 |
+
}
|
| 2480 |
+
if (formatted !== undefined) {
|
| 2481 |
+
container.append(formatted);
|
| 2482 |
+
}
|
| 2483 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2484 |
+
if (cssClass !== undefined) {
|
| 2485 |
+
container.addClass(cssClass);
|
| 2486 |
+
}
|
| 2487 |
+
|
| 2488 |
+
this.selection.removeClass("select2-default");
|
| 2489 |
+
|
| 2490 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2491 |
+
this.container.addClass("select2-allowclear");
|
| 2492 |
+
}
|
| 2493 |
+
},
|
| 2494 |
+
|
| 2495 |
+
// single
|
| 2496 |
+
val: function () {
|
| 2497 |
+
var val,
|
| 2498 |
+
triggerChange = false,
|
| 2499 |
+
data = null,
|
| 2500 |
+
self = this,
|
| 2501 |
+
oldData = this.data();
|
| 2502 |
+
|
| 2503 |
+
if (arguments.length === 0) {
|
| 2504 |
+
return this.opts.element.val();
|
| 2505 |
+
}
|
| 2506 |
+
|
| 2507 |
+
val = arguments[0];
|
| 2508 |
+
|
| 2509 |
+
if (arguments.length > 1) {
|
| 2510 |
+
triggerChange = arguments[1];
|
| 2511 |
+
}
|
| 2512 |
+
|
| 2513 |
+
if (this.select) {
|
| 2514 |
+
this.select
|
| 2515 |
+
.val(val)
|
| 2516 |
+
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
| 2517 |
+
data = self.optionToData(elm);
|
| 2518 |
+
return false;
|
| 2519 |
+
});
|
| 2520 |
+
this.updateSelection(data);
|
| 2521 |
+
this.setPlaceholder();
|
| 2522 |
+
if (triggerChange) {
|
| 2523 |
+
this.triggerChange({added: data, removed:oldData});
|
| 2524 |
+
}
|
| 2525 |
+
} else {
|
| 2526 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2527 |
+
if (!val && val !== 0) {
|
| 2528 |
+
this.clear(triggerChange);
|
| 2529 |
+
return;
|
| 2530 |
+
}
|
| 2531 |
+
if (this.opts.initSelection === undefined) {
|
| 2532 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2533 |
+
}
|
| 2534 |
+
this.opts.element.val(val);
|
| 2535 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 2536 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
| 2537 |
+
self.updateSelection(data);
|
| 2538 |
+
self.setPlaceholder();
|
| 2539 |
+
if (triggerChange) {
|
| 2540 |
+
self.triggerChange({added: data, removed:oldData});
|
| 2541 |
+
}
|
| 2542 |
+
});
|
| 2543 |
+
}
|
| 2544 |
+
},
|
| 2545 |
+
|
| 2546 |
+
// single
|
| 2547 |
+
clearSearch: function () {
|
| 2548 |
+
this.search.val("");
|
| 2549 |
+
this.focusser.val("");
|
| 2550 |
+
},
|
| 2551 |
+
|
| 2552 |
+
// single
|
| 2553 |
+
data: function(value) {
|
| 2554 |
+
var data,
|
| 2555 |
+
triggerChange = false;
|
| 2556 |
+
|
| 2557 |
+
if (arguments.length === 0) {
|
| 2558 |
+
data = this.selection.data("select2-data");
|
| 2559 |
+
if (data == undefined) data = null;
|
| 2560 |
+
return data;
|
| 2561 |
+
} else {
|
| 2562 |
+
if (arguments.length > 1) {
|
| 2563 |
+
triggerChange = arguments[1];
|
| 2564 |
+
}
|
| 2565 |
+
if (!value) {
|
| 2566 |
+
this.clear(triggerChange);
|
| 2567 |
+
} else {
|
| 2568 |
+
data = this.data();
|
| 2569 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
| 2570 |
+
this.updateSelection(value);
|
| 2571 |
+
if (triggerChange) {
|
| 2572 |
+
this.triggerChange({added: value, removed:data});
|
| 2573 |
+
}
|
| 2574 |
+
}
|
| 2575 |
+
}
|
| 2576 |
+
}
|
| 2577 |
+
});
|
| 2578 |
+
|
| 2579 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2580 |
+
|
| 2581 |
+
// multi
|
| 2582 |
+
createContainer: function () {
|
| 2583 |
+
var container = $(document.createElement("div")).attr({
|
| 2584 |
+
"class": "select2-container select2-container-multi"
|
| 2585 |
+
}).html([
|
| 2586 |
+
"<ul class='select2-choices'>",
|
| 2587 |
+
" <li class='select2-search-field'>",
|
| 2588 |
+
" <label for='' class='select2-offscreen'></label>",
|
| 2589 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
| 2590 |
+
" </li>",
|
| 2591 |
+
"</ul>",
|
| 2592 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2593 |
+
" <ul class='select2-results'>",
|
| 2594 |
+
" </ul>",
|
| 2595 |
+
"</div>"].join(""));
|
| 2596 |
+
return container;
|
| 2597 |
+
},
|
| 2598 |
+
|
| 2599 |
+
// multi
|
| 2600 |
+
prepareOpts: function () {
|
| 2601 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2602 |
+
self=this;
|
| 2603 |
+
|
| 2604 |
+
// TODO validate placeholder is a string if specified
|
| 2605 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2606 |
+
// install the selection initializer
|
| 2607 |
+
opts.initSelection = function (element, callback) {
|
| 2608 |
+
|
| 2609 |
+
var data = [];
|
| 2610 |
+
|
| 2611 |
+
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
| 2612 |
+
data.push(self.optionToData(elm));
|
| 2613 |
+
});
|
| 2614 |
+
callback(data);
|
| 2615 |
+
};
|
| 2616 |
+
} else if ("data" in opts) {
|
| 2617 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2618 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2619 |
+
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
| 2620 |
+
//search in data by array of ids, storing matching items in a list
|
| 2621 |
+
var matches = [];
|
| 2622 |
+
opts.query({
|
| 2623 |
+
matcher: function(term, text, el){
|
| 2624 |
+
var is_match = $.grep(ids, function(id) {
|
| 2625 |
+
return equal(id, opts.id(el));
|
| 2626 |
+
}).length;
|
| 2627 |
+
if (is_match) {
|
| 2628 |
+
matches.push(el);
|
| 2629 |
+
}
|
| 2630 |
+
return is_match;
|
| 2631 |
+
},
|
| 2632 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2633 |
+
// reorder matches based on the order they appear in the ids array because right now
|
| 2634 |
+
// they are in the order in which they appear in data array
|
| 2635 |
+
var ordered = [];
|
| 2636 |
+
for (var i = 0; i < ids.length; i++) {
|
| 2637 |
+
var id = ids[i];
|
| 2638 |
+
for (var j = 0; j < matches.length; j++) {
|
| 2639 |
+
var match = matches[j];
|
| 2640 |
+
if (equal(id, opts.id(match))) {
|
| 2641 |
+
ordered.push(match);
|
| 2642 |
+
matches.splice(j, 1);
|
| 2643 |
+
break;
|
| 2644 |
+
}
|
| 2645 |
+
}
|
| 2646 |
+
}
|
| 2647 |
+
callback(ordered);
|
| 2648 |
+
}
|
| 2649 |
+
});
|
| 2650 |
+
};
|
| 2651 |
+
}
|
| 2652 |
+
|
| 2653 |
+
return opts;
|
| 2654 |
+
},
|
| 2655 |
+
|
| 2656 |
+
// multi
|
| 2657 |
+
selectChoice: function (choice) {
|
| 2658 |
+
|
| 2659 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
| 2660 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2661 |
+
|
| 2662 |
+
} else {
|
| 2663 |
+
if (selected.length) {
|
| 2664 |
+
this.opts.element.trigger("choice-deselected", selected);
|
| 2665 |
+
}
|
| 2666 |
+
selected.removeClass("select2-search-choice-focus");
|
| 2667 |
+
if (choice && choice.length) {
|
| 2668 |
+
this.close();
|
| 2669 |
+
choice.addClass("select2-search-choice-focus");
|
| 2670 |
+
this.opts.element.trigger("choice-selected", choice);
|
| 2671 |
+
}
|
| 2672 |
+
}
|
| 2673 |
+
},
|
| 2674 |
+
|
| 2675 |
+
// multi
|
| 2676 |
+
destroy: function() {
|
| 2677 |
+
$("label[for='" + this.search.attr('id') + "']")
|
| 2678 |
+
.attr('for', this.opts.element.attr("id"));
|
| 2679 |
+
this.parent.destroy.apply(this, arguments);
|
| 2680 |
+
|
| 2681 |
+
cleanupJQueryElements.call(this,
|
| 2682 |
+
"searchContainer",
|
| 2683 |
+
"selection"
|
| 2684 |
+
);
|
| 2685 |
+
},
|
| 2686 |
+
|
| 2687 |
+
// multi
|
| 2688 |
+
initContainer: function () {
|
| 2689 |
+
|
| 2690 |
+
var selector = ".select2-choices", selection;
|
| 2691 |
+
|
| 2692 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
| 2693 |
+
this.selection = selection = this.container.find(selector);
|
| 2694 |
+
|
| 2695 |
+
var _this = this;
|
| 2696 |
+
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
| 2697 |
+
_this.search[0].focus();
|
| 2698 |
+
_this.selectChoice($(this));
|
| 2699 |
+
});
|
| 2700 |
+
|
| 2701 |
+
// rewrite labels from original element to focusser
|
| 2702 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2703 |
+
|
| 2704 |
+
this.search.prev()
|
| 2705 |
+
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
| 2706 |
+
.attr('for', this.search.attr('id'));
|
| 2707 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
| 2708 |
+
|
| 2709 |
+
this.search.on("input paste", this.bind(function() {
|
| 2710 |
+
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
| 2711 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2712 |
+
if (!this.opened()) {
|
| 2713 |
+
this.open();
|
| 2714 |
+
}
|
| 2715 |
+
}));
|
| 2716 |
+
|
| 2717 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
| 2718 |
+
|
| 2719 |
+
this.keydowns = 0;
|
| 2720 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 2721 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2722 |
+
|
| 2723 |
+
++this.keydowns;
|
| 2724 |
+
var selected = selection.find(".select2-search-choice-focus");
|
| 2725 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2726 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2727 |
+
var pos = getCursorInfo(this.search);
|
| 2728 |
+
|
| 2729 |
+
if (selected.length &&
|
| 2730 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2731 |
+
var selectedChoice = selected;
|
| 2732 |
+
if (e.which == KEY.LEFT && prev.length) {
|
| 2733 |
+
selectedChoice = prev;
|
| 2734 |
+
}
|
| 2735 |
+
else if (e.which == KEY.RIGHT) {
|
| 2736 |
+
selectedChoice = next.length ? next : null;
|
| 2737 |
+
}
|
| 2738 |
+
else if (e.which === KEY.BACKSPACE) {
|
| 2739 |
+
if (this.unselect(selected.first())) {
|
| 2740 |
+
this.search.width(10);
|
| 2741 |
+
selectedChoice = prev.length ? prev : next;
|
| 2742 |
+
}
|
| 2743 |
+
} else if (e.which == KEY.DELETE) {
|
| 2744 |
+
if (this.unselect(selected.first())) {
|
| 2745 |
+
this.search.width(10);
|
| 2746 |
+
selectedChoice = next.length ? next : null;
|
| 2747 |
+
}
|
| 2748 |
+
} else if (e.which == KEY.ENTER) {
|
| 2749 |
+
selectedChoice = null;
|
| 2750 |
+
}
|
| 2751 |
+
|
| 2752 |
+
this.selectChoice(selectedChoice);
|
| 2753 |
+
killEvent(e);
|
| 2754 |
+
if (!selectedChoice || !selectedChoice.length) {
|
| 2755 |
+
this.open();
|
| 2756 |
+
}
|
| 2757 |
+
return;
|
| 2758 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2759 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2760 |
+
|
| 2761 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2762 |
+
killEvent(e);
|
| 2763 |
+
return;
|
| 2764 |
+
} else {
|
| 2765 |
+
this.selectChoice(null);
|
| 2766 |
+
}
|
| 2767 |
+
|
| 2768 |
+
if (this.opened()) {
|
| 2769 |
+
switch (e.which) {
|
| 2770 |
+
case KEY.UP:
|
| 2771 |
+
case KEY.DOWN:
|
| 2772 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2773 |
+
killEvent(e);
|
| 2774 |
+
return;
|
| 2775 |
+
case KEY.ENTER:
|
| 2776 |
+
this.selectHighlighted();
|
| 2777 |
+
killEvent(e);
|
| 2778 |
+
return;
|
| 2779 |
+
case KEY.TAB:
|
| 2780 |
+
this.selectHighlighted({noFocus:true});
|
| 2781 |
+
this.close();
|
| 2782 |
+
return;
|
| 2783 |
+
case KEY.ESC:
|
| 2784 |
+
this.cancel(e);
|
| 2785 |
+
killEvent(e);
|
| 2786 |
+
return;
|
| 2787 |
+
}
|
| 2788 |
+
}
|
| 2789 |
+
|
| 2790 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2791 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2792 |
+
return;
|
| 2793 |
+
}
|
| 2794 |
+
|
| 2795 |
+
if (e.which === KEY.ENTER) {
|
| 2796 |
+
if (this.opts.openOnEnter === false) {
|
| 2797 |
+
return;
|
| 2798 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2799 |
+
return;
|
| 2800 |
+
}
|
| 2801 |
+
}
|
| 2802 |
+
|
| 2803 |
+
this.open();
|
| 2804 |
+
|
| 2805 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2806 |
+
// prevent the page from scrolling
|
| 2807 |
+
killEvent(e);
|
| 2808 |
+
}
|
| 2809 |
+
|
| 2810 |
+
if (e.which === KEY.ENTER) {
|
| 2811 |
+
// prevent form from being submitted
|
| 2812 |
+
killEvent(e);
|
| 2813 |
+
}
|
| 2814 |
+
|
| 2815 |
+
}));
|
| 2816 |
+
|
| 2817 |
+
this.search.on("keyup", this.bind(function (e) {
|
| 2818 |
+
this.keydowns = 0;
|
| 2819 |
+
this.resizeSearch();
|
| 2820 |
+
})
|
| 2821 |
+
);
|
| 2822 |
+
|
| 2823 |
+
this.search.on("blur", this.bind(function(e) {
|
| 2824 |
+
this.container.removeClass("select2-container-active");
|
| 2825 |
+
this.search.removeClass("select2-focused");
|
| 2826 |
+
this.selectChoice(null);
|
| 2827 |
+
if (!this.opened()) this.clearSearch();
|
| 2828 |
+
e.stopImmediatePropagation();
|
| 2829 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 2830 |
+
}));
|
| 2831 |
+
|
| 2832 |
+
this.container.on("click", selector, this.bind(function (e) {
|
| 2833 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2834 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2835 |
+
// clicked inside a select2 search choice, do not open
|
| 2836 |
+
return;
|
| 2837 |
+
}
|
| 2838 |
+
this.selectChoice(null);
|
| 2839 |
+
this.clearPlaceholder();
|
| 2840 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2841 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2842 |
+
}
|
| 2843 |
+
this.open();
|
| 2844 |
+
this.focusSearch();
|
| 2845 |
+
e.preventDefault();
|
| 2846 |
+
}));
|
| 2847 |
+
|
| 2848 |
+
this.container.on("focus", selector, this.bind(function () {
|
| 2849 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2850 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2851 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2852 |
+
}
|
| 2853 |
+
this.container.addClass("select2-container-active");
|
| 2854 |
+
this.dropdown.addClass("select2-drop-active");
|
| 2855 |
+
this.clearPlaceholder();
|
| 2856 |
+
}));
|
| 2857 |
+
|
| 2858 |
+
this.initContainerWidth();
|
| 2859 |
+
this.opts.element.hide();
|
| 2860 |
+
|
| 2861 |
+
// set the placeholder if necessary
|
| 2862 |
+
this.clearSearch();
|
| 2863 |
+
},
|
| 2864 |
+
|
| 2865 |
+
// multi
|
| 2866 |
+
enableInterface: function() {
|
| 2867 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2868 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2869 |
+
}
|
| 2870 |
+
},
|
| 2871 |
+
|
| 2872 |
+
// multi
|
| 2873 |
+
initSelection: function () {
|
| 2874 |
+
var data;
|
| 2875 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2876 |
+
this.updateSelection([]);
|
| 2877 |
+
this.close();
|
| 2878 |
+
// set the placeholder if necessary
|
| 2879 |
+
this.clearSearch();
|
| 2880 |
+
}
|
| 2881 |
+
if (this.select || this.opts.element.val() !== "") {
|
| 2882 |
+
var self = this;
|
| 2883 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2884 |
+
if (data !== undefined && data !== null) {
|
| 2885 |
+
self.updateSelection(data);
|
| 2886 |
+
self.close();
|
| 2887 |
+
// set the placeholder if necessary
|
| 2888 |
+
self.clearSearch();
|
| 2889 |
+
}
|
| 2890 |
+
});
|
| 2891 |
+
}
|
| 2892 |
+
},
|
| 2893 |
+
|
| 2894 |
+
// multi
|
| 2895 |
+
clearSearch: function () {
|
| 2896 |
+
var placeholder = this.getPlaceholder(),
|
| 2897 |
+
maxWidth = this.getMaxSearchWidth();
|
| 2898 |
+
|
| 2899 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2900 |
+
this.search.val(placeholder).addClass("select2-default");
|
| 2901 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2902 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2903 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2904 |
+
} else {
|
| 2905 |
+
this.search.val("").width(10);
|
| 2906 |
+
}
|
| 2907 |
+
},
|
| 2908 |
+
|
| 2909 |
+
// multi
|
| 2910 |
+
clearPlaceholder: function () {
|
| 2911 |
+
if (this.search.hasClass("select2-default")) {
|
| 2912 |
+
this.search.val("").removeClass("select2-default");
|
| 2913 |
+
}
|
| 2914 |
+
},
|
| 2915 |
+
|
| 2916 |
+
// multi
|
| 2917 |
+
opening: function () {
|
| 2918 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2919 |
+
this.resizeSearch();
|
| 2920 |
+
|
| 2921 |
+
this.parent.opening.apply(this, arguments);
|
| 2922 |
+
|
| 2923 |
+
this.focusSearch();
|
| 2924 |
+
|
| 2925 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
| 2926 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
| 2927 |
+
if(this.search.val() === "") {
|
| 2928 |
+
if(this.nextSearchTerm != undefined){
|
| 2929 |
+
this.search.val(this.nextSearchTerm);
|
| 2930 |
+
this.search.select();
|
| 2931 |
+
}
|
| 2932 |
+
}
|
| 2933 |
+
|
| 2934 |
+
this.updateResults(true);
|
| 2935 |
+
if (this.opts.shouldFocusInput(this)) {
|
| 2936 |
+
this.search.focus();
|
| 2937 |
+
}
|
| 2938 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 2939 |
+
},
|
| 2940 |
+
|
| 2941 |
+
// multi
|
| 2942 |
+
close: function () {
|
| 2943 |
+
if (!this.opened()) return;
|
| 2944 |
+
this.parent.close.apply(this, arguments);
|
| 2945 |
+
},
|
| 2946 |
+
|
| 2947 |
+
// multi
|
| 2948 |
+
focus: function () {
|
| 2949 |
+
this.close();
|
| 2950 |
+
this.search.focus();
|
| 2951 |
+
},
|
| 2952 |
+
|
| 2953 |
+
// multi
|
| 2954 |
+
isFocused: function () {
|
| 2955 |
+
return this.search.hasClass("select2-focused");
|
| 2956 |
+
},
|
| 2957 |
+
|
| 2958 |
+
// multi
|
| 2959 |
+
updateSelection: function (data) {
|
| 2960 |
+
var ids = [], filtered = [], self = this;
|
| 2961 |
+
|
| 2962 |
+
// filter out duplicates
|
| 2963 |
+
$(data).each(function () {
|
| 2964 |
+
if (indexOf(self.id(this), ids) < 0) {
|
| 2965 |
+
ids.push(self.id(this));
|
| 2966 |
+
filtered.push(this);
|
| 2967 |
+
}
|
| 2968 |
+
});
|
| 2969 |
+
data = filtered;
|
| 2970 |
+
|
| 2971 |
+
this.selection.find(".select2-search-choice").remove();
|
| 2972 |
+
$(data).each(function () {
|
| 2973 |
+
self.addSelectedChoice(this);
|
| 2974 |
+
});
|
| 2975 |
+
self.postprocessResults();
|
| 2976 |
+
},
|
| 2977 |
+
|
| 2978 |
+
// multi
|
| 2979 |
+
tokenize: function() {
|
| 2980 |
+
var input = this.search.val();
|
| 2981 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2982 |
+
if (input != null && input != undefined) {
|
| 2983 |
+
this.search.val(input);
|
| 2984 |
+
if (input.length > 0) {
|
| 2985 |
+
this.open();
|
| 2986 |
+
}
|
| 2987 |
+
}
|
| 2988 |
+
|
| 2989 |
+
},
|
| 2990 |
+
|
| 2991 |
+
// multi
|
| 2992 |
+
onSelect: function (data, options) {
|
| 2993 |
+
|
| 2994 |
+
if (!this.triggerSelect(data) || data.text === "") { return; }
|
| 2995 |
+
|
| 2996 |
+
this.addSelectedChoice(data);
|
| 2997 |
+
|
| 2998 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2999 |
+
|
| 3000 |
+
// keep track of the search's value before it gets cleared
|
| 3001 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
| 3002 |
+
|
| 3003 |
+
this.clearSearch();
|
| 3004 |
+
this.updateResults();
|
| 3005 |
+
|
| 3006 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
| 3007 |
+
|
| 3008 |
+
if (this.opts.closeOnSelect) {
|
| 3009 |
+
this.close();
|
| 3010 |
+
this.search.width(10);
|
| 3011 |
+
} else {
|
| 3012 |
+
if (this.countSelectableResults()>0) {
|
| 3013 |
+
this.search.width(10);
|
| 3014 |
+
this.resizeSearch();
|
| 3015 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 3016 |
+
// if we reached max selection size repaint the results so choices
|
| 3017 |
+
// are replaced with the max selection reached message
|
| 3018 |
+
this.updateResults(true);
|
| 3019 |
+
} else {
|
| 3020 |
+
// initializes search's value with nextSearchTerm and update search result
|
| 3021 |
+
if(this.nextSearchTerm != undefined){
|
| 3022 |
+
this.search.val(this.nextSearchTerm);
|
| 3023 |
+
this.updateResults();
|
| 3024 |
+
this.search.select();
|
| 3025 |
+
}
|
| 3026 |
+
}
|
| 3027 |
+
this.positionDropdown();
|
| 3028 |
+
} else {
|
| 3029 |
+
// if nothing left to select close
|
| 3030 |
+
this.close();
|
| 3031 |
+
this.search.width(10);
|
| 3032 |
+
}
|
| 3033 |
+
}
|
| 3034 |
+
|
| 3035 |
+
// since its not possible to select an element that has already been
|
| 3036 |
+
// added we do not need to check if this is a new element before firing change
|
| 3037 |
+
this.triggerChange({ added: data });
|
| 3038 |
+
|
| 3039 |
+
if (!options || !options.noFocus)
|
| 3040 |
+
this.focusSearch();
|
| 3041 |
+
},
|
| 3042 |
+
|
| 3043 |
+
// multi
|
| 3044 |
+
cancel: function () {
|
| 3045 |
+
this.close();
|
| 3046 |
+
this.focusSearch();
|
| 3047 |
+
},
|
| 3048 |
+
|
| 3049 |
+
addSelectedChoice: function (data) {
|
| 3050 |
+
var enableChoice = !data.locked,
|
| 3051 |
+
enabledItem = $(
|
| 3052 |
+
"<li class='select2-search-choice'>" +
|
| 3053 |
+
" <div></div>" +
|
| 3054 |
+
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 3055 |
+
"</li>"),
|
| 3056 |
+
disabledItem = $(
|
| 3057 |
+
"<li class='select2-search-choice select2-locked'>" +
|
| 3058 |
+
"<div></div>" +
|
| 3059 |
+
"</li>");
|
| 3060 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
| 3061 |
+
id = this.id(data),
|
| 3062 |
+
val = this.getVal(),
|
| 3063 |
+
formatted,
|
| 3064 |
+
cssClass;
|
| 3065 |
+
|
| 3066 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 3067 |
+
if (formatted != undefined) {
|
| 3068 |
+
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
| 3069 |
+
}
|
| 3070 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 3071 |
+
if (cssClass != undefined) {
|
| 3072 |
+
choice.addClass(cssClass);
|
| 3073 |
+
}
|
| 3074 |
+
|
| 3075 |
+
if(enableChoice){
|
| 3076 |
+
choice.find(".select2-search-choice-close")
|
| 3077 |
+
.on("mousedown", killEvent)
|
| 3078 |
+
.on("click dblclick", this.bind(function (e) {
|
| 3079 |
+
if (!this.isInterfaceEnabled()) return;
|
| 3080 |
+
|
| 3081 |
+
this.unselect($(e.target));
|
| 3082 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 3083 |
+
killEvent(e);
|
| 3084 |
+
this.close();
|
| 3085 |
+
this.focusSearch();
|
| 3086 |
+
})).on("focus", this.bind(function () {
|
| 3087 |
+
if (!this.isInterfaceEnabled()) return;
|
| 3088 |
+
this.container.addClass("select2-container-active");
|
| 3089 |
+
this.dropdown.addClass("select2-drop-active");
|
| 3090 |
+
}));
|
| 3091 |
+
}
|
| 3092 |
+
|
| 3093 |
+
choice.data("select2-data", data);
|
| 3094 |
+
choice.insertBefore(this.searchContainer);
|
| 3095 |
+
|
| 3096 |
+
val.push(id);
|
| 3097 |
+
this.setVal(val);
|
| 3098 |
+
},
|
| 3099 |
+
|
| 3100 |
+
// multi
|
| 3101 |
+
unselect: function (selected) {
|
| 3102 |
+
var val = this.getVal(),
|
| 3103 |
+
data,
|
| 3104 |
+
index;
|
| 3105 |
+
selected = selected.closest(".select2-search-choice");
|
| 3106 |
+
|
| 3107 |
+
if (selected.length === 0) {
|
| 3108 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 3109 |
+
}
|
| 3110 |
+
|
| 3111 |
+
data = selected.data("select2-data");
|
| 3112 |
+
|
| 3113 |
+
if (!data) {
|
| 3114 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 3115 |
+
// and invoked on an element already removed
|
| 3116 |
+
return;
|
| 3117 |
+
}
|
| 3118 |
+
|
| 3119 |
+
var evt = $.Event("select2-removing");
|
| 3120 |
+
evt.val = this.id(data);
|
| 3121 |
+
evt.choice = data;
|
| 3122 |
+
this.opts.element.trigger(evt);
|
| 3123 |
+
|
| 3124 |
+
if (evt.isDefaultPrevented()) {
|
| 3125 |
+
return false;
|
| 3126 |
+
}
|
| 3127 |
+
|
| 3128 |
+
while((index = indexOf(this.id(data), val)) >= 0) {
|
| 3129 |
+
val.splice(index, 1);
|
| 3130 |
+
this.setVal(val);
|
| 3131 |
+
if (this.select) this.postprocessResults();
|
| 3132 |
+
}
|
| 3133 |
+
|
| 3134 |
+
selected.remove();
|
| 3135 |
+
|
| 3136 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 3137 |
+
this.triggerChange({ removed: data });
|
| 3138 |
+
|
| 3139 |
+
return true;
|
| 3140 |
+
},
|
| 3141 |
+
|
| 3142 |
+
// multi
|
| 3143 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 3144 |
+
var val = this.getVal(),
|
| 3145 |
+
choices = this.results.find(".select2-result"),
|
| 3146 |
+
compound = this.results.find(".select2-result-with-children"),
|
| 3147 |
+
self = this;
|
| 3148 |
+
|
| 3149 |
+
choices.each2(function (i, choice) {
|
| 3150 |
+
var id = self.id(choice.data("select2-data"));
|
| 3151 |
+
if (indexOf(id, val) >= 0) {
|
| 3152 |
+
choice.addClass("select2-selected");
|
| 3153 |
+
// mark all children of the selected parent as selected
|
| 3154 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 3155 |
+
}
|
| 3156 |
+
});
|
| 3157 |
+
|
| 3158 |
+
compound.each2(function(i, choice) {
|
| 3159 |
+
// hide an optgroup if it doesn't have any selectable children
|
| 3160 |
+
if (!choice.is('.select2-result-selectable')
|
| 3161 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 3162 |
+
choice.addClass("select2-selected");
|
| 3163 |
+
}
|
| 3164 |
+
});
|
| 3165 |
+
|
| 3166 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
| 3167 |
+
self.highlight(0);
|
| 3168 |
+
}
|
| 3169 |
+
|
| 3170 |
+
//If all results are chosen render formatNoMatches
|
| 3171 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 3172 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 3173 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 3174 |
+
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
| 3175 |
+
}
|
| 3176 |
+
}
|
| 3177 |
+
}
|
| 3178 |
+
|
| 3179 |
+
},
|
| 3180 |
+
|
| 3181 |
+
// multi
|
| 3182 |
+
getMaxSearchWidth: function() {
|
| 3183 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
| 3184 |
+
},
|
| 3185 |
+
|
| 3186 |
+
// multi
|
| 3187 |
+
resizeSearch: function () {
|
| 3188 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 3189 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
| 3190 |
+
|
| 3191 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
| 3192 |
+
|
| 3193 |
+
left = this.search.offset().left;
|
| 3194 |
+
|
| 3195 |
+
maxWidth = this.selection.width();
|
| 3196 |
+
containerLeft = this.selection.offset().left;
|
| 3197 |
+
|
| 3198 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 3199 |
+
|
| 3200 |
+
if (searchWidth < minimumWidth) {
|
| 3201 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 3202 |
+
}
|
| 3203 |
+
|
| 3204 |
+
if (searchWidth < 40) {
|
| 3205 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 3206 |
+
}
|
| 3207 |
+
|
| 3208 |
+
if (searchWidth <= 0) {
|
| 3209 |
+
searchWidth = minimumWidth;
|
| 3210 |
+
}
|
| 3211 |
+
|
| 3212 |
+
this.search.width(Math.floor(searchWidth));
|
| 3213 |
+
},
|
| 3214 |
+
|
| 3215 |
+
// multi
|
| 3216 |
+
getVal: function () {
|
| 3217 |
+
var val;
|
| 3218 |
+
if (this.select) {
|
| 3219 |
+
val = this.select.val();
|
| 3220 |
+
return val === null ? [] : val;
|
| 3221 |
+
} else {
|
| 3222 |
+
val = this.opts.element.val();
|
| 3223 |
+
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
| 3224 |
+
}
|
| 3225 |
+
},
|
| 3226 |
+
|
| 3227 |
+
// multi
|
| 3228 |
+
setVal: function (val) {
|
| 3229 |
+
var unique;
|
| 3230 |
+
if (this.select) {
|
| 3231 |
+
this.select.val(val);
|
| 3232 |
+
} else {
|
| 3233 |
+
unique = [];
|
| 3234 |
+
// filter out duplicates
|
| 3235 |
+
$(val).each(function () {
|
| 3236 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
| 3237 |
+
});
|
| 3238 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 3239 |
+
}
|
| 3240 |
+
},
|
| 3241 |
+
|
| 3242 |
+
// multi
|
| 3243 |
+
buildChangeDetails: function (old, current) {
|
| 3244 |
+
var current = current.slice(0),
|
| 3245 |
+
old = old.slice(0);
|
| 3246 |
+
|
| 3247 |
+
// remove intersection from each array
|
| 3248 |
+
for (var i = 0; i < current.length; i++) {
|
| 3249 |
+
for (var j = 0; j < old.length; j++) {
|
| 3250 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 3251 |
+
current.splice(i, 1);
|
| 3252 |
+
if(i>0){
|
| 3253 |
+
i--;
|
| 3254 |
+
}
|
| 3255 |
+
old.splice(j, 1);
|
| 3256 |
+
j--;
|
| 3257 |
+
}
|
| 3258 |
+
}
|
| 3259 |
+
}
|
| 3260 |
+
|
| 3261 |
+
return {added: current, removed: old};
|
| 3262 |
+
},
|
| 3263 |
+
|
| 3264 |
+
|
| 3265 |
+
// multi
|
| 3266 |
+
val: function (val, triggerChange) {
|
| 3267 |
+
var oldData, self=this;
|
| 3268 |
+
|
| 3269 |
+
if (arguments.length === 0) {
|
| 3270 |
+
return this.getVal();
|
| 3271 |
+
}
|
| 3272 |
+
|
| 3273 |
+
oldData=this.data();
|
| 3274 |
+
if (!oldData.length) oldData=[];
|
| 3275 |
+
|
| 3276 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 3277 |
+
if (!val && val !== 0) {
|
| 3278 |
+
this.opts.element.val("");
|
| 3279 |
+
this.updateSelection([]);
|
| 3280 |
+
this.clearSearch();
|
| 3281 |
+
if (triggerChange) {
|
| 3282 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
| 3283 |
+
}
|
| 3284 |
+
return;
|
| 3285 |
+
}
|
| 3286 |
+
|
| 3287 |
+
// val is a list of ids
|
| 3288 |
+
this.setVal(val);
|
| 3289 |
+
|
| 3290 |
+
if (this.select) {
|
| 3291 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 3292 |
+
if (triggerChange) {
|
| 3293 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 3294 |
+
}
|
| 3295 |
+
} else {
|
| 3296 |
+
if (this.opts.initSelection === undefined) {
|
| 3297 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 3298 |
+
}
|
| 3299 |
+
|
| 3300 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 3301 |
+
var ids=$.map(data, self.id);
|
| 3302 |
+
self.setVal(ids);
|
| 3303 |
+
self.updateSelection(data);
|
| 3304 |
+
self.clearSearch();
|
| 3305 |
+
if (triggerChange) {
|
| 3306 |
+
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
| 3307 |
+
}
|
| 3308 |
+
});
|
| 3309 |
+
}
|
| 3310 |
+
this.clearSearch();
|
| 3311 |
+
},
|
| 3312 |
+
|
| 3313 |
+
// multi
|
| 3314 |
+
onSortStart: function() {
|
| 3315 |
+
if (this.select) {
|
| 3316 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 3317 |
+
}
|
| 3318 |
+
|
| 3319 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
| 3320 |
+
this.search.width(0);
|
| 3321 |
+
// hide the container
|
| 3322 |
+
this.searchContainer.hide();
|
| 3323 |
+
},
|
| 3324 |
+
|
| 3325 |
+
// multi
|
| 3326 |
+
onSortEnd:function() {
|
| 3327 |
+
|
| 3328 |
+
var val=[], self=this;
|
| 3329 |
+
|
| 3330 |
+
// show search and move it to the end of the list
|
| 3331 |
+
this.searchContainer.show();
|
| 3332 |
+
// make sure the search container is the last item in the list
|
| 3333 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 3334 |
+
// since we collapsed the width in dragStarted, we resize it here
|
| 3335 |
+
this.resizeSearch();
|
| 3336 |
+
|
| 3337 |
+
// update selection
|
| 3338 |
+
this.selection.find(".select2-search-choice").each(function() {
|
| 3339 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
| 3340 |
+
});
|
| 3341 |
+
this.setVal(val);
|
| 3342 |
+
this.triggerChange();
|
| 3343 |
+
},
|
| 3344 |
+
|
| 3345 |
+
// multi
|
| 3346 |
+
data: function(values, triggerChange) {
|
| 3347 |
+
var self=this, ids, old;
|
| 3348 |
+
if (arguments.length === 0) {
|
| 3349 |
+
return this.selection
|
| 3350 |
+
.children(".select2-search-choice")
|
| 3351 |
+
.map(function() { return $(this).data("select2-data"); })
|
| 3352 |
+
.get();
|
| 3353 |
+
} else {
|
| 3354 |
+
old = this.data();
|
| 3355 |
+
if (!values) { values = []; }
|
| 3356 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 3357 |
+
this.setVal(ids);
|
| 3358 |
+
this.updateSelection(values);
|
| 3359 |
+
this.clearSearch();
|
| 3360 |
+
if (triggerChange) {
|
| 3361 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3362 |
+
}
|
| 3363 |
+
}
|
| 3364 |
+
}
|
| 3365 |
+
});
|
| 3366 |
+
|
| 3367 |
+
$.fn.select2 = function () {
|
| 3368 |
+
|
| 3369 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
| 3370 |
+
opts,
|
| 3371 |
+
select2,
|
| 3372 |
+
method, value, multiple,
|
| 3373 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
| 3374 |
+
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
| 3375 |
+
propertyMethods = ["val", "data"],
|
| 3376 |
+
methodsMap = { search: "externalSearch" };
|
| 3377 |
+
|
| 3378 |
+
this.each(function () {
|
| 3379 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3380 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3381 |
+
opts.element = $(this);
|
| 3382 |
+
|
| 3383 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3384 |
+
multiple = opts.element.prop("multiple");
|
| 3385 |
+
} else {
|
| 3386 |
+
multiple = opts.multiple || false;
|
| 3387 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3388 |
+
}
|
| 3389 |
+
|
| 3390 |
+
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
| 3391 |
+
select2.init(opts);
|
| 3392 |
+
} else if (typeof(args[0]) === "string") {
|
| 3393 |
+
|
| 3394 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3395 |
+
throw "Unknown method: " + args[0];
|
| 3396 |
+
}
|
| 3397 |
+
|
| 3398 |
+
value = undefined;
|
| 3399 |
+
select2 = $(this).data("select2");
|
| 3400 |
+
if (select2 === undefined) return;
|
| 3401 |
+
|
| 3402 |
+
method=args[0];
|
| 3403 |
+
|
| 3404 |
+
if (method === "container") {
|
| 3405 |
+
value = select2.container;
|
| 3406 |
+
} else if (method === "dropdown") {
|
| 3407 |
+
value = select2.dropdown;
|
| 3408 |
+
} else {
|
| 3409 |
+
if (methodsMap[method]) method = methodsMap[method];
|
| 3410 |
+
|
| 3411 |
+
value = select2[method].apply(select2, args.slice(1));
|
| 3412 |
+
}
|
| 3413 |
+
if (indexOf(args[0], valueMethods) >= 0
|
| 3414 |
+
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
| 3415 |
+
return false; // abort the iteration, ready to return first matched value
|
| 3416 |
+
}
|
| 3417 |
+
} else {
|
| 3418 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
| 3419 |
+
}
|
| 3420 |
+
});
|
| 3421 |
+
return (value === undefined) ? this : value;
|
| 3422 |
+
};
|
| 3423 |
+
|
| 3424 |
+
// plugin defaults, accessible to users
|
| 3425 |
+
$.fn.select2.defaults = {
|
| 3426 |
+
width: "copy",
|
| 3427 |
+
loadMorePadding: 0,
|
| 3428 |
+
closeOnSelect: true,
|
| 3429 |
+
openOnEnter: true,
|
| 3430 |
+
containerCss: {},
|
| 3431 |
+
dropdownCss: {},
|
| 3432 |
+
containerCssClass: "",
|
| 3433 |
+
dropdownCssClass: "",
|
| 3434 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
| 3435 |
+
var markup=[];
|
| 3436 |
+
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
| 3437 |
+
return markup.join("");
|
| 3438 |
+
},
|
| 3439 |
+
transformVal: function(val) {
|
| 3440 |
+
return $.trim(val);
|
| 3441 |
+
},
|
| 3442 |
+
formatSelection: function (data, container, escapeMarkup) {
|
| 3443 |
+
return data ? escapeMarkup(this.text(data)) : undefined;
|
| 3444 |
+
},
|
| 3445 |
+
sortResults: function (results, container, query) {
|
| 3446 |
+
return results;
|
| 3447 |
+
},
|
| 3448 |
+
formatResultCssClass: function(data) {return data.css;},
|
| 3449 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3450 |
+
minimumResultsForSearch: 0,
|
| 3451 |
+
minimumInputLength: 0,
|
| 3452 |
+
maximumInputLength: null,
|
| 3453 |
+
maximumSelectionSize: 0,
|
| 3454 |
+
id: function (e) { return e == undefined ? null : e.id; },
|
| 3455 |
+
text: function (e) {
|
| 3456 |
+
if (e && this.data && this.data.text) {
|
| 3457 |
+
if ($.isFunction(this.data.text)) {
|
| 3458 |
+
return this.data.text(e);
|
| 3459 |
+
} else {
|
| 3460 |
+
return e[this.data.text];
|
| 3461 |
+
}
|
| 3462 |
+
} else {
|
| 3463 |
+
return e.text;
|
| 3464 |
+
}
|
| 3465 |
+
},
|
| 3466 |
+
matcher: function(term, text) {
|
| 3467 |
+
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
| 3468 |
+
},
|
| 3469 |
+
separator: ",",
|
| 3470 |
+
tokenSeparators: [],
|
| 3471 |
+
tokenizer: defaultTokenizer,
|
| 3472 |
+
escapeMarkup: defaultEscapeMarkup,
|
| 3473 |
+
blurOnChange: false,
|
| 3474 |
+
selectOnBlur: false,
|
| 3475 |
+
adaptContainerCssClass: function(c) { return c; },
|
| 3476 |
+
adaptDropdownCssClass: function(c) { return null; },
|
| 3477 |
+
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
| 3478 |
+
searchInputPlaceholder: '',
|
| 3479 |
+
createSearchChoicePosition: 'top',
|
| 3480 |
+
shouldFocusInput: function (instance) {
|
| 3481 |
+
// Attempt to detect touch devices
|
| 3482 |
+
var supportsTouchEvents = (('ontouchstart' in window) ||
|
| 3483 |
+
(navigator.msMaxTouchPoints > 0));
|
| 3484 |
+
|
| 3485 |
+
// Only devices which support touch events should be special cased
|
| 3486 |
+
if (!supportsTouchEvents) {
|
| 3487 |
+
return true;
|
| 3488 |
+
}
|
| 3489 |
+
|
| 3490 |
+
// Never focus the input if search is disabled
|
| 3491 |
+
if (instance.opts.minimumResultsForSearch < 0) {
|
| 3492 |
+
return false;
|
| 3493 |
+
}
|
| 3494 |
+
|
| 3495 |
+
return true;
|
| 3496 |
+
}
|
| 3497 |
+
};
|
| 3498 |
+
|
| 3499 |
+
$.fn.select2.locales = [];
|
| 3500 |
+
|
| 3501 |
+
$.fn.select2.locales['en'] = {
|
| 3502 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 3503 |
+
formatNoMatches: function () { return "No matches found"; },
|
| 3504 |
+
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
| 3505 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 3506 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 3507 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3508 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 3509 |
+
formatSearching: function () { return "Searching…"; }
|
| 3510 |
+
};
|
| 3511 |
+
|
| 3512 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 3513 |
+
|
| 3514 |
+
$.fn.select2.ajaxDefaults = {
|
| 3515 |
+
transport: $.ajax,
|
| 3516 |
+
params: {
|
| 3517 |
+
type: "GET",
|
| 3518 |
+
cache: false,
|
| 3519 |
+
dataType: "json"
|
| 3520 |
+
}
|
| 3521 |
+
};
|
| 3522 |
+
|
| 3523 |
+
// exports
|
| 3524 |
+
window.Select2 = {
|
| 3525 |
+
query: {
|
| 3526 |
+
ajax: ajax,
|
| 3527 |
+
local: local,
|
| 3528 |
+
tags: tags
|
| 3529 |
+
}, util: {
|
| 3530 |
+
debounce: debounce,
|
| 3531 |
+
markMatch: markMatch,
|
| 3532 |
+
escapeMarkup: defaultEscapeMarkup,
|
| 3533 |
+
stripDiacritics: stripDiacritics
|
| 3534 |
+
}, "class": {
|
| 3535 |
+
"abstract": AbstractSelect2,
|
| 3536 |
+
"single": SingleSelect2,
|
| 3537 |
+
"multi": MultiSelect2
|
| 3538 |
+
}
|
| 3539 |
+
};
|
| 3540 |
+
|
| 3541 |
+
}(jQuery));
|
assets/deps/select2-3.5.2/select2.min.js
ADDED
|
@@ -0,0 +1,23 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2014 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
+
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
| 22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
| 23 |
+
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
assets/deps/select2-3.5.2/select2.png
ADDED
|
Binary file
|
assets/deps/select2-3.5.2/select2_locale_ar.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Arabic translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Adel KEDJOUR <adel@kedjour.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ar'] = {
|
| 10 |
+
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
| 15 |
+
formatSearching: function () { return "البحث…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_az.js
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Azerbaijani translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['az'] = {
|
| 10 |
+
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
| 11 |
+
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
| 12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
| 13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
| 14 |
+
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
| 15 |
+
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
| 16 |
+
formatSearching: function () { return "Axtarılır…"; }
|
| 17 |
+
};
|
| 18 |
+
|
| 19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
| 20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_bg.js
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Bulgarian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
| 5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['bg'] = {
|
| 11 |
+
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
| 12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
| 13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
| 14 |
+
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
| 15 |
+
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
| 16 |
+
formatSearching: function () { return "Търсене…"; }
|
| 17 |
+
};
|
| 18 |
+
|
| 19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
| 20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ca.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Catalan translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: David Planella <david.planella@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ca'] = {
|
| 10 |
+
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
| 15 |
+
formatSearching: function () { return "S'està cercant…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_cs.js
ADDED
|
@@ -0,0 +1,51 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Czech translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Michal Marek <ahoj@michal-marek.cz>
|
| 5 |
+
* Author - sklonovani: David Vallner <david@vallner.net>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
// use text for the numbers 2 through 4
|
| 10 |
+
var smallNumbers = {
|
| 11 |
+
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
| 12 |
+
3: function() { return "tři"; },
|
| 13 |
+
4: function() { return "čtyři"; }
|
| 14 |
+
}
|
| 15 |
+
$.fn.select2.locales['cs'] = {
|
| 16 |
+
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
| 17 |
+
formatInputTooShort: function (input, min) {
|
| 18 |
+
var n = min - input.length;
|
| 19 |
+
if (n == 1) {
|
| 20 |
+
return "Prosím zadejte ještě jeden znak";
|
| 21 |
+
} else if (n <= 4) {
|
| 22 |
+
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
| 23 |
+
} else {
|
| 24 |
+
return "Prosím zadejte ještě dalších "+n+" znaků";
|
| 25 |
+
}
|
| 26 |
+
},
|
| 27 |
+
formatInputTooLong: function (input, max) {
|
| 28 |
+
var n = input.length - max;
|
| 29 |
+
if (n == 1) {
|
| 30 |
+
return "Prosím zadejte o jeden znak méně";
|
| 31 |
+
} else if (n <= 4) {
|
| 32 |
+
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
| 33 |
+
} else {
|
| 34 |
+
return "Prosím zadejte o "+n+" znaků méně";
|
| 35 |
+
}
|
| 36 |
+
},
|
| 37 |
+
formatSelectionTooBig: function (limit) {
|
| 38 |
+
if (limit == 1) {
|
| 39 |
+
return "Můžete zvolit jen jednu položku";
|
| 40 |
+
} else if (limit <= 4) {
|
| 41 |
+
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
| 42 |
+
} else {
|
| 43 |
+
return "Můžete zvolit maximálně "+limit+" položek";
|
| 44 |
+
}
|
| 45 |
+
},
|
| 46 |
+
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
| 47 |
+
formatSearching: function () { return "Vyhledávání…"; }
|
| 48 |
+
};
|
| 49 |
+
|
| 50 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
| 51 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_da.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Danish translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Anders Jenbo <anders@jenbo.dk>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['da'] = {
|
| 10 |
+
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
| 15 |
+
formatSearching: function () { return "Søger…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_de.js
ADDED
|
@@ -0,0 +1,18 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 German translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['de'] = {
|
| 8 |
+
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
| 13 |
+
formatSearching: function () { return "Suche…"; },
|
| 14 |
+
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
| 15 |
+
};
|
| 16 |
+
|
| 17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
| 18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_el.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Greek translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['el'] = {
|
| 10 |
+
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
| 15 |
+
formatSearching: function () { return "Αναζήτηση…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_en.js.template
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 <Language> translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Your Name <your@email>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['en'] = {
|
| 10 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
| 11 |
+
formatNoMatches: function () { return "No matches found"; },
|
| 12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
| 13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
| 14 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 15 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
| 16 |
+
formatSearching: function () { return "Searching…"; }
|
| 17 |
+
};
|
| 18 |
+
|
| 19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
| 20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_es.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Spanish translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['es'] = {
|
| 8 |
+
formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
|
| 9 |
+
formatNoMatches: function () { return "No se encontraron resultados"; },
|
| 10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
| 12 |
+
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 13 |
+
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
| 14 |
+
formatSearching: function () { return "Buscando…"; },
|
| 15 |
+
formatAjaxError: function() { return "La carga falló"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_et.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Estonian translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['et'] = {
|
| 10 |
+
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
| 15 |
+
formatSearching: function () { return "Otsin.."; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_eu.js
ADDED
|
@@ -0,0 +1,45 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Basque translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['eu'] = {
|
| 10 |
+
formatNoMatches: function () {
|
| 11 |
+
return "Ez da bat datorrenik aurkitu";
|
| 12 |
+
},
|
| 13 |
+
formatInputTooShort: function (input, min) {
|
| 14 |
+
var n = min - input.length;
|
| 15 |
+
if (n === 1) {
|
| 16 |
+
return "Idatzi karaktere bat gehiago";
|
| 17 |
+
} else {
|
| 18 |
+
return "Idatzi " + n + " karaktere gehiago";
|
| 19 |
+
}
|
| 20 |
+
},
|
| 21 |
+
formatInputTooLong: function (input, max) {
|
| 22 |
+
var n = input.length - max;
|
| 23 |
+
if (n === 1) {
|
| 24 |
+
return "Idatzi karaktere bat gutxiago";
|
| 25 |
+
} else {
|
| 26 |
+
return "Idatzi " + n + " karaktere gutxiago";
|
| 27 |
+
}
|
| 28 |
+
},
|
| 29 |
+
formatSelectionTooBig: function (limit) {
|
| 30 |
+
if (limit === 1 ) {
|
| 31 |
+
return "Elementu bakarra hauta dezakezu";
|
| 32 |
+
} else {
|
| 33 |
+
return limit + " elementu hauta ditzakezu soilik";
|
| 34 |
+
}
|
| 35 |
+
},
|
| 36 |
+
formatLoadMore: function (pageNumber) {
|
| 37 |
+
return "Emaitza gehiago kargatzen…";
|
| 38 |
+
},
|
| 39 |
+
formatSearching: function () {
|
| 40 |
+
return "Bilatzen…";
|
| 41 |
+
}
|
| 42 |
+
};
|
| 43 |
+
|
| 44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
| 45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fa.js
ADDED
|
@@ -0,0 +1,21 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Persian translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Ali Choopan <choopan@arsh.co>
|
| 5 |
+
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['fa'] = {
|
| 11 |
+
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
| 12 |
+
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
| 13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
| 14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
| 15 |
+
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
| 16 |
+
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
| 17 |
+
formatSearching: function () { return "در حال جستجو…"; }
|
| 18 |
+
};
|
| 19 |
+
|
| 20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
| 21 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fi.js
ADDED
|
@@ -0,0 +1,30 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Finnish translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
$.fn.select2.locales['fi'] = {
|
| 7 |
+
formatNoMatches: function () {
|
| 8 |
+
return "Ei tuloksia";
|
| 9 |
+
},
|
| 10 |
+
formatInputTooShort: function (input, min) {
|
| 11 |
+
var n = min - input.length;
|
| 12 |
+
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
| 13 |
+
},
|
| 14 |
+
formatInputTooLong: function (input, max) {
|
| 15 |
+
var n = input.length - max;
|
| 16 |
+
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
| 17 |
+
},
|
| 18 |
+
formatSelectionTooBig: function (limit) {
|
| 19 |
+
return "Voit valita ainoastaan " + limit + " kpl";
|
| 20 |
+
},
|
| 21 |
+
formatLoadMore: function (pageNumber) {
|
| 22 |
+
return "Ladataan lisää tuloksia…";
|
| 23 |
+
},
|
| 24 |
+
formatSearching: function () {
|
| 25 |
+
return "Etsitään…";
|
| 26 |
+
}
|
| 27 |
+
};
|
| 28 |
+
|
| 29 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
| 30 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fr.js
ADDED
|
@@ -0,0 +1,18 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 French translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['fr'] = {
|
| 8 |
+
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
| 9 |
+
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
| 10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
| 11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
| 12 |
+
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
| 13 |
+
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
| 14 |
+
formatSearching: function () { return "Recherche en cours…"; }
|
| 15 |
+
};
|
| 16 |
+
|
| 17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
| 18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_gl.js
ADDED
|
@@ -0,0 +1,45 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Galician translation
|
| 3 |
+
*
|
| 4 |
+
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['gl'] = {
|
| 10 |
+
formatNoMatches: function () {
|
| 11 |
+
return "Non se atoparon resultados";
|
| 12 |
+
},
|
| 13 |
+
formatInputTooShort: function (input, min) {
|
| 14 |
+
var n = min - input.length;
|
| 15 |
+
if (n === 1) {
|
| 16 |
+
return "Engada un carácter";
|
| 17 |
+
} else {
|
| 18 |
+
return "Engada " + n + " caracteres";
|
| 19 |
+
}
|
| 20 |
+
},
|
| 21 |
+
formatInputTooLong: function (input, max) {
|
| 22 |
+
var n = input.length - max;
|
| 23 |
+
if (n === 1) {
|
| 24 |
+
return "Elimine un carácter";
|
| 25 |
+
} else {
|
| 26 |
+
return "Elimine " + n + " caracteres";
|
| 27 |
+
}
|
| 28 |
+
},
|
| 29 |
+
formatSelectionTooBig: function (limit) {
|
| 30 |
+
if (limit === 1 ) {
|
| 31 |
+
return "Só pode seleccionar un elemento";
|
| 32 |
+
} else {
|
| 33 |
+
return "Só pode seleccionar " + limit + " elementos";
|
| 34 |
+
}
|
| 35 |
+
},
|
| 36 |
+
formatLoadMore: function (pageNumber) {
|
| 37 |
+
return "Cargando máis resultados…";
|
| 38 |
+
},
|
| 39 |
+
formatSearching: function () {
|
| 40 |
+
return "Buscando…";
|
| 41 |
+
}
|
| 42 |
+
};
|
| 43 |
+
|
| 44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
| 45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_he.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Hebrew translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['he'] = {
|
| 10 |
+
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
| 15 |
+
formatSearching: function () { return "מחפש…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hr.js
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Croatian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Edi Modrić <edi.modric@gmail.com>
|
| 5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['hr'] = {
|
| 11 |
+
formatNoMatches: function () { return "Nema rezultata"; },
|
| 12 |
+
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
| 13 |
+
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
| 14 |
+
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
| 15 |
+
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
| 16 |
+
formatSearching: function () { return "Pretraga…"; }
|
| 17 |
+
};
|
| 18 |
+
|
| 19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
| 20 |
+
|
| 21 |
+
function character (n) {
|
| 22 |
+
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
| 23 |
+
}
|
| 24 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hu.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Hungarian translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['hu'] = {
|
| 8 |
+
formatNoMatches: function () { return "Nincs találat."; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
| 13 |
+
formatSearching: function () { return "Keresés…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_id.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Indonesian translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['id'] = {
|
| 10 |
+
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
| 15 |
+
formatSearching: function () { return "Mencari…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_is.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Icelandic translation.
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['is'] = {
|
| 8 |
+
formatNoMatches: function () { return "Ekkert fannst"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
| 13 |
+
formatSearching: function () { return "Leita…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_it.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Italian translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['it'] = {
|
| 8 |
+
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
| 13 |
+
formatSearching: function () { return "Ricerca…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ja.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Japanese translation.
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['ja'] = {
|
| 8 |
+
formatNoMatches: function () { return "該当なし"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "読込中･･･"; },
|
| 13 |
+
formatSearching: function () { return "検索中･･･"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ka.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Georgian (Kartuli) translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Dimitri Kurashvili dimakura@gmail.com
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ka'] = {
|
| 10 |
+
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
| 15 |
+
formatSearching: function () { return "ძებნა…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ko.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Korean translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Swen Mun <longfinfunnel@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ko'] = {
|
| 10 |
+
formatNoMatches: function () { return "결과 없음"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
| 15 |
+
formatSearching: function () { return "검색 중…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lt.js
ADDED
|
@@ -0,0 +1,26 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Lithuanian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
| 5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['lt'] = {
|
| 11 |
+
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
| 12 |
+
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
| 13 |
+
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
| 14 |
+
formatSelectionTooBig: function (limit) {
|
| 15 |
+
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
| 16 |
+
},
|
| 17 |
+
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
| 18 |
+
formatSearching: function () { return "Ieškoma…"; }
|
| 19 |
+
};
|
| 20 |
+
|
| 21 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
| 22 |
+
|
| 23 |
+
function character (n) {
|
| 24 |
+
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
| 25 |
+
}
|
| 26 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lv.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Latvian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['lv'] = {
|
| 10 |
+
formatNoMatches: function () { return "Sakritību nav"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
| 15 |
+
formatSearching: function () { return "Meklēšana…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_mk.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Macedonian translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Marko Aleksic <psybaron@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['mk'] = {
|
| 10 |
+
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
| 15 |
+
formatSearching: function () { return "Пребарување…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ms.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Malay translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Kepoweran <kepoweran@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ms'] = {
|
| 10 |
+
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
| 15 |
+
formatSearching: function () { return "Mencari…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_nb.js
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Norwegian Bokmål translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
| 5 |
+
* Author: Bjørn Johansen <post@bjornjohansen.no>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['nb'] = {
|
| 11 |
+
formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
|
| 12 |
+
formatNoMatches: function () { return "Ingen treff"; },
|
| 13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
| 14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
| 15 |
+
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
| 16 |
+
formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
|
| 17 |
+
formatSearching: function () { return "Søker …"; }
|
| 18 |
+
};
|
| 19 |
+
|
| 20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
| 21 |
+
})(jQuery);
|
| 22 |
+
|
assets/deps/select2-3.5.2/select2_locale_nl.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Dutch translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['nl'] = {
|
| 8 |
+
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
| 13 |
+
formatSearching: function () { return "Zoeken…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pl.js
ADDED
|
@@ -0,0 +1,54 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Polish translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
| 5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
+
* @author Michał Połtyn <mike@poltyn.com>
|
| 7 |
+
* @author Damian Zajkowski <damian.zajkowski@gmail.com>
|
| 8 |
+
*/
|
| 9 |
+
(function($) {
|
| 10 |
+
"use strict";
|
| 11 |
+
|
| 12 |
+
$.fn.select2.locales['pl'] = {
|
| 13 |
+
formatNoMatches: function() {
|
| 14 |
+
return "Brak wyników";
|
| 15 |
+
},
|
| 16 |
+
formatInputTooShort: function(input, min) {
|
| 17 |
+
return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
|
| 18 |
+
},
|
| 19 |
+
formatInputTooLong: function(input, max) {
|
| 20 |
+
return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
|
| 21 |
+
},
|
| 22 |
+
formatSelectionTooBig: function(limit) {
|
| 23 |
+
return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
|
| 24 |
+
},
|
| 25 |
+
formatLoadMore: function(pageNumber) {
|
| 26 |
+
return "Ładowanie wyników…";
|
| 27 |
+
},
|
| 28 |
+
formatSearching: function() {
|
| 29 |
+
return "Szukanie…";
|
| 30 |
+
}
|
| 31 |
+
};
|
| 32 |
+
|
| 33 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
| 34 |
+
|
| 35 |
+
function character(n, word, pluralSuffix) {
|
| 36 |
+
//Liczba pojedyncza - brak suffiksu
|
| 37 |
+
//jeden znak
|
| 38 |
+
//jeden element
|
| 39 |
+
var suffix = '';
|
| 40 |
+
if (n > 1 && n < 5) {
|
| 41 |
+
//Liczaba mnoga ilość od 2 do 4 - własny suffiks
|
| 42 |
+
//Dwa znaki, trzy znaki, cztery znaki.
|
| 43 |
+
//Dwa elementy, trzy elementy, cztery elementy
|
| 44 |
+
suffix = pluralSuffix;
|
| 45 |
+
} else if (n == 0 || n >= 5) {
|
| 46 |
+
//Ilość 0 suffiks ów
|
| 47 |
+
//Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
|
| 48 |
+
//Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
|
| 49 |
+
//Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
|
| 50 |
+
suffix = 'ów';
|
| 51 |
+
}
|
| 52 |
+
return " " + n + " " + word + suffix;
|
| 53 |
+
}
|
| 54 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-BR.js
ADDED
|
@@ -0,0 +1,18 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Brazilian Portuguese translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['pt-BR'] = {
|
| 8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
+
formatAjaxError: function () { return "Erro na busca"; },
|
| 10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
|
| 11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
| 12 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 13 |
+
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
| 14 |
+
formatSearching: function () { return "Buscando…"; }
|
| 15 |
+
};
|
| 16 |
+
|
| 17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
| 18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-PT.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Portuguese (Portugal) translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['pt-PT'] = {
|
| 8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
| 13 |
+
formatSearching: function () { return "A pesquisar…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ro.js
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Romanian translation.
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
|
| 7 |
+
$.fn.select2.locales['ro'] = {
|
| 8 |
+
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
| 9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
| 10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
| 11 |
+
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
| 12 |
+
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
| 13 |
+
formatSearching: function () { return "Căutare…"; }
|
| 14 |
+
};
|
| 15 |
+
|
| 16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
| 17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_rs.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Serbian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Limon Monte <limon.monte@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['rs'] = {
|
| 10 |
+
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
| 15 |
+
formatSearching: function () { return "Pretraga…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ru.js
ADDED
|
@@ -0,0 +1,23 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Russian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['ru'] = {
|
| 10 |
+
formatNoMatches: function () { return "Совпадений не найдено"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
| 12 |
+
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
| 15 |
+
formatSearching: function () { return "Поиск…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
| 19 |
+
|
| 20 |
+
function character (n) {
|
| 21 |
+
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
| 22 |
+
}
|
| 23 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sk.js
ADDED
|
@@ -0,0 +1,50 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Slovak translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: David Vallner <david@vallner.net>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
// use text for the numbers 2 through 4
|
| 9 |
+
var smallNumbers = {
|
| 10 |
+
2: function(masc) { return (masc ? "dva" : "dve"); },
|
| 11 |
+
3: function() { return "tri"; },
|
| 12 |
+
4: function() { return "štyri"; }
|
| 13 |
+
};
|
| 14 |
+
$.fn.select2.locales['sk'] = {
|
| 15 |
+
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
| 16 |
+
formatInputTooShort: function (input, min) {
|
| 17 |
+
var n = min - input.length;
|
| 18 |
+
if (n == 1) {
|
| 19 |
+
return "Prosím, zadajte ešte jeden znak";
|
| 20 |
+
} else if (n <= 4) {
|
| 21 |
+
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
| 22 |
+
} else {
|
| 23 |
+
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
| 24 |
+
}
|
| 25 |
+
},
|
| 26 |
+
formatInputTooLong: function (input, max) {
|
| 27 |
+
var n = input.length - max;
|
| 28 |
+
if (n == 1) {
|
| 29 |
+
return "Prosím, zadajte o jeden znak menej";
|
| 30 |
+
} else if (n >= 2 && n <= 4) {
|
| 31 |
+
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
| 32 |
+
} else {
|
| 33 |
+
return "Prosím, zadajte o "+n+" znakov menej";
|
| 34 |
+
}
|
| 35 |
+
},
|
| 36 |
+
formatSelectionTooBig: function (limit) {
|
| 37 |
+
if (limit == 1) {
|
| 38 |
+
return "Môžete zvoliť len jednu položku";
|
| 39 |
+
} else if (limit >= 2 && limit <= 4) {
|
| 40 |
+
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
| 41 |
+
} else {
|
| 42 |
+
return "Môžete zvoliť najviac "+limit+" položiek";
|
| 43 |
+
}
|
| 44 |
+
},
|
| 45 |
+
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
| 46 |
+
formatSearching: function () { return "Vyhľadávanie…"; }
|
| 47 |
+
};
|
| 48 |
+
|
| 49 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
| 50 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sv.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Swedish translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Jens Rantil <jens.rantil@telavox.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['sv'] = {
|
| 10 |
+
formatNoMatches: function () { return "Inga träffar"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
| 15 |
+
formatSearching: function () { return "Söker…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_th.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Thai translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['th'] = {
|
| 10 |
+
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
| 15 |
+
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_tr.js
ADDED
|
@@ -0,0 +1,19 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Turkish translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['tr'] = {
|
| 10 |
+
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
| 15 |
+
formatSearching: function () { return "Aranıyor…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
| 19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ug-CN.js
ADDED
|
@@ -0,0 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Uyghur translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
$.fn.select2.locales['ug-CN'] = {
|
| 7 |
+
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
| 8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
| 9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
| 10 |
+
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
| 11 |
+
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
| 12 |
+
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
| 13 |
+
};
|
| 14 |
+
|
| 15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
| 16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_uk.js
ADDED
|
@@ -0,0 +1,25 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Ukrainian translation.
|
| 3 |
+
*
|
| 4 |
+
* @author bigmihail <bigmihail@bigmir.net>
|
| 5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
| 6 |
+
*/
|
| 7 |
+
(function ($) {
|
| 8 |
+
"use strict";
|
| 9 |
+
|
| 10 |
+
$.fn.select2.locales['uk'] = {
|
| 11 |
+
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
| 12 |
+
formatNoMatches: function () { return "Нічого не знайдено"; },
|
| 13 |
+
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
| 14 |
+
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
| 15 |
+
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
| 16 |
+
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
| 17 |
+
formatSearching: function () { return "Пошук…"; }
|
| 18 |
+
};
|
| 19 |
+
|
| 20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
| 21 |
+
|
| 22 |
+
function character (n, word) {
|
| 23 |
+
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
| 24 |
+
}
|
| 25 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_vi.js
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Vietnamese translation.
|
| 3 |
+
*
|
| 4 |
+
* Author: Long Nguyen <olragon@gmail.com>
|
| 5 |
+
*/
|
| 6 |
+
(function ($) {
|
| 7 |
+
"use strict";
|
| 8 |
+
|
| 9 |
+
$.fn.select2.locales['vi'] = {
|
| 10 |
+
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
| 11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
| 12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
| 13 |
+
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
| 14 |
+
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
| 15 |
+
formatSearching: function () { return "Đang tìm…"; }
|
| 16 |
+
};
|
| 17 |
+
|
| 18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
| 19 |
+
})(jQuery);
|
| 20 |
+
|
assets/deps/select2-3.5.2/select2_locale_zh-CN.js
ADDED
|
@@ -0,0 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Chinese translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
$.fn.select2.locales['zh-CN'] = {
|
| 7 |
+
formatNoMatches: function () { return "没有找到匹配项"; },
|
| 8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
| 9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
| 10 |
+
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
| 11 |
+
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
| 12 |
+
formatSearching: function () { return "搜索中…"; }
|
| 13 |
+
};
|
| 14 |
+
|
| 15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
| 16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_zh-TW.js
ADDED
|
@@ -0,0 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/**
|
| 2 |
+
* Select2 Traditional Chinese translation
|
| 3 |
+
*/
|
| 4 |
+
(function ($) {
|
| 5 |
+
"use strict";
|
| 6 |
+
$.fn.select2.locales['zh-TW'] = {
|
| 7 |
+
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
| 8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
| 9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
| 10 |
+
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
| 11 |
+
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
| 12 |
+
formatSearching: function () { return "搜尋中…"; }
|
| 13 |
+
};
|
| 14 |
+
|
| 15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
| 16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2x2.png
ADDED
|
Binary file
|
assets/deps/starrr/starrr.js
ADDED
|
@@ -0,0 +1,123 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
var __slice = [].slice;
|
| 2 |
+
|
| 3 |
+
(function(jQuery, window) {
|
| 4 |
+
var Starrr;
|
| 5 |
+
window.Starrr = Starrr = (function() {
|
| 6 |
+
Starrr.prototype.defaults = {
|
| 7 |
+
rating: void 0,
|
| 8 |
+
numStars: 5,
|
| 9 |
+
emptyStarClass: 'fa fa-star-o',
|
| 10 |
+
fullStarClass: 'fa fa-star',
|
| 11 |
+
change: function(e, value) {}
|
| 12 |
+
};
|
| 13 |
+
|
| 14 |
+
function Starrr($el, options) {
|
| 15 |
+
var i, _, _ref;
|
| 16 |
+
this.options = jQuery.extend({}, this.defaults, options);
|
| 17 |
+
this.$el = $el;
|
| 18 |
+
_ref = this.defaults;
|
| 19 |
+
for (i in _ref) {
|
| 20 |
+
_ = _ref[i];
|
| 21 |
+
if (this.$el.data(i.toLowerCase()) != null) {
|
| 22 |
+
this.options[i] = this.$el.data(i.toLowerCase());
|
| 23 |
+
}
|
| 24 |
+
}
|
| 25 |
+
if (this.$el.data('connected-input')) {
|
| 26 |
+
this.$connectedInput = jQuery("[name=\"" + (this.$el.data('connected-input')) + "\"]");
|
| 27 |
+
this.options.rating = this.$connectedInput.val() ? parseInt(this.$connectedInput.val(), 10) : void 0;
|
| 28 |
+
}
|
| 29 |
+
this.createStars();
|
| 30 |
+
this.syncRating();
|
| 31 |
+
if (this.$connectedInput && this.$connectedInput.is(':disabled')) {
|
| 32 |
+
return;
|
| 33 |
+
}
|
| 34 |
+
this.$el.on('mouseover.starrr', 'i', (function(_this) {
|
| 35 |
+
return function(e) {
|
| 36 |
+
return _this.syncRating(_this.getStars().index(e.currentTarget) + 1);
|
| 37 |
+
};
|
| 38 |
+
})(this));
|
| 39 |
+
this.$el.on('mouseout.starrr', (function(_this) {
|
| 40 |
+
return function() {
|
| 41 |
+
return _this.syncRating();
|
| 42 |
+
};
|
| 43 |
+
})(this));
|
| 44 |
+
this.$el.on('click.starrr', 'i', (function(_this) {
|
| 45 |
+
return function(e) {
|
| 46 |
+
return _this.setRating(_this.getStars().index(e.currentTarget) + 1);
|
| 47 |
+
};
|
| 48 |
+
})(this));
|
| 49 |
+
this.$el.on('starrr:change', this.options.change);
|
| 50 |
+
if (this.$connectedInput != null) {
|
| 51 |
+
this.$el.on('starrr:change', (function(_this) {
|
| 52 |
+
return function(e, value) {
|
| 53 |
+
_this.$connectedInput.val(value);
|
| 54 |
+
return _this.$connectedInput.trigger('focusout');
|
| 55 |
+
};
|
| 56 |
+
})(this));
|
| 57 |
+
}
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
Starrr.prototype.getStars = function() {
|
| 61 |
+
return this.$el.find('i');
|
| 62 |
+
};
|
| 63 |
+
|
| 64 |
+
Starrr.prototype.createStars = function() {
|
| 65 |
+
var _i, _ref, _results;
|
| 66 |
+
_results = [];
|
| 67 |
+
for (_i = 1, _ref = this.options.numStars; 1 <= _ref ? _i <= _ref : _i >= _ref; 1 <= _ref ? _i++ : _i--) {
|
| 68 |
+
_results.push(this.$el.append("<i class='" + this.options.emptyStarClass + "'></i>"));
|
| 69 |
+
}
|
| 70 |
+
return _results;
|
| 71 |
+
};
|
| 72 |
+
|
| 73 |
+
Starrr.prototype.setRating = function(rating) {
|
| 74 |
+
if (this.options.rating === rating) {
|
| 75 |
+
rating = void 0;
|
| 76 |
+
}
|
| 77 |
+
this.options.rating = rating;
|
| 78 |
+
this.syncRating();
|
| 79 |
+
return this.$el.trigger('starrr:change', rating);
|
| 80 |
+
};
|
| 81 |
+
|
| 82 |
+
Starrr.prototype.getRating = function() {
|
| 83 |
+
return this.options.rating;
|
| 84 |
+
};
|
| 85 |
+
|
| 86 |
+
Starrr.prototype.syncRating = function(rating) {
|
| 87 |
+
var i, _i, _j, _ref, _ref1;
|
| 88 |
+
rating || (rating = this.options.rating);
|
| 89 |
+
if (rating) {
|
| 90 |
+
for (i = _i = 0, _ref = rating - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
|
| 91 |
+
this.getStars().eq(i).removeClass(this.options.emptyStarClass).addClass(this.options.fullStarClass);
|
| 92 |
+
}
|
| 93 |
+
}
|
| 94 |
+
if (rating && rating < this.options.numStars) {
|
| 95 |
+
for (i = _j = rating, _ref1 = this.options.numStars - 1; rating <= _ref1 ? _j <= _ref1 : _j >= _ref1; i = rating <= _ref1 ? ++_j : --_j) {
|
| 96 |
+
this.getStars().eq(i).removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
| 97 |
+
}
|
| 98 |
+
}
|
| 99 |
+
if (!rating) {
|
| 100 |
+
return this.getStars().removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
| 101 |
+
}
|
| 102 |
+
};
|
| 103 |
+
|
| 104 |
+
return Starrr;
|
| 105 |
+
|
| 106 |
+
})();
|
| 107 |
+
return jQuery.fn.extend({
|
| 108 |
+
starrr: function() {
|
| 109 |
+
var args, option;
|
| 110 |
+
option = arguments[0], args = 2 <= arguments.length ? __slice.call(arguments, 1) : [];
|
| 111 |
+
return this.each(function() {
|
| 112 |
+
var data;
|
| 113 |
+
data = jQuery(this).data('starrr');
|
| 114 |
+
if (!data) {
|
| 115 |
+
jQuery(this).data('starrr', (data = new Starrr(jQuery(this), option)));
|
| 116 |
+
}
|
| 117 |
+
if (typeof option === 'string') {
|
| 118 |
+
return data[option].apply(data, args);
|
| 119 |
+
}
|
| 120 |
+
});
|
| 121 |
+
}
|
| 122 |
+
});
|
| 123 |
+
})(window.jQuery, window);
|
assets/images/button.png
ADDED
|
Binary file
|
assets/images/email.png
ADDED
|
Binary file
|
assets/images/heart.png
ADDED
|
Binary file
|
assets/images/internet.png
ADDED
|
Binary file
|
assets/images/iwp.png
ADDED
|
Binary file
|
assets/images/next-arrow.png
ADDED
|
Binary file
|
assets/images/question-mark.png
ADDED
|
Binary file
|
assets/images/repeat.png
ADDED
|
Binary file
|
assets/images/select-all.png
ADDED
|
Binary file
|
assets/images/simple-arrow.png
ADDED
|
Binary file
|
assets/images/tick.png
ADDED
|
Binary file
|
assets/images/twitter.png
ADDED
|
Binary file
|
assets/js/button-mce.js
ADDED
|
@@ -0,0 +1,45 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
(function() {
|
| 2 |
+
tinymce.PluginManager.add('irp_mce_button', function(editor, url) {
|
| 3 |
+
editor.addButton('irp_mce_button', {
|
| 4 |
+
title: 'Inline Related Posts PRO'
|
| 5 |
+
, type: 'menubutton'
|
| 6 |
+
, icon: 'icon irp-own-icon'
|
| 7 |
+
, image : url + '/../images/repeat.png'
|
| 8 |
+
, menu: [
|
| 9 |
+
{
|
| 10 |
+
text: 'Inline Related Post'
|
| 11 |
+
, onclick: function() {
|
| 12 |
+
var code='[irp]';
|
| 13 |
+
editor.insertContent(code);
|
| 14 |
+
}
|
| 15 |
+
}
|
| 16 |
+
, {
|
| 17 |
+
text: 'Custom Related Post'
|
| 18 |
+
, onclick: function() {
|
| 19 |
+
editor.windowManager.open({
|
| 20 |
+
title: 'Choose a post'
|
| 21 |
+
, width: 350
|
| 22 |
+
, height: 250
|
| 23 |
+
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=post'
|
| 24 |
+
, inline: 1
|
| 25 |
+
, resizable: false
|
| 26 |
+
});
|
| 27 |
+
}
|
| 28 |
+
}
|
| 29 |
+
, {
|
| 30 |
+
text: 'Custom Related Page'
|
| 31 |
+
, onclick: function() {
|
| 32 |
+
editor.windowManager.open({
|
| 33 |
+
title: 'Choose a page'
|
| 34 |
+
, width: 350
|
| 35 |
+
, height: 250
|
| 36 |
+
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=page'
|
| 37 |
+
, inline: 1
|
| 38 |
+
, resizable: false
|
| 39 |
+
});
|
| 40 |
+
}
|
| 41 |
+
}
|
| 42 |
+
]
|
| 43 |
+
});
|
| 44 |
+
});
|
| 45 |
+
})();
|
assets/js/common.js
ADDED
|
@@ -0,0 +1,174 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
//IntellyWP
|
| 2 |
+
jQuery('.wrap .updated.fade').remove();
|
| 3 |
+
jQuery('.woocommerce-message').remove();
|
| 4 |
+
jQuery('.error').remove();
|
| 5 |
+
jQuery('.info').remove();
|
| 6 |
+
jQuery('.update-nag').remove();
|
| 7 |
+
|
| 8 |
+
jQuery(function() {
|
| 9 |
+
"use strict";
|
| 10 |
+
//WooCommerce errors
|
| 11 |
+
var removeWooUpdateTheme = setInterval(function () {
|
| 12 |
+
if (jQuery('.wrap .updated.fade').length > 0) {
|
| 13 |
+
jQuery('.wrap .updated.fade').remove();
|
| 14 |
+
clearInterval(removeWooUpdateTheme);
|
| 15 |
+
}
|
| 16 |
+
}, 100);
|
| 17 |
+
var removeWooMessage = setInterval(function () {
|
| 18 |
+
if (jQuery('.woocommerce-message').length > 0) {
|
| 19 |
+
jQuery('.woocommerce-message').remove();
|
| 20 |
+
clearInterval(removeWooMessage);
|
| 21 |
+
}
|
| 22 |
+
}, 100);
|
| 23 |
+
|
| 24 |
+
jQuery('.wrap .updated.fade').remove();
|
| 25 |
+
jQuery('.woocommerce-message').remove();
|
| 26 |
+
jQuery('.error').remove();
|
| 27 |
+
jQuery('.info').remove();
|
| 28 |
+
jQuery('.update-nag').remove();
|
| 29 |
+
});
|
| 30 |
+
|
| 31 |
+
function IRP_stripos(haystack, needle, offset) {
|
| 32 |
+
// discuss at: http://phpjs.org/functions/stripos/
|
| 33 |
+
// original by: Martijn Wieringa
|
| 34 |
+
// revised by: Onno Marsman
|
| 35 |
+
// example 1: stripos('ABC', 'a');
|
| 36 |
+
// returns 1: 0
|
| 37 |
+
|
| 38 |
+
var haystack = (haystack + '').toLowerCase();
|
| 39 |
+
var needle = (needle + '').toLowerCase();
|
| 40 |
+
var index = 0;
|
| 41 |
+
|
| 42 |
+
if ((index = haystack.indexOf(needle, offset)) !== -1) {
|
| 43 |
+
return index;
|
| 44 |
+
}
|
| 45 |
+
return false;
|
| 46 |
+
}
|
| 47 |
+
function IRP_val(name) {
|
| 48 |
+
return jQuery('[name='+name+']').val();
|
| 49 |
+
}
|
| 50 |
+
function IRP_check(name) {
|
| 51 |
+
return (jQuery('[name='+name+']').is(':checked') ? 1 : 0);
|
| 52 |
+
}
|
| 53 |
+
function IRP_radio(name) {
|
| 54 |
+
return (jQuery('[name='+name+']:checked').val());
|
| 55 |
+
}
|
| 56 |
+
function IRP_visible(name, visible) {
|
| 57 |
+
if(visible) {
|
| 58 |
+
jQuery(name).hide();
|
| 59 |
+
} else {
|
| 60 |
+
jQuery(name).show();
|
| 61 |
+
}
|
| 62 |
+
}
|
| 63 |
+
function IRP_aval(name) {
|
| 64 |
+
var data={};
|
| 65 |
+
jQuery("[name^='"+name+"']").each(function(i,v) {
|
| 66 |
+
var $this=jQuery(this);
|
| 67 |
+
var k=$this.attr('name');
|
| 68 |
+
var v=$this.val();
|
| 69 |
+
if($this.attr('type')=='checkbox') {
|
| 70 |
+
v=IRP_check(k);
|
| 71 |
+
} else if($this.attr('type')=='radio') {
|
| 72 |
+
v=IRP_radio(k);
|
| 73 |
+
}
|
| 74 |
+
data[k]=v;
|
| 75 |
+
});
|
| 76 |
+
//console.log(data);
|
| 77 |
+
return data;
|
| 78 |
+
}
|
| 79 |
+
function IRP_formatColorOption(option) {
|
| 80 |
+
if (!option.id) {
|
| 81 |
+
return option.text;
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
var color=jQuery(option.element).css('background-color');
|
| 85 |
+
var font=jQuery(option.element).css('color');
|
| 86 |
+
var $option = jQuery('<div></div>')
|
| 87 |
+
.html(option.text)
|
| 88 |
+
.css('background-color', color)
|
| 89 |
+
.css('color', font)
|
| 90 |
+
.addClass('irpColorSelectItem');
|
| 91 |
+
return $option;
|
| 92 |
+
}
|
| 93 |
+
function IRP_hideShow(v) {
|
| 94 |
+
var $source = jQuery(v);
|
| 95 |
+
if ($source.attr('irp-hideIfTrue') && $source.attr('irp-hideShow')) {
|
| 96 |
+
var $destination = jQuery('[name=' + $source.attr('irp-hideShow') + ']');
|
| 97 |
+
if ($destination.length == 0) {
|
| 98 |
+
$destination = jQuery('#' + $source.attr('irp-hideShow'));
|
| 99 |
+
}
|
| 100 |
+
if ($destination.length > 0) {
|
| 101 |
+
var isChecked = $source.is(":checked");
|
| 102 |
+
var hideIfTrue = ($source.attr('irp-hideIfTrue').toLowerCase() == 'true');
|
| 103 |
+
|
| 104 |
+
if (isChecked) {
|
| 105 |
+
if (hideIfTrue) {
|
| 106 |
+
$destination.hide();
|
| 107 |
+
} else {
|
| 108 |
+
$destination.show();
|
| 109 |
+
}
|
| 110 |
+
} else {
|
| 111 |
+
if (hideIfTrue) {
|
| 112 |
+
$destination.show();
|
| 113 |
+
} else {
|
| 114 |
+
$destination.hide();
|
| 115 |
+
}
|
| 116 |
+
}
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
jQuery(function() {
|
| 122 |
+
jQuery(".irp-hideShow").click(function () {
|
| 123 |
+
IRP_hideShow(this);
|
| 124 |
+
});
|
| 125 |
+
jQuery(".irp-hideShow").each(function () {
|
| 126 |
+
IRP_hideShow(this);
|
| 127 |
+
});
|
| 128 |
+
|
| 129 |
+
if(jQuery(".irpTags").length>0) {
|
| 130 |
+
jQuery(".irpTags").select2({
|
| 131 |
+
placeholder: "Type here..."
|
| 132 |
+
, theme: "classic"
|
| 133 |
+
, width: '300px'
|
| 134 |
+
});
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
if(jQuery(".irpColorSelect").length>0) {
|
| 138 |
+
jQuery(".irpColorSelect").select2({
|
| 139 |
+
placeholder: "Type here..."
|
| 140 |
+
, theme: "classic"
|
| 141 |
+
, width: '300px'
|
| 142 |
+
, formatResult: IRP_formatColorOption
|
| 143 |
+
, formatSelection: IRP_formatColorOption
|
| 144 |
+
, escapeMarkup: function(m) {
|
| 145 |
+
return m;
|
| 146 |
+
}
|
| 147 |
+
});
|
| 148 |
+
}
|
| 149 |
+
if(jQuery('.irp-help').qtip) {
|
| 150 |
+
jQuery('.irp-help').qtip({
|
| 151 |
+
position: {
|
| 152 |
+
corner: {
|
| 153 |
+
target: 'topMiddle',
|
| 154 |
+
tooltip: 'bottomLeft'
|
| 155 |
+
}
|
| 156 |
+
},
|
| 157 |
+
show: {
|
| 158 |
+
when: {
|
| 159 |
+
event: 'mouseover'
|
| 160 |
+
}
|
| 161 |
+
},
|
| 162 |
+
hide: {
|
| 163 |
+
fixed: true,
|
| 164 |
+
when: {
|
| 165 |
+
event: 'mouseout'
|
| 166 |
+
}
|
| 167 |
+
},
|
| 168 |
+
style: {
|
| 169 |
+
tip: 'bottomLeft',
|
| 170 |
+
name: 'green'
|
| 171 |
+
}
|
| 172 |
+
});
|
| 173 |
+
}
|
| 174 |
+
});
|
assets/landing/img-whatsnew.001.jpg
ADDED
|
Binary file
|
assets/landing/img-whatsnew.002.jpg
ADDED
|
Binary file
|
assets/landing/img-whatsnew.003.jpg
ADDED
|
Binary file
|
assets/landing/mac-irl-wahtsnew.png
ADDED
|
Binary file
|
assets/templates/preview-button.jpg
ADDED
|
Binary file
|
assets/templates/preview-kangoo.jpg
ADDED
|
Binary file
|
assets/templates/preview-ruby.jpg
ADDED
|
Binary file
|
assets/templates/styles.html
ADDED
|
@@ -0,0 +1,198 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#Template Minimalist
|
| 2 |
+
#Defaults {ctaTextColor=, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=BLUE #2 Light, borderColorLabel=border}
|
| 3 |
+
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
| 4 |
+
{comment}
|
| 5 |
+
<style>
|
| 6 |
+
.{utemplate} {
|
| 7 |
+
padding:0px;
|
| 8 |
+
margin: 0;
|
| 9 |
+
padding-top:1em!important;
|
| 10 |
+
padding-bottom:1em!important;
|
| 11 |
+
width:100%;
|
| 12 |
+
display: block;
|
| 13 |
+
font-weight:bold;
|
| 14 |
+
background-color:{boxColor};
|
| 15 |
+
border:0!important;
|
| 16 |
+
{if borderColor}
|
| 17 |
+
border-left:4px solid {borderColor}!important;
|
| 18 |
+
{/if}
|
| 19 |
+
{if hasShadow}
|
| 20 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 21 |
+
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 22 |
+
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 23 |
+
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 24 |
+
{/if}
|
| 25 |
+
text-decoration:none;
|
| 26 |
+
}
|
| 27 |
+
.{utemplate}:active, .{utemplate}:hover {
|
| 28 |
+
opacity: 1;
|
| 29 |
+
transition: opacity 250ms;
|
| 30 |
+
webkit-transition: opacity 250ms;
|
| 31 |
+
text-decoration:none;
|
| 32 |
+
}
|
| 33 |
+
.{utemplate} {
|
| 34 |
+
transition: background-color 250ms;
|
| 35 |
+
webkit-transition: background-color 250ms;
|
| 36 |
+
opacity: {boxOpacity};
|
| 37 |
+
transition: opacity 250ms;
|
| 38 |
+
webkit-transition: opacity 250ms;
|
| 39 |
+
}
|
| 40 |
+
.{utemplate} .ctaText {
|
| 41 |
+
font-weight:bold;
|
| 42 |
+
color:{ctaTextColor};
|
| 43 |
+
text-decoration:none;
|
| 44 |
+
font-size: 16px;
|
| 45 |
+
}
|
| 46 |
+
.{utemplate} .postTitle {
|
| 47 |
+
color:{postTitleColor};
|
| 48 |
+
text-decoration: underline!important;
|
| 49 |
+
font-size: 16px;
|
| 50 |
+
}
|
| 51 |
+
.{utemplate}:hover .postTitle {
|
| 52 |
+
text-decoration: underline!important;
|
| 53 |
+
}
|
| 54 |
+
</style>
|
| 55 |
+
<div style="padding-left:1em; padding-right:1em;">
|
| 56 |
+
<span class="ctaText">{ctaText}</span>
|
| 57 |
+
<span class="postTitle">{postTitle}</span>
|
| 58 |
+
</div>
|
| 59 |
+
</a>
|
| 60 |
+
|
| 61 |
+
#Template Shock
|
| 62 |
+
#Defaults {ctaTextColor=GREY #1 Light, postTitleColor=BLUE #2 Dark, boxColor=ORANGE Light, borderColor=ORANGE Dark, borderColorLabel=hover}
|
| 63 |
+
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
| 64 |
+
{comment}
|
| 65 |
+
<style>
|
| 66 |
+
.{utemplate}
|
| 67 |
+
, .{utemplate} .postImageUrl
|
| 68 |
+
, .{utemplate} .centered-text-area {
|
| 69 |
+
min-height: 80px;
|
| 70 |
+
position: relative;
|
| 71 |
+
}
|
| 72 |
+
.{utemplate}
|
| 73 |
+
, .{utemplate}:hover
|
| 74 |
+
, .{utemplate}:visited
|
| 75 |
+
, .{utemplate}:active {
|
| 76 |
+
border:0!important;
|
| 77 |
+
}
|
| 78 |
+
.{utemplate} .clearfix:after {
|
| 79 |
+
content: "";
|
| 80 |
+
display: table;
|
| 81 |
+
clear: both;
|
| 82 |
+
}
|
| 83 |
+
.{utemplate} {
|
| 84 |
+
display: block;
|
| 85 |
+
transition: background-color 250ms;
|
| 86 |
+
webkit-transition: background-color 250ms;
|
| 87 |
+
width: 100%;
|
| 88 |
+
opacity: {boxOpacity};
|
| 89 |
+
transition: opacity 250ms;
|
| 90 |
+
webkit-transition: opacity 250ms;
|
| 91 |
+
background-color: {boxColor};
|
| 92 |
+
{if hasShadow}
|
| 93 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 94 |
+
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 95 |
+
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 96 |
+
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
| 97 |
+
{/if}
|
| 98 |
+
}
|
| 99 |
+
.{utemplate}:active
|
| 100 |
+
, .{utemplate}:hover {
|
| 101 |
+
opacity: 1;
|
| 102 |
+
transition: opacity 250ms;
|
| 103 |
+
webkit-transition: opacity 250ms;
|
| 104 |
+
background-color: {borderColor};
|
| 105 |
+
}
|
| 106 |
+
.{utemplate} .centered-text-area {
|
| 107 |
+
width: 100%;
|
| 108 |
+
position: relative;
|
| 109 |
+
}
|
| 110 |
+
.{utemplate} .ctaText {
|
| 111 |
+
border-bottom: 0 solid #fff;
|
| 112 |
+
color: {ctaTextColor};
|
| 113 |
+
font-size: 16px;
|
| 114 |
+
font-weight: bold;
|
| 115 |
+
margin: 0;
|
| 116 |
+
padding: 0;
|
| 117 |
+
text-decoration: underline;
|
| 118 |
+
}
|
| 119 |
+
.{utemplate} .postTitle {
|
| 120 |
+
color: {postTitleColor};
|
| 121 |
+
font-size: 16px;
|
| 122 |
+
font-weight: 600;
|
| 123 |
+
margin: 0;
|
| 124 |
+
padding: 0;
|
| 125 |
+
width: 100%;
|
| 126 |
+
}
|
| 127 |
+
.{utemplate} .ctaButton {
|
| 128 |
+
background-color: {boxColorHover}!important;
|
| 129 |
+
color: {ctaTextColor};
|
| 130 |
+
border: none;
|
| 131 |
+
border-radius: 3px;
|
| 132 |
+
box-shadow: none;
|
| 133 |
+
font-size: 14px;
|
| 134 |
+
font-weight: bold;
|
| 135 |
+
line-height: 26px;
|
| 136 |
+
moz-border-radius: 3px;
|
| 137 |
+
text-align: center;
|
| 138 |
+
text-decoration: none;
|
| 139 |
+
text-shadow: none;
|
| 140 |
+
width: 80px;
|
| 141 |
+
min-height: 80px;
|
| 142 |
+
background: url({assetsImages}simple-arrow.png)no-repeat;
|
| 143 |
+
position: absolute;
|
| 144 |
+
right: 0;
|
| 145 |
+
top: 0;
|
| 146 |
+
}
|
| 147 |
+
.{utemplate}:hover .ctaButton {
|
| 148 |
+
background-color: {borderColorHover}!important;
|
| 149 |
+
}
|
| 150 |
+
.{utemplate} .centered-text {
|
| 151 |
+
display: table;
|
| 152 |
+
height: 80px;
|
| 153 |
+
padding-left: 18px;
|
| 154 |
+
top: 0;
|
| 155 |
+
}
|
| 156 |
+
.{utemplate} .{utemplate}-content {
|
| 157 |
+
display: table-cell;
|
| 158 |
+
margin: 0;
|
| 159 |
+
padding: 0;
|
| 160 |
+
padding-right: 108px;
|
| 161 |
+
position: relative;
|
| 162 |
+
vertical-align: middle;
|
| 163 |
+
width: 100%;
|
| 164 |
+
}
|
| 165 |
+
.{utemplate}:after {
|
| 166 |
+
content: "";
|
| 167 |
+
display: block;
|
| 168 |
+
clear: both;
|
| 169 |
+
}
|
| 170 |
+
</style>
|
| 171 |
+
<div class="centered-text-area">
|
| 172 |
+
<div class="centered-text" style="float: left;">
|
| 173 |
+
<div class="{utemplate}-content">
|
| 174 |
+
<span class="ctaText">{ctaText}</span>
|
| 175 |
+
<span class="postTitle">{postTitle}</span>
|
| 176 |
+
</div>
|
| 177 |
+
</div>
|
| 178 |
+
</div>
|
| 179 |
+
<div class="ctaButton"></div>
|
| 180 |
+
</a>
|
| 181 |
+
|
| 182 |
+
#Template Ruby
|
| 183 |
+
#Defaults {proTheme=true, ctaTextColor=BLUE #1 Light, postTitleColor=GREY #1 Light, boxColor=BLUE #2 Dark, borderColor=, borderColorLabel=arrow}
|
| 184 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
| 185 |
+
<img src="{assets}templates/preview-ruby.jpg" />
|
| 186 |
+
</a>
|
| 187 |
+
|
| 188 |
+
#Template Button
|
| 189 |
+
#Defaults {proTheme=true, ctaTextColor=WHITE Light, postTitleColor=GREY #1 Light, boxColor=BLACK Light, borderColor=AQUA Light, borderColorLabel=button}
|
| 190 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
| 191 |
+
<img src="{assets}templates/preview-button.jpg" />
|
| 192 |
+
</a>
|
| 193 |
+
|
| 194 |
+
#Template Kangoo
|
| 195 |
+
#Defaults {proTheme=true, ctaTextColor=BLUE #2 Light, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=WHITE Light, borderColorLabel=hover}
|
| 196 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
| 197 |
+
<img src="{assets}templates/preview-kangoo.jpg" />
|
| 198 |
+
</a>
|
autoload.php
ADDED
|
@@ -0,0 +1,48 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
spl_autoload_register('irp_autoload');
|
| 3 |
+
function irp_autoload($class) {
|
| 4 |
+
$root=dirname(__FILE__).'/includes/classes/';
|
| 5 |
+
irp_autoload_root($root, $class);
|
| 6 |
+
}
|
| 7 |
+
function irp_autoload_root($root, $class) {
|
| 8 |
+
$slash=substr($root, strlen($root)-1);
|
| 9 |
+
if($slash!='/' && $slash!='\\') {
|
| 10 |
+
$root.='/';
|
| 11 |
+
}
|
| 12 |
+
$name=str_replace(IRP_PLUGIN_PREFIX, '', $class);
|
| 13 |
+
if(strpos($class, IRP_PLUGIN_PREFIX)===FALSE) {
|
| 14 |
+
//autoload only plugin classes
|
| 15 |
+
return;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
$h=opendir($root);
|
| 19 |
+
while($file=readdir($h)) {
|
| 20 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..') {
|
| 21 |
+
irp_autoload_root($root.$file, $class);
|
| 22 |
+
} elseif(file_exists($root.$name.'.php')) {
|
| 23 |
+
include_once($root.$name.'.php');
|
| 24 |
+
} elseif(file_exists($root.$class.'.php')) {
|
| 25 |
+
include_once($root.$class.'.php');
|
| 26 |
+
}
|
| 27 |
+
}
|
| 28 |
+
}
|
| 29 |
+
function irp_include_php($root) {
|
| 30 |
+
$h=opendir($root);
|
| 31 |
+
$slash=substr($root, strlen($root)-1);
|
| 32 |
+
if($slash!='/' && $slash!='\\') {
|
| 33 |
+
$root.='/';
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
while($file=readdir($h)) {
|
| 37 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..'){
|
| 38 |
+
irp_include_php($root.$file);
|
| 39 |
+
} elseif(strlen($file)>5) {
|
| 40 |
+
$ext='.php';
|
| 41 |
+
$length=strlen($ext);
|
| 42 |
+
$start=$length*-1; //negative
|
| 43 |
+
if(strcasecmp(substr($file, $start), $ext)==0) {
|
| 44 |
+
include_once($root.$file);
|
| 45 |
+
}
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
}
|
includes/actions.php
ADDED
|
@@ -0,0 +1,67 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Front-end Actions
|
| 4 |
+
*
|
| 5 |
+
* @package EDD
|
| 6 |
+
* @subpackage Functions
|
| 7 |
+
* @copyright Copyright (c) 2015, Pippin Williamson
|
| 8 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 9 |
+
* @since 1.0.8.1
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
// Exit if accessed directly
|
| 13 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 14 |
+
|
| 15 |
+
/**
|
| 16 |
+
* Hooks EDD actions, when present in the $_GET superglobal. Every edd_action
|
| 17 |
+
* present in $_GET is called using WordPress's do_action function. These
|
| 18 |
+
* functions are called on init.
|
| 19 |
+
*
|
| 20 |
+
* @since 1.0
|
| 21 |
+
* @return void
|
| 22 |
+
*/
|
| 23 |
+
add_action('init', 'irp_do_action');
|
| 24 |
+
add_action('wp_ajax_do_action', 'irp_do_action');
|
| 25 |
+
function irp_do_action() {
|
| 26 |
+
global $irp;
|
| 27 |
+
|
| 28 |
+
if ($irp->Utils->qs('irp_action')) {
|
| 29 |
+
$args=array_merge($_GET, $_POST, $_COOKIE, $_SERVER);
|
| 30 |
+
$name='irp_'.$irp->Utils->qs('irp_action');
|
| 31 |
+
if(has_action($name)) {
|
| 32 |
+
$irp->Log->debug('EXECUTING ACTION=%s', $name);
|
| 33 |
+
do_action($name, $args);
|
| 34 |
+
} elseif(function_exists($name)) {
|
| 35 |
+
$irp->Log->debug('EXECUTING FUNCTION=%s DATA=%s', $name, $args);
|
| 36 |
+
call_user_func($name, $args);
|
| 37 |
+
} elseif(strpos($irp->Utils->qs('irp_action'), '_')!==FALSE) {
|
| 38 |
+
$pos=strpos($irp->Utils->qs('irp_action'), '_');
|
| 39 |
+
$what=substr($irp->Utils->qs('irp_action'), 0, $pos);
|
| 40 |
+
$function=substr($irp->Utils->qs('irp_action'), $pos+1);
|
| 41 |
+
|
| 42 |
+
$class=NULL;
|
| 43 |
+
switch (strtolower($what)) {
|
| 44 |
+
case 'cron':
|
| 45 |
+
$class=$irp->Cron;
|
| 46 |
+
break;
|
| 47 |
+
case 'tracking':
|
| 48 |
+
$class=$irp->Tracking;
|
| 49 |
+
break;
|
| 50 |
+
case 'properties':
|
| 51 |
+
$class=$irp->Options;
|
| 52 |
+
break;
|
| 53 |
+
}
|
| 54 |
+
|
| 55 |
+
if(!$class) {
|
| 56 |
+
$irp->Log->fatal('NO CLASS FOR=%s IN ACTION=%s', $what, $irp->Utils->qs('irp_action'));
|
| 57 |
+
} elseif(!method_exists ($class, $function)) {
|
| 58 |
+
$irp->Log->fatal('NO METHOD FOR=%s IN CLASS=%s IN ACTION=%s', $function, $what, $irp->Utils->qs('irp_action'));
|
| 59 |
+
} else {
|
| 60 |
+
$irp->Log->debug('METHOD=%s OF CLASS=%s', $function, $what);
|
| 61 |
+
call_user_func(array($class, $function), $args);
|
| 62 |
+
}
|
| 63 |
+
} else {
|
| 64 |
+
$irp->Log->fatal('NO FUNCTION FOR==%s', $irp->Utils->qs('irp_action'));
|
| 65 |
+
}
|
| 66 |
+
}
|
| 67 |
+
}
|
includes/admin/about.php
ADDED
|
@@ -0,0 +1,27 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
function irp_ui_about() {
|
| 3 |
+
global $irp;
|
| 4 |
+
irp_ui_tracking(TRUE);
|
| 5 |
+
?>
|
| 6 |
+
<div><?php $irp->Lang->P('AboutText')?></div>
|
| 7 |
+
<style>
|
| 8 |
+
ul li {
|
| 9 |
+
padding:2px;
|
| 10 |
+
}
|
| 11 |
+
</style>
|
| 12 |
+
<ul>
|
| 13 |
+
<li>
|
| 14 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>email.png" />
|
| 15 |
+
<a href="mailto:aleste@intellywp.com">aleste@intellywp.com</a>
|
| 16 |
+
</li>
|
| 17 |
+
<li>
|
| 18 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>twitter.png" />
|
| 19 |
+
<?php $irp->Utils->twitter('intellywp')?>
|
| 20 |
+
</li>
|
| 21 |
+
<li>
|
| 22 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>internet.png" />
|
| 23 |
+
<a href="http://www.intellywp.com" target="_new">IntellyWP.com</a>
|
| 24 |
+
</li>
|
| 25 |
+
</ul>
|
| 26 |
+
<?php
|
| 27 |
+
}
|
includes/admin/button-mce.php
ADDED
|
@@ -0,0 +1,134 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
add_action('admin_head', 'irp_add_mce_button');
|
| 3 |
+
function irp_add_mce_button() {
|
| 4 |
+
global $typenow;
|
| 5 |
+
|
| 6 |
+
if (!current_user_can('edit_posts') && !current_user_can('edit_pages')) {
|
| 7 |
+
return;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
if(!in_array($typenow, array('post', 'page'))) {
|
| 11 |
+
return;
|
| 12 |
+
}
|
| 13 |
+
if (get_user_option('rich_editing') == 'true') {
|
| 14 |
+
add_filter("mce_external_plugins", "irp_add_mce_plugin");
|
| 15 |
+
add_filter('mce_buttons', 'irp_register_mce_button');
|
| 16 |
+
}
|
| 17 |
+
}
|
| 18 |
+
|
| 19 |
+
function irp_add_mce_plugin($plugin_array) {
|
| 20 |
+
$plugin_array['irp_mce_button']=IRP_PLUGIN_ASSETS.'js/button-mce.js';
|
| 21 |
+
return $plugin_array;
|
| 22 |
+
}
|
| 23 |
+
function irp_register_mce_button($buttons) {
|
| 24 |
+
array_push($buttons, "irp_mce_button");
|
| 25 |
+
return $buttons;
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
function irp_ui_button_editor() {
|
| 29 |
+
global $irp;
|
| 30 |
+
|
| 31 |
+
$irp->Utils->printScriptCss();
|
| 32 |
+
$irp->Form->prefix='Editor';
|
| 33 |
+
$irp->Form->labels=FALSE;
|
| 34 |
+
|
| 35 |
+
$args=array('class'=>'wp-admin wp-core-ui admin-bar'
|
| 36 |
+
, 'style'=>'padding:10px; margin-left:auto; margin-right:auto;');
|
| 37 |
+
$irp->Form->formStarts('post', '', $args);
|
| 38 |
+
{
|
| 39 |
+
?>
|
| 40 |
+
<p style="text-align:center;"><?php $irp->Lang->P('EditorSubtitle') ?></p>
|
| 41 |
+
<?php
|
| 42 |
+
$args = array('post_type' => 'post', 'all' => FALSE);
|
| 43 |
+
$options = $irp->Utils->query(IRP_QUERY_POSTS_OF_TYPE, $args);
|
| 44 |
+
$irp->Form->text('irpPostId', '', FALSE);
|
| 45 |
+
?>
|
| 46 |
+
<div style="clear:both;"></div>
|
| 47 |
+
<p style="text-align:right;">
|
| 48 |
+
<input type="button" id="btnInsert" class="button button-primary irp-button irp-submit" value="<?php $irp->Lang->P('Insert')?>"/>
|
| 49 |
+
<input type="button" id="btnClose" class="button irp-button" value="<?php $irp->Lang->P('Cancel')?>"/>
|
| 50 |
+
</p>
|
| 51 |
+
|
| 52 |
+
<script>
|
| 53 |
+
jQuery(function () {
|
| 54 |
+
jQuery('#btnInsert').click(function () {
|
| 55 |
+
var editor = top.tinymce.activeEditor;
|
| 56 |
+
var postId = parseInt(jQuery('#irpPostId').val());
|
| 57 |
+
var name=jQuery('#select2-chosen-1').text().replace('"', ' ');
|
| 58 |
+
if(name) {
|
| 59 |
+
name='name="'+name+'"';
|
| 60 |
+
}
|
| 61 |
+
if (postId > 0) {
|
| 62 |
+
var code = '[irp posts="' + postId + '" '+name+']';
|
| 63 |
+
editor.insertContent(code);
|
| 64 |
+
}
|
| 65 |
+
editor.windowManager.close();
|
| 66 |
+
});
|
| 67 |
+
jQuery('#btnClose').click(function () {
|
| 68 |
+
var editor = top.tinymce.activeEditor;
|
| 69 |
+
editor.windowManager.close();
|
| 70 |
+
});
|
| 71 |
+
/*
|
| 72 |
+
jQuery("#irpPostId").select2({
|
| 73 |
+
placeholder: "Type here..."
|
| 74 |
+
, theme: "classic"
|
| 75 |
+
, width: '100%'
|
| 76 |
+
//, maximumSelectionLength: 3
|
| 77 |
+
});
|
| 78 |
+
*/
|
| 79 |
+
var ajaxurl = 'admin-ajax.php';
|
| 80 |
+
jQuery('#irpPostId').select2({
|
| 81 |
+
|
| 82 |
+
ajax: {
|
| 83 |
+
|
| 84 |
+
url: ajaxurl,
|
| 85 |
+
dataType: 'json',
|
| 86 |
+
|
| 87 |
+
delay: 250,
|
| 88 |
+
|
| 89 |
+
data: function (term, page) {
|
| 90 |
+
|
| 91 |
+
return {
|
| 92 |
+
action: 'irp_list_posts',
|
| 93 |
+
irp_post_type: '<?php echo esc_attr($_REQUEST['irp_post_type']);?>',
|
| 94 |
+
q: term,
|
| 95 |
+
page: page
|
| 96 |
+
};
|
| 97 |
+
|
| 98 |
+
},
|
| 99 |
+
|
| 100 |
+
results: function (data, page) {
|
| 101 |
+
|
| 102 |
+
page = page || 1;
|
| 103 |
+
|
| 104 |
+
return {
|
| 105 |
+
results: data.items,
|
| 106 |
+
more: false,
|
| 107 |
+
};
|
| 108 |
+
|
| 109 |
+
},
|
| 110 |
+
|
| 111 |
+
cache: true
|
| 112 |
+
|
| 113 |
+
},
|
| 114 |
+
|
| 115 |
+
placeholder: "Type here to search an item...",
|
| 116 |
+
minimumInputLength: 3,
|
| 117 |
+
width: '100%'
|
| 118 |
+
|
| 119 |
+
});
|
| 120 |
+
});
|
| 121 |
+
</script>
|
| 122 |
+
|
| 123 |
+
<style>
|
| 124 |
+
.select2-results {
|
| 125 |
+
max-height: 100px;
|
| 126 |
+
overflow-y: auto;
|
| 127 |
+
}
|
| 128 |
+
</style>
|
| 129 |
+
<?php
|
| 130 |
+
}
|
| 131 |
+
$irp->Form->formEnds();
|
| 132 |
+
exit;
|
| 133 |
+
}
|
| 134 |
+
|
includes/admin/faq.php
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
function irp_ui_faq() {
|
| 3 |
+
global $irp;
|
| 4 |
+
$i=1;
|
| 5 |
+
while($irp->Lang->H('Faq.Question'.$i)) {
|
| 6 |
+
$q=$irp->Lang->L('Faq.Question'.$i);
|
| 7 |
+
$r=$irp->Lang->L('Faq.Response'.$i);
|
| 8 |
+
?>
|
| 9 |
+
<p>
|
| 10 |
+
<b><?php echo $q?></b>
|
| 11 |
+
<br/>
|
| 12 |
+
<?php echo $r?>
|
| 13 |
+
</p>
|
| 14 |
+
<?php
|
| 15 |
+
++$i;
|
| 16 |
+
}
|
| 17 |
+
}
|
includes/admin/feedback.php
ADDED
|
@@ -0,0 +1,44 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
function irp_ui_feedback() {
|
| 4 |
+
global $irp;
|
| 5 |
+
|
| 6 |
+
$irp->Form->prefix='Feedback';
|
| 7 |
+
if($irp->Check->nonce('irp_feedback', 'irp_feedback')) {
|
| 8 |
+
$irp->Check->email('email');
|
| 9 |
+
$irp->Check->value('body');
|
| 10 |
+
|
| 11 |
+
if(!$irp->Check->hasErrors()) {
|
| 12 |
+
$irp->Options->setFeedbackEmail($irp->Check->of('email'));
|
| 13 |
+
$id=-1;
|
| 14 |
+
if($irp->Check->of('track', 0)) {
|
| 15 |
+
$id=$irp->Tracking->sendTracking(TRUE);
|
| 16 |
+
}
|
| 17 |
+
$irp->Check->data['tracking_id']=$id;
|
| 18 |
+
$irp->Check->data['plugin']=IRP_PLUGIN_SLUG;
|
| 19 |
+
$data=$irp->Utils->remotePost('feedback', $irp->Check->data);
|
| 20 |
+
if($data) {
|
| 21 |
+
$irp->Options->pushSuccessMessage('FeedbackSuccess');
|
| 22 |
+
} else {
|
| 23 |
+
$irp->Options->pushErrorMessage('FeedbackError');
|
| 24 |
+
}
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
?>
|
| 28 |
+
<br>
|
| 29 |
+
<h2><?php $irp->Lang->P('FeedbackHeader')?></h2>
|
| 30 |
+
<?php
|
| 31 |
+
$irp->Options->writeMessages();
|
| 32 |
+
|
| 33 |
+
$irp->Form->formStarts();
|
| 34 |
+
$irp->Form->text('email', $irp->Options->getFeedbackEmail());
|
| 35 |
+
$irp->Form->textarea('body', '', array('rows'=>5));
|
| 36 |
+
|
| 37 |
+
$irp->Form->leftLabels=FALSE;
|
| 38 |
+
$irp->Form->checkbox('track');
|
| 39 |
+
$irp->Form->leftLabels=TRUE;
|
| 40 |
+
|
| 41 |
+
$irp->Form->nonce('irp_feedback', 'irp_feedback');
|
| 42 |
+
$irp->Form->submit('Send');
|
| 43 |
+
$irp->Form->formEnds();
|
| 44 |
+
}
|
includes/admin/metabox.php
ADDED
|
@@ -0,0 +1,70 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
function irp_ui_metabox($post) {
|
| 3 |
+
global $irp;
|
| 4 |
+
|
| 5 |
+
wp_nonce_field('irp_meta_box', 'irp_meta_box_nonce');
|
| 6 |
+
$array=$irp->Options->getExcludedPostsIds();
|
| 7 |
+
$exclude=FALSE;
|
| 8 |
+
if(in_array($post->ID, $array)) {
|
| 9 |
+
$exclude=TRUE;
|
| 10 |
+
}
|
| 11 |
+
?>
|
| 12 |
+
<input type="hidden" name="irp_previous" value="<?php echo ($exclude ? 1 : 0)?>" />
|
| 13 |
+
<input type="checkbox" class="irp-checkbox" name="irp_exclude" value="1" <?php echo ($exclude ? ' CHECKED' : '')?> />
|
| 14 |
+
<?php $irp->Lang->P('Post without related posts')?>
|
| 15 |
+
<?php
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
add_action('add_meta_boxes', 'irp_add_meta_box');
|
| 19 |
+
function irp_add_meta_box() {
|
| 20 |
+
global $irp;
|
| 21 |
+
|
| 22 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 23 |
+
return;
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
$options=$irp->Options->getMetaboxPostTypes();
|
| 27 |
+
$screens=array();
|
| 28 |
+
foreach($options as $k=>$v) {
|
| 29 |
+
if(intval($v)>0) {
|
| 30 |
+
$screens[]=$k;
|
| 31 |
+
}
|
| 32 |
+
}
|
| 33 |
+
if(count($screens)>0) {
|
| 34 |
+
foreach ($screens as $screen) {
|
| 35 |
+
add_meta_box(
|
| 36 |
+
'irp_sectionid'
|
| 37 |
+
, $irp->Lang->L('Related Posts by IntellyWP')
|
| 38 |
+
, 'irp_ui_metabox'
|
| 39 |
+
, $screen
|
| 40 |
+
, 'side'
|
| 41 |
+
);
|
| 42 |
+
}
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
//si aggancia a quando un post viene salvato per salvare anche gli altri dati del metabox
|
| 46 |
+
add_action('save_post', 'irp_save_meta_box_data');
|
| 47 |
+
function irp_save_meta_box_data($postId) {
|
| 48 |
+
global $irp;
|
| 49 |
+
|
| 50 |
+
if (defined('DOING_AUTOSAVE') && DOING_AUTOSAVE) {
|
| 51 |
+
return;
|
| 52 |
+
}
|
| 53 |
+
if (!isset($_POST['irp_meta_box_nonce']) || !isset($_POST['post_type'])) {
|
| 54 |
+
return;
|
| 55 |
+
}
|
| 56 |
+
if (!wp_verify_nonce( $_POST['irp_meta_box_nonce'], 'irp_meta_box')) {
|
| 57 |
+
return;
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
$exclude=$irp->Utils->qs('irp_exclude', 0);
|
| 61 |
+
$previous=$irp->Utils->qs('irp_previous', 0);
|
| 62 |
+
if($exclude!=$previous) {
|
| 63 |
+
$array=$irp->Options->getExcludedPostsIds();
|
| 64 |
+
$array=array_diff($array, array($postId));
|
| 65 |
+
if($exclude) {
|
| 66 |
+
array_push($array, $postId);
|
| 67 |
+
}
|
| 68 |
+
$irp->Options->setExcludedPostsIds($array);
|
| 69 |
+
}
|
| 70 |
+
}
|
includes/admin/settings.php
ADDED
|
@@ -0,0 +1,417 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
function irp_ui_tracking($override=FALSE) {
|
| 3 |
+
global $irp;
|
| 4 |
+
|
| 5 |
+
$track=$irp->Utils->qs('track', '');
|
| 6 |
+
if($track!='') {
|
| 7 |
+
$track=intval($track);
|
| 8 |
+
$irp->Options->setTrackingEnable($track);
|
| 9 |
+
$irp->Tracking->sendTracking(TRUE);
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
$uri=IRP_TAB_SETTINGS_URI.'&track=';
|
| 13 |
+
if($irp->Options->isTrackingEnable()) {
|
| 14 |
+
if($override) {
|
| 15 |
+
$uri.='0';
|
| 16 |
+
$irp->Options->pushSuccessMessage('EnableAllowTrackingNotice', $uri);
|
| 17 |
+
}
|
| 18 |
+
} else {
|
| 19 |
+
$uri.='1';
|
| 20 |
+
$irp->Options->pushWarningMessage('DisableAllowTrackingNotice', $uri);
|
| 21 |
+
}
|
| 22 |
+
$irp->Options->writeMessages();
|
| 23 |
+
}
|
| 24 |
+
function irp_io_first_time() {
|
| 25 |
+
global $irp;
|
| 26 |
+
if($irp->Options->isShowActivationNotice()) {
|
| 27 |
+
$irp->Options->pushSuccessMessage('FirstTimeActivation');
|
| 28 |
+
$irp->Options->writeMessages();
|
| 29 |
+
$irp->Options->setShowActivationNotice(FALSE);
|
| 30 |
+
}
|
| 31 |
+
}
|
| 32 |
+
function irp_ui_box_preview() {
|
| 33 |
+
global $irp;
|
| 34 |
+
|
| 35 |
+
$count=$irp->Options->getRewritePostsInBoxCount();
|
| 36 |
+
$count=$irp->Utils->iqs('rewritePostsInBoxCount', $count);
|
| 37 |
+
$args=array(
|
| 38 |
+
'orderby'=>'rand'
|
| 39 |
+
, 'numberposts'=>$count
|
| 40 |
+
);
|
| 41 |
+
|
| 42 |
+
$days=$irp->Options->getRewritePostsDays();
|
| 43 |
+
$days=$irp->Utils->iqs('rewritePostsDays', $days);
|
| 44 |
+
if($days>0) {
|
| 45 |
+
$args['date_query'] = array(
|
| 46 |
+
'column' => 'post_date'
|
| 47 |
+
, 'after' => '- '.$days.' days'
|
| 48 |
+
);
|
| 49 |
+
}
|
| 50 |
+
$posts=get_posts($args);
|
| 51 |
+
$ids=array();
|
| 52 |
+
foreach($posts as $p) {
|
| 53 |
+
$ids[]=$p->ID;
|
| 54 |
+
}
|
| 55 |
+
if(count($ids)==0) {
|
| 56 |
+
echo "<b>No posts available. Check settings and try again</b>";
|
| 57 |
+
die();
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
$defaults=$irp->Options->getTemplateStyle();
|
| 61 |
+
$args=$irp->Utils->aqs('template-', $defaults);
|
| 62 |
+
$args['includeCss']=TRUE;
|
| 63 |
+
$args['preview']=TRUE;
|
| 64 |
+
$box=irp_ui_get_box($ids, $args);
|
| 65 |
+
echo $box;
|
| 66 |
+
die();
|
| 67 |
+
}
|
| 68 |
+
function irp_ui_settings() {
|
| 69 |
+
global $irp;
|
| 70 |
+
irp_ui_tracking(FALSE);
|
| 71 |
+
|
| 72 |
+
?>
|
| 73 |
+
<script>
|
| 74 |
+
var IRP_preview=true;
|
| 75 |
+
var IRP_labelColor='';
|
| 76 |
+
var IRP_defaults={};
|
| 77 |
+
<?php
|
| 78 |
+
$defaults=$irp->HtmlTemplate->getDefaults();
|
| 79 |
+
foreach($defaults as $k=>$v) {
|
| 80 |
+
$buffer='';
|
| 81 |
+
foreach($v as $kk=>$vv) {
|
| 82 |
+
if($buffer!='') {
|
| 83 |
+
$buffer.=', ';
|
| 84 |
+
}
|
| 85 |
+
|
| 86 |
+
if(stripos($kk, 'label')!==FALSE) {
|
| 87 |
+
$vv=$irp->Lang->L('Settings.Color.'.$vv);
|
| 88 |
+
} elseif(stripos($kk, 'color')!==FALSE) {
|
| 89 |
+
$vv=$irp->Options->getColor($vv);
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
$buffer.=$kk.': "'.$vv.'"';
|
| 93 |
+
}
|
| 94 |
+
?>
|
| 95 |
+
IRP_defaults["<?php echo $k?>"]={<?php echo $buffer?>};
|
| 96 |
+
<?php }
|
| 97 |
+
?>
|
| 98 |
+
|
| 99 |
+
function IRP_changeTheme() {
|
| 100 |
+
IRP_preview=false;
|
| 101 |
+
t=IRP_val('template-template');
|
| 102 |
+
t=IRP_defaults[t];
|
| 103 |
+
isProTheme=false;
|
| 104 |
+
console.log(t);
|
| 105 |
+
jQuery.each(t, function(k,v) {
|
| 106 |
+
if(IRP_stripos(k, 'color')!==false) {
|
| 107 |
+
var $k=jQuery('[name=template-'+k+']');
|
| 108 |
+
$k.select2("val", v);
|
| 109 |
+
} else if(k=='proTheme') {
|
| 110 |
+
isProTheme=(v+''.toLowerCase()=='true');
|
| 111 |
+
}
|
| 112 |
+
});
|
| 113 |
+
|
| 114 |
+
jQuery("[name*='Color']").each(function(i,v) {
|
| 115 |
+
var $cbo=jQuery(this);
|
| 116 |
+
$cbo.prop("disabled", isProTheme);
|
| 117 |
+
$cbo.select2("enable", !isProTheme);
|
| 118 |
+
});
|
| 119 |
+
jQuery("[id*='ColorLabel']").each(function(i,v) {
|
| 120 |
+
var $lbl=jQuery(this);
|
| 121 |
+
if(IRP_labelColor!='') {
|
| 122 |
+
IRP_labelColor=$lbl.css('color');
|
| 123 |
+
}
|
| 124 |
+
if(isProTheme) {
|
| 125 |
+
$lbl.css('color', '#ccc');
|
| 126 |
+
} else {
|
| 127 |
+
$lbl.css('color', IRP_labelColor);
|
| 128 |
+
}
|
| 129 |
+
});
|
| 130 |
+
jQuery('.irp-submit').prop("disabled", isProTheme);
|
| 131 |
+
IRP_preview=true;
|
| 132 |
+
}
|
| 133 |
+
function IRP_changeRelatedBox() {
|
| 134 |
+
if(!IRP_preview) {
|
| 135 |
+
return;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
var t=IRP_val('template-template');
|
| 139 |
+
t=IRP_defaults[t].borderColorLabel;
|
| 140 |
+
jQuery('#template-borderColorLabel').text(t);
|
| 141 |
+
|
| 142 |
+
data=IRP_aval('template-');
|
| 143 |
+
data=jQuery.extend({
|
| 144 |
+
'action': 'do_action'
|
| 145 |
+
, 'irp_action': 'ui_box_preview'
|
| 146 |
+
, 'rewritePostsDays': IRP_val('irpRewritePostsDays')
|
| 147 |
+
}, data);
|
| 148 |
+
//console.log(data);
|
| 149 |
+
|
| 150 |
+
var request=jQuery.ajax({
|
| 151 |
+
url: ajaxurl
|
| 152 |
+
, method: "POST"
|
| 153 |
+
, data: data
|
| 154 |
+
, dataType: "html"
|
| 155 |
+
});
|
| 156 |
+
|
| 157 |
+
request.done(function(html) {
|
| 158 |
+
jQuery("#relatedBoxExample").html(html);
|
| 159 |
+
});
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
jQuery(function() {
|
| 163 |
+
IRP_preview=false;
|
| 164 |
+
var array=['irpRewritePostsDays', 'irpRewritePostsInBoxCount', 'irpRewriteBoxesCount'];
|
| 165 |
+
for(i=0; i<array.length; i++) {
|
| 166 |
+
if(jQuery('[name='+array[i]+']').length>0) {
|
| 167 |
+
jQuery('[name='+array[i]+']').change(function() {
|
| 168 |
+
IRP_changeRelatedBox();
|
| 169 |
+
});
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
jQuery("[name^='template-']").change(function() {
|
| 173 |
+
if(!IRP_preview) {
|
| 174 |
+
return;
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
var $self=jQuery(this);
|
| 178 |
+
var name=$self.attr('name');
|
| 179 |
+
if(name=='template-template') {
|
| 180 |
+
IRP_changeTheme();
|
| 181 |
+
}
|
| 182 |
+
IRP_changeRelatedBox();
|
| 183 |
+
});
|
| 184 |
+
//IRP_changeTheme();
|
| 185 |
+
IRP_preview=true;
|
| 186 |
+
IRP_changeRelatedBox();
|
| 187 |
+
});
|
| 188 |
+
</script>
|
| 189 |
+
<?php
|
| 190 |
+
|
| 191 |
+
$irp->Form->prefix='Settings';
|
| 192 |
+
$irp->Form->helps = FALSE;
|
| 193 |
+
$irp->Form->formStarts();
|
| 194 |
+
|
| 195 |
+
if($irp->Check->nonce('irp_settings')) {
|
| 196 |
+
|
| 197 |
+
$irp->Options->resetMaxExecutionTime();
|
| 198 |
+
$irp->Options->setActive($irp->Utils->iqs('irpActive'));
|
| 199 |
+
|
| 200 |
+
$defaults=array(
|
| 201 |
+
'hasShadow'=>0
|
| 202 |
+
, 'hasPoweredBy'=>0
|
| 203 |
+
);
|
| 204 |
+
$template=$irp->Utils->aqs('template-', $defaults);
|
| 205 |
+
$irp->Options->setTemplateStyle($template);
|
| 206 |
+
|
| 207 |
+
$irp->Options->setMarginTop($irp->Utils->qs('marginTop', '0em'));
|
| 208 |
+
$irp->Options->setMarginBottom($irp->Utils->qs('marginBottom', '1em'));
|
| 209 |
+
$irp->Options->setRewriteActive($irp->Utils->iqs('irpRewriteActive'));
|
| 210 |
+
$irp->Options->setRewriteBoxesCount($irp->Utils->iqs('irpRewriteBoxesCount', 1));
|
| 211 |
+
//$irp->Options->setRewritePostsInBoxCount($irp->Utils->iqs('irpRewritePostsInBoxCount', 1));
|
| 212 |
+
$irp->Options->setRewritePostsDays($irp->Utils->iqs('irpRewritePostsDays', 0));
|
| 213 |
+
$irp->Options->setRewriteThreshold($irp->Utils->iqs('irpRewriteThreshold', 300));
|
| 214 |
+
$irp->Options->setRewriteAtEnd($irp->Utils->iqs('irpRewriteAtEnd'));
|
| 215 |
+
|
| 216 |
+
$irp->Options->setEngineSearch($irp->Utils->iqs('irpEngineSearch', IRP_ENGINE_SEARCH_CATEGORIES_TAGS));
|
| 217 |
+
|
| 218 |
+
$options = $irp->Options->getRewritePostTypes();
|
| 219 |
+
foreach ($options as $k => $template) {
|
| 220 |
+
$template = intval($irp->Utils->qs('irpRewritePostType_' . $k, 0));
|
| 221 |
+
$options[$k] = $template;
|
| 222 |
+
}
|
| 223 |
+
$irp->Options->setRewritePostTypes($options);
|
| 224 |
+
|
| 225 |
+
$options = $irp->Options->getMetaboxPostTypes();
|
| 226 |
+
foreach ($options as $k => $template) {
|
| 227 |
+
$template = intval($irp->Utils->qs('metabox_' . $k, 0));
|
| 228 |
+
$options[$k] = $template;
|
| 229 |
+
}
|
| 230 |
+
$irp->Options->setMetaboxPostTypes($options);
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
$c=wp_count_posts()->publish;
|
| 234 |
+
$t=$irp->Options->getMaxExecutionTime();
|
| 235 |
+
if($t>0) {?>
|
| 236 |
+
<p style="width:auto; font-style: italic;"><?php $irp->Lang->P('PreviewSectionMaxTime', $t, $c)?></p>
|
| 237 |
+
<?php }
|
| 238 |
+
|
| 239 |
+
$irp->Form->p('GeneralSection');
|
| 240 |
+
$args=array(
|
| 241 |
+
'class'=>'irp-hideShow irp-checkbox'
|
| 242 |
+
, 'irp-hideIfTrue'=>'false'
|
| 243 |
+
, 'irp-hideShow'=>'irp-active-box'
|
| 244 |
+
);
|
| 245 |
+
$irp->Form->checkbox('irpActive', $irp->Options->isActive(), 1, $args);
|
| 246 |
+
$args=array(
|
| 247 |
+
'id'=>'irp-active-box'
|
| 248 |
+
, 'name'=>'irp-active-box'
|
| 249 |
+
, 'style'=>'margin-top:10px;'
|
| 250 |
+
);
|
| 251 |
+
$irp->Form->divStarts($args);
|
| 252 |
+
{
|
| 253 |
+
$template=$irp->Options->getTemplateStyle();
|
| 254 |
+
$prefix='template-';
|
| 255 |
+
$irp->Form->text($prefix.'ctaText', $irp->Utils->get($template, 'ctaText'));
|
| 256 |
+
$options=$irp->HtmlTemplate->getTemplatesNames();
|
| 257 |
+
$irp->Form->select($prefix.'template', $irp->Utils->get($template, 'template'), $options);
|
| 258 |
+
$irp->Form->number($prefix.'boxOpacity', $irp->Utils->get($template, 'boxOpacity'));
|
| 259 |
+
$irp->Form->text('marginTop', $irp->Options->getMarginTop());
|
| 260 |
+
$irp->Form->text('marginBottom', $irp->Options->getMarginBottom());
|
| 261 |
+
//$options=array('none', 'capitalize', 'uppercase', 'lowercase');
|
| 262 |
+
//$irp->Form->select($t.'textTransform', $irp->Utils->get($v, 'textTransform'), $options);
|
| 263 |
+
$array=array('ctaTextColor', 'postTitleColor', 'boxColor', 'borderColor');
|
| 264 |
+
$blanks=array('(Default)', '(Default)', '(Trasparent)', '(Without)');
|
| 265 |
+
for($i=0; $i<count($array); $i++) {
|
| 266 |
+
$k=$array[$i];
|
| 267 |
+
$v=$blanks[$i];
|
| 268 |
+
$colors=$irp->Options->getColors($v);
|
| 269 |
+
|
| 270 |
+
$v=$irp->Utils->get($template, $k);
|
| 271 |
+
$v=$irp->Options->getColor($v);
|
| 272 |
+
$irp->Form->colorSelect($prefix.$k, $v, $colors);
|
| 273 |
+
}
|
| 274 |
+
$array=array('hasShadow', 'hasPoweredBy');
|
| 275 |
+
foreach($array as $k) {
|
| 276 |
+
$irp->Form->checkbox($prefix.$k, $irp->Utils->iget($template, $k));
|
| 277 |
+
}
|
| 278 |
+
?>
|
| 279 |
+
<div style="padding-left:10px; padding-right:10px; border:1px dashed #444444">
|
| 280 |
+
<?php $irp->Form->p('PreviewSection'); ?>
|
| 281 |
+
<p id="relatedBoxExample" style="width:auto;"></p>
|
| 282 |
+
</div>
|
| 283 |
+
<?php
|
| 284 |
+
$irp->Form->p('RewriteSection');
|
| 285 |
+
$args=array(
|
| 286 |
+
'class'=>'irp-hideShow irp-checkbox'
|
| 287 |
+
, 'irp-hideIfTrue'=>'false'
|
| 288 |
+
, 'irp-hideShow'=>'irp-rewrite-box'
|
| 289 |
+
);
|
| 290 |
+
$irp->Form->checkbox('irpRewriteActive', $irp->Options->isRewriteActive(), 1, $args);
|
| 291 |
+
$args=array('id'=>'irp-rewrite-box', 'name'=>'irp-rewrite-box', 'style'=>'margin-top:10px;');
|
| 292 |
+
$irp->Form->divStarts($args);
|
| 293 |
+
{
|
| 294 |
+
$options=array();
|
| 295 |
+
$options[]=array('id'=>1, 'name'=>1);
|
| 296 |
+
$options[]=array('id'=>2, 'name'=>2);
|
| 297 |
+
$options[]=array('id'=>3, 'name'=>3);
|
| 298 |
+
$irp->Form->select('irpRewriteBoxesCount', $irp->Options->getRewriteBoxesCount(), $options);
|
| 299 |
+
$irp->Form->number('irpRewritePostsDays', $irp->Options->getRewritePostsDays());
|
| 300 |
+
$irp->Form->number('irpRewriteThreshold', $irp->Options->getRewriteThreshold(), $args);
|
| 301 |
+
$irp->Form->checkbox('irpRewriteAtEnd', $irp->Options->isRewriteAtEnd());
|
| 302 |
+
$irp->Form->p('');
|
| 303 |
+
|
| 304 |
+
$options=$irp->Options->getRewritePostTypes();
|
| 305 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
| 306 |
+
foreach($types as $v) {
|
| 307 |
+
$v=$v['name'];
|
| 308 |
+
$irp->Form->checkbox('irpRewritePostType_'.$v, $options[$v]);
|
| 309 |
+
}
|
| 310 |
+
}
|
| 311 |
+
$irp->Form->divEnds();
|
| 312 |
+
|
| 313 |
+
$irp->Form->p('EngineSection');
|
| 314 |
+
$irp->Form->divStarts();
|
| 315 |
+
{
|
| 316 |
+
$options=array(
|
| 317 |
+
IRP_ENGINE_SEARCH_CATEGORIES_TAGS
|
| 318 |
+
, IRP_ENGINE_SEARCH_CATEGORIES
|
| 319 |
+
, IRP_ENGINE_SEARCH_TAGS
|
| 320 |
+
);
|
| 321 |
+
$irp->Form->select('irpEngineSearch', $irp->Options->getEngineSearch(), $options);
|
| 322 |
+
$options=array();
|
| 323 |
+
$options[]=array('id'=>'nofollow', 'name'=>'nofollow');
|
| 324 |
+
$options[]=array('id'=>'dofollow', 'name'=>'dofollow');
|
| 325 |
+
$k='linkRel';
|
| 326 |
+
|
| 327 |
+
$irp->Form->select($prefix.$k, $irp->Utils->get($template, $k), $options);
|
| 328 |
+
$options=array();
|
| 329 |
+
$options[]=array('id'=>'_blank', 'name'=>'_blank');
|
| 330 |
+
$options[]=array('id'=>'_self', 'name'=>'_self');
|
| 331 |
+
$k='linkTarget';
|
| 332 |
+
$irp->Form->select($prefix.$k, $irp->Utils->get($template, $k), $options);
|
| 333 |
+
}
|
| 334 |
+
$irp->Form->divEnds();
|
| 335 |
+
|
| 336 |
+
$irp->Form->p('MetaboxSection');
|
| 337 |
+
$irp->Form->divStarts();
|
| 338 |
+
{
|
| 339 |
+
$metaboxes=$irp->Options->getMetaboxPostTypes();
|
| 340 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
| 341 |
+
foreach($types as $template) {
|
| 342 |
+
$template=$template['name'];
|
| 343 |
+
$irp->Form->checkbox('metabox_'.$template, $metaboxes[$template]);
|
| 344 |
+
}
|
| 345 |
+
}
|
| 346 |
+
$irp->Form->divEnds();
|
| 347 |
+
}
|
| 348 |
+
$irp->Form->divEnds();
|
| 349 |
+
|
| 350 |
+
$irp->Form->nonce('irp_settings');
|
| 351 |
+
irp_notice_pro_features();
|
| 352 |
+
$args=array('id'=>'boxDontSave', 'style'=>'display:none;');
|
| 353 |
+
$irp->Form->divStarts($args);
|
| 354 |
+
{
|
| 355 |
+
$irp->Form->p('Notice.DontSave');
|
| 356 |
+
}
|
| 357 |
+
$irp->Form->divEnds();
|
| 358 |
+
$irp->Form->submit('Save');
|
| 359 |
+
|
| 360 |
+
$irp->Form->formEnds();
|
| 361 |
+
$irp->Form->helps=FALSE;
|
| 362 |
+
}
|
| 363 |
+
|
| 364 |
+
function irp_notice_pro_features() {
|
| 365 |
+
global $irp;
|
| 366 |
+
|
| 367 |
+
?>
|
| 368 |
+
<br/>
|
| 369 |
+
<div class="message updated below-h2" style="max-width:600px;">
|
| 370 |
+
<div style="height:10px;"></div>
|
| 371 |
+
<?php
|
| 372 |
+
$i=1;
|
| 373 |
+
while($irp->Lang->H('Notice.ProHeader'.$i)) {
|
| 374 |
+
$irp->Lang->P('Notice.ProHeader'.$i);
|
| 375 |
+
echo '<br/>';
|
| 376 |
+
++$i;
|
| 377 |
+
}
|
| 378 |
+
$i=1;
|
| 379 |
+
?>
|
| 380 |
+
<br/>
|
| 381 |
+
<?php
|
| 382 |
+
/*
|
| 383 |
+
$options = array('public' => TRUE, '_builtin' => FALSE);
|
| 384 |
+
$q=get_post_types($options, 'names');
|
| 385 |
+
if(is_array($q) && count($q)>0) {
|
| 386 |
+
sort($q);
|
| 387 |
+
$q=implode(', ', $q);
|
| 388 |
+
$q='(<b>'.$q.'</b>)';
|
| 389 |
+
} else {
|
| 390 |
+
$q='';
|
| 391 |
+
}*/
|
| 392 |
+
|
| 393 |
+
while($irp->Lang->H('Notice.ProFeature'.$i)) { ?>
|
| 394 |
+
<div style="clear:both; margin-top: 2px;"></div>
|
| 395 |
+
<div style="float:left; vertical-align:middle; height:24px; margin-right:5px;">
|
| 396 |
+
<img src="<?php echo IRP_PLUGIN_IMAGES?>tick.png" />
|
| 397 |
+
</div>
|
| 398 |
+
<div style="float:left; vertical-align:middle; height:24px;">
|
| 399 |
+
<?php $irp->Lang->P('Notice.ProFeature'.$i)?>
|
| 400 |
+
</div>
|
| 401 |
+
<?php ++$i;
|
| 402 |
+
}
|
| 403 |
+
?>
|
| 404 |
+
<div style="clear:both;"></div>
|
| 405 |
+
<div style="height:10px;"></div>
|
| 406 |
+
<div style="float:right;">
|
| 407 |
+
<?php
|
| 408 |
+
$url=IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG.'/?utm_source=free-users&utm_medium=irp-cta&utm_campaign=IRP';
|
| 409 |
+
?>
|
| 410 |
+
<a href="<?php echo $url?>" target="_blank">
|
| 411 |
+
<b><?php $irp->Lang->P('Notice.ProCTA')?></b>
|
| 412 |
+
</a>
|
| 413 |
+
</div>
|
| 414 |
+
<div style="height:10px; clear:both;"></div>
|
| 415 |
+
</div>
|
| 416 |
+
<br/>
|
| 417 |
+
<?php }
|
includes/admin/whatsnew.php
ADDED
|
@@ -0,0 +1,105 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
function irp_ui_whats_new() {
|
| 3 |
+
?>
|
| 4 |
+
<style>
|
| 5 |
+
.irp-grid {
|
| 6 |
+
margin-left: auto;
|
| 7 |
+
margin-right: auto;
|
| 8 |
+
border-spacing: 10px;
|
| 9 |
+
}
|
| 10 |
+
.irp-grid td {
|
| 11 |
+
text-align: center;
|
| 12 |
+
}
|
| 13 |
+
.irp-headline {
|
| 14 |
+
font-size:40px;
|
| 15 |
+
font-weight:bold;
|
| 16 |
+
text-align:center;
|
| 17 |
+
margin: 5px!important;
|
| 18 |
+
}
|
| 19 |
+
</style>
|
| 20 |
+
|
| 21 |
+
<p class="irp-headline">Welcome in Inline Related Posts (v.<?php echo IRP_PLUGIN_VERSION ?>)</p>
|
| 22 |
+
<p class="irp-headline" style="font-size: 35px;">Get even more page views with box themes</p>
|
| 23 |
+
<div style="clear:both; height:30px;"></div>
|
| 24 |
+
|
| 25 |
+
<div style="text-align:center; width:auto;">
|
| 26 |
+
<img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/mac-irl-wahtsnew.png" />
|
| 27 |
+
</div>
|
| 28 |
+
<div style="clear:both; height:30px;"></div>
|
| 29 |
+
|
| 30 |
+
<table border="0" class="irp-grid">
|
| 31 |
+
<tr>
|
| 32 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.001.jpg" /></td>
|
| 33 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.002.jpg" /></td>
|
| 34 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.003.jpg" /></td>
|
| 35 |
+
</tr>
|
| 36 |
+
<tr>
|
| 37 |
+
<td>Box Themes</td>
|
| 38 |
+
<td>More colors</td>
|
| 39 |
+
<td>Featured Image</td>
|
| 40 |
+
</tr>
|
| 41 |
+
</table>
|
| 42 |
+
<div style="clear:both"></div>
|
| 43 |
+
|
| 44 |
+
<hr/>
|
| 45 |
+
|
| 46 |
+
<p class="irp-headline">Get gorgeous themes with Inline Related Posts PRO</p>
|
| 47 |
+
<table border="0" class="irp-grid">
|
| 48 |
+
<tr>
|
| 49 |
+
<td style="text-align:left;">
|
| 50 |
+
<?php irp_notice_pro_features() ?>
|
| 51 |
+
</td>
|
| 52 |
+
<td>
|
| 53 |
+
<div style="border:1px dashed red; padding:10px;">
|
| 54 |
+
<iframe width="560" height="350" src="https://www.youtube.com/embed/CjdTr14Nd1g" frameborder="0" allowfullscreen></iframe>
|
| 55 |
+
</div>
|
| 56 |
+
</td>
|
| 57 |
+
</tr>
|
| 58 |
+
</table>
|
| 59 |
+
|
| 60 |
+
<table border="0" class="irp-grid">
|
| 61 |
+
<tr>
|
| 62 |
+
<td style="text-align: right; vertical-align: top;">
|
| 63 |
+
<form method="get" action="<?php echo IRP_PAGE_SETTINGS?>">
|
| 64 |
+
<input type="hidden" name="page" value="<?php echo IRP_PLUGIN_SLUG?>" />
|
| 65 |
+
<input type="submit" class="button" value="CONTINUE USING FREE VERSION" />
|
| 66 |
+
</form>
|
| 67 |
+
</td>
|
| 68 |
+
<td style="text-align: left; vertical-align: top;">
|
| 69 |
+
<form method="get" action="<?php echo IRP_PAGE_PREMIUM?>">
|
| 70 |
+
<input type="hidden" name="utm_source" value="free-users" />
|
| 71 |
+
<input type="hidden" name="utm_medium" value="irp-whatsnew" />
|
| 72 |
+
<input type="hidden" name="utm_campaign" value="IRP" />
|
| 73 |
+
<input type="submit" class="button-primary" value="UPGRADE TO PREMIUM NOW ››" />
|
| 74 |
+
</form>
|
| 75 |
+
<a href="<?php echo irp_preview_link()?>" target="_blank">or preview your posts with PRO themes</a>
|
| 76 |
+
</td>
|
| 77 |
+
</tr>
|
| 78 |
+
</table>
|
| 79 |
+
<?php }
|
| 80 |
+
|
| 81 |
+
function irp_preview_link() {
|
| 82 |
+
global $irp;
|
| 83 |
+
|
| 84 |
+
$options=array(
|
| 85 |
+
'count'=>1
|
| 86 |
+
, 'array'=>TRUE
|
| 87 |
+
, 'numberposts'=>5
|
| 88 |
+
);
|
| 89 |
+
$posts=wp_get_recent_posts($options);
|
| 90 |
+
$ids=array();
|
| 91 |
+
foreach($posts as $p) {
|
| 92 |
+
$ids[]=$p['ID'];
|
| 93 |
+
}
|
| 94 |
+
shuffle($ids);
|
| 95 |
+
$options=irp_ui_get_box($ids, $options);
|
| 96 |
+
|
| 97 |
+
$options=array(
|
| 98 |
+
'ctaText'=>urlencode($options['ctaText'])
|
| 99 |
+
, 'postTitle'=>urlencode($options['postTitle'])
|
| 100 |
+
, 'postImageUrl'=>urlencode($options['postImageUrl'])
|
| 101 |
+
);
|
| 102 |
+
$uri=IRP_PAGE_PREMIUM;
|
| 103 |
+
$uri=add_query_arg($options, $uri);
|
| 104 |
+
return $uri;
|
| 105 |
+
}
|
includes/classes/common/Stack.php
ADDED
|
@@ -0,0 +1,27 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_Stack {
|
| 5 |
+
var $array;
|
| 6 |
+
|
| 7 |
+
public function __construct() {
|
| 8 |
+
$this->array=array();
|
| 9 |
+
}
|
| 10 |
+
|
| 11 |
+
public function push($v) {
|
| 12 |
+
array_push($this->array, $v);
|
| 13 |
+
}
|
| 14 |
+
public function pop() {
|
| 15 |
+
$v=array_pop($this->array);
|
| 16 |
+
return $v;
|
| 17 |
+
}
|
| 18 |
+
public function peek() {
|
| 19 |
+
return $this->array[count($this->array)-1];
|
| 20 |
+
}
|
| 21 |
+
public function size() {
|
| 22 |
+
return count($this->array);
|
| 23 |
+
}
|
| 24 |
+
public function isEmpty() {
|
| 25 |
+
return (count($this->array)==0);
|
| 26 |
+
}
|
| 27 |
+
}
|
includes/classes/core/HtmlTemplate.php
ADDED
|
@@ -0,0 +1,297 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_HtmlTemplate {
|
| 5 |
+
var $templates;
|
| 6 |
+
var $defaults;
|
| 7 |
+
|
| 8 |
+
public function __construct() {
|
| 9 |
+
$this->templates=array();
|
| 10 |
+
$this->defaults=array();
|
| 11 |
+
}
|
| 12 |
+
|
| 13 |
+
public function getTemplates() {
|
| 14 |
+
return $this->templates;
|
| 15 |
+
}
|
| 16 |
+
public function getDefaults() {
|
| 17 |
+
return $this->defaults;
|
| 18 |
+
}
|
| 19 |
+
public function getTemplatesNames() {
|
| 20 |
+
$array=array_keys($this->templates);
|
| 21 |
+
asort($array);
|
| 22 |
+
return $array;
|
| 23 |
+
}
|
| 24 |
+
public function getFields($name) {
|
| 25 |
+
return $this->getFieldsOrBody($name);
|
| 26 |
+
}
|
| 27 |
+
public function getBody($name, $values=array()) {
|
| 28 |
+
return $this->getFieldsOrBody($name, $values);
|
| 29 |
+
}
|
| 30 |
+
private function getFieldsOrBody($name, $values=array()) {
|
| 31 |
+
global $irp;
|
| 32 |
+
|
| 33 |
+
if(!is_array($values)) {
|
| 34 |
+
$values=array();
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
$buffer='';
|
| 38 |
+
$fields=array();
|
| 39 |
+
$fields['template']='template';
|
| 40 |
+
if(isset($this->templates[$name])) {
|
| 41 |
+
$body=$this->templates[$name];
|
| 42 |
+
$len=strlen($body);
|
| 43 |
+
$previous=0;
|
| 44 |
+
while($previous<$len) {
|
| 45 |
+
$start=strpos($body, '{', $previous);
|
| 46 |
+
if($start!==FALSE) {
|
| 47 |
+
if($previous!=$start) {
|
| 48 |
+
$text=$irp->Utils->substr($body, $previous, $start);
|
| 49 |
+
$buffer.=$text;
|
| 50 |
+
}
|
| 51 |
+
$end=strpos($body, '}', $start+1);
|
| 52 |
+
$another=strpos($body, '{', $start+1);
|
| 53 |
+
|
| 54 |
+
if($end!==FALSE) {
|
| 55 |
+
if($another!==FALSE && $another<$end) {
|
| 56 |
+
$text=$irp->Utils->substr($body, $start, $another);
|
| 57 |
+
$buffer.=$text;
|
| 58 |
+
$previous=$another;
|
| 59 |
+
} else {
|
| 60 |
+
$k=$irp->Utils->substr($body, $start+1, $end);
|
| 61 |
+
if(trim($k)!='' && strpos($k, "\n")===FALSE) {
|
| 62 |
+
if($irp->Utils->startsWith($k, 'if ')) {
|
| 63 |
+
$k=substr($k, 3);
|
| 64 |
+
$fields[$k]=$k;
|
| 65 |
+
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
| 66 |
+
if($irp->Utils->isTrue($v)) {
|
| 67 |
+
//ok continue analysing the rest of template
|
| 68 |
+
//WARN: currently no nested if are allowed
|
| 69 |
+
} else {
|
| 70 |
+
$if='{/if}';
|
| 71 |
+
$start=strpos($body, $if, $end+1);
|
| 72 |
+
if($start===FALSE) {
|
| 73 |
+
$irp->Log->error("CHECK THE TEMPLATE. NO {/if} FOUND FOR {if %s}", $k);
|
| 74 |
+
break;
|
| 75 |
+
} else {
|
| 76 |
+
//skip all the text between {if xxx} and {/if}
|
| 77 |
+
$end=$start+strlen($if)-1;
|
| 78 |
+
}
|
| 79 |
+
}
|
| 80 |
+
} elseif($irp->Utils->startsWith($k, '/if')) {
|
| 81 |
+
//nothing
|
| 82 |
+
} else {
|
| 83 |
+
$fields[$k]=$k;
|
| 84 |
+
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
| 85 |
+
$buffer.=$v;
|
| 86 |
+
}
|
| 87 |
+
} else {
|
| 88 |
+
$text=$irp->Utils->substr($body, $start, $end+1);
|
| 89 |
+
$buffer.=$text;
|
| 90 |
+
}
|
| 91 |
+
$previous=$end+1;
|
| 92 |
+
}
|
| 93 |
+
} else {
|
| 94 |
+
$text=substr($body, $previous);
|
| 95 |
+
$buffer.=$text;
|
| 96 |
+
break;
|
| 97 |
+
}
|
| 98 |
+
} else {
|
| 99 |
+
$text=substr($body, $previous);
|
| 100 |
+
$buffer.=$text;
|
| 101 |
+
break;
|
| 102 |
+
}
|
| 103 |
+
}
|
| 104 |
+
}
|
| 105 |
+
$fields=array_keys($fields);
|
| 106 |
+
$buffer=str_replace("\n\n", "\n", $buffer);
|
| 107 |
+
$result=$buffer;
|
| 108 |
+
if(!is_array($values) || $values==NULL) {
|
| 109 |
+
$result=$fields;
|
| 110 |
+
}
|
| 111 |
+
return $result;
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
//load html template from file system stored in .html files
|
| 115 |
+
public function load($file) {
|
| 116 |
+
if(!file_exists($file)) {
|
| 117 |
+
return;
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
$matchTemplate='#template';
|
| 121 |
+
$matchDefaults='#defaults';
|
| 122 |
+
|
| 123 |
+
$file=file_get_contents($file);
|
| 124 |
+
if($file!=NULL && strlen($file)>0) {
|
| 125 |
+
$file=str_replace("\r\n", "\n", $file);
|
| 126 |
+
$file=str_replace("\n\n", "\n", $file);
|
| 127 |
+
$file=explode("\n", $file);
|
| 128 |
+
|
| 129 |
+
$name='';
|
| 130 |
+
$html='';
|
| 131 |
+
foreach($file as $row) {
|
| 132 |
+
if(stripos($row, $matchTemplate)!==FALSE) {
|
| 133 |
+
if($html!='' && $name!='') {
|
| 134 |
+
$this->templates[$name]=$html;
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
$name=substr($row, strlen($matchTemplate)+1);
|
| 138 |
+
$name=trim($name);
|
| 139 |
+
$html='';
|
| 140 |
+
continue;
|
| 141 |
+
}
|
| 142 |
+
elseif(stripos($row, $matchDefaults)!==FALSE && $name!='') {
|
| 143 |
+
if($html!='' && $name!='') {
|
| 144 |
+
$this->templates[$name]=$html;
|
| 145 |
+
}
|
| 146 |
+
|
| 147 |
+
$defaults=substr($row, strlen($matchDefaults)+1);
|
| 148 |
+
$defaults=str_replace('{', '', $defaults);
|
| 149 |
+
$defaults=str_replace('}', '', $defaults);
|
| 150 |
+
$defaults=explode(',', $defaults);
|
| 151 |
+
$tmp=array();
|
| 152 |
+
foreach($defaults as $v) {
|
| 153 |
+
$v=explode('=', $v);
|
| 154 |
+
if(count($v)>1) {
|
| 155 |
+
|
| 156 |
+
}
|
| 157 |
+
$tmp[trim($v[0])]=trim($v[1]);
|
| 158 |
+
}
|
| 159 |
+
$this->defaults[$name]=$tmp;
|
| 160 |
+
continue;
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
+
if($name=='') {
|
| 164 |
+
continue;
|
| 165 |
+
}
|
| 166 |
+
|
| 167 |
+
$html.=$row."\n";
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
if($html!='' && $name!='') {
|
| 171 |
+
$this->templates[$name]=$html;
|
| 172 |
+
}
|
| 173 |
+
}
|
| 174 |
+
}
|
| 175 |
+
public function html($name, $values, $options='') {
|
| 176 |
+
global $irp;
|
| 177 |
+
$defaults=array(
|
| 178 |
+
'includeCss'=>TRUE
|
| 179 |
+
);
|
| 180 |
+
$options=$irp->Utils->parseArgs($options, $defaults);
|
| 181 |
+
|
| 182 |
+
if(!is_array($values)) {
|
| 183 |
+
$values=array();
|
| 184 |
+
}
|
| 185 |
+
$values['template']=str_replace(' ', '-', $name);
|
| 186 |
+
$values['utemplate']=$irp->Options->getTemplateUUID($values['template']);
|
| 187 |
+
$values['assetsImages']=IRP_PLUGIN_ASSETS.'images/';
|
| 188 |
+
$values['assets']=IRP_PLUGIN_ASSETS;
|
| 189 |
+
$values['demoLink']=irp_preview_link();
|
| 190 |
+
|
| 191 |
+
if(isset($values['linkRel'])) {
|
| 192 |
+
$values['linkRel']=$values['linkRel'];
|
| 193 |
+
if($values['linkRel']!='nofollow') {
|
| 194 |
+
$values['linkRel']='';
|
| 195 |
+
}
|
| 196 |
+
}
|
| 197 |
+
$values['linkRel']=($values['linkRel']!='' ? 'rel="'.$values['linkRel'].'"' : '');
|
| 198 |
+
|
| 199 |
+
$style=array();
|
| 200 |
+
$code='';
|
| 201 |
+
if(isset($this->templates[$name])) {
|
| 202 |
+
foreach($values as $k=>$v) {
|
| 203 |
+
if(stripos($k, 'color')!==FALSE) {
|
| 204 |
+
$values[$k]=$irp->Options->getColor($values[$k]);
|
| 205 |
+
if($values[$k]=='') {
|
| 206 |
+
$values[$k]='inherit';
|
| 207 |
+
}
|
| 208 |
+
$values[$k.'Hover']=$irp->Options->getHoverColor($values[$k]);
|
| 209 |
+
if($values[$k.'Hover']=='') {
|
| 210 |
+
$values[$k.'Hover']='inherit';
|
| 211 |
+
}
|
| 212 |
+
} elseif(stripos($k, 'opacity')!==FALSE) {
|
| 213 |
+
$values[$k]=(intval($values[$k])/100);
|
| 214 |
+
}
|
| 215 |
+
$values[$k.'Display']=($irp->Utils->isTrue($values[$k]) ? 'block' : 'none');
|
| 216 |
+
$values[$k.'Visibility']=($irp->Utils->isTrue($values[$k]) ? 'visible' : 'hidden');
|
| 217 |
+
}
|
| 218 |
+
if(isset($values['comment']) && trim($values['comment'])!=''
|
| 219 |
+
&& !$irp->Utils->startsWith($values['comment'], "<!--")) {
|
| 220 |
+
$values['comment']="<!-- ".trim($values['comment'])." //-->";
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
if($options['includeCss']) {
|
| 224 |
+
//generate unique id from all the combinations, this grant to use the same theme
|
| 225 |
+
//but with different color using shotcodes
|
| 226 |
+
$values['utemplate']=$irp->Utils->getUUID($values);
|
| 227 |
+
}
|
| 228 |
+
$code=$this->getBody($name, $values);
|
| 229 |
+
if(!$options['includeCss']) {
|
| 230 |
+
$array=explode("\n", $code);
|
| 231 |
+
$code=array();
|
| 232 |
+
|
| 233 |
+
$css=FALSE;
|
| 234 |
+
foreach($array as $row) {
|
| 235 |
+
if (stripos($row, '<style>') !== FALSE) {
|
| 236 |
+
$css = TRUE;
|
| 237 |
+
if(!$options['includeCss']) {
|
| 238 |
+
$style[]=$row;
|
| 239 |
+
$row='';
|
| 240 |
+
}
|
| 241 |
+
} elseif (stripos($row, '</style>') !== FALSE) {
|
| 242 |
+
$css = FALSE;
|
| 243 |
+
if(!$options['includeCss']) {
|
| 244 |
+
$style[]=$row;
|
| 245 |
+
$row='';
|
| 246 |
+
}
|
| 247 |
+
} elseif ($css) {
|
| 248 |
+
if(!$options['includeCss']) {
|
| 249 |
+
$style[]=$row;
|
| 250 |
+
$row='';
|
| 251 |
+
}
|
| 252 |
+
}
|
| 253 |
+
|
| 254 |
+
if(trim($row)!='') {
|
| 255 |
+
$code[]=$row;
|
| 256 |
+
}
|
| 257 |
+
}
|
| 258 |
+
$code=implode("\n", $code);
|
| 259 |
+
if(count($style)>0) {
|
| 260 |
+
$irp->Options->pushCssStyle($style);
|
| 261 |
+
}
|
| 262 |
+
}
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
$code=$irp->Utils->trimCode($code);
|
| 266 |
+
if($code!='') {
|
| 267 |
+
if(isset($values['hasPoweredBy']) && $values['hasPoweredBy']) {
|
| 268 |
+
$code.='<div style="width:100%; text-align:right; font-weight:normal;">';
|
| 269 |
+
$code.='<div style="font-size:10px;">';
|
| 270 |
+
$code.='<span class="poweredByText">Powered by</span>';
|
| 271 |
+
$code.=' ';
|
| 272 |
+
$code.='<a rel="nofollow" style="font-weight:bold;" href="https://wordpress.org/plugins/intelly-related-posts/" target="_blank">';
|
| 273 |
+
$code.='Inline Related Posts';
|
| 274 |
+
$code.='</a>';
|
| 275 |
+
$code.='</div>';
|
| 276 |
+
$code.='</div>';
|
| 277 |
+
$code.='<div style="clear:both"></div>';
|
| 278 |
+
}
|
| 279 |
+
$mt=$irp->Options->getMarginTop();
|
| 280 |
+
$mb=$irp->Options->getMarginBottom();
|
| 281 |
+
$code='<div style="clear:both; margin-top:'.$mt.'; margin-bottom:'.$mb.';">'.$code.'</div>';
|
| 282 |
+
//$code.="\n";
|
| 283 |
+
//$code.="<br>";
|
| 284 |
+
}
|
| 285 |
+
|
| 286 |
+
$defaults=$irp->HtmlTemplate->getDefaults();
|
| 287 |
+
$defaults=$defaults[$options['template']];
|
| 288 |
+
if($code!='' && isset($defaults['proTheme']) && $irp->Utils->isTrue($defaults['proTheme'])) {
|
| 289 |
+
$code.='<p style="text-align:center;">';
|
| 290 |
+
$code.='<a style="font-size:20px; color:green; font-weight:bold;" href="'.$values['demoLink'].'" rel="nofollow" target="_blank">';
|
| 291 |
+
$code.='Click here to preview your posts with PRO themes ››';
|
| 292 |
+
$code.='</p>';
|
| 293 |
+
$code.='</a>';
|
| 294 |
+
}
|
| 295 |
+
return $code;
|
| 296 |
+
}
|
| 297 |
+
}
|
includes/classes/core/Manager.php
ADDED
|
@@ -0,0 +1,100 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_Manager {
|
| 5 |
+
|
| 6 |
+
public function __construct() {
|
| 7 |
+
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
public function getRelatedPostsIds($args) {
|
| 11 |
+
global $irp;
|
| 12 |
+
|
| 13 |
+
$ids=array();
|
| 14 |
+
if(IRP_DISABLE_RELATED || !$irp->Options->isActive()) {
|
| 15 |
+
return $ids;
|
| 16 |
+
}
|
| 17 |
+
|
| 18 |
+
$defaults=array('postId'=>0
|
| 19 |
+
, 'posts'=>array(), 'cats'=>array(), 'tags'=>array()
|
| 20 |
+
, 'count'=>10
|
| 21 |
+
, 'shuffle'=>FALSE);
|
| 22 |
+
$args=$irp->Utils->parseArgs($args, $defaults);
|
| 23 |
+
|
| 24 |
+
$args['posts']=$irp->Utils->toCommaArray($args['posts']);
|
| 25 |
+
$args['cats']=$irp->Utils->toCommaArray($args['cats']);
|
| 26 |
+
$args['tags']=$irp->Utils->toCommaArray($args['tags']);
|
| 27 |
+
$args['postId']=intval($args['postId']);
|
| 28 |
+
if($args['postId']>0) {
|
| 29 |
+
$options=array('orderby' => 'name', 'order' => 'ASC', 'fields' => 'ids');
|
| 30 |
+
$args['tags']=wp_get_post_tags($args['postId'], $options);
|
| 31 |
+
$args['cats']=wp_get_post_categories($args['postId']);
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
if(count($args['posts'])>0) {
|
| 35 |
+
$ids=$args['posts'];
|
| 36 |
+
} else {
|
| 37 |
+
$ids=array();
|
| 38 |
+
switch ($irp->Options->getEngineSearch()) {
|
| 39 |
+
case IRP_ENGINE_SEARCH_CATEGORIES:
|
| 40 |
+
$ids=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
| 41 |
+
break;
|
| 42 |
+
case IRP_ENGINE_SEARCH_TAGS:
|
| 43 |
+
$ids=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
| 44 |
+
break;
|
| 45 |
+
case IRP_ENGINE_SEARCH_CATEGORIES_TAGS:
|
| 46 |
+
//if we execute this query with the 2 parameters togheter category__in
|
| 47 |
+
//and tag__in WP do an AND query and not an OR query as we need
|
| 48 |
+
$cats=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
| 49 |
+
$tags=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
| 50 |
+
$ids=array_merge($cats, $tags);
|
| 51 |
+
$ids=array_unique($ids);
|
| 52 |
+
break;
|
| 53 |
+
}
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
if($args['shuffle']) {
|
| 57 |
+
shuffle($ids);
|
| 58 |
+
}
|
| 59 |
+
return $ids;
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
private function queryRelatedPostsIds($args, $optionKey, $optionArray) {
|
| 63 |
+
global $irp;
|
| 64 |
+
|
| 65 |
+
$ids=array();
|
| 66 |
+
if(!is_array($optionArray) || count($optionArray)==0) {
|
| 67 |
+
return $ids;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
$post=$irp->Options->getPostShown();
|
| 71 |
+
$options=array(
|
| 72 |
+
'post_type'=>$post->post_type
|
| 73 |
+
//, 'nopaging'=>TRUE
|
| 74 |
+
, 'posts_per_page'=>10
|
| 75 |
+
, 'post_status'=>'publish'
|
| 76 |
+
, 'post__not_in'=>array($post->ID)
|
| 77 |
+
, 'orderby'=>'rand'
|
| 78 |
+
);
|
| 79 |
+
$days=$irp->Options->getRewritePostsDays();
|
| 80 |
+
if($days>0) {
|
| 81 |
+
$options['date_query'] = array(
|
| 82 |
+
'column' => 'post_date'
|
| 83 |
+
, 'after' => '- '.$days.' days'
|
| 84 |
+
);
|
| 85 |
+
}
|
| 86 |
+
$options[$optionKey]=$optionArray;
|
| 87 |
+
|
| 88 |
+
$q=new WP_Query();
|
| 89 |
+
$irp->Log->debug('RELATED POSTS QUERY=%s', $options);
|
| 90 |
+
$posts=$q->query($options);
|
| 91 |
+
|
| 92 |
+
$irp->Log->debug('RELATED POSTS RESULT COUNT=%s', count($posts));
|
| 93 |
+
foreach($posts as $p) {
|
| 94 |
+
if($args['postId']<=0 || $args['postId']!=$p->ID) {
|
| 95 |
+
$ids[]=$p->ID;
|
| 96 |
+
}
|
| 97 |
+
}
|
| 98 |
+
return $ids;
|
| 99 |
+
}
|
| 100 |
+
}
|
includes/classes/core/Singleton.php
ADDED
|
@@ -0,0 +1,36 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class IRP_Singleton {
|
| 3 |
+
var $Lang;
|
| 4 |
+
var $Utils;
|
| 5 |
+
var $Form;
|
| 6 |
+
var $Check;
|
| 7 |
+
var $Options;
|
| 8 |
+
var $Manager;
|
| 9 |
+
var $Log;
|
| 10 |
+
var $Cron;
|
| 11 |
+
var $Tracking;
|
| 12 |
+
var $Tabs;
|
| 13 |
+
var $Plugin;
|
| 14 |
+
var $HtmlTemplate;
|
| 15 |
+
|
| 16 |
+
function __construct() {
|
| 17 |
+
$this->Lang=new IRP_Language();
|
| 18 |
+
$this->Utils=new IRP_Utils();
|
| 19 |
+
$this->Form=new IRP_Form();
|
| 20 |
+
$this->Check=new IRP_Check();
|
| 21 |
+
$this->Options=new IRP_AppOptions();
|
| 22 |
+
$this->Manager=new IRP_Manager();
|
| 23 |
+
$this->Log=new IRP_Logger();
|
| 24 |
+
$this->Cron=new IRP_Cron();
|
| 25 |
+
$this->Tracking=new IRP_Tracking();
|
| 26 |
+
$this->Tabs=new IRP_Tabs();
|
| 27 |
+
$this->Plugin=new IRP_Plugin();
|
| 28 |
+
$this->HtmlTemplate=new IRP_HtmlTemplate();
|
| 29 |
+
}
|
| 30 |
+
function init() {
|
| 31 |
+
$this->Lang->load('irp', IRP_PLUGIN_ROOT.'languages/Lang.txt');
|
| 32 |
+
$this->HtmlTemplate->load(IRP_PLUGIN_ROOT.'assets/templates/styles.html');
|
| 33 |
+
$this->Tabs->init();
|
| 34 |
+
$this->Cron->init();
|
| 35 |
+
}
|
| 36 |
+
}
|
includes/classes/html/BehaviourTag.php
ADDED
|
@@ -0,0 +1,51 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_BehaviourTag extends IRP_HTMLTag {
|
| 5 |
+
|
| 6 |
+
var $allowBoxBefore=FALSE;
|
| 7 |
+
var $allowBoxAfter=FALSE;
|
| 8 |
+
var $skipWordsCount=FALSE;
|
| 9 |
+
var $ensureUncuttable=FALSE;
|
| 10 |
+
var $ensureWithoutPreviousBox=FALSE;
|
| 11 |
+
var $ensureWithoutNextBox=FALSE;
|
| 12 |
+
|
| 13 |
+
public function write(IRP_HTMLContext $context) {
|
| 14 |
+
$w=$context->skipWordsCount;
|
| 15 |
+
$context->skipWordsCount=$this->skipWordsCount;
|
| 16 |
+
|
| 17 |
+
if($this->ensureWithoutPreviousBox) {
|
| 18 |
+
//if present remove the last related box
|
| 19 |
+
$args=array('last'=>TRUE);
|
| 20 |
+
$context->popRelatedBox($args);
|
| 21 |
+
}
|
| 22 |
+
if($this->allowBoxBefore) {
|
| 23 |
+
$context->writeRelatedBoxIfNeeded();
|
| 24 |
+
}
|
| 25 |
+
|
| 26 |
+
if($this->ensureUncuttable) {
|
| 27 |
+
$previous=$context->isUncuttable();
|
| 28 |
+
$context->setUncuttable(TRUE);
|
| 29 |
+
}
|
| 30 |
+
parent::write($context);
|
| 31 |
+
if($this->ensureUncuttable) {
|
| 32 |
+
$context->setUncuttable($previous);
|
| 33 |
+
}
|
| 34 |
+
|
| 35 |
+
if($this->allowBoxAfter) {
|
| 36 |
+
$context->writeRelatedBoxIfNeeded();
|
| 37 |
+
}
|
| 38 |
+
if($this->ensureWithoutNextBox) {
|
| 39 |
+
$context->setWithoutNextBox();
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
$context->skipWordsCount=$w;
|
| 43 |
+
}
|
| 44 |
+
public function analyseText(IRP_HTMLContext $context) {
|
| 45 |
+
if($this->skipWordsCount) {
|
| 46 |
+
return;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
parent::analyseText($context);
|
| 50 |
+
}
|
| 51 |
+
}
|
includes/classes/html/HTMLContext.php
ADDED
|
@@ -0,0 +1,564 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_HTMLContext {
|
| 5 |
+
var $root; //MainTag
|
| 6 |
+
var $buffer; //IRP_Stack
|
| 7 |
+
|
| 8 |
+
var $uncuttable;
|
| 9 |
+
var $withoutNextState;
|
| 10 |
+
var $withoutNextWords;
|
| 11 |
+
|
| 12 |
+
var $currentWords;
|
| 13 |
+
var $lastBoxWords;
|
| 14 |
+
//last time that the plugin insert the related posts box counter values
|
| 15 |
+
var $wordsThreshold;
|
| 16 |
+
var $skipWordsCount=FALSE;
|
| 17 |
+
|
| 18 |
+
public function __construct() {
|
| 19 |
+
$this->clearBuffer();
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
public function setWithoutNextBox() {
|
| 23 |
+
$this->withoutNextState=TRUE;
|
| 24 |
+
$this->withoutNextWords=$this->currentWords;
|
| 25 |
+
}
|
| 26 |
+
public function isSkipCurrentBox() {
|
| 27 |
+
$result=FALSE;
|
| 28 |
+
if($this->withoutNextState) {
|
| 29 |
+
//if i already had written some words i can unlock the withoutNext lock
|
| 30 |
+
$result=($this->currentWords<=$this->withoutNextWords);
|
| 31 |
+
if(!$result) {
|
| 32 |
+
$this->withoutNextState=FALSE;
|
| 33 |
+
$this->withoutNextWords=0;
|
| 34 |
+
}
|
| 35 |
+
}
|
| 36 |
+
return $result;
|
| 37 |
+
}
|
| 38 |
+
public function clearSkipNext() {
|
| 39 |
+
$this->withoutNextState=FALSE;
|
| 40 |
+
$this->withoutNextWords=0;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
public function setUncuttable($value) {
|
| 44 |
+
$this->uncuttable=$value;
|
| 45 |
+
}
|
| 46 |
+
public function isUncuttable() {
|
| 47 |
+
return $this->uncuttable;
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
private function clearBuffer() {
|
| 51 |
+
$this->buffer=new IRP_Stack();
|
| 52 |
+
$this->uncuttable=FALSE;
|
| 53 |
+
$this->isParentTable=FALSE;
|
| 54 |
+
$this->withoutNextState=FALSE;
|
| 55 |
+
$this->currentWords=0;
|
| 56 |
+
$this->lastBoxWords=0;
|
| 57 |
+
$this->withoutNextState=FALSE;
|
| 58 |
+
$this->withoutNextWords=0;
|
| 59 |
+
}
|
| 60 |
+
private function pushTextContent($part, $text, IRP_Stack &$tagsStack) {
|
| 61 |
+
if(!$part) {
|
| 62 |
+
$parent=$tagsStack->peek();
|
| 63 |
+
$part=new IRP_TextContent();
|
| 64 |
+
$parent->pushTag($part);
|
| 65 |
+
}
|
| 66 |
+
$part->append($text);
|
| 67 |
+
return $part;
|
| 68 |
+
}
|
| 69 |
+
|
| 70 |
+
public function isWriteRelatedBox() {
|
| 71 |
+
global $irp;
|
| 72 |
+
if($this->isSkipCurrentBox()) {
|
| 73 |
+
return FALSE;
|
| 74 |
+
}
|
| 75 |
+
if($this->isUncuttable()) {
|
| 76 |
+
return FALSE;
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
$irp->Log->debug('WriteRelatedBox?');
|
| 80 |
+
$diff=($this->currentWords-$this->lastBoxWords);
|
| 81 |
+
$irp->Log->debug('currentWords[%s]-lastBoxWords[%s]=diff[%s]'
|
| 82 |
+
, $this->currentWords, $this->lastBoxWords, $diff);
|
| 83 |
+
|
| 84 |
+
$postLimit=$this->wordsThreshold*($irp->Options->getRewriteBoxesWritten()+1);
|
| 85 |
+
$irp->Log->debug('wordsThreshold[%s]*(RewriteBoxesWritten[%s]+1)=postLimit[%s]'
|
| 86 |
+
, $this->wordsThreshold, $irp->Options->getRewriteBoxesWritten(), $postLimit);
|
| 87 |
+
|
| 88 |
+
$minLimit=$irp->Options->getRewriteThreshold();
|
| 89 |
+
$result=($this->currentWords>=$postLimit && $diff>=$minLimit);
|
| 90 |
+
$irp->Log->debug('(currentWords[%s]>=postLimit[%s]) AND (diff[%s]>=minLimit[%s])=%s'
|
| 91 |
+
, $this->currentWords, $postLimit
|
| 92 |
+
, $diff, $minLimit, $result);
|
| 93 |
+
return $result;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
function getTagAttribute($fullTag, $name) {
|
| 97 |
+
$close=strpos($fullTag, '>');
|
| 98 |
+
$attr=strpos($fullTag, ' '.$name.'=');
|
| 99 |
+
$result='';
|
| 100 |
+
if($attr!==FALSE && $close!==FALSE && $attr<$close) {
|
| 101 |
+
$quote=substr($fullTag, $attr+strlen($name)+2, 1);
|
| 102 |
+
$text=substr($fullTag, $attr+strlen($name)+3);
|
| 103 |
+
$end=strpos($text, $quote, 1);
|
| 104 |
+
if($end!==FALSE) {
|
| 105 |
+
$result=substr($text, 0, $end);
|
| 106 |
+
}
|
| 107 |
+
}
|
| 108 |
+
return $result;
|
| 109 |
+
}
|
| 110 |
+
|
| 111 |
+
//get the tag name to lower case, could be that is not defined
|
| 112 |
+
//so this function return '' could also be that
|
| 113 |
+
function getTagName($fullTag) {
|
| 114 |
+
global $irp;
|
| 115 |
+
|
| 116 |
+
$start=1;
|
| 117 |
+
$p=strpos($fullTag, ' ');
|
| 118 |
+
if($p===FALSE) {
|
| 119 |
+
$p=strpos($fullTag, '/');
|
| 120 |
+
if($p!==FALSE && $p==1) {
|
| 121 |
+
$start=2;
|
| 122 |
+
$p=FALSE;
|
| 123 |
+
}
|
| 124 |
+
if($p===FALSE) {
|
| 125 |
+
$p=strpos($fullTag, '>');
|
| 126 |
+
if($p===FALSE) {
|
| 127 |
+
$irp->Log->error('UNABLE TO DECODE TAG %s', $fullTag);
|
| 128 |
+
return '';
|
| 129 |
+
}
|
| 130 |
+
}
|
| 131 |
+
}
|
| 132 |
+
$tag=trim(substr($fullTag, $start, $p-$start));
|
| 133 |
+
$tag=strtolower($tag);
|
| 134 |
+
return $tag;
|
| 135 |
+
}
|
| 136 |
+
function getHtmlTag($fullTag){
|
| 137 |
+
global $irp;
|
| 138 |
+
|
| 139 |
+
$tag=$this->getTagName($fullTag);
|
| 140 |
+
$tagId=$this->getTagAttribute($fullTag, 'id');
|
| 141 |
+
$tagClasses=$this->getTagAttribute($fullTag, 'class');
|
| 142 |
+
if($tagClasses!=='') {
|
| 143 |
+
$tagClasses=explode(' ', $tagClasses);
|
| 144 |
+
} else {
|
| 145 |
+
$tagClasses=array();
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
if($tag=='') {
|
| 149 |
+
return NULL;
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
$result=new IRP_OtherTag();
|
| 153 |
+
if(in_array($tag, array('h1','h2','h3','h4','h5','h6'))) {
|
| 154 |
+
$result=new IRP_BehaviourTag();
|
| 155 |
+
$result->allowBoxBefore=TRUE;
|
| 156 |
+
$result->ensureUncuttable=TRUE;
|
| 157 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 158 |
+
} elseif(in_array($tag, array('ul', 'ol', 'dl'))) {
|
| 159 |
+
$result=new IRP_BehaviourTag();
|
| 160 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
| 161 |
+
$result->ensureUncuttable=TRUE;
|
| 162 |
+
$result->allowBoxAfter=TRUE;
|
| 163 |
+
} elseif(in_array($tag, array('area','base','col','br','command','embed','hr','img','input','link','meta','param','source'))) {
|
| 164 |
+
$result=new IRP_SingletonTag();
|
| 165 |
+
} elseif(in_array($tag, array('iframe'))) {
|
| 166 |
+
$result=new IRP_BehaviourTag();
|
| 167 |
+
$result->allowBoxBefore=TRUE;
|
| 168 |
+
$result->ensureUncuttable=TRUE;
|
| 169 |
+
$result->allowBoxAfter=TRUE;
|
| 170 |
+
$result->skipWordsCount=TRUE;
|
| 171 |
+
} elseif(in_array($tag, array('table'))) {
|
| 172 |
+
$result=new IRP_BehaviourTag();
|
| 173 |
+
$result->allowBoxBefore=TRUE;
|
| 174 |
+
$result->ensureUncuttable=TRUE;
|
| 175 |
+
$result->allowBoxAfter=TRUE;
|
| 176 |
+
} elseif(in_array($tag, array('span'))) {
|
| 177 |
+
$result=new IRP_BehaviourTag();
|
| 178 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
| 179 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 180 |
+
} elseif(in_array($tag, array('figure'))) {
|
| 181 |
+
$result=new IRP_BehaviourTag();
|
| 182 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 183 |
+
$result->skipWordsCount=TRUE;
|
| 184 |
+
$result->ensureUncuttable=TRUE;
|
| 185 |
+
} elseif(in_array($tag, array('div'))) {
|
| 186 |
+
$result=new IRP_BehaviourTag();
|
| 187 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
| 188 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 189 |
+
|
| 190 |
+
$ids=explode('|', 'optinforms-|wpautbox-|wpurp-container-recipe-');
|
| 191 |
+
if($irp->Utils->startsWith($tagId, $ids)) {
|
| 192 |
+
$result->skipWordsCount=TRUE;
|
| 193 |
+
$result->ensureUncuttable=TRUE;
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
$classes=explode('|', 'yuzo_related_post|shareaholic-|wp-caption|wordpress-post-tabs|amp-wp-article-content|title-wrapper|sa-source-wrapper|et_pb_text_inner|wprm-recipe-name|toc_light_blue|ast-oembed-container|depiction|wc-tab|gkblock-3|et_pb_toggle_content|et_pb_module|aawp-product__description|fusion-text|fusion-alert-content|mv-create-instructions|recipe-ingredients-wrap|guide-box|underPostOptin|x-columnize');
|
| 197 |
+
if($irp->Utils->startsWith($tagClasses, $classes)) {
|
| 198 |
+
$result->skipWordsCount=TRUE;
|
| 199 |
+
$result->ensureUncuttable=TRUE;
|
| 200 |
+
}
|
| 201 |
+
} elseif(in_array($tag, array('p'))) {
|
| 202 |
+
$result=new IRP_BehaviourTag();
|
| 203 |
+
$result->allowBoxBefore=TRUE;
|
| 204 |
+
$result->allowBoxAfter=TRUE;
|
| 205 |
+
} elseif(in_array($tag, array('blockquote', 'cite', 'code', 'em', 'pre'))) {
|
| 206 |
+
$result=new IRP_BehaviourTag();
|
| 207 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
| 208 |
+
$result->ensureUncuttable=TRUE;
|
| 209 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 210 |
+
} elseif(in_array($tag, array('irp', 'script', 'style'))) {
|
| 211 |
+
$result=new IRP_BehaviourTag();
|
| 212 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
| 213 |
+
$result->ensureUncuttable=TRUE;
|
| 214 |
+
$result->ensureWithoutNextBox=TRUE;
|
| 215 |
+
$result->skipWordsCount=TRUE;
|
| 216 |
+
} elseif(in_array($tag, array('sub', 'sup'))) {
|
| 217 |
+
$result=new IRP_BehaviourTag();
|
| 218 |
+
$result->ensureUncuttable=TRUE;
|
| 219 |
+
}
|
| 220 |
+
return $result;
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
public function decode($all) {
|
| 224 |
+
global $irp;
|
| 225 |
+
|
| 226 |
+
$this->root=new IRP_MainTag();
|
| 227 |
+
$this->clearBuffer();
|
| 228 |
+
|
| 229 |
+
if(!$all || trim($all)=='') return FALSE;
|
| 230 |
+
|
| 231 |
+
//qui sono a ricercare tutti i tag per poi farci delle verifiche
|
| 232 |
+
$tagsStack=new IRP_Stack();
|
| 233 |
+
$tagsStack->push($this->root);
|
| 234 |
+
|
| 235 |
+
$errors=FALSE;
|
| 236 |
+
$part=NULL;
|
| 237 |
+
$previous=0;
|
| 238 |
+
|
| 239 |
+
try {
|
| 240 |
+
do {
|
| 241 |
+
$less=strpos($all, '<', $previous);
|
| 242 |
+
if($less===FALSE) {
|
| 243 |
+
if($previous!=strlen($all)) {
|
| 244 |
+
$text=$irp->Utils->substrln($all, $previous);
|
| 245 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
| 246 |
+
}
|
| 247 |
+
break;
|
| 248 |
+
}
|
| 249 |
+
|
| 250 |
+
if($previous!=$less) {
|
| 251 |
+
$text=$irp->Utils->substrln($all, $previous, $less);
|
| 252 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
| 253 |
+
}
|
| 254 |
+
|
| 255 |
+
$more=strpos($all, '>', $less+1);
|
| 256 |
+
$another=strpos($all, '<', $less+1);
|
| 257 |
+
if($more===FALSE) {
|
| 258 |
+
//only open tag so I considate all as text (in this case is better
|
| 259 |
+
//to use html code like > or <
|
| 260 |
+
$text=$irp->Utils->substrln($all, $previous);
|
| 261 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
| 262 |
+
break;
|
| 263 |
+
}
|
| 264 |
+
|
| 265 |
+
if($another!==FALSE && $another<$more) {
|
| 266 |
+
//something like this <bla bla bla <bla bla> so we considerate
|
| 267 |
+
//from the last < before >
|
| 268 |
+
$previous=$another;
|
| 269 |
+
$text=$irp->Utils->substrln($all, $less, $previous);
|
| 270 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
| 271 |
+
continue;
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
$previous=$more+1;
|
| 275 |
+
$text=$irp->Utils->substrln($all, $less, $previous);
|
| 276 |
+
$parent=$tagsStack->peek();
|
| 277 |
+
$tag=$this->getOpenTag($text);
|
| 278 |
+
if($tag) {
|
| 279 |
+
//detected tag open
|
| 280 |
+
$part=NULL;
|
| 281 |
+
$parent->pushTag($tag);
|
| 282 |
+
if($tag->hasTagContent()) {
|
| 283 |
+
//this tag contains a content
|
| 284 |
+
$tagsStack->push($tag);
|
| 285 |
+
}
|
| 286 |
+
} else {
|
| 287 |
+
//detected tag close
|
| 288 |
+
$tag=$this->getCloseTag($text, $tagsStack);
|
| 289 |
+
if($tag) {
|
| 290 |
+
$part=NULL;
|
| 291 |
+
$compare=$tagsStack->pop();
|
| 292 |
+
while(!$tagsStack->isEmpty() && $compare!=$tag) {
|
| 293 |
+
//security check: close each tag until i found my tag
|
| 294 |
+
$irp->Log->error('WHAT? UNABLE TO FIND OPENED TAG..TRY CLOSING AND RETRYING AGAIN');
|
| 295 |
+
$compare->closeTag='</'.$compare->tag.'>';
|
| 296 |
+
$compare=$tagsStack->pop();
|
| 297 |
+
}
|
| 298 |
+
if($compare!=$tag) {
|
| 299 |
+
$irp->Log->error('WHAT? UNABLE TO FIND OPENED TAG');
|
| 300 |
+
$errors=TRUE;
|
| 301 |
+
} else {
|
| 302 |
+
$compare->closeTag=$text;
|
| 303 |
+
}
|
| 304 |
+
} else {
|
| 305 |
+
//simply text
|
| 306 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
| 307 |
+
}
|
| 308 |
+
}
|
| 309 |
+
}
|
| 310 |
+
while($previous<strlen($all));
|
| 311 |
+
} catch(Exception $ex) {
|
| 312 |
+
$irp->Log->exception($ex);
|
| 313 |
+
}
|
| 314 |
+
|
| 315 |
+
return !$errors;
|
| 316 |
+
}
|
| 317 |
+
|
| 318 |
+
private function getOpenTag($openTag) {
|
| 319 |
+
global $irp;
|
| 320 |
+
if($irp->Utils->startsWith($openTag, '</')) {
|
| 321 |
+
return NULL;
|
| 322 |
+
}
|
| 323 |
+
|
| 324 |
+
$name=$this->getTagName($openTag);
|
| 325 |
+
$tag=$this->getHtmlTag($openTag);
|
| 326 |
+
if($tag) {
|
| 327 |
+
$tag->tag=$name;
|
| 328 |
+
$tag->openTag=$openTag;
|
| 329 |
+
}
|
| 330 |
+
return $tag;
|
| 331 |
+
}
|
| 332 |
+
private function getCloseTag($closeTag, IRP_Stack $tagsStack) {
|
| 333 |
+
global $irp;
|
| 334 |
+
if(!$irp->Utils->startsWith($closeTag, '</')) {
|
| 335 |
+
return NULL;
|
| 336 |
+
}
|
| 337 |
+
|
| 338 |
+
$compare=$this->getTagName($closeTag);
|
| 339 |
+
if($compare=='') return NULL;
|
| 340 |
+
|
| 341 |
+
$tos=$tagsStack->peek();
|
| 342 |
+
if(!$tos || !isset($tos->tag) || strcasecmp($tos->tag, $compare)!=0) {
|
| 343 |
+
$irp->Log->error('CHECK YOU BODY TAG %s ENDS WITH %s TAG', $tos->tag, $compare);
|
| 344 |
+
return NULL;
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
$tos->closeTag=$closeTag;
|
| 348 |
+
return $tos;
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
public function execute($body) {
|
| 352 |
+
global $irp;
|
| 353 |
+
if(!$irp->Options->isRewriteActive()) {
|
| 354 |
+
return $body;
|
| 355 |
+
}
|
| 356 |
+
|
| 357 |
+
$this->decode($body);
|
| 358 |
+
$this->root->analyseText($this);
|
| 359 |
+
$t=intval($this->currentWords/($irp->Options->getRewriteBoxesCount()+1));
|
| 360 |
+
if($t<$irp->Options->getRewriteThreshold()) {
|
| 361 |
+
$t=$irp->Options->getRewriteThreshold();
|
| 362 |
+
}
|
| 363 |
+
/*
|
| 364 |
+
if($t<$irp->Options->getRewriteThreshold()) {
|
| 365 |
+
if($irp->Options->isRewriteAtEnd()) {
|
| 366 |
+
//this avoid to write a box just before the end of the posts
|
| 367 |
+
//where, due the isRewriteAtEnd flag we will write another box
|
| 368 |
+
$t=$this->wordsCounter+1;
|
| 369 |
+
} else {
|
| 370 |
+
$t=$irp->Options->getRewriteThreshold();
|
| 371 |
+
}
|
| 372 |
+
}
|
| 373 |
+
*/
|
| 374 |
+
$this->wordsThreshold=$t;
|
| 375 |
+
|
| 376 |
+
$this->clearBuffer();
|
| 377 |
+
$this->root->write($this);
|
| 378 |
+
|
| 379 |
+
$result='';
|
| 380 |
+
foreach($this->buffer->array as $v) {
|
| 381 |
+
$result.=$v->getText();
|
| 382 |
+
}
|
| 383 |
+
return $result;
|
| 384 |
+
}
|
| 385 |
+
public function write($text, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 386 |
+
global $irp;
|
| 387 |
+
if(!$text || $text=='') return;
|
| 388 |
+
$text=$irp->Utils->format($text, $v1, $v2, $v3, $v4, $v5);
|
| 389 |
+
|
| 390 |
+
$v=NULL;
|
| 391 |
+
$new=$this->buffer->isEmpty();
|
| 392 |
+
if(!$new) {
|
| 393 |
+
$v=$this->buffer->peek();
|
| 394 |
+
if(!$v->isBufferText()) {
|
| 395 |
+
$new=TRUE;
|
| 396 |
+
}
|
| 397 |
+
}
|
| 398 |
+
|
| 399 |
+
if($new) {
|
| 400 |
+
$v=new IRP_BufferText();
|
| 401 |
+
$this->buffer->push($v);
|
| 402 |
+
}
|
| 403 |
+
$v->appendText($text);
|
| 404 |
+
}
|
| 405 |
+
public function writeRelatedBoxIfNeeded() {
|
| 406 |
+
$result=FALSE;
|
| 407 |
+
//write the box at the end of the tag only if this is not an <Hn> tag
|
| 408 |
+
if($this->isWriteRelatedBox()) {
|
| 409 |
+
$result=$this->writeRelatedBox();
|
| 410 |
+
}
|
| 411 |
+
return $result;
|
| 412 |
+
}
|
| 413 |
+
public function writeRelatedBox($forceBox=FALSE) {
|
| 414 |
+
global $irp;
|
| 415 |
+
|
| 416 |
+
$written=$irp->Options->getRewriteBoxesWritten();
|
| 417 |
+
$max=$irp->Options->getRewriteBoxesCount();
|
| 418 |
+
if(!$forceBox && $written>=$max) {
|
| 419 |
+
$irp->Log->error('MAX BOX=%s REACHED', $max);
|
| 420 |
+
return FALSE;
|
| 421 |
+
}
|
| 422 |
+
|
| 423 |
+
$irp->Log->debug('WRITING BOX=%s/%s', $written+1, $max);
|
| 424 |
+
$result=FALSE;
|
| 425 |
+
$count=1;//$irp->Options->getRewritePostsInBoxCount();
|
| 426 |
+
$ids=$irp->Options->getToShowPostsIds($count, TRUE);
|
| 427 |
+
|
| 428 |
+
$comment="INLINE RELATED POSTS %s/%s";
|
| 429 |
+
$comment=sprintf($comment, $written+1, $max);
|
| 430 |
+
$options=array(
|
| 431 |
+
'comment'=>$comment
|
| 432 |
+
, 'shortcode'=>FALSE
|
| 433 |
+
);
|
| 434 |
+
$box=irp_ui_get_box($ids, $options);
|
| 435 |
+
if($box!='') {
|
| 436 |
+
$this->pushRelatedBox($box);
|
| 437 |
+
$result=TRUE;
|
| 438 |
+
} else {
|
| 439 |
+
$result=FALSE;
|
| 440 |
+
$irp->Log->error('NO BOX TO WRITE WITH IDS=%s', $ids);
|
| 441 |
+
}
|
| 442 |
+
return $result;
|
| 443 |
+
}
|
| 444 |
+
//append related-box element to buffer
|
| 445 |
+
public function pushRelatedBox($box) {
|
| 446 |
+
global $irp;
|
| 447 |
+
|
| 448 |
+
$v=new IRP_BufferBox();
|
| 449 |
+
$v->appendText($box);
|
| 450 |
+
$v->currentBoxWords=$this->currentWords;
|
| 451 |
+
$v->previousBoxWords=$this->lastBoxWords;
|
| 452 |
+
$this->buffer->push($v);
|
| 453 |
+
|
| 454 |
+
$written=$irp->Options->getRewriteBoxesWritten()+1;
|
| 455 |
+
$irp->Options->setRewriteBoxesWritten($written);
|
| 456 |
+
$this->lastBoxWords=$v->currentBoxWords;
|
| 457 |
+
}
|
| 458 |
+
//remove related-box elements from buffer starting from the end
|
| 459 |
+
public function popRelatedBox($args=NULL) {
|
| 460 |
+
global $irp;
|
| 461 |
+
if($this->buffer->isEmpty()) {
|
| 462 |
+
return FALSE;
|
| 463 |
+
}
|
| 464 |
+
|
| 465 |
+
$result=FALSE;
|
| 466 |
+
$defaults=array('last'=>TRUE, 'all'=>FALSE);
|
| 467 |
+
$args=$irp->Utils->parseArgs($args, $defaults);
|
| 468 |
+
if($args['last']) {
|
| 469 |
+
$v=$this->buffer->peek();
|
| 470 |
+
if($v->isBufferBox()) {
|
| 471 |
+
$v=$this->buffer->pop();
|
| 472 |
+
$this->lastBoxWords=$v->previousBoxWords;
|
| 473 |
+
$result=TRUE;
|
| 474 |
+
|
| 475 |
+
$w=$irp->Options->getRewriteBoxesWritten()-1;
|
| 476 |
+
$irp->Options->setRewriteBoxesWritten($w);
|
| 477 |
+
}
|
| 478 |
+
} elseif($args['all']) {
|
| 479 |
+
$array=array();
|
| 480 |
+
for($i=0; $i<count($this->buffer->array); $i++) {
|
| 481 |
+
$v=$this->buffer->array[$i];
|
| 482 |
+
if($v->isBufferBox()) {
|
| 483 |
+
$result=TRUE;
|
| 484 |
+
} else {
|
| 485 |
+
$array[]=$v;
|
| 486 |
+
}
|
| 487 |
+
}
|
| 488 |
+
$this->buffer->array=$array;
|
| 489 |
+
$this->lastBoxWords=0;
|
| 490 |
+
$irp->Options->setRewriteBoxesWritten(0);
|
| 491 |
+
}
|
| 492 |
+
return $result;
|
| 493 |
+
}
|
| 494 |
+
public function incCounters($text){
|
| 495 |
+
global $irp;
|
| 496 |
+
if($this->skipWordsCount) {
|
| 497 |
+
return;
|
| 498 |
+
}
|
| 499 |
+
|
| 500 |
+
$text=trim($text);
|
| 501 |
+
$words=explode(' ', $text);
|
| 502 |
+
$c=0;
|
| 503 |
+
foreach($words as $w) {
|
| 504 |
+
$w=trim($w);
|
| 505 |
+
if($w!='' && strlen($w)>1) {
|
| 506 |
+
$c++;
|
| 507 |
+
}
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
$this->currentWords+=$c;
|
| 511 |
+
$irp->Log->debug('TEXT=[%s] INCREMENT WORDS words[%s]/currentWords[%s]'
|
| 512 |
+
, $text, $c, $this->currentWords);
|
| 513 |
+
}
|
| 514 |
+
}
|
| 515 |
+
|
| 516 |
+
class IRP_BufferElement {
|
| 517 |
+
var $text;
|
| 518 |
+
public function __construct() {
|
| 519 |
+
$this->text='';
|
| 520 |
+
}
|
| 521 |
+
|
| 522 |
+
public function getText() {
|
| 523 |
+
return $this->text;
|
| 524 |
+
}
|
| 525 |
+
public function appendText($text) {
|
| 526 |
+
$this->text.=$text;
|
| 527 |
+
}
|
| 528 |
+
|
| 529 |
+
public function isBufferBox() {
|
| 530 |
+
return FALSE;
|
| 531 |
+
}
|
| 532 |
+
public function isBufferText() {
|
| 533 |
+
return FALSE;
|
| 534 |
+
}
|
| 535 |
+
}
|
| 536 |
+
class IRP_BufferText extends IRP_BufferElement {
|
| 537 |
+
public function __construct() {
|
| 538 |
+
parent::__construct();
|
| 539 |
+
}
|
| 540 |
+
|
| 541 |
+
public function isBufferBox() {
|
| 542 |
+
return FALSE;
|
| 543 |
+
}
|
| 544 |
+
public function isBufferText() {
|
| 545 |
+
return TRUE;
|
| 546 |
+
}
|
| 547 |
+
}
|
| 548 |
+
class IRP_BufferBox extends IRP_BufferElement {
|
| 549 |
+
var $currentBoxWords;
|
| 550 |
+
var $previousBoxWords;
|
| 551 |
+
|
| 552 |
+
public function __construct() {
|
| 553 |
+
parent::__construct();
|
| 554 |
+
$this->currentBoxWords=0;
|
| 555 |
+
$this->previousBoxWords=0;
|
| 556 |
+
}
|
| 557 |
+
|
| 558 |
+
public function isBufferBox() {
|
| 559 |
+
return TRUE;
|
| 560 |
+
}
|
| 561 |
+
public function isBufferText() {
|
| 562 |
+
return FALSE;
|
| 563 |
+
}
|
| 564 |
+
}
|
includes/classes/html/HTMLTag.php
ADDED
|
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_HTMLTag {
|
| 5 |
+
var $tags;
|
| 6 |
+
var $tag;
|
| 7 |
+
var $openTag;
|
| 8 |
+
var $closeTag;
|
| 9 |
+
|
| 10 |
+
public function __construct() {
|
| 11 |
+
$this->tags = array();
|
| 12 |
+
$this->tag='';
|
| 13 |
+
$this->openTag='';
|
| 14 |
+
$this->closeTag='';
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
public function hasTagContent() {
|
| 18 |
+
return TRUE;
|
| 19 |
+
}
|
| 20 |
+
public function pushTag(IRP_HTMLTag $child) {
|
| 21 |
+
if(count($this->tags)>0) {
|
| 22 |
+
//replace the TextContent tag that only contains \r\n with NewLineText
|
| 23 |
+
//due to now we use the substrln is impossible that we enter here
|
| 24 |
+
$last=$this->tags[count($this->tags)-1];
|
| 25 |
+
if(isset($last->body)) {
|
| 26 |
+
$newline=TRUE;
|
| 27 |
+
if($last->body=="\n" || $last->body=="\r\n") {
|
| 28 |
+
//we dont have to do nothing... sure this is a newlinetext!
|
| 29 |
+
} else {
|
| 30 |
+
for($i=0; $i<strlen($last->body); $i++) {
|
| 31 |
+
$c=substr($last->body, $i, 1);
|
| 32 |
+
if($c!="\n" && $c!="\n") {
|
| 33 |
+
$newline=FALSE;
|
| 34 |
+
break;
|
| 35 |
+
}
|
| 36 |
+
}
|
| 37 |
+
}
|
| 38 |
+
|
| 39 |
+
if($newline) {
|
| 40 |
+
$tag=new IRP_NewLineText();
|
| 41 |
+
$tag->body=$last->body;
|
| 42 |
+
$this->tags[count($this->tags)-1]=$tag;
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
}
|
| 46 |
+
$this->tags[] = $child;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
public function write(IRP_HTMLContext $context) {
|
| 50 |
+
$context->write($this->openTag);
|
| 51 |
+
foreach($this->tags as $tag) {
|
| 52 |
+
$tag->write($context);
|
| 53 |
+
}
|
| 54 |
+
$context->write($this->closeTag);
|
| 55 |
+
}
|
| 56 |
+
public function analyseText(IRP_HTMLContext $context) {
|
| 57 |
+
foreach ($this->tags as $tag) {
|
| 58 |
+
$tag->analyseText($context);
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
}
|
includes/classes/html/MainTag.php
ADDED
|
@@ -0,0 +1,27 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_MainTag extends IRP_HTMLTag {
|
| 5 |
+
public function __construct() {
|
| 6 |
+
parent::__construct();
|
| 7 |
+
}
|
| 8 |
+
|
| 9 |
+
public function write(IRP_HTMLContext $context) {
|
| 10 |
+
global $irp;
|
| 11 |
+
foreach ($this->tags as $tag) {
|
| 12 |
+
$tag->write($context);
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
//try to write the last box only if no boxes are written before
|
| 16 |
+
//this prevent from inserting at the end a box due to tipically
|
| 17 |
+
//marketer insert a CTA box (for instance download free book)
|
| 18 |
+
if($irp->Options->isRewriteAtEnd() && $irp->Options->getRewriteBoxesWritten()==0) {
|
| 19 |
+
$context->clearSkipNext();
|
| 20 |
+
$context->setUncuttable(FALSE);
|
| 21 |
+
$context->writeRelatedBox(TRUE);
|
| 22 |
+
} elseif(!$irp->Options->isRewriteAtEnd()) {
|
| 23 |
+
$args=array('last'=>TRUE);
|
| 24 |
+
$context->popRelatedBox($args);
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
}
|
includes/classes/html/NewLineText.php
ADDED
|
@@ -0,0 +1,18 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_NewLineText extends IRP_TextContent {
|
| 5 |
+
|
| 6 |
+
public function __construct() {
|
| 7 |
+
parent::__construct();
|
| 8 |
+
}
|
| 9 |
+
public function hasTagContent() {
|
| 10 |
+
return FALSE;
|
| 11 |
+
}
|
| 12 |
+
public function append($text) {
|
| 13 |
+
$this->body.=$text;
|
| 14 |
+
}
|
| 15 |
+
public function write(IRP_HTMLContext $context) {
|
| 16 |
+
$context->write($this->body);
|
| 17 |
+
}
|
| 18 |
+
}
|
includes/classes/html/OtherTag.php
ADDED
|
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_OtherTag extends IRP_HTMLTag {
|
| 5 |
+
public function __construct() {
|
| 6 |
+
parent::__construct();
|
| 7 |
+
}
|
| 8 |
+
|
| 9 |
+
public function write(IRP_HTMLContext $context) {
|
| 10 |
+
parent::write($context);
|
| 11 |
+
}
|
| 12 |
+
}
|
includes/classes/html/SingletonTag.php
ADDED
|
@@ -0,0 +1,15 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_SingletonTag extends IRP_HTMLTag {
|
| 5 |
+
public function __construct() {
|
| 6 |
+
parent::__construct();
|
| 7 |
+
}
|
| 8 |
+
|
| 9 |
+
public function hasTagContent() {
|
| 10 |
+
return FALSE;
|
| 11 |
+
}
|
| 12 |
+
public function write(IRP_HTMLContext $context) {
|
| 13 |
+
$context->write($this->openTag);
|
| 14 |
+
}
|
| 15 |
+
}
|
includes/classes/html/TextContent.php
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_TextContent extends IRP_HTMLTag {
|
| 5 |
+
var $body;
|
| 6 |
+
public function __construct() {
|
| 7 |
+
parent::__construct();
|
| 8 |
+
$this->body='';
|
| 9 |
+
}
|
| 10 |
+
|
| 11 |
+
public function hasTagContent() {
|
| 12 |
+
return FALSE;
|
| 13 |
+
}
|
| 14 |
+
public function append($text) {
|
| 15 |
+
$this->body.=$text;
|
| 16 |
+
}
|
| 17 |
+
public function write(IRP_HTMLContext $context) {
|
| 18 |
+
global $irp;
|
| 19 |
+
if($context->isUncuttable() || trim($this->body)=='') {
|
| 20 |
+
//we dont want to insert nothing inside iframe or table
|
| 21 |
+
$context->write($this->body);
|
| 22 |
+
$context->incCounters($this->body);
|
| 23 |
+
if(defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
| 24 |
+
$context->write(sprintf('<sup style="color:red;"> {%s/%s,%s}</sup>'
|
| 25 |
+
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
| 26 |
+
}
|
| 27 |
+
} else {
|
| 28 |
+
//here is all text so we have to decide when cut it
|
| 29 |
+
$text=explode("\n", $this->body);
|
| 30 |
+
for($i=0; $i<count($text); $i++) {
|
| 31 |
+
$line=$text[$i];
|
| 32 |
+
if(trim($line)=='') {
|
| 33 |
+
$context->writeRelatedBoxIfNeeded();
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
if($i<(count($text)-1)) {
|
| 37 |
+
$line.="\n";
|
| 38 |
+
}
|
| 39 |
+
$context->write($line);
|
| 40 |
+
$context->incCounters($line);
|
| 41 |
+
if(trim($line)!='') {
|
| 42 |
+
if (defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
| 43 |
+
$context->write(sprintf('<sup style="color:#008000"> {%s/%s,%s}</sup>'
|
| 44 |
+
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
| 45 |
+
}
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
}
|
| 49 |
+
}
|
| 50 |
+
public function analyseText(IRP_HTMLContext $context) {
|
| 51 |
+
$context->incCounters($this->body);
|
| 52 |
+
}
|
| 53 |
+
}
|
includes/classes/ui/Check.php
ADDED
|
@@ -0,0 +1,107 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 4 |
+
|
| 5 |
+
class IRP_Check {
|
| 6 |
+
var $data;
|
| 7 |
+
|
| 8 |
+
public function __construct() {
|
| 9 |
+
$this->data=array_merge($_POST, $_GET);
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
public function is($name, $value, $ignoreCase=TRUE) {
|
| 13 |
+
$result=FALSE;
|
| 14 |
+
if(isset($this->data[$name])) {
|
| 15 |
+
if($ignoreCase) {
|
| 16 |
+
$result=(strtolower($this->data[$name])==strtolower($value));
|
| 17 |
+
} else {
|
| 18 |
+
$result=($this->data[$name]==$value);
|
| 19 |
+
}
|
| 20 |
+
}
|
| 21 |
+
return $result;
|
| 22 |
+
}
|
| 23 |
+
public function of($name, $default='') {
|
| 24 |
+
$result=$default;
|
| 25 |
+
if(isset($this->data[$name])) {
|
| 26 |
+
$result=$this->data[$name];
|
| 27 |
+
}
|
| 28 |
+
return $result;
|
| 29 |
+
}
|
| 30 |
+
public function nonce($action, $nonce='_wpnonce') {
|
| 31 |
+
if(isset($_REQUEST[$nonce])) {
|
| 32 |
+
$nonce=$_REQUEST[$nonce];
|
| 33 |
+
}
|
| 34 |
+
return wp_verify_nonce($nonce, $action);
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
//check if is a mandatory field by checking the .txt language file
|
| 38 |
+
private function error($name) {
|
| 39 |
+
global $irp;
|
| 40 |
+
|
| 41 |
+
$result=FALSE;
|
| 42 |
+
$k=$irp->Form->prefix.'.'.$name.'.check';
|
| 43 |
+
$v=$irp->Lang->L($k);
|
| 44 |
+
if($v!=$k) {
|
| 45 |
+
//this is a mandatory field so we give error
|
| 46 |
+
$irp->Options->pushErrorMessage($v);
|
| 47 |
+
$result=TRUE;
|
| 48 |
+
}
|
| 49 |
+
return $result;
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
public function value($name) {
|
| 53 |
+
$result='';
|
| 54 |
+
if(isset($this->data[$name])) {
|
| 55 |
+
$result=sanitize_text_field($this->data[$name]);
|
| 56 |
+
}
|
| 57 |
+
if($result=='') {
|
| 58 |
+
$this->error($name);
|
| 59 |
+
}
|
| 60 |
+
$this->data[$name]=$result;
|
| 61 |
+
return $result;
|
| 62 |
+
}
|
| 63 |
+
public function values($name) {
|
| 64 |
+
$result=array();
|
| 65 |
+
if(is_string($name)) {
|
| 66 |
+
$name=explode(',', $name);
|
| 67 |
+
}
|
| 68 |
+
foreach($name as $v) {
|
| 69 |
+
$result[]=$this->value(trim($v));
|
| 70 |
+
}
|
| 71 |
+
return $result;
|
| 72 |
+
}
|
| 73 |
+
public function email($name) {
|
| 74 |
+
$result=$this->value($name);
|
| 75 |
+
if($result!='') {
|
| 76 |
+
$result=sanitize_email($result);
|
| 77 |
+
if(!is_email($result)) {
|
| 78 |
+
$this->error($name);
|
| 79 |
+
}
|
| 80 |
+
}
|
| 81 |
+
$this->data[$name]=$result;
|
| 82 |
+
return $result;
|
| 83 |
+
}
|
| 84 |
+
public function float($name) {
|
| 85 |
+
$result=$this->value($name);
|
| 86 |
+
if($result!='' && !is_float($result)) {
|
| 87 |
+
$this->error($name);
|
| 88 |
+
}
|
| 89 |
+
$result=floatval($result);
|
| 90 |
+
$this->data[$name]=$result;
|
| 91 |
+
return $result;
|
| 92 |
+
}
|
| 93 |
+
public function integer($name) {
|
| 94 |
+
$result=$this->value($name);
|
| 95 |
+
if($result!='' && !is_int($result)) {
|
| 96 |
+
$this->error($name);
|
| 97 |
+
}
|
| 98 |
+
$result=intval($result);
|
| 99 |
+
$this->data[$name]=$result;
|
| 100 |
+
return $result;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
public function hasErrors() {
|
| 104 |
+
global $irp;
|
| 105 |
+
return $irp->Options->hasErrorMessages();
|
| 106 |
+
}
|
| 107 |
+
}
|
includes/classes/ui/Form.php
ADDED
|
@@ -0,0 +1,455 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 4 |
+
|
| 5 |
+
class IRP_Form {
|
| 6 |
+
var $prefix='Form';
|
| 7 |
+
var $labels=TRUE;
|
| 8 |
+
var $leftLabels=TRUE;
|
| 9 |
+
var $newline;
|
| 10 |
+
var $helps=FALSE;
|
| 11 |
+
var $selectIdField='id';
|
| 12 |
+
|
| 13 |
+
var $tags=FALSE;
|
| 14 |
+
var $tagNew=FALSE;
|
| 15 |
+
var $leftTags=FALSE;
|
| 16 |
+
|
| 17 |
+
public function __construct() {
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
//args can be a string or an associative array if you want
|
| 21 |
+
private function getTextArgs($args, $defaults, $excludes=array()) {
|
| 22 |
+
$result=$args;
|
| 23 |
+
if(is_string($excludes)) {
|
| 24 |
+
$excludes=explode(',', $excludes);
|
| 25 |
+
}
|
| 26 |
+
if(is_array($result) && count($result)>0) {
|
| 27 |
+
$result='';
|
| 28 |
+
foreach($args as $k=>$v) {
|
| 29 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
| 30 |
+
$result.=' '.$k.'="'.$v.'"';
|
| 31 |
+
}
|
| 32 |
+
}
|
| 33 |
+
} elseif(!$args) {
|
| 34 |
+
$result='';
|
| 35 |
+
}
|
| 36 |
+
if(is_array($defaults) && count($defaults)>0) {
|
| 37 |
+
foreach($defaults as $k=>$v) {
|
| 38 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
| 39 |
+
if(stripos($result, $k.'=')===FALSE) {
|
| 40 |
+
$result.=' '.$k.'="'.$v.'"';
|
| 41 |
+
}
|
| 42 |
+
}
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
return $result;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
public function help($name) {
|
| 49 |
+
global $irp;
|
| 50 |
+
if(!$this->helps) return;
|
| 51 |
+
|
| 52 |
+
$k=$this->prefix.'.'.$name.'.Tooltip';
|
| 53 |
+
$label=$irp->Lang->L($k);
|
| 54 |
+
?>
|
| 55 |
+
<img src="<?php echo IRP_PLUGIN_IMAGES.'question-mark.png'?>" class="irp-help" id="<?php echo $name?>-help" alt="<?php echo esc_attr($label)?>" />
|
| 56 |
+
<?php
|
| 57 |
+
}
|
| 58 |
+
public function label($name, $args='') {
|
| 59 |
+
global $irp;
|
| 60 |
+
$defaults=array('class'=>'');
|
| 61 |
+
$otherText=$this->getTextArgs($args, $defaults, array('label', 'id'));
|
| 62 |
+
|
| 63 |
+
$k=$this->prefix.'.'.$name;
|
| 64 |
+
if(!is_array($args)) {
|
| 65 |
+
$args=array();
|
| 66 |
+
}
|
| 67 |
+
if(isset($args['label']) && $args['label']) {
|
| 68 |
+
$k=$args['label'];
|
| 69 |
+
}
|
| 70 |
+
$label=$irp->Lang->L($k);
|
| 71 |
+
$for=(isset($args['id']) ? $args['id'] : $name);
|
| 72 |
+
|
| 73 |
+
//check if is a mandatory field by checking the .txt language file
|
| 74 |
+
$k=$this->prefix.'.'.$name.'.check';
|
| 75 |
+
if($irp->Lang->H($k)) {
|
| 76 |
+
$label.=' (*)';
|
| 77 |
+
}
|
| 78 |
+
|
| 79 |
+
$aClass='';
|
| 80 |
+
?>
|
| 81 |
+
<label for="<?php echo $for?>" <?php echo $otherText?> >
|
| 82 |
+
<?php if($this->leftTags) {
|
| 83 |
+
$this->tag();
|
| 84 |
+
}?>
|
| 85 |
+
<span style="float:left; margin-right:5px;" class="<?php echo $aClass?>" id="<?PHP echo $for?>Label"><?php echo $label?></span>
|
| 86 |
+
<?php if(!$this->leftTags) {
|
| 87 |
+
$this->tag();
|
| 88 |
+
}?>
|
| 89 |
+
</label>
|
| 90 |
+
<?php }
|
| 91 |
+
|
| 92 |
+
public function leftInput($name, $args='') {
|
| 93 |
+
if(!$this->labels) return;
|
| 94 |
+
|
| 95 |
+
if($this->leftLabels) {
|
| 96 |
+
$this->help($name);
|
| 97 |
+
$this->label($name, $args);
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
if($this->newline) {
|
| 101 |
+
$this->newline();
|
| 102 |
+
}
|
| 103 |
+
}
|
| 104 |
+
|
| 105 |
+
public function newline() {
|
| 106 |
+
?><div class="irp-form-newline"></div><?php
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
public function rightInput($name, $args='') {
|
| 110 |
+
if(!$this->labels) return;
|
| 111 |
+
if (!$this->leftLabels) {
|
| 112 |
+
$this->label($name, $args);
|
| 113 |
+
}
|
| 114 |
+
$this->newline();
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
public function formStarts($method='post', $action='', $args=NULL) {
|
| 118 |
+
//$defaults=array('style'=>'margin:1em 0; padding:1px 1em; background:#fff; border:1px solid #ccc;'
|
| 119 |
+
$defaults=array('class'=>'irp-form');
|
| 120 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 121 |
+
?>
|
| 122 |
+
<form method="<?php echo $method?>" action="<?php echo $action?>" <?php echo $other?> >
|
| 123 |
+
<?php }
|
| 124 |
+
|
| 125 |
+
public function formEnds() { ?>
|
| 126 |
+
</form>
|
| 127 |
+
<div style="clear:both;"></div>
|
| 128 |
+
<?php }
|
| 129 |
+
|
| 130 |
+
public function divStarts($args=array()) {
|
| 131 |
+
$defaults=array();
|
| 132 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 133 |
+
?>
|
| 134 |
+
<div <?php echo $other?>>
|
| 135 |
+
<?php }
|
| 136 |
+
public function divEnds() { ?>
|
| 137 |
+
</div>
|
| 138 |
+
<div style="clear:both;"></div>
|
| 139 |
+
<?php }
|
| 140 |
+
|
| 141 |
+
public function p($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 142 |
+
global $irp;
|
| 143 |
+
?>
|
| 144 |
+
<p style="font-weight:bold;">
|
| 145 |
+
<?php
|
| 146 |
+
$irp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);
|
| 147 |
+
if($irp->Lang->H($message.'Subtitle')) { ?>
|
| 148 |
+
<br/>
|
| 149 |
+
<span style="font-weight:normal;">
|
| 150 |
+
<i><?php $irp->Lang->P($message.'Subtitle', $v1, $v2, $v3, $v4, $v5)?></i>
|
| 151 |
+
</span>
|
| 152 |
+
<?php } ?>
|
| 153 |
+
</p>
|
| 154 |
+
<?php }
|
| 155 |
+
|
| 156 |
+
public function textarea($name, $value='', $args=NULL) {
|
| 157 |
+
if(is_array($value) && isset($value[$name])) {
|
| 158 |
+
$value=$value[$name];
|
| 159 |
+
}
|
| 160 |
+
$defaults=array('rows'=>10, 'class'=>'irp-textarea');
|
| 161 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 162 |
+
|
| 163 |
+
$args=array('class'=>'irp-label', 'style'=>'width:auto;');
|
| 164 |
+
$this->newline=TRUE;
|
| 165 |
+
$this->leftInput($name, $args);
|
| 166 |
+
?>
|
| 167 |
+
<textarea dir="ltr" dirname="ltr" id="<?php echo $name ?>" name="<?php echo $name?>" <?php echo $other?> ><?php echo $value ?></textarea>
|
| 168 |
+
<?php
|
| 169 |
+
$this->newline=FALSE;
|
| 170 |
+
$this->rightInput($name, $args);
|
| 171 |
+
}
|
| 172 |
+
|
| 173 |
+
public function number($name, $value='', $options=NULL) {
|
| 174 |
+
if(!$options) {
|
| 175 |
+
$options=array();
|
| 176 |
+
}
|
| 177 |
+
$options['type']='number';
|
| 178 |
+
$options['autocomplete']='off';
|
| 179 |
+
$options['style']='width:100px;';
|
| 180 |
+
if(!isset($options['min'])) {
|
| 181 |
+
$options['min']=0;
|
| 182 |
+
}
|
| 183 |
+
//if(!isset($options['step'])) {
|
| 184 |
+
// $options['step']=1;
|
| 185 |
+
//}
|
| 186 |
+
return $this->text($name, $value, $options);
|
| 187 |
+
}
|
| 188 |
+
public function text($name, $value='', $options=NULL) {
|
| 189 |
+
if(is_array($value) && isset($value[$name])) {
|
| 190 |
+
$value=$value[$name];
|
| 191 |
+
}
|
| 192 |
+
$type='text';
|
| 193 |
+
if(isset($options['type'])) {
|
| 194 |
+
$type=$options['type'];
|
| 195 |
+
}
|
| 196 |
+
$defaults=array('class'=>'irp-'.$type);
|
| 197 |
+
$other=$this->getTextArgs($options, $defaults, 'type');
|
| 198 |
+
|
| 199 |
+
$args=array('class'=>'irp-label');
|
| 200 |
+
$this->leftInput($name, $args);
|
| 201 |
+
?>
|
| 202 |
+
<input type="<?php echo $type?>" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
| 203 |
+
<?php
|
| 204 |
+
$this->rightInput($name, $args);
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
public function hidden($name, $value='', $args=NULL) {
|
| 208 |
+
if(is_array($value) && isset($value[$name])) {
|
| 209 |
+
$value=$value[$name];
|
| 210 |
+
}
|
| 211 |
+
$defaults=array();
|
| 212 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 213 |
+
?>
|
| 214 |
+
<input type="hidden" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
| 215 |
+
<?php }
|
| 216 |
+
|
| 217 |
+
public function nonce($action=-1, $name='_wpnonce', $referer=true, $echo=true) {
|
| 218 |
+
wp_nonce_field($action, $name, $referer, $echo);
|
| 219 |
+
}
|
| 220 |
+
|
| 221 |
+
public function colorSelect($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
| 222 |
+
$array=array();
|
| 223 |
+
foreach($options as $k=>$v) {
|
| 224 |
+
$color=(isset($v['color']) ? $v['color'] : '');
|
| 225 |
+
$fontColor=(isset($v['fontColor']) ? $v['fontColor'] : 'white');
|
| 226 |
+
$style='';
|
| 227 |
+
if($color!='') {
|
| 228 |
+
if($style!='') {
|
| 229 |
+
$style.='; ';
|
| 230 |
+
}
|
| 231 |
+
$style.='background-color:'.$color;
|
| 232 |
+
}
|
| 233 |
+
if($fontColor!='') {
|
| 234 |
+
if($style!='') {
|
| 235 |
+
$style.='; ';
|
| 236 |
+
}
|
| 237 |
+
$style.='color:'.$fontColor.'; font-weight:bold';
|
| 238 |
+
}
|
| 239 |
+
$v['id']=$color;
|
| 240 |
+
$v['name']=$k;
|
| 241 |
+
$v['style']=$style;
|
| 242 |
+
$array[]=$v;
|
| 243 |
+
}
|
| 244 |
+
if($args) {
|
| 245 |
+
$args=array();
|
| 246 |
+
}
|
| 247 |
+
$args['class']='irpColorSelect';
|
| 248 |
+
return $this->select($name, $value, $array, $multiple, $args);
|
| 249 |
+
}
|
| 250 |
+
public function select($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
| 251 |
+
global $irp;
|
| 252 |
+
if(is_array($value) && isset($value[$name])) {
|
| 253 |
+
$value=$value[$name];
|
| 254 |
+
}
|
| 255 |
+
$defaults=array('class'=>'irp-select');
|
| 256 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 257 |
+
|
| 258 |
+
if(!is_array($value)) {
|
| 259 |
+
$value=array($value);
|
| 260 |
+
}
|
| 261 |
+
if(is_string($options)) {
|
| 262 |
+
$options=explode(',', $options);
|
| 263 |
+
}
|
| 264 |
+
if(is_array($options) && count($options)>0) {
|
| 265 |
+
if(is_string($options[0]) || !isset($options[0][$this->selectIdField])) {
|
| 266 |
+
//this is a normal array so I use the values for "id" field and the "name" into the txt file
|
| 267 |
+
$temp=array();
|
| 268 |
+
foreach($options as $v) {
|
| 269 |
+
$item=array();
|
| 270 |
+
$item[$this->selectIdField]=$v;
|
| 271 |
+
$item['name']=$v;
|
| 272 |
+
if($irp->Lang->H($this->prefix.'.'.$name.'.'.$v)) {
|
| 273 |
+
$item['name']=$irp->Lang->L($this->prefix.'.'.$name.'.'.$v);
|
| 274 |
+
}
|
| 275 |
+
$temp[]=$item;
|
| 276 |
+
}
|
| 277 |
+
$options=$temp;
|
| 278 |
+
}
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
$args=array('class'=>'irp-label');
|
| 282 |
+
$this->leftInput($name, $args);
|
| 283 |
+
?>
|
| 284 |
+
<select id="<?php echo $name ?>" name="<?php echo $name?><?php echo ($multiple ? '[]' : '')?>" <?php echo ($multiple ? 'multiple' : '')?> <?php echo $other?> >
|
| 285 |
+
<?php
|
| 286 |
+
foreach($options as $v) {
|
| 287 |
+
$style='';
|
| 288 |
+
if(isset($v['style'])) {
|
| 289 |
+
$style=$v['style'];
|
| 290 |
+
}
|
| 291 |
+
|
| 292 |
+
$selected='';
|
| 293 |
+
if(in_array($v[$this->selectIdField], $value)) {
|
| 294 |
+
$selected=' selected="selected"';
|
| 295 |
+
}
|
| 296 |
+
?>
|
| 297 |
+
<option value="<?php echo $v[$this->selectIdField]?>" <?php echo $selected?> style="<?php echo $style?>"><?php echo $v['name']?></option>
|
| 298 |
+
<?php } ?>
|
| 299 |
+
</select>
|
| 300 |
+
<?php
|
| 301 |
+
$this->rightInput($name, $args);
|
| 302 |
+
}
|
| 303 |
+
|
| 304 |
+
public function submit($value='', $args=NULL) {
|
| 305 |
+
global $irp;
|
| 306 |
+
$defaults=array();
|
| 307 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 308 |
+
if($value=='') {
|
| 309 |
+
$value='Send';
|
| 310 |
+
}
|
| 311 |
+
$this->newline();
|
| 312 |
+
?>
|
| 313 |
+
<input type="submit" class="button-primary irp-button irp-submit" value="<?php $irp->Lang->P($value)?>" <?php echo $other?>/>
|
| 314 |
+
<?php }
|
| 315 |
+
|
| 316 |
+
public function delete($id, $action='delete', $args=NULL) {
|
| 317 |
+
global $irp;
|
| 318 |
+
$defaults=array();
|
| 319 |
+
$other=$this->getTextArgs($args, $defaults);
|
| 320 |
+
?>
|
| 321 |
+
<input type="button" class="button irp-button" value="<?php $irp->Lang->P('Delete?')?>" onclick="if (confirm('<?php $irp->Lang->P('Are you sure you want to delete?')?>') ) window.location='<?php echo IRP_TAB_BUILDER_URI?>&action=<?php echo $action?>&id=<?php echo $id ?>&irp_nonce=<?php echo esc_attr(wp_create_nonce('irp_delete')); ?>';" <?php echo $other?> />
|
| 322 |
+
|
| 323 |
+
<?php
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
public function radio($name, $current=1, $value=1, $args=NULL) {
|
| 327 |
+
if(!is_array($args)) {
|
| 328 |
+
$args=array();
|
| 329 |
+
}
|
| 330 |
+
$args['radio']=TRUE;
|
| 331 |
+
$args['id']=$name.'_'.$value;
|
| 332 |
+
return $this->checkbox($name, $current, $value, $args);
|
| 333 |
+
}
|
| 334 |
+
public function checkbox($name, $current=1, $value=1, $args=NULL) {
|
| 335 |
+
global $irp;
|
| 336 |
+
if(is_array($current) && isset($current[$name])) {
|
| 337 |
+
$current=$current[$name];
|
| 338 |
+
}
|
| 339 |
+
|
| 340 |
+
/*
|
| 341 |
+
$defaults=array('class'=>'irp-checkbox', 'style'=>'margin:0px; margin-right:4px;');
|
| 342 |
+
if($this->premium && !$irp->License->hasPremium()) {
|
| 343 |
+
$defaults['disabled']='disabled';
|
| 344 |
+
$value='';
|
| 345 |
+
}
|
| 346 |
+
*/
|
| 347 |
+
if(!is_array($args)) {
|
| 348 |
+
$args=array();
|
| 349 |
+
}
|
| 350 |
+
|
| 351 |
+
$label=$name;
|
| 352 |
+
$type='checkbox';
|
| 353 |
+
if(isset($args['radio']) && $args['radio']) {
|
| 354 |
+
$type='radio';
|
| 355 |
+
$label.='_'.$value;
|
| 356 |
+
}
|
| 357 |
+
|
| 358 |
+
$defaults=array(
|
| 359 |
+
'class'=>'irp-checkbox'
|
| 360 |
+
, 'style'=>'margin:0px; margin-right:4px;'
|
| 361 |
+
, 'id'=>$name
|
| 362 |
+
);
|
| 363 |
+
$other=$this->getTextArgs($args, $defaults, 'radio,label,type');
|
| 364 |
+
$prev=$this->leftLabels;
|
| 365 |
+
$this->leftLabels=FALSE;
|
| 366 |
+
|
| 367 |
+
$label=(isset($args['label']) ? $args['label'] : $this->prefix.'.'.$label);
|
| 368 |
+
$id=(isset($args['id']) ? $args['id'] : $name);
|
| 369 |
+
$args=array(
|
| 370 |
+
'class'=>''
|
| 371 |
+
, 'style'=>'margin-top:-1px;'
|
| 372 |
+
, 'label'=>$label
|
| 373 |
+
, 'id'=>$id
|
| 374 |
+
);
|
| 375 |
+
$this->leftInput($name, $args);
|
| 376 |
+
?>
|
| 377 |
+
<input type="<?php echo $type ?>" name="<?php echo $name?>" value="<?php echo $value?>" <?php echo($current==$value ? 'checked="checked"' : '') ?> <?php echo $other?> >
|
| 378 |
+
<?php
|
| 379 |
+
$this->rightInput($name, $args);
|
| 380 |
+
$this->leftLabels=$prev;
|
| 381 |
+
}
|
| 382 |
+
|
| 383 |
+
public function checkText($nameActive, $nameText, $value) {
|
| 384 |
+
global $irp;
|
| 385 |
+
|
| 386 |
+
$args=array('class'=>'irp-hideShow irp-checkbox'
|
| 387 |
+
, 'irp-hideIfTrue'=>'false'
|
| 388 |
+
, 'irp-hideShow'=>$nameText.'Text');
|
| 389 |
+
$this->checkbox($nameActive, $value, 1, $args);
|
| 390 |
+
?>
|
| 391 |
+
<div id="<?php echo $nameText?>Text" style="float:left;">
|
| 392 |
+
<?php
|
| 393 |
+
$prev=$this->labels;
|
| 394 |
+
$this->labels=FALSE;
|
| 395 |
+
$args=array();
|
| 396 |
+
$this->text($nameText, $value, $args);
|
| 397 |
+
$this->labels=$prev;
|
| 398 |
+
?>
|
| 399 |
+
</div>
|
| 400 |
+
<?php }
|
| 401 |
+
|
| 402 |
+
//create a checkbox with a left select visible only when the checkbox is selected
|
| 403 |
+
public function checkSelect($nameActive, $nameArray, $value, $values) {
|
| 404 |
+
global $irp;
|
| 405 |
+
?>
|
| 406 |
+
<div id="<?php echo $nameArray?>Box" style="float:left;">
|
| 407 |
+
<?php
|
| 408 |
+
$args=array('class'=>'irp-hideShow irp-checkbox'
|
| 409 |
+
, 'irp-hideIfTrue'=>'false'
|
| 410 |
+
, 'irp-hideShow'=>$nameArray.'Tags');
|
| 411 |
+
$this->checkbox($nameActive, $value, 1, $args);
|
| 412 |
+
if(TRUE) { ?>
|
| 413 |
+
<div id="<?php echo $nameArray?>Tags" style="float:left;">
|
| 414 |
+
<?php
|
| 415 |
+
$prev=$this->labels;
|
| 416 |
+
$this->labels=FALSE;
|
| 417 |
+
$args=array('class'=>'irp-select irpLineTags');
|
| 418 |
+
$this->select($nameArray, $value, $values, TRUE, $args);
|
| 419 |
+
$this->labels=$prev;
|
| 420 |
+
?>
|
| 421 |
+
</div>
|
| 422 |
+
<?php } ?>
|
| 423 |
+
</div>
|
| 424 |
+
<?php
|
| 425 |
+
$this->newline();
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
public function br() { ?>
|
| 429 |
+
<br/>
|
| 430 |
+
<?php }
|
| 431 |
+
public function tag($overridePremium=FALSE) {
|
| 432 |
+
global $irp;
|
| 433 |
+
/*
|
| 434 |
+
$premium=($overridePremium || $this->premium);
|
| 435 |
+
if((!$overridePremium && !$this->tags) || $irp->License->hasPremium() || ($this->onlyPremium && !$premium)) return;
|
| 436 |
+
|
| 437 |
+
$tagClass='irp-tag-free';
|
| 438 |
+
$tagText='FREE';
|
| 439 |
+
if($premium) {
|
| 440 |
+
$tagClass='irp-tag-premium';
|
| 441 |
+
$tagText='<a href="'.irp_PAGE_PREMIUM.'" target="_new">PRO</a>';
|
| 442 |
+
}
|
| 443 |
+
*/
|
| 444 |
+
|
| 445 |
+
if(!$this->tags || !$this->tagNew) {
|
| 446 |
+
return;
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
$tagClass='irp-tag-free';
|
| 450 |
+
$tagText='NEW!';
|
| 451 |
+
?>
|
| 452 |
+
<div style="float:left;" class="irp-tag <?php echo $tagClass?>"><?php echo $tagText?></div>
|
| 453 |
+
<?php
|
| 454 |
+
}
|
| 455 |
+
}
|
includes/classes/ui/Tabs.php
ADDED
|
@@ -0,0 +1,185 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
class IRP_Tabs {
|
| 3 |
+
private $tabs = array();
|
| 4 |
+
|
| 5 |
+
function init() {
|
| 6 |
+
global $irp;
|
| 7 |
+
if($irp->Utils->isAdminUser()) {
|
| 8 |
+
add_action('admin_menu', array(&$this, 'attachMenu'));
|
| 9 |
+
add_filter('plugin_action_links', array(&$this, 'pluginActions'), 10, 2);
|
| 10 |
+
if($irp->Utils->isPluginPage()) {
|
| 11 |
+
add_action('admin_enqueue_scripts', array(&$this, 'enqueueScripts'));
|
| 12 |
+
}
|
| 13 |
+
}
|
| 14 |
+
}
|
| 15 |
+
|
| 16 |
+
function attachMenu() {
|
| 17 |
+
global $irp;
|
| 18 |
+
|
| 19 |
+
if(!$irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 20 |
+
$name='Inline Related Posts';
|
| 21 |
+
add_submenu_page('options-general.php'
|
| 22 |
+
, $name, $name
|
| 23 |
+
, 'manage_options', IRP_PLUGIN_SLUG, array(&$this, 'showTabPage'));
|
| 24 |
+
}
|
| 25 |
+
}
|
| 26 |
+
function pluginActions($links, $file) {
|
| 27 |
+
global $irp;
|
| 28 |
+
if($file==IRP_PLUGIN_SLUG.'/index.php'){
|
| 29 |
+
$settings = "<a href='".IRP_PAGE_SETTINGS."'>" . $irp->Lang->L('Settings') . '</a> ';
|
| 30 |
+
$url=IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG.'?utm_source=free-users&utm_medium=irp-plugins&utm_campaign=IRP';
|
| 31 |
+
$premium = "<a href='".$url."' target='_blank'>" . $irp->Lang->L('PREMIUM') . '</a> ';
|
| 32 |
+
$links = array_merge(array($settings, $premium), $links);
|
| 33 |
+
}
|
| 34 |
+
return $links;
|
| 35 |
+
}
|
| 36 |
+
function enqueueScripts() {
|
| 37 |
+
global $irp;
|
| 38 |
+
wp_enqueue_script('jquery');
|
| 39 |
+
wp_enqueue_script('suggest');
|
| 40 |
+
wp_enqueue_script('jquery-ui-autocomplete');
|
| 41 |
+
|
| 42 |
+
$uri='//maxcdn.bootstrapcdn.com/font-awesome/4.4.0/css/font-awesome.min.css';
|
| 43 |
+
wp_enqueue_style('font-awesome', $uri);
|
| 44 |
+
|
| 45 |
+
$this->wpEnqueueStyle('assets/css/style.css');
|
| 46 |
+
$this->wpEnqueueStyle('assets/deps/select2-3.5.2/select2.css');
|
| 47 |
+
$this->wpEnqueueScript('assets/deps/select2-3.5.2/select2.min.js');
|
| 48 |
+
$this->wpEnqueueScript('assets/deps/starrr/starrr.js');
|
| 49 |
+
|
| 50 |
+
$this->wpEnqueueScript('assets/deps/qtip/jquery.qtip.min.js');
|
| 51 |
+
$this->wpEnqueueScript('assets/js/common.js');
|
| 52 |
+
}
|
| 53 |
+
function wpEnqueueStyle($uri, $name='') {
|
| 54 |
+
if($name=='') {
|
| 55 |
+
$name=explode('/', $uri);
|
| 56 |
+
$name=$name[count($name)-1];
|
| 57 |
+
$dot=strrpos($name, '.');
|
| 58 |
+
if($dot!==FALSE) {
|
| 59 |
+
$name=substr($name, 0, $dot);
|
| 60 |
+
}
|
| 61 |
+
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
$v='?v='.IRP_PLUGIN_VERSION;
|
| 65 |
+
wp_enqueue_style($name, IRP_PLUGIN_URI.$uri.$v);
|
| 66 |
+
}
|
| 67 |
+
function wpEnqueueScript($uri, $name='', $version=FALSE) {
|
| 68 |
+
if($name=='') {
|
| 69 |
+
$name=explode('/', $uri);
|
| 70 |
+
$name=$name[count($name)-1];
|
| 71 |
+
$dot=strrpos($name, '.');
|
| 72 |
+
if($dot!==FALSE) {
|
| 73 |
+
$name=substr($name, 0, $dot);
|
| 74 |
+
}
|
| 75 |
+
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
| 76 |
+
}
|
| 77 |
+
|
| 78 |
+
$v='?v='.IRP_PLUGIN_VERSION;
|
| 79 |
+
$deps=array();
|
| 80 |
+
wp_enqueue_script($name, IRP_PLUGIN_URI.$uri.$v, $deps, $version, FALSE);
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
function showTabPage() {
|
| 84 |
+
global $irp;
|
| 85 |
+
|
| 86 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 87 |
+
$irp->Options->pushWarningMessage('YouHaveThePremiumVersion', IRP_TAB_SETTINGS_URI);
|
| 88 |
+
$irp->Options->writeMessages();
|
| 89 |
+
return;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
$defaultTab=IRP_TAB_SETTINGS;
|
| 93 |
+
if($irp->Options->isShowWhatsNew()) {
|
| 94 |
+
$tab=IRP_TAB_WHATS_NEW;
|
| 95 |
+
$defaultTab=$tab;
|
| 96 |
+
$this->tabs[IRP_TAB_WHATS_NEW]=$irp->Lang->L('What\'s New');
|
| 97 |
+
} else {
|
| 98 |
+
$tab = $irp->Utils->qs('tab', $defaultTab);
|
| 99 |
+
$this->tabs[IRP_TAB_SETTINGS] = $irp->Lang->L('Settings');
|
| 100 |
+
$this->tabs[IRP_TAB_DOCS] = $irp->Lang->L('FAQ & Docs');
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
?>
|
| 104 |
+
<div class="wrap" style="margin:5px;">
|
| 105 |
+
<?php
|
| 106 |
+
$this->showTabs($defaultTab);
|
| 107 |
+
$header='';
|
| 108 |
+
switch ($tab) {
|
| 109 |
+
case IRP_TAB_SETTINGS:
|
| 110 |
+
$header='Settings';
|
| 111 |
+
break;
|
| 112 |
+
case IRP_TAB_WHATS_NEW:
|
| 113 |
+
$header='';
|
| 114 |
+
break;
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
if($irp->Lang->H($header.'Title')) { ?>
|
| 118 |
+
<h2><?php $irp->Lang->P($header . 'Title', IRP_PLUGIN_VERSION) ?></h2>
|
| 119 |
+
<?php if ($irp->Lang->H($header . 'Subtitle')) { ?>
|
| 120 |
+
<div><?php $irp->Lang->P($header . 'Subtitle') ?></div>
|
| 121 |
+
<?php } ?>
|
| 122 |
+
<div style="clear:both;"></div>
|
| 123 |
+
<?php }
|
| 124 |
+
|
| 125 |
+
if($tab!=IRP_TAB_WHATS_NEW) {
|
| 126 |
+
irp_ui_first_time();
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
switch ($tab) {
|
| 130 |
+
case IRP_TAB_SETTINGS:
|
| 131 |
+
irp_ui_settings();
|
| 132 |
+
break;
|
| 133 |
+
case IRP_TAB_WHATS_NEW:
|
| 134 |
+
irp_ui_whats_new();
|
| 135 |
+
break;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
if($irp->Options->isShowWhatsNew()) {
|
| 139 |
+
$irp->Options->setShowWhatsNew(FALSE);
|
| 140 |
+
}
|
| 141 |
+
?>
|
| 142 |
+
</div>
|
| 143 |
+
<?php }
|
| 144 |
+
|
| 145 |
+
function showTabs($defaultTab) {
|
| 146 |
+
global $irp;
|
| 147 |
+
$tab=$irp->Check->of('tab', $defaultTab);
|
| 148 |
+
if($tab==IRP_TAB_DOCS) {
|
| 149 |
+
$irp->Utils->redirect(IRP_TAB_DOCS_URI);
|
| 150 |
+
}
|
| 151 |
+
|
| 152 |
+
?>
|
| 153 |
+
<h2 class="nav-tab-wrapper" style="float:left; width:97%;">
|
| 154 |
+
<?php
|
| 155 |
+
foreach ($this->tabs as $k=>$v) {
|
| 156 |
+
$active = ($tab==$k ? 'nav-tab-active' : '');
|
| 157 |
+
?>
|
| 158 |
+
<a style="float:left; margin-left:10px;" class="nav-tab <?php echo $active?>" href="?page=<?php echo IRP_PLUGIN_SLUG?>&tab=<?php echo $k?>"><?php echo $v?></a>
|
| 159 |
+
<?php
|
| 160 |
+
}
|
| 161 |
+
?>
|
| 162 |
+
<style>
|
| 163 |
+
.starrr {display:inline-block}
|
| 164 |
+
.starrr i{font-size:16px;padding:0 1px;cursor:pointer;color:#2ea2cc;}
|
| 165 |
+
</style>
|
| 166 |
+
<div style="float:right; display:none;" id="rate-box">
|
| 167 |
+
<span style="font-weight:700; font-size:13px; color:#555;"><?php $irp->Lang->P('Rate us')?></span>
|
| 168 |
+
<div id="irp-rate" class="starrr" data-connected-input="irp-rate-rank"></div>
|
| 169 |
+
<input type="hidden" id="irp-rate-rank" name="irp-rate-rank" value="5" />
|
| 170 |
+
<?php $irp->Utils->twitter('intellywp') ?>
|
| 171 |
+
</div>
|
| 172 |
+
<script>
|
| 173 |
+
jQuery(function() {
|
| 174 |
+
jQuery(".starrr").starrr();
|
| 175 |
+
jQuery('#irp-rate').on('starrr:change', function(e, value){
|
| 176 |
+
var url='https://wordpress.org/support/view/plugin-reviews/<?php echo IRP_PLUGIN_SLUG?>?rate=5#postform';
|
| 177 |
+
window.open(url);
|
| 178 |
+
});
|
| 179 |
+
jQuery('#rate-box').show();
|
| 180 |
+
});
|
| 181 |
+
</script>
|
| 182 |
+
</h2>
|
| 183 |
+
<div style="clear:both;"></div>
|
| 184 |
+
<?php }
|
| 185 |
+
}
|
includes/classes/utils/AppOptions.php
ADDED
|
@@ -0,0 +1,422 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
class IRP_AppOptions extends IRP_Options {
|
| 4 |
+
public function __construct() {
|
| 5 |
+
}
|
| 6 |
+
|
| 7 |
+
public function getMarginTop() {
|
| 8 |
+
return $this->getOption('MarginTop', '0em');
|
| 9 |
+
}
|
| 10 |
+
public function setMarginTop($value) {
|
| 11 |
+
$this->setOption('MarginTop', $value);
|
| 12 |
+
}
|
| 13 |
+
public function getMarginBottom() {
|
| 14 |
+
return $this->getOption('MarginBottom', '1em');
|
| 15 |
+
}
|
| 16 |
+
public function setMarginBottom($value) {
|
| 17 |
+
$this->setOption('MarginBottom', $value);
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
public function hasRelatedPostsIds() {
|
| 21 |
+
$array=$this->getRequest('RelatedPostsIds', array());
|
| 22 |
+
return (is_array($array) && count($array)>0);
|
| 23 |
+
}
|
| 24 |
+
public function initRelatedPostsIds($ids) {
|
| 25 |
+
$this->setRequest('RelatedPostsIds', $ids);
|
| 26 |
+
if($ids) {
|
| 27 |
+
shuffle($ids);
|
| 28 |
+
}
|
| 29 |
+
$this->setRequest('ToShowPostsIds', $ids);
|
| 30 |
+
$this->setRequest('ShownPostsIdsSequence', array());
|
| 31 |
+
$this->setRewriteBoxesWritten(0);
|
| 32 |
+
}
|
| 33 |
+
public function refreshRelatedPostsIds() {
|
| 34 |
+
$ids=$this->getRequest('RelatedPostsIds', array());
|
| 35 |
+
$this->initRelatedPostsIds($ids);
|
| 36 |
+
}
|
| 37 |
+
//if you pass maxIds as a number this function take next [maxIds] posts to show as related
|
| 38 |
+
//if you pass maxIds as an array of postsIds will return this array as posts to show as related
|
| 39 |
+
public function getToShowPostsIds($maxIds, $repeat=FALSE) {
|
| 40 |
+
$result=array();
|
| 41 |
+
$maxIds=intval($maxIds);
|
| 42 |
+
if(!$this->hasRelatedPostsIds()) {
|
| 43 |
+
return $result;
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
$toShow=$this->getRequest('ToShowPostsIds', array());
|
| 47 |
+
if(is_numeric($maxIds)) {
|
| 48 |
+
if(!is_array($toShow) || (count($toShow)==0 && !$repeat)) {
|
| 49 |
+
return $result;
|
| 50 |
+
}
|
| 51 |
+
while($maxIds>0) {
|
| 52 |
+
if(count($toShow)==0) {
|
| 53 |
+
if($repeat) {
|
| 54 |
+
//i can use again the posts shown
|
| 55 |
+
$toShow=$this->getRequest('RelatedPostsIds');
|
| 56 |
+
shuffle($toShow);
|
| 57 |
+
} else {
|
| 58 |
+
break;
|
| 59 |
+
}
|
| 60 |
+
}
|
| 61 |
+
|
| 62 |
+
$postId=array_pop($toShow);
|
| 63 |
+
$result[]=$postId;
|
| 64 |
+
--$maxIds;
|
| 65 |
+
}
|
| 66 |
+
} elseif(is_array($maxIds)) {
|
| 67 |
+
$toShow=array_diff($toShow, $maxIds);
|
| 68 |
+
$result=$maxIds;
|
| 69 |
+
}
|
| 70 |
+
$this->setRequest('ToShowPostsIds', $toShow);
|
| 71 |
+
|
| 72 |
+
//update the sequence shown
|
| 73 |
+
$array=$this->getRequest('ShownPostsIdsSequence', array());
|
| 74 |
+
$array[]=$result;
|
| 75 |
+
$this->setRequest('ShownPostsIdsSequence', $array);
|
| 76 |
+
|
| 77 |
+
return $result;
|
| 78 |
+
}
|
| 79 |
+
public function getShownPostsIdsSequence() {
|
| 80 |
+
return $this->getRequest('ShownPostsIdsSequence', array());
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
public function getPostShown() {
|
| 84 |
+
return $this->getRequest('PostShown', NULL);
|
| 85 |
+
}
|
| 86 |
+
public function setPostShown($value) {
|
| 87 |
+
$this->setRequest('PostShown', $value);
|
| 88 |
+
}
|
| 89 |
+
public function isPostShownExcluded() {
|
| 90 |
+
global $irp;
|
| 91 |
+
$array=$this->getExcludedPostsIds();
|
| 92 |
+
$post=$this->getPostShown();
|
| 93 |
+
|
| 94 |
+
$result=FALSE;
|
| 95 |
+
if(!$post || !isset($post->ID)) {
|
| 96 |
+
$result=TRUE;
|
| 97 |
+
} elseif(in_array($post->ID, $array)) {
|
| 98 |
+
$irp->Log->info('POST ID=%s IN RELATED POSTS EXCLUDE LIST', $post->ID);
|
| 99 |
+
$result=TRUE;
|
| 100 |
+
} else {
|
| 101 |
+
$result=FALSE;
|
| 102 |
+
}
|
| 103 |
+
return $result;
|
| 104 |
+
}
|
| 105 |
+
public function isShortcodeUsed() {
|
| 106 |
+
return $this->getRequest('ShortcodeUsed', 0);
|
| 107 |
+
}
|
| 108 |
+
public function setShortcodeUsed($value) {
|
| 109 |
+
$this->setRequest('ShortcodeUsed', $value);
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
public function getTemplateStyle() {
|
| 113 |
+
global $irp;
|
| 114 |
+
|
| 115 |
+
$defaults=array(
|
| 116 |
+
'template'=>''
|
| 117 |
+
, 'linkRel'=>$this->getOption('LinkRel', 'nofollow')
|
| 118 |
+
, 'linkTarget'=>$this->getOption('LinkTarget', '_blank')
|
| 119 |
+
, 'ctaText'=>$this->getOption('RelatedText', 'READ')
|
| 120 |
+
, 'ctaTextColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
| 121 |
+
, 'postTitleColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
| 122 |
+
, 'boxColor'=>$this->getOption('TemplateBackgroundColor', '')
|
| 123 |
+
, 'borderColor'=>$this->getOption('TemplateBorderColor', '')
|
| 124 |
+
, 'hasShadow'=>$this->getOption('TemplateShadow', FALSE)
|
| 125 |
+
, 'hasPoweredBy'=>$this->getOption('ShowPoweredBy', FALSE)
|
| 126 |
+
, 'boxOpacity'=>100
|
| 127 |
+
);
|
| 128 |
+
$result=$this->getOption('TemplateStyle', $defaults);
|
| 129 |
+
$names=$irp->HtmlTemplate->getTemplatesNames();
|
| 130 |
+
if($result['template']=='' || !in_array($result['template'], $names)) {
|
| 131 |
+
if(count($names)>0) {
|
| 132 |
+
$result['template']='Minimalist';//$names[0];
|
| 133 |
+
}
|
| 134 |
+
}
|
| 135 |
+
return $result;
|
| 136 |
+
}
|
| 137 |
+
public function setTemplateStyle($value) {
|
| 138 |
+
$this->setOption('TemplateStyle', $value);
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
//is related posts active in posts without any [irl] shortcodes defined
|
| 142 |
+
public function isRewriteActive() {
|
| 143 |
+
return $this->getOption('RewriteActive', 1);
|
| 144 |
+
}
|
| 145 |
+
public function setRewriteActive($value) {
|
| 146 |
+
$this->setOption('RewriteActive', $value);
|
| 147 |
+
}
|
| 148 |
+
public function getExcludedPostsIds() {
|
| 149 |
+
return $this->getOption('ExcludedPostsIds', array());
|
| 150 |
+
}
|
| 151 |
+
public function setExcludedPostsIds($value) {
|
| 152 |
+
$value=array_unique($value);
|
| 153 |
+
$this->setOption('ExcludedPostsIds', $value);
|
| 154 |
+
}
|
| 155 |
+
public function getMetaboxPostTypes($create=TRUE) {
|
| 156 |
+
global $irp;
|
| 157 |
+
$result=$this->getOption('MetaboxPostTypes', array());
|
| 158 |
+
if($create) {
|
| 159 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
| 160 |
+
foreach($types as $v) {
|
| 161 |
+
$v=$v['id'];
|
| 162 |
+
if(!isset($result[$v])) {
|
| 163 |
+
$result[$v]=($v=='post' ? 1 : 0);
|
| 164 |
+
}
|
| 165 |
+
}
|
| 166 |
+
}
|
| 167 |
+
return $result;
|
| 168 |
+
}
|
| 169 |
+
public function setMetaboxPostTypes($values) {
|
| 170 |
+
$this->setOption('MetaboxPostTypes', $values);
|
| 171 |
+
}
|
| 172 |
+
//is integrated with which post types?
|
| 173 |
+
public function getRewritePostTypes($create=TRUE) {
|
| 174 |
+
global $irp;
|
| 175 |
+
$result=$this->getOption('RewritePostTypes', array());
|
| 176 |
+
if($create) {
|
| 177 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
| 178 |
+
foreach($types as $v) {
|
| 179 |
+
$v=$v['id'];
|
| 180 |
+
if(!isset($result[$v])) {
|
| 181 |
+
$result[$v]=($v=='post' ? 1 : 0);
|
| 182 |
+
}
|
| 183 |
+
}
|
| 184 |
+
}
|
| 185 |
+
return $result;
|
| 186 |
+
}
|
| 187 |
+
public function setRewritePostTypes($values) {
|
| 188 |
+
$this->setOption('RewritePostTypes', $values);
|
| 189 |
+
}
|
| 190 |
+
//how many related posts boxes we have to include?
|
| 191 |
+
public function getRewriteBoxesCount() {
|
| 192 |
+
return intval($this->getOption('RewriteBoxesCount', 3));
|
| 193 |
+
}
|
| 194 |
+
public function setRewriteBoxesCount($value) {
|
| 195 |
+
$this->setOption('RewriteBoxesCount', $value);
|
| 196 |
+
}
|
| 197 |
+
//how many related posts we see in each box?
|
| 198 |
+
public function getRewritePostsInBoxCount() {
|
| 199 |
+
//return $this->getOption('RewritePostsInBoxCount', 1);
|
| 200 |
+
return 1;
|
| 201 |
+
}
|
| 202 |
+
public function setRewritePostsInBoxCount($value) {
|
| 203 |
+
$this->setOption('RewritePostsInBoxCount', $value);
|
| 204 |
+
}
|
| 205 |
+
public function getRewritePostsDays() {
|
| 206 |
+
return intval($this->getOption('RewritePostsDays', 0));
|
| 207 |
+
}
|
| 208 |
+
public function setRewritePostsDays($value) {
|
| 209 |
+
$this->setOption('RewritePostsDays', intval($value));
|
| 210 |
+
}
|
| 211 |
+
//how many words we have to "wait" before inserting a related box
|
| 212 |
+
public function getRewriteThreshold() {
|
| 213 |
+
return $this->getOption('RewriteThreshold', 250);
|
| 214 |
+
}
|
| 215 |
+
public function setRewriteThreshold($value) {
|
| 216 |
+
$this->setOption('RewriteThreshold', $value);
|
| 217 |
+
}
|
| 218 |
+
//include also a related box in the end?
|
| 219 |
+
public function isRewriteAtEnd() {
|
| 220 |
+
return $this->getOption('RewriteAtEnd', TRUE);
|
| 221 |
+
}
|
| 222 |
+
public function setRewriteAtEnd($value) {
|
| 223 |
+
$this->setOption('RewriteAtEnd', $value);
|
| 224 |
+
}
|
| 225 |
+
//how many boxes are already been written?
|
| 226 |
+
public function getRewriteBoxesWritten() {
|
| 227 |
+
return $this->getRequest('RewriteBoxesWritten', 0);
|
| 228 |
+
}
|
| 229 |
+
public function setRewriteBoxesWritten($value) {
|
| 230 |
+
$this->setRequest('RewriteBoxesWritten', $value);
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
public function getEngineSearch() {
|
| 234 |
+
return $this->getOption('EngineSearch', IRP_ENGINE_SEARCH_CATEGORIES_TAGS);
|
| 235 |
+
}
|
| 236 |
+
public function setEngineSearch($value) {
|
| 237 |
+
$this->setOption('EngineSearch', $value);
|
| 238 |
+
}
|
| 239 |
+
|
| 240 |
+
public function getMaxExecutionTime(){
|
| 241 |
+
return $this->getOption('MaxExecutionTime', -1);
|
| 242 |
+
}
|
| 243 |
+
public function resetMaxExecutionTime(){
|
| 244 |
+
$this->setOption('MaxExecutionTime', -1);
|
| 245 |
+
}
|
| 246 |
+
public function updateMaxExecutionTime($value){
|
| 247 |
+
$now=$this->getMaxExecutionTime();
|
| 248 |
+
if($value>$now) {
|
| 249 |
+
$this->setOption('MaxExecutionTime', $value);
|
| 250 |
+
}
|
| 251 |
+
}
|
| 252 |
+
|
| 253 |
+
public function pushCssStyle($code) {
|
| 254 |
+
global $irp;
|
| 255 |
+
if(is_array($code)) {
|
| 256 |
+
$code=implode("\n", $code);
|
| 257 |
+
}
|
| 258 |
+
$code=str_replace('<style>', '', $code);
|
| 259 |
+
$code=str_replace('</style>', '', $code);
|
| 260 |
+
$code=$irp->Utils->trimCode($code);
|
| 261 |
+
|
| 262 |
+
$array=$this->getCssStyles();
|
| 263 |
+
$exists=FALSE;
|
| 264 |
+
if(count($array)>0) {
|
| 265 |
+
foreach($array as $v) {
|
| 266 |
+
if(trim($v)==trim($code)) {
|
| 267 |
+
$exists=TRUE;
|
| 268 |
+
break;
|
| 269 |
+
}
|
| 270 |
+
}
|
| 271 |
+
}
|
| 272 |
+
if(!$exists) {
|
| 273 |
+
$array[]=$code;
|
| 274 |
+
$this->setRequest('CssStyles', $array);
|
| 275 |
+
}
|
| 276 |
+
}
|
| 277 |
+
public function getCssStyles() {
|
| 278 |
+
return $this->getRequest('CssStyles', array());
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
public function getColor($color) {
|
| 282 |
+
global $irp;
|
| 283 |
+
$result=$color;
|
| 284 |
+
if(!$irp->Utils->startsWith($color, '#')) {
|
| 285 |
+
$colors=$this->getLegacyColors();
|
| 286 |
+
$v=$irp->Utils->geti($colors, $color, FALSE);
|
| 287 |
+
if($v!==FALSE) {
|
| 288 |
+
$result=$v['color'];
|
| 289 |
+
} else {
|
| 290 |
+
$colors=$this->getColors();
|
| 291 |
+
$v=$irp->Utils->geti($colors, $color, FALSE);
|
| 292 |
+
if($v!==FALSE) {
|
| 293 |
+
$result=$v['color'];
|
| 294 |
+
}
|
| 295 |
+
}
|
| 296 |
+
}
|
| 297 |
+
return $result;
|
| 298 |
+
}
|
| 299 |
+
public function getHoverColor($color) {
|
| 300 |
+
$color=$this->getColor($color);
|
| 301 |
+
$colors=$this->getLightDarkColors();
|
| 302 |
+
$result='';
|
| 303 |
+
foreach($colors as $k=>$v) {
|
| 304 |
+
if($v['light']==$color) {
|
| 305 |
+
$result=$v['dark'];
|
| 306 |
+
break;
|
| 307 |
+
} elseif($v['dark']==$color) {
|
| 308 |
+
$result=$v['light'];
|
| 309 |
+
break;
|
| 310 |
+
}
|
| 311 |
+
}
|
| 312 |
+
return $result;
|
| 313 |
+
}
|
| 314 |
+
public function getColors($blank='') {
|
| 315 |
+
$array=$this->getLightDarkColors();
|
| 316 |
+
$result=array();
|
| 317 |
+
if($blank!='') {
|
| 318 |
+
$result[$blank]=array('color'=>'', 'fontColor'=>'#464646');
|
| 319 |
+
}
|
| 320 |
+
foreach($array as $k=>$v) {
|
| 321 |
+
if(isset($v['color'])) {
|
| 322 |
+
$a=array();
|
| 323 |
+
$a['color']=$v['color'];
|
| 324 |
+
if(isset($v['fontColor'])) {
|
| 325 |
+
$a['fontColor']=$v['fontColor'];
|
| 326 |
+
}
|
| 327 |
+
$result[$k]=$a;
|
| 328 |
+
}
|
| 329 |
+
if(isset($v['light'])) {
|
| 330 |
+
$a=array();
|
| 331 |
+
$a['color']=$v['light'];
|
| 332 |
+
if(isset($v['fontLight'])) {
|
| 333 |
+
$a['fontColor']=$v['fontLight'];
|
| 334 |
+
}
|
| 335 |
+
$result[$k.' Light']=$a;
|
| 336 |
+
}
|
| 337 |
+
if(isset($v['dark'])) {
|
| 338 |
+
$a=array();
|
| 339 |
+
$a['color']=$v['dark'];
|
| 340 |
+
if(isset($v['fontDark'])) {
|
| 341 |
+
$a['fontColor']=$v['fontDark'];
|
| 342 |
+
}
|
| 343 |
+
$result[$k.' Dark']=$a;
|
| 344 |
+
}
|
| 345 |
+
}
|
| 346 |
+
|
| 347 |
+
ksort($result);
|
| 348 |
+
return $result;
|
| 349 |
+
}
|
| 350 |
+
//$colors['(Default)']=array('color'=>'', 'fontColor'=>'#464646');
|
| 351 |
+
public function getLightDarkColors() {
|
| 352 |
+
$colors['WHITE']=array(
|
| 353 |
+
'light'=>'#FFFFFF', 'fontLight'=>'#464646'
|
| 354 |
+
, 'dark'=>'#eaeaea', 'fontDark'=>'#464646'
|
| 355 |
+
);
|
| 356 |
+
$colors['AQUA']=array('light'=>'#1ABC9C', 'dark'=>'#16A085');
|
| 357 |
+
$colors['GREEN']=array('light'=>'#2ECC71', 'dark'=>'#27AE60');
|
| 358 |
+
$colors['VIOLET']=array('light'=>'#9B59B6', 'dark'=>'#8E44AD');
|
| 359 |
+
$colors['BLUE #1']=array('light'=>'#3498DB', 'dark'=>'#2980B9');
|
| 360 |
+
$colors['BLUE #2']=array('light'=>'#34495E', 'dark'=>'#2C3E50');
|
| 361 |
+
$colors['YELLOW']=array('light'=>'#F1C40F', 'dark'=>'#F39C12');
|
| 362 |
+
$colors['ORANGE']=array('light'=>'#E67E22', 'dark'=>'#D35400');
|
| 363 |
+
$colors['RED']=array('light'=>'#E74C3C', 'dark'=>'#C0392B');
|
| 364 |
+
$colors['GREY #1']=array(
|
| 365 |
+
'light'=>'#ECF0F1', 'fontLight'=>'#464646'
|
| 366 |
+
, 'dark'=>'#e6e6e6', 'fontDark'=>'#464646'
|
| 367 |
+
);
|
| 368 |
+
$colors['GREY #2']=array('light'=>'#95A5A6', 'dark'=>'#7F8C8D');
|
| 369 |
+
$colors['BLACK']=array('light'=>'#141414', 'dark'=>'#000000');
|
| 370 |
+
ksort($colors);
|
| 371 |
+
return $colors;
|
| 372 |
+
}
|
| 373 |
+
public function getLegacyColors() {
|
| 374 |
+
$colors=array();
|
| 375 |
+
$colors['(Default)']=array('color'=>'', 'fontColor'=>'#464646');
|
| 376 |
+
$colors['WHITE']=array('color'=>'#FFFFFF', 'fontColor'=>'#464646');
|
| 377 |
+
$colors['LIGHT GREY']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');
|
| 378 |
+
$colors['DARK GREY']=array('color'=>'#555555');
|
| 379 |
+
$colors['BLACK']=array('color'=>'#000000');
|
| 380 |
+
|
| 381 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
| 382 |
+
$colors['WHITE']=array('color'=>'#FFFFFF', 'fontColor'=>'#464646');
|
| 383 |
+
$colors['LIGHT GREY']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');
|
| 384 |
+
$colors['DARK GREY']=array('color'=>'#555555');
|
| 385 |
+
$colors['BLACK']=array('color'=>'#000000'); //black
|
| 386 |
+
|
| 387 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
| 388 |
+
$colors['TURQUOISE']=array('color'=>'#1ABC9C'); //Aqua
|
| 389 |
+
$colors['EMERALD']=array('color'=>'#2ECC71'); //green
|
| 390 |
+
$colors['AMETHYST']=array('color'=>'#9B59B6');//violet
|
| 391 |
+
$colors['PETER RIVER']=array('color'=>'#3498DB');//blue
|
| 392 |
+
$colors['WET ASPHALT']=array('color'=>'#34495E');//blue
|
| 393 |
+
$colors['SUN FLOWER']=array('color'=>'#F1C40F');//yellow
|
| 394 |
+
$colors['CARROT']=array('color'=>'#E67E22');//orange
|
| 395 |
+
$colors['ALIZARIN']=array('color'=>'#E74C3C');//red
|
| 396 |
+
$colors['CLOUDS']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');//grey
|
| 397 |
+
$colors['CONCRETE']=array('color'=>'#95A5A6');//grey (+grey)
|
| 398 |
+
|
| 399 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
| 400 |
+
$colors['GREEN SEA']=array('color'=>'#16A085');
|
| 401 |
+
$colors['NEPHRITIS']=array('color'=>'#27AE60');
|
| 402 |
+
$colors['WISTERIA']=array('color'=>'#8E44AD');
|
| 403 |
+
$colors['BELIZE HOLE']=array('color'=>'#2980B9');
|
| 404 |
+
$colors['MIDNIGHT BLUE']=array('color'=>'#2C3E50');
|
| 405 |
+
$colors['ORANGE']=array('color'=>'#F39C12');
|
| 406 |
+
$colors['PUMPKIN']=array('color'=>'#D35400');
|
| 407 |
+
$colors['POMEGRANATE']=array('color'=>'#C0392B');
|
| 408 |
+
$colors['SILVER']=array('color'=>'#BDC3C7');
|
| 409 |
+
$colors['ASBESTOS']=array('color'=>'#7F8C8D');
|
| 410 |
+
ksort($colors);
|
| 411 |
+
return $colors;
|
| 412 |
+
}
|
| 413 |
+
|
| 414 |
+
public function getTemplateUUID($template) {
|
| 415 |
+
$uuid=$this->getRequest("Template>".$template);
|
| 416 |
+
if(!$uuid) {
|
| 417 |
+
$uuid="s".md5($template."-".date("Ymd"));
|
| 418 |
+
$this->setRequest("Template>".$template, $uuid);
|
| 419 |
+
}
|
| 420 |
+
return $uuid;
|
| 421 |
+
}
|
| 422 |
+
}
|
includes/classes/utils/Cron.php
ADDED
|
@@ -0,0 +1,85 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Cron
|
| 4 |
+
*
|
| 5 |
+
* @package EDD
|
| 6 |
+
* @subpackage Classes/Cron
|
| 7 |
+
* @copyright Copyright (c) 2015, Pippin Williamson
|
| 8 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 9 |
+
* @since 1.6
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
// Exit if accessed directly
|
| 13 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 14 |
+
|
| 15 |
+
class IRP_Cron {
|
| 16 |
+
/**
|
| 17 |
+
* Get things going
|
| 18 |
+
*
|
| 19 |
+
* @since 1.6
|
| 20 |
+
* @see EDD_Cron::weekly_events()
|
| 21 |
+
*/
|
| 22 |
+
public function __construct() {
|
| 23 |
+
}
|
| 24 |
+
public function init() {
|
| 25 |
+
add_filter( 'cron_schedules', array( $this, 'add_schedules' ) );
|
| 26 |
+
add_action( 'wp', array( $this, 'schedule_Events' ) );
|
| 27 |
+
}
|
| 28 |
+
|
| 29 |
+
/**
|
| 30 |
+
* Registers new cron schedules
|
| 31 |
+
*
|
| 32 |
+
* @since 1.6
|
| 33 |
+
*
|
| 34 |
+
* @param array $schedules
|
| 35 |
+
* @return array
|
| 36 |
+
*/
|
| 37 |
+
public function add_schedules( $schedules = array() ) {
|
| 38 |
+
global $irp;
|
| 39 |
+
// Adds once weekly to the existing schedules.
|
| 40 |
+
$schedules['weekly'] = array(
|
| 41 |
+
'interval' => 604800,
|
| 42 |
+
'display' => $irp->Lang->L('Once Weekly')
|
| 43 |
+
);
|
| 44 |
+
|
| 45 |
+
return $schedules;
|
| 46 |
+
}
|
| 47 |
+
|
| 48 |
+
/**
|
| 49 |
+
* Schedules our events
|
| 50 |
+
*
|
| 51 |
+
* @access public
|
| 52 |
+
* @since 1.6
|
| 53 |
+
* @return void
|
| 54 |
+
*/
|
| 55 |
+
public function schedule_Events() {
|
| 56 |
+
$this->weekly_events();
|
| 57 |
+
$this->daily_events();
|
| 58 |
+
}
|
| 59 |
+
|
| 60 |
+
/**
|
| 61 |
+
* Schedule weekly events
|
| 62 |
+
*
|
| 63 |
+
* @access private
|
| 64 |
+
* @since 1.6
|
| 65 |
+
* @return void
|
| 66 |
+
*/
|
| 67 |
+
private function weekly_events() {
|
| 68 |
+
if ( ! wp_next_scheduled( 'irp_weekly_scheduled_events' ) ) {
|
| 69 |
+
wp_schedule_event( current_time( 'timestamp' ), 'weekly', 'irp_weekly_scheduled_events' );
|
| 70 |
+
}
|
| 71 |
+
}
|
| 72 |
+
|
| 73 |
+
/**
|
| 74 |
+
* Schedule daily events
|
| 75 |
+
*
|
| 76 |
+
* @access private
|
| 77 |
+
* @since 1.6
|
| 78 |
+
* @return void
|
| 79 |
+
*/
|
| 80 |
+
private function daily_events() {
|
| 81 |
+
if ( ! wp_next_scheduled( 'irp_daily_scheduled_events' ) ) {
|
| 82 |
+
wp_schedule_event( current_time( 'timestamp' ), 'daily', 'irp_daily_scheduled_events' );
|
| 83 |
+
}
|
| 84 |
+
}
|
| 85 |
+
}
|
includes/classes/utils/Language.php
ADDED
|
@@ -0,0 +1,121 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_Language {
|
| 5 |
+
var $domain;
|
| 6 |
+
function load($domain, $file) {
|
| 7 |
+
$this->domain=$domain;
|
| 8 |
+
if(!file_exists($file)) {
|
| 9 |
+
return;
|
| 10 |
+
}
|
| 11 |
+
$file=file_get_contents($file);
|
| 12 |
+
if($file!=NULL && strlen($file)>0) {
|
| 13 |
+
$bundle=array();
|
| 14 |
+
$file=str_replace("\r\n", "\n", $file);
|
| 15 |
+
$file=str_replace("\n\n", "\n", $file);
|
| 16 |
+
$file=explode("\n", $file);
|
| 17 |
+
|
| 18 |
+
foreach($file as $row) {
|
| 19 |
+
$index=strpos($row, "=");
|
| 20 |
+
if($index===FALSE) continue;
|
| 21 |
+
|
| 22 |
+
$k=trim(substr($row, 0, $index));
|
| 23 |
+
$v=trim(substr($row, $index+1));
|
| 24 |
+
$bundle[$k]=$v;
|
| 25 |
+
}
|
| 26 |
+
|
| 27 |
+
global $wp_session;
|
| 28 |
+
$wp_session['LanguageBundle_'.$domain]=$bundle;
|
| 29 |
+
}
|
| 30 |
+
}
|
| 31 |
+
//echo the $tcm->Lang->L result
|
| 32 |
+
function P($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 33 |
+
$what=$this->L($key, $v1, $v2, $v3, $v4, $v5);
|
| 34 |
+
echo $what;
|
| 35 |
+
}
|
| 36 |
+
//verify if the key is defined or not
|
| 37 |
+
function H($key) {
|
| 38 |
+
global $wp_session;
|
| 39 |
+
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
| 40 |
+
if($bundle==NULL || count($bundle)==0) {
|
| 41 |
+
return FALSE;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
$result=FALSE;
|
| 45 |
+
if(isset($bundle[$key])) {
|
| 46 |
+
$result=TRUE;
|
| 47 |
+
} elseif(isset($bundle[$key.'1'])) {
|
| 48 |
+
$result=TRUE;
|
| 49 |
+
} else {
|
| 50 |
+
//special way to call this function passing arguments
|
| 51 |
+
//WTF_something means key=WTF and something as first argument
|
| 52 |
+
$s=strpos($result, '_');
|
| 53 |
+
if ($s!==FALSE) {
|
| 54 |
+
$text = substr($result, 0, $s);
|
| 55 |
+
$value = substr($result, $s + 1);
|
| 56 |
+
$e = strrpos($value, '_');
|
| 57 |
+
if ($e!==FALSE) {
|
| 58 |
+
$text .= substr($value, $e + 1);
|
| 59 |
+
$value = substr($value, 0, $e);
|
| 60 |
+
}
|
| 61 |
+
if (isset($bundle[$text])) {
|
| 62 |
+
$result = TRUE;
|
| 63 |
+
}
|
| 64 |
+
}
|
| 65 |
+
}
|
| 66 |
+
return $result;
|
| 67 |
+
}
|
| 68 |
+
//read the key from a text file with its translation. Try to translate using __(
|
| 69 |
+
function L($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 70 |
+
global $wp_session;
|
| 71 |
+
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
| 72 |
+
$result = $key;
|
| 73 |
+
$args = array($v1, $v2, $v3, $v4, $v5);
|
| 74 |
+
|
| 75 |
+
if($bundle==NULL || count($bundle)==0) {
|
| 76 |
+
$result=__($result, $this->domain);
|
| 77 |
+
} else {
|
| 78 |
+
//i use the file to store the translations without writing it inside the code
|
| 79 |
+
if (isset($bundle[$key])) {
|
| 80 |
+
$result = $bundle[$key];
|
| 81 |
+
$result = __($result, $this->domain);
|
| 82 |
+
} elseif (isset($bundle[$key . '1'])) {
|
| 83 |
+
$result = '';
|
| 84 |
+
$n = 1;
|
| 85 |
+
while (isset($bundle[$key . $n])) {
|
| 86 |
+
if ($result != '') {
|
| 87 |
+
$result .= '<br/>';
|
| 88 |
+
}
|
| 89 |
+
$result .= __($bundle[$key . $n], $this->domain);
|
| 90 |
+
++$n;
|
| 91 |
+
}
|
| 92 |
+
} else {
|
| 93 |
+
//special way to call this function passing arguments
|
| 94 |
+
//WTF_something means key=WTF and something as first argument
|
| 95 |
+
$s=strpos($result, '_');
|
| 96 |
+
if ($s!==FALSE) {
|
| 97 |
+
$text = substr($result, 0, $s);
|
| 98 |
+
$value = substr($result, $s + 1);
|
| 99 |
+
$e = strrpos($value, '_');
|
| 100 |
+
if ($e!==FALSE) {
|
| 101 |
+
$text .= substr($value, $e + 1);
|
| 102 |
+
$value = substr($value, 0, $e);
|
| 103 |
+
}
|
| 104 |
+
if (isset($bundle[$text])) {
|
| 105 |
+
$result = $bundle[$text];
|
| 106 |
+
$args=array($value);
|
| 107 |
+
}
|
| 108 |
+
}
|
| 109 |
+
$result = __($result, $this->domain);
|
| 110 |
+
}
|
| 111 |
+
}
|
| 112 |
+
//here i translate it using WP
|
| 113 |
+
foreach($args as $k=>$v) {
|
| 114 |
+
$k='{'.$k.'}';
|
| 115 |
+
while(strpos($result, $k)!==FALSE) {
|
| 116 |
+
$result=str_replace($k, $v, $result);
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
return $result;
|
| 120 |
+
}
|
| 121 |
+
}
|
includes/classes/utils/Logger.php
ADDED
|
@@ -0,0 +1,119 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Exit if accessed directly
|
| 4 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 5 |
+
|
| 6 |
+
class IRP_Logger {
|
| 7 |
+
var $name;
|
| 8 |
+
var $context=array();
|
| 9 |
+
|
| 10 |
+
var $allTime;
|
| 11 |
+
var $time;
|
| 12 |
+
var $profile;
|
| 13 |
+
|
| 14 |
+
public function __construct($name='IRPP') {
|
| 15 |
+
if($name=='') $name='IRPP';
|
| 16 |
+
$this->name=$name;
|
| 17 |
+
$this->time=-1;
|
| 18 |
+
$this->allTime=-1;
|
| 19 |
+
$this->profile='';
|
| 20 |
+
}
|
| 21 |
+
|
| 22 |
+
public function startTime($profile) {
|
| 23 |
+
$this->info('TIME [startTime]=%s', $profile);
|
| 24 |
+
$this->profile=$profile;
|
| 25 |
+
$this->time=microtime(TRUE);
|
| 26 |
+
}
|
| 27 |
+
public function pauseTime() {
|
| 28 |
+
if($this->time>0 && $this->profile!='') {
|
| 29 |
+
$diff=round(microtime(TRUE)-$this->time, 3)*1000;
|
| 30 |
+
if($diff!='' && $diff>0) {
|
| 31 |
+
if($this->allTime<0) {
|
| 32 |
+
$this->allTime=0;
|
| 33 |
+
}
|
| 34 |
+
$this->allTime+=$diff;
|
| 35 |
+
$this->info('TIME pauseTime [%s]=%s', $this->profile, $diff);
|
| 36 |
+
}
|
| 37 |
+
}
|
| 38 |
+
$this->time=-1;
|
| 39 |
+
$this->profile='';
|
| 40 |
+
}
|
| 41 |
+
public function stopTime() {
|
| 42 |
+
global $irp;
|
| 43 |
+
$this->info('TIME [stopTime]=%s', $this->allTime);
|
| 44 |
+
if($this->allTime>0) {
|
| 45 |
+
$irp->Options->updateMaxExecutionTime($this->allTime);
|
| 46 |
+
}
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
public function pushContext($context) {
|
| 50 |
+
array_push($this->context, $context);
|
| 51 |
+
}
|
| 52 |
+
public function popContext() {
|
| 53 |
+
array_pop($this->context);
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
public function exception(Exception $ex) {
|
| 57 |
+
$this->write('[EXCEPTION]', 'FILE=%s, LINE=%s, CODE=%s, MESSAGE=%s'
|
| 58 |
+
, $ex->getFile(), $ex->getLine(), $ex->getCode(), $ex->getMessage());
|
| 59 |
+
}
|
| 60 |
+
public function fatal($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
| 61 |
+
$what=$this->write('[FATAL]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
| 62 |
+
die($what);
|
| 63 |
+
}
|
| 64 |
+
public function debug($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
| 65 |
+
$this->write('[DEBUG]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
| 66 |
+
}
|
| 67 |
+
public function info($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
| 68 |
+
$this->write('[INFO] ', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
| 69 |
+
}
|
| 70 |
+
public function error($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
| 71 |
+
$this->write('[ERROR]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
| 72 |
+
}
|
| 73 |
+
private function dump($v) {
|
| 74 |
+
if(is_array($v) && count($v)==0) {
|
| 75 |
+
$v='[]';
|
| 76 |
+
}
|
| 77 |
+
if($v!=NULL) {
|
| 78 |
+
if(is_array($v) || is_object($v)) {
|
| 79 |
+
$v=print_r($v, TRUE);
|
| 80 |
+
}
|
| 81 |
+
}
|
| 82 |
+
if(is_bool($v)) {
|
| 83 |
+
$v=($v ? 'TRUE' : 'FALSE');
|
| 84 |
+
}
|
| 85 |
+
return $v;
|
| 86 |
+
}
|
| 87 |
+
private function write($verbosity, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
| 88 |
+
global $irp;
|
| 89 |
+
|
| 90 |
+
$text=sprintf($message
|
| 91 |
+
, $this->dump($v1), $this->dump($v2), $this->dump($v3)
|
| 92 |
+
, $this->dump($v4), $this->dump($v5), $this->dump($v6));
|
| 93 |
+
$m=microtime(TRUE)%1000;
|
| 94 |
+
$m=":".str_pad(''.$m, 3, "0", STR_PAD_LEFT);
|
| 95 |
+
$message=date("d/m/Y H:i:s").$m." ".$verbosity." ";
|
| 96 |
+
if(count($this->context)>0) {
|
| 97 |
+
$message.='{'.$this->context[count($this->context)-1].'} ';
|
| 98 |
+
}
|
| 99 |
+
$message="\n".$message.$text;
|
| 100 |
+
if(!$irp->Options->isLoggerEnable()) {
|
| 101 |
+
return $message;
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
$hasErrors=false;
|
| 105 |
+
$filename=IRP_PLUGIN_ROOT."logs/".$this->name."_".date("Ym").".txt";
|
| 106 |
+
if (!$handle = fopen($filename, 'a')) {
|
| 107 |
+
$hasErrors=true;
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
if(!$hasErrors && fwrite($handle, $message)===FALSE) {
|
| 111 |
+
$hasErrors=true;
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
if(!$hasErrors) {
|
| 115 |
+
fclose($handle);
|
| 116 |
+
}
|
| 117 |
+
return $message;
|
| 118 |
+
}
|
| 119 |
+
}
|
includes/classes/utils/Options.php
ADDED
|
@@ -0,0 +1,261 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Exit if accessed directly
|
| 4 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 5 |
+
|
| 6 |
+
class IRP_Options {
|
| 7 |
+
var $vars;
|
| 8 |
+
public function __construct() {
|
| 9 |
+
$this->vars=array();
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
//always add a prefix to avoid conflicts with other plugins
|
| 13 |
+
protected function getKey($key) {
|
| 14 |
+
return 'IRP_'.$key;
|
| 15 |
+
}
|
| 16 |
+
//option
|
| 17 |
+
protected function removeOption($key) {
|
| 18 |
+
$key=$this->getKey($key);
|
| 19 |
+
delete_option($key);
|
| 20 |
+
}
|
| 21 |
+
protected function getOption($key, $default=FALSE) {
|
| 22 |
+
$key=$this->getKey($key);
|
| 23 |
+
$result=get_option($key, $default);
|
| 24 |
+
if(is_string($result)) {
|
| 25 |
+
$result=trim($result);
|
| 26 |
+
}
|
| 27 |
+
return $result;
|
| 28 |
+
}
|
| 29 |
+
protected function setOption($key, $value) {
|
| 30 |
+
$key=$this->getKey($key);
|
| 31 |
+
if(is_bool($value)) {
|
| 32 |
+
$value=($value ? 1 : 0);
|
| 33 |
+
}
|
| 34 |
+
update_option($key, $value);
|
| 35 |
+
}
|
| 36 |
+
|
| 37 |
+
//$_SESSION
|
| 38 |
+
protected function removeSession($key) {
|
| 39 |
+
global $wp_session;
|
| 40 |
+
|
| 41 |
+
$key=$this->getKey($key);
|
| 42 |
+
if(isset($wp_session[$key])) {
|
| 43 |
+
unset($wp_session[$key]);
|
| 44 |
+
}
|
| 45 |
+
}
|
| 46 |
+
protected function getSession($key, $default=FALSE) {
|
| 47 |
+
global $wp_session;
|
| 48 |
+
|
| 49 |
+
$key=$this->getKey($key);
|
| 50 |
+
$result=$default;
|
| 51 |
+
if(isset($wp_session[$key])) {
|
| 52 |
+
$result=$wp_session[$key];
|
| 53 |
+
}
|
| 54 |
+
if(is_string($result)) {
|
| 55 |
+
$result=trim($result);
|
| 56 |
+
}
|
| 57 |
+
return $result;
|
| 58 |
+
}
|
| 59 |
+
protected function setSession($key, $value) {
|
| 60 |
+
global $wp_session;
|
| 61 |
+
|
| 62 |
+
$key=$this->getKey($key);
|
| 63 |
+
$wp_session[$key]=$value;
|
| 64 |
+
}
|
| 65 |
+
|
| 66 |
+
//$_REQUEST
|
| 67 |
+
//However WP enforces its own logic - during load process wp_magic_quotes() processes variables to emulate magic quotes setting and enforces $_REQUEST to contain combination of $_GET and $_POST, no matter what PHP configuration says.
|
| 68 |
+
protected function removeRequest($key) {
|
| 69 |
+
$key=$this->getKey($key);
|
| 70 |
+
if(isset($this->vars[$key])) {
|
| 71 |
+
unset($this->vars[$key]);
|
| 72 |
+
}
|
| 73 |
+
}
|
| 74 |
+
protected function getRequest($key, $default=FALSE) {
|
| 75 |
+
$key=$this->getKey($key);
|
| 76 |
+
$result=$default;
|
| 77 |
+
if(isset($this->vars[$key])) {
|
| 78 |
+
$result=$this->vars[$key];
|
| 79 |
+
}
|
| 80 |
+
return $result;
|
| 81 |
+
}
|
| 82 |
+
protected function setRequest($key, $value) {
|
| 83 |
+
$key=$this->getKey($key);
|
| 84 |
+
$this->vars[$key]=$value;
|
| 85 |
+
}
|
| 86 |
+
|
| 87 |
+
//ShowWhatsNew
|
| 88 |
+
public function isShowWhatsNew() {
|
| 89 |
+
return $this->getOption('ShowWhatsNew', FALSE);
|
| 90 |
+
}
|
| 91 |
+
public function setShowWhatsNew($value) {
|
| 92 |
+
$this->setOption('ShowWhatsNew', $value);
|
| 93 |
+
}
|
| 94 |
+
|
| 95 |
+
//TrackingEnable
|
| 96 |
+
public function isTrackingEnable() {
|
| 97 |
+
return $this->getOption('TrackingEnable', 0);
|
| 98 |
+
}
|
| 99 |
+
public function setTrackingEnable($value) {
|
| 100 |
+
$this->setOption('TrackingEnable', $value);
|
| 101 |
+
}
|
| 102 |
+
//TrackingNotice
|
| 103 |
+
public function isTrackingNotice() {
|
| 104 |
+
return $this->getOption('TrackingNotice', 1);
|
| 105 |
+
}
|
| 106 |
+
public function setTrackingNotice($value) {
|
| 107 |
+
$this->setOption('TrackingNotice', $value);
|
| 108 |
+
}
|
| 109 |
+
|
| 110 |
+
public function isActive() {
|
| 111 |
+
return $this->getOption('Active', 0);
|
| 112 |
+
}
|
| 113 |
+
public function setActive($value) {
|
| 114 |
+
$this->setOption('Active', $value);
|
| 115 |
+
}
|
| 116 |
+
|
| 117 |
+
public function getTrackingLastSend() {
|
| 118 |
+
return $this->getOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', 0);
|
| 119 |
+
}
|
| 120 |
+
public function setTrackingLastSend($value) {
|
| 121 |
+
$this->setOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', $value);
|
| 122 |
+
}
|
| 123 |
+
public function getPluginInstallDate() {
|
| 124 |
+
return $this->getOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', 0);
|
| 125 |
+
}
|
| 126 |
+
public function setPluginInstallDate($value) {
|
| 127 |
+
$this->setOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', $value);
|
| 128 |
+
}
|
| 129 |
+
public function getPluginUpdateDate() {
|
| 130 |
+
return $this->getOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', 0);
|
| 131 |
+
}
|
| 132 |
+
public function setPluginUpdateDate($value) {
|
| 133 |
+
$this->setOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', $value);
|
| 134 |
+
}
|
| 135 |
+
|
| 136 |
+
public function isPluginFirstInstall() {
|
| 137 |
+
return $this->getOption('PluginFirstInstall', FALSE);
|
| 138 |
+
}
|
| 139 |
+
public function setPluginFirstInstall($value) {
|
| 140 |
+
$this->setOption('PluginFirstInstall', $value);
|
| 141 |
+
}
|
| 142 |
+
public function isShowActivationNotice() {
|
| 143 |
+
return $this->getOption('ShowActivationNotice', FALSE);
|
| 144 |
+
}
|
| 145 |
+
public function setShowActivationNotice($value) {
|
| 146 |
+
$this->setOption('ShowActivationNotice', $value);
|
| 147 |
+
}
|
| 148 |
+
|
| 149 |
+
//LoggerEnable
|
| 150 |
+
public function isLoggerEnable() {
|
| 151 |
+
return ($this->getOption('LoggerEnable', FALSE) || (defined('IRP_LOGGER') && IRP_LOGGER));
|
| 152 |
+
}
|
| 153 |
+
public function setLoggerEnable($value) {
|
| 154 |
+
$this->setOption('LoggerEnable', $value);
|
| 155 |
+
}
|
| 156 |
+
|
| 157 |
+
//Cache
|
| 158 |
+
public function getCache($name, $id) {
|
| 159 |
+
return $this->getRequest('Cache_'.$name.'_'.$id);
|
| 160 |
+
}
|
| 161 |
+
public function setCache($name, $id, $value) {
|
| 162 |
+
$this->setRequest('Cache_'.$name.'_'.$id, $value);
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
public function getFeedbackEmail() {
|
| 166 |
+
return $this->getOption('FeedbackEmail', get_bloginfo('admin_email'));
|
| 167 |
+
}
|
| 168 |
+
public function setFeedbackEmail($value) {
|
| 169 |
+
$this->setOption('FeedbackEmail', $value);
|
| 170 |
+
}
|
| 171 |
+
|
| 172 |
+
private function hasGenericMessages($type) {
|
| 173 |
+
$result=$this->getRequest($type.'Messages', NULL);
|
| 174 |
+
return (is_array($result) && count($result)>0);
|
| 175 |
+
}
|
| 176 |
+
|
| 177 |
+
private function pushGenericMessage($type, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 178 |
+
global $irp;
|
| 179 |
+
$array=$this->getRequest($type.'Messages', array());
|
| 180 |
+
$array[]=$irp->Lang->L($message, $v1, $v2, $v3, $v4, $v5);
|
| 181 |
+
$this->setRequest($type.'Messages', $array);
|
| 182 |
+
}
|
| 183 |
+
private function writeGenericMessages($type, $clean=TRUE) {
|
| 184 |
+
$result=FALSE;
|
| 185 |
+
$array=$this->getRequest($type.'Messages', array());
|
| 186 |
+
if(is_array($array) && count($array)>0) {
|
| 187 |
+
$result=TRUE;
|
| 188 |
+
?>
|
| 189 |
+
<div class="irp-box-<?php echo strtolower($type)?>"><?php echo wpautop(implode("\n", $array)); ?></div>
|
| 190 |
+
<?php }
|
| 191 |
+
if($clean) {
|
| 192 |
+
$this->removeRequest($type.'Messages');
|
| 193 |
+
}
|
| 194 |
+
return $result;
|
| 195 |
+
}
|
| 196 |
+
//WarningMessages
|
| 197 |
+
public function hasWarningMessages() {
|
| 198 |
+
return $this->hasGenericMessages('Warning');
|
| 199 |
+
}
|
| 200 |
+
public function pushWarningMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 201 |
+
return $this->pushGenericMessage('Warning', $message, $v1, $v2, $v3, $v4, $v5);
|
| 202 |
+
}
|
| 203 |
+
public function writeWarningMessages($clean=TRUE) {
|
| 204 |
+
return $this->writeGenericMessages('Warning', $clean);
|
| 205 |
+
}
|
| 206 |
+
//SuccessMessages
|
| 207 |
+
public function hasSuccessMessages() {
|
| 208 |
+
return $this->hasGenericMessages('Success');
|
| 209 |
+
}
|
| 210 |
+
public function pushSuccessMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 211 |
+
return $this->pushGenericMessage('Success', $message, $v1, $v2, $v3, $v4, $v5);
|
| 212 |
+
}
|
| 213 |
+
public function writeSuccessMessages($clean=TRUE) {
|
| 214 |
+
return $this->writeGenericMessages('Success', $clean);
|
| 215 |
+
}
|
| 216 |
+
//InfoMessages
|
| 217 |
+
public function hasInfoMessages() {
|
| 218 |
+
return $this->hasGenericMessages('Info');
|
| 219 |
+
}
|
| 220 |
+
public function pushInfoMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 221 |
+
return $this->pushGenericMessage('Info', $message, $v1, $v2, $v3, $v4, $v5);
|
| 222 |
+
}
|
| 223 |
+
public function writeInfoMessages($clean=TRUE) {
|
| 224 |
+
return $this->writeGenericMessages('Info', $clean);
|
| 225 |
+
}
|
| 226 |
+
//ErrorMessages
|
| 227 |
+
public function hasErrorMessages() {
|
| 228 |
+
return $this->hasGenericMessages('Error');
|
| 229 |
+
}
|
| 230 |
+
public function pushErrorMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 231 |
+
return $this->pushGenericMessage('Error', $message, $v1, $v2, $v3, $v4, $v5);
|
| 232 |
+
}
|
| 233 |
+
public function writeErrorMessages($clean=TRUE) {
|
| 234 |
+
return $this->writeGenericMessages('Error', $clean);
|
| 235 |
+
}
|
| 236 |
+
|
| 237 |
+
public function writeMessages($clean=TRUE) {
|
| 238 |
+
$result=FALSE;
|
| 239 |
+
if($this->writeInfoMessages($clean)) {
|
| 240 |
+
$result=TRUE;
|
| 241 |
+
}
|
| 242 |
+
if($this->writeSuccessMessages($clean)) {
|
| 243 |
+
$result=TRUE;
|
| 244 |
+
}
|
| 245 |
+
if($this->writeWarningMessages($clean)) {
|
| 246 |
+
$result=TRUE;
|
| 247 |
+
}
|
| 248 |
+
if($this->writeErrorMessages($clean)) {
|
| 249 |
+
$result=TRUE;
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
return $result;
|
| 253 |
+
}
|
| 254 |
+
public function pushMessage($success, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 255 |
+
if($success) {
|
| 256 |
+
$this->pushSuccessMessage($message.'Success', $v1, $v2, $v3, $v4, $v5);
|
| 257 |
+
} else {
|
| 258 |
+
$this->pushErrorMessage($message.'Error', $v1, $v2, $v3, $v4, $v5);
|
| 259 |
+
}
|
| 260 |
+
}
|
| 261 |
+
}
|
includes/classes/utils/Plugin.php
ADDED
|
@@ -0,0 +1,263 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if (!defined('ABSPATH')) exit;
|
| 3 |
+
|
| 4 |
+
define('IRP_PLUGINS_NO_PLUGINS', 10000);
|
| 5 |
+
define('IRP_PLUGINS_WOOCOMMERCE', 10001);
|
| 6 |
+
define('IRP_PLUGINS_EDD', 10002);
|
| 7 |
+
define('IRP_PLUGINS_WP_ECOMMERCE', 10003);
|
| 8 |
+
define('IRP_PLUGINS_WP_SPSC', 10004);
|
| 9 |
+
define('IRP_PLUGINS_S2MEMBER', 10005);
|
| 10 |
+
define('IRP_PLUGINS_MEMBERS', 10006);
|
| 11 |
+
define('IRP_PLUGINS_CART66', 10007);
|
| 12 |
+
define('IRP_PLUGINS_ESHOP', 10008);
|
| 13 |
+
define('IRP_PLUGINS_JIGOSHOP', 10009);
|
| 14 |
+
define('IRP_PLUGINS_MARKETPRESS', 10010);
|
| 15 |
+
define('IRP_PLUGINS_SHOPP', 10011);
|
| 16 |
+
define('IRP_PLUGINS_SIMPLE_WP_ECOMMERCE', 10012);
|
| 17 |
+
define('IRP_PLUGINS_CF7', 10013);
|
| 18 |
+
define('IRP_PLUGINS_GRAVITY', 10014);
|
| 19 |
+
define('IRP_PLUGINS_TRACKING_CODE_MANAGER', 10015);
|
| 20 |
+
define('IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO', 10016);
|
| 21 |
+
define('IRP_PLUGINS_INTELLY_RELATED_POSTS', 10017);
|
| 22 |
+
define('IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO', 10018);
|
| 23 |
+
|
| 24 |
+
class IRP_Plugin {
|
| 25 |
+
function __construct() {
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
function getName($pluginId) {
|
| 29 |
+
$result='';
|
| 30 |
+
switch ($pluginId) {
|
| 31 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
| 32 |
+
$result='WooCommerce';
|
| 33 |
+
break;
|
| 34 |
+
case IRP_PLUGINS_EDD:
|
| 35 |
+
$result='Easy Digital Download';
|
| 36 |
+
break;
|
| 37 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
| 38 |
+
$result='WP eCommerce';
|
| 39 |
+
break;
|
| 40 |
+
case IRP_PLUGINS_WP_SPSC:
|
| 41 |
+
$result='WordPress Simple Paypal Shopping Cart';
|
| 42 |
+
break;
|
| 43 |
+
case IRP_PLUGINS_S2MEMBER:
|
| 44 |
+
$result='s2member';
|
| 45 |
+
break;
|
| 46 |
+
case IRP_PLUGINS_MEMBERS:
|
| 47 |
+
$result='Members';
|
| 48 |
+
break;
|
| 49 |
+
case IRP_PLUGINS_CART66:
|
| 50 |
+
$result='Cart66 Lite :: WordPress Ecommerce';
|
| 51 |
+
break;
|
| 52 |
+
case IRP_PLUGINS_ESHOP:
|
| 53 |
+
$result='eShop';
|
| 54 |
+
break;
|
| 55 |
+
case IRP_PLUGINS_JIGOSHOP:
|
| 56 |
+
$result='Jigoshop';
|
| 57 |
+
break;
|
| 58 |
+
case IRP_PLUGINS_MARKETPRESS:
|
| 59 |
+
$result='MarketPress - WordPress eCommerce';
|
| 60 |
+
break;
|
| 61 |
+
case IRP_PLUGINS_SHOPP:
|
| 62 |
+
$result='Shopp';
|
| 63 |
+
break;
|
| 64 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
| 65 |
+
$result='iThemes Exchange: Simple WP Ecommerce';
|
| 66 |
+
break;
|
| 67 |
+
case IRP_PLUGINS_CF7:
|
| 68 |
+
$result='Contact Form 7';
|
| 69 |
+
break;
|
| 70 |
+
case IRP_PLUGINS_GRAVITY:
|
| 71 |
+
$result='Gravity Form';
|
| 72 |
+
break;
|
| 73 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
| 74 |
+
$result='Tracking Code Manager';
|
| 75 |
+
break;
|
| 76 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
| 77 |
+
$result='Tracking Code Manager PRO';
|
| 78 |
+
break;
|
| 79 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
| 80 |
+
$result='Inline Related Posts';
|
| 81 |
+
break;
|
| 82 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
| 83 |
+
$result='Inline Related Posts PRO';
|
| 84 |
+
break;
|
| 85 |
+
}
|
| 86 |
+
return $result;
|
| 87 |
+
}
|
| 88 |
+
function isActive($pluginId) {
|
| 89 |
+
global $tcm;
|
| 90 |
+
|
| 91 |
+
$php='';
|
| 92 |
+
$class='';
|
| 93 |
+
$constant='';
|
| 94 |
+
switch ($pluginId) {
|
| 95 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
| 96 |
+
$php='woocommerce/woocommerce.php';
|
| 97 |
+
$class='WooCommerce';
|
| 98 |
+
$constant='WOOCOMMERCE_VERSION';
|
| 99 |
+
break;
|
| 100 |
+
case IRP_PLUGINS_EDD:
|
| 101 |
+
$php='easy-digital-downloads/easy-digital-downloads.php';
|
| 102 |
+
$class='Easy_Digital_Downloads';
|
| 103 |
+
$constant='EDD_SL_VERSION';
|
| 104 |
+
break;
|
| 105 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
| 106 |
+
$class='WP_eCommerce';
|
| 107 |
+
$constant='WPSC_VERSION';
|
| 108 |
+
break;
|
| 109 |
+
case IRP_PLUGINS_WP_SPSC:
|
| 110 |
+
$constant='WP_CART_VERSION';
|
| 111 |
+
break;
|
| 112 |
+
case IRP_PLUGINS_S2MEMBER:
|
| 113 |
+
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
| 114 |
+
break;
|
| 115 |
+
case IRP_PLUGINS_MEMBERS:
|
| 116 |
+
$constant='MEMBERS_VERSION';
|
| 117 |
+
break;
|
| 118 |
+
case IRP_PLUGINS_CART66:
|
| 119 |
+
$class='Cart66';
|
| 120 |
+
$constant='CART66_VERSION_NUMBER';
|
| 121 |
+
break;
|
| 122 |
+
case IRP_PLUGINS_ESHOP:
|
| 123 |
+
$constant='ESHOP_VERSION';
|
| 124 |
+
break;
|
| 125 |
+
case IRP_PLUGINS_JIGOSHOP:
|
| 126 |
+
$constant='JIGOSHOP_VERSION';
|
| 127 |
+
break;
|
| 128 |
+
case IRP_PLUGINS_MARKETPRESS:
|
| 129 |
+
$class='MarketPress';
|
| 130 |
+
$constant='MP_LITE';
|
| 131 |
+
break;
|
| 132 |
+
case IRP_PLUGINS_SHOPP:
|
| 133 |
+
$constant='ESHOP_VERSION';
|
| 134 |
+
break;
|
| 135 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
| 136 |
+
$class='IT_Exchange';
|
| 137 |
+
$constant='';
|
| 138 |
+
break;
|
| 139 |
+
case IRP_PLUGINS_CF7:
|
| 140 |
+
$constant='WPCF7_VERSION';
|
| 141 |
+
break;
|
| 142 |
+
case IRP_PLUGINS_GRAVITY:
|
| 143 |
+
$constant='';
|
| 144 |
+
break;
|
| 145 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
| 146 |
+
$constant='TCM_PLUGIN_VERSION';
|
| 147 |
+
break;
|
| 148 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
| 149 |
+
$constant='TCMP_PLUGIN_VERSION';
|
| 150 |
+
break;
|
| 151 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
| 152 |
+
$constant='IRP_PLUGIN_VERSION';
|
| 153 |
+
break;
|
| 154 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
| 155 |
+
$constant='IRPP_PLUGIN_VERSION';
|
| 156 |
+
break;
|
| 157 |
+
}
|
| 158 |
+
$result=$this->isPluginActive($class, $constant, $php);
|
| 159 |
+
return $result;
|
| 160 |
+
}
|
| 161 |
+
|
| 162 |
+
private function isPluginActive($class='', $constant='', $plugin='') {
|
| 163 |
+
$result=FALSE;
|
| 164 |
+
$result=($result || ($class!='' && class_exists($class)));
|
| 165 |
+
$result=($result || ($constant!='' && defined($constant)));
|
| 166 |
+
//require plugin.php
|
| 167 |
+
//$result=($result || ($plugin!='' && is_plugin_active($plugin)));
|
| 168 |
+
return $result;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
function getVersion($pluginId) {
|
| 172 |
+
$constant='';
|
| 173 |
+
$version='';
|
| 174 |
+
switch ($pluginId) {
|
| 175 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
| 176 |
+
$constant='WOOCOMMERCE_VERSION';
|
| 177 |
+
break;
|
| 178 |
+
case IRP_PLUGINS_EDD:
|
| 179 |
+
$constant='EDD_SL_VERSION';
|
| 180 |
+
break;
|
| 181 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
| 182 |
+
$constant='WPSC_VERSION';
|
| 183 |
+
break;
|
| 184 |
+
case IRP_PLUGINS_WP_SPSC:
|
| 185 |
+
$constant='WP_CART_VERSION';
|
| 186 |
+
break;
|
| 187 |
+
case IRP_PLUGINS_S2MEMBER:
|
| 188 |
+
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
| 189 |
+
break;
|
| 190 |
+
case IRP_PLUGINS_MEMBERS:
|
| 191 |
+
$constant='MEMBERS_VERSION';
|
| 192 |
+
break;
|
| 193 |
+
case IRP_PLUGINS_CART66:
|
| 194 |
+
$constant='CART66_VERSION_NUMBER';
|
| 195 |
+
break;
|
| 196 |
+
case IRP_PLUGINS_ESHOP:
|
| 197 |
+
$constant='ESHOP_VERSION';
|
| 198 |
+
break;
|
| 199 |
+
case IRP_PLUGINS_JIGOSHOP:
|
| 200 |
+
$constant='JIGOSHOP_VERSION';
|
| 201 |
+
break;
|
| 202 |
+
case IRP_PLUGINS_MARKETPRESS:
|
| 203 |
+
global $mp;
|
| 204 |
+
$version=$mp->version;
|
| 205 |
+
break;
|
| 206 |
+
case IRP_PLUGINS_SHOPP:
|
| 207 |
+
$constant='ESHOP_VERSION';
|
| 208 |
+
break;
|
| 209 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
| 210 |
+
$version=$GLOBALS['it_exchange']['version'];
|
| 211 |
+
break;
|
| 212 |
+
case IRP_PLUGINS_CF7:
|
| 213 |
+
$constant='WPCF7_VERSION';
|
| 214 |
+
break;
|
| 215 |
+
case IRP_PLUGINS_GRAVITY:
|
| 216 |
+
$constant='';
|
| 217 |
+
break;
|
| 218 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
| 219 |
+
$constant='TCM_PLUGIN_VERSION';
|
| 220 |
+
break;
|
| 221 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
| 222 |
+
$constant='TCMP_PLUGIN_VERSION';
|
| 223 |
+
break;
|
| 224 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
| 225 |
+
$constant='IRP_PLUGIN_VERSION';
|
| 226 |
+
break;
|
| 227 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
| 228 |
+
$constant='IRPP_PLUGIN_VERSION';
|
| 229 |
+
break;
|
| 230 |
+
}
|
| 231 |
+
if($version=='' && $constant!='') {
|
| 232 |
+
$version=(defined($constant) ? constant($constant) : '');
|
| 233 |
+
}
|
| 234 |
+
return $version;
|
| 235 |
+
}
|
| 236 |
+
|
| 237 |
+
function getActivePlugins($ids) {
|
| 238 |
+
return $this->getActivePlugins($ids, TRUE);
|
| 239 |
+
}
|
| 240 |
+
function getPlugins($ids, $onlyActive=TRUE) {
|
| 241 |
+
$array=array();
|
| 242 |
+
if(!is_array($ids)) {
|
| 243 |
+
$ids=array(intval($ids));
|
| 244 |
+
}
|
| 245 |
+
|
| 246 |
+
foreach($ids as $id) {
|
| 247 |
+
if(!$onlyActive || $this->isActive($id)) {
|
| 248 |
+
$name=$this->getName($id);
|
| 249 |
+
$version=$this->getVersion($id);
|
| 250 |
+
|
| 251 |
+
$v=array(
|
| 252 |
+
'id'=>$id
|
| 253 |
+
, 'name'=>$name
|
| 254 |
+
, 'version'=>$version
|
| 255 |
+
, 'active'=>$this->isActive($id)
|
| 256 |
+
);
|
| 257 |
+
$array[$name]=$v;
|
| 258 |
+
}
|
| 259 |
+
}
|
| 260 |
+
ksort($array);
|
| 261 |
+
return $array;
|
| 262 |
+
}
|
| 263 |
+
}
|
includes/classes/utils/Tracking.php
ADDED
|
@@ -0,0 +1,191 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Exit if accessed directly
|
| 4 |
+
if (!defined('ABSPATH')) exit;
|
| 5 |
+
|
| 6 |
+
/**
|
| 7 |
+
* Usage tracking
|
| 8 |
+
*
|
| 9 |
+
* @access public
|
| 10 |
+
* @since 1.8.2
|
| 11 |
+
* @return void
|
| 12 |
+
*/
|
| 13 |
+
class IRP_Tracking {
|
| 14 |
+
|
| 15 |
+
public function __construct() {
|
| 16 |
+
//We send once a week (while tracking is allowed) to check in which can be used
|
| 17 |
+
//to determine active sites
|
| 18 |
+
add_action('irp_weekly_scheduled_events', array($this, 'sendTracking'));
|
| 19 |
+
|
| 20 |
+
//add_action('irp_tracking_on', array($this, 'enableTracking'));
|
| 21 |
+
//add_action('irp_tracking_off', array($this, 'disableTracking'));
|
| 22 |
+
//add_action('admin_notices', array($this, 'admin_notice'));
|
| 23 |
+
}
|
| 24 |
+
|
| 25 |
+
private function getThemeData() {
|
| 26 |
+
$theme_data = wp_get_theme();
|
| 27 |
+
$theme = array(
|
| 28 |
+
'name' => $theme_data->display( 'Name', false, false ),
|
| 29 |
+
'theme_uri' => $theme_data->display( 'ThemeURI', false, false ),
|
| 30 |
+
'version' => $theme_data->display( 'Version', false, false ),
|
| 31 |
+
'author' => $theme_data->display( 'Author', false, false ),
|
| 32 |
+
'author_uri' => $theme_data->display( 'AuthorURI', false, false ),
|
| 33 |
+
);
|
| 34 |
+
$theme_template = $theme_data->get_template();
|
| 35 |
+
if ( $theme_template !== '' && $theme_data->parent() ) {
|
| 36 |
+
$theme['template'] = array(
|
| 37 |
+
'version' => $theme_data->parent()->display( 'Version', false, false ),
|
| 38 |
+
'name' => $theme_data->parent()->display( 'Name', false, false ),
|
| 39 |
+
'theme_uri' => $theme_data->parent()->display( 'ThemeURI', false, false ),
|
| 40 |
+
'author' => $theme_data->parent()->display( 'Author', false, false ),
|
| 41 |
+
'author_uri' => $theme_data->parent()->display( 'AuthorURI', false, false ),
|
| 42 |
+
);
|
| 43 |
+
}
|
| 44 |
+
else {
|
| 45 |
+
$theme['template'] = '';
|
| 46 |
+
}
|
| 47 |
+
unset( $theme_template );
|
| 48 |
+
return $theme;
|
| 49 |
+
}
|
| 50 |
+
private function getPluginData() {
|
| 51 |
+
//retrieve plugins (active/inactive) list
|
| 52 |
+
if(!function_exists('get_plugins')) {
|
| 53 |
+
include ABSPATH . '/wp-admin/includes/plugin.php';
|
| 54 |
+
}
|
| 55 |
+
|
| 56 |
+
$plugins=array();
|
| 57 |
+
$active_plugin = get_option( 'active_plugins' );
|
| 58 |
+
foreach ( $active_plugin as $plugin_path ) {
|
| 59 |
+
if ( ! function_exists( 'get_plugin_data' ) ) {
|
| 60 |
+
require_once(ABSPATH . 'wp-admin/includes/plugin.php');
|
| 61 |
+
}
|
| 62 |
+
|
| 63 |
+
$plugin_info = get_plugin_data( WP_PLUGIN_DIR . '/' . $plugin_path );
|
| 64 |
+
|
| 65 |
+
$slug= str_replace( '/' . basename( $plugin_path ), '', $plugin_path );
|
| 66 |
+
$plugins[ $slug ] = array(
|
| 67 |
+
'version' => $plugin_info['Version'],
|
| 68 |
+
'name' => $plugin_info['Name'],
|
| 69 |
+
'plugin_uri' => $plugin_info['PluginURI'],
|
| 70 |
+
'author' => $plugin_info['AuthorName'],
|
| 71 |
+
'author_uri' => $plugin_info['AuthorURI'],
|
| 72 |
+
);
|
| 73 |
+
}
|
| 74 |
+
unset( $active_plugins, $plugin_path );
|
| 75 |
+
return $plugins;
|
| 76 |
+
}
|
| 77 |
+
//obtain tracking data into an associative array
|
| 78 |
+
public function getData() {
|
| 79 |
+
global $irp;
|
| 80 |
+
|
| 81 |
+
//retrieve blog info
|
| 82 |
+
$result['wp_url']=home_url();
|
| 83 |
+
$result['wp_version']=get_bloginfo('version');
|
| 84 |
+
$result['wp_language']=get_bloginfo('language');
|
| 85 |
+
$result['wp_wpurl']=get_bloginfo('wpurl');
|
| 86 |
+
$result['wp_admin_email']=get_bloginfo('admin_email');
|
| 87 |
+
|
| 88 |
+
$result['plugins']=$this->getPluginData();
|
| 89 |
+
$result['theme']=$this->getThemeData();
|
| 90 |
+
|
| 91 |
+
//to obtain for each post type its count
|
| 92 |
+
$post_types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
| 93 |
+
$data=array();
|
| 94 |
+
foreach ($post_types as $v) {
|
| 95 |
+
$v=$v['name'];
|
| 96 |
+
$data[$v]=intval(wp_count_posts($v)->publish);
|
| 97 |
+
}
|
| 98 |
+
$result['post_types']=$data;
|
| 99 |
+
|
| 100 |
+
$data=array(
|
| 101 |
+
'debug'=>(defined('WP_DEBUG') && WP_DEBUG)
|
| 102 |
+
, 'maxTime'=>$irp->Options->getMaxExecutionTime()
|
| 103 |
+
, 'active'=>$irp->Options->isActive()
|
| 104 |
+
, 'engineSearch'=>$irp->Options->getEngineSearch()
|
| 105 |
+
, 'rewriteAtEnd'=>$irp->Options->isRewriteAtEnd()
|
| 106 |
+
, 'rewriteThresold'=>$irp->Options->getRewriteThreshold()
|
| 107 |
+
, 'rewriteBoxesCount'=>$irp->Options->getRewriteBoxesCount()
|
| 108 |
+
, 'rewriteActive'=>$irp->Options->isRewriteActive()
|
| 109 |
+
, 'metaboxPostTypes'=>$irp->Options->getMetaboxPostTypes()
|
| 110 |
+
, 'rewritePostTypes'=>$irp->Options->getRewritePostTypes()
|
| 111 |
+
);
|
| 112 |
+
$data=$irp->Utils->parseArgs($irp->Options->getTemplateStyle(), $data);
|
| 113 |
+
$result['iwpm_plugin_name']=IRP_PLUGIN_SLUG;
|
| 114 |
+
$result['iwpm_plugin_version']=IRP_PLUGIN_VERSION;
|
| 115 |
+
$result['iwpm_plugin_data']=$data;
|
| 116 |
+
$result['iwpm_plugin_install_date']=$irp->Options->getPluginInstallDate();
|
| 117 |
+
$result['iwpm_plugin_update_date']=$irp->Options->getPluginUpdateDate();
|
| 118 |
+
|
| 119 |
+
$result['iwpm_tracking_enable']=$irp->Options->isTrackingEnable();
|
| 120 |
+
$result['iwpm_logger_enable']=$irp->Options->isLoggerEnable();
|
| 121 |
+
$result['iwpm_feedback_email']=$irp->Options->getFeedbackEmail();
|
| 122 |
+
|
| 123 |
+
return $result;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
//send tracking data info to our server
|
| 127 |
+
public function sendTracking($override = FALSE) {
|
| 128 |
+
global $irp;
|
| 129 |
+
|
| 130 |
+
$result=-1;
|
| 131 |
+
if(!$override && !$irp->Options->isTrackingEnable())
|
| 132 |
+
return $result;
|
| 133 |
+
|
| 134 |
+
// Send a maximum of once per week
|
| 135 |
+
$last_send=$irp->Options->getTrackingLastSend();
|
| 136 |
+
if(!$override && $last_send>strtotime('-1 week'))
|
| 137 |
+
return $result;
|
| 138 |
+
|
| 139 |
+
//add_filter('https_local_ssl_verify', '__return_false');
|
| 140 |
+
//add_filter('https_ssl_verify', '__return_false');
|
| 141 |
+
//add_filter('block_local_requests', '__return_false');
|
| 142 |
+
$data=$irp->Utils->remotePost('usage', $this->getData());
|
| 143 |
+
if($data) {
|
| 144 |
+
$result=intval($data['id']);
|
| 145 |
+
$irp->Options->setTrackingLastSend(time());
|
| 146 |
+
}
|
| 147 |
+
return $result;
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
public function enableTracking() {
|
| 151 |
+
global $irp;
|
| 152 |
+
|
| 153 |
+
$irp->Options->setTrackingEnable(TRUE);
|
| 154 |
+
$irp->Options->setTrackingNotice(FALSE);
|
| 155 |
+
$this->sendTracking(TRUE);
|
| 156 |
+
}
|
| 157 |
+
public function disableTracking() {
|
| 158 |
+
global $irp;
|
| 159 |
+
|
| 160 |
+
$irp->Options->setTrackingEnable(FALSE);
|
| 161 |
+
$irp->Options->setTrackingNotice(FALSE);
|
| 162 |
+
$this->sendTracking(TRUE);
|
| 163 |
+
}
|
| 164 |
+
|
| 165 |
+
public function admin_notice() {
|
| 166 |
+
global $irp;
|
| 167 |
+
|
| 168 |
+
if(!$irp->Options->isTrackingNotice() || $irp->Options->isTrackingEnable() || !current_user_can('manage_options'))
|
| 169 |
+
return;
|
| 170 |
+
|
| 171 |
+
if(FALSE && (
|
| 172 |
+
stristr(network_site_url('/'), 'dev' ) !== false ||
|
| 173 |
+
stristr(network_site_url('/'), 'localhost') !== false ||
|
| 174 |
+
stristr(network_site_url('/'), ':8888' ) !== false // This is common with MAMP on OS X
|
| 175 |
+
)) {
|
| 176 |
+
$irp->Options->setTrackingNotice(TRUE);
|
| 177 |
+
} else {
|
| 178 |
+
$yes_url=add_query_arg('irp_action', 'manager_trackingOn');
|
| 179 |
+
$no_url=add_query_arg('irp_action', 'manager_trackingOff');
|
| 180 |
+
|
| 181 |
+
?>
|
| 182 |
+
<div class="updated">
|
| 183 |
+
<p>
|
| 184 |
+
<?php $irp->Lang->P('Allow IntellyWP to track plugin usage?');?>
|
| 185 |
+
<a href="<?php echo esc_url($yes_url)?>" class="button-primary"><?php $irp->Lang->P('Oh yes :)')?></a>
|
| 186 |
+
<a href="<?php echo esc_url($no_url)?>" class="button-secondary"><?php $irp->Lang->P('Refuse!')?></a>
|
| 187 |
+
</p>
|
| 188 |
+
</div>
|
| 189 |
+
<?php }
|
| 190 |
+
}
|
| 191 |
+
}
|
includes/classes/utils/Utils.php
ADDED
|
@@ -0,0 +1,599 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 3 |
+
|
| 4 |
+
class IRP_Utils {
|
| 5 |
+
|
| 6 |
+
function format($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
| 7 |
+
if($v1 || $v2 || $v3 || $v4 || $v5) {
|
| 8 |
+
$message=sprintf($message, $v1, $v2, $v3, $v4, $v5);
|
| 9 |
+
}
|
| 10 |
+
return $message;
|
| 11 |
+
}
|
| 12 |
+
function startsWith($haystack, $needle) {
|
| 13 |
+
$result=FALSE;
|
| 14 |
+
if (is_array($needle)) {
|
| 15 |
+
foreach($needle as $w) {
|
| 16 |
+
if ($this->startsWith($haystack, $w)) {
|
| 17 |
+
$result=TRUE;
|
| 18 |
+
break;
|
| 19 |
+
}
|
| 20 |
+
}
|
| 21 |
+
} elseif($needle!='') {
|
| 22 |
+
if(is_array($haystack)) {
|
| 23 |
+
foreach($haystack as $h) {
|
| 24 |
+
if($this->startsWith($h, $needle)) {
|
| 25 |
+
$result=TRUE;
|
| 26 |
+
break;
|
| 27 |
+
}
|
| 28 |
+
}
|
| 29 |
+
} elseif($haystack!='') {
|
| 30 |
+
$length = strlen($needle);
|
| 31 |
+
$result = (substr($haystack, 0, $length) === $needle);
|
| 32 |
+
}
|
| 33 |
+
}
|
| 34 |
+
return $result;
|
| 35 |
+
}
|
| 36 |
+
function endsWith($haystack, $needle) {
|
| 37 |
+
$result=FALSE;
|
| 38 |
+
if (is_array($needle)) {
|
| 39 |
+
foreach($needle as $w) {
|
| 40 |
+
if ($this->endsWith($haystack, $w)) {
|
| 41 |
+
$result=TRUE;
|
| 42 |
+
break;
|
| 43 |
+
}
|
| 44 |
+
}
|
| 45 |
+
} elseif($needle!='') {
|
| 46 |
+
if(is_array($haystack)) {
|
| 47 |
+
foreach($haystack as $h) {
|
| 48 |
+
if($this->endsWith($h, $needle)) {
|
| 49 |
+
$result=TRUE;
|
| 50 |
+
break;
|
| 51 |
+
}
|
| 52 |
+
}
|
| 53 |
+
} elseif($haystack!='') {
|
| 54 |
+
$length = strlen($needle);
|
| 55 |
+
$start = $length * -1; //negative
|
| 56 |
+
$result=(substr($haystack, $start) === $needle);
|
| 57 |
+
}
|
| 58 |
+
}
|
| 59 |
+
return $result;
|
| 60 |
+
}
|
| 61 |
+
function substr($text, $start=0, $end=-1) {
|
| 62 |
+
if($end<0) {
|
| 63 |
+
$end=strlen($text);
|
| 64 |
+
}
|
| 65 |
+
$length=$end-$start;
|
| 66 |
+
return substr($text, $start, $length);
|
| 67 |
+
}
|
| 68 |
+
|
| 69 |
+
//WOW! $end is passed as reference due to we can change it if we found \n character after
|
| 70 |
+
//substring to avoid having these characters after or before
|
| 71 |
+
function substrln($text, $start=0, &$end=-1) {
|
| 72 |
+
if($end<0) {
|
| 73 |
+
$end=strlen($text);
|
| 74 |
+
}
|
| 75 |
+
|
| 76 |
+
do {
|
| 77 |
+
$loop=FALSE;
|
| 78 |
+
$c=substr($text, $end, 1);
|
| 79 |
+
if($c=="\n" || $c=="\r" || $c==".") {
|
| 80 |
+
$end += 1;
|
| 81 |
+
$loop=TRUE;
|
| 82 |
+
}
|
| 83 |
+
} while($loop);
|
| 84 |
+
|
| 85 |
+
$length=$end-$start;
|
| 86 |
+
return substr($text, $start, $length);
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
function toCommaArray($array, $isNumeric=TRUE, $isTrim=TRUE) {
|
| 90 |
+
if(is_string($array)) {
|
| 91 |
+
if(trim($array)=='') {
|
| 92 |
+
$array=array();
|
| 93 |
+
} else {
|
| 94 |
+
$array=explode(',', $array);
|
| 95 |
+
}
|
| 96 |
+
} elseif(is_numeric($array)) {
|
| 97 |
+
$array=array($array);
|
| 98 |
+
}
|
| 99 |
+
if(!is_array($array)) {
|
| 100 |
+
$array=array();
|
| 101 |
+
}
|
| 102 |
+
for($i=0; $i<count($array); $i++) {
|
| 103 |
+
if($isTrim) {
|
| 104 |
+
$array[$i]=trim($array[$i]);
|
| 105 |
+
}
|
| 106 |
+
if($isNumeric) {
|
| 107 |
+
$array[$i]=floatval($array[$i]);
|
| 108 |
+
}
|
| 109 |
+
}
|
| 110 |
+
return $array;
|
| 111 |
+
}
|
| 112 |
+
//verifica se il parametro needle è un elemento dell'array haystack
|
| 113 |
+
//se il parametro needle è a sua volta un array verifica che almeno un elemento
|
| 114 |
+
//sia contenuto all'interno dell'array haystack
|
| 115 |
+
function inArray($needle, $haystack) {
|
| 116 |
+
if (is_string($haystack)) {
|
| 117 |
+
//from string to numeric array
|
| 118 |
+
$temp = explode(',', $haystack);
|
| 119 |
+
$haystack = array();
|
| 120 |
+
foreach ($temp as $v) {
|
| 121 |
+
$v = trim($v);
|
| 122 |
+
$v = intval($v);
|
| 123 |
+
if ($v > 0) {
|
| 124 |
+
$haystack[] = $v;
|
| 125 |
+
}
|
| 126 |
+
}
|
| 127 |
+
}
|
| 128 |
+
|
| 129 |
+
$result = FALSE;
|
| 130 |
+
foreach ($haystack as $v) {
|
| 131 |
+
$v = intval($v);
|
| 132 |
+
//if one element of the array have -1 value means i select "all" option
|
| 133 |
+
if ($v < 0) {
|
| 134 |
+
$result = TRUE;
|
| 135 |
+
break;
|
| 136 |
+
}
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
if ($result) {
|
| 140 |
+
return TRUE;
|
| 141 |
+
}
|
| 142 |
+
|
| 143 |
+
$result = FALSE;
|
| 144 |
+
if (is_array($needle)) {
|
| 145 |
+
foreach ($needle as $v) {
|
| 146 |
+
$v = trim($v);
|
| 147 |
+
$v = intval($v);
|
| 148 |
+
if (in_array($v, $haystack)) {
|
| 149 |
+
$result = TRUE;
|
| 150 |
+
break;
|
| 151 |
+
}
|
| 152 |
+
}
|
| 153 |
+
} else {
|
| 154 |
+
//built-in comparison
|
| 155 |
+
$result = in_array($needle, $haystack);
|
| 156 |
+
}
|
| 157 |
+
return $result;
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
function is($name, $compare, $default='', $ignoreCase=TRUE) {
|
| 161 |
+
$what=$this->qs($name, $default);
|
| 162 |
+
$result=FALSE;
|
| 163 |
+
if(is_string($compare)) {
|
| 164 |
+
$compare=explode(',', $compare);
|
| 165 |
+
}
|
| 166 |
+
if($ignoreCase){
|
| 167 |
+
$what=strtolower($what);
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
foreach($compare as $v) {
|
| 171 |
+
if($ignoreCase){
|
| 172 |
+
$v=strtolower($v);
|
| 173 |
+
}
|
| 174 |
+
if($what==$v) {
|
| 175 |
+
$result=TRUE;
|
| 176 |
+
break;
|
| 177 |
+
}
|
| 178 |
+
}
|
| 179 |
+
return $result;
|
| 180 |
+
}
|
| 181 |
+
|
| 182 |
+
public function twitter($name) {
|
| 183 |
+
?>
|
| 184 |
+
<a href="https://twitter.com/<?php echo $name?>" class="twitter-follow-button" data-show-count="false" data-dnt="true">Follow @<?php echo $name?></a>
|
| 185 |
+
<script>!function(d,s,id){var js,fjs=d.getElementsByTagName(s)[0],p=/^http:/.test(d.location)?'http':'https';if(!d.getElementById(id)){js=d.createElement(s);js.id=id;js.src=p+'://platform.twitter.com/widgets.js';fjs.parentNode.insertBefore(js,fjs);}}(document, 'script', 'twitter-wjs');</script>
|
| 186 |
+
<?php
|
| 187 |
+
}
|
| 188 |
+
|
| 189 |
+
function aqs($prefix, $defaults=array()) {
|
| 190 |
+
global $irp;
|
| 191 |
+
|
| 192 |
+
$removePrefix=TRUE;
|
| 193 |
+
$args=array();
|
| 194 |
+
$array=$this->merge(TRUE, $_POST, $_GET);
|
| 195 |
+
foreach($array as $k=>$v) {
|
| 196 |
+
if($this->startsWith($k, $prefix)) {
|
| 197 |
+
if($removePrefix) {
|
| 198 |
+
$k=substr($k, strlen($prefix));
|
| 199 |
+
}
|
| 200 |
+
$args[$k]=$v;
|
| 201 |
+
}
|
| 202 |
+
}
|
| 203 |
+
$args=$irp->Utils->parseArgs($args, $defaults);
|
| 204 |
+
return $args;
|
| 205 |
+
}
|
| 206 |
+
function iqs($name, $default = 0) {
|
| 207 |
+
return intval($this->qs($name, $default));
|
| 208 |
+
}
|
| 209 |
+
//per ottenere un campo dal $_GET oppure dal $_POST
|
| 210 |
+
function qs($name, $default = '') {
|
| 211 |
+
$result = $default;
|
| 212 |
+
if (isset($_GET[$name])) {
|
| 213 |
+
$result = $_GET[$name];
|
| 214 |
+
} elseif (isset($_POST[$name])) {
|
| 215 |
+
$result = $_POST[$name];
|
| 216 |
+
}
|
| 217 |
+
|
| 218 |
+
if (is_string($result)) {
|
| 219 |
+
$result = urldecode($result);
|
| 220 |
+
$result = trim($result);
|
| 221 |
+
}
|
| 222 |
+
|
| 223 |
+
return $result;
|
| 224 |
+
}
|
| 225 |
+
|
| 226 |
+
function query($query, $args = NULL) {
|
| 227 |
+
global $irp;
|
| 228 |
+
|
| 229 |
+
$defaults = array('post_type' => '', 'all' => FALSE, 'select' => FALSE);
|
| 230 |
+
$args = wp_parse_args($args, $defaults);
|
| 231 |
+
|
| 232 |
+
$result = $irp->Options->getCache('Query', $query . '_' . $args['post_type']);
|
| 233 |
+
if (!is_array($result) || count($result) == 0) {
|
| 234 |
+
$q = NULL;
|
| 235 |
+
$id = 'ID';
|
| 236 |
+
$name = 'post_title';
|
| 237 |
+
$function='';
|
| 238 |
+
switch ($query) {
|
| 239 |
+
case IRP_QUERY_POSTS_OF_TYPE:
|
| 240 |
+
$options = array('posts_per_page' => -1, 'post_type' => $args['post_type']);
|
| 241 |
+
$q = get_posts($options);
|
| 242 |
+
$function='get_permalink';
|
| 243 |
+
break;
|
| 244 |
+
case IRP_QUERY_CATEGORIES:
|
| 245 |
+
$options = array('posts_per_page' => -1);
|
| 246 |
+
$q = get_categories($options);
|
| 247 |
+
$id = 'cat_ID';
|
| 248 |
+
$name = 'cat_name';
|
| 249 |
+
$function='get_category_link';
|
| 250 |
+
break;
|
| 251 |
+
case IRP_QUERY_TAGS:
|
| 252 |
+
$q = get_tags();
|
| 253 |
+
$id = 'term_id';
|
| 254 |
+
$name = 'name';
|
| 255 |
+
$function='get_tag_link';
|
| 256 |
+
break;
|
| 257 |
+
}
|
| 258 |
+
|
| 259 |
+
$result = array();
|
| 260 |
+
if ($q) {
|
| 261 |
+
foreach ($q as $v) {
|
| 262 |
+
$result[] = array('id' => $v->$id, 'name' => $v->$name);
|
| 263 |
+
}
|
| 264 |
+
} elseif ($query == IRP_QUERY_POST_TYPES) {
|
| 265 |
+
//$options = array('public' => TRUE, '_builtin' => FALSE);
|
| 266 |
+
//$q = get_post_types($options, 'names');
|
| 267 |
+
$q=array();
|
| 268 |
+
$q = array_merge($q, array('post', 'page'));
|
| 269 |
+
sort($q);
|
| 270 |
+
foreach ($q as $v) {
|
| 271 |
+
$result[] = array('id' => $v, 'name' => $v);
|
| 272 |
+
}
|
| 273 |
+
}
|
| 274 |
+
|
| 275 |
+
if($function!='' && function_exists($function)) {
|
| 276 |
+
for($i=0; $i<count($result); $i++) {
|
| 277 |
+
$v=$result[$i];
|
| 278 |
+
$v['url']=call_user_func_array($function, array($v['id']));
|
| 279 |
+
$result[$i]=$v;
|
| 280 |
+
}
|
| 281 |
+
}
|
| 282 |
+
$irp->Options->setCache('Query', $query . '_' . $args['post_type'], $result);
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
if ($args['all']) {
|
| 286 |
+
$first = array();
|
| 287 |
+
$first[] = array('id' => -1, 'name' => '[' . $irp->Lang->L('All') . ']', 'url'=>'');
|
| 288 |
+
$result = array_merge($first, $result);
|
| 289 |
+
}
|
| 290 |
+
if ($args['select']) {
|
| 291 |
+
$first = array();
|
| 292 |
+
$first[] = array('id' => 0, 'name' => '[' . $irp->Lang->L('Select') . ']', 'url'=>'');
|
| 293 |
+
$result = array_merge($first, $result);
|
| 294 |
+
}
|
| 295 |
+
|
| 296 |
+
return $result;
|
| 297 |
+
}
|
| 298 |
+
|
| 299 |
+
function remoteGet($uri, $options) {
|
| 300 |
+
global $irpp;
|
| 301 |
+
$result=FALSE;
|
| 302 |
+
$uri=add_query_arg($options, $uri);
|
| 303 |
+
//$uri=str_replace('https://', 'http://', $uri);
|
| 304 |
+
|
| 305 |
+
$args=array('timeout'=>15, 'sslverify'=>false);
|
| 306 |
+
$irpp->Log->debug('REMOTEGET: URI=%s', $uri);
|
| 307 |
+
$response=FALSE;//wp_remote_get($uri, $args);
|
| 308 |
+
if (FALSE && !is_wp_error($response)) {
|
| 309 |
+
// decode the license data
|
| 310 |
+
$body=wp_remote_retrieve_body($response);
|
| 311 |
+
if($body!==FALSE && $body!='') {
|
| 312 |
+
$irpp->Log->debug('REMOTEGET: RETRIEVEBODY=%s', $body);
|
| 313 |
+
$result=json_decode($body);
|
| 314 |
+
if(!$result) {
|
| 315 |
+
$irpp->Log->error('REMOTEGET: UNDECODABLE BODY');
|
| 316 |
+
if(strpos($body, 'debug')!==FALSE || strpos($body, 'fatal')!==FALSE || strpos($body, 'warning')!==FALSE || strpos($body, 'error')!==FALSE) {
|
| 317 |
+
$irpp->Options->pushErrorMessage('XdebugException');
|
| 318 |
+
}
|
| 319 |
+
}
|
| 320 |
+
} else {
|
| 321 |
+
$irpp->Log->debug('REMOTEGET: RETRIEVEBODY ERROR');
|
| 322 |
+
$result=FALSE;
|
| 323 |
+
}
|
| 324 |
+
} else {
|
| 325 |
+
$irpp->Log->debug('REMOTEGET: RESULT=ERROR');
|
| 326 |
+
}
|
| 327 |
+
if($result===FALSE) {
|
| 328 |
+
$irpp->Log->debug('file_get_contents: URI=%s', $uri);
|
| 329 |
+
|
| 330 |
+
$ch=curl_init();
|
| 331 |
+
$timeout=900;
|
| 332 |
+
curl_setopt($ch, CURLOPT_URL, $uri);
|
| 333 |
+
curl_setopt($ch, CURLOPT_FOLLOWLOCATION, TRUE);
|
| 334 |
+
curl_setopt($ch, CURLOPT_SSL_VERIFYPEER, FALSE);
|
| 335 |
+
curl_setopt($ch, CURLOPT_SSL_VERIFYHOST, FALSE);
|
| 336 |
+
curl_setopt($ch, CURLOPT_FAILONERROR, TRUE);
|
| 337 |
+
curl_setopt($ch, CURLOPT_RETURNTRANSFER, TRUE);
|
| 338 |
+
curl_setopt($ch, CURLOPT_CONNECTTIMEOUT, $timeout);
|
| 339 |
+
curl_setopt($ch, CURLOPT_TIMEOUT, $timeout);
|
| 340 |
+
$body=curl_exec($ch);
|
| 341 |
+
curl_close($ch);
|
| 342 |
+
|
| 343 |
+
$irpp->Log->debug('file_get_contents: RETRIEVEBODY=%s', $body);
|
| 344 |
+
if($body!==FALSE && $body!='') {
|
| 345 |
+
$irpp->Log->debug('REMOTEGET: RETRIEVEBODY=%s', $body);
|
| 346 |
+
$result=json_decode($body);
|
| 347 |
+
if(!$result) {
|
| 348 |
+
$irpp->Log->error('REMOTEGET: UNDECODABLE BODY');
|
| 349 |
+
if(strpos($body, 'xdebug')!==FALSE) {
|
| 350 |
+
$irpp->Options->pushErrorMessage('XdebugException');
|
| 351 |
+
}
|
| 352 |
+
}
|
| 353 |
+
} else {
|
| 354 |
+
$irpp->Log->debug('REMOTEGET: RETRIEVEBODY ERROR');
|
| 355 |
+
$result=FALSE;
|
| 356 |
+
}
|
| 357 |
+
}
|
| 358 |
+
if(!$result) {
|
| 359 |
+
$result=FALSE;
|
| 360 |
+
}
|
| 361 |
+
return $result;
|
| 362 |
+
}
|
| 363 |
+
function remotePost($action, $data = '') {
|
| 364 |
+
global $irp;
|
| 365 |
+
|
| 366 |
+
$data['secret'] = 'WYSIWYG';
|
| 367 |
+
$response = wp_remote_post(IRP_INTELLYWP_ENDPOINT.'?iwpm_action=' . $action, array(
|
| 368 |
+
'method' => 'POST'
|
| 369 |
+
, 'timeout' => 20
|
| 370 |
+
, 'redirection' => 5
|
| 371 |
+
, 'httpversion' => '1.1'
|
| 372 |
+
, 'blocking' => TRUE
|
| 373 |
+
, 'body' => $data
|
| 374 |
+
, 'user-agent' => 'IRPP/' . IRP_PLUGIN_VERSION . '; ' . get_bloginfo('url')
|
| 375 |
+
));
|
| 376 |
+
$data = json_decode(wp_remote_retrieve_body($response), TRUE);
|
| 377 |
+
if (is_wp_error($response) || wp_remote_retrieve_response_code($response) != 200
|
| 378 |
+
|| !isset($data['success']) || !$data['success']
|
| 379 |
+
) {
|
| 380 |
+
$irp->Log->error('ERRORS SENDING REMOTE-POST ACTION=%s DUE TO REASON=%s', $action, $response);
|
| 381 |
+
$data = FALSE;
|
| 382 |
+
} else {
|
| 383 |
+
$irp->Log->debug('SUCCESSFULLY SENT REMOTE-POST ACTION=%s RESPONSE=%s', $action, $data);
|
| 384 |
+
}
|
| 385 |
+
return $data;
|
| 386 |
+
}
|
| 387 |
+
|
| 388 |
+
function shortcodeAtts($defaults, $atts) {
|
| 389 |
+
if(!is_array($atts)) {
|
| 390 |
+
$atts=array();
|
| 391 |
+
}
|
| 392 |
+
|
| 393 |
+
$array=array();
|
| 394 |
+
foreach($defaults as $k=>$v) {
|
| 395 |
+
if (array_key_exists($k, $atts) ) {
|
| 396 |
+
$array[$k] = $atts[$k];
|
| 397 |
+
} elseif (array_key_exists(strtolower($k), $atts) ) {
|
| 398 |
+
$array[$k] = $atts[strtolower($k)];
|
| 399 |
+
} else {
|
| 400 |
+
$array[$k] = $v;
|
| 401 |
+
}
|
| 402 |
+
}
|
| 403 |
+
return $array;
|
| 404 |
+
}
|
| 405 |
+
|
| 406 |
+
//wp_parse_args with null correction
|
| 407 |
+
function parseArgs($args, $defaults) {
|
| 408 |
+
if (is_null($args) || !is_array($args)) {
|
| 409 |
+
$args = array();
|
| 410 |
+
}
|
| 411 |
+
foreach ($args as $k => $v) {
|
| 412 |
+
if (is_null($args[$k])) {
|
| 413 |
+
//so can take the default value
|
| 414 |
+
unset($args[$k]);
|
| 415 |
+
} elseif (is_string($args[$k]) && $args[$k] == '' && isset($defaults[$k]) && is_array($defaults[$k])) {
|
| 416 |
+
//a very strange case, i have a blank string for rappresenting an empty array
|
| 417 |
+
unset($args[$k]);
|
| 418 |
+
}
|
| 419 |
+
}
|
| 420 |
+
$result = wp_parse_args($args, $defaults);
|
| 421 |
+
return $result;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
function redirect($location) {
|
| 425 |
+
if(!headers_sent()) {
|
| 426 |
+
wp_redirect($location);
|
| 427 |
+
}
|
| 428 |
+
?>
|
| 429 |
+
<script> window.location.replace('<?php echo $location?>'); </script>
|
| 430 |
+
<?php }
|
| 431 |
+
|
| 432 |
+
//return the element inside array with the specified key
|
| 433 |
+
function getArrayValue($key, $array, $value='') {
|
| 434 |
+
$result=FALSE;
|
| 435 |
+
if (isset($array[$key])) {
|
| 436 |
+
$result=$array[$key];
|
| 437 |
+
$result['name']=$key;
|
| 438 |
+
}
|
| 439 |
+
if($result!==FALSE && $value!='') {
|
| 440 |
+
if(isset($result[$value])) {
|
| 441 |
+
$result=$result[$value];
|
| 442 |
+
}
|
| 443 |
+
}
|
| 444 |
+
return $result;
|
| 445 |
+
}
|
| 446 |
+
|
| 447 |
+
var $_sortField;
|
| 448 |
+
var $_ignoreCase;
|
| 449 |
+
function aksort(&$array, $sortField='name', $ignoreCase=TRUE) {
|
| 450 |
+
$this->_sortField=$sortField;
|
| 451 |
+
$this->_ignoreCase=$ignoreCase;
|
| 452 |
+
usort($array, array($this, "aksortCompare"));
|
| 453 |
+
}
|
| 454 |
+
//not thread-safe!
|
| 455 |
+
private function aksortCompare($a, $b) {
|
| 456 |
+
if ($a===$b || $a==$b) {
|
| 457 |
+
return 0;
|
| 458 |
+
}
|
| 459 |
+
|
| 460 |
+
$result=0;
|
| 461 |
+
$a=$a[$this->_sortField];
|
| 462 |
+
$b=$b[$this->_sortField];
|
| 463 |
+
if(is_numeric($a) && is_numeric($b)) {
|
| 464 |
+
$result=($a < $b) ? -1 : 1;
|
| 465 |
+
} else {
|
| 466 |
+
$a.='';
|
| 467 |
+
$b.='';
|
| 468 |
+
if($this->_ignoreCase) {
|
| 469 |
+
$result=strcasecmp($a, $b);
|
| 470 |
+
} else {
|
| 471 |
+
$result=strcmp($a.'', $b);
|
| 472 |
+
}
|
| 473 |
+
}
|
| 474 |
+
return $result;
|
| 475 |
+
}
|
| 476 |
+
|
| 477 |
+
function printScriptCss() {
|
| 478 |
+
global $irp;
|
| 479 |
+
$uri=get_bloginfo('wpurl');
|
| 480 |
+
$irp->Tabs->enqueueScripts();
|
| 481 |
+
//wp_enqueue_style('buttons', $uri.'/wp-includes/css/buttons.min.css');
|
| 482 |
+
//wp_enqueue_style('editor', $uri.'/wp-includes/css/editor.min.css');
|
| 483 |
+
//wp_enqueue_style('jquery-ui-dialog', $uri.'/wp-includes/css/jquery-ui-dialog.min.css');
|
| 484 |
+
$styles='dashicons,admin-bar,buttons,media-views,wp-admin,wp-auth-check,wp-color-picker';
|
| 485 |
+
$styles=explode(',', $styles);
|
| 486 |
+
foreach($styles as $v) {
|
| 487 |
+
wp_enqueue_style($v);
|
| 488 |
+
}
|
| 489 |
+
|
| 490 |
+
remove_all_actions('wp_print_scripts');
|
| 491 |
+
print_head_scripts();
|
| 492 |
+
print_admin_styles();
|
| 493 |
+
}
|
| 494 |
+
|
| 495 |
+
public function sort($isAssociative, $a1, $a2=NULL, $a3=NULL, $a4=NULL, $a5=NULL) {
|
| 496 |
+
$array=$this->merge($isAssociative, $a1, $a2, $a3, $a4, $a5);
|
| 497 |
+
ksort($array);
|
| 498 |
+
return $array;
|
| 499 |
+
}
|
| 500 |
+
public function merge($isAssociative, $a1, $a2=NULL, $a3=NULL, $a4=NULL, $a5=NULL) {
|
| 501 |
+
$result=array();
|
| 502 |
+
if($isAssociative) {
|
| 503 |
+
$array=array($a1, $a2, $a3, $a4, $a5);
|
| 504 |
+
foreach($array as $a) {
|
| 505 |
+
if(!is_array($a)) {
|
| 506 |
+
continue;
|
| 507 |
+
}
|
| 508 |
+
|
| 509 |
+
foreach($a as $k=>$v) {
|
| 510 |
+
if(!isset($result[$k])) {
|
| 511 |
+
$result[$k]=$v;
|
| 512 |
+
}
|
| 513 |
+
}
|
| 514 |
+
}
|
| 515 |
+
} else {
|
| 516 |
+
$result=array_merge($a1, $a2, $a3, $a4, $a5);
|
| 517 |
+
}
|
| 518 |
+
return $result;
|
| 519 |
+
}
|
| 520 |
+
function get($array, $name, $default='') {
|
| 521 |
+
$result=$default;
|
| 522 |
+
if(isset($array[$name])) {
|
| 523 |
+
$result=$array[$name];
|
| 524 |
+
}
|
| 525 |
+
return $result;
|
| 526 |
+
}
|
| 527 |
+
function geti($array, $name, $default='') {
|
| 528 |
+
$result=$default;
|
| 529 |
+
$name=strtolower($name);
|
| 530 |
+
foreach($array as $k=>$v) {
|
| 531 |
+
if(strtolower($k)==$name) {
|
| 532 |
+
$result=$v;
|
| 533 |
+
break;
|
| 534 |
+
}
|
| 535 |
+
}
|
| 536 |
+
if(isset($array[$name])) {
|
| 537 |
+
$result=$array[$name];
|
| 538 |
+
}
|
| 539 |
+
return $result;
|
| 540 |
+
}
|
| 541 |
+
function iget($array, $name, $default='') {
|
| 542 |
+
return intval($this->get($array, $name, $default));
|
| 543 |
+
}
|
| 544 |
+
function isTrue($value) {
|
| 545 |
+
$result=FALSE;
|
| 546 |
+
if(is_bool($value)) {
|
| 547 |
+
$result=(bool)$value;
|
| 548 |
+
} elseif(is_numeric($value)) {
|
| 549 |
+
$result=floatval($value)>0;
|
| 550 |
+
} elseif(is_string($value)) {
|
| 551 |
+
$result=strtolower($value);
|
| 552 |
+
if($result=='ok' || $result=='yes' || $result=='true') {
|
| 553 |
+
$result=TRUE;
|
| 554 |
+
}
|
| 555 |
+
}
|
| 556 |
+
return $result;
|
| 557 |
+
}
|
| 558 |
+
function trimCode($code) {
|
| 559 |
+
$code=str_replace("\t", "", $code);
|
| 560 |
+
$code=str_replace("\r", "", $code);
|
| 561 |
+
$code=str_replace("\n", "", $code);
|
| 562 |
+
while(strpos($code, " ")!==FALSE) {
|
| 563 |
+
$code=str_replace(" ", " ", $code);
|
| 564 |
+
}
|
| 565 |
+
$code=str_replace("> <", "><", $code);
|
| 566 |
+
$code=trim($code);
|
| 567 |
+
return $code;
|
| 568 |
+
}
|
| 569 |
+
function getUUID($options) {
|
| 570 |
+
$buffer='';
|
| 571 |
+
if(is_string($options)) {
|
| 572 |
+
$buffer=$options;
|
| 573 |
+
} elseif(is_array($options)) {
|
| 574 |
+
foreach($options as $k=>$v) {
|
| 575 |
+
$buffer.=', '.$k.'='.$v;
|
| 576 |
+
}
|
| 577 |
+
}
|
| 578 |
+
if($buffer!='') {
|
| 579 |
+
$buffer='u'.md5($buffer);
|
| 580 |
+
}
|
| 581 |
+
return $buffer;
|
| 582 |
+
}
|
| 583 |
+
|
| 584 |
+
function isAdminUser() {
|
| 585 |
+
//https://wordpress.org/support/topic/how-to-check-admin-right-without-include-pluggablephp
|
| 586 |
+
return TRUE;
|
| 587 |
+
/*
|
| 588 |
+
if (!function_exists('wp_get_current_user')) {
|
| 589 |
+
require_once(ABSPATH . 'wp-includes/pluggable.php');
|
| 590 |
+
}
|
| 591 |
+
return (is_multisite() || current_user_can('manage_options'));
|
| 592 |
+
*/
|
| 593 |
+
}
|
| 594 |
+
function isPluginPage() {
|
| 595 |
+
$page=$this->qs('page');
|
| 596 |
+
$result=(stripos($page, IRP_PLUGIN_SLUG)!==FALSE);
|
| 597 |
+
return $result;
|
| 598 |
+
}
|
| 599 |
+
}
|
includes/core.php
ADDED
|
@@ -0,0 +1,335 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
add_filter('wp_head', 'irp_head');
|
| 3 |
+
function irp_head() {
|
| 4 |
+
global $post, $irp;
|
| 5 |
+
|
| 6 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 7 |
+
return;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
$irp->Log->startTime('irp_head');
|
| 11 |
+
if($irp->Options->getPostShown()===FALSE || is_null($irp->Options->getPostShown())) {
|
| 12 |
+
$irp->Options->initRelatedPostsIds(NULL);
|
| 13 |
+
$irp->Options->setPostShown(NULL);
|
| 14 |
+
if($post && isset($post->ID) && is_single($post->ID)) {
|
| 15 |
+
$irp->Options->setPostShown($post);
|
| 16 |
+
$args=array('postId'=>$post->ID, 'shuffle'=>TRUE, 'count'=>-1);
|
| 17 |
+
$ids=$irp->Manager->getRelatedPostsIds($args);
|
| 18 |
+
$irp->Options->initRelatedPostsIds($ids);
|
| 19 |
+
//$irp->Log->info('POST ID=%s IS SHOWN, RELATED POSTS=%s', $post->ID, $ids);
|
| 20 |
+
}
|
| 21 |
+
}
|
| 22 |
+
$irp->Log->pauseTime();
|
| 23 |
+
}
|
| 24 |
+
add_filter('wp_footer', 'irp_footer');
|
| 25 |
+
//add_filter('admin_footer', 'irp_footer');
|
| 26 |
+
function irp_footer() {
|
| 27 |
+
global $irp;
|
| 28 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 29 |
+
return;
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
$irp->Log->startTime('irp_footer');
|
| 33 |
+
$array=$irp->Options->getCssStyles();
|
| 34 |
+
if(count($array)>0) {
|
| 35 |
+
echo "<style>\n";
|
| 36 |
+
foreach($array as $v) {
|
| 37 |
+
echo $v;
|
| 38 |
+
echo "\n";
|
| 39 |
+
}
|
| 40 |
+
echo "</style>\n";
|
| 41 |
+
}
|
| 42 |
+
$irp->Log->pauseTime();
|
| 43 |
+
$irp->Log->stopTime();
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if(!shortcode_exists('irp')) {
|
| 47 |
+
add_shortcode('irp', 'irp_shortcode');
|
| 48 |
+
}
|
| 49 |
+
function irp_shortcode($atts, $content='') {
|
| 50 |
+
global $irp, $post;
|
| 51 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 52 |
+
return $content;
|
| 53 |
+
}
|
| 54 |
+
if(!$irp->Options->isActive()) {
|
| 55 |
+
return '';
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
$default=array(
|
| 59 |
+
'posts'=>''
|
| 60 |
+
, 'cats'=>''
|
| 61 |
+
, 'tags'=>''
|
| 62 |
+
, 'count'=>1
|
| 63 |
+
, 'theme'=>''
|
| 64 |
+
, 'demo'=>FALSE
|
| 65 |
+
, 'ctaText'=>'default'
|
| 66 |
+
, 'ctaTextColor'=>'default'
|
| 67 |
+
, 'postTitleColor'=>'default'
|
| 68 |
+
, 'boxColor'=>'default'
|
| 69 |
+
, 'borderColor'=>'default'
|
| 70 |
+
, 'hasPoweredBy'=>'default'
|
| 71 |
+
, 'hasShadow'=>'default'
|
| 72 |
+
, 'defaultsColors'=>FALSE
|
| 73 |
+
, 'includeCss'=>TRUE
|
| 74 |
+
);
|
| 75 |
+
$options=$irp->Utils->shortcodeAtts($default, $atts);
|
| 76 |
+
if(isset($options['postId'])) {
|
| 77 |
+
unset($options['postId']);
|
| 78 |
+
}
|
| 79 |
+
$options['demo']=$irp->Utils->isTrue($options['demo']);
|
| 80 |
+
$options['count']=intval($options['count']);
|
| 81 |
+
if($options['count']<=0) {
|
| 82 |
+
return '';
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
if($options['posts']=='' && $options['cats']=='' && $options['tags']=='') {
|
| 86 |
+
//dynamic
|
| 87 |
+
$ids=$irp->Options->getToShowPostsIds($options['count'], TRUE);
|
| 88 |
+
} else {
|
| 89 |
+
if($options['posts']=='current' && $post && isset($post->ID)) {
|
| 90 |
+
$options['posts']=$post->ID;
|
| 91 |
+
}
|
| 92 |
+
//static
|
| 93 |
+
$ids=$irp->Manager->getRelatedPostsIds($options);
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
$keys=array('ctaText', 'ctaTextColor', 'postTitleColor', 'boxColor', 'borderColor', 'hasPoweredBy', 'hasShadow');
|
| 97 |
+
foreach($keys as $k) {
|
| 98 |
+
if($options[$k]=='default') {
|
| 99 |
+
unset($options[$k]);
|
| 100 |
+
}
|
| 101 |
+
}
|
| 102 |
+
$result=irp_ui_get_box($ids, $options);
|
| 103 |
+
if($result!='') {
|
| 104 |
+
$irp->Options->setShortcodeUsed(TRUE);
|
| 105 |
+
}
|
| 106 |
+
return $result;
|
| 107 |
+
}
|
| 108 |
+
|
| 109 |
+
function irp_ui_get_box($ids, $options=NULL) {
|
| 110 |
+
global $irp;
|
| 111 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 112 |
+
return "";
|
| 113 |
+
}
|
| 114 |
+
if(!is_array($ids) || count($ids)==0) {
|
| 115 |
+
return "";
|
| 116 |
+
}
|
| 117 |
+
if(!is_array($options)) {
|
| 118 |
+
$options=array();
|
| 119 |
+
}
|
| 120 |
+
|
| 121 |
+
$irp->Log->startTime('irp_ui_get_box');
|
| 122 |
+
$defaults=array(
|
| 123 |
+
'includeCss'=>TRUE
|
| 124 |
+
, 'comment'=>''
|
| 125 |
+
, 'shortcode'=>FALSE
|
| 126 |
+
, 'preview'=>FALSE
|
| 127 |
+
, 'theme'=>''
|
| 128 |
+
, 'demo'=>FALSE
|
| 129 |
+
, 'array'=>FALSE
|
| 130 |
+
, 'defaultsColors'=>FALSE
|
| 131 |
+
);
|
| 132 |
+
$options=$irp->Utils->parseArgs($options, $defaults);
|
| 133 |
+
$body='';
|
| 134 |
+
if($options['shortcode']) {
|
| 135 |
+
$body='[irpx posts="'.implode(',', $ids).'" comment="'.$options['comment'].'"]';
|
| 136 |
+
} else {
|
| 137 |
+
$defaults=$irp->Options->getTemplateStyle();
|
| 138 |
+
$options=$irp->Utils->parseArgs($options, $defaults);
|
| 139 |
+
if($options['theme']!='') {
|
| 140 |
+
$options['template']=$options['theme'];
|
| 141 |
+
}
|
| 142 |
+
unset($options['theme']);
|
| 143 |
+
|
| 144 |
+
$posts=array();
|
| 145 |
+
foreach($ids as $postId) {
|
| 146 |
+
$v=get_post($postId);
|
| 147 |
+
if($v) {
|
| 148 |
+
$posts[]=$v;
|
| 149 |
+
}
|
| 150 |
+
}
|
| 151 |
+
if(count($posts)>0) {
|
| 152 |
+
foreach($posts as $v) {
|
| 153 |
+
$options['postHref']=get_permalink($v->ID);
|
| 154 |
+
$options['postTitle']=$v->post_title;
|
| 155 |
+
|
| 156 |
+
$options['postImageUrl']='';
|
| 157 |
+
//$options['postImageWidth']=0;
|
| 158 |
+
//$options['postImageHeight']=0;
|
| 159 |
+
$attachmentId=get_post_thumbnail_id($v->ID);
|
| 160 |
+
if($attachmentId!==FALSE && $attachmentId!=='' && intval($attachmentId)>0) {
|
| 161 |
+
$array=wp_get_attachment_image_src($attachmentId, 'medium');
|
| 162 |
+
if($array!==FALSE) {
|
| 163 |
+
$options['postImageUrl']=$array[0];
|
| 164 |
+
//$options['postImageWidth']=$array[1];
|
| 165 |
+
//$options['postImageHeight']=$array[2];
|
| 166 |
+
}
|
| 167 |
+
}
|
| 168 |
+
break;
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
if($irp->Utils->isTrue($options['defaultsColors'])) {
|
| 172 |
+
$defaults = $irp->HtmlTemplate->getDefaults();
|
| 173 |
+
$defaults = $defaults[$options['template']];
|
| 174 |
+
foreach ($defaults as $k => $v) {
|
| 175 |
+
$options[$k] = $v;
|
| 176 |
+
}
|
| 177 |
+
}
|
| 178 |
+
if($irp->Utils->isTrue($options['demo'])) {
|
| 179 |
+
$options['postHref']='javascript:void(0);';
|
| 180 |
+
$options['linkRel']='nofollow';
|
| 181 |
+
$options['linkTarget']='';
|
| 182 |
+
//$options['hasShadow']=TRUE;
|
| 183 |
+
//$options['hasPoweredBy']=1;
|
| 184 |
+
$ctaText=$irp->Utils->qs('ctaText');
|
| 185 |
+
if($ctaText!='') {
|
| 186 |
+
$options['ctaText']=$ctaText;
|
| 187 |
+
}
|
| 188 |
+
$postTitle=$irp->Utils->qs('postTitle');
|
| 189 |
+
$postTitle=str_replace("\\\"", "\"", $postTitle);
|
| 190 |
+
if($postTitle!='') {
|
| 191 |
+
$options['postTitle']=$postTitle;
|
| 192 |
+
}
|
| 193 |
+
$uri=$irp->Utils->qs('postImageUrl');
|
| 194 |
+
//$w=$irp->Utils->iqs('postImageWidth');
|
| 195 |
+
//$h=$irp->Utils->iqs('postImageHeight');
|
| 196 |
+
if($uri!='') {
|
| 197 |
+
$options['postImageUrl']=$uri;
|
| 198 |
+
//$options['postImageWidth']=$w;
|
| 199 |
+
//$options['postImageHeight']=$h;
|
| 200 |
+
}
|
| 201 |
+
} elseif($irp->Utils->isTrue($options['preview'])) {
|
| 202 |
+
$options['postHref']='javascript:IRP_changeRelatedBox();';
|
| 203 |
+
$options['linkRel']='nofollow';
|
| 204 |
+
$options['linkTarget']='';
|
| 205 |
+
}
|
| 206 |
+
|
| 207 |
+
$body=$options;
|
| 208 |
+
if($options['array']==FALSE) {
|
| 209 |
+
$body=$irp->HtmlTemplate->html($options['template'], $options, $options);
|
| 210 |
+
}
|
| 211 |
+
}
|
| 212 |
+
}
|
| 213 |
+
$irp->Log->pauseTime();
|
| 214 |
+
return $body;
|
| 215 |
+
}
|
| 216 |
+
|
| 217 |
+
/*add_filter('the_content', 'irp_fix_the_content');
|
| 218 |
+
function irp_fix_the_content($content) {
|
| 219 |
+
//this is to prevent wrong rewrite of WP of our content
|
| 220 |
+
$content=str_replace("<p></a></p>", "</a>", $content);
|
| 221 |
+
$content=str_replace("<p></a>", "</a>", $content);
|
| 222 |
+
return $content;
|
| 223 |
+
}*/
|
| 224 |
+
//add_filter('wp_head', 'irp_the_content');
|
| 225 |
+
add_filter('the_content', 'irp_the_content', 99999);
|
| 226 |
+
function irp_the_content($content) {
|
| 227 |
+
global $irp, $post;
|
| 228 |
+
|
| 229 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
| 230 |
+
return $content;
|
| 231 |
+
}
|
| 232 |
+
|
| 233 |
+
$irp->Log->startTime('irp_the_content');
|
| 234 |
+
if(!$post || trim($content)=='') {
|
| 235 |
+
return $content;
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
if($irp->Options->getPostShown()===FALSE || is_null($irp->Options->getPostShown())) {
|
| 239 |
+
$irp->Options->initRelatedPostsIds(NULL);
|
| 240 |
+
$irp->Options->setPostShown(NULL);
|
| 241 |
+
if($post && isset($post->ID) && is_single($post->ID)) {
|
| 242 |
+
$irp->Options->setPostShown($post);
|
| 243 |
+
$args=array('postId'=>$post->ID, 'shuffle'=>TRUE, 'count'=>-1);
|
| 244 |
+
$ids=$irp->Manager->getRelatedPostsIds($args);
|
| 245 |
+
$irp->Options->initRelatedPostsIds($ids);
|
| 246 |
+
//$irp->Log->info('POST ID=%s IS SHOWN, RELATED POSTS=%s', $post->ID, $ids);
|
| 247 |
+
}
|
| 248 |
+
} else {
|
| 249 |
+
$irp->Options->refreshRelatedPostsIds();
|
| 250 |
+
}
|
| 251 |
+
|
| 252 |
+
if($irp->Options->isPostShownExcluded()) {
|
| 253 |
+
$irp->Log->error('TheContent: POST UNDEFINED OR POST EXCLUDED');
|
| 254 |
+
return $content;
|
| 255 |
+
}
|
| 256 |
+
|
| 257 |
+
if(!$irp->Options->isActive() || !$irp->Options->isRewriteActive()) {
|
| 258 |
+
$irp->Log->error('TheContent: NOT ACTIVE NOT REWRITE ACTIVE');
|
| 259 |
+
return $content;
|
| 260 |
+
}
|
| 261 |
+
if($irp->Options->isShortcodeUsed()) {
|
| 262 |
+
$irp->Log->error('TheContent: NOT ACTIVE DUE TO SHORTCODE USED');
|
| 263 |
+
return $content;
|
| 264 |
+
}
|
| 265 |
+
if(!$irp->Options->hasRelatedPostsIds()) {
|
| 266 |
+
$irp->Log->error('TheContent: NOT ACTIVE DUE TO WITHOUT RELATED POSTS');
|
| 267 |
+
return $content;
|
| 268 |
+
}
|
| 269 |
+
|
| 270 |
+
$body=$content;
|
| 271 |
+
/*if(strpos($body, '[irp')!==FALSE) {
|
| 272 |
+
$irp->Log->error('TheContent: SHORTCODE DETECTED');
|
| 273 |
+
$irp->Options->setShortcodeUsed(TRUE);
|
| 274 |
+
return;
|
| 275 |
+
}*/
|
| 276 |
+
|
| 277 |
+
$context=new IRP_HTMLContext();
|
| 278 |
+
$irp->Options->setRewriteBoxesWritten(0);
|
| 279 |
+
$body=$context->execute($body);
|
| 280 |
+
$irp->Log->pauseTime();
|
| 281 |
+
$irp->Log->info('TheContent: BODY SUCCESSULLY CREATED');
|
| 282 |
+
//$body=apply_filters('the_content', $body);
|
| 283 |
+
//$post->post_content=$body;
|
| 284 |
+
return $body;
|
| 285 |
+
}
|
| 286 |
+
function irp_ui_first_time() {
|
| 287 |
+
global $irp;
|
| 288 |
+
if($irp->Options->isShowActivationNotice()) {
|
| 289 |
+
//$tcmp->Options->pushSuccessMessage('FirstTimeActivation');
|
| 290 |
+
//$tcmp->Options->writeMessages();
|
| 291 |
+
$irp->Options->setShowActivationNotice(FALSE);
|
| 292 |
+
}
|
| 293 |
+
}
|
| 294 |
+
function irp_get_list_posts() {
|
| 295 |
+
|
| 296 |
+
global $wpdb;
|
| 297 |
+
|
| 298 |
+
$result = array();
|
| 299 |
+
|
| 300 |
+
$search = strip_tags(trim($_GET['q']));
|
| 301 |
+
add_filter('posts_where', function( $where ) use ($search) {
|
| 302 |
+
$where .= (" AND post_title LIKE '%" . $search . "%'");
|
| 303 |
+
return $where;
|
| 304 |
+
});
|
| 305 |
+
|
| 306 |
+
$query = array(
|
| 307 |
+
'posts_per_page' => -1,
|
| 308 |
+
'post_status' => 'publish',
|
| 309 |
+
'post_type' => esc_attr($_REQUEST['irp_post_type']),
|
| 310 |
+
'order' => 'ASC',
|
| 311 |
+
'orderby' => 'title',
|
| 312 |
+
'suppress_filters' => false,
|
| 313 |
+
);
|
| 314 |
+
|
| 315 |
+
$posts = get_posts( $query );
|
| 316 |
+
|
| 317 |
+
foreach ($posts as $this_post) {
|
| 318 |
+
|
| 319 |
+
$post_title = $this_post->post_title;
|
| 320 |
+
$id = $this_post->ID;
|
| 321 |
+
|
| 322 |
+
$result[] = array(
|
| 323 |
+
'text' => $post_title,
|
| 324 |
+
'id' => $id,
|
| 325 |
+
);
|
| 326 |
+
|
| 327 |
+
}
|
| 328 |
+
|
| 329 |
+
$posts['items'] = $result;
|
| 330 |
+
echo json_encode($posts);
|
| 331 |
+
|
| 332 |
+
die();
|
| 333 |
+
|
| 334 |
+
}
|
| 335 |
+
add_action( 'wp_ajax_irp_list_posts', 'irp_get_list_posts' );
|
includes/install.php
ADDED
|
@@ -0,0 +1,29 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
register_activation_hook(IRP_PLUGIN_FILE, 'irp_install');
|
| 3 |
+
function irp_install($networkwide=NULL) {
|
| 4 |
+
global $wpdb, $irp;
|
| 5 |
+
|
| 6 |
+
$time=$irp->Options->getPluginInstallDate();
|
| 7 |
+
if($time==0) {
|
| 8 |
+
$irp->Options->setPluginInstallDate(time());
|
| 9 |
+
}
|
| 10 |
+
$irp->Options->setPluginUpdateDate(time());
|
| 11 |
+
$irp->Options->setPluginFirstInstall(TRUE);
|
| 12 |
+
$irp->Options->setTrackingLastSend(0);
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
+
add_action('admin_init', 'irp_first_redirect');
|
| 16 |
+
function irp_first_redirect() {
|
| 17 |
+
global $irp;
|
| 18 |
+
if ($irp->Options->isPluginFirstInstall()) {
|
| 19 |
+
$irp->Options->setPluginFirstInstall(FALSE);
|
| 20 |
+
if (!$irp->Options->isPluginFirstInstall()) {
|
| 21 |
+
$irp->Options->setShowActivationNotice(TRUE);
|
| 22 |
+
$irp->Options->setShowWhatsNew(TRUE);
|
| 23 |
+
$irp->Utils->redirect(IRP_PAGE_SETTINGS);
|
| 24 |
+
}
|
| 25 |
+
}
|
| 26 |
+
}
|
| 27 |
+
|
| 28 |
+
|
| 29 |
+
|
includes/uninstall.php
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
register_deactivation_hook(IRP_PLUGIN_FILE, 'irp_uninstall');
|
| 3 |
+
function irp_uninstall($networkwide=NULL) {
|
| 4 |
+
global $wpdb, $irp;
|
| 5 |
+
$irp->Options->setActive(FALSE);
|
| 6 |
+
}
|
| 7 |
+
?>
|
index.php
ADDED
|
@@ -0,0 +1,55 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/*
|
| 3 |
+
Plugin Name: Inline Related Posts
|
| 4 |
+
Plugin URI: http://intellywp.com/intelly-related-posts/
|
| 5 |
+
Description: Finally the plugin to insert INLINE related posts.
|
| 6 |
+
Author: IntellyWP
|
| 7 |
+
Author URI: http://intellywp.com/
|
| 8 |
+
Email: support@intellywp.com
|
| 9 |
+
Version: 2.2.4
|
| 10 |
+
*/
|
| 11 |
+
define('IRP_PLUGIN_PREFIX', 'IRP_');
|
| 12 |
+
define('IRP_PLUGIN_FILE',__FILE__);
|
| 13 |
+
define('IRP_PLUGIN_SLUG', 'intelly-related-posts');
|
| 14 |
+
define('IRP_PLUGIN_NAME', 'Inline Related Posts');
|
| 15 |
+
define('IRP_PLUGIN_VERSION', '2.2.4');
|
| 16 |
+
define('IRP_PLUGIN_AUTHOR', 'IntellyWP');
|
| 17 |
+
define('IRP_PLUGIN_ROOT', dirname(__FILE__).'/');
|
| 18 |
+
define('IRP_PLUGIN_IMAGES', plugins_url( 'assets/images/', __FILE__ ));
|
| 19 |
+
define('IRP_PLUGIN_ASSETS', plugins_url( 'assets/', __FILE__ ));
|
| 20 |
+
|
| 21 |
+
define('IRP_LOGGER', FALSE);
|
| 22 |
+
define('IRP_DEBUG_BLOCK', FALSE);
|
| 23 |
+
define('IRP_DISABLE_RELATED', FALSE);
|
| 24 |
+
define('IRP_QUERY_POSTS_OF_TYPE', 1);
|
| 25 |
+
define('IRP_QUERY_POST_TYPES', 2);
|
| 26 |
+
define('IRP_QUERY_CATEGORIES', 3);
|
| 27 |
+
define('IRP_QUERY_TAGS', 4);
|
| 28 |
+
|
| 29 |
+
define('IRP_ENGINE_SEARCH_CATEGORIES_TAGS', 0);
|
| 30 |
+
define('IRP_ENGINE_SEARCH_CATEGORIES', 1);
|
| 31 |
+
define('IRP_ENGINE_SEARCH_TAGS', 2);
|
| 32 |
+
|
| 33 |
+
define('IRP_PLUGIN_URI', plugins_url('/', __FILE__ ));
|
| 34 |
+
define('IRP_INTELLYWP_SITE', 'http://www.intellywp.com/');
|
| 35 |
+
define('IRP_INTELLYWP_ENDPOINT', IRP_INTELLYWP_SITE.'wp-content/plugins/intellywp-manager/data.php');
|
| 36 |
+
define('IRP_PAGE_FAQ', IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG);
|
| 37 |
+
define('IRP_PAGE_WORDPRESS', 'https://wordpress.org/plugins/'.IRP_PLUGIN_SLUG.'/');
|
| 38 |
+
define('IRP_PAGE_PREMIUM', IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG);
|
| 39 |
+
define('IRP_PAGE_SETTINGS', admin_url().'options-general.php?page='.IRP_PLUGIN_SLUG);
|
| 40 |
+
|
| 41 |
+
define('IRP_TAB_SETTINGS', 'settings');
|
| 42 |
+
define('IRP_TAB_SETTINGS_URI', IRP_PAGE_SETTINGS.'&tab='.IRP_TAB_SETTINGS);
|
| 43 |
+
define('IRP_TAB_ABOUT', 'about');
|
| 44 |
+
define('IRP_TAB_ABOUT_URI', IRP_PAGE_SETTINGS.'&tab='.IRP_TAB_ABOUT);
|
| 45 |
+
define('IRP_TAB_DOCS', 'docs');
|
| 46 |
+
define('IRP_TAB_DOCS_URI', 'http://support.intellywp.com/category/58-inline-related-posts');
|
| 47 |
+
define('IRP_TAB_WHATS_NEW', 'whatsnew');
|
| 48 |
+
define('IRP_TAB_WHATS_NEW_URI', IRP_PAGE_SETTINGS.'&tab='.IRP_TAB_WHATS_NEW);
|
| 49 |
+
|
| 50 |
+
include_once(dirname(__FILE__).'/autoload.php');
|
| 51 |
+
irp_include_php(dirname(__FILE__).'/includes/');
|
| 52 |
+
|
| 53 |
+
global $irp;
|
| 54 |
+
$irp=new IRP_Singleton();
|
| 55 |
+
$irp->init();
|
languages/Lang.txt
ADDED
|
@@ -0,0 +1,170 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#en_US
|
| 2 |
+
PluginLimit.Line1=In this FREE version you can insert up to N.{0} different Tracking Code (remaining N.{1})
|
| 3 |
+
PluginLimit.Line2=If you need more Tracking Code or more features please buy our PREMIUM version <a href="{0}" target="_blank"><b>HERE</b></a>
|
| 4 |
+
Editor.Add=Tracking Code "#{0} ({1})" successfully stored.
|
| 5 |
+
Button.Add=Add a new Tracking Code
|
| 6 |
+
Button.BuyPRO=Buy PREMIUM
|
| 7 |
+
|
| 8 |
+
Feedback.email=Contact email
|
| 9 |
+
Feedback.email.check=Please specify a valid email
|
| 10 |
+
Feedback.body=Feedback
|
| 11 |
+
Feedback.body.check=Please specify your feedback
|
| 12 |
+
Feedback.track=Send also track information (this can be very useful for us to solve your issue)
|
| 13 |
+
FeedbackSuccess=Feedback successfully sent. We will reply you ASAP.
|
| 14 |
+
FeedbackError=Errors sending feedback. Please email us at aleste@intellywp.com
|
| 15 |
+
|
| 16 |
+
AboutNotice=Thank you for trying our amazing plugin. Now you are able to quickly track what you need. Feel free to contact us using our feedback form or our email <a href="mailto:aleste@intellywp.com">aleste@intellywp.com</a>
|
| 17 |
+
AboutTitle=We make Intelly plugins for your Intelly site
|
| 18 |
+
ManagerTitle=Tracking Code Manager FREE
|
| 19 |
+
ManagerSubtitle=<b>WARNING</b> This does not filter your HTML code for errors or for malicious scripts. Use it at your own risk.
|
| 20 |
+
SettingsTitle=Inline Related Posts (v.{0})
|
| 21 |
+
FaqTitle=F.A.Q. Frequently Asked Question
|
| 22 |
+
FeedbackHeader=Are you looking for new features? Send us a feedback
|
| 23 |
+
AboutText1=We are Stefan and Alex, two guys in love with Wordpress, coding and marketing! Our company IntellyWP is an idea to bring Intelly ideas to your Intelly site ;)
|
| 24 |
+
AboutText2=Feel free to reach us by the feedback form below.
|
| 25 |
+
|
| 26 |
+
CodeDeleteNotice=Tracking code "#{0} ({1})" successfully deleted
|
| 27 |
+
CodeUpdateNotice=Tracking code "#{0} ({1})" successfully updated
|
| 28 |
+
CodeAddNotice=Tracking code "#{0} ({1})" successfully added
|
| 29 |
+
|
| 30 |
+
FreeLicenseReached=You have reached the FREE version limit. Please buy the PREMIUM version or delete unused tracking code and create new ones.
|
| 31 |
+
EditTitle=Edit tracking code
|
| 32 |
+
EditSubtitle=Edit the information that you need and click "Save"
|
| 33 |
+
AddTitle=New tracking code
|
| 34 |
+
AddSubtitle=Fill in the information and click "Save"
|
| 35 |
+
EnableAllowTrackingNotice1=Currently we receive plugin usage information. It allows us to have a BETTER development so many many thanks from the development team.
|
| 36 |
+
EnableAllowTrackingNotice2=If you want to stop tracking please click <a href="{0}">HERE :(</a>
|
| 37 |
+
DisableAllowTrackingNotice1=Seems that you are not allowing us to receive plugin usage information. It allows us to have a BETTER development without collecting any sensitive-data.
|
| 38 |
+
DisableAllowTrackingNotice2=Please allow us to receive this information clicking <a href="{0}">HERE :)</a> once enabled you can disallow them in the About tab.
|
| 39 |
+
DisableAllowTrackingNotice3=Welcome on board from the IntellyWP team and many thanks for choosing our products!
|
| 40 |
+
|
| 41 |
+
Editor.active=Active?
|
| 42 |
+
Editor.name=Name
|
| 43 |
+
Editor.code=Paste your Tracking Code here
|
| 44 |
+
Editor.position.0=Before </HEAD>
|
| 45 |
+
Editor.position.1=After <BODY>
|
| 46 |
+
Editor.position.2=Before </BODY>
|
| 47 |
+
Editor.position=Position inside the code
|
| 48 |
+
Editor.includeEverywhereActive=Include in the whole website (pages, posts and archives)
|
| 49 |
+
Editor.includeCategoriesActive=Include in posts with specific categories
|
| 50 |
+
Editor.includeTagsActive=Include in posts with specific tags
|
| 51 |
+
Editor.includePostsOfTypeActive=Include in "<b>{0}</b>"
|
| 52 |
+
Editor.exceptCategoriesActive=Exclude in posts with specific categories
|
| 53 |
+
Editor.exceptTagsActive=Exclude in posts with specific tags
|
| 54 |
+
Editor.exceptPostsOfTypeActive=Exclude in "<b>{0}</b>"
|
| 55 |
+
Editor.includeLastPostsActive=Include in latest posts (specify the number of posts)
|
| 56 |
+
|
| 57 |
+
DeactivateSuccess=License key "{0}" successfully deactivated
|
| 58 |
+
DeactivateError=Errors deactivating key. Network problem??
|
| 59 |
+
ActivateSuccess1=License key "{0}" successfully activated
|
| 60 |
+
ActivateSuccess2=CONGRATS...YOU ARE NOW A PREMIUM MEMBER! :)
|
| 61 |
+
ActivateError=Errors activating key. Network problem or wrong activation key.
|
| 62 |
+
|
| 63 |
+
LicenseSection=License information
|
| 64 |
+
LicenseSectionSubtitle=Insert the activation key received by email in the text below to see all the settings
|
| 65 |
+
MetaboxSection=Metabox integration
|
| 66 |
+
MetaboxSectionSubtitle=You will display a metabox to disable the plugin in a specific post or page.
|
| 67 |
+
License.metabox=In "<b>{0}</b>"
|
| 68 |
+
License.key=Insert the activation key received by email
|
| 69 |
+
EmptyTrackingList=Your tracking code list is empty, please <a href="{0}">CLICK HERE</a> to create new ones.
|
| 70 |
+
|
| 71 |
+
Notice.ProHeader1=Do you like this plugin?
|
| 72 |
+
Notice.ProHeader2=Using the <b>PREMIUM</b> version you can also include/exclude tracking code:
|
| 73 |
+
Notice.ProFeature1=In your custom post type {0}
|
| 74 |
+
Notice.ProFeature2=In the latest post
|
| 75 |
+
Notice.ProFeature3=In specific categories
|
| 76 |
+
Notice.ProFeature4=In specific tags
|
| 77 |
+
|
| 78 |
+
QuestionActiveOn=Do you want to activate this code?
|
| 79 |
+
QuestionActiveOff=Do you want to deactivate this code?
|
| 80 |
+
|
| 81 |
+
GeneralSection=Style Settings
|
| 82 |
+
GeneralSectionSubtitle=Just few settings and Kaboooom!!
|
| 83 |
+
RewriteSection=Plugin Settings
|
| 84 |
+
RewriteSectionSubtitle=Set the plugin's behavior.
|
| 85 |
+
EngineSection=Engine Settings
|
| 86 |
+
EngineSectionSubtitle=Choose how the plugin discovers similar posts
|
| 87 |
+
PreviewSection=Real time preview
|
| 88 |
+
PreviewSectionSubtitle=Change any above settings to refresh preview OR <a href="javascript:IRP_changeRelatedBox()">REFRESH HERE</a>
|
| 89 |
+
PreviewSectionMaxTime=With these settings the plugin has ran in max {0} milliseconds with {1} different posts. Enjoy! :)
|
| 90 |
+
Settings.irpActive=Active?
|
| 91 |
+
Settings.irpText=Related text
|
| 92 |
+
Settings.irpBackgroundColor=Background Color
|
| 93 |
+
Settings.irpBorderColor=Border Color
|
| 94 |
+
Settings.irpRewriteActive=Insert in already existing posts?
|
| 95 |
+
Settings.irpRewriteBoxesCount=How many boxes per single post?
|
| 96 |
+
Settings.irpRewritePostsInBoxCount=Max posts per box N.
|
| 97 |
+
Settings.irpRewriteThreshold=Interval between the boxes <i>(minimum N° words)</i>
|
| 98 |
+
Settings.irpRewriteAtEnd=Insert a box at the end of the post? (if needed)
|
| 99 |
+
Settings.irpRewritePostType=Use on <b>{0}</b>
|
| 100 |
+
Settings.irpRewritePostsDays=Only posts of last N. days<br /><i>(set zero for no limits)</i>
|
| 101 |
+
Settings.irpEngineSearch=Search similar posts
|
| 102 |
+
Settings.irpEngineSearch.0=Using categories and tags
|
| 103 |
+
Settings.irpEngineSearch.1=Using only categories
|
| 104 |
+
Settings.irpEngineSearch.2=Using only tags
|
| 105 |
+
Settings.irpShowPoweredBy=Display "Powered by" text<br/><i>(and show us some love :)</i>
|
| 106 |
+
Settings.irpTemplate=Box template
|
| 107 |
+
Settings.irpTemplateBackgroundColor=Background color
|
| 108 |
+
Settings.irpTemplateBorderColor=Left border color
|
| 109 |
+
Settings.irpTemplateShadow=Shadow?
|
| 110 |
+
Settings.irpTemplateRelatedTextColor=Related Text Color
|
| 111 |
+
Settings.template-linkRel=Link "rel" attribute
|
| 112 |
+
Settings.template-linkTarget=Link "target" attribute
|
| 113 |
+
Settings.key=Activation key
|
| 114 |
+
|
| 115 |
+
TemplateName=Example template "{0}"
|
| 116 |
+
FirstTimeActivation=Thank you for activating our plugin. This is the page settings where you need to start to configure it. You will see this box only the first time.
|
| 117 |
+
Settings.metabox=Integrate in <b>"{0}"</b>
|
| 118 |
+
EditorSubtitle=Select the item that you want to insert into the box automatically created by the Intelly Related Posts
|
| 119 |
+
Faq.Question1=Why should I use this plugin?
|
| 120 |
+
Faq.Response1=Because it will increase the page views on your site, improving engagement and reducing your bounce rate.
|
| 121 |
+
Faq.Question2=Can I use the Inline related Posts plugin along with another Related posts plugin?
|
| 122 |
+
Faq.Response2=Yes you can! Our plugin puts fancy boxes INSIDE the content, not at the end of it.
|
| 123 |
+
Faq.Question3=Will this plugin break the structure of my content?
|
| 124 |
+
Faq.Response3=NOPE. Our algorithm knows HTML tags and avoid placing the boxes in the wrong place!
|
| 125 |
+
Faq.Question4=Will this plugin slow my website?
|
| 126 |
+
Faq.Response4=Absolutely Not! Inline Related Posts is built with lightweight code and you won’t notice any difference in speed using it.
|
| 127 |
+
|
| 128 |
+
EasySection=Easy Configuration
|
| 129 |
+
CoolSection=Cool Configuration (are you ready?)
|
| 130 |
+
Settings.template-ctaText=Related text or Call-To-Action
|
| 131 |
+
Settings.template-textTransform=Text transform
|
| 132 |
+
Settings.template-useDefaults=Use template colors schema
|
| 133 |
+
Settings.template-ctaTextColor=Related Text Color
|
| 134 |
+
Settings.template-ctaTextColorHover=Related Text Color Hover
|
| 135 |
+
Settings.template-ctaBoxColor=Related Box Color
|
| 136 |
+
Settings.template-ctaBoxColorHover=Related Box Color Hover
|
| 137 |
+
Settings.template-boxColor=Box Background Color
|
| 138 |
+
Settings.template-boxColorHover=Box Color Hover
|
| 139 |
+
Settings.template-postTitleColor=Post Title Color
|
| 140 |
+
Settings.template-postTitleColorHover=Post Title Color Hover
|
| 141 |
+
Settings.template-borderColor=Border Color
|
| 142 |
+
Settings.template-borderColorHover=Border Color Hover
|
| 143 |
+
Settings.template-useHoverDefaults=Use template hover colors schema
|
| 144 |
+
Settings.template-template=Theme
|
| 145 |
+
Settings.template-hasShadow=Display border shadow
|
| 146 |
+
Settings.template-hasPoweredBy=Display "Powered by" text <i>(and show us some love :)</i>
|
| 147 |
+
Settings.template-boxOpacity=Initial opacity %
|
| 148 |
+
Settings.Color.border=Border Color
|
| 149 |
+
Settings.Color.arrow=Arrow background Color
|
| 150 |
+
Settings.Color.hover=Hover Box background Color
|
| 151 |
+
Settings.Color.button=Button Color
|
| 152 |
+
Notice.DontSave=Please <a href="{0}">Buy PREMIUM</a> to use this theme
|
| 153 |
+
|
| 154 |
+
Notice.ProHeader1=Do you like this plugin?
|
| 155 |
+
Notice.ProHeader2=With <b>PREMIUM</b> version you can have awesome features like:
|
| 156 |
+
Notice.ProFeature1=Configure UNLIMITED Inline Related Boxes
|
| 157 |
+
Notice.ProFeature2=Premium box themes with featured images
|
| 158 |
+
Notice.ProFeature3=Configure hover effect with different colors
|
| 159 |
+
Notice.ProFeature4=24/7 World champion support
|
| 160 |
+
Notice.ProFeature5=FREE IntellyTrust: Solve your problem in 48h
|
| 161 |
+
Notice.ProFeature6=100 seconds Install & Forget
|
| 162 |
+
Notice.ProCTA=Check all premium features now ››
|
| 163 |
+
|
| 164 |
+
YouHaveThePremiumVersion1=You have installed the PREMIUM version of this plugin, please click <a href="{0}">here</a> to have access at all the features.
|
| 165 |
+
YouHaveThePremiumVersion2=You can deactivate the "<b>Inline Related Posts</b>" plugin and only still active the "<b>Inline Related Posts PRO</b>" plugin
|
| 166 |
+
|
| 167 |
+
Settings.marginTop=CSS margin-top
|
| 168 |
+
Settings.marginBottom=CSS margin-bottom
|
| 169 |
+
GuruInfo=Below some GURU info (useful to request support at support@intellywp.com)
|
| 170 |
+
XdebugException=XdebugException: please contact our support at support@intellywp.com. Few hours and we will help you, guaranteed :)
|
readme.txt
ADDED
|
@@ -0,0 +1,210 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
=== Inline Related Posts ===
|
| 2 |
+
Contributors: IntellyWP
|
| 3 |
+
Donate link: http://intellywp.com/intelly-related-posts/
|
| 4 |
+
Tags: related post,related posts,inline related posts, inside related posts, suggestions, similar post, similar posts, related,contextual, relations, seo, bounce rate, internal links, similarity, related content, inline related post, Zemanta, inline, Related Links, Contextual Related Posts, YARPP recommendation engine, YARPP
|
| 5 |
+
Requires at least: 2.7
|
| 6 |
+
Tested up to: 5.2
|
| 7 |
+
|
| 8 |
+
Inline Related Posts AUTOMATICALLY inserts related posts INSIDE your content, capturing immediately the reader's attention.
|
| 9 |
+
|
| 10 |
+
== Description ==
|
| 11 |
+
|
| 12 |
+
Companies like Entrepreneur, The Wall Street Journal, BBC, Business Insider, Financial Times and many others understood this concept and embraced it as you can see in this GIF in <a href="https://wordpress.org/plugins/intelly-related-posts/screenshots/">Screenshots</a>.
|
| 13 |
+
|
| 14 |
+
In <a href="http://www.intellywp.com" target="_blank">IntellyWP</a> we take care of the marketing aspects of your Wordpress site and today we have brought to you the same technology they use, to help you to increase engagement, page views and to reduce the bounce rate.
|
| 15 |
+
|
| 16 |
+
> <strong>Just one week after testing this plugin on a low traffic site, our page views increased by 99%.</strong>
|
| 17 |
+
|
| 18 |
+
<strong>ANOTHER IMPORTANT POINT OF VIEW</strong>
|
| 19 |
+
<br>
|
| 20 |
+
How many things have you have in the footer post?
|
| 21 |
+
|
| 22 |
+
* The author box?
|
| 23 |
+
* Subscription to your newsletter?
|
| 24 |
+
* Maybe you ask users to share the post on social networks?
|
| 25 |
+
* You ask them to leave a comment?
|
| 26 |
+
* And also... to read related posts?
|
| 27 |
+
|
| 28 |
+
Do you know that asking too many things is equal to ask nothing?
|
| 29 |
+
|
| 30 |
+
[youtube https://www.youtube.com/watch?v=CjdTr14Nd1g]
|
| 31 |
+
|
| 32 |
+
Inline related posts plugin bring a new experience to your visitors and help you to win the fight of catching readers attention ;)
|
| 33 |
+
|
| 34 |
+
> With Inline Related Posts Plugin you can:<br>
|
| 35 |
+
> 1. Put related posts boxes INSIDE your content (<a href="https://wordpress.org/plugins/intelly-related-posts/screenshots/">see Screenshots</a>)<br>
|
| 36 |
+
> 2. Automatically put multiple boxes in all your posts<br>
|
| 37 |
+
> 3. Automatically detect line breaks (without destroy your paragraphs or headlines)<br>
|
| 38 |
+
> 4. Choose over 20+ combinations of style (themes, colors, hover)
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
<a href="https://downloads.wordpress.org/plugin/intelly-related-posts.zip">Download now the Inline Related posts plugin into your Wordpress.</a>
|
| 42 |
+
<br>
|
| 43 |
+
<br>
|
| 44 |
+
Brought to you by IntellyWP. Intelly solution for your Intelly site ;)
|
| 45 |
+
|
| 46 |
+
== Installation ==
|
| 47 |
+
|
| 48 |
+
1. Download our plugin
|
| 49 |
+
2. Upload to your /wp-contents/plugins/ directory.
|
| 50 |
+
3. Activate the plugin through the "Plugins" menu in WordPress.
|
| 51 |
+
4. You will be redirected to Settings >> Inline Related Posts
|
| 52 |
+
|
| 53 |
+
== Frequently Asked Questions ==
|
| 54 |
+
|
| 55 |
+
= Why should I use this plugin? =
|
| 56 |
+
|
| 57 |
+
Because it will increase the page views on your site, improving engagement and reducing your bounce rate.
|
| 58 |
+
|
| 59 |
+
= Can I use the Inline related Posts plugin along with another Related posts plugin? =
|
| 60 |
+
|
| 61 |
+
Yes you can! Our plugin puts fancy boxes INSIDE the content, not at the end of it.
|
| 62 |
+
|
| 63 |
+
= Will this plugin break the structure of my content? =
|
| 64 |
+
|
| 65 |
+
NOPE. Our algorithm knows HTML tags and avoid placing the boxes in the wrong place!
|
| 66 |
+
|
| 67 |
+
= Do you have some others fancy box styles? =
|
| 68 |
+
|
| 69 |
+
Yes! We have other cool styles and features in the PRO version. Check it out <a href="https://intellywp.com/intelly-related-posts/">https://intellywp.com/intelly-related-posts/</a>
|
| 70 |
+
|
| 71 |
+
= Will this plugin slow my website? =
|
| 72 |
+
|
| 73 |
+
Absolutely Not! Inline Related Posts is built with lightweight code so you won’t notice any difference in speed using it.
|
| 74 |
+
|
| 75 |
+
== Screenshots ==
|
| 76 |
+
|
| 77 |
+
1. Some example of famous websites with "Related post box"
|
| 78 |
+
2. An example of a style that you can use
|
| 79 |
+
3. Another example of a style that you can use
|
| 80 |
+
4. Another example of a style that you can use
|
| 81 |
+
5. Hover effect is allowed using this theme
|
| 82 |
+
6. Our Intelly Line Breaks technology which detects grammar rules and avoids content breaks.
|
| 83 |
+
7. The backend of our plugin. Live preview available and super fast options to fit your theme style.
|
| 84 |
+
8. A Box Theme of Inline Related Posts PRO. Check other PREMIUM feature <a href="https://intellywp.com/intelly-related-posts/">here</a>. (https://intellywp.com/intelly-related-posts/)
|
| 85 |
+
9. Another Box Theme of Inline Related Posts PRO. Check other PREMIUM feature <a href="https://intellywp.com/intelly-related-posts/">here</a>. (https://intellywp.com/intelly-related-posts/)
|
| 86 |
+
|
| 87 |
+
== Changelog ==
|
| 88 |
+
|
| 89 |
+
= 2.2.4 =
|
| 90 |
+
*Release Date - 2019-05-18*
|
| 91 |
+
|
| 92 |
+
* Tested with WP 5.2 Plugin updated and supported.
|
| 93 |
+
* [Improvement] Prevent the related posts inside specific divs
|
| 94 |
+
|
| 95 |
+
= 2.2.3 =
|
| 96 |
+
*Release Date - 2019-03-16*
|
| 97 |
+
|
| 98 |
+
* Tested with WP 5.1.1. Plugin updated and supported.
|
| 99 |
+
|
| 100 |
+
= 2.2.2 =
|
| 101 |
+
*Release Date - 2019-02-21*
|
| 102 |
+
|
| 103 |
+
* [NEW] Ajax dropdown to choose a specific post for our "irp" shortcode from the editor button.
|
| 104 |
+
* [NEW] Ajax dropdown to choose a specific page for our "irp" shortcode from the editor button.
|
| 105 |
+
* Finally compatible with WP 5.0.3. Plugin updated and supported.
|
| 106 |
+
|
| 107 |
+
= 2.2.1 =
|
| 108 |
+
*Release Date - 2018-05-01*
|
| 109 |
+
|
| 110 |
+
* Finally compatible with WP 4.9.5. Plugin updated and supported.
|
| 111 |
+
|
| 112 |
+
= 2.2.0 =
|
| 113 |
+
*Release Date - 21/08/2016*
|
| 114 |
+
|
| 115 |
+
* Compatible with PHP < 5.3
|
| 116 |
+
* No also inline image are recognized if featured image is not defined
|
| 117 |
+
|
| 118 |
+
= 2.1.8 =
|
| 119 |
+
*Release Date - 27/04/2016*
|
| 120 |
+
* Documentation link fixed
|
| 121 |
+
= 2.1.7 =
|
| 122 |
+
*Release Date - 19/09/2015*
|
| 123 |
+
|
| 124 |
+
* [Bugfix] hasPoweredBy not is default disable due to WP repository guidelines
|
| 125 |
+
|
| 126 |
+
= 2.1.6 =
|
| 127 |
+
*Release Date - 13/09/2015*
|
| 128 |
+
|
| 129 |
+
* [Improvement] Improvement the "wp-caption" recognition
|
| 130 |
+
|
| 131 |
+
= 2.1.5 =
|
| 132 |
+
*Release Date - 12/09/2015*
|
| 133 |
+
|
| 134 |
+
* [Improvement] Improvement in "div" detection
|
| 135 |
+
* [Bugfix] Fixed vertical-alignment in Firefox
|
| 136 |
+
|
| 137 |
+
= 2.1.4 =
|
| 138 |
+
*Release Date - 11/09/2015*
|
| 139 |
+
|
| 140 |
+
* [Bugfix] Fixed bugs on "irp" shortcode
|
| 141 |
+
|
| 142 |
+
= 2.1.3 =
|
| 143 |
+
*Release Date - 09/09/2015*
|
| 144 |
+
|
| 145 |
+
* [Bugfix] Fixed bugs on "style" tag in content
|
| 146 |
+
|
| 147 |
+
= 2.1.2 =
|
| 148 |
+
*Release Date - 27/08/2015*
|
| 149 |
+
|
| 150 |
+
* [Bugfix] Fixed bugs on related box placement
|
| 151 |
+
|
| 152 |
+
= 2.1.0 =
|
| 153 |
+
*Release Date - 26/08/2015*
|
| 154 |
+
|
| 155 |
+
* [Improvements] Included into the WP menu only if user has manage_options rights
|
| 156 |
+
* [Bugfix] Fixed bugs on bottom spacing
|
| 157 |
+
* [Improvements] Inserted as parameters CSS margin-top and CSS margin-bottom
|
| 158 |
+
* [Improvements] Various fixed
|
| 159 |
+
|
| 160 |
+
= 2.0.4 =
|
| 161 |
+
*Release Date - 23/08/2015*
|
| 162 |
+
|
| 163 |
+
* [Improvements] Various fixed
|
| 164 |
+
|
| 165 |
+
= 2.0.3 =
|
| 166 |
+
*Release Date - 09/07/2015*
|
| 167 |
+
|
| 168 |
+
* [Bugfix] Speed optimization
|
| 169 |
+
* [Bugfix] Corrected the function to filter only recent posts
|
| 170 |
+
* Minor bugfix
|
| 171 |
+
|
| 172 |
+
= 2.0.2 =
|
| 173 |
+
*Release Date - 06/07/2015*
|
| 174 |
+
|
| 175 |
+
* Minor bugfix
|
| 176 |
+
|
| 177 |
+
= 2.0.1 =
|
| 178 |
+
*Release Date - 05/07/2015*
|
| 179 |
+
|
| 180 |
+
* [Bugfix] Fixed bug with PRE tag
|
| 181 |
+
* [Bugfix] Fixed notice Array to string conversion in ../intelly-related-posts/index.php on line 127
|
| 182 |
+
* [NEW] Created themes for the plugin
|
| 183 |
+
* [NEW] Created 2 different themes for free with various effect
|
| 184 |
+
* [NEW] Created 3 different themes in PRO version with various effect
|
| 185 |
+
|
| 186 |
+
= 1.3.4 =
|
| 187 |
+
*Release Date - 06/06/2015*
|
| 188 |
+
|
| 189 |
+
* Added rel="nofollow" by default with a dropdown where you can choose also dofollow if you prefer
|
| 190 |
+
|
| 191 |
+
= 1.3.3 =
|
| 192 |
+
*Release Date - 27/05/2015*
|
| 193 |
+
|
| 194 |
+
* [Thanks to msshams] Bugfix persian language
|
| 195 |
+
* [Thanks to reweb] Bugfix Parse error: syntax error, unexpected ':' in [...] wp-content/plugins/intelly-related-posts/index.php on line 118
|
| 196 |
+
|
| 197 |
+
= 1.3.2 =
|
| 198 |
+
*Release Date - 14/05/2015*
|
| 199 |
+
|
| 200 |
+
* Tested with a lot of websites, blogs, etc
|
| 201 |
+
* Approved by WP community
|
| 202 |
+
|
| 203 |
+
= 1.1 =
|
| 204 |
+
*Release Date - 09/05/2015*
|
| 205 |
+
|
| 206 |
+
* HTML parsing to insert properly Inline Related Posts automatically
|
| 207 |
+
* Bugfixes and test with a lots of posts
|
| 208 |
+
|
| 209 |
+
= 1.0 =
|
| 210 |
+
* First release
|
screenshot-1.gif
ADDED
|
Binary file
|
screenshot-2.png
ADDED
|
Binary file
|
screenshot-3.png
ADDED
|
Binary file
|
screenshot-4.png
ADDED
|
Binary file
|
screenshot-5.png
ADDED
|
Binary file
|
screenshot-6.jpg
ADDED
|
Binary file
|
screenshot-7.png
ADDED
|
Binary file
|
screenshot-8.png
ADDED
|
Binary file
|
screenshot-9.png
ADDED
|
Binary file
|
