Version Description
Release Date 2022-2-3*
IWP-378 Support the Gutenberg editor by providing an IRP widget
Download this release
Release Info
Developer | data443 |
Plugin | Inline Related Posts |
Version | 3.0.9 |
Comparing to | |
See all releases |
Code changes from version 3.0.7 to 3.0.9
- .editorconfig +14 -0
- assets/css/style.css +162 -162
- assets/deps/qtip/jquery.qtip.min.js +21 -21
- assets/deps/select2-3.5.2/select2-bootstrap.css +87 -87
- assets/deps/select2-3.5.2/select2.css +704 -704
- assets/deps/select2-3.5.2/select2.js +3541 -3541
- assets/deps/select2-3.5.2/select2.min.js +22 -22
- assets/deps/select2-3.5.2/select2_locale_ar.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_az.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_bg.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_ca.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_cs.js +51 -51
- assets/deps/select2-3.5.2/select2_locale_da.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_de.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_el.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_en.js.template +20 -20
- assets/deps/select2-3.5.2/select2_locale_es.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_et.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_eu.js +45 -45
- assets/deps/select2-3.5.2/select2_locale_fa.js +21 -21
- assets/deps/select2-3.5.2/select2_locale_fi.js +30 -30
- assets/deps/select2-3.5.2/select2_locale_fr.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_gl.js +45 -45
- assets/deps/select2-3.5.2/select2_locale_he.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_hr.js +24 -24
- assets/deps/select2-3.5.2/select2_locale_hu.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_id.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_is.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_it.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_ja.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_ka.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ko.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_lt.js +26 -26
- assets/deps/select2-3.5.2/select2_locale_lv.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_mk.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_ms.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_nb.js +22 -22
- assets/deps/select2-3.5.2/select2_locale_nl.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_pl.js +54 -54
- assets/deps/select2-3.5.2/select2_locale_pt-BR.js +18 -18
- assets/deps/select2-3.5.2/select2_locale_pt-PT.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_ro.js +17 -17
- assets/deps/select2-3.5.2/select2_locale_rs.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ru.js +23 -23
- assets/deps/select2-3.5.2/select2_locale_sk.js +50 -50
- assets/deps/select2-3.5.2/select2_locale_sv.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_th.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_tr.js +19 -19
- assets/deps/select2-3.5.2/select2_locale_ug-CN.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_uk.js +25 -25
- assets/deps/select2-3.5.2/select2_locale_vi.js +20 -20
- assets/deps/select2-3.5.2/select2_locale_zh-CN.js +16 -16
- assets/deps/select2-3.5.2/select2_locale_zh-TW.js +16 -16
- assets/deps/starrr/starrr.js +123 -123
- assets/js/button-mce.js +44 -44
- assets/js/common.js +186 -186
- assets/templates/styles.html +197 -197
- autoload.php +47 -47
- includes/actions.php +69 -69
- includes/admin/about.php +26 -26
- includes/admin/button-mce.php +134 -134
- includes/admin/faq.php +16 -16
- includes/admin/feedback.php +43 -43
- includes/admin/metabox.php +70 -70
- includes/admin/settings.php +443 -441
- includes/admin/whatsnew.php +104 -104
- includes/classes/common/Stack.php +27 -27
- includes/classes/core/HtmlTemplate.php +294 -294
- includes/classes/core/Manager.php +99 -99
- includes/classes/core/Singleton.php +35 -35
- includes/classes/html/BehaviourTag.php +51 -51
- includes/classes/html/HTMLContext.php +558 -563
- includes/classes/html/HTMLTag.php +61 -61
- includes/classes/html/MainTag.php +27 -27
- includes/classes/html/NewLineText.php +18 -18
- includes/classes/html/OtherTag.php +12 -12
- includes/classes/html/SingletonTag.php +15 -15
- includes/classes/html/TextContent.php +53 -53
- includes/classes/ui/Check.php +106 -106
- includes/classes/ui/Form.php +457 -457
- includes/classes/ui/Tabs.php +243 -243
- includes/classes/utils/AppOptions.php +504 -496
- includes/classes/utils/Cron.php +85 -85
- includes/classes/utils/Language.php +121 -121
- includes/classes/utils/Logger.php +118 -118
- includes/classes/utils/Options.php +260 -260
- includes/classes/utils/Plugin.php +263 -263
- includes/classes/utils/Tracking.php +178 -190
.editorconfig
ADDED
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
# This file is for unifying the coding style for different editors and IDEs
|
2 |
+
# editorconfig.org
|
3 |
+
|
4 |
+
# WordPress Coding Standards
|
5 |
+
# https://make.wordpress.org/core/handbook/coding-standards/
|
6 |
+
|
7 |
+
root = true
|
8 |
+
|
9 |
+
[*]
|
10 |
+
charset = utf-8
|
11 |
+
end_of_line = lf
|
12 |
+
insert_final_newline = true
|
13 |
+
trim_trailing_whitespace = true
|
14 |
+
indent_style = spaces
|
assets/css/style.css
CHANGED
@@ -1,163 +1,163 @@
|
|
1 |
-
._irp {
|
2 |
-
background-color: #efc439;
|
3 |
-
border-radius: 2px;
|
4 |
-
color: #fff;
|
5 |
-
display: inline-block;
|
6 |
-
font-size: 12px;
|
7 |
-
padding: 0 2px;
|
8 |
-
line-height: 14px;
|
9 |
-
vertical-align: baseline;
|
10 |
-
}
|
11 |
-
|
12 |
-
.irp-tag {
|
13 |
-
display: inline-block;
|
14 |
-
line-height: 13px;
|
15 |
-
padding: 0 3px;
|
16 |
-
color: white;
|
17 |
-
font-size: 10px;
|
18 |
-
font-weight: normal;
|
19 |
-
width:25px;
|
20 |
-
margin-top:3px;
|
21 |
-
margin-right:5px;
|
22 |
-
text-align:center;
|
23 |
-
-webkit-border-radius: 2px;
|
24 |
-
border-radius: 2px;
|
25 |
-
vertical-align: baseline;
|
26 |
-
}
|
27 |
-
.irp-tag-free {
|
28 |
-
/*background-color: #edb802;*/
|
29 |
-
background-color: #16a765;
|
30 |
-
}
|
31 |
-
.irp-tag-premium {
|
32 |
-
/*background-color: #edb802;*/
|
33 |
-
background-color: #4986e7;
|
34 |
-
opacity: 0.7;
|
35 |
-
filter: alpha(opacity=70);
|
36 |
-
}
|
37 |
-
.irp-tag-premium a {
|
38 |
-
color:white;
|
39 |
-
text-decoration:none;
|
40 |
-
}
|
41 |
-
.irp-button {
|
42 |
-
margin-right:5px!important;
|
43 |
-
}
|
44 |
-
|
45 |
-
.irp-textarea {
|
46 |
-
font-family:"Courier New", Courier, mono;
|
47 |
-
font-size:12px;
|
48 |
-
color:#555;
|
49 |
-
background-color:#f8f8f8;
|
50 |
-
width:550px;
|
51 |
-
height:350px;
|
52 |
-
}
|
53 |
-
|
54 |
-
.irp-form {
|
55 |
-
float:left;
|
56 |
-
padding:5px;
|
57 |
-
}
|
58 |
-
.irp-form input, .irp-form label {
|
59 |
-
float:left;
|
60 |
-
}
|
61 |
-
.irp-text {
|
62 |
-
width: 400px;
|
63 |
-
}
|
64 |
-
.irp-label {
|
65 |
-
width: 200px;
|
66 |
-
margin: 0px;
|
67 |
-
background-color: transparent;
|
68 |
-
}
|
69 |
-
.irp-label-disabled {
|
70 |
-
/*color:#A8A8A8;*/
|
71 |
-
opacity: 0.7;
|
72 |
-
filter: alpha(opacity=70);
|
73 |
-
}
|
74 |
-
.irp-checkbox {
|
75 |
-
margin:0px;
|
76 |
-
}
|
77 |
-
.irp-checkbox:disabled {
|
78 |
-
background-color: #f8f8f8;
|
79 |
-
}
|
80 |
-
.irp-select {
|
81 |
-
|
82 |
-
}
|
83 |
-
.irp-form-newline {
|
84 |
-
clear:both;
|
85 |
-
margin-bottom:5px;
|
86 |
-
}
|
87 |
-
|
88 |
-
img.irp-help {
|
89 |
-
cursor: pointer;
|
90 |
-
float: left;
|
91 |
-
margin-right: 10px;
|
92 |
-
}
|
93 |
-
|
94 |
-
.irp-qtip {
|
95 |
-
font-size: 14px !important;
|
96 |
-
line-height: 18px !important;
|
97 |
-
}
|
98 |
-
|
99 |
-
i.mce-i-icon {
|
100 |
-
font: 400 20px/1 dashicons;
|
101 |
-
padding: 0;
|
102 |
-
vertical-align: top;
|
103 |
-
speak: none;
|
104 |
-
-webkit-font-smoothing: antialiased;
|
105 |
-
-moz-osx-font-smoothing: grayscale;
|
106 |
-
margin-left: -2px;
|
107 |
-
padding-right: 2px
|
108 |
-
}
|
109 |
-
|
110 |
-
i.irp-own-icon {
|
111 |
-
background-image: url('../images/repeat.png');
|
112 |
-
}
|
113 |
-
|
114 |
-
.irp-box-error {
|
115 |
-
background: #fff;
|
116 |
-
border-left: 4px solid #dd3d36;
|
117 |
-
margin: 5px 0 15px;
|
118 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
119 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
120 |
-
padding: 1px 12px;
|
121 |
-
}
|
122 |
-
.irp-box-warning {
|
123 |
-
background: #fff;
|
124 |
-
border-left: 4px solid #ffba00;
|
125 |
-
margin: 5px 0 15px;
|
126 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
127 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
128 |
-
padding: 1px 12px;
|
129 |
-
}
|
130 |
-
.irp-box-success {
|
131 |
-
background: #fff;
|
132 |
-
border-left: 4px solid #7ad03a;
|
133 |
-
margin: 5px 0 15px;
|
134 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
135 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
136 |
-
padding: 1px 12px;
|
137 |
-
}
|
138 |
-
.irp-box-info {
|
139 |
-
background: #fff;
|
140 |
-
border-left: 4px solid #00a0d2;
|
141 |
-
margin: 5px 0 15px;
|
142 |
-
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
143 |
-
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
144 |
-
padding: 1px 12px;
|
145 |
-
}
|
146 |
-
|
147 |
-
.select2-chosen .irpColorSelectItem {
|
148 |
-
padding-bottom:0px!important;
|
149 |
-
padding-top:0px!important;
|
150 |
-
}
|
151 |
-
.irpColorSelectItem {
|
152 |
-
padding: 5px;
|
153 |
-
width: 100%;
|
154 |
-
}
|
155 |
-
|
156 |
-
#irp-sidebar li {
|
157 |
-
margin: 0px!important;
|
158 |
-
margin-left: 20px!important;;
|
159 |
-
}
|
160 |
-
.irp-plugin-widget {
|
161 |
-
padding: 10px;
|
162 |
-
border: 2px dashed red;
|
163 |
}
|
1 |
+
._irp {
|
2 |
+
background-color: #efc439;
|
3 |
+
border-radius: 2px;
|
4 |
+
color: #fff;
|
5 |
+
display: inline-block;
|
6 |
+
font-size: 12px;
|
7 |
+
padding: 0 2px;
|
8 |
+
line-height: 14px;
|
9 |
+
vertical-align: baseline;
|
10 |
+
}
|
11 |
+
|
12 |
+
.irp-tag {
|
13 |
+
display: inline-block;
|
14 |
+
line-height: 13px;
|
15 |
+
padding: 0 3px;
|
16 |
+
color: white;
|
17 |
+
font-size: 10px;
|
18 |
+
font-weight: normal;
|
19 |
+
width:25px;
|
20 |
+
margin-top:3px;
|
21 |
+
margin-right:5px;
|
22 |
+
text-align:center;
|
23 |
+
-webkit-border-radius: 2px;
|
24 |
+
border-radius: 2px;
|
25 |
+
vertical-align: baseline;
|
26 |
+
}
|
27 |
+
.irp-tag-free {
|
28 |
+
/*background-color: #edb802;*/
|
29 |
+
background-color: #16a765;
|
30 |
+
}
|
31 |
+
.irp-tag-premium {
|
32 |
+
/*background-color: #edb802;*/
|
33 |
+
background-color: #4986e7;
|
34 |
+
opacity: 0.7;
|
35 |
+
filter: alpha(opacity=70);
|
36 |
+
}
|
37 |
+
.irp-tag-premium a {
|
38 |
+
color:white;
|
39 |
+
text-decoration:none;
|
40 |
+
}
|
41 |
+
.irp-button {
|
42 |
+
margin-right:5px!important;
|
43 |
+
}
|
44 |
+
|
45 |
+
.irp-textarea {
|
46 |
+
font-family:"Courier New", Courier, mono;
|
47 |
+
font-size:12px;
|
48 |
+
color:#555;
|
49 |
+
background-color:#f8f8f8;
|
50 |
+
width:550px;
|
51 |
+
height:350px;
|
52 |
+
}
|
53 |
+
|
54 |
+
.irp-form {
|
55 |
+
float:left;
|
56 |
+
padding:5px;
|
57 |
+
}
|
58 |
+
.irp-form input, .irp-form label {
|
59 |
+
float:left;
|
60 |
+
}
|
61 |
+
.irp-text {
|
62 |
+
width: 400px;
|
63 |
+
}
|
64 |
+
.irp-label {
|
65 |
+
width: 200px;
|
66 |
+
margin: 0px;
|
67 |
+
background-color: transparent;
|
68 |
+
}
|
69 |
+
.irp-label-disabled {
|
70 |
+
/*color:#A8A8A8;*/
|
71 |
+
opacity: 0.7;
|
72 |
+
filter: alpha(opacity=70);
|
73 |
+
}
|
74 |
+
.irp-checkbox {
|
75 |
+
margin:0px;
|
76 |
+
}
|
77 |
+
.irp-checkbox:disabled {
|
78 |
+
background-color: #f8f8f8;
|
79 |
+
}
|
80 |
+
.irp-select {
|
81 |
+
|
82 |
+
}
|
83 |
+
.irp-form-newline {
|
84 |
+
clear:both;
|
85 |
+
margin-bottom:5px;
|
86 |
+
}
|
87 |
+
|
88 |
+
img.irp-help {
|
89 |
+
cursor: pointer;
|
90 |
+
float: left;
|
91 |
+
margin-right: 10px;
|
92 |
+
}
|
93 |
+
|
94 |
+
.irp-qtip {
|
95 |
+
font-size: 14px !important;
|
96 |
+
line-height: 18px !important;
|
97 |
+
}
|
98 |
+
|
99 |
+
i.mce-i-icon {
|
100 |
+
font: 400 20px/1 dashicons;
|
101 |
+
padding: 0;
|
102 |
+
vertical-align: top;
|
103 |
+
speak: none;
|
104 |
+
-webkit-font-smoothing: antialiased;
|
105 |
+
-moz-osx-font-smoothing: grayscale;
|
106 |
+
margin-left: -2px;
|
107 |
+
padding-right: 2px
|
108 |
+
}
|
109 |
+
|
110 |
+
i.irp-own-icon {
|
111 |
+
background-image: url('../images/repeat.png');
|
112 |
+
}
|
113 |
+
|
114 |
+
.irp-box-error {
|
115 |
+
background: #fff;
|
116 |
+
border-left: 4px solid #dd3d36;
|
117 |
+
margin: 5px 0 15px;
|
118 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
119 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
120 |
+
padding: 1px 12px;
|
121 |
+
}
|
122 |
+
.irp-box-warning {
|
123 |
+
background: #fff;
|
124 |
+
border-left: 4px solid #ffba00;
|
125 |
+
margin: 5px 0 15px;
|
126 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
127 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
128 |
+
padding: 1px 12px;
|
129 |
+
}
|
130 |
+
.irp-box-success {
|
131 |
+
background: #fff;
|
132 |
+
border-left: 4px solid #7ad03a;
|
133 |
+
margin: 5px 0 15px;
|
134 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
135 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
136 |
+
padding: 1px 12px;
|
137 |
+
}
|
138 |
+
.irp-box-info {
|
139 |
+
background: #fff;
|
140 |
+
border-left: 4px solid #00a0d2;
|
141 |
+
margin: 5px 0 15px;
|
142 |
+
-webkit-box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
143 |
+
box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
|
144 |
+
padding: 1px 12px;
|
145 |
+
}
|
146 |
+
|
147 |
+
.select2-chosen .irpColorSelectItem {
|
148 |
+
padding-bottom:0px!important;
|
149 |
+
padding-top:0px!important;
|
150 |
+
}
|
151 |
+
.irpColorSelectItem {
|
152 |
+
padding: 5px;
|
153 |
+
width: 100%;
|
154 |
+
}
|
155 |
+
|
156 |
+
#irp-sidebar li {
|
157 |
+
margin: 0px!important;
|
158 |
+
margin-left: 20px!important;;
|
159 |
+
}
|
160 |
+
.irp-plugin-widget {
|
161 |
+
padding: 10px;
|
162 |
+
border: 2px dashed red;
|
163 |
}
|
assets/deps/qtip/jquery.qtip.min.js
CHANGED
@@ -1,21 +1,21 @@
|
|
1 |
-
/*
|
2 |
-
* jquery.qtip. The jQuery tooltip plugin
|
3 |
-
*
|
4 |
-
* Copyright (c) 2009 Craig Thompson
|
5 |
-
* http://craigsworks.com
|
6 |
-
*
|
7 |
-
* Licensed under MIT
|
8 |
-
* http://www.opensource.org/licenses/mit-license.php
|
9 |
-
*
|
10 |
-
* Launch : February 2009
|
11 |
-
* Version : 1.0.0-rc3
|
12 |
-
* Released: Tuesday 12th May, 2009 - 00:00
|
13 |
-
* Debug: jquery.qtip.debug.js
|
14 |
-
*/
|
15 |
-
(function(f){f.fn.qtip=function(B,u){var y,t,A,s,x,w,v,z;if(typeof B=="string"){if(typeof f(this).data("qtip")!=="object"){f.fn.qtip.log.error.call(self,1,f.fn.qtip.constants.NO_TOOLTIP_PRESENT,false)}if(B=="api"){return f(this).data("qtip").interfaces[f(this).data("qtip").current]}else{if(B=="interfaces"){return f(this).data("qtip").interfaces}}}else{if(!B){B={}}if(typeof B.content!=="object"||(B.content.jquery&&B.content.length>0)){B.content={text:B.content}}if(typeof B.content.title!=="object"){B.content.title={text:B.content.title}}if(typeof B.position!=="object"){B.position={corner:B.position}}if(typeof B.position.corner!=="object"){B.position.corner={target:B.position.corner,tooltip:B.position.corner}}if(typeof B.show!=="object"){B.show={when:B.show}}if(typeof B.show.when!=="object"){B.show.when={event:B.show.when}}if(typeof B.show.effect!=="object"){B.show.effect={type:B.show.effect}}if(typeof B.hide!=="object"){B.hide={when:B.hide}}if(typeof B.hide.when!=="object"){B.hide.when={event:B.hide.when}}if(typeof B.hide.effect!=="object"){B.hide.effect={type:B.hide.effect}}if(typeof B.style!=="object"){B.style={name:B.style}}B.style=c(B.style);s=f.extend(true,{},f.fn.qtip.defaults,B);s.style=a.call({options:s},s.style);s.user=f.extend(true,{},B)}return f(this).each(function(){if(typeof B=="string"){w=B.toLowerCase();A=f(this).qtip("interfaces");if(typeof A=="object"){if(u===true&&w=="destroy"){while(A.length>0){A[A.length-1].destroy()}}else{if(u!==true){A=[f(this).qtip("api")]}for(y=0;y<A.length;y++){if(w=="destroy"){A[y].destroy()}else{if(A[y].status.rendered===true){if(w=="show"){A[y].show()}else{if(w=="hide"){A[y].hide()}else{if(w=="focus"){A[y].focus()}else{if(w=="disable"){A[y].disable(true)}else{if(w=="enable"){A[y].disable(false)}}}}}}}}}}}else{v=f.extend(true,{},s);v.hide.effect.length=s.hide.effect.length;v.show.effect.length=s.show.effect.length;if(v.position.container===false){v.position.container=f(document.body)}if(v.position.target===false){v.position.target=f(this)}if(v.show.when.target===false){v.show.when.target=f(this)}if(v.hide.when.target===false){v.hide.when.target=f(this)}t=f.fn.qtip.interfaces.length;for(y=0;y<t;y++){if(typeof f.fn.qtip.interfaces[y]=="undefined"){t=y;break}}x=new d(f(this),v,t);f.fn.qtip.interfaces[t]=x;if(typeof f(this).data("qtip")=="object"){if(typeof f(this).attr("qtip")==="undefined"){f(this).data("qtip").current=f(this).data("qtip").interfaces.length}f(this).data("qtip").interfaces.push(x)}else{f(this).data("qtip",{current:0,interfaces:[x]})}if(v.content.prerender===false&&v.show.when.event!==false&&v.show.ready!==true){v.show.when.target.bind(v.show.when.event+".qtip-"+t+"-create",{qtip:t},function(C){z=f.fn.qtip.interfaces[C.data.qtip];z.options.show.when.target.unbind(z.options.show.when.event+".qtip-"+C.data.qtip+"-create");z.cache.mouse={x:C.pageX,y:C.pageY};p.call(z);z.options.show.when.target.trigger(z.options.show.when.event)})}else{x.cache.mouse={x:v.show.when.target.offset().left,y:v.show.when.target.offset().top};p.call(x)}}})};function d(u,t,v){var s=this;s.id=v;s.options=t;s.status={animated:false,rendered:false,disabled:false,focused:false};s.elements={target:u.addClass(s.options.style.classes.target),tooltip:null,wrapper:null,content:null,contentWrapper:null,title:null,button:null,tip:null,bgiframe:null};s.cache={mouse:{},position:{},toggle:0};s.timers={};f.extend(s,s.options.api,{show:function(y){var x,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"show")}if(s.elements.tooltip.css("display")!=="none"){return s}s.elements.tooltip.stop(true,false);x=s.beforeShow.call(s,y);if(x===false){return s}function w(){if(s.options.position.type!=="static"){s.focus()}s.onShow.call(s,y);if(f.browser.msie){s.elements.tooltip.get(0).style.removeAttribute("filter")}}s.cache.toggle=1;if(s.options.position.type!=="static"){s.updatePosition(y,(s.options.show.effect.length>0))}if(typeof s.options.show.solo=="object"){z=f(s.options.show.solo)}else{if(s.options.show.solo===true){z=f("div.qtip").not(s.elements.tooltip)}}if(z){z.each(function(){if(f(this).qtip("api").status.rendered===true){f(this).qtip("api").hide()}})}if(typeof s.options.show.effect.type=="function"){s.options.show.effect.type.call(s.elements.tooltip,s.options.show.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.show.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeIn(s.options.show.effect.length,w);break;case"slide":s.elements.tooltip.slideDown(s.options.show.effect.length,function(){w();if(s.options.position.type!=="static"){s.updatePosition(y,true)}});break;case"grow":s.elements.tooltip.show(s.options.show.effect.length,w);break;default:s.elements.tooltip.show(null,w);break}s.elements.tooltip.addClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_SHOWN,"show")},hide:function(y){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"hide")}else{if(s.elements.tooltip.css("display")==="none"){return s}}clearTimeout(s.timers.show);s.elements.tooltip.stop(true,false);x=s.beforeHide.call(s,y);if(x===false){return s}function w(){s.onHide.call(s,y)}s.cache.toggle=0;if(typeof s.options.hide.effect.type=="function"){s.options.hide.effect.type.call(s.elements.tooltip,s.options.hide.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.hide.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeOut(s.options.hide.effect.length,w);break;case"slide":s.elements.tooltip.slideUp(s.options.hide.effect.length,w);break;case"grow":s.elements.tooltip.hide(s.options.hide.effect.length,w);break;default:s.elements.tooltip.hide(null,w);break}s.elements.tooltip.removeClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_HIDDEN,"hide")},updatePosition:function(w,x){var C,G,L,J,H,E,y,I,B,D,K,A,F,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updatePosition")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_POSITION_STATIC,"updatePosition")}}G={position:{left:0,top:0},dimensions:{height:0,width:0},corner:s.options.position.corner.target};L={position:s.getPosition(),dimensions:s.getDimensions(),corner:s.options.position.corner.tooltip};if(s.options.position.target!=="mouse"){if(s.options.position.target.get(0).nodeName.toLowerCase()=="area"){J=s.options.position.target.attr("coords").split(",");for(C=0;C<J.length;C++){J[C]=parseInt(J[C])}H=s.options.position.target.parent("map").attr("name");E=f('img[usemap="#'+H+'"]:first').offset();G.position={left:Math.floor(E.left+J[0]),top:Math.floor(E.top+J[1])};switch(s.options.position.target.attr("shape").toLowerCase()){case"rect":G.dimensions={width:Math.ceil(Math.abs(J[2]-J[0])),height:Math.ceil(Math.abs(J[3]-J[1]))};break;case"circle":G.dimensions={width:J[2]+1,height:J[2]+1};break;case"poly":G.dimensions={width:J[0],height:J[1]};for(C=0;C<J.length;C++){if(C%2==0){if(J[C]>G.dimensions.width){G.dimensions.width=J[C]}if(J[C]<J[0]){G.position.left=Math.floor(E.left+J[C])}}else{if(J[C]>G.dimensions.height){G.dimensions.height=J[C]}if(J[C]<J[1]){G.position.top=Math.floor(E.top+J[C])}}}G.dimensions.width=G.dimensions.width-(G.position.left-E.left);G.dimensions.height=G.dimensions.height-(G.position.top-E.top);break;default:return f.fn.qtip.log.error.call(s,4,f.fn.qtip.constants.INVALID_AREA_SHAPE,"updatePosition");break}G.dimensions.width-=2;G.dimensions.height-=2}else{if(s.options.position.target.add(document.body).length===1){G.position={left:f(document).scrollLeft(),top:f(document).scrollTop()};G.dimensions={height:f(window).height(),width:f(window).width()}}else{if(typeof s.options.position.target.attr("qtip")!=="undefined"){G.position=s.options.position.target.qtip("api").cache.position}else{G.position=s.options.position.target.offset()}G.dimensions={height:s.options.position.target.outerHeight(),width:s.options.position.target.outerWidth()}}}y=f.extend({},G.position);if(G.corner.search(/right/i)!==-1){y.left+=G.dimensions.width}if(G.corner.search(/bottom/i)!==-1){y.top+=G.dimensions.height}if(G.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left+=(G.dimensions.width/2)}if(G.corner.search(/((left|right)Middle)|center/)!==-1){y.top+=(G.dimensions.height/2)}}else{G.position=y={left:s.cache.mouse.x,top:s.cache.mouse.y};G.dimensions={height:1,width:1}}if(L.corner.search(/right/i)!==-1){y.left-=L.dimensions.width}if(L.corner.search(/bottom/i)!==-1){y.top-=L.dimensions.height}if(L.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left-=(L.dimensions.width/2)}if(L.corner.search(/((left|right)Middle)|center/)!==-1){y.top-=(L.dimensions.height/2)}I=(f.browser.msie)?1:0;B=(f.browser.msie&&parseInt(f.browser.version.charAt(0))===6)?1:0;if(s.options.style.border.radius>0){if(L.corner.search(/Left/)!==-1){y.left-=s.options.style.border.radius}else{if(L.corner.search(/Right/)!==-1){y.left+=s.options.style.border.radius}}if(L.corner.search(/Top/)!==-1){y.top-=s.options.style.border.radius}else{if(L.corner.search(/Bottom/)!==-1){y.top+=s.options.style.border.radius}}}if(I){if(L.corner.search(/top/)!==-1){y.top-=I}else{if(L.corner.search(/bottom/)!==-1){y.top+=I}}if(L.corner.search(/left/)!==-1){y.left-=I}else{if(L.corner.search(/right/)!==-1){y.left+=I}}if(L.corner.search(/leftMiddle|rightMiddle/)!==-1){y.top-=1}}if(s.options.position.adjust.screen===true){y=o.call(s,y,G,L)}if(s.options.position.target==="mouse"&&s.options.position.adjust.mouse===true){if(s.options.position.adjust.screen===true&&s.elements.tip){K=s.elements.tip.attr("rel")}else{K=s.options.position.corner.tooltip}y.left+=(K.search(/right/i)!==-1)?-6:6;y.top+=(K.search(/bottom/i)!==-1)?-6:6}if(!s.elements.bgiframe&&f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){f("select, object").each(function(){A=f(this).offset();A.bottom=A.top+f(this).height();A.right=A.left+f(this).width();if(y.top+L.dimensions.height>=A.top&&y.left+L.dimensions.width>=A.left){k.call(s)}})}y.left+=s.options.position.adjust.x;y.top+=s.options.position.adjust.y;F=s.getPosition();if(y.left!=F.left||y.top!=F.top){z=s.beforePositionUpdate.call(s,w);if(z===false){return s}s.cache.position=y;if(x===true){s.status.animated=true;s.elements.tooltip.animate(y,200,"swing",function(){s.status.animated=false})}else{s.elements.tooltip.css(y)}s.onPositionUpdate.call(s,w);if(typeof w!=="undefined"&&w.type&&w.type!=="mousemove"){f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_POSITION_UPDATED,"updatePosition")}}return s},updateWidth:function(w){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateWidth")}else{if(w&&typeof w!=="number"){return f.fn.qtip.log.error.call(s,2,"newWidth must be of type number","updateWidth")}}x=s.elements.contentWrapper.siblings().add(s.elements.tip).add(s.elements.button);if(!w){if(typeof s.options.style.width.value=="number"){w=s.options.style.width.value}else{s.elements.tooltip.css({width:"auto"});x.hide();if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"normal"})}w=s.getDimensions().width+1;if(!s.options.style.width.value){if(w>s.options.style.width.max){w=s.options.style.width.max}if(w<s.options.style.width.min){w=s.options.style.width.min}}}}if(w%2!==0){w-=1}s.elements.tooltip.width(w);x.show();if(s.options.style.border.radius){s.elements.tooltip.find(".qtip-betweenCorners").each(function(y){f(this).width(w-(s.options.style.border.radius*2))})}if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"1"});s.elements.wrapper.width(w);if(s.elements.bgiframe){s.elements.bgiframe.width(w).height(s.getDimensions.height)}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_WIDTH_UPDATED,"updateWidth")},updateStyle:function(w){var z,A,x,y,B;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateStyle")}else{if(typeof w!=="string"||!f.fn.qtip.styles[w]){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.STYLE_NOT_DEFINED,"updateStyle")}}s.options.style=a.call(s,f.fn.qtip.styles[w],s.options.user.style);s.elements.content.css(q(s.options.style));if(s.options.content.title.text!==false){s.elements.title.css(q(s.options.style.title,true))}s.elements.contentWrapper.css({borderColor:s.options.style.border.color});if(s.options.style.tip.corner!==false){if(f("<canvas>").get(0).getContext){z=s.elements.tooltip.find(".qtip-tip canvas:first");x=z.get(0).getContext("2d");x.clearRect(0,0,300,300);y=z.parent("div[rel]:first").attr("rel");B=b(y,s.options.style.tip.size.width,s.options.style.tip.size.height);h.call(s,z,B,s.options.style.tip.color||s.options.style.border.color)}else{if(f.browser.msie){z=s.elements.tooltip.find('.qtip-tip [nodeName="shape"]');z.attr("fillcolor",s.options.style.tip.color||s.options.style.border.color)}}}if(s.options.style.border.radius>0){s.elements.tooltip.find(".qtip-betweenCorners").css({backgroundColor:s.options.style.border.color});if(f("<canvas>").get(0).getContext){A=g(s.options.style.border.radius);s.elements.tooltip.find(".qtip-wrapper canvas").each(function(){x=f(this).get(0).getContext("2d");x.clearRect(0,0,300,300);y=f(this).parent("div[rel]:first").attr("rel");r.call(s,f(this),A[y],s.options.style.border.radius,s.options.style.border.color)})}else{if(f.browser.msie){s.elements.tooltip.find('.qtip-wrapper [nodeName="arc"]').each(function(){f(this).attr("fillcolor",s.options.style.border.color)})}}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_STYLE_UPDATED,"updateStyle")},updateContent:function(A,y){var z,x,w;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateContent")}else{if(!A){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateContent")}}z=s.beforeContentUpdate.call(s,A);if(typeof z=="string"){A=z}else{if(z===false){return}}if(f.browser.msie){s.elements.contentWrapper.children().css({zoom:"normal"})}if(A.jquery&&A.length>0){A.clone(true).appendTo(s.elements.content).show()}else{s.elements.content.html(A)}x=s.elements.content.find("img[complete=false]");if(x.length>0){w=0;x.each(function(C){f('<img src="'+f(this).attr("src")+'" />').load(function(){if(++w==x.length){B()}})})}else{B()}function B(){s.updateWidth();if(y!==false){if(s.options.position.type!=="static"){s.updatePosition(s.elements.tooltip.is(":visible"),true)}if(s.options.style.tip.corner!==false){n.call(s)}}}s.onContentUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_UPDATED,"loadContent")},loadContent:function(w,z,A){var y;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"loadContent")}y=s.beforeContentLoad.call(s);if(y===false){return s}if(A=="post"){f.post(w,z,x)}else{f.get(w,z,x)}function x(B){s.onContentLoad.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_LOADED,"loadContent");s.updateContent(B)}return s},updateTitle:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateTitle")}else{if(!w){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateTitle")}}returned=s.beforeTitleUpdate.call(s);if(returned===false){return s}if(s.elements.button){s.elements.button=s.elements.button.clone(true)}s.elements.title.html(w);if(s.elements.button){s.elements.title.prepend(s.elements.button)}s.onTitleUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_TITLE_UPDATED,"updateTitle")},focus:function(A){var y,x,w,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"focus")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_FOCUS_STATIC,"focus")}}y=parseInt(s.elements.tooltip.css("z-index"));x=6000+f("div.qtip[qtip]").length-1;if(!s.status.focused&&y!==x){z=s.beforeFocus.call(s,A);if(z===false){return s}f("div.qtip[qtip]").not(s.elements.tooltip).each(function(){if(f(this).qtip("api").status.rendered===true){w=parseInt(f(this).css("z-index"));if(typeof w=="number"&&w>-1){f(this).css({zIndex:parseInt(f(this).css("z-index"))-1})}f(this).qtip("api").status.focused=false}});s.elements.tooltip.css({zIndex:x});s.status.focused=true;s.onFocus.call(s,A);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_FOCUSED,"focus")}return s},disable:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"disable")}if(w){if(!s.status.disabled){s.status.disabled=true;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DISABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_DISABLED,"disable")}}else{if(s.status.disabled){s.status.disabled=false;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_ENABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_ENABLED,"disable")}}return s},destroy:function(){var w,x,y;x=s.beforeDestroy.call(s);if(x===false){return s}if(s.status.rendered){s.options.show.when.target.unbind("mousemove.qtip",s.updatePosition);s.options.show.when.target.unbind("mouseout.qtip",s.hide);s.options.show.when.target.unbind(s.options.show.when.event+".qtip");s.options.hide.when.target.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind("mouseover.qtip",s.focus);s.elements.tooltip.remove()}else{s.options.show.when.target.unbind(s.options.show.when.event+".qtip-create")}if(typeof s.elements.target.data("qtip")=="object"){y=s.elements.target.data("qtip").interfaces;if(typeof y=="object"&&y.length>0){for(w=0;w<y.length-1;w++){if(y[w].id==s.id){y.splice(w,1)}}}}delete f.fn.qtip.interfaces[s.id];if(typeof y=="object"&&y.length>0){s.elements.target.data("qtip").current=y.length-1}else{s.elements.target.removeData("qtip")}s.onDestroy.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DESTROYED,"destroy");return s.elements.target},getPosition:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getPosition")}w=(s.elements.tooltip.css("display")!=="none")?false:true;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x=s.elements.tooltip.offset();if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x},getDimensions:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getDimensions")}w=(!s.elements.tooltip.is(":visible"))?true:false;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x={height:s.elements.tooltip.outerHeight(),width:s.elements.tooltip.outerWidth()};if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x}})}function p(){var s,w,u,t,v,y,x;s=this;s.beforeRender.call(s);s.status.rendered=true;s.elements.tooltip='<div qtip="'+s.id+'" class="qtip '+(s.options.style.classes.tooltip||s.options.style)+'"style="display:none; -moz-border-radius:0; -webkit-border-radius:0; border-radius:0;position:'+s.options.position.type+';"> <div class="qtip-wrapper" style="position:relative; overflow:hidden; text-align:left;"> <div class="qtip-contentWrapper" style="overflow:hidden;"> <div class="qtip-content '+s.options.style.classes.content+'"></div></div></div></div>';s.elements.tooltip=f(s.elements.tooltip);s.elements.tooltip.appendTo(s.options.position.container);s.elements.tooltip.data("qtip",{current:0,interfaces:[s]});s.elements.wrapper=s.elements.tooltip.children("div:first");s.elements.contentWrapper=s.elements.wrapper.children("div:first").css({background:s.options.style.background});s.elements.content=s.elements.contentWrapper.children("div:first").css(q(s.options.style));if(f.browser.msie){s.elements.wrapper.add(s.elements.content).css({zoom:1})}if(s.options.hide.when.event=="unfocus"){s.elements.tooltip.attr("unfocus",true)}if(typeof s.options.style.width.value=="number"){s.updateWidth()}if(f("<canvas>").get(0).getContext||f.browser.msie){if(s.options.style.border.radius>0){m.call(s)}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color})}if(s.options.style.tip.corner!==false){e.call(s)}}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color});s.options.style.border.radius=0;s.options.style.tip.corner=false;f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.CANVAS_VML_NOT_SUPPORTED,"render")}if((typeof s.options.content.text=="string"&&s.options.content.text.length>0)||(s.options.content.text.jquery&&s.options.content.text.length>0)){u=s.options.content.text}else{if(typeof s.elements.target.attr("title")=="string"&&s.elements.target.attr("title").length>0){u=s.elements.target.attr("title").replace("\\n","<br />");s.elements.target.attr("title","")}else{if(typeof s.elements.target.attr("alt")=="string"&&s.elements.target.attr("alt").length>0){u=s.elements.target.attr("alt").replace("\\n","<br />");s.elements.target.attr("alt","")}else{u=" ";f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.NO_VALID_CONTENT,"render")}}}if(s.options.content.title.text!==false){j.call(s)}s.updateContent(u);l.call(s);if(s.options.show.ready===true){s.show()}if(s.options.content.url!==false){t=s.options.content.url;v=s.options.content.data;y=s.options.content.method||"get";s.loadContent(t,v,y)}s.onRender.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_RENDERED,"render")}function m(){var F,z,t,B,x,E,u,G,D,y,w,C,A,s,v;F=this;F.elements.wrapper.find(".qtip-borderBottom, .qtip-borderTop").remove();t=F.options.style.border.width;B=F.options.style.border.radius;x=F.options.style.border.color||F.options.style.tip.color;E=g(B);u={};for(z in E){u[z]='<div rel="'+z+'" style="'+((z.search(/Left/)!==-1)?"left":"right")+":0; position:absolute; height:"+B+"px; width:"+B+'px; overflow:hidden; line-height:0.1px; font-size:1px">';if(f("<canvas>").get(0).getContext){u[z]+='<canvas height="'+B+'" width="'+B+'" style="vertical-align: top"></canvas>'}else{if(f.browser.msie){G=B*2+3;u[z]+='<v:arc stroked="false" fillcolor="'+x+'" startangle="'+E[z][0]+'" endangle="'+E[z][1]+'" style="width:'+G+"px; height:"+G+"px; margin-top:"+((z.search(/bottom/)!==-1)?-2:-1)+"px; margin-left:"+((z.search(/Right/)!==-1)?E[z][2]-3.5:-1)+'px; vertical-align:top; display:inline-block; behavior:url(#default#VML)"></v:arc>'}}u[z]+="</div>"}D=F.getDimensions().width-(Math.max(t,B)*2);y='<div class="qtip-betweenCorners" style="height:'+B+"px; width:"+D+"px; overflow:hidden; background-color:"+x+'; line-height:0.1px; font-size:1px;">';w='<div class="qtip-borderTop" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.topLeft+u.topRight+y;F.elements.wrapper.prepend(w);C='<div class="qtip-borderBottom" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.bottomLeft+u.bottomRight+y;F.elements.wrapper.append(C);if(f("<canvas>").get(0).getContext){F.elements.wrapper.find("canvas").each(function(){A=E[f(this).parent("[rel]:first").attr("rel")];r.call(F,f(this),A,B,x)})}else{if(f.browser.msie){F.elements.tooltip.append('<v:image style="behavior:url(#default#VML);"></v:image>')}}s=Math.max(B,(B+(t-B)));v=Math.max(t-B,0);F.elements.contentWrapper.css({border:"0px solid "+x,borderWidth:v+"px "+s+"px"})}function r(u,w,s,t){var v=u.get(0).getContext("2d");v.fillStyle=t;v.beginPath();v.arc(w[0],w[1],s,0,Math.PI*2,false);v.fill()}function e(v){var t,s,x,u,w;t=this;if(t.elements.tip!==null){t.elements.tip.remove()}s=t.options.style.tip.color||t.options.style.border.color;if(t.options.style.tip.corner===false){return}else{if(!v){v=t.options.style.tip.corner}}x=b(v,t.options.style.tip.size.width,t.options.style.tip.size.height);t.elements.tip='<div class="'+t.options.style.classes.tip+'" dir="ltr" rel="'+v+'" style="position:absolute; height:'+t.options.style.tip.size.height+"px; width:"+t.options.style.tip.size.width+'px; margin:0 auto; line-height:0.1px; font-size:1px;">';if(f("<canvas>").get(0).getContext){t.elements.tip+='<canvas height="'+t.options.style.tip.size.height+'" width="'+t.options.style.tip.size.width+'"></canvas>'}else{if(f.browser.msie){u=t.options.style.tip.size.width+","+t.options.style.tip.size.height;w="m"+x[0][0]+","+x[0][1];w+=" l"+x[1][0]+","+x[1][1];w+=" "+x[2][0]+","+x[2][1];w+=" xe";t.elements.tip+='<v:shape fillcolor="'+s+'" stroked="false" filled="true" path="'+w+'" coordsize="'+u+'" style="width:'+t.options.style.tip.size.width+"px; height:"+t.options.style.tip.size.height+"px; line-height:0.1px; display:inline-block; behavior:url(#default#VML); vertical-align:"+((v.search(/top/)!==-1)?"bottom":"top")+'"></v:shape>';t.elements.tip+='<v:image style="behavior:url(#default#VML);"></v:image>';t.elements.contentWrapper.css("position","relative")}}t.elements.tooltip.prepend(t.elements.tip+"</div>");t.elements.tip=t.elements.tooltip.find("."+t.options.style.classes.tip).eq(0);if(f("<canvas>").get(0).getContext){h.call(t,t.elements.tip.find("canvas:first"),x,s)}if(v.search(/top/)!==-1&&f.browser.msie&&parseInt(f.browser.version.charAt(0))===6){t.elements.tip.css({marginTop:-4})}n.call(t,v)}function h(t,v,s){var u=t.get(0).getContext("2d");u.fillStyle=s;u.beginPath();u.moveTo(v[0][0],v[0][1]);u.lineTo(v[1][0],v[1][1]);u.lineTo(v[2][0],v[2][1]);u.fill()}function n(u){var t,w,s,x,v;t=this;if(t.options.style.tip.corner===false||!t.elements.tip){return}if(!u){u=t.elements.tip.attr("rel")}w=positionAdjust=(f.browser.msie)?1:0;t.elements.tip.css(u.match(/left|right|top|bottom/)[0],0);if(u.search(/top|bottom/)!==-1){if(f.browser.msie){if(parseInt(f.browser.version.charAt(0))===6){positionAdjust=(u.search(/top/)!==-1)?-3:1}else{positionAdjust=(u.search(/top/)!==-1)?1:2}}if(u.search(/Middle/)!==-1){t.elements.tip.css({left:"50%",marginLeft:-(t.options.style.tip.size.width/2)})}else{if(u.search(/Left/)!==-1){t.elements.tip.css({left:t.options.style.border.radius-w})}else{if(u.search(/Right/)!==-1){t.elements.tip.css({right:t.options.style.border.radius+w})}}}if(u.search(/top/)!==-1){t.elements.tip.css({top:-positionAdjust})}else{t.elements.tip.css({bottom:positionAdjust})}}else{if(u.search(/left|right/)!==-1){if(f.browser.msie){positionAdjust=(parseInt(f.browser.version.charAt(0))===6)?1:((u.search(/left/)!==-1)?1:2)}if(u.search(/Middle/)!==-1){t.elements.tip.css({top:"50%",marginTop:-(t.options.style.tip.size.height/2)})}else{if(u.search(/Top/)!==-1){t.elements.tip.css({top:t.options.style.border.radius-w})}else{if(u.search(/Bottom/)!==-1){t.elements.tip.css({bottom:t.options.style.border.radius+w})}}}if(u.search(/left/)!==-1){t.elements.tip.css({left:-positionAdjust})}else{t.elements.tip.css({right:positionAdjust})}}}s="padding-"+u.match(/left|right|top|bottom/)[0];x=t.options.style.tip.size[(s.search(/left|right/)!==-1)?"width":"height"];t.elements.tooltip.css("padding",0);t.elements.tooltip.css(s,x);if(f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){v=parseInt(t.elements.tip.css("margin-top"))||0;v+=parseInt(t.elements.content.css("margin-top"))||0;t.elements.tip.css({marginTop:v})}}function j(){var s=this;if(s.elements.title!==null){s.elements.title.remove()}s.elements.title=f('<div class="'+s.options.style.classes.title+'">').css(q(s.options.style.title,true)).css({zoom:(f.browser.msie)?1:0}).prependTo(s.elements.contentWrapper);if(s.options.content.title.text){s.updateTitle.call(s,s.options.content.title.text)}if(s.options.content.title.button!==false&&typeof s.options.content.title.button=="string"){s.elements.button=f('<a class="'+s.options.style.classes.button+'" style="float:right; position: relative"></a>').css(q(s.options.style.button,true)).html(s.options.content.title.button).prependTo(s.elements.title).click(function(t){if(!s.status.disabled){s.hide(t)}})}}function l(){var t,v,u,s;t=this;v=t.options.show.when.target;u=t.options.hide.when.target;if(t.options.hide.fixed){u=u.add(t.elements.tooltip)}if(t.options.hide.when.event=="inactive"){s=["click","dblclick","mousedown","mouseup","mousemove","mouseout","mouseenter","mouseleave","mouseover"];function y(z){if(t.status.disabled===true){return}clearTimeout(t.timers.inactive);t.timers.inactive=setTimeout(function(){f(s).each(function(){u.unbind(this+".qtip-inactive");t.elements.content.unbind(this+".qtip-inactive")});t.hide(z)},t.options.hide.delay)}}else{if(t.options.hide.fixed===true){t.elements.tooltip.bind("mouseover.qtip",function(){if(t.status.disabled===true){return}clearTimeout(t.timers.hide)})}}function x(z){if(t.status.disabled===true){return}if(t.options.hide.when.event=="inactive"){f(s).each(function(){u.bind(this+".qtip-inactive",y);t.elements.content.bind(this+".qtip-inactive",y)});y()}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.timers.show=setTimeout(function(){t.show(z)},t.options.show.delay)}function w(z){if(t.status.disabled===true){return}if(t.options.hide.fixed===true&&t.options.hide.when.event.search(/mouse(out|leave)/i)!==-1&&f(z.relatedTarget).parents("div.qtip[qtip]").length>0){z.stopPropagation();z.preventDefault();clearTimeout(t.timers.hide);return false}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.elements.tooltip.stop(true,true);t.timers.hide=setTimeout(function(){t.hide(z)},t.options.hide.delay)}if((t.options.show.when.target.add(t.options.hide.when.target).length===1&&t.options.show.when.event==t.options.hide.when.event&&t.options.hide.when.event!=="inactive")||t.options.hide.when.event=="unfocus"){t.cache.toggle=0;v.bind(t.options.show.when.event+".qtip",function(z){if(t.cache.toggle==0){x(z)}else{w(z)}})}else{v.bind(t.options.show.when.event+".qtip",x);if(t.options.hide.when.event!=="inactive"){u.bind(t.options.hide.when.event+".qtip",w)}}if(t.options.position.type.search(/(fixed|absolute)/)!==-1){t.elements.tooltip.bind("mouseover.qtip",t.focus)}if(t.options.position.target==="mouse"&&t.options.position.type!=="static"){v.bind("mousemove.qtip",function(z){t.cache.mouse={x:z.pageX,y:z.pageY};if(t.status.disabled===false&&t.options.position.adjust.mouse===true&&t.options.position.type!=="static"&&t.elements.tooltip.css("display")!=="none"){t.updatePosition(z)}})}}function o(u,v,A){var z,s,x,y,t,w;z=this;if(A.corner=="center"){return v.position}s=f.extend({},u);y={x:false,y:false};t={left:(s.left<f.fn.qtip.cache.screen.scroll.left),right:(s.left+A.dimensions.width+2>=f.fn.qtip.cache.screen.width+f.fn.qtip.cache.screen.scroll.left),top:(s.top<f.fn.qtip.cache.screen.scroll.top),bottom:(s.top+A.dimensions.height+2>=f.fn.qtip.cache.screen.height+f.fn.qtip.cache.screen.scroll.top)};x={left:(t.left&&(A.corner.search(/right/i)!=-1||(A.corner.search(/right/i)==-1&&!t.right))),right:(t.right&&(A.corner.search(/left/i)!=-1||(A.corner.search(/left/i)==-1&&!t.left))),top:(t.top&&A.corner.search(/top/i)==-1),bottom:(t.bottom&&A.corner.search(/bottom/i)==-1)};if(x.left){if(z.options.position.target!=="mouse"){s.left=v.position.left+v.dimensions.width}else{s.left=z.cache.mouse.x}y.x="Left"}else{if(x.right){if(z.options.position.target!=="mouse"){s.left=v.position.left-A.dimensions.width}else{s.left=z.cache.mouse.x-A.dimensions.width}y.x="Right"}}if(x.top){if(z.options.position.target!=="mouse"){s.top=v.position.top+v.dimensions.height}else{s.top=z.cache.mouse.y}y.y="top"}else{if(x.bottom){if(z.options.position.target!=="mouse"){s.top=v.position.top-A.dimensions.height}else{s.top=z.cache.mouse.y-A.dimensions.height}y.y="bottom"}}if(s.left<0){s.left=u.left;y.x=false}if(s.top<0){s.top=u.top;y.y=false}if(z.options.style.tip.corner!==false){s.corner=new String(A.corner);if(y.x!==false){s.corner=s.corner.replace(/Left|Right|Middle/,y.x)}if(y.y!==false){s.corner=s.corner.replace(/top|bottom/,y.y)}if(s.corner!==z.elements.tip.attr("rel")){e.call(z,s.corner)}}return s}function q(u,t){var v,s;v=f.extend(true,{},u);for(s in v){if(t===true&&s.search(/(tip|classes)/i)!==-1){delete v[s]}else{if(!t&&s.search(/(width|border|tip|title|classes|user)/i)!==-1){delete v[s]}}}return v}function c(s){if(typeof s.tip!=="object"){s.tip={corner:s.tip}}if(typeof s.tip.size!=="object"){s.tip.size={width:s.tip.size,height:s.tip.size}}if(typeof s.border!=="object"){s.border={width:s.border}}if(typeof s.width!=="object"){s.width={value:s.width}}if(typeof s.width.max=="string"){s.width.max=parseInt(s.width.max.replace(/([0-9]+)/i,"$1"))}if(typeof s.width.min=="string"){s.width.min=parseInt(s.width.min.replace(/([0-9]+)/i,"$1"))}if(typeof s.tip.size.x=="number"){s.tip.size.width=s.tip.size.x;delete s.tip.size.x}if(typeof s.tip.size.y=="number"){s.tip.size.height=s.tip.size.y;delete s.tip.size.y}return s}function a(){var s,t,u,x,v,w;s=this;u=[true,{}];for(t=0;t<arguments.length;t++){u.push(arguments[t])}x=[f.extend.apply(f,u)];while(typeof x[0].name=="string"){x.unshift(c(f.fn.qtip.styles[x[0].name]))}x.unshift(true,{classes:{tooltip:"qtip-"+(arguments[0].name||"defaults")}},f.fn.qtip.styles.defaults);v=f.extend.apply(f,x);w=(f.browser.msie)?1:0;v.tip.size.width+=w;v.tip.size.height+=w;if(v.tip.size.width%2>0){v.tip.size.width+=1}if(v.tip.size.height%2>0){v.tip.size.height+=1}if(v.tip.corner===true){v.tip.corner=(s.options.position.corner.tooltip==="center")?false:s.options.position.corner.tooltip}return v}function b(v,u,t){var s={bottomRight:[[0,0],[u,t],[u,0]],bottomLeft:[[0,0],[u,0],[0,t]],topRight:[[0,t],[u,0],[u,t]],topLeft:[[0,0],[0,t],[u,t]],topMiddle:[[0,t],[u/2,0],[u,t]],bottomMiddle:[[0,0],[u,0],[u/2,t]],rightMiddle:[[0,0],[u,t/2],[0,t]],leftMiddle:[[u,0],[u,t],[0,t/2]]};s.leftTop=s.bottomRight;s.rightTop=s.bottomLeft;s.leftBottom=s.topRight;s.rightBottom=s.topLeft;return s[v]}function g(s){var t;if(f("<canvas>").get(0).getContext){t={topLeft:[s,s],topRight:[0,s],bottomLeft:[s,0],bottomRight:[0,0]}}else{if(f.browser.msie){t={topLeft:[-90,90,0],topRight:[-90,90,-s],bottomLeft:[90,270,0],bottomRight:[90,270,-s]}}}return t}function k(){var s,t,u;s=this;u=s.getDimensions();t='<iframe class="qtip-bgiframe" frameborder="0" tabindex="-1" src="javascript:false" style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=\'0\'); border: 1px solid red; height:'+u.height+"px; width:"+u.width+'px" />';s.elements.bgiframe=s.elements.wrapper.prepend(t).children(".qtip-bgiframe:first")}f(document).ready(function(){f.fn.qtip.cache={screen:{scroll:{left:f(window).scrollLeft(),top:f(window).scrollTop()},width:f(window).width(),height:f(window).height()}};var s;f(window).bind("resize scroll",function(t){clearTimeout(s);s=setTimeout(function(){if(t.type==="scroll"){f.fn.qtip.cache.screen.scroll={left:f(window).scrollLeft(),top:f(window).scrollTop()}}else{f.fn.qtip.cache.screen.width=f(window).width();f.fn.qtip.cache.screen.height=f(window).height()}for(i=0;i<f.fn.qtip.interfaces.length;i++){var u=f.fn.qtip.interfaces[i];if(u.status.rendered===true&&(u.options.position.type!=="static"||u.options.position.adjust.scroll&&t.type==="scroll"||u.options.position.adjust.resize&&t.type==="resize")){u.updatePosition(t,true)}}},100)});f(document).bind("mousedown.qtip",function(t){if(f(t.target).parents("div.qtip").length===0){f(".qtip[unfocus]").each(function(){var u=f(this).qtip("api");if(f(this).is(":visible")&&!u.status.disabled&&f(t.target).add(u.elements.target).length>1){u.hide(t)}})}})});f.fn.qtip.interfaces=[];f.fn.qtip.log={error:function(){return this}};f.fn.qtip.constants={};f.fn.qtip.defaults={content:{prerender:false,text:false,url:false,data:null,title:{text:false,button:false}},position:{target:false,corner:{target:"bottomRight",tooltip:"topLeft"},adjust:{x:0,y:0,mouse:true,screen:false,scroll:true,resize:true},type:"absolute",container:false},show:{when:{target:false,event:"mouseover"},effect:{type:"fade",length:100},delay:140,solo:false,ready:false},hide:{when:{target:false,event:"mouseout"},effect:{type:"fade",length:100},delay:0,fixed:false},api:{beforeRender:function(){},onRender:function(){},beforePositionUpdate:function(){},onPositionUpdate:function(){},beforeShow:function(){},onShow:function(){},beforeHide:function(){},onHide:function(){},beforeContentUpdate:function(){},onContentUpdate:function(){},beforeContentLoad:function(){},onContentLoad:function(){},beforeTitleUpdate:function(){},onTitleUpdate:function(){},beforeDestroy:function(){},onDestroy:function(){},beforeFocus:function(){},onFocus:function(){}}};f.fn.qtip.styles={defaults:{background:"white",color:"#111",overflow:"hidden",textAlign:"left",width:{min:0,max:250},padding:"5px 9px",border:{width:1,radius:0,color:"#d3d3d3"},tip:{corner:false,color:false,size:{width:13,height:13},opacity:1},title:{background:"#e1e1e1",fontWeight:"bold",padding:"7px 12px"},button:{cursor:"pointer"},classes:{target:"",tip:"qtip-tip",title:"qtip-title",button:"qtip-button",content:"qtip-content",active:"qtip-active"}},cream:{border:{width:3,radius:0,color:"#F9E98E"},title:{background:"#F0DE7D",color:"#A27D35"},background:"#FBF7AA",color:"#A27D35",classes:{tooltip:"qtip-cream"}},light:{border:{width:3,radius:0,color:"#E2E2E2"},title:{background:"#f1f1f1",color:"#454545"},background:"white",color:"#454545",classes:{tooltip:"qtip-light"}},dark:{border:{width:3,radius:0,color:"#303030"},title:{background:"#404040",color:"#f3f3f3"},background:"#505050",color:"#f3f3f3",classes:{tooltip:"qtip-dark"}},red:{border:{width:3,radius:0,color:"#CE6F6F"},title:{background:"#f28279",color:"#9C2F2F"},background:"#F79992",color:"#9C2F2F",classes:{tooltip:"qtip-red"}},green:{border:{width:3,radius:0,color:"#A9DB66"},title:{background:"#b9db8c",color:"#58792E"},background:"#CDE6AC",color:"#58792E",classes:{tooltip:"qtip-green"}},blue:{border:{width:3,radius:0,color:"#ADD9ED"},title:{background:"#D0E9F5",color:"#5E99BD"},background:"#E5F6FE",color:"#4D9FBF",classes:{tooltip:"qtip-blue"}}}})(jQuery);
|
16 |
-
|
17 |
-
|
18 |
-
|
19 |
-
|
20 |
-
|
21 |
-
|
1 |
+
/*
|
2 |
+
* jquery.qtip. The jQuery tooltip plugin
|
3 |
+
*
|
4 |
+
* Copyright (c) 2009 Craig Thompson
|
5 |
+
* http://craigsworks.com
|
6 |
+
*
|
7 |
+
* Licensed under MIT
|
8 |
+
* http://www.opensource.org/licenses/mit-license.php
|
9 |
+
*
|
10 |
+
* Launch : February 2009
|
11 |
+
* Version : 1.0.0-rc3
|
12 |
+
* Released: Tuesday 12th May, 2009 - 00:00
|
13 |
+
* Debug: jquery.qtip.debug.js
|
14 |
+
*/
|
15 |
+
(function(f){f.fn.qtip=function(B,u){var y,t,A,s,x,w,v,z;if(typeof B=="string"){if(typeof f(this).data("qtip")!=="object"){f.fn.qtip.log.error.call(self,1,f.fn.qtip.constants.NO_TOOLTIP_PRESENT,false)}if(B=="api"){return f(this).data("qtip").interfaces[f(this).data("qtip").current]}else{if(B=="interfaces"){return f(this).data("qtip").interfaces}}}else{if(!B){B={}}if(typeof B.content!=="object"||(B.content.jquery&&B.content.length>0)){B.content={text:B.content}}if(typeof B.content.title!=="object"){B.content.title={text:B.content.title}}if(typeof B.position!=="object"){B.position={corner:B.position}}if(typeof B.position.corner!=="object"){B.position.corner={target:B.position.corner,tooltip:B.position.corner}}if(typeof B.show!=="object"){B.show={when:B.show}}if(typeof B.show.when!=="object"){B.show.when={event:B.show.when}}if(typeof B.show.effect!=="object"){B.show.effect={type:B.show.effect}}if(typeof B.hide!=="object"){B.hide={when:B.hide}}if(typeof B.hide.when!=="object"){B.hide.when={event:B.hide.when}}if(typeof B.hide.effect!=="object"){B.hide.effect={type:B.hide.effect}}if(typeof B.style!=="object"){B.style={name:B.style}}B.style=c(B.style);s=f.extend(true,{},f.fn.qtip.defaults,B);s.style=a.call({options:s},s.style);s.user=f.extend(true,{},B)}return f(this).each(function(){if(typeof B=="string"){w=B.toLowerCase();A=f(this).qtip("interfaces");if(typeof A=="object"){if(u===true&&w=="destroy"){while(A.length>0){A[A.length-1].destroy()}}else{if(u!==true){A=[f(this).qtip("api")]}for(y=0;y<A.length;y++){if(w=="destroy"){A[y].destroy()}else{if(A[y].status.rendered===true){if(w=="show"){A[y].show()}else{if(w=="hide"){A[y].hide()}else{if(w=="focus"){A[y].focus()}else{if(w=="disable"){A[y].disable(true)}else{if(w=="enable"){A[y].disable(false)}}}}}}}}}}}else{v=f.extend(true,{},s);v.hide.effect.length=s.hide.effect.length;v.show.effect.length=s.show.effect.length;if(v.position.container===false){v.position.container=f(document.body)}if(v.position.target===false){v.position.target=f(this)}if(v.show.when.target===false){v.show.when.target=f(this)}if(v.hide.when.target===false){v.hide.when.target=f(this)}t=f.fn.qtip.interfaces.length;for(y=0;y<t;y++){if(typeof f.fn.qtip.interfaces[y]=="undefined"){t=y;break}}x=new d(f(this),v,t);f.fn.qtip.interfaces[t]=x;if(typeof f(this).data("qtip")=="object"){if(typeof f(this).attr("qtip")==="undefined"){f(this).data("qtip").current=f(this).data("qtip").interfaces.length}f(this).data("qtip").interfaces.push(x)}else{f(this).data("qtip",{current:0,interfaces:[x]})}if(v.content.prerender===false&&v.show.when.event!==false&&v.show.ready!==true){v.show.when.target.bind(v.show.when.event+".qtip-"+t+"-create",{qtip:t},function(C){z=f.fn.qtip.interfaces[C.data.qtip];z.options.show.when.target.unbind(z.options.show.when.event+".qtip-"+C.data.qtip+"-create");z.cache.mouse={x:C.pageX,y:C.pageY};p.call(z);z.options.show.when.target.trigger(z.options.show.when.event)})}else{x.cache.mouse={x:v.show.when.target.offset().left,y:v.show.when.target.offset().top};p.call(x)}}})};function d(u,t,v){var s=this;s.id=v;s.options=t;s.status={animated:false,rendered:false,disabled:false,focused:false};s.elements={target:u.addClass(s.options.style.classes.target),tooltip:null,wrapper:null,content:null,contentWrapper:null,title:null,button:null,tip:null,bgiframe:null};s.cache={mouse:{},position:{},toggle:0};s.timers={};f.extend(s,s.options.api,{show:function(y){var x,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"show")}if(s.elements.tooltip.css("display")!=="none"){return s}s.elements.tooltip.stop(true,false);x=s.beforeShow.call(s,y);if(x===false){return s}function w(){if(s.options.position.type!=="static"){s.focus()}s.onShow.call(s,y);if(f.browser.msie){s.elements.tooltip.get(0).style.removeAttribute("filter")}}s.cache.toggle=1;if(s.options.position.type!=="static"){s.updatePosition(y,(s.options.show.effect.length>0))}if(typeof s.options.show.solo=="object"){z=f(s.options.show.solo)}else{if(s.options.show.solo===true){z=f("div.qtip").not(s.elements.tooltip)}}if(z){z.each(function(){if(f(this).qtip("api").status.rendered===true){f(this).qtip("api").hide()}})}if(typeof s.options.show.effect.type=="function"){s.options.show.effect.type.call(s.elements.tooltip,s.options.show.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.show.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeIn(s.options.show.effect.length,w);break;case"slide":s.elements.tooltip.slideDown(s.options.show.effect.length,function(){w();if(s.options.position.type!=="static"){s.updatePosition(y,true)}});break;case"grow":s.elements.tooltip.show(s.options.show.effect.length,w);break;default:s.elements.tooltip.show(null,w);break}s.elements.tooltip.addClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_SHOWN,"show")},hide:function(y){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"hide")}else{if(s.elements.tooltip.css("display")==="none"){return s}}clearTimeout(s.timers.show);s.elements.tooltip.stop(true,false);x=s.beforeHide.call(s,y);if(x===false){return s}function w(){s.onHide.call(s,y)}s.cache.toggle=0;if(typeof s.options.hide.effect.type=="function"){s.options.hide.effect.type.call(s.elements.tooltip,s.options.hide.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.hide.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeOut(s.options.hide.effect.length,w);break;case"slide":s.elements.tooltip.slideUp(s.options.hide.effect.length,w);break;case"grow":s.elements.tooltip.hide(s.options.hide.effect.length,w);break;default:s.elements.tooltip.hide(null,w);break}s.elements.tooltip.removeClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_HIDDEN,"hide")},updatePosition:function(w,x){var C,G,L,J,H,E,y,I,B,D,K,A,F,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updatePosition")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_POSITION_STATIC,"updatePosition")}}G={position:{left:0,top:0},dimensions:{height:0,width:0},corner:s.options.position.corner.target};L={position:s.getPosition(),dimensions:s.getDimensions(),corner:s.options.position.corner.tooltip};if(s.options.position.target!=="mouse"){if(s.options.position.target.get(0).nodeName.toLowerCase()=="area"){J=s.options.position.target.attr("coords").split(",");for(C=0;C<J.length;C++){J[C]=parseInt(J[C])}H=s.options.position.target.parent("map").attr("name");E=f('img[usemap="#'+H+'"]:first').offset();G.position={left:Math.floor(E.left+J[0]),top:Math.floor(E.top+J[1])};switch(s.options.position.target.attr("shape").toLowerCase()){case"rect":G.dimensions={width:Math.ceil(Math.abs(J[2]-J[0])),height:Math.ceil(Math.abs(J[3]-J[1]))};break;case"circle":G.dimensions={width:J[2]+1,height:J[2]+1};break;case"poly":G.dimensions={width:J[0],height:J[1]};for(C=0;C<J.length;C++){if(C%2==0){if(J[C]>G.dimensions.width){G.dimensions.width=J[C]}if(J[C]<J[0]){G.position.left=Math.floor(E.left+J[C])}}else{if(J[C]>G.dimensions.height){G.dimensions.height=J[C]}if(J[C]<J[1]){G.position.top=Math.floor(E.top+J[C])}}}G.dimensions.width=G.dimensions.width-(G.position.left-E.left);G.dimensions.height=G.dimensions.height-(G.position.top-E.top);break;default:return f.fn.qtip.log.error.call(s,4,f.fn.qtip.constants.INVALID_AREA_SHAPE,"updatePosition");break}G.dimensions.width-=2;G.dimensions.height-=2}else{if(s.options.position.target.add(document.body).length===1){G.position={left:f(document).scrollLeft(),top:f(document).scrollTop()};G.dimensions={height:f(window).height(),width:f(window).width()}}else{if(typeof s.options.position.target.attr("qtip")!=="undefined"){G.position=s.options.position.target.qtip("api").cache.position}else{G.position=s.options.position.target.offset()}G.dimensions={height:s.options.position.target.outerHeight(),width:s.options.position.target.outerWidth()}}}y=f.extend({},G.position);if(G.corner.search(/right/i)!==-1){y.left+=G.dimensions.width}if(G.corner.search(/bottom/i)!==-1){y.top+=G.dimensions.height}if(G.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left+=(G.dimensions.width/2)}if(G.corner.search(/((left|right)Middle)|center/)!==-1){y.top+=(G.dimensions.height/2)}}else{G.position=y={left:s.cache.mouse.x,top:s.cache.mouse.y};G.dimensions={height:1,width:1}}if(L.corner.search(/right/i)!==-1){y.left-=L.dimensions.width}if(L.corner.search(/bottom/i)!==-1){y.top-=L.dimensions.height}if(L.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left-=(L.dimensions.width/2)}if(L.corner.search(/((left|right)Middle)|center/)!==-1){y.top-=(L.dimensions.height/2)}I=(f.browser.msie)?1:0;B=(f.browser.msie&&parseInt(f.browser.version.charAt(0))===6)?1:0;if(s.options.style.border.radius>0){if(L.corner.search(/Left/)!==-1){y.left-=s.options.style.border.radius}else{if(L.corner.search(/Right/)!==-1){y.left+=s.options.style.border.radius}}if(L.corner.search(/Top/)!==-1){y.top-=s.options.style.border.radius}else{if(L.corner.search(/Bottom/)!==-1){y.top+=s.options.style.border.radius}}}if(I){if(L.corner.search(/top/)!==-1){y.top-=I}else{if(L.corner.search(/bottom/)!==-1){y.top+=I}}if(L.corner.search(/left/)!==-1){y.left-=I}else{if(L.corner.search(/right/)!==-1){y.left+=I}}if(L.corner.search(/leftMiddle|rightMiddle/)!==-1){y.top-=1}}if(s.options.position.adjust.screen===true){y=o.call(s,y,G,L)}if(s.options.position.target==="mouse"&&s.options.position.adjust.mouse===true){if(s.options.position.adjust.screen===true&&s.elements.tip){K=s.elements.tip.attr("rel")}else{K=s.options.position.corner.tooltip}y.left+=(K.search(/right/i)!==-1)?-6:6;y.top+=(K.search(/bottom/i)!==-1)?-6:6}if(!s.elements.bgiframe&&f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){f("select, object").each(function(){A=f(this).offset();A.bottom=A.top+f(this).height();A.right=A.left+f(this).width();if(y.top+L.dimensions.height>=A.top&&y.left+L.dimensions.width>=A.left){k.call(s)}})}y.left+=s.options.position.adjust.x;y.top+=s.options.position.adjust.y;F=s.getPosition();if(y.left!=F.left||y.top!=F.top){z=s.beforePositionUpdate.call(s,w);if(z===false){return s}s.cache.position=y;if(x===true){s.status.animated=true;s.elements.tooltip.animate(y,200,"swing",function(){s.status.animated=false})}else{s.elements.tooltip.css(y)}s.onPositionUpdate.call(s,w);if(typeof w!=="undefined"&&w.type&&w.type!=="mousemove"){f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_POSITION_UPDATED,"updatePosition")}}return s},updateWidth:function(w){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateWidth")}else{if(w&&typeof w!=="number"){return f.fn.qtip.log.error.call(s,2,"newWidth must be of type number","updateWidth")}}x=s.elements.contentWrapper.siblings().add(s.elements.tip).add(s.elements.button);if(!w){if(typeof s.options.style.width.value=="number"){w=s.options.style.width.value}else{s.elements.tooltip.css({width:"auto"});x.hide();if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"normal"})}w=s.getDimensions().width+1;if(!s.options.style.width.value){if(w>s.options.style.width.max){w=s.options.style.width.max}if(w<s.options.style.width.min){w=s.options.style.width.min}}}}if(w%2!==0){w-=1}s.elements.tooltip.width(w);x.show();if(s.options.style.border.radius){s.elements.tooltip.find(".qtip-betweenCorners").each(function(y){f(this).width(w-(s.options.style.border.radius*2))})}if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"1"});s.elements.wrapper.width(w);if(s.elements.bgiframe){s.elements.bgiframe.width(w).height(s.getDimensions.height)}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_WIDTH_UPDATED,"updateWidth")},updateStyle:function(w){var z,A,x,y,B;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateStyle")}else{if(typeof w!=="string"||!f.fn.qtip.styles[w]){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.STYLE_NOT_DEFINED,"updateStyle")}}s.options.style=a.call(s,f.fn.qtip.styles[w],s.options.user.style);s.elements.content.css(q(s.options.style));if(s.options.content.title.text!==false){s.elements.title.css(q(s.options.style.title,true))}s.elements.contentWrapper.css({borderColor:s.options.style.border.color});if(s.options.style.tip.corner!==false){if(f("<canvas>").get(0).getContext){z=s.elements.tooltip.find(".qtip-tip canvas:first");x=z.get(0).getContext("2d");x.clearRect(0,0,300,300);y=z.parent("div[rel]:first").attr("rel");B=b(y,s.options.style.tip.size.width,s.options.style.tip.size.height);h.call(s,z,B,s.options.style.tip.color||s.options.style.border.color)}else{if(f.browser.msie){z=s.elements.tooltip.find('.qtip-tip [nodeName="shape"]');z.attr("fillcolor",s.options.style.tip.color||s.options.style.border.color)}}}if(s.options.style.border.radius>0){s.elements.tooltip.find(".qtip-betweenCorners").css({backgroundColor:s.options.style.border.color});if(f("<canvas>").get(0).getContext){A=g(s.options.style.border.radius);s.elements.tooltip.find(".qtip-wrapper canvas").each(function(){x=f(this).get(0).getContext("2d");x.clearRect(0,0,300,300);y=f(this).parent("div[rel]:first").attr("rel");r.call(s,f(this),A[y],s.options.style.border.radius,s.options.style.border.color)})}else{if(f.browser.msie){s.elements.tooltip.find('.qtip-wrapper [nodeName="arc"]').each(function(){f(this).attr("fillcolor",s.options.style.border.color)})}}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_STYLE_UPDATED,"updateStyle")},updateContent:function(A,y){var z,x,w;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateContent")}else{if(!A){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateContent")}}z=s.beforeContentUpdate.call(s,A);if(typeof z=="string"){A=z}else{if(z===false){return}}if(f.browser.msie){s.elements.contentWrapper.children().css({zoom:"normal"})}if(A.jquery&&A.length>0){A.clone(true).appendTo(s.elements.content).show()}else{s.elements.content.html(A)}x=s.elements.content.find("img[complete=false]");if(x.length>0){w=0;x.each(function(C){f('<img src="'+f(this).attr("src")+'" />').load(function(){if(++w==x.length){B()}})})}else{B()}function B(){s.updateWidth();if(y!==false){if(s.options.position.type!=="static"){s.updatePosition(s.elements.tooltip.is(":visible"),true)}if(s.options.style.tip.corner!==false){n.call(s)}}}s.onContentUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_UPDATED,"loadContent")},loadContent:function(w,z,A){var y;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"loadContent")}y=s.beforeContentLoad.call(s);if(y===false){return s}if(A=="post"){f.post(w,z,x)}else{f.get(w,z,x)}function x(B){s.onContentLoad.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_LOADED,"loadContent");s.updateContent(B)}return s},updateTitle:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateTitle")}else{if(!w){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateTitle")}}returned=s.beforeTitleUpdate.call(s);if(returned===false){return s}if(s.elements.button){s.elements.button=s.elements.button.clone(true)}s.elements.title.html(w);if(s.elements.button){s.elements.title.prepend(s.elements.button)}s.onTitleUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_TITLE_UPDATED,"updateTitle")},focus:function(A){var y,x,w,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"focus")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_FOCUS_STATIC,"focus")}}y=parseInt(s.elements.tooltip.css("z-index"));x=6000+f("div.qtip[qtip]").length-1;if(!s.status.focused&&y!==x){z=s.beforeFocus.call(s,A);if(z===false){return s}f("div.qtip[qtip]").not(s.elements.tooltip).each(function(){if(f(this).qtip("api").status.rendered===true){w=parseInt(f(this).css("z-index"));if(typeof w=="number"&&w>-1){f(this).css({zIndex:parseInt(f(this).css("z-index"))-1})}f(this).qtip("api").status.focused=false}});s.elements.tooltip.css({zIndex:x});s.status.focused=true;s.onFocus.call(s,A);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_FOCUSED,"focus")}return s},disable:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"disable")}if(w){if(!s.status.disabled){s.status.disabled=true;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DISABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_DISABLED,"disable")}}else{if(s.status.disabled){s.status.disabled=false;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_ENABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_ENABLED,"disable")}}return s},destroy:function(){var w,x,y;x=s.beforeDestroy.call(s);if(x===false){return s}if(s.status.rendered){s.options.show.when.target.unbind("mousemove.qtip",s.updatePosition);s.options.show.when.target.unbind("mouseout.qtip",s.hide);s.options.show.when.target.unbind(s.options.show.when.event+".qtip");s.options.hide.when.target.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind("mouseover.qtip",s.focus);s.elements.tooltip.remove()}else{s.options.show.when.target.unbind(s.options.show.when.event+".qtip-create")}if(typeof s.elements.target.data("qtip")=="object"){y=s.elements.target.data("qtip").interfaces;if(typeof y=="object"&&y.length>0){for(w=0;w<y.length-1;w++){if(y[w].id==s.id){y.splice(w,1)}}}}delete f.fn.qtip.interfaces[s.id];if(typeof y=="object"&&y.length>0){s.elements.target.data("qtip").current=y.length-1}else{s.elements.target.removeData("qtip")}s.onDestroy.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DESTROYED,"destroy");return s.elements.target},getPosition:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getPosition")}w=(s.elements.tooltip.css("display")!=="none")?false:true;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x=s.elements.tooltip.offset();if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x},getDimensions:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getDimensions")}w=(!s.elements.tooltip.is(":visible"))?true:false;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x={height:s.elements.tooltip.outerHeight(),width:s.elements.tooltip.outerWidth()};if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x}})}function p(){var s,w,u,t,v,y,x;s=this;s.beforeRender.call(s);s.status.rendered=true;s.elements.tooltip='<div qtip="'+s.id+'" class="qtip '+(s.options.style.classes.tooltip||s.options.style)+'"style="display:none; -moz-border-radius:0; -webkit-border-radius:0; border-radius:0;position:'+s.options.position.type+';"> <div class="qtip-wrapper" style="position:relative; overflow:hidden; text-align:left;"> <div class="qtip-contentWrapper" style="overflow:hidden;"> <div class="qtip-content '+s.options.style.classes.content+'"></div></div></div></div>';s.elements.tooltip=f(s.elements.tooltip);s.elements.tooltip.appendTo(s.options.position.container);s.elements.tooltip.data("qtip",{current:0,interfaces:[s]});s.elements.wrapper=s.elements.tooltip.children("div:first");s.elements.contentWrapper=s.elements.wrapper.children("div:first").css({background:s.options.style.background});s.elements.content=s.elements.contentWrapper.children("div:first").css(q(s.options.style));if(f.browser.msie){s.elements.wrapper.add(s.elements.content).css({zoom:1})}if(s.options.hide.when.event=="unfocus"){s.elements.tooltip.attr("unfocus",true)}if(typeof s.options.style.width.value=="number"){s.updateWidth()}if(f("<canvas>").get(0).getContext||f.browser.msie){if(s.options.style.border.radius>0){m.call(s)}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color})}if(s.options.style.tip.corner!==false){e.call(s)}}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color});s.options.style.border.radius=0;s.options.style.tip.corner=false;f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.CANVAS_VML_NOT_SUPPORTED,"render")}if((typeof s.options.content.text=="string"&&s.options.content.text.length>0)||(s.options.content.text.jquery&&s.options.content.text.length>0)){u=s.options.content.text}else{if(typeof s.elements.target.attr("title")=="string"&&s.elements.target.attr("title").length>0){u=s.elements.target.attr("title").replace("\\n","<br />");s.elements.target.attr("title","")}else{if(typeof s.elements.target.attr("alt")=="string"&&s.elements.target.attr("alt").length>0){u=s.elements.target.attr("alt").replace("\\n","<br />");s.elements.target.attr("alt","")}else{u=" ";f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.NO_VALID_CONTENT,"render")}}}if(s.options.content.title.text!==false){j.call(s)}s.updateContent(u);l.call(s);if(s.options.show.ready===true){s.show()}if(s.options.content.url!==false){t=s.options.content.url;v=s.options.content.data;y=s.options.content.method||"get";s.loadContent(t,v,y)}s.onRender.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_RENDERED,"render")}function m(){var F,z,t,B,x,E,u,G,D,y,w,C,A,s,v;F=this;F.elements.wrapper.find(".qtip-borderBottom, .qtip-borderTop").remove();t=F.options.style.border.width;B=F.options.style.border.radius;x=F.options.style.border.color||F.options.style.tip.color;E=g(B);u={};for(z in E){u[z]='<div rel="'+z+'" style="'+((z.search(/Left/)!==-1)?"left":"right")+":0; position:absolute; height:"+B+"px; width:"+B+'px; overflow:hidden; line-height:0.1px; font-size:1px">';if(f("<canvas>").get(0).getContext){u[z]+='<canvas height="'+B+'" width="'+B+'" style="vertical-align: top"></canvas>'}else{if(f.browser.msie){G=B*2+3;u[z]+='<v:arc stroked="false" fillcolor="'+x+'" startangle="'+E[z][0]+'" endangle="'+E[z][1]+'" style="width:'+G+"px; height:"+G+"px; margin-top:"+((z.search(/bottom/)!==-1)?-2:-1)+"px; margin-left:"+((z.search(/Right/)!==-1)?E[z][2]-3.5:-1)+'px; vertical-align:top; display:inline-block; behavior:url(#default#VML)"></v:arc>'}}u[z]+="</div>"}D=F.getDimensions().width-(Math.max(t,B)*2);y='<div class="qtip-betweenCorners" style="height:'+B+"px; width:"+D+"px; overflow:hidden; background-color:"+x+'; line-height:0.1px; font-size:1px;">';w='<div class="qtip-borderTop" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.topLeft+u.topRight+y;F.elements.wrapper.prepend(w);C='<div class="qtip-borderBottom" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.bottomLeft+u.bottomRight+y;F.elements.wrapper.append(C);if(f("<canvas>").get(0).getContext){F.elements.wrapper.find("canvas").each(function(){A=E[f(this).parent("[rel]:first").attr("rel")];r.call(F,f(this),A,B,x)})}else{if(f.browser.msie){F.elements.tooltip.append('<v:image style="behavior:url(#default#VML);"></v:image>')}}s=Math.max(B,(B+(t-B)));v=Math.max(t-B,0);F.elements.contentWrapper.css({border:"0px solid "+x,borderWidth:v+"px "+s+"px"})}function r(u,w,s,t){var v=u.get(0).getContext("2d");v.fillStyle=t;v.beginPath();v.arc(w[0],w[1],s,0,Math.PI*2,false);v.fill()}function e(v){var t,s,x,u,w;t=this;if(t.elements.tip!==null){t.elements.tip.remove()}s=t.options.style.tip.color||t.options.style.border.color;if(t.options.style.tip.corner===false){return}else{if(!v){v=t.options.style.tip.corner}}x=b(v,t.options.style.tip.size.width,t.options.style.tip.size.height);t.elements.tip='<div class="'+t.options.style.classes.tip+'" dir="ltr" rel="'+v+'" style="position:absolute; height:'+t.options.style.tip.size.height+"px; width:"+t.options.style.tip.size.width+'px; margin:0 auto; line-height:0.1px; font-size:1px;">';if(f("<canvas>").get(0).getContext){t.elements.tip+='<canvas height="'+t.options.style.tip.size.height+'" width="'+t.options.style.tip.size.width+'"></canvas>'}else{if(f.browser.msie){u=t.options.style.tip.size.width+","+t.options.style.tip.size.height;w="m"+x[0][0]+","+x[0][1];w+=" l"+x[1][0]+","+x[1][1];w+=" "+x[2][0]+","+x[2][1];w+=" xe";t.elements.tip+='<v:shape fillcolor="'+s+'" stroked="false" filled="true" path="'+w+'" coordsize="'+u+'" style="width:'+t.options.style.tip.size.width+"px; height:"+t.options.style.tip.size.height+"px; line-height:0.1px; display:inline-block; behavior:url(#default#VML); vertical-align:"+((v.search(/top/)!==-1)?"bottom":"top")+'"></v:shape>';t.elements.tip+='<v:image style="behavior:url(#default#VML);"></v:image>';t.elements.contentWrapper.css("position","relative")}}t.elements.tooltip.prepend(t.elements.tip+"</div>");t.elements.tip=t.elements.tooltip.find("."+t.options.style.classes.tip).eq(0);if(f("<canvas>").get(0).getContext){h.call(t,t.elements.tip.find("canvas:first"),x,s)}if(v.search(/top/)!==-1&&f.browser.msie&&parseInt(f.browser.version.charAt(0))===6){t.elements.tip.css({marginTop:-4})}n.call(t,v)}function h(t,v,s){var u=t.get(0).getContext("2d");u.fillStyle=s;u.beginPath();u.moveTo(v[0][0],v[0][1]);u.lineTo(v[1][0],v[1][1]);u.lineTo(v[2][0],v[2][1]);u.fill()}function n(u){var t,w,s,x,v;t=this;if(t.options.style.tip.corner===false||!t.elements.tip){return}if(!u){u=t.elements.tip.attr("rel")}w=positionAdjust=(f.browser.msie)?1:0;t.elements.tip.css(u.match(/left|right|top|bottom/)[0],0);if(u.search(/top|bottom/)!==-1){if(f.browser.msie){if(parseInt(f.browser.version.charAt(0))===6){positionAdjust=(u.search(/top/)!==-1)?-3:1}else{positionAdjust=(u.search(/top/)!==-1)?1:2}}if(u.search(/Middle/)!==-1){t.elements.tip.css({left:"50%",marginLeft:-(t.options.style.tip.size.width/2)})}else{if(u.search(/Left/)!==-1){t.elements.tip.css({left:t.options.style.border.radius-w})}else{if(u.search(/Right/)!==-1){t.elements.tip.css({right:t.options.style.border.radius+w})}}}if(u.search(/top/)!==-1){t.elements.tip.css({top:-positionAdjust})}else{t.elements.tip.css({bottom:positionAdjust})}}else{if(u.search(/left|right/)!==-1){if(f.browser.msie){positionAdjust=(parseInt(f.browser.version.charAt(0))===6)?1:((u.search(/left/)!==-1)?1:2)}if(u.search(/Middle/)!==-1){t.elements.tip.css({top:"50%",marginTop:-(t.options.style.tip.size.height/2)})}else{if(u.search(/Top/)!==-1){t.elements.tip.css({top:t.options.style.border.radius-w})}else{if(u.search(/Bottom/)!==-1){t.elements.tip.css({bottom:t.options.style.border.radius+w})}}}if(u.search(/left/)!==-1){t.elements.tip.css({left:-positionAdjust})}else{t.elements.tip.css({right:positionAdjust})}}}s="padding-"+u.match(/left|right|top|bottom/)[0];x=t.options.style.tip.size[(s.search(/left|right/)!==-1)?"width":"height"];t.elements.tooltip.css("padding",0);t.elements.tooltip.css(s,x);if(f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){v=parseInt(t.elements.tip.css("margin-top"))||0;v+=parseInt(t.elements.content.css("margin-top"))||0;t.elements.tip.css({marginTop:v})}}function j(){var s=this;if(s.elements.title!==null){s.elements.title.remove()}s.elements.title=f('<div class="'+s.options.style.classes.title+'">').css(q(s.options.style.title,true)).css({zoom:(f.browser.msie)?1:0}).prependTo(s.elements.contentWrapper);if(s.options.content.title.text){s.updateTitle.call(s,s.options.content.title.text)}if(s.options.content.title.button!==false&&typeof s.options.content.title.button=="string"){s.elements.button=f('<a class="'+s.options.style.classes.button+'" style="float:right; position: relative"></a>').css(q(s.options.style.button,true)).html(s.options.content.title.button).prependTo(s.elements.title).click(function(t){if(!s.status.disabled){s.hide(t)}})}}function l(){var t,v,u,s;t=this;v=t.options.show.when.target;u=t.options.hide.when.target;if(t.options.hide.fixed){u=u.add(t.elements.tooltip)}if(t.options.hide.when.event=="inactive"){s=["click","dblclick","mousedown","mouseup","mousemove","mouseout","mouseenter","mouseleave","mouseover"];function y(z){if(t.status.disabled===true){return}clearTimeout(t.timers.inactive);t.timers.inactive=setTimeout(function(){f(s).each(function(){u.unbind(this+".qtip-inactive");t.elements.content.unbind(this+".qtip-inactive")});t.hide(z)},t.options.hide.delay)}}else{if(t.options.hide.fixed===true){t.elements.tooltip.bind("mouseover.qtip",function(){if(t.status.disabled===true){return}clearTimeout(t.timers.hide)})}}function x(z){if(t.status.disabled===true){return}if(t.options.hide.when.event=="inactive"){f(s).each(function(){u.bind(this+".qtip-inactive",y);t.elements.content.bind(this+".qtip-inactive",y)});y()}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.timers.show=setTimeout(function(){t.show(z)},t.options.show.delay)}function w(z){if(t.status.disabled===true){return}if(t.options.hide.fixed===true&&t.options.hide.when.event.search(/mouse(out|leave)/i)!==-1&&f(z.relatedTarget).parents("div.qtip[qtip]").length>0){z.stopPropagation();z.preventDefault();clearTimeout(t.timers.hide);return false}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.elements.tooltip.stop(true,true);t.timers.hide=setTimeout(function(){t.hide(z)},t.options.hide.delay)}if((t.options.show.when.target.add(t.options.hide.when.target).length===1&&t.options.show.when.event==t.options.hide.when.event&&t.options.hide.when.event!=="inactive")||t.options.hide.when.event=="unfocus"){t.cache.toggle=0;v.bind(t.options.show.when.event+".qtip",function(z){if(t.cache.toggle==0){x(z)}else{w(z)}})}else{v.bind(t.options.show.when.event+".qtip",x);if(t.options.hide.when.event!=="inactive"){u.bind(t.options.hide.when.event+".qtip",w)}}if(t.options.position.type.search(/(fixed|absolute)/)!==-1){t.elements.tooltip.bind("mouseover.qtip",t.focus)}if(t.options.position.target==="mouse"&&t.options.position.type!=="static"){v.bind("mousemove.qtip",function(z){t.cache.mouse={x:z.pageX,y:z.pageY};if(t.status.disabled===false&&t.options.position.adjust.mouse===true&&t.options.position.type!=="static"&&t.elements.tooltip.css("display")!=="none"){t.updatePosition(z)}})}}function o(u,v,A){var z,s,x,y,t,w;z=this;if(A.corner=="center"){return v.position}s=f.extend({},u);y={x:false,y:false};t={left:(s.left<f.fn.qtip.cache.screen.scroll.left),right:(s.left+A.dimensions.width+2>=f.fn.qtip.cache.screen.width+f.fn.qtip.cache.screen.scroll.left),top:(s.top<f.fn.qtip.cache.screen.scroll.top),bottom:(s.top+A.dimensions.height+2>=f.fn.qtip.cache.screen.height+f.fn.qtip.cache.screen.scroll.top)};x={left:(t.left&&(A.corner.search(/right/i)!=-1||(A.corner.search(/right/i)==-1&&!t.right))),right:(t.right&&(A.corner.search(/left/i)!=-1||(A.corner.search(/left/i)==-1&&!t.left))),top:(t.top&&A.corner.search(/top/i)==-1),bottom:(t.bottom&&A.corner.search(/bottom/i)==-1)};if(x.left){if(z.options.position.target!=="mouse"){s.left=v.position.left+v.dimensions.width}else{s.left=z.cache.mouse.x}y.x="Left"}else{if(x.right){if(z.options.position.target!=="mouse"){s.left=v.position.left-A.dimensions.width}else{s.left=z.cache.mouse.x-A.dimensions.width}y.x="Right"}}if(x.top){if(z.options.position.target!=="mouse"){s.top=v.position.top+v.dimensions.height}else{s.top=z.cache.mouse.y}y.y="top"}else{if(x.bottom){if(z.options.position.target!=="mouse"){s.top=v.position.top-A.dimensions.height}else{s.top=z.cache.mouse.y-A.dimensions.height}y.y="bottom"}}if(s.left<0){s.left=u.left;y.x=false}if(s.top<0){s.top=u.top;y.y=false}if(z.options.style.tip.corner!==false){s.corner=new String(A.corner);if(y.x!==false){s.corner=s.corner.replace(/Left|Right|Middle/,y.x)}if(y.y!==false){s.corner=s.corner.replace(/top|bottom/,y.y)}if(s.corner!==z.elements.tip.attr("rel")){e.call(z,s.corner)}}return s}function q(u,t){var v,s;v=f.extend(true,{},u);for(s in v){if(t===true&&s.search(/(tip|classes)/i)!==-1){delete v[s]}else{if(!t&&s.search(/(width|border|tip|title|classes|user)/i)!==-1){delete v[s]}}}return v}function c(s){if(typeof s.tip!=="object"){s.tip={corner:s.tip}}if(typeof s.tip.size!=="object"){s.tip.size={width:s.tip.size,height:s.tip.size}}if(typeof s.border!=="object"){s.border={width:s.border}}if(typeof s.width!=="object"){s.width={value:s.width}}if(typeof s.width.max=="string"){s.width.max=parseInt(s.width.max.replace(/([0-9]+)/i,"$1"))}if(typeof s.width.min=="string"){s.width.min=parseInt(s.width.min.replace(/([0-9]+)/i,"$1"))}if(typeof s.tip.size.x=="number"){s.tip.size.width=s.tip.size.x;delete s.tip.size.x}if(typeof s.tip.size.y=="number"){s.tip.size.height=s.tip.size.y;delete s.tip.size.y}return s}function a(){var s,t,u,x,v,w;s=this;u=[true,{}];for(t=0;t<arguments.length;t++){u.push(arguments[t])}x=[f.extend.apply(f,u)];while(typeof x[0].name=="string"){x.unshift(c(f.fn.qtip.styles[x[0].name]))}x.unshift(true,{classes:{tooltip:"qtip-"+(arguments[0].name||"defaults")}},f.fn.qtip.styles.defaults);v=f.extend.apply(f,x);w=(f.browser.msie)?1:0;v.tip.size.width+=w;v.tip.size.height+=w;if(v.tip.size.width%2>0){v.tip.size.width+=1}if(v.tip.size.height%2>0){v.tip.size.height+=1}if(v.tip.corner===true){v.tip.corner=(s.options.position.corner.tooltip==="center")?false:s.options.position.corner.tooltip}return v}function b(v,u,t){var s={bottomRight:[[0,0],[u,t],[u,0]],bottomLeft:[[0,0],[u,0],[0,t]],topRight:[[0,t],[u,0],[u,t]],topLeft:[[0,0],[0,t],[u,t]],topMiddle:[[0,t],[u/2,0],[u,t]],bottomMiddle:[[0,0],[u,0],[u/2,t]],rightMiddle:[[0,0],[u,t/2],[0,t]],leftMiddle:[[u,0],[u,t],[0,t/2]]};s.leftTop=s.bottomRight;s.rightTop=s.bottomLeft;s.leftBottom=s.topRight;s.rightBottom=s.topLeft;return s[v]}function g(s){var t;if(f("<canvas>").get(0).getContext){t={topLeft:[s,s],topRight:[0,s],bottomLeft:[s,0],bottomRight:[0,0]}}else{if(f.browser.msie){t={topLeft:[-90,90,0],topRight:[-90,90,-s],bottomLeft:[90,270,0],bottomRight:[90,270,-s]}}}return t}function k(){var s,t,u;s=this;u=s.getDimensions();t='<iframe class="qtip-bgiframe" frameborder="0" tabindex="-1" src="javascript:false" style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=\'0\'); border: 1px solid red; height:'+u.height+"px; width:"+u.width+'px" />';s.elements.bgiframe=s.elements.wrapper.prepend(t).children(".qtip-bgiframe:first")}f(document).ready(function(){f.fn.qtip.cache={screen:{scroll:{left:f(window).scrollLeft(),top:f(window).scrollTop()},width:f(window).width(),height:f(window).height()}};var s;f(window).bind("resize scroll",function(t){clearTimeout(s);s=setTimeout(function(){if(t.type==="scroll"){f.fn.qtip.cache.screen.scroll={left:f(window).scrollLeft(),top:f(window).scrollTop()}}else{f.fn.qtip.cache.screen.width=f(window).width();f.fn.qtip.cache.screen.height=f(window).height()}for(i=0;i<f.fn.qtip.interfaces.length;i++){var u=f.fn.qtip.interfaces[i];if(u.status.rendered===true&&(u.options.position.type!=="static"||u.options.position.adjust.scroll&&t.type==="scroll"||u.options.position.adjust.resize&&t.type==="resize")){u.updatePosition(t,true)}}},100)});f(document).bind("mousedown.qtip",function(t){if(f(t.target).parents("div.qtip").length===0){f(".qtip[unfocus]").each(function(){var u=f(this).qtip("api");if(f(this).is(":visible")&&!u.status.disabled&&f(t.target).add(u.elements.target).length>1){u.hide(t)}})}})});f.fn.qtip.interfaces=[];f.fn.qtip.log={error:function(){return this}};f.fn.qtip.constants={};f.fn.qtip.defaults={content:{prerender:false,text:false,url:false,data:null,title:{text:false,button:false}},position:{target:false,corner:{target:"bottomRight",tooltip:"topLeft"},adjust:{x:0,y:0,mouse:true,screen:false,scroll:true,resize:true},type:"absolute",container:false},show:{when:{target:false,event:"mouseover"},effect:{type:"fade",length:100},delay:140,solo:false,ready:false},hide:{when:{target:false,event:"mouseout"},effect:{type:"fade",length:100},delay:0,fixed:false},api:{beforeRender:function(){},onRender:function(){},beforePositionUpdate:function(){},onPositionUpdate:function(){},beforeShow:function(){},onShow:function(){},beforeHide:function(){},onHide:function(){},beforeContentUpdate:function(){},onContentUpdate:function(){},beforeContentLoad:function(){},onContentLoad:function(){},beforeTitleUpdate:function(){},onTitleUpdate:function(){},beforeDestroy:function(){},onDestroy:function(){},beforeFocus:function(){},onFocus:function(){}}};f.fn.qtip.styles={defaults:{background:"white",color:"#111",overflow:"hidden",textAlign:"left",width:{min:0,max:250},padding:"5px 9px",border:{width:1,radius:0,color:"#d3d3d3"},tip:{corner:false,color:false,size:{width:13,height:13},opacity:1},title:{background:"#e1e1e1",fontWeight:"bold",padding:"7px 12px"},button:{cursor:"pointer"},classes:{target:"",tip:"qtip-tip",title:"qtip-title",button:"qtip-button",content:"qtip-content",active:"qtip-active"}},cream:{border:{width:3,radius:0,color:"#F9E98E"},title:{background:"#F0DE7D",color:"#A27D35"},background:"#FBF7AA",color:"#A27D35",classes:{tooltip:"qtip-cream"}},light:{border:{width:3,radius:0,color:"#E2E2E2"},title:{background:"#f1f1f1",color:"#454545"},background:"white",color:"#454545",classes:{tooltip:"qtip-light"}},dark:{border:{width:3,radius:0,color:"#303030"},title:{background:"#404040",color:"#f3f3f3"},background:"#505050",color:"#f3f3f3",classes:{tooltip:"qtip-dark"}},red:{border:{width:3,radius:0,color:"#CE6F6F"},title:{background:"#f28279",color:"#9C2F2F"},background:"#F79992",color:"#9C2F2F",classes:{tooltip:"qtip-red"}},green:{border:{width:3,radius:0,color:"#A9DB66"},title:{background:"#b9db8c",color:"#58792E"},background:"#CDE6AC",color:"#58792E",classes:{tooltip:"qtip-green"}},blue:{border:{width:3,radius:0,color:"#ADD9ED"},title:{background:"#D0E9F5",color:"#5E99BD"},background:"#E5F6FE",color:"#4D9FBF",classes:{tooltip:"qtip-blue"}}}})(jQuery);
|
16 |
+
|
17 |
+
|
18 |
+
|
19 |
+
|
20 |
+
|
21 |
+
|
assets/deps/select2-3.5.2/select2-bootstrap.css
CHANGED
@@ -1,87 +1,87 @@
|
|
1 |
-
.form-control .select2-choice {
|
2 |
-
border: 0;
|
3 |
-
border-radius: 2px;
|
4 |
-
}
|
5 |
-
|
6 |
-
.form-control .select2-choice .select2-arrow {
|
7 |
-
border-radius: 0 2px 2px 0;
|
8 |
-
}
|
9 |
-
|
10 |
-
.form-control.select2-container {
|
11 |
-
height: auto !important;
|
12 |
-
padding: 0;
|
13 |
-
}
|
14 |
-
|
15 |
-
.form-control.select2-container.select2-dropdown-open {
|
16 |
-
border-color: #5897FB;
|
17 |
-
border-radius: 3px 3px 0 0;
|
18 |
-
}
|
19 |
-
|
20 |
-
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
21 |
-
border-radius: 3px 3px 0 0;
|
22 |
-
}
|
23 |
-
|
24 |
-
.form-control.select2-container .select2-choices {
|
25 |
-
border: 0 !important;
|
26 |
-
border-radius: 3px;
|
27 |
-
}
|
28 |
-
|
29 |
-
.control-group.warning .select2-container .select2-choice,
|
30 |
-
.control-group.warning .select2-container .select2-choices,
|
31 |
-
.control-group.warning .select2-container-active .select2-choice,
|
32 |
-
.control-group.warning .select2-container-active .select2-choices,
|
33 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
34 |
-
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
35 |
-
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
36 |
-
border: 1px solid #C09853 !important;
|
37 |
-
}
|
38 |
-
|
39 |
-
.control-group.warning .select2-container .select2-choice div {
|
40 |
-
border-left: 1px solid #C09853 !important;
|
41 |
-
background: #FCF8E3 !important;
|
42 |
-
}
|
43 |
-
|
44 |
-
.control-group.error .select2-container .select2-choice,
|
45 |
-
.control-group.error .select2-container .select2-choices,
|
46 |
-
.control-group.error .select2-container-active .select2-choice,
|
47 |
-
.control-group.error .select2-container-active .select2-choices,
|
48 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
49 |
-
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
50 |
-
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
51 |
-
border: 1px solid #B94A48 !important;
|
52 |
-
}
|
53 |
-
|
54 |
-
.control-group.error .select2-container .select2-choice div {
|
55 |
-
border-left: 1px solid #B94A48 !important;
|
56 |
-
background: #F2DEDE !important;
|
57 |
-
}
|
58 |
-
|
59 |
-
.control-group.info .select2-container .select2-choice,
|
60 |
-
.control-group.info .select2-container .select2-choices,
|
61 |
-
.control-group.info .select2-container-active .select2-choice,
|
62 |
-
.control-group.info .select2-container-active .select2-choices,
|
63 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
64 |
-
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
65 |
-
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
66 |
-
border: 1px solid #3A87AD !important;
|
67 |
-
}
|
68 |
-
|
69 |
-
.control-group.info .select2-container .select2-choice div {
|
70 |
-
border-left: 1px solid #3A87AD !important;
|
71 |
-
background: #D9EDF7 !important;
|
72 |
-
}
|
73 |
-
|
74 |
-
.control-group.success .select2-container .select2-choice,
|
75 |
-
.control-group.success .select2-container .select2-choices,
|
76 |
-
.control-group.success .select2-container-active .select2-choice,
|
77 |
-
.control-group.success .select2-container-active .select2-choices,
|
78 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
79 |
-
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
80 |
-
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
81 |
-
border: 1px solid #468847 !important;
|
82 |
-
}
|
83 |
-
|
84 |
-
.control-group.success .select2-container .select2-choice div {
|
85 |
-
border-left: 1px solid #468847 !important;
|
86 |
-
background: #DFF0D8 !important;
|
87 |
-
}
|
1 |
+
.form-control .select2-choice {
|
2 |
+
border: 0;
|
3 |
+
border-radius: 2px;
|
4 |
+
}
|
5 |
+
|
6 |
+
.form-control .select2-choice .select2-arrow {
|
7 |
+
border-radius: 0 2px 2px 0;
|
8 |
+
}
|
9 |
+
|
10 |
+
.form-control.select2-container {
|
11 |
+
height: auto !important;
|
12 |
+
padding: 0;
|
13 |
+
}
|
14 |
+
|
15 |
+
.form-control.select2-container.select2-dropdown-open {
|
16 |
+
border-color: #5897FB;
|
17 |
+
border-radius: 3px 3px 0 0;
|
18 |
+
}
|
19 |
+
|
20 |
+
.form-control .select2-container.select2-dropdown-open .select2-choices {
|
21 |
+
border-radius: 3px 3px 0 0;
|
22 |
+
}
|
23 |
+
|
24 |
+
.form-control.select2-container .select2-choices {
|
25 |
+
border: 0 !important;
|
26 |
+
border-radius: 3px;
|
27 |
+
}
|
28 |
+
|
29 |
+
.control-group.warning .select2-container .select2-choice,
|
30 |
+
.control-group.warning .select2-container .select2-choices,
|
31 |
+
.control-group.warning .select2-container-active .select2-choice,
|
32 |
+
.control-group.warning .select2-container-active .select2-choices,
|
33 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
|
34 |
+
.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
|
35 |
+
.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
|
36 |
+
border: 1px solid #C09853 !important;
|
37 |
+
}
|
38 |
+
|
39 |
+
.control-group.warning .select2-container .select2-choice div {
|
40 |
+
border-left: 1px solid #C09853 !important;
|
41 |
+
background: #FCF8E3 !important;
|
42 |
+
}
|
43 |
+
|
44 |
+
.control-group.error .select2-container .select2-choice,
|
45 |
+
.control-group.error .select2-container .select2-choices,
|
46 |
+
.control-group.error .select2-container-active .select2-choice,
|
47 |
+
.control-group.error .select2-container-active .select2-choices,
|
48 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
|
49 |
+
.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
|
50 |
+
.control-group.error .select2-container-multi.select2-container-active .select2-choices {
|
51 |
+
border: 1px solid #B94A48 !important;
|
52 |
+
}
|
53 |
+
|
54 |
+
.control-group.error .select2-container .select2-choice div {
|
55 |
+
border-left: 1px solid #B94A48 !important;
|
56 |
+
background: #F2DEDE !important;
|
57 |
+
}
|
58 |
+
|
59 |
+
.control-group.info .select2-container .select2-choice,
|
60 |
+
.control-group.info .select2-container .select2-choices,
|
61 |
+
.control-group.info .select2-container-active .select2-choice,
|
62 |
+
.control-group.info .select2-container-active .select2-choices,
|
63 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
|
64 |
+
.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
|
65 |
+
.control-group.info .select2-container-multi.select2-container-active .select2-choices {
|
66 |
+
border: 1px solid #3A87AD !important;
|
67 |
+
}
|
68 |
+
|
69 |
+
.control-group.info .select2-container .select2-choice div {
|
70 |
+
border-left: 1px solid #3A87AD !important;
|
71 |
+
background: #D9EDF7 !important;
|
72 |
+
}
|
73 |
+
|
74 |
+
.control-group.success .select2-container .select2-choice,
|
75 |
+
.control-group.success .select2-container .select2-choices,
|
76 |
+
.control-group.success .select2-container-active .select2-choice,
|
77 |
+
.control-group.success .select2-container-active .select2-choices,
|
78 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
|
79 |
+
.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
|
80 |
+
.control-group.success .select2-container-multi.select2-container-active .select2-choices {
|
81 |
+
border: 1px solid #468847 !important;
|
82 |
+
}
|
83 |
+
|
84 |
+
.control-group.success .select2-container .select2-choice div {
|
85 |
+
border-left: 1px solid #468847 !important;
|
86 |
+
background: #DFF0D8 !important;
|
87 |
+
}
|
assets/deps/select2-3.5.2/select2.css
CHANGED
@@ -1,704 +1,704 @@
|
|
1 |
-
/*
|
2 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
3 |
-
*/
|
4 |
-
.select2-container {
|
5 |
-
margin: 0;
|
6 |
-
position: relative;
|
7 |
-
display: inline-block;
|
8 |
-
/* inline-block for ie7 */
|
9 |
-
zoom: 1;
|
10 |
-
*display: inline;
|
11 |
-
vertical-align: middle;
|
12 |
-
}
|
13 |
-
|
14 |
-
.select2-container,
|
15 |
-
.select2-drop,
|
16 |
-
.select2-search,
|
17 |
-
.select2-search input {
|
18 |
-
/*
|
19 |
-
Force border-box so that % widths fit the parent
|
20 |
-
container without overlap because of margin/padding.
|
21 |
-
More Info : http://www.quirksmode.org/css/box.html
|
22 |
-
*/
|
23 |
-
-webkit-box-sizing: border-box; /* webkit */
|
24 |
-
-moz-box-sizing: border-box; /* firefox */
|
25 |
-
box-sizing: border-box; /* css3 */
|
26 |
-
}
|
27 |
-
|
28 |
-
.select2-container .select2-choice {
|
29 |
-
display: block;
|
30 |
-
height: 26px;
|
31 |
-
padding: 0 0 0 8px;
|
32 |
-
overflow: hidden;
|
33 |
-
position: relative;
|
34 |
-
|
35 |
-
border: 1px solid #aaa;
|
36 |
-
white-space: nowrap;
|
37 |
-
line-height: 26px;
|
38 |
-
color: #444;
|
39 |
-
text-decoration: none;
|
40 |
-
|
41 |
-
border-radius: 4px;
|
42 |
-
|
43 |
-
background-clip: padding-box;
|
44 |
-
|
45 |
-
-webkit-touch-callout: none;
|
46 |
-
-webkit-user-select: none;
|
47 |
-
-moz-user-select: none;
|
48 |
-
-ms-user-select: none;
|
49 |
-
user-select: none;
|
50 |
-
|
51 |
-
background-color: #fff;
|
52 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
53 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
54 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
55 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
56 |
-
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
57 |
-
}
|
58 |
-
|
59 |
-
html[dir="rtl"] .select2-container .select2-choice {
|
60 |
-
padding: 0 8px 0 0;
|
61 |
-
}
|
62 |
-
|
63 |
-
.select2-container.select2-drop-above .select2-choice {
|
64 |
-
border-bottom-color: #aaa;
|
65 |
-
|
66 |
-
border-radius: 0 0 4px 4px;
|
67 |
-
|
68 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
69 |
-
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
70 |
-
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
71 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
72 |
-
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
73 |
-
}
|
74 |
-
|
75 |
-
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
76 |
-
margin-right: 42px;
|
77 |
-
}
|
78 |
-
|
79 |
-
.select2-container .select2-choice > .select2-chosen {
|
80 |
-
margin-right: 26px;
|
81 |
-
display: block;
|
82 |
-
overflow: hidden;
|
83 |
-
|
84 |
-
white-space: nowrap;
|
85 |
-
|
86 |
-
text-overflow: ellipsis;
|
87 |
-
float: none;
|
88 |
-
width: auto;
|
89 |
-
}
|
90 |
-
|
91 |
-
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
92 |
-
margin-left: 26px;
|
93 |
-
margin-right: 0;
|
94 |
-
}
|
95 |
-
|
96 |
-
.select2-container .select2-choice abbr {
|
97 |
-
display: none;
|
98 |
-
width: 12px;
|
99 |
-
height: 12px;
|
100 |
-
position: absolute;
|
101 |
-
right: 24px;
|
102 |
-
top: 8px;
|
103 |
-
|
104 |
-
font-size: 1px;
|
105 |
-
text-decoration: none;
|
106 |
-
|
107 |
-
border: 0;
|
108 |
-
background: url('select2.png') right top no-repeat;
|
109 |
-
cursor: pointer;
|
110 |
-
outline: 0;
|
111 |
-
}
|
112 |
-
|
113 |
-
.select2-container.select2-allowclear .select2-choice abbr {
|
114 |
-
display: inline-block;
|
115 |
-
}
|
116 |
-
|
117 |
-
.select2-container .select2-choice abbr:hover {
|
118 |
-
background-position: right -11px;
|
119 |
-
cursor: pointer;
|
120 |
-
}
|
121 |
-
|
122 |
-
.select2-drop-mask {
|
123 |
-
border: 0;
|
124 |
-
margin: 0;
|
125 |
-
padding: 0;
|
126 |
-
position: fixed;
|
127 |
-
left: 0;
|
128 |
-
top: 0;
|
129 |
-
min-height: 100%;
|
130 |
-
min-width: 100%;
|
131 |
-
height: auto;
|
132 |
-
width: auto;
|
133 |
-
opacity: 0;
|
134 |
-
z-index: 9998;
|
135 |
-
/* styles required for IE to work */
|
136 |
-
background-color: #fff;
|
137 |
-
filter: alpha(opacity=0);
|
138 |
-
}
|
139 |
-
|
140 |
-
.select2-drop {
|
141 |
-
width: 100%;
|
142 |
-
margin-top: -1px;
|
143 |
-
position: absolute;
|
144 |
-
z-index: 9999;
|
145 |
-
top: 100%;
|
146 |
-
|
147 |
-
background: #fff;
|
148 |
-
color: #000;
|
149 |
-
border: 1px solid #aaa;
|
150 |
-
border-top: 0;
|
151 |
-
|
152 |
-
border-radius: 0 0 4px 4px;
|
153 |
-
|
154 |
-
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
155 |
-
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
156 |
-
}
|
157 |
-
|
158 |
-
.select2-drop.select2-drop-above {
|
159 |
-
margin-top: 1px;
|
160 |
-
border-top: 1px solid #aaa;
|
161 |
-
border-bottom: 0;
|
162 |
-
|
163 |
-
border-radius: 4px 4px 0 0;
|
164 |
-
|
165 |
-
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
166 |
-
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
167 |
-
}
|
168 |
-
|
169 |
-
.select2-drop-active {
|
170 |
-
border: 1px solid #5897fb;
|
171 |
-
border-top: none;
|
172 |
-
}
|
173 |
-
|
174 |
-
.select2-drop.select2-drop-above.select2-drop-active {
|
175 |
-
border-top: 1px solid #5897fb;
|
176 |
-
}
|
177 |
-
|
178 |
-
.select2-drop-auto-width {
|
179 |
-
border-top: 1px solid #aaa;
|
180 |
-
width: auto;
|
181 |
-
}
|
182 |
-
|
183 |
-
.select2-drop-auto-width .select2-search {
|
184 |
-
padding-top: 4px;
|
185 |
-
}
|
186 |
-
|
187 |
-
.select2-container .select2-choice .select2-arrow {
|
188 |
-
display: inline-block;
|
189 |
-
width: 18px;
|
190 |
-
height: 100%;
|
191 |
-
position: absolute;
|
192 |
-
right: 0;
|
193 |
-
top: 0;
|
194 |
-
|
195 |
-
border-left: 1px solid #aaa;
|
196 |
-
border-radius: 0 4px 4px 0;
|
197 |
-
|
198 |
-
background-clip: padding-box;
|
199 |
-
|
200 |
-
background: #ccc;
|
201 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
202 |
-
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
203 |
-
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
204 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
205 |
-
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
206 |
-
}
|
207 |
-
|
208 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
209 |
-
left: 0;
|
210 |
-
right: auto;
|
211 |
-
|
212 |
-
border-left: none;
|
213 |
-
border-right: 1px solid #aaa;
|
214 |
-
border-radius: 4px 0 0 4px;
|
215 |
-
}
|
216 |
-
|
217 |
-
.select2-container .select2-choice .select2-arrow b {
|
218 |
-
display: block;
|
219 |
-
width: 100%;
|
220 |
-
height: 100%;
|
221 |
-
background: url('select2.png') no-repeat 0 1px;
|
222 |
-
}
|
223 |
-
|
224 |
-
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
225 |
-
background-position: 2px 1px;
|
226 |
-
}
|
227 |
-
|
228 |
-
.select2-search {
|
229 |
-
display: inline-block;
|
230 |
-
width: 100%;
|
231 |
-
min-height: 26px;
|
232 |
-
margin: 0;
|
233 |
-
padding-left: 4px;
|
234 |
-
padding-right: 4px;
|
235 |
-
|
236 |
-
position: relative;
|
237 |
-
z-index: 10000;
|
238 |
-
|
239 |
-
white-space: nowrap;
|
240 |
-
}
|
241 |
-
|
242 |
-
.select2-search input {
|
243 |
-
width: 100%;
|
244 |
-
height: auto !important;
|
245 |
-
min-height: 26px;
|
246 |
-
padding: 4px 20px 4px 5px;
|
247 |
-
margin: 0;
|
248 |
-
|
249 |
-
outline: 0;
|
250 |
-
font-family: sans-serif;
|
251 |
-
font-size: 1em;
|
252 |
-
|
253 |
-
border: 1px solid #aaa;
|
254 |
-
border-radius: 0;
|
255 |
-
|
256 |
-
-webkit-box-shadow: none;
|
257 |
-
box-shadow: none;
|
258 |
-
|
259 |
-
background: #fff url('select2.png') no-repeat 100% -22px;
|
260 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
261 |
-
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
262 |
-
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
263 |
-
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
264 |
-
}
|
265 |
-
|
266 |
-
html[dir="rtl"] .select2-search input {
|
267 |
-
padding: 4px 5px 4px 20px;
|
268 |
-
|
269 |
-
background: #fff url('select2.png') no-repeat -37px -22px;
|
270 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
-
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
-
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
-
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
-
}
|
275 |
-
|
276 |
-
.select2-drop.select2-drop-above .select2-search input {
|
277 |
-
margin-top: 4px;
|
278 |
-
}
|
279 |
-
|
280 |
-
.select2-search input.select2-active {
|
281 |
-
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
282 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
283 |
-
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
284 |
-
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
285 |
-
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
286 |
-
}
|
287 |
-
|
288 |
-
.select2-container-active .select2-choice,
|
289 |
-
.select2-container-active .select2-choices {
|
290 |
-
border: 1px solid #5897fb;
|
291 |
-
outline: none;
|
292 |
-
|
293 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
294 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
295 |
-
}
|
296 |
-
|
297 |
-
.select2-dropdown-open .select2-choice {
|
298 |
-
border-bottom-color: transparent;
|
299 |
-
-webkit-box-shadow: 0 1px 0 #fff inset;
|
300 |
-
box-shadow: 0 1px 0 #fff inset;
|
301 |
-
|
302 |
-
border-bottom-left-radius: 0;
|
303 |
-
border-bottom-right-radius: 0;
|
304 |
-
|
305 |
-
background-color: #eee;
|
306 |
-
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
-
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
308 |
-
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
309 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
-
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
311 |
-
}
|
312 |
-
|
313 |
-
.select2-dropdown-open.select2-drop-above .select2-choice,
|
314 |
-
.select2-dropdown-open.select2-drop-above .select2-choices {
|
315 |
-
border: 1px solid #5897fb;
|
316 |
-
border-top-color: transparent;
|
317 |
-
|
318 |
-
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
319 |
-
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
320 |
-
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
321 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
322 |
-
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
323 |
-
}
|
324 |
-
|
325 |
-
.select2-dropdown-open .select2-choice .select2-arrow {
|
326 |
-
background: transparent;
|
327 |
-
border-left: none;
|
328 |
-
filter: none;
|
329 |
-
}
|
330 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
331 |
-
border-right: none;
|
332 |
-
}
|
333 |
-
|
334 |
-
.select2-dropdown-open .select2-choice .select2-arrow b {
|
335 |
-
background-position: -18px 1px;
|
336 |
-
}
|
337 |
-
|
338 |
-
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
339 |
-
background-position: -16px 1px;
|
340 |
-
}
|
341 |
-
|
342 |
-
.select2-hidden-accessible {
|
343 |
-
border: 0;
|
344 |
-
clip: rect(0 0 0 0);
|
345 |
-
height: 1px;
|
346 |
-
margin: -1px;
|
347 |
-
overflow: hidden;
|
348 |
-
padding: 0;
|
349 |
-
position: absolute;
|
350 |
-
width: 1px;
|
351 |
-
}
|
352 |
-
|
353 |
-
/* results */
|
354 |
-
.select2-results {
|
355 |
-
max-height: 200px;
|
356 |
-
padding: 0 0 0 4px;
|
357 |
-
margin: 4px 4px 4px 0;
|
358 |
-
position: relative;
|
359 |
-
overflow-x: hidden;
|
360 |
-
overflow-y: auto;
|
361 |
-
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
362 |
-
}
|
363 |
-
|
364 |
-
html[dir="rtl"] .select2-results {
|
365 |
-
padding: 0 4px 0 0;
|
366 |
-
margin: 4px 0 4px 4px;
|
367 |
-
}
|
368 |
-
|
369 |
-
.select2-results ul.select2-result-sub {
|
370 |
-
margin: 0;
|
371 |
-
padding-left: 0;
|
372 |
-
}
|
373 |
-
|
374 |
-
.select2-results li {
|
375 |
-
list-style: none;
|
376 |
-
display: list-item;
|
377 |
-
background-image: none;
|
378 |
-
}
|
379 |
-
|
380 |
-
.select2-results li.select2-result-with-children > .select2-result-label {
|
381 |
-
font-weight: bold;
|
382 |
-
}
|
383 |
-
|
384 |
-
.select2-results .select2-result-label {
|
385 |
-
padding: 3px 7px 4px;
|
386 |
-
margin: 0;
|
387 |
-
cursor: pointer;
|
388 |
-
|
389 |
-
min-height: 1em;
|
390 |
-
|
391 |
-
-webkit-touch-callout: none;
|
392 |
-
-webkit-user-select: none;
|
393 |
-
-moz-user-select: none;
|
394 |
-
-ms-user-select: none;
|
395 |
-
user-select: none;
|
396 |
-
}
|
397 |
-
|
398 |
-
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
399 |
-
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
400 |
-
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
401 |
-
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
402 |
-
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
403 |
-
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
404 |
-
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
405 |
-
|
406 |
-
.select2-results .select2-highlighted {
|
407 |
-
background: #3875d7;
|
408 |
-
color: #fff;
|
409 |
-
}
|
410 |
-
|
411 |
-
.select2-results li em {
|
412 |
-
background: #feffde;
|
413 |
-
font-style: normal;
|
414 |
-
}
|
415 |
-
|
416 |
-
.select2-results .select2-highlighted em {
|
417 |
-
background: transparent;
|
418 |
-
}
|
419 |
-
|
420 |
-
.select2-results .select2-highlighted ul {
|
421 |
-
background: #fff;
|
422 |
-
color: #000;
|
423 |
-
}
|
424 |
-
|
425 |
-
.select2-results .select2-no-results,
|
426 |
-
.select2-results .select2-searching,
|
427 |
-
.select2-results .select2-ajax-error,
|
428 |
-
.select2-results .select2-selection-limit {
|
429 |
-
background: #f4f4f4;
|
430 |
-
display: list-item;
|
431 |
-
padding-left: 5px;
|
432 |
-
}
|
433 |
-
|
434 |
-
/*
|
435 |
-
disabled look for disabled choices in the results dropdown
|
436 |
-
*/
|
437 |
-
.select2-results .select2-disabled.select2-highlighted {
|
438 |
-
color: #666;
|
439 |
-
background: #f4f4f4;
|
440 |
-
display: list-item;
|
441 |
-
cursor: default;
|
442 |
-
}
|
443 |
-
.select2-results .select2-disabled {
|
444 |
-
background: #f4f4f4;
|
445 |
-
display: list-item;
|
446 |
-
cursor: default;
|
447 |
-
}
|
448 |
-
|
449 |
-
.select2-results .select2-selected {
|
450 |
-
display: none;
|
451 |
-
}
|
452 |
-
|
453 |
-
.select2-more-results.select2-active {
|
454 |
-
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
455 |
-
}
|
456 |
-
|
457 |
-
.select2-results .select2-ajax-error {
|
458 |
-
background: rgba(255, 50, 50, .2);
|
459 |
-
}
|
460 |
-
|
461 |
-
.select2-more-results {
|
462 |
-
background: #f4f4f4;
|
463 |
-
display: list-item;
|
464 |
-
}
|
465 |
-
|
466 |
-
/* disabled styles */
|
467 |
-
|
468 |
-
.select2-container.select2-container-disabled .select2-choice {
|
469 |
-
background-color: #f4f4f4;
|
470 |
-
background-image: none;
|
471 |
-
border: 1px solid #ddd;
|
472 |
-
cursor: default;
|
473 |
-
}
|
474 |
-
|
475 |
-
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
476 |
-
background-color: #f4f4f4;
|
477 |
-
background-image: none;
|
478 |
-
border-left: 0;
|
479 |
-
}
|
480 |
-
|
481 |
-
.select2-container.select2-container-disabled .select2-choice abbr {
|
482 |
-
display: none;
|
483 |
-
}
|
484 |
-
|
485 |
-
|
486 |
-
/* multiselect */
|
487 |
-
|
488 |
-
.select2-container-multi .select2-choices {
|
489 |
-
height: auto !important;
|
490 |
-
height: 1%;
|
491 |
-
margin: 0;
|
492 |
-
padding: 0 5px 0 0;
|
493 |
-
position: relative;
|
494 |
-
|
495 |
-
border: 1px solid #aaa;
|
496 |
-
cursor: text;
|
497 |
-
overflow: hidden;
|
498 |
-
|
499 |
-
background-color: #fff;
|
500 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
501 |
-
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
502 |
-
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
503 |
-
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
504 |
-
}
|
505 |
-
|
506 |
-
html[dir="rtl"] .select2-container-multi .select2-choices {
|
507 |
-
padding: 0 0 0 5px;
|
508 |
-
}
|
509 |
-
|
510 |
-
.select2-locked {
|
511 |
-
padding: 3px 5px 3px 5px !important;
|
512 |
-
}
|
513 |
-
|
514 |
-
.select2-container-multi .select2-choices {
|
515 |
-
min-height: 26px;
|
516 |
-
}
|
517 |
-
|
518 |
-
.select2-container-multi.select2-container-active .select2-choices {
|
519 |
-
border: 1px solid #5897fb;
|
520 |
-
outline: none;
|
521 |
-
|
522 |
-
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
523 |
-
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
524 |
-
}
|
525 |
-
.select2-container-multi .select2-choices li {
|
526 |
-
float: left;
|
527 |
-
list-style: none;
|
528 |
-
}
|
529 |
-
html[dir="rtl"] .select2-container-multi .select2-choices li
|
530 |
-
{
|
531 |
-
float: right;
|
532 |
-
}
|
533 |
-
.select2-container-multi .select2-choices .select2-search-field {
|
534 |
-
margin: 0;
|
535 |
-
padding: 0;
|
536 |
-
white-space: nowrap;
|
537 |
-
}
|
538 |
-
|
539 |
-
.select2-container-multi .select2-choices .select2-search-field input {
|
540 |
-
padding: 5px;
|
541 |
-
margin: 1px 0;
|
542 |
-
|
543 |
-
font-family: sans-serif;
|
544 |
-
font-size: 100%;
|
545 |
-
color: #666;
|
546 |
-
outline: 0;
|
547 |
-
border: 0;
|
548 |
-
-webkit-box-shadow: none;
|
549 |
-
box-shadow: none;
|
550 |
-
background: transparent !important;
|
551 |
-
}
|
552 |
-
|
553 |
-
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
554 |
-
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
555 |
-
}
|
556 |
-
|
557 |
-
.select2-default {
|
558 |
-
color: #999 !important;
|
559 |
-
}
|
560 |
-
|
561 |
-
.select2-container-multi .select2-choices .select2-search-choice {
|
562 |
-
padding: 3px 5px 3px 18px;
|
563 |
-
margin: 3px 0 3px 5px;
|
564 |
-
position: relative;
|
565 |
-
|
566 |
-
line-height: 13px;
|
567 |
-
color: #333;
|
568 |
-
cursor: default;
|
569 |
-
border: 1px solid #aaaaaa;
|
570 |
-
|
571 |
-
border-radius: 3px;
|
572 |
-
|
573 |
-
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
574 |
-
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
575 |
-
|
576 |
-
background-clip: padding-box;
|
577 |
-
|
578 |
-
-webkit-touch-callout: none;
|
579 |
-
-webkit-user-select: none;
|
580 |
-
-moz-user-select: none;
|
581 |
-
-ms-user-select: none;
|
582 |
-
user-select: none;
|
583 |
-
|
584 |
-
background-color: #e4e4e4;
|
585 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
586 |
-
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
587 |
-
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
588 |
-
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
589 |
-
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
590 |
-
}
|
591 |
-
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
592 |
-
{
|
593 |
-
margin: 3px 5px 3px 0;
|
594 |
-
padding: 3px 18px 3px 5px;
|
595 |
-
}
|
596 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
597 |
-
cursor: default;
|
598 |
-
}
|
599 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
600 |
-
background: #d4d4d4;
|
601 |
-
}
|
602 |
-
|
603 |
-
.select2-search-choice-close {
|
604 |
-
display: block;
|
605 |
-
width: 12px;
|
606 |
-
height: 13px;
|
607 |
-
position: absolute;
|
608 |
-
right: 3px;
|
609 |
-
top: 4px;
|
610 |
-
|
611 |
-
font-size: 1px;
|
612 |
-
outline: none;
|
613 |
-
background: url('select2.png') right top no-repeat;
|
614 |
-
}
|
615 |
-
html[dir="rtl"] .select2-search-choice-close {
|
616 |
-
right: auto;
|
617 |
-
left: 3px;
|
618 |
-
}
|
619 |
-
|
620 |
-
.select2-container-multi .select2-search-choice-close {
|
621 |
-
left: 3px;
|
622 |
-
}
|
623 |
-
|
624 |
-
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
625 |
-
left: auto;
|
626 |
-
right: 2px;
|
627 |
-
}
|
628 |
-
|
629 |
-
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
630 |
-
background-position: right -11px;
|
631 |
-
}
|
632 |
-
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
633 |
-
background-position: right -11px;
|
634 |
-
}
|
635 |
-
|
636 |
-
/* disabled styles */
|
637 |
-
.select2-container-multi.select2-container-disabled .select2-choices {
|
638 |
-
background-color: #f4f4f4;
|
639 |
-
background-image: none;
|
640 |
-
border: 1px solid #ddd;
|
641 |
-
cursor: default;
|
642 |
-
}
|
643 |
-
|
644 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
645 |
-
padding: 3px 5px 3px 5px;
|
646 |
-
border: 1px solid #ddd;
|
647 |
-
background-image: none;
|
648 |
-
background-color: #f4f4f4;
|
649 |
-
}
|
650 |
-
|
651 |
-
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
652 |
-
background: none;
|
653 |
-
}
|
654 |
-
/* end multiselect */
|
655 |
-
|
656 |
-
|
657 |
-
.select2-result-selectable .select2-match,
|
658 |
-
.select2-result-unselectable .select2-match {
|
659 |
-
text-decoration: underline;
|
660 |
-
}
|
661 |
-
|
662 |
-
.select2-offscreen, .select2-offscreen:focus {
|
663 |
-
clip: rect(0 0 0 0) !important;
|
664 |
-
width: 1px !important;
|
665 |
-
height: 1px !important;
|
666 |
-
border: 0 !important;
|
667 |
-
margin: 0 !important;
|
668 |
-
padding: 0 !important;
|
669 |
-
overflow: hidden !important;
|
670 |
-
position: absolute !important;
|
671 |
-
outline: 0 !important;
|
672 |
-
left: 0px !important;
|
673 |
-
top: 0px !important;
|
674 |
-
}
|
675 |
-
|
676 |
-
.select2-display-none {
|
677 |
-
display: none;
|
678 |
-
}
|
679 |
-
|
680 |
-
.select2-measure-scrollbar {
|
681 |
-
position: absolute;
|
682 |
-
top: -10000px;
|
683 |
-
left: -10000px;
|
684 |
-
width: 100px;
|
685 |
-
height: 100px;
|
686 |
-
overflow: scroll;
|
687 |
-
}
|
688 |
-
|
689 |
-
/* Retina-ize icons */
|
690 |
-
|
691 |
-
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
692 |
-
.select2-search input,
|
693 |
-
.select2-search-choice-close,
|
694 |
-
.select2-container .select2-choice abbr,
|
695 |
-
.select2-container .select2-choice .select2-arrow b {
|
696 |
-
background-image: url('select2x2.png') !important;
|
697 |
-
background-repeat: no-repeat !important;
|
698 |
-
background-size: 60px 40px !important;
|
699 |
-
}
|
700 |
-
|
701 |
-
.select2-search input {
|
702 |
-
background-position: 100% -21px !important;
|
703 |
-
}
|
704 |
-
}
|
1 |
+
/*
|
2 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
3 |
+
*/
|
4 |
+
.select2-container {
|
5 |
+
margin: 0;
|
6 |
+
position: relative;
|
7 |
+
display: inline-block;
|
8 |
+
/* inline-block for ie7 */
|
9 |
+
zoom: 1;
|
10 |
+
*display: inline;
|
11 |
+
vertical-align: middle;
|
12 |
+
}
|
13 |
+
|
14 |
+
.select2-container,
|
15 |
+
.select2-drop,
|
16 |
+
.select2-search,
|
17 |
+
.select2-search input {
|
18 |
+
/*
|
19 |
+
Force border-box so that % widths fit the parent
|
20 |
+
container without overlap because of margin/padding.
|
21 |
+
More Info : http://www.quirksmode.org/css/box.html
|
22 |
+
*/
|
23 |
+
-webkit-box-sizing: border-box; /* webkit */
|
24 |
+
-moz-box-sizing: border-box; /* firefox */
|
25 |
+
box-sizing: border-box; /* css3 */
|
26 |
+
}
|
27 |
+
|
28 |
+
.select2-container .select2-choice {
|
29 |
+
display: block;
|
30 |
+
height: 26px;
|
31 |
+
padding: 0 0 0 8px;
|
32 |
+
overflow: hidden;
|
33 |
+
position: relative;
|
34 |
+
|
35 |
+
border: 1px solid #aaa;
|
36 |
+
white-space: nowrap;
|
37 |
+
line-height: 26px;
|
38 |
+
color: #444;
|
39 |
+
text-decoration: none;
|
40 |
+
|
41 |
+
border-radius: 4px;
|
42 |
+
|
43 |
+
background-clip: padding-box;
|
44 |
+
|
45 |
+
-webkit-touch-callout: none;
|
46 |
+
-webkit-user-select: none;
|
47 |
+
-moz-user-select: none;
|
48 |
+
-ms-user-select: none;
|
49 |
+
user-select: none;
|
50 |
+
|
51 |
+
background-color: #fff;
|
52 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
|
53 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
54 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
|
55 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
|
56 |
+
background-image: linear-gradient(to top, #eee 0%, #fff 50%);
|
57 |
+
}
|
58 |
+
|
59 |
+
html[dir="rtl"] .select2-container .select2-choice {
|
60 |
+
padding: 0 8px 0 0;
|
61 |
+
}
|
62 |
+
|
63 |
+
.select2-container.select2-drop-above .select2-choice {
|
64 |
+
border-bottom-color: #aaa;
|
65 |
+
|
66 |
+
border-radius: 0 0 4px 4px;
|
67 |
+
|
68 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
|
69 |
+
background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
70 |
+
background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
|
71 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
|
72 |
+
background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
|
73 |
+
}
|
74 |
+
|
75 |
+
.select2-container.select2-allowclear .select2-choice .select2-chosen {
|
76 |
+
margin-right: 42px;
|
77 |
+
}
|
78 |
+
|
79 |
+
.select2-container .select2-choice > .select2-chosen {
|
80 |
+
margin-right: 26px;
|
81 |
+
display: block;
|
82 |
+
overflow: hidden;
|
83 |
+
|
84 |
+
white-space: nowrap;
|
85 |
+
|
86 |
+
text-overflow: ellipsis;
|
87 |
+
float: none;
|
88 |
+
width: auto;
|
89 |
+
}
|
90 |
+
|
91 |
+
html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
|
92 |
+
margin-left: 26px;
|
93 |
+
margin-right: 0;
|
94 |
+
}
|
95 |
+
|
96 |
+
.select2-container .select2-choice abbr {
|
97 |
+
display: none;
|
98 |
+
width: 12px;
|
99 |
+
height: 12px;
|
100 |
+
position: absolute;
|
101 |
+
right: 24px;
|
102 |
+
top: 8px;
|
103 |
+
|
104 |
+
font-size: 1px;
|
105 |
+
text-decoration: none;
|
106 |
+
|
107 |
+
border: 0;
|
108 |
+
background: url('select2.png') right top no-repeat;
|
109 |
+
cursor: pointer;
|
110 |
+
outline: 0;
|
111 |
+
}
|
112 |
+
|
113 |
+
.select2-container.select2-allowclear .select2-choice abbr {
|
114 |
+
display: inline-block;
|
115 |
+
}
|
116 |
+
|
117 |
+
.select2-container .select2-choice abbr:hover {
|
118 |
+
background-position: right -11px;
|
119 |
+
cursor: pointer;
|
120 |
+
}
|
121 |
+
|
122 |
+
.select2-drop-mask {
|
123 |
+
border: 0;
|
124 |
+
margin: 0;
|
125 |
+
padding: 0;
|
126 |
+
position: fixed;
|
127 |
+
left: 0;
|
128 |
+
top: 0;
|
129 |
+
min-height: 100%;
|
130 |
+
min-width: 100%;
|
131 |
+
height: auto;
|
132 |
+
width: auto;
|
133 |
+
opacity: 0;
|
134 |
+
z-index: 9998;
|
135 |
+
/* styles required for IE to work */
|
136 |
+
background-color: #fff;
|
137 |
+
filter: alpha(opacity=0);
|
138 |
+
}
|
139 |
+
|
140 |
+
.select2-drop {
|
141 |
+
width: 100%;
|
142 |
+
margin-top: -1px;
|
143 |
+
position: absolute;
|
144 |
+
z-index: 9999;
|
145 |
+
top: 100%;
|
146 |
+
|
147 |
+
background: #fff;
|
148 |
+
color: #000;
|
149 |
+
border: 1px solid #aaa;
|
150 |
+
border-top: 0;
|
151 |
+
|
152 |
+
border-radius: 0 0 4px 4px;
|
153 |
+
|
154 |
+
-webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
155 |
+
box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
|
156 |
+
}
|
157 |
+
|
158 |
+
.select2-drop.select2-drop-above {
|
159 |
+
margin-top: 1px;
|
160 |
+
border-top: 1px solid #aaa;
|
161 |
+
border-bottom: 0;
|
162 |
+
|
163 |
+
border-radius: 4px 4px 0 0;
|
164 |
+
|
165 |
+
-webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
166 |
+
box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
|
167 |
+
}
|
168 |
+
|
169 |
+
.select2-drop-active {
|
170 |
+
border: 1px solid #5897fb;
|
171 |
+
border-top: none;
|
172 |
+
}
|
173 |
+
|
174 |
+
.select2-drop.select2-drop-above.select2-drop-active {
|
175 |
+
border-top: 1px solid #5897fb;
|
176 |
+
}
|
177 |
+
|
178 |
+
.select2-drop-auto-width {
|
179 |
+
border-top: 1px solid #aaa;
|
180 |
+
width: auto;
|
181 |
+
}
|
182 |
+
|
183 |
+
.select2-drop-auto-width .select2-search {
|
184 |
+
padding-top: 4px;
|
185 |
+
}
|
186 |
+
|
187 |
+
.select2-container .select2-choice .select2-arrow {
|
188 |
+
display: inline-block;
|
189 |
+
width: 18px;
|
190 |
+
height: 100%;
|
191 |
+
position: absolute;
|
192 |
+
right: 0;
|
193 |
+
top: 0;
|
194 |
+
|
195 |
+
border-left: 1px solid #aaa;
|
196 |
+
border-radius: 0 4px 4px 0;
|
197 |
+
|
198 |
+
background-clip: padding-box;
|
199 |
+
|
200 |
+
background: #ccc;
|
201 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
|
202 |
+
background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
203 |
+
background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
|
204 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
|
205 |
+
background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
|
206 |
+
}
|
207 |
+
|
208 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
|
209 |
+
left: 0;
|
210 |
+
right: auto;
|
211 |
+
|
212 |
+
border-left: none;
|
213 |
+
border-right: 1px solid #aaa;
|
214 |
+
border-radius: 4px 0 0 4px;
|
215 |
+
}
|
216 |
+
|
217 |
+
.select2-container .select2-choice .select2-arrow b {
|
218 |
+
display: block;
|
219 |
+
width: 100%;
|
220 |
+
height: 100%;
|
221 |
+
background: url('select2.png') no-repeat 0 1px;
|
222 |
+
}
|
223 |
+
|
224 |
+
html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
|
225 |
+
background-position: 2px 1px;
|
226 |
+
}
|
227 |
+
|
228 |
+
.select2-search {
|
229 |
+
display: inline-block;
|
230 |
+
width: 100%;
|
231 |
+
min-height: 26px;
|
232 |
+
margin: 0;
|
233 |
+
padding-left: 4px;
|
234 |
+
padding-right: 4px;
|
235 |
+
|
236 |
+
position: relative;
|
237 |
+
z-index: 10000;
|
238 |
+
|
239 |
+
white-space: nowrap;
|
240 |
+
}
|
241 |
+
|
242 |
+
.select2-search input {
|
243 |
+
width: 100%;
|
244 |
+
height: auto !important;
|
245 |
+
min-height: 26px;
|
246 |
+
padding: 4px 20px 4px 5px;
|
247 |
+
margin: 0;
|
248 |
+
|
249 |
+
outline: 0;
|
250 |
+
font-family: sans-serif;
|
251 |
+
font-size: 1em;
|
252 |
+
|
253 |
+
border: 1px solid #aaa;
|
254 |
+
border-radius: 0;
|
255 |
+
|
256 |
+
-webkit-box-shadow: none;
|
257 |
+
box-shadow: none;
|
258 |
+
|
259 |
+
background: #fff url('select2.png') no-repeat 100% -22px;
|
260 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
261 |
+
background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
262 |
+
background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
263 |
+
background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
264 |
+
}
|
265 |
+
|
266 |
+
html[dir="rtl"] .select2-search input {
|
267 |
+
padding: 4px 5px 4px 20px;
|
268 |
+
|
269 |
+
background: #fff url('select2.png') no-repeat -37px -22px;
|
270 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
271 |
+
background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
272 |
+
background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
273 |
+
background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
274 |
+
}
|
275 |
+
|
276 |
+
.select2-drop.select2-drop-above .select2-search input {
|
277 |
+
margin-top: 4px;
|
278 |
+
}
|
279 |
+
|
280 |
+
.select2-search input.select2-active {
|
281 |
+
background: #fff url('select2-spinner.gif') no-repeat 100%;
|
282 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
|
283 |
+
background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
284 |
+
background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
|
285 |
+
background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
|
286 |
+
}
|
287 |
+
|
288 |
+
.select2-container-active .select2-choice,
|
289 |
+
.select2-container-active .select2-choices {
|
290 |
+
border: 1px solid #5897fb;
|
291 |
+
outline: none;
|
292 |
+
|
293 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
294 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
295 |
+
}
|
296 |
+
|
297 |
+
.select2-dropdown-open .select2-choice {
|
298 |
+
border-bottom-color: transparent;
|
299 |
+
-webkit-box-shadow: 0 1px 0 #fff inset;
|
300 |
+
box-shadow: 0 1px 0 #fff inset;
|
301 |
+
|
302 |
+
border-bottom-left-radius: 0;
|
303 |
+
border-bottom-right-radius: 0;
|
304 |
+
|
305 |
+
background-color: #eee;
|
306 |
+
background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
|
307 |
+
background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
308 |
+
background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
|
309 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
310 |
+
background-image: linear-gradient(to top, #fff 0%, #eee 50%);
|
311 |
+
}
|
312 |
+
|
313 |
+
.select2-dropdown-open.select2-drop-above .select2-choice,
|
314 |
+
.select2-dropdown-open.select2-drop-above .select2-choices {
|
315 |
+
border: 1px solid #5897fb;
|
316 |
+
border-top-color: transparent;
|
317 |
+
|
318 |
+
background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
|
319 |
+
background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
|
320 |
+
background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
|
321 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
|
322 |
+
background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
|
323 |
+
}
|
324 |
+
|
325 |
+
.select2-dropdown-open .select2-choice .select2-arrow {
|
326 |
+
background: transparent;
|
327 |
+
border-left: none;
|
328 |
+
filter: none;
|
329 |
+
}
|
330 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
|
331 |
+
border-right: none;
|
332 |
+
}
|
333 |
+
|
334 |
+
.select2-dropdown-open .select2-choice .select2-arrow b {
|
335 |
+
background-position: -18px 1px;
|
336 |
+
}
|
337 |
+
|
338 |
+
html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
|
339 |
+
background-position: -16px 1px;
|
340 |
+
}
|
341 |
+
|
342 |
+
.select2-hidden-accessible {
|
343 |
+
border: 0;
|
344 |
+
clip: rect(0 0 0 0);
|
345 |
+
height: 1px;
|
346 |
+
margin: -1px;
|
347 |
+
overflow: hidden;
|
348 |
+
padding: 0;
|
349 |
+
position: absolute;
|
350 |
+
width: 1px;
|
351 |
+
}
|
352 |
+
|
353 |
+
/* results */
|
354 |
+
.select2-results {
|
355 |
+
max-height: 200px;
|
356 |
+
padding: 0 0 0 4px;
|
357 |
+
margin: 4px 4px 4px 0;
|
358 |
+
position: relative;
|
359 |
+
overflow-x: hidden;
|
360 |
+
overflow-y: auto;
|
361 |
+
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
362 |
+
}
|
363 |
+
|
364 |
+
html[dir="rtl"] .select2-results {
|
365 |
+
padding: 0 4px 0 0;
|
366 |
+
margin: 4px 0 4px 4px;
|
367 |
+
}
|
368 |
+
|
369 |
+
.select2-results ul.select2-result-sub {
|
370 |
+
margin: 0;
|
371 |
+
padding-left: 0;
|
372 |
+
}
|
373 |
+
|
374 |
+
.select2-results li {
|
375 |
+
list-style: none;
|
376 |
+
display: list-item;
|
377 |
+
background-image: none;
|
378 |
+
}
|
379 |
+
|
380 |
+
.select2-results li.select2-result-with-children > .select2-result-label {
|
381 |
+
font-weight: bold;
|
382 |
+
}
|
383 |
+
|
384 |
+
.select2-results .select2-result-label {
|
385 |
+
padding: 3px 7px 4px;
|
386 |
+
margin: 0;
|
387 |
+
cursor: pointer;
|
388 |
+
|
389 |
+
min-height: 1em;
|
390 |
+
|
391 |
+
-webkit-touch-callout: none;
|
392 |
+
-webkit-user-select: none;
|
393 |
+
-moz-user-select: none;
|
394 |
+
-ms-user-select: none;
|
395 |
+
user-select: none;
|
396 |
+
}
|
397 |
+
|
398 |
+
.select2-results-dept-1 .select2-result-label { padding-left: 20px }
|
399 |
+
.select2-results-dept-2 .select2-result-label { padding-left: 40px }
|
400 |
+
.select2-results-dept-3 .select2-result-label { padding-left: 60px }
|
401 |
+
.select2-results-dept-4 .select2-result-label { padding-left: 80px }
|
402 |
+
.select2-results-dept-5 .select2-result-label { padding-left: 100px }
|
403 |
+
.select2-results-dept-6 .select2-result-label { padding-left: 110px }
|
404 |
+
.select2-results-dept-7 .select2-result-label { padding-left: 120px }
|
405 |
+
|
406 |
+
.select2-results .select2-highlighted {
|
407 |
+
background: #3875d7;
|
408 |
+
color: #fff;
|
409 |
+
}
|
410 |
+
|
411 |
+
.select2-results li em {
|
412 |
+
background: #feffde;
|
413 |
+
font-style: normal;
|
414 |
+
}
|
415 |
+
|
416 |
+
.select2-results .select2-highlighted em {
|
417 |
+
background: transparent;
|
418 |
+
}
|
419 |
+
|
420 |
+
.select2-results .select2-highlighted ul {
|
421 |
+
background: #fff;
|
422 |
+
color: #000;
|
423 |
+
}
|
424 |
+
|
425 |
+
.select2-results .select2-no-results,
|
426 |
+
.select2-results .select2-searching,
|
427 |
+
.select2-results .select2-ajax-error,
|
428 |
+
.select2-results .select2-selection-limit {
|
429 |
+
background: #f4f4f4;
|
430 |
+
display: list-item;
|
431 |
+
padding-left: 5px;
|
432 |
+
}
|
433 |
+
|
434 |
+
/*
|
435 |
+
disabled look for disabled choices in the results dropdown
|
436 |
+
*/
|
437 |
+
.select2-results .select2-disabled.select2-highlighted {
|
438 |
+
color: #666;
|
439 |
+
background: #f4f4f4;
|
440 |
+
display: list-item;
|
441 |
+
cursor: default;
|
442 |
+
}
|
443 |
+
.select2-results .select2-disabled {
|
444 |
+
background: #f4f4f4;
|
445 |
+
display: list-item;
|
446 |
+
cursor: default;
|
447 |
+
}
|
448 |
+
|
449 |
+
.select2-results .select2-selected {
|
450 |
+
display: none;
|
451 |
+
}
|
452 |
+
|
453 |
+
.select2-more-results.select2-active {
|
454 |
+
background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
|
455 |
+
}
|
456 |
+
|
457 |
+
.select2-results .select2-ajax-error {
|
458 |
+
background: rgba(255, 50, 50, .2);
|
459 |
+
}
|
460 |
+
|
461 |
+
.select2-more-results {
|
462 |
+
background: #f4f4f4;
|
463 |
+
display: list-item;
|
464 |
+
}
|
465 |
+
|
466 |
+
/* disabled styles */
|
467 |
+
|
468 |
+
.select2-container.select2-container-disabled .select2-choice {
|
469 |
+
background-color: #f4f4f4;
|
470 |
+
background-image: none;
|
471 |
+
border: 1px solid #ddd;
|
472 |
+
cursor: default;
|
473 |
+
}
|
474 |
+
|
475 |
+
.select2-container.select2-container-disabled .select2-choice .select2-arrow {
|
476 |
+
background-color: #f4f4f4;
|
477 |
+
background-image: none;
|
478 |
+
border-left: 0;
|
479 |
+
}
|
480 |
+
|
481 |
+
.select2-container.select2-container-disabled .select2-choice abbr {
|
482 |
+
display: none;
|
483 |
+
}
|
484 |
+
|
485 |
+
|
486 |
+
/* multiselect */
|
487 |
+
|
488 |
+
.select2-container-multi .select2-choices {
|
489 |
+
height: auto !important;
|
490 |
+
height: 1%;
|
491 |
+
margin: 0;
|
492 |
+
padding: 0 5px 0 0;
|
493 |
+
position: relative;
|
494 |
+
|
495 |
+
border: 1px solid #aaa;
|
496 |
+
cursor: text;
|
497 |
+
overflow: hidden;
|
498 |
+
|
499 |
+
background-color: #fff;
|
500 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
|
501 |
+
background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
|
502 |
+
background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
|
503 |
+
background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
|
504 |
+
}
|
505 |
+
|
506 |
+
html[dir="rtl"] .select2-container-multi .select2-choices {
|
507 |
+
padding: 0 0 0 5px;
|
508 |
+
}
|
509 |
+
|
510 |
+
.select2-locked {
|
511 |
+
padding: 3px 5px 3px 5px !important;
|
512 |
+
}
|
513 |
+
|
514 |
+
.select2-container-multi .select2-choices {
|
515 |
+
min-height: 26px;
|
516 |
+
}
|
517 |
+
|
518 |
+
.select2-container-multi.select2-container-active .select2-choices {
|
519 |
+
border: 1px solid #5897fb;
|
520 |
+
outline: none;
|
521 |
+
|
522 |
+
-webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
523 |
+
box-shadow: 0 0 5px rgba(0, 0, 0, .3);
|
524 |
+
}
|
525 |
+
.select2-container-multi .select2-choices li {
|
526 |
+
float: left;
|
527 |
+
list-style: none;
|
528 |
+
}
|
529 |
+
html[dir="rtl"] .select2-container-multi .select2-choices li
|
530 |
+
{
|
531 |
+
float: right;
|
532 |
+
}
|
533 |
+
.select2-container-multi .select2-choices .select2-search-field {
|
534 |
+
margin: 0;
|
535 |
+
padding: 0;
|
536 |
+
white-space: nowrap;
|
537 |
+
}
|
538 |
+
|
539 |
+
.select2-container-multi .select2-choices .select2-search-field input {
|
540 |
+
padding: 5px;
|
541 |
+
margin: 1px 0;
|
542 |
+
|
543 |
+
font-family: sans-serif;
|
544 |
+
font-size: 100%;
|
545 |
+
color: #666;
|
546 |
+
outline: 0;
|
547 |
+
border: 0;
|
548 |
+
-webkit-box-shadow: none;
|
549 |
+
box-shadow: none;
|
550 |
+
background: transparent !important;
|
551 |
+
}
|
552 |
+
|
553 |
+
.select2-container-multi .select2-choices .select2-search-field input.select2-active {
|
554 |
+
background: #fff url('select2-spinner.gif') no-repeat 100% !important;
|
555 |
+
}
|
556 |
+
|
557 |
+
.select2-default {
|
558 |
+
color: #999 !important;
|
559 |
+
}
|
560 |
+
|
561 |
+
.select2-container-multi .select2-choices .select2-search-choice {
|
562 |
+
padding: 3px 5px 3px 18px;
|
563 |
+
margin: 3px 0 3px 5px;
|
564 |
+
position: relative;
|
565 |
+
|
566 |
+
line-height: 13px;
|
567 |
+
color: #333;
|
568 |
+
cursor: default;
|
569 |
+
border: 1px solid #aaaaaa;
|
570 |
+
|
571 |
+
border-radius: 3px;
|
572 |
+
|
573 |
+
-webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
574 |
+
box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
|
575 |
+
|
576 |
+
background-clip: padding-box;
|
577 |
+
|
578 |
+
-webkit-touch-callout: none;
|
579 |
+
-webkit-user-select: none;
|
580 |
+
-moz-user-select: none;
|
581 |
+
-ms-user-select: none;
|
582 |
+
user-select: none;
|
583 |
+
|
584 |
+
background-color: #e4e4e4;
|
585 |
+
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
|
586 |
+
background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
|
587 |
+
background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
588 |
+
background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
589 |
+
background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
|
590 |
+
}
|
591 |
+
html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
|
592 |
+
{
|
593 |
+
margin: 3px 5px 3px 0;
|
594 |
+
padding: 3px 18px 3px 5px;
|
595 |
+
}
|
596 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
|
597 |
+
cursor: default;
|
598 |
+
}
|
599 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus {
|
600 |
+
background: #d4d4d4;
|
601 |
+
}
|
602 |
+
|
603 |
+
.select2-search-choice-close {
|
604 |
+
display: block;
|
605 |
+
width: 12px;
|
606 |
+
height: 13px;
|
607 |
+
position: absolute;
|
608 |
+
right: 3px;
|
609 |
+
top: 4px;
|
610 |
+
|
611 |
+
font-size: 1px;
|
612 |
+
outline: none;
|
613 |
+
background: url('select2.png') right top no-repeat;
|
614 |
+
}
|
615 |
+
html[dir="rtl"] .select2-search-choice-close {
|
616 |
+
right: auto;
|
617 |
+
left: 3px;
|
618 |
+
}
|
619 |
+
|
620 |
+
.select2-container-multi .select2-search-choice-close {
|
621 |
+
left: 3px;
|
622 |
+
}
|
623 |
+
|
624 |
+
html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
|
625 |
+
left: auto;
|
626 |
+
right: 2px;
|
627 |
+
}
|
628 |
+
|
629 |
+
.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
|
630 |
+
background-position: right -11px;
|
631 |
+
}
|
632 |
+
.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
|
633 |
+
background-position: right -11px;
|
634 |
+
}
|
635 |
+
|
636 |
+
/* disabled styles */
|
637 |
+
.select2-container-multi.select2-container-disabled .select2-choices {
|
638 |
+
background-color: #f4f4f4;
|
639 |
+
background-image: none;
|
640 |
+
border: 1px solid #ddd;
|
641 |
+
cursor: default;
|
642 |
+
}
|
643 |
+
|
644 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
|
645 |
+
padding: 3px 5px 3px 5px;
|
646 |
+
border: 1px solid #ddd;
|
647 |
+
background-image: none;
|
648 |
+
background-color: #f4f4f4;
|
649 |
+
}
|
650 |
+
|
651 |
+
.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
|
652 |
+
background: none;
|
653 |
+
}
|
654 |
+
/* end multiselect */
|
655 |
+
|
656 |
+
|
657 |
+
.select2-result-selectable .select2-match,
|
658 |
+
.select2-result-unselectable .select2-match {
|
659 |
+
text-decoration: underline;
|
660 |
+
}
|
661 |
+
|
662 |
+
.select2-offscreen, .select2-offscreen:focus {
|
663 |
+
clip: rect(0 0 0 0) !important;
|
664 |
+
width: 1px !important;
|
665 |
+
height: 1px !important;
|
666 |
+
border: 0 !important;
|
667 |
+
margin: 0 !important;
|
668 |
+
padding: 0 !important;
|
669 |
+
overflow: hidden !important;
|
670 |
+
position: absolute !important;
|
671 |
+
outline: 0 !important;
|
672 |
+
left: 0px !important;
|
673 |
+
top: 0px !important;
|
674 |
+
}
|
675 |
+
|
676 |
+
.select2-display-none {
|
677 |
+
display: none;
|
678 |
+
}
|
679 |
+
|
680 |
+
.select2-measure-scrollbar {
|
681 |
+
position: absolute;
|
682 |
+
top: -10000px;
|
683 |
+
left: -10000px;
|
684 |
+
width: 100px;
|
685 |
+
height: 100px;
|
686 |
+
overflow: scroll;
|
687 |
+
}
|
688 |
+
|
689 |
+
/* Retina-ize icons */
|
690 |
+
|
691 |
+
@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
|
692 |
+
.select2-search input,
|
693 |
+
.select2-search-choice-close,
|
694 |
+
.select2-container .select2-choice abbr,
|
695 |
+
.select2-container .select2-choice .select2-arrow b {
|
696 |
+
background-image: url('select2x2.png') !important;
|
697 |
+
background-repeat: no-repeat !important;
|
698 |
+
background-size: 60px 40px !important;
|
699 |
+
}
|
700 |
+
|
701 |
+
.select2-search input {
|
702 |
+
background-position: 100% -21px !important;
|
703 |
+
}
|
704 |
+
}
|
assets/deps/select2-3.5.2/select2.js
CHANGED
@@ -1,3541 +1,3541 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2012 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
-
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
-
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
-
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
(function ($) {
|
22 |
-
if(typeof $.fn.each2 == "undefined") {
|
23 |
-
$.extend($.fn, {
|
24 |
-
/*
|
25 |
-
* 4-10 times faster .each replacement
|
26 |
-
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
-
*/
|
28 |
-
each2 : function (c) {
|
29 |
-
var j = $([0]), i = -1, l = this.length;
|
30 |
-
while (
|
31 |
-
++i < l
|
32 |
-
&& (j.context = j[0] = this[i])
|
33 |
-
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
-
);
|
35 |
-
return this;
|
36 |
-
}
|
37 |
-
});
|
38 |
-
}
|
39 |
-
})(jQuery);
|
40 |
-
|
41 |
-
(function ($, undefined) {
|
42 |
-
"use strict";
|
43 |
-
/*global document, window, jQuery, console */
|
44 |
-
|
45 |
-
if (window.Select2 !== undefined) {
|
46 |
-
return;
|
47 |
-
}
|
48 |
-
|
49 |
-
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
-
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
-
|
52 |
-
KEY = {
|
53 |
-
TAB: 9,
|
54 |
-
ENTER: 13,
|
55 |
-
ESC: 27,
|
56 |
-
SPACE: 32,
|
57 |
-
LEFT: 37,
|
58 |
-
UP: 38,
|
59 |
-
RIGHT: 39,
|
60 |
-
DOWN: 40,
|
61 |
-
SHIFT: 16,
|
62 |
-
CTRL: 17,
|
63 |
-
ALT: 18,
|
64 |
-
PAGE_UP: 33,
|
65 |
-
PAGE_DOWN: 34,
|
66 |
-
HOME: 36,
|
67 |
-
END: 35,
|
68 |
-
BACKSPACE: 8,
|
69 |
-
DELETE: 46,
|
70 |
-
isArrow: function (k) {
|
71 |
-
k = k.which ? k.which : k;
|
72 |
-
switch (k) {
|
73 |
-
case KEY.LEFT:
|
74 |
-
case KEY.RIGHT:
|
75 |
-
case KEY.UP:
|
76 |
-
case KEY.DOWN:
|
77 |
-
return true;
|
78 |
-
}
|
79 |
-
return false;
|
80 |
-
},
|
81 |
-
isControl: function (e) {
|
82 |
-
var k = e.which;
|
83 |
-
switch (k) {
|
84 |
-
case KEY.SHIFT:
|
85 |
-
case KEY.CTRL:
|
86 |
-
case KEY.ALT:
|
87 |
-
return true;
|
88 |
-
}
|
89 |
-
|
90 |
-
if (e.metaKey) return true;
|
91 |
-
|
92 |
-
return false;
|
93 |
-
},
|
94 |
-
isFunctionKey: function (k) {
|
95 |
-
k = k.which ? k.which : k;
|
96 |
-
return k >= 112 && k <= 123;
|
97 |
-
}
|
98 |
-
},
|
99 |
-
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
-
|
101 |
-
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
-
|
103 |
-
$document = $(document);
|
104 |
-
|
105 |
-
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
-
|
107 |
-
|
108 |
-
function reinsertElement(element) {
|
109 |
-
var placeholder = $(document.createTextNode(''));
|
110 |
-
|
111 |
-
element.before(placeholder);
|
112 |
-
placeholder.before(element);
|
113 |
-
placeholder.remove();
|
114 |
-
}
|
115 |
-
|
116 |
-
function stripDiacritics(str) {
|
117 |
-
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
-
function match(a) {
|
119 |
-
return DIACRITICS[a] || a;
|
120 |
-
}
|
121 |
-
|
122 |
-
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
-
}
|
124 |
-
|
125 |
-
function indexOf(value, array) {
|
126 |
-
var i = 0, l = array.length;
|
127 |
-
for (; i < l; i = i + 1) {
|
128 |
-
if (equal(value, array[i])) return i;
|
129 |
-
}
|
130 |
-
return -1;
|
131 |
-
}
|
132 |
-
|
133 |
-
function measureScrollbar () {
|
134 |
-
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
-
$template.appendTo(document.body);
|
136 |
-
|
137 |
-
var dim = {
|
138 |
-
width: $template.width() - $template[0].clientWidth,
|
139 |
-
height: $template.height() - $template[0].clientHeight
|
140 |
-
};
|
141 |
-
$template.remove();
|
142 |
-
|
143 |
-
return dim;
|
144 |
-
}
|
145 |
-
|
146 |
-
/**
|
147 |
-
* Compares equality of a and b
|
148 |
-
* @param a
|
149 |
-
* @param b
|
150 |
-
*/
|
151 |
-
function equal(a, b) {
|
152 |
-
if (a === b) return true;
|
153 |
-
if (a === undefined || b === undefined) return false;
|
154 |
-
if (a === null || b === null) return false;
|
155 |
-
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
-
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
-
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
-
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
-
return false;
|
160 |
-
}
|
161 |
-
|
162 |
-
/**
|
163 |
-
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
-
* strings
|
165 |
-
* @param string
|
166 |
-
* @param separator
|
167 |
-
*/
|
168 |
-
function splitVal(string, separator, transform) {
|
169 |
-
var val, i, l;
|
170 |
-
if (string === null || string.length < 1) return [];
|
171 |
-
val = string.split(separator);
|
172 |
-
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
-
return val;
|
174 |
-
}
|
175 |
-
|
176 |
-
function getSideBorderPadding(element) {
|
177 |
-
return element.outerWidth(false) - element.width();
|
178 |
-
}
|
179 |
-
|
180 |
-
function installKeyUpChangeEvent(element) {
|
181 |
-
var key="keyup-change-value";
|
182 |
-
element.on("keydown", function () {
|
183 |
-
if ($.data(element, key) === undefined) {
|
184 |
-
$.data(element, key, element.val());
|
185 |
-
}
|
186 |
-
});
|
187 |
-
element.on("keyup", function () {
|
188 |
-
var val= $.data(element, key);
|
189 |
-
if (val !== undefined && element.val() !== val) {
|
190 |
-
$.removeData(element, key);
|
191 |
-
element.trigger("keyup-change");
|
192 |
-
}
|
193 |
-
});
|
194 |
-
}
|
195 |
-
|
196 |
-
|
197 |
-
/**
|
198 |
-
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
-
*
|
200 |
-
* filters out mouse events that occur when mouse is stationary but
|
201 |
-
* the elements under the pointer are scrolled.
|
202 |
-
*/
|
203 |
-
function installFilteredMouseMove(element) {
|
204 |
-
element.on("mousemove", function (e) {
|
205 |
-
var lastpos = lastMousePosition;
|
206 |
-
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
-
$(e.target).trigger("mousemove-filtered", e);
|
208 |
-
}
|
209 |
-
});
|
210 |
-
}
|
211 |
-
|
212 |
-
/**
|
213 |
-
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
-
* within the last quietMillis milliseconds.
|
215 |
-
*
|
216 |
-
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
-
* @param fn function to be debounced
|
218 |
-
* @param ctx object to be used as this reference within fn
|
219 |
-
* @return debounced version of fn
|
220 |
-
*/
|
221 |
-
function debounce(quietMillis, fn, ctx) {
|
222 |
-
ctx = ctx || undefined;
|
223 |
-
var timeout;
|
224 |
-
return function () {
|
225 |
-
var args = arguments;
|
226 |
-
window.clearTimeout(timeout);
|
227 |
-
timeout = window.setTimeout(function() {
|
228 |
-
fn.apply(ctx, args);
|
229 |
-
}, quietMillis);
|
230 |
-
};
|
231 |
-
}
|
232 |
-
|
233 |
-
function installDebouncedScroll(threshold, element) {
|
234 |
-
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
-
element.on("scroll", function (e) {
|
236 |
-
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
-
});
|
238 |
-
}
|
239 |
-
|
240 |
-
function focus($el) {
|
241 |
-
if ($el[0] === document.activeElement) return;
|
242 |
-
|
243 |
-
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
-
of the current event has finished - which seems like the only reliable way
|
245 |
-
to set focus */
|
246 |
-
window.setTimeout(function() {
|
247 |
-
var el=$el[0], pos=$el.val().length, range;
|
248 |
-
|
249 |
-
$el.focus();
|
250 |
-
|
251 |
-
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
-
sometimes modals or others listeners may steal it after its set */
|
253 |
-
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
-
if (isVisible && el === document.activeElement) {
|
255 |
-
|
256 |
-
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
-
just before setting focus */
|
258 |
-
if(el.setSelectionRange)
|
259 |
-
{
|
260 |
-
el.setSelectionRange(pos, pos);
|
261 |
-
}
|
262 |
-
else if (el.createTextRange) {
|
263 |
-
range = el.createTextRange();
|
264 |
-
range.collapse(false);
|
265 |
-
range.select();
|
266 |
-
}
|
267 |
-
}
|
268 |
-
}, 0);
|
269 |
-
}
|
270 |
-
|
271 |
-
function getCursorInfo(el) {
|
272 |
-
el = $(el)[0];
|
273 |
-
var offset = 0;
|
274 |
-
var length = 0;
|
275 |
-
if ('selectionStart' in el) {
|
276 |
-
offset = el.selectionStart;
|
277 |
-
length = el.selectionEnd - offset;
|
278 |
-
} else if ('selection' in document) {
|
279 |
-
el.focus();
|
280 |
-
var sel = document.selection.createRange();
|
281 |
-
length = document.selection.createRange().text.length;
|
282 |
-
sel.moveStart('character', -el.value.length);
|
283 |
-
offset = sel.text.length - length;
|
284 |
-
}
|
285 |
-
return { offset: offset, length: length };
|
286 |
-
}
|
287 |
-
|
288 |
-
function killEvent(event) {
|
289 |
-
event.preventDefault();
|
290 |
-
event.stopPropagation();
|
291 |
-
}
|
292 |
-
function killEventImmediately(event) {
|
293 |
-
event.preventDefault();
|
294 |
-
event.stopImmediatePropagation();
|
295 |
-
}
|
296 |
-
|
297 |
-
function measureTextWidth(e) {
|
298 |
-
if (!sizer){
|
299 |
-
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
-
sizer = $(document.createElement("div")).css({
|
301 |
-
position: "absolute",
|
302 |
-
left: "-10000px",
|
303 |
-
top: "-10000px",
|
304 |
-
display: "none",
|
305 |
-
fontSize: style.fontSize,
|
306 |
-
fontFamily: style.fontFamily,
|
307 |
-
fontStyle: style.fontStyle,
|
308 |
-
fontWeight: style.fontWeight,
|
309 |
-
letterSpacing: style.letterSpacing,
|
310 |
-
textTransform: style.textTransform,
|
311 |
-
whiteSpace: "nowrap"
|
312 |
-
});
|
313 |
-
sizer.attr("class","select2-sizer");
|
314 |
-
$(document.body).append(sizer);
|
315 |
-
}
|
316 |
-
sizer.text(e.val());
|
317 |
-
return sizer.width();
|
318 |
-
}
|
319 |
-
|
320 |
-
function syncCssClasses(dest, src, adapter) {
|
321 |
-
var classes, replacements = [], adapted;
|
322 |
-
|
323 |
-
classes = $.trim(dest.attr("class"));
|
324 |
-
|
325 |
-
if (classes) {
|
326 |
-
classes = '' + classes; // for IE which returns object
|
327 |
-
|
328 |
-
$(classes.split(/\s+/)).each2(function() {
|
329 |
-
if (this.indexOf("select2-") === 0) {
|
330 |
-
replacements.push(this);
|
331 |
-
}
|
332 |
-
});
|
333 |
-
}
|
334 |
-
|
335 |
-
classes = $.trim(src.attr("class"));
|
336 |
-
|
337 |
-
if (classes) {
|
338 |
-
classes = '' + classes; // for IE which returns object
|
339 |
-
|
340 |
-
$(classes.split(/\s+/)).each2(function() {
|
341 |
-
if (this.indexOf("select2-") !== 0) {
|
342 |
-
adapted = adapter(this);
|
343 |
-
|
344 |
-
if (adapted) {
|
345 |
-
replacements.push(adapted);
|
346 |
-
}
|
347 |
-
}
|
348 |
-
});
|
349 |
-
}
|
350 |
-
|
351 |
-
dest.attr("class", replacements.join(" "));
|
352 |
-
}
|
353 |
-
|
354 |
-
|
355 |
-
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
-
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
-
tl=term.length;
|
358 |
-
|
359 |
-
if (match<0) {
|
360 |
-
markup.push(escapeMarkup(text));
|
361 |
-
return;
|
362 |
-
}
|
363 |
-
|
364 |
-
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
-
markup.push("<span class='select2-match'>");
|
366 |
-
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
-
markup.push("</span>");
|
368 |
-
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
-
}
|
370 |
-
|
371 |
-
function defaultEscapeMarkup(markup) {
|
372 |
-
var replace_map = {
|
373 |
-
'\\': '\',
|
374 |
-
'&': '&',
|
375 |
-
'<': '<',
|
376 |
-
'>': '>',
|
377 |
-
'"': '"',
|
378 |
-
"'": ''',
|
379 |
-
"/": '/'
|
380 |
-
};
|
381 |
-
|
382 |
-
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
-
return replace_map[match];
|
384 |
-
});
|
385 |
-
}
|
386 |
-
|
387 |
-
/**
|
388 |
-
* Produces an ajax-based query function
|
389 |
-
*
|
390 |
-
* @param options object containing configuration parameters
|
391 |
-
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
-
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
-
* @param options.url url for the data
|
394 |
-
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
-
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
-
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
-
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
-
* The expected format is an object containing the following keys:
|
399 |
-
* results array of objects that will be used as choices
|
400 |
-
* more (optional) boolean indicating whether there are more results available
|
401 |
-
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
-
*/
|
403 |
-
function ajax(options) {
|
404 |
-
var timeout, // current scheduled but not yet executed request
|
405 |
-
handler = null,
|
406 |
-
quietMillis = options.quietMillis || 100,
|
407 |
-
ajaxUrl = options.url,
|
408 |
-
self = this;
|
409 |
-
|
410 |
-
return function (query) {
|
411 |
-
window.clearTimeout(timeout);
|
412 |
-
timeout = window.setTimeout(function () {
|
413 |
-
var data = options.data, // ajax data function
|
414 |
-
url = ajaxUrl, // ajax url string or function
|
415 |
-
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
-
// deprecated - to be removed in 4.0 - use params instead
|
417 |
-
deprecated = {
|
418 |
-
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
-
cache: options.cache || false,
|
420 |
-
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
-
dataType: options.dataType||"json"
|
422 |
-
},
|
423 |
-
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
-
|
425 |
-
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
-
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
-
|
428 |
-
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
-
|
430 |
-
if (options.params) {
|
431 |
-
if ($.isFunction(options.params)) {
|
432 |
-
$.extend(params, options.params.call(self));
|
433 |
-
} else {
|
434 |
-
$.extend(params, options.params);
|
435 |
-
}
|
436 |
-
}
|
437 |
-
|
438 |
-
$.extend(params, {
|
439 |
-
url: url,
|
440 |
-
dataType: options.dataType,
|
441 |
-
data: data,
|
442 |
-
success: function (data) {
|
443 |
-
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
-
// added query as third paramter to keep backwards compatibility
|
445 |
-
var results = options.results(data, query.page, query);
|
446 |
-
query.callback(results);
|
447 |
-
},
|
448 |
-
error: function(jqXHR, textStatus, errorThrown){
|
449 |
-
var results = {
|
450 |
-
hasError: true,
|
451 |
-
jqXHR: jqXHR,
|
452 |
-
textStatus: textStatus,
|
453 |
-
errorThrown: errorThrown
|
454 |
-
};
|
455 |
-
|
456 |
-
query.callback(results);
|
457 |
-
}
|
458 |
-
});
|
459 |
-
handler = transport.call(self, params);
|
460 |
-
}, quietMillis);
|
461 |
-
};
|
462 |
-
}
|
463 |
-
|
464 |
-
/**
|
465 |
-
* Produces a query function that works with a local array
|
466 |
-
*
|
467 |
-
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
-
* object.
|
469 |
-
*
|
470 |
-
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
-
*
|
472 |
-
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
-
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
-
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
-
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
-
* the text.
|
477 |
-
*/
|
478 |
-
function local(options) {
|
479 |
-
var data = options, // data elements
|
480 |
-
dataText,
|
481 |
-
tmp,
|
482 |
-
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
-
|
484 |
-
if ($.isArray(data)) {
|
485 |
-
tmp = data;
|
486 |
-
data = { results: tmp };
|
487 |
-
}
|
488 |
-
|
489 |
-
if ($.isFunction(data) === false) {
|
490 |
-
tmp = data;
|
491 |
-
data = function() { return tmp; };
|
492 |
-
}
|
493 |
-
|
494 |
-
var dataItem = data();
|
495 |
-
if (dataItem.text) {
|
496 |
-
text = dataItem.text;
|
497 |
-
// if text is not a function we assume it to be a key name
|
498 |
-
if (!$.isFunction(text)) {
|
499 |
-
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
-
text = function (item) { return item[dataText]; };
|
501 |
-
}
|
502 |
-
}
|
503 |
-
|
504 |
-
return function (query) {
|
505 |
-
var t = query.term, filtered = { results: [] }, process;
|
506 |
-
if (t === "") {
|
507 |
-
query.callback(data());
|
508 |
-
return;
|
509 |
-
}
|
510 |
-
|
511 |
-
process = function(datum, collection) {
|
512 |
-
var group, attr;
|
513 |
-
datum = datum[0];
|
514 |
-
if (datum.children) {
|
515 |
-
group = {};
|
516 |
-
for (attr in datum) {
|
517 |
-
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
-
}
|
519 |
-
group.children=[];
|
520 |
-
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
-
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
-
collection.push(group);
|
523 |
-
}
|
524 |
-
} else {
|
525 |
-
if (query.matcher(t, text(datum), datum)) {
|
526 |
-
collection.push(datum);
|
527 |
-
}
|
528 |
-
}
|
529 |
-
};
|
530 |
-
|
531 |
-
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
-
query.callback(filtered);
|
533 |
-
};
|
534 |
-
}
|
535 |
-
|
536 |
-
// TODO javadoc
|
537 |
-
function tags(data) {
|
538 |
-
var isFunc = $.isFunction(data);
|
539 |
-
return function (query) {
|
540 |
-
var t = query.term, filtered = {results: []};
|
541 |
-
var result = isFunc ? data(query) : data;
|
542 |
-
if ($.isArray(result)) {
|
543 |
-
$(result).each(function () {
|
544 |
-
var isObject = this.text !== undefined,
|
545 |
-
text = isObject ? this.text : this;
|
546 |
-
if (t === "" || query.matcher(t, text)) {
|
547 |
-
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
-
}
|
549 |
-
});
|
550 |
-
query.callback(filtered);
|
551 |
-
}
|
552 |
-
};
|
553 |
-
}
|
554 |
-
|
555 |
-
/**
|
556 |
-
* Checks if the formatter function should be used.
|
557 |
-
*
|
558 |
-
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
-
* false if no formatting should be performed.
|
560 |
-
*
|
561 |
-
* @param formatter
|
562 |
-
*/
|
563 |
-
function checkFormatter(formatter, formatterName) {
|
564 |
-
if ($.isFunction(formatter)) return true;
|
565 |
-
if (!formatter) return false;
|
566 |
-
if (typeof(formatter) === 'string') return true;
|
567 |
-
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
-
}
|
569 |
-
|
570 |
-
/**
|
571 |
-
* Returns a given value
|
572 |
-
* If given a function, returns its output
|
573 |
-
*
|
574 |
-
* @param val string|function
|
575 |
-
* @param context value of "this" to be passed to function
|
576 |
-
* @returns {*}
|
577 |
-
*/
|
578 |
-
function evaluate(val, context) {
|
579 |
-
if ($.isFunction(val)) {
|
580 |
-
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
-
return val.apply(context, args);
|
582 |
-
}
|
583 |
-
return val;
|
584 |
-
}
|
585 |
-
|
586 |
-
function countResults(results) {
|
587 |
-
var count = 0;
|
588 |
-
$.each(results, function(i, item) {
|
589 |
-
if (item.children) {
|
590 |
-
count += countResults(item.children);
|
591 |
-
} else {
|
592 |
-
count++;
|
593 |
-
}
|
594 |
-
});
|
595 |
-
return count;
|
596 |
-
}
|
597 |
-
|
598 |
-
/**
|
599 |
-
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
-
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
-
* two options have to be defined in order for the tokenizer to work.
|
602 |
-
*
|
603 |
-
* @param input text user has typed so far or pasted into the search field
|
604 |
-
* @param selection currently selected choices
|
605 |
-
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
-
* @param opts select2's opts
|
607 |
-
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
-
*/
|
609 |
-
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
-
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
-
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
-
token, // token
|
613 |
-
index, // position at which the separator was found
|
614 |
-
i, l, // looping variables
|
615 |
-
separator; // the matched separator
|
616 |
-
|
617 |
-
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
-
|
619 |
-
while (true) {
|
620 |
-
index = -1;
|
621 |
-
|
622 |
-
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
-
separator = opts.tokenSeparators[i];
|
624 |
-
index = input.indexOf(separator);
|
625 |
-
if (index >= 0) break;
|
626 |
-
}
|
627 |
-
|
628 |
-
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
-
|
630 |
-
token = input.substring(0, index);
|
631 |
-
input = input.substring(index + separator.length);
|
632 |
-
|
633 |
-
if (token.length > 0) {
|
634 |
-
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
-
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
-
dupe = false;
|
637 |
-
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
-
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
-
dupe = true; break;
|
640 |
-
}
|
641 |
-
}
|
642 |
-
|
643 |
-
if (!dupe) selectCallback(token);
|
644 |
-
}
|
645 |
-
}
|
646 |
-
}
|
647 |
-
|
648 |
-
if (original!==input) return input;
|
649 |
-
}
|
650 |
-
|
651 |
-
function cleanupJQueryElements() {
|
652 |
-
var self = this;
|
653 |
-
|
654 |
-
$.each(arguments, function (i, element) {
|
655 |
-
self[element].remove();
|
656 |
-
self[element] = null;
|
657 |
-
});
|
658 |
-
}
|
659 |
-
|
660 |
-
/**
|
661 |
-
* Creates a new class
|
662 |
-
*
|
663 |
-
* @param superClass
|
664 |
-
* @param methods
|
665 |
-
*/
|
666 |
-
function clazz(SuperClass, methods) {
|
667 |
-
var constructor = function () {};
|
668 |
-
constructor.prototype = new SuperClass;
|
669 |
-
constructor.prototype.constructor = constructor;
|
670 |
-
constructor.prototype.parent = SuperClass.prototype;
|
671 |
-
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
-
return constructor;
|
673 |
-
}
|
674 |
-
|
675 |
-
AbstractSelect2 = clazz(Object, {
|
676 |
-
|
677 |
-
// abstract
|
678 |
-
bind: function (func) {
|
679 |
-
var self = this;
|
680 |
-
return function () {
|
681 |
-
func.apply(self, arguments);
|
682 |
-
};
|
683 |
-
},
|
684 |
-
|
685 |
-
// abstract
|
686 |
-
init: function (opts) {
|
687 |
-
var results, search, resultsSelector = ".select2-results";
|
688 |
-
|
689 |
-
// prepare options
|
690 |
-
this.opts = opts = this.prepareOpts(opts);
|
691 |
-
|
692 |
-
this.id=opts.id;
|
693 |
-
|
694 |
-
// destroy if called on an existing component
|
695 |
-
if (opts.element.data("select2") !== undefined &&
|
696 |
-
opts.element.data("select2") !== null) {
|
697 |
-
opts.element.data("select2").destroy();
|
698 |
-
}
|
699 |
-
|
700 |
-
this.container = this.createContainer();
|
701 |
-
|
702 |
-
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
-
if (this.liveRegion.length == 0) {
|
704 |
-
this.liveRegion = $("<span>", {
|
705 |
-
role: "status",
|
706 |
-
"aria-live": "polite"
|
707 |
-
})
|
708 |
-
.addClass("select2-hidden-accessible")
|
709 |
-
.appendTo(document.body);
|
710 |
-
}
|
711 |
-
|
712 |
-
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
-
this.containerEventName= this.containerId
|
714 |
-
.replace(/([.])/g, '_')
|
715 |
-
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
-
this.container.attr("id", this.containerId);
|
717 |
-
|
718 |
-
this.container.attr("title", opts.element.attr("title"));
|
719 |
-
|
720 |
-
this.body = $(document.body);
|
721 |
-
|
722 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
-
|
724 |
-
this.container.attr("style", opts.element.attr("style"));
|
725 |
-
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
-
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
-
|
728 |
-
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
-
|
730 |
-
// swap container for the element
|
731 |
-
this.opts.element
|
732 |
-
.data("select2", this)
|
733 |
-
.attr("tabindex", "-1")
|
734 |
-
.before(this.container)
|
735 |
-
.on("click.select2", killEvent); // do not leak click events
|
736 |
-
|
737 |
-
this.container.data("select2", this);
|
738 |
-
|
739 |
-
this.dropdown = this.container.find(".select2-drop");
|
740 |
-
|
741 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
-
|
743 |
-
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
-
this.dropdown.data("select2", this);
|
745 |
-
this.dropdown.on("click", killEvent);
|
746 |
-
|
747 |
-
this.results = results = this.container.find(resultsSelector);
|
748 |
-
this.search = search = this.container.find("input.select2-input");
|
749 |
-
|
750 |
-
this.queryCount = 0;
|
751 |
-
this.resultsPage = 0;
|
752 |
-
this.context = null;
|
753 |
-
|
754 |
-
// initialize the container
|
755 |
-
this.initContainer();
|
756 |
-
|
757 |
-
this.container.on("click", killEvent);
|
758 |
-
|
759 |
-
installFilteredMouseMove(this.results);
|
760 |
-
|
761 |
-
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
-
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
-
this._touchEvent = true;
|
764 |
-
this.highlightUnderEvent(event);
|
765 |
-
}));
|
766 |
-
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
-
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
-
|
769 |
-
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
-
// otherwise click will be triggered on an underlying element
|
771 |
-
this.dropdown.on('click', this.bind(function (event) {
|
772 |
-
if (this._touchEvent) {
|
773 |
-
this._touchEvent = false;
|
774 |
-
this.selectHighlighted();
|
775 |
-
}
|
776 |
-
}));
|
777 |
-
|
778 |
-
installDebouncedScroll(80, this.results);
|
779 |
-
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
-
|
781 |
-
// do not propagate change event from the search field out of the component
|
782 |
-
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
-
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
-
|
785 |
-
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
-
if ($.fn.mousewheel) {
|
787 |
-
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
-
var top = results.scrollTop();
|
789 |
-
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
-
results.scrollTop(0);
|
791 |
-
killEvent(e);
|
792 |
-
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
-
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
-
killEvent(e);
|
795 |
-
}
|
796 |
-
});
|
797 |
-
}
|
798 |
-
|
799 |
-
installKeyUpChangeEvent(search);
|
800 |
-
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
-
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
-
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
-
|
804 |
-
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
-
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
-
this.highlightUnderEvent(e);
|
807 |
-
this.selectHighlighted(e);
|
808 |
-
}
|
809 |
-
}));
|
810 |
-
|
811 |
-
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
-
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
-
// dom it will trigger the popup close, which is not what we want
|
814 |
-
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
-
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
-
|
817 |
-
this.nextSearchTerm = undefined;
|
818 |
-
|
819 |
-
if ($.isFunction(this.opts.initSelection)) {
|
820 |
-
// initialize selection based on the current value of the source element
|
821 |
-
this.initSelection();
|
822 |
-
|
823 |
-
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
-
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
-
this.monitorSource();
|
826 |
-
}
|
827 |
-
|
828 |
-
if (opts.maximumInputLength !== null) {
|
829 |
-
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
-
}
|
831 |
-
|
832 |
-
var disabled = opts.element.prop("disabled");
|
833 |
-
if (disabled === undefined) disabled = false;
|
834 |
-
this.enable(!disabled);
|
835 |
-
|
836 |
-
var readonly = opts.element.prop("readonly");
|
837 |
-
if (readonly === undefined) readonly = false;
|
838 |
-
this.readonly(readonly);
|
839 |
-
|
840 |
-
// Calculate size of scrollbar
|
841 |
-
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
-
|
843 |
-
this.autofocus = opts.element.prop("autofocus");
|
844 |
-
opts.element.prop("autofocus", false);
|
845 |
-
if (this.autofocus) this.focus();
|
846 |
-
|
847 |
-
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
-
},
|
849 |
-
|
850 |
-
// abstract
|
851 |
-
destroy: function () {
|
852 |
-
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
-
|
854 |
-
this.close();
|
855 |
-
|
856 |
-
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
-
element.each(function () {
|
858 |
-
if (self._sync) {
|
859 |
-
this.detachEvent("onpropertychange", self._sync);
|
860 |
-
}
|
861 |
-
});
|
862 |
-
}
|
863 |
-
if (this.propertyObserver) {
|
864 |
-
this.propertyObserver.disconnect();
|
865 |
-
this.propertyObserver = null;
|
866 |
-
}
|
867 |
-
this._sync = null;
|
868 |
-
|
869 |
-
if (select2 !== undefined) {
|
870 |
-
select2.container.remove();
|
871 |
-
select2.liveRegion.remove();
|
872 |
-
select2.dropdown.remove();
|
873 |
-
element
|
874 |
-
.show()
|
875 |
-
.removeData("select2")
|
876 |
-
.off(".select2")
|
877 |
-
.prop("autofocus", this.autofocus || false);
|
878 |
-
if (this.elementTabIndex) {
|
879 |
-
element.attr({tabindex: this.elementTabIndex});
|
880 |
-
} else {
|
881 |
-
element.removeAttr("tabindex");
|
882 |
-
}
|
883 |
-
element.show();
|
884 |
-
}
|
885 |
-
|
886 |
-
cleanupJQueryElements.call(this,
|
887 |
-
"container",
|
888 |
-
"liveRegion",
|
889 |
-
"dropdown",
|
890 |
-
"results",
|
891 |
-
"search"
|
892 |
-
);
|
893 |
-
},
|
894 |
-
|
895 |
-
// abstract
|
896 |
-
optionToData: function(element) {
|
897 |
-
if (element.is("option")) {
|
898 |
-
return {
|
899 |
-
id:element.prop("value"),
|
900 |
-
text:element.text(),
|
901 |
-
element: element.get(),
|
902 |
-
css: element.attr("class"),
|
903 |
-
disabled: element.prop("disabled"),
|
904 |
-
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
905 |
-
};
|
906 |
-
} else if (element.is("optgroup")) {
|
907 |
-
return {
|
908 |
-
text:element.attr("label"),
|
909 |
-
children:[],
|
910 |
-
element: element.get(),
|
911 |
-
css: element.attr("class")
|
912 |
-
};
|
913 |
-
}
|
914 |
-
},
|
915 |
-
|
916 |
-
// abstract
|
917 |
-
prepareOpts: function (opts) {
|
918 |
-
var element, select, idKey, ajaxUrl, self = this;
|
919 |
-
|
920 |
-
element = opts.element;
|
921 |
-
|
922 |
-
if (element.get(0).tagName.toLowerCase() === "select") {
|
923 |
-
this.select = select = opts.element;
|
924 |
-
}
|
925 |
-
|
926 |
-
if (select) {
|
927 |
-
// these options are not allowed when attached to a select because they are picked up off the element itself
|
928 |
-
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
929 |
-
if (this in opts) {
|
930 |
-
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
931 |
-
}
|
932 |
-
});
|
933 |
-
}
|
934 |
-
|
935 |
-
opts = $.extend({}, {
|
936 |
-
populateResults: function(container, results, query) {
|
937 |
-
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
938 |
-
|
939 |
-
populate=function(results, container, depth) {
|
940 |
-
|
941 |
-
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
942 |
-
|
943 |
-
results = opts.sortResults(results, container, query);
|
944 |
-
|
945 |
-
// collect the created nodes for bulk append
|
946 |
-
var nodes = [];
|
947 |
-
for (i = 0, l = results.length; i < l; i = i + 1) {
|
948 |
-
|
949 |
-
result=results[i];
|
950 |
-
|
951 |
-
disabled = (result.disabled === true);
|
952 |
-
selectable = (!disabled) && (id(result) !== undefined);
|
953 |
-
|
954 |
-
compound=result.children && result.children.length > 0;
|
955 |
-
|
956 |
-
node=$("<li></li>");
|
957 |
-
node.addClass("select2-results-dept-"+depth);
|
958 |
-
node.addClass("select2-result");
|
959 |
-
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
960 |
-
if (disabled) { node.addClass("select2-disabled"); }
|
961 |
-
if (compound) { node.addClass("select2-result-with-children"); }
|
962 |
-
node.addClass(self.opts.formatResultCssClass(result));
|
963 |
-
node.attr("role", "presentation");
|
964 |
-
|
965 |
-
label=$(document.createElement("div"));
|
966 |
-
label.addClass("select2-result-label");
|
967 |
-
label.attr("id", "select2-result-label-" + nextUid());
|
968 |
-
label.attr("role", "option");
|
969 |
-
|
970 |
-
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
971 |
-
if (formatted!==undefined) {
|
972 |
-
label.html(formatted);
|
973 |
-
node.append(label);
|
974 |
-
}
|
975 |
-
|
976 |
-
|
977 |
-
if (compound) {
|
978 |
-
|
979 |
-
innerContainer=$("<ul></ul>");
|
980 |
-
innerContainer.addClass("select2-result-sub");
|
981 |
-
populate(result.children, innerContainer, depth+1);
|
982 |
-
node.append(innerContainer);
|
983 |
-
}
|
984 |
-
|
985 |
-
node.data("select2-data", result);
|
986 |
-
nodes.push(node[0]);
|
987 |
-
}
|
988 |
-
|
989 |
-
// bulk append the created nodes
|
990 |
-
container.append(nodes);
|
991 |
-
liveRegion.text(opts.formatMatches(results.length));
|
992 |
-
};
|
993 |
-
|
994 |
-
populate(results, container, 0);
|
995 |
-
}
|
996 |
-
}, $.fn.select2.defaults, opts);
|
997 |
-
|
998 |
-
if (typeof(opts.id) !== "function") {
|
999 |
-
idKey = opts.id;
|
1000 |
-
opts.id = function (e) { return e[idKey]; };
|
1001 |
-
}
|
1002 |
-
|
1003 |
-
if ($.isArray(opts.element.data("select2Tags"))) {
|
1004 |
-
if ("tags" in opts) {
|
1005 |
-
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1006 |
-
}
|
1007 |
-
opts.tags=opts.element.data("select2Tags");
|
1008 |
-
}
|
1009 |
-
|
1010 |
-
if (select) {
|
1011 |
-
opts.query = this.bind(function (query) {
|
1012 |
-
var data = { results: [], more: false },
|
1013 |
-
term = query.term,
|
1014 |
-
children, placeholderOption, process;
|
1015 |
-
|
1016 |
-
process=function(element, collection) {
|
1017 |
-
var group;
|
1018 |
-
if (element.is("option")) {
|
1019 |
-
if (query.matcher(term, element.text(), element)) {
|
1020 |
-
collection.push(self.optionToData(element));
|
1021 |
-
}
|
1022 |
-
} else if (element.is("optgroup")) {
|
1023 |
-
group=self.optionToData(element);
|
1024 |
-
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1025 |
-
if (group.children.length>0) {
|
1026 |
-
collection.push(group);
|
1027 |
-
}
|
1028 |
-
}
|
1029 |
-
};
|
1030 |
-
|
1031 |
-
children=element.children();
|
1032 |
-
|
1033 |
-
// ignore the placeholder option if there is one
|
1034 |
-
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1035 |
-
placeholderOption = this.getPlaceholderOption();
|
1036 |
-
if (placeholderOption) {
|
1037 |
-
children=children.not(placeholderOption);
|
1038 |
-
}
|
1039 |
-
}
|
1040 |
-
|
1041 |
-
children.each2(function(i, elm) { process(elm, data.results); });
|
1042 |
-
|
1043 |
-
query.callback(data);
|
1044 |
-
});
|
1045 |
-
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1046 |
-
opts.id=function(e) { return e.id; };
|
1047 |
-
} else {
|
1048 |
-
if (!("query" in opts)) {
|
1049 |
-
|
1050 |
-
if ("ajax" in opts) {
|
1051 |
-
ajaxUrl = opts.element.data("ajax-url");
|
1052 |
-
if (ajaxUrl && ajaxUrl.length > 0) {
|
1053 |
-
opts.ajax.url = ajaxUrl;
|
1054 |
-
}
|
1055 |
-
opts.query = ajax.call(opts.element, opts.ajax);
|
1056 |
-
} else if ("data" in opts) {
|
1057 |
-
opts.query = local(opts.data);
|
1058 |
-
} else if ("tags" in opts) {
|
1059 |
-
opts.query = tags(opts.tags);
|
1060 |
-
if (opts.createSearchChoice === undefined) {
|
1061 |
-
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1062 |
-
}
|
1063 |
-
if (opts.initSelection === undefined) {
|
1064 |
-
opts.initSelection = function (element, callback) {
|
1065 |
-
var data = [];
|
1066 |
-
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1067 |
-
var obj = { id: this, text: this },
|
1068 |
-
tags = opts.tags;
|
1069 |
-
if ($.isFunction(tags)) tags=tags();
|
1070 |
-
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1071 |
-
data.push(obj);
|
1072 |
-
});
|
1073 |
-
|
1074 |
-
callback(data);
|
1075 |
-
};
|
1076 |
-
}
|
1077 |
-
}
|
1078 |
-
}
|
1079 |
-
}
|
1080 |
-
if (typeof(opts.query) !== "function") {
|
1081 |
-
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1082 |
-
}
|
1083 |
-
|
1084 |
-
if (opts.createSearchChoicePosition === 'top') {
|
1085 |
-
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1086 |
-
}
|
1087 |
-
else if (opts.createSearchChoicePosition === 'bottom') {
|
1088 |
-
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1089 |
-
}
|
1090 |
-
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1091 |
-
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1092 |
-
}
|
1093 |
-
|
1094 |
-
return opts;
|
1095 |
-
},
|
1096 |
-
|
1097 |
-
/**
|
1098 |
-
* Monitor the original element for changes and update select2 accordingly
|
1099 |
-
*/
|
1100 |
-
// abstract
|
1101 |
-
monitorSource: function () {
|
1102 |
-
var el = this.opts.element, observer, self = this;
|
1103 |
-
|
1104 |
-
el.on("change.select2", this.bind(function (e) {
|
1105 |
-
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1106 |
-
this.initSelection();
|
1107 |
-
}
|
1108 |
-
}));
|
1109 |
-
|
1110 |
-
this._sync = this.bind(function () {
|
1111 |
-
|
1112 |
-
// sync enabled state
|
1113 |
-
var disabled = el.prop("disabled");
|
1114 |
-
if (disabled === undefined) disabled = false;
|
1115 |
-
this.enable(!disabled);
|
1116 |
-
|
1117 |
-
var readonly = el.prop("readonly");
|
1118 |
-
if (readonly === undefined) readonly = false;
|
1119 |
-
this.readonly(readonly);
|
1120 |
-
|
1121 |
-
if (this.container) {
|
1122 |
-
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1123 |
-
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1124 |
-
}
|
1125 |
-
|
1126 |
-
if (this.dropdown) {
|
1127 |
-
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1128 |
-
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1129 |
-
}
|
1130 |
-
|
1131 |
-
});
|
1132 |
-
|
1133 |
-
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1134 |
-
if (el.length && el[0].attachEvent) {
|
1135 |
-
el.each(function() {
|
1136 |
-
this.attachEvent("onpropertychange", self._sync);
|
1137 |
-
});
|
1138 |
-
}
|
1139 |
-
|
1140 |
-
// safari, chrome, firefox, IE11
|
1141 |
-
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1142 |
-
if (observer !== undefined) {
|
1143 |
-
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1144 |
-
this.propertyObserver = new observer(function (mutations) {
|
1145 |
-
$.each(mutations, self._sync);
|
1146 |
-
});
|
1147 |
-
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1148 |
-
}
|
1149 |
-
},
|
1150 |
-
|
1151 |
-
// abstract
|
1152 |
-
triggerSelect: function(data) {
|
1153 |
-
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1154 |
-
this.opts.element.trigger(evt);
|
1155 |
-
return !evt.isDefaultPrevented();
|
1156 |
-
},
|
1157 |
-
|
1158 |
-
/**
|
1159 |
-
* Triggers the change event on the source element
|
1160 |
-
*/
|
1161 |
-
// abstract
|
1162 |
-
triggerChange: function (details) {
|
1163 |
-
|
1164 |
-
details = details || {};
|
1165 |
-
details= $.extend({}, details, { type: "change", val: this.val() });
|
1166 |
-
// prevents recursive triggering
|
1167 |
-
this.opts.element.data("select2-change-triggered", true);
|
1168 |
-
this.opts.element.trigger(details);
|
1169 |
-
this.opts.element.data("select2-change-triggered", false);
|
1170 |
-
|
1171 |
-
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1172 |
-
// so here we trigger the click event manually
|
1173 |
-
this.opts.element.click();
|
1174 |
-
|
1175 |
-
// ValidationEngine ignores the change event and listens instead to blur
|
1176 |
-
// so here we trigger the blur event manually if so desired
|
1177 |
-
if (this.opts.blurOnChange)
|
1178 |
-
this.opts.element.blur();
|
1179 |
-
},
|
1180 |
-
|
1181 |
-
//abstract
|
1182 |
-
isInterfaceEnabled: function()
|
1183 |
-
{
|
1184 |
-
return this.enabledInterface === true;
|
1185 |
-
},
|
1186 |
-
|
1187 |
-
// abstract
|
1188 |
-
enableInterface: function() {
|
1189 |
-
var enabled = this._enabled && !this._readonly,
|
1190 |
-
disabled = !enabled;
|
1191 |
-
|
1192 |
-
if (enabled === this.enabledInterface) return false;
|
1193 |
-
|
1194 |
-
this.container.toggleClass("select2-container-disabled", disabled);
|
1195 |
-
this.close();
|
1196 |
-
this.enabledInterface = enabled;
|
1197 |
-
|
1198 |
-
return true;
|
1199 |
-
},
|
1200 |
-
|
1201 |
-
// abstract
|
1202 |
-
enable: function(enabled) {
|
1203 |
-
if (enabled === undefined) enabled = true;
|
1204 |
-
if (this._enabled === enabled) return;
|
1205 |
-
this._enabled = enabled;
|
1206 |
-
|
1207 |
-
this.opts.element.prop("disabled", !enabled);
|
1208 |
-
this.enableInterface();
|
1209 |
-
},
|
1210 |
-
|
1211 |
-
// abstract
|
1212 |
-
disable: function() {
|
1213 |
-
this.enable(false);
|
1214 |
-
},
|
1215 |
-
|
1216 |
-
// abstract
|
1217 |
-
readonly: function(enabled) {
|
1218 |
-
if (enabled === undefined) enabled = false;
|
1219 |
-
if (this._readonly === enabled) return;
|
1220 |
-
this._readonly = enabled;
|
1221 |
-
|
1222 |
-
this.opts.element.prop("readonly", enabled);
|
1223 |
-
this.enableInterface();
|
1224 |
-
},
|
1225 |
-
|
1226 |
-
// abstract
|
1227 |
-
opened: function () {
|
1228 |
-
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1229 |
-
},
|
1230 |
-
|
1231 |
-
// abstract
|
1232 |
-
positionDropdown: function() {
|
1233 |
-
var $dropdown = this.dropdown,
|
1234 |
-
container = this.container,
|
1235 |
-
offset = container.offset(),
|
1236 |
-
height = container.outerHeight(false),
|
1237 |
-
width = container.outerWidth(false),
|
1238 |
-
dropHeight = $dropdown.outerHeight(false),
|
1239 |
-
$window = $(window),
|
1240 |
-
windowWidth = $window.width(),
|
1241 |
-
windowHeight = $window.height(),
|
1242 |
-
viewPortRight = $window.scrollLeft() + windowWidth,
|
1243 |
-
viewportBottom = $window.scrollTop() + windowHeight,
|
1244 |
-
dropTop = offset.top + height,
|
1245 |
-
dropLeft = offset.left,
|
1246 |
-
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1247 |
-
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1248 |
-
dropWidth = $dropdown.outerWidth(false),
|
1249 |
-
enoughRoomOnRight = function() {
|
1250 |
-
return dropLeft + dropWidth <= viewPortRight;
|
1251 |
-
},
|
1252 |
-
enoughRoomOnLeft = function() {
|
1253 |
-
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1254 |
-
},
|
1255 |
-
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1256 |
-
bodyOffset,
|
1257 |
-
above,
|
1258 |
-
changeDirection,
|
1259 |
-
css,
|
1260 |
-
resultsListNode;
|
1261 |
-
|
1262 |
-
// always prefer the current above/below alignment, unless there is not enough room
|
1263 |
-
if (aboveNow) {
|
1264 |
-
above = true;
|
1265 |
-
if (!enoughRoomAbove && enoughRoomBelow) {
|
1266 |
-
changeDirection = true;
|
1267 |
-
above = false;
|
1268 |
-
}
|
1269 |
-
} else {
|
1270 |
-
above = false;
|
1271 |
-
if (!enoughRoomBelow && enoughRoomAbove) {
|
1272 |
-
changeDirection = true;
|
1273 |
-
above = true;
|
1274 |
-
}
|
1275 |
-
}
|
1276 |
-
|
1277 |
-
//if we are changing direction we need to get positions when dropdown is hidden;
|
1278 |
-
if (changeDirection) {
|
1279 |
-
$dropdown.hide();
|
1280 |
-
offset = this.container.offset();
|
1281 |
-
height = this.container.outerHeight(false);
|
1282 |
-
width = this.container.outerWidth(false);
|
1283 |
-
dropHeight = $dropdown.outerHeight(false);
|
1284 |
-
viewPortRight = $window.scrollLeft() + windowWidth;
|
1285 |
-
viewportBottom = $window.scrollTop() + windowHeight;
|
1286 |
-
dropTop = offset.top + height;
|
1287 |
-
dropLeft = offset.left;
|
1288 |
-
dropWidth = $dropdown.outerWidth(false);
|
1289 |
-
$dropdown.show();
|
1290 |
-
|
1291 |
-
// fix so the cursor does not move to the left within the search-textbox in IE
|
1292 |
-
this.focusSearch();
|
1293 |
-
}
|
1294 |
-
|
1295 |
-
if (this.opts.dropdownAutoWidth) {
|
1296 |
-
resultsListNode = $('.select2-results', $dropdown)[0];
|
1297 |
-
$dropdown.addClass('select2-drop-auto-width');
|
1298 |
-
$dropdown.css('width', '');
|
1299 |
-
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1300 |
-
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1301 |
-
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1302 |
-
dropHeight = $dropdown.outerHeight(false);
|
1303 |
-
}
|
1304 |
-
else {
|
1305 |
-
this.container.removeClass('select2-drop-auto-width');
|
1306 |
-
}
|
1307 |
-
|
1308 |
-
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1309 |
-
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1310 |
-
|
1311 |
-
// fix positioning when body has an offset and is not position: static
|
1312 |
-
if (this.body.css('position') !== 'static') {
|
1313 |
-
bodyOffset = this.body.offset();
|
1314 |
-
dropTop -= bodyOffset.top;
|
1315 |
-
dropLeft -= bodyOffset.left;
|
1316 |
-
}
|
1317 |
-
|
1318 |
-
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1319 |
-
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1320 |
-
}
|
1321 |
-
|
1322 |
-
css = {
|
1323 |
-
left: dropLeft,
|
1324 |
-
width: width
|
1325 |
-
};
|
1326 |
-
|
1327 |
-
if (above) {
|
1328 |
-
css.top = offset.top - dropHeight;
|
1329 |
-
css.bottom = 'auto';
|
1330 |
-
this.container.addClass("select2-drop-above");
|
1331 |
-
$dropdown.addClass("select2-drop-above");
|
1332 |
-
}
|
1333 |
-
else {
|
1334 |
-
css.top = dropTop;
|
1335 |
-
css.bottom = 'auto';
|
1336 |
-
this.container.removeClass("select2-drop-above");
|
1337 |
-
$dropdown.removeClass("select2-drop-above");
|
1338 |
-
}
|
1339 |
-
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1340 |
-
|
1341 |
-
$dropdown.css(css);
|
1342 |
-
},
|
1343 |
-
|
1344 |
-
// abstract
|
1345 |
-
shouldOpen: function() {
|
1346 |
-
var event;
|
1347 |
-
|
1348 |
-
if (this.opened()) return false;
|
1349 |
-
|
1350 |
-
if (this._enabled === false || this._readonly === true) return false;
|
1351 |
-
|
1352 |
-
event = $.Event("select2-opening");
|
1353 |
-
this.opts.element.trigger(event);
|
1354 |
-
return !event.isDefaultPrevented();
|
1355 |
-
},
|
1356 |
-
|
1357 |
-
// abstract
|
1358 |
-
clearDropdownAlignmentPreference: function() {
|
1359 |
-
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1360 |
-
this.container.removeClass("select2-drop-above");
|
1361 |
-
this.dropdown.removeClass("select2-drop-above");
|
1362 |
-
},
|
1363 |
-
|
1364 |
-
/**
|
1365 |
-
* Opens the dropdown
|
1366 |
-
*
|
1367 |
-
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1368 |
-
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1369 |
-
*/
|
1370 |
-
// abstract
|
1371 |
-
open: function () {
|
1372 |
-
|
1373 |
-
if (!this.shouldOpen()) return false;
|
1374 |
-
|
1375 |
-
this.opening();
|
1376 |
-
|
1377 |
-
// Only bind the document mousemove when the dropdown is visible
|
1378 |
-
$document.on("mousemove.select2Event", function (e) {
|
1379 |
-
lastMousePosition.x = e.pageX;
|
1380 |
-
lastMousePosition.y = e.pageY;
|
1381 |
-
});
|
1382 |
-
|
1383 |
-
return true;
|
1384 |
-
},
|
1385 |
-
|
1386 |
-
/**
|
1387 |
-
* Performs the opening of the dropdown
|
1388 |
-
*/
|
1389 |
-
// abstract
|
1390 |
-
opening: function() {
|
1391 |
-
var cid = this.containerEventName,
|
1392 |
-
scroll = "scroll." + cid,
|
1393 |
-
resize = "resize."+cid,
|
1394 |
-
orient = "orientationchange."+cid,
|
1395 |
-
mask;
|
1396 |
-
|
1397 |
-
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1398 |
-
|
1399 |
-
this.clearDropdownAlignmentPreference();
|
1400 |
-
|
1401 |
-
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1402 |
-
this.dropdown.detach().appendTo(this.body);
|
1403 |
-
}
|
1404 |
-
|
1405 |
-
// create the dropdown mask if doesn't already exist
|
1406 |
-
mask = $("#select2-drop-mask");
|
1407 |
-
if (mask.length === 0) {
|
1408 |
-
mask = $(document.createElement("div"));
|
1409 |
-
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1410 |
-
mask.hide();
|
1411 |
-
mask.appendTo(this.body);
|
1412 |
-
mask.on("mousedown touchstart click", function (e) {
|
1413 |
-
// Prevent IE from generating a click event on the body
|
1414 |
-
reinsertElement(mask);
|
1415 |
-
|
1416 |
-
var dropdown = $("#select2-drop"), self;
|
1417 |
-
if (dropdown.length > 0) {
|
1418 |
-
self=dropdown.data("select2");
|
1419 |
-
if (self.opts.selectOnBlur) {
|
1420 |
-
self.selectHighlighted({noFocus: true});
|
1421 |
-
}
|
1422 |
-
self.close();
|
1423 |
-
e.preventDefault();
|
1424 |
-
e.stopPropagation();
|
1425 |
-
}
|
1426 |
-
});
|
1427 |
-
}
|
1428 |
-
|
1429 |
-
// ensure the mask is always right before the dropdown
|
1430 |
-
if (this.dropdown.prev()[0] !== mask[0]) {
|
1431 |
-
this.dropdown.before(mask);
|
1432 |
-
}
|
1433 |
-
|
1434 |
-
// move the global id to the correct dropdown
|
1435 |
-
$("#select2-drop").removeAttr("id");
|
1436 |
-
this.dropdown.attr("id", "select2-drop");
|
1437 |
-
|
1438 |
-
// show the elements
|
1439 |
-
mask.show();
|
1440 |
-
|
1441 |
-
this.positionDropdown();
|
1442 |
-
this.dropdown.show();
|
1443 |
-
this.positionDropdown();
|
1444 |
-
|
1445 |
-
this.dropdown.addClass("select2-drop-active");
|
1446 |
-
|
1447 |
-
// attach listeners to events that can change the position of the container and thus require
|
1448 |
-
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1449 |
-
var that = this;
|
1450 |
-
this.container.parents().add(window).each(function () {
|
1451 |
-
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1452 |
-
if (that.opened()) that.positionDropdown();
|
1453 |
-
});
|
1454 |
-
});
|
1455 |
-
|
1456 |
-
|
1457 |
-
},
|
1458 |
-
|
1459 |
-
// abstract
|
1460 |
-
close: function () {
|
1461 |
-
if (!this.opened()) return;
|
1462 |
-
|
1463 |
-
var cid = this.containerEventName,
|
1464 |
-
scroll = "scroll." + cid,
|
1465 |
-
resize = "resize."+cid,
|
1466 |
-
orient = "orientationchange."+cid;
|
1467 |
-
|
1468 |
-
// unbind event listeners
|
1469 |
-
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1470 |
-
|
1471 |
-
this.clearDropdownAlignmentPreference();
|
1472 |
-
|
1473 |
-
$("#select2-drop-mask").hide();
|
1474 |
-
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1475 |
-
this.dropdown.hide();
|
1476 |
-
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1477 |
-
this.results.empty();
|
1478 |
-
|
1479 |
-
// Now that the dropdown is closed, unbind the global document mousemove event
|
1480 |
-
$document.off("mousemove.select2Event");
|
1481 |
-
|
1482 |
-
this.clearSearch();
|
1483 |
-
this.search.removeClass("select2-active");
|
1484 |
-
this.opts.element.trigger($.Event("select2-close"));
|
1485 |
-
},
|
1486 |
-
|
1487 |
-
/**
|
1488 |
-
* Opens control, sets input value, and updates results.
|
1489 |
-
*/
|
1490 |
-
// abstract
|
1491 |
-
externalSearch: function (term) {
|
1492 |
-
this.open();
|
1493 |
-
this.search.val(term);
|
1494 |
-
this.updateResults(false);
|
1495 |
-
},
|
1496 |
-
|
1497 |
-
// abstract
|
1498 |
-
clearSearch: function () {
|
1499 |
-
|
1500 |
-
},
|
1501 |
-
|
1502 |
-
//abstract
|
1503 |
-
getMaximumSelectionSize: function() {
|
1504 |
-
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1505 |
-
},
|
1506 |
-
|
1507 |
-
// abstract
|
1508 |
-
ensureHighlightVisible: function () {
|
1509 |
-
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1510 |
-
|
1511 |
-
index = this.highlight();
|
1512 |
-
|
1513 |
-
if (index < 0) return;
|
1514 |
-
|
1515 |
-
if (index == 0) {
|
1516 |
-
|
1517 |
-
// if the first element is highlighted scroll all the way to the top,
|
1518 |
-
// that way any unselectable headers above it will also be scrolled
|
1519 |
-
// into view
|
1520 |
-
|
1521 |
-
results.scrollTop(0);
|
1522 |
-
return;
|
1523 |
-
}
|
1524 |
-
|
1525 |
-
children = this.findHighlightableChoices().find('.select2-result-label');
|
1526 |
-
|
1527 |
-
child = $(children[index]);
|
1528 |
-
|
1529 |
-
topOffset = (child.offset() || {}).top || 0;
|
1530 |
-
|
1531 |
-
hb = topOffset + child.outerHeight(true);
|
1532 |
-
|
1533 |
-
// if this is the last child lets also make sure select2-more-results is visible
|
1534 |
-
if (index === children.length - 1) {
|
1535 |
-
more = results.find("li.select2-more-results");
|
1536 |
-
if (more.length > 0) {
|
1537 |
-
hb = more.offset().top + more.outerHeight(true);
|
1538 |
-
}
|
1539 |
-
}
|
1540 |
-
|
1541 |
-
rb = results.offset().top + results.outerHeight(false);
|
1542 |
-
if (hb > rb) {
|
1543 |
-
results.scrollTop(results.scrollTop() + (hb - rb));
|
1544 |
-
}
|
1545 |
-
y = topOffset - results.offset().top;
|
1546 |
-
|
1547 |
-
// make sure the top of the element is visible
|
1548 |
-
if (y < 0 && child.css('display') != 'none' ) {
|
1549 |
-
results.scrollTop(results.scrollTop() + y); // y is negative
|
1550 |
-
}
|
1551 |
-
},
|
1552 |
-
|
1553 |
-
// abstract
|
1554 |
-
findHighlightableChoices: function() {
|
1555 |
-
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1556 |
-
},
|
1557 |
-
|
1558 |
-
// abstract
|
1559 |
-
moveHighlight: function (delta) {
|
1560 |
-
var choices = this.findHighlightableChoices(),
|
1561 |
-
index = this.highlight();
|
1562 |
-
|
1563 |
-
while (index > -1 && index < choices.length) {
|
1564 |
-
index += delta;
|
1565 |
-
var choice = $(choices[index]);
|
1566 |
-
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1567 |
-
this.highlight(index);
|
1568 |
-
break;
|
1569 |
-
}
|
1570 |
-
}
|
1571 |
-
},
|
1572 |
-
|
1573 |
-
// abstract
|
1574 |
-
highlight: function (index) {
|
1575 |
-
var choices = this.findHighlightableChoices(),
|
1576 |
-
choice,
|
1577 |
-
data;
|
1578 |
-
|
1579 |
-
if (arguments.length === 0) {
|
1580 |
-
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1581 |
-
}
|
1582 |
-
|
1583 |
-
if (index >= choices.length) index = choices.length - 1;
|
1584 |
-
if (index < 0) index = 0;
|
1585 |
-
|
1586 |
-
this.removeHighlight();
|
1587 |
-
|
1588 |
-
choice = $(choices[index]);
|
1589 |
-
choice.addClass("select2-highlighted");
|
1590 |
-
|
1591 |
-
// ensure assistive technology can determine the active choice
|
1592 |
-
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1593 |
-
|
1594 |
-
this.ensureHighlightVisible();
|
1595 |
-
|
1596 |
-
this.liveRegion.text(choice.text());
|
1597 |
-
|
1598 |
-
data = choice.data("select2-data");
|
1599 |
-
if (data) {
|
1600 |
-
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1601 |
-
}
|
1602 |
-
},
|
1603 |
-
|
1604 |
-
removeHighlight: function() {
|
1605 |
-
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1606 |
-
},
|
1607 |
-
|
1608 |
-
touchMoved: function() {
|
1609 |
-
this._touchMoved = true;
|
1610 |
-
},
|
1611 |
-
|
1612 |
-
clearTouchMoved: function() {
|
1613 |
-
this._touchMoved = false;
|
1614 |
-
},
|
1615 |
-
|
1616 |
-
// abstract
|
1617 |
-
countSelectableResults: function() {
|
1618 |
-
return this.findHighlightableChoices().length;
|
1619 |
-
},
|
1620 |
-
|
1621 |
-
// abstract
|
1622 |
-
highlightUnderEvent: function (event) {
|
1623 |
-
var el = $(event.target).closest(".select2-result-selectable");
|
1624 |
-
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1625 |
-
var choices = this.findHighlightableChoices();
|
1626 |
-
this.highlight(choices.index(el));
|
1627 |
-
} else if (el.length == 0) {
|
1628 |
-
// if we are over an unselectable item remove all highlights
|
1629 |
-
this.removeHighlight();
|
1630 |
-
}
|
1631 |
-
},
|
1632 |
-
|
1633 |
-
// abstract
|
1634 |
-
loadMoreIfNeeded: function () {
|
1635 |
-
var results = this.results,
|
1636 |
-
more = results.find("li.select2-more-results"),
|
1637 |
-
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1638 |
-
page = this.resultsPage + 1,
|
1639 |
-
self=this,
|
1640 |
-
term=this.search.val(),
|
1641 |
-
context=this.context;
|
1642 |
-
|
1643 |
-
if (more.length === 0) return;
|
1644 |
-
below = more.offset().top - results.offset().top - results.height();
|
1645 |
-
|
1646 |
-
if (below <= this.opts.loadMorePadding) {
|
1647 |
-
more.addClass("select2-active");
|
1648 |
-
this.opts.query({
|
1649 |
-
element: this.opts.element,
|
1650 |
-
term: term,
|
1651 |
-
page: page,
|
1652 |
-
context: context,
|
1653 |
-
matcher: this.opts.matcher,
|
1654 |
-
callback: this.bind(function (data) {
|
1655 |
-
|
1656 |
-
// ignore a response if the select2 has been closed before it was received
|
1657 |
-
if (!self.opened()) return;
|
1658 |
-
|
1659 |
-
|
1660 |
-
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1661 |
-
self.postprocessResults(data, false, false);
|
1662 |
-
|
1663 |
-
if (data.more===true) {
|
1664 |
-
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1665 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1666 |
-
} else {
|
1667 |
-
more.remove();
|
1668 |
-
}
|
1669 |
-
self.positionDropdown();
|
1670 |
-
self.resultsPage = page;
|
1671 |
-
self.context = data.context;
|
1672 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1673 |
-
})});
|
1674 |
-
}
|
1675 |
-
},
|
1676 |
-
|
1677 |
-
/**
|
1678 |
-
* Default tokenizer function which does nothing
|
1679 |
-
*/
|
1680 |
-
tokenize: function() {
|
1681 |
-
|
1682 |
-
},
|
1683 |
-
|
1684 |
-
/**
|
1685 |
-
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1686 |
-
*/
|
1687 |
-
// abstract
|
1688 |
-
updateResults: function (initial) {
|
1689 |
-
var search = this.search,
|
1690 |
-
results = this.results,
|
1691 |
-
opts = this.opts,
|
1692 |
-
data,
|
1693 |
-
self = this,
|
1694 |
-
input,
|
1695 |
-
term = search.val(),
|
1696 |
-
lastTerm = $.data(this.container, "select2-last-term"),
|
1697 |
-
// sequence number used to drop out-of-order responses
|
1698 |
-
queryNumber;
|
1699 |
-
|
1700 |
-
// prevent duplicate queries against the same term
|
1701 |
-
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1702 |
-
|
1703 |
-
$.data(this.container, "select2-last-term", term);
|
1704 |
-
|
1705 |
-
// if the search is currently hidden we do not alter the results
|
1706 |
-
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1707 |
-
return;
|
1708 |
-
}
|
1709 |
-
|
1710 |
-
function postRender() {
|
1711 |
-
search.removeClass("select2-active");
|
1712 |
-
self.positionDropdown();
|
1713 |
-
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1714 |
-
self.liveRegion.text(results.text());
|
1715 |
-
}
|
1716 |
-
else {
|
1717 |
-
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1718 |
-
}
|
1719 |
-
}
|
1720 |
-
|
1721 |
-
function render(html) {
|
1722 |
-
results.html(html);
|
1723 |
-
postRender();
|
1724 |
-
}
|
1725 |
-
|
1726 |
-
queryNumber = ++this.queryCount;
|
1727 |
-
|
1728 |
-
var maxSelSize = this.getMaximumSelectionSize();
|
1729 |
-
if (maxSelSize >=1) {
|
1730 |
-
data = this.data();
|
1731 |
-
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1732 |
-
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1733 |
-
return;
|
1734 |
-
}
|
1735 |
-
}
|
1736 |
-
|
1737 |
-
if (search.val().length < opts.minimumInputLength) {
|
1738 |
-
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1739 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1740 |
-
} else {
|
1741 |
-
render("");
|
1742 |
-
}
|
1743 |
-
if (initial && this.showSearch) this.showSearch(true);
|
1744 |
-
return;
|
1745 |
-
}
|
1746 |
-
|
1747 |
-
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1748 |
-
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1749 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1750 |
-
} else {
|
1751 |
-
render("");
|
1752 |
-
}
|
1753 |
-
return;
|
1754 |
-
}
|
1755 |
-
|
1756 |
-
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1757 |
-
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1758 |
-
}
|
1759 |
-
|
1760 |
-
search.addClass("select2-active");
|
1761 |
-
|
1762 |
-
this.removeHighlight();
|
1763 |
-
|
1764 |
-
// give the tokenizer a chance to pre-process the input
|
1765 |
-
input = this.tokenize();
|
1766 |
-
if (input != undefined && input != null) {
|
1767 |
-
search.val(input);
|
1768 |
-
}
|
1769 |
-
|
1770 |
-
this.resultsPage = 1;
|
1771 |
-
|
1772 |
-
opts.query({
|
1773 |
-
element: opts.element,
|
1774 |
-
term: search.val(),
|
1775 |
-
page: this.resultsPage,
|
1776 |
-
context: null,
|
1777 |
-
matcher: opts.matcher,
|
1778 |
-
callback: this.bind(function (data) {
|
1779 |
-
var def; // default choice
|
1780 |
-
|
1781 |
-
// ignore old responses
|
1782 |
-
if (queryNumber != this.queryCount) {
|
1783 |
-
return;
|
1784 |
-
}
|
1785 |
-
|
1786 |
-
// ignore a response if the select2 has been closed before it was received
|
1787 |
-
if (!this.opened()) {
|
1788 |
-
this.search.removeClass("select2-active");
|
1789 |
-
return;
|
1790 |
-
}
|
1791 |
-
|
1792 |
-
// handle ajax error
|
1793 |
-
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1794 |
-
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1795 |
-
return;
|
1796 |
-
}
|
1797 |
-
|
1798 |
-
// save context, if any
|
1799 |
-
this.context = (data.context===undefined) ? null : data.context;
|
1800 |
-
// create a default choice and prepend it to the list
|
1801 |
-
if (this.opts.createSearchChoice && search.val() !== "") {
|
1802 |
-
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1803 |
-
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1804 |
-
if ($(data.results).filter(
|
1805 |
-
function () {
|
1806 |
-
return equal(self.id(this), self.id(def));
|
1807 |
-
}).length === 0) {
|
1808 |
-
this.opts.createSearchChoicePosition(data.results, def);
|
1809 |
-
}
|
1810 |
-
}
|
1811 |
-
}
|
1812 |
-
|
1813 |
-
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1814 |
-
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1815 |
-
return;
|
1816 |
-
}
|
1817 |
-
|
1818 |
-
results.empty();
|
1819 |
-
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1820 |
-
|
1821 |
-
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
1822 |
-
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
1823 |
-
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1824 |
-
}
|
1825 |
-
|
1826 |
-
this.postprocessResults(data, initial);
|
1827 |
-
|
1828 |
-
postRender();
|
1829 |
-
|
1830 |
-
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1831 |
-
})});
|
1832 |
-
},
|
1833 |
-
|
1834 |
-
// abstract
|
1835 |
-
cancel: function () {
|
1836 |
-
this.close();
|
1837 |
-
},
|
1838 |
-
|
1839 |
-
// abstract
|
1840 |
-
blur: function () {
|
1841 |
-
// if selectOnBlur == true, select the currently highlighted option
|
1842 |
-
if (this.opts.selectOnBlur)
|
1843 |
-
this.selectHighlighted({noFocus: true});
|
1844 |
-
|
1845 |
-
this.close();
|
1846 |
-
this.container.removeClass("select2-container-active");
|
1847 |
-
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
1848 |
-
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
1849 |
-
this.clearSearch();
|
1850 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
1851 |
-
},
|
1852 |
-
|
1853 |
-
// abstract
|
1854 |
-
focusSearch: function () {
|
1855 |
-
focus(this.search);
|
1856 |
-
},
|
1857 |
-
|
1858 |
-
// abstract
|
1859 |
-
selectHighlighted: function (options) {
|
1860 |
-
if (this._touchMoved) {
|
1861 |
-
this.clearTouchMoved();
|
1862 |
-
return;
|
1863 |
-
}
|
1864 |
-
var index=this.highlight(),
|
1865 |
-
highlighted=this.results.find(".select2-highlighted"),
|
1866 |
-
data = highlighted.closest('.select2-result').data("select2-data");
|
1867 |
-
|
1868 |
-
if (data) {
|
1869 |
-
this.highlight(index);
|
1870 |
-
this.onSelect(data, options);
|
1871 |
-
} else if (options && options.noFocus) {
|
1872 |
-
this.close();
|
1873 |
-
}
|
1874 |
-
},
|
1875 |
-
|
1876 |
-
// abstract
|
1877 |
-
getPlaceholder: function () {
|
1878 |
-
var placeholderOption;
|
1879 |
-
return this.opts.element.attr("placeholder") ||
|
1880 |
-
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
1881 |
-
this.opts.element.data("placeholder") ||
|
1882 |
-
this.opts.placeholder ||
|
1883 |
-
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
1884 |
-
},
|
1885 |
-
|
1886 |
-
// abstract
|
1887 |
-
getPlaceholderOption: function() {
|
1888 |
-
if (this.select) {
|
1889 |
-
var firstOption = this.select.children('option').first();
|
1890 |
-
if (this.opts.placeholderOption !== undefined ) {
|
1891 |
-
//Determine the placeholder option based on the specified placeholderOption setting
|
1892 |
-
return (this.opts.placeholderOption === "first" && firstOption) ||
|
1893 |
-
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
1894 |
-
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
1895 |
-
//No explicit placeholder option specified, use the first if it's blank
|
1896 |
-
return firstOption;
|
1897 |
-
}
|
1898 |
-
}
|
1899 |
-
},
|
1900 |
-
|
1901 |
-
/**
|
1902 |
-
* Get the desired width for the container element. This is
|
1903 |
-
* derived first from option `width` passed to select2, then
|
1904 |
-
* the inline 'style' on the original element, and finally
|
1905 |
-
* falls back to the jQuery calculated element width.
|
1906 |
-
*/
|
1907 |
-
// abstract
|
1908 |
-
initContainerWidth: function () {
|
1909 |
-
function resolveContainerWidth() {
|
1910 |
-
var style, attrs, matches, i, l, attr;
|
1911 |
-
|
1912 |
-
if (this.opts.width === "off") {
|
1913 |
-
return null;
|
1914 |
-
} else if (this.opts.width === "element"){
|
1915 |
-
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
1916 |
-
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
1917 |
-
// check if there is inline style on the element that contains width
|
1918 |
-
style = this.opts.element.attr('style');
|
1919 |
-
if (style !== undefined) {
|
1920 |
-
attrs = style.split(';');
|
1921 |
-
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
1922 |
-
attr = attrs[i].replace(/\s/g, '');
|
1923 |
-
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
1924 |
-
if (matches !== null && matches.length >= 1)
|
1925 |
-
return matches[1];
|
1926 |
-
}
|
1927 |
-
}
|
1928 |
-
|
1929 |
-
if (this.opts.width === "resolve") {
|
1930 |
-
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
1931 |
-
// when attached to input type=hidden or elements hidden via css
|
1932 |
-
style = this.opts.element.css('width');
|
1933 |
-
if (style.indexOf("%") > 0) return style;
|
1934 |
-
|
1935 |
-
// finally, fallback on the calculated width of the element
|
1936 |
-
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
1937 |
-
}
|
1938 |
-
|
1939 |
-
return null;
|
1940 |
-
} else if ($.isFunction(this.opts.width)) {
|
1941 |
-
return this.opts.width();
|
1942 |
-
} else {
|
1943 |
-
return this.opts.width;
|
1944 |
-
}
|
1945 |
-
};
|
1946 |
-
|
1947 |
-
var width = resolveContainerWidth.call(this);
|
1948 |
-
if (width !== null) {
|
1949 |
-
this.container.css("width", width);
|
1950 |
-
}
|
1951 |
-
}
|
1952 |
-
});
|
1953 |
-
|
1954 |
-
SingleSelect2 = clazz(AbstractSelect2, {
|
1955 |
-
|
1956 |
-
// single
|
1957 |
-
|
1958 |
-
createContainer: function () {
|
1959 |
-
var container = $(document.createElement("div")).attr({
|
1960 |
-
"class": "select2-container"
|
1961 |
-
}).html([
|
1962 |
-
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
1963 |
-
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
1964 |
-
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
1965 |
-
"</a>",
|
1966 |
-
"<label for='' class='select2-offscreen'></label>",
|
1967 |
-
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
1968 |
-
"<div class='select2-drop select2-display-none'>",
|
1969 |
-
" <div class='select2-search'>",
|
1970 |
-
" <label for='' class='select2-offscreen'></label>",
|
1971 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
1972 |
-
" aria-autocomplete='list' />",
|
1973 |
-
" </div>",
|
1974 |
-
" <ul class='select2-results' role='listbox'>",
|
1975 |
-
" </ul>",
|
1976 |
-
"</div>"].join(""));
|
1977 |
-
return container;
|
1978 |
-
},
|
1979 |
-
|
1980 |
-
// single
|
1981 |
-
enableInterface: function() {
|
1982 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
1983 |
-
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
1984 |
-
}
|
1985 |
-
},
|
1986 |
-
|
1987 |
-
// single
|
1988 |
-
opening: function () {
|
1989 |
-
var el, range, len;
|
1990 |
-
|
1991 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
1992 |
-
this.showSearch(true);
|
1993 |
-
}
|
1994 |
-
|
1995 |
-
this.parent.opening.apply(this, arguments);
|
1996 |
-
|
1997 |
-
if (this.showSearchInput !== false) {
|
1998 |
-
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
1999 |
-
// all other browsers handle this just fine
|
2000 |
-
|
2001 |
-
this.search.val(this.focusser.val());
|
2002 |
-
}
|
2003 |
-
if (this.opts.shouldFocusInput(this)) {
|
2004 |
-
this.search.focus();
|
2005 |
-
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2006 |
-
// new text will appear *before* focusser.val()
|
2007 |
-
el = this.search.get(0);
|
2008 |
-
if (el.createTextRange) {
|
2009 |
-
range = el.createTextRange();
|
2010 |
-
range.collapse(false);
|
2011 |
-
range.select();
|
2012 |
-
} else if (el.setSelectionRange) {
|
2013 |
-
len = this.search.val().length;
|
2014 |
-
el.setSelectionRange(len, len);
|
2015 |
-
}
|
2016 |
-
}
|
2017 |
-
|
2018 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
2019 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2020 |
-
if(this.search.val() === "") {
|
2021 |
-
if(this.nextSearchTerm != undefined){
|
2022 |
-
this.search.val(this.nextSearchTerm);
|
2023 |
-
this.search.select();
|
2024 |
-
}
|
2025 |
-
}
|
2026 |
-
|
2027 |
-
this.focusser.prop("disabled", true).val("");
|
2028 |
-
this.updateResults(true);
|
2029 |
-
this.opts.element.trigger($.Event("select2-open"));
|
2030 |
-
},
|
2031 |
-
|
2032 |
-
// single
|
2033 |
-
close: function () {
|
2034 |
-
if (!this.opened()) return;
|
2035 |
-
this.parent.close.apply(this, arguments);
|
2036 |
-
|
2037 |
-
this.focusser.prop("disabled", false);
|
2038 |
-
|
2039 |
-
if (this.opts.shouldFocusInput(this)) {
|
2040 |
-
this.focusser.focus();
|
2041 |
-
}
|
2042 |
-
},
|
2043 |
-
|
2044 |
-
// single
|
2045 |
-
focus: function () {
|
2046 |
-
if (this.opened()) {
|
2047 |
-
this.close();
|
2048 |
-
} else {
|
2049 |
-
this.focusser.prop("disabled", false);
|
2050 |
-
if (this.opts.shouldFocusInput(this)) {
|
2051 |
-
this.focusser.focus();
|
2052 |
-
}
|
2053 |
-
}
|
2054 |
-
},
|
2055 |
-
|
2056 |
-
// single
|
2057 |
-
isFocused: function () {
|
2058 |
-
return this.container.hasClass("select2-container-active");
|
2059 |
-
},
|
2060 |
-
|
2061 |
-
// single
|
2062 |
-
cancel: function () {
|
2063 |
-
this.parent.cancel.apply(this, arguments);
|
2064 |
-
this.focusser.prop("disabled", false);
|
2065 |
-
|
2066 |
-
if (this.opts.shouldFocusInput(this)) {
|
2067 |
-
this.focusser.focus();
|
2068 |
-
}
|
2069 |
-
},
|
2070 |
-
|
2071 |
-
// single
|
2072 |
-
destroy: function() {
|
2073 |
-
$("label[for='" + this.focusser.attr('id') + "']")
|
2074 |
-
.attr('for', this.opts.element.attr("id"));
|
2075 |
-
this.parent.destroy.apply(this, arguments);
|
2076 |
-
|
2077 |
-
cleanupJQueryElements.call(this,
|
2078 |
-
"selection",
|
2079 |
-
"focusser"
|
2080 |
-
);
|
2081 |
-
},
|
2082 |
-
|
2083 |
-
// single
|
2084 |
-
initContainer: function () {
|
2085 |
-
|
2086 |
-
var selection,
|
2087 |
-
container = this.container,
|
2088 |
-
dropdown = this.dropdown,
|
2089 |
-
idSuffix = nextUid(),
|
2090 |
-
elementLabel;
|
2091 |
-
|
2092 |
-
if (this.opts.minimumResultsForSearch < 0) {
|
2093 |
-
this.showSearch(false);
|
2094 |
-
} else {
|
2095 |
-
this.showSearch(true);
|
2096 |
-
}
|
2097 |
-
|
2098 |
-
this.selection = selection = container.find(".select2-choice");
|
2099 |
-
|
2100 |
-
this.focusser = container.find(".select2-focusser");
|
2101 |
-
|
2102 |
-
// add aria associations
|
2103 |
-
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2104 |
-
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2105 |
-
this.results.attr("id", "select2-results-"+idSuffix);
|
2106 |
-
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2107 |
-
|
2108 |
-
// rewrite labels from original element to focusser
|
2109 |
-
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2110 |
-
|
2111 |
-
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2112 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2113 |
-
|
2114 |
-
this.focusser.prev()
|
2115 |
-
.text(elementLabel.text())
|
2116 |
-
.attr('for', this.focusser.attr('id'));
|
2117 |
-
|
2118 |
-
// Ensure the original element retains an accessible name
|
2119 |
-
var originalTitle = this.opts.element.attr("title");
|
2120 |
-
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2121 |
-
|
2122 |
-
this.focusser.attr("tabindex", this.elementTabIndex);
|
2123 |
-
|
2124 |
-
// write label for search field using the label from the focusser element
|
2125 |
-
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2126 |
-
|
2127 |
-
this.search.prev()
|
2128 |
-
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2129 |
-
.attr('for', this.search.attr('id'));
|
2130 |
-
|
2131 |
-
this.search.on("keydown", this.bind(function (e) {
|
2132 |
-
if (!this.isInterfaceEnabled()) return;
|
2133 |
-
|
2134 |
-
// filter 229 keyCodes (input method editor is processing key input)
|
2135 |
-
if (229 == e.keyCode) return;
|
2136 |
-
|
2137 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2138 |
-
// prevent the page from scrolling
|
2139 |
-
killEvent(e);
|
2140 |
-
return;
|
2141 |
-
}
|
2142 |
-
|
2143 |
-
switch (e.which) {
|
2144 |
-
case KEY.UP:
|
2145 |
-
case KEY.DOWN:
|
2146 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2147 |
-
killEvent(e);
|
2148 |
-
return;
|
2149 |
-
case KEY.ENTER:
|
2150 |
-
this.selectHighlighted();
|
2151 |
-
killEvent(e);
|
2152 |
-
return;
|
2153 |
-
case KEY.TAB:
|
2154 |
-
this.selectHighlighted({noFocus: true});
|
2155 |
-
return;
|
2156 |
-
case KEY.ESC:
|
2157 |
-
this.cancel(e);
|
2158 |
-
killEvent(e);
|
2159 |
-
return;
|
2160 |
-
}
|
2161 |
-
}));
|
2162 |
-
|
2163 |
-
this.search.on("blur", this.bind(function(e) {
|
2164 |
-
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2165 |
-
// without this the search field loses focus which is annoying
|
2166 |
-
if (document.activeElement === this.body.get(0)) {
|
2167 |
-
window.setTimeout(this.bind(function() {
|
2168 |
-
if (this.opened()) {
|
2169 |
-
this.search.focus();
|
2170 |
-
}
|
2171 |
-
}), 0);
|
2172 |
-
}
|
2173 |
-
}));
|
2174 |
-
|
2175 |
-
this.focusser.on("keydown", this.bind(function (e) {
|
2176 |
-
if (!this.isInterfaceEnabled()) return;
|
2177 |
-
|
2178 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2179 |
-
return;
|
2180 |
-
}
|
2181 |
-
|
2182 |
-
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2183 |
-
killEvent(e);
|
2184 |
-
return;
|
2185 |
-
}
|
2186 |
-
|
2187 |
-
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2188 |
-
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2189 |
-
|
2190 |
-
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2191 |
-
|
2192 |
-
this.open();
|
2193 |
-
killEvent(e);
|
2194 |
-
return;
|
2195 |
-
}
|
2196 |
-
|
2197 |
-
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2198 |
-
if (this.opts.allowClear) {
|
2199 |
-
this.clear();
|
2200 |
-
}
|
2201 |
-
killEvent(e);
|
2202 |
-
return;
|
2203 |
-
}
|
2204 |
-
}));
|
2205 |
-
|
2206 |
-
|
2207 |
-
installKeyUpChangeEvent(this.focusser);
|
2208 |
-
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2209 |
-
if (this.opts.minimumResultsForSearch >= 0) {
|
2210 |
-
e.stopPropagation();
|
2211 |
-
if (this.opened()) return;
|
2212 |
-
this.open();
|
2213 |
-
}
|
2214 |
-
}));
|
2215 |
-
|
2216 |
-
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2217 |
-
if (!this.isInterfaceEnabled()) {
|
2218 |
-
return;
|
2219 |
-
}
|
2220 |
-
|
2221 |
-
this.clear();
|
2222 |
-
killEventImmediately(e);
|
2223 |
-
this.close();
|
2224 |
-
|
2225 |
-
if (this.selection) {
|
2226 |
-
this.selection.focus();
|
2227 |
-
}
|
2228 |
-
}));
|
2229 |
-
|
2230 |
-
selection.on("mousedown touchstart", this.bind(function (e) {
|
2231 |
-
// Prevent IE from generating a click event on the body
|
2232 |
-
reinsertElement(selection);
|
2233 |
-
|
2234 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2235 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2236 |
-
}
|
2237 |
-
|
2238 |
-
if (this.opened()) {
|
2239 |
-
this.close();
|
2240 |
-
} else if (this.isInterfaceEnabled()) {
|
2241 |
-
this.open();
|
2242 |
-
}
|
2243 |
-
|
2244 |
-
killEvent(e);
|
2245 |
-
}));
|
2246 |
-
|
2247 |
-
dropdown.on("mousedown touchstart", this.bind(function() {
|
2248 |
-
if (this.opts.shouldFocusInput(this)) {
|
2249 |
-
this.search.focus();
|
2250 |
-
}
|
2251 |
-
}));
|
2252 |
-
|
2253 |
-
selection.on("focus", this.bind(function(e) {
|
2254 |
-
killEvent(e);
|
2255 |
-
}));
|
2256 |
-
|
2257 |
-
this.focusser.on("focus", this.bind(function(){
|
2258 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2259 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2260 |
-
}
|
2261 |
-
this.container.addClass("select2-container-active");
|
2262 |
-
})).on("blur", this.bind(function() {
|
2263 |
-
if (!this.opened()) {
|
2264 |
-
this.container.removeClass("select2-container-active");
|
2265 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
2266 |
-
}
|
2267 |
-
}));
|
2268 |
-
this.search.on("focus", this.bind(function(){
|
2269 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2270 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2271 |
-
}
|
2272 |
-
this.container.addClass("select2-container-active");
|
2273 |
-
}));
|
2274 |
-
|
2275 |
-
this.initContainerWidth();
|
2276 |
-
this.opts.element.hide();
|
2277 |
-
this.setPlaceholder();
|
2278 |
-
|
2279 |
-
},
|
2280 |
-
|
2281 |
-
// single
|
2282 |
-
clear: function(triggerChange) {
|
2283 |
-
var data=this.selection.data("select2-data");
|
2284 |
-
if (data) { // guard against queued quick consecutive clicks
|
2285 |
-
var evt = $.Event("select2-clearing");
|
2286 |
-
this.opts.element.trigger(evt);
|
2287 |
-
if (evt.isDefaultPrevented()) {
|
2288 |
-
return;
|
2289 |
-
}
|
2290 |
-
var placeholderOption = this.getPlaceholderOption();
|
2291 |
-
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2292 |
-
this.selection.find(".select2-chosen").empty();
|
2293 |
-
this.selection.removeData("select2-data");
|
2294 |
-
this.setPlaceholder();
|
2295 |
-
|
2296 |
-
if (triggerChange !== false){
|
2297 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2298 |
-
this.triggerChange({removed:data});
|
2299 |
-
}
|
2300 |
-
}
|
2301 |
-
},
|
2302 |
-
|
2303 |
-
/**
|
2304 |
-
* Sets selection based on source element's value
|
2305 |
-
*/
|
2306 |
-
// single
|
2307 |
-
initSelection: function () {
|
2308 |
-
var selected;
|
2309 |
-
if (this.isPlaceholderOptionSelected()) {
|
2310 |
-
this.updateSelection(null);
|
2311 |
-
this.close();
|
2312 |
-
this.setPlaceholder();
|
2313 |
-
} else {
|
2314 |
-
var self = this;
|
2315 |
-
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2316 |
-
if (selected !== undefined && selected !== null) {
|
2317 |
-
self.updateSelection(selected);
|
2318 |
-
self.close();
|
2319 |
-
self.setPlaceholder();
|
2320 |
-
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
2321 |
-
}
|
2322 |
-
});
|
2323 |
-
}
|
2324 |
-
},
|
2325 |
-
|
2326 |
-
isPlaceholderOptionSelected: function() {
|
2327 |
-
var placeholderOption;
|
2328 |
-
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2329 |
-
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2330 |
-
|| (this.opts.element.val() === "")
|
2331 |
-
|| (this.opts.element.val() === undefined)
|
2332 |
-
|| (this.opts.element.val() === null);
|
2333 |
-
},
|
2334 |
-
|
2335 |
-
// single
|
2336 |
-
prepareOpts: function () {
|
2337 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2338 |
-
self=this;
|
2339 |
-
|
2340 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2341 |
-
// install the selection initializer
|
2342 |
-
opts.initSelection = function (element, callback) {
|
2343 |
-
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2344 |
-
// a single select box always has a value, no need to null check 'selected'
|
2345 |
-
callback(self.optionToData(selected));
|
2346 |
-
};
|
2347 |
-
} else if ("data" in opts) {
|
2348 |
-
// install default initSelection when applied to hidden input and data is local
|
2349 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2350 |
-
var id = element.val();
|
2351 |
-
//search in data by id, storing the actual matching item
|
2352 |
-
var match = null;
|
2353 |
-
opts.query({
|
2354 |
-
matcher: function(term, text, el){
|
2355 |
-
var is_match = equal(id, opts.id(el));
|
2356 |
-
if (is_match) {
|
2357 |
-
match = el;
|
2358 |
-
}
|
2359 |
-
return is_match;
|
2360 |
-
},
|
2361 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2362 |
-
callback(match);
|
2363 |
-
}
|
2364 |
-
});
|
2365 |
-
};
|
2366 |
-
}
|
2367 |
-
|
2368 |
-
return opts;
|
2369 |
-
},
|
2370 |
-
|
2371 |
-
// single
|
2372 |
-
getPlaceholder: function() {
|
2373 |
-
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2374 |
-
if (this.select) {
|
2375 |
-
if (this.getPlaceholderOption() === undefined) {
|
2376 |
-
return undefined;
|
2377 |
-
}
|
2378 |
-
}
|
2379 |
-
|
2380 |
-
return this.parent.getPlaceholder.apply(this, arguments);
|
2381 |
-
},
|
2382 |
-
|
2383 |
-
// single
|
2384 |
-
setPlaceholder: function () {
|
2385 |
-
var placeholder = this.getPlaceholder();
|
2386 |
-
|
2387 |
-
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2388 |
-
|
2389 |
-
// check for a placeholder option if attached to a select
|
2390 |
-
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2391 |
-
|
2392 |
-
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2393 |
-
|
2394 |
-
this.selection.addClass("select2-default");
|
2395 |
-
|
2396 |
-
this.container.removeClass("select2-allowclear");
|
2397 |
-
}
|
2398 |
-
},
|
2399 |
-
|
2400 |
-
// single
|
2401 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2402 |
-
var selected = 0, self = this, showSearchInput = true;
|
2403 |
-
|
2404 |
-
// find the selected element in the result list
|
2405 |
-
|
2406 |
-
this.findHighlightableChoices().each2(function (i, elm) {
|
2407 |
-
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2408 |
-
selected = i;
|
2409 |
-
return false;
|
2410 |
-
}
|
2411 |
-
});
|
2412 |
-
|
2413 |
-
// and highlight it
|
2414 |
-
if (noHighlightUpdate !== false) {
|
2415 |
-
if (initial === true && selected >= 0) {
|
2416 |
-
this.highlight(selected);
|
2417 |
-
} else {
|
2418 |
-
this.highlight(0);
|
2419 |
-
}
|
2420 |
-
}
|
2421 |
-
|
2422 |
-
// hide the search box if this is the first we got the results and there are enough of them for search
|
2423 |
-
|
2424 |
-
if (initial === true) {
|
2425 |
-
var min = this.opts.minimumResultsForSearch;
|
2426 |
-
if (min >= 0) {
|
2427 |
-
this.showSearch(countResults(data.results) >= min);
|
2428 |
-
}
|
2429 |
-
}
|
2430 |
-
},
|
2431 |
-
|
2432 |
-
// single
|
2433 |
-
showSearch: function(showSearchInput) {
|
2434 |
-
if (this.showSearchInput === showSearchInput) return;
|
2435 |
-
|
2436 |
-
this.showSearchInput = showSearchInput;
|
2437 |
-
|
2438 |
-
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2439 |
-
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2440 |
-
//add "select2-with-searchbox" to the container if search box is shown
|
2441 |
-
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2442 |
-
},
|
2443 |
-
|
2444 |
-
// single
|
2445 |
-
onSelect: function (data, options) {
|
2446 |
-
|
2447 |
-
if (!this.triggerSelect(data)) { return; }
|
2448 |
-
|
2449 |
-
var old = this.opts.element.val(),
|
2450 |
-
oldData = this.data();
|
2451 |
-
|
2452 |
-
this.opts.element.val(this.id(data));
|
2453 |
-
this.updateSelection(data);
|
2454 |
-
|
2455 |
-
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2456 |
-
|
2457 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
2458 |
-
this.close();
|
2459 |
-
|
2460 |
-
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2461 |
-
this.focusser.focus();
|
2462 |
-
}
|
2463 |
-
|
2464 |
-
if (!equal(old, this.id(data))) {
|
2465 |
-
this.triggerChange({ added: data, removed: oldData });
|
2466 |
-
}
|
2467 |
-
},
|
2468 |
-
|
2469 |
-
// single
|
2470 |
-
updateSelection: function (data) {
|
2471 |
-
|
2472 |
-
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2473 |
-
|
2474 |
-
this.selection.data("select2-data", data);
|
2475 |
-
|
2476 |
-
container.empty();
|
2477 |
-
if (data !== null) {
|
2478 |
-
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2479 |
-
}
|
2480 |
-
if (formatted !== undefined) {
|
2481 |
-
container.append(formatted);
|
2482 |
-
}
|
2483 |
-
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2484 |
-
if (cssClass !== undefined) {
|
2485 |
-
container.addClass(cssClass);
|
2486 |
-
}
|
2487 |
-
|
2488 |
-
this.selection.removeClass("select2-default");
|
2489 |
-
|
2490 |
-
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2491 |
-
this.container.addClass("select2-allowclear");
|
2492 |
-
}
|
2493 |
-
},
|
2494 |
-
|
2495 |
-
// single
|
2496 |
-
val: function () {
|
2497 |
-
var val,
|
2498 |
-
triggerChange = false,
|
2499 |
-
data = null,
|
2500 |
-
self = this,
|
2501 |
-
oldData = this.data();
|
2502 |
-
|
2503 |
-
if (arguments.length === 0) {
|
2504 |
-
return this.opts.element.val();
|
2505 |
-
}
|
2506 |
-
|
2507 |
-
val = arguments[0];
|
2508 |
-
|
2509 |
-
if (arguments.length > 1) {
|
2510 |
-
triggerChange = arguments[1];
|
2511 |
-
}
|
2512 |
-
|
2513 |
-
if (this.select) {
|
2514 |
-
this.select
|
2515 |
-
.val(val)
|
2516 |
-
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2517 |
-
data = self.optionToData(elm);
|
2518 |
-
return false;
|
2519 |
-
});
|
2520 |
-
this.updateSelection(data);
|
2521 |
-
this.setPlaceholder();
|
2522 |
-
if (triggerChange) {
|
2523 |
-
this.triggerChange({added: data, removed:oldData});
|
2524 |
-
}
|
2525 |
-
} else {
|
2526 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2527 |
-
if (!val && val !== 0) {
|
2528 |
-
this.clear(triggerChange);
|
2529 |
-
return;
|
2530 |
-
}
|
2531 |
-
if (this.opts.initSelection === undefined) {
|
2532 |
-
throw new Error("cannot call val() if initSelection() is not defined");
|
2533 |
-
}
|
2534 |
-
this.opts.element.val(val);
|
2535 |
-
this.opts.initSelection(this.opts.element, function(data){
|
2536 |
-
self.opts.element.val(!data ? "" : self.id(data));
|
2537 |
-
self.updateSelection(data);
|
2538 |
-
self.setPlaceholder();
|
2539 |
-
if (triggerChange) {
|
2540 |
-
self.triggerChange({added: data, removed:oldData});
|
2541 |
-
}
|
2542 |
-
});
|
2543 |
-
}
|
2544 |
-
},
|
2545 |
-
|
2546 |
-
// single
|
2547 |
-
clearSearch: function () {
|
2548 |
-
this.search.val("");
|
2549 |
-
this.focusser.val("");
|
2550 |
-
},
|
2551 |
-
|
2552 |
-
// single
|
2553 |
-
data: function(value) {
|
2554 |
-
var data,
|
2555 |
-
triggerChange = false;
|
2556 |
-
|
2557 |
-
if (arguments.length === 0) {
|
2558 |
-
data = this.selection.data("select2-data");
|
2559 |
-
if (data == undefined) data = null;
|
2560 |
-
return data;
|
2561 |
-
} else {
|
2562 |
-
if (arguments.length > 1) {
|
2563 |
-
triggerChange = arguments[1];
|
2564 |
-
}
|
2565 |
-
if (!value) {
|
2566 |
-
this.clear(triggerChange);
|
2567 |
-
} else {
|
2568 |
-
data = this.data();
|
2569 |
-
this.opts.element.val(!value ? "" : this.id(value));
|
2570 |
-
this.updateSelection(value);
|
2571 |
-
if (triggerChange) {
|
2572 |
-
this.triggerChange({added: value, removed:data});
|
2573 |
-
}
|
2574 |
-
}
|
2575 |
-
}
|
2576 |
-
}
|
2577 |
-
});
|
2578 |
-
|
2579 |
-
MultiSelect2 = clazz(AbstractSelect2, {
|
2580 |
-
|
2581 |
-
// multi
|
2582 |
-
createContainer: function () {
|
2583 |
-
var container = $(document.createElement("div")).attr({
|
2584 |
-
"class": "select2-container select2-container-multi"
|
2585 |
-
}).html([
|
2586 |
-
"<ul class='select2-choices'>",
|
2587 |
-
" <li class='select2-search-field'>",
|
2588 |
-
" <label for='' class='select2-offscreen'></label>",
|
2589 |
-
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2590 |
-
" </li>",
|
2591 |
-
"</ul>",
|
2592 |
-
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2593 |
-
" <ul class='select2-results'>",
|
2594 |
-
" </ul>",
|
2595 |
-
"</div>"].join(""));
|
2596 |
-
return container;
|
2597 |
-
},
|
2598 |
-
|
2599 |
-
// multi
|
2600 |
-
prepareOpts: function () {
|
2601 |
-
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2602 |
-
self=this;
|
2603 |
-
|
2604 |
-
// TODO validate placeholder is a string if specified
|
2605 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2606 |
-
// install the selection initializer
|
2607 |
-
opts.initSelection = function (element, callback) {
|
2608 |
-
|
2609 |
-
var data = [];
|
2610 |
-
|
2611 |
-
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2612 |
-
data.push(self.optionToData(elm));
|
2613 |
-
});
|
2614 |
-
callback(data);
|
2615 |
-
};
|
2616 |
-
} else if ("data" in opts) {
|
2617 |
-
// install default initSelection when applied to hidden input and data is local
|
2618 |
-
opts.initSelection = opts.initSelection || function (element, callback) {
|
2619 |
-
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2620 |
-
//search in data by array of ids, storing matching items in a list
|
2621 |
-
var matches = [];
|
2622 |
-
opts.query({
|
2623 |
-
matcher: function(term, text, el){
|
2624 |
-
var is_match = $.grep(ids, function(id) {
|
2625 |
-
return equal(id, opts.id(el));
|
2626 |
-
}).length;
|
2627 |
-
if (is_match) {
|
2628 |
-
matches.push(el);
|
2629 |
-
}
|
2630 |
-
return is_match;
|
2631 |
-
},
|
2632 |
-
callback: !$.isFunction(callback) ? $.noop : function() {
|
2633 |
-
// reorder matches based on the order they appear in the ids array because right now
|
2634 |
-
// they are in the order in which they appear in data array
|
2635 |
-
var ordered = [];
|
2636 |
-
for (var i = 0; i < ids.length; i++) {
|
2637 |
-
var id = ids[i];
|
2638 |
-
for (var j = 0; j < matches.length; j++) {
|
2639 |
-
var match = matches[j];
|
2640 |
-
if (equal(id, opts.id(match))) {
|
2641 |
-
ordered.push(match);
|
2642 |
-
matches.splice(j, 1);
|
2643 |
-
break;
|
2644 |
-
}
|
2645 |
-
}
|
2646 |
-
}
|
2647 |
-
callback(ordered);
|
2648 |
-
}
|
2649 |
-
});
|
2650 |
-
};
|
2651 |
-
}
|
2652 |
-
|
2653 |
-
return opts;
|
2654 |
-
},
|
2655 |
-
|
2656 |
-
// multi
|
2657 |
-
selectChoice: function (choice) {
|
2658 |
-
|
2659 |
-
var selected = this.container.find(".select2-search-choice-focus");
|
2660 |
-
if (selected.length && choice && choice[0] == selected[0]) {
|
2661 |
-
|
2662 |
-
} else {
|
2663 |
-
if (selected.length) {
|
2664 |
-
this.opts.element.trigger("choice-deselected", selected);
|
2665 |
-
}
|
2666 |
-
selected.removeClass("select2-search-choice-focus");
|
2667 |
-
if (choice && choice.length) {
|
2668 |
-
this.close();
|
2669 |
-
choice.addClass("select2-search-choice-focus");
|
2670 |
-
this.opts.element.trigger("choice-selected", choice);
|
2671 |
-
}
|
2672 |
-
}
|
2673 |
-
},
|
2674 |
-
|
2675 |
-
// multi
|
2676 |
-
destroy: function() {
|
2677 |
-
$("label[for='" + this.search.attr('id') + "']")
|
2678 |
-
.attr('for', this.opts.element.attr("id"));
|
2679 |
-
this.parent.destroy.apply(this, arguments);
|
2680 |
-
|
2681 |
-
cleanupJQueryElements.call(this,
|
2682 |
-
"searchContainer",
|
2683 |
-
"selection"
|
2684 |
-
);
|
2685 |
-
},
|
2686 |
-
|
2687 |
-
// multi
|
2688 |
-
initContainer: function () {
|
2689 |
-
|
2690 |
-
var selector = ".select2-choices", selection;
|
2691 |
-
|
2692 |
-
this.searchContainer = this.container.find(".select2-search-field");
|
2693 |
-
this.selection = selection = this.container.find(selector);
|
2694 |
-
|
2695 |
-
var _this = this;
|
2696 |
-
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2697 |
-
_this.search[0].focus();
|
2698 |
-
_this.selectChoice($(this));
|
2699 |
-
});
|
2700 |
-
|
2701 |
-
// rewrite labels from original element to focusser
|
2702 |
-
this.search.attr("id", "s2id_autogen"+nextUid());
|
2703 |
-
|
2704 |
-
this.search.prev()
|
2705 |
-
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2706 |
-
.attr('for', this.search.attr('id'));
|
2707 |
-
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2708 |
-
|
2709 |
-
this.search.on("input paste", this.bind(function() {
|
2710 |
-
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2711 |
-
if (!this.isInterfaceEnabled()) return;
|
2712 |
-
if (!this.opened()) {
|
2713 |
-
this.open();
|
2714 |
-
}
|
2715 |
-
}));
|
2716 |
-
|
2717 |
-
this.search.attr("tabindex", this.elementTabIndex);
|
2718 |
-
|
2719 |
-
this.keydowns = 0;
|
2720 |
-
this.search.on("keydown", this.bind(function (e) {
|
2721 |
-
if (!this.isInterfaceEnabled()) return;
|
2722 |
-
|
2723 |
-
++this.keydowns;
|
2724 |
-
var selected = selection.find(".select2-search-choice-focus");
|
2725 |
-
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2726 |
-
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2727 |
-
var pos = getCursorInfo(this.search);
|
2728 |
-
|
2729 |
-
if (selected.length &&
|
2730 |
-
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2731 |
-
var selectedChoice = selected;
|
2732 |
-
if (e.which == KEY.LEFT && prev.length) {
|
2733 |
-
selectedChoice = prev;
|
2734 |
-
}
|
2735 |
-
else if (e.which == KEY.RIGHT) {
|
2736 |
-
selectedChoice = next.length ? next : null;
|
2737 |
-
}
|
2738 |
-
else if (e.which === KEY.BACKSPACE) {
|
2739 |
-
if (this.unselect(selected.first())) {
|
2740 |
-
this.search.width(10);
|
2741 |
-
selectedChoice = prev.length ? prev : next;
|
2742 |
-
}
|
2743 |
-
} else if (e.which == KEY.DELETE) {
|
2744 |
-
if (this.unselect(selected.first())) {
|
2745 |
-
this.search.width(10);
|
2746 |
-
selectedChoice = next.length ? next : null;
|
2747 |
-
}
|
2748 |
-
} else if (e.which == KEY.ENTER) {
|
2749 |
-
selectedChoice = null;
|
2750 |
-
}
|
2751 |
-
|
2752 |
-
this.selectChoice(selectedChoice);
|
2753 |
-
killEvent(e);
|
2754 |
-
if (!selectedChoice || !selectedChoice.length) {
|
2755 |
-
this.open();
|
2756 |
-
}
|
2757 |
-
return;
|
2758 |
-
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2759 |
-
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2760 |
-
|
2761 |
-
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2762 |
-
killEvent(e);
|
2763 |
-
return;
|
2764 |
-
} else {
|
2765 |
-
this.selectChoice(null);
|
2766 |
-
}
|
2767 |
-
|
2768 |
-
if (this.opened()) {
|
2769 |
-
switch (e.which) {
|
2770 |
-
case KEY.UP:
|
2771 |
-
case KEY.DOWN:
|
2772 |
-
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2773 |
-
killEvent(e);
|
2774 |
-
return;
|
2775 |
-
case KEY.ENTER:
|
2776 |
-
this.selectHighlighted();
|
2777 |
-
killEvent(e);
|
2778 |
-
return;
|
2779 |
-
case KEY.TAB:
|
2780 |
-
this.selectHighlighted({noFocus:true});
|
2781 |
-
this.close();
|
2782 |
-
return;
|
2783 |
-
case KEY.ESC:
|
2784 |
-
this.cancel(e);
|
2785 |
-
killEvent(e);
|
2786 |
-
return;
|
2787 |
-
}
|
2788 |
-
}
|
2789 |
-
|
2790 |
-
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2791 |
-
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2792 |
-
return;
|
2793 |
-
}
|
2794 |
-
|
2795 |
-
if (e.which === KEY.ENTER) {
|
2796 |
-
if (this.opts.openOnEnter === false) {
|
2797 |
-
return;
|
2798 |
-
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2799 |
-
return;
|
2800 |
-
}
|
2801 |
-
}
|
2802 |
-
|
2803 |
-
this.open();
|
2804 |
-
|
2805 |
-
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2806 |
-
// prevent the page from scrolling
|
2807 |
-
killEvent(e);
|
2808 |
-
}
|
2809 |
-
|
2810 |
-
if (e.which === KEY.ENTER) {
|
2811 |
-
// prevent form from being submitted
|
2812 |
-
killEvent(e);
|
2813 |
-
}
|
2814 |
-
|
2815 |
-
}));
|
2816 |
-
|
2817 |
-
this.search.on("keyup", this.bind(function (e) {
|
2818 |
-
this.keydowns = 0;
|
2819 |
-
this.resizeSearch();
|
2820 |
-
})
|
2821 |
-
);
|
2822 |
-
|
2823 |
-
this.search.on("blur", this.bind(function(e) {
|
2824 |
-
this.container.removeClass("select2-container-active");
|
2825 |
-
this.search.removeClass("select2-focused");
|
2826 |
-
this.selectChoice(null);
|
2827 |
-
if (!this.opened()) this.clearSearch();
|
2828 |
-
e.stopImmediatePropagation();
|
2829 |
-
this.opts.element.trigger($.Event("select2-blur"));
|
2830 |
-
}));
|
2831 |
-
|
2832 |
-
this.container.on("click", selector, this.bind(function (e) {
|
2833 |
-
if (!this.isInterfaceEnabled()) return;
|
2834 |
-
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
2835 |
-
// clicked inside a select2 search choice, do not open
|
2836 |
-
return;
|
2837 |
-
}
|
2838 |
-
this.selectChoice(null);
|
2839 |
-
this.clearPlaceholder();
|
2840 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2841 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2842 |
-
}
|
2843 |
-
this.open();
|
2844 |
-
this.focusSearch();
|
2845 |
-
e.preventDefault();
|
2846 |
-
}));
|
2847 |
-
|
2848 |
-
this.container.on("focus", selector, this.bind(function () {
|
2849 |
-
if (!this.isInterfaceEnabled()) return;
|
2850 |
-
if (!this.container.hasClass("select2-container-active")) {
|
2851 |
-
this.opts.element.trigger($.Event("select2-focus"));
|
2852 |
-
}
|
2853 |
-
this.container.addClass("select2-container-active");
|
2854 |
-
this.dropdown.addClass("select2-drop-active");
|
2855 |
-
this.clearPlaceholder();
|
2856 |
-
}));
|
2857 |
-
|
2858 |
-
this.initContainerWidth();
|
2859 |
-
this.opts.element.hide();
|
2860 |
-
|
2861 |
-
// set the placeholder if necessary
|
2862 |
-
this.clearSearch();
|
2863 |
-
},
|
2864 |
-
|
2865 |
-
// multi
|
2866 |
-
enableInterface: function() {
|
2867 |
-
if (this.parent.enableInterface.apply(this, arguments)) {
|
2868 |
-
this.search.prop("disabled", !this.isInterfaceEnabled());
|
2869 |
-
}
|
2870 |
-
},
|
2871 |
-
|
2872 |
-
// multi
|
2873 |
-
initSelection: function () {
|
2874 |
-
var data;
|
2875 |
-
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
2876 |
-
this.updateSelection([]);
|
2877 |
-
this.close();
|
2878 |
-
// set the placeholder if necessary
|
2879 |
-
this.clearSearch();
|
2880 |
-
}
|
2881 |
-
if (this.select || this.opts.element.val() !== "") {
|
2882 |
-
var self = this;
|
2883 |
-
this.opts.initSelection.call(null, this.opts.element, function(data){
|
2884 |
-
if (data !== undefined && data !== null) {
|
2885 |
-
self.updateSelection(data);
|
2886 |
-
self.close();
|
2887 |
-
// set the placeholder if necessary
|
2888 |
-
self.clearSearch();
|
2889 |
-
}
|
2890 |
-
});
|
2891 |
-
}
|
2892 |
-
},
|
2893 |
-
|
2894 |
-
// multi
|
2895 |
-
clearSearch: function () {
|
2896 |
-
var placeholder = this.getPlaceholder(),
|
2897 |
-
maxWidth = this.getMaxSearchWidth();
|
2898 |
-
|
2899 |
-
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
2900 |
-
this.search.val(placeholder).addClass("select2-default");
|
2901 |
-
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
2902 |
-
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
2903 |
-
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
2904 |
-
} else {
|
2905 |
-
this.search.val("").width(10);
|
2906 |
-
}
|
2907 |
-
},
|
2908 |
-
|
2909 |
-
// multi
|
2910 |
-
clearPlaceholder: function () {
|
2911 |
-
if (this.search.hasClass("select2-default")) {
|
2912 |
-
this.search.val("").removeClass("select2-default");
|
2913 |
-
}
|
2914 |
-
},
|
2915 |
-
|
2916 |
-
// multi
|
2917 |
-
opening: function () {
|
2918 |
-
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
2919 |
-
this.resizeSearch();
|
2920 |
-
|
2921 |
-
this.parent.opening.apply(this, arguments);
|
2922 |
-
|
2923 |
-
this.focusSearch();
|
2924 |
-
|
2925 |
-
// initializes search's value with nextSearchTerm (if defined by user)
|
2926 |
-
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2927 |
-
if(this.search.val() === "") {
|
2928 |
-
if(this.nextSearchTerm != undefined){
|
2929 |
-
this.search.val(this.nextSearchTerm);
|
2930 |
-
this.search.select();
|
2931 |
-
}
|
2932 |
-
}
|
2933 |
-
|
2934 |
-
this.updateResults(true);
|
2935 |
-
if (this.opts.shouldFocusInput(this)) {
|
2936 |
-
this.search.focus();
|
2937 |
-
}
|
2938 |
-
this.opts.element.trigger($.Event("select2-open"));
|
2939 |
-
},
|
2940 |
-
|
2941 |
-
// multi
|
2942 |
-
close: function () {
|
2943 |
-
if (!this.opened()) return;
|
2944 |
-
this.parent.close.apply(this, arguments);
|
2945 |
-
},
|
2946 |
-
|
2947 |
-
// multi
|
2948 |
-
focus: function () {
|
2949 |
-
this.close();
|
2950 |
-
this.search.focus();
|
2951 |
-
},
|
2952 |
-
|
2953 |
-
// multi
|
2954 |
-
isFocused: function () {
|
2955 |
-
return this.search.hasClass("select2-focused");
|
2956 |
-
},
|
2957 |
-
|
2958 |
-
// multi
|
2959 |
-
updateSelection: function (data) {
|
2960 |
-
var ids = [], filtered = [], self = this;
|
2961 |
-
|
2962 |
-
// filter out duplicates
|
2963 |
-
$(data).each(function () {
|
2964 |
-
if (indexOf(self.id(this), ids) < 0) {
|
2965 |
-
ids.push(self.id(this));
|
2966 |
-
filtered.push(this);
|
2967 |
-
}
|
2968 |
-
});
|
2969 |
-
data = filtered;
|
2970 |
-
|
2971 |
-
this.selection.find(".select2-search-choice").remove();
|
2972 |
-
$(data).each(function () {
|
2973 |
-
self.addSelectedChoice(this);
|
2974 |
-
});
|
2975 |
-
self.postprocessResults();
|
2976 |
-
},
|
2977 |
-
|
2978 |
-
// multi
|
2979 |
-
tokenize: function() {
|
2980 |
-
var input = this.search.val();
|
2981 |
-
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
2982 |
-
if (input != null && input != undefined) {
|
2983 |
-
this.search.val(input);
|
2984 |
-
if (input.length > 0) {
|
2985 |
-
this.open();
|
2986 |
-
}
|
2987 |
-
}
|
2988 |
-
|
2989 |
-
},
|
2990 |
-
|
2991 |
-
// multi
|
2992 |
-
onSelect: function (data, options) {
|
2993 |
-
|
2994 |
-
if (!this.triggerSelect(data) || data.text === "") { return; }
|
2995 |
-
|
2996 |
-
this.addSelectedChoice(data);
|
2997 |
-
|
2998 |
-
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
2999 |
-
|
3000 |
-
// keep track of the search's value before it gets cleared
|
3001 |
-
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
3002 |
-
|
3003 |
-
this.clearSearch();
|
3004 |
-
this.updateResults();
|
3005 |
-
|
3006 |
-
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3007 |
-
|
3008 |
-
if (this.opts.closeOnSelect) {
|
3009 |
-
this.close();
|
3010 |
-
this.search.width(10);
|
3011 |
-
} else {
|
3012 |
-
if (this.countSelectableResults()>0) {
|
3013 |
-
this.search.width(10);
|
3014 |
-
this.resizeSearch();
|
3015 |
-
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3016 |
-
// if we reached max selection size repaint the results so choices
|
3017 |
-
// are replaced with the max selection reached message
|
3018 |
-
this.updateResults(true);
|
3019 |
-
} else {
|
3020 |
-
// initializes search's value with nextSearchTerm and update search result
|
3021 |
-
if(this.nextSearchTerm != undefined){
|
3022 |
-
this.search.val(this.nextSearchTerm);
|
3023 |
-
this.updateResults();
|
3024 |
-
this.search.select();
|
3025 |
-
}
|
3026 |
-
}
|
3027 |
-
this.positionDropdown();
|
3028 |
-
} else {
|
3029 |
-
// if nothing left to select close
|
3030 |
-
this.close();
|
3031 |
-
this.search.width(10);
|
3032 |
-
}
|
3033 |
-
}
|
3034 |
-
|
3035 |
-
// since its not possible to select an element that has already been
|
3036 |
-
// added we do not need to check if this is a new element before firing change
|
3037 |
-
this.triggerChange({ added: data });
|
3038 |
-
|
3039 |
-
if (!options || !options.noFocus)
|
3040 |
-
this.focusSearch();
|
3041 |
-
},
|
3042 |
-
|
3043 |
-
// multi
|
3044 |
-
cancel: function () {
|
3045 |
-
this.close();
|
3046 |
-
this.focusSearch();
|
3047 |
-
},
|
3048 |
-
|
3049 |
-
addSelectedChoice: function (data) {
|
3050 |
-
var enableChoice = !data.locked,
|
3051 |
-
enabledItem = $(
|
3052 |
-
"<li class='select2-search-choice'>" +
|
3053 |
-
" <div></div>" +
|
3054 |
-
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3055 |
-
"</li>"),
|
3056 |
-
disabledItem = $(
|
3057 |
-
"<li class='select2-search-choice select2-locked'>" +
|
3058 |
-
"<div></div>" +
|
3059 |
-
"</li>");
|
3060 |
-
var choice = enableChoice ? enabledItem : disabledItem,
|
3061 |
-
id = this.id(data),
|
3062 |
-
val = this.getVal(),
|
3063 |
-
formatted,
|
3064 |
-
cssClass;
|
3065 |
-
|
3066 |
-
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3067 |
-
if (formatted != undefined) {
|
3068 |
-
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3069 |
-
}
|
3070 |
-
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3071 |
-
if (cssClass != undefined) {
|
3072 |
-
choice.addClass(cssClass);
|
3073 |
-
}
|
3074 |
-
|
3075 |
-
if(enableChoice){
|
3076 |
-
choice.find(".select2-search-choice-close")
|
3077 |
-
.on("mousedown", killEvent)
|
3078 |
-
.on("click dblclick", this.bind(function (e) {
|
3079 |
-
if (!this.isInterfaceEnabled()) return;
|
3080 |
-
|
3081 |
-
this.unselect($(e.target));
|
3082 |
-
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3083 |
-
killEvent(e);
|
3084 |
-
this.close();
|
3085 |
-
this.focusSearch();
|
3086 |
-
})).on("focus", this.bind(function () {
|
3087 |
-
if (!this.isInterfaceEnabled()) return;
|
3088 |
-
this.container.addClass("select2-container-active");
|
3089 |
-
this.dropdown.addClass("select2-drop-active");
|
3090 |
-
}));
|
3091 |
-
}
|
3092 |
-
|
3093 |
-
choice.data("select2-data", data);
|
3094 |
-
choice.insertBefore(this.searchContainer);
|
3095 |
-
|
3096 |
-
val.push(id);
|
3097 |
-
this.setVal(val);
|
3098 |
-
},
|
3099 |
-
|
3100 |
-
// multi
|
3101 |
-
unselect: function (selected) {
|
3102 |
-
var val = this.getVal(),
|
3103 |
-
data,
|
3104 |
-
index;
|
3105 |
-
selected = selected.closest(".select2-search-choice");
|
3106 |
-
|
3107 |
-
if (selected.length === 0) {
|
3108 |
-
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3109 |
-
}
|
3110 |
-
|
3111 |
-
data = selected.data("select2-data");
|
3112 |
-
|
3113 |
-
if (!data) {
|
3114 |
-
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3115 |
-
// and invoked on an element already removed
|
3116 |
-
return;
|
3117 |
-
}
|
3118 |
-
|
3119 |
-
var evt = $.Event("select2-removing");
|
3120 |
-
evt.val = this.id(data);
|
3121 |
-
evt.choice = data;
|
3122 |
-
this.opts.element.trigger(evt);
|
3123 |
-
|
3124 |
-
if (evt.isDefaultPrevented()) {
|
3125 |
-
return false;
|
3126 |
-
}
|
3127 |
-
|
3128 |
-
while((index = indexOf(this.id(data), val)) >= 0) {
|
3129 |
-
val.splice(index, 1);
|
3130 |
-
this.setVal(val);
|
3131 |
-
if (this.select) this.postprocessResults();
|
3132 |
-
}
|
3133 |
-
|
3134 |
-
selected.remove();
|
3135 |
-
|
3136 |
-
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3137 |
-
this.triggerChange({ removed: data });
|
3138 |
-
|
3139 |
-
return true;
|
3140 |
-
},
|
3141 |
-
|
3142 |
-
// multi
|
3143 |
-
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3144 |
-
var val = this.getVal(),
|
3145 |
-
choices = this.results.find(".select2-result"),
|
3146 |
-
compound = this.results.find(".select2-result-with-children"),
|
3147 |
-
self = this;
|
3148 |
-
|
3149 |
-
choices.each2(function (i, choice) {
|
3150 |
-
var id = self.id(choice.data("select2-data"));
|
3151 |
-
if (indexOf(id, val) >= 0) {
|
3152 |
-
choice.addClass("select2-selected");
|
3153 |
-
// mark all children of the selected parent as selected
|
3154 |
-
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3155 |
-
}
|
3156 |
-
});
|
3157 |
-
|
3158 |
-
compound.each2(function(i, choice) {
|
3159 |
-
// hide an optgroup if it doesn't have any selectable children
|
3160 |
-
if (!choice.is('.select2-result-selectable')
|
3161 |
-
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3162 |
-
choice.addClass("select2-selected");
|
3163 |
-
}
|
3164 |
-
});
|
3165 |
-
|
3166 |
-
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3167 |
-
self.highlight(0);
|
3168 |
-
}
|
3169 |
-
|
3170 |
-
//If all results are chosen render formatNoMatches
|
3171 |
-
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3172 |
-
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3173 |
-
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3174 |
-
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3175 |
-
}
|
3176 |
-
}
|
3177 |
-
}
|
3178 |
-
|
3179 |
-
},
|
3180 |
-
|
3181 |
-
// multi
|
3182 |
-
getMaxSearchWidth: function() {
|
3183 |
-
return this.selection.width() - getSideBorderPadding(this.search);
|
3184 |
-
},
|
3185 |
-
|
3186 |
-
// multi
|
3187 |
-
resizeSearch: function () {
|
3188 |
-
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3189 |
-
sideBorderPadding = getSideBorderPadding(this.search);
|
3190 |
-
|
3191 |
-
minimumWidth = measureTextWidth(this.search) + 10;
|
3192 |
-
|
3193 |
-
left = this.search.offset().left;
|
3194 |
-
|
3195 |
-
maxWidth = this.selection.width();
|
3196 |
-
containerLeft = this.selection.offset().left;
|
3197 |
-
|
3198 |
-
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3199 |
-
|
3200 |
-
if (searchWidth < minimumWidth) {
|
3201 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3202 |
-
}
|
3203 |
-
|
3204 |
-
if (searchWidth < 40) {
|
3205 |
-
searchWidth = maxWidth - sideBorderPadding;
|
3206 |
-
}
|
3207 |
-
|
3208 |
-
if (searchWidth <= 0) {
|
3209 |
-
searchWidth = minimumWidth;
|
3210 |
-
}
|
3211 |
-
|
3212 |
-
this.search.width(Math.floor(searchWidth));
|
3213 |
-
},
|
3214 |
-
|
3215 |
-
// multi
|
3216 |
-
getVal: function () {
|
3217 |
-
var val;
|
3218 |
-
if (this.select) {
|
3219 |
-
val = this.select.val();
|
3220 |
-
return val === null ? [] : val;
|
3221 |
-
} else {
|
3222 |
-
val = this.opts.element.val();
|
3223 |
-
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3224 |
-
}
|
3225 |
-
},
|
3226 |
-
|
3227 |
-
// multi
|
3228 |
-
setVal: function (val) {
|
3229 |
-
var unique;
|
3230 |
-
if (this.select) {
|
3231 |
-
this.select.val(val);
|
3232 |
-
} else {
|
3233 |
-
unique = [];
|
3234 |
-
// filter out duplicates
|
3235 |
-
$(val).each(function () {
|
3236 |
-
if (indexOf(this, unique) < 0) unique.push(this);
|
3237 |
-
});
|
3238 |
-
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3239 |
-
}
|
3240 |
-
},
|
3241 |
-
|
3242 |
-
// multi
|
3243 |
-
buildChangeDetails: function (old, current) {
|
3244 |
-
var current = current.slice(0),
|
3245 |
-
old = old.slice(0);
|
3246 |
-
|
3247 |
-
// remove intersection from each array
|
3248 |
-
for (var i = 0; i < current.length; i++) {
|
3249 |
-
for (var j = 0; j < old.length; j++) {
|
3250 |
-
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3251 |
-
current.splice(i, 1);
|
3252 |
-
if(i>0){
|
3253 |
-
i--;
|
3254 |
-
}
|
3255 |
-
old.splice(j, 1);
|
3256 |
-
j--;
|
3257 |
-
}
|
3258 |
-
}
|
3259 |
-
}
|
3260 |
-
|
3261 |
-
return {added: current, removed: old};
|
3262 |
-
},
|
3263 |
-
|
3264 |
-
|
3265 |
-
// multi
|
3266 |
-
val: function (val, triggerChange) {
|
3267 |
-
var oldData, self=this;
|
3268 |
-
|
3269 |
-
if (arguments.length === 0) {
|
3270 |
-
return this.getVal();
|
3271 |
-
}
|
3272 |
-
|
3273 |
-
oldData=this.data();
|
3274 |
-
if (!oldData.length) oldData=[];
|
3275 |
-
|
3276 |
-
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3277 |
-
if (!val && val !== 0) {
|
3278 |
-
this.opts.element.val("");
|
3279 |
-
this.updateSelection([]);
|
3280 |
-
this.clearSearch();
|
3281 |
-
if (triggerChange) {
|
3282 |
-
this.triggerChange({added: this.data(), removed: oldData});
|
3283 |
-
}
|
3284 |
-
return;
|
3285 |
-
}
|
3286 |
-
|
3287 |
-
// val is a list of ids
|
3288 |
-
this.setVal(val);
|
3289 |
-
|
3290 |
-
if (this.select) {
|
3291 |
-
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3292 |
-
if (triggerChange) {
|
3293 |
-
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3294 |
-
}
|
3295 |
-
} else {
|
3296 |
-
if (this.opts.initSelection === undefined) {
|
3297 |
-
throw new Error("val() cannot be called if initSelection() is not defined");
|
3298 |
-
}
|
3299 |
-
|
3300 |
-
this.opts.initSelection(this.opts.element, function(data){
|
3301 |
-
var ids=$.map(data, self.id);
|
3302 |
-
self.setVal(ids);
|
3303 |
-
self.updateSelection(data);
|
3304 |
-
self.clearSearch();
|
3305 |
-
if (triggerChange) {
|
3306 |
-
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3307 |
-
}
|
3308 |
-
});
|
3309 |
-
}
|
3310 |
-
this.clearSearch();
|
3311 |
-
},
|
3312 |
-
|
3313 |
-
// multi
|
3314 |
-
onSortStart: function() {
|
3315 |
-
if (this.select) {
|
3316 |
-
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3317 |
-
}
|
3318 |
-
|
3319 |
-
// collapse search field into 0 width so its container can be collapsed as well
|
3320 |
-
this.search.width(0);
|
3321 |
-
// hide the container
|
3322 |
-
this.searchContainer.hide();
|
3323 |
-
},
|
3324 |
-
|
3325 |
-
// multi
|
3326 |
-
onSortEnd:function() {
|
3327 |
-
|
3328 |
-
var val=[], self=this;
|
3329 |
-
|
3330 |
-
// show search and move it to the end of the list
|
3331 |
-
this.searchContainer.show();
|
3332 |
-
// make sure the search container is the last item in the list
|
3333 |
-
this.searchContainer.appendTo(this.searchContainer.parent());
|
3334 |
-
// since we collapsed the width in dragStarted, we resize it here
|
3335 |
-
this.resizeSearch();
|
3336 |
-
|
3337 |
-
// update selection
|
3338 |
-
this.selection.find(".select2-search-choice").each(function() {
|
3339 |
-
val.push(self.opts.id($(this).data("select2-data")));
|
3340 |
-
});
|
3341 |
-
this.setVal(val);
|
3342 |
-
this.triggerChange();
|
3343 |
-
},
|
3344 |
-
|
3345 |
-
// multi
|
3346 |
-
data: function(values, triggerChange) {
|
3347 |
-
var self=this, ids, old;
|
3348 |
-
if (arguments.length === 0) {
|
3349 |
-
return this.selection
|
3350 |
-
.children(".select2-search-choice")
|
3351 |
-
.map(function() { return $(this).data("select2-data"); })
|
3352 |
-
.get();
|
3353 |
-
} else {
|
3354 |
-
old = this.data();
|
3355 |
-
if (!values) { values = []; }
|
3356 |
-
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3357 |
-
this.setVal(ids);
|
3358 |
-
this.updateSelection(values);
|
3359 |
-
this.clearSearch();
|
3360 |
-
if (triggerChange) {
|
3361 |
-
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3362 |
-
}
|
3363 |
-
}
|
3364 |
-
}
|
3365 |
-
});
|
3366 |
-
|
3367 |
-
$.fn.select2 = function () {
|
3368 |
-
|
3369 |
-
var args = Array.prototype.slice.call(arguments, 0),
|
3370 |
-
opts,
|
3371 |
-
select2,
|
3372 |
-
method, value, multiple,
|
3373 |
-
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3374 |
-
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3375 |
-
propertyMethods = ["val", "data"],
|
3376 |
-
methodsMap = { search: "externalSearch" };
|
3377 |
-
|
3378 |
-
this.each(function () {
|
3379 |
-
if (args.length === 0 || typeof(args[0]) === "object") {
|
3380 |
-
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3381 |
-
opts.element = $(this);
|
3382 |
-
|
3383 |
-
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3384 |
-
multiple = opts.element.prop("multiple");
|
3385 |
-
} else {
|
3386 |
-
multiple = opts.multiple || false;
|
3387 |
-
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3388 |
-
}
|
3389 |
-
|
3390 |
-
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3391 |
-
select2.init(opts);
|
3392 |
-
} else if (typeof(args[0]) === "string") {
|
3393 |
-
|
3394 |
-
if (indexOf(args[0], allowedMethods) < 0) {
|
3395 |
-
throw "Unknown method: " + args[0];
|
3396 |
-
}
|
3397 |
-
|
3398 |
-
value = undefined;
|
3399 |
-
select2 = $(this).data("select2");
|
3400 |
-
if (select2 === undefined) return;
|
3401 |
-
|
3402 |
-
method=args[0];
|
3403 |
-
|
3404 |
-
if (method === "container") {
|
3405 |
-
value = select2.container;
|
3406 |
-
} else if (method === "dropdown") {
|
3407 |
-
value = select2.dropdown;
|
3408 |
-
} else {
|
3409 |
-
if (methodsMap[method]) method = methodsMap[method];
|
3410 |
-
|
3411 |
-
value = select2[method].apply(select2, args.slice(1));
|
3412 |
-
}
|
3413 |
-
if (indexOf(args[0], valueMethods) >= 0
|
3414 |
-
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3415 |
-
return false; // abort the iteration, ready to return first matched value
|
3416 |
-
}
|
3417 |
-
} else {
|
3418 |
-
throw "Invalid arguments to select2 plugin: " + args;
|
3419 |
-
}
|
3420 |
-
});
|
3421 |
-
return (value === undefined) ? this : value;
|
3422 |
-
};
|
3423 |
-
|
3424 |
-
// plugin defaults, accessible to users
|
3425 |
-
$.fn.select2.defaults = {
|
3426 |
-
width: "copy",
|
3427 |
-
loadMorePadding: 0,
|
3428 |
-
closeOnSelect: true,
|
3429 |
-
openOnEnter: true,
|
3430 |
-
containerCss: {},
|
3431 |
-
dropdownCss: {},
|
3432 |
-
containerCssClass: "",
|
3433 |
-
dropdownCssClass: "",
|
3434 |
-
formatResult: function(result, container, query, escapeMarkup) {
|
3435 |
-
var markup=[];
|
3436 |
-
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3437 |
-
return markup.join("");
|
3438 |
-
},
|
3439 |
-
transformVal: function(val) {
|
3440 |
-
return $.trim(val);
|
3441 |
-
},
|
3442 |
-
formatSelection: function (data, container, escapeMarkup) {
|
3443 |
-
return data ? escapeMarkup(this.text(data)) : undefined;
|
3444 |
-
},
|
3445 |
-
sortResults: function (results, container, query) {
|
3446 |
-
return results;
|
3447 |
-
},
|
3448 |
-
formatResultCssClass: function(data) {return data.css;},
|
3449 |
-
formatSelectionCssClass: function(data, container) {return undefined;},
|
3450 |
-
minimumResultsForSearch: 0,
|
3451 |
-
minimumInputLength: 0,
|
3452 |
-
maximumInputLength: null,
|
3453 |
-
maximumSelectionSize: 0,
|
3454 |
-
id: function (e) { return e == undefined ? null : e.id; },
|
3455 |
-
text: function (e) {
|
3456 |
-
if (e && this.data && this.data.text) {
|
3457 |
-
if ($.isFunction(this.data.text)) {
|
3458 |
-
return this.data.text(e);
|
3459 |
-
} else {
|
3460 |
-
return e[this.data.text];
|
3461 |
-
}
|
3462 |
-
} else {
|
3463 |
-
return e.text;
|
3464 |
-
}
|
3465 |
-
},
|
3466 |
-
matcher: function(term, text) {
|
3467 |
-
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3468 |
-
},
|
3469 |
-
separator: ",",
|
3470 |
-
tokenSeparators: [],
|
3471 |
-
tokenizer: defaultTokenizer,
|
3472 |
-
escapeMarkup: defaultEscapeMarkup,
|
3473 |
-
blurOnChange: false,
|
3474 |
-
selectOnBlur: false,
|
3475 |
-
adaptContainerCssClass: function(c) { return c; },
|
3476 |
-
adaptDropdownCssClass: function(c) { return null; },
|
3477 |
-
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3478 |
-
searchInputPlaceholder: '',
|
3479 |
-
createSearchChoicePosition: 'top',
|
3480 |
-
shouldFocusInput: function (instance) {
|
3481 |
-
// Attempt to detect touch devices
|
3482 |
-
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3483 |
-
(navigator.msMaxTouchPoints > 0));
|
3484 |
-
|
3485 |
-
// Only devices which support touch events should be special cased
|
3486 |
-
if (!supportsTouchEvents) {
|
3487 |
-
return true;
|
3488 |
-
}
|
3489 |
-
|
3490 |
-
// Never focus the input if search is disabled
|
3491 |
-
if (instance.opts.minimumResultsForSearch < 0) {
|
3492 |
-
return false;
|
3493 |
-
}
|
3494 |
-
|
3495 |
-
return true;
|
3496 |
-
}
|
3497 |
-
};
|
3498 |
-
|
3499 |
-
$.fn.select2.locales = [];
|
3500 |
-
|
3501 |
-
$.fn.select2.locales['en'] = {
|
3502 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3503 |
-
formatNoMatches: function () { return "No matches found"; },
|
3504 |
-
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3505 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3506 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3507 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3508 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3509 |
-
formatSearching: function () { return "Searching…"; }
|
3510 |
-
};
|
3511 |
-
|
3512 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3513 |
-
|
3514 |
-
$.fn.select2.ajaxDefaults = {
|
3515 |
-
transport: $.ajax,
|
3516 |
-
params: {
|
3517 |
-
type: "GET",
|
3518 |
-
cache: false,
|
3519 |
-
dataType: "json"
|
3520 |
-
}
|
3521 |
-
};
|
3522 |
-
|
3523 |
-
// exports
|
3524 |
-
window.Select2 = {
|
3525 |
-
query: {
|
3526 |
-
ajax: ajax,
|
3527 |
-
local: local,
|
3528 |
-
tags: tags
|
3529 |
-
}, util: {
|
3530 |
-
debounce: debounce,
|
3531 |
-
markMatch: markMatch,
|
3532 |
-
escapeMarkup: defaultEscapeMarkup,
|
3533 |
-
stripDiacritics: stripDiacritics
|
3534 |
-
}, "class": {
|
3535 |
-
"abstract": AbstractSelect2,
|
3536 |
-
"single": SingleSelect2,
|
3537 |
-
"multi": MultiSelect2
|
3538 |
-
}
|
3539 |
-
};
|
3540 |
-
|
3541 |
-
}(jQuery));
|
1 |
+
/*
|
2 |
+
Copyright 2012 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
17 |
+
Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
(function ($) {
|
22 |
+
if(typeof $.fn.each2 == "undefined") {
|
23 |
+
$.extend($.fn, {
|
24 |
+
/*
|
25 |
+
* 4-10 times faster .each replacement
|
26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
27 |
+
*/
|
28 |
+
each2 : function (c) {
|
29 |
+
var j = $([0]), i = -1, l = this.length;
|
30 |
+
while (
|
31 |
+
++i < l
|
32 |
+
&& (j.context = j[0] = this[i])
|
33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
34 |
+
);
|
35 |
+
return this;
|
36 |
+
}
|
37 |
+
});
|
38 |
+
}
|
39 |
+
})(jQuery);
|
40 |
+
|
41 |
+
(function ($, undefined) {
|
42 |
+
"use strict";
|
43 |
+
/*global document, window, jQuery, console */
|
44 |
+
|
45 |
+
if (window.Select2 !== undefined) {
|
46 |
+
return;
|
47 |
+
}
|
48 |
+
|
49 |
+
var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
51 |
+
|
52 |
+
KEY = {
|
53 |
+
TAB: 9,
|
54 |
+
ENTER: 13,
|
55 |
+
ESC: 27,
|
56 |
+
SPACE: 32,
|
57 |
+
LEFT: 37,
|
58 |
+
UP: 38,
|
59 |
+
RIGHT: 39,
|
60 |
+
DOWN: 40,
|
61 |
+
SHIFT: 16,
|
62 |
+
CTRL: 17,
|
63 |
+
ALT: 18,
|
64 |
+
PAGE_UP: 33,
|
65 |
+
PAGE_DOWN: 34,
|
66 |
+
HOME: 36,
|
67 |
+
END: 35,
|
68 |
+
BACKSPACE: 8,
|
69 |
+
DELETE: 46,
|
70 |
+
isArrow: function (k) {
|
71 |
+
k = k.which ? k.which : k;
|
72 |
+
switch (k) {
|
73 |
+
case KEY.LEFT:
|
74 |
+
case KEY.RIGHT:
|
75 |
+
case KEY.UP:
|
76 |
+
case KEY.DOWN:
|
77 |
+
return true;
|
78 |
+
}
|
79 |
+
return false;
|
80 |
+
},
|
81 |
+
isControl: function (e) {
|
82 |
+
var k = e.which;
|
83 |
+
switch (k) {
|
84 |
+
case KEY.SHIFT:
|
85 |
+
case KEY.CTRL:
|
86 |
+
case KEY.ALT:
|
87 |
+
return true;
|
88 |
+
}
|
89 |
+
|
90 |
+
if (e.metaKey) return true;
|
91 |
+
|
92 |
+
return false;
|
93 |
+
},
|
94 |
+
isFunctionKey: function (k) {
|
95 |
+
k = k.which ? k.which : k;
|
96 |
+
return k >= 112 && k <= 123;
|
97 |
+
}
|
98 |
+
},
|
99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
|
100 |
+
|
101 |
+
DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
|
102 |
+
|
103 |
+
$document = $(document);
|
104 |
+
|
105 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
106 |
+
|
107 |
+
|
108 |
+
function reinsertElement(element) {
|
109 |
+
var placeholder = $(document.createTextNode(''));
|
110 |
+
|
111 |
+
element.before(placeholder);
|
112 |
+
placeholder.before(element);
|
113 |
+
placeholder.remove();
|
114 |
+
}
|
115 |
+
|
116 |
+
function stripDiacritics(str) {
|
117 |
+
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
|
118 |
+
function match(a) {
|
119 |
+
return DIACRITICS[a] || a;
|
120 |
+
}
|
121 |
+
|
122 |
+
return str.replace(/[^\u0000-\u007E]/g, match);
|
123 |
+
}
|
124 |
+
|
125 |
+
function indexOf(value, array) {
|
126 |
+
var i = 0, l = array.length;
|
127 |
+
for (; i < l; i = i + 1) {
|
128 |
+
if (equal(value, array[i])) return i;
|
129 |
+
}
|
130 |
+
return -1;
|
131 |
+
}
|
132 |
+
|
133 |
+
function measureScrollbar () {
|
134 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
135 |
+
$template.appendTo(document.body);
|
136 |
+
|
137 |
+
var dim = {
|
138 |
+
width: $template.width() - $template[0].clientWidth,
|
139 |
+
height: $template.height() - $template[0].clientHeight
|
140 |
+
};
|
141 |
+
$template.remove();
|
142 |
+
|
143 |
+
return dim;
|
144 |
+
}
|
145 |
+
|
146 |
+
/**
|
147 |
+
* Compares equality of a and b
|
148 |
+
* @param a
|
149 |
+
* @param b
|
150 |
+
*/
|
151 |
+
function equal(a, b) {
|
152 |
+
if (a === b) return true;
|
153 |
+
if (a === undefined || b === undefined) return false;
|
154 |
+
if (a === null || b === null) return false;
|
155 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
156 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
157 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
158 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
159 |
+
return false;
|
160 |
+
}
|
161 |
+
|
162 |
+
/**
|
163 |
+
* Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
|
164 |
+
* strings
|
165 |
+
* @param string
|
166 |
+
* @param separator
|
167 |
+
*/
|
168 |
+
function splitVal(string, separator, transform) {
|
169 |
+
var val, i, l;
|
170 |
+
if (string === null || string.length < 1) return [];
|
171 |
+
val = string.split(separator);
|
172 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
|
173 |
+
return val;
|
174 |
+
}
|
175 |
+
|
176 |
+
function getSideBorderPadding(element) {
|
177 |
+
return element.outerWidth(false) - element.width();
|
178 |
+
}
|
179 |
+
|
180 |
+
function installKeyUpChangeEvent(element) {
|
181 |
+
var key="keyup-change-value";
|
182 |
+
element.on("keydown", function () {
|
183 |
+
if ($.data(element, key) === undefined) {
|
184 |
+
$.data(element, key, element.val());
|
185 |
+
}
|
186 |
+
});
|
187 |
+
element.on("keyup", function () {
|
188 |
+
var val= $.data(element, key);
|
189 |
+
if (val !== undefined && element.val() !== val) {
|
190 |
+
$.removeData(element, key);
|
191 |
+
element.trigger("keyup-change");
|
192 |
+
}
|
193 |
+
});
|
194 |
+
}
|
195 |
+
|
196 |
+
|
197 |
+
/**
|
198 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
199 |
+
*
|
200 |
+
* filters out mouse events that occur when mouse is stationary but
|
201 |
+
* the elements under the pointer are scrolled.
|
202 |
+
*/
|
203 |
+
function installFilteredMouseMove(element) {
|
204 |
+
element.on("mousemove", function (e) {
|
205 |
+
var lastpos = lastMousePosition;
|
206 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
207 |
+
$(e.target).trigger("mousemove-filtered", e);
|
208 |
+
}
|
209 |
+
});
|
210 |
+
}
|
211 |
+
|
212 |
+
/**
|
213 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
214 |
+
* within the last quietMillis milliseconds.
|
215 |
+
*
|
216 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
217 |
+
* @param fn function to be debounced
|
218 |
+
* @param ctx object to be used as this reference within fn
|
219 |
+
* @return debounced version of fn
|
220 |
+
*/
|
221 |
+
function debounce(quietMillis, fn, ctx) {
|
222 |
+
ctx = ctx || undefined;
|
223 |
+
var timeout;
|
224 |
+
return function () {
|
225 |
+
var args = arguments;
|
226 |
+
window.clearTimeout(timeout);
|
227 |
+
timeout = window.setTimeout(function() {
|
228 |
+
fn.apply(ctx, args);
|
229 |
+
}, quietMillis);
|
230 |
+
};
|
231 |
+
}
|
232 |
+
|
233 |
+
function installDebouncedScroll(threshold, element) {
|
234 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
235 |
+
element.on("scroll", function (e) {
|
236 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
237 |
+
});
|
238 |
+
}
|
239 |
+
|
240 |
+
function focus($el) {
|
241 |
+
if ($el[0] === document.activeElement) return;
|
242 |
+
|
243 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
244 |
+
of the current event has finished - which seems like the only reliable way
|
245 |
+
to set focus */
|
246 |
+
window.setTimeout(function() {
|
247 |
+
var el=$el[0], pos=$el.val().length, range;
|
248 |
+
|
249 |
+
$el.focus();
|
250 |
+
|
251 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
252 |
+
sometimes modals or others listeners may steal it after its set */
|
253 |
+
var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
|
254 |
+
if (isVisible && el === document.activeElement) {
|
255 |
+
|
256 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
257 |
+
just before setting focus */
|
258 |
+
if(el.setSelectionRange)
|
259 |
+
{
|
260 |
+
el.setSelectionRange(pos, pos);
|
261 |
+
}
|
262 |
+
else if (el.createTextRange) {
|
263 |
+
range = el.createTextRange();
|
264 |
+
range.collapse(false);
|
265 |
+
range.select();
|
266 |
+
}
|
267 |
+
}
|
268 |
+
}, 0);
|
269 |
+
}
|
270 |
+
|
271 |
+
function getCursorInfo(el) {
|
272 |
+
el = $(el)[0];
|
273 |
+
var offset = 0;
|
274 |
+
var length = 0;
|
275 |
+
if ('selectionStart' in el) {
|
276 |
+
offset = el.selectionStart;
|
277 |
+
length = el.selectionEnd - offset;
|
278 |
+
} else if ('selection' in document) {
|
279 |
+
el.focus();
|
280 |
+
var sel = document.selection.createRange();
|
281 |
+
length = document.selection.createRange().text.length;
|
282 |
+
sel.moveStart('character', -el.value.length);
|
283 |
+
offset = sel.text.length - length;
|
284 |
+
}
|
285 |
+
return { offset: offset, length: length };
|
286 |
+
}
|
287 |
+
|
288 |
+
function killEvent(event) {
|
289 |
+
event.preventDefault();
|
290 |
+
event.stopPropagation();
|
291 |
+
}
|
292 |
+
function killEventImmediately(event) {
|
293 |
+
event.preventDefault();
|
294 |
+
event.stopImmediatePropagation();
|
295 |
+
}
|
296 |
+
|
297 |
+
function measureTextWidth(e) {
|
298 |
+
if (!sizer){
|
299 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
300 |
+
sizer = $(document.createElement("div")).css({
|
301 |
+
position: "absolute",
|
302 |
+
left: "-10000px",
|
303 |
+
top: "-10000px",
|
304 |
+
display: "none",
|
305 |
+
fontSize: style.fontSize,
|
306 |
+
fontFamily: style.fontFamily,
|
307 |
+
fontStyle: style.fontStyle,
|
308 |
+
fontWeight: style.fontWeight,
|
309 |
+
letterSpacing: style.letterSpacing,
|
310 |
+
textTransform: style.textTransform,
|
311 |
+
whiteSpace: "nowrap"
|
312 |
+
});
|
313 |
+
sizer.attr("class","select2-sizer");
|
314 |
+
$(document.body).append(sizer);
|
315 |
+
}
|
316 |
+
sizer.text(e.val());
|
317 |
+
return sizer.width();
|
318 |
+
}
|
319 |
+
|
320 |
+
function syncCssClasses(dest, src, adapter) {
|
321 |
+
var classes, replacements = [], adapted;
|
322 |
+
|
323 |
+
classes = $.trim(dest.attr("class"));
|
324 |
+
|
325 |
+
if (classes) {
|
326 |
+
classes = '' + classes; // for IE which returns object
|
327 |
+
|
328 |
+
$(classes.split(/\s+/)).each2(function() {
|
329 |
+
if (this.indexOf("select2-") === 0) {
|
330 |
+
replacements.push(this);
|
331 |
+
}
|
332 |
+
});
|
333 |
+
}
|
334 |
+
|
335 |
+
classes = $.trim(src.attr("class"));
|
336 |
+
|
337 |
+
if (classes) {
|
338 |
+
classes = '' + classes; // for IE which returns object
|
339 |
+
|
340 |
+
$(classes.split(/\s+/)).each2(function() {
|
341 |
+
if (this.indexOf("select2-") !== 0) {
|
342 |
+
adapted = adapter(this);
|
343 |
+
|
344 |
+
if (adapted) {
|
345 |
+
replacements.push(adapted);
|
346 |
+
}
|
347 |
+
}
|
348 |
+
});
|
349 |
+
}
|
350 |
+
|
351 |
+
dest.attr("class", replacements.join(" "));
|
352 |
+
}
|
353 |
+
|
354 |
+
|
355 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
356 |
+
var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
|
357 |
+
tl=term.length;
|
358 |
+
|
359 |
+
if (match<0) {
|
360 |
+
markup.push(escapeMarkup(text));
|
361 |
+
return;
|
362 |
+
}
|
363 |
+
|
364 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
365 |
+
markup.push("<span class='select2-match'>");
|
366 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
367 |
+
markup.push("</span>");
|
368 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
369 |
+
}
|
370 |
+
|
371 |
+
function defaultEscapeMarkup(markup) {
|
372 |
+
var replace_map = {
|
373 |
+
'\\': '\',
|
374 |
+
'&': '&',
|
375 |
+
'<': '<',
|
376 |
+
'>': '>',
|
377 |
+
'"': '"',
|
378 |
+
"'": ''',
|
379 |
+
"/": '/'
|
380 |
+
};
|
381 |
+
|
382 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
383 |
+
return replace_map[match];
|
384 |
+
});
|
385 |
+
}
|
386 |
+
|
387 |
+
/**
|
388 |
+
* Produces an ajax-based query function
|
389 |
+
*
|
390 |
+
* @param options object containing configuration parameters
|
391 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
392 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
393 |
+
* @param options.url url for the data
|
394 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
395 |
+
* @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
|
396 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
397 |
+
* @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
|
398 |
+
* The expected format is an object containing the following keys:
|
399 |
+
* results array of objects that will be used as choices
|
400 |
+
* more (optional) boolean indicating whether there are more results available
|
401 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
402 |
+
*/
|
403 |
+
function ajax(options) {
|
404 |
+
var timeout, // current scheduled but not yet executed request
|
405 |
+
handler = null,
|
406 |
+
quietMillis = options.quietMillis || 100,
|
407 |
+
ajaxUrl = options.url,
|
408 |
+
self = this;
|
409 |
+
|
410 |
+
return function (query) {
|
411 |
+
window.clearTimeout(timeout);
|
412 |
+
timeout = window.setTimeout(function () {
|
413 |
+
var data = options.data, // ajax data function
|
414 |
+
url = ajaxUrl, // ajax url string or function
|
415 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
416 |
+
// deprecated - to be removed in 4.0 - use params instead
|
417 |
+
deprecated = {
|
418 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
419 |
+
cache: options.cache || false,
|
420 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
421 |
+
dataType: options.dataType||"json"
|
422 |
+
},
|
423 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
424 |
+
|
425 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
426 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
427 |
+
|
428 |
+
if (handler && typeof handler.abort === "function") { handler.abort(); }
|
429 |
+
|
430 |
+
if (options.params) {
|
431 |
+
if ($.isFunction(options.params)) {
|
432 |
+
$.extend(params, options.params.call(self));
|
433 |
+
} else {
|
434 |
+
$.extend(params, options.params);
|
435 |
+
}
|
436 |
+
}
|
437 |
+
|
438 |
+
$.extend(params, {
|
439 |
+
url: url,
|
440 |
+
dataType: options.dataType,
|
441 |
+
data: data,
|
442 |
+
success: function (data) {
|
443 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
444 |
+
// added query as third paramter to keep backwards compatibility
|
445 |
+
var results = options.results(data, query.page, query);
|
446 |
+
query.callback(results);
|
447 |
+
},
|
448 |
+
error: function(jqXHR, textStatus, errorThrown){
|
449 |
+
var results = {
|
450 |
+
hasError: true,
|
451 |
+
jqXHR: jqXHR,
|
452 |
+
textStatus: textStatus,
|
453 |
+
errorThrown: errorThrown
|
454 |
+
};
|
455 |
+
|
456 |
+
query.callback(results);
|
457 |
+
}
|
458 |
+
});
|
459 |
+
handler = transport.call(self, params);
|
460 |
+
}, quietMillis);
|
461 |
+
};
|
462 |
+
}
|
463 |
+
|
464 |
+
/**
|
465 |
+
* Produces a query function that works with a local array
|
466 |
+
*
|
467 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
468 |
+
* object.
|
469 |
+
*
|
470 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
471 |
+
*
|
472 |
+
* If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
473 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
474 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
475 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
476 |
+
* the text.
|
477 |
+
*/
|
478 |
+
function local(options) {
|
479 |
+
var data = options, // data elements
|
480 |
+
dataText,
|
481 |
+
tmp,
|
482 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
483 |
+
|
484 |
+
if ($.isArray(data)) {
|
485 |
+
tmp = data;
|
486 |
+
data = { results: tmp };
|
487 |
+
}
|
488 |
+
|
489 |
+
if ($.isFunction(data) === false) {
|
490 |
+
tmp = data;
|
491 |
+
data = function() { return tmp; };
|
492 |
+
}
|
493 |
+
|
494 |
+
var dataItem = data();
|
495 |
+
if (dataItem.text) {
|
496 |
+
text = dataItem.text;
|
497 |
+
// if text is not a function we assume it to be a key name
|
498 |
+
if (!$.isFunction(text)) {
|
499 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
500 |
+
text = function (item) { return item[dataText]; };
|
501 |
+
}
|
502 |
+
}
|
503 |
+
|
504 |
+
return function (query) {
|
505 |
+
var t = query.term, filtered = { results: [] }, process;
|
506 |
+
if (t === "") {
|
507 |
+
query.callback(data());
|
508 |
+
return;
|
509 |
+
}
|
510 |
+
|
511 |
+
process = function(datum, collection) {
|
512 |
+
var group, attr;
|
513 |
+
datum = datum[0];
|
514 |
+
if (datum.children) {
|
515 |
+
group = {};
|
516 |
+
for (attr in datum) {
|
517 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
518 |
+
}
|
519 |
+
group.children=[];
|
520 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
521 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
522 |
+
collection.push(group);
|
523 |
+
}
|
524 |
+
} else {
|
525 |
+
if (query.matcher(t, text(datum), datum)) {
|
526 |
+
collection.push(datum);
|
527 |
+
}
|
528 |
+
}
|
529 |
+
};
|
530 |
+
|
531 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
532 |
+
query.callback(filtered);
|
533 |
+
};
|
534 |
+
}
|
535 |
+
|
536 |
+
// TODO javadoc
|
537 |
+
function tags(data) {
|
538 |
+
var isFunc = $.isFunction(data);
|
539 |
+
return function (query) {
|
540 |
+
var t = query.term, filtered = {results: []};
|
541 |
+
var result = isFunc ? data(query) : data;
|
542 |
+
if ($.isArray(result)) {
|
543 |
+
$(result).each(function () {
|
544 |
+
var isObject = this.text !== undefined,
|
545 |
+
text = isObject ? this.text : this;
|
546 |
+
if (t === "" || query.matcher(t, text)) {
|
547 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
548 |
+
}
|
549 |
+
});
|
550 |
+
query.callback(filtered);
|
551 |
+
}
|
552 |
+
};
|
553 |
+
}
|
554 |
+
|
555 |
+
/**
|
556 |
+
* Checks if the formatter function should be used.
|
557 |
+
*
|
558 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
559 |
+
* false if no formatting should be performed.
|
560 |
+
*
|
561 |
+
* @param formatter
|
562 |
+
*/
|
563 |
+
function checkFormatter(formatter, formatterName) {
|
564 |
+
if ($.isFunction(formatter)) return true;
|
565 |
+
if (!formatter) return false;
|
566 |
+
if (typeof(formatter) === 'string') return true;
|
567 |
+
throw new Error(formatterName +" must be a string, function, or falsy value");
|
568 |
+
}
|
569 |
+
|
570 |
+
/**
|
571 |
+
* Returns a given value
|
572 |
+
* If given a function, returns its output
|
573 |
+
*
|
574 |
+
* @param val string|function
|
575 |
+
* @param context value of "this" to be passed to function
|
576 |
+
* @returns {*}
|
577 |
+
*/
|
578 |
+
function evaluate(val, context) {
|
579 |
+
if ($.isFunction(val)) {
|
580 |
+
var args = Array.prototype.slice.call(arguments, 2);
|
581 |
+
return val.apply(context, args);
|
582 |
+
}
|
583 |
+
return val;
|
584 |
+
}
|
585 |
+
|
586 |
+
function countResults(results) {
|
587 |
+
var count = 0;
|
588 |
+
$.each(results, function(i, item) {
|
589 |
+
if (item.children) {
|
590 |
+
count += countResults(item.children);
|
591 |
+
} else {
|
592 |
+
count++;
|
593 |
+
}
|
594 |
+
});
|
595 |
+
return count;
|
596 |
+
}
|
597 |
+
|
598 |
+
/**
|
599 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
600 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
601 |
+
* two options have to be defined in order for the tokenizer to work.
|
602 |
+
*
|
603 |
+
* @param input text user has typed so far or pasted into the search field
|
604 |
+
* @param selection currently selected choices
|
605 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
606 |
+
* @param opts select2's opts
|
607 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
608 |
+
*/
|
609 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
610 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
611 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
612 |
+
token, // token
|
613 |
+
index, // position at which the separator was found
|
614 |
+
i, l, // looping variables
|
615 |
+
separator; // the matched separator
|
616 |
+
|
617 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
618 |
+
|
619 |
+
while (true) {
|
620 |
+
index = -1;
|
621 |
+
|
622 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
623 |
+
separator = opts.tokenSeparators[i];
|
624 |
+
index = input.indexOf(separator);
|
625 |
+
if (index >= 0) break;
|
626 |
+
}
|
627 |
+
|
628 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
629 |
+
|
630 |
+
token = input.substring(0, index);
|
631 |
+
input = input.substring(index + separator.length);
|
632 |
+
|
633 |
+
if (token.length > 0) {
|
634 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
635 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
636 |
+
dupe = false;
|
637 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
638 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
639 |
+
dupe = true; break;
|
640 |
+
}
|
641 |
+
}
|
642 |
+
|
643 |
+
if (!dupe) selectCallback(token);
|
644 |
+
}
|
645 |
+
}
|
646 |
+
}
|
647 |
+
|
648 |
+
if (original!==input) return input;
|
649 |
+
}
|
650 |
+
|
651 |
+
function cleanupJQueryElements() {
|
652 |
+
var self = this;
|
653 |
+
|
654 |
+
$.each(arguments, function (i, element) {
|
655 |
+
self[element].remove();
|
656 |
+
self[element] = null;
|
657 |
+
});
|
658 |
+
}
|
659 |
+
|
660 |
+
/**
|
661 |
+
* Creates a new class
|
662 |
+
*
|
663 |
+
* @param superClass
|
664 |
+
* @param methods
|
665 |
+
*/
|
666 |
+
function clazz(SuperClass, methods) {
|
667 |
+
var constructor = function () {};
|
668 |
+
constructor.prototype = new SuperClass;
|
669 |
+
constructor.prototype.constructor = constructor;
|
670 |
+
constructor.prototype.parent = SuperClass.prototype;
|
671 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
672 |
+
return constructor;
|
673 |
+
}
|
674 |
+
|
675 |
+
AbstractSelect2 = clazz(Object, {
|
676 |
+
|
677 |
+
// abstract
|
678 |
+
bind: function (func) {
|
679 |
+
var self = this;
|
680 |
+
return function () {
|
681 |
+
func.apply(self, arguments);
|
682 |
+
};
|
683 |
+
},
|
684 |
+
|
685 |
+
// abstract
|
686 |
+
init: function (opts) {
|
687 |
+
var results, search, resultsSelector = ".select2-results";
|
688 |
+
|
689 |
+
// prepare options
|
690 |
+
this.opts = opts = this.prepareOpts(opts);
|
691 |
+
|
692 |
+
this.id=opts.id;
|
693 |
+
|
694 |
+
// destroy if called on an existing component
|
695 |
+
if (opts.element.data("select2") !== undefined &&
|
696 |
+
opts.element.data("select2") !== null) {
|
697 |
+
opts.element.data("select2").destroy();
|
698 |
+
}
|
699 |
+
|
700 |
+
this.container = this.createContainer();
|
701 |
+
|
702 |
+
this.liveRegion = $('.select2-hidden-accessible');
|
703 |
+
if (this.liveRegion.length == 0) {
|
704 |
+
this.liveRegion = $("<span>", {
|
705 |
+
role: "status",
|
706 |
+
"aria-live": "polite"
|
707 |
+
})
|
708 |
+
.addClass("select2-hidden-accessible")
|
709 |
+
.appendTo(document.body);
|
710 |
+
}
|
711 |
+
|
712 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
713 |
+
this.containerEventName= this.containerId
|
714 |
+
.replace(/([.])/g, '_')
|
715 |
+
.replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
716 |
+
this.container.attr("id", this.containerId);
|
717 |
+
|
718 |
+
this.container.attr("title", opts.element.attr("title"));
|
719 |
+
|
720 |
+
this.body = $(document.body);
|
721 |
+
|
722 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
723 |
+
|
724 |
+
this.container.attr("style", opts.element.attr("style"));
|
725 |
+
this.container.css(evaluate(opts.containerCss, this.opts.element));
|
726 |
+
this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
|
727 |
+
|
728 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
729 |
+
|
730 |
+
// swap container for the element
|
731 |
+
this.opts.element
|
732 |
+
.data("select2", this)
|
733 |
+
.attr("tabindex", "-1")
|
734 |
+
.before(this.container)
|
735 |
+
.on("click.select2", killEvent); // do not leak click events
|
736 |
+
|
737 |
+
this.container.data("select2", this);
|
738 |
+
|
739 |
+
this.dropdown = this.container.find(".select2-drop");
|
740 |
+
|
741 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
742 |
+
|
743 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
|
744 |
+
this.dropdown.data("select2", this);
|
745 |
+
this.dropdown.on("click", killEvent);
|
746 |
+
|
747 |
+
this.results = results = this.container.find(resultsSelector);
|
748 |
+
this.search = search = this.container.find("input.select2-input");
|
749 |
+
|
750 |
+
this.queryCount = 0;
|
751 |
+
this.resultsPage = 0;
|
752 |
+
this.context = null;
|
753 |
+
|
754 |
+
// initialize the container
|
755 |
+
this.initContainer();
|
756 |
+
|
757 |
+
this.container.on("click", killEvent);
|
758 |
+
|
759 |
+
installFilteredMouseMove(this.results);
|
760 |
+
|
761 |
+
this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
|
762 |
+
this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
|
763 |
+
this._touchEvent = true;
|
764 |
+
this.highlightUnderEvent(event);
|
765 |
+
}));
|
766 |
+
this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
|
767 |
+
this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
|
768 |
+
|
769 |
+
// Waiting for a click event on touch devices to select option and hide dropdown
|
770 |
+
// otherwise click will be triggered on an underlying element
|
771 |
+
this.dropdown.on('click', this.bind(function (event) {
|
772 |
+
if (this._touchEvent) {
|
773 |
+
this._touchEvent = false;
|
774 |
+
this.selectHighlighted();
|
775 |
+
}
|
776 |
+
}));
|
777 |
+
|
778 |
+
installDebouncedScroll(80, this.results);
|
779 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
780 |
+
|
781 |
+
// do not propagate change event from the search field out of the component
|
782 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
783 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
784 |
+
|
785 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
786 |
+
if ($.fn.mousewheel) {
|
787 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
788 |
+
var top = results.scrollTop();
|
789 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
790 |
+
results.scrollTop(0);
|
791 |
+
killEvent(e);
|
792 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
793 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
794 |
+
killEvent(e);
|
795 |
+
}
|
796 |
+
});
|
797 |
+
}
|
798 |
+
|
799 |
+
installKeyUpChangeEvent(search);
|
800 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
801 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
802 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
803 |
+
|
804 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
805 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
806 |
+
this.highlightUnderEvent(e);
|
807 |
+
this.selectHighlighted(e);
|
808 |
+
}
|
809 |
+
}));
|
810 |
+
|
811 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
812 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
813 |
+
// dom it will trigger the popup close, which is not what we want
|
814 |
+
// focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
|
815 |
+
this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
|
816 |
+
|
817 |
+
this.nextSearchTerm = undefined;
|
818 |
+
|
819 |
+
if ($.isFunction(this.opts.initSelection)) {
|
820 |
+
// initialize selection based on the current value of the source element
|
821 |
+
this.initSelection();
|
822 |
+
|
823 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
824 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
825 |
+
this.monitorSource();
|
826 |
+
}
|
827 |
+
|
828 |
+
if (opts.maximumInputLength !== null) {
|
829 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
830 |
+
}
|
831 |
+
|
832 |
+
var disabled = opts.element.prop("disabled");
|
833 |
+
if (disabled === undefined) disabled = false;
|
834 |
+
this.enable(!disabled);
|
835 |
+
|
836 |
+
var readonly = opts.element.prop("readonly");
|
837 |
+
if (readonly === undefined) readonly = false;
|
838 |
+
this.readonly(readonly);
|
839 |
+
|
840 |
+
// Calculate size of scrollbar
|
841 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
842 |
+
|
843 |
+
this.autofocus = opts.element.prop("autofocus");
|
844 |
+
opts.element.prop("autofocus", false);
|
845 |
+
if (this.autofocus) this.focus();
|
846 |
+
|
847 |
+
this.search.attr("placeholder", opts.searchInputPlaceholder);
|
848 |
+
},
|
849 |
+
|
850 |
+
// abstract
|
851 |
+
destroy: function () {
|
852 |
+
var element=this.opts.element, select2 = element.data("select2"), self = this;
|
853 |
+
|
854 |
+
this.close();
|
855 |
+
|
856 |
+
if (element.length && element[0].detachEvent && self._sync) {
|
857 |
+
element.each(function () {
|
858 |
+
if (self._sync) {
|
859 |
+
this.detachEvent("onpropertychange", self._sync);
|
860 |
+
}
|
861 |
+
});
|
862 |
+
}
|
863 |
+
if (this.propertyObserver) {
|
864 |
+
this.propertyObserver.disconnect();
|
865 |
+
this.propertyObserver = null;
|
866 |
+
}
|
867 |
+
this._sync = null;
|
868 |
+
|
869 |
+
if (select2 !== undefined) {
|
870 |
+
select2.container.remove();
|
871 |
+
select2.liveRegion.remove();
|
872 |
+
select2.dropdown.remove();
|
873 |
+
element
|
874 |
+
.show()
|
875 |
+
.removeData("select2")
|
876 |
+
.off(".select2")
|
877 |
+
.prop("autofocus", this.autofocus || false);
|
878 |
+
if (this.elementTabIndex) {
|
879 |
+
element.attr({tabindex: this.elementTabIndex});
|
880 |
+
} else {
|
881 |
+
element.removeAttr("tabindex");
|
882 |
+
}
|
883 |
+
element.show();
|
884 |
+
}
|
885 |
+
|
886 |
+
cleanupJQueryElements.call(this,
|
887 |
+
"container",
|
888 |
+
"liveRegion",
|
889 |
+
"dropdown",
|
890 |
+
"results",
|
891 |
+
"search"
|
892 |
+
);
|
893 |
+
},
|
894 |
+
|
895 |
+
// abstract
|
896 |
+
optionToData: function(element) {
|
897 |
+
if (element.is("option")) {
|
898 |
+
return {
|
899 |
+
id:element.prop("value"),
|
900 |
+
text:element.text(),
|
901 |
+
element: element.get(),
|
902 |
+
css: element.attr("class"),
|
903 |
+
disabled: element.prop("disabled"),
|
904 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
905 |
+
};
|
906 |
+
} else if (element.is("optgroup")) {
|
907 |
+
return {
|
908 |
+
text:element.attr("label"),
|
909 |
+
children:[],
|
910 |
+
element: element.get(),
|
911 |
+
css: element.attr("class")
|
912 |
+
};
|
913 |
+
}
|
914 |
+
},
|
915 |
+
|
916 |
+
// abstract
|
917 |
+
prepareOpts: function (opts) {
|
918 |
+
var element, select, idKey, ajaxUrl, self = this;
|
919 |
+
|
920 |
+
element = opts.element;
|
921 |
+
|
922 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
923 |
+
this.select = select = opts.element;
|
924 |
+
}
|
925 |
+
|
926 |
+
if (select) {
|
927 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
928 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
929 |
+
if (this in opts) {
|
930 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
931 |
+
}
|
932 |
+
});
|
933 |
+
}
|
934 |
+
|
935 |
+
opts = $.extend({}, {
|
936 |
+
populateResults: function(container, results, query) {
|
937 |
+
var populate, id=this.opts.id, liveRegion=this.liveRegion;
|
938 |
+
|
939 |
+
populate=function(results, container, depth) {
|
940 |
+
|
941 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
942 |
+
|
943 |
+
results = opts.sortResults(results, container, query);
|
944 |
+
|
945 |
+
// collect the created nodes for bulk append
|
946 |
+
var nodes = [];
|
947 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
948 |
+
|
949 |
+
result=results[i];
|
950 |
+
|
951 |
+
disabled = (result.disabled === true);
|
952 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
953 |
+
|
954 |
+
compound=result.children && result.children.length > 0;
|
955 |
+
|
956 |
+
node=$("<li></li>");
|
957 |
+
node.addClass("select2-results-dept-"+depth);
|
958 |
+
node.addClass("select2-result");
|
959 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
960 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
961 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
962 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
963 |
+
node.attr("role", "presentation");
|
964 |
+
|
965 |
+
label=$(document.createElement("div"));
|
966 |
+
label.addClass("select2-result-label");
|
967 |
+
label.attr("id", "select2-result-label-" + nextUid());
|
968 |
+
label.attr("role", "option");
|
969 |
+
|
970 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
971 |
+
if (formatted!==undefined) {
|
972 |
+
label.html(formatted);
|
973 |
+
node.append(label);
|
974 |
+
}
|
975 |
+
|
976 |
+
|
977 |
+
if (compound) {
|
978 |
+
|
979 |
+
innerContainer=$("<ul></ul>");
|
980 |
+
innerContainer.addClass("select2-result-sub");
|
981 |
+
populate(result.children, innerContainer, depth+1);
|
982 |
+
node.append(innerContainer);
|
983 |
+
}
|
984 |
+
|
985 |
+
node.data("select2-data", result);
|
986 |
+
nodes.push(node[0]);
|
987 |
+
}
|
988 |
+
|
989 |
+
// bulk append the created nodes
|
990 |
+
container.append(nodes);
|
991 |
+
liveRegion.text(opts.formatMatches(results.length));
|
992 |
+
};
|
993 |
+
|
994 |
+
populate(results, container, 0);
|
995 |
+
}
|
996 |
+
}, $.fn.select2.defaults, opts);
|
997 |
+
|
998 |
+
if (typeof(opts.id) !== "function") {
|
999 |
+
idKey = opts.id;
|
1000 |
+
opts.id = function (e) { return e[idKey]; };
|
1001 |
+
}
|
1002 |
+
|
1003 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
1004 |
+
if ("tags" in opts) {
|
1005 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
1006 |
+
}
|
1007 |
+
opts.tags=opts.element.data("select2Tags");
|
1008 |
+
}
|
1009 |
+
|
1010 |
+
if (select) {
|
1011 |
+
opts.query = this.bind(function (query) {
|
1012 |
+
var data = { results: [], more: false },
|
1013 |
+
term = query.term,
|
1014 |
+
children, placeholderOption, process;
|
1015 |
+
|
1016 |
+
process=function(element, collection) {
|
1017 |
+
var group;
|
1018 |
+
if (element.is("option")) {
|
1019 |
+
if (query.matcher(term, element.text(), element)) {
|
1020 |
+
collection.push(self.optionToData(element));
|
1021 |
+
}
|
1022 |
+
} else if (element.is("optgroup")) {
|
1023 |
+
group=self.optionToData(element);
|
1024 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
1025 |
+
if (group.children.length>0) {
|
1026 |
+
collection.push(group);
|
1027 |
+
}
|
1028 |
+
}
|
1029 |
+
};
|
1030 |
+
|
1031 |
+
children=element.children();
|
1032 |
+
|
1033 |
+
// ignore the placeholder option if there is one
|
1034 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
1035 |
+
placeholderOption = this.getPlaceholderOption();
|
1036 |
+
if (placeholderOption) {
|
1037 |
+
children=children.not(placeholderOption);
|
1038 |
+
}
|
1039 |
+
}
|
1040 |
+
|
1041 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
1042 |
+
|
1043 |
+
query.callback(data);
|
1044 |
+
});
|
1045 |
+
// this is needed because inside val() we construct choices from options and their id is hardcoded
|
1046 |
+
opts.id=function(e) { return e.id; };
|
1047 |
+
} else {
|
1048 |
+
if (!("query" in opts)) {
|
1049 |
+
|
1050 |
+
if ("ajax" in opts) {
|
1051 |
+
ajaxUrl = opts.element.data("ajax-url");
|
1052 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
1053 |
+
opts.ajax.url = ajaxUrl;
|
1054 |
+
}
|
1055 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
1056 |
+
} else if ("data" in opts) {
|
1057 |
+
opts.query = local(opts.data);
|
1058 |
+
} else if ("tags" in opts) {
|
1059 |
+
opts.query = tags(opts.tags);
|
1060 |
+
if (opts.createSearchChoice === undefined) {
|
1061 |
+
opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
|
1062 |
+
}
|
1063 |
+
if (opts.initSelection === undefined) {
|
1064 |
+
opts.initSelection = function (element, callback) {
|
1065 |
+
var data = [];
|
1066 |
+
$(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
|
1067 |
+
var obj = { id: this, text: this },
|
1068 |
+
tags = opts.tags;
|
1069 |
+
if ($.isFunction(tags)) tags=tags();
|
1070 |
+
$(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
|
1071 |
+
data.push(obj);
|
1072 |
+
});
|
1073 |
+
|
1074 |
+
callback(data);
|
1075 |
+
};
|
1076 |
+
}
|
1077 |
+
}
|
1078 |
+
}
|
1079 |
+
}
|
1080 |
+
if (typeof(opts.query) !== "function") {
|
1081 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
1082 |
+
}
|
1083 |
+
|
1084 |
+
if (opts.createSearchChoicePosition === 'top') {
|
1085 |
+
opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
|
1086 |
+
}
|
1087 |
+
else if (opts.createSearchChoicePosition === 'bottom') {
|
1088 |
+
opts.createSearchChoicePosition = function(list, item) { list.push(item); };
|
1089 |
+
}
|
1090 |
+
else if (typeof(opts.createSearchChoicePosition) !== "function") {
|
1091 |
+
throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
|
1092 |
+
}
|
1093 |
+
|
1094 |
+
return opts;
|
1095 |
+
},
|
1096 |
+
|
1097 |
+
/**
|
1098 |
+
* Monitor the original element for changes and update select2 accordingly
|
1099 |
+
*/
|
1100 |
+
// abstract
|
1101 |
+
monitorSource: function () {
|
1102 |
+
var el = this.opts.element, observer, self = this;
|
1103 |
+
|
1104 |
+
el.on("change.select2", this.bind(function (e) {
|
1105 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
1106 |
+
this.initSelection();
|
1107 |
+
}
|
1108 |
+
}));
|
1109 |
+
|
1110 |
+
this._sync = this.bind(function () {
|
1111 |
+
|
1112 |
+
// sync enabled state
|
1113 |
+
var disabled = el.prop("disabled");
|
1114 |
+
if (disabled === undefined) disabled = false;
|
1115 |
+
this.enable(!disabled);
|
1116 |
+
|
1117 |
+
var readonly = el.prop("readonly");
|
1118 |
+
if (readonly === undefined) readonly = false;
|
1119 |
+
this.readonly(readonly);
|
1120 |
+
|
1121 |
+
if (this.container) {
|
1122 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
1123 |
+
this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
|
1124 |
+
}
|
1125 |
+
|
1126 |
+
if (this.dropdown) {
|
1127 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
1128 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
|
1129 |
+
}
|
1130 |
+
|
1131 |
+
});
|
1132 |
+
|
1133 |
+
// IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
|
1134 |
+
if (el.length && el[0].attachEvent) {
|
1135 |
+
el.each(function() {
|
1136 |
+
this.attachEvent("onpropertychange", self._sync);
|
1137 |
+
});
|
1138 |
+
}
|
1139 |
+
|
1140 |
+
// safari, chrome, firefox, IE11
|
1141 |
+
observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
|
1142 |
+
if (observer !== undefined) {
|
1143 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
1144 |
+
this.propertyObserver = new observer(function (mutations) {
|
1145 |
+
$.each(mutations, self._sync);
|
1146 |
+
});
|
1147 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
1148 |
+
}
|
1149 |
+
},
|
1150 |
+
|
1151 |
+
// abstract
|
1152 |
+
triggerSelect: function(data) {
|
1153 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
|
1154 |
+
this.opts.element.trigger(evt);
|
1155 |
+
return !evt.isDefaultPrevented();
|
1156 |
+
},
|
1157 |
+
|
1158 |
+
/**
|
1159 |
+
* Triggers the change event on the source element
|
1160 |
+
*/
|
1161 |
+
// abstract
|
1162 |
+
triggerChange: function (details) {
|
1163 |
+
|
1164 |
+
details = details || {};
|
1165 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
1166 |
+
// prevents recursive triggering
|
1167 |
+
this.opts.element.data("select2-change-triggered", true);
|
1168 |
+
this.opts.element.trigger(details);
|
1169 |
+
this.opts.element.data("select2-change-triggered", false);
|
1170 |
+
|
1171 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
1172 |
+
// so here we trigger the click event manually
|
1173 |
+
this.opts.element.click();
|
1174 |
+
|
1175 |
+
// ValidationEngine ignores the change event and listens instead to blur
|
1176 |
+
// so here we trigger the blur event manually if so desired
|
1177 |
+
if (this.opts.blurOnChange)
|
1178 |
+
this.opts.element.blur();
|
1179 |
+
},
|
1180 |
+
|
1181 |
+
//abstract
|
1182 |
+
isInterfaceEnabled: function()
|
1183 |
+
{
|
1184 |
+
return this.enabledInterface === true;
|
1185 |
+
},
|
1186 |
+
|
1187 |
+
// abstract
|
1188 |
+
enableInterface: function() {
|
1189 |
+
var enabled = this._enabled && !this._readonly,
|
1190 |
+
disabled = !enabled;
|
1191 |
+
|
1192 |
+
if (enabled === this.enabledInterface) return false;
|
1193 |
+
|
1194 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
1195 |
+
this.close();
|
1196 |
+
this.enabledInterface = enabled;
|
1197 |
+
|
1198 |
+
return true;
|
1199 |
+
},
|
1200 |
+
|
1201 |
+
// abstract
|
1202 |
+
enable: function(enabled) {
|
1203 |
+
if (enabled === undefined) enabled = true;
|
1204 |
+
if (this._enabled === enabled) return;
|
1205 |
+
this._enabled = enabled;
|
1206 |
+
|
1207 |
+
this.opts.element.prop("disabled", !enabled);
|
1208 |
+
this.enableInterface();
|
1209 |
+
},
|
1210 |
+
|
1211 |
+
// abstract
|
1212 |
+
disable: function() {
|
1213 |
+
this.enable(false);
|
1214 |
+
},
|
1215 |
+
|
1216 |
+
// abstract
|
1217 |
+
readonly: function(enabled) {
|
1218 |
+
if (enabled === undefined) enabled = false;
|
1219 |
+
if (this._readonly === enabled) return;
|
1220 |
+
this._readonly = enabled;
|
1221 |
+
|
1222 |
+
this.opts.element.prop("readonly", enabled);
|
1223 |
+
this.enableInterface();
|
1224 |
+
},
|
1225 |
+
|
1226 |
+
// abstract
|
1227 |
+
opened: function () {
|
1228 |
+
return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
|
1229 |
+
},
|
1230 |
+
|
1231 |
+
// abstract
|
1232 |
+
positionDropdown: function() {
|
1233 |
+
var $dropdown = this.dropdown,
|
1234 |
+
container = this.container,
|
1235 |
+
offset = container.offset(),
|
1236 |
+
height = container.outerHeight(false),
|
1237 |
+
width = container.outerWidth(false),
|
1238 |
+
dropHeight = $dropdown.outerHeight(false),
|
1239 |
+
$window = $(window),
|
1240 |
+
windowWidth = $window.width(),
|
1241 |
+
windowHeight = $window.height(),
|
1242 |
+
viewPortRight = $window.scrollLeft() + windowWidth,
|
1243 |
+
viewportBottom = $window.scrollTop() + windowHeight,
|
1244 |
+
dropTop = offset.top + height,
|
1245 |
+
dropLeft = offset.left,
|
1246 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
1247 |
+
enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
|
1248 |
+
dropWidth = $dropdown.outerWidth(false),
|
1249 |
+
enoughRoomOnRight = function() {
|
1250 |
+
return dropLeft + dropWidth <= viewPortRight;
|
1251 |
+
},
|
1252 |
+
enoughRoomOnLeft = function() {
|
1253 |
+
return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
|
1254 |
+
},
|
1255 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
1256 |
+
bodyOffset,
|
1257 |
+
above,
|
1258 |
+
changeDirection,
|
1259 |
+
css,
|
1260 |
+
resultsListNode;
|
1261 |
+
|
1262 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
1263 |
+
if (aboveNow) {
|
1264 |
+
above = true;
|
1265 |
+
if (!enoughRoomAbove && enoughRoomBelow) {
|
1266 |
+
changeDirection = true;
|
1267 |
+
above = false;
|
1268 |
+
}
|
1269 |
+
} else {
|
1270 |
+
above = false;
|
1271 |
+
if (!enoughRoomBelow && enoughRoomAbove) {
|
1272 |
+
changeDirection = true;
|
1273 |
+
above = true;
|
1274 |
+
}
|
1275 |
+
}
|
1276 |
+
|
1277 |
+
//if we are changing direction we need to get positions when dropdown is hidden;
|
1278 |
+
if (changeDirection) {
|
1279 |
+
$dropdown.hide();
|
1280 |
+
offset = this.container.offset();
|
1281 |
+
height = this.container.outerHeight(false);
|
1282 |
+
width = this.container.outerWidth(false);
|
1283 |
+
dropHeight = $dropdown.outerHeight(false);
|
1284 |
+
viewPortRight = $window.scrollLeft() + windowWidth;
|
1285 |
+
viewportBottom = $window.scrollTop() + windowHeight;
|
1286 |
+
dropTop = offset.top + height;
|
1287 |
+
dropLeft = offset.left;
|
1288 |
+
dropWidth = $dropdown.outerWidth(false);
|
1289 |
+
$dropdown.show();
|
1290 |
+
|
1291 |
+
// fix so the cursor does not move to the left within the search-textbox in IE
|
1292 |
+
this.focusSearch();
|
1293 |
+
}
|
1294 |
+
|
1295 |
+
if (this.opts.dropdownAutoWidth) {
|
1296 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
1297 |
+
$dropdown.addClass('select2-drop-auto-width');
|
1298 |
+
$dropdown.css('width', '');
|
1299 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
1300 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
1301 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
1302 |
+
dropHeight = $dropdown.outerHeight(false);
|
1303 |
+
}
|
1304 |
+
else {
|
1305 |
+
this.container.removeClass('select2-drop-auto-width');
|
1306 |
+
}
|
1307 |
+
|
1308 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
1309 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
|
1310 |
+
|
1311 |
+
// fix positioning when body has an offset and is not position: static
|
1312 |
+
if (this.body.css('position') !== 'static') {
|
1313 |
+
bodyOffset = this.body.offset();
|
1314 |
+
dropTop -= bodyOffset.top;
|
1315 |
+
dropLeft -= bodyOffset.left;
|
1316 |
+
}
|
1317 |
+
|
1318 |
+
if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
|
1319 |
+
dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
|
1320 |
+
}
|
1321 |
+
|
1322 |
+
css = {
|
1323 |
+
left: dropLeft,
|
1324 |
+
width: width
|
1325 |
+
};
|
1326 |
+
|
1327 |
+
if (above) {
|
1328 |
+
css.top = offset.top - dropHeight;
|
1329 |
+
css.bottom = 'auto';
|
1330 |
+
this.container.addClass("select2-drop-above");
|
1331 |
+
$dropdown.addClass("select2-drop-above");
|
1332 |
+
}
|
1333 |
+
else {
|
1334 |
+
css.top = dropTop;
|
1335 |
+
css.bottom = 'auto';
|
1336 |
+
this.container.removeClass("select2-drop-above");
|
1337 |
+
$dropdown.removeClass("select2-drop-above");
|
1338 |
+
}
|
1339 |
+
css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
|
1340 |
+
|
1341 |
+
$dropdown.css(css);
|
1342 |
+
},
|
1343 |
+
|
1344 |
+
// abstract
|
1345 |
+
shouldOpen: function() {
|
1346 |
+
var event;
|
1347 |
+
|
1348 |
+
if (this.opened()) return false;
|
1349 |
+
|
1350 |
+
if (this._enabled === false || this._readonly === true) return false;
|
1351 |
+
|
1352 |
+
event = $.Event("select2-opening");
|
1353 |
+
this.opts.element.trigger(event);
|
1354 |
+
return !event.isDefaultPrevented();
|
1355 |
+
},
|
1356 |
+
|
1357 |
+
// abstract
|
1358 |
+
clearDropdownAlignmentPreference: function() {
|
1359 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
1360 |
+
this.container.removeClass("select2-drop-above");
|
1361 |
+
this.dropdown.removeClass("select2-drop-above");
|
1362 |
+
},
|
1363 |
+
|
1364 |
+
/**
|
1365 |
+
* Opens the dropdown
|
1366 |
+
*
|
1367 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
1368 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
1369 |
+
*/
|
1370 |
+
// abstract
|
1371 |
+
open: function () {
|
1372 |
+
|
1373 |
+
if (!this.shouldOpen()) return false;
|
1374 |
+
|
1375 |
+
this.opening();
|
1376 |
+
|
1377 |
+
// Only bind the document mousemove when the dropdown is visible
|
1378 |
+
$document.on("mousemove.select2Event", function (e) {
|
1379 |
+
lastMousePosition.x = e.pageX;
|
1380 |
+
lastMousePosition.y = e.pageY;
|
1381 |
+
});
|
1382 |
+
|
1383 |
+
return true;
|
1384 |
+
},
|
1385 |
+
|
1386 |
+
/**
|
1387 |
+
* Performs the opening of the dropdown
|
1388 |
+
*/
|
1389 |
+
// abstract
|
1390 |
+
opening: function() {
|
1391 |
+
var cid = this.containerEventName,
|
1392 |
+
scroll = "scroll." + cid,
|
1393 |
+
resize = "resize."+cid,
|
1394 |
+
orient = "orientationchange."+cid,
|
1395 |
+
mask;
|
1396 |
+
|
1397 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
1398 |
+
|
1399 |
+
this.clearDropdownAlignmentPreference();
|
1400 |
+
|
1401 |
+
if(this.dropdown[0] !== this.body.children().last()[0]) {
|
1402 |
+
this.dropdown.detach().appendTo(this.body);
|
1403 |
+
}
|
1404 |
+
|
1405 |
+
// create the dropdown mask if doesn't already exist
|
1406 |
+
mask = $("#select2-drop-mask");
|
1407 |
+
if (mask.length === 0) {
|
1408 |
+
mask = $(document.createElement("div"));
|
1409 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
1410 |
+
mask.hide();
|
1411 |
+
mask.appendTo(this.body);
|
1412 |
+
mask.on("mousedown touchstart click", function (e) {
|
1413 |
+
// Prevent IE from generating a click event on the body
|
1414 |
+
reinsertElement(mask);
|
1415 |
+
|
1416 |
+
var dropdown = $("#select2-drop"), self;
|
1417 |
+
if (dropdown.length > 0) {
|
1418 |
+
self=dropdown.data("select2");
|
1419 |
+
if (self.opts.selectOnBlur) {
|
1420 |
+
self.selectHighlighted({noFocus: true});
|
1421 |
+
}
|
1422 |
+
self.close();
|
1423 |
+
e.preventDefault();
|
1424 |
+
e.stopPropagation();
|
1425 |
+
}
|
1426 |
+
});
|
1427 |
+
}
|
1428 |
+
|
1429 |
+
// ensure the mask is always right before the dropdown
|
1430 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
1431 |
+
this.dropdown.before(mask);
|
1432 |
+
}
|
1433 |
+
|
1434 |
+
// move the global id to the correct dropdown
|
1435 |
+
$("#select2-drop").removeAttr("id");
|
1436 |
+
this.dropdown.attr("id", "select2-drop");
|
1437 |
+
|
1438 |
+
// show the elements
|
1439 |
+
mask.show();
|
1440 |
+
|
1441 |
+
this.positionDropdown();
|
1442 |
+
this.dropdown.show();
|
1443 |
+
this.positionDropdown();
|
1444 |
+
|
1445 |
+
this.dropdown.addClass("select2-drop-active");
|
1446 |
+
|
1447 |
+
// attach listeners to events that can change the position of the container and thus require
|
1448 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
1449 |
+
var that = this;
|
1450 |
+
this.container.parents().add(window).each(function () {
|
1451 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
1452 |
+
if (that.opened()) that.positionDropdown();
|
1453 |
+
});
|
1454 |
+
});
|
1455 |
+
|
1456 |
+
|
1457 |
+
},
|
1458 |
+
|
1459 |
+
// abstract
|
1460 |
+
close: function () {
|
1461 |
+
if (!this.opened()) return;
|
1462 |
+
|
1463 |
+
var cid = this.containerEventName,
|
1464 |
+
scroll = "scroll." + cid,
|
1465 |
+
resize = "resize."+cid,
|
1466 |
+
orient = "orientationchange."+cid;
|
1467 |
+
|
1468 |
+
// unbind event listeners
|
1469 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
1470 |
+
|
1471 |
+
this.clearDropdownAlignmentPreference();
|
1472 |
+
|
1473 |
+
$("#select2-drop-mask").hide();
|
1474 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
1475 |
+
this.dropdown.hide();
|
1476 |
+
this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
|
1477 |
+
this.results.empty();
|
1478 |
+
|
1479 |
+
// Now that the dropdown is closed, unbind the global document mousemove event
|
1480 |
+
$document.off("mousemove.select2Event");
|
1481 |
+
|
1482 |
+
this.clearSearch();
|
1483 |
+
this.search.removeClass("select2-active");
|
1484 |
+
this.opts.element.trigger($.Event("select2-close"));
|
1485 |
+
},
|
1486 |
+
|
1487 |
+
/**
|
1488 |
+
* Opens control, sets input value, and updates results.
|
1489 |
+
*/
|
1490 |
+
// abstract
|
1491 |
+
externalSearch: function (term) {
|
1492 |
+
this.open();
|
1493 |
+
this.search.val(term);
|
1494 |
+
this.updateResults(false);
|
1495 |
+
},
|
1496 |
+
|
1497 |
+
// abstract
|
1498 |
+
clearSearch: function () {
|
1499 |
+
|
1500 |
+
},
|
1501 |
+
|
1502 |
+
//abstract
|
1503 |
+
getMaximumSelectionSize: function() {
|
1504 |
+
return evaluate(this.opts.maximumSelectionSize, this.opts.element);
|
1505 |
+
},
|
1506 |
+
|
1507 |
+
// abstract
|
1508 |
+
ensureHighlightVisible: function () {
|
1509 |
+
var results = this.results, children, index, child, hb, rb, y, more, topOffset;
|
1510 |
+
|
1511 |
+
index = this.highlight();
|
1512 |
+
|
1513 |
+
if (index < 0) return;
|
1514 |
+
|
1515 |
+
if (index == 0) {
|
1516 |
+
|
1517 |
+
// if the first element is highlighted scroll all the way to the top,
|
1518 |
+
// that way any unselectable headers above it will also be scrolled
|
1519 |
+
// into view
|
1520 |
+
|
1521 |
+
results.scrollTop(0);
|
1522 |
+
return;
|
1523 |
+
}
|
1524 |
+
|
1525 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
1526 |
+
|
1527 |
+
child = $(children[index]);
|
1528 |
+
|
1529 |
+
topOffset = (child.offset() || {}).top || 0;
|
1530 |
+
|
1531 |
+
hb = topOffset + child.outerHeight(true);
|
1532 |
+
|
1533 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
1534 |
+
if (index === children.length - 1) {
|
1535 |
+
more = results.find("li.select2-more-results");
|
1536 |
+
if (more.length > 0) {
|
1537 |
+
hb = more.offset().top + more.outerHeight(true);
|
1538 |
+
}
|
1539 |
+
}
|
1540 |
+
|
1541 |
+
rb = results.offset().top + results.outerHeight(false);
|
1542 |
+
if (hb > rb) {
|
1543 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
1544 |
+
}
|
1545 |
+
y = topOffset - results.offset().top;
|
1546 |
+
|
1547 |
+
// make sure the top of the element is visible
|
1548 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
1549 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
1550 |
+
}
|
1551 |
+
},
|
1552 |
+
|
1553 |
+
// abstract
|
1554 |
+
findHighlightableChoices: function() {
|
1555 |
+
return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
|
1556 |
+
},
|
1557 |
+
|
1558 |
+
// abstract
|
1559 |
+
moveHighlight: function (delta) {
|
1560 |
+
var choices = this.findHighlightableChoices(),
|
1561 |
+
index = this.highlight();
|
1562 |
+
|
1563 |
+
while (index > -1 && index < choices.length) {
|
1564 |
+
index += delta;
|
1565 |
+
var choice = $(choices[index]);
|
1566 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
1567 |
+
this.highlight(index);
|
1568 |
+
break;
|
1569 |
+
}
|
1570 |
+
}
|
1571 |
+
},
|
1572 |
+
|
1573 |
+
// abstract
|
1574 |
+
highlight: function (index) {
|
1575 |
+
var choices = this.findHighlightableChoices(),
|
1576 |
+
choice,
|
1577 |
+
data;
|
1578 |
+
|
1579 |
+
if (arguments.length === 0) {
|
1580 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
1581 |
+
}
|
1582 |
+
|
1583 |
+
if (index >= choices.length) index = choices.length - 1;
|
1584 |
+
if (index < 0) index = 0;
|
1585 |
+
|
1586 |
+
this.removeHighlight();
|
1587 |
+
|
1588 |
+
choice = $(choices[index]);
|
1589 |
+
choice.addClass("select2-highlighted");
|
1590 |
+
|
1591 |
+
// ensure assistive technology can determine the active choice
|
1592 |
+
this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
|
1593 |
+
|
1594 |
+
this.ensureHighlightVisible();
|
1595 |
+
|
1596 |
+
this.liveRegion.text(choice.text());
|
1597 |
+
|
1598 |
+
data = choice.data("select2-data");
|
1599 |
+
if (data) {
|
1600 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
1601 |
+
}
|
1602 |
+
},
|
1603 |
+
|
1604 |
+
removeHighlight: function() {
|
1605 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
1606 |
+
},
|
1607 |
+
|
1608 |
+
touchMoved: function() {
|
1609 |
+
this._touchMoved = true;
|
1610 |
+
},
|
1611 |
+
|
1612 |
+
clearTouchMoved: function() {
|
1613 |
+
this._touchMoved = false;
|
1614 |
+
},
|
1615 |
+
|
1616 |
+
// abstract
|
1617 |
+
countSelectableResults: function() {
|
1618 |
+
return this.findHighlightableChoices().length;
|
1619 |
+
},
|
1620 |
+
|
1621 |
+
// abstract
|
1622 |
+
highlightUnderEvent: function (event) {
|
1623 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
1624 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
1625 |
+
var choices = this.findHighlightableChoices();
|
1626 |
+
this.highlight(choices.index(el));
|
1627 |
+
} else if (el.length == 0) {
|
1628 |
+
// if we are over an unselectable item remove all highlights
|
1629 |
+
this.removeHighlight();
|
1630 |
+
}
|
1631 |
+
},
|
1632 |
+
|
1633 |
+
// abstract
|
1634 |
+
loadMoreIfNeeded: function () {
|
1635 |
+
var results = this.results,
|
1636 |
+
more = results.find("li.select2-more-results"),
|
1637 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
1638 |
+
page = this.resultsPage + 1,
|
1639 |
+
self=this,
|
1640 |
+
term=this.search.val(),
|
1641 |
+
context=this.context;
|
1642 |
+
|
1643 |
+
if (more.length === 0) return;
|
1644 |
+
below = more.offset().top - results.offset().top - results.height();
|
1645 |
+
|
1646 |
+
if (below <= this.opts.loadMorePadding) {
|
1647 |
+
more.addClass("select2-active");
|
1648 |
+
this.opts.query({
|
1649 |
+
element: this.opts.element,
|
1650 |
+
term: term,
|
1651 |
+
page: page,
|
1652 |
+
context: context,
|
1653 |
+
matcher: this.opts.matcher,
|
1654 |
+
callback: this.bind(function (data) {
|
1655 |
+
|
1656 |
+
// ignore a response if the select2 has been closed before it was received
|
1657 |
+
if (!self.opened()) return;
|
1658 |
+
|
1659 |
+
|
1660 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
1661 |
+
self.postprocessResults(data, false, false);
|
1662 |
+
|
1663 |
+
if (data.more===true) {
|
1664 |
+
more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
|
1665 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1666 |
+
} else {
|
1667 |
+
more.remove();
|
1668 |
+
}
|
1669 |
+
self.positionDropdown();
|
1670 |
+
self.resultsPage = page;
|
1671 |
+
self.context = data.context;
|
1672 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1673 |
+
})});
|
1674 |
+
}
|
1675 |
+
},
|
1676 |
+
|
1677 |
+
/**
|
1678 |
+
* Default tokenizer function which does nothing
|
1679 |
+
*/
|
1680 |
+
tokenize: function() {
|
1681 |
+
|
1682 |
+
},
|
1683 |
+
|
1684 |
+
/**
|
1685 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
1686 |
+
*/
|
1687 |
+
// abstract
|
1688 |
+
updateResults: function (initial) {
|
1689 |
+
var search = this.search,
|
1690 |
+
results = this.results,
|
1691 |
+
opts = this.opts,
|
1692 |
+
data,
|
1693 |
+
self = this,
|
1694 |
+
input,
|
1695 |
+
term = search.val(),
|
1696 |
+
lastTerm = $.data(this.container, "select2-last-term"),
|
1697 |
+
// sequence number used to drop out-of-order responses
|
1698 |
+
queryNumber;
|
1699 |
+
|
1700 |
+
// prevent duplicate queries against the same term
|
1701 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
1702 |
+
|
1703 |
+
$.data(this.container, "select2-last-term", term);
|
1704 |
+
|
1705 |
+
// if the search is currently hidden we do not alter the results
|
1706 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
1707 |
+
return;
|
1708 |
+
}
|
1709 |
+
|
1710 |
+
function postRender() {
|
1711 |
+
search.removeClass("select2-active");
|
1712 |
+
self.positionDropdown();
|
1713 |
+
if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
|
1714 |
+
self.liveRegion.text(results.text());
|
1715 |
+
}
|
1716 |
+
else {
|
1717 |
+
self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
|
1718 |
+
}
|
1719 |
+
}
|
1720 |
+
|
1721 |
+
function render(html) {
|
1722 |
+
results.html(html);
|
1723 |
+
postRender();
|
1724 |
+
}
|
1725 |
+
|
1726 |
+
queryNumber = ++this.queryCount;
|
1727 |
+
|
1728 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
1729 |
+
if (maxSelSize >=1) {
|
1730 |
+
data = this.data();
|
1731 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
1732 |
+
render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
|
1733 |
+
return;
|
1734 |
+
}
|
1735 |
+
}
|
1736 |
+
|
1737 |
+
if (search.val().length < opts.minimumInputLength) {
|
1738 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
1739 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
|
1740 |
+
} else {
|
1741 |
+
render("");
|
1742 |
+
}
|
1743 |
+
if (initial && this.showSearch) this.showSearch(true);
|
1744 |
+
return;
|
1745 |
+
}
|
1746 |
+
|
1747 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
1748 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
1749 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
|
1750 |
+
} else {
|
1751 |
+
render("");
|
1752 |
+
}
|
1753 |
+
return;
|
1754 |
+
}
|
1755 |
+
|
1756 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
1757 |
+
render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
|
1758 |
+
}
|
1759 |
+
|
1760 |
+
search.addClass("select2-active");
|
1761 |
+
|
1762 |
+
this.removeHighlight();
|
1763 |
+
|
1764 |
+
// give the tokenizer a chance to pre-process the input
|
1765 |
+
input = this.tokenize();
|
1766 |
+
if (input != undefined && input != null) {
|
1767 |
+
search.val(input);
|
1768 |
+
}
|
1769 |
+
|
1770 |
+
this.resultsPage = 1;
|
1771 |
+
|
1772 |
+
opts.query({
|
1773 |
+
element: opts.element,
|
1774 |
+
term: search.val(),
|
1775 |
+
page: this.resultsPage,
|
1776 |
+
context: null,
|
1777 |
+
matcher: opts.matcher,
|
1778 |
+
callback: this.bind(function (data) {
|
1779 |
+
var def; // default choice
|
1780 |
+
|
1781 |
+
// ignore old responses
|
1782 |
+
if (queryNumber != this.queryCount) {
|
1783 |
+
return;
|
1784 |
+
}
|
1785 |
+
|
1786 |
+
// ignore a response if the select2 has been closed before it was received
|
1787 |
+
if (!this.opened()) {
|
1788 |
+
this.search.removeClass("select2-active");
|
1789 |
+
return;
|
1790 |
+
}
|
1791 |
+
|
1792 |
+
// handle ajax error
|
1793 |
+
if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
|
1794 |
+
render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
|
1795 |
+
return;
|
1796 |
+
}
|
1797 |
+
|
1798 |
+
// save context, if any
|
1799 |
+
this.context = (data.context===undefined) ? null : data.context;
|
1800 |
+
// create a default choice and prepend it to the list
|
1801 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
1802 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
1803 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
1804 |
+
if ($(data.results).filter(
|
1805 |
+
function () {
|
1806 |
+
return equal(self.id(this), self.id(def));
|
1807 |
+
}).length === 0) {
|
1808 |
+
this.opts.createSearchChoicePosition(data.results, def);
|
1809 |
+
}
|
1810 |
+
}
|
1811 |
+
}
|
1812 |
+
|
1813 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
1814 |
+
render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
|
1815 |
+
return;
|
1816 |
+
}
|
1817 |
+
|
1818 |
+
results.empty();
|
1819 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
1820 |
+
|
1821 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
1822 |
+
results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
|
1823 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
1824 |
+
}
|
1825 |
+
|
1826 |
+
this.postprocessResults(data, initial);
|
1827 |
+
|
1828 |
+
postRender();
|
1829 |
+
|
1830 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
1831 |
+
})});
|
1832 |
+
},
|
1833 |
+
|
1834 |
+
// abstract
|
1835 |
+
cancel: function () {
|
1836 |
+
this.close();
|
1837 |
+
},
|
1838 |
+
|
1839 |
+
// abstract
|
1840 |
+
blur: function () {
|
1841 |
+
// if selectOnBlur == true, select the currently highlighted option
|
1842 |
+
if (this.opts.selectOnBlur)
|
1843 |
+
this.selectHighlighted({noFocus: true});
|
1844 |
+
|
1845 |
+
this.close();
|
1846 |
+
this.container.removeClass("select2-container-active");
|
1847 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
1848 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
1849 |
+
this.clearSearch();
|
1850 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
1851 |
+
},
|
1852 |
+
|
1853 |
+
// abstract
|
1854 |
+
focusSearch: function () {
|
1855 |
+
focus(this.search);
|
1856 |
+
},
|
1857 |
+
|
1858 |
+
// abstract
|
1859 |
+
selectHighlighted: function (options) {
|
1860 |
+
if (this._touchMoved) {
|
1861 |
+
this.clearTouchMoved();
|
1862 |
+
return;
|
1863 |
+
}
|
1864 |
+
var index=this.highlight(),
|
1865 |
+
highlighted=this.results.find(".select2-highlighted"),
|
1866 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
1867 |
+
|
1868 |
+
if (data) {
|
1869 |
+
this.highlight(index);
|
1870 |
+
this.onSelect(data, options);
|
1871 |
+
} else if (options && options.noFocus) {
|
1872 |
+
this.close();
|
1873 |
+
}
|
1874 |
+
},
|
1875 |
+
|
1876 |
+
// abstract
|
1877 |
+
getPlaceholder: function () {
|
1878 |
+
var placeholderOption;
|
1879 |
+
return this.opts.element.attr("placeholder") ||
|
1880 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
1881 |
+
this.opts.element.data("placeholder") ||
|
1882 |
+
this.opts.placeholder ||
|
1883 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
1884 |
+
},
|
1885 |
+
|
1886 |
+
// abstract
|
1887 |
+
getPlaceholderOption: function() {
|
1888 |
+
if (this.select) {
|
1889 |
+
var firstOption = this.select.children('option').first();
|
1890 |
+
if (this.opts.placeholderOption !== undefined ) {
|
1891 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
1892 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
1893 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
1894 |
+
} else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
|
1895 |
+
//No explicit placeholder option specified, use the first if it's blank
|
1896 |
+
return firstOption;
|
1897 |
+
}
|
1898 |
+
}
|
1899 |
+
},
|
1900 |
+
|
1901 |
+
/**
|
1902 |
+
* Get the desired width for the container element. This is
|
1903 |
+
* derived first from option `width` passed to select2, then
|
1904 |
+
* the inline 'style' on the original element, and finally
|
1905 |
+
* falls back to the jQuery calculated element width.
|
1906 |
+
*/
|
1907 |
+
// abstract
|
1908 |
+
initContainerWidth: function () {
|
1909 |
+
function resolveContainerWidth() {
|
1910 |
+
var style, attrs, matches, i, l, attr;
|
1911 |
+
|
1912 |
+
if (this.opts.width === "off") {
|
1913 |
+
return null;
|
1914 |
+
} else if (this.opts.width === "element"){
|
1915 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
1916 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
1917 |
+
// check if there is inline style on the element that contains width
|
1918 |
+
style = this.opts.element.attr('style');
|
1919 |
+
if (style !== undefined) {
|
1920 |
+
attrs = style.split(';');
|
1921 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
1922 |
+
attr = attrs[i].replace(/\s/g, '');
|
1923 |
+
matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
1924 |
+
if (matches !== null && matches.length >= 1)
|
1925 |
+
return matches[1];
|
1926 |
+
}
|
1927 |
+
}
|
1928 |
+
|
1929 |
+
if (this.opts.width === "resolve") {
|
1930 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
1931 |
+
// when attached to input type=hidden or elements hidden via css
|
1932 |
+
style = this.opts.element.css('width');
|
1933 |
+
if (style.indexOf("%") > 0) return style;
|
1934 |
+
|
1935 |
+
// finally, fallback on the calculated width of the element
|
1936 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
1937 |
+
}
|
1938 |
+
|
1939 |
+
return null;
|
1940 |
+
} else if ($.isFunction(this.opts.width)) {
|
1941 |
+
return this.opts.width();
|
1942 |
+
} else {
|
1943 |
+
return this.opts.width;
|
1944 |
+
}
|
1945 |
+
};
|
1946 |
+
|
1947 |
+
var width = resolveContainerWidth.call(this);
|
1948 |
+
if (width !== null) {
|
1949 |
+
this.container.css("width", width);
|
1950 |
+
}
|
1951 |
+
}
|
1952 |
+
});
|
1953 |
+
|
1954 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
1955 |
+
|
1956 |
+
// single
|
1957 |
+
|
1958 |
+
createContainer: function () {
|
1959 |
+
var container = $(document.createElement("div")).attr({
|
1960 |
+
"class": "select2-container"
|
1961 |
+
}).html([
|
1962 |
+
"<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
|
1963 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
1964 |
+
" <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
|
1965 |
+
"</a>",
|
1966 |
+
"<label for='' class='select2-offscreen'></label>",
|
1967 |
+
"<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
|
1968 |
+
"<div class='select2-drop select2-display-none'>",
|
1969 |
+
" <div class='select2-search'>",
|
1970 |
+
" <label for='' class='select2-offscreen'></label>",
|
1971 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
|
1972 |
+
" aria-autocomplete='list' />",
|
1973 |
+
" </div>",
|
1974 |
+
" <ul class='select2-results' role='listbox'>",
|
1975 |
+
" </ul>",
|
1976 |
+
"</div>"].join(""));
|
1977 |
+
return container;
|
1978 |
+
},
|
1979 |
+
|
1980 |
+
// single
|
1981 |
+
enableInterface: function() {
|
1982 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
1983 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
1984 |
+
}
|
1985 |
+
},
|
1986 |
+
|
1987 |
+
// single
|
1988 |
+
opening: function () {
|
1989 |
+
var el, range, len;
|
1990 |
+
|
1991 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
1992 |
+
this.showSearch(true);
|
1993 |
+
}
|
1994 |
+
|
1995 |
+
this.parent.opening.apply(this, arguments);
|
1996 |
+
|
1997 |
+
if (this.showSearchInput !== false) {
|
1998 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
1999 |
+
// all other browsers handle this just fine
|
2000 |
+
|
2001 |
+
this.search.val(this.focusser.val());
|
2002 |
+
}
|
2003 |
+
if (this.opts.shouldFocusInput(this)) {
|
2004 |
+
this.search.focus();
|
2005 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
2006 |
+
// new text will appear *before* focusser.val()
|
2007 |
+
el = this.search.get(0);
|
2008 |
+
if (el.createTextRange) {
|
2009 |
+
range = el.createTextRange();
|
2010 |
+
range.collapse(false);
|
2011 |
+
range.select();
|
2012 |
+
} else if (el.setSelectionRange) {
|
2013 |
+
len = this.search.val().length;
|
2014 |
+
el.setSelectionRange(len, len);
|
2015 |
+
}
|
2016 |
+
}
|
2017 |
+
|
2018 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2019 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2020 |
+
if(this.search.val() === "") {
|
2021 |
+
if(this.nextSearchTerm != undefined){
|
2022 |
+
this.search.val(this.nextSearchTerm);
|
2023 |
+
this.search.select();
|
2024 |
+
}
|
2025 |
+
}
|
2026 |
+
|
2027 |
+
this.focusser.prop("disabled", true).val("");
|
2028 |
+
this.updateResults(true);
|
2029 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2030 |
+
},
|
2031 |
+
|
2032 |
+
// single
|
2033 |
+
close: function () {
|
2034 |
+
if (!this.opened()) return;
|
2035 |
+
this.parent.close.apply(this, arguments);
|
2036 |
+
|
2037 |
+
this.focusser.prop("disabled", false);
|
2038 |
+
|
2039 |
+
if (this.opts.shouldFocusInput(this)) {
|
2040 |
+
this.focusser.focus();
|
2041 |
+
}
|
2042 |
+
},
|
2043 |
+
|
2044 |
+
// single
|
2045 |
+
focus: function () {
|
2046 |
+
if (this.opened()) {
|
2047 |
+
this.close();
|
2048 |
+
} else {
|
2049 |
+
this.focusser.prop("disabled", false);
|
2050 |
+
if (this.opts.shouldFocusInput(this)) {
|
2051 |
+
this.focusser.focus();
|
2052 |
+
}
|
2053 |
+
}
|
2054 |
+
},
|
2055 |
+
|
2056 |
+
// single
|
2057 |
+
isFocused: function () {
|
2058 |
+
return this.container.hasClass("select2-container-active");
|
2059 |
+
},
|
2060 |
+
|
2061 |
+
// single
|
2062 |
+
cancel: function () {
|
2063 |
+
this.parent.cancel.apply(this, arguments);
|
2064 |
+
this.focusser.prop("disabled", false);
|
2065 |
+
|
2066 |
+
if (this.opts.shouldFocusInput(this)) {
|
2067 |
+
this.focusser.focus();
|
2068 |
+
}
|
2069 |
+
},
|
2070 |
+
|
2071 |
+
// single
|
2072 |
+
destroy: function() {
|
2073 |
+
$("label[for='" + this.focusser.attr('id') + "']")
|
2074 |
+
.attr('for', this.opts.element.attr("id"));
|
2075 |
+
this.parent.destroy.apply(this, arguments);
|
2076 |
+
|
2077 |
+
cleanupJQueryElements.call(this,
|
2078 |
+
"selection",
|
2079 |
+
"focusser"
|
2080 |
+
);
|
2081 |
+
},
|
2082 |
+
|
2083 |
+
// single
|
2084 |
+
initContainer: function () {
|
2085 |
+
|
2086 |
+
var selection,
|
2087 |
+
container = this.container,
|
2088 |
+
dropdown = this.dropdown,
|
2089 |
+
idSuffix = nextUid(),
|
2090 |
+
elementLabel;
|
2091 |
+
|
2092 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
2093 |
+
this.showSearch(false);
|
2094 |
+
} else {
|
2095 |
+
this.showSearch(true);
|
2096 |
+
}
|
2097 |
+
|
2098 |
+
this.selection = selection = container.find(".select2-choice");
|
2099 |
+
|
2100 |
+
this.focusser = container.find(".select2-focusser");
|
2101 |
+
|
2102 |
+
// add aria associations
|
2103 |
+
selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
|
2104 |
+
this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
|
2105 |
+
this.results.attr("id", "select2-results-"+idSuffix);
|
2106 |
+
this.search.attr("aria-owns", "select2-results-"+idSuffix);
|
2107 |
+
|
2108 |
+
// rewrite labels from original element to focusser
|
2109 |
+
this.focusser.attr("id", "s2id_autogen"+idSuffix);
|
2110 |
+
|
2111 |
+
elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
|
2112 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2113 |
+
|
2114 |
+
this.focusser.prev()
|
2115 |
+
.text(elementLabel.text())
|
2116 |
+
.attr('for', this.focusser.attr('id'));
|
2117 |
+
|
2118 |
+
// Ensure the original element retains an accessible name
|
2119 |
+
var originalTitle = this.opts.element.attr("title");
|
2120 |
+
this.opts.element.attr("title", (originalTitle || elementLabel.text()));
|
2121 |
+
|
2122 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
2123 |
+
|
2124 |
+
// write label for search field using the label from the focusser element
|
2125 |
+
this.search.attr("id", this.focusser.attr('id') + '_search');
|
2126 |
+
|
2127 |
+
this.search.prev()
|
2128 |
+
.text($("label[for='" + this.focusser.attr('id') + "']").text())
|
2129 |
+
.attr('for', this.search.attr('id'));
|
2130 |
+
|
2131 |
+
this.search.on("keydown", this.bind(function (e) {
|
2132 |
+
if (!this.isInterfaceEnabled()) return;
|
2133 |
+
|
2134 |
+
// filter 229 keyCodes (input method editor is processing key input)
|
2135 |
+
if (229 == e.keyCode) return;
|
2136 |
+
|
2137 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2138 |
+
// prevent the page from scrolling
|
2139 |
+
killEvent(e);
|
2140 |
+
return;
|
2141 |
+
}
|
2142 |
+
|
2143 |
+
switch (e.which) {
|
2144 |
+
case KEY.UP:
|
2145 |
+
case KEY.DOWN:
|
2146 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2147 |
+
killEvent(e);
|
2148 |
+
return;
|
2149 |
+
case KEY.ENTER:
|
2150 |
+
this.selectHighlighted();
|
2151 |
+
killEvent(e);
|
2152 |
+
return;
|
2153 |
+
case KEY.TAB:
|
2154 |
+
this.selectHighlighted({noFocus: true});
|
2155 |
+
return;
|
2156 |
+
case KEY.ESC:
|
2157 |
+
this.cancel(e);
|
2158 |
+
killEvent(e);
|
2159 |
+
return;
|
2160 |
+
}
|
2161 |
+
}));
|
2162 |
+
|
2163 |
+
this.search.on("blur", this.bind(function(e) {
|
2164 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
2165 |
+
// without this the search field loses focus which is annoying
|
2166 |
+
if (document.activeElement === this.body.get(0)) {
|
2167 |
+
window.setTimeout(this.bind(function() {
|
2168 |
+
if (this.opened()) {
|
2169 |
+
this.search.focus();
|
2170 |
+
}
|
2171 |
+
}), 0);
|
2172 |
+
}
|
2173 |
+
}));
|
2174 |
+
|
2175 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
2176 |
+
if (!this.isInterfaceEnabled()) return;
|
2177 |
+
|
2178 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
2179 |
+
return;
|
2180 |
+
}
|
2181 |
+
|
2182 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
2183 |
+
killEvent(e);
|
2184 |
+
return;
|
2185 |
+
}
|
2186 |
+
|
2187 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
2188 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
2189 |
+
|
2190 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
2191 |
+
|
2192 |
+
this.open();
|
2193 |
+
killEvent(e);
|
2194 |
+
return;
|
2195 |
+
}
|
2196 |
+
|
2197 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
2198 |
+
if (this.opts.allowClear) {
|
2199 |
+
this.clear();
|
2200 |
+
}
|
2201 |
+
killEvent(e);
|
2202 |
+
return;
|
2203 |
+
}
|
2204 |
+
}));
|
2205 |
+
|
2206 |
+
|
2207 |
+
installKeyUpChangeEvent(this.focusser);
|
2208 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
2209 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
2210 |
+
e.stopPropagation();
|
2211 |
+
if (this.opened()) return;
|
2212 |
+
this.open();
|
2213 |
+
}
|
2214 |
+
}));
|
2215 |
+
|
2216 |
+
selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
|
2217 |
+
if (!this.isInterfaceEnabled()) {
|
2218 |
+
return;
|
2219 |
+
}
|
2220 |
+
|
2221 |
+
this.clear();
|
2222 |
+
killEventImmediately(e);
|
2223 |
+
this.close();
|
2224 |
+
|
2225 |
+
if (this.selection) {
|
2226 |
+
this.selection.focus();
|
2227 |
+
}
|
2228 |
+
}));
|
2229 |
+
|
2230 |
+
selection.on("mousedown touchstart", this.bind(function (e) {
|
2231 |
+
// Prevent IE from generating a click event on the body
|
2232 |
+
reinsertElement(selection);
|
2233 |
+
|
2234 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2235 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2236 |
+
}
|
2237 |
+
|
2238 |
+
if (this.opened()) {
|
2239 |
+
this.close();
|
2240 |
+
} else if (this.isInterfaceEnabled()) {
|
2241 |
+
this.open();
|
2242 |
+
}
|
2243 |
+
|
2244 |
+
killEvent(e);
|
2245 |
+
}));
|
2246 |
+
|
2247 |
+
dropdown.on("mousedown touchstart", this.bind(function() {
|
2248 |
+
if (this.opts.shouldFocusInput(this)) {
|
2249 |
+
this.search.focus();
|
2250 |
+
}
|
2251 |
+
}));
|
2252 |
+
|
2253 |
+
selection.on("focus", this.bind(function(e) {
|
2254 |
+
killEvent(e);
|
2255 |
+
}));
|
2256 |
+
|
2257 |
+
this.focusser.on("focus", this.bind(function(){
|
2258 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2259 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2260 |
+
}
|
2261 |
+
this.container.addClass("select2-container-active");
|
2262 |
+
})).on("blur", this.bind(function() {
|
2263 |
+
if (!this.opened()) {
|
2264 |
+
this.container.removeClass("select2-container-active");
|
2265 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2266 |
+
}
|
2267 |
+
}));
|
2268 |
+
this.search.on("focus", this.bind(function(){
|
2269 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2270 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2271 |
+
}
|
2272 |
+
this.container.addClass("select2-container-active");
|
2273 |
+
}));
|
2274 |
+
|
2275 |
+
this.initContainerWidth();
|
2276 |
+
this.opts.element.hide();
|
2277 |
+
this.setPlaceholder();
|
2278 |
+
|
2279 |
+
},
|
2280 |
+
|
2281 |
+
// single
|
2282 |
+
clear: function(triggerChange) {
|
2283 |
+
var data=this.selection.data("select2-data");
|
2284 |
+
if (data) { // guard against queued quick consecutive clicks
|
2285 |
+
var evt = $.Event("select2-clearing");
|
2286 |
+
this.opts.element.trigger(evt);
|
2287 |
+
if (evt.isDefaultPrevented()) {
|
2288 |
+
return;
|
2289 |
+
}
|
2290 |
+
var placeholderOption = this.getPlaceholderOption();
|
2291 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
2292 |
+
this.selection.find(".select2-chosen").empty();
|
2293 |
+
this.selection.removeData("select2-data");
|
2294 |
+
this.setPlaceholder();
|
2295 |
+
|
2296 |
+
if (triggerChange !== false){
|
2297 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
2298 |
+
this.triggerChange({removed:data});
|
2299 |
+
}
|
2300 |
+
}
|
2301 |
+
},
|
2302 |
+
|
2303 |
+
/**
|
2304 |
+
* Sets selection based on source element's value
|
2305 |
+
*/
|
2306 |
+
// single
|
2307 |
+
initSelection: function () {
|
2308 |
+
var selected;
|
2309 |
+
if (this.isPlaceholderOptionSelected()) {
|
2310 |
+
this.updateSelection(null);
|
2311 |
+
this.close();
|
2312 |
+
this.setPlaceholder();
|
2313 |
+
} else {
|
2314 |
+
var self = this;
|
2315 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
2316 |
+
if (selected !== undefined && selected !== null) {
|
2317 |
+
self.updateSelection(selected);
|
2318 |
+
self.close();
|
2319 |
+
self.setPlaceholder();
|
2320 |
+
self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
|
2321 |
+
}
|
2322 |
+
});
|
2323 |
+
}
|
2324 |
+
},
|
2325 |
+
|
2326 |
+
isPlaceholderOptionSelected: function() {
|
2327 |
+
var placeholderOption;
|
2328 |
+
if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
|
2329 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
|
2330 |
+
|| (this.opts.element.val() === "")
|
2331 |
+
|| (this.opts.element.val() === undefined)
|
2332 |
+
|| (this.opts.element.val() === null);
|
2333 |
+
},
|
2334 |
+
|
2335 |
+
// single
|
2336 |
+
prepareOpts: function () {
|
2337 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2338 |
+
self=this;
|
2339 |
+
|
2340 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2341 |
+
// install the selection initializer
|
2342 |
+
opts.initSelection = function (element, callback) {
|
2343 |
+
var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
|
2344 |
+
// a single select box always has a value, no need to null check 'selected'
|
2345 |
+
callback(self.optionToData(selected));
|
2346 |
+
};
|
2347 |
+
} else if ("data" in opts) {
|
2348 |
+
// install default initSelection when applied to hidden input and data is local
|
2349 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2350 |
+
var id = element.val();
|
2351 |
+
//search in data by id, storing the actual matching item
|
2352 |
+
var match = null;
|
2353 |
+
opts.query({
|
2354 |
+
matcher: function(term, text, el){
|
2355 |
+
var is_match = equal(id, opts.id(el));
|
2356 |
+
if (is_match) {
|
2357 |
+
match = el;
|
2358 |
+
}
|
2359 |
+
return is_match;
|
2360 |
+
},
|
2361 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2362 |
+
callback(match);
|
2363 |
+
}
|
2364 |
+
});
|
2365 |
+
};
|
2366 |
+
}
|
2367 |
+
|
2368 |
+
return opts;
|
2369 |
+
},
|
2370 |
+
|
2371 |
+
// single
|
2372 |
+
getPlaceholder: function() {
|
2373 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
2374 |
+
if (this.select) {
|
2375 |
+
if (this.getPlaceholderOption() === undefined) {
|
2376 |
+
return undefined;
|
2377 |
+
}
|
2378 |
+
}
|
2379 |
+
|
2380 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
2381 |
+
},
|
2382 |
+
|
2383 |
+
// single
|
2384 |
+
setPlaceholder: function () {
|
2385 |
+
var placeholder = this.getPlaceholder();
|
2386 |
+
|
2387 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
2388 |
+
|
2389 |
+
// check for a placeholder option if attached to a select
|
2390 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
2391 |
+
|
2392 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
2393 |
+
|
2394 |
+
this.selection.addClass("select2-default");
|
2395 |
+
|
2396 |
+
this.container.removeClass("select2-allowclear");
|
2397 |
+
}
|
2398 |
+
},
|
2399 |
+
|
2400 |
+
// single
|
2401 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
2402 |
+
var selected = 0, self = this, showSearchInput = true;
|
2403 |
+
|
2404 |
+
// find the selected element in the result list
|
2405 |
+
|
2406 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
2407 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
2408 |
+
selected = i;
|
2409 |
+
return false;
|
2410 |
+
}
|
2411 |
+
});
|
2412 |
+
|
2413 |
+
// and highlight it
|
2414 |
+
if (noHighlightUpdate !== false) {
|
2415 |
+
if (initial === true && selected >= 0) {
|
2416 |
+
this.highlight(selected);
|
2417 |
+
} else {
|
2418 |
+
this.highlight(0);
|
2419 |
+
}
|
2420 |
+
}
|
2421 |
+
|
2422 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
2423 |
+
|
2424 |
+
if (initial === true) {
|
2425 |
+
var min = this.opts.minimumResultsForSearch;
|
2426 |
+
if (min >= 0) {
|
2427 |
+
this.showSearch(countResults(data.results) >= min);
|
2428 |
+
}
|
2429 |
+
}
|
2430 |
+
},
|
2431 |
+
|
2432 |
+
// single
|
2433 |
+
showSearch: function(showSearchInput) {
|
2434 |
+
if (this.showSearchInput === showSearchInput) return;
|
2435 |
+
|
2436 |
+
this.showSearchInput = showSearchInput;
|
2437 |
+
|
2438 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
2439 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
2440 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
2441 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
2442 |
+
},
|
2443 |
+
|
2444 |
+
// single
|
2445 |
+
onSelect: function (data, options) {
|
2446 |
+
|
2447 |
+
if (!this.triggerSelect(data)) { return; }
|
2448 |
+
|
2449 |
+
var old = this.opts.element.val(),
|
2450 |
+
oldData = this.data();
|
2451 |
+
|
2452 |
+
this.opts.element.val(this.id(data));
|
2453 |
+
this.updateSelection(data);
|
2454 |
+
|
2455 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
2456 |
+
|
2457 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
2458 |
+
this.close();
|
2459 |
+
|
2460 |
+
if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
|
2461 |
+
this.focusser.focus();
|
2462 |
+
}
|
2463 |
+
|
2464 |
+
if (!equal(old, this.id(data))) {
|
2465 |
+
this.triggerChange({ added: data, removed: oldData });
|
2466 |
+
}
|
2467 |
+
},
|
2468 |
+
|
2469 |
+
// single
|
2470 |
+
updateSelection: function (data) {
|
2471 |
+
|
2472 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
2473 |
+
|
2474 |
+
this.selection.data("select2-data", data);
|
2475 |
+
|
2476 |
+
container.empty();
|
2477 |
+
if (data !== null) {
|
2478 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
2479 |
+
}
|
2480 |
+
if (formatted !== undefined) {
|
2481 |
+
container.append(formatted);
|
2482 |
+
}
|
2483 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
2484 |
+
if (cssClass !== undefined) {
|
2485 |
+
container.addClass(cssClass);
|
2486 |
+
}
|
2487 |
+
|
2488 |
+
this.selection.removeClass("select2-default");
|
2489 |
+
|
2490 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
2491 |
+
this.container.addClass("select2-allowclear");
|
2492 |
+
}
|
2493 |
+
},
|
2494 |
+
|
2495 |
+
// single
|
2496 |
+
val: function () {
|
2497 |
+
var val,
|
2498 |
+
triggerChange = false,
|
2499 |
+
data = null,
|
2500 |
+
self = this,
|
2501 |
+
oldData = this.data();
|
2502 |
+
|
2503 |
+
if (arguments.length === 0) {
|
2504 |
+
return this.opts.element.val();
|
2505 |
+
}
|
2506 |
+
|
2507 |
+
val = arguments[0];
|
2508 |
+
|
2509 |
+
if (arguments.length > 1) {
|
2510 |
+
triggerChange = arguments[1];
|
2511 |
+
}
|
2512 |
+
|
2513 |
+
if (this.select) {
|
2514 |
+
this.select
|
2515 |
+
.val(val)
|
2516 |
+
.find("option").filter(function() { return this.selected }).each2(function (i, elm) {
|
2517 |
+
data = self.optionToData(elm);
|
2518 |
+
return false;
|
2519 |
+
});
|
2520 |
+
this.updateSelection(data);
|
2521 |
+
this.setPlaceholder();
|
2522 |
+
if (triggerChange) {
|
2523 |
+
this.triggerChange({added: data, removed:oldData});
|
2524 |
+
}
|
2525 |
+
} else {
|
2526 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
2527 |
+
if (!val && val !== 0) {
|
2528 |
+
this.clear(triggerChange);
|
2529 |
+
return;
|
2530 |
+
}
|
2531 |
+
if (this.opts.initSelection === undefined) {
|
2532 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
2533 |
+
}
|
2534 |
+
this.opts.element.val(val);
|
2535 |
+
this.opts.initSelection(this.opts.element, function(data){
|
2536 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
2537 |
+
self.updateSelection(data);
|
2538 |
+
self.setPlaceholder();
|
2539 |
+
if (triggerChange) {
|
2540 |
+
self.triggerChange({added: data, removed:oldData});
|
2541 |
+
}
|
2542 |
+
});
|
2543 |
+
}
|
2544 |
+
},
|
2545 |
+
|
2546 |
+
// single
|
2547 |
+
clearSearch: function () {
|
2548 |
+
this.search.val("");
|
2549 |
+
this.focusser.val("");
|
2550 |
+
},
|
2551 |
+
|
2552 |
+
// single
|
2553 |
+
data: function(value) {
|
2554 |
+
var data,
|
2555 |
+
triggerChange = false;
|
2556 |
+
|
2557 |
+
if (arguments.length === 0) {
|
2558 |
+
data = this.selection.data("select2-data");
|
2559 |
+
if (data == undefined) data = null;
|
2560 |
+
return data;
|
2561 |
+
} else {
|
2562 |
+
if (arguments.length > 1) {
|
2563 |
+
triggerChange = arguments[1];
|
2564 |
+
}
|
2565 |
+
if (!value) {
|
2566 |
+
this.clear(triggerChange);
|
2567 |
+
} else {
|
2568 |
+
data = this.data();
|
2569 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
2570 |
+
this.updateSelection(value);
|
2571 |
+
if (triggerChange) {
|
2572 |
+
this.triggerChange({added: value, removed:data});
|
2573 |
+
}
|
2574 |
+
}
|
2575 |
+
}
|
2576 |
+
}
|
2577 |
+
});
|
2578 |
+
|
2579 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
2580 |
+
|
2581 |
+
// multi
|
2582 |
+
createContainer: function () {
|
2583 |
+
var container = $(document.createElement("div")).attr({
|
2584 |
+
"class": "select2-container select2-container-multi"
|
2585 |
+
}).html([
|
2586 |
+
"<ul class='select2-choices'>",
|
2587 |
+
" <li class='select2-search-field'>",
|
2588 |
+
" <label for='' class='select2-offscreen'></label>",
|
2589 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
|
2590 |
+
" </li>",
|
2591 |
+
"</ul>",
|
2592 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
2593 |
+
" <ul class='select2-results'>",
|
2594 |
+
" </ul>",
|
2595 |
+
"</div>"].join(""));
|
2596 |
+
return container;
|
2597 |
+
},
|
2598 |
+
|
2599 |
+
// multi
|
2600 |
+
prepareOpts: function () {
|
2601 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
2602 |
+
self=this;
|
2603 |
+
|
2604 |
+
// TODO validate placeholder is a string if specified
|
2605 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
2606 |
+
// install the selection initializer
|
2607 |
+
opts.initSelection = function (element, callback) {
|
2608 |
+
|
2609 |
+
var data = [];
|
2610 |
+
|
2611 |
+
element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
|
2612 |
+
data.push(self.optionToData(elm));
|
2613 |
+
});
|
2614 |
+
callback(data);
|
2615 |
+
};
|
2616 |
+
} else if ("data" in opts) {
|
2617 |
+
// install default initSelection when applied to hidden input and data is local
|
2618 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
2619 |
+
var ids = splitVal(element.val(), opts.separator, opts.transformVal);
|
2620 |
+
//search in data by array of ids, storing matching items in a list
|
2621 |
+
var matches = [];
|
2622 |
+
opts.query({
|
2623 |
+
matcher: function(term, text, el){
|
2624 |
+
var is_match = $.grep(ids, function(id) {
|
2625 |
+
return equal(id, opts.id(el));
|
2626 |
+
}).length;
|
2627 |
+
if (is_match) {
|
2628 |
+
matches.push(el);
|
2629 |
+
}
|
2630 |
+
return is_match;
|
2631 |
+
},
|
2632 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
2633 |
+
// reorder matches based on the order they appear in the ids array because right now
|
2634 |
+
// they are in the order in which they appear in data array
|
2635 |
+
var ordered = [];
|
2636 |
+
for (var i = 0; i < ids.length; i++) {
|
2637 |
+
var id = ids[i];
|
2638 |
+
for (var j = 0; j < matches.length; j++) {
|
2639 |
+
var match = matches[j];
|
2640 |
+
if (equal(id, opts.id(match))) {
|
2641 |
+
ordered.push(match);
|
2642 |
+
matches.splice(j, 1);
|
2643 |
+
break;
|
2644 |
+
}
|
2645 |
+
}
|
2646 |
+
}
|
2647 |
+
callback(ordered);
|
2648 |
+
}
|
2649 |
+
});
|
2650 |
+
};
|
2651 |
+
}
|
2652 |
+
|
2653 |
+
return opts;
|
2654 |
+
},
|
2655 |
+
|
2656 |
+
// multi
|
2657 |
+
selectChoice: function (choice) {
|
2658 |
+
|
2659 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
2660 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
2661 |
+
|
2662 |
+
} else {
|
2663 |
+
if (selected.length) {
|
2664 |
+
this.opts.element.trigger("choice-deselected", selected);
|
2665 |
+
}
|
2666 |
+
selected.removeClass("select2-search-choice-focus");
|
2667 |
+
if (choice && choice.length) {
|
2668 |
+
this.close();
|
2669 |
+
choice.addClass("select2-search-choice-focus");
|
2670 |
+
this.opts.element.trigger("choice-selected", choice);
|
2671 |
+
}
|
2672 |
+
}
|
2673 |
+
},
|
2674 |
+
|
2675 |
+
// multi
|
2676 |
+
destroy: function() {
|
2677 |
+
$("label[for='" + this.search.attr('id') + "']")
|
2678 |
+
.attr('for', this.opts.element.attr("id"));
|
2679 |
+
this.parent.destroy.apply(this, arguments);
|
2680 |
+
|
2681 |
+
cleanupJQueryElements.call(this,
|
2682 |
+
"searchContainer",
|
2683 |
+
"selection"
|
2684 |
+
);
|
2685 |
+
},
|
2686 |
+
|
2687 |
+
// multi
|
2688 |
+
initContainer: function () {
|
2689 |
+
|
2690 |
+
var selector = ".select2-choices", selection;
|
2691 |
+
|
2692 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
2693 |
+
this.selection = selection = this.container.find(selector);
|
2694 |
+
|
2695 |
+
var _this = this;
|
2696 |
+
this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
|
2697 |
+
_this.search[0].focus();
|
2698 |
+
_this.selectChoice($(this));
|
2699 |
+
});
|
2700 |
+
|
2701 |
+
// rewrite labels from original element to focusser
|
2702 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
2703 |
+
|
2704 |
+
this.search.prev()
|
2705 |
+
.text($("label[for='" + this.opts.element.attr("id") + "']").text())
|
2706 |
+
.attr('for', this.search.attr('id'));
|
2707 |
+
this.opts.element.focus(this.bind(function () { this.focus(); }));
|
2708 |
+
|
2709 |
+
this.search.on("input paste", this.bind(function() {
|
2710 |
+
if (this.search.attr('placeholder') && this.search.val().length == 0) return;
|
2711 |
+
if (!this.isInterfaceEnabled()) return;
|
2712 |
+
if (!this.opened()) {
|
2713 |
+
this.open();
|
2714 |
+
}
|
2715 |
+
}));
|
2716 |
+
|
2717 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
2718 |
+
|
2719 |
+
this.keydowns = 0;
|
2720 |
+
this.search.on("keydown", this.bind(function (e) {
|
2721 |
+
if (!this.isInterfaceEnabled()) return;
|
2722 |
+
|
2723 |
+
++this.keydowns;
|
2724 |
+
var selected = selection.find(".select2-search-choice-focus");
|
2725 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
2726 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
2727 |
+
var pos = getCursorInfo(this.search);
|
2728 |
+
|
2729 |
+
if (selected.length &&
|
2730 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
2731 |
+
var selectedChoice = selected;
|
2732 |
+
if (e.which == KEY.LEFT && prev.length) {
|
2733 |
+
selectedChoice = prev;
|
2734 |
+
}
|
2735 |
+
else if (e.which == KEY.RIGHT) {
|
2736 |
+
selectedChoice = next.length ? next : null;
|
2737 |
+
}
|
2738 |
+
else if (e.which === KEY.BACKSPACE) {
|
2739 |
+
if (this.unselect(selected.first())) {
|
2740 |
+
this.search.width(10);
|
2741 |
+
selectedChoice = prev.length ? prev : next;
|
2742 |
+
}
|
2743 |
+
} else if (e.which == KEY.DELETE) {
|
2744 |
+
if (this.unselect(selected.first())) {
|
2745 |
+
this.search.width(10);
|
2746 |
+
selectedChoice = next.length ? next : null;
|
2747 |
+
}
|
2748 |
+
} else if (e.which == KEY.ENTER) {
|
2749 |
+
selectedChoice = null;
|
2750 |
+
}
|
2751 |
+
|
2752 |
+
this.selectChoice(selectedChoice);
|
2753 |
+
killEvent(e);
|
2754 |
+
if (!selectedChoice || !selectedChoice.length) {
|
2755 |
+
this.open();
|
2756 |
+
}
|
2757 |
+
return;
|
2758 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
2759 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
2760 |
+
|
2761 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
2762 |
+
killEvent(e);
|
2763 |
+
return;
|
2764 |
+
} else {
|
2765 |
+
this.selectChoice(null);
|
2766 |
+
}
|
2767 |
+
|
2768 |
+
if (this.opened()) {
|
2769 |
+
switch (e.which) {
|
2770 |
+
case KEY.UP:
|
2771 |
+
case KEY.DOWN:
|
2772 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
2773 |
+
killEvent(e);
|
2774 |
+
return;
|
2775 |
+
case KEY.ENTER:
|
2776 |
+
this.selectHighlighted();
|
2777 |
+
killEvent(e);
|
2778 |
+
return;
|
2779 |
+
case KEY.TAB:
|
2780 |
+
this.selectHighlighted({noFocus:true});
|
2781 |
+
this.close();
|
2782 |
+
return;
|
2783 |
+
case KEY.ESC:
|
2784 |
+
this.cancel(e);
|
2785 |
+
killEvent(e);
|
2786 |
+
return;
|
2787 |
+
}
|
2788 |
+
}
|
2789 |
+
|
2790 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
2791 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
2792 |
+
return;
|
2793 |
+
}
|
2794 |
+
|
2795 |
+
if (e.which === KEY.ENTER) {
|
2796 |
+
if (this.opts.openOnEnter === false) {
|
2797 |
+
return;
|
2798 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
2799 |
+
return;
|
2800 |
+
}
|
2801 |
+
}
|
2802 |
+
|
2803 |
+
this.open();
|
2804 |
+
|
2805 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
2806 |
+
// prevent the page from scrolling
|
2807 |
+
killEvent(e);
|
2808 |
+
}
|
2809 |
+
|
2810 |
+
if (e.which === KEY.ENTER) {
|
2811 |
+
// prevent form from being submitted
|
2812 |
+
killEvent(e);
|
2813 |
+
}
|
2814 |
+
|
2815 |
+
}));
|
2816 |
+
|
2817 |
+
this.search.on("keyup", this.bind(function (e) {
|
2818 |
+
this.keydowns = 0;
|
2819 |
+
this.resizeSearch();
|
2820 |
+
})
|
2821 |
+
);
|
2822 |
+
|
2823 |
+
this.search.on("blur", this.bind(function(e) {
|
2824 |
+
this.container.removeClass("select2-container-active");
|
2825 |
+
this.search.removeClass("select2-focused");
|
2826 |
+
this.selectChoice(null);
|
2827 |
+
if (!this.opened()) this.clearSearch();
|
2828 |
+
e.stopImmediatePropagation();
|
2829 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
2830 |
+
}));
|
2831 |
+
|
2832 |
+
this.container.on("click", selector, this.bind(function (e) {
|
2833 |
+
if (!this.isInterfaceEnabled()) return;
|
2834 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
2835 |
+
// clicked inside a select2 search choice, do not open
|
2836 |
+
return;
|
2837 |
+
}
|
2838 |
+
this.selectChoice(null);
|
2839 |
+
this.clearPlaceholder();
|
2840 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2841 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2842 |
+
}
|
2843 |
+
this.open();
|
2844 |
+
this.focusSearch();
|
2845 |
+
e.preventDefault();
|
2846 |
+
}));
|
2847 |
+
|
2848 |
+
this.container.on("focus", selector, this.bind(function () {
|
2849 |
+
if (!this.isInterfaceEnabled()) return;
|
2850 |
+
if (!this.container.hasClass("select2-container-active")) {
|
2851 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
2852 |
+
}
|
2853 |
+
this.container.addClass("select2-container-active");
|
2854 |
+
this.dropdown.addClass("select2-drop-active");
|
2855 |
+
this.clearPlaceholder();
|
2856 |
+
}));
|
2857 |
+
|
2858 |
+
this.initContainerWidth();
|
2859 |
+
this.opts.element.hide();
|
2860 |
+
|
2861 |
+
// set the placeholder if necessary
|
2862 |
+
this.clearSearch();
|
2863 |
+
},
|
2864 |
+
|
2865 |
+
// multi
|
2866 |
+
enableInterface: function() {
|
2867 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
2868 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
2869 |
+
}
|
2870 |
+
},
|
2871 |
+
|
2872 |
+
// multi
|
2873 |
+
initSelection: function () {
|
2874 |
+
var data;
|
2875 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
2876 |
+
this.updateSelection([]);
|
2877 |
+
this.close();
|
2878 |
+
// set the placeholder if necessary
|
2879 |
+
this.clearSearch();
|
2880 |
+
}
|
2881 |
+
if (this.select || this.opts.element.val() !== "") {
|
2882 |
+
var self = this;
|
2883 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
2884 |
+
if (data !== undefined && data !== null) {
|
2885 |
+
self.updateSelection(data);
|
2886 |
+
self.close();
|
2887 |
+
// set the placeholder if necessary
|
2888 |
+
self.clearSearch();
|
2889 |
+
}
|
2890 |
+
});
|
2891 |
+
}
|
2892 |
+
},
|
2893 |
+
|
2894 |
+
// multi
|
2895 |
+
clearSearch: function () {
|
2896 |
+
var placeholder = this.getPlaceholder(),
|
2897 |
+
maxWidth = this.getMaxSearchWidth();
|
2898 |
+
|
2899 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
2900 |
+
this.search.val(placeholder).addClass("select2-default");
|
2901 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
2902 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
2903 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
2904 |
+
} else {
|
2905 |
+
this.search.val("").width(10);
|
2906 |
+
}
|
2907 |
+
},
|
2908 |
+
|
2909 |
+
// multi
|
2910 |
+
clearPlaceholder: function () {
|
2911 |
+
if (this.search.hasClass("select2-default")) {
|
2912 |
+
this.search.val("").removeClass("select2-default");
|
2913 |
+
}
|
2914 |
+
},
|
2915 |
+
|
2916 |
+
// multi
|
2917 |
+
opening: function () {
|
2918 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
2919 |
+
this.resizeSearch();
|
2920 |
+
|
2921 |
+
this.parent.opening.apply(this, arguments);
|
2922 |
+
|
2923 |
+
this.focusSearch();
|
2924 |
+
|
2925 |
+
// initializes search's value with nextSearchTerm (if defined by user)
|
2926 |
+
// ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
|
2927 |
+
if(this.search.val() === "") {
|
2928 |
+
if(this.nextSearchTerm != undefined){
|
2929 |
+
this.search.val(this.nextSearchTerm);
|
2930 |
+
this.search.select();
|
2931 |
+
}
|
2932 |
+
}
|
2933 |
+
|
2934 |
+
this.updateResults(true);
|
2935 |
+
if (this.opts.shouldFocusInput(this)) {
|
2936 |
+
this.search.focus();
|
2937 |
+
}
|
2938 |
+
this.opts.element.trigger($.Event("select2-open"));
|
2939 |
+
},
|
2940 |
+
|
2941 |
+
// multi
|
2942 |
+
close: function () {
|
2943 |
+
if (!this.opened()) return;
|
2944 |
+
this.parent.close.apply(this, arguments);
|
2945 |
+
},
|
2946 |
+
|
2947 |
+
// multi
|
2948 |
+
focus: function () {
|
2949 |
+
this.close();
|
2950 |
+
this.search.focus();
|
2951 |
+
},
|
2952 |
+
|
2953 |
+
// multi
|
2954 |
+
isFocused: function () {
|
2955 |
+
return this.search.hasClass("select2-focused");
|
2956 |
+
},
|
2957 |
+
|
2958 |
+
// multi
|
2959 |
+
updateSelection: function (data) {
|
2960 |
+
var ids = [], filtered = [], self = this;
|
2961 |
+
|
2962 |
+
// filter out duplicates
|
2963 |
+
$(data).each(function () {
|
2964 |
+
if (indexOf(self.id(this), ids) < 0) {
|
2965 |
+
ids.push(self.id(this));
|
2966 |
+
filtered.push(this);
|
2967 |
+
}
|
2968 |
+
});
|
2969 |
+
data = filtered;
|
2970 |
+
|
2971 |
+
this.selection.find(".select2-search-choice").remove();
|
2972 |
+
$(data).each(function () {
|
2973 |
+
self.addSelectedChoice(this);
|
2974 |
+
});
|
2975 |
+
self.postprocessResults();
|
2976 |
+
},
|
2977 |
+
|
2978 |
+
// multi
|
2979 |
+
tokenize: function() {
|
2980 |
+
var input = this.search.val();
|
2981 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
2982 |
+
if (input != null && input != undefined) {
|
2983 |
+
this.search.val(input);
|
2984 |
+
if (input.length > 0) {
|
2985 |
+
this.open();
|
2986 |
+
}
|
2987 |
+
}
|
2988 |
+
|
2989 |
+
},
|
2990 |
+
|
2991 |
+
// multi
|
2992 |
+
onSelect: function (data, options) {
|
2993 |
+
|
2994 |
+
if (!this.triggerSelect(data) || data.text === "") { return; }
|
2995 |
+
|
2996 |
+
this.addSelectedChoice(data);
|
2997 |
+
|
2998 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
2999 |
+
|
3000 |
+
// keep track of the search's value before it gets cleared
|
3001 |
+
this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
|
3002 |
+
|
3003 |
+
this.clearSearch();
|
3004 |
+
this.updateResults();
|
3005 |
+
|
3006 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
|
3007 |
+
|
3008 |
+
if (this.opts.closeOnSelect) {
|
3009 |
+
this.close();
|
3010 |
+
this.search.width(10);
|
3011 |
+
} else {
|
3012 |
+
if (this.countSelectableResults()>0) {
|
3013 |
+
this.search.width(10);
|
3014 |
+
this.resizeSearch();
|
3015 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
3016 |
+
// if we reached max selection size repaint the results so choices
|
3017 |
+
// are replaced with the max selection reached message
|
3018 |
+
this.updateResults(true);
|
3019 |
+
} else {
|
3020 |
+
// initializes search's value with nextSearchTerm and update search result
|
3021 |
+
if(this.nextSearchTerm != undefined){
|
3022 |
+
this.search.val(this.nextSearchTerm);
|
3023 |
+
this.updateResults();
|
3024 |
+
this.search.select();
|
3025 |
+
}
|
3026 |
+
}
|
3027 |
+
this.positionDropdown();
|
3028 |
+
} else {
|
3029 |
+
// if nothing left to select close
|
3030 |
+
this.close();
|
3031 |
+
this.search.width(10);
|
3032 |
+
}
|
3033 |
+
}
|
3034 |
+
|
3035 |
+
// since its not possible to select an element that has already been
|
3036 |
+
// added we do not need to check if this is a new element before firing change
|
3037 |
+
this.triggerChange({ added: data });
|
3038 |
+
|
3039 |
+
if (!options || !options.noFocus)
|
3040 |
+
this.focusSearch();
|
3041 |
+
},
|
3042 |
+
|
3043 |
+
// multi
|
3044 |
+
cancel: function () {
|
3045 |
+
this.close();
|
3046 |
+
this.focusSearch();
|
3047 |
+
},
|
3048 |
+
|
3049 |
+
addSelectedChoice: function (data) {
|
3050 |
+
var enableChoice = !data.locked,
|
3051 |
+
enabledItem = $(
|
3052 |
+
"<li class='select2-search-choice'>" +
|
3053 |
+
" <div></div>" +
|
3054 |
+
" <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
|
3055 |
+
"</li>"),
|
3056 |
+
disabledItem = $(
|
3057 |
+
"<li class='select2-search-choice select2-locked'>" +
|
3058 |
+
"<div></div>" +
|
3059 |
+
"</li>");
|
3060 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
3061 |
+
id = this.id(data),
|
3062 |
+
val = this.getVal(),
|
3063 |
+
formatted,
|
3064 |
+
cssClass;
|
3065 |
+
|
3066 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
3067 |
+
if (formatted != undefined) {
|
3068 |
+
choice.find("div").replaceWith($("<div></div>").html(formatted));
|
3069 |
+
}
|
3070 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
3071 |
+
if (cssClass != undefined) {
|
3072 |
+
choice.addClass(cssClass);
|
3073 |
+
}
|
3074 |
+
|
3075 |
+
if(enableChoice){
|
3076 |
+
choice.find(".select2-search-choice-close")
|
3077 |
+
.on("mousedown", killEvent)
|
3078 |
+
.on("click dblclick", this.bind(function (e) {
|
3079 |
+
if (!this.isInterfaceEnabled()) return;
|
3080 |
+
|
3081 |
+
this.unselect($(e.target));
|
3082 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
3083 |
+
killEvent(e);
|
3084 |
+
this.close();
|
3085 |
+
this.focusSearch();
|
3086 |
+
})).on("focus", this.bind(function () {
|
3087 |
+
if (!this.isInterfaceEnabled()) return;
|
3088 |
+
this.container.addClass("select2-container-active");
|
3089 |
+
this.dropdown.addClass("select2-drop-active");
|
3090 |
+
}));
|
3091 |
+
}
|
3092 |
+
|
3093 |
+
choice.data("select2-data", data);
|
3094 |
+
choice.insertBefore(this.searchContainer);
|
3095 |
+
|
3096 |
+
val.push(id);
|
3097 |
+
this.setVal(val);
|
3098 |
+
},
|
3099 |
+
|
3100 |
+
// multi
|
3101 |
+
unselect: function (selected) {
|
3102 |
+
var val = this.getVal(),
|
3103 |
+
data,
|
3104 |
+
index;
|
3105 |
+
selected = selected.closest(".select2-search-choice");
|
3106 |
+
|
3107 |
+
if (selected.length === 0) {
|
3108 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
3109 |
+
}
|
3110 |
+
|
3111 |
+
data = selected.data("select2-data");
|
3112 |
+
|
3113 |
+
if (!data) {
|
3114 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
3115 |
+
// and invoked on an element already removed
|
3116 |
+
return;
|
3117 |
+
}
|
3118 |
+
|
3119 |
+
var evt = $.Event("select2-removing");
|
3120 |
+
evt.val = this.id(data);
|
3121 |
+
evt.choice = data;
|
3122 |
+
this.opts.element.trigger(evt);
|
3123 |
+
|
3124 |
+
if (evt.isDefaultPrevented()) {
|
3125 |
+
return false;
|
3126 |
+
}
|
3127 |
+
|
3128 |
+
while((index = indexOf(this.id(data), val)) >= 0) {
|
3129 |
+
val.splice(index, 1);
|
3130 |
+
this.setVal(val);
|
3131 |
+
if (this.select) this.postprocessResults();
|
3132 |
+
}
|
3133 |
+
|
3134 |
+
selected.remove();
|
3135 |
+
|
3136 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
3137 |
+
this.triggerChange({ removed: data });
|
3138 |
+
|
3139 |
+
return true;
|
3140 |
+
},
|
3141 |
+
|
3142 |
+
// multi
|
3143 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
3144 |
+
var val = this.getVal(),
|
3145 |
+
choices = this.results.find(".select2-result"),
|
3146 |
+
compound = this.results.find(".select2-result-with-children"),
|
3147 |
+
self = this;
|
3148 |
+
|
3149 |
+
choices.each2(function (i, choice) {
|
3150 |
+
var id = self.id(choice.data("select2-data"));
|
3151 |
+
if (indexOf(id, val) >= 0) {
|
3152 |
+
choice.addClass("select2-selected");
|
3153 |
+
// mark all children of the selected parent as selected
|
3154 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
3155 |
+
}
|
3156 |
+
});
|
3157 |
+
|
3158 |
+
compound.each2(function(i, choice) {
|
3159 |
+
// hide an optgroup if it doesn't have any selectable children
|
3160 |
+
if (!choice.is('.select2-result-selectable')
|
3161 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
3162 |
+
choice.addClass("select2-selected");
|
3163 |
+
}
|
3164 |
+
});
|
3165 |
+
|
3166 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
|
3167 |
+
self.highlight(0);
|
3168 |
+
}
|
3169 |
+
|
3170 |
+
//If all results are chosen render formatNoMatches
|
3171 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
3172 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
3173 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
3174 |
+
this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
|
3175 |
+
}
|
3176 |
+
}
|
3177 |
+
}
|
3178 |
+
|
3179 |
+
},
|
3180 |
+
|
3181 |
+
// multi
|
3182 |
+
getMaxSearchWidth: function() {
|
3183 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
3184 |
+
},
|
3185 |
+
|
3186 |
+
// multi
|
3187 |
+
resizeSearch: function () {
|
3188 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
3189 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
3190 |
+
|
3191 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
3192 |
+
|
3193 |
+
left = this.search.offset().left;
|
3194 |
+
|
3195 |
+
maxWidth = this.selection.width();
|
3196 |
+
containerLeft = this.selection.offset().left;
|
3197 |
+
|
3198 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
3199 |
+
|
3200 |
+
if (searchWidth < minimumWidth) {
|
3201 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3202 |
+
}
|
3203 |
+
|
3204 |
+
if (searchWidth < 40) {
|
3205 |
+
searchWidth = maxWidth - sideBorderPadding;
|
3206 |
+
}
|
3207 |
+
|
3208 |
+
if (searchWidth <= 0) {
|
3209 |
+
searchWidth = minimumWidth;
|
3210 |
+
}
|
3211 |
+
|
3212 |
+
this.search.width(Math.floor(searchWidth));
|
3213 |
+
},
|
3214 |
+
|
3215 |
+
// multi
|
3216 |
+
getVal: function () {
|
3217 |
+
var val;
|
3218 |
+
if (this.select) {
|
3219 |
+
val = this.select.val();
|
3220 |
+
return val === null ? [] : val;
|
3221 |
+
} else {
|
3222 |
+
val = this.opts.element.val();
|
3223 |
+
return splitVal(val, this.opts.separator, this.opts.transformVal);
|
3224 |
+
}
|
3225 |
+
},
|
3226 |
+
|
3227 |
+
// multi
|
3228 |
+
setVal: function (val) {
|
3229 |
+
var unique;
|
3230 |
+
if (this.select) {
|
3231 |
+
this.select.val(val);
|
3232 |
+
} else {
|
3233 |
+
unique = [];
|
3234 |
+
// filter out duplicates
|
3235 |
+
$(val).each(function () {
|
3236 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
3237 |
+
});
|
3238 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
3239 |
+
}
|
3240 |
+
},
|
3241 |
+
|
3242 |
+
// multi
|
3243 |
+
buildChangeDetails: function (old, current) {
|
3244 |
+
var current = current.slice(0),
|
3245 |
+
old = old.slice(0);
|
3246 |
+
|
3247 |
+
// remove intersection from each array
|
3248 |
+
for (var i = 0; i < current.length; i++) {
|
3249 |
+
for (var j = 0; j < old.length; j++) {
|
3250 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
3251 |
+
current.splice(i, 1);
|
3252 |
+
if(i>0){
|
3253 |
+
i--;
|
3254 |
+
}
|
3255 |
+
old.splice(j, 1);
|
3256 |
+
j--;
|
3257 |
+
}
|
3258 |
+
}
|
3259 |
+
}
|
3260 |
+
|
3261 |
+
return {added: current, removed: old};
|
3262 |
+
},
|
3263 |
+
|
3264 |
+
|
3265 |
+
// multi
|
3266 |
+
val: function (val, triggerChange) {
|
3267 |
+
var oldData, self=this;
|
3268 |
+
|
3269 |
+
if (arguments.length === 0) {
|
3270 |
+
return this.getVal();
|
3271 |
+
}
|
3272 |
+
|
3273 |
+
oldData=this.data();
|
3274 |
+
if (!oldData.length) oldData=[];
|
3275 |
+
|
3276 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
3277 |
+
if (!val && val !== 0) {
|
3278 |
+
this.opts.element.val("");
|
3279 |
+
this.updateSelection([]);
|
3280 |
+
this.clearSearch();
|
3281 |
+
if (triggerChange) {
|
3282 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
3283 |
+
}
|
3284 |
+
return;
|
3285 |
+
}
|
3286 |
+
|
3287 |
+
// val is a list of ids
|
3288 |
+
this.setVal(val);
|
3289 |
+
|
3290 |
+
if (this.select) {
|
3291 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
3292 |
+
if (triggerChange) {
|
3293 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
3294 |
+
}
|
3295 |
+
} else {
|
3296 |
+
if (this.opts.initSelection === undefined) {
|
3297 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
3298 |
+
}
|
3299 |
+
|
3300 |
+
this.opts.initSelection(this.opts.element, function(data){
|
3301 |
+
var ids=$.map(data, self.id);
|
3302 |
+
self.setVal(ids);
|
3303 |
+
self.updateSelection(data);
|
3304 |
+
self.clearSearch();
|
3305 |
+
if (triggerChange) {
|
3306 |
+
self.triggerChange(self.buildChangeDetails(oldData, self.data()));
|
3307 |
+
}
|
3308 |
+
});
|
3309 |
+
}
|
3310 |
+
this.clearSearch();
|
3311 |
+
},
|
3312 |
+
|
3313 |
+
// multi
|
3314 |
+
onSortStart: function() {
|
3315 |
+
if (this.select) {
|
3316 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
3317 |
+
}
|
3318 |
+
|
3319 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
3320 |
+
this.search.width(0);
|
3321 |
+
// hide the container
|
3322 |
+
this.searchContainer.hide();
|
3323 |
+
},
|
3324 |
+
|
3325 |
+
// multi
|
3326 |
+
onSortEnd:function() {
|
3327 |
+
|
3328 |
+
var val=[], self=this;
|
3329 |
+
|
3330 |
+
// show search and move it to the end of the list
|
3331 |
+
this.searchContainer.show();
|
3332 |
+
// make sure the search container is the last item in the list
|
3333 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
3334 |
+
// since we collapsed the width in dragStarted, we resize it here
|
3335 |
+
this.resizeSearch();
|
3336 |
+
|
3337 |
+
// update selection
|
3338 |
+
this.selection.find(".select2-search-choice").each(function() {
|
3339 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
3340 |
+
});
|
3341 |
+
this.setVal(val);
|
3342 |
+
this.triggerChange();
|
3343 |
+
},
|
3344 |
+
|
3345 |
+
// multi
|
3346 |
+
data: function(values, triggerChange) {
|
3347 |
+
var self=this, ids, old;
|
3348 |
+
if (arguments.length === 0) {
|
3349 |
+
return this.selection
|
3350 |
+
.children(".select2-search-choice")
|
3351 |
+
.map(function() { return $(this).data("select2-data"); })
|
3352 |
+
.get();
|
3353 |
+
} else {
|
3354 |
+
old = this.data();
|
3355 |
+
if (!values) { values = []; }
|
3356 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
3357 |
+
this.setVal(ids);
|
3358 |
+
this.updateSelection(values);
|
3359 |
+
this.clearSearch();
|
3360 |
+
if (triggerChange) {
|
3361 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
3362 |
+
}
|
3363 |
+
}
|
3364 |
+
}
|
3365 |
+
});
|
3366 |
+
|
3367 |
+
$.fn.select2 = function () {
|
3368 |
+
|
3369 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
3370 |
+
opts,
|
3371 |
+
select2,
|
3372 |
+
method, value, multiple,
|
3373 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
|
3374 |
+
valueMethods = ["opened", "isFocused", "container", "dropdown"],
|
3375 |
+
propertyMethods = ["val", "data"],
|
3376 |
+
methodsMap = { search: "externalSearch" };
|
3377 |
+
|
3378 |
+
this.each(function () {
|
3379 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
3380 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
3381 |
+
opts.element = $(this);
|
3382 |
+
|
3383 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
3384 |
+
multiple = opts.element.prop("multiple");
|
3385 |
+
} else {
|
3386 |
+
multiple = opts.multiple || false;
|
3387 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
3388 |
+
}
|
3389 |
+
|
3390 |
+
select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
|
3391 |
+
select2.init(opts);
|
3392 |
+
} else if (typeof(args[0]) === "string") {
|
3393 |
+
|
3394 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
3395 |
+
throw "Unknown method: " + args[0];
|
3396 |
+
}
|
3397 |
+
|
3398 |
+
value = undefined;
|
3399 |
+
select2 = $(this).data("select2");
|
3400 |
+
if (select2 === undefined) return;
|
3401 |
+
|
3402 |
+
method=args[0];
|
3403 |
+
|
3404 |
+
if (method === "container") {
|
3405 |
+
value = select2.container;
|
3406 |
+
} else if (method === "dropdown") {
|
3407 |
+
value = select2.dropdown;
|
3408 |
+
} else {
|
3409 |
+
if (methodsMap[method]) method = methodsMap[method];
|
3410 |
+
|
3411 |
+
value = select2[method].apply(select2, args.slice(1));
|
3412 |
+
}
|
3413 |
+
if (indexOf(args[0], valueMethods) >= 0
|
3414 |
+
|| (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
|
3415 |
+
return false; // abort the iteration, ready to return first matched value
|
3416 |
+
}
|
3417 |
+
} else {
|
3418 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
3419 |
+
}
|
3420 |
+
});
|
3421 |
+
return (value === undefined) ? this : value;
|
3422 |
+
};
|
3423 |
+
|
3424 |
+
// plugin defaults, accessible to users
|
3425 |
+
$.fn.select2.defaults = {
|
3426 |
+
width: "copy",
|
3427 |
+
loadMorePadding: 0,
|
3428 |
+
closeOnSelect: true,
|
3429 |
+
openOnEnter: true,
|
3430 |
+
containerCss: {},
|
3431 |
+
dropdownCss: {},
|
3432 |
+
containerCssClass: "",
|
3433 |
+
dropdownCssClass: "",
|
3434 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
3435 |
+
var markup=[];
|
3436 |
+
markMatch(this.text(result), query.term, markup, escapeMarkup);
|
3437 |
+
return markup.join("");
|
3438 |
+
},
|
3439 |
+
transformVal: function(val) {
|
3440 |
+
return $.trim(val);
|
3441 |
+
},
|
3442 |
+
formatSelection: function (data, container, escapeMarkup) {
|
3443 |
+
return data ? escapeMarkup(this.text(data)) : undefined;
|
3444 |
+
},
|
3445 |
+
sortResults: function (results, container, query) {
|
3446 |
+
return results;
|
3447 |
+
},
|
3448 |
+
formatResultCssClass: function(data) {return data.css;},
|
3449 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
3450 |
+
minimumResultsForSearch: 0,
|
3451 |
+
minimumInputLength: 0,
|
3452 |
+
maximumInputLength: null,
|
3453 |
+
maximumSelectionSize: 0,
|
3454 |
+
id: function (e) { return e == undefined ? null : e.id; },
|
3455 |
+
text: function (e) {
|
3456 |
+
if (e && this.data && this.data.text) {
|
3457 |
+
if ($.isFunction(this.data.text)) {
|
3458 |
+
return this.data.text(e);
|
3459 |
+
} else {
|
3460 |
+
return e[this.data.text];
|
3461 |
+
}
|
3462 |
+
} else {
|
3463 |
+
return e.text;
|
3464 |
+
}
|
3465 |
+
},
|
3466 |
+
matcher: function(term, text) {
|
3467 |
+
return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
|
3468 |
+
},
|
3469 |
+
separator: ",",
|
3470 |
+
tokenSeparators: [],
|
3471 |
+
tokenizer: defaultTokenizer,
|
3472 |
+
escapeMarkup: defaultEscapeMarkup,
|
3473 |
+
blurOnChange: false,
|
3474 |
+
selectOnBlur: false,
|
3475 |
+
adaptContainerCssClass: function(c) { return c; },
|
3476 |
+
adaptDropdownCssClass: function(c) { return null; },
|
3477 |
+
nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
|
3478 |
+
searchInputPlaceholder: '',
|
3479 |
+
createSearchChoicePosition: 'top',
|
3480 |
+
shouldFocusInput: function (instance) {
|
3481 |
+
// Attempt to detect touch devices
|
3482 |
+
var supportsTouchEvents = (('ontouchstart' in window) ||
|
3483 |
+
(navigator.msMaxTouchPoints > 0));
|
3484 |
+
|
3485 |
+
// Only devices which support touch events should be special cased
|
3486 |
+
if (!supportsTouchEvents) {
|
3487 |
+
return true;
|
3488 |
+
}
|
3489 |
+
|
3490 |
+
// Never focus the input if search is disabled
|
3491 |
+
if (instance.opts.minimumResultsForSearch < 0) {
|
3492 |
+
return false;
|
3493 |
+
}
|
3494 |
+
|
3495 |
+
return true;
|
3496 |
+
}
|
3497 |
+
};
|
3498 |
+
|
3499 |
+
$.fn.select2.locales = [];
|
3500 |
+
|
3501 |
+
$.fn.select2.locales['en'] = {
|
3502 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
3503 |
+
formatNoMatches: function () { return "No matches found"; },
|
3504 |
+
formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
|
3505 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
3506 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
3507 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
3508 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
3509 |
+
formatSearching: function () { return "Searching…"; }
|
3510 |
+
};
|
3511 |
+
|
3512 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
3513 |
+
|
3514 |
+
$.fn.select2.ajaxDefaults = {
|
3515 |
+
transport: $.ajax,
|
3516 |
+
params: {
|
3517 |
+
type: "GET",
|
3518 |
+
cache: false,
|
3519 |
+
dataType: "json"
|
3520 |
+
}
|
3521 |
+
};
|
3522 |
+
|
3523 |
+
// exports
|
3524 |
+
window.Select2 = {
|
3525 |
+
query: {
|
3526 |
+
ajax: ajax,
|
3527 |
+
local: local,
|
3528 |
+
tags: tags
|
3529 |
+
}, util: {
|
3530 |
+
debounce: debounce,
|
3531 |
+
markMatch: markMatch,
|
3532 |
+
escapeMarkup: defaultEscapeMarkup,
|
3533 |
+
stripDiacritics: stripDiacritics
|
3534 |
+
}, "class": {
|
3535 |
+
"abstract": AbstractSelect2,
|
3536 |
+
"single": SingleSelect2,
|
3537 |
+
"multi": MultiSelect2
|
3538 |
+
}
|
3539 |
+
};
|
3540 |
+
|
3541 |
+
}(jQuery));
|
assets/deps/select2-3.5.2/select2.min.js
CHANGED
@@ -1,23 +1,23 @@
|
|
1 |
-
/*
|
2 |
-
Copyright 2014 Igor Vaynberg
|
3 |
-
|
4 |
-
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
-
|
6 |
-
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
-
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
-
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
-
License or the GPL License.
|
10 |
-
|
11 |
-
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
-
|
13 |
-
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
-
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
-
|
16 |
-
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
-
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
-
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
-
permissions and limitations under the Apache License and the GPL License.
|
20 |
-
*/
|
21 |
-
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
22 |
-
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
23 |
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
1 |
+
/*
|
2 |
+
Copyright 2014 Igor Vaynberg
|
3 |
+
|
4 |
+
Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
|
5 |
+
|
6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
9 |
+
License or the GPL License.
|
10 |
+
|
11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
12 |
+
|
13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
15 |
+
|
16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
19 |
+
permissions and limitations under the Apache License and the GPL License.
|
20 |
+
*/
|
21 |
+
!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
|
22 |
+
var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
|
23 |
},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ar.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Arabic translation.
|
3 |
-
*
|
4 |
-
* Author: Adel KEDJOUR <adel@kedjour.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ar'] = {
|
10 |
-
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
13 |
-
formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
15 |
-
formatSearching: function () { return "البحث…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Arabic translation.
|
3 |
+
*
|
4 |
+
* Author: Adel KEDJOUR <adel@kedjour.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ar'] = {
|
10 |
+
formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
|
13 |
+
formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
|
15 |
+
formatSearching: function () { return "البحث…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_az.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Azerbaijani translation.
|
3 |
-
*
|
4 |
-
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['az'] = {
|
10 |
-
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
11 |
-
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
16 |
-
formatSearching: function () { return "Axtarılır…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Azerbaijani translation.
|
3 |
+
*
|
4 |
+
* Author: Farhad Safarov <farhad.safarov@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['az'] = {
|
10 |
+
formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
|
11 |
+
formatNoMatches: function () { return "Nəticə tapılmadı"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
|
16 |
+
formatSearching: function () { return "Axtarılır…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_bg.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Bulgarian translation.
|
3 |
-
*
|
4 |
-
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['bg'] = {
|
11 |
-
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
16 |
-
formatSearching: function () { return "Търсене…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Bulgarian translation.
|
3 |
+
*
|
4 |
+
* @author Lubomir Vikev <lubomirvikev@gmail.com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['bg'] = {
|
11 |
+
formatNoMatches: function () { return "Няма намерени съвпадения"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
|
16 |
+
formatSearching: function () { return "Търсене…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ca.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Catalan translation.
|
3 |
-
*
|
4 |
-
* Author: David Planella <david.planella@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ca'] = {
|
10 |
-
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
15 |
-
formatSearching: function () { return "S'està cercant…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Catalan translation.
|
3 |
+
*
|
4 |
+
* Author: David Planella <david.planella@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ca'] = {
|
10 |
+
formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
|
15 |
+
formatSearching: function () { return "S'està cercant…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_cs.js
CHANGED
@@ -1,51 +1,51 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Czech translation.
|
3 |
-
*
|
4 |
-
* Author: Michal Marek <ahoj@michal-marek.cz>
|
5 |
-
* Author - sklonovani: David Vallner <david@vallner.net>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
// use text for the numbers 2 through 4
|
10 |
-
var smallNumbers = {
|
11 |
-
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
12 |
-
3: function() { return "tři"; },
|
13 |
-
4: function() { return "čtyři"; }
|
14 |
-
}
|
15 |
-
$.fn.select2.locales['cs'] = {
|
16 |
-
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
17 |
-
formatInputTooShort: function (input, min) {
|
18 |
-
var n = min - input.length;
|
19 |
-
if (n == 1) {
|
20 |
-
return "Prosím zadejte ještě jeden znak";
|
21 |
-
} else if (n <= 4) {
|
22 |
-
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
23 |
-
} else {
|
24 |
-
return "Prosím zadejte ještě dalších "+n+" znaků";
|
25 |
-
}
|
26 |
-
},
|
27 |
-
formatInputTooLong: function (input, max) {
|
28 |
-
var n = input.length - max;
|
29 |
-
if (n == 1) {
|
30 |
-
return "Prosím zadejte o jeden znak méně";
|
31 |
-
} else if (n <= 4) {
|
32 |
-
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
33 |
-
} else {
|
34 |
-
return "Prosím zadejte o "+n+" znaků méně";
|
35 |
-
}
|
36 |
-
},
|
37 |
-
formatSelectionTooBig: function (limit) {
|
38 |
-
if (limit == 1) {
|
39 |
-
return "Můžete zvolit jen jednu položku";
|
40 |
-
} else if (limit <= 4) {
|
41 |
-
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
42 |
-
} else {
|
43 |
-
return "Můžete zvolit maximálně "+limit+" položek";
|
44 |
-
}
|
45 |
-
},
|
46 |
-
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
47 |
-
formatSearching: function () { return "Vyhledávání…"; }
|
48 |
-
};
|
49 |
-
|
50 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
51 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Czech translation.
|
3 |
+
*
|
4 |
+
* Author: Michal Marek <ahoj@michal-marek.cz>
|
5 |
+
* Author - sklonovani: David Vallner <david@vallner.net>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
// use text for the numbers 2 through 4
|
10 |
+
var smallNumbers = {
|
11 |
+
2: function(masc) { return (masc ? "dva" : "dvě"); },
|
12 |
+
3: function() { return "tři"; },
|
13 |
+
4: function() { return "čtyři"; }
|
14 |
+
}
|
15 |
+
$.fn.select2.locales['cs'] = {
|
16 |
+
formatNoMatches: function () { return "Nenalezeny žádné položky"; },
|
17 |
+
formatInputTooShort: function (input, min) {
|
18 |
+
var n = min - input.length;
|
19 |
+
if (n == 1) {
|
20 |
+
return "Prosím zadejte ještě jeden znak";
|
21 |
+
} else if (n <= 4) {
|
22 |
+
return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
|
23 |
+
} else {
|
24 |
+
return "Prosím zadejte ještě dalších "+n+" znaků";
|
25 |
+
}
|
26 |
+
},
|
27 |
+
formatInputTooLong: function (input, max) {
|
28 |
+
var n = input.length - max;
|
29 |
+
if (n == 1) {
|
30 |
+
return "Prosím zadejte o jeden znak méně";
|
31 |
+
} else if (n <= 4) {
|
32 |
+
return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
|
33 |
+
} else {
|
34 |
+
return "Prosím zadejte o "+n+" znaků méně";
|
35 |
+
}
|
36 |
+
},
|
37 |
+
formatSelectionTooBig: function (limit) {
|
38 |
+
if (limit == 1) {
|
39 |
+
return "Můžete zvolit jen jednu položku";
|
40 |
+
} else if (limit <= 4) {
|
41 |
+
return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
|
42 |
+
} else {
|
43 |
+
return "Můžete zvolit maximálně "+limit+" položek";
|
44 |
+
}
|
45 |
+
},
|
46 |
+
formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
|
47 |
+
formatSearching: function () { return "Vyhledávání…"; }
|
48 |
+
};
|
49 |
+
|
50 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
|
51 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_da.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Danish translation.
|
3 |
-
*
|
4 |
-
* Author: Anders Jenbo <anders@jenbo.dk>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['da'] = {
|
10 |
-
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
15 |
-
formatSearching: function () { return "Søger…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Danish translation.
|
3 |
+
*
|
4 |
+
* Author: Anders Jenbo <anders@jenbo.dk>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['da'] = {
|
10 |
+
formatNoMatches: function () { return "Ingen resultater fundet"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
|
15 |
+
formatSearching: function () { return "Søger…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_de.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 German translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['de'] = {
|
8 |
-
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
13 |
-
formatSearching: function () { return "Suche…"; },
|
14 |
-
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
18 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 German translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['de'] = {
|
8 |
+
formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
|
13 |
+
formatSearching: function () { return "Suche…"; },
|
14 |
+
formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
|
18 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_el.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Greek translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['el'] = {
|
10 |
-
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
15 |
-
formatSearching: function () { return "Αναζήτηση…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
19 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Greek translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['el'] = {
|
10 |
+
formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
|
15 |
+
formatSearching: function () { return "Αναζήτηση…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
|
19 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_en.js.template
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 <Language> translation.
|
3 |
-
*
|
4 |
-
* Author: Your Name <your@email>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['en'] = {
|
10 |
-
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
11 |
-
formatNoMatches: function () { return "No matches found"; },
|
12 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
13 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
14 |
-
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
16 |
-
formatSearching: function () { return "Searching…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
20 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 <Language> translation.
|
3 |
+
*
|
4 |
+
* Author: Your Name <your@email>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['en'] = {
|
10 |
+
formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
|
11 |
+
formatNoMatches: function () { return "No matches found"; },
|
12 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
|
13 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
|
14 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Loading more results…"; },
|
16 |
+
formatSearching: function () { return "Searching…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
|
20 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_es.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Spanish translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['es'] = {
|
8 |
-
formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
|
9 |
-
formatNoMatches: function () { return "No se encontraron resultados"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
14 |
-
formatSearching: function () { return "Buscando…"; },
|
15 |
-
formatAjaxError: function() { return "La carga falló"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Spanish translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['es'] = {
|
8 |
+
formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
|
9 |
+
formatNoMatches: function () { return "No se encontraron resultados"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
|
14 |
+
formatSearching: function () { return "Buscando…"; },
|
15 |
+
formatAjaxError: function() { return "La carga falló"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_et.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Estonian translation.
|
3 |
-
*
|
4 |
-
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['et'] = {
|
10 |
-
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
15 |
-
formatSearching: function () { return "Otsin.."; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Estonian translation.
|
3 |
+
*
|
4 |
+
* Author: Kuldar Kalvik <kuldar@kalvik.ee>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['et'] = {
|
10 |
+
formatNoMatches: function () { return "Tulemused puuduvad"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
|
15 |
+
formatSearching: function () { return "Otsin.."; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_eu.js
CHANGED
@@ -1,45 +1,45 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Basque translation.
|
3 |
-
*
|
4 |
-
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['eu'] = {
|
10 |
-
formatNoMatches: function () {
|
11 |
-
return "Ez da bat datorrenik aurkitu";
|
12 |
-
},
|
13 |
-
formatInputTooShort: function (input, min) {
|
14 |
-
var n = min - input.length;
|
15 |
-
if (n === 1) {
|
16 |
-
return "Idatzi karaktere bat gehiago";
|
17 |
-
} else {
|
18 |
-
return "Idatzi " + n + " karaktere gehiago";
|
19 |
-
}
|
20 |
-
},
|
21 |
-
formatInputTooLong: function (input, max) {
|
22 |
-
var n = input.length - max;
|
23 |
-
if (n === 1) {
|
24 |
-
return "Idatzi karaktere bat gutxiago";
|
25 |
-
} else {
|
26 |
-
return "Idatzi " + n + " karaktere gutxiago";
|
27 |
-
}
|
28 |
-
},
|
29 |
-
formatSelectionTooBig: function (limit) {
|
30 |
-
if (limit === 1 ) {
|
31 |
-
return "Elementu bakarra hauta dezakezu";
|
32 |
-
} else {
|
33 |
-
return limit + " elementu hauta ditzakezu soilik";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatLoadMore: function (pageNumber) {
|
37 |
-
return "Emaitza gehiago kargatzen…";
|
38 |
-
},
|
39 |
-
formatSearching: function () {
|
40 |
-
return "Bilatzen…";
|
41 |
-
}
|
42 |
-
};
|
43 |
-
|
44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
45 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Basque translation.
|
3 |
+
*
|
4 |
+
* Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['eu'] = {
|
10 |
+
formatNoMatches: function () {
|
11 |
+
return "Ez da bat datorrenik aurkitu";
|
12 |
+
},
|
13 |
+
formatInputTooShort: function (input, min) {
|
14 |
+
var n = min - input.length;
|
15 |
+
if (n === 1) {
|
16 |
+
return "Idatzi karaktere bat gehiago";
|
17 |
+
} else {
|
18 |
+
return "Idatzi " + n + " karaktere gehiago";
|
19 |
+
}
|
20 |
+
},
|
21 |
+
formatInputTooLong: function (input, max) {
|
22 |
+
var n = input.length - max;
|
23 |
+
if (n === 1) {
|
24 |
+
return "Idatzi karaktere bat gutxiago";
|
25 |
+
} else {
|
26 |
+
return "Idatzi " + n + " karaktere gutxiago";
|
27 |
+
}
|
28 |
+
},
|
29 |
+
formatSelectionTooBig: function (limit) {
|
30 |
+
if (limit === 1 ) {
|
31 |
+
return "Elementu bakarra hauta dezakezu";
|
32 |
+
} else {
|
33 |
+
return limit + " elementu hauta ditzakezu soilik";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatLoadMore: function (pageNumber) {
|
37 |
+
return "Emaitza gehiago kargatzen…";
|
38 |
+
},
|
39 |
+
formatSearching: function () {
|
40 |
+
return "Bilatzen…";
|
41 |
+
}
|
42 |
+
};
|
43 |
+
|
44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
|
45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fa.js
CHANGED
@@ -1,21 +1,21 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Persian translation.
|
3 |
-
*
|
4 |
-
* Author: Ali Choopan <choopan@arsh.co>
|
5 |
-
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['fa'] = {
|
11 |
-
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
12 |
-
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
16 |
-
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
17 |
-
formatSearching: function () { return "در حال جستجو…"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
21 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Persian translation.
|
3 |
+
*
|
4 |
+
* Author: Ali Choopan <choopan@arsh.co>
|
5 |
+
* Author: Ebrahim Byagowi <ebrahim@gnu.org>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['fa'] = {
|
11 |
+
formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
|
12 |
+
formatNoMatches: function () { return "نتیجهای یافت نشد."; },
|
13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
|
14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
|
16 |
+
formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
|
17 |
+
formatSearching: function () { return "در حال جستجو…"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
|
21 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fi.js
CHANGED
@@ -1,30 +1,30 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Finnish translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['fi'] = {
|
7 |
-
formatNoMatches: function () {
|
8 |
-
return "Ei tuloksia";
|
9 |
-
},
|
10 |
-
formatInputTooShort: function (input, min) {
|
11 |
-
var n = min - input.length;
|
12 |
-
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
13 |
-
},
|
14 |
-
formatInputTooLong: function (input, max) {
|
15 |
-
var n = input.length - max;
|
16 |
-
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
17 |
-
},
|
18 |
-
formatSelectionTooBig: function (limit) {
|
19 |
-
return "Voit valita ainoastaan " + limit + " kpl";
|
20 |
-
},
|
21 |
-
formatLoadMore: function (pageNumber) {
|
22 |
-
return "Ladataan lisää tuloksia…";
|
23 |
-
},
|
24 |
-
formatSearching: function () {
|
25 |
-
return "Etsitään…";
|
26 |
-
}
|
27 |
-
};
|
28 |
-
|
29 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
30 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Finnish translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['fi'] = {
|
7 |
+
formatNoMatches: function () {
|
8 |
+
return "Ei tuloksia";
|
9 |
+
},
|
10 |
+
formatInputTooShort: function (input, min) {
|
11 |
+
var n = min - input.length;
|
12 |
+
return "Ole hyvä ja anna " + n + " merkkiä lisää";
|
13 |
+
},
|
14 |
+
formatInputTooLong: function (input, max) {
|
15 |
+
var n = input.length - max;
|
16 |
+
return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
|
17 |
+
},
|
18 |
+
formatSelectionTooBig: function (limit) {
|
19 |
+
return "Voit valita ainoastaan " + limit + " kpl";
|
20 |
+
},
|
21 |
+
formatLoadMore: function (pageNumber) {
|
22 |
+
return "Ladataan lisää tuloksia…";
|
23 |
+
},
|
24 |
+
formatSearching: function () {
|
25 |
+
return "Etsitään…";
|
26 |
+
}
|
27 |
+
};
|
28 |
+
|
29 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
|
30 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_fr.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 French translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['fr'] = {
|
8 |
-
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
9 |
-
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
14 |
-
formatSearching: function () { return "Recherche en cours…"; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
18 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 French translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['fr'] = {
|
8 |
+
formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
|
9 |
+
formatNoMatches: function () { return "Aucun résultat trouvé"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
|
14 |
+
formatSearching: function () { return "Recherche en cours…"; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
|
18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_gl.js
CHANGED
@@ -1,45 +1,45 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Galician translation
|
3 |
-
*
|
4 |
-
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['gl'] = {
|
10 |
-
formatNoMatches: function () {
|
11 |
-
return "Non se atoparon resultados";
|
12 |
-
},
|
13 |
-
formatInputTooShort: function (input, min) {
|
14 |
-
var n = min - input.length;
|
15 |
-
if (n === 1) {
|
16 |
-
return "Engada un carácter";
|
17 |
-
} else {
|
18 |
-
return "Engada " + n + " caracteres";
|
19 |
-
}
|
20 |
-
},
|
21 |
-
formatInputTooLong: function (input, max) {
|
22 |
-
var n = input.length - max;
|
23 |
-
if (n === 1) {
|
24 |
-
return "Elimine un carácter";
|
25 |
-
} else {
|
26 |
-
return "Elimine " + n + " caracteres";
|
27 |
-
}
|
28 |
-
},
|
29 |
-
formatSelectionTooBig: function (limit) {
|
30 |
-
if (limit === 1 ) {
|
31 |
-
return "Só pode seleccionar un elemento";
|
32 |
-
} else {
|
33 |
-
return "Só pode seleccionar " + limit + " elementos";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatLoadMore: function (pageNumber) {
|
37 |
-
return "Cargando máis resultados…";
|
38 |
-
},
|
39 |
-
formatSearching: function () {
|
40 |
-
return "Buscando…";
|
41 |
-
}
|
42 |
-
};
|
43 |
-
|
44 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
45 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Galician translation
|
3 |
+
*
|
4 |
+
* Author: Leandro Regueiro <leandro.regueiro@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['gl'] = {
|
10 |
+
formatNoMatches: function () {
|
11 |
+
return "Non se atoparon resultados";
|
12 |
+
},
|
13 |
+
formatInputTooShort: function (input, min) {
|
14 |
+
var n = min - input.length;
|
15 |
+
if (n === 1) {
|
16 |
+
return "Engada un carácter";
|
17 |
+
} else {
|
18 |
+
return "Engada " + n + " caracteres";
|
19 |
+
}
|
20 |
+
},
|
21 |
+
formatInputTooLong: function (input, max) {
|
22 |
+
var n = input.length - max;
|
23 |
+
if (n === 1) {
|
24 |
+
return "Elimine un carácter";
|
25 |
+
} else {
|
26 |
+
return "Elimine " + n + " caracteres";
|
27 |
+
}
|
28 |
+
},
|
29 |
+
formatSelectionTooBig: function (limit) {
|
30 |
+
if (limit === 1 ) {
|
31 |
+
return "Só pode seleccionar un elemento";
|
32 |
+
} else {
|
33 |
+
return "Só pode seleccionar " + limit + " elementos";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatLoadMore: function (pageNumber) {
|
37 |
+
return "Cargando máis resultados…";
|
38 |
+
},
|
39 |
+
formatSearching: function () {
|
40 |
+
return "Buscando…";
|
41 |
+
}
|
42 |
+
};
|
43 |
+
|
44 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
|
45 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_he.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Hebrew translation.
|
3 |
-
*
|
4 |
-
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['he'] = {
|
10 |
-
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
15 |
-
formatSearching: function () { return "מחפש…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Hebrew translation.
|
3 |
+
*
|
4 |
+
* Author: Yakir Sitbon <http://www.yakirs.net/>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['he'] = {
|
10 |
+
formatNoMatches: function () { return "לא נמצאו התאמות"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
|
15 |
+
formatSearching: function () { return "מחפש…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hr.js
CHANGED
@@ -1,24 +1,24 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Croatian translation.
|
3 |
-
*
|
4 |
-
* @author Edi Modrić <edi.modric@gmail.com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['hr'] = {
|
11 |
-
formatNoMatches: function () { return "Nema rezultata"; },
|
12 |
-
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
13 |
-
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
14 |
-
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
15 |
-
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
16 |
-
formatSearching: function () { return "Pretraga…"; }
|
17 |
-
};
|
18 |
-
|
19 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
20 |
-
|
21 |
-
function character (n) {
|
22 |
-
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
23 |
-
}
|
24 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Croatian translation.
|
3 |
+
*
|
4 |
+
* @author Edi Modrić <edi.modric@gmail.com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['hr'] = {
|
11 |
+
formatNoMatches: function () { return "Nema rezultata"; },
|
12 |
+
formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
|
13 |
+
formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
|
14 |
+
formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
|
15 |
+
formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
|
16 |
+
formatSearching: function () { return "Pretraga…"; }
|
17 |
+
};
|
18 |
+
|
19 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
|
20 |
+
|
21 |
+
function character (n) {
|
22 |
+
return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
|
23 |
+
}
|
24 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_hu.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Hungarian translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['hu'] = {
|
8 |
-
formatNoMatches: function () { return "Nincs találat."; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
13 |
-
formatSearching: function () { return "Keresés…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Hungarian translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['hu'] = {
|
8 |
+
formatNoMatches: function () { return "Nincs találat."; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Töltés…"; },
|
13 |
+
formatSearching: function () { return "Keresés…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_id.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Indonesian translation.
|
3 |
-
*
|
4 |
-
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['id'] = {
|
10 |
-
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
15 |
-
formatSearching: function () { return "Mencari…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Indonesian translation.
|
3 |
+
*
|
4 |
+
* Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['id'] = {
|
10 |
+
formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
|
15 |
+
formatSearching: function () { return "Mencari…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_is.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Icelandic translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['is'] = {
|
8 |
-
formatNoMatches: function () { return "Ekkert fannst"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
13 |
-
formatSearching: function () { return "Leita…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Icelandic translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['is'] = {
|
8 |
+
formatNoMatches: function () { return "Ekkert fannst"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
|
13 |
+
formatSearching: function () { return "Leita…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_it.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Italian translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['it'] = {
|
8 |
-
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
13 |
-
formatSearching: function () { return "Ricerca…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
17 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Italian translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['it'] = {
|
8 |
+
formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
|
13 |
+
formatSearching: function () { return "Ricerca…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
|
17 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ja.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Japanese translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['ja'] = {
|
8 |
-
formatNoMatches: function () { return "該当なし"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "読込中・・・"; },
|
13 |
-
formatSearching: function () { return "検索中・・・"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Japanese translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['ja'] = {
|
8 |
+
formatNoMatches: function () { return "該当なし"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "読込中・・・"; },
|
13 |
+
formatSearching: function () { return "検索中・・・"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ka.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Georgian (Kartuli) translation.
|
3 |
-
*
|
4 |
-
* Author: Dimitri Kurashvili dimakura@gmail.com
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ka'] = {
|
10 |
-
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
15 |
-
formatSearching: function () { return "ძებნა…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Georgian (Kartuli) translation.
|
3 |
+
*
|
4 |
+
* Author: Dimitri Kurashvili dimakura@gmail.com
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ka'] = {
|
10 |
+
formatNoMatches: function () { return "ვერ მოიძებნა"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
|
15 |
+
formatSearching: function () { return "ძებნა…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ko.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Korean translation.
|
3 |
-
*
|
4 |
-
* @author Swen Mun <longfinfunnel@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ko'] = {
|
10 |
-
formatNoMatches: function () { return "결과 없음"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
15 |
-
formatSearching: function () { return "검색 중…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Korean translation.
|
3 |
+
*
|
4 |
+
* @author Swen Mun <longfinfunnel@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ko'] = {
|
10 |
+
formatNoMatches: function () { return "결과 없음"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
|
15 |
+
formatSearching: function () { return "검색 중…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lt.js
CHANGED
@@ -1,26 +1,26 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Lithuanian translation.
|
3 |
-
*
|
4 |
-
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['lt'] = {
|
11 |
-
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
12 |
-
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
13 |
-
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
14 |
-
formatSelectionTooBig: function (limit) {
|
15 |
-
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
16 |
-
},
|
17 |
-
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
18 |
-
formatSearching: function () { return "Ieškoma…"; }
|
19 |
-
};
|
20 |
-
|
21 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
22 |
-
|
23 |
-
function character (n) {
|
24 |
-
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
25 |
-
}
|
26 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Lithuanian translation.
|
3 |
+
*
|
4 |
+
* @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['lt'] = {
|
11 |
+
formatNoMatches: function () { return "Atitikmenų nerasta"; },
|
12 |
+
formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
|
13 |
+
formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
|
14 |
+
formatSelectionTooBig: function (limit) {
|
15 |
+
return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
|
16 |
+
},
|
17 |
+
formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
|
18 |
+
formatSearching: function () { return "Ieškoma…"; }
|
19 |
+
};
|
20 |
+
|
21 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
|
22 |
+
|
23 |
+
function character (n) {
|
24 |
+
return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
|
25 |
+
}
|
26 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_lv.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Latvian translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['lv'] = {
|
10 |
-
formatNoMatches: function () { return "Sakritību nav"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
15 |
-
formatSearching: function () { return "Meklēšana…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Latvian translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['lv'] = {
|
10 |
+
formatNoMatches: function () { return "Sakritību nav"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
|
15 |
+
formatSearching: function () { return "Meklēšana…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_mk.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Macedonian translation.
|
3 |
-
*
|
4 |
-
* Author: Marko Aleksic <psybaron@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['mk'] = {
|
10 |
-
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
15 |
-
formatSearching: function () { return "Пребарување…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
19 |
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Macedonian translation.
|
3 |
+
*
|
4 |
+
* Author: Marko Aleksic <psybaron@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['mk'] = {
|
10 |
+
formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
|
15 |
+
formatSearching: function () { return "Пребарување…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
|
19 |
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ms.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Malay translation.
|
3 |
-
*
|
4 |
-
* Author: Kepoweran <kepoweran@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ms'] = {
|
10 |
-
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
15 |
-
formatSearching: function () { return "Mencari…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Malay translation.
|
3 |
+
*
|
4 |
+
* Author: Kepoweran <kepoweran@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ms'] = {
|
10 |
+
formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
|
15 |
+
formatSearching: function () { return "Mencari…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_nb.js
CHANGED
@@ -1,22 +1,22 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Norwegian Bokmål translation.
|
3 |
-
*
|
4 |
-
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
5 |
-
* Author: Bjørn Johansen <post@bjornjohansen.no>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['nb'] = {
|
11 |
-
formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
|
12 |
-
formatNoMatches: function () { return "Ingen treff"; },
|
13 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
14 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
16 |
-
formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
|
17 |
-
formatSearching: function () { return "Søker …"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
21 |
-
})(jQuery);
|
22 |
-
|
1 |
+
/**
|
2 |
+
* Select2 Norwegian Bokmål translation.
|
3 |
+
*
|
4 |
+
* Author: Torgeir Veimo <torgeir.veimo@gmail.com>
|
5 |
+
* Author: Bjørn Johansen <post@bjornjohansen.no>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['nb'] = {
|
11 |
+
formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
|
12 |
+
formatNoMatches: function () { return "Ingen treff"; },
|
13 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
|
14 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
|
16 |
+
formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
|
17 |
+
formatSearching: function () { return "Søker …"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
|
21 |
+
})(jQuery);
|
22 |
+
|
assets/deps/select2-3.5.2/select2_locale_nl.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Dutch translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['nl'] = {
|
8 |
-
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
13 |
-
formatSearching: function () { return "Zoeken…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Dutch translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['nl'] = {
|
8 |
+
formatNoMatches: function () { return "Geen resultaten gevonden"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
|
13 |
+
formatSearching: function () { return "Zoeken…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pl.js
CHANGED
@@ -1,54 +1,54 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Polish translation.
|
3 |
-
*
|
4 |
-
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
* @author Michał Połtyn <mike@poltyn.com>
|
7 |
-
* @author Damian Zajkowski <damian.zajkowski@gmail.com>
|
8 |
-
*/
|
9 |
-
(function($) {
|
10 |
-
"use strict";
|
11 |
-
|
12 |
-
$.fn.select2.locales['pl'] = {
|
13 |
-
formatNoMatches: function() {
|
14 |
-
return "Brak wyników";
|
15 |
-
},
|
16 |
-
formatInputTooShort: function(input, min) {
|
17 |
-
return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
|
18 |
-
},
|
19 |
-
formatInputTooLong: function(input, max) {
|
20 |
-
return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
|
21 |
-
},
|
22 |
-
formatSelectionTooBig: function(limit) {
|
23 |
-
return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
|
24 |
-
},
|
25 |
-
formatLoadMore: function(pageNumber) {
|
26 |
-
return "Ładowanie wyników…";
|
27 |
-
},
|
28 |
-
formatSearching: function() {
|
29 |
-
return "Szukanie…";
|
30 |
-
}
|
31 |
-
};
|
32 |
-
|
33 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
34 |
-
|
35 |
-
function character(n, word, pluralSuffix) {
|
36 |
-
//Liczba pojedyncza - brak suffiksu
|
37 |
-
//jeden znak
|
38 |
-
//jeden element
|
39 |
-
var suffix = '';
|
40 |
-
if (n > 1 && n < 5) {
|
41 |
-
//Liczaba mnoga ilość od 2 do 4 - własny suffiks
|
42 |
-
//Dwa znaki, trzy znaki, cztery znaki.
|
43 |
-
//Dwa elementy, trzy elementy, cztery elementy
|
44 |
-
suffix = pluralSuffix;
|
45 |
-
} else if (n == 0 || n >= 5) {
|
46 |
-
//Ilość 0 suffiks ów
|
47 |
-
//Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
|
48 |
-
//Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
|
49 |
-
//Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
|
50 |
-
suffix = 'ów';
|
51 |
-
}
|
52 |
-
return " " + n + " " + word + suffix;
|
53 |
-
}
|
54 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Polish translation.
|
3 |
+
*
|
4 |
+
* @author Jan Kondratowicz <jan@kondratowicz.pl>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
* @author Michał Połtyn <mike@poltyn.com>
|
7 |
+
* @author Damian Zajkowski <damian.zajkowski@gmail.com>
|
8 |
+
*/
|
9 |
+
(function($) {
|
10 |
+
"use strict";
|
11 |
+
|
12 |
+
$.fn.select2.locales['pl'] = {
|
13 |
+
formatNoMatches: function() {
|
14 |
+
return "Brak wyników";
|
15 |
+
},
|
16 |
+
formatInputTooShort: function(input, min) {
|
17 |
+
return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
|
18 |
+
},
|
19 |
+
formatInputTooLong: function(input, max) {
|
20 |
+
return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
|
21 |
+
},
|
22 |
+
formatSelectionTooBig: function(limit) {
|
23 |
+
return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
|
24 |
+
},
|
25 |
+
formatLoadMore: function(pageNumber) {
|
26 |
+
return "Ładowanie wyników…";
|
27 |
+
},
|
28 |
+
formatSearching: function() {
|
29 |
+
return "Szukanie…";
|
30 |
+
}
|
31 |
+
};
|
32 |
+
|
33 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
|
34 |
+
|
35 |
+
function character(n, word, pluralSuffix) {
|
36 |
+
//Liczba pojedyncza - brak suffiksu
|
37 |
+
//jeden znak
|
38 |
+
//jeden element
|
39 |
+
var suffix = '';
|
40 |
+
if (n > 1 && n < 5) {
|
41 |
+
//Liczaba mnoga ilość od 2 do 4 - własny suffiks
|
42 |
+
//Dwa znaki, trzy znaki, cztery znaki.
|
43 |
+
//Dwa elementy, trzy elementy, cztery elementy
|
44 |
+
suffix = pluralSuffix;
|
45 |
+
} else if (n == 0 || n >= 5) {
|
46 |
+
//Ilość 0 suffiks ów
|
47 |
+
//Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
|
48 |
+
//Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
|
49 |
+
//Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
|
50 |
+
suffix = 'ów';
|
51 |
+
}
|
52 |
+
return " " + n + " " + word + suffix;
|
53 |
+
}
|
54 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-BR.js
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Brazilian Portuguese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['pt-BR'] = {
|
8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
-
formatAjaxError: function () { return "Erro na busca"; },
|
10 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
|
11 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
12 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
-
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
14 |
-
formatSearching: function () { return "Buscando…"; }
|
15 |
-
};
|
16 |
-
|
17 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
18 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Brazilian Portuguese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['pt-BR'] = {
|
8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
+
formatAjaxError: function () { return "Erro na busca"; },
|
10 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
|
11 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
|
12 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
13 |
+
formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
|
14 |
+
formatSearching: function () { return "Buscando…"; }
|
15 |
+
};
|
16 |
+
|
17 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
|
18 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_pt-PT.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Portuguese (Portugal) translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['pt-PT'] = {
|
8 |
-
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
13 |
-
formatSearching: function () { return "A pesquisar…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Portuguese (Portugal) translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['pt-PT'] = {
|
8 |
+
formatNoMatches: function () { return "Nenhum resultado encontrado"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
|
13 |
+
formatSearching: function () { return "A pesquisar…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ro.js
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Romanian translation.
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
|
7 |
-
$.fn.select2.locales['ro'] = {
|
8 |
-
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
9 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
10 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
11 |
-
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
12 |
-
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
13 |
-
formatSearching: function () { return "Căutare…"; }
|
14 |
-
};
|
15 |
-
|
16 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
17 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Romanian translation.
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
|
7 |
+
$.fn.select2.locales['ro'] = {
|
8 |
+
formatNoMatches: function () { return "Nu a fost găsit nimic"; },
|
9 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
|
10 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
|
11 |
+
formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
|
12 |
+
formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
|
13 |
+
formatSearching: function () { return "Căutare…"; }
|
14 |
+
};
|
15 |
+
|
16 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
|
17 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_rs.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Serbian translation.
|
3 |
-
*
|
4 |
-
* @author Limon Monte <limon.monte@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['rs'] = {
|
10 |
-
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
15 |
-
formatSearching: function () { return "Pretraga…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Serbian translation.
|
3 |
+
*
|
4 |
+
* @author Limon Monte <limon.monte@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['rs'] = {
|
10 |
+
formatNoMatches: function () { return "Ništa nije pronađeno"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
|
15 |
+
formatSearching: function () { return "Pretraga…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ru.js
CHANGED
@@ -1,23 +1,23 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Russian translation.
|
3 |
-
*
|
4 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['ru'] = {
|
10 |
-
formatNoMatches: function () { return "Совпадений не найдено"; },
|
11 |
-
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
12 |
-
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
15 |
-
formatSearching: function () { return "Поиск…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
19 |
-
|
20 |
-
function character (n) {
|
21 |
-
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
22 |
-
}
|
23 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Russian translation.
|
3 |
+
*
|
4 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['ru'] = {
|
10 |
+
formatNoMatches: function () { return "Совпадений не найдено"; },
|
11 |
+
formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
|
12 |
+
formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
|
15 |
+
formatSearching: function () { return "Поиск…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
|
19 |
+
|
20 |
+
function character (n) {
|
21 |
+
return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
|
22 |
+
}
|
23 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sk.js
CHANGED
@@ -1,50 +1,50 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Slovak translation.
|
3 |
-
*
|
4 |
-
* Author: David Vallner <david@vallner.net>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
// use text for the numbers 2 through 4
|
9 |
-
var smallNumbers = {
|
10 |
-
2: function(masc) { return (masc ? "dva" : "dve"); },
|
11 |
-
3: function() { return "tri"; },
|
12 |
-
4: function() { return "štyri"; }
|
13 |
-
};
|
14 |
-
$.fn.select2.locales['sk'] = {
|
15 |
-
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
16 |
-
formatInputTooShort: function (input, min) {
|
17 |
-
var n = min - input.length;
|
18 |
-
if (n == 1) {
|
19 |
-
return "Prosím, zadajte ešte jeden znak";
|
20 |
-
} else if (n <= 4) {
|
21 |
-
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
22 |
-
} else {
|
23 |
-
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
24 |
-
}
|
25 |
-
},
|
26 |
-
formatInputTooLong: function (input, max) {
|
27 |
-
var n = input.length - max;
|
28 |
-
if (n == 1) {
|
29 |
-
return "Prosím, zadajte o jeden znak menej";
|
30 |
-
} else if (n >= 2 && n <= 4) {
|
31 |
-
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
32 |
-
} else {
|
33 |
-
return "Prosím, zadajte o "+n+" znakov menej";
|
34 |
-
}
|
35 |
-
},
|
36 |
-
formatSelectionTooBig: function (limit) {
|
37 |
-
if (limit == 1) {
|
38 |
-
return "Môžete zvoliť len jednu položku";
|
39 |
-
} else if (limit >= 2 && limit <= 4) {
|
40 |
-
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
41 |
-
} else {
|
42 |
-
return "Môžete zvoliť najviac "+limit+" položiek";
|
43 |
-
}
|
44 |
-
},
|
45 |
-
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
46 |
-
formatSearching: function () { return "Vyhľadávanie…"; }
|
47 |
-
};
|
48 |
-
|
49 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
50 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Slovak translation.
|
3 |
+
*
|
4 |
+
* Author: David Vallner <david@vallner.net>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
// use text for the numbers 2 through 4
|
9 |
+
var smallNumbers = {
|
10 |
+
2: function(masc) { return (masc ? "dva" : "dve"); },
|
11 |
+
3: function() { return "tri"; },
|
12 |
+
4: function() { return "štyri"; }
|
13 |
+
};
|
14 |
+
$.fn.select2.locales['sk'] = {
|
15 |
+
formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
|
16 |
+
formatInputTooShort: function (input, min) {
|
17 |
+
var n = min - input.length;
|
18 |
+
if (n == 1) {
|
19 |
+
return "Prosím, zadajte ešte jeden znak";
|
20 |
+
} else if (n <= 4) {
|
21 |
+
return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
|
22 |
+
} else {
|
23 |
+
return "Prosím, zadajte ešte ďalších "+n+" znakov";
|
24 |
+
}
|
25 |
+
},
|
26 |
+
formatInputTooLong: function (input, max) {
|
27 |
+
var n = input.length - max;
|
28 |
+
if (n == 1) {
|
29 |
+
return "Prosím, zadajte o jeden znak menej";
|
30 |
+
} else if (n >= 2 && n <= 4) {
|
31 |
+
return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
|
32 |
+
} else {
|
33 |
+
return "Prosím, zadajte o "+n+" znakov menej";
|
34 |
+
}
|
35 |
+
},
|
36 |
+
formatSelectionTooBig: function (limit) {
|
37 |
+
if (limit == 1) {
|
38 |
+
return "Môžete zvoliť len jednu položku";
|
39 |
+
} else if (limit >= 2 && limit <= 4) {
|
40 |
+
return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
|
41 |
+
} else {
|
42 |
+
return "Môžete zvoliť najviac "+limit+" položiek";
|
43 |
+
}
|
44 |
+
},
|
45 |
+
formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
|
46 |
+
formatSearching: function () { return "Vyhľadávanie…"; }
|
47 |
+
};
|
48 |
+
|
49 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
|
50 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_sv.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Swedish translation.
|
3 |
-
*
|
4 |
-
* Author: Jens Rantil <jens.rantil@telavox.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['sv'] = {
|
10 |
-
formatNoMatches: function () { return "Inga träffar"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
15 |
-
formatSearching: function () { return "Söker…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Swedish translation.
|
3 |
+
*
|
4 |
+
* Author: Jens Rantil <jens.rantil@telavox.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['sv'] = {
|
10 |
+
formatNoMatches: function () { return "Inga träffar"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
|
15 |
+
formatSearching: function () { return "Söker…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_th.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Thai translation.
|
3 |
-
*
|
4 |
-
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['th'] = {
|
10 |
-
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
15 |
-
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Thai translation.
|
3 |
+
*
|
4 |
+
* Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['th'] = {
|
10 |
+
formatNoMatches: function () { return "ไม่พบข้อมูล"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
|
15 |
+
formatSearching: function () { return "กำลังค้นข้อมูล…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_tr.js
CHANGED
@@ -1,19 +1,19 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Turkish translation.
|
3 |
-
*
|
4 |
-
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['tr'] = {
|
10 |
-
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
15 |
-
formatSearching: function () { return "Aranıyor…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
19 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Turkish translation.
|
3 |
+
*
|
4 |
+
* Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['tr'] = {
|
10 |
+
formatNoMatches: function () { return "Sonuç bulunamadı"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
|
15 |
+
formatSearching: function () { return "Aranıyor…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
|
19 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_ug-CN.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Uyghur translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['ug-CN'] = {
|
7 |
-
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
12 |
-
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Uyghur translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['ug-CN'] = {
|
7 |
+
formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
|
12 |
+
formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
|
16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_uk.js
CHANGED
@@ -1,25 +1,25 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Ukrainian translation.
|
3 |
-
*
|
4 |
-
* @author bigmihail <bigmihail@bigmir.net>
|
5 |
-
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
-
*/
|
7 |
-
(function ($) {
|
8 |
-
"use strict";
|
9 |
-
|
10 |
-
$.fn.select2.locales['uk'] = {
|
11 |
-
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
12 |
-
formatNoMatches: function () { return "Нічого не знайдено"; },
|
13 |
-
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
14 |
-
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
15 |
-
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
16 |
-
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
17 |
-
formatSearching: function () { return "Пошук…"; }
|
18 |
-
};
|
19 |
-
|
20 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
21 |
-
|
22 |
-
function character (n, word) {
|
23 |
-
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
24 |
-
}
|
25 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Ukrainian translation.
|
3 |
+
*
|
4 |
+
* @author bigmihail <bigmihail@bigmir.net>
|
5 |
+
* @author Uriy Efremochkin <efremochkin@uriy.me>
|
6 |
+
*/
|
7 |
+
(function ($) {
|
8 |
+
"use strict";
|
9 |
+
|
10 |
+
$.fn.select2.locales['uk'] = {
|
11 |
+
formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
|
12 |
+
formatNoMatches: function () { return "Нічого не знайдено"; },
|
13 |
+
formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
|
14 |
+
formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
|
15 |
+
formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
|
16 |
+
formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
|
17 |
+
formatSearching: function () { return "Пошук…"; }
|
18 |
+
};
|
19 |
+
|
20 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
|
21 |
+
|
22 |
+
function character (n, word) {
|
23 |
+
return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
|
24 |
+
}
|
25 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_vi.js
CHANGED
@@ -1,20 +1,20 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Vietnamese translation.
|
3 |
-
*
|
4 |
-
* Author: Long Nguyen <olragon@gmail.com>
|
5 |
-
*/
|
6 |
-
(function ($) {
|
7 |
-
"use strict";
|
8 |
-
|
9 |
-
$.fn.select2.locales['vi'] = {
|
10 |
-
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
11 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
12 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
13 |
-
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
14 |
-
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
15 |
-
formatSearching: function () { return "Đang tìm…"; }
|
16 |
-
};
|
17 |
-
|
18 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
19 |
-
})(jQuery);
|
20 |
-
|
1 |
+
/**
|
2 |
+
* Select2 Vietnamese translation.
|
3 |
+
*
|
4 |
+
* Author: Long Nguyen <olragon@gmail.com>
|
5 |
+
*/
|
6 |
+
(function ($) {
|
7 |
+
"use strict";
|
8 |
+
|
9 |
+
$.fn.select2.locales['vi'] = {
|
10 |
+
formatNoMatches: function () { return "Không tìm thấy kết quả"; },
|
11 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
|
12 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
|
13 |
+
formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
|
14 |
+
formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
|
15 |
+
formatSearching: function () { return "Đang tìm…"; }
|
16 |
+
};
|
17 |
+
|
18 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
|
19 |
+
})(jQuery);
|
20 |
+
|
assets/deps/select2-3.5.2/select2_locale_zh-CN.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Chinese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['zh-CN'] = {
|
7 |
-
formatNoMatches: function () { return "没有找到匹配项"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
12 |
-
formatSearching: function () { return "搜索中…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Chinese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['zh-CN'] = {
|
7 |
+
formatNoMatches: function () { return "没有找到匹配项"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "加载结果中…"; },
|
12 |
+
formatSearching: function () { return "搜索中…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
|
16 |
+
})(jQuery);
|
assets/deps/select2-3.5.2/select2_locale_zh-TW.js
CHANGED
@@ -1,16 +1,16 @@
|
|
1 |
-
/**
|
2 |
-
* Select2 Traditional Chinese translation
|
3 |
-
*/
|
4 |
-
(function ($) {
|
5 |
-
"use strict";
|
6 |
-
$.fn.select2.locales['zh-TW'] = {
|
7 |
-
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
8 |
-
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
9 |
-
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
10 |
-
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
11 |
-
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
12 |
-
formatSearching: function () { return "搜尋中…"; }
|
13 |
-
};
|
14 |
-
|
15 |
-
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
16 |
-
})(jQuery);
|
1 |
+
/**
|
2 |
+
* Select2 Traditional Chinese translation
|
3 |
+
*/
|
4 |
+
(function ($) {
|
5 |
+
"use strict";
|
6 |
+
$.fn.select2.locales['zh-TW'] = {
|
7 |
+
formatNoMatches: function () { return "沒有找到相符的項目"; },
|
8 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
|
9 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
|
10 |
+
formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
|
11 |
+
formatLoadMore: function (pageNumber) { return "載入中…"; },
|
12 |
+
formatSearching: function () { return "搜尋中…"; }
|
13 |
+
};
|
14 |
+
|
15 |
+
$.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
|
16 |
+
})(jQuery);
|
assets/deps/starrr/starrr.js
CHANGED
@@ -1,123 +1,123 @@
|
|
1 |
-
var __slice = [].slice;
|
2 |
-
|
3 |
-
(function(jQuery, window) {
|
4 |
-
var Starrr;
|
5 |
-
window.Starrr = Starrr = (function() {
|
6 |
-
Starrr.prototype.defaults = {
|
7 |
-
rating: void 0,
|
8 |
-
numStars: 5,
|
9 |
-
emptyStarClass: 'fa fa-star-o',
|
10 |
-
fullStarClass: 'fa fa-star',
|
11 |
-
change: function(e, value) {}
|
12 |
-
};
|
13 |
-
|
14 |
-
function Starrr($el, options) {
|
15 |
-
var i, _, _ref;
|
16 |
-
this.options = jQuery.extend({}, this.defaults, options);
|
17 |
-
this.$el = $el;
|
18 |
-
_ref = this.defaults;
|
19 |
-
for (i in _ref) {
|
20 |
-
_ = _ref[i];
|
21 |
-
if (this.$el.data(i.toLowerCase()) != null) {
|
22 |
-
this.options[i] = this.$el.data(i.toLowerCase());
|
23 |
-
}
|
24 |
-
}
|
25 |
-
if (this.$el.data('connected-input')) {
|
26 |
-
this.$connectedInput = jQuery("[name=\"" + (this.$el.data('connected-input')) + "\"]");
|
27 |
-
this.options.rating = this.$connectedInput.val() ? parseInt(this.$connectedInput.val(), 10) : void 0;
|
28 |
-
}
|
29 |
-
this.createStars();
|
30 |
-
this.syncRating();
|
31 |
-
if (this.$connectedInput && this.$connectedInput.is(':disabled')) {
|
32 |
-
return;
|
33 |
-
}
|
34 |
-
this.$el.on('mouseover.starrr', 'i', (function(_this) {
|
35 |
-
return function(e) {
|
36 |
-
return _this.syncRating(_this.getStars().index(e.currentTarget) + 1);
|
37 |
-
};
|
38 |
-
})(this));
|
39 |
-
this.$el.on('mouseout.starrr', (function(_this) {
|
40 |
-
return function() {
|
41 |
-
return _this.syncRating();
|
42 |
-
};
|
43 |
-
})(this));
|
44 |
-
this.$el.on('click.starrr', 'i', (function(_this) {
|
45 |
-
return function(e) {
|
46 |
-
return _this.setRating(_this.getStars().index(e.currentTarget) + 1);
|
47 |
-
};
|
48 |
-
})(this));
|
49 |
-
this.$el.on('starrr:change', this.options.change);
|
50 |
-
if (this.$connectedInput != null) {
|
51 |
-
this.$el.on('starrr:change', (function(_this) {
|
52 |
-
return function(e, value) {
|
53 |
-
_this.$connectedInput.val(value);
|
54 |
-
return _this.$connectedInput.trigger('focusout');
|
55 |
-
};
|
56 |
-
})(this));
|
57 |
-
}
|
58 |
-
}
|
59 |
-
|
60 |
-
Starrr.prototype.getStars = function() {
|
61 |
-
return this.$el.find('i');
|
62 |
-
};
|
63 |
-
|
64 |
-
Starrr.prototype.createStars = function() {
|
65 |
-
var _i, _ref, _results;
|
66 |
-
_results = [];
|
67 |
-
for (_i = 1, _ref = this.options.numStars; 1 <= _ref ? _i <= _ref : _i >= _ref; 1 <= _ref ? _i++ : _i--) {
|
68 |
-
_results.push(this.$el.append("<i class='" + this.options.emptyStarClass + "'></i>"));
|
69 |
-
}
|
70 |
-
return _results;
|
71 |
-
};
|
72 |
-
|
73 |
-
Starrr.prototype.setRating = function(rating) {
|
74 |
-
if (this.options.rating === rating) {
|
75 |
-
rating = void 0;
|
76 |
-
}
|
77 |
-
this.options.rating = rating;
|
78 |
-
this.syncRating();
|
79 |
-
return this.$el.trigger('starrr:change', rating);
|
80 |
-
};
|
81 |
-
|
82 |
-
Starrr.prototype.getRating = function() {
|
83 |
-
return this.options.rating;
|
84 |
-
};
|
85 |
-
|
86 |
-
Starrr.prototype.syncRating = function(rating) {
|
87 |
-
var i, _i, _j, _ref, _ref1;
|
88 |
-
rating || (rating = this.options.rating);
|
89 |
-
if (rating) {
|
90 |
-
for (i = _i = 0, _ref = rating - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
|
91 |
-
this.getStars().eq(i).removeClass(this.options.emptyStarClass).addClass(this.options.fullStarClass);
|
92 |
-
}
|
93 |
-
}
|
94 |
-
if (rating && rating < this.options.numStars) {
|
95 |
-
for (i = _j = rating, _ref1 = this.options.numStars - 1; rating <= _ref1 ? _j <= _ref1 : _j >= _ref1; i = rating <= _ref1 ? ++_j : --_j) {
|
96 |
-
this.getStars().eq(i).removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
97 |
-
}
|
98 |
-
}
|
99 |
-
if (!rating) {
|
100 |
-
return this.getStars().removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
101 |
-
}
|
102 |
-
};
|
103 |
-
|
104 |
-
return Starrr;
|
105 |
-
|
106 |
-
})();
|
107 |
-
return jQuery.fn.extend({
|
108 |
-
starrr: function() {
|
109 |
-
var args, option;
|
110 |
-
option = arguments[0], args = 2 <= arguments.length ? __slice.call(arguments, 1) : [];
|
111 |
-
return this.each(function() {
|
112 |
-
var data;
|
113 |
-
data = jQuery(this).data('starrr');
|
114 |
-
if (!data) {
|
115 |
-
jQuery(this).data('starrr', (data = new Starrr(jQuery(this), option)));
|
116 |
-
}
|
117 |
-
if (typeof option === 'string') {
|
118 |
-
return data[option].apply(data, args);
|
119 |
-
}
|
120 |
-
});
|
121 |
-
}
|
122 |
-
});
|
123 |
-
})(window.jQuery, window);
|
1 |
+
var __slice = [].slice;
|
2 |
+
|
3 |
+
(function(jQuery, window) {
|
4 |
+
var Starrr;
|
5 |
+
window.Starrr = Starrr = (function() {
|
6 |
+
Starrr.prototype.defaults = {
|
7 |
+
rating: void 0,
|
8 |
+
numStars: 5,
|
9 |
+
emptyStarClass: 'fa fa-star-o',
|
10 |
+
fullStarClass: 'fa fa-star',
|
11 |
+
change: function(e, value) {}
|
12 |
+
};
|
13 |
+
|
14 |
+
function Starrr($el, options) {
|
15 |
+
var i, _, _ref;
|
16 |
+
this.options = jQuery.extend({}, this.defaults, options);
|
17 |
+
this.$el = $el;
|
18 |
+
_ref = this.defaults;
|
19 |
+
for (i in _ref) {
|
20 |
+
_ = _ref[i];
|
21 |
+
if (this.$el.data(i.toLowerCase()) != null) {
|
22 |
+
this.options[i] = this.$el.data(i.toLowerCase());
|
23 |
+
}
|
24 |
+
}
|
25 |
+
if (this.$el.data('connected-input')) {
|
26 |
+
this.$connectedInput = jQuery("[name=\"" + (this.$el.data('connected-input')) + "\"]");
|
27 |
+
this.options.rating = this.$connectedInput.val() ? parseInt(this.$connectedInput.val(), 10) : void 0;
|
28 |
+
}
|
29 |
+
this.createStars();
|
30 |
+
this.syncRating();
|
31 |
+
if (this.$connectedInput && this.$connectedInput.is(':disabled')) {
|
32 |
+
return;
|
33 |
+
}
|
34 |
+
this.$el.on('mouseover.starrr', 'i', (function(_this) {
|
35 |
+
return function(e) {
|
36 |
+
return _this.syncRating(_this.getStars().index(e.currentTarget) + 1);
|
37 |
+
};
|
38 |
+
})(this));
|
39 |
+
this.$el.on('mouseout.starrr', (function(_this) {
|
40 |
+
return function() {
|
41 |
+
return _this.syncRating();
|
42 |
+
};
|
43 |
+
})(this));
|
44 |
+
this.$el.on('click.starrr', 'i', (function(_this) {
|
45 |
+
return function(e) {
|
46 |
+
return _this.setRating(_this.getStars().index(e.currentTarget) + 1);
|
47 |
+
};
|
48 |
+
})(this));
|
49 |
+
this.$el.on('starrr:change', this.options.change);
|
50 |
+
if (this.$connectedInput != null) {
|
51 |
+
this.$el.on('starrr:change', (function(_this) {
|
52 |
+
return function(e, value) {
|
53 |
+
_this.$connectedInput.val(value);
|
54 |
+
return _this.$connectedInput.trigger('focusout');
|
55 |
+
};
|
56 |
+
})(this));
|
57 |
+
}
|
58 |
+
}
|
59 |
+
|
60 |
+
Starrr.prototype.getStars = function() {
|
61 |
+
return this.$el.find('i');
|
62 |
+
};
|
63 |
+
|
64 |
+
Starrr.prototype.createStars = function() {
|
65 |
+
var _i, _ref, _results;
|
66 |
+
_results = [];
|
67 |
+
for (_i = 1, _ref = this.options.numStars; 1 <= _ref ? _i <= _ref : _i >= _ref; 1 <= _ref ? _i++ : _i--) {
|
68 |
+
_results.push(this.$el.append("<i class='" + this.options.emptyStarClass + "'></i>"));
|
69 |
+
}
|
70 |
+
return _results;
|
71 |
+
};
|
72 |
+
|
73 |
+
Starrr.prototype.setRating = function(rating) {
|
74 |
+
if (this.options.rating === rating) {
|
75 |
+
rating = void 0;
|
76 |
+
}
|
77 |
+
this.options.rating = rating;
|
78 |
+
this.syncRating();
|
79 |
+
return this.$el.trigger('starrr:change', rating);
|
80 |
+
};
|
81 |
+
|
82 |
+
Starrr.prototype.getRating = function() {
|
83 |
+
return this.options.rating;
|
84 |
+
};
|
85 |
+
|
86 |
+
Starrr.prototype.syncRating = function(rating) {
|
87 |
+
var i, _i, _j, _ref, _ref1;
|
88 |
+
rating || (rating = this.options.rating);
|
89 |
+
if (rating) {
|
90 |
+
for (i = _i = 0, _ref = rating - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
|
91 |
+
this.getStars().eq(i).removeClass(this.options.emptyStarClass).addClass(this.options.fullStarClass);
|
92 |
+
}
|
93 |
+
}
|
94 |
+
if (rating && rating < this.options.numStars) {
|
95 |
+
for (i = _j = rating, _ref1 = this.options.numStars - 1; rating <= _ref1 ? _j <= _ref1 : _j >= _ref1; i = rating <= _ref1 ? ++_j : --_j) {
|
96 |
+
this.getStars().eq(i).removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
97 |
+
}
|
98 |
+
}
|
99 |
+
if (!rating) {
|
100 |
+
return this.getStars().removeClass(this.options.fullStarClass).addClass(this.options.emptyStarClass);
|
101 |
+
}
|
102 |
+
};
|
103 |
+
|
104 |
+
return Starrr;
|
105 |
+
|
106 |
+
})();
|
107 |
+
return jQuery.fn.extend({
|
108 |
+
starrr: function() {
|
109 |
+
var args, option;
|
110 |
+
option = arguments[0], args = 2 <= arguments.length ? __slice.call(arguments, 1) : [];
|
111 |
+
return this.each(function() {
|
112 |
+
var data;
|
113 |
+
data = jQuery(this).data('starrr');
|
114 |
+
if (!data) {
|
115 |
+
jQuery(this).data('starrr', (data = new Starrr(jQuery(this), option)));
|
116 |
+
}
|
117 |
+
if (typeof option === 'string') {
|
118 |
+
return data[option].apply(data, args);
|
119 |
+
}
|
120 |
+
});
|
121 |
+
}
|
122 |
+
});
|
123 |
+
})(window.jQuery, window);
|
assets/js/button-mce.js
CHANGED
@@ -1,45 +1,45 @@
|
|
1 |
-
(function() {
|
2 |
-
tinymce.PluginManager.add('irp_mce_button', function(editor, url) {
|
3 |
-
editor.addButton('irp_mce_button', {
|
4 |
-
title: 'Inline Related Posts'
|
5 |
-
, type: 'menubutton'
|
6 |
-
, icon: 'icon irp-own-icon'
|
7 |
-
, image : url + '/../images/repeat.png'
|
8 |
-
, menu: [
|
9 |
-
{
|
10 |
-
text: 'Inline Related Post'
|
11 |
-
, onclick: function() {
|
12 |
-
var code='[irp]';
|
13 |
-
editor.insertContent(code);
|
14 |
-
}
|
15 |
-
}
|
16 |
-
, {
|
17 |
-
text: 'Custom Related Post'
|
18 |
-
, onclick: function() {
|
19 |
-
editor.windowManager.open({
|
20 |
-
title: 'Choose a post'
|
21 |
-
, width: 350
|
22 |
-
, height: 250
|
23 |
-
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=post'
|
24 |
-
, inline: 1
|
25 |
-
, resizable: false
|
26 |
-
});
|
27 |
-
}
|
28 |
-
}
|
29 |
-
, {
|
30 |
-
text: 'Custom Related Page'
|
31 |
-
, onclick: function() {
|
32 |
-
editor.windowManager.open({
|
33 |
-
title: 'Choose a page'
|
34 |
-
, width: 350
|
35 |
-
, height: 250
|
36 |
-
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=page'
|
37 |
-
, inline: 1
|
38 |
-
, resizable: false
|
39 |
-
});
|
40 |
-
}
|
41 |
-
}
|
42 |
-
]
|
43 |
-
});
|
44 |
-
});
|
45 |
})();
|
1 |
+
(function() {
|
2 |
+
tinymce.PluginManager.add('irp_mce_button', function(editor, url) {
|
3 |
+
editor.addButton('irp_mce_button', {
|
4 |
+
title: 'Inline Related Posts'
|
5 |
+
, type: 'menubutton'
|
6 |
+
, icon: 'icon irp-own-icon'
|
7 |
+
, image : url + '/../images/repeat.png'
|
8 |
+
, menu: [
|
9 |
+
{
|
10 |
+
text: 'Inline Related Post'
|
11 |
+
, onclick: function() {
|
12 |
+
var code='[irp]';
|
13 |
+
editor.insertContent(code);
|
14 |
+
}
|
15 |
+
}
|
16 |
+
, {
|
17 |
+
text: 'Custom Related Post'
|
18 |
+
, onclick: function() {
|
19 |
+
editor.windowManager.open({
|
20 |
+
title: 'Choose a post'
|
21 |
+
, width: 350
|
22 |
+
, height: 250
|
23 |
+
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=post'
|
24 |
+
, inline: 1
|
25 |
+
, resizable: false
|
26 |
+
});
|
27 |
+
}
|
28 |
+
}
|
29 |
+
, {
|
30 |
+
text: 'Custom Related Page'
|
31 |
+
, onclick: function() {
|
32 |
+
editor.windowManager.open({
|
33 |
+
title: 'Choose a page'
|
34 |
+
, width: 350
|
35 |
+
, height: 250
|
36 |
+
, file: ajaxurl+'?action=do_action&irp_action=ui_button_editor&irp_post_type=page'
|
37 |
+
, inline: 1
|
38 |
+
, resizable: false
|
39 |
+
});
|
40 |
+
}
|
41 |
+
}
|
42 |
+
]
|
43 |
+
});
|
44 |
+
});
|
45 |
})();
|
assets/js/common.js
CHANGED
@@ -1,186 +1,186 @@
|
|
1 |
-
//IntellyWP
|
2 |
-
jQuery('.wrap .updated.fade').remove();
|
3 |
-
jQuery('.woocommerce-message').remove();
|
4 |
-
jQuery('.error').remove();
|
5 |
-
jQuery('.info').remove();
|
6 |
-
jQuery('.update-nag').remove();
|
7 |
-
|
8 |
-
jQuery(function() {
|
9 |
-
"use strict";
|
10 |
-
//WooCommerce errors
|
11 |
-
var removeWooUpdateTheme = setInterval(function () {
|
12 |
-
if (jQuery('.wrap .updated.fade').length > 0) {
|
13 |
-
jQuery('.wrap .updated.fade').remove();
|
14 |
-
clearInterval(removeWooUpdateTheme);
|
15 |
-
}
|
16 |
-
}, 100);
|
17 |
-
var removeWooMessage = setInterval(function () {
|
18 |
-
if (jQuery('.woocommerce-message').length > 0) {
|
19 |
-
jQuery('.woocommerce-message').remove();
|
20 |
-
clearInterval(removeWooMessage);
|
21 |
-
}
|
22 |
-
}, 100);
|
23 |
-
|
24 |
-
jQuery('.wrap .updated.fade').remove();
|
25 |
-
jQuery('.woocommerce-message').remove();
|
26 |
-
jQuery('.error').remove();
|
27 |
-
jQuery('.info').remove();
|
28 |
-
jQuery('.update-nag').remove();
|
29 |
-
});
|
30 |
-
|
31 |
-
function IRP_stripos(haystack, needle, offset) {
|
32 |
-
// discuss at: http://phpjs.org/functions/stripos/
|
33 |
-
// original by: Martijn Wieringa
|
34 |
-
// revised by: Onno Marsman
|
35 |
-
// example 1: stripos('ABC', 'a');
|
36 |
-
// returns 1: 0
|
37 |
-
|
38 |
-
var haystack = (haystack + '').toLowerCase();
|
39 |
-
var needle = (needle + '').toLowerCase();
|
40 |
-
var index = 0;
|
41 |
-
|
42 |
-
if ((index = haystack.indexOf(needle, offset)) !== -1) {
|
43 |
-
return index;
|
44 |
-
}
|
45 |
-
return false;
|
46 |
-
}
|
47 |
-
function IRP_val(name) {
|
48 |
-
return jQuery('[name='+name+']').val();
|
49 |
-
}
|
50 |
-
function IRP_check(name) {
|
51 |
-
return (jQuery('[name='+name+']').is(':checked') ? 1 : 0);
|
52 |
-
}
|
53 |
-
function IRP_radio(name) {
|
54 |
-
return (jQuery('[name='+name+']:checked').val());
|
55 |
-
}
|
56 |
-
function IRP_visible(name, visible) {
|
57 |
-
if(visible) {
|
58 |
-
jQuery(name).hide();
|
59 |
-
} else {
|
60 |
-
jQuery(name).show();
|
61 |
-
}
|
62 |
-
}
|
63 |
-
function IRP_aval(name) {
|
64 |
-
var data={};
|
65 |
-
jQuery("[name^='"+name+"']").each(function(i,v) {
|
66 |
-
var $this=jQuery(this);
|
67 |
-
var k=$this.attr('name');
|
68 |
-
var v=$this.val();
|
69 |
-
if($this.attr('type')=='checkbox') {
|
70 |
-
v=IRP_check(k);
|
71 |
-
} else if($this.attr('type')=='radio') {
|
72 |
-
v=IRP_radio(k);
|
73 |
-
}
|
74 |
-
data[k]=v;
|
75 |
-
});
|
76 |
-
//console.log(data);
|
77 |
-
return data;
|
78 |
-
}
|
79 |
-
function IRP_formatColorOption(option) {
|
80 |
-
if (!option.id) {
|
81 |
-
return option.text;
|
82 |
-
}
|
83 |
-
|
84 |
-
var color=jQuery(option.element).css('background-color');
|
85 |
-
var font=jQuery(option.element).css('color');
|
86 |
-
var $option = jQuery('<div></div>')
|
87 |
-
.html(option.text)
|
88 |
-
.css('background-color', color)
|
89 |
-
.css('color', font)
|
90 |
-
.addClass('irpColorSelectItem');
|
91 |
-
return $option;
|
92 |
-
}
|
93 |
-
function IRP_hideShow(v) {
|
94 |
-
var $source = jQuery(v);
|
95 |
-
if ($source.attr('irp-hideIfTrue') && $source.attr('irp-hideShow')) {
|
96 |
-
var $destination = jQuery('[name=' + $source.attr('irp-hideShow') + ']');
|
97 |
-
if ($destination.length == 0) {
|
98 |
-
$destination = jQuery('#' + $source.attr('irp-hideShow'));
|
99 |
-
}
|
100 |
-
if ($destination.length > 0) {
|
101 |
-
var isChecked = $source.is(":checked");
|
102 |
-
var hideIfTrue = ($source.attr('irp-hideIfTrue').toLowerCase() == 'true');
|
103 |
-
|
104 |
-
if (isChecked) {
|
105 |
-
if (hideIfTrue) {
|
106 |
-
$destination.hide();
|
107 |
-
} else {
|
108 |
-
$destination.show();
|
109 |
-
}
|
110 |
-
} else {
|
111 |
-
if (hideIfTrue) {
|
112 |
-
$destination.show();
|
113 |
-
} else {
|
114 |
-
$destination.hide();
|
115 |
-
}
|
116 |
-
}
|
117 |
-
}
|
118 |
-
}
|
119 |
-
}
|
120 |
-
|
121 |
-
jQuery(function() {
|
122 |
-
jQuery(".irp-hideShow").click(function () {
|
123 |
-
IRP_hideShow(this);
|
124 |
-
});
|
125 |
-
jQuery(".irp-hideShow").each(function () {
|
126 |
-
IRP_hideShow(this);
|
127 |
-
});
|
128 |
-
|
129 |
-
if(jQuery(".irpTags").length>0) {
|
130 |
-
jQuery(".irpTags").select2({
|
131 |
-
placeholder: "Type here..."
|
132 |
-
, theme: "classic"
|
133 |
-
, width: '300px'
|
134 |
-
});
|
135 |
-
}
|
136 |
-
|
137 |
-
if(jQuery(".irpColorSelect").length>0) {
|
138 |
-
jQuery(".irpColorSelect").select2({
|
139 |
-
placeholder: "Type here..."
|
140 |
-
, theme: "classic"
|
141 |
-
, width: '300px'
|
142 |
-
, formatResult: IRP_formatColorOption
|
143 |
-
, formatSelection: IRP_formatColorOption
|
144 |
-
, escapeMarkup: function(m) {
|
145 |
-
return m;
|
146 |
-
}
|
147 |
-
});
|
148 |
-
}
|
149 |
-
|
150 |
-
if(jQuery('.irp-help').qtip) {
|
151 |
-
|
152 |
-
jQuery.browser = {};
|
153 |
-
(function () {
|
154 |
-
jQuery.browser.msie = false;
|
155 |
-
jQuery.browser.version = 0;
|
156 |
-
if (navigator.userAgent.match(/MSIE ([0-9]+)\./)) {
|
157 |
-
jQuery.browser.msie = true;
|
158 |
-
jQuery.browser.version = RegExp.$1;
|
159 |
-
}
|
160 |
-
})();
|
161 |
-
|
162 |
-
jQuery('.irp-help').qtip({
|
163 |
-
position: {
|
164 |
-
corner: {
|
165 |
-
target: 'topMiddle',
|
166 |
-
tooltip: 'bottomLeft'
|
167 |
-
}
|
168 |
-
},
|
169 |
-
show: {
|
170 |
-
when: {
|
171 |
-
event: 'mouseover'
|
172 |
-
}
|
173 |
-
},
|
174 |
-
hide: {
|
175 |
-
fixed: true,
|
176 |
-
when: {
|
177 |
-
event: 'mouseout'
|
178 |
-
}
|
179 |
-
},
|
180 |
-
style: {
|
181 |
-
tip: 'bottomLeft',
|
182 |
-
name: 'green'
|
183 |
-
}
|
184 |
-
});
|
185 |
-
}
|
186 |
-
});
|
1 |
+
//IntellyWP
|
2 |
+
jQuery('.wrap .updated.fade').remove();
|
3 |
+
jQuery('.woocommerce-message').remove();
|
4 |
+
jQuery('.error').remove();
|
5 |
+
jQuery('.info').remove();
|
6 |
+
jQuery('.update-nag').remove();
|
7 |
+
|
8 |
+
jQuery(function() {
|
9 |
+
"use strict";
|
10 |
+
//WooCommerce errors
|
11 |
+
var removeWooUpdateTheme = setInterval(function () {
|
12 |
+
if (jQuery('.wrap .updated.fade').length > 0) {
|
13 |
+
jQuery('.wrap .updated.fade').remove();
|
14 |
+
clearInterval(removeWooUpdateTheme);
|
15 |
+
}
|
16 |
+
}, 100);
|
17 |
+
var removeWooMessage = setInterval(function () {
|
18 |
+
if (jQuery('.woocommerce-message').length > 0) {
|
19 |
+
jQuery('.woocommerce-message').remove();
|
20 |
+
clearInterval(removeWooMessage);
|
21 |
+
}
|
22 |
+
}, 100);
|
23 |
+
|
24 |
+
jQuery('.wrap .updated.fade').remove();
|
25 |
+
jQuery('.woocommerce-message').remove();
|
26 |
+
jQuery('.error').remove();
|
27 |
+
jQuery('.info').remove();
|
28 |
+
jQuery('.update-nag').remove();
|
29 |
+
});
|
30 |
+
|
31 |
+
function IRP_stripos(haystack, needle, offset) {
|
32 |
+
// discuss at: http://phpjs.org/functions/stripos/
|
33 |
+
// original by: Martijn Wieringa
|
34 |
+
// revised by: Onno Marsman
|
35 |
+
// example 1: stripos('ABC', 'a');
|
36 |
+
// returns 1: 0
|
37 |
+
|
38 |
+
var haystack = (haystack + '').toLowerCase();
|
39 |
+
var needle = (needle + '').toLowerCase();
|
40 |
+
var index = 0;
|
41 |
+
|
42 |
+
if ((index = haystack.indexOf(needle, offset)) !== -1) {
|
43 |
+
return index;
|
44 |
+
}
|
45 |
+
return false;
|
46 |
+
}
|
47 |
+
function IRP_val(name) {
|
48 |
+
return jQuery('[name='+name+']').val();
|
49 |
+
}
|
50 |
+
function IRP_check(name) {
|
51 |
+
return (jQuery('[name='+name+']').is(':checked') ? 1 : 0);
|
52 |
+
}
|
53 |
+
function IRP_radio(name) {
|
54 |
+
return (jQuery('[name='+name+']:checked').val());
|
55 |
+
}
|
56 |
+
function IRP_visible(name, visible) {
|
57 |
+
if(visible) {
|
58 |
+
jQuery(name).hide();
|
59 |
+
} else {
|
60 |
+
jQuery(name).show();
|
61 |
+
}
|
62 |
+
}
|
63 |
+
function IRP_aval(name) {
|
64 |
+
var data={};
|
65 |
+
jQuery("[name^='"+name+"']").each(function(i,v) {
|
66 |
+
var $this=jQuery(this);
|
67 |
+
var k=$this.attr('name');
|
68 |
+
var v=$this.val();
|
69 |
+
if($this.attr('type')=='checkbox') {
|
70 |
+
v=IRP_check(k);
|
71 |
+
} else if($this.attr('type')=='radio') {
|
72 |
+
v=IRP_radio(k);
|
73 |
+
}
|
74 |
+
data[k]=v;
|
75 |
+
});
|
76 |
+
//console.log(data);
|
77 |
+
return data;
|
78 |
+
}
|
79 |
+
function IRP_formatColorOption(option) {
|
80 |
+
if (!option.id) {
|
81 |
+
return option.text;
|
82 |
+
}
|
83 |
+
|
84 |
+
var color=jQuery(option.element).css('background-color');
|
85 |
+
var font=jQuery(option.element).css('color');
|
86 |
+
var $option = jQuery('<div></div>')
|
87 |
+
.html(option.text)
|
88 |
+
.css('background-color', color)
|
89 |
+
.css('color', font)
|
90 |
+
.addClass('irpColorSelectItem');
|
91 |
+
return $option;
|
92 |
+
}
|
93 |
+
function IRP_hideShow(v) {
|
94 |
+
var $source = jQuery(v);
|
95 |
+
if ($source.attr('irp-hideIfTrue') && $source.attr('irp-hideShow')) {
|
96 |
+
var $destination = jQuery('[name=' + $source.attr('irp-hideShow') + ']');
|
97 |
+
if ($destination.length == 0) {
|
98 |
+
$destination = jQuery('#' + $source.attr('irp-hideShow'));
|
99 |
+
}
|
100 |
+
if ($destination.length > 0) {
|
101 |
+
var isChecked = $source.is(":checked");
|
102 |
+
var hideIfTrue = ($source.attr('irp-hideIfTrue').toLowerCase() == 'true');
|
103 |
+
|
104 |
+
if (isChecked) {
|
105 |
+
if (hideIfTrue) {
|
106 |
+
$destination.hide();
|
107 |
+
} else {
|
108 |
+
$destination.show();
|
109 |
+
}
|
110 |
+
} else {
|
111 |
+
if (hideIfTrue) {
|
112 |
+
$destination.show();
|
113 |
+
} else {
|
114 |
+
$destination.hide();
|
115 |
+
}
|
116 |
+
}
|
117 |
+
}
|
118 |
+
}
|
119 |
+
}
|
120 |
+
|
121 |
+
jQuery(function() {
|
122 |
+
jQuery(".irp-hideShow").click(function () {
|
123 |
+
IRP_hideShow(this);
|
124 |
+
});
|
125 |
+
jQuery(".irp-hideShow").each(function () {
|
126 |
+
IRP_hideShow(this);
|
127 |
+
});
|
128 |
+
|
129 |
+
if(jQuery(".irpTags").length>0) {
|
130 |
+
jQuery(".irpTags").select2({
|
131 |
+
placeholder: "Type here..."
|
132 |
+
, theme: "classic"
|
133 |
+
, width: '300px'
|
134 |
+
});
|
135 |
+
}
|
136 |
+
|
137 |
+
if(jQuery(".irpColorSelect").length>0) {
|
138 |
+
jQuery(".irpColorSelect").select2({
|
139 |
+
placeholder: "Type here..."
|
140 |
+
, theme: "classic"
|
141 |
+
, width: '300px'
|
142 |
+
, formatResult: IRP_formatColorOption
|
143 |
+
, formatSelection: IRP_formatColorOption
|
144 |
+
, escapeMarkup: function(m) {
|
145 |
+
return m;
|
146 |
+
}
|
147 |
+
});
|
148 |
+
}
|
149 |
+
|
150 |
+
if(jQuery('.irp-help').qtip) {
|
151 |
+
|
152 |
+
jQuery.browser = {};
|
153 |
+
(function () {
|
154 |
+
jQuery.browser.msie = false;
|
155 |
+
jQuery.browser.version = 0;
|
156 |
+
if (navigator.userAgent.match(/MSIE ([0-9]+)\./)) {
|
157 |
+
jQuery.browser.msie = true;
|
158 |
+
jQuery.browser.version = RegExp.$1;
|
159 |
+
}
|
160 |
+
})();
|
161 |
+
|
162 |
+
jQuery('.irp-help').qtip({
|
163 |
+
position: {
|
164 |
+
corner: {
|
165 |
+
target: 'topMiddle',
|
166 |
+
tooltip: 'bottomLeft'
|
167 |
+
}
|
168 |
+
},
|
169 |
+
show: {
|
170 |
+
when: {
|
171 |
+
event: 'mouseover'
|
172 |
+
}
|
173 |
+
},
|
174 |
+
hide: {
|
175 |
+
fixed: true,
|
176 |
+
when: {
|
177 |
+
event: 'mouseout'
|
178 |
+
}
|
179 |
+
},
|
180 |
+
style: {
|
181 |
+
tip: 'bottomLeft',
|
182 |
+
name: 'green'
|
183 |
+
}
|
184 |
+
});
|
185 |
+
}
|
186 |
+
});
|
assets/templates/styles.html
CHANGED
@@ -1,198 +1,198 @@
|
|
1 |
-
#Template Minimalist
|
2 |
-
#Defaults {ctaTextColor=, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=BLUE #2 Light, borderColorLabel=border}
|
3 |
-
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
4 |
-
{comment}
|
5 |
-
<style>
|
6 |
-
.{utemplate} {
|
7 |
-
padding:0px;
|
8 |
-
margin: 0;
|
9 |
-
padding-top:1em!important;
|
10 |
-
padding-bottom:1em!important;
|
11 |
-
width:100%;
|
12 |
-
display: block;
|
13 |
-
font-weight:bold;
|
14 |
-
background-color:{boxColor};
|
15 |
-
border:0!important;
|
16 |
-
{if borderColor}
|
17 |
-
border-left:4px solid {borderColor}!important;
|
18 |
-
{/if}
|
19 |
-
{if hasShadow}
|
20 |
-
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
21 |
-
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
22 |
-
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
23 |
-
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
24 |
-
{/if}
|
25 |
-
text-decoration:none;
|
26 |
-
}
|
27 |
-
.{utemplate}:active, .{utemplate}:hover {
|
28 |
-
opacity: 1;
|
29 |
-
transition: opacity 250ms;
|
30 |
-
webkit-transition: opacity 250ms;
|
31 |
-
text-decoration:none;
|
32 |
-
}
|
33 |
-
.{utemplate} {
|
34 |
-
transition: background-color 250ms;
|
35 |
-
webkit-transition: background-color 250ms;
|
36 |
-
opacity: {boxOpacity};
|
37 |
-
transition: opacity 250ms;
|
38 |
-
webkit-transition: opacity 250ms;
|
39 |
-
}
|
40 |
-
.{utemplate} .ctaText {
|
41 |
-
font-weight:bold;
|
42 |
-
color:{ctaTextColor};
|
43 |
-
text-decoration:none;
|
44 |
-
font-size: 16px;
|
45 |
-
}
|
46 |
-
.{utemplate} .postTitle {
|
47 |
-
color:{postTitleColor};
|
48 |
-
text-decoration: underline!important;
|
49 |
-
font-size: 16px;
|
50 |
-
}
|
51 |
-
.{utemplate}:hover .postTitle {
|
52 |
-
text-decoration: underline!important;
|
53 |
-
}
|
54 |
-
</style>
|
55 |
-
<div style="padding-left:1em; padding-right:1em;">
|
56 |
-
<span class="ctaText">{ctaText}</span>
|
57 |
-
<span class="postTitle">{postTitle}</span>
|
58 |
-
</div>
|
59 |
-
</a>
|
60 |
-
|
61 |
-
#Template Shock
|
62 |
-
#Defaults {ctaTextColor=GREY #1 Light, postTitleColor=BLUE #2 Dark, boxColor=ORANGE Light, borderColor=ORANGE Dark, borderColorLabel=hover}
|
63 |
-
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
64 |
-
{comment}
|
65 |
-
<style>
|
66 |
-
.{utemplate}
|
67 |
-
, .{utemplate} .postImageUrl
|
68 |
-
, .{utemplate} .centered-text-area {
|
69 |
-
min-height: 80px;
|
70 |
-
position: relative;
|
71 |
-
}
|
72 |
-
.{utemplate}
|
73 |
-
, .{utemplate}:hover
|
74 |
-
, .{utemplate}:visited
|
75 |
-
, .{utemplate}:active {
|
76 |
-
border:0!important;
|
77 |
-
}
|
78 |
-
.{utemplate} .clearfix:after {
|
79 |
-
content: "";
|
80 |
-
display: table;
|
81 |
-
clear: both;
|
82 |
-
}
|
83 |
-
.{utemplate} {
|
84 |
-
display: block;
|
85 |
-
transition: background-color 250ms;
|
86 |
-
webkit-transition: background-color 250ms;
|
87 |
-
width: 100%;
|
88 |
-
opacity: {boxOpacity};
|
89 |
-
transition: opacity 250ms;
|
90 |
-
webkit-transition: opacity 250ms;
|
91 |
-
background-color: {boxColor};
|
92 |
-
{if hasShadow}
|
93 |
-
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
94 |
-
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
95 |
-
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
96 |
-
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
97 |
-
{/if}
|
98 |
-
}
|
99 |
-
.{utemplate}:active
|
100 |
-
, .{utemplate}:hover {
|
101 |
-
opacity: 1;
|
102 |
-
transition: opacity 250ms;
|
103 |
-
webkit-transition: opacity 250ms;
|
104 |
-
background-color: {borderColor};
|
105 |
-
}
|
106 |
-
.{utemplate} .centered-text-area {
|
107 |
-
width: 100%;
|
108 |
-
position: relative;
|
109 |
-
}
|
110 |
-
.{utemplate} .ctaText {
|
111 |
-
border-bottom: 0 solid #fff;
|
112 |
-
color: {ctaTextColor};
|
113 |
-
font-size: 16px;
|
114 |
-
font-weight: bold;
|
115 |
-
margin: 0;
|
116 |
-
padding: 0;
|
117 |
-
text-decoration: underline;
|
118 |
-
}
|
119 |
-
.{utemplate} .postTitle {
|
120 |
-
color: {postTitleColor};
|
121 |
-
font-size: 16px;
|
122 |
-
font-weight: 600;
|
123 |
-
margin: 0;
|
124 |
-
padding: 0;
|
125 |
-
width: 100%;
|
126 |
-
}
|
127 |
-
.{utemplate} .ctaButton {
|
128 |
-
background-color: {boxColorHover}!important;
|
129 |
-
color: {ctaTextColor};
|
130 |
-
border: none;
|
131 |
-
border-radius: 3px;
|
132 |
-
box-shadow: none;
|
133 |
-
font-size: 14px;
|
134 |
-
font-weight: bold;
|
135 |
-
line-height: 26px;
|
136 |
-
moz-border-radius: 3px;
|
137 |
-
text-align: center;
|
138 |
-
text-decoration: none;
|
139 |
-
text-shadow: none;
|
140 |
-
width: 80px;
|
141 |
-
min-height: 80px;
|
142 |
-
background: url({assetsImages}simple-arrow.png)no-repeat;
|
143 |
-
position: absolute;
|
144 |
-
right: 0;
|
145 |
-
top: 0;
|
146 |
-
}
|
147 |
-
.{utemplate}:hover .ctaButton {
|
148 |
-
background-color: {borderColorHover}!important;
|
149 |
-
}
|
150 |
-
.{utemplate} .centered-text {
|
151 |
-
display: table;
|
152 |
-
height: 80px;
|
153 |
-
padding-left: 18px;
|
154 |
-
top: 0;
|
155 |
-
}
|
156 |
-
.{utemplate} .{utemplate}-content {
|
157 |
-
display: table-cell;
|
158 |
-
margin: 0;
|
159 |
-
padding: 0;
|
160 |
-
padding-right: 108px;
|
161 |
-
position: relative;
|
162 |
-
vertical-align: middle;
|
163 |
-
width: 100%;
|
164 |
-
}
|
165 |
-
.{utemplate}:after {
|
166 |
-
content: "";
|
167 |
-
display: block;
|
168 |
-
clear: both;
|
169 |
-
}
|
170 |
-
</style>
|
171 |
-
<div class="centered-text-area">
|
172 |
-
<div class="centered-text" style="float: left;">
|
173 |
-
<div class="{utemplate}-content">
|
174 |
-
<span class="ctaText">{ctaText}</span>
|
175 |
-
<span class="postTitle">{postTitle}</span>
|
176 |
-
</div>
|
177 |
-
</div>
|
178 |
-
</div>
|
179 |
-
<div class="ctaButton"></div>
|
180 |
-
</a>
|
181 |
-
|
182 |
-
#Template Ruby
|
183 |
-
#Defaults {proTheme=true, ctaTextColor=BLUE #1 Light, postTitleColor=GREY #1 Light, boxColor=BLUE #2 Dark, borderColor=, borderColorLabel=arrow}
|
184 |
-
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
185 |
-
<img src="{assets}templates/preview-ruby.jpg" />
|
186 |
-
</a>
|
187 |
-
|
188 |
-
#Template Button
|
189 |
-
#Defaults {proTheme=true, ctaTextColor=WHITE Light, postTitleColor=GREY #1 Light, boxColor=BLACK Light, borderColor=AQUA Light, borderColorLabel=button}
|
190 |
-
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
191 |
-
<img src="{assets}templates/preview-button.jpg" />
|
192 |
-
</a>
|
193 |
-
|
194 |
-
#Template Kangoo
|
195 |
-
#Defaults {proTheme=true, ctaTextColor=BLUE #2 Light, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=WHITE Light, borderColorLabel=hover}
|
196 |
-
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
197 |
-
<img src="{assets}templates/preview-kangoo.jpg" />
|
198 |
</a>
|
1 |
+
#Template Minimalist
|
2 |
+
#Defaults {ctaTextColor=, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=BLUE #2 Light, borderColorLabel=border}
|
3 |
+
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
4 |
+
{comment}
|
5 |
+
<style>
|
6 |
+
.{utemplate} {
|
7 |
+
padding:0px;
|
8 |
+
margin: 0;
|
9 |
+
padding-top:1em!important;
|
10 |
+
padding-bottom:1em!important;
|
11 |
+
width:100%;
|
12 |
+
display: block;
|
13 |
+
font-weight:bold;
|
14 |
+
background-color:{boxColor};
|
15 |
+
border:0!important;
|
16 |
+
{if borderColor}
|
17 |
+
border-left:4px solid {borderColor}!important;
|
18 |
+
{/if}
|
19 |
+
{if hasShadow}
|
20 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
21 |
+
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
22 |
+
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
23 |
+
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
24 |
+
{/if}
|
25 |
+
text-decoration:none;
|
26 |
+
}
|
27 |
+
.{utemplate}:active, .{utemplate}:hover {
|
28 |
+
opacity: 1;
|
29 |
+
transition: opacity 250ms;
|
30 |
+
webkit-transition: opacity 250ms;
|
31 |
+
text-decoration:none;
|
32 |
+
}
|
33 |
+
.{utemplate} {
|
34 |
+
transition: background-color 250ms;
|
35 |
+
webkit-transition: background-color 250ms;
|
36 |
+
opacity: {boxOpacity};
|
37 |
+
transition: opacity 250ms;
|
38 |
+
webkit-transition: opacity 250ms;
|
39 |
+
}
|
40 |
+
.{utemplate} .ctaText {
|
41 |
+
font-weight:bold;
|
42 |
+
color:{ctaTextColor};
|
43 |
+
text-decoration:none;
|
44 |
+
font-size: 16px;
|
45 |
+
}
|
46 |
+
.{utemplate} .postTitle {
|
47 |
+
color:{postTitleColor};
|
48 |
+
text-decoration: underline!important;
|
49 |
+
font-size: 16px;
|
50 |
+
}
|
51 |
+
.{utemplate}:hover .postTitle {
|
52 |
+
text-decoration: underline!important;
|
53 |
+
}
|
54 |
+
</style>
|
55 |
+
<div style="padding-left:1em; padding-right:1em;">
|
56 |
+
<span class="ctaText">{ctaText}</span>
|
57 |
+
<span class="postTitle">{postTitle}</span>
|
58 |
+
</div>
|
59 |
+
</a>
|
60 |
+
|
61 |
+
#Template Shock
|
62 |
+
#Defaults {ctaTextColor=GREY #1 Light, postTitleColor=BLUE #2 Dark, boxColor=ORANGE Light, borderColor=ORANGE Dark, borderColorLabel=hover}
|
63 |
+
<a href="{postHref}" target="{linkTarget}" {linkRel} class="{utemplate}">
|
64 |
+
{comment}
|
65 |
+
<style>
|
66 |
+
.{utemplate}
|
67 |
+
, .{utemplate} .postImageUrl
|
68 |
+
, .{utemplate} .centered-text-area {
|
69 |
+
min-height: 80px;
|
70 |
+
position: relative;
|
71 |
+
}
|
72 |
+
.{utemplate}
|
73 |
+
, .{utemplate}:hover
|
74 |
+
, .{utemplate}:visited
|
75 |
+
, .{utemplate}:active {
|
76 |
+
border:0!important;
|
77 |
+
}
|
78 |
+
.{utemplate} .clearfix:after {
|
79 |
+
content: "";
|
80 |
+
display: table;
|
81 |
+
clear: both;
|
82 |
+
}
|
83 |
+
.{utemplate} {
|
84 |
+
display: block;
|
85 |
+
transition: background-color 250ms;
|
86 |
+
webkit-transition: background-color 250ms;
|
87 |
+
width: 100%;
|
88 |
+
opacity: {boxOpacity};
|
89 |
+
transition: opacity 250ms;
|
90 |
+
webkit-transition: opacity 250ms;
|
91 |
+
background-color: {boxColor};
|
92 |
+
{if hasShadow}
|
93 |
+
box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
94 |
+
-moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
95 |
+
-o-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
96 |
+
-webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.17);
|
97 |
+
{/if}
|
98 |
+
}
|
99 |
+
.{utemplate}:active
|
100 |
+
, .{utemplate}:hover {
|
101 |
+
opacity: 1;
|
102 |
+
transition: opacity 250ms;
|
103 |
+
webkit-transition: opacity 250ms;
|
104 |
+
background-color: {borderColor};
|
105 |
+
}
|
106 |
+
.{utemplate} .centered-text-area {
|
107 |
+
width: 100%;
|
108 |
+
position: relative;
|
109 |
+
}
|
110 |
+
.{utemplate} .ctaText {
|
111 |
+
border-bottom: 0 solid #fff;
|
112 |
+
color: {ctaTextColor};
|
113 |
+
font-size: 16px;
|
114 |
+
font-weight: bold;
|
115 |
+
margin: 0;
|
116 |
+
padding: 0;
|
117 |
+
text-decoration: underline;
|
118 |
+
}
|
119 |
+
.{utemplate} .postTitle {
|
120 |
+
color: {postTitleColor};
|
121 |
+
font-size: 16px;
|
122 |
+
font-weight: 600;
|
123 |
+
margin: 0;
|
124 |
+
padding: 0;
|
125 |
+
width: 100%;
|
126 |
+
}
|
127 |
+
.{utemplate} .ctaButton {
|
128 |
+
background-color: {boxColorHover}!important;
|
129 |
+
color: {ctaTextColor};
|
130 |
+
border: none;
|
131 |
+
border-radius: 3px;
|
132 |
+
box-shadow: none;
|
133 |
+
font-size: 14px;
|
134 |
+
font-weight: bold;
|
135 |
+
line-height: 26px;
|
136 |
+
moz-border-radius: 3px;
|
137 |
+
text-align: center;
|
138 |
+
text-decoration: none;
|
139 |
+
text-shadow: none;
|
140 |
+
width: 80px;
|
141 |
+
min-height: 80px;
|
142 |
+
background: url({assetsImages}simple-arrow.png)no-repeat;
|
143 |
+
position: absolute;
|
144 |
+
right: 0;
|
145 |
+
top: 0;
|
146 |
+
}
|
147 |
+
.{utemplate}:hover .ctaButton {
|
148 |
+
background-color: {borderColorHover}!important;
|
149 |
+
}
|
150 |
+
.{utemplate} .centered-text {
|
151 |
+
display: table;
|
152 |
+
height: 80px;
|
153 |
+
padding-left: 18px;
|
154 |
+
top: 0;
|
155 |
+
}
|
156 |
+
.{utemplate} .{utemplate}-content {
|
157 |
+
display: table-cell;
|
158 |
+
margin: 0;
|
159 |
+
padding: 0;
|
160 |
+
padding-right: 108px;
|
161 |
+
position: relative;
|
162 |
+
vertical-align: middle;
|
163 |
+
width: 100%;
|
164 |
+
}
|
165 |
+
.{utemplate}:after {
|
166 |
+
content: "";
|
167 |
+
display: block;
|
168 |
+
clear: both;
|
169 |
+
}
|
170 |
+
</style>
|
171 |
+
<div class="centered-text-area">
|
172 |
+
<div class="centered-text" style="float: left;">
|
173 |
+
<div class="{utemplate}-content">
|
174 |
+
<span class="ctaText">{ctaText}</span>
|
175 |
+
<span class="postTitle">{postTitle}</span>
|
176 |
+
</div>
|
177 |
+
</div>
|
178 |
+
</div>
|
179 |
+
<div class="ctaButton"></div>
|
180 |
+
</a>
|
181 |
+
|
182 |
+
#Template Ruby
|
183 |
+
#Defaults {proTheme=true, ctaTextColor=BLUE #1 Light, postTitleColor=GREY #1 Light, boxColor=BLUE #2 Dark, borderColor=, borderColorLabel=arrow}
|
184 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
185 |
+
<img src="{assets}templates/preview-ruby.jpg" />
|
186 |
+
</a>
|
187 |
+
|
188 |
+
#Template Button
|
189 |
+
#Defaults {proTheme=true, ctaTextColor=WHITE Light, postTitleColor=GREY #1 Light, boxColor=BLACK Light, borderColor=AQUA Light, borderColorLabel=button}
|
190 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
191 |
+
<img src="{assets}templates/preview-button.jpg" />
|
192 |
+
</a>
|
193 |
+
|
194 |
+
#Template Kangoo
|
195 |
+
#Defaults {proTheme=true, ctaTextColor=BLUE #2 Light, postTitleColor=BLACK Dark, boxColor=WHITE Dark, borderColor=WHITE Light, borderColorLabel=hover}
|
196 |
+
<a href="{demoLink}" target="_blank" rel="nofollow" class="{utemplate}">
|
197 |
+
<img src="{assets}templates/preview-kangoo.jpg" />
|
198 |
</a>
|
autoload.php
CHANGED
@@ -1,48 +1,48 @@
|
|
1 |
-
<?php
|
2 |
-
spl_autoload_register('irp_autoload');
|
3 |
-
function irp_autoload($class) {
|
4 |
-
$root=dirname(__FILE__).'/includes/classes/';
|
5 |
-
irp_autoload_root($root, $class);
|
6 |
-
}
|
7 |
-
function irp_autoload_root($root, $class) {
|
8 |
-
$slash=substr($root, strlen($root)-1);
|
9 |
-
if($slash!='/' && $slash!='\\') {
|
10 |
-
$root.='/';
|
11 |
-
}
|
12 |
-
$name=str_replace(IRP_PLUGIN_PREFIX, '', $class);
|
13 |
-
if(strpos($class, IRP_PLUGIN_PREFIX)===FALSE) {
|
14 |
-
//autoload only plugin classes
|
15 |
-
return;
|
16 |
-
}
|
17 |
-
|
18 |
-
$h=opendir($root);
|
19 |
-
while($file=readdir($h)) {
|
20 |
-
if(is_dir($root.$file) && $file != '.' && $file != '..') {
|
21 |
-
irp_autoload_root($root.$file, $class);
|
22 |
-
} elseif(file_exists($root.$name.'.php')) {
|
23 |
-
include_once($root.$name.'.php');
|
24 |
-
} elseif(file_exists($root.$class.'.php')) {
|
25 |
-
include_once($root.$class.'.php');
|
26 |
-
}
|
27 |
-
}
|
28 |
-
}
|
29 |
-
function irp_include_php($root) {
|
30 |
-
$h=opendir($root);
|
31 |
-
$slash=substr($root, strlen($root)-1);
|
32 |
-
if($slash!='/' && $slash!='\\') {
|
33 |
-
$root.='/';
|
34 |
-
}
|
35 |
-
|
36 |
-
while($file=readdir($h)) {
|
37 |
-
if(is_dir($root.$file) && $file != '.' && $file != '..'){
|
38 |
-
irp_include_php($root.$file);
|
39 |
-
} elseif(strlen($file)>5) {
|
40 |
-
$ext='.php';
|
41 |
-
$length=strlen($ext);
|
42 |
-
$start=$length*-1; //negative
|
43 |
-
if(strcasecmp(substr($file, $start), $ext)==0) {
|
44 |
-
include_once($root.$file);
|
45 |
-
}
|
46 |
-
}
|
47 |
-
}
|
48 |
}
|
1 |
+
<?php
|
2 |
+
spl_autoload_register('irp_autoload');
|
3 |
+
function irp_autoload($class) {
|
4 |
+
$root=dirname(__FILE__).'/includes/classes/';
|
5 |
+
irp_autoload_root($root, $class);
|
6 |
+
}
|
7 |
+
function irp_autoload_root($root, $class) {
|
8 |
+
$slash=substr($root, strlen($root)-1);
|
9 |
+
if($slash!='/' && $slash!='\\') {
|
10 |
+
$root.='/';
|
11 |
+
}
|
12 |
+
$name=str_replace(IRP_PLUGIN_PREFIX, '', $class);
|
13 |
+
if(strpos($class, IRP_PLUGIN_PREFIX)===FALSE) {
|
14 |
+
//autoload only plugin classes
|
15 |
+
return;
|
16 |
+
}
|
17 |
+
|
18 |
+
$h=opendir($root);
|
19 |
+
while($file=readdir($h)) {
|
20 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..') {
|
21 |
+
irp_autoload_root($root.$file, $class);
|
22 |
+
} elseif(file_exists($root.$name.'.php')) {
|
23 |
+
include_once($root.$name.'.php');
|
24 |
+
} elseif(file_exists($root.$class.'.php')) {
|
25 |
+
include_once($root.$class.'.php');
|
26 |
+
}
|
27 |
+
}
|
28 |
+
}
|
29 |
+
function irp_include_php($root) {
|
30 |
+
$h=opendir($root);
|
31 |
+
$slash=substr($root, strlen($root)-1);
|
32 |
+
if($slash!='/' && $slash!='\\') {
|
33 |
+
$root.='/';
|
34 |
+
}
|
35 |
+
|
36 |
+
while($file=readdir($h)) {
|
37 |
+
if(is_dir($root.$file) && $file != '.' && $file != '..'){
|
38 |
+
irp_include_php($root.$file);
|
39 |
+
} elseif(strlen($file)>5) {
|
40 |
+
$ext='.php';
|
41 |
+
$length=strlen($ext);
|
42 |
+
$start=$length*-1; //negative
|
43 |
+
if(strcasecmp(substr($file, $start), $ext)==0) {
|
44 |
+
include_once($root.$file);
|
45 |
+
}
|
46 |
+
}
|
47 |
+
}
|
48 |
}
|
includes/actions.php
CHANGED
@@ -1,69 +1,69 @@
|
|
1 |
-
<?php
|
2 |
-
// Exit if accessed directly
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
-
|
5 |
-
add_action('init', 'irp_do_action');
|
6 |
-
add_action('wp_ajax_do_action', 'irp_do_action');
|
7 |
-
function irp_do_action() {
|
8 |
-
global $irp;
|
9 |
-
|
10 |
-
load_plugin_textdomain(IRP_PLUGIN_SLUG, false, dirname( plugin_basename(__FILE__ ), 2) . '/languages');
|
11 |
-
|
12 |
-
$action = $irp->Utils->qs('irp_action');
|
13 |
-
$irp->Log->info('[actions::irp_do_action] Action: %s', $action);
|
14 |
-
switch($action) {
|
15 |
-
case 'ui_button_editor':
|
16 |
-
call_irp_ui_button_editor($irp);
|
17 |
-
break;
|
18 |
-
case 'ui_box_preview':
|
19 |
-
call_irp_ui_box_preview($irp);
|
20 |
-
break;
|
21 |
-
case 'manager_trackingOn':
|
22 |
-
call_irp_manager_trackingOn($irp);
|
23 |
-
break;
|
24 |
-
case 'manager_trackingOff':
|
25 |
-
call_irp_manager_trackingOff($irp);
|
26 |
-
break;
|
27 |
-
case '':
|
28 |
-
break; // blank strings are okay. We just want to ignore them.
|
29 |
-
default:
|
30 |
-
$irp->Log->fatal('Attempting to execute unknown function %s', $action);
|
31 |
-
break;
|
32 |
-
}
|
33 |
-
}
|
34 |
-
|
35 |
-
function call_irp_ui_button_editor($irp)
|
36 |
-
{
|
37 |
-
if (current_user_can('edit_posts')
|
38 |
-
|| current_user_can('edit_pages')
|
39 |
-
|| current_user_can('edit_published_posts')
|
40 |
-
|| current_user_can('edit_published_pages')
|
41 |
-
|| current_user_can('edit_others_posts')
|
42 |
-
|| current_user_can('edit_others_pages')
|
43 |
-
|| current_user_can('edit_private_posts')
|
44 |
-
|| current_user_can('edit_private_pages')
|
45 |
-
) {
|
46 |
-
irp_ui_button_editor();
|
47 |
-
}
|
48 |
-
}
|
49 |
-
|
50 |
-
function call_irp_ui_box_preview($irp)
|
51 |
-
{
|
52 |
-
if (current_user_can('activate_plugins')) {
|
53 |
-
irp_ui_box_preview();
|
54 |
-
}
|
55 |
-
}
|
56 |
-
|
57 |
-
function call_irp_manager_trackingOn($irp)
|
58 |
-
{
|
59 |
-
if (current_user_can('activate_plugins')) {
|
60 |
-
$irp->Tracking->enableTracking();
|
61 |
-
}
|
62 |
-
}
|
63 |
-
|
64 |
-
function call_irp_manager_trackingOff($irp)
|
65 |
-
{
|
66 |
-
if (current_user_can('activate_plugins')) {
|
67 |
-
$irp->Tracking->disableTracking();
|
68 |
-
}
|
69 |
-
}
|
1 |
+
<?php
|
2 |
+
// Exit if accessed directly
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
+
|
5 |
+
add_action('init', 'irp_do_action');
|
6 |
+
add_action('wp_ajax_do_action', 'irp_do_action');
|
7 |
+
function irp_do_action() {
|
8 |
+
global $irp;
|
9 |
+
|
10 |
+
load_plugin_textdomain(IRP_PLUGIN_SLUG, false, dirname( plugin_basename(__FILE__ ), 2) . '/languages');
|
11 |
+
|
12 |
+
$action = $irp->Utils->qs('irp_action');
|
13 |
+
$irp->Log->info('[actions::irp_do_action] Action: %s', $action);
|
14 |
+
switch($action) {
|
15 |
+
case 'ui_button_editor':
|
16 |
+
call_irp_ui_button_editor($irp);
|
17 |
+
break;
|
18 |
+
case 'ui_box_preview':
|
19 |
+
call_irp_ui_box_preview($irp);
|
20 |
+
break;
|
21 |
+
case 'manager_trackingOn':
|
22 |
+
call_irp_manager_trackingOn($irp);
|
23 |
+
break;
|
24 |
+
case 'manager_trackingOff':
|
25 |
+
call_irp_manager_trackingOff($irp);
|
26 |
+
break;
|
27 |
+
case '':
|
28 |
+
break; // blank strings are okay. We just want to ignore them.
|
29 |
+
default:
|
30 |
+
$irp->Log->fatal('Attempting to execute unknown function %s', $action);
|
31 |
+
break;
|
32 |
+
}
|
33 |
+
}
|
34 |
+
|
35 |
+
function call_irp_ui_button_editor($irp)
|
36 |
+
{
|
37 |
+
if (current_user_can('edit_posts')
|
38 |
+
|| current_user_can('edit_pages')
|
39 |
+
|| current_user_can('edit_published_posts')
|
40 |
+
|| current_user_can('edit_published_pages')
|
41 |
+
|| current_user_can('edit_others_posts')
|
42 |
+
|| current_user_can('edit_others_pages')
|
43 |
+
|| current_user_can('edit_private_posts')
|
44 |
+
|| current_user_can('edit_private_pages')
|
45 |
+
) {
|
46 |
+
irp_ui_button_editor();
|
47 |
+
}
|
48 |
+
}
|
49 |
+
|
50 |
+
function call_irp_ui_box_preview($irp)
|
51 |
+
{
|
52 |
+
if (current_user_can('activate_plugins')) {
|
53 |
+
irp_ui_box_preview();
|
54 |
+
}
|
55 |
+
}
|
56 |
+
|
57 |
+
function call_irp_manager_trackingOn($irp)
|
58 |
+
{
|
59 |
+
if (current_user_can('activate_plugins')) {
|
60 |
+
$irp->Tracking->enableTracking();
|
61 |
+
}
|
62 |
+
}
|
63 |
+
|
64 |
+
function call_irp_manager_trackingOff($irp)
|
65 |
+
{
|
66 |
+
if (current_user_can('activate_plugins')) {
|
67 |
+
$irp->Tracking->disableTracking();
|
68 |
+
}
|
69 |
+
}
|
includes/admin/about.php
CHANGED
@@ -1,27 +1,27 @@
|
|
1 |
-
<?php
|
2 |
-
function irp_ui_about() {
|
3 |
-
global $irp;
|
4 |
-
irp_ui_tracking(TRUE);
|
5 |
-
?>
|
6 |
-
<div><?php $irp->Lang->P('AboutText')?></div>
|
7 |
-
<style>
|
8 |
-
ul li {
|
9 |
-
padding:2px;
|
10 |
-
}
|
11 |
-
</style>
|
12 |
-
<ul>
|
13 |
-
<li>
|
14 |
-
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>email.png" />
|
15 |
-
<a href="mailto:
|
16 |
-
</li>
|
17 |
-
<li>
|
18 |
-
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>twitter.png" />
|
19 |
-
<?php $irp->Utils->twitter('
|
20 |
-
</li>
|
21 |
-
<li>
|
22 |
-
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>internet.png" />
|
23 |
-
<a href="
|
24 |
-
</li>
|
25 |
-
</ul>
|
26 |
-
<?php
|
27 |
}
|
1 |
+
<?php
|
2 |
+
function irp_ui_about() {
|
3 |
+
global $irp;
|
4 |
+
irp_ui_tracking(TRUE);
|
5 |
+
?>
|
6 |
+
<div><?php $irp->Lang->P('AboutText')?></div>
|
7 |
+
<style>
|
8 |
+
ul li {
|
9 |
+
padding:2px;
|
10 |
+
}
|
11 |
+
</style>
|
12 |
+
<ul>
|
13 |
+
<li>
|
14 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>email.png" />
|
15 |
+
<a href="mailto:support@intellywp.com">support@intellywp.com</a>
|
16 |
+
</li>
|
17 |
+
<li>
|
18 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>twitter.png" />
|
19 |
+
<?php $irp->Utils->twitter('data443risk')?>
|
20 |
+
</li>
|
21 |
+
<li>
|
22 |
+
<img style="float:left; margin-right:10px;" src="<?php echo IRP_PLUGIN_IMAGES?>internet.png" />
|
23 |
+
<a href="https://data443.com" target="_new">Data443.com</a>
|
24 |
+
</li>
|
25 |
+
</ul>
|
26 |
+
<?php
|
27 |
}
|
includes/admin/button-mce.php
CHANGED
@@ -1,134 +1,134 @@
|
|
1 |
-
<?php
|
2 |
-
add_action('admin_head', 'irp_add_mce_button');
|
3 |
-
function irp_add_mce_button() {
|
4 |
-
global $typenow;
|
5 |
-
|
6 |
-
if (!current_user_can('edit_posts') && !current_user_can('edit_pages')) {
|
7 |
-
return;
|
8 |
-
}
|
9 |
-
|
10 |
-
if(!in_array($typenow, array('post', 'page'))) {
|
11 |
-
return;
|
12 |
-
}
|
13 |
-
if (get_user_option('rich_editing') == 'true') {
|
14 |
-
add_filter("mce_external_plugins", "irp_add_mce_plugin");
|
15 |
-
add_filter('mce_buttons', 'irp_register_mce_button');
|
16 |
-
}
|
17 |
-
}
|
18 |
-
|
19 |
-
function irp_add_mce_plugin($plugin_array) {
|
20 |
-
$plugin_array['irp_mce_button']=IRP_PLUGIN_ASSETS.'js/button-mce.js';
|
21 |
-
return $plugin_array;
|
22 |
-
}
|
23 |
-
function irp_register_mce_button($buttons) {
|
24 |
-
array_push($buttons, "irp_mce_button");
|
25 |
-
return $buttons;
|
26 |
-
}
|
27 |
-
|
28 |
-
function irp_ui_button_editor() {
|
29 |
-
global $irp;
|
30 |
-
|
31 |
-
$irp->Utils->printScriptCss();
|
32 |
-
$irp->Form->prefix='Editor';
|
33 |
-
$irp->Form->labels=FALSE;
|
34 |
-
|
35 |
-
$args=array('class'=>'wp-admin wp-core-ui admin-bar'
|
36 |
-
, 'style'=>'padding:10px; margin-left:auto; margin-right:auto;');
|
37 |
-
$irp->Form->formStarts('post', '', $args);
|
38 |
-
{
|
39 |
-
?>
|
40 |
-
<p style="text-align:center;"><?php $irp->Lang->P('EditorSubtitle') ?></p>
|
41 |
-
<?php
|
42 |
-
$args = array('post_type' => 'post', 'all' => FALSE);
|
43 |
-
$options = $irp->Utils->query(IRP_QUERY_POSTS_OF_TYPE, $args);
|
44 |
-
$irp->Form->text('irpPostId', '', FALSE);
|
45 |
-
?>
|
46 |
-
<div style="clear:both;"></div>
|
47 |
-
<p style="text-align:right;">
|
48 |
-
<input type="button" id="btnInsert" class="button button-primary irp-button irp-submit" value="<?php $irp->Lang->P('Insert')?>"/>
|
49 |
-
<input type="button" id="btnClose" class="button irp-button" value="<?php $irp->Lang->P('Cancel')?>"/>
|
50 |
-
</p>
|
51 |
-
|
52 |
-
<script>
|
53 |
-
jQuery(function () {
|
54 |
-
jQuery('#btnInsert').click(function () {
|
55 |
-
var editor = top.tinymce.activeEditor;
|
56 |
-
var postId = parseInt(jQuery('#irpPostId').val());
|
57 |
-
var name=jQuery('#select2-chosen-1').text().replace('"', ' ');
|
58 |
-
if(name) {
|
59 |
-
name='name="'+name+'"';
|
60 |
-
}
|
61 |
-
if (postId > 0) {
|
62 |
-
var code = '[irp posts="' + postId + '" '+name+']';
|
63 |
-
editor.insertContent(code);
|
64 |
-
}
|
65 |
-
editor.windowManager.close();
|
66 |
-
});
|
67 |
-
jQuery('#btnClose').click(function () {
|
68 |
-
var editor = top.tinymce.activeEditor;
|
69 |
-
editor.windowManager.close();
|
70 |
-
});
|
71 |
-
/*
|
72 |
-
jQuery("#irpPostId").select2({
|
73 |
-
placeholder: "Type here..."
|
74 |
-
, theme: "classic"
|
75 |
-
, width: '100%'
|
76 |
-
//, maximumSelectionLength: 3
|
77 |
-
});
|
78 |
-
*/
|
79 |
-
var ajaxurl = 'admin-ajax.php';
|
80 |
-
jQuery('#irpPostId').select2({
|
81 |
-
|
82 |
-
ajax: {
|
83 |
-
|
84 |
-
url: ajaxurl,
|
85 |
-
dataType: 'json',
|
86 |
-
|
87 |
-
delay: 250,
|
88 |
-
|
89 |
-
data: function (term, page) {
|
90 |
-
|
91 |
-
return {
|
92 |
-
action: 'irp_list_posts',
|
93 |
-
irp_post_type: '<?php echo esc_attr($_REQUEST['irp_post_type']);?>',
|
94 |
-
q: term,
|
95 |
-
page: page
|
96 |
-
};
|
97 |
-
|
98 |
-
},
|
99 |
-
|
100 |
-
results: function (data, page) {
|
101 |
-
|
102 |
-
page = page || 1;
|
103 |
-
|
104 |
-
return {
|
105 |
-
results: data.items,
|
106 |
-
more: false,
|
107 |
-
};
|
108 |
-
|
109 |
-
},
|
110 |
-
|
111 |
-
cache: true
|
112 |
-
|
113 |
-
},
|
114 |
-
|
115 |
-
placeholder: "Type here to search an item...",
|
116 |
-
minimumInputLength: 3,
|
117 |
-
width: '100%'
|
118 |
-
|
119 |
-
});
|
120 |
-
});
|
121 |
-
</script>
|
122 |
-
|
123 |
-
<style>
|
124 |
-
.select2-results {
|
125 |
-
max-height: 100px;
|
126 |
-
overflow-y: auto;
|
127 |
-
}
|
128 |
-
</style>
|
129 |
-
<?php
|
130 |
-
}
|
131 |
-
$irp->Form->formEnds();
|
132 |
-
exit;
|
133 |
-
}
|
134 |
-
|
1 |
+
<?php
|
2 |
+
add_action('admin_head', 'irp_add_mce_button');
|
3 |
+
function irp_add_mce_button() {
|
4 |
+
global $typenow;
|
5 |
+
|
6 |
+
if (!current_user_can('edit_posts') && !current_user_can('edit_pages')) {
|
7 |
+
return;
|
8 |
+
}
|
9 |
+
|
10 |
+
if(!in_array($typenow, array('post', 'page'))) {
|
11 |
+
return;
|
12 |
+
}
|
13 |
+
if (get_user_option('rich_editing') == 'true') {
|
14 |
+
add_filter("mce_external_plugins", "irp_add_mce_plugin");
|
15 |
+
add_filter('mce_buttons', 'irp_register_mce_button');
|
16 |
+
}
|
17 |
+
}
|
18 |
+
|
19 |
+
function irp_add_mce_plugin($plugin_array) {
|
20 |
+
$plugin_array['irp_mce_button']=IRP_PLUGIN_ASSETS.'js/button-mce.js';
|
21 |
+
return $plugin_array;
|
22 |
+
}
|
23 |
+
function irp_register_mce_button($buttons) {
|
24 |
+
array_push($buttons, "irp_mce_button");
|
25 |
+
return $buttons;
|
26 |
+
}
|
27 |
+
|
28 |
+
function irp_ui_button_editor() {
|
29 |
+
global $irp;
|
30 |
+
|
31 |
+
$irp->Utils->printScriptCss();
|
32 |
+
$irp->Form->prefix='Editor';
|
33 |
+
$irp->Form->labels=FALSE;
|
34 |
+
|
35 |
+
$args=array('class'=>'wp-admin wp-core-ui admin-bar'
|
36 |
+
, 'style'=>'padding:10px; margin-left:auto; margin-right:auto;');
|
37 |
+
$irp->Form->formStarts('post', '', $args);
|
38 |
+
{
|
39 |
+
?>
|
40 |
+
<p style="text-align:center;"><?php $irp->Lang->P('EditorSubtitle') ?></p>
|
41 |
+
<?php
|
42 |
+
$args = array('post_type' => 'post', 'all' => FALSE);
|
43 |
+
$options = $irp->Utils->query(IRP_QUERY_POSTS_OF_TYPE, $args);
|
44 |
+
$irp->Form->text('irpPostId', '', FALSE);
|
45 |
+
?>
|
46 |
+
<div style="clear:both;"></div>
|
47 |
+
<p style="text-align:right;">
|
48 |
+
<input type="button" id="btnInsert" class="button button-primary irp-button irp-submit" value="<?php $irp->Lang->P('Insert')?>"/>
|
49 |
+
<input type="button" id="btnClose" class="button irp-button" value="<?php $irp->Lang->P('Cancel')?>"/>
|
50 |
+
</p>
|
51 |
+
|
52 |
+
<script>
|
53 |
+
jQuery(function () {
|
54 |
+
jQuery('#btnInsert').click(function () {
|
55 |
+
var editor = top.tinymce.activeEditor;
|
56 |
+
var postId = parseInt(jQuery('#irpPostId').val());
|
57 |
+
var name=jQuery('#select2-chosen-1').text().replace('"', ' ');
|
58 |
+
if(name) {
|
59 |
+
name='name="'+name+'"';
|
60 |
+
}
|
61 |
+
if (postId > 0) {
|
62 |
+
var code = '[irp posts="' + postId + '" '+name+']';
|
63 |
+
editor.insertContent(code);
|
64 |
+
}
|
65 |
+
editor.windowManager.close();
|
66 |
+
});
|
67 |
+
jQuery('#btnClose').click(function () {
|
68 |
+
var editor = top.tinymce.activeEditor;
|
69 |
+
editor.windowManager.close();
|
70 |
+
});
|
71 |
+
/*
|
72 |
+
jQuery("#irpPostId").select2({
|
73 |
+
placeholder: "Type here..."
|
74 |
+
, theme: "classic"
|
75 |
+
, width: '100%'
|
76 |
+
//, maximumSelectionLength: 3
|
77 |
+
});
|
78 |
+
*/
|
79 |
+
var ajaxurl = 'admin-ajax.php';
|
80 |
+
jQuery('#irpPostId').select2({
|
81 |
+
|
82 |
+
ajax: {
|
83 |
+
|
84 |
+
url: ajaxurl,
|
85 |
+
dataType: 'json',
|
86 |
+
|
87 |
+
delay: 250,
|
88 |
+
|
89 |
+
data: function (term, page) {
|
90 |
+
|
91 |
+
return {
|
92 |
+
action: 'irp_list_posts',
|
93 |
+
irp_post_type: '<?php echo esc_attr($_REQUEST['irp_post_type']);?>',
|
94 |
+
q: term,
|
95 |
+
page: page
|
96 |
+
};
|
97 |
+
|
98 |
+
},
|
99 |
+
|
100 |
+
results: function (data, page) {
|
101 |
+
|
102 |
+
page = page || 1;
|
103 |
+
|
104 |
+
return {
|
105 |
+
results: data.items,
|
106 |
+
more: false,
|
107 |
+
};
|
108 |
+
|
109 |
+
},
|
110 |
+
|
111 |
+
cache: true
|
112 |
+
|
113 |
+
},
|
114 |
+
|
115 |
+
placeholder: "Type here to search an item...",
|
116 |
+
minimumInputLength: 3,
|
117 |
+
width: '100%'
|
118 |
+
|
119 |
+
});
|
120 |
+
});
|
121 |
+
</script>
|
122 |
+
|
123 |
+
<style>
|
124 |
+
.select2-results {
|
125 |
+
max-height: 100px;
|
126 |
+
overflow-y: auto;
|
127 |
+
}
|
128 |
+
</style>
|
129 |
+
<?php
|
130 |
+
}
|
131 |
+
$irp->Form->formEnds();
|
132 |
+
exit;
|
133 |
+
}
|
134 |
+
|
includes/admin/faq.php
CHANGED
@@ -1,17 +1,17 @@
|
|
1 |
-
<?php
|
2 |
-
function irp_ui_faq() {
|
3 |
-
global $irp;
|
4 |
-
$i=1;
|
5 |
-
while($irp->Lang->H('Faq.Question'.$i)) {
|
6 |
-
$q=$irp->Lang->L('Faq.Question'.$i);
|
7 |
-
$r=$irp->Lang->L('Faq.Response'.$i);
|
8 |
-
?>
|
9 |
-
<p>
|
10 |
-
<b><?php echo $q?></b>
|
11 |
-
<br/>
|
12 |
-
<?php echo $r?>
|
13 |
-
</p>
|
14 |
-
<?php
|
15 |
-
++$i;
|
16 |
-
}
|
17 |
}
|
1 |
+
<?php
|
2 |
+
function irp_ui_faq() {
|
3 |
+
global $irp;
|
4 |
+
$i=1;
|
5 |
+
while($irp->Lang->H('Faq.Question'.$i)) {
|
6 |
+
$q=$irp->Lang->L('Faq.Question'.$i);
|
7 |
+
$r=$irp->Lang->L('Faq.Response'.$i);
|
8 |
+
?>
|
9 |
+
<p>
|
10 |
+
<b><?php echo $q?></b>
|
11 |
+
<br/>
|
12 |
+
<?php echo $r?>
|
13 |
+
</p>
|
14 |
+
<?php
|
15 |
+
++$i;
|
16 |
+
}
|
17 |
}
|
includes/admin/feedback.php
CHANGED
@@ -1,44 +1,44 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
function irp_ui_feedback() {
|
4 |
-
global $irp;
|
5 |
-
|
6 |
-
$irp->Form->prefix='Feedback';
|
7 |
-
if($irp->Check->nonce('irp_feedback', 'irp_feedback')) {
|
8 |
-
$irp->Check->email('email');
|
9 |
-
$irp->Check->value('body');
|
10 |
-
|
11 |
-
if(!$irp->Check->hasErrors()) {
|
12 |
-
$irp->Options->setFeedbackEmail($irp->Check->of('email'));
|
13 |
-
$id=-1;
|
14 |
-
if($irp->Check->of('track', 0)) {
|
15 |
-
$id=$irp->Tracking->sendTracking(TRUE);
|
16 |
-
}
|
17 |
-
$irp->Check->data['tracking_id']=$id;
|
18 |
-
$irp->Check->data['plugin']=IRP_PLUGIN_SLUG;
|
19 |
-
$data=$irp->Utils->remotePost('feedback', $irp->Check->data);
|
20 |
-
if($data) {
|
21 |
-
$irp->Options->pushSuccessMessage('FeedbackSuccess');
|
22 |
-
} else {
|
23 |
-
$irp->Options->pushErrorMessage('FeedbackError');
|
24 |
-
}
|
25 |
-
}
|
26 |
-
}
|
27 |
-
?>
|
28 |
-
<br>
|
29 |
-
<h2><?php $irp->Lang->P('FeedbackHeader')?></h2>
|
30 |
-
<?php
|
31 |
-
$irp->Options->writeMessages();
|
32 |
-
|
33 |
-
$irp->Form->formStarts();
|
34 |
-
$irp->Form->text('email', $irp->Options->getFeedbackEmail());
|
35 |
-
$irp->Form->textarea('body', '', array('rows'=>5));
|
36 |
-
|
37 |
-
$irp->Form->leftLabels=FALSE;
|
38 |
-
$irp->Form->checkbox('track');
|
39 |
-
$irp->Form->leftLabels=TRUE;
|
40 |
-
|
41 |
-
$irp->Form->nonce('irp_feedback', 'irp_feedback');
|
42 |
-
$irp->Form->submit('Send');
|
43 |
-
$irp->Form->formEnds();
|
44 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
function irp_ui_feedback() {
|
4 |
+
global $irp;
|
5 |
+
|
6 |
+
$irp->Form->prefix='Feedback';
|
7 |
+
if($irp->Check->nonce('irp_feedback', 'irp_feedback')) {
|
8 |
+
$irp->Check->email('email');
|
9 |
+
$irp->Check->value('body');
|
10 |
+
|
11 |
+
if(!$irp->Check->hasErrors()) {
|
12 |
+
$irp->Options->setFeedbackEmail($irp->Check->of('email'));
|
13 |
+
$id=-1;
|
14 |
+
if($irp->Check->of('track', 0)) {
|
15 |
+
$id=$irp->Tracking->sendTracking(TRUE);
|
16 |
+
}
|
17 |
+
$irp->Check->data['tracking_id']=$id;
|
18 |
+
$irp->Check->data['plugin']=IRP_PLUGIN_SLUG;
|
19 |
+
$data=$irp->Utils->remotePost('feedback', $irp->Check->data);
|
20 |
+
if($data) {
|
21 |
+
$irp->Options->pushSuccessMessage('FeedbackSuccess');
|
22 |
+
} else {
|
23 |
+
$irp->Options->pushErrorMessage('FeedbackError');
|
24 |
+
}
|
25 |
+
}
|
26 |
+
}
|
27 |
+
?>
|
28 |
+
<br>
|
29 |
+
<h2><?php $irp->Lang->P('FeedbackHeader')?></h2>
|
30 |
+
<?php
|
31 |
+
$irp->Options->writeMessages();
|
32 |
+
|
33 |
+
$irp->Form->formStarts();
|
34 |
+
$irp->Form->text('email', $irp->Options->getFeedbackEmail());
|
35 |
+
$irp->Form->textarea('body', '', array('rows'=>5));
|
36 |
+
|
37 |
+
$irp->Form->leftLabels=FALSE;
|
38 |
+
$irp->Form->checkbox('track');
|
39 |
+
$irp->Form->leftLabels=TRUE;
|
40 |
+
|
41 |
+
$irp->Form->nonce('irp_feedback', 'irp_feedback');
|
42 |
+
$irp->Form->submit('Send');
|
43 |
+
$irp->Form->formEnds();
|
44 |
}
|
includes/admin/metabox.php
CHANGED
@@ -1,70 +1,70 @@
|
|
1 |
-
<?php
|
2 |
-
function irp_ui_metabox($post) {
|
3 |
-
global $irp;
|
4 |
-
|
5 |
-
wp_nonce_field('irp_meta_box', 'irp_meta_box_nonce');
|
6 |
-
$array=$irp->Options->getExcludedPostsIds();
|
7 |
-
$exclude=FALSE;
|
8 |
-
if(in_array($post->ID, $array)) {
|
9 |
-
$exclude=TRUE;
|
10 |
-
}
|
11 |
-
?>
|
12 |
-
<input type="hidden" name="irp_previous" value="<?php echo ($exclude ? 1 : 0)?>" />
|
13 |
-
<input type="checkbox" class="irp-checkbox" name="irp_exclude" value="1" <?php echo ($exclude ? ' CHECKED' : '')?> />
|
14 |
-
<?php $irp->Lang->P('Post without related posts')?>
|
15 |
-
<?php
|
16 |
-
}
|
17 |
-
|
18 |
-
add_action('add_meta_boxes', 'irp_add_meta_box');
|
19 |
-
function irp_add_meta_box() {
|
20 |
-
global $irp;
|
21 |
-
|
22 |
-
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
23 |
-
return;
|
24 |
-
}
|
25 |
-
|
26 |
-
$options=$irp->Options->getMetaboxPostTypes();
|
27 |
-
$screens=array();
|
28 |
-
foreach($options as $k=>$v) {
|
29 |
-
if(intval($v)>0) {
|
30 |
-
$screens[]=$k;
|
31 |
-
}
|
32 |
-
}
|
33 |
-
if(count($screens)>0) {
|
34 |
-
foreach ($screens as $screen) {
|
35 |
-
add_meta_box(
|
36 |
-
'irp_sectionid'
|
37 |
-
, $irp->Lang->L('Related Posts by IntellyWP')
|
38 |
-
, 'irp_ui_metabox'
|
39 |
-
, $screen
|
40 |
-
, 'side'
|
41 |
-
);
|
42 |
-
}
|
43 |
-
}
|
44 |
-
}
|
45 |
-
//si aggancia a quando un post viene salvato per salvare anche gli altri dati del metabox
|
46 |
-
add_action('save_post', 'irp_save_meta_box_data');
|
47 |
-
function irp_save_meta_box_data($postId) {
|
48 |
-
global $irp;
|
49 |
-
|
50 |
-
if (defined('DOING_AUTOSAVE') && DOING_AUTOSAVE) {
|
51 |
-
return;
|
52 |
-
}
|
53 |
-
if (!isset($_POST['irp_meta_box_nonce']) || !isset($_POST['post_type'])) {
|
54 |
-
return;
|
55 |
-
}
|
56 |
-
if (!wp_verify_nonce( $_POST['irp_meta_box_nonce'], 'irp_meta_box')) {
|
57 |
-
return;
|
58 |
-
}
|
59 |
-
|
60 |
-
$exclude=$irp->Utils->qs('irp_exclude', 0);
|
61 |
-
$previous=$irp->Utils->qs('irp_previous', 0);
|
62 |
-
if($exclude!=$previous) {
|
63 |
-
$array=$irp->Options->getExcludedPostsIds();
|
64 |
-
$array=array_diff($array, array($postId));
|
65 |
-
if($exclude) {
|
66 |
-
array_push($array, $postId);
|
67 |
-
}
|
68 |
-
$irp->Options->setExcludedPostsIds($array);
|
69 |
-
}
|
70 |
-
}
|
1 |
+
<?php
|
2 |
+
function irp_ui_metabox($post) {
|
3 |
+
global $irp;
|
4 |
+
|
5 |
+
wp_nonce_field('irp_meta_box', 'irp_meta_box_nonce');
|
6 |
+
$array=$irp->Options->getExcludedPostsIds();
|
7 |
+
$exclude=FALSE;
|
8 |
+
if(in_array($post->ID, $array)) {
|
9 |
+
$exclude=TRUE;
|
10 |
+
}
|
11 |
+
?>
|
12 |
+
<input type="hidden" name="irp_previous" value="<?php echo ($exclude ? 1 : 0)?>" />
|
13 |
+
<input type="checkbox" class="irp-checkbox" name="irp_exclude" value="1" <?php echo ($exclude ? ' CHECKED' : '')?> />
|
14 |
+
<?php $irp->Lang->P('Post without related posts')?>
|
15 |
+
<?php
|
16 |
+
}
|
17 |
+
|
18 |
+
add_action('add_meta_boxes', 'irp_add_meta_box');
|
19 |
+
function irp_add_meta_box() {
|
20 |
+
global $irp;
|
21 |
+
|
22 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
23 |
+
return;
|
24 |
+
}
|
25 |
+
|
26 |
+
$options=$irp->Options->getMetaboxPostTypes();
|
27 |
+
$screens=array();
|
28 |
+
foreach($options as $k=>$v) {
|
29 |
+
if(intval($v)>0) {
|
30 |
+
$screens[]=$k;
|
31 |
+
}
|
32 |
+
}
|
33 |
+
if(count($screens)>0) {
|
34 |
+
foreach ($screens as $screen) {
|
35 |
+
add_meta_box(
|
36 |
+
'irp_sectionid'
|
37 |
+
, $irp->Lang->L('Related Posts by IntellyWP')
|
38 |
+
, 'irp_ui_metabox'
|
39 |
+
, $screen
|
40 |
+
, 'side'
|
41 |
+
);
|
42 |
+
}
|
43 |
+
}
|
44 |
+
}
|
45 |
+
//si aggancia a quando un post viene salvato per salvare anche gli altri dati del metabox
|
46 |
+
add_action('save_post', 'irp_save_meta_box_data');
|
47 |
+
function irp_save_meta_box_data($postId) {
|
48 |
+
global $irp;
|
49 |
+
|
50 |
+
if (defined('DOING_AUTOSAVE') && DOING_AUTOSAVE) {
|
51 |
+
return;
|
52 |
+
}
|
53 |
+
if (!isset($_POST['irp_meta_box_nonce']) || !isset($_POST['post_type'])) {
|
54 |
+
return;
|
55 |
+
}
|
56 |
+
if (!wp_verify_nonce( $_POST['irp_meta_box_nonce'], 'irp_meta_box')) {
|
57 |
+
return;
|
58 |
+
}
|
59 |
+
|
60 |
+
$exclude=$irp->Utils->qs('irp_exclude', 0);
|
61 |
+
$previous=$irp->Utils->qs('irp_previous', 0);
|
62 |
+
if($exclude!=$previous) {
|
63 |
+
$array=$irp->Options->getExcludedPostsIds();
|
64 |
+
$array=array_diff($array, array($postId));
|
65 |
+
if($exclude) {
|
66 |
+
array_push($array, $postId);
|
67 |
+
}
|
68 |
+
$irp->Options->setExcludedPostsIds($array);
|
69 |
+
}
|
70 |
+
}
|
includes/admin/settings.php
CHANGED
@@ -1,441 +1,443 @@
|
|
1 |
-
<?php
|
2 |
-
function irp_ui_tracking($override=FALSE) {
|
3 |
-
global $irp;
|
4 |
-
|
5 |
-
$track=$irp->Utils->qs('track', '');
|
6 |
-
if($track!='') {
|
7 |
-
$track=intval($track);
|
8 |
-
$irp->Options->setTrackingEnable($track);
|
9 |
-
$irp->Tracking->sendTracking(TRUE);
|
10 |
-
}
|
11 |
-
|
12 |
-
$uri=IRP_TAB_SETTINGS_URI.'&track=';
|
13 |
-
if($irp->Options->isTrackingEnable()) {
|
14 |
-
if($override) {
|
15 |
-
$uri.='0';
|
16 |
-
$irp->Options->pushSuccessMessage('EnableAllowTrackingNotice', $uri);
|
17 |
-
}
|
18 |
-
} else {
|
19 |
-
$uri.='1';
|
20 |
-
$irp->Options->pushWarningMessage('DisableAllowTrackingNotice', $uri);
|
21 |
-
}
|
22 |
-
$irp->Options->writeMessages();
|
23 |
-
}
|
24 |
-
function irp_io_first_time() {
|
25 |
-
global $irp;
|
26 |
-
if($irp->Options->isShowActivationNotice()) {
|
27 |
-
$irp->Options->pushSuccessMessage('FirstTimeActivation');
|
28 |
-
$irp->Options->writeMessages();
|
29 |
-
$irp->Options->setShowActivationNotice(FALSE);
|
30 |
-
}
|
31 |
-
}
|
32 |
-
function irp_ui_box_preview() {
|
33 |
-
global $irp;
|
34 |
-
|
35 |
-
$count=$irp->Options->getRewritePostsInBoxCount();
|
36 |
-
$count=$irp->Utils->iqs('rewritePostsInBoxCount', $count);
|
37 |
-
$args=array(
|
38 |
-
'orderby'=>'rand'
|
39 |
-
, 'numberposts'=>$count
|
40 |
-
);
|
41 |
-
|
42 |
-
$days=$irp->Options->getRewritePostsDays();
|
43 |
-
$days=$irp->Utils->iqs('rewritePostsDays', $days);
|
44 |
-
if($days>0) {
|
45 |
-
$args['date_query'] = array(
|
46 |
-
'column' => 'post_date'
|
47 |
-
, 'after' => '- '.$days.' days'
|
48 |
-
);
|
49 |
-
}
|
50 |
-
$posts=get_posts($args);
|
51 |
-
$ids=array();
|
52 |
-
foreach($posts as $p) {
|
53 |
-
$ids[]=$p->ID;
|
54 |
-
}
|
55 |
-
if(count($ids)==0) {
|
56 |
-
echo "<b>No posts available. Check settings and try again</b>";
|
57 |
-
die();
|
58 |
-
}
|
59 |
-
|
60 |
-
$defaults=$irp->Options->getTemplateStyle();
|
61 |
-
$args=$irp->Utils->aqs('template-', $defaults);
|
62 |
-
$args['includeCss']=TRUE;
|
63 |
-
$args['preview']=TRUE;
|
64 |
-
$box=irp_ui_get_box($ids, $args);
|
65 |
-
echo $box;
|
66 |
-
die();
|
67 |
-
}
|
68 |
-
function irp_ui_settings() {
|
69 |
-
global $irp;
|
70 |
-
irp_ui_tracking(FALSE);
|
71 |
-
|
72 |
-
?>
|
73 |
-
<script>
|
74 |
-
var IRP_preview=true;
|
75 |
-
var IRP_labelColor='';
|
76 |
-
var IRP_defaults={};
|
77 |
-
<?php
|
78 |
-
$defaults=$irp->HtmlTemplate->getDefaults();
|
79 |
-
foreach($defaults as $k=>$v) {
|
80 |
-
$buffer='';
|
81 |
-
foreach($v as $kk=>$vv) {
|
82 |
-
if($buffer!='') {
|
83 |
-
$buffer.=', ';
|
84 |
-
}
|
85 |
-
|
86 |
-
if(stripos($kk, 'label')!==FALSE) {
|
87 |
-
$vv=$irp->Lang->L('Settings.Color.'.$vv);
|
88 |
-
} elseif(stripos($kk, 'color')!==FALSE) {
|
89 |
-
$vv=$irp->Options->getColor($vv);
|
90 |
-
}
|
91 |
-
|
92 |
-
$buffer.=$kk.': "'.$vv.'"';
|
93 |
-
}
|
94 |
-
?>
|
95 |
-
IRP_defaults["<?php echo $k?>"]={<?php echo $buffer?>};
|
96 |
-
<?php }
|
97 |
-
?>
|
98 |
-
|
99 |
-
function IRP_changeTheme() {
|
100 |
-
IRP_preview=false;
|
101 |
-
t=IRP_val('template-template');
|
102 |
-
t=IRP_defaults[t];
|
103 |
-
isProTheme=false;
|
104 |
-
console.log(t);
|
105 |
-
jQuery.each(t, function(k,v) {
|
106 |
-
if(IRP_stripos(k, 'color')!==false) {
|
107 |
-
var $k=jQuery('[name=template-'+k+']');
|
108 |
-
$k.select2("val", v);
|
109 |
-
} else if(k=='proTheme') {
|
110 |
-
isProTheme=(v+''.toLowerCase()=='true');
|
111 |
-
}
|
112 |
-
});
|
113 |
-
|
114 |
-
jQuery("[name*='Color']").each(function(i,v) {
|
115 |
-
var $cbo=jQuery(this);
|
116 |
-
$cbo.prop("disabled", isProTheme);
|
117 |
-
$cbo.select2("enable", !isProTheme);
|
118 |
-
});
|
119 |
-
jQuery("[id*='ColorLabel']").each(function(i,v) {
|
120 |
-
var $lbl=jQuery(this);
|
121 |
-
if(IRP_labelColor!='') {
|
122 |
-
IRP_labelColor=$lbl.css('color');
|
123 |
-
}
|
124 |
-
if(isProTheme) {
|
125 |
-
$lbl.css('color', '#ccc');
|
126 |
-
} else {
|
127 |
-
$lbl.css('color', IRP_labelColor);
|
128 |
-
}
|
129 |
-
});
|
130 |
-
jQuery('.irp-submit').prop("disabled", isProTheme);
|
131 |
-
IRP_preview=true;
|
132 |
-
}
|
133 |
-
function IRP_changeRelatedBox() {
|
134 |
-
if(!IRP_preview) {
|
135 |
-
return;
|
136 |
-
}
|
137 |
-
|
138 |
-
var t=IRP_val('template-template');
|
139 |
-
t=IRP_defaults[t].borderColorLabel;
|
140 |
-
jQuery('#template-borderColorLabel').text(t);
|
141 |
-
|
142 |
-
data=IRP_aval('template-');
|
143 |
-
data=jQuery.extend({
|
144 |
-
'action': 'do_action'
|
145 |
-
, 'irp_action': 'ui_box_preview'
|
146 |
-
, 'rewritePostsDays': IRP_val('irpRewritePostsDays')
|
147 |
-
}, data);
|
148 |
-
//console.log(data);
|
149 |
-
|
150 |
-
var request=jQuery.ajax({
|
151 |
-
url: ajaxurl
|
152 |
-
, method: "POST"
|
153 |
-
, data: data
|
154 |
-
, dataType: "html"
|
155 |
-
});
|
156 |
-
|
157 |
-
request.done(function(html) {
|
158 |
-
jQuery("#relatedBoxExample").html(html);
|
159 |
-
});
|
160 |
-
}
|
161 |
-
|
162 |
-
jQuery(function() {
|
163 |
-
IRP_preview=false;
|
164 |
-
var array=['irpRewritePostsDays', 'irpRewritePostsInBoxCount', 'irpRewriteBoxesCount'];
|
165 |
-
for(i=0; i<array.length; i++) {
|
166 |
-
if(jQuery('[name='+array[i]+']').length>0) {
|
167 |
-
jQuery('[name='+array[i]+']').change(function() {
|
168 |
-
IRP_changeRelatedBox();
|
169 |
-
});
|
170 |
-
}
|
171 |
-
}
|
172 |
-
jQuery("[name^='template-']").change(function() {
|
173 |
-
if(!IRP_preview) {
|
174 |
-
return;
|
175 |
-
}
|
176 |
-
|
177 |
-
var $self=jQuery(this);
|
178 |
-
var name=$self.attr('name');
|
179 |
-
if(name=='template-template') {
|
180 |
-
IRP_changeTheme();
|
181 |
-
}
|
182 |
-
IRP_changeRelatedBox();
|
183 |
-
});
|
184 |
-
//IRP_changeTheme();
|
185 |
-
IRP_preview=true;
|
186 |
-
IRP_changeRelatedBox();
|
187 |
-
});
|
188 |
-
</script>
|
189 |
-
<?php
|
190 |
-
|
191 |
-
$irp->Form->prefix='Settings';
|
192 |
-
$irp->Form->helps = FALSE;
|
193 |
-
$irp->Form->formStarts();
|
194 |
-
|
195 |
-
if($irp->Check->nonce('irp_settings')) {
|
196 |
-
|
197 |
-
$irp->Options->resetMaxExecutionTime();
|
198 |
-
$irp->Options->setActive($irp->Utils->iqs('irpActive'));
|
199 |
-
|
200 |
-
$defaults=array(
|
201 |
-
'hasShadow'=>0
|
202 |
-
, 'hasPoweredBy'=>0
|
203 |
-
);
|
204 |
-
$template=$irp->Utils->aqs('template-', $defaults);
|
205 |
-
$irp->Options->setTemplateStyle($template);
|
206 |
-
|
207 |
-
$irp->Options->setMarginTop($irp->Utils->qs('marginTop', '0em'));
|
208 |
-
$irp->Options->setMarginBottom($irp->Utils->qs('marginBottom', '1em'));
|
209 |
-
$irp->Options->setRewriteActive($irp->Utils->iqs('irpRewriteActive'));
|
210 |
-
$irp->Options->setRewriteBoxesCount($irp->Utils->iqs('irpRewriteBoxesCount', 1));
|
211 |
-
//$irp->Options->setRewritePostsInBoxCount($irp->Utils->iqs('irpRewritePostsInBoxCount', 1));
|
212 |
-
$irp->Options->setRewritePostsDays($irp->Utils->iqs('irpRewritePostsDays', 0));
|
213 |
-
$irp->Options->setRewriteThreshold($irp->Utils->iqs('irpRewriteThreshold', 300));
|
214 |
-
$irp->Options->setHookPriority($irp->Utils->iqs('irpHookPriority', 99999));
|
215 |
-
$irp->Options->setRewriteAtEnd($irp->Utils->iqs('irpRewriteAtEnd'));
|
216 |
-
$irp->Options->setRewriteStaticLinks($irp->Utils->iqs('irpRewriteStaticLinks'));
|
217 |
-
|
218 |
-
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
-
|
223 |
-
$
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
$
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
$
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
$
|
243 |
-
|
244 |
-
|
245 |
-
, 'irp-
|
246 |
-
|
247 |
-
|
248 |
-
$args
|
249 |
-
|
250 |
-
|
251 |
-
, '
|
252 |
-
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
$
|
257 |
-
$
|
258 |
-
$
|
259 |
-
$irp->
|
260 |
-
$irp->Form->
|
261 |
-
|
262 |
-
$irp->Form->text('
|
263 |
-
|
264 |
-
//$
|
265 |
-
$
|
266 |
-
$
|
267 |
-
|
268 |
-
|
269 |
-
$
|
270 |
-
$
|
271 |
-
|
272 |
-
|
273 |
-
$v=$irp->
|
274 |
-
$irp->
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
$
|
288 |
-
|
289 |
-
|
290 |
-
, 'irp-
|
291 |
-
|
292 |
-
|
293 |
-
$
|
294 |
-
$irp
|
295 |
-
|
296 |
-
|
297 |
-
$options
|
298 |
-
$options[]=array('id'=>
|
299 |
-
$options[]=array('id'=>
|
300 |
-
$
|
301 |
-
$irp->Form->
|
302 |
-
$irp->Form->number('
|
303 |
-
$irp->Form->number('
|
304 |
-
$irp->Form->
|
305 |
-
$irp->Form->checkbox('
|
306 |
-
$irp->Form->
|
307 |
-
|
308 |
-
$
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
$irp->Form->
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
|
325 |
-
|
326 |
-
|
327 |
-
$
|
328 |
-
$options
|
329 |
-
$
|
330 |
-
|
331 |
-
$
|
332 |
-
|
333 |
-
$
|
334 |
-
$options
|
335 |
-
$
|
336 |
-
$
|
337 |
-
|
338 |
-
|
339 |
-
|
340 |
-
$irp->Form->
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
|
348 |
-
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
$irp->Form->
|
355 |
-
|
356 |
-
$
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
|
363 |
-
|
364 |
-
$irp->Form->
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
$
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
|
404 |
-
|
405 |
-
|
406 |
-
|
407 |
-
|
408 |
-
|
409 |
-
|
410 |
-
|
411 |
-
|
412 |
-
$q
|
413 |
-
|
414 |
-
$q='';
|
415 |
-
}
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
-
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
<div style="
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
|
|
|
1 |
+
<?php
|
2 |
+
function irp_ui_tracking($override=FALSE) {
|
3 |
+
global $irp;
|
4 |
+
|
5 |
+
$track=$irp->Utils->qs('track', '');
|
6 |
+
if($track!='') {
|
7 |
+
$track=intval($track);
|
8 |
+
$irp->Options->setTrackingEnable($track);
|
9 |
+
$irp->Tracking->sendTracking(TRUE);
|
10 |
+
}
|
11 |
+
|
12 |
+
$uri=IRP_TAB_SETTINGS_URI.'&track=';
|
13 |
+
if($irp->Options->isTrackingEnable()) {
|
14 |
+
if($override) {
|
15 |
+
$uri.='0';
|
16 |
+
$irp->Options->pushSuccessMessage('EnableAllowTrackingNotice', $uri);
|
17 |
+
}
|
18 |
+
} else {
|
19 |
+
$uri.='1';
|
20 |
+
$irp->Options->pushWarningMessage('DisableAllowTrackingNotice', $uri);
|
21 |
+
}
|
22 |
+
$irp->Options->writeMessages();
|
23 |
+
}
|
24 |
+
function irp_io_first_time() {
|
25 |
+
global $irp;
|
26 |
+
if($irp->Options->isShowActivationNotice()) {
|
27 |
+
$irp->Options->pushSuccessMessage('FirstTimeActivation');
|
28 |
+
$irp->Options->writeMessages();
|
29 |
+
$irp->Options->setShowActivationNotice(FALSE);
|
30 |
+
}
|
31 |
+
}
|
32 |
+
function irp_ui_box_preview() {
|
33 |
+
global $irp;
|
34 |
+
|
35 |
+
$count=$irp->Options->getRewritePostsInBoxCount();
|
36 |
+
$count=$irp->Utils->iqs('rewritePostsInBoxCount', $count);
|
37 |
+
$args=array(
|
38 |
+
'orderby'=>'rand'
|
39 |
+
, 'numberposts'=>$count
|
40 |
+
);
|
41 |
+
|
42 |
+
$days=$irp->Options->getRewritePostsDays();
|
43 |
+
$days=$irp->Utils->iqs('rewritePostsDays', $days);
|
44 |
+
if($days>0) {
|
45 |
+
$args['date_query'] = array(
|
46 |
+
'column' => 'post_date'
|
47 |
+
, 'after' => '- '.$days.' days'
|
48 |
+
);
|
49 |
+
}
|
50 |
+
$posts=get_posts($args);
|
51 |
+
$ids=array();
|
52 |
+
foreach($posts as $p) {
|
53 |
+
$ids[]=$p->ID;
|
54 |
+
}
|
55 |
+
if(count($ids)==0) {
|
56 |
+
echo "<b>No posts available. Check settings and try again</b>";
|
57 |
+
die();
|
58 |
+
}
|
59 |
+
|
60 |
+
$defaults=$irp->Options->getTemplateStyle();
|
61 |
+
$args=$irp->Utils->aqs('template-', $defaults);
|
62 |
+
$args['includeCss']=TRUE;
|
63 |
+
$args['preview']=TRUE;
|
64 |
+
$box=irp_ui_get_box($ids, $args);
|
65 |
+
echo $box;
|
66 |
+
die();
|
67 |
+
}
|
68 |
+
function irp_ui_settings() {
|
69 |
+
global $irp;
|
70 |
+
irp_ui_tracking(FALSE);
|
71 |
+
|
72 |
+
?>
|
73 |
+
<script>
|
74 |
+
var IRP_preview=true;
|
75 |
+
var IRP_labelColor='';
|
76 |
+
var IRP_defaults={};
|
77 |
+
<?php
|
78 |
+
$defaults=$irp->HtmlTemplate->getDefaults();
|
79 |
+
foreach($defaults as $k=>$v) {
|
80 |
+
$buffer='';
|
81 |
+
foreach($v as $kk=>$vv) {
|
82 |
+
if($buffer!='') {
|
83 |
+
$buffer.=', ';
|
84 |
+
}
|
85 |
+
|
86 |
+
if(stripos($kk, 'label')!==FALSE) {
|
87 |
+
$vv=$irp->Lang->L('Settings.Color.'.$vv);
|
88 |
+
} elseif(stripos($kk, 'color')!==FALSE) {
|
89 |
+
$vv=$irp->Options->getColor($vv);
|
90 |
+
}
|
91 |
+
|
92 |
+
$buffer.=$kk.': "'.$vv.'"';
|
93 |
+
}
|
94 |
+
?>
|
95 |
+
IRP_defaults["<?php echo $k?>"]={<?php echo $buffer?>};
|
96 |
+
<?php }
|
97 |
+
?>
|
98 |
+
|
99 |
+
function IRP_changeTheme() {
|
100 |
+
IRP_preview=false;
|
101 |
+
t=IRP_val('template-template');
|
102 |
+
t=IRP_defaults[t];
|
103 |
+
isProTheme=false;
|
104 |
+
console.log(t);
|
105 |
+
jQuery.each(t, function(k,v) {
|
106 |
+
if(IRP_stripos(k, 'color')!==false) {
|
107 |
+
var $k=jQuery('[name=template-'+k+']');
|
108 |
+
$k.select2("val", v);
|
109 |
+
} else if(k=='proTheme') {
|
110 |
+
isProTheme=(v+''.toLowerCase()=='true');
|
111 |
+
}
|
112 |
+
});
|
113 |
+
|
114 |
+
jQuery("[name*='Color']").each(function(i,v) {
|
115 |
+
var $cbo=jQuery(this);
|
116 |
+
$cbo.prop("disabled", isProTheme);
|
117 |
+
$cbo.select2("enable", !isProTheme);
|
118 |
+
});
|
119 |
+
jQuery("[id*='ColorLabel']").each(function(i,v) {
|
120 |
+
var $lbl=jQuery(this);
|
121 |
+
if(IRP_labelColor!='') {
|
122 |
+
IRP_labelColor=$lbl.css('color');
|
123 |
+
}
|
124 |
+
if(isProTheme) {
|
125 |
+
$lbl.css('color', '#ccc');
|
126 |
+
} else {
|
127 |
+
$lbl.css('color', IRP_labelColor);
|
128 |
+
}
|
129 |
+
});
|
130 |
+
jQuery('.irp-submit').prop("disabled", isProTheme);
|
131 |
+
IRP_preview=true;
|
132 |
+
}
|
133 |
+
function IRP_changeRelatedBox() {
|
134 |
+
if(!IRP_preview) {
|
135 |
+
return;
|
136 |
+
}
|
137 |
+
|
138 |
+
var t=IRP_val('template-template');
|
139 |
+
t=IRP_defaults[t].borderColorLabel;
|
140 |
+
jQuery('#template-borderColorLabel').text(t);
|
141 |
+
|
142 |
+
data=IRP_aval('template-');
|
143 |
+
data=jQuery.extend({
|
144 |
+
'action': 'do_action'
|
145 |
+
, 'irp_action': 'ui_box_preview'
|
146 |
+
, 'rewritePostsDays': IRP_val('irpRewritePostsDays')
|
147 |
+
}, data);
|
148 |
+
//console.log(data);
|
149 |
+
|
150 |
+
var request=jQuery.ajax({
|
151 |
+
url: ajaxurl
|
152 |
+
, method: "POST"
|
153 |
+
, data: data
|
154 |
+
, dataType: "html"
|
155 |
+
});
|
156 |
+
|
157 |
+
request.done(function(html) {
|
158 |
+
jQuery("#relatedBoxExample").html(html);
|
159 |
+
});
|
160 |
+
}
|
161 |
+
|
162 |
+
jQuery(function() {
|
163 |
+
IRP_preview=false;
|
164 |
+
var array=['irpRewritePostsDays', 'irpRewritePostsInBoxCount', 'irpRewriteBoxesCount'];
|
165 |
+
for(i=0; i<array.length; i++) {
|
166 |
+
if(jQuery('[name='+array[i]+']').length>0) {
|
167 |
+
jQuery('[name='+array[i]+']').change(function() {
|
168 |
+
IRP_changeRelatedBox();
|
169 |
+
});
|
170 |
+
}
|
171 |
+
}
|
172 |
+
jQuery("[name^='template-']").change(function() {
|
173 |
+
if(!IRP_preview) {
|
174 |
+
return;
|
175 |
+
}
|
176 |
+
|
177 |
+
var $self=jQuery(this);
|
178 |
+
var name=$self.attr('name');
|
179 |
+
if(name=='template-template') {
|
180 |
+
IRP_changeTheme();
|
181 |
+
}
|
182 |
+
IRP_changeRelatedBox();
|
183 |
+
});
|
184 |
+
//IRP_changeTheme();
|
185 |
+
IRP_preview=true;
|
186 |
+
IRP_changeRelatedBox();
|
187 |
+
});
|
188 |
+
</script>
|
189 |
+
<?php
|
190 |
+
|
191 |
+
$irp->Form->prefix='Settings';
|
192 |
+
$irp->Form->helps = FALSE;
|
193 |
+
$irp->Form->formStarts();
|
194 |
+
|
195 |
+
if($irp->Check->nonce('irp_settings')) {
|
196 |
+
|
197 |
+
$irp->Options->resetMaxExecutionTime();
|
198 |
+
$irp->Options->setActive($irp->Utils->iqs('irpActive'));
|
199 |
+
|
200 |
+
$defaults=array(
|
201 |
+
'hasShadow'=>0
|
202 |
+
, 'hasPoweredBy'=>0
|
203 |
+
);
|
204 |
+
$template=$irp->Utils->aqs('template-', $defaults);
|
205 |
+
$irp->Options->setTemplateStyle($template);
|
206 |
+
|
207 |
+
$irp->Options->setMarginTop($irp->Utils->qs('marginTop', '0em'));
|
208 |
+
$irp->Options->setMarginBottom($irp->Utils->qs('marginBottom', '1em'));
|
209 |
+
$irp->Options->setRewriteActive($irp->Utils->iqs('irpRewriteActive'));
|
210 |
+
$irp->Options->setRewriteBoxesCount($irp->Utils->iqs('irpRewriteBoxesCount', 1));
|
211 |
+
//$irp->Options->setRewritePostsInBoxCount($irp->Utils->iqs('irpRewritePostsInBoxCount', 1));
|
212 |
+
$irp->Options->setRewritePostsDays($irp->Utils->iqs('irpRewritePostsDays', 0));
|
213 |
+
$irp->Options->setRewriteThreshold($irp->Utils->iqs('irpRewriteThreshold', 300));
|
214 |
+
$irp->Options->setHookPriority($irp->Utils->iqs('irpHookPriority', 99999));
|
215 |
+
$irp->Options->setRewriteAtEnd($irp->Utils->iqs('irpRewriteAtEnd'));
|
216 |
+
$irp->Options->setRewriteStaticLinks($irp->Utils->iqs('irpRewriteStaticLinks'));
|
217 |
+
$irp->Options->setPlaceInsideSpanElements($irp->Utils->iqs('irpPlaceInsideSpanElements'));
|
218 |
+
|
219 |
+
$irp->Options->setEngineSearch($irp->Utils->iqs('irpEngineSearch', IRP_ENGINE_SEARCH_CATEGORIES_TAGS));
|
220 |
+
|
221 |
+
$options = $irp->Options->getRewritePostTypes();
|
222 |
+
foreach ($options as $k => $template) {
|
223 |
+
$template = intval($irp->Utils->qs('irpRewritePostType_' . $k, 0));
|
224 |
+
$options[$k] = $template;
|
225 |
+
}
|
226 |
+
$irp->Options->setRewritePostTypes($options);
|
227 |
+
|
228 |
+
$options = $irp->Options->getMetaboxPostTypes();
|
229 |
+
foreach ($options as $k => $template) {
|
230 |
+
$template = intval($irp->Utils->qs('metabox_' . $k, 0));
|
231 |
+
$options[$k] = $template;
|
232 |
+
}
|
233 |
+
$irp->Options->setMetaboxPostTypes($options);
|
234 |
+
}
|
235 |
+
|
236 |
+
$c=wp_count_posts()->publish;
|
237 |
+
$t=$irp->Options->getMaxExecutionTime();
|
238 |
+
if($t>0) {?>
|
239 |
+
<p style="width:auto; font-style: italic;"><?php $irp->Lang->P('PreviewSectionMaxTime', $t, $c)?></p>
|
240 |
+
<?php }
|
241 |
+
|
242 |
+
$irp->Form->p('GeneralSection');
|
243 |
+
$args=array(
|
244 |
+
'class'=>'irp-hideShow irp-checkbox'
|
245 |
+
, 'irp-hideIfTrue'=>'false'
|
246 |
+
, 'irp-hideShow'=>'irp-active-box'
|
247 |
+
);
|
248 |
+
$irp->Form->checkbox('irpActive', $irp->Options->isActive(), 1, $args);
|
249 |
+
$args=array(
|
250 |
+
'id'=>'irp-active-box'
|
251 |
+
, 'name'=>'irp-active-box'
|
252 |
+
, 'style'=>'margin-top:10px;'
|
253 |
+
);
|
254 |
+
$irp->Form->divStarts($args);
|
255 |
+
{
|
256 |
+
$template=$irp->Options->getTemplateStyle();
|
257 |
+
$prefix='template-';
|
258 |
+
$irp->Form->text($prefix.'ctaText', $irp->Utils->get($template, 'ctaText'));
|
259 |
+
$options=$irp->HtmlTemplate->getTemplatesNames();
|
260 |
+
$irp->Form->select($prefix.'template', $irp->Utils->get($template, 'template'), $options);
|
261 |
+
$irp->Form->number($prefix.'boxOpacity', $irp->Utils->get($template, 'boxOpacity'));
|
262 |
+
$irp->Form->text('marginTop', $irp->Options->getMarginTop());
|
263 |
+
$irp->Form->text('marginBottom', $irp->Options->getMarginBottom());
|
264 |
+
//$options=array('none', 'capitalize', 'uppercase', 'lowercase');
|
265 |
+
//$irp->Form->select($t.'textTransform', $irp->Utils->get($v, 'textTransform'), $options);
|
266 |
+
$array=array('ctaTextColor', 'postTitleColor', 'boxColor', 'borderColor');
|
267 |
+
$blanks=array('(Default)', '(Default)', '(Trasparent)', '(Without)');
|
268 |
+
for($i=0; $i<count($array); $i++) {
|
269 |
+
$k=$array[$i];
|
270 |
+
$v=$blanks[$i];
|
271 |
+
$colors=$irp->Options->getColors($v);
|
272 |
+
|
273 |
+
$v=$irp->Utils->get($template, $k);
|
274 |
+
$v=$irp->Options->getColor($v);
|
275 |
+
$irp->Form->colorSelect($prefix.$k, $v, $colors);
|
276 |
+
}
|
277 |
+
$array=array('hasShadow', 'hasPoweredBy');
|
278 |
+
foreach($array as $k) {
|
279 |
+
$irp->Form->checkbox($prefix.$k, $irp->Utils->iget($template, $k));
|
280 |
+
}
|
281 |
+
?>
|
282 |
+
<div style="padding-left:10px; padding-right:10px; border:1px dashed #444444">
|
283 |
+
<?php $irp->Form->p('PreviewSection'); ?>
|
284 |
+
<p id="relatedBoxExample" style="width:auto;"></p>
|
285 |
+
</div>
|
286 |
+
<?php
|
287 |
+
$irp->Form->p('RewriteSection');
|
288 |
+
$args=array(
|
289 |
+
'class'=>'irp-hideShow irp-checkbox'
|
290 |
+
, 'irp-hideIfTrue'=>'false'
|
291 |
+
, 'irp-hideShow'=>'irp-rewrite-box'
|
292 |
+
);
|
293 |
+
$irp->Form->checkbox('irpRewriteActive', $irp->Options->isRewriteActive(), 1, $args);
|
294 |
+
$args=array('id'=>'irp-rewrite-box', 'name'=>'irp-rewrite-box', 'style'=>'margin-top:10px;');
|
295 |
+
$irp->Form->divStarts($args);
|
296 |
+
{
|
297 |
+
$options=array();
|
298 |
+
$options[]=array('id'=>1, 'name'=>1);
|
299 |
+
$options[]=array('id'=>2, 'name'=>2);
|
300 |
+
$options[]=array('id'=>3, 'name'=>3);
|
301 |
+
$irp->Form->select('irpRewriteBoxesCount', $irp->Options->getRewriteBoxesCount(), $options);
|
302 |
+
$irp->Form->number('irpRewritePostsDays', $irp->Options->getRewritePostsDays());
|
303 |
+
$irp->Form->number('irpRewriteThreshold', $irp->Options->getRewriteThreshold(), $args);
|
304 |
+
$irp->Form->number('irpHookPriority', $irp->Options->getHookPriority());
|
305 |
+
$irp->Form->checkbox('irpRewriteAtEnd', $irp->Options->isRewriteAtEnd());
|
306 |
+
$irp->Form->checkbox('irpRewriteStaticLinks', $irp->Options->isRewriteStaticLinks());
|
307 |
+
$irp->Form->checkbox('irpPlaceInsideSpanElements', $irp->Options->isPlaceInsideSpanElements());
|
308 |
+
$irp->Form->p('');
|
309 |
+
|
310 |
+
$options=$irp->Options->getRewritePostTypes();
|
311 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
312 |
+
foreach($types as $v) {
|
313 |
+
$v=$v['name'];
|
314 |
+
$irp->Form->checkbox('irpRewritePostType_'.$v, $options[$v]);
|
315 |
+
}
|
316 |
+
}
|
317 |
+
$irp->Form->divEnds();
|
318 |
+
|
319 |
+
$irp->Form->p('EngineSection');
|
320 |
+
$irp->Form->divStarts();
|
321 |
+
{
|
322 |
+
$options=array(
|
323 |
+
IRP_ENGINE_SEARCH_CATEGORIES_TAGS
|
324 |
+
, IRP_ENGINE_SEARCH_CATEGORIES
|
325 |
+
, IRP_ENGINE_SEARCH_TAGS
|
326 |
+
);
|
327 |
+
$irp->Form->select('irpEngineSearch', $irp->Options->getEngineSearch(), $options);
|
328 |
+
$options=array();
|
329 |
+
$options[]=array('id'=>'dofollow', 'name'=>'dofollow');
|
330 |
+
$options[]=array('id'=>'nofollow', 'name'=>'nofollow');
|
331 |
+
$k='linkRel';
|
332 |
+
|
333 |
+
$irp->Form->select($prefix.$k, $irp->Utils->get($template, $k), $options);
|
334 |
+
$options=array();
|
335 |
+
$options[]=array('id'=>'_blank', 'name'=>'_blank');
|
336 |
+
$options[]=array('id'=>'_self', 'name'=>'_self');
|
337 |
+
$k='linkTarget';
|
338 |
+
$irp->Form->select($prefix.$k, $irp->Utils->get($template, $k), $options);
|
339 |
+
}
|
340 |
+
$irp->Form->divEnds();
|
341 |
+
|
342 |
+
$irp->Form->p('MetaboxSection');
|
343 |
+
$irp->Form->divStarts();
|
344 |
+
{
|
345 |
+
$metaboxes=$irp->Options->getMetaboxPostTypes();
|
346 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
347 |
+
foreach($types as $template) {
|
348 |
+
$template=$template['name'];
|
349 |
+
$irp->Form->checkbox('metabox_'.$template, $metaboxes[$template]);
|
350 |
+
}
|
351 |
+
}
|
352 |
+
$irp->Form->divEnds();
|
353 |
+
}
|
354 |
+
$irp->Form->divEnds();
|
355 |
+
|
356 |
+
$irp->Form->nonce('irp_settings');
|
357 |
+
irp_notice_pro_features();
|
358 |
+
$args=array('id'=>'boxDontSave', 'style'=>'display:none;');
|
359 |
+
$irp->Form->divStarts($args);
|
360 |
+
{
|
361 |
+
$irp->Form->p('Notice.DontSave');
|
362 |
+
}
|
363 |
+
$irp->Form->divEnds();
|
364 |
+
$irp->Form->submit('Save');
|
365 |
+
|
366 |
+
$irp->Form->formEnds(false);
|
367 |
+
$irp->Form->helps=FALSE;
|
368 |
+
|
369 |
+
$args=array('id'=>'irp-sidebar', 'style'=>'float:left; max-width: 250px; margin-left:10px');
|
370 |
+
$irp->Form->divStarts($args);
|
371 |
+
|
372 |
+
$count=$irp->Tabs->getPluginsCount();
|
373 |
+
$plugins=array();
|
374 |
+
while(count($plugins)<2) {
|
375 |
+
$id=rand(1, $count);
|
376 |
+
if(!isset($plugins[$id])) {
|
377 |
+
$plugins[$id]=$id;
|
378 |
+
}
|
379 |
+
}
|
380 |
+
|
381 |
+
$count=$irp->Tabs->drawContactUsWidget();
|
382 |
+
foreach($plugins as $id) {
|
383 |
+
$count=$irp->Tabs->drawPluginWidget($id);
|
384 |
+
}
|
385 |
+
|
386 |
+
$irp->Form->divEnds();
|
387 |
+
|
388 |
+
}
|
389 |
+
|
390 |
+
function irp_notice_pro_features() {
|
391 |
+
global $irp;
|
392 |
+
|
393 |
+
?>
|
394 |
+
<br/>
|
395 |
+
<div class="message updated below-h2" style="max-width:600px;">
|
396 |
+
<div style="height:10px;"></div>
|
397 |
+
<?php
|
398 |
+
$i=1;
|
399 |
+
while($irp->Lang->H('Notice.ProHeader'.$i)) {
|
400 |
+
$irp->Lang->P('Notice.ProHeader'.$i);
|
401 |
+
echo '<br/>';
|
402 |
+
++$i;
|
403 |
+
}
|
404 |
+
$i=1;
|
405 |
+
?>
|
406 |
+
<br/>
|
407 |
+
<?php
|
408 |
+
/*
|
409 |
+
$options = array('public' => TRUE, '_builtin' => FALSE);
|
410 |
+
$q=get_post_types($options, 'names');
|
411 |
+
if(is_array($q) && count($q)>0) {
|
412 |
+
sort($q);
|
413 |
+
$q=implode(', ', $q);
|
414 |
+
$q='(<b>'.$q.'</b>)';
|
415 |
+
} else {
|
416 |
+
$q='';
|
417 |
+
}*/
|
418 |
+
|
419 |
+
while($irp->Lang->H('Notice.ProFeature'.$i)) { ?>
|
420 |
+
<div style="clear:both; margin-top: 2px;"></div>
|
421 |
+
<div style="float:left; vertical-align:middle; height:24px; margin-right:5px;">
|
422 |
+
<img src="<?php echo IRP_PLUGIN_IMAGES?>tick.png" />
|
423 |
+
</div>
|
424 |
+
<div style="float:left; vertical-align:middle; height:24px;">
|
425 |
+
<?php $irp->Lang->P('Notice.ProFeature'.$i)?>
|
426 |
+
</div>
|
427 |
+
<?php ++$i;
|
428 |
+
}
|
429 |
+
?>
|
430 |
+
<div style="clear:both;"></div>
|
431 |
+
<div style="height:10px;"></div>
|
432 |
+
<div style="float:right;">
|
433 |
+
<?php
|
434 |
+
$url=IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG.'/?utm_source=free-users&utm_medium=irp-cta&utm_campaign=IRP';
|
435 |
+
?>
|
436 |
+
<a href="<?php echo $url?>" target="_blank">
|
437 |
+
<b><?php $irp->Lang->P('Notice.ProCTA')?></b>
|
438 |
+
</a>
|
439 |
+
</div>
|
440 |
+
<div style="height:10px; clear:both;"></div>
|
441 |
+
</div>
|
442 |
+
<br/>
|
443 |
+
<?php }
|
includes/admin/whatsnew.php
CHANGED
@@ -1,105 +1,105 @@
|
|
1 |
-
<?php
|
2 |
-
function irp_ui_whats_new() {
|
3 |
-
?>
|
4 |
-
<style>
|
5 |
-
.irp-grid {
|
6 |
-
margin-left: auto;
|
7 |
-
margin-right: auto;
|
8 |
-
border-spacing: 10px;
|
9 |
-
}
|
10 |
-
.irp-grid td {
|
11 |
-
text-align: center;
|
12 |
-
}
|
13 |
-
.irp-headline {
|
14 |
-
font-size:40px;
|
15 |
-
font-weight:bold;
|
16 |
-
text-align:center;
|
17 |
-
margin: 5px!important;
|
18 |
-
}
|
19 |
-
</style>
|
20 |
-
|
21 |
-
<p class="irp-headline">Welcome to Inline Related Posts (v.<?php echo IRP_PLUGIN_VERSION ?>)</p>
|
22 |
-
<p class="irp-headline" style="font-size: 35px;">Get even more page views with box themes</p>
|
23 |
-
<div style="clear:both; height:30px;"></div>
|
24 |
-
|
25 |
-
<div style="text-align:center; width:auto;">
|
26 |
-
<img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/mac-irl-wahtsnew.png" />
|
27 |
-
</div>
|
28 |
-
<div style="clear:both; height:30px;"></div>
|
29 |
-
|
30 |
-
<table border="0" class="irp-grid">
|
31 |
-
<tr>
|
32 |
-
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.001.jpg" /></td>
|
33 |
-
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.002.jpg" /></td>
|
34 |
-
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.003.jpg" /></td>
|
35 |
-
</tr>
|
36 |
-
<tr>
|
37 |
-
<td>Box Themes</td>
|
38 |
-
<td>More colors</td>
|
39 |
-
<td>Featured Image</td>
|
40 |
-
</tr>
|
41 |
-
</table>
|
42 |
-
<div style="clear:both"></div>
|
43 |
-
|
44 |
-
<hr/>
|
45 |
-
|
46 |
-
<p class="irp-headline">Get gorgeous themes with Inline Related Posts PRO</p>
|
47 |
-
<table border="0" class="irp-grid">
|
48 |
-
<tr>
|
49 |
-
<td style="text-align:left;">
|
50 |
-
<?php irp_notice_pro_features() ?>
|
51 |
-
</td>
|
52 |
-
<td>
|
53 |
-
<div style="border:1px dashed red; padding:10px;">
|
54 |
-
<iframe width="560" height="350" src="https://www.youtube.com/embed/CjdTr14Nd1g" frameborder="0" allowfullscreen></iframe>
|
55 |
-
</div>
|
56 |
-
</td>
|
57 |
-
</tr>
|
58 |
-
</table>
|
59 |
-
|
60 |
-
<table border="0" class="irp-grid">
|
61 |
-
<tr>
|
62 |
-
<td style="text-align: right; vertical-align: top;">
|
63 |
-
<form method="get" action="<?php echo IRP_PAGE_SETTINGS?>">
|
64 |
-
<input type="hidden" name="page" value="<?php echo IRP_PLUGIN_SLUG?>" />
|
65 |
-
<input type="submit" class="button" value="CONTINUE USING FREE VERSION" />
|
66 |
-
</form>
|
67 |
-
</td>
|
68 |
-
<td style="text-align: left; vertical-align: top;">
|
69 |
-
<form method="get" action="<?php echo IRP_PAGE_PREMIUM?>">
|
70 |
-
<input type="hidden" name="utm_source" value="free-users" />
|
71 |
-
<input type="hidden" name="utm_medium" value="irp-whatsnew" />
|
72 |
-
<input type="hidden" name="utm_campaign" value="IRP" />
|
73 |
-
<input type="submit" class="button-primary" value="UPGRADE TO PREMIUM NOW ››" />
|
74 |
-
</form>
|
75 |
-
<a href="<?php echo irp_preview_link()?>" target="_blank">or preview your posts with PRO themes</a>
|
76 |
-
</td>
|
77 |
-
</tr>
|
78 |
-
</table>
|
79 |
-
<?php }
|
80 |
-
|
81 |
-
function irp_preview_link() {
|
82 |
-
global $irp;
|
83 |
-
|
84 |
-
$options=array(
|
85 |
-
'count'=>1
|
86 |
-
, 'array'=>TRUE
|
87 |
-
, 'numberposts'=>5
|
88 |
-
);
|
89 |
-
$posts=wp_get_recent_posts($options);
|
90 |
-
$ids=array();
|
91 |
-
foreach($posts as $p) {
|
92 |
-
$ids[]=$p['ID'];
|
93 |
-
}
|
94 |
-
shuffle($ids);
|
95 |
-
$options=irp_ui_get_box($ids, $options);
|
96 |
-
|
97 |
-
$options=array(
|
98 |
-
'ctaText'=>urlencode($options['ctaText'])
|
99 |
-
, 'postTitle'=>urlencode($options['postTitle'])
|
100 |
-
, 'postImageUrl'=>urlencode($options['postImageUrl'])
|
101 |
-
);
|
102 |
-
$uri=IRP_PAGE_PREMIUM;
|
103 |
-
$uri=add_query_arg($options, $uri);
|
104 |
-
return $uri;
|
105 |
}
|
1 |
+
<?php
|
2 |
+
function irp_ui_whats_new() {
|
3 |
+
?>
|
4 |
+
<style>
|
5 |
+
.irp-grid {
|
6 |
+
margin-left: auto;
|
7 |
+
margin-right: auto;
|
8 |
+
border-spacing: 10px;
|
9 |
+
}
|
10 |
+
.irp-grid td {
|
11 |
+
text-align: center;
|
12 |
+
}
|
13 |
+
.irp-headline {
|
14 |
+
font-size:40px;
|
15 |
+
font-weight:bold;
|
16 |
+
text-align:center;
|
17 |
+
margin: 5px!important;
|
18 |
+
}
|
19 |
+
</style>
|
20 |
+
|
21 |
+
<p class="irp-headline">Welcome to Inline Related Posts (v.<?php echo IRP_PLUGIN_VERSION ?>)</p>
|
22 |
+
<p class="irp-headline" style="font-size: 35px;">Get even more page views with box themes</p>
|
23 |
+
<div style="clear:both; height:30px;"></div>
|
24 |
+
|
25 |
+
<div style="text-align:center; width:auto;">
|
26 |
+
<img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/mac-irl-wahtsnew.png" />
|
27 |
+
</div>
|
28 |
+
<div style="clear:both; height:30px;"></div>
|
29 |
+
|
30 |
+
<table border="0" class="irp-grid">
|
31 |
+
<tr>
|
32 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.001.jpg" /></td>
|
33 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.002.jpg" /></td>
|
34 |
+
<td><img src="<?php echo IRP_PLUGIN_ASSETS ?>landing/img-whatsnew.003.jpg" /></td>
|
35 |
+
</tr>
|
36 |
+
<tr>
|
37 |
+
<td>Box Themes</td>
|
38 |
+
<td>More colors</td>
|
39 |
+
<td>Featured Image</td>
|
40 |
+
</tr>
|
41 |
+
</table>
|
42 |
+
<div style="clear:both"></div>
|
43 |
+
|
44 |
+
<hr/>
|
45 |
+
|
46 |
+
<p class="irp-headline">Get gorgeous themes with Inline Related Posts PRO</p>
|
47 |
+
<table border="0" class="irp-grid">
|
48 |
+
<tr>
|
49 |
+
<td style="text-align:left;">
|
50 |
+
<?php irp_notice_pro_features() ?>
|
51 |
+
</td>
|
52 |
+
<td>
|
53 |
+
<div style="border:1px dashed red; padding:10px;">
|
54 |
+
<iframe width="560" height="350" src="https://www.youtube.com/embed/CjdTr14Nd1g" frameborder="0" allowfullscreen></iframe>
|
55 |
+
</div>
|
56 |
+
</td>
|
57 |
+
</tr>
|
58 |
+
</table>
|
59 |
+
|
60 |
+
<table border="0" class="irp-grid">
|
61 |
+
<tr>
|
62 |
+
<td style="text-align: right; vertical-align: top;">
|
63 |
+
<form method="get" action="<?php echo IRP_PAGE_SETTINGS?>">
|
64 |
+
<input type="hidden" name="page" value="<?php echo IRP_PLUGIN_SLUG?>" />
|
65 |
+
<input type="submit" class="button" value="CONTINUE USING FREE VERSION" />
|
66 |
+
</form>
|
67 |
+
</td>
|
68 |
+
<td style="text-align: left; vertical-align: top;">
|
69 |
+
<form method="get" action="<?php echo IRP_PAGE_PREMIUM?>">
|
70 |
+
<input type="hidden" name="utm_source" value="free-users" />
|
71 |
+
<input type="hidden" name="utm_medium" value="irp-whatsnew" />
|
72 |
+
<input type="hidden" name="utm_campaign" value="IRP" />
|
73 |
+
<input type="submit" class="button-primary" value="UPGRADE TO PREMIUM NOW ››" />
|
74 |
+
</form>
|
75 |
+
<a href="<?php echo irp_preview_link()?>" target="_blank">or preview your posts with PRO themes</a>
|
76 |
+
</td>
|
77 |
+
</tr>
|
78 |
+
</table>
|
79 |
+
<?php }
|
80 |
+
|
81 |
+
function irp_preview_link() {
|
82 |
+
global $irp;
|
83 |
+
|
84 |
+
$options=array(
|
85 |
+
'count'=>1
|
86 |
+
, 'array'=>TRUE
|
87 |
+
, 'numberposts'=>5
|
88 |
+
);
|
89 |
+
$posts=wp_get_recent_posts($options);
|
90 |
+
$ids=array();
|
91 |
+
foreach($posts as $p) {
|
92 |
+
$ids[]=$p['ID'];
|
93 |
+
}
|
94 |
+
shuffle($ids);
|
95 |
+
$options=irp_ui_get_box($ids, $options);
|
96 |
+
|
97 |
+
$options=array(
|
98 |
+
'ctaText'=>urlencode($options['ctaText'])
|
99 |
+
, 'postTitle'=>urlencode($options['postTitle'])
|
100 |
+
, 'postImageUrl'=>urlencode($options['postImageUrl'])
|
101 |
+
);
|
102 |
+
$uri=IRP_PAGE_PREMIUM;
|
103 |
+
$uri=add_query_arg($options, $uri);
|
104 |
+
return $uri;
|
105 |
}
|
includes/classes/common/Stack.php
CHANGED
@@ -1,27 +1,27 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_Stack {
|
5 |
-
var $array;
|
6 |
-
|
7 |
-
public function __construct() {
|
8 |
-
$this->array=array();
|
9 |
-
}
|
10 |
-
|
11 |
-
public function push($v) {
|
12 |
-
array_push($this->array, $v);
|
13 |
-
}
|
14 |
-
public function pop() {
|
15 |
-
$v=array_pop($this->array);
|
16 |
-
return $v;
|
17 |
-
}
|
18 |
-
public function peek() {
|
19 |
-
return $this->array[count($this->array)-1];
|
20 |
-
}
|
21 |
-
public function size() {
|
22 |
-
return count($this->array);
|
23 |
-
}
|
24 |
-
public function isEmpty() {
|
25 |
-
return (count($this->array)==0);
|
26 |
-
}
|
27 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_Stack {
|
5 |
+
var $array;
|
6 |
+
|
7 |
+
public function __construct() {
|
8 |
+
$this->array=array();
|
9 |
+
}
|
10 |
+
|
11 |
+
public function push($v) {
|
12 |
+
array_push($this->array, $v);
|
13 |
+
}
|
14 |
+
public function pop() {
|
15 |
+
$v=array_pop($this->array);
|
16 |
+
return $v;
|
17 |
+
}
|
18 |
+
public function peek() {
|
19 |
+
return $this->array[count($this->array)-1];
|
20 |
+
}
|
21 |
+
public function size() {
|
22 |
+
return count($this->array);
|
23 |
+
}
|
24 |
+
public function isEmpty() {
|
25 |
+
return (count($this->array)==0);
|
26 |
+
}
|
27 |
+
}
|
includes/classes/core/HtmlTemplate.php
CHANGED
@@ -1,295 +1,295 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_HtmlTemplate {
|
5 |
-
var $templates;
|
6 |
-
var $defaults;
|
7 |
-
|
8 |
-
public function __construct() {
|
9 |
-
$this->templates=array();
|
10 |
-
$this->defaults=array();
|
11 |
-
}
|
12 |
-
|
13 |
-
public function getTemplates() {
|
14 |
-
return $this->templates;
|
15 |
-
}
|
16 |
-
public function getDefaults() {
|
17 |
-
return $this->defaults;
|
18 |
-
}
|
19 |
-
public function getTemplatesNames() {
|
20 |
-
$array=array_keys($this->templates);
|
21 |
-
asort($array);
|
22 |
-
return $array;
|
23 |
-
}
|
24 |
-
public function getFields($name) {
|
25 |
-
return $this->getFieldsOrBody($name);
|
26 |
-
}
|
27 |
-
public function getBody($name, $values=array()) {
|
28 |
-
return $this->getFieldsOrBody($name, $values);
|
29 |
-
}
|
30 |
-
private function getFieldsOrBody($name, $values=array()) {
|
31 |
-
global $irp;
|
32 |
-
|
33 |
-
if(!is_array($values)) {
|
34 |
-
$values=array();
|
35 |
-
}
|
36 |
-
|
37 |
-
$buffer='';
|
38 |
-
$fields=array();
|
39 |
-
$fields['template']='template';
|
40 |
-
if(isset($this->templates[$name])) {
|
41 |
-
$body=$this->templates[$name];
|
42 |
-
$len=strlen($body);
|
43 |
-
$previous=0;
|
44 |
-
while($previous<$len) {
|
45 |
-
$start=strpos($body, '{', $previous);
|
46 |
-
if($start!==FALSE) {
|
47 |
-
if($previous!=$start) {
|
48 |
-
$text=$irp->Utils->substr($body, $previous, $start);
|
49 |
-
$buffer.=$text;
|
50 |
-
}
|
51 |
-
$end=strpos($body, '}', $start+1);
|
52 |
-
$another=strpos($body, '{', $start+1);
|
53 |
-
|
54 |
-
if($end!==FALSE) {
|
55 |
-
if($another!==FALSE && $another<$end) {
|
56 |
-
$text=$irp->Utils->substr($body, $start, $another);
|
57 |
-
$buffer.=$text;
|
58 |
-
$previous=$another;
|
59 |
-
} else {
|
60 |
-
$k=$irp->Utils->substr($body, $start+1, $end);
|
61 |
-
if(trim($k)!='' && strpos($k, "\n")===FALSE) {
|
62 |
-
if($irp->Utils->startsWith($k, 'if ')) {
|
63 |
-
$k=substr($k, 3);
|
64 |
-
$fields[$k]=$k;
|
65 |
-
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
66 |
-
if($irp->Utils->isTrue($v)) {
|
67 |
-
//ok continue analysing the rest of template
|
68 |
-
//WARN: currently no nested if are allowed
|
69 |
-
} else {
|
70 |
-
$if='{/if}';
|
71 |
-
$start=strpos($body, $if, $end+1);
|
72 |
-
if($start===FALSE) {
|
73 |
-
$irp->Log->error("CHECK THE TEMPLATE. NO {/if} FOUND FOR {if %s}", $k);
|
74 |
-
break;
|
75 |
-
} else {
|
76 |
-
//skip all the text between {if xxx} and {/if}
|
77 |
-
$end=$start+strlen($if)-1;
|
78 |
-
}
|
79 |
-
}
|
80 |
-
} elseif($irp->Utils->startsWith($k, '/if')) {
|
81 |
-
//nothing
|
82 |
-
} else {
|
83 |
-
$fields[$k]=$k;
|
84 |
-
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
85 |
-
$buffer.=$v;
|
86 |
-
}
|
87 |
-
} else {
|
88 |
-
$text=$irp->Utils->substr($body, $start, $end+1);
|
89 |
-
$buffer.=$text;
|
90 |
-
}
|
91 |
-
$previous=$end+1;
|
92 |
-
}
|
93 |
-
} else {
|
94 |
-
$text=substr($body, $previous);
|
95 |
-
$buffer.=$text;
|
96 |
-
break;
|
97 |
-
}
|
98 |
-
} else {
|
99 |
-
$text=substr($body, $previous);
|
100 |
-
$buffer.=$text;
|
101 |
-
break;
|
102 |
-
}
|
103 |
-
}
|
104 |
-
}
|
105 |
-
$fields=array_keys($fields);
|
106 |
-
$buffer=str_replace("\n\n", "\n", $buffer);
|
107 |
-
$result=$buffer;
|
108 |
-
if(!is_array($values) || $values==NULL) {
|
109 |
-
$result=$fields;
|
110 |
-
}
|
111 |
-
return $result;
|
112 |
-
}
|
113 |
-
|
114 |
-
//load html template from file system stored in .html files
|
115 |
-
public function load($file) {
|
116 |
-
if(!file_exists($file)) {
|
117 |
-
return;
|
118 |
-
}
|
119 |
-
|
120 |
-
$matchTemplate='#template';
|
121 |
-
$matchDefaults='#defaults';
|
122 |
-
|
123 |
-
$file=file_get_contents($file);
|
124 |
-
if($file!=NULL && strlen($file)>0) {
|
125 |
-
$file=str_replace("\r\n", "\n", $file);
|
126 |
-
$file=str_replace("\n\n", "\n", $file);
|
127 |
-
$file=explode("\n", $file);
|
128 |
-
|
129 |
-
$name='';
|
130 |
-
$html='';
|
131 |
-
foreach($file as $row) {
|
132 |
-
if(stripos($row, $matchTemplate)!==FALSE) {
|
133 |
-
if($html!='' && $name!='') {
|
134 |
-
$this->templates[$name]=$html;
|
135 |
-
}
|
136 |
-
|
137 |
-
$name=substr($row, strlen($matchTemplate)+1);
|
138 |
-
$name=trim($name);
|
139 |
-
$html='';
|
140 |
-
continue;
|
141 |
-
}
|
142 |
-
elseif(stripos($row, $matchDefaults)!==FALSE && $name!='') {
|
143 |
-
if($html!='' && $name!='') {
|
144 |
-
$this->templates[$name]=$html;
|
145 |
-
}
|
146 |
-
|
147 |
-
$defaults=substr($row, strlen($matchDefaults)+1);
|
148 |
-
$defaults=str_replace('{', '', $defaults);
|
149 |
-
$defaults=str_replace('}', '', $defaults);
|
150 |
-
$defaults=explode(',', $defaults);
|
151 |
-
$tmp=array();
|
152 |
-
foreach($defaults as $v) {
|
153 |
-
$v=explode('=', $v);
|
154 |
-
if(count($v)>1) {
|
155 |
-
|
156 |
-
}
|
157 |
-
$tmp[trim($v[0])]=trim($v[1]);
|
158 |
-
}
|
159 |
-
$this->defaults[$name]=$tmp;
|
160 |
-
continue;
|
161 |
-
}
|
162 |
-
|
163 |
-
if($name=='') {
|
164 |
-
continue;
|
165 |
-
}
|
166 |
-
|
167 |
-
$html.=$row."\n";
|
168 |
-
}
|
169 |
-
|
170 |
-
if($html!='' && $name!='') {
|
171 |
-
$this->templates[$name]=$html;
|
172 |
-
}
|
173 |
-
}
|
174 |
-
}
|
175 |
-
public function html($name, $values, $options='') {
|
176 |
-
global $irp;
|
177 |
-
$defaults=array(
|
178 |
-
'includeCss'=>TRUE
|
179 |
-
);
|
180 |
-
$options=$irp->Utils->parseArgs($options, $defaults);
|
181 |
-
|
182 |
-
if(!is_array($values)) {
|
183 |
-
$values=array();
|
184 |
-
}
|
185 |
-
$values['template']=str_replace(' ', '-', $name);
|
186 |
-
$values['utemplate']=$irp->Options->getTemplateUUID($values['template']);
|
187 |
-
$values['assetsImages']=IRP_PLUGIN_ASSETS.'images/';
|
188 |
-
$values['assets']=IRP_PLUGIN_ASSETS;
|
189 |
-
$values['demoLink']=irp_preview_link();
|
190 |
-
|
191 |
-
if (isset($values['linkRel'])) {
|
192 |
-
$values['linkRel'] = $values['linkRel'];
|
193 |
-
if ($values['linkRel'] != 'nofollow' && $values['linkRel'] != 'dofollow') {
|
194 |
-
$values['linkRel'] = '';
|
195 |
-
}
|
196 |
-
}
|
197 |
-
$values['linkRel']=($values['linkRel']!='' ? 'rel="'.$values['linkRel'].'"' : '');
|
198 |
-
|
199 |
-
$style=array();
|
200 |
-
$code='';
|
201 |
-
if(isset($this->templates[$name])) {
|
202 |
-
foreach($values as $k=>$v) {
|
203 |
-
if(stripos($k, 'color')!==FALSE) {
|
204 |
-
$values[$k]=$irp->Options->getColor($values[$k]);
|
205 |
-
if($values[$k]=='') {
|
206 |
-
$values[$k]='inherit';
|
207 |
-
}
|
208 |
-
$values[$k.'Hover']=$irp->Options->getHoverColor($values[$k]);
|
209 |
-
if($values[$k.'Hover']=='') {
|
210 |
-
$values[$k.'Hover']='inherit';
|
211 |
-
}
|
212 |
-
} elseif(stripos($k, 'opacity')!==FALSE) {
|
213 |
-
$values[$k]=(intval($values[$k])/100);
|
214 |
-
}
|
215 |
-
$values[$k.'Display']=($irp->Utils->isTrue($values[$k]) ? 'block' : 'none');
|
216 |
-
$values[$k.'Visibility']=($irp->Utils->isTrue($values[$k]) ? 'visible' : 'hidden');
|
217 |
-
}
|
218 |
-
if(isset($values['comment']) && trim($values['comment'])!=''
|
219 |
-
&& !$irp->Utils->startsWith($values['comment'], "<!--")) {
|
220 |
-
$values['comment']="<!-- ".trim($values['comment'])." //-->";
|
221 |
-
}
|
222 |
-
|
223 |
-
if($options['includeCss']) {
|
224 |
-
//generate unique id from all the combinations, this grant to use the same theme
|
225 |
-
//but with different color using shotcodes
|
226 |
-
$values['utemplate']=$irp->Utils->getUUID($values);
|
227 |
-
}
|
228 |
-
$code=$this->getBody($name, $values);
|
229 |
-
if(!$options['includeCss']) {
|
230 |
-
$array=explode("\n", $code);
|
231 |
-
$code=array();
|
232 |
-
|
233 |
-
$css=FALSE;
|
234 |
-
foreach($array as $row) {
|
235 |
-
if (stripos($row, '<style>') !== FALSE) {
|
236 |
-
$css = TRUE;
|
237 |
-
if(!$options['includeCss']) {
|
238 |
-
$style[]=$row;
|
239 |
-
$row='';
|
240 |
-
}
|
241 |
-
} elseif (stripos($row, '</style>') !== FALSE) {
|
242 |
-
$css = FALSE;
|
243 |
-
if(!$options['includeCss']) {
|
244 |
-
$style[]=$row;
|
245 |
-
$row='';
|
246 |
-
}
|
247 |
-
} elseif ($css) {
|
248 |
-
if(!$options['includeCss']) {
|
249 |
-
$style[]=$row;
|
250 |
-
$row='';
|
251 |
-
}
|
252 |
-
}
|
253 |
-
|
254 |
-
if(trim($row)!='') {
|
255 |
-
$code[]=$row;
|
256 |
-
}
|
257 |
-
}
|
258 |
-
$code=implode("\n", $code);
|
259 |
-
if(count($style)>0) {
|
260 |
-
$irp->Options->pushCssStyle($style);
|
261 |
-
}
|
262 |
-
}
|
263 |
-
}
|
264 |
-
|
265 |
-
$code=$irp->Utils->trimCode($code);
|
266 |
-
if($code!='') {
|
267 |
-
if(isset($values['hasPoweredBy']) && $values['hasPoweredBy']) {
|
268 |
-
$code.='<div style="width:100%; text-align:right; font-weight:normal;">';
|
269 |
-
$code.='<div style="font-size:10px;">';
|
270 |
-
$code.='<span class="poweredByText">Powered by</span>';
|
271 |
-
$code.=' ';
|
272 |
-
$code.='<a rel="' . IRP_DEFAULT_LINK_REL_ATTRIBUTE . '" style="font-weight:bold;" href="https://wordpress.org/plugins/intelly-related-posts/" target="_blank">';
|
273 |
-
$code.='Inline Related Posts';
|
274 |
-
$code.='</a>';
|
275 |
-
$code.='</div>';
|
276 |
-
$code.='</div>';
|
277 |
-
$code.='<div style="clear:both"></div>';
|
278 |
-
}
|
279 |
-
$mt=$irp->Options->getMarginTop();
|
280 |
-
$mb=$irp->Options->getMarginBottom();
|
281 |
-
$code='<div style="clear:both; margin-top:'.$mt.'; margin-bottom:'.$mb.';">'.$code.'</div>';
|
282 |
-
}
|
283 |
-
|
284 |
-
$defaults=$irp->HtmlTemplate->getDefaults();
|
285 |
-
$defaults=$defaults[$options['template']];
|
286 |
-
if($code!='' && isset($defaults['proTheme']) && $irp->Utils->isTrue($defaults['proTheme'])) {
|
287 |
-
$code.='<p style="text-align:center;">';
|
288 |
-
$code.='<a style="font-size:20px; color:green; font-weight:bold;" href="'.$values['demoLink'].'" rel="' . IRP_DEFAULT_LINK_REL_ATTRIBUTE . '" target="_blank">';
|
289 |
-
$code.='Click here to preview your posts with PRO themes ››';
|
290 |
-
$code.='</p>';
|
291 |
-
$code.='</a>';
|
292 |
-
}
|
293 |
-
return $code;
|
294 |
-
}
|
295 |
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_HtmlTemplate {
|
5 |
+
var $templates;
|
6 |
+
var $defaults;
|
7 |
+
|
8 |
+
public function __construct() {
|
9 |
+
$this->templates=array();
|
10 |
+
$this->defaults=array();
|
11 |
+
}
|
12 |
+
|
13 |
+
public function getTemplates() {
|
14 |
+
return $this->templates;
|
15 |
+
}
|
16 |
+
public function getDefaults() {
|
17 |
+
return $this->defaults;
|
18 |
+
}
|
19 |
+
public function getTemplatesNames() {
|
20 |
+
$array=array_keys($this->templates);
|
21 |
+
asort($array);
|
22 |
+
return $array;
|
23 |
+
}
|
24 |
+
public function getFields($name) {
|
25 |
+
return $this->getFieldsOrBody($name);
|
26 |
+
}
|
27 |
+
public function getBody($name, $values=array()) {
|
28 |
+
return $this->getFieldsOrBody($name, $values);
|
29 |
+
}
|
30 |
+
private function getFieldsOrBody($name, $values=array()) {
|
31 |
+
global $irp;
|
32 |
+
|
33 |
+
if(!is_array($values)) {
|
34 |
+
$values=array();
|
35 |
+
}
|
36 |
+
|
37 |
+
$buffer='';
|
38 |
+
$fields=array();
|
39 |
+
$fields['template']='template';
|
40 |
+
if(isset($this->templates[$name])) {
|
41 |
+
$body=$this->templates[$name];
|
42 |
+
$len=strlen($body);
|
43 |
+
$previous=0;
|
44 |
+
while($previous<$len) {
|
45 |
+
$start=strpos($body, '{', $previous);
|
46 |
+
if($start!==FALSE) {
|
47 |
+
if($previous!=$start) {
|
48 |
+
$text=$irp->Utils->substr($body, $previous, $start);
|
49 |
+
$buffer.=$text;
|
50 |
+
}
|
51 |
+
$end=strpos($body, '}', $start+1);
|
52 |
+
$another=strpos($body, '{', $start+1);
|
53 |
+
|
54 |
+
if($end!==FALSE) {
|
55 |
+
if($another!==FALSE && $another<$end) {
|
56 |
+
$text=$irp->Utils->substr($body, $start, $another);
|
57 |
+
$buffer.=$text;
|
58 |
+
$previous=$another;
|
59 |
+
} else {
|
60 |
+
$k=$irp->Utils->substr($body, $start+1, $end);
|
61 |
+
if(trim($k)!='' && strpos($k, "\n")===FALSE) {
|
62 |
+
if($irp->Utils->startsWith($k, 'if ')) {
|
63 |
+
$k=substr($k, 3);
|
64 |
+
$fields[$k]=$k;
|
65 |
+
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
66 |
+
if($irp->Utils->isTrue($v)) {
|
67 |
+
//ok continue analysing the rest of template
|
68 |
+
//WARN: currently no nested if are allowed
|
69 |
+
} else {
|
70 |
+
$if='{/if}';
|
71 |
+
$start=strpos($body, $if, $end+1);
|
72 |
+
if($start===FALSE) {
|
73 |
+
$irp->Log->error("CHECK THE TEMPLATE. NO {/if} FOUND FOR {if %s}", $k);
|
74 |
+
break;
|
75 |
+
} else {
|
76 |
+
//skip all the text between {if xxx} and {/if}
|
77 |
+
$end=$start+strlen($if)-1;
|
78 |
+
}
|
79 |
+
}
|
80 |
+
} elseif($irp->Utils->startsWith($k, '/if')) {
|
81 |
+
//nothing
|
82 |
+
} else {
|
83 |
+
$fields[$k]=$k;
|
84 |
+
$v=$irp->Utils->get($values, $k, '#'.$k.'??#');
|
85 |
+
$buffer.=$v;
|
86 |
+
}
|
87 |
+
} else {
|
88 |
+
$text=$irp->Utils->substr($body, $start, $end+1);
|
89 |
+
$buffer.=$text;
|
90 |
+
}
|
91 |
+
$previous=$end+1;
|
92 |
+
}
|
93 |
+
} else {
|
94 |
+
$text=substr($body, $previous);
|
95 |
+
$buffer.=$text;
|
96 |
+
break;
|
97 |
+
}
|
98 |
+
} else {
|
99 |
+
$text=substr($body, $previous);
|
100 |
+
$buffer.=$text;
|
101 |
+
break;
|
102 |
+
}
|
103 |
+
}
|
104 |
+
}
|
105 |
+
$fields=array_keys($fields);
|
106 |
+
$buffer=str_replace("\n\n", "\n", $buffer);
|
107 |
+
$result=$buffer;
|
108 |
+
if(!is_array($values) || $values==NULL) {
|
109 |
+
$result=$fields;
|
110 |
+
}
|
111 |
+
return $result;
|
112 |
+
}
|
113 |
+
|
114 |
+
//load html template from file system stored in .html files
|
115 |
+
public function load($file) {
|
116 |
+
if(!file_exists($file)) {
|
117 |
+
return;
|
118 |
+
}
|
119 |
+
|
120 |
+
$matchTemplate='#template';
|
121 |
+
$matchDefaults='#defaults';
|
122 |
+
|
123 |
+
$file=file_get_contents($file);
|
124 |
+
if($file!=NULL && strlen($file)>0) {
|
125 |
+
$file=str_replace("\r\n", "\n", $file);
|
126 |
+
$file=str_replace("\n\n", "\n", $file);
|
127 |
+
$file=explode("\n", $file);
|
128 |
+
|
129 |
+
$name='';
|
130 |
+
$html='';
|
131 |
+
foreach($file as $row) {
|
132 |
+
if(stripos($row, $matchTemplate)!==FALSE) {
|
133 |
+
if($html!='' && $name!='') {
|
134 |
+
$this->templates[$name]=$html;
|
135 |
+
}
|
136 |
+
|
137 |
+
$name=substr($row, strlen($matchTemplate)+1);
|
138 |
+
$name=trim($name);
|
139 |
+
$html='';
|
140 |
+
continue;
|
141 |
+
}
|
142 |
+
elseif(stripos($row, $matchDefaults)!==FALSE && $name!='') {
|
143 |
+
if($html!='' && $name!='') {
|
144 |
+
$this->templates[$name]=$html;
|
145 |
+
}
|
146 |
+
|
147 |
+
$defaults=substr($row, strlen($matchDefaults)+1);
|
148 |
+
$defaults=str_replace('{', '', $defaults);
|
149 |
+
$defaults=str_replace('}', '', $defaults);
|
150 |
+
$defaults=explode(',', $defaults);
|
151 |
+
$tmp=array();
|
152 |
+
foreach($defaults as $v) {
|
153 |
+
$v=explode('=', $v);
|
154 |
+
if(count($v)>1) {
|
155 |
+
|
156 |
+
}
|
157 |
+
$tmp[trim($v[0])]=trim($v[1]);
|
158 |
+
}
|
159 |
+
$this->defaults[$name]=$tmp;
|
160 |
+
continue;
|
161 |
+
}
|
162 |
+
|
163 |
+
if($name=='') {
|
164 |
+
continue;
|
165 |
+
}
|
166 |
+
|
167 |
+
$html.=$row."\n";
|
168 |
+
}
|
169 |
+
|
170 |
+
if($html!='' && $name!='') {
|
171 |
+
$this->templates[$name]=$html;
|
172 |
+
}
|
173 |
+
}
|
174 |
+
}
|
175 |
+
public function html($name, $values, $options='') {
|
176 |
+
global $irp;
|
177 |
+
$defaults=array(
|
178 |
+
'includeCss'=>TRUE
|
179 |
+
);
|
180 |
+
$options=$irp->Utils->parseArgs($options, $defaults);
|
181 |
+
|
182 |
+
if(!is_array($values)) {
|
183 |
+
$values=array();
|
184 |
+
}
|
185 |
+
$values['template']=str_replace(' ', '-', $name);
|
186 |
+
$values['utemplate']=$irp->Options->getTemplateUUID($values['template']);
|
187 |
+
$values['assetsImages']=IRP_PLUGIN_ASSETS.'images/';
|
188 |
+
$values['assets']=IRP_PLUGIN_ASSETS;
|
189 |
+
$values['demoLink']=irp_preview_link();
|
190 |
+
|
191 |
+
if (isset($values['linkRel'])) {
|
192 |
+
$values['linkRel'] = $values['linkRel'];
|
193 |
+
if ($values['linkRel'] != 'nofollow' && $values['linkRel'] != 'dofollow') {
|
194 |
+
$values['linkRel'] = '';
|
195 |
+
}
|
196 |
+
}
|
197 |
+
$values['linkRel']=($values['linkRel']!='' ? 'rel="'.$values['linkRel'].'"' : '');
|
198 |
+
|
199 |
+
$style=array();
|
200 |
+
$code='';
|
201 |
+
if(isset($this->templates[$name])) {
|
202 |
+
foreach($values as $k=>$v) {
|
203 |
+
if(stripos($k, 'color')!==FALSE) {
|
204 |
+
$values[$k]=$irp->Options->getColor($values[$k]);
|
205 |
+
if($values[$k]=='') {
|
206 |
+
$values[$k]='inherit';
|
207 |
+
}
|
208 |
+
$values[$k.'Hover']=$irp->Options->getHoverColor($values[$k]);
|
209 |
+
if($values[$k.'Hover']=='') {
|
210 |
+
$values[$k.'Hover']='inherit';
|
211 |
+
}
|
212 |
+
} elseif(stripos($k, 'opacity')!==FALSE) {
|
213 |
+
$values[$k]=(intval($values[$k])/100);
|
214 |
+
}
|
215 |
+
$values[$k.'Display']=($irp->Utils->isTrue($values[$k]) ? 'block' : 'none');
|
216 |
+
$values[$k.'Visibility']=($irp->Utils->isTrue($values[$k]) ? 'visible' : 'hidden');
|
217 |
+
}
|
218 |
+
if(isset($values['comment']) && trim($values['comment'])!=''
|
219 |
+
&& !$irp->Utils->startsWith($values['comment'], "<!--")) {
|
220 |
+
$values['comment']="<!-- ".trim($values['comment'])." //-->";
|
221 |
+
}
|
222 |
+
|
223 |
+
if($options['includeCss']) {
|
224 |
+
//generate unique id from all the combinations, this grant to use the same theme
|
225 |
+
//but with different color using shotcodes
|
226 |
+
$values['utemplate']=$irp->Utils->getUUID($values);
|
227 |
+
}
|
228 |
+
$code=$this->getBody($name, $values);
|
229 |
+
if(!$options['includeCss']) {
|
230 |
+
$array=explode("\n", $code);
|
231 |
+
$code=array();
|
232 |
+
|
233 |
+
$css=FALSE;
|
234 |
+
foreach($array as $row) {
|
235 |
+
if (stripos($row, '<style>') !== FALSE) {
|
236 |
+
$css = TRUE;
|
237 |
+
if(!$options['includeCss']) {
|
238 |
+
$style[]=$row;
|
239 |
+
$row='';
|
240 |
+
}
|
241 |
+
} elseif (stripos($row, '</style>') !== FALSE) {
|
242 |
+
$css = FALSE;
|
243 |
+
if(!$options['includeCss']) {
|
244 |
+
$style[]=$row;
|
245 |
+
$row='';
|
246 |
+
}
|
247 |
+
} elseif ($css) {
|
248 |
+
if(!$options['includeCss']) {
|
249 |
+
$style[]=$row;
|
250 |
+
$row='';
|
251 |
+
}
|
252 |
+
}
|
253 |
+
|
254 |
+
if(trim($row)!='') {
|
255 |
+
$code[]=$row;
|
256 |
+
}
|
257 |
+
}
|
258 |
+
$code=implode("\n", $code);
|
259 |
+
if(count($style)>0) {
|
260 |
+
$irp->Options->pushCssStyle($style);
|
261 |
+
}
|
262 |
+
}
|
263 |
+
}
|
264 |
+
|
265 |
+
$code=$irp->Utils->trimCode($code);
|
266 |
+
if($code!='') {
|
267 |
+
if(isset($values['hasPoweredBy']) && $values['hasPoweredBy']) {
|
268 |
+
$code.='<div style="width:100%; text-align:right; font-weight:normal;">';
|
269 |
+
$code.='<div style="font-size:10px;">';
|
270 |
+
$code.='<span class="poweredByText">Powered by</span>';
|
271 |
+
$code.=' ';
|
272 |
+
$code.='<a rel="' . IRP_DEFAULT_LINK_REL_ATTRIBUTE . '" style="font-weight:bold;" href="https://wordpress.org/plugins/intelly-related-posts/" target="_blank">';
|
273 |
+
$code.='Inline Related Posts';
|
274 |
+
$code.='</a>';
|
275 |
+
$code.='</div>';
|
276 |
+
$code.='</div>';
|
277 |
+
$code.='<div style="clear:both"></div>';
|
278 |
+
}
|
279 |
+
$mt=$irp->Options->getMarginTop();
|
280 |
+
$mb=$irp->Options->getMarginBottom();
|
281 |
+
$code='<div style="clear:both; margin-top:'.$mt.'; margin-bottom:'.$mb.';">'.$code.'</div>';
|
282 |
+
}
|
283 |
+
|
284 |
+
$defaults=$irp->HtmlTemplate->getDefaults();
|
285 |
+
$defaults=$defaults[$options['template']];
|
286 |
+
if($code!='' && isset($defaults['proTheme']) && $irp->Utils->isTrue($defaults['proTheme'])) {
|
287 |
+
$code.='<p style="text-align:center;">';
|
288 |
+
$code.='<a style="font-size:20px; color:green; font-weight:bold;" href="'.$values['demoLink'].'" rel="' . IRP_DEFAULT_LINK_REL_ATTRIBUTE . '" target="_blank">';
|
289 |
+
$code.='Click here to preview your posts with PRO themes ››';
|
290 |
+
$code.='</p>';
|
291 |
+
$code.='</a>';
|
292 |
+
}
|
293 |
+
return $code;
|
294 |
+
}
|
295 |
}
|
includes/classes/core/Manager.php
CHANGED
@@ -1,100 +1,100 @@
|
|
1 |
-
<?php
|
2 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
3 |
-
|
4 |
-
class IRP_Manager {
|
5 |
-
|
6 |
-
public function __construct() {
|
7 |
-
|
8 |
-
}
|
9 |
-
|
10 |
-
public function getRelatedPostsIds($args) {
|
11 |
-
global $irp;
|
12 |
-
|
13 |
-
$ids=array();
|
14 |
-
if(IRP_DISABLE_RELATED || !$irp->Options->isActive()) {
|
15 |
-
return $ids;
|
16 |
-
}
|
17 |
-
|
18 |
-
$defaults=array('postId'=>0
|
19 |
-
, 'posts'=>array(), 'cats'=>array(), 'tags'=>array()
|
20 |
-
, 'count'=>10
|
21 |
-
, 'shuffle'=>FALSE);
|
22 |
-
$args=$irp->Utils->parseArgs($args, $defaults);
|
23 |
-
|
24 |
-
$args['posts']=$irp->Utils->toCommaArray($args['posts']);
|
25 |
-
$args['cats']=$irp->Utils->toCommaArray($args['cats']);
|
26 |
-
$args['tags']=$irp->Utils->toCommaArray($args['tags']);
|
27 |
-
$args['postId']=intval($args['postId']);
|
28 |
-
if($args['postId']>0) {
|
29 |
-
$options=array('orderby' => 'name', 'order' => 'ASC', 'fields' => 'ids');
|
30 |
-
$args['tags']=wp_get_post_tags($args['postId'], $options);
|
31 |
-
$args['cats']=wp_get_post_categories($args['postId']);
|
32 |
-
}
|
33 |
-
|
34 |
-
if(count($args['posts'])>0) {
|
35 |
-
$ids=$args['posts'];
|
36 |
-
} else {
|
37 |
-
$ids=array();
|
38 |
-
switch ($irp->Options->getEngineSearch()) {
|
39 |
-
case IRP_ENGINE_SEARCH_CATEGORIES:
|
40 |
-
$ids=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
41 |
-
break;
|
42 |
-
case IRP_ENGINE_SEARCH_TAGS:
|
43 |
-
$ids=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
44 |
-
break;
|
45 |
-
case IRP_ENGINE_SEARCH_CATEGORIES_TAGS:
|
46 |
-
//if we execute this query with the 2 parameters togheter category__in
|
47 |
-
//and tag__in WP do an AND query and not an OR query as we need
|
48 |
-
$cats=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
49 |
-
$tags=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
50 |
-
$ids=array_merge($cats, $tags);
|
51 |
-
$ids=array_unique($ids);
|
52 |
-
break;
|
53 |
-
}
|
54 |
-
}
|
55 |
-
|
56 |
-
if($args['shuffle']) {
|
57 |
-
shuffle($ids);
|
58 |
-
}
|
59 |
-
return $ids;
|
60 |
-
}
|
61 |
-
|
62 |
-
private function queryRelatedPostsIds($args, $optionKey, $optionArray) {
|
63 |
-
global $irp;
|
64 |
-
|
65 |
-
$ids=array();
|
66 |
-
if(!is_array($optionArray) || count($optionArray)==0) {
|
67 |
-
return $ids;
|
68 |
-
}
|
69 |
-
|
70 |
-
$post=$irp->Options->getPostShown();
|
71 |
-
$options=array(
|
72 |
-
'post_type'=>$post->post_type
|
73 |
-
//, 'nopaging'=>TRUE
|
74 |
-
, 'posts_per_page'=>10
|
75 |
-
, 'post_status'=>'publish'
|
76 |
-
, 'post__not_in'=>array($post->ID)
|
77 |
-
, 'orderby'=>'rand'
|
78 |
-
);
|
79 |
-
$days=$irp->Options->getRewritePostsDays();
|
80 |
-
if($days>0) {
|
81 |
-
$options['date_query'] = array(
|
82 |
-
'column' => 'post_date'
|
83 |
-
, 'after' => '- '.$days.' days'
|
84 |
-
);
|
85 |
-
}
|
86 |
-
$options[$optionKey]=$optionArray;
|
87 |
-
|
88 |
-
$q=new WP_Query();
|
89 |
-
$irp->Log->debug('RELATED POSTS QUERY=%s', $options);
|
90 |
-
$posts=$q->query($options);
|
91 |
-
|
92 |
-
$irp->Log->debug('RELATED POSTS RESULT COUNT=%s', count($posts));
|
93 |
-
foreach($posts as $p) {
|
94 |
-
if($args['postId']<=0 || $args['postId']!=$p->ID) {
|
95 |
-
$ids[]=$p->ID;
|
96 |
-
}
|
97 |
-
}
|
98 |
-
return $ids;
|
99 |
-
}
|
100 |
}
|
1 |
+
<?php
|
2 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
3 |
+
|
4 |
+
class IRP_Manager {
|
5 |
+
|
6 |
+
public function __construct() {
|
7 |
+
|
8 |
+
}
|
9 |
+
|
10 |
+
public function getRelatedPostsIds($args) {
|
11 |
+
global $irp;
|
12 |
+
|
13 |
+
$ids=array();
|
14 |
+
if(IRP_DISABLE_RELATED || !$irp->Options->isActive()) {
|
15 |
+
return $ids;
|
16 |
+
}
|
17 |
+
|
18 |
+
$defaults=array('postId'=>0
|
19 |
+
, 'posts'=>array(), 'cats'=>array(), 'tags'=>array()
|
20 |
+
, 'count'=>10
|
21 |
+
, 'shuffle'=>FALSE);
|
22 |
+
$args=$irp->Utils->parseArgs($args, $defaults);
|
23 |
+
|
24 |
+
$args['posts']=$irp->Utils->toCommaArray($args['posts']);
|
25 |
+
$args['cats']=$irp->Utils->toCommaArray($args['cats']);
|
26 |
+
$args['tags']=$irp->Utils->toCommaArray($args['tags']);
|
27 |
+
$args['postId']=intval($args['postId']);
|
28 |
+
if($args['postId']>0) {
|
29 |
+
$options=array('orderby' => 'name', 'order' => 'ASC', 'fields' => 'ids');
|
30 |
+
$args['tags']=wp_get_post_tags($args['postId'], $options);
|
31 |
+
$args['cats']=wp_get_post_categories($args['postId']);
|
32 |
+
}
|
33 |
+
|
34 |
+
if(count($args['posts'])>0) {
|
35 |
+
$ids=$args['posts'];
|
36 |
+
} else {
|
37 |
+
$ids=array();
|
38 |
+
switch ($irp->Options->getEngineSearch()) {
|
39 |
+
case IRP_ENGINE_SEARCH_CATEGORIES:
|
40 |
+
$ids=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
41 |
+
break;
|
42 |
+
case IRP_ENGINE_SEARCH_TAGS:
|
43 |
+
$ids=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
44 |
+
break;
|
45 |
+
case IRP_ENGINE_SEARCH_CATEGORIES_TAGS:
|
46 |
+
//if we execute this query with the 2 parameters togheter category__in
|
47 |
+
//and tag__in WP do an AND query and not an OR query as we need
|
48 |
+
$cats=$this->queryRelatedPostsIds($args, 'category__in', $args['cats']);
|
49 |
+
$tags=$this->queryRelatedPostsIds($args, 'tag__in', $args['tags']);
|
50 |
+
$ids=array_merge($cats, $tags);
|
51 |
+
$ids=array_unique($ids);
|
52 |
+
break;
|
53 |
+
}
|
54 |
+
}
|
55 |
+
|
56 |
+
if($args['shuffle']) {
|
57 |
+
shuffle($ids);
|
58 |
+
}
|
59 |
+
return $ids;
|
60 |
+
}
|
61 |
+
|
62 |
+
private function queryRelatedPostsIds($args, $optionKey, $optionArray) {
|
63 |
+
global $irp;
|
64 |
+
|
65 |
+
$ids=array();
|
66 |
+
if(!is_array($optionArray) || count($optionArray)==0) {
|
67 |
+
return $ids;
|
68 |
+
}
|
69 |
+
|
70 |
+
$post=$irp->Options->getPostShown();
|
71 |
+
$options=array(
|
72 |
+
'post_type'=>$post->post_type
|
73 |
+
//, 'nopaging'=>TRUE
|
74 |
+
, 'posts_per_page'=>10
|
75 |
+
, 'post_status'=>'publish'
|
76 |
+
, 'post__not_in'=>array($post->ID)
|
77 |
+
, 'orderby'=>'rand'
|
78 |
+
);
|
79 |
+
$days=$irp->Options->getRewritePostsDays();
|
80 |
+
if($days>0) {
|
81 |
+
$options['date_query'] = array(
|
82 |
+
'column' => 'post_date'
|
83 |
+
, 'after' => '- '.$days.' days'
|
84 |
+
);
|
85 |
+
}
|
86 |
+
$options[$optionKey]=$optionArray;
|
87 |
+
|
88 |
+
$q=new WP_Query();
|
89 |
+
$irp->Log->debug('RELATED POSTS QUERY=%s', $options);
|
90 |
+
$posts=$q->query($options);
|
91 |
+
|
92 |
+
$irp->Log->debug('RELATED POSTS RESULT COUNT=%s', count($posts));
|
93 |
+
foreach($posts as $p) {
|
94 |
+
if($args['postId']<=0 || $args['postId']!=$p->ID) {
|
95 |
+
$ids[]=$p->ID;
|
96 |
+
}
|
97 |
+
}
|
98 |
+
return $ids;
|
99 |
+
}
|
100 |
}
|
includes/classes/core/Singleton.php
CHANGED
@@ -1,36 +1,36 @@
|
|
1 |
-
<?php
|
2 |
-
class IRP_Singleton {
|
3 |
-
var $Lang;
|
4 |
-
var $Utils;
|
5 |
-
var $Form;
|
6 |
-
var $Check;
|
7 |
-
var $Options;
|
8 |
-
var $Manager;
|
9 |
-
var $Log;
|
10 |
-
var $Cron;
|
11 |
-
var $Tracking;
|
12 |
-
var $Tabs;
|
13 |
-
var $Plugin;
|
14 |
-
var $HtmlTemplate;
|
15 |
-
|
16 |
-
function __construct() {
|
17 |
-
$this->Lang=new IRP_Language();
|
18 |
-
$this->Utils=new IRP_Utils();
|
19 |
-
$this->Form=new IRP_Form();
|
20 |
-
$this->Check=new IRP_Check();
|
21 |
-
$this->Options=new IRP_AppOptions();
|
22 |
-
$this->Manager=new IRP_Manager();
|
23 |
-
$this->Log=new IRP_Logger();
|
24 |
-
$this->Cron=new IRP_Cron();
|
25 |
-
$this->Tracking=new IRP_Tracking();
|
26 |
-
$this->Tabs=new IRP_Tabs();
|
27 |
-
$this->Plugin=new IRP_Plugin();
|
28 |
-
$this->HtmlTemplate=new IRP_HtmlTemplate();
|
29 |
-
}
|
30 |
-
function init() {
|
31 |
-
$this->Lang->load('irp', IRP_PLUGIN_ROOT.'languages/Lang.txt');
|
32 |
-
$this->HtmlTemplate->load(IRP_PLUGIN_ROOT.'assets/templates/styles.html');
|
33 |
-
$this->Tabs->init();
|
34 |
-
$this->Cron->init();
|
35 |
-
}
|
36 |
}
|
1 |
+
<?php
|
2 |
+
class IRP_Singleton {
|
3 |
+
var $Lang;
|
4 |
+
var $Utils;
|
5 |
+
var $Form;
|
6 |
+
var $Check;
|
7 |
+
var $Options;
|
8 |
+
var $Manager;
|
9 |
+
var $Log;
|
10 |
+
var $Cron;
|
11 |
+
var $Tracking;
|
12 |
+
var $Tabs;
|
13 |
+
var $Plugin;
|
14 |
+
var $HtmlTemplate;
|
15 |
+
|
16 |
+
function __construct() {
|
17 |
+
$this->Lang=new IRP_Language();
|
18 |
+
$this->Utils=new IRP_Utils();
|
19 |
+
$this->Form=new IRP_Form();
|
20 |
+
$this->Check=new IRP_Check();
|
21 |
+
$this->Options=new IRP_AppOptions();
|
22 |
+
$this->Manager=new IRP_Manager();
|
23 |
+
$this->Log=new IRP_Logger();
|
24 |
+
$this->Cron=new IRP_Cron();
|
25 |
+
$this->Tracking=new IRP_Tracking();
|
26 |
+
$this->Tabs=new IRP_Tabs();
|
27 |
+
$this->Plugin=new IRP_Plugin();
|
28 |
+
$this->HtmlTemplate=new IRP_HtmlTemplate();
|
29 |
+
}
|
30 |
+
function init() {
|
31 |
+
$this->Lang->load('irp', IRP_PLUGIN_ROOT.'languages/Lang.txt');
|
32 |
+
$this->HtmlTemplate->load(IRP_PLUGIN_ROOT.'assets/templates/styles.html');
|
33 |
+
$this->Tabs->init();
|
34 |
+
$this->Cron->init();
|
35 |
+
}
|
36 |
}
|
includes/classes/html/BehaviourTag.php
CHANGED
@@ -1,51 +1,51 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_BehaviourTag extends IRP_HTMLTag {
|
5 |
-
|
6 |
-
var $allowBoxBefore=FALSE;
|
7 |
-
var $allowBoxAfter=FALSE;
|
8 |
-
var $skipWordsCount=FALSE;
|
9 |
-
var $ensureUncuttable=FALSE;
|
10 |
-
var $ensureWithoutPreviousBox=FALSE;
|
11 |
-
var $ensureWithoutNextBox=FALSE;
|
12 |
-
|
13 |
-
public function write(IRP_HTMLContext $context) {
|
14 |
-
$w=$context->skipWordsCount;
|
15 |
-
$context->skipWordsCount=$this->skipWordsCount;
|
16 |
-
|
17 |
-
if($this->ensureWithoutPreviousBox) {
|
18 |
-
//if present remove the last related box
|
19 |
-
$args=array('last'=>TRUE);
|
20 |
-
$context->popRelatedBox($args);
|
21 |
-
}
|
22 |
-
if($this->allowBoxBefore) {
|
23 |
-
$context->writeRelatedBoxIfNeeded();
|
24 |
-
}
|
25 |
-
|
26 |
-
if($this->ensureUncuttable) {
|
27 |
-
$previous=$context->isUncuttable();
|
28 |
-
$context->setUncuttable(TRUE);
|
29 |
-
}
|
30 |
-
parent::write($context);
|
31 |
-
if($this->ensureUncuttable) {
|
32 |
-
$context->setUncuttable($previous);
|
33 |
-
}
|
34 |
-
|
35 |
-
if($this->allowBoxAfter) {
|
36 |
-
$context->writeRelatedBoxIfNeeded();
|
37 |
-
}
|
38 |
-
if($this->ensureWithoutNextBox) {
|
39 |
-
$context->setWithoutNextBox();
|
40 |
-
}
|
41 |
-
|
42 |
-
$context->skipWordsCount=$w;
|
43 |
-
}
|
44 |
-
public function analyseText(IRP_HTMLContext $context) {
|
45 |
-
if($this->skipWordsCount) {
|
46 |
-
return;
|
47 |
-
}
|
48 |
-
|
49 |
-
parent::analyseText($context);
|
50 |
-
}
|
51 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_BehaviourTag extends IRP_HTMLTag {
|
5 |
+
|
6 |
+
var $allowBoxBefore=FALSE;
|
7 |
+
var $allowBoxAfter=FALSE;
|
8 |
+
var $skipWordsCount=FALSE;
|
9 |
+
var $ensureUncuttable=FALSE;
|
10 |
+
var $ensureWithoutPreviousBox=FALSE;
|
11 |
+
var $ensureWithoutNextBox=FALSE;
|
12 |
+
|
13 |
+
public function write(IRP_HTMLContext $context) {
|
14 |
+
$w=$context->skipWordsCount;
|
15 |
+
$context->skipWordsCount=$this->skipWordsCount;
|
16 |
+
|
17 |
+
if($this->ensureWithoutPreviousBox) {
|
18 |
+
//if present remove the last related box
|
19 |
+
$args=array('last'=>TRUE);
|
20 |
+
$context->popRelatedBox($args);
|
21 |
+
}
|
22 |
+
if($this->allowBoxBefore) {
|
23 |
+
$context->writeRelatedBoxIfNeeded();
|
24 |
+
}
|
25 |
+
|
26 |
+
if($this->ensureUncuttable) {
|
27 |
+
$previous=$context->isUncuttable();
|
28 |
+
$context->setUncuttable(TRUE);
|
29 |
+
}
|
30 |
+
parent::write($context);
|
31 |
+
if($this->ensureUncuttable) {
|
32 |
+
$context->setUncuttable($previous);
|
33 |
+
}
|
34 |
+
|
35 |
+
if($this->allowBoxAfter) {
|
36 |
+
$context->writeRelatedBoxIfNeeded();
|
37 |
+
}
|
38 |
+
if($this->ensureWithoutNextBox) {
|
39 |
+
$context->setWithoutNextBox();
|
40 |
+
}
|
41 |
+
|
42 |
+
$context->skipWordsCount=$w;
|
43 |
+
}
|
44 |
+
public function analyseText(IRP_HTMLContext $context) {
|
45 |
+
if($this->skipWordsCount) {
|
46 |
+
return;
|
47 |
+
}
|
48 |
+
|
49 |
+
parent::analyseText($context);
|
50 |
+
}
|
51 |
+
}
|
includes/classes/html/HTMLContext.php
CHANGED
@@ -1,564 +1,559 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_HTMLContext {
|
5 |
-
var $root; //MainTag
|
6 |
-
var $buffer; //IRP_Stack
|
7 |
-
|
8 |
-
var $uncuttable;
|
9 |
-
var $withoutNextState;
|
10 |
-
var $withoutNextWords;
|
11 |
-
|
12 |
-
var $currentWords;
|
13 |
-
var $lastBoxWords;
|
14 |
-
//last time that the plugin insert the related posts box counter values
|
15 |
-
var $wordsThreshold;
|
16 |
-
var $skipWordsCount=FALSE;
|
17 |
-
|
18 |
-
public function __construct() {
|
19 |
-
$this->clearBuffer();
|
20 |
-
}
|
21 |
-
|
22 |
-
public function setWithoutNextBox() {
|
23 |
-
$this->withoutNextState=TRUE;
|
24 |
-
$this->withoutNextWords=$this->currentWords;
|
25 |
-
}
|
26 |
-
public function isSkipCurrentBox() {
|
27 |
-
$result=FALSE;
|
28 |
-
if($this->withoutNextState) {
|
29 |
-
//if i already had written some words i can unlock the withoutNext lock
|
30 |
-
$result=($this->currentWords<=$this->withoutNextWords);
|
31 |
-
if(!$result) {
|
32 |
-
$this->withoutNextState=FALSE;
|
33 |
-
$this->withoutNextWords=0;
|
34 |
-
}
|
35 |
-
}
|
36 |
-
return $result;
|
37 |
-
}
|
38 |
-
public function clearSkipNext() {
|
39 |
-
$this->withoutNextState=FALSE;
|
40 |
-
$this->withoutNextWords=0;
|
41 |
-
}
|
42 |
-
|
43 |
-
public function setUncuttable($value) {
|
44 |
-
$this->uncuttable=$value;
|
45 |
-
}
|
46 |
-
public function isUncuttable() {
|
47 |
-
return $this->uncuttable;
|
48 |
-
}
|
49 |
-
|
50 |
-
private function clearBuffer() {
|
51 |
-
$this->buffer=new IRP_Stack();
|
52 |
-
$this->uncuttable=FALSE;
|
53 |
-
$this->isParentTable=FALSE;
|
54 |
-
$this->withoutNextState=FALSE;
|
55 |
-
$this->currentWords=0;
|
56 |
-
$this->lastBoxWords=0;
|
57 |
-
$this->withoutNextState=FALSE;
|
58 |
-
$this->withoutNextWords=0;
|
59 |
-
}
|
60 |
-
private function pushTextContent($part, $text, IRP_Stack &$tagsStack) {
|
61 |
-
if(!$part) {
|
62 |
-
$parent=$tagsStack->peek();
|
63 |
-
$part=new IRP_TextContent();
|
64 |
-
$parent->pushTag($part);
|
65 |
-
}
|
66 |
-
$part->append($text);
|
67 |
-
return $part;
|
68 |
-
}
|
69 |
-
|
70 |
-
public function isWriteRelatedBox() {
|
71 |
-
global $irp;
|
72 |
-
if($this->isSkipCurrentBox()) {
|
73 |
-
return FALSE;
|
74 |
-
}
|
75 |
-
if($this->isUncuttable()) {
|
76 |
-
return FALSE;
|
77 |
-
}
|
78 |
-
|
79 |
-
$irp->Log->debug('WriteRelatedBox?');
|
80 |
-
$diff=($this->currentWords-$this->lastBoxWords);
|
81 |
-
$irp->Log->debug('currentWords[%s]-lastBoxWords[%s]=diff[%s]'
|
82 |
-
, $this->currentWords, $this->lastBoxWords, $diff);
|
83 |
-
|
84 |
-
$postLimit=$this->wordsThreshold*($irp->Options->getRewriteBoxesWritten()+1);
|
85 |
-
$irp->Log->debug('wordsThreshold[%s]*(RewriteBoxesWritten[%s]+1)=postLimit[%s]'
|
86 |
-
, $this->wordsThreshold, $irp->Options->getRewriteBoxesWritten(), $postLimit);
|
87 |
-
|
88 |
-
$minLimit=$irp->Options->getRewriteThreshold();
|
89 |
-
$result=($this->currentWords>=$postLimit && $diff>=$minLimit);
|
90 |
-
$irp->Log->debug('(currentWords[%s]>=postLimit[%s]) AND (diff[%s]>=minLimit[%s])=%s'
|
91 |
-
, $this->currentWords, $postLimit
|
92 |
-
, $diff, $minLimit, $result);
|
93 |
-
return $result;
|
94 |
-
}
|
95 |
-
|
96 |
-
function getTagAttribute($fullTag, $name) {
|
97 |
-
$close=strpos($fullTag, '>');
|
98 |
-
$attr=strpos($fullTag, ' '.$name.'=');
|
99 |
-
$result='';
|
100 |
-
if($attr!==FALSE && $close!==FALSE && $attr<$close) {
|
101 |
-
$quote=substr($fullTag, $attr+strlen($name)+2, 1);
|
102 |
-
$text=substr($fullTag, $attr+strlen($name)+3);
|
103 |
-
$end=strpos($text, $quote, 1);
|
104 |
-
if($end!==FALSE) {
|
105 |
-
$result=substr($text, 0, $end);
|
106 |
-
}
|
107 |
-
}
|
108 |
-
return $result;
|
109 |
-
}
|
110 |
-
|
111 |
-
//get the tag name to lower case, could be that is not defined
|
112 |
-
//so this function return '' could also be that
|
113 |
-
function getTagName($fullTag) {
|
114 |
-
global $irp;
|
115 |
-
|
116 |
-
$start=1;
|
117 |
-
$p=strpos($fullTag, ' ');
|
118 |
-
if($p===FALSE) {
|
119 |
-
$p=strpos($fullTag, '/');
|
120 |
-
if($p!==FALSE && $p==1) {
|
121 |
-
$start=2;
|
122 |
-
$p=FALSE;
|
123 |
-
}
|
124 |
-
if($p===FALSE) {
|
125 |
-
$p=strpos($fullTag, '>');
|
126 |
-
if($p===FALSE) {
|
127 |
-
$irp->Log->error('UNABLE TO DECODE TAG %s', $fullTag);
|
128 |
-
return '';
|
129 |
-
}
|
130 |
-
}
|
131 |
-
}
|
132 |
-
$tag=trim(substr($fullTag, $start, $p-$start));
|
133 |
-
$tag=strtolower($tag);
|
134 |
-
return $tag;
|
135 |
-
}
|
136 |
-
function getHtmlTag($fullTag){
|
137 |
-
global $irp;
|
138 |
-
|
139 |
-
$tag=$this->getTagName($fullTag);
|
140 |
-
$tagId=$this->getTagAttribute($fullTag, 'id');
|
141 |
-
$tagClasses=$this->getTagAttribute($fullTag, 'class');
|
142 |
-
if($tagClasses!=='') {
|
143 |
-
$tagClasses=explode(' ', $tagClasses);
|
144 |
-
} else {
|
145 |
-
$tagClasses=array();
|
146 |
-
}
|
147 |
-
|
148 |
-
if($tag=='') {
|
149 |
-
return NULL;
|
150 |
-
}
|
151 |
-
|
152 |
-
$result=new IRP_OtherTag();
|
153 |
-
if(in_array($tag, array('h1','h2','h3','h4','h5','h6'))) {
|
154 |
-
$result=new IRP_BehaviourTag();
|
155 |
-
$result->allowBoxBefore=TRUE;
|
156 |
-
$result->ensureUncuttable=TRUE;
|
157 |
-
$result->ensureWithoutNextBox=TRUE;
|
158 |
-
} elseif(in_array($tag, array('ul', 'ol', 'dl'))) {
|
159 |
-
$result=new IRP_BehaviourTag();
|
160 |
-
$result->ensureWithoutPreviousBox=TRUE;
|
161 |
-
$result->ensureUncuttable=TRUE;
|
162 |
-
$result->allowBoxAfter=TRUE;
|
163 |
-
} elseif(in_array($tag, array('area','base','col','br','command','embed','hr','img','input','link','meta','param','source'))) {
|
164 |
-
$result=new IRP_SingletonTag();
|
165 |
-
} elseif(in_array($tag, array('iframe'))) {
|
166 |
-
$result=new IRP_BehaviourTag();
|
167 |
-
$result->allowBoxBefore=TRUE;
|
168 |
-
$result->ensureUncuttable=TRUE;
|
169 |
-
$result->allowBoxAfter=TRUE;
|
170 |
-
$result->skipWordsCount=TRUE;
|
171 |
-
} elseif(in_array($tag, array('table'))) {
|
172 |
-
$result=new IRP_BehaviourTag();
|
173 |
-
$result->allowBoxBefore=TRUE;
|
174 |
-
$result->ensureUncuttable=TRUE;
|
175 |
-
$result->allowBoxAfter=TRUE;
|
176 |
-
} elseif(in_array($tag, array('span'))) {
|
177 |
-
$result=new IRP_BehaviourTag();
|
178 |
-
$
|
179 |
-
|
180 |
-
|
181 |
-
|
182 |
-
|
183 |
-
|
184 |
-
|
185 |
-
} elseif(in_array($tag, array('
|
186 |
-
$result=new IRP_BehaviourTag();
|
187 |
-
$result->
|
188 |
-
$result->
|
189 |
-
|
190 |
-
|
191 |
-
|
192 |
-
|
193 |
-
|
194 |
-
|
195 |
-
|
196 |
-
$
|
197 |
-
|
198 |
-
$result->
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
$
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
$result
|
208 |
-
$result->
|
209 |
-
$result->
|
210 |
-
} elseif(in_array($tag, array('
|
211 |
-
$result=new IRP_BehaviourTag();
|
212 |
-
$result->ensureWithoutPreviousBox=TRUE;
|
213 |
-
$result->ensureUncuttable=TRUE;
|
214 |
-
$result->ensureWithoutNextBox=TRUE;
|
215 |
-
|
216 |
-
|
217 |
-
$result=
|
218 |
-
$result->ensureUncuttable=TRUE;
|
219 |
-
|
220 |
-
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
$
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
$
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
|
253 |
-
}
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
|
269 |
-
|
270 |
-
|
271 |
-
|
272 |
-
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
-
|
297 |
-
|
298 |
-
|
299 |
-
$irp->Log->error('WHAT? UNABLE TO FIND OPENED TAG');
|
300 |
-
$
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
$
|
325 |
-
$
|
326 |
-
|
327 |
-
|
328 |
-
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
|
335 |
-
|
336 |
-
|
337 |
-
|
338 |
-
$
|
339 |
-
if($
|
340 |
-
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
$tos->
|
348 |
-
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
-
$
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
|
363 |
-
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
$
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
if(!$
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
|
395 |
-
|
396 |
-
|
397 |
-
}
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
$
|
404 |
-
|
405 |
-
|
406 |
-
$result
|
407 |
-
|
408 |
-
|
409 |
-
|
410 |
-
|
411 |
-
|
412 |
-
|
413 |
-
|
414 |
-
|
415 |
-
|
416 |
-
|
417 |
-
|
418 |
-
|
419 |
-
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
$
|
424 |
-
$
|
425 |
-
$
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
$
|
430 |
-
$
|
431 |
-
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
|
440 |
-
|
441 |
-
|
442 |
-
|
443 |
-
|
444 |
-
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
$
|
450 |
-
$
|
451 |
-
$
|
452 |
-
|
453 |
-
|
454 |
-
|
455 |
-
$irp
|
456 |
-
$this->
|
457 |
-
|
458 |
-
|
459 |
-
|
460 |
-
|
461 |
-
|
462 |
-
|
463 |
-
|
464 |
-
|
465 |
-
|
466 |
-
|
467 |
-
|
468 |
-
|
469 |
-
|
470 |
-
|
471 |
-
$
|
472 |
-
|
473 |
-
|
474 |
-
|
475 |
-
|
476 |
-
$
|
477 |
-
|
478 |
-
|
479 |
-
|
480 |
-
|
481 |
-
|
482 |
-
|
483 |
-
|
484 |
-
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
497 |
-
|
498 |
-
|
499 |
-
|
500 |
-
|
501 |
-
|
502 |
-
|
503 |
-
|
504 |
-
|
505 |
-
|
506 |
-
|
507 |
-
|
508 |
-
|
509 |
-
|
510 |
-
|
511 |
-
|
512 |
-
|
513 |
-
|
514 |
-
|
515 |
-
|
516 |
-
|
517 |
-
|
518 |
-
|
519 |
-
|
520 |
-
|
521 |
-
|
522 |
-
|
523 |
-
|
524 |
-
|
525 |
-
|
526 |
-
|
527 |
-
|
528 |
-
|
529 |
-
|
530 |
-
|
531 |
-
|
532 |
-
public function
|
533 |
-
|
534 |
-
}
|
535 |
-
|
536 |
-
|
537 |
-
|
538 |
-
|
539 |
-
|
540 |
-
|
541 |
-
|
542 |
-
|
543 |
-
|
544 |
-
|
545 |
-
|
546 |
-
|
547 |
-
|
548 |
-
|
549 |
-
|
550 |
-
|
551 |
-
|
552 |
-
|
553 |
-
|
554 |
-
|
555 |
-
|
556 |
-
|
557 |
-
|
558 |
-
|
559 |
-
return TRUE;
|
560 |
-
}
|
561 |
-
public function isBufferText() {
|
562 |
-
return FALSE;
|
563 |
-
}
|
564 |
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_HTMLContext {
|
5 |
+
var $root; //MainTag
|
6 |
+
var $buffer; //IRP_Stack
|
7 |
+
|
8 |
+
var $uncuttable;
|
9 |
+
var $withoutNextState;
|
10 |
+
var $withoutNextWords;
|
11 |
+
|
12 |
+
var $currentWords;
|
13 |
+
var $lastBoxWords;
|
14 |
+
//last time that the plugin insert the related posts box counter values
|
15 |
+
var $wordsThreshold;
|
16 |
+
var $skipWordsCount=FALSE;
|
17 |
+
|
18 |
+
public function __construct() {
|
19 |
+
$this->clearBuffer();
|
20 |
+
}
|
21 |
+
|
22 |
+
public function setWithoutNextBox() {
|
23 |
+
$this->withoutNextState=TRUE;
|
24 |
+
$this->withoutNextWords=$this->currentWords;
|
25 |
+
}
|
26 |
+
public function isSkipCurrentBox() {
|
27 |
+
$result=FALSE;
|
28 |
+
if($this->withoutNextState) {
|
29 |
+
//if i already had written some words i can unlock the withoutNext lock
|
30 |
+
$result=($this->currentWords<=$this->withoutNextWords);
|
31 |
+
if(!$result) {
|
32 |
+
$this->withoutNextState=FALSE;
|
33 |
+
$this->withoutNextWords=0;
|
34 |
+
}
|
35 |
+
}
|
36 |
+
return $result;
|
37 |
+
}
|
38 |
+
public function clearSkipNext() {
|
39 |
+
$this->withoutNextState=FALSE;
|
40 |
+
$this->withoutNextWords=0;
|
41 |
+
}
|
42 |
+
|
43 |
+
public function setUncuttable($value) {
|
44 |
+
$this->uncuttable=$value;
|
45 |
+
}
|
46 |
+
public function isUncuttable() {
|
47 |
+
return $this->uncuttable;
|
48 |
+
}
|
49 |
+
|
50 |
+
private function clearBuffer() {
|
51 |
+
$this->buffer=new IRP_Stack();
|
52 |
+
$this->uncuttable=FALSE;
|
53 |
+
$this->isParentTable=FALSE;
|
54 |
+
$this->withoutNextState=FALSE;
|
55 |
+
$this->currentWords=0;
|
56 |
+
$this->lastBoxWords=0;
|
57 |
+
$this->withoutNextState=FALSE;
|
58 |
+
$this->withoutNextWords=0;
|
59 |
+
}
|
60 |
+
private function pushTextContent($part, $text, IRP_Stack &$tagsStack) {
|
61 |
+
if(!$part) {
|
62 |
+
$parent=$tagsStack->peek();
|
63 |
+
$part=new IRP_TextContent();
|
64 |
+
$parent->pushTag($part);
|
65 |
+
}
|
66 |
+
$part->append($text);
|
67 |
+
return $part;
|
68 |
+
}
|
69 |
+
|
70 |
+
public function isWriteRelatedBox() {
|
71 |
+
global $irp;
|
72 |
+
if($this->isSkipCurrentBox()) {
|
73 |
+
return FALSE;
|
74 |
+
}
|
75 |
+
if($this->isUncuttable()) {
|
76 |
+
return FALSE;
|
77 |
+
}
|
78 |
+
|
79 |
+
$irp->Log->debug('WriteRelatedBox?');
|
80 |
+
$diff=($this->currentWords-$this->lastBoxWords);
|
81 |
+
$irp->Log->debug('currentWords[%s]-lastBoxWords[%s]=diff[%s]'
|
82 |
+
, $this->currentWords, $this->lastBoxWords, $diff);
|
83 |
+
|
84 |
+
$postLimit=$this->wordsThreshold*($irp->Options->getRewriteBoxesWritten()+1);
|
85 |
+
$irp->Log->debug('wordsThreshold[%s]*(RewriteBoxesWritten[%s]+1)=postLimit[%s]'
|
86 |
+
, $this->wordsThreshold, $irp->Options->getRewriteBoxesWritten(), $postLimit);
|
87 |
+
|
88 |
+
$minLimit=$irp->Options->getRewriteThreshold();
|
89 |
+
$result=($this->currentWords>=$postLimit && $diff>=$minLimit);
|
90 |
+
$irp->Log->debug('(currentWords[%s]>=postLimit[%s]) AND (diff[%s]>=minLimit[%s])=%s'
|
91 |
+
, $this->currentWords, $postLimit
|
92 |
+
, $diff, $minLimit, $result);
|
93 |
+
return $result;
|
94 |
+
}
|
95 |
+
|
96 |
+
function getTagAttribute($fullTag, $name) {
|
97 |
+
$close=strpos($fullTag, '>');
|
98 |
+
$attr=strpos($fullTag, ' '.$name.'=');
|
99 |
+
$result='';
|
100 |
+
if($attr!==FALSE && $close!==FALSE && $attr<$close) {
|
101 |
+
$quote=substr($fullTag, $attr+strlen($name)+2, 1);
|
102 |
+
$text=substr($fullTag, $attr+strlen($name)+3);
|
103 |
+
$end=strpos($text, $quote, 1);
|
104 |
+
if($end!==FALSE) {
|
105 |
+
$result=substr($text, 0, $end);
|
106 |
+
}
|
107 |
+
}
|
108 |
+
return $result;
|
109 |
+
}
|
110 |
+
|
111 |
+
//get the tag name to lower case, could be that is not defined
|
112 |
+
//so this function return '' could also be that
|
113 |
+
function getTagName($fullTag) {
|
114 |
+
global $irp;
|
115 |
+
|
116 |
+
$start=1;
|
117 |
+
$p=strpos($fullTag, ' ');
|
118 |
+
if($p===FALSE) {
|
119 |
+
$p=strpos($fullTag, '/');
|
120 |
+
if($p!==FALSE && $p==1) {
|
121 |
+
$start=2;
|
122 |
+
$p=FALSE;
|
123 |
+
}
|
124 |
+
if($p===FALSE) {
|
125 |
+
$p=strpos($fullTag, '>');
|
126 |
+
if($p===FALSE) {
|
127 |
+
$irp->Log->error('UNABLE TO DECODE TAG %s', $fullTag);
|
128 |
+
return '';
|
129 |
+
}
|
130 |
+
}
|
131 |
+
}
|
132 |
+
$tag=trim(substr($fullTag, $start, $p-$start));
|
133 |
+
$tag=strtolower($tag);
|
134 |
+
return $tag;
|
135 |
+
}
|
136 |
+
function getHtmlTag($fullTag){
|
137 |
+
global $irp;
|
138 |
+
|
139 |
+
$tag=$this->getTagName($fullTag);
|
140 |
+
$tagId=$this->getTagAttribute($fullTag, 'id');
|
141 |
+
$tagClasses=$this->getTagAttribute($fullTag, 'class');
|
142 |
+
if($tagClasses!=='') {
|
143 |
+
$tagClasses=explode(' ', $tagClasses);
|
144 |
+
} else {
|
145 |
+
$tagClasses=array();
|
146 |
+
}
|
147 |
+
|
148 |
+
if($tag=='') {
|
149 |
+
return NULL;
|
150 |
+
}
|
151 |
+
|
152 |
+
$result=new IRP_OtherTag();
|
153 |
+
if(in_array($tag, array('h1','h2','h3','h4','h5','h6'))) {
|
154 |
+
$result=new IRP_BehaviourTag();
|
155 |
+
$result->allowBoxBefore=TRUE;
|
156 |
+
$result->ensureUncuttable=TRUE;
|
157 |
+
$result->ensureWithoutNextBox=TRUE;
|
158 |
+
} elseif(in_array($tag, array('ul', 'ol', 'dl'))) {
|
159 |
+
$result=new IRP_BehaviourTag();
|
160 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
161 |
+
$result->ensureUncuttable=TRUE;
|
162 |
+
$result->allowBoxAfter=TRUE;
|
163 |
+
} elseif(in_array($tag, array('area','base','col','br','command','embed','hr','img','input','link','meta','param','source'))) {
|
164 |
+
$result=new IRP_SingletonTag();
|
165 |
+
} elseif(in_array($tag, array('iframe'))) {
|
166 |
+
$result=new IRP_BehaviourTag();
|
167 |
+
$result->allowBoxBefore=TRUE;
|
168 |
+
$result->ensureUncuttable=TRUE;
|
169 |
+
$result->allowBoxAfter=TRUE;
|
170 |
+
$result->skipWordsCount=TRUE;
|
171 |
+
} elseif(in_array($tag, array('table'))) {
|
172 |
+
$result=new IRP_BehaviourTag();
|
173 |
+
$result->allowBoxBefore=TRUE;
|
174 |
+
$result->ensureUncuttable=TRUE;
|
175 |
+
$result->allowBoxAfter=TRUE;
|
176 |
+
} elseif(in_array($tag, array('span'))) {
|
177 |
+
$result=new IRP_BehaviourTag();
|
178 |
+
if ($irp->Options->isPlaceInsideSpanElements()) {
|
179 |
+
$result->ensureWithoutPreviousBox = false;
|
180 |
+
$result->ensureWithoutNextBox = false;
|
181 |
+
} else {
|
182 |
+
$result->ensureWithoutPreviousBox = true;
|
183 |
+
$result->ensureWithoutNextBox = true;
|
184 |
+
}
|
185 |
+
} elseif(in_array($tag, array('figure'))) {
|
186 |
+
$result=new IRP_BehaviourTag();
|
187 |
+
$result->ensureWithoutNextBox=TRUE;
|
188 |
+
$result->skipWordsCount=TRUE;
|
189 |
+
$result->ensureUncuttable=TRUE;
|
190 |
+
} elseif(in_array($tag, array('div'))) {
|
191 |
+
$result=new IRP_BehaviourTag();
|
192 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
193 |
+
$result->ensureWithoutNextBox=TRUE;
|
194 |
+
|
195 |
+
$ids=explode('|', 'optinforms-|wpautbox-|wpurp-container-recipe-');
|
196 |
+
if($irp->Utils->startsWith($tagId, $ids)) {
|
197 |
+
$result->skipWordsCount=TRUE;
|
198 |
+
$result->ensureUncuttable=TRUE;
|
199 |
+
}
|
200 |
+
|
201 |
+
$classes=explode('|', 'yuzo_related_post|shareaholic-|wp-caption|wordpress-post-tabs|amp-wp-article-content|title-wrapper|sa-source-wrapper|et_pb_text_inner|wprm-recipe-name|toc_light_blue|ast-oembed-container|depiction|wc-tab|gkblock-3|et_pb_toggle_content|et_pb_module|aawp-product__description|fusion-text|fusion-alert-content|mv-create-instructions|recipe-ingredients-wrap|guide-box|underPostOptin|x-columnize');
|
202 |
+
if($irp->Utils->startsWith($tagClasses, $classes)) {
|
203 |
+
$result->skipWordsCount=TRUE;
|
204 |
+
$result->ensureUncuttable=TRUE;
|
205 |
+
}
|
206 |
+
} elseif(in_array($tag, array('p'))) {
|
207 |
+
$result=new IRP_BehaviourTag();
|
208 |
+
$result->allowBoxBefore=TRUE;
|
209 |
+
$result->allowBoxAfter=TRUE;
|
210 |
+
} elseif(in_array($tag, array('blockquote', 'cite', 'code', 'em', 'pre'))) {
|
211 |
+
$result=new IRP_BehaviourTag();
|
212 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
213 |
+
$result->ensureUncuttable=TRUE;
|
214 |
+
$result->ensureWithoutNextBox=TRUE;
|
215 |
+
} elseif(in_array($tag, array('irp', 'script', 'style'))) {
|
216 |
+
$result=new IRP_BehaviourTag();
|
217 |
+
$result->ensureWithoutPreviousBox=TRUE;
|
218 |
+
$result->ensureUncuttable=TRUE;
|
219 |
+
$result->ensureWithoutNextBox=TRUE;
|
220 |
+
$result->skipWordsCount=TRUE;
|
221 |
+
} elseif(in_array($tag, array('sub', 'sup'))) {
|
222 |
+
$result=new IRP_BehaviourTag();
|
223 |
+
$result->ensureUncuttable=TRUE;
|
224 |
+
}
|
225 |
+
return $result;
|
226 |
+
}
|
227 |
+
|
228 |
+
public function decode($all) {
|
229 |
+
global $irp;
|
230 |
+
|
231 |
+
$this->root=new IRP_MainTag();
|
232 |
+
$this->clearBuffer();
|
233 |
+
|
234 |
+
if(!$all || trim($all)=='') return FALSE;
|
235 |
+
|
236 |
+
//qui sono a ricercare tutti i tag per poi farci delle verifiche
|
237 |
+
$tagsStack=new IRP_Stack();
|
238 |
+
$tagsStack->push($this->root);
|
239 |
+
|
240 |
+
$errors=FALSE;
|
241 |
+
$part=NULL;
|
242 |
+
$previous=0;
|
243 |
+
|
244 |
+
try {
|
245 |
+
do {
|
246 |
+
$less=strpos($all, '<', $previous);
|
247 |
+
if($less===FALSE) {
|
248 |
+
if($previous!=strlen($all)) {
|
249 |
+
$text=$irp->Utils->substrln($all, $previous);
|
250 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
251 |
+
}
|
252 |
+
break;
|
253 |
+
}
|
254 |
+
|
255 |
+
if($previous!=$less) {
|
256 |
+
$text=$irp->Utils->substrln($all, $previous, $less);
|
257 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
258 |
+
}
|
259 |
+
|
260 |
+
$more=strpos($all, '>', $less+1);
|
261 |
+
$another=strpos($all, '<', $less+1);
|
262 |
+
if($more===FALSE) {
|
263 |
+
//only open tag so I considate all as text (in this case is better
|
264 |
+
//to use html code like > or <
|
265 |
+
$text=$irp->Utils->substrln($all, $previous);
|
266 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
267 |
+
break;
|
268 |
+
}
|
269 |
+
|
270 |
+
if($another!==FALSE && $another<$more) {
|
271 |
+
//something like this <bla bla bla <bla bla> so we considerate
|
272 |
+
//from the last < before >
|
273 |
+
$previous=$another;
|
274 |
+
$text=$irp->Utils->substrln($all, $less, $previous);
|
275 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
276 |
+
continue;
|
277 |
+
}
|
278 |
+
|
279 |
+
$previous=$more+1;
|
280 |
+
$text=$irp->Utils->substrln($all, $less, $previous);
|
281 |
+
$parent=$tagsStack->peek();
|
282 |
+
$tag=$this->getOpenTag($text);
|
283 |
+
if($tag) {
|
284 |
+
//detected tag open
|
285 |
+
$part=NULL;
|
286 |
+
$parent->pushTag($tag);
|
287 |
+
if($tag->hasTagContent()) {
|
288 |
+
//this tag contains a content
|
289 |
+
$tagsStack->push($tag);
|
290 |
+
}
|
291 |
+
} else {
|
292 |
+
//detected tag close
|
293 |
+
$tag=$this->getCloseTag($text, $tagsStack);
|
294 |
+
if($tag) {
|
295 |
+
$part=NULL;
|
296 |
+
$compare=$tagsStack->pop();
|
297 |
+
while(!$tagsStack->isEmpty() && $compare!=$tag) {
|
298 |
+
//security check: close each tag until i found my tag
|
299 |
+
$irp->Log->error('WHAT? UNABLE TO FIND OPENED TAG..TRY CLOSING AND RETRYING AGAIN');
|
300 |
+
$compare->closeTag='</'.$compare->tag.'>';
|
301 |
+
$compare=$tagsStack->pop();
|
302 |
+
}
|
303 |
+
if($compare!=$tag) {
|
304 |
+
$irp->Log->error('WHAT? UNABLE TO FIND OPENED TAG');
|
305 |
+
$errors=TRUE;
|
306 |
+
} else {
|
307 |
+
$compare->closeTag=$text;
|
308 |
+
}
|
309 |
+
} else {
|
310 |
+
//simply text
|
311 |
+
$part=$this->pushTextContent($part, $text, $tagsStack);
|
312 |
+
}
|
313 |
+
}
|
314 |
+
}
|
315 |
+
while($previous<strlen($all));
|
316 |
+
} catch(Exception $ex) {
|
317 |
+
$irp->Log->exception($ex);
|
318 |
+
}
|
319 |
+
|
320 |
+
return !$errors;
|
321 |
+
}
|
322 |
+
|
323 |
+
private function getOpenTag($openTag) {
|
324 |
+
global $irp;
|
325 |
+
if($irp->Utils->startsWith($openTag, '</')) {
|
326 |
+
return NULL;
|
327 |
+
}
|
328 |
+
|
329 |
+
$name=$this->getTagName($openTag);
|
330 |
+
$tag=$this->getHtmlTag($openTag);
|
331 |
+
if($tag) {
|
332 |
+
$tag->tag=$name;
|
333 |
+
$tag->openTag=$openTag;
|
334 |
+
}
|
335 |
+
return $tag;
|
336 |
+
}
|
337 |
+
private function getCloseTag($closeTag, IRP_Stack $tagsStack) {
|
338 |
+
global $irp;
|
339 |
+
if(!$irp->Utils->startsWith($closeTag, '</')) {
|
340 |
+
return NULL;
|
341 |
+
}
|
342 |
+
|
343 |
+
$compare=$this->getTagName($closeTag);
|
344 |
+
if($compare=='') return NULL;
|
345 |
+
|
346 |
+
$tos=$tagsStack->peek();
|
347 |
+
if(!$tos || !isset($tos->tag) || strcasecmp($tos->tag, $compare)!=0) {
|
348 |
+
$irp->Log->error('CHECK YOU BODY TAG %s ENDS WITH %s TAG', $tos->tag, $compare);
|
349 |
+
return NULL;
|
350 |
+
}
|
351 |
+
|
352 |
+
$tos->closeTag=$closeTag;
|
353 |
+
return $tos;
|
354 |
+
}
|
355 |
+
|
356 |
+
public function execute($body) {
|
357 |
+
global $irp;
|
358 |
+
if(!$irp->Options->isRewriteActive()) {
|
359 |
+
return $body;
|
360 |
+
}
|
361 |
+
|
362 |
+
$this->decode($body);
|
363 |
+
$this->root->analyseText($this);
|
364 |
+
$t=intval($this->currentWords/($irp->Options->getRewriteBoxesCount()+1));
|
365 |
+
if($t<$irp->Options->getRewriteThreshold()) {
|
366 |
+
$t=$irp->Options->getRewriteThreshold();
|
367 |
+
}
|
368 |
+
|
369 |
+
$this->wordsThreshold=$t;
|
370 |
+
|
371 |
+
$this->clearBuffer();
|
372 |
+
$this->root->write($this);
|
373 |
+
|
374 |
+
$result='';
|
375 |
+
foreach($this->buffer->array as $v) {
|
376 |
+
$result.=$v->getText();
|
377 |
+
}
|
378 |
+
return $result;
|
379 |
+
}
|
380 |
+
public function write($text, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
381 |
+
global $irp;
|
382 |
+
if(!$text || $text=='') return;
|
383 |
+
$text=$irp->Utils->format($text, $v1, $v2, $v3, $v4, $v5);
|
384 |
+
|
385 |
+
$v=NULL;
|
386 |
+
$new=$this->buffer->isEmpty();
|
387 |
+
if(!$new) {
|
388 |
+
$v=$this->buffer->peek();
|
389 |
+
if(!$v->isBufferText()) {
|
390 |
+
$new=TRUE;
|
391 |
+
}
|
392 |
+
}
|
393 |
+
|
394 |
+
if($new) {
|
395 |
+
$v=new IRP_BufferText();
|
396 |
+
$this->buffer->push($v);
|
397 |
+
}
|
398 |
+
$v->appendText($text);
|
399 |
+
}
|
400 |
+
public function writeRelatedBoxIfNeeded() {
|
401 |
+
$result=FALSE;
|
402 |
+
//write the box at the end of the tag only if this is not an <Hn> tag
|
403 |
+
if($this->isWriteRelatedBox()) {
|
404 |
+
$result=$this->writeRelatedBox();
|
405 |
+
}
|
406 |
+
return $result;
|
407 |
+
}
|
408 |
+
public function writeRelatedBox($forceBox=FALSE) {
|
409 |
+
global $irp;
|
410 |
+
|
411 |
+
$written=$irp->Options->getRewriteBoxesWritten();
|
412 |
+
$max=$irp->Options->getRewriteBoxesCount();
|
413 |
+
if(!$forceBox && $written>=$max) {
|
414 |
+
$irp->Log->error('MAX BOX=%s REACHED', $max);
|
415 |
+
return FALSE;
|
416 |
+
}
|
417 |
+
|
418 |
+
$irp->Log->debug('WRITING BOX=%s/%s', $written+1, $max);
|
419 |
+
$result=FALSE;
|
420 |
+
$count=1;//$irp->Options->getRewritePostsInBoxCount();
|
421 |
+
$ids=$irp->Options->getToShowPostsIds($count, TRUE);
|
422 |
+
|
423 |
+
$comment="INLINE RELATED POSTS %s/%s";
|
424 |
+
$comment=sprintf($comment, $written+1, $max);
|
425 |
+
$options=array(
|
426 |
+
'comment'=>$comment
|
427 |
+
, 'shortcode'=>FALSE
|
428 |
+
);
|
429 |
+
$box=irp_ui_get_box($ids, $options);
|
430 |
+
if($box!='') {
|
431 |
+
$this->pushRelatedBox($box);
|
432 |
+
$result=TRUE;
|
433 |
+
} else {
|
434 |
+
$result=FALSE;
|
435 |
+
$irp->Log->error('NO BOX TO WRITE WITH IDS=%s', $ids);
|
436 |
+
}
|
437 |
+
return $result;
|
438 |
+
}
|
439 |
+
//append related-box element to buffer
|
440 |
+
public function pushRelatedBox($box) {
|
441 |
+
global $irp;
|
442 |
+
|
443 |
+
$v=new IRP_BufferBox();
|
444 |
+
$v->appendText($box);
|
445 |
+
$v->currentBoxWords=$this->currentWords;
|
446 |
+
$v->previousBoxWords=$this->lastBoxWords;
|
447 |
+
$this->buffer->push($v);
|
448 |
+
|
449 |
+
$written=$irp->Options->getRewriteBoxesWritten()+1;
|
450 |
+
$irp->Options->setRewriteBoxesWritten($written);
|
451 |
+
$this->lastBoxWords=$v->currentBoxWords;
|
452 |
+
}
|
453 |
+
//remove related-box elements from buffer starting from the end
|
454 |
+
public function popRelatedBox($args=NULL) {
|
455 |
+
global $irp;
|
456 |
+
if($this->buffer->isEmpty()) {
|
457 |
+
return FALSE;
|
458 |
+
}
|
459 |
+
|
460 |
+
$result=FALSE;
|
461 |
+
$defaults=array('last'=>TRUE, 'all'=>FALSE);
|
462 |
+
$args=$irp->Utils->parseArgs($args, $defaults);
|
463 |
+
if($args['last']) {
|
464 |
+
$v=$this->buffer->peek();
|
465 |
+
if($v->isBufferBox()) {
|
466 |
+
$v=$this->buffer->pop();
|
467 |
+
$this->lastBoxWords=$v->previousBoxWords;
|
468 |
+
$result=TRUE;
|
469 |
+
|
470 |
+
$w=$irp->Options->getRewriteBoxesWritten()-1;
|
471 |
+
$irp->Options->setRewriteBoxesWritten($w);
|
472 |
+
}
|
473 |
+
} elseif($args['all']) {
|
474 |
+
$array=array();
|
475 |
+
for($i=0; $i<count($this->buffer->array); $i++) {
|
476 |
+
$v=$this->buffer->array[$i];
|
477 |
+
if($v->isBufferBox()) {
|
478 |
+
$result=TRUE;
|
479 |
+
} else {
|
480 |
+
$array[]=$v;
|
481 |
+
}
|
482 |
+
}
|
483 |
+
$this->buffer->array=$array;
|
484 |
+
$this->lastBoxWords=0;
|
485 |
+
$irp->Options->setRewriteBoxesWritten(0);
|
486 |
+
}
|
487 |
+
return $result;
|
488 |
+
}
|
489 |
+
public function incCounters($text){
|
490 |
+
global $irp;
|
491 |
+
if($this->skipWordsCount) {
|
492 |
+
return;
|
493 |
+
}
|
494 |
+
|
495 |
+
$text=trim($text);
|
496 |
+
$words=explode(' ', $text);
|
497 |
+
$c=0;
|
498 |
+
foreach($words as $w) {
|
499 |
+
$w=trim($w);
|
500 |
+
if($w!='' && strlen($w)>1) {
|
501 |
+
$c++;
|
502 |
+
}
|
503 |
+
}
|
504 |
+
|
505 |
+
$this->currentWords+=$c;
|
506 |
+
$irp->Log->debug('TEXT=[%s] INCREMENT WORDS words[%s]/currentWords[%s]'
|
507 |
+
, $text, $c, $this->currentWords);
|
508 |
+
}
|
509 |
+
}
|
510 |
+
|
511 |
+
class IRP_BufferElement {
|
512 |
+
var $text;
|
513 |
+
public function __construct() {
|
514 |
+
$this->text='';
|
515 |
+
}
|
516 |
+
|
517 |
+
public function getText() {
|
518 |
+
return $this->text;
|
519 |
+
}
|
520 |
+
public function appendText($text) {
|
521 |
+
$this->text.=$text;
|
522 |
+
}
|
523 |
+
|
524 |
+
public function isBufferBox() {
|
525 |
+
return FALSE;
|
526 |
+
}
|
527 |
+
public function isBufferText() {
|
528 |
+
return FALSE;
|
529 |
+
}
|
530 |
+
}
|
531 |
+
class IRP_BufferText extends IRP_BufferElement {
|
532 |
+
public function __construct() {
|
533 |
+
parent::__construct();
|
534 |
+
}
|
535 |
+
|
536 |
+
public function isBufferBox() {
|
537 |
+
return FALSE;
|
538 |
+
}
|
539 |
+
public function isBufferText() {
|
540 |
+
return TRUE;
|
541 |
+
}
|
542 |
+
}
|
543 |
+
class IRP_BufferBox extends IRP_BufferElement {
|
544 |
+
var $currentBoxWords;
|
545 |
+
var $previousBoxWords;
|
546 |
+
|
547 |
+
public function __construct() {
|
548 |
+
parent::__construct();
|
549 |
+
$this->currentBoxWords=0;
|
550 |
+
$this->previousBoxWords=0;
|
551 |
+
}
|
552 |
+
|
553 |
+
public function isBufferBox() {
|
554 |
+
return TRUE;
|
555 |
+
}
|
556 |
+
public function isBufferText() {
|
557 |
+
return FALSE;
|
558 |
+
}
|
|
|
|
|
|
|
|
|
|
|
559 |
}
|
includes/classes/html/HTMLTag.php
CHANGED
@@ -1,61 +1,61 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_HTMLTag {
|
5 |
-
var $tags;
|
6 |
-
var $tag;
|
7 |
-
var $openTag;
|
8 |
-
var $closeTag;
|
9 |
-
|
10 |
-
public function __construct() {
|
11 |
-
$this->tags = array();
|
12 |
-
$this->tag='';
|
13 |
-
$this->openTag='';
|
14 |
-
$this->closeTag='';
|
15 |
-
}
|
16 |
-
|
17 |
-
public function hasTagContent() {
|
18 |
-
return TRUE;
|
19 |
-
}
|
20 |
-
public function pushTag(IRP_HTMLTag $child) {
|
21 |
-
if(count($this->tags)>0) {
|
22 |
-
//replace the TextContent tag that only contains \r\n with NewLineText
|
23 |
-
//due to now we use the substrln is impossible that we enter here
|
24 |
-
$last=$this->tags[count($this->tags)-1];
|
25 |
-
if(isset($last->body)) {
|
26 |
-
$newline=TRUE;
|
27 |
-
if($last->body=="\n" || $last->body=="\r\n") {
|
28 |
-
//we dont have to do nothing... sure this is a newlinetext!
|
29 |
-
} else {
|
30 |
-
for($i=0; $i<strlen($last->body); $i++) {
|
31 |
-
$c=substr($last->body, $i, 1);
|
32 |
-
if($c!="\n" && $c!="\n") {
|
33 |
-
$newline=FALSE;
|
34 |
-
break;
|
35 |
-
}
|
36 |
-
}
|
37 |
-
}
|
38 |
-
|
39 |
-
if($newline) {
|
40 |
-
$tag=new IRP_NewLineText();
|
41 |
-
$tag->body=$last->body;
|
42 |
-
$this->tags[count($this->tags)-1]=$tag;
|
43 |
-
}
|
44 |
-
}
|
45 |
-
}
|
46 |
-
$this->tags[] = $child;
|
47 |
-
}
|
48 |
-
|
49 |
-
public function write(IRP_HTMLContext $context) {
|
50 |
-
$context->write($this->openTag);
|
51 |
-
foreach($this->tags as $tag) {
|
52 |
-
$tag->write($context);
|
53 |
-
}
|
54 |
-
$context->write($this->closeTag);
|
55 |
-
}
|
56 |
-
public function analyseText(IRP_HTMLContext $context) {
|
57 |
-
foreach ($this->tags as $tag) {
|
58 |
-
$tag->analyseText($context);
|
59 |
-
}
|
60 |
-
}
|
61 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_HTMLTag {
|
5 |
+
var $tags;
|
6 |
+
var $tag;
|
7 |
+
var $openTag;
|
8 |
+
var $closeTag;
|
9 |
+
|
10 |
+
public function __construct() {
|
11 |
+
$this->tags = array();
|
12 |
+
$this->tag='';
|
13 |
+
$this->openTag='';
|
14 |
+
$this->closeTag='';
|
15 |
+
}
|
16 |
+
|
17 |
+
public function hasTagContent() {
|
18 |
+
return TRUE;
|
19 |
+
}
|
20 |
+
public function pushTag(IRP_HTMLTag $child) {
|
21 |
+
if(count($this->tags)>0) {
|
22 |
+
//replace the TextContent tag that only contains \r\n with NewLineText
|
23 |
+
//due to now we use the substrln is impossible that we enter here
|
24 |
+
$last=$this->tags[count($this->tags)-1];
|
25 |
+
if(isset($last->body)) {
|
26 |
+
$newline=TRUE;
|
27 |
+
if($last->body=="\n" || $last->body=="\r\n") {
|
28 |
+
//we dont have to do nothing... sure this is a newlinetext!
|
29 |
+
} else {
|
30 |
+
for($i=0; $i<strlen($last->body); $i++) {
|
31 |
+
$c=substr($last->body, $i, 1);
|
32 |
+
if($c!="\n" && $c!="\n") {
|
33 |
+
$newline=FALSE;
|
34 |
+
break;
|
35 |
+
}
|
36 |
+
}
|
37 |
+
}
|
38 |
+
|
39 |
+
if($newline) {
|
40 |
+
$tag=new IRP_NewLineText();
|
41 |
+
$tag->body=$last->body;
|
42 |
+
$this->tags[count($this->tags)-1]=$tag;
|
43 |
+
}
|
44 |
+
}
|
45 |
+
}
|
46 |
+
$this->tags[] = $child;
|
47 |
+
}
|
48 |
+
|
49 |
+
public function write(IRP_HTMLContext $context) {
|
50 |
+
$context->write($this->openTag);
|
51 |
+
foreach($this->tags as $tag) {
|
52 |
+
$tag->write($context);
|
53 |
+
}
|
54 |
+
$context->write($this->closeTag);
|
55 |
+
}
|
56 |
+
public function analyseText(IRP_HTMLContext $context) {
|
57 |
+
foreach ($this->tags as $tag) {
|
58 |
+
$tag->analyseText($context);
|
59 |
+
}
|
60 |
+
}
|
61 |
+
}
|
includes/classes/html/MainTag.php
CHANGED
@@ -1,27 +1,27 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_MainTag extends IRP_HTMLTag {
|
5 |
-
public function __construct() {
|
6 |
-
parent::__construct();
|
7 |
-
}
|
8 |
-
|
9 |
-
public function write(IRP_HTMLContext $context) {
|
10 |
-
global $irp;
|
11 |
-
foreach ($this->tags as $tag) {
|
12 |
-
$tag->write($context);
|
13 |
-
}
|
14 |
-
|
15 |
-
//try to write the last box only if no boxes are written before
|
16 |
-
//this prevent from inserting at the end a box due to tipically
|
17 |
-
//marketer insert a CTA box (for instance download free book)
|
18 |
-
if($irp->Options->isRewriteAtEnd() && $irp->Options->getRewriteBoxesWritten()==0) {
|
19 |
-
$context->clearSkipNext();
|
20 |
-
$context->setUncuttable(FALSE);
|
21 |
-
$context->writeRelatedBox(TRUE);
|
22 |
-
} elseif(!$irp->Options->isRewriteAtEnd()) {
|
23 |
-
$args=array('last'=>TRUE);
|
24 |
-
$context->popRelatedBox($args);
|
25 |
-
}
|
26 |
-
}
|
27 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_MainTag extends IRP_HTMLTag {
|
5 |
+
public function __construct() {
|
6 |
+
parent::__construct();
|
7 |
+
}
|
8 |
+
|
9 |
+
public function write(IRP_HTMLContext $context) {
|
10 |
+
global $irp;
|
11 |
+
foreach ($this->tags as $tag) {
|
12 |
+
$tag->write($context);
|
13 |
+
}
|
14 |
+
|
15 |
+
//try to write the last box only if no boxes are written before
|
16 |
+
//this prevent from inserting at the end a box due to tipically
|
17 |
+
//marketer insert a CTA box (for instance download free book)
|
18 |
+
if($irp->Options->isRewriteAtEnd() && $irp->Options->getRewriteBoxesWritten()==0) {
|
19 |
+
$context->clearSkipNext();
|
20 |
+
$context->setUncuttable(FALSE);
|
21 |
+
$context->writeRelatedBox(TRUE);
|
22 |
+
} elseif(!$irp->Options->isRewriteAtEnd()) {
|
23 |
+
$args=array('last'=>TRUE);
|
24 |
+
$context->popRelatedBox($args);
|
25 |
+
}
|
26 |
+
}
|
27 |
+
}
|
includes/classes/html/NewLineText.php
CHANGED
@@ -1,18 +1,18 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_NewLineText extends IRP_TextContent {
|
5 |
-
|
6 |
-
public function __construct() {
|
7 |
-
parent::__construct();
|
8 |
-
}
|
9 |
-
public function hasTagContent() {
|
10 |
-
return FALSE;
|
11 |
-
}
|
12 |
-
public function append($text) {
|
13 |
-
$this->body.=$text;
|
14 |
-
}
|
15 |
-
public function write(IRP_HTMLContext $context) {
|
16 |
-
$context->write($this->body);
|
17 |
-
}
|
18 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_NewLineText extends IRP_TextContent {
|
5 |
+
|
6 |
+
public function __construct() {
|
7 |
+
parent::__construct();
|
8 |
+
}
|
9 |
+
public function hasTagContent() {
|
10 |
+
return FALSE;
|
11 |
+
}
|
12 |
+
public function append($text) {
|
13 |
+
$this->body.=$text;
|
14 |
+
}
|
15 |
+
public function write(IRP_HTMLContext $context) {
|
16 |
+
$context->write($this->body);
|
17 |
+
}
|
18 |
+
}
|
includes/classes/html/OtherTag.php
CHANGED
@@ -1,12 +1,12 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_OtherTag extends IRP_HTMLTag {
|
5 |
-
public function __construct() {
|
6 |
-
parent::__construct();
|
7 |
-
}
|
8 |
-
|
9 |
-
public function write(IRP_HTMLContext $context) {
|
10 |
-
parent::write($context);
|
11 |
-
}
|
12 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_OtherTag extends IRP_HTMLTag {
|
5 |
+
public function __construct() {
|
6 |
+
parent::__construct();
|
7 |
+
}
|
8 |
+
|
9 |
+
public function write(IRP_HTMLContext $context) {
|
10 |
+
parent::write($context);
|
11 |
+
}
|
12 |
+
}
|
includes/classes/html/SingletonTag.php
CHANGED
@@ -1,15 +1,15 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_SingletonTag extends IRP_HTMLTag {
|
5 |
-
public function __construct() {
|
6 |
-
parent::__construct();
|
7 |
-
}
|
8 |
-
|
9 |
-
public function hasTagContent() {
|
10 |
-
return FALSE;
|
11 |
-
}
|
12 |
-
public function write(IRP_HTMLContext $context) {
|
13 |
-
$context->write($this->openTag);
|
14 |
-
}
|
15 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_SingletonTag extends IRP_HTMLTag {
|
5 |
+
public function __construct() {
|
6 |
+
parent::__construct();
|
7 |
+
}
|
8 |
+
|
9 |
+
public function hasTagContent() {
|
10 |
+
return FALSE;
|
11 |
+
}
|
12 |
+
public function write(IRP_HTMLContext $context) {
|
13 |
+
$context->write($this->openTag);
|
14 |
+
}
|
15 |
+
}
|
includes/classes/html/TextContent.php
CHANGED
@@ -1,53 +1,53 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_TextContent extends IRP_HTMLTag {
|
5 |
-
var $body;
|
6 |
-
public function __construct() {
|
7 |
-
parent::__construct();
|
8 |
-
$this->body='';
|
9 |
-
}
|
10 |
-
|
11 |
-
public function hasTagContent() {
|
12 |
-
return FALSE;
|
13 |
-
}
|
14 |
-
public function append($text) {
|
15 |
-
$this->body.=$text;
|
16 |
-
}
|
17 |
-
public function write(IRP_HTMLContext $context) {
|
18 |
-
global $irp;
|
19 |
-
if($context->isUncuttable() || trim($this->body)=='') {
|
20 |
-
//we dont want to insert nothing inside iframe or table
|
21 |
-
$context->write($this->body);
|
22 |
-
$context->incCounters($this->body);
|
23 |
-
if(defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
24 |
-
$context->write(sprintf('<sup style="color:red;"> {%s/%s,%s}</sup>'
|
25 |
-
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
26 |
-
}
|
27 |
-
} else {
|
28 |
-
//here is all text so we have to decide when cut it
|
29 |
-
$text=explode("\n", $this->body);
|
30 |
-
for($i=0; $i<count($text); $i++) {
|
31 |
-
$line=$text[$i];
|
32 |
-
if(trim($line)=='') {
|
33 |
-
$context->writeRelatedBoxIfNeeded();
|
34 |
-
}
|
35 |
-
|
36 |
-
if($i<(count($text)-1)) {
|
37 |
-
$line.="\n";
|
38 |
-
}
|
39 |
-
$context->write($line);
|
40 |
-
$context->incCounters($line);
|
41 |
-
if(trim($line)!='') {
|
42 |
-
if (defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
43 |
-
$context->write(sprintf('<sup style="color:#008000"> {%s/%s,%s}</sup>'
|
44 |
-
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
45 |
-
}
|
46 |
-
}
|
47 |
-
}
|
48 |
-
}
|
49 |
-
}
|
50 |
-
public function analyseText(IRP_HTMLContext $context) {
|
51 |
-
$context->incCounters($this->body);
|
52 |
-
}
|
53 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_TextContent extends IRP_HTMLTag {
|
5 |
+
var $body;
|
6 |
+
public function __construct() {
|
7 |
+
parent::__construct();
|
8 |
+
$this->body='';
|
9 |
+
}
|
10 |
+
|
11 |
+
public function hasTagContent() {
|
12 |
+
return FALSE;
|
13 |
+
}
|
14 |
+
public function append($text) {
|
15 |
+
$this->body.=$text;
|
16 |
+
}
|
17 |
+
public function write(IRP_HTMLContext $context) {
|
18 |
+
global $irp;
|
19 |
+
if($context->isUncuttable() || trim($this->body)=='') {
|
20 |
+
//we dont want to insert nothing inside iframe or table
|
21 |
+
$context->write($this->body);
|
22 |
+
$context->incCounters($this->body);
|
23 |
+
if(defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
24 |
+
$context->write(sprintf('<sup style="color:red;"> {%s/%s,%s}</sup>'
|
25 |
+
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
26 |
+
}
|
27 |
+
} else {
|
28 |
+
//here is all text so we have to decide when cut it
|
29 |
+
$text=explode("\n", $this->body);
|
30 |
+
for($i=0; $i<count($text); $i++) {
|
31 |
+
$line=$text[$i];
|
32 |
+
if(trim($line)=='') {
|
33 |
+
$context->writeRelatedBoxIfNeeded();
|
34 |
+
}
|
35 |
+
|
36 |
+
if($i<(count($text)-1)) {
|
37 |
+
$line.="\n";
|
38 |
+
}
|
39 |
+
$context->write($line);
|
40 |
+
$context->incCounters($line);
|
41 |
+
if(trim($line)!='') {
|
42 |
+
if (defined('IRP_DEBUG_BLOCK') && IRP_DEBUG_BLOCK) {
|
43 |
+
$context->write(sprintf('<sup style="color:#008000"> {%s/%s,%s}</sup>'
|
44 |
+
, $context->currentWords, $context->wordsThreshold, $context->lastBoxWords));
|
45 |
+
}
|
46 |
+
}
|
47 |
+
}
|
48 |
+
}
|
49 |
+
}
|
50 |
+
public function analyseText(IRP_HTMLContext $context) {
|
51 |
+
$context->incCounters($this->body);
|
52 |
+
}
|
53 |
+
}
|
includes/classes/ui/Check.php
CHANGED
@@ -1,107 +1,107 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
-
|
5 |
-
class IRP_Check {
|
6 |
-
var $data;
|
7 |
-
|
8 |
-
public function __construct() {
|
9 |
-
$this->data=array_merge($_POST, $_GET);
|
10 |
-
}
|
11 |
-
|
12 |
-
public function is($name, $value, $ignoreCase=TRUE) {
|
13 |
-
$result=FALSE;
|
14 |
-
if(isset($this->data[$name])) {
|
15 |
-
if($ignoreCase) {
|
16 |
-
$result=(strtolower($this->data[$name])==strtolower($value));
|
17 |
-
} else {
|
18 |
-
$result=($this->data[$name]==$value);
|
19 |
-
}
|
20 |
-
}
|
21 |
-
return $result;
|
22 |
-
}
|
23 |
-
public function of($name, $default='') {
|
24 |
-
$result=$default;
|
25 |
-
if(isset($this->data[$name])) {
|
26 |
-
$result=$this->data[$name];
|
27 |
-
}
|
28 |
-
return $result;
|
29 |
-
}
|
30 |
-
public function nonce($action, $nonce='_wpnonce') {
|
31 |
-
if(isset($_REQUEST[$nonce])) {
|
32 |
-
$nonce=$_REQUEST[$nonce];
|
33 |
-
}
|
34 |
-
return wp_verify_nonce($nonce, $action);
|
35 |
-
}
|
36 |
-
|
37 |
-
//check if is a mandatory field by checking the .txt language file
|
38 |
-
private function error($name) {
|
39 |
-
global $irp;
|
40 |
-
|
41 |
-
$result=FALSE;
|
42 |
-
$k=$irp->Form->prefix.'.'.$name.'.check';
|
43 |
-
$v=$irp->Lang->L($k);
|
44 |
-
if($v!=$k) {
|
45 |
-
//this is a mandatory field so we give error
|
46 |
-
$irp->Options->pushErrorMessage($v);
|
47 |
-
$result=TRUE;
|
48 |
-
}
|
49 |
-
return $result;
|
50 |
-
}
|
51 |
-
|
52 |
-
public function value($name) {
|
53 |
-
$result='';
|
54 |
-
if(isset($this->data[$name])) {
|
55 |
-
$result=sanitize_text_field($this->data[$name]);
|
56 |
-
}
|
57 |
-
if($result=='') {
|
58 |
-
$this->error($name);
|
59 |
-
}
|
60 |
-
$this->data[$name]=$result;
|
61 |
-
return $result;
|
62 |
-
}
|
63 |
-
public function values($name) {
|
64 |
-
$result=array();
|
65 |
-
if(is_string($name)) {
|
66 |
-
$name=explode(',', $name);
|
67 |
-
}
|
68 |
-
foreach($name as $v) {
|
69 |
-
$result[]=$this->value(trim($v));
|
70 |
-
}
|
71 |
-
return $result;
|
72 |
-
}
|
73 |
-
public function email($name) {
|
74 |
-
$result=$this->value($name);
|
75 |
-
if($result!='') {
|
76 |
-
$result=sanitize_email($result);
|
77 |
-
if(!is_email($result)) {
|
78 |
-
$this->error($name);
|
79 |
-
}
|
80 |
-
}
|
81 |
-
$this->data[$name]=$result;
|
82 |
-
return $result;
|
83 |
-
}
|
84 |
-
public function float($name) {
|
85 |
-
$result=$this->value($name);
|
86 |
-
if($result!='' && !is_float($result)) {
|
87 |
-
$this->error($name);
|
88 |
-
}
|
89 |
-
$result=floatval($result);
|
90 |
-
$this->data[$name]=$result;
|
91 |
-
return $result;
|
92 |
-
}
|
93 |
-
public function integer($name) {
|
94 |
-
$result=$this->value($name);
|
95 |
-
if($result!='' && !is_int($result)) {
|
96 |
-
$this->error($name);
|
97 |
-
}
|
98 |
-
$result=intval($result);
|
99 |
-
$this->data[$name]=$result;
|
100 |
-
return $result;
|
101 |
-
}
|
102 |
-
|
103 |
-
public function hasErrors() {
|
104 |
-
global $irp;
|
105 |
-
return $irp->Options->hasErrorMessages();
|
106 |
-
}
|
107 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
+
|
5 |
+
class IRP_Check {
|
6 |
+
var $data;
|
7 |
+
|
8 |
+
public function __construct() {
|
9 |
+
$this->data=array_merge($_POST, $_GET);
|
10 |
+
}
|
11 |
+
|
12 |
+
public function is($name, $value, $ignoreCase=TRUE) {
|
13 |
+
$result=FALSE;
|
14 |
+
if(isset($this->data[$name])) {
|
15 |
+
if($ignoreCase) {
|
16 |
+
$result=(strtolower($this->data[$name])==strtolower($value));
|
17 |
+
} else {
|
18 |
+
$result=($this->data[$name]==$value);
|
19 |
+
}
|
20 |
+
}
|
21 |
+
return $result;
|
22 |
+
}
|
23 |
+
public function of($name, $default='') {
|
24 |
+
$result=$default;
|
25 |
+
if(isset($this->data[$name])) {
|
26 |
+
$result=$this->data[$name];
|
27 |
+
}
|
28 |
+
return $result;
|
29 |
+
}
|
30 |
+
public function nonce($action, $nonce='_wpnonce') {
|
31 |
+
if(isset($_REQUEST[$nonce])) {
|
32 |
+
$nonce=$_REQUEST[$nonce];
|
33 |
+
}
|
34 |
+
return wp_verify_nonce($nonce, $action);
|
35 |
+
}
|
36 |
+
|
37 |
+
//check if is a mandatory field by checking the .txt language file
|
38 |
+
private function error($name) {
|
39 |
+
global $irp;
|
40 |
+
|
41 |
+
$result=FALSE;
|
42 |
+
$k=$irp->Form->prefix.'.'.$name.'.check';
|
43 |
+
$v=$irp->Lang->L($k);
|
44 |
+
if($v!=$k) {
|
45 |
+
//this is a mandatory field so we give error
|
46 |
+
$irp->Options->pushErrorMessage($v);
|
47 |
+
$result=TRUE;
|
48 |
+
}
|
49 |
+
return $result;
|
50 |
+
}
|
51 |
+
|
52 |
+
public function value($name) {
|
53 |
+
$result='';
|
54 |
+
if(isset($this->data[$name])) {
|
55 |
+
$result=sanitize_text_field($this->data[$name]);
|
56 |
+
}
|
57 |
+
if($result=='') {
|
58 |
+
$this->error($name);
|
59 |
+
}
|
60 |
+
$this->data[$name]=$result;
|
61 |
+
return $result;
|
62 |
+
}
|
63 |
+
public function values($name) {
|
64 |
+
$result=array();
|
65 |
+
if(is_string($name)) {
|
66 |
+
$name=explode(',', $name);
|
67 |
+
}
|
68 |
+
foreach($name as $v) {
|
69 |
+
$result[]=$this->value(trim($v));
|
70 |
+
}
|
71 |
+
return $result;
|
72 |
+
}
|
73 |
+
public function email($name) {
|
74 |
+
$result=$this->value($name);
|
75 |
+
if($result!='') {
|
76 |
+
$result=sanitize_email($result);
|
77 |
+
if(!is_email($result)) {
|
78 |
+
$this->error($name);
|
79 |
+
}
|
80 |
+
}
|
81 |
+
$this->data[$name]=$result;
|
82 |
+
return $result;
|
83 |
+
}
|
84 |
+
public function float($name) {
|
85 |
+
$result=$this->value($name);
|
86 |
+
if($result!='' && !is_float($result)) {
|
87 |
+
$this->error($name);
|
88 |
+
}
|
89 |
+
$result=floatval($result);
|
90 |
+
$this->data[$name]=$result;
|
91 |
+
return $result;
|
92 |
+
}
|
93 |
+
public function integer($name) {
|
94 |
+
$result=$this->value($name);
|
95 |
+
if($result!='' && !is_int($result)) {
|
96 |
+
$this->error($name);
|
97 |
+
}
|
98 |
+
$result=intval($result);
|
99 |
+
$this->data[$name]=$result;
|
100 |
+
return $result;
|
101 |
+
}
|
102 |
+
|
103 |
+
public function hasErrors() {
|
104 |
+
global $irp;
|
105 |
+
return $irp->Options->hasErrorMessages();
|
106 |
+
}
|
107 |
}
|
includes/classes/ui/Form.php
CHANGED
@@ -1,458 +1,458 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
-
|
5 |
-
class IRP_Form {
|
6 |
-
var $prefix='Form';
|
7 |
-
var $labels=TRUE;
|
8 |
-
var $leftLabels=TRUE;
|
9 |
-
var $newline;
|
10 |
-
var $helps=FALSE;
|
11 |
-
var $selectIdField='id';
|
12 |
-
|
13 |
-
var $tags=FALSE;
|
14 |
-
var $tagNew=FALSE;
|
15 |
-
var $leftTags=FALSE;
|
16 |
-
|
17 |
-
public function __construct() {
|
18 |
-
}
|
19 |
-
|
20 |
-
//args can be a string or an associative array if you want
|
21 |
-
private function getTextArgs($args, $defaults, $excludes=array()) {
|
22 |
-
$result=$args;
|
23 |
-
if(is_string($excludes)) {
|
24 |
-
$excludes=explode(',', $excludes);
|
25 |
-
}
|
26 |
-
if(is_array($result) && count($result)>0) {
|
27 |
-
$result='';
|
28 |
-
foreach($args as $k=>$v) {
|
29 |
-
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
30 |
-
$result.=' '.$k.'="'.$v.'"';
|
31 |
-
}
|
32 |
-
}
|
33 |
-
} elseif(!$args) {
|
34 |
-
$result='';
|
35 |
-
}
|
36 |
-
if(is_array($defaults) && count($defaults)>0) {
|
37 |
-
foreach($defaults as $k=>$v) {
|
38 |
-
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
39 |
-
if(stripos($result, $k.'=')===FALSE) {
|
40 |
-
$result.=' '.$k.'="'.$v.'"';
|
41 |
-
}
|
42 |
-
}
|
43 |
-
}
|
44 |
-
}
|
45 |
-
return $result;
|
46 |
-
}
|
47 |
-
|
48 |
-
public function help($name) {
|
49 |
-
global $irp;
|
50 |
-
if(!$this->helps) return;
|
51 |
-
|
52 |
-
$k=$this->prefix.'.'.$name.'.Tooltip';
|
53 |
-
$label=$irp->Lang->L($k);
|
54 |
-
?>
|
55 |
-
<img src="<?php echo IRP_PLUGIN_IMAGES.'question-mark.png'?>" class="irp-help" id="<?php echo $name?>-help" alt="<?php echo esc_attr($label)?>" />
|
56 |
-
<?php
|
57 |
-
}
|
58 |
-
public function label($name, $args='') {
|
59 |
-
global $irp;
|
60 |
-
$defaults=array('class'=>'');
|
61 |
-
$otherText=$this->getTextArgs($args, $defaults, array('label', 'id'));
|
62 |
-
|
63 |
-
$k=$this->prefix.'.'.$name;
|
64 |
-
if(!is_array($args)) {
|
65 |
-
$args=array();
|
66 |
-
}
|
67 |
-
if(isset($args['label']) && $args['label']) {
|
68 |
-
$k=$args['label'];
|
69 |
-
}
|
70 |
-
$label=$irp->Lang->L($k);
|
71 |
-
$for=(isset($args['id']) ? $args['id'] : $name);
|
72 |
-
|
73 |
-
//check if is a mandatory field by checking the .txt language file
|
74 |
-
$k=$this->prefix.'.'.$name.'.check';
|
75 |
-
if($irp->Lang->H($k)) {
|
76 |
-
$label.=' (*)';
|
77 |
-
}
|
78 |
-
|
79 |
-
$aClass='';
|
80 |
-
?>
|
81 |
-
<label for="<?php echo $for?>" <?php echo $otherText?> >
|
82 |
-
<?php if($this->leftTags) {
|
83 |
-
$this->tag();
|
84 |
-
}?>
|
85 |
-
<span style="float:left; margin-right:5px;" class="<?php echo $aClass?>" id="<?PHP echo $for?>Label"><?php echo $label?></span>
|
86 |
-
<?php if(!$this->leftTags) {
|
87 |
-
$this->tag();
|
88 |
-
}?>
|
89 |
-
</label>
|
90 |
-
<?php }
|
91 |
-
|
92 |
-
public function leftInput($name, $args='') {
|
93 |
-
if(!$this->labels) return;
|
94 |
-
|
95 |
-
if($this->leftLabels) {
|
96 |
-
$this->help($name);
|
97 |
-
$this->label($name, $args);
|
98 |
-
}
|
99 |
-
|
100 |
-
if($this->newline) {
|
101 |
-
$this->newline();
|
102 |
-
}
|
103 |
-
}
|
104 |
-
|
105 |
-
public function newline() {
|
106 |
-
?><div class="irp-form-newline"></div><?php
|
107 |
-
}
|
108 |
-
|
109 |
-
public function rightInput($name, $args='') {
|
110 |
-
if(!$this->labels) return;
|
111 |
-
if (!$this->leftLabels) {
|
112 |
-
$this->label($name, $args);
|
113 |
-
}
|
114 |
-
$this->newline();
|
115 |
-
}
|
116 |
-
|
117 |
-
public function formStarts($method='post', $action='', $args=NULL) {
|
118 |
-
//$defaults=array('style'=>'margin:1em 0; padding:1px 1em; background:#fff; border:1px solid #ccc;'
|
119 |
-
$defaults=array('class'=>'irp-form');
|
120 |
-
$other=$this->getTextArgs($args, $defaults);
|
121 |
-
?>
|
122 |
-
<form method="<?php echo $method?>" action="<?php echo $action?>" <?php echo $other?> >
|
123 |
-
<?php }
|
124 |
-
|
125 |
-
public function formEnds($clearfix = true) { ?>
|
126 |
-
</form>
|
127 |
-
<?php if ($clearfix == true) : ?>
|
128 |
-
<div style="clear:both;"></div>
|
129 |
-
<?php
|
130 |
-
endif;
|
131 |
-
}
|
132 |
-
|
133 |
-
public function divStarts($args=array()) {
|
134 |
-
$defaults=array();
|
135 |
-
$other=$this->getTextArgs($args, $defaults);
|
136 |
-
?>
|
137 |
-
<div <?php echo $other?>>
|
138 |
-
<?php }
|
139 |
-
public function divEnds() { ?>
|
140 |
-
</div>
|
141 |
-
<div style="clear:both;"></div>
|
142 |
-
<?php }
|
143 |
-
|
144 |
-
public function p($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
145 |
-
global $irp;
|
146 |
-
?>
|
147 |
-
<p style="font-weight:bold;">
|
148 |
-
<?php
|
149 |
-
$irp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);
|
150 |
-
if($irp->Lang->H($message.'Subtitle')) { ?>
|
151 |
-
<br/>
|
152 |
-
<span style="font-weight:normal;">
|
153 |
-
<i><?php $irp->Lang->P($message.'Subtitle', $v1, $v2, $v3, $v4, $v5)?></i>
|
154 |
-
</span>
|
155 |
-
<?php } ?>
|
156 |
-
</p>
|
157 |
-
<?php }
|
158 |
-
|
159 |
-
public function textarea($name, $value='', $args=NULL) {
|
160 |
-
if(is_array($value) && isset($value[$name])) {
|
161 |
-
$value=$value[$name];
|
162 |
-
}
|
163 |
-
$defaults=array('rows'=>10, 'class'=>'irp-textarea');
|
164 |
-
$other=$this->getTextArgs($args, $defaults);
|
165 |
-
|
166 |
-
$args=array('class'=>'irp-label', 'style'=>'width:auto;');
|
167 |
-
$this->newline=TRUE;
|
168 |
-
$this->leftInput($name, $args);
|
169 |
-
?>
|
170 |
-
<textarea dir="ltr" dirname="ltr" id="<?php echo $name ?>" name="<?php echo $name?>" <?php echo $other?> ><?php echo $value ?></textarea>
|
171 |
-
<?php
|
172 |
-
$this->newline=FALSE;
|
173 |
-
$this->rightInput($name, $args);
|
174 |
-
}
|
175 |
-
|
176 |
-
public function number($name, $value='', $options=NULL) {
|
177 |
-
if(!$options) {
|
178 |
-
$options=array();
|
179 |
-
}
|
180 |
-
$options['type']='number';
|
181 |
-
$options['autocomplete']='off';
|
182 |
-
$options['style']='width:100px;';
|
183 |
-
if(!isset($options['min'])) {
|
184 |
-
$options['min']=0;
|
185 |
-
}
|
186 |
-
//if(!isset($options['step'])) {
|
187 |
-
// $options['step']=1;
|
188 |
-
//}
|
189 |
-
return $this->text($name, $value, $options);
|
190 |
-
}
|
191 |
-
public function text($name, $value='', $options=NULL) {
|
192 |
-
if(is_array($value) && isset($value[$name])) {
|
193 |
-
$value=$value[$name];
|
194 |
-
}
|
195 |
-
$type='text';
|
196 |
-
if(isset($options['type'])) {
|
197 |
-
$type=$options['type'];
|
198 |
-
}
|
199 |
-
$defaults=array('class'=>'irp-'.$type);
|
200 |
-
$other=$this->getTextArgs($options, $defaults, 'type');
|
201 |
-
|
202 |
-
$args=array('class'=>'irp-label');
|
203 |
-
$this->leftInput($name, $args);
|
204 |
-
?>
|
205 |
-
<input type="<?php echo $type?>" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
206 |
-
<?php
|
207 |
-
$this->rightInput($name, $args);
|
208 |
-
}
|
209 |
-
|
210 |
-
public function hidden($name, $value='', $args=NULL) {
|
211 |
-
if(is_array($value) && isset($value[$name])) {
|
212 |
-
$value=$value[$name];
|
213 |
-
}
|
214 |
-
$defaults=array();
|
215 |
-
$other=$this->getTextArgs($args, $defaults);
|
216 |
-
?>
|
217 |
-
<input type="hidden" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
218 |
-
<?php }
|
219 |
-
|
220 |
-
public function nonce($action=-1, $name='_wpnonce', $referer=true, $echo=true) {
|
221 |
-
wp_nonce_field($action, $name, $referer, $echo);
|
222 |
-
}
|
223 |
-
|
224 |
-
public function colorSelect($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
225 |
-
$array=array();
|
226 |
-
foreach($options as $k=>$v) {
|
227 |
-
$color=(isset($v['color']) ? $v['color'] : '');
|
228 |
-
$fontColor=(isset($v['fontColor']) ? $v['fontColor'] : 'white');
|
229 |
-
$style='';
|
230 |
-
if($color!='') {
|
231 |
-
if($style!='') {
|
232 |
-
$style.='; ';
|
233 |
-
}
|
234 |
-
$style.='background-color:'.$color;
|
235 |
-
}
|
236 |
-
if($fontColor!='') {
|
237 |
-
if($style!='') {
|
238 |
-
$style.='; ';
|
239 |
-
}
|
240 |
-
$style.='color:'.$fontColor.'; font-weight:bold';
|
241 |
-
}
|
242 |
-
$v['id']=$color;
|
243 |
-
$v['name']=$k;
|
244 |
-
$v['style']=$style;
|
245 |
-
$array[]=$v;
|
246 |
-
}
|
247 |
-
if($args) {
|
248 |
-
$args=array();
|
249 |
-
}
|
250 |
-
$args['class']='irpColorSelect';
|
251 |
-
return $this->select($name, $value, $array, $multiple, $args);
|
252 |
-
}
|
253 |
-
public function select($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
254 |
-
global $irp;
|
255 |
-
if(is_array($value) && isset($value[$name])) {
|
256 |
-
$value=$value[$name];
|
257 |
-
}
|
258 |
-
$defaults=array('class'=>'irp-select');
|
259 |
-
$other=$this->getTextArgs($args, $defaults);
|
260 |
-
|
261 |
-
if(!is_array($value)) {
|
262 |
-
$value=array($value);
|
263 |
-
}
|
264 |
-
if(is_string($options)) {
|
265 |
-
$options=explode(',', $options);
|
266 |
-
}
|
267 |
-
if(is_array($options) && count($options)>0) {
|
268 |
-
if(is_string($options[0]) || !isset($options[0][$this->selectIdField])) {
|
269 |
-
//this is a normal array so I use the values for "id" field and the "name" into the txt file
|
270 |
-
$temp=array();
|
271 |
-
foreach($options as $v) {
|
272 |
-
$item=array();
|
273 |
-
$item[$this->selectIdField]=$v;
|
274 |
-
$item['name']=$v;
|
275 |
-
if($irp->Lang->H($this->prefix.'.'.$name.'.'.$v)) {
|
276 |
-
$item['name']=$irp->Lang->L($this->prefix.'.'.$name.'.'.$v);
|
277 |
-
}
|
278 |
-
$temp[]=$item;
|
279 |
-
}
|
280 |
-
$options=$temp;
|
281 |
-
}
|
282 |
-
}
|
283 |
-
|
284 |
-
$args=array('class'=>'irp-label');
|
285 |
-
$this->leftInput($name, $args);
|
286 |
-
?>
|
287 |
-
<select id="<?php echo $name ?>" name="<?php echo $name?><?php echo ($multiple ? '[]' : '')?>" <?php echo ($multiple ? 'multiple' : '')?> <?php echo $other?> >
|
288 |
-
<?php
|
289 |
-
foreach($options as $v) {
|
290 |
-
$style='';
|
291 |
-
if(isset($v['style'])) {
|
292 |
-
$style=$v['style'];
|
293 |
-
}
|
294 |
-
|
295 |
-
$selected='';
|
296 |
-
if(in_array($v[$this->selectIdField], $value)) {
|
297 |
-
$selected=' selected="selected"';
|
298 |
-
}
|
299 |
-
?>
|
300 |
-
<option value="<?php echo $v[$this->selectIdField]?>" <?php echo $selected?> style="<?php echo $style?>"><?php echo $v['name']?></option>
|
301 |
-
<?php } ?>
|
302 |
-
</select>
|
303 |
-
<?php
|
304 |
-
$this->rightInput($name, $args);
|
305 |
-
}
|
306 |
-
|
307 |
-
public function submit($value='', $args=NULL) {
|
308 |
-
global $irp;
|
309 |
-
$defaults=array();
|
310 |
-
$other=$this->getTextArgs($args, $defaults);
|
311 |
-
if($value=='') {
|
312 |
-
$value='Send';
|
313 |
-
}
|
314 |
-
$this->newline();
|
315 |
-
?>
|
316 |
-
<input type="submit" class="button-primary irp-button irp-submit" value="<?php $irp->Lang->P($value)?>" <?php echo $other?>/>
|
317 |
-
<?php }
|
318 |
-
|
319 |
-
public function delete($id, $action='delete', $args=NULL) {
|
320 |
-
global $irp;
|
321 |
-
$defaults=array();
|
322 |
-
$other=$this->getTextArgs($args, $defaults);
|
323 |
-
?>
|
324 |
-
<input type="button" class="button irp-button" value="<?php $irp->Lang->P('Delete?')?>" onclick="if (confirm('<?php $irp->Lang->P('Are you sure you want to delete?')?>') ) window.location='<?php echo IRP_TAB_BUILDER_URI?>&action=<?php echo $action?>&id=<?php echo $id ?>&irp_nonce=<?php echo esc_attr(wp_create_nonce('irp_delete')); ?>';" <?php echo $other?> />
|
325 |
-
|
326 |
-
<?php
|
327 |
-
}
|
328 |
-
|
329 |
-
public function radio($name, $current=1, $value=1, $args=NULL) {
|
330 |
-
if(!is_array($args)) {
|
331 |
-
$args=array();
|
332 |
-
}
|
333 |
-
$args['radio']=TRUE;
|
334 |
-
$args['id']=$name.'_'.$value;
|
335 |
-
return $this->checkbox($name, $current, $value, $args);
|
336 |
-
}
|
337 |
-
public function checkbox($name, $current=1, $value=1, $args=NULL) {
|
338 |
-
global $irp;
|
339 |
-
if(is_array($current) && isset($current[$name])) {
|
340 |
-
$current=$current[$name];
|
341 |
-
}
|
342 |
-
|
343 |
-
/*
|
344 |
-
$defaults=array('class'=>'irp-checkbox', 'style'=>'margin:0px; margin-right:4px;');
|
345 |
-
if($this->premium && !$irp->License->hasPremium()) {
|
346 |
-
$defaults['disabled']='disabled';
|
347 |
-
$value='';
|
348 |
-
}
|
349 |
-
*/
|
350 |
-
if(!is_array($args)) {
|
351 |
-
$args=array();
|
352 |
-
}
|
353 |
-
|
354 |
-
$label=$name;
|
355 |
-
$type='checkbox';
|
356 |
-
if(isset($args['radio']) && $args['radio']) {
|
357 |
-
$type='radio';
|
358 |
-
$label.='_'.$value;
|
359 |
-
}
|
360 |
-
|
361 |
-
$defaults=array(
|
362 |
-
'class'=>'irp-checkbox'
|
363 |
-
, 'style'=>'margin:0px; margin-right:4px;'
|
364 |
-
, 'id'=>$name
|
365 |
-
);
|
366 |
-
$other=$this->getTextArgs($args, $defaults, 'radio,label,type');
|
367 |
-
$prev=$this->leftLabels;
|
368 |
-
$this->leftLabels=FALSE;
|
369 |
-
|
370 |
-
$label=(isset($args['label']) ? $args['label'] : $this->prefix.'.'.$label);
|
371 |
-
$id=(isset($args['id']) ? $args['id'] : $name);
|
372 |
-
$args=array(
|
373 |
-
'class'=>''
|
374 |
-
, 'style'=>'margin-top:-1px;'
|
375 |
-
, 'label'=>$label
|
376 |
-
, 'id'=>$id
|
377 |
-
);
|
378 |
-
$this->leftInput($name, $args);
|
379 |
-
?>
|
380 |
-
<input type="<?php echo $type ?>" name="<?php echo $name?>" value="<?php echo $value?>" <?php echo($current==$value ? 'checked="checked"' : '') ?> <?php echo $other?> >
|
381 |
-
<?php
|
382 |
-
$this->rightInput($name, $args);
|
383 |
-
$this->leftLabels=$prev;
|
384 |
-
}
|
385 |
-
|
386 |
-
public function checkText($nameActive, $nameText, $value) {
|
387 |
-
global $irp;
|
388 |
-
|
389 |
-
$args=array('class'=>'irp-hideShow irp-checkbox'
|
390 |
-
, 'irp-hideIfTrue'=>'false'
|
391 |
-
, 'irp-hideShow'=>$nameText.'Text');
|
392 |
-
$this->checkbox($nameActive, $value, 1, $args);
|
393 |
-
?>
|
394 |
-
<div id="<?php echo $nameText?>Text" style="float:left;">
|
395 |
-
<?php
|
396 |
-
$prev=$this->labels;
|
397 |
-
$this->labels=FALSE;
|
398 |
-
$args=array();
|
399 |
-
$this->text($nameText, $value, $args);
|
400 |
-
$this->labels=$prev;
|
401 |
-
?>
|
402 |
-
</div>
|
403 |
-
<?php }
|
404 |
-
|
405 |
-
//create a checkbox with a left select visible only when the checkbox is selected
|
406 |
-
public function checkSelect($nameActive, $nameArray, $value, $values) {
|
407 |
-
global $irp;
|
408 |
-
?>
|
409 |
-
<div id="<?php echo $nameArray?>Box" style="float:left;">
|
410 |
-
<?php
|
411 |
-
$args=array('class'=>'irp-hideShow irp-checkbox'
|
412 |
-
, 'irp-hideIfTrue'=>'false'
|
413 |
-
, 'irp-hideShow'=>$nameArray.'Tags');
|
414 |
-
$this->checkbox($nameActive, $value, 1, $args);
|
415 |
-
if(TRUE) { ?>
|
416 |
-
<div id="<?php echo $nameArray?>Tags" style="float:left;">
|
417 |
-
<?php
|
418 |
-
$prev=$this->labels;
|
419 |
-
$this->labels=FALSE;
|
420 |
-
$args=array('class'=>'irp-select irpLineTags');
|
421 |
-
$this->select($nameArray, $value, $values, TRUE, $args);
|
422 |
-
$this->labels=$prev;
|
423 |
-
?>
|
424 |
-
</div>
|
425 |
-
<?php } ?>
|
426 |
-
</div>
|
427 |
-
<?php
|
428 |
-
$this->newline();
|
429 |
-
}
|
430 |
-
|
431 |
-
public function br() { ?>
|
432 |
-
<br/>
|
433 |
-
<?php }
|
434 |
-
public function tag($overridePremium=FALSE) {
|
435 |
-
global $irp;
|
436 |
-
/*
|
437 |
-
$premium=($overridePremium || $this->premium);
|
438 |
-
if((!$overridePremium && !$this->tags) || $irp->License->hasPremium() || ($this->onlyPremium && !$premium)) return;
|
439 |
-
|
440 |
-
$tagClass='irp-tag-free';
|
441 |
-
$tagText='FREE';
|
442 |
-
if($premium) {
|
443 |
-
$tagClass='irp-tag-premium';
|
444 |
-
$tagText='<a href="'.irp_PAGE_PREMIUM.'" target="_new">PRO</a>';
|
445 |
-
}
|
446 |
-
*/
|
447 |
-
|
448 |
-
if(!$this->tags || !$this->tagNew) {
|
449 |
-
return;
|
450 |
-
}
|
451 |
-
|
452 |
-
$tagClass='irp-tag-free';
|
453 |
-
$tagText='NEW!';
|
454 |
-
?>
|
455 |
-
<div style="float:left;" class="irp-tag <?php echo $tagClass?>"><?php echo $tagText?></div>
|
456 |
-
<?php
|
457 |
-
}
|
458 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
4 |
+
|
5 |
+
class IRP_Form {
|
6 |
+
var $prefix='Form';
|
7 |
+
var $labels=TRUE;
|
8 |
+
var $leftLabels=TRUE;
|
9 |
+
var $newline;
|
10 |
+
var $helps=FALSE;
|
11 |
+
var $selectIdField='id';
|
12 |
+
|
13 |
+
var $tags=FALSE;
|
14 |
+
var $tagNew=FALSE;
|
15 |
+
var $leftTags=FALSE;
|
16 |
+
|
17 |
+
public function __construct() {
|
18 |
+
}
|
19 |
+
|
20 |
+
//args can be a string or an associative array if you want
|
21 |
+
private function getTextArgs($args, $defaults, $excludes=array()) {
|
22 |
+
$result=$args;
|
23 |
+
if(is_string($excludes)) {
|
24 |
+
$excludes=explode(',', $excludes);
|
25 |
+
}
|
26 |
+
if(is_array($result) && count($result)>0) {
|
27 |
+
$result='';
|
28 |
+
foreach($args as $k=>$v) {
|
29 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
30 |
+
$result.=' '.$k.'="'.$v.'"';
|
31 |
+
}
|
32 |
+
}
|
33 |
+
} elseif(!$args) {
|
34 |
+
$result='';
|
35 |
+
}
|
36 |
+
if(is_array($defaults) && count($defaults)>0) {
|
37 |
+
foreach($defaults as $k=>$v) {
|
38 |
+
if(count($excludes)==0 || !in_array($k, $excludes)) {
|
39 |
+
if(stripos($result, $k.'=')===FALSE) {
|
40 |
+
$result.=' '.$k.'="'.$v.'"';
|
41 |
+
}
|
42 |
+
}
|
43 |
+
}
|
44 |
+
}
|
45 |
+
return $result;
|
46 |
+
}
|
47 |
+
|
48 |
+
public function help($name) {
|
49 |
+
global $irp;
|
50 |
+
if(!$this->helps) return;
|
51 |
+
|
52 |
+
$k=$this->prefix.'.'.$name.'.Tooltip';
|
53 |
+
$label=$irp->Lang->L($k);
|
54 |
+
?>
|
55 |
+
<img src="<?php echo IRP_PLUGIN_IMAGES.'question-mark.png'?>" class="irp-help" id="<?php echo $name?>-help" alt="<?php echo esc_attr($label)?>" />
|
56 |
+
<?php
|
57 |
+
}
|
58 |
+
public function label($name, $args='') {
|
59 |
+
global $irp;
|
60 |
+
$defaults=array('class'=>'');
|
61 |
+
$otherText=$this->getTextArgs($args, $defaults, array('label', 'id'));
|
62 |
+
|
63 |
+
$k=$this->prefix.'.'.$name;
|
64 |
+
if(!is_array($args)) {
|
65 |
+
$args=array();
|
66 |
+
}
|
67 |
+
if(isset($args['label']) && $args['label']) {
|
68 |
+
$k=$args['label'];
|
69 |
+
}
|
70 |
+
$label=$irp->Lang->L($k);
|
71 |
+
$for=(isset($args['id']) ? $args['id'] : $name);
|
72 |
+
|
73 |
+
//check if is a mandatory field by checking the .txt language file
|
74 |
+
$k=$this->prefix.'.'.$name.'.check';
|
75 |
+
if($irp->Lang->H($k)) {
|
76 |
+
$label.=' (*)';
|
77 |
+
}
|
78 |
+
|
79 |
+
$aClass='';
|
80 |
+
?>
|
81 |
+
<label for="<?php echo $for?>" <?php echo $otherText?> >
|
82 |
+
<?php if($this->leftTags) {
|
83 |
+
$this->tag();
|
84 |
+
}?>
|
85 |
+
<span style="float:left; margin-right:5px;" class="<?php echo $aClass?>" id="<?PHP echo $for?>Label"><?php echo $label?></span>
|
86 |
+
<?php if(!$this->leftTags) {
|
87 |
+
$this->tag();
|
88 |
+
}?>
|
89 |
+
</label>
|
90 |
+
<?php }
|
91 |
+
|
92 |
+
public function leftInput($name, $args='') {
|
93 |
+
if(!$this->labels) return;
|
94 |
+
|
95 |
+
if($this->leftLabels) {
|
96 |
+
$this->help($name);
|
97 |
+
$this->label($name, $args);
|
98 |
+
}
|
99 |
+
|
100 |
+
if($this->newline) {
|
101 |
+
$this->newline();
|
102 |
+
}
|
103 |
+
}
|
104 |
+
|
105 |
+
public function newline() {
|
106 |
+
?><div class="irp-form-newline"></div><?php
|
107 |
+
}
|
108 |
+
|
109 |
+
public function rightInput($name, $args='') {
|
110 |
+
if(!$this->labels) return;
|
111 |
+
if (!$this->leftLabels) {
|
112 |
+
$this->label($name, $args);
|
113 |
+
}
|
114 |
+
$this->newline();
|
115 |
+
}
|
116 |
+
|
117 |
+
public function formStarts($method='post', $action='', $args=NULL) {
|
118 |
+
//$defaults=array('style'=>'margin:1em 0; padding:1px 1em; background:#fff; border:1px solid #ccc;'
|
119 |
+
$defaults=array('class'=>'irp-form');
|
120 |
+
$other=$this->getTextArgs($args, $defaults);
|
121 |
+
?>
|
122 |
+
<form method="<?php echo $method?>" action="<?php echo $action?>" <?php echo $other?> >
|
123 |
+
<?php }
|
124 |
+
|
125 |
+
public function formEnds($clearfix = true) { ?>
|
126 |
+
</form>
|
127 |
+
<?php if ($clearfix == true) : ?>
|
128 |
+
<div style="clear:both;"></div>
|
129 |
+
<?php
|
130 |
+
endif;
|
131 |
+
}
|
132 |
+
|
133 |
+
public function divStarts($args=array()) {
|
134 |
+
$defaults=array();
|
135 |
+
$other=$this->getTextArgs($args, $defaults);
|
136 |
+
?>
|
137 |
+
<div <?php echo $other?>>
|
138 |
+
<?php }
|
139 |
+
public function divEnds() { ?>
|
140 |
+
</div>
|
141 |
+
<div style="clear:both;"></div>
|
142 |
+
<?php }
|
143 |
+
|
144 |
+
public function p($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
145 |
+
global $irp;
|
146 |
+
?>
|
147 |
+
<p style="font-weight:bold;">
|
148 |
+
<?php
|
149 |
+
$irp->Lang->P($message, $v1, $v2, $v3, $v4, $v5);
|
150 |
+
if($irp->Lang->H($message.'Subtitle')) { ?>
|
151 |
+
<br/>
|
152 |
+
<span style="font-weight:normal;">
|
153 |
+
<i><?php $irp->Lang->P($message.'Subtitle', $v1, $v2, $v3, $v4, $v5)?></i>
|
154 |
+
</span>
|
155 |
+
<?php } ?>
|
156 |
+
</p>
|
157 |
+
<?php }
|
158 |
+
|
159 |
+
public function textarea($name, $value='', $args=NULL) {
|
160 |
+
if(is_array($value) && isset($value[$name])) {
|
161 |
+
$value=$value[$name];
|
162 |
+
}
|
163 |
+
$defaults=array('rows'=>10, 'class'=>'irp-textarea');
|
164 |
+
$other=$this->getTextArgs($args, $defaults);
|
165 |
+
|
166 |
+
$args=array('class'=>'irp-label', 'style'=>'width:auto;');
|
167 |
+
$this->newline=TRUE;
|
168 |
+
$this->leftInput($name, $args);
|
169 |
+
?>
|
170 |
+
<textarea dir="ltr" dirname="ltr" id="<?php echo $name ?>" name="<?php echo $name?>" <?php echo $other?> ><?php echo $value ?></textarea>
|
171 |
+
<?php
|
172 |
+
$this->newline=FALSE;
|
173 |
+
$this->rightInput($name, $args);
|
174 |
+
}
|
175 |
+
|
176 |
+
public function number($name, $value='', $options=NULL) {
|
177 |
+
if(!$options) {
|
178 |
+
$options=array();
|
179 |
+
}
|
180 |
+
$options['type']='number';
|
181 |
+
$options['autocomplete']='off';
|
182 |
+
$options['style']='width:100px;';
|
183 |
+
if(!isset($options['min'])) {
|
184 |
+
$options['min']=0;
|
185 |
+
}
|
186 |
+
//if(!isset($options['step'])) {
|
187 |
+
// $options['step']=1;
|
188 |
+
//}
|
189 |
+
return $this->text($name, $value, $options);
|
190 |
+
}
|
191 |
+
public function text($name, $value='', $options=NULL) {
|
192 |
+
if(is_array($value) && isset($value[$name])) {
|
193 |
+
$value=$value[$name];
|
194 |
+
}
|
195 |
+
$type='text';
|
196 |
+
if(isset($options['type'])) {
|
197 |
+
$type=$options['type'];
|
198 |
+
}
|
199 |
+
$defaults=array('class'=>'irp-'.$type);
|
200 |
+
$other=$this->getTextArgs($options, $defaults, 'type');
|
201 |
+
|
202 |
+
$args=array('class'=>'irp-label');
|
203 |
+
$this->leftInput($name, $args);
|
204 |
+
?>
|
205 |
+
<input type="<?php echo $type?>" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
206 |
+
<?php
|
207 |
+
$this->rightInput($name, $args);
|
208 |
+
}
|
209 |
+
|
210 |
+
public function hidden($name, $value='', $args=NULL) {
|
211 |
+
if(is_array($value) && isset($value[$name])) {
|
212 |
+
$value=$value[$name];
|
213 |
+
}
|
214 |
+
$defaults=array();
|
215 |
+
$other=$this->getTextArgs($args, $defaults);
|
216 |
+
?>
|
217 |
+
<input type="hidden" id="<?php echo $name ?>" name="<?php echo $name ?>" value="<?php echo $value ?>" <?php echo $other?> />
|
218 |
+
<?php }
|
219 |
+
|
220 |
+
public function nonce($action=-1, $name='_wpnonce', $referer=true, $echo=true) {
|
221 |
+
wp_nonce_field($action, $name, $referer, $echo);
|
222 |
+
}
|
223 |
+
|
224 |
+
public function colorSelect($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
225 |
+
$array=array();
|
226 |
+
foreach($options as $k=>$v) {
|
227 |
+
$color=(isset($v['color']) ? $v['color'] : '');
|
228 |
+
$fontColor=(isset($v['fontColor']) ? $v['fontColor'] : 'white');
|
229 |
+
$style='';
|
230 |
+
if($color!='') {
|
231 |
+
if($style!='') {
|
232 |
+
$style.='; ';
|
233 |
+
}
|
234 |
+
$style.='background-color:'.$color;
|
235 |
+
}
|
236 |
+
if($fontColor!='') {
|
237 |
+
if($style!='') {
|
238 |
+
$style.='; ';
|
239 |
+
}
|
240 |
+
$style.='color:'.$fontColor.'; font-weight:bold';
|
241 |
+
}
|
242 |
+
$v['id']=$color;
|
243 |
+
$v['name']=$k;
|
244 |
+
$v['style']=$style;
|
245 |
+
$array[]=$v;
|
246 |
+
}
|
247 |
+
if($args) {
|
248 |
+
$args=array();
|
249 |
+
}
|
250 |
+
$args['class']='irpColorSelect';
|
251 |
+
return $this->select($name, $value, $array, $multiple, $args);
|
252 |
+
}
|
253 |
+
public function select($name, $value, $options, $multiple=FALSE, $args=NULL) {
|
254 |
+
global $irp;
|
255 |
+
if(is_array($value) && isset($value[$name])) {
|
256 |
+
$value=$value[$name];
|
257 |
+
}
|
258 |
+
$defaults=array('class'=>'irp-select');
|
259 |
+
$other=$this->getTextArgs($args, $defaults);
|
260 |
+
|
261 |
+
if(!is_array($value)) {
|
262 |
+
$value=array($value);
|
263 |
+
}
|
264 |
+
if(is_string($options)) {
|
265 |
+
$options=explode(',', $options);
|
266 |
+
}
|
267 |
+
if(is_array($options) && count($options)>0) {
|
268 |
+
if(is_string($options[0]) || !isset($options[0][$this->selectIdField])) {
|
269 |
+
//this is a normal array so I use the values for "id" field and the "name" into the txt file
|
270 |
+
$temp=array();
|
271 |
+
foreach($options as $v) {
|
272 |
+
$item=array();
|
273 |
+
$item[$this->selectIdField]=$v;
|
274 |
+
$item['name']=$v;
|
275 |
+
if($irp->Lang->H($this->prefix.'.'.$name.'.'.$v)) {
|
276 |
+
$item['name']=$irp->Lang->L($this->prefix.'.'.$name.'.'.$v);
|
277 |
+
}
|
278 |
+
$temp[]=$item;
|
279 |
+
}
|
280 |
+
$options=$temp;
|
281 |
+
}
|
282 |
+
}
|
283 |
+
|
284 |
+
$args=array('class'=>'irp-label');
|
285 |
+
$this->leftInput($name, $args);
|
286 |
+
?>
|
287 |
+
<select id="<?php echo $name ?>" name="<?php echo $name?><?php echo ($multiple ? '[]' : '')?>" <?php echo ($multiple ? 'multiple' : '')?> <?php echo $other?> >
|
288 |
+
<?php
|
289 |
+
foreach($options as $v) {
|
290 |
+
$style='';
|
291 |
+
if(isset($v['style'])) {
|
292 |
+
$style=$v['style'];
|
293 |
+
}
|
294 |
+
|
295 |
+
$selected='';
|
296 |
+
if(in_array($v[$this->selectIdField], $value)) {
|
297 |
+
$selected=' selected="selected"';
|
298 |
+
}
|
299 |
+
?>
|
300 |
+
<option value="<?php echo $v[$this->selectIdField]?>" <?php echo $selected?> style="<?php echo $style?>"><?php echo $v['name']?></option>
|
301 |
+
<?php } ?>
|
302 |
+
</select>
|
303 |
+
<?php
|
304 |
+
$this->rightInput($name, $args);
|
305 |
+
}
|
306 |
+
|
307 |
+
public function submit($value='', $args=NULL) {
|
308 |
+
global $irp;
|
309 |
+
$defaults=array();
|
310 |
+
$other=$this->getTextArgs($args, $defaults);
|
311 |
+
if($value=='') {
|
312 |
+
$value='Send';
|
313 |
+
}
|
314 |
+
$this->newline();
|
315 |
+
?>
|
316 |
+
<input type="submit" class="button-primary irp-button irp-submit" value="<?php $irp->Lang->P($value)?>" <?php echo $other?>/>
|
317 |
+
<?php }
|
318 |
+
|
319 |
+
public function delete($id, $action='delete', $args=NULL) {
|
320 |
+
global $irp;
|
321 |
+
$defaults=array();
|
322 |
+
$other=$this->getTextArgs($args, $defaults);
|
323 |
+
?>
|
324 |
+
<input type="button" class="button irp-button" value="<?php $irp->Lang->P('Delete?')?>" onclick="if (confirm('<?php $irp->Lang->P('Are you sure you want to delete?')?>') ) window.location='<?php echo IRP_TAB_BUILDER_URI?>&action=<?php echo $action?>&id=<?php echo $id ?>&irp_nonce=<?php echo esc_attr(wp_create_nonce('irp_delete')); ?>';" <?php echo $other?> />
|
325 |
+
|
326 |
+
<?php
|
327 |
+
}
|
328 |
+
|
329 |
+
public function radio($name, $current=1, $value=1, $args=NULL) {
|
330 |
+
if(!is_array($args)) {
|
331 |
+
$args=array();
|
332 |
+
}
|
333 |
+
$args['radio']=TRUE;
|
334 |
+
$args['id']=$name.'_'.$value;
|
335 |
+
return $this->checkbox($name, $current, $value, $args);
|
336 |
+
}
|
337 |
+
public function checkbox($name, $current=1, $value=1, $args=NULL) {
|
338 |
+
global $irp;
|
339 |
+
if(is_array($current) && isset($current[$name])) {
|
340 |
+
$current=$current[$name];
|
341 |
+
}
|
342 |
+
|
343 |
+
/*
|
344 |
+
$defaults=array('class'=>'irp-checkbox', 'style'=>'margin:0px; margin-right:4px;');
|
345 |
+
if($this->premium && !$irp->License->hasPremium()) {
|
346 |
+
$defaults['disabled']='disabled';
|
347 |
+
$value='';
|
348 |
+
}
|
349 |
+
*/
|
350 |
+
if(!is_array($args)) {
|
351 |
+
$args=array();
|
352 |
+
}
|
353 |
+
|
354 |
+
$label=$name;
|
355 |
+
$type='checkbox';
|
356 |
+
if(isset($args['radio']) && $args['radio']) {
|
357 |
+
$type='radio';
|
358 |
+
$label.='_'.$value;
|
359 |
+
}
|
360 |
+
|
361 |
+
$defaults=array(
|
362 |
+
'class'=>'irp-checkbox'
|
363 |
+
, 'style'=>'margin:0px; margin-right:4px;'
|
364 |
+
, 'id'=>$name
|
365 |
+
);
|
366 |
+
$other=$this->getTextArgs($args, $defaults, 'radio,label,type');
|
367 |
+
$prev=$this->leftLabels;
|
368 |
+
$this->leftLabels=FALSE;
|
369 |
+
|
370 |
+
$label=(isset($args['label']) ? $args['label'] : $this->prefix.'.'.$label);
|
371 |
+
$id=(isset($args['id']) ? $args['id'] : $name);
|
372 |
+
$args=array(
|
373 |
+
'class'=>''
|
374 |
+
, 'style'=>'margin-top:-1px;'
|
375 |
+
, 'label'=>$label
|
376 |
+
, 'id'=>$id
|
377 |
+
);
|
378 |
+
$this->leftInput($name, $args);
|
379 |
+
?>
|
380 |
+
<input type="<?php echo $type ?>" name="<?php echo $name?>" value="<?php echo $value?>" <?php echo($current==$value ? 'checked="checked"' : '') ?> <?php echo $other?> >
|
381 |
+
<?php
|
382 |
+
$this->rightInput($name, $args);
|
383 |
+
$this->leftLabels=$prev;
|
384 |
+
}
|
385 |
+
|
386 |
+
public function checkText($nameActive, $nameText, $value) {
|
387 |
+
global $irp;
|
388 |
+
|
389 |
+
$args=array('class'=>'irp-hideShow irp-checkbox'
|
390 |
+
, 'irp-hideIfTrue'=>'false'
|
391 |
+
, 'irp-hideShow'=>$nameText.'Text');
|
392 |
+
$this->checkbox($nameActive, $value, 1, $args);
|
393 |
+
?>
|
394 |
+
<div id="<?php echo $nameText?>Text" style="float:left;">
|
395 |
+
<?php
|
396 |
+
$prev=$this->labels;
|
397 |
+
$this->labels=FALSE;
|
398 |
+
$args=array();
|
399 |
+
$this->text($nameText, $value, $args);
|
400 |
+
$this->labels=$prev;
|
401 |
+
?>
|
402 |
+
</div>
|
403 |
+
<?php }
|
404 |
+
|
405 |
+
//create a checkbox with a left select visible only when the checkbox is selected
|
406 |
+
public function checkSelect($nameActive, $nameArray, $value, $values) {
|
407 |
+
global $irp;
|
408 |
+
?>
|
409 |
+
<div id="<?php echo $nameArray?>Box" style="float:left;">
|
410 |
+
<?php
|
411 |
+
$args=array('class'=>'irp-hideShow irp-checkbox'
|
412 |
+
, 'irp-hideIfTrue'=>'false'
|
413 |
+
, 'irp-hideShow'=>$nameArray.'Tags');
|
414 |
+
$this->checkbox($nameActive, $value, 1, $args);
|
415 |
+
if(TRUE) { ?>
|
416 |
+
<div id="<?php echo $nameArray?>Tags" style="float:left;">
|
417 |
+
<?php
|
418 |
+
$prev=$this->labels;
|
419 |
+
$this->labels=FALSE;
|
420 |
+
$args=array('class'=>'irp-select irpLineTags');
|
421 |
+
$this->select($nameArray, $value, $values, TRUE, $args);
|
422 |
+
$this->labels=$prev;
|
423 |
+
?>
|
424 |
+
</div>
|
425 |
+
<?php } ?>
|
426 |
+
</div>
|
427 |
+
<?php
|
428 |
+
$this->newline();
|
429 |
+
}
|
430 |
+
|
431 |
+
public function br() { ?>
|
432 |
+
<br/>
|
433 |
+
<?php }
|
434 |
+
public function tag($overridePremium=FALSE) {
|
435 |
+
global $irp;
|
436 |
+
/*
|
437 |
+
$premium=($overridePremium || $this->premium);
|
438 |
+
if((!$overridePremium && !$this->tags) || $irp->License->hasPremium() || ($this->onlyPremium && !$premium)) return;
|
439 |
+
|
440 |
+
$tagClass='irp-tag-free';
|
441 |
+
$tagText='FREE';
|
442 |
+
if($premium) {
|
443 |
+
$tagClass='irp-tag-premium';
|
444 |
+
$tagText='<a href="'.irp_PAGE_PREMIUM.'" target="_new">PRO</a>';
|
445 |
+
}
|
446 |
+
*/
|
447 |
+
|
448 |
+
if(!$this->tags || !$this->tagNew) {
|
449 |
+
return;
|
450 |
+
}
|
451 |
+
|
452 |
+
$tagClass='irp-tag-free';
|
453 |
+
$tagText='NEW!';
|
454 |
+
?>
|
455 |
+
<div style="float:left;" class="irp-tag <?php echo $tagClass?>"><?php echo $tagText?></div>
|
456 |
+
<?php
|
457 |
+
}
|
458 |
}
|
includes/classes/ui/Tabs.php
CHANGED
@@ -1,243 +1,243 @@
|
|
1 |
-
<?php
|
2 |
-
class IRP_Tabs {
|
3 |
-
private $tabs = array();
|
4 |
-
|
5 |
-
function init() {
|
6 |
-
global $irp;
|
7 |
-
if($irp->Utils->isAdminUser()) {
|
8 |
-
add_action('admin_menu', array(&$this, 'attachMenu'));
|
9 |
-
add_filter('plugin_action_links', array(&$this, 'pluginActions'), 10, 2);
|
10 |
-
if($irp->Utils->isPluginPage()) {
|
11 |
-
add_action('admin_enqueue_scripts', array(&$this, 'enqueueScripts'));
|
12 |
-
}
|
13 |
-
}
|
14 |
-
}
|
15 |
-
|
16 |
-
function attachMenu() {
|
17 |
-
global $irp;
|
18 |
-
|
19 |
-
if(!$irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
20 |
-
$name='Inline Related Posts';
|
21 |
-
add_submenu_page('options-general.php'
|
22 |
-
, $name, $name
|
23 |
-
, 'manage_options', IRP_PLUGIN_SLUG, array(&$this, 'showTabPage'));
|
24 |
-
}
|
25 |
-
}
|
26 |
-
function pluginActions($links, $file) {
|
27 |
-
global $irp;
|
28 |
-
if($file==IRP_PLUGIN_SLUG.'/index.php'){
|
29 |
-
$settings = "<a href='".IRP_PAGE_SETTINGS."'>" . $irp->Lang->L('Settings') . '</a> ';
|
30 |
-
$url=IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG.'?utm_source=free-users&utm_medium=irp-plugins&utm_campaign=IRP';
|
31 |
-
$premium = "<a href='".$url."' target='_blank'>" . $irp->Lang->L('PREMIUM') . '</a> ';
|
32 |
-
$links = array_merge(array($settings, $premium), $links);
|
33 |
-
}
|
34 |
-
return $links;
|
35 |
-
}
|
36 |
-
function enqueueScripts() {
|
37 |
-
global $irp;
|
38 |
-
wp_enqueue_script('jquery');
|
39 |
-
wp_enqueue_script('suggest');
|
40 |
-
wp_enqueue_script('jquery-ui-autocomplete');
|
41 |
-
|
42 |
-
$uri='//maxcdn.bootstrapcdn.com/font-awesome/4.4.0/css/font-awesome.min.css';
|
43 |
-
wp_enqueue_style('font-awesome', $uri);
|
44 |
-
|
45 |
-
$this->wpEnqueueStyle('assets/css/style.css');
|
46 |
-
$this->wpEnqueueStyle('assets/deps/select2-3.5.2/select2.css');
|
47 |
-
$this->wpEnqueueScript('assets/deps/select2-3.5.2/select2.min.js');
|
48 |
-
$this->wpEnqueueScript('assets/deps/starrr/starrr.js');
|
49 |
-
|
50 |
-
$this->wpEnqueueScript('assets/deps/qtip/jquery.qtip.min.js');
|
51 |
-
$this->wpEnqueueScript('assets/js/common.js');
|
52 |
-
}
|
53 |
-
function wpEnqueueStyle($uri, $name='') {
|
54 |
-
if($name=='') {
|
55 |
-
$name=explode('/', $uri);
|
56 |
-
$name=$name[count($name)-1];
|
57 |
-
$dot=strrpos($name, '.');
|
58 |
-
if($dot!==FALSE) {
|
59 |
-
$name=substr($name, 0, $dot);
|
60 |
-
}
|
61 |
-
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
62 |
-
}
|
63 |
-
|
64 |
-
$v='?v='.IRP_PLUGIN_VERSION;
|
65 |
-
wp_enqueue_style($name, IRP_PLUGIN_URI.$uri.$v);
|
66 |
-
}
|
67 |
-
function wpEnqueueScript($uri, $name='', $version=FALSE) {
|
68 |
-
if($name=='') {
|
69 |
-
$name=explode('/', $uri);
|
70 |
-
$name=$name[count($name)-1];
|
71 |
-
$dot=strrpos($name, '.');
|
72 |
-
if($dot!==FALSE) {
|
73 |
-
$name=substr($name, 0, $dot);
|
74 |
-
}
|
75 |
-
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
76 |
-
}
|
77 |
-
|
78 |
-
$v='?v='.IRP_PLUGIN_VERSION;
|
79 |
-
$deps=array();
|
80 |
-
wp_enqueue_script($name, IRP_PLUGIN_URI.$uri.$v, $deps, $version, FALSE);
|
81 |
-
}
|
82 |
-
|
83 |
-
function showTabPage() {
|
84 |
-
global $irp;
|
85 |
-
|
86 |
-
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
87 |
-
$irp->Options->pushWarningMessage('YouHaveThePremiumVersion', IRP_TAB_SETTINGS_URI);
|
88 |
-
$irp->Options->writeMessages();
|
89 |
-
return;
|
90 |
-
}
|
91 |
-
|
92 |
-
$defaultTab=IRP_TAB_SETTINGS;
|
93 |
-
if($irp->Options->isShowWhatsNew()) {
|
94 |
-
$tab=IRP_TAB_WHATS_NEW;
|
95 |
-
$defaultTab=$tab;
|
96 |
-
$this->tabs[IRP_TAB_WHATS_NEW]=$irp->Lang->L('What\'s New');
|
97 |
-
} else {
|
98 |
-
$tab = $irp->Utils->qs('tab', $defaultTab);
|
99 |
-
$this->tabs[IRP_TAB_SETTINGS] = $irp->Lang->L('Settings');
|
100 |
-
$this->tabs[IRP_TAB_DOCS] = $irp->Lang->L('FAQ & Docs');
|
101 |
-
}
|
102 |
-
|
103 |
-
?>
|
104 |
-
<div class="wrap" style="margin:5px;">
|
105 |
-
<?php
|
106 |
-
$this->showTabs($defaultTab);
|
107 |
-
$header='';
|
108 |
-
switch ($tab) {
|
109 |
-
case IRP_TAB_SETTINGS:
|
110 |
-
$header='Settings';
|
111 |
-
break;
|
112 |
-
case IRP_TAB_WHATS_NEW:
|
113 |
-
$header='';
|
114 |
-
break;
|
115 |
-
}
|
116 |
-
|
117 |
-
if($irp->Lang->H($header.'Title')) { ?>
|
118 |
-
<h2><?php $irp->Lang->P($header . 'Title', IRP_PLUGIN_VERSION) ?></h2>
|
119 |
-
<?php if ($irp->Lang->H($header . 'Subtitle')) { ?>
|
120 |
-
<div><?php $irp->Lang->P($header . 'Subtitle') ?></div>
|
121 |
-
<?php } ?>
|
122 |
-
<div style="clear:both;"></div>
|
123 |
-
<?php }
|
124 |
-
|
125 |
-
if($tab!=IRP_TAB_WHATS_NEW) {
|
126 |
-
irp_ui_first_time();
|
127 |
-
}
|
128 |
-
|
129 |
-
switch ($tab) {
|
130 |
-
case IRP_TAB_SETTINGS:
|
131 |
-
irp_ui_settings();
|
132 |
-
break;
|
133 |
-
case IRP_TAB_WHATS_NEW:
|
134 |
-
irp_ui_whats_new();
|
135 |
-
break;
|
136 |
-
}
|
137 |
-
|
138 |
-
if($irp->Options->isShowWhatsNew()) {
|
139 |
-
$irp->Options->setShowWhatsNew(FALSE);
|
140 |
-
}
|
141 |
-
?>
|
142 |
-
</div>
|
143 |
-
<?php }
|
144 |
-
|
145 |
-
function getPluginsCount() {
|
146 |
-
global $irp;
|
147 |
-
$index=1;
|
148 |
-
while($irp->Lang->H('Plugin'.$index.'.Name')) {
|
149 |
-
$index++;
|
150 |
-
}
|
151 |
-
return $index-1;
|
152 |
-
}
|
153 |
-
function drawPluginWidget($id) {
|
154 |
-
global $irp;
|
155 |
-
?>
|
156 |
-
<div class="irp-plugin-widget">
|
157 |
-
<b><?php $irp->Lang->P('Plugin'.$id.'.Name') ?></b>
|
158 |
-
<br>
|
159 |
-
<i><?php $irp->Lang->P('Plugin'.$id.'.Subtitle') ?></i>
|
160 |
-
<br>
|
161 |
-
<ul style="list-style: circle;">
|
162 |
-
<?php
|
163 |
-
$index=1;
|
164 |
-
while($irp->Lang->H('Plugin'.$id.'.Feature'.$index)) { ?>
|
165 |
-
<li><?php $irp->Lang->P('Plugin'.$id.'.Feature'.$index) ?></li>
|
166 |
-
<?php $index++;
|
167 |
-
} ?>
|
168 |
-
</ul>
|
169 |
-
<a style="float:right;" class="button-primary" href="<?php $irp->Lang->P('Plugin'.$id.'.Permalink') ?>" target="_blank">
|
170 |
-
<?php $irp->Lang->P('PluginCTA')?>
|
171 |
-
</a>
|
172 |
-
<div style="clear:both"></div>
|
173 |
-
</div>
|
174 |
-
<br>
|
175 |
-
<?php }
|
176 |
-
function drawContactUsWidget() {
|
177 |
-
global $irp;
|
178 |
-
?>
|
179 |
-
<b><?php $irp->Lang->P('Sidebar.Title') ?></b>
|
180 |
-
<ul style="list-style: circle;">
|
181 |
-
<?php
|
182 |
-
$index=1;
|
183 |
-
while($irp->Lang->H('Sidebar'.$index.'.Name')) { ?>
|
184 |
-
<li>
|
185 |
-
<a href="<?php $irp->Lang->P('Sidebar'.$index.'.Url')?>" target="_blank">
|
186 |
-
<?php $irp->Lang->P('Sidebar'.$index.'.Name')?>
|
187 |
-
</a>
|
188 |
-
</li>
|
189 |
-
<?php $index++;
|
190 |
-
} ?>
|
191 |
-
</ul>
|
192 |
-
<?php }
|
193 |
-
|
194 |
-
function showTabs($defaultTab) {
|
195 |
-
global $irp;
|
196 |
-
$tab=$irp->Check->of('tab', $defaultTab);
|
197 |
-
if($tab==IRP_TAB_DOCS) {
|
198 |
-
$irp->Utils->redirect(IRP_TAB_DOCS_URI);
|
199 |
-
}
|
200 |
-
?>
|
201 |
-
<h2 class="nav-tab-wrapper" style="float:left; width:97%;">
|
202 |
-
<?php
|
203 |
-
foreach ($this->tabs as $k=>$v) {
|
204 |
-
$active = ($tab==$k ? 'nav-tab-active' : '');
|
205 |
-
$target='_self';
|
206 |
-
|
207 |
-
$styles=array();
|
208 |
-
$styles[]='float:left';
|
209 |
-
$styles[]='margin-left:10px';
|
210 |
-
if($k==IRP_TAB_DOCS) {
|
211 |
-
$target='_blank';
|
212 |
-
$styles[] ='background-color:#F2E49B';
|
213 |
-
}
|
214 |
-
$styles=implode(';', $styles);
|
215 |
-
?>
|
216 |
-
<a target="<?php echo $target ?>" style="<?php echo $styles?>" class="nav-tab <?php echo $active?>" href="?page=<?php echo IRP_PLUGIN_SLUG?>&tab=<?php echo $k?>"><?php echo $v?></a>
|
217 |
-
<?php
|
218 |
-
}
|
219 |
-
?>
|
220 |
-
<style>
|
221 |
-
.starrr {display:inline-block}
|
222 |
-
.starrr i{font-size:16px;padding:0 1px;cursor:pointer;color:#2ea2cc;}
|
223 |
-
</style>
|
224 |
-
<div style="float:right; display:none;" id="rate-box">
|
225 |
-
<span style="font-weight:700; font-size:13px; color:#555;"><?php $irp->Lang->P('Rate us')?></span>
|
226 |
-
<div id="irp-rate" class="starrr" data-connected-input="irp-rate-rank"></div>
|
227 |
-
<input type="hidden" id="irp-rate-rank" name="irp-rate-rank" value="5" />
|
228 |
-
<?php $irp->Utils->twitter('
|
229 |
-
</div>
|
230 |
-
<script>
|
231 |
-
jQuery(function() {
|
232 |
-
jQuery(".starrr").starrr();
|
233 |
-
jQuery('#irp-rate').on('starrr:change', function(e, value){
|
234 |
-
var url='https://wordpress.org/support/view/plugin-reviews/<?php echo IRP_PLUGIN_SLUG?>?rate=5#postform';
|
235 |
-
window.open(url);
|
236 |
-
});
|
237 |
-
jQuery('#rate-box').show();
|
238 |
-
});
|
239 |
-
</script>
|
240 |
-
</h2>
|
241 |
-
<div style="clear:both;"></div>
|
242 |
-
<?php }
|
243 |
-
}
|
1 |
+
<?php
|
2 |
+
class IRP_Tabs {
|
3 |
+
private $tabs = array();
|
4 |
+
|
5 |
+
function init() {
|
6 |
+
global $irp;
|
7 |
+
if($irp->Utils->isAdminUser()) {
|
8 |
+
add_action('admin_menu', array(&$this, 'attachMenu'));
|
9 |
+
add_filter('plugin_action_links', array(&$this, 'pluginActions'), 10, 2);
|
10 |
+
if($irp->Utils->isPluginPage()) {
|
11 |
+
add_action('admin_enqueue_scripts', array(&$this, 'enqueueScripts'));
|
12 |
+
}
|
13 |
+
}
|
14 |
+
}
|
15 |
+
|
16 |
+
function attachMenu() {
|
17 |
+
global $irp;
|
18 |
+
|
19 |
+
if(!$irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
20 |
+
$name='Inline Related Posts';
|
21 |
+
add_submenu_page('options-general.php'
|
22 |
+
, $name, $name
|
23 |
+
, 'manage_options', IRP_PLUGIN_SLUG, array(&$this, 'showTabPage'));
|
24 |
+
}
|
25 |
+
}
|
26 |
+
function pluginActions($links, $file) {
|
27 |
+
global $irp;
|
28 |
+
if($file==IRP_PLUGIN_SLUG.'/index.php'){
|
29 |
+
$settings = "<a href='".IRP_PAGE_SETTINGS."'>" . $irp->Lang->L('Settings') . '</a> ';
|
30 |
+
$url=IRP_INTELLYWP_SITE.IRP_PLUGIN_SLUG.'?utm_source=free-users&utm_medium=irp-plugins&utm_campaign=IRP';
|
31 |
+
$premium = "<a href='".$url."' target='_blank'>" . $irp->Lang->L('PREMIUM') . '</a> ';
|
32 |
+
$links = array_merge(array($settings, $premium), $links);
|
33 |
+
}
|
34 |
+
return $links;
|
35 |
+
}
|
36 |
+
function enqueueScripts() {
|
37 |
+
global $irp;
|
38 |
+
wp_enqueue_script('jquery');
|
39 |
+
wp_enqueue_script('suggest');
|
40 |
+
wp_enqueue_script('jquery-ui-autocomplete');
|
41 |
+
|
42 |
+
$uri='//maxcdn.bootstrapcdn.com/font-awesome/4.4.0/css/font-awesome.min.css';
|
43 |
+
wp_enqueue_style('font-awesome', $uri);
|
44 |
+
|
45 |
+
$this->wpEnqueueStyle('assets/css/style.css');
|
46 |
+
$this->wpEnqueueStyle('assets/deps/select2-3.5.2/select2.css');
|
47 |
+
$this->wpEnqueueScript('assets/deps/select2-3.5.2/select2.min.js');
|
48 |
+
$this->wpEnqueueScript('assets/deps/starrr/starrr.js');
|
49 |
+
|
50 |
+
$this->wpEnqueueScript('assets/deps/qtip/jquery.qtip.min.js');
|
51 |
+
$this->wpEnqueueScript('assets/js/common.js');
|
52 |
+
}
|
53 |
+
function wpEnqueueStyle($uri, $name='') {
|
54 |
+
if($name=='') {
|
55 |
+
$name=explode('/', $uri);
|
56 |
+
$name=$name[count($name)-1];
|
57 |
+
$dot=strrpos($name, '.');
|
58 |
+
if($dot!==FALSE) {
|
59 |
+
$name=substr($name, 0, $dot);
|
60 |
+
}
|
61 |
+
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
62 |
+
}
|
63 |
+
|
64 |
+
$v='?v='.IRP_PLUGIN_VERSION;
|
65 |
+
wp_enqueue_style($name, IRP_PLUGIN_URI.$uri.$v);
|
66 |
+
}
|
67 |
+
function wpEnqueueScript($uri, $name='', $version=FALSE) {
|
68 |
+
if($name=='') {
|
69 |
+
$name=explode('/', $uri);
|
70 |
+
$name=$name[count($name)-1];
|
71 |
+
$dot=strrpos($name, '.');
|
72 |
+
if($dot!==FALSE) {
|
73 |
+
$name=substr($name, 0, $dot);
|
74 |
+
}
|
75 |
+
$name=IRP_PLUGIN_PREFIX.'_'.$name;
|
76 |
+
}
|
77 |
+
|
78 |
+
$v='?v='.IRP_PLUGIN_VERSION;
|
79 |
+
$deps=array();
|
80 |
+
wp_enqueue_script($name, IRP_PLUGIN_URI.$uri.$v, $deps, $version, FALSE);
|
81 |
+
}
|
82 |
+
|
83 |
+
function showTabPage() {
|
84 |
+
global $irp;
|
85 |
+
|
86 |
+
if($irp->Plugin->isActive(IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO)) {
|
87 |
+
$irp->Options->pushWarningMessage('YouHaveThePremiumVersion', IRP_TAB_SETTINGS_URI);
|
88 |
+
$irp->Options->writeMessages();
|
89 |
+
return;
|
90 |
+
}
|
91 |
+
|
92 |
+
$defaultTab=IRP_TAB_SETTINGS;
|
93 |
+
if($irp->Options->isShowWhatsNew()) {
|
94 |
+
$tab=IRP_TAB_WHATS_NEW;
|
95 |
+
$defaultTab=$tab;
|
96 |
+
$this->tabs[IRP_TAB_WHATS_NEW]=$irp->Lang->L('What\'s New');
|
97 |
+
} else {
|
98 |
+
$tab = $irp->Utils->qs('tab', $defaultTab);
|
99 |
+
$this->tabs[IRP_TAB_SETTINGS] = $irp->Lang->L('Settings');
|
100 |
+
$this->tabs[IRP_TAB_DOCS] = $irp->Lang->L('FAQ & Docs');
|
101 |
+
}
|
102 |
+
|
103 |
+
?>
|
104 |
+
<div class="wrap" style="margin:5px;">
|
105 |
+
<?php
|
106 |
+
$this->showTabs($defaultTab);
|
107 |
+
$header='';
|
108 |
+
switch ($tab) {
|
109 |
+
case IRP_TAB_SETTINGS:
|
110 |
+
$header='Settings';
|
111 |
+
break;
|
112 |
+
case IRP_TAB_WHATS_NEW:
|
113 |
+
$header='';
|
114 |
+
break;
|
115 |
+
}
|
116 |
+
|
117 |
+
if($irp->Lang->H($header.'Title')) { ?>
|
118 |
+
<h2><?php $irp->Lang->P($header . 'Title', IRP_PLUGIN_VERSION) ?></h2>
|
119 |
+
<?php if ($irp->Lang->H($header . 'Subtitle')) { ?>
|
120 |
+
<div><?php $irp->Lang->P($header . 'Subtitle') ?></div>
|
121 |
+
<?php } ?>
|
122 |
+
<div style="clear:both;"></div>
|
123 |
+
<?php }
|
124 |
+
|
125 |
+
if($tab!=IRP_TAB_WHATS_NEW) {
|
126 |
+
irp_ui_first_time();
|
127 |
+
}
|
128 |
+
|
129 |
+
switch ($tab) {
|
130 |
+
case IRP_TAB_SETTINGS:
|
131 |
+
irp_ui_settings();
|
132 |
+
break;
|
133 |
+
case IRP_TAB_WHATS_NEW:
|
134 |
+
irp_ui_whats_new();
|
135 |
+
break;
|
136 |
+
}
|
137 |
+
|
138 |
+
if($irp->Options->isShowWhatsNew()) {
|
139 |
+
$irp->Options->setShowWhatsNew(FALSE);
|
140 |
+
}
|
141 |
+
?>
|
142 |
+
</div>
|
143 |
+
<?php }
|
144 |
+
|
145 |
+
function getPluginsCount() {
|
146 |
+
global $irp;
|
147 |
+
$index=1;
|
148 |
+
while($irp->Lang->H('Plugin'.$index.'.Name')) {
|
149 |
+
$index++;
|
150 |
+
}
|
151 |
+
return $index-1;
|
152 |
+
}
|
153 |
+
function drawPluginWidget($id) {
|
154 |
+
global $irp;
|
155 |
+
?>
|
156 |
+
<div class="irp-plugin-widget">
|
157 |
+
<b><?php $irp->Lang->P('Plugin'.$id.'.Name') ?></b>
|
158 |
+
<br>
|
159 |
+
<i><?php $irp->Lang->P('Plugin'.$id.'.Subtitle') ?></i>
|
160 |
+
<br>
|
161 |
+
<ul style="list-style: circle;">
|
162 |
+
<?php
|
163 |
+
$index=1;
|
164 |
+
while($irp->Lang->H('Plugin'.$id.'.Feature'.$index)) { ?>
|
165 |
+
<li><?php $irp->Lang->P('Plugin'.$id.'.Feature'.$index) ?></li>
|
166 |
+
<?php $index++;
|
167 |
+
} ?>
|
168 |
+
</ul>
|
169 |
+
<a style="float:right;" class="button-primary" href="<?php $irp->Lang->P('Plugin'.$id.'.Permalink') ?>" target="_blank">
|
170 |
+
<?php $irp->Lang->P('PluginCTA')?>
|
171 |
+
</a>
|
172 |
+
<div style="clear:both"></div>
|
173 |
+
</div>
|
174 |
+
<br>
|
175 |
+
<?php }
|
176 |
+
function drawContactUsWidget() {
|
177 |
+
global $irp;
|
178 |
+
?>
|
179 |
+
<b><?php $irp->Lang->P('Sidebar.Title') ?></b>
|
180 |
+
<ul style="list-style: circle;">
|
181 |
+
<?php
|
182 |
+
$index=1;
|
183 |
+
while($irp->Lang->H('Sidebar'.$index.'.Name')) { ?>
|
184 |
+
<li>
|
185 |
+
<a href="<?php $irp->Lang->P('Sidebar'.$index.'.Url')?>" target="_blank">
|
186 |
+
<?php $irp->Lang->P('Sidebar'.$index.'.Name')?>
|
187 |
+
</a>
|
188 |
+
</li>
|
189 |
+
<?php $index++;
|
190 |
+
} ?>
|
191 |
+
</ul>
|
192 |
+
<?php }
|
193 |
+
|
194 |
+
function showTabs($defaultTab) {
|
195 |
+
global $irp;
|
196 |
+
$tab=$irp->Check->of('tab', $defaultTab);
|
197 |
+
if($tab==IRP_TAB_DOCS) {
|
198 |
+
$irp->Utils->redirect(IRP_TAB_DOCS_URI);
|
199 |
+
}
|
200 |
+
?>
|
201 |
+
<h2 class="nav-tab-wrapper" style="float:left; width:97%;">
|
202 |
+
<?php
|
203 |
+
foreach ($this->tabs as $k=>$v) {
|
204 |
+
$active = ($tab==$k ? 'nav-tab-active' : '');
|
205 |
+
$target='_self';
|
206 |
+
|
207 |
+
$styles=array();
|
208 |
+
$styles[]='float:left';
|
209 |
+
$styles[]='margin-left:10px';
|
210 |
+
if($k==IRP_TAB_DOCS) {
|
211 |
+
$target='_blank';
|
212 |
+
$styles[] ='background-color:#F2E49B';
|
213 |
+
}
|
214 |
+
$styles=implode(';', $styles);
|
215 |
+
?>
|
216 |
+
<a target="<?php echo $target ?>" style="<?php echo $styles?>" class="nav-tab <?php echo $active?>" href="?page=<?php echo IRP_PLUGIN_SLUG?>&tab=<?php echo $k?>"><?php echo $v?></a>
|
217 |
+
<?php
|
218 |
+
}
|
219 |
+
?>
|
220 |
+
<style>
|
221 |
+
.starrr {display:inline-block}
|
222 |
+
.starrr i{font-size:16px;padding:0 1px;cursor:pointer;color:#2ea2cc;}
|
223 |
+
</style>
|
224 |
+
<div style="float:right; display:none;" id="rate-box">
|
225 |
+
<span style="font-weight:700; font-size:13px; color:#555;"><?php $irp->Lang->P('Rate us')?></span>
|
226 |
+
<div id="irp-rate" class="starrr" data-connected-input="irp-rate-rank"></div>
|
227 |
+
<input type="hidden" id="irp-rate-rank" name="irp-rate-rank" value="5" />
|
228 |
+
<?php $irp->Utils->twitter('data443risk') ?>
|
229 |
+
</div>
|
230 |
+
<script>
|
231 |
+
jQuery(function() {
|
232 |
+
jQuery(".starrr").starrr();
|
233 |
+
jQuery('#irp-rate').on('starrr:change', function(e, value){
|
234 |
+
var url='https://wordpress.org/support/view/plugin-reviews/<?php echo IRP_PLUGIN_SLUG?>?rate=5#postform';
|
235 |
+
window.open(url);
|
236 |
+
});
|
237 |
+
jQuery('#rate-box').show();
|
238 |
+
});
|
239 |
+
</script>
|
240 |
+
</h2>
|
241 |
+
<div style="clear:both;"></div>
|
242 |
+
<?php }
|
243 |
+
}
|
includes/classes/utils/AppOptions.php
CHANGED
@@ -1,497 +1,505 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
class IRP_AppOptions extends IRP_Options {
|
4 |
-
public function __construct() {
|
5 |
-
}
|
6 |
-
|
7 |
-
public function getMarginTop() {
|
8 |
-
return $this->getOption('MarginTop', '0em');
|
9 |
-
}
|
10 |
-
public function setMarginTop($value) {
|
11 |
-
$this->setOption('MarginTop', $value);
|
12 |
-
}
|
13 |
-
public function getMarginBottom() {
|
14 |
-
return $this->getOption('MarginBottom', '1em');
|
15 |
-
}
|
16 |
-
public function setMarginBottom($value) {
|
17 |
-
$this->setOption('MarginBottom', $value);
|
18 |
-
}
|
19 |
-
|
20 |
-
public function hasRelatedPostsIds() {
|
21 |
-
$array=$this->getRequest('RelatedPostsIds', array());
|
22 |
-
return (is_array($array) && count($array)>0);
|
23 |
-
}
|
24 |
-
|
25 |
-
public function initRelatedPostsIds($ids, $postId = -1)
|
26 |
-
{
|
27 |
-
$staticLinks = $this->isRewriteStaticLinks();
|
28 |
-
if ($postId > 0 && $staticLinks) {
|
29 |
-
$ids = $this->getStaticLinks($postId, $ids);
|
30 |
-
}
|
31 |
-
$this->setRequest('RelatedPostsIds', $ids);
|
32 |
-
if ($ids && !$staticLinks) {
|
33 |
-
shuffle($ids);
|
34 |
-
}
|
35 |
-
$this->setRequest('ToShowPostsIds', $ids);
|
36 |
-
$this->setRequest('ShownPostsIdsSequence', array());
|
37 |
-
$this->setRewriteBoxesWritten(0);
|
38 |
-
}
|
39 |
-
|
40 |
-
private function getStaticLinks($postId, $ids)
|
41 |
-
{
|
42 |
-
$key = 'POST_' . $postId;
|
43 |
-
$staticIds = $this->getOption($key, array());
|
44 |
-
$checkedDate = get_the_modified_date('', $postId) . ' ' . get_the_modified_time('', $postId);
|
45 |
-
if (empty($staticIds)) {
|
46 |
-
$data = array (
|
47 |
-
'date' => $checkedDate,
|
48 |
-
'ids' => $ids
|
49 |
-
);
|
50 |
-
$this->setOption($key, $data);
|
51 |
-
} else {
|
52 |
-
$savedDate = $staticIds['date'];
|
53 |
-
$savedIds = $staticIds['ids'];
|
54 |
-
$valid = $this->validatePostIds($savedIds);
|
55 |
-
if (!$valid || $savedDate != $checkedDate) {
|
56 |
-
$data = array (
|
57 |
-
'date' => $checkedDate,
|
58 |
-
'ids' => $ids
|
59 |
-
);
|
60 |
-
$this->setOption($key, $data);
|
61 |
-
} else {
|
62 |
-
$ids = $savedIds;
|
63 |
-
}
|
64 |
-
}
|
65 |
-
return $ids;
|
66 |
-
}
|
67 |
-
|
68 |
-
private function validatePostIds($ids)
|
69 |
-
{
|
70 |
-
foreach ($ids as $id) {
|
71 |
-
$status = get_post_status($id);
|
72 |
-
if ($status === false) {
|
73 |
-
return false;
|
74 |
-
}
|
75 |
-
}
|
76 |
-
return true;
|
77 |
-
}
|
78 |
-
|
79 |
-
public function refreshRelatedPostsIds() {
|
80 |
-
$ids=$this->getRequest('RelatedPostsIds', array());
|
81 |
-
$this->initRelatedPostsIds($ids);
|
82 |
-
}
|
83 |
-
//if you pass maxIds as a number this function take next [maxIds] posts to show as related
|
84 |
-
//if you pass maxIds as an array of postsIds will return this array as posts to show as related
|
85 |
-
public function getToShowPostsIds($maxIds, $repeat=FALSE) {
|
86 |
-
$result=array();
|
87 |
-
$maxIds=intval($maxIds);
|
88 |
-
if(!$this->hasRelatedPostsIds()) {
|
89 |
-
return $result;
|
90 |
-
}
|
91 |
-
|
92 |
-
$toShow=$this->getRequest('ToShowPostsIds', array());
|
93 |
-
if(is_numeric($maxIds)) {
|
94 |
-
if(!is_array($toShow) || (count($toShow)==0 && !$repeat)) {
|
95 |
-
return $result;
|
96 |
-
}
|
97 |
-
while($maxIds>0) {
|
98 |
-
if(count($toShow)==0) {
|
99 |
-
if($repeat) {
|
100 |
-
//i can use again the posts shown
|
101 |
-
$toShow=$this->getRequest('RelatedPostsIds');
|
102 |
-
shuffle($toShow);
|
103 |
-
} else {
|
104 |
-
break;
|
105 |
-
}
|
106 |
-
}
|
107 |
-
|
108 |
-
$postId=array_pop($toShow);
|
109 |
-
$result[]=$postId;
|
110 |
-
--$maxIds;
|
111 |
-
}
|
112 |
-
} elseif(is_array($maxIds)) {
|
113 |
-
$toShow=array_diff($toShow, $maxIds);
|
114 |
-
$result=$maxIds;
|
115 |
-
}
|
116 |
-
$this->setRequest('ToShowPostsIds', $toShow);
|
117 |
-
|
118 |
-
//update the sequence shown
|
119 |
-
$array=$this->getRequest('ShownPostsIdsSequence', array());
|
120 |
-
$array[]=$result;
|
121 |
-
$this->setRequest('ShownPostsIdsSequence', $array);
|
122 |
-
|
123 |
-
return $result;
|
124 |
-
}
|
125 |
-
public function getShownPostsIdsSequence() {
|
126 |
-
return $this->getRequest('ShownPostsIdsSequence', array());
|
127 |
-
}
|
128 |
-
|
129 |
-
public function getPostShown() {
|
130 |
-
return $this->getRequest('PostShown', NULL);
|
131 |
-
}
|
132 |
-
public function setPostShown($value) {
|
133 |
-
$this->setRequest('PostShown', $value);
|
134 |
-
}
|
135 |
-
public function isPostShownExcluded() {
|
136 |
-
global $irp;
|
137 |
-
$array=$this->getExcludedPostsIds();
|
138 |
-
$post=$this->getPostShown();
|
139 |
-
|
140 |
-
$result=FALSE;
|
141 |
-
if(!$post || !isset($post->ID)) {
|
142 |
-
$result=TRUE;
|
143 |
-
} elseif(in_array($post->ID, $array)) {
|
144 |
-
$irp->Log->info('POST ID=%s IN RELATED POSTS EXCLUDE LIST', $post->ID);
|
145 |
-
$result=TRUE;
|
146 |
-
} else {
|
147 |
-
$result=FALSE;
|
148 |
-
}
|
149 |
-
return $result;
|
150 |
-
}
|
151 |
-
public function isShortcodeUsed() {
|
152 |
-
return $this->getRequest('ShortcodeUsed', 0);
|
153 |
-
}
|
154 |
-
public function setShortcodeUsed($value) {
|
155 |
-
$this->setRequest('ShortcodeUsed', $value);
|
156 |
-
}
|
157 |
-
|
158 |
-
public function getTemplateStyle() {
|
159 |
-
global $irp;
|
160 |
-
|
161 |
-
$defaults=array(
|
162 |
-
'template'=>''
|
163 |
-
, 'linkRel'=>$this->getOption('LinkRel', IRP_DEFAULT_LINK_REL_ATTRIBUTE)
|
164 |
-
, 'linkTarget'=>$this->getOption('LinkTarget', '_blank')
|
165 |
-
, 'ctaText'=>$this->getOption('RelatedText', 'READ')
|
166 |
-
, 'ctaTextColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
167 |
-
, 'postTitleColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
168 |
-
, 'boxColor'=>$this->getOption('TemplateBackgroundColor', '')
|
169 |
-
, 'borderColor'=>$this->getOption('TemplateBorderColor', '')
|
170 |
-
, 'hasShadow'=>$this->getOption('TemplateShadow', FALSE)
|
171 |
-
, 'hasPoweredBy'=>$this->getOption('ShowPoweredBy', FALSE)
|
172 |
-
, 'boxOpacity'=>100
|
173 |
-
);
|
174 |
-
$result=$this->getOption('TemplateStyle', $defaults);
|
175 |
-
$names=$irp->HtmlTemplate->getTemplatesNames();
|
176 |
-
if($result['template']=='' || !in_array($result['template'], $names)) {
|
177 |
-
if(count($names)>0) {
|
178 |
-
$result['template']='Minimalist';//$names[0];
|
179 |
-
}
|
180 |
-
}
|
181 |
-
return $result;
|
182 |
-
}
|
183 |
-
public function setTemplateStyle($value) {
|
184 |
-
$this->setOption('TemplateStyle', $value);
|
185 |
-
}
|
186 |
-
|
187 |
-
//is related posts active in posts without any [irl] shortcodes defined
|
188 |
-
public function isRewriteActive() {
|
189 |
-
return $this->getOption('RewriteActive', 1);
|
190 |
-
}
|
191 |
-
public function setRewriteActive($value) {
|
192 |
-
$this->setOption('RewriteActive', $value);
|
193 |
-
}
|
194 |
-
|
195 |
-
public function
|
196 |
-
|
197 |
-
|
198 |
-
|
199 |
-
|
200 |
-
|
201 |
-
|
202 |
-
|
203 |
-
|
204 |
-
|
205 |
-
|
206 |
-
|
207 |
-
|
208 |
-
|
209 |
-
|
210 |
-
|
211 |
-
|
212 |
-
|
213 |
-
|
214 |
-
|
215 |
-
|
216 |
-
$this->setOption('
|
217 |
-
}
|
218 |
-
|
219 |
-
|
220 |
-
$
|
221 |
-
|
222 |
-
|
223 |
-
|
224 |
-
|
225 |
-
|
226 |
-
|
227 |
-
|
228 |
-
|
229 |
-
|
230 |
-
|
231 |
-
|
232 |
-
|
233 |
-
|
234 |
-
|
235 |
-
|
236 |
-
|
237 |
-
|
238 |
-
|
239 |
-
|
240 |
-
|
241 |
-
|
242 |
-
|
243 |
-
$result
|
244 |
-
|
245 |
-
|
246 |
-
|
247 |
-
|
248 |
-
|
249 |
-
|
250 |
-
|
251 |
-
|
252 |
-
|
253 |
-
|
254 |
-
|
255 |
-
|
256 |
-
|
257 |
-
|
258 |
-
|
259 |
-
|
260 |
-
|
261 |
-
|
262 |
-
|
263 |
-
|
264 |
-
|
265 |
-
|
266 |
-
|
267 |
-
|
268 |
-
return
|
269 |
-
}
|
270 |
-
public function
|
271 |
-
$this->setOption('
|
272 |
-
}
|
273 |
-
|
274 |
-
|
275 |
-
|
276 |
-
|
277 |
-
|
278 |
-
|
279 |
-
|
280 |
-
|
281 |
-
|
282 |
-
|
283 |
-
|
284 |
-
|
285 |
-
|
286 |
-
|
287 |
-
|
288 |
-
|
289 |
-
|
290 |
-
|
291 |
-
|
292 |
-
|
293 |
-
|
294 |
-
|
295 |
-
|
296 |
-
|
297 |
-
|
298 |
-
|
299 |
-
|
300 |
-
|
301 |
-
|
302 |
-
|
303 |
-
|
304 |
-
|
305 |
-
|
306 |
-
|
307 |
-
|
308 |
-
|
309 |
-
|
310 |
-
|
311 |
-
|
312 |
-
|
313 |
-
|
314 |
-
|
315 |
-
|
316 |
-
|
317 |
-
|
318 |
-
|
319 |
-
|
320 |
-
|
321 |
-
|
322 |
-
|
323 |
-
|
324 |
-
|
325 |
-
|
326 |
-
|
327 |
-
|
328 |
-
|
329 |
-
|
330 |
-
|
331 |
-
|
332 |
-
|
333 |
-
|
334 |
-
|
335 |
-
|
336 |
-
|
337 |
-
$
|
338 |
-
$
|
339 |
-
|
340 |
-
|
341 |
-
|
342 |
-
|
343 |
-
|
344 |
-
|
345 |
-
|
346 |
-
|
347 |
-
if(
|
348 |
-
$array
|
349 |
-
|
350 |
-
|
351 |
-
|
352 |
-
|
353 |
-
|
354 |
-
|
355 |
-
|
356 |
-
|
357 |
-
|
358 |
-
|
359 |
-
|
360 |
-
|
361 |
-
|
362 |
-
|
363 |
-
|
364 |
-
|
365 |
-
|
366 |
-
|
367 |
-
|
368 |
-
|
369 |
-
|
370 |
-
|
371 |
-
|
372 |
-
|
373 |
-
|
374 |
-
|
375 |
-
|
376 |
-
|
377 |
-
|
378 |
-
|
379 |
-
|
380 |
-
|
381 |
-
|
382 |
-
|
383 |
-
|
384 |
-
|
385 |
-
|
386 |
-
|
387 |
-
|
388 |
-
|
389 |
-
|
390 |
-
|
391 |
-
|
392 |
-
|
393 |
-
|
394 |
-
}
|
395 |
-
|
396 |
-
|
397 |
-
|
398 |
-
|
399 |
-
|
400 |
-
|
401 |
-
|
402 |
-
|
403 |
-
|
404 |
-
if(isset($v['
|
405 |
-
$a=array();
|
406 |
-
$a['color']=$v['
|
407 |
-
if(isset($v['
|
408 |
-
$a['fontColor']=$v['
|
409 |
-
}
|
410 |
-
$result[$k
|
411 |
-
}
|
412 |
-
if(isset($v['
|
413 |
-
$a=array();
|
414 |
-
$a['color']=$v['
|
415 |
-
if(isset($v['
|
416 |
-
$a['fontColor']=$v['
|
417 |
-
}
|
418 |
-
$result[$k.'
|
419 |
-
}
|
420 |
-
|
421 |
-
|
422 |
-
|
423 |
-
|
424 |
-
|
425 |
-
|
426 |
-
|
427 |
-
|
428 |
-
|
429 |
-
|
430 |
-
);
|
431 |
-
$
|
432 |
-
|
433 |
-
|
434 |
-
|
435 |
-
$colors['
|
436 |
-
|
437 |
-
|
438 |
-
|
439 |
-
$colors['
|
440 |
-
|
441 |
-
|
442 |
-
);
|
443 |
-
$colors['
|
444 |
-
$colors['
|
445 |
-
|
446 |
-
|
447 |
-
|
448 |
-
|
449 |
-
|
450 |
-
|
451 |
-
$colors['
|
452 |
-
$colors['
|
453 |
-
$colors
|
454 |
-
$colors
|
455 |
-
|
456 |
-
|
457 |
-
$colors
|
458 |
-
$colors['
|
459 |
-
$colors['
|
460 |
-
$colors['
|
461 |
-
|
462 |
-
$colors['
|
463 |
-
|
464 |
-
$colors['
|
465 |
-
$colors['
|
466 |
-
$colors['
|
467 |
-
$colors['
|
468 |
-
$colors['
|
469 |
-
|
470 |
-
$colors['
|
471 |
-
$colors['
|
472 |
-
$colors['
|
473 |
-
|
474 |
-
$colors['
|
475 |
-
$colors['
|
476 |
-
$colors['
|
477 |
-
$colors['
|
478 |
-
$colors['
|
479 |
-
$colors['
|
480 |
-
$colors['
|
481 |
-
|
482 |
-
$colors['
|
483 |
-
$colors['
|
484 |
-
$colors['
|
485 |
-
|
486 |
-
|
487 |
-
|
488 |
-
|
489 |
-
|
490 |
-
$
|
491 |
-
|
492 |
-
|
493 |
-
|
494 |
-
|
495 |
-
|
496 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
497 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
class IRP_AppOptions extends IRP_Options {
|
4 |
+
public function __construct() {
|
5 |
+
}
|
6 |
+
|
7 |
+
public function getMarginTop() {
|
8 |
+
return $this->getOption('MarginTop', '0em');
|
9 |
+
}
|
10 |
+
public function setMarginTop($value) {
|
11 |
+
$this->setOption('MarginTop', $value);
|
12 |
+
}
|
13 |
+
public function getMarginBottom() {
|
14 |
+
return $this->getOption('MarginBottom', '1em');
|
15 |
+
}
|
16 |
+
public function setMarginBottom($value) {
|
17 |
+
$this->setOption('MarginBottom', $value);
|
18 |
+
}
|
19 |
+
|
20 |
+
public function hasRelatedPostsIds() {
|
21 |
+
$array=$this->getRequest('RelatedPostsIds', array());
|
22 |
+
return (is_array($array) && count($array)>0);
|
23 |
+
}
|
24 |
+
|
25 |
+
public function initRelatedPostsIds($ids, $postId = -1)
|
26 |
+
{
|
27 |
+
$staticLinks = $this->isRewriteStaticLinks();
|
28 |
+
if ($postId > 0 && $staticLinks) {
|
29 |
+
$ids = $this->getStaticLinks($postId, $ids);
|
30 |
+
}
|
31 |
+
$this->setRequest('RelatedPostsIds', $ids);
|
32 |
+
if ($ids && !$staticLinks) {
|
33 |
+
shuffle($ids);
|
34 |
+
}
|
35 |
+
$this->setRequest('ToShowPostsIds', $ids);
|
36 |
+
$this->setRequest('ShownPostsIdsSequence', array());
|
37 |
+
$this->setRewriteBoxesWritten(0);
|
38 |
+
}
|
39 |
+
|
40 |
+
private function getStaticLinks($postId, $ids)
|
41 |
+
{
|
42 |
+
$key = 'POST_' . $postId;
|
43 |
+
$staticIds = $this->getOption($key, array());
|
44 |
+
$checkedDate = get_the_modified_date('', $postId) . ' ' . get_the_modified_time('', $postId);
|
45 |
+
if (empty($staticIds)) {
|
46 |
+
$data = array (
|
47 |
+
'date' => $checkedDate,
|
48 |
+
'ids' => $ids
|
49 |
+
);
|
50 |
+
$this->setOption($key, $data);
|
51 |
+
} else {
|
52 |
+
$savedDate = $staticIds['date'];
|
53 |
+
$savedIds = $staticIds['ids'];
|
54 |
+
$valid = $this->validatePostIds($savedIds);
|
55 |
+
if (!$valid || $savedDate != $checkedDate) {
|
56 |
+
$data = array (
|
57 |
+
'date' => $checkedDate,
|
58 |
+
'ids' => $ids
|
59 |
+
);
|
60 |
+
$this->setOption($key, $data);
|
61 |
+
} else {
|
62 |
+
$ids = $savedIds;
|
63 |
+
}
|
64 |
+
}
|
65 |
+
return $ids;
|
66 |
+
}
|
67 |
+
|
68 |
+
private function validatePostIds($ids)
|
69 |
+
{
|
70 |
+
foreach ($ids as $id) {
|
71 |
+
$status = get_post_status($id);
|
72 |
+
if ($status === false) {
|
73 |
+
return false;
|
74 |
+
}
|
75 |
+
}
|
76 |
+
return true;
|
77 |
+
}
|
78 |
+
|
79 |
+
public function refreshRelatedPostsIds() {
|
80 |
+
$ids=$this->getRequest('RelatedPostsIds', array());
|
81 |
+
$this->initRelatedPostsIds($ids);
|
82 |
+
}
|
83 |
+
//if you pass maxIds as a number this function take next [maxIds] posts to show as related
|
84 |
+
//if you pass maxIds as an array of postsIds will return this array as posts to show as related
|
85 |
+
public function getToShowPostsIds($maxIds, $repeat=FALSE) {
|
86 |
+
$result=array();
|
87 |
+
$maxIds=intval($maxIds);
|
88 |
+
if(!$this->hasRelatedPostsIds()) {
|
89 |
+
return $result;
|
90 |
+
}
|
91 |
+
|
92 |
+
$toShow=$this->getRequest('ToShowPostsIds', array());
|
93 |
+
if(is_numeric($maxIds)) {
|
94 |
+
if(!is_array($toShow) || (count($toShow)==0 && !$repeat)) {
|
95 |
+
return $result;
|
96 |
+
}
|
97 |
+
while($maxIds>0) {
|
98 |
+
if(count($toShow)==0) {
|
99 |
+
if($repeat) {
|
100 |
+
//i can use again the posts shown
|
101 |
+
$toShow=$this->getRequest('RelatedPostsIds');
|
102 |
+
shuffle($toShow);
|
103 |
+
} else {
|
104 |
+
break;
|
105 |
+
}
|
106 |
+
}
|
107 |
+
|
108 |
+
$postId=array_pop($toShow);
|
109 |
+
$result[]=$postId;
|
110 |
+
--$maxIds;
|
111 |
+
}
|
112 |
+
} elseif(is_array($maxIds)) {
|
113 |
+
$toShow=array_diff($toShow, $maxIds);
|
114 |
+
$result=$maxIds;
|
115 |
+
}
|
116 |
+
$this->setRequest('ToShowPostsIds', $toShow);
|
117 |
+
|
118 |
+
//update the sequence shown
|
119 |
+
$array=$this->getRequest('ShownPostsIdsSequence', array());
|
120 |
+
$array[]=$result;
|
121 |
+
$this->setRequest('ShownPostsIdsSequence', $array);
|
122 |
+
|
123 |
+
return $result;
|
124 |
+
}
|
125 |
+
public function getShownPostsIdsSequence() {
|
126 |
+
return $this->getRequest('ShownPostsIdsSequence', array());
|
127 |
+
}
|
128 |
+
|
129 |
+
public function getPostShown() {
|
130 |
+
return $this->getRequest('PostShown', NULL);
|
131 |
+
}
|
132 |
+
public function setPostShown($value) {
|
133 |
+
$this->setRequest('PostShown', $value);
|
134 |
+
}
|
135 |
+
public function isPostShownExcluded() {
|
136 |
+
global $irp;
|
137 |
+
$array=$this->getExcludedPostsIds();
|
138 |
+
$post=$this->getPostShown();
|
139 |
+
|
140 |
+
$result=FALSE;
|
141 |
+
if(!$post || !isset($post->ID)) {
|
142 |
+
$result=TRUE;
|
143 |
+
} elseif(in_array($post->ID, $array)) {
|
144 |
+
$irp->Log->info('POST ID=%s IN RELATED POSTS EXCLUDE LIST', $post->ID);
|
145 |
+
$result=TRUE;
|
146 |
+
} else {
|
147 |
+
$result=FALSE;
|
148 |
+
}
|
149 |
+
return $result;
|
150 |
+
}
|
151 |
+
public function isShortcodeUsed() {
|
152 |
+
return $this->getRequest('ShortcodeUsed', 0);
|
153 |
+
}
|
154 |
+
public function setShortcodeUsed($value) {
|
155 |
+
$this->setRequest('ShortcodeUsed', $value);
|
156 |
+
}
|
157 |
+
|
158 |
+
public function getTemplateStyle() {
|
159 |
+
global $irp;
|
160 |
+
|
161 |
+
$defaults=array(
|
162 |
+
'template'=>''
|
163 |
+
, 'linkRel'=>$this->getOption('LinkRel', IRP_DEFAULT_LINK_REL_ATTRIBUTE)
|
164 |
+
, 'linkTarget'=>$this->getOption('LinkTarget', '_blank')
|
165 |
+
, 'ctaText'=>$this->getOption('RelatedText', 'READ')
|
166 |
+
, 'ctaTextColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
167 |
+
, 'postTitleColor'=>$this->getOption('TemplateRelatedTextColor', '')
|
168 |
+
, 'boxColor'=>$this->getOption('TemplateBackgroundColor', '')
|
169 |
+
, 'borderColor'=>$this->getOption('TemplateBorderColor', '')
|
170 |
+
, 'hasShadow'=>$this->getOption('TemplateShadow', FALSE)
|
171 |
+
, 'hasPoweredBy'=>$this->getOption('ShowPoweredBy', FALSE)
|
172 |
+
, 'boxOpacity'=>100
|
173 |
+
);
|
174 |
+
$result=$this->getOption('TemplateStyle', $defaults);
|
175 |
+
$names=$irp->HtmlTemplate->getTemplatesNames();
|
176 |
+
if($result['template']=='' || !in_array($result['template'], $names)) {
|
177 |
+
if(count($names)>0) {
|
178 |
+
$result['template']='Minimalist';//$names[0];
|
179 |
+
}
|
180 |
+
}
|
181 |
+
return $result;
|
182 |
+
}
|
183 |
+
public function setTemplateStyle($value) {
|
184 |
+
$this->setOption('TemplateStyle', $value);
|
185 |
+
}
|
186 |
+
|
187 |
+
//is related posts active in posts without any [irl] shortcodes defined
|
188 |
+
public function isRewriteActive() {
|
189 |
+
return $this->getOption('RewriteActive', 1);
|
190 |
+
}
|
191 |
+
public function setRewriteActive($value) {
|
192 |
+
$this->setOption('RewriteActive', $value);
|
193 |
+
}
|
194 |
+
|
195 |
+
public function isPlaceInsideSpanElements() {
|
196 |
+
return $this->getOption('PlaceInsideSpanElements', 1);
|
197 |
+
}
|
198 |
+
|
199 |
+
public function setPlaceInsideSpanElements($value) {
|
200 |
+
$this->setOption('PlaceInsideSpanElements', $value);
|
201 |
+
}
|
202 |
+
|
203 |
+
public function isRewriteStaticLinks()
|
204 |
+
{
|
205 |
+
return $this->getOption('RewriteStaticLinks', false);
|
206 |
+
}
|
207 |
+
|
208 |
+
public function setRewriteStaticLinks($value)
|
209 |
+
{
|
210 |
+
if (!$value && $this->isRewriteStaticLinks()) {
|
211 |
+
// remove all saved links
|
212 |
+
global $wpdb;
|
213 |
+
$sql = "DELETE FROM `wp_options` where option_name like 'IRP_POST_%'";
|
214 |
+
$wpdb->query($sql);
|
215 |
+
}
|
216 |
+
$this->setOption('RewriteStaticLinks', $value);
|
217 |
+
}
|
218 |
+
|
219 |
+
public function getExcludedPostsIds() {
|
220 |
+
return $this->getOption('ExcludedPostsIds', array());
|
221 |
+
}
|
222 |
+
public function setExcludedPostsIds($value) {
|
223 |
+
$value=array_unique($value);
|
224 |
+
$this->setOption('ExcludedPostsIds', $value);
|
225 |
+
}
|
226 |
+
public function getMetaboxPostTypes($create=TRUE) {
|
227 |
+
global $irp;
|
228 |
+
$result=$this->getOption('MetaboxPostTypes', array());
|
229 |
+
if($create) {
|
230 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
231 |
+
foreach($types as $v) {
|
232 |
+
$v=$v['id'];
|
233 |
+
if(!isset($result[$v])) {
|
234 |
+
$result[$v]=($v=='post' ? 1 : 0);
|
235 |
+
}
|
236 |
+
}
|
237 |
+
}
|
238 |
+
// We used to try to apply the automatic IRP to pages even though it never really worked.
|
239 |
+
// The unset is here to expunge the value from the database. The unset needs to stay
|
240 |
+
// here because a $create will put it back into the database and if it's returned from
|
241 |
+
// here, the IRP checkbox will be placed in the page editor.
|
242 |
+
unset($result['page']);
|
243 |
+
return $result;
|
244 |
+
}
|
245 |
+
public function setMetaboxPostTypes($values) {
|
246 |
+
$this->setOption('MetaboxPostTypes', $values);
|
247 |
+
}
|
248 |
+
//is integrated with which post types?
|
249 |
+
public function getRewritePostTypes($create=TRUE) {
|
250 |
+
global $irp;
|
251 |
+
$result=$this->getOption('RewritePostTypes', array());
|
252 |
+
if($create) {
|
253 |
+
$types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
254 |
+
foreach($types as $v) {
|
255 |
+
$v=$v['id'];
|
256 |
+
if(!isset($result[$v])) {
|
257 |
+
$result[$v]=($v=='post' ? 1 : 0);
|
258 |
+
}
|
259 |
+
}
|
260 |
+
}
|
261 |
+
return $result;
|
262 |
+
}
|
263 |
+
public function setRewritePostTypes($values) {
|
264 |
+
$this->setOption('RewritePostTypes', $values);
|
265 |
+
}
|
266 |
+
//how many related posts boxes we have to include?
|
267 |
+
public function getRewriteBoxesCount() {
|
268 |
+
return intval($this->getOption('RewriteBoxesCount', 3));
|
269 |
+
}
|
270 |
+
public function setRewriteBoxesCount($value) {
|
271 |
+
$this->setOption('RewriteBoxesCount', $value);
|
272 |
+
}
|
273 |
+
//how many related posts we see in each box?
|
274 |
+
public function getRewritePostsInBoxCount() {
|
275 |
+
//return $this->getOption('RewritePostsInBoxCount', 1);
|
276 |
+
return 1;
|
277 |
+
}
|
278 |
+
public function setRewritePostsInBoxCount($value) {
|
279 |
+
$this->setOption('RewritePostsInBoxCount', $value);
|
280 |
+
}
|
281 |
+
public function getRewritePostsDays() {
|
282 |
+
return intval($this->getOption('RewritePostsDays', 0));
|
283 |
+
}
|
284 |
+
public function setRewritePostsDays($value) {
|
285 |
+
$this->setOption('RewritePostsDays', intval($value));
|
286 |
+
}
|
287 |
+
//how many words we have to "wait" before inserting a related box
|
288 |
+
public function getRewriteThreshold() {
|
289 |
+
return $this->getOption('RewriteThreshold', 250);
|
290 |
+
}
|
291 |
+
public function setRewriteThreshold($value) {
|
292 |
+
$this->setOption('RewriteThreshold', $value);
|
293 |
+
}
|
294 |
+
//hook priority
|
295 |
+
public function getHookPriority() {
|
296 |
+
return intval($this->getOption('HookPriority', 99999));
|
297 |
+
}
|
298 |
+
public function setHookPriority($value) {
|
299 |
+
$this->setOption('HookPriority', $value);
|
300 |
+
}
|
301 |
+
//include also a related box in the end?
|
302 |
+
public function isRewriteAtEnd() {
|
303 |
+
return $this->getOption('RewriteAtEnd', TRUE);
|
304 |
+
}
|
305 |
+
public function setRewriteAtEnd($value) {
|
306 |
+
$this->setOption('RewriteAtEnd', $value);
|
307 |
+
}
|
308 |
+
//how many boxes are already been written?
|
309 |
+
public function getRewriteBoxesWritten() {
|
310 |
+
return $this->getRequest('RewriteBoxesWritten', 0);
|
311 |
+
}
|
312 |
+
public function setRewriteBoxesWritten($value) {
|
313 |
+
$this->setRequest('RewriteBoxesWritten', $value);
|
314 |
+
}
|
315 |
+
|
316 |
+
public function getEngineSearch() {
|
317 |
+
return $this->getOption('EngineSearch', IRP_ENGINE_SEARCH_CATEGORIES_TAGS);
|
318 |
+
}
|
319 |
+
public function setEngineSearch($value) {
|
320 |
+
$this->setOption('EngineSearch', $value);
|
321 |
+
}
|
322 |
+
|
323 |
+
public function getMaxExecutionTime(){
|
324 |
+
return $this->getOption('MaxExecutionTime', -1);
|
325 |
+
}
|
326 |
+
public function resetMaxExecutionTime(){
|
327 |
+
$this->setOption('MaxExecutionTime', -1);
|
328 |
+
}
|
329 |
+
public function updateMaxExecutionTime($value){
|
330 |
+
$now=$this->getMaxExecutionTime();
|
331 |
+
if($value>$now) {
|
332 |
+
$this->setOption('MaxExecutionTime', $value);
|
333 |
+
}
|
334 |
+
}
|
335 |
+
|
336 |
+
public function pushCssStyle($code) {
|
337 |
+
global $irp;
|
338 |
+
if(is_array($code)) {
|
339 |
+
$code=implode("\n", $code);
|
340 |
+
}
|
341 |
+
$code=str_replace('<style>', '', $code);
|
342 |
+
$code=str_replace('</style>', '', $code);
|
343 |
+
$code=$irp->Utils->trimCode($code);
|
344 |
+
|
345 |
+
$array=$this->getCssStyles();
|
346 |
+
$exists=FALSE;
|
347 |
+
if(count($array)>0) {
|
348 |
+
foreach($array as $v) {
|
349 |
+
if(trim($v)==trim($code)) {
|
350 |
+
$exists=TRUE;
|
351 |
+
break;
|
352 |
+
}
|
353 |
+
}
|
354 |
+
}
|
355 |
+
if(!$exists) {
|
356 |
+
$array[]=$code;
|
357 |
+
$this->setRequest('CssStyles', $array);
|
358 |
+
}
|
359 |
+
}
|
360 |
+
public function getCssStyles() {
|
361 |
+
return $this->getRequest('CssStyles', array());
|
362 |
+
}
|
363 |
+
|
364 |
+
public function getColor($color) {
|
365 |
+
global $irp;
|
366 |
+
$result=$color;
|
367 |
+
if(!$irp->Utils->startsWith($color, '#')) {
|
368 |
+
$colors=$this->getLegacyColors();
|
369 |
+
$v=$irp->Utils->geti($colors, $color, FALSE);
|
370 |
+
if($v!==FALSE) {
|
371 |
+
$result=$v['color'];
|
372 |
+
} else {
|
373 |
+
$colors=$this->getColors();
|
374 |
+
$v=$irp->Utils->geti($colors, $color, FALSE);
|
375 |
+
if($v!==FALSE) {
|
376 |
+
$result=$v['color'];
|
377 |
+
}
|
378 |
+
}
|
379 |
+
}
|
380 |
+
return $result;
|
381 |
+
}
|
382 |
+
public function getHoverColor($color) {
|
383 |
+
$color=$this->getColor($color);
|
384 |
+
$colors=$this->getLightDarkColors();
|
385 |
+
$result='';
|
386 |
+
foreach($colors as $k=>$v) {
|
387 |
+
if($v['light']==$color) {
|
388 |
+
$result=$v['dark'];
|
389 |
+
break;
|
390 |
+
} elseif($v['dark']==$color) {
|
391 |
+
$result=$v['light'];
|
392 |
+
break;
|
393 |
+
}
|
394 |
+
}
|
395 |
+
return $result;
|
396 |
+
}
|
397 |
+
public function getColors($blank='') {
|
398 |
+
$array=$this->getLightDarkColors();
|
399 |
+
$result=array();
|
400 |
+
if($blank!='') {
|
401 |
+
$result[$blank]=array('color'=>'', 'fontColor'=>'#464646');
|
402 |
+
}
|
403 |
+
foreach($array as $k=>$v) {
|
404 |
+
if(isset($v['color'])) {
|
405 |
+
$a=array();
|
406 |
+
$a['color']=$v['color'];
|
407 |
+
if(isset($v['fontColor'])) {
|
408 |
+
$a['fontColor']=$v['fontColor'];
|
409 |
+
}
|
410 |
+
$result[$k]=$a;
|
411 |
+
}
|
412 |
+
if(isset($v['light'])) {
|
413 |
+
$a=array();
|
414 |
+
$a['color']=$v['light'];
|
415 |
+
if(isset($v['fontLight'])) {
|
416 |
+
$a['fontColor']=$v['fontLight'];
|
417 |
+
}
|
418 |
+
$result[$k.' Light']=$a;
|
419 |
+
}
|
420 |
+
if(isset($v['dark'])) {
|
421 |
+
$a=array();
|
422 |
+
$a['color']=$v['dark'];
|
423 |
+
if(isset($v['fontDark'])) {
|
424 |
+
$a['fontColor']=$v['fontDark'];
|
425 |
+
}
|
426 |
+
$result[$k.' Dark']=$a;
|
427 |
+
}
|
428 |
+
}
|
429 |
+
|
430 |
+
ksort($result);
|
431 |
+
return $result;
|
432 |
+
}
|
433 |
+
//$colors['(Default)']=array('color'=>'', 'fontColor'=>'#464646');
|
434 |
+
public function getLightDarkColors() {
|
435 |
+
$colors['WHITE']=array(
|
436 |
+
'light'=>'#FFFFFF', 'fontLight'=>'#464646'
|
437 |
+
, 'dark'=>'#eaeaea', 'fontDark'=>'#464646'
|
438 |
+
);
|
439 |
+
$colors['AQUA']=array('light'=>'#1ABC9C', 'dark'=>'#16A085');
|
440 |
+
$colors['GREEN']=array('light'=>'#2ECC71', 'dark'=>'#27AE60');
|
441 |
+
$colors['VIOLET']=array('light'=>'#9B59B6', 'dark'=>'#8E44AD');
|
442 |
+
$colors['BLUE #1']=array('light'=>'#3498DB', 'dark'=>'#2980B9');
|
443 |
+
$colors['BLUE #2']=array('light'=>'#34495E', 'dark'=>'#2C3E50');
|
444 |
+
$colors['YELLOW']=array('light'=>'#F1C40F', 'dark'=>'#F39C12');
|
445 |
+
$colors['ORANGE']=array('light'=>'#E67E22', 'dark'=>'#D35400');
|
446 |
+
$colors['RED']=array('light'=>'#E74C3C', 'dark'=>'#C0392B');
|
447 |
+
$colors['GREY #1']=array(
|
448 |
+
'light'=>'#ECF0F1', 'fontLight'=>'#464646'
|
449 |
+
, 'dark'=>'#e6e6e6', 'fontDark'=>'#464646'
|
450 |
+
);
|
451 |
+
$colors['GREY #2']=array('light'=>'#95A5A6', 'dark'=>'#7F8C8D');
|
452 |
+
$colors['BLACK']=array('light'=>'#141414', 'dark'=>'#000000');
|
453 |
+
ksort($colors);
|
454 |
+
return $colors;
|
455 |
+
}
|
456 |
+
public function getLegacyColors() {
|
457 |
+
$colors=array();
|
458 |
+
$colors['(Default)']=array('color'=>'', 'fontColor'=>'#464646');
|
459 |
+
$colors['WHITE']=array('color'=>'#FFFFFF', 'fontColor'=>'#464646');
|
460 |
+
$colors['LIGHT GREY']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');
|
461 |
+
$colors['DARK GREY']=array('color'=>'#555555');
|
462 |
+
$colors['BLACK']=array('color'=>'#000000');
|
463 |
+
|
464 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
465 |
+
$colors['WHITE']=array('color'=>'#FFFFFF', 'fontColor'=>'#464646');
|
466 |
+
$colors['LIGHT GREY']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');
|
467 |
+
$colors['DARK GREY']=array('color'=>'#555555');
|
468 |
+
$colors['BLACK']=array('color'=>'#000000'); //black
|
469 |
+
|
470 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
471 |
+
$colors['TURQUOISE']=array('color'=>'#1ABC9C'); //Aqua
|
472 |
+
$colors['EMERALD']=array('color'=>'#2ECC71'); //green
|
473 |
+
$colors['AMETHYST']=array('color'=>'#9B59B6');//violet
|
474 |
+
$colors['PETER RIVER']=array('color'=>'#3498DB');//blue
|
475 |
+
$colors['WET ASPHALT']=array('color'=>'#34495E');//blue
|
476 |
+
$colors['SUN FLOWER']=array('color'=>'#F1C40F');//yellow
|
477 |
+
$colors['CARROT']=array('color'=>'#E67E22');//orange
|
478 |
+
$colors['ALIZARIN']=array('color'=>'#E74C3C');//red
|
479 |
+
$colors['CLOUDS']=array('color'=>'#ECF0F1', 'fontColor'=>'#464646');//grey
|
480 |
+
$colors['CONCRETE']=array('color'=>'#95A5A6');//grey (+grey)
|
481 |
+
|
482 |
+
$colors['(Transparent)']=array('color'=>'', 'fontColor'=>'#464646');
|
483 |
+
$colors['GREEN SEA']=array('color'=>'#16A085');
|
484 |
+
$colors['NEPHRITIS']=array('color'=>'#27AE60');
|
485 |
+
$colors['WISTERIA']=array('color'=>'#8E44AD');
|
486 |
+
$colors['BELIZE HOLE']=array('color'=>'#2980B9');
|
487 |
+
$colors['MIDNIGHT BLUE']=array('color'=>'#2C3E50');
|
488 |
+
$colors['ORANGE']=array('color'=>'#F39C12');
|
489 |
+
$colors['PUMPKIN']=array('color'=>'#D35400');
|
490 |
+
$colors['POMEGRANATE']=array('color'=>'#C0392B');
|
491 |
+
$colors['SILVER']=array('color'=>'#BDC3C7');
|
492 |
+
$colors['ASBESTOS']=array('color'=>'#7F8C8D');
|
493 |
+
ksort($colors);
|
494 |
+
return $colors;
|
495 |
+
}
|
496 |
+
|
497 |
+
public function getTemplateUUID($template) {
|
498 |
+
$uuid=$this->getRequest("Template>".$template);
|
499 |
+
if(!$uuid) {
|
500 |
+
$uuid="s".md5($template."-".date("Ymd"));
|
501 |
+
$this->setRequest("Template>".$template, $uuid);
|
502 |
+
}
|
503 |
+
return $uuid;
|
504 |
+
}
|
505 |
}
|
includes/classes/utils/Cron.php
CHANGED
@@ -1,85 +1,85 @@
|
|
1 |
-
<?php
|
2 |
-
/**
|
3 |
-
* Cron
|
4 |
-
*
|
5 |
-
* @package EDD
|
6 |
-
* @subpackage Classes/Cron
|
7 |
-
* @copyright Copyright (c) 2015, Pippin Williamson
|
8 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
9 |
-
* @since 1.6
|
10 |
-
*/
|
11 |
-
|
12 |
-
// Exit if accessed directly
|
13 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
14 |
-
|
15 |
-
class IRP_Cron {
|
16 |
-
/**
|
17 |
-
* Get things going
|
18 |
-
*
|
19 |
-
* @since 1.6
|
20 |
-
* @see EDD_Cron::weekly_events()
|
21 |
-
*/
|
22 |
-
public function __construct() {
|
23 |
-
}
|
24 |
-
public function init() {
|
25 |
-
add_filter( 'cron_schedules', array( $this, 'add_schedules' ) );
|
26 |
-
add_action( 'wp', array( $this, 'schedule_Events' ) );
|
27 |
-
}
|
28 |
-
|
29 |
-
/**
|
30 |
-
* Registers new cron schedules
|
31 |
-
*
|
32 |
-
* @since 1.6
|
33 |
-
*
|
34 |
-
* @param array $schedules
|
35 |
-
* @return array
|
36 |
-
*/
|
37 |
-
public function add_schedules( $schedules = array() ) {
|
38 |
-
global $irp;
|
39 |
-
// Adds once weekly to the existing schedules.
|
40 |
-
$schedules['weekly'] = array(
|
41 |
-
'interval' => 604800,
|
42 |
-
'display' => $irp->Lang->L('Once Weekly')
|
43 |
-
);
|
44 |
-
|
45 |
-
return $schedules;
|
46 |
-
}
|
47 |
-
|
48 |
-
/**
|
49 |
-
* Schedules our events
|
50 |
-
*
|
51 |
-
* @access public
|
52 |
-
* @since 1.6
|
53 |
-
* @return void
|
54 |
-
*/
|
55 |
-
public function schedule_Events() {
|
56 |
-
$this->weekly_events();
|
57 |
-
$this->daily_events();
|
58 |
-
}
|
59 |
-
|
60 |
-
/**
|
61 |
-
* Schedule weekly events
|
62 |
-
*
|
63 |
-
* @access private
|
64 |
-
* @since 1.6
|
65 |
-
* @return void
|
66 |
-
*/
|
67 |
-
private function weekly_events() {
|
68 |
-
if ( ! wp_next_scheduled( 'irp_weekly_scheduled_events' ) ) {
|
69 |
-
wp_schedule_event( current_time( 'timestamp' ), 'weekly', 'irp_weekly_scheduled_events' );
|
70 |
-
}
|
71 |
-
}
|
72 |
-
|
73 |
-
/**
|
74 |
-
* Schedule daily events
|
75 |
-
*
|
76 |
-
* @access private
|
77 |
-
* @since 1.6
|
78 |
-
* @return void
|
79 |
-
*/
|
80 |
-
private function daily_events() {
|
81 |
-
if ( ! wp_next_scheduled( 'irp_daily_scheduled_events' ) ) {
|
82 |
-
wp_schedule_event( current_time( 'timestamp' ), 'daily', 'irp_daily_scheduled_events' );
|
83 |
-
}
|
84 |
-
}
|
85 |
-
}
|
1 |
+
<?php
|
2 |
+
/**
|
3 |
+
* Cron
|
4 |
+
*
|
5 |
+
* @package EDD
|
6 |
+
* @subpackage Classes/Cron
|
7 |
+
* @copyright Copyright (c) 2015, Pippin Williamson
|
8 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
9 |
+
* @since 1.6
|
10 |
+
*/
|
11 |
+
|
12 |
+
// Exit if accessed directly
|
13 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
14 |
+
|
15 |
+
class IRP_Cron {
|
16 |
+
/**
|
17 |
+
* Get things going
|
18 |
+
*
|
19 |
+
* @since 1.6
|
20 |
+
* @see EDD_Cron::weekly_events()
|
21 |
+
*/
|
22 |
+
public function __construct() {
|
23 |
+
}
|
24 |
+
public function init() {
|
25 |
+
add_filter( 'cron_schedules', array( $this, 'add_schedules' ) );
|
26 |
+
add_action( 'wp', array( $this, 'schedule_Events' ) );
|
27 |
+
}
|
28 |
+
|
29 |
+
/**
|
30 |
+
* Registers new cron schedules
|
31 |
+
*
|
32 |
+
* @since 1.6
|
33 |
+
*
|
34 |
+
* @param array $schedules
|
35 |
+
* @return array
|
36 |
+
*/
|
37 |
+
public function add_schedules( $schedules = array() ) {
|
38 |
+
global $irp;
|
39 |
+
// Adds once weekly to the existing schedules.
|
40 |
+
$schedules['weekly'] = array(
|
41 |
+
'interval' => 604800,
|
42 |
+
'display' => $irp->Lang->L('Once Weekly')
|
43 |
+
);
|
44 |
+
|
45 |
+
return $schedules;
|
46 |
+
}
|
47 |
+
|
48 |
+
/**
|
49 |
+
* Schedules our events
|
50 |
+
*
|
51 |
+
* @access public
|
52 |
+
* @since 1.6
|
53 |
+
* @return void
|
54 |
+
*/
|
55 |
+
public function schedule_Events() {
|
56 |
+
$this->weekly_events();
|
57 |
+
$this->daily_events();
|
58 |
+
}
|
59 |
+
|
60 |
+
/**
|
61 |
+
* Schedule weekly events
|
62 |
+
*
|
63 |
+
* @access private
|
64 |
+
* @since 1.6
|
65 |
+
* @return void
|
66 |
+
*/
|
67 |
+
private function weekly_events() {
|
68 |
+
if ( ! wp_next_scheduled( 'irp_weekly_scheduled_events' ) ) {
|
69 |
+
wp_schedule_event( current_time( 'timestamp' ), 'weekly', 'irp_weekly_scheduled_events' );
|
70 |
+
}
|
71 |
+
}
|
72 |
+
|
73 |
+
/**
|
74 |
+
* Schedule daily events
|
75 |
+
*
|
76 |
+
* @access private
|
77 |
+
* @since 1.6
|
78 |
+
* @return void
|
79 |
+
*/
|
80 |
+
private function daily_events() {
|
81 |
+
if ( ! wp_next_scheduled( 'irp_daily_scheduled_events' ) ) {
|
82 |
+
wp_schedule_event( current_time( 'timestamp' ), 'daily', 'irp_daily_scheduled_events' );
|
83 |
+
}
|
84 |
+
}
|
85 |
+
}
|
includes/classes/utils/Language.php
CHANGED
@@ -1,121 +1,121 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
class IRP_Language {
|
5 |
-
var $domain;
|
6 |
-
function load($domain, $file) {
|
7 |
-
$this->domain=$domain;
|
8 |
-
if(!file_exists($file)) {
|
9 |
-
return;
|
10 |
-
}
|
11 |
-
$file=file_get_contents($file);
|
12 |
-
if($file!=NULL && strlen($file)>0) {
|
13 |
-
$bundle=array();
|
14 |
-
$file=str_replace("\r\n", "\n", $file);
|
15 |
-
$file=str_replace("\n\n", "\n", $file);
|
16 |
-
$file=explode("\n", $file);
|
17 |
-
|
18 |
-
foreach($file as $row) {
|
19 |
-
$index=strpos($row, "=");
|
20 |
-
if($index===FALSE) continue;
|
21 |
-
|
22 |
-
$k=trim(substr($row, 0, $index));
|
23 |
-
$v=trim(substr($row, $index+1));
|
24 |
-
$bundle[$k]=$v;
|
25 |
-
}
|
26 |
-
|
27 |
-
global $wp_session;
|
28 |
-
$wp_session['LanguageBundle_'.$domain]=$bundle;
|
29 |
-
}
|
30 |
-
}
|
31 |
-
//echo the $tcm->Lang->L result
|
32 |
-
function P($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
33 |
-
$what=$this->L($key, $v1, $v2, $v3, $v4, $v5);
|
34 |
-
echo $what;
|
35 |
-
}
|
36 |
-
//verify if the key is defined or not
|
37 |
-
function H($key) {
|
38 |
-
global $wp_session;
|
39 |
-
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
40 |
-
if($bundle==NULL || count($bundle)==0) {
|
41 |
-
return FALSE;
|
42 |
-
}
|
43 |
-
|
44 |
-
$result=FALSE;
|
45 |
-
if(isset($bundle[$key])) {
|
46 |
-
$result=TRUE;
|
47 |
-
} elseif(isset($bundle[$key.'1'])) {
|
48 |
-
$result=TRUE;
|
49 |
-
} else {
|
50 |
-
//special way to call this function passing arguments
|
51 |
-
//WTF_something means key=WTF and something as first argument
|
52 |
-
$s=strpos($result, '_');
|
53 |
-
if ($s!==FALSE) {
|
54 |
-
$text = substr($result, 0, $s);
|
55 |
-
$value = substr($result, $s + 1);
|
56 |
-
$e = strrpos($value, '_');
|
57 |
-
if ($e!==FALSE) {
|
58 |
-
$text .= substr($value, $e + 1);
|
59 |
-
$value = substr($value, 0, $e);
|
60 |
-
}
|
61 |
-
if (isset($bundle[$text])) {
|
62 |
-
$result = TRUE;
|
63 |
-
}
|
64 |
-
}
|
65 |
-
}
|
66 |
-
return $result;
|
67 |
-
}
|
68 |
-
//read the key from a text file with its translation. Try to translate using __(
|
69 |
-
function L($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
70 |
-
global $wp_session;
|
71 |
-
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
72 |
-
$result = $key;
|
73 |
-
$args = array($v1, $v2, $v3, $v4, $v5);
|
74 |
-
|
75 |
-
if($bundle==NULL || count($bundle)==0) {
|
76 |
-
$result=__($result, $this->domain);
|
77 |
-
} else {
|
78 |
-
//i use the file to store the translations without writing it inside the code
|
79 |
-
if (isset($bundle[$key])) {
|
80 |
-
$result = $bundle[$key];
|
81 |
-
$result = __($result, $this->domain);
|
82 |
-
} elseif (isset($bundle[$key . '1'])) {
|
83 |
-
$result = '';
|
84 |
-
$n = 1;
|
85 |
-
while (isset($bundle[$key . $n])) {
|
86 |
-
if ($result != '') {
|
87 |
-
$result .= '<br/>';
|
88 |
-
}
|
89 |
-
$result .= __($bundle[$key . $n], $this->domain);
|
90 |
-
++$n;
|
91 |
-
}
|
92 |
-
} else {
|
93 |
-
//special way to call this function passing arguments
|
94 |
-
//WTF_something means key=WTF and something as first argument
|
95 |
-
$s=strpos($result, '_');
|
96 |
-
if ($s!==FALSE) {
|
97 |
-
$text = substr($result, 0, $s);
|
98 |
-
$value = substr($result, $s + 1);
|
99 |
-
$e = strrpos($value, '_');
|
100 |
-
if ($e!==FALSE) {
|
101 |
-
$text .= substr($value, $e + 1);
|
102 |
-
$value = substr($value, 0, $e);
|
103 |
-
}
|
104 |
-
if (isset($bundle[$text])) {
|
105 |
-
$result = $bundle[$text];
|
106 |
-
$args=array($value);
|
107 |
-
}
|
108 |
-
}
|
109 |
-
$result = __($result, $this->domain);
|
110 |
-
}
|
111 |
-
}
|
112 |
-
//here i translate it using WP
|
113 |
-
foreach($args as $k=>$v) {
|
114 |
-
$k='{'.$k.'}';
|
115 |
-
while(strpos($result, $k)!==FALSE) {
|
116 |
-
$result=str_replace($k, $v, $result);
|
117 |
-
}
|
118 |
-
}
|
119 |
-
return $result;
|
120 |
-
}
|
121 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
class IRP_Language {
|
5 |
+
var $domain;
|
6 |
+
function load($domain, $file) {
|
7 |
+
$this->domain=$domain;
|
8 |
+
if(!file_exists($file)) {
|
9 |
+
return;
|
10 |
+
}
|
11 |
+
$file=file_get_contents($file);
|
12 |
+
if($file!=NULL && strlen($file)>0) {
|
13 |
+
$bundle=array();
|
14 |
+
$file=str_replace("\r\n", "\n", $file);
|
15 |
+
$file=str_replace("\n\n", "\n", $file);
|
16 |
+
$file=explode("\n", $file);
|
17 |
+
|
18 |
+
foreach($file as $row) {
|
19 |
+
$index=strpos($row, "=");
|
20 |
+
if($index===FALSE) continue;
|
21 |
+
|
22 |
+
$k=trim(substr($row, 0, $index));
|
23 |
+
$v=trim(substr($row, $index+1));
|
24 |
+
$bundle[$k]=$v;
|
25 |
+
}
|
26 |
+
|
27 |
+
global $wp_session;
|
28 |
+
$wp_session['LanguageBundle_'.$domain]=$bundle;
|
29 |
+
}
|
30 |
+
}
|
31 |
+
//echo the $tcm->Lang->L result
|
32 |
+
function P($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
33 |
+
$what=$this->L($key, $v1, $v2, $v3, $v4, $v5);
|
34 |
+
echo $what;
|
35 |
+
}
|
36 |
+
//verify if the key is defined or not
|
37 |
+
function H($key) {
|
38 |
+
global $wp_session;
|
39 |
+
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
40 |
+
if($bundle==NULL || count($bundle)==0) {
|
41 |
+
return FALSE;
|
42 |
+
}
|
43 |
+
|
44 |
+
$result=FALSE;
|
45 |
+
if(isset($bundle[$key])) {
|
46 |
+
$result=TRUE;
|
47 |
+
} elseif(isset($bundle[$key.'1'])) {
|
48 |
+
$result=TRUE;
|
49 |
+
} else {
|
50 |
+
//special way to call this function passing arguments
|
51 |
+
//WTF_something means key=WTF and something as first argument
|
52 |
+
$s=strpos($result, '_');
|
53 |
+
if ($s!==FALSE) {
|
54 |
+
$text = substr($result, 0, $s);
|
55 |
+
$value = substr($result, $s + 1);
|
56 |
+
$e = strrpos($value, '_');
|
57 |
+
if ($e!==FALSE) {
|
58 |
+
$text .= substr($value, $e + 1);
|
59 |
+
$value = substr($value, 0, $e);
|
60 |
+
}
|
61 |
+
if (isset($bundle[$text])) {
|
62 |
+
$result = TRUE;
|
63 |
+
}
|
64 |
+
}
|
65 |
+
}
|
66 |
+
return $result;
|
67 |
+
}
|
68 |
+
//read the key from a text file with its translation. Try to translate using __(
|
69 |
+
function L($key, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
70 |
+
global $wp_session;
|
71 |
+
$bundle=$wp_session['LanguageBundle_'.$this->domain];
|
72 |
+
$result = $key;
|
73 |
+
$args = array($v1, $v2, $v3, $v4, $v5);
|
74 |
+
|
75 |
+
if($bundle==NULL || count($bundle)==0) {
|
76 |
+
$result=__($result, $this->domain);
|
77 |
+
} else {
|
78 |
+
//i use the file to store the translations without writing it inside the code
|
79 |
+
if (isset($bundle[$key])) {
|
80 |
+
$result = $bundle[$key];
|
81 |
+
$result = __($result, $this->domain);
|
82 |
+
} elseif (isset($bundle[$key . '1'])) {
|
83 |
+
$result = '';
|
84 |
+
$n = 1;
|
85 |
+
while (isset($bundle[$key . $n])) {
|
86 |
+
if ($result != '') {
|
87 |
+
$result .= '<br/>';
|
88 |
+
}
|
89 |
+
$result .= __($bundle[$key . $n], $this->domain);
|
90 |
+
++$n;
|
91 |
+
}
|
92 |
+
} else {
|
93 |
+
//special way to call this function passing arguments
|
94 |
+
//WTF_something means key=WTF and something as first argument
|
95 |
+
$s=strpos($result, '_');
|
96 |
+
if ($s!==FALSE) {
|
97 |
+
$text = substr($result, 0, $s);
|
98 |
+
$value = substr($result, $s + 1);
|
99 |
+
$e = strrpos($value, '_');
|
100 |
+
if ($e!==FALSE) {
|
101 |
+
$text .= substr($value, $e + 1);
|
102 |
+
$value = substr($value, 0, $e);
|
103 |
+
}
|
104 |
+
if (isset($bundle[$text])) {
|
105 |
+
$result = $bundle[$text];
|
106 |
+
$args=array($value);
|
107 |
+
}
|
108 |
+
}
|
109 |
+
$result = __($result, $this->domain);
|
110 |
+
}
|
111 |
+
}
|
112 |
+
//here i translate it using WP
|
113 |
+
foreach($args as $k=>$v) {
|
114 |
+
$k='{'.$k.'}';
|
115 |
+
while(strpos($result, $k)!==FALSE) {
|
116 |
+
$result=str_replace($k, $v, $result);
|
117 |
+
}
|
118 |
+
}
|
119 |
+
return $result;
|
120 |
+
}
|
121 |
+
}
|
includes/classes/utils/Logger.php
CHANGED
@@ -1,119 +1,119 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
// Exit if accessed directly
|
4 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
-
|
6 |
-
class IRP_Logger {
|
7 |
-
var $name;
|
8 |
-
var $context=array();
|
9 |
-
|
10 |
-
var $allTime;
|
11 |
-
var $time;
|
12 |
-
var $profile;
|
13 |
-
|
14 |
-
public function __construct($name='IRPP') {
|
15 |
-
if($name=='') $name='IRPP';
|
16 |
-
$this->name=$name;
|
17 |
-
$this->time=-1;
|
18 |
-
$this->allTime=-1;
|
19 |
-
$this->profile='';
|
20 |
-
}
|
21 |
-
|
22 |
-
public function startTime($profile) {
|
23 |
-
$this->info('TIME [startTime]=%s', $profile);
|
24 |
-
$this->profile=$profile;
|
25 |
-
$this->time=microtime(TRUE);
|
26 |
-
}
|
27 |
-
public function pauseTime() {
|
28 |
-
if($this->time>0 && $this->profile!='') {
|
29 |
-
$diff=round(microtime(TRUE)-$this->time, 3)*1000;
|
30 |
-
if($diff!='' && $diff>0) {
|
31 |
-
if($this->allTime<0) {
|
32 |
-
$this->allTime=0;
|
33 |
-
}
|
34 |
-
$this->allTime+=$diff;
|
35 |
-
$this->info('TIME pauseTime [%s]=%s', $this->profile, $diff);
|
36 |
-
}
|
37 |
-
}
|
38 |
-
$this->time=-1;
|
39 |
-
$this->profile='';
|
40 |
-
}
|
41 |
-
public function stopTime() {
|
42 |
-
global $irp;
|
43 |
-
$this->info('TIME [stopTime]=%s', $this->allTime);
|
44 |
-
if($this->allTime>0) {
|
45 |
-
$irp->Options->updateMaxExecutionTime($this->allTime);
|
46 |
-
}
|
47 |
-
}
|
48 |
-
|
49 |
-
public function pushContext($context) {
|
50 |
-
array_push($this->context, $context);
|
51 |
-
}
|
52 |
-
public function popContext() {
|
53 |
-
array_pop($this->context);
|
54 |
-
}
|
55 |
-
|
56 |
-
public function exception(Exception $ex) {
|
57 |
-
$this->write('[EXCEPTION]', 'FILE=%s, LINE=%s, CODE=%s, MESSAGE=%s'
|
58 |
-
, $ex->getFile(), $ex->getLine(), $ex->getCode(), $ex->getMessage());
|
59 |
-
}
|
60 |
-
public function fatal($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
61 |
-
$what=$this->write('[FATAL]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
62 |
-
die($what);
|
63 |
-
}
|
64 |
-
public function debug($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
65 |
-
$this->write('[DEBUG]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
66 |
-
}
|
67 |
-
public function info($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
68 |
-
$this->write('[INFO] ', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
69 |
-
}
|
70 |
-
public function error($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
71 |
-
$this->write('[ERROR]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
72 |
-
}
|
73 |
-
private function dump($v) {
|
74 |
-
if(is_array($v) && count($v)==0) {
|
75 |
-
$v='[]';
|
76 |
-
}
|
77 |
-
if($v!=NULL) {
|
78 |
-
if(is_array($v) || is_object($v)) {
|
79 |
-
$v=print_r($v, TRUE);
|
80 |
-
}
|
81 |
-
}
|
82 |
-
if(is_bool($v)) {
|
83 |
-
$v=($v ? 'TRUE' : 'FALSE');
|
84 |
-
}
|
85 |
-
return $v;
|
86 |
-
}
|
87 |
-
private function write($verbosity, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
88 |
-
global $irp;
|
89 |
-
|
90 |
-
$text=sprintf($message
|
91 |
-
, $this->dump($v1), $this->dump($v2), $this->dump($v3)
|
92 |
-
, $this->dump($v4), $this->dump($v5), $this->dump($v6));
|
93 |
-
$m=microtime(TRUE)%1000;
|
94 |
-
$m=":".str_pad(''.$m, 3, "0", STR_PAD_LEFT);
|
95 |
-
$message=date("d/m/Y H:i:s").$m." ".$verbosity." ";
|
96 |
-
if(count($this->context)>0) {
|
97 |
-
$message.='{'.$this->context[count($this->context)-1].'} ';
|
98 |
-
}
|
99 |
-
$message="\n".$message.$text;
|
100 |
-
if(!$irp->Options->isLoggerEnable()) {
|
101 |
-
return $message;
|
102 |
-
}
|
103 |
-
|
104 |
-
$hasErrors=false;
|
105 |
-
$filename=IRP_PLUGIN_ROOT."logs/".$this->name."_".date("Ym").".txt";
|
106 |
-
if (!$handle = fopen($filename, 'a')) {
|
107 |
-
$hasErrors=true;
|
108 |
-
}
|
109 |
-
|
110 |
-
if(!$hasErrors && fwrite($handle, $message)===FALSE) {
|
111 |
-
$hasErrors=true;
|
112 |
-
}
|
113 |
-
|
114 |
-
if(!$hasErrors) {
|
115 |
-
fclose($handle);
|
116 |
-
}
|
117 |
-
return $message;
|
118 |
-
}
|
119 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
// Exit if accessed directly
|
4 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
+
|
6 |
+
class IRP_Logger {
|
7 |
+
var $name;
|
8 |
+
var $context=array();
|
9 |
+
|
10 |
+
var $allTime;
|
11 |
+
var $time;
|
12 |
+
var $profile;
|
13 |
+
|
14 |
+
public function __construct($name='IRPP') {
|
15 |
+
if($name=='') $name='IRPP';
|
16 |
+
$this->name=$name;
|
17 |
+
$this->time=-1;
|
18 |
+
$this->allTime=-1;
|
19 |
+
$this->profile='';
|
20 |
+
}
|
21 |
+
|
22 |
+
public function startTime($profile) {
|
23 |
+
$this->info('TIME [startTime]=%s', $profile);
|
24 |
+
$this->profile=$profile;
|
25 |
+
$this->time=microtime(TRUE);
|
26 |
+
}
|
27 |
+
public function pauseTime() {
|
28 |
+
if($this->time>0 && $this->profile!='') {
|
29 |
+
$diff=round(microtime(TRUE)-$this->time, 3)*1000;
|
30 |
+
if($diff!='' && $diff>0) {
|
31 |
+
if($this->allTime<0) {
|
32 |
+
$this->allTime=0;
|
33 |
+
}
|
34 |
+
$this->allTime+=$diff;
|
35 |
+
$this->info('TIME pauseTime [%s]=%s', $this->profile, $diff);
|
36 |
+
}
|
37 |
+
}
|
38 |
+
$this->time=-1;
|
39 |
+
$this->profile='';
|
40 |
+
}
|
41 |
+
public function stopTime() {
|
42 |
+
global $irp;
|
43 |
+
$this->info('TIME [stopTime]=%s', $this->allTime);
|
44 |
+
if($this->allTime>0) {
|
45 |
+
$irp->Options->updateMaxExecutionTime($this->allTime);
|
46 |
+
}
|
47 |
+
}
|
48 |
+
|
49 |
+
public function pushContext($context) {
|
50 |
+
array_push($this->context, $context);
|
51 |
+
}
|
52 |
+
public function popContext() {
|
53 |
+
array_pop($this->context);
|
54 |
+
}
|
55 |
+
|
56 |
+
public function exception(Exception $ex) {
|
57 |
+
$this->write('[EXCEPTION]', 'FILE=%s, LINE=%s, CODE=%s, MESSAGE=%s'
|
58 |
+
, $ex->getFile(), $ex->getLine(), $ex->getCode(), $ex->getMessage());
|
59 |
+
}
|
60 |
+
public function fatal($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
61 |
+
$what=$this->write('[FATAL]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
62 |
+
die($what);
|
63 |
+
}
|
64 |
+
public function debug($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
65 |
+
$this->write('[DEBUG]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
66 |
+
}
|
67 |
+
public function info($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
68 |
+
$this->write('[INFO] ', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
69 |
+
}
|
70 |
+
public function error($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
71 |
+
$this->write('[ERROR]', $message, $v1, $v2, $v3, $v4, $v5, $v6);
|
72 |
+
}
|
73 |
+
private function dump($v) {
|
74 |
+
if(is_array($v) && count($v)==0) {
|
75 |
+
$v='[]';
|
76 |
+
}
|
77 |
+
if($v!=NULL) {
|
78 |
+
if(is_array($v) || is_object($v)) {
|
79 |
+
$v=print_r($v, TRUE);
|
80 |
+
}
|
81 |
+
}
|
82 |
+
if(is_bool($v)) {
|
83 |
+
$v=($v ? 'TRUE' : 'FALSE');
|
84 |
+
}
|
85 |
+
return $v;
|
86 |
+
}
|
87 |
+
private function write($verbosity, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL, $v6=NULL) {
|
88 |
+
global $irp;
|
89 |
+
|
90 |
+
$text=sprintf($message
|
91 |
+
, $this->dump($v1), $this->dump($v2), $this->dump($v3)
|
92 |
+
, $this->dump($v4), $this->dump($v5), $this->dump($v6));
|
93 |
+
$m=microtime(TRUE)%1000;
|
94 |
+
$m=":".str_pad(''.$m, 3, "0", STR_PAD_LEFT);
|
95 |
+
$message=date("d/m/Y H:i:s").$m." ".$verbosity." ";
|
96 |
+
if(count($this->context)>0) {
|
97 |
+
$message.='{'.$this->context[count($this->context)-1].'} ';
|
98 |
+
}
|
99 |
+
$message="\n".$message.$text;
|
100 |
+
if(!$irp->Options->isLoggerEnable()) {
|
101 |
+
return $message;
|
102 |
+
}
|
103 |
+
|
104 |
+
$hasErrors=false;
|
105 |
+
$filename=IRP_PLUGIN_ROOT."logs/".$this->name."_".date("Ym").".txt";
|
106 |
+
if (!$handle = fopen($filename, 'a')) {
|
107 |
+
$hasErrors=true;
|
108 |
+
}
|
109 |
+
|
110 |
+
if(!$hasErrors && fwrite($handle, $message)===FALSE) {
|
111 |
+
$hasErrors=true;
|
112 |
+
}
|
113 |
+
|
114 |
+
if(!$hasErrors) {
|
115 |
+
fclose($handle);
|
116 |
+
}
|
117 |
+
return $message;
|
118 |
+
}
|
119 |
}
|
includes/classes/utils/Options.php
CHANGED
@@ -1,261 +1,261 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
// Exit if accessed directly
|
4 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
-
|
6 |
-
class IRP_Options {
|
7 |
-
var $vars;
|
8 |
-
public function __construct() {
|
9 |
-
$this->vars=array();
|
10 |
-
}
|
11 |
-
|
12 |
-
//always add a prefix to avoid conflicts with other plugins
|
13 |
-
protected function getKey($key) {
|
14 |
-
return 'IRP_'.$key;
|
15 |
-
}
|
16 |
-
//option
|
17 |
-
protected function removeOption($key) {
|
18 |
-
$key=$this->getKey($key);
|
19 |
-
delete_option($key);
|
20 |
-
}
|
21 |
-
protected function getOption($key, $default=FALSE) {
|
22 |
-
$key=$this->getKey($key);
|
23 |
-
$result=get_option($key, $default);
|
24 |
-
if(is_string($result)) {
|
25 |
-
$result=trim($result);
|
26 |
-
}
|
27 |
-
return $result;
|
28 |
-
}
|
29 |
-
protected function setOption($key, $value) {
|
30 |
-
$key=$this->getKey($key);
|
31 |
-
if(is_bool($value)) {
|
32 |
-
$value=($value ? 1 : 0);
|
33 |
-
}
|
34 |
-
update_option($key, $value);
|
35 |
-
}
|
36 |
-
|
37 |
-
//$_SESSION
|
38 |
-
protected function removeSession($key) {
|
39 |
-
global $wp_session;
|
40 |
-
|
41 |
-
$key=$this->getKey($key);
|
42 |
-
if(isset($wp_session[$key])) {
|
43 |
-
unset($wp_session[$key]);
|
44 |
-
}
|
45 |
-
}
|
46 |
-
protected function getSession($key, $default=FALSE) {
|
47 |
-
global $wp_session;
|
48 |
-
|
49 |
-
$key=$this->getKey($key);
|
50 |
-
$result=$default;
|
51 |
-
if(isset($wp_session[$key])) {
|
52 |
-
$result=$wp_session[$key];
|
53 |
-
}
|
54 |
-
if(is_string($result)) {
|
55 |
-
$result=trim($result);
|
56 |
-
}
|
57 |
-
return $result;
|
58 |
-
}
|
59 |
-
protected function setSession($key, $value) {
|
60 |
-
global $wp_session;
|
61 |
-
|
62 |
-
$key=$this->getKey($key);
|
63 |
-
$wp_session[$key]=$value;
|
64 |
-
}
|
65 |
-
|
66 |
-
//$_REQUEST
|
67 |
-
//However WP enforces its own logic - during load process wp_magic_quotes() processes variables to emulate magic quotes setting and enforces $_REQUEST to contain combination of $_GET and $_POST, no matter what PHP configuration says.
|
68 |
-
protected function removeRequest($key) {
|
69 |
-
$key=$this->getKey($key);
|
70 |
-
if(isset($this->vars[$key])) {
|
71 |
-
unset($this->vars[$key]);
|
72 |
-
}
|
73 |
-
}
|
74 |
-
protected function getRequest($key, $default=FALSE) {
|
75 |
-
$key=$this->getKey($key);
|
76 |
-
$result=$default;
|
77 |
-
if(isset($this->vars[$key])) {
|
78 |
-
$result=$this->vars[$key];
|
79 |
-
}
|
80 |
-
return $result;
|
81 |
-
}
|
82 |
-
protected function setRequest($key, $value) {
|
83 |
-
$key=$this->getKey($key);
|
84 |
-
$this->vars[$key]=$value;
|
85 |
-
}
|
86 |
-
|
87 |
-
//ShowWhatsNew
|
88 |
-
public function isShowWhatsNew() {
|
89 |
-
return $this->getOption('ShowWhatsNew', FALSE);
|
90 |
-
}
|
91 |
-
public function setShowWhatsNew($value) {
|
92 |
-
$this->setOption('ShowWhatsNew', $value);
|
93 |
-
}
|
94 |
-
|
95 |
-
//TrackingEnable
|
96 |
-
public function isTrackingEnable() {
|
97 |
-
return $this->getOption('TrackingEnable', 0);
|
98 |
-
}
|
99 |
-
public function setTrackingEnable($value) {
|
100 |
-
$this->setOption('TrackingEnable', $value);
|
101 |
-
}
|
102 |
-
//TrackingNotice
|
103 |
-
public function isTrackingNotice() {
|
104 |
-
return $this->getOption('TrackingNotice', 1);
|
105 |
-
}
|
106 |
-
public function setTrackingNotice($value) {
|
107 |
-
$this->setOption('TrackingNotice', $value);
|
108 |
-
}
|
109 |
-
|
110 |
-
public function isActive() {
|
111 |
-
return $this->getOption('Active', 0);
|
112 |
-
}
|
113 |
-
public function setActive($value) {
|
114 |
-
$this->setOption('Active', $value);
|
115 |
-
}
|
116 |
-
|
117 |
-
public function getTrackingLastSend() {
|
118 |
-
return $this->getOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', 0);
|
119 |
-
}
|
120 |
-
public function setTrackingLastSend($value) {
|
121 |
-
$this->setOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', $value);
|
122 |
-
}
|
123 |
-
public function getPluginInstallDate() {
|
124 |
-
return $this->getOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', 0);
|
125 |
-
}
|
126 |
-
public function setPluginInstallDate($value) {
|
127 |
-
$this->setOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', $value);
|
128 |
-
}
|
129 |
-
public function getPluginUpdateDate() {
|
130 |
-
return $this->getOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', 0);
|
131 |
-
}
|
132 |
-
public function setPluginUpdateDate($value) {
|
133 |
-
$this->setOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', $value);
|
134 |
-
}
|
135 |
-
|
136 |
-
public function isPluginFirstInstall() {
|
137 |
-
return $this->getOption('PluginFirstInstall', FALSE);
|
138 |
-
}
|
139 |
-
public function setPluginFirstInstall($value) {
|
140 |
-
$this->setOption('PluginFirstInstall', $value);
|
141 |
-
}
|
142 |
-
public function isShowActivationNotice() {
|
143 |
-
return $this->getOption('ShowActivationNotice', FALSE);
|
144 |
-
}
|
145 |
-
public function setShowActivationNotice($value) {
|
146 |
-
$this->setOption('ShowActivationNotice', $value);
|
147 |
-
}
|
148 |
-
|
149 |
-
//LoggerEnable
|
150 |
-
public function isLoggerEnable() {
|
151 |
-
return ($this->getOption('LoggerEnable', FALSE) || (defined('IRP_LOGGER') && IRP_LOGGER));
|
152 |
-
}
|
153 |
-
public function setLoggerEnable($value) {
|
154 |
-
$this->setOption('LoggerEnable', $value);
|
155 |
-
}
|
156 |
-
|
157 |
-
//Cache
|
158 |
-
public function getCache($name, $id) {
|
159 |
-
return $this->getRequest('Cache_'.$name.'_'.$id);
|
160 |
-
}
|
161 |
-
public function setCache($name, $id, $value) {
|
162 |
-
$this->setRequest('Cache_'.$name.'_'.$id, $value);
|
163 |
-
}
|
164 |
-
|
165 |
-
public function getFeedbackEmail() {
|
166 |
-
return $this->getOption('FeedbackEmail', get_bloginfo('admin_email'));
|
167 |
-
}
|
168 |
-
public function setFeedbackEmail($value) {
|
169 |
-
$this->setOption('FeedbackEmail', $value);
|
170 |
-
}
|
171 |
-
|
172 |
-
private function hasGenericMessages($type) {
|
173 |
-
$result=$this->getRequest($type.'Messages', NULL);
|
174 |
-
return (is_array($result) && count($result)>0);
|
175 |
-
}
|
176 |
-
|
177 |
-
private function pushGenericMessage($type, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
178 |
-
global $irp;
|
179 |
-
$array=$this->getRequest($type.'Messages', array());
|
180 |
-
$array[]=$irp->Lang->L($message, $v1, $v2, $v3, $v4, $v5);
|
181 |
-
$this->setRequest($type.'Messages', $array);
|
182 |
-
}
|
183 |
-
private function writeGenericMessages($type, $clean=TRUE) {
|
184 |
-
$result=FALSE;
|
185 |
-
$array=$this->getRequest($type.'Messages', array());
|
186 |
-
if(is_array($array) && count($array)>0) {
|
187 |
-
$result=TRUE;
|
188 |
-
?>
|
189 |
-
<div class="irp-box-<?php echo strtolower($type)?>"><?php echo wpautop(implode("\n", $array)); ?></div>
|
190 |
-
<?php }
|
191 |
-
if($clean) {
|
192 |
-
$this->removeRequest($type.'Messages');
|
193 |
-
}
|
194 |
-
return $result;
|
195 |
-
}
|
196 |
-
//WarningMessages
|
197 |
-
public function hasWarningMessages() {
|
198 |
-
return $this->hasGenericMessages('Warning');
|
199 |
-
}
|
200 |
-
public function pushWarningMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
201 |
-
return $this->pushGenericMessage('Warning', $message, $v1, $v2, $v3, $v4, $v5);
|
202 |
-
}
|
203 |
-
public function writeWarningMessages($clean=TRUE) {
|
204 |
-
return $this->writeGenericMessages('Warning', $clean);
|
205 |
-
}
|
206 |
-
//SuccessMessages
|
207 |
-
public function hasSuccessMessages() {
|
208 |
-
return $this->hasGenericMessages('Success');
|
209 |
-
}
|
210 |
-
public function pushSuccessMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
211 |
-
return $this->pushGenericMessage('Success', $message, $v1, $v2, $v3, $v4, $v5);
|
212 |
-
}
|
213 |
-
public function writeSuccessMessages($clean=TRUE) {
|
214 |
-
return $this->writeGenericMessages('Success', $clean);
|
215 |
-
}
|
216 |
-
//InfoMessages
|
217 |
-
public function hasInfoMessages() {
|
218 |
-
return $this->hasGenericMessages('Info');
|
219 |
-
}
|
220 |
-
public function pushInfoMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
221 |
-
return $this->pushGenericMessage('Info', $message, $v1, $v2, $v3, $v4, $v5);
|
222 |
-
}
|
223 |
-
public function writeInfoMessages($clean=TRUE) {
|
224 |
-
return $this->writeGenericMessages('Info', $clean);
|
225 |
-
}
|
226 |
-
//ErrorMessages
|
227 |
-
public function hasErrorMessages() {
|
228 |
-
return $this->hasGenericMessages('Error');
|
229 |
-
}
|
230 |
-
public function pushErrorMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
231 |
-
return $this->pushGenericMessage('Error', $message, $v1, $v2, $v3, $v4, $v5);
|
232 |
-
}
|
233 |
-
public function writeErrorMessages($clean=TRUE) {
|
234 |
-
return $this->writeGenericMessages('Error', $clean);
|
235 |
-
}
|
236 |
-
|
237 |
-
public function writeMessages($clean=TRUE) {
|
238 |
-
$result=FALSE;
|
239 |
-
if($this->writeInfoMessages($clean)) {
|
240 |
-
$result=TRUE;
|
241 |
-
}
|
242 |
-
if($this->writeSuccessMessages($clean)) {
|
243 |
-
$result=TRUE;
|
244 |
-
}
|
245 |
-
if($this->writeWarningMessages($clean)) {
|
246 |
-
$result=TRUE;
|
247 |
-
}
|
248 |
-
if($this->writeErrorMessages($clean)) {
|
249 |
-
$result=TRUE;
|
250 |
-
}
|
251 |
-
|
252 |
-
return $result;
|
253 |
-
}
|
254 |
-
public function pushMessage($success, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
255 |
-
if($success) {
|
256 |
-
$this->pushSuccessMessage($message.'Success', $v1, $v2, $v3, $v4, $v5);
|
257 |
-
} else {
|
258 |
-
$this->pushErrorMessage($message.'Error', $v1, $v2, $v3, $v4, $v5);
|
259 |
-
}
|
260 |
-
}
|
261 |
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
// Exit if accessed directly
|
4 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
5 |
+
|
6 |
+
class IRP_Options {
|
7 |
+
var $vars;
|
8 |
+
public function __construct() {
|
9 |
+
$this->vars=array();
|
10 |
+
}
|
11 |
+
|
12 |
+
//always add a prefix to avoid conflicts with other plugins
|
13 |
+
protected function getKey($key) {
|
14 |
+
return 'IRP_'.$key;
|
15 |
+
}
|
16 |
+
//option
|
17 |
+
protected function removeOption($key) {
|
18 |
+
$key=$this->getKey($key);
|
19 |
+
delete_option($key);
|
20 |
+
}
|
21 |
+
protected function getOption($key, $default=FALSE) {
|
22 |
+
$key=$this->getKey($key);
|
23 |
+
$result=get_option($key, $default);
|
24 |
+
if(is_string($result)) {
|
25 |
+
$result=trim($result);
|
26 |
+
}
|
27 |
+
return $result;
|
28 |
+
}
|
29 |
+
protected function setOption($key, $value) {
|
30 |
+
$key=$this->getKey($key);
|
31 |
+
if(is_bool($value)) {
|
32 |
+
$value=($value ? 1 : 0);
|
33 |
+
}
|
34 |
+
update_option($key, $value);
|
35 |
+
}
|
36 |
+
|
37 |
+
//$_SESSION
|
38 |
+
protected function removeSession($key) {
|
39 |
+
global $wp_session;
|
40 |
+
|
41 |
+
$key=$this->getKey($key);
|
42 |
+
if(isset($wp_session[$key])) {
|
43 |
+
unset($wp_session[$key]);
|
44 |
+
}
|
45 |
+
}
|
46 |
+
protected function getSession($key, $default=FALSE) {
|
47 |
+
global $wp_session;
|
48 |
+
|
49 |
+
$key=$this->getKey($key);
|
50 |
+
$result=$default;
|
51 |
+
if(isset($wp_session[$key])) {
|
52 |
+
$result=$wp_session[$key];
|
53 |
+
}
|
54 |
+
if(is_string($result)) {
|
55 |
+
$result=trim($result);
|
56 |
+
}
|
57 |
+
return $result;
|
58 |
+
}
|
59 |
+
protected function setSession($key, $value) {
|
60 |
+
global $wp_session;
|
61 |
+
|
62 |
+
$key=$this->getKey($key);
|
63 |
+
$wp_session[$key]=$value;
|
64 |
+
}
|
65 |
+
|
66 |
+
//$_REQUEST
|
67 |
+
//However WP enforces its own logic - during load process wp_magic_quotes() processes variables to emulate magic quotes setting and enforces $_REQUEST to contain combination of $_GET and $_POST, no matter what PHP configuration says.
|
68 |
+
protected function removeRequest($key) {
|
69 |
+
$key=$this->getKey($key);
|
70 |
+
if(isset($this->vars[$key])) {
|
71 |
+
unset($this->vars[$key]);
|
72 |
+
}
|
73 |
+
}
|
74 |
+
protected function getRequest($key, $default=FALSE) {
|
75 |
+
$key=$this->getKey($key);
|
76 |
+
$result=$default;
|
77 |
+
if(isset($this->vars[$key])) {
|
78 |
+
$result=$this->vars[$key];
|
79 |
+
}
|
80 |
+
return $result;
|
81 |
+
}
|
82 |
+
protected function setRequest($key, $value) {
|
83 |
+
$key=$this->getKey($key);
|
84 |
+
$this->vars[$key]=$value;
|
85 |
+
}
|
86 |
+
|
87 |
+
//ShowWhatsNew
|
88 |
+
public function isShowWhatsNew() {
|
89 |
+
return $this->getOption('ShowWhatsNew', FALSE);
|
90 |
+
}
|
91 |
+
public function setShowWhatsNew($value) {
|
92 |
+
$this->setOption('ShowWhatsNew', $value);
|
93 |
+
}
|
94 |
+
|
95 |
+
//TrackingEnable
|
96 |
+
public function isTrackingEnable() {
|
97 |
+
return $this->getOption('TrackingEnable', 0);
|
98 |
+
}
|
99 |
+
public function setTrackingEnable($value) {
|
100 |
+
$this->setOption('TrackingEnable', $value);
|
101 |
+
}
|
102 |
+
//TrackingNotice
|
103 |
+
public function isTrackingNotice() {
|
104 |
+
return $this->getOption('TrackingNotice', 1);
|
105 |
+
}
|
106 |
+
public function setTrackingNotice($value) {
|
107 |
+
$this->setOption('TrackingNotice', $value);
|
108 |
+
}
|
109 |
+
|
110 |
+
public function isActive() {
|
111 |
+
return $this->getOption('Active', 0);
|
112 |
+
}
|
113 |
+
public function setActive($value) {
|
114 |
+
$this->setOption('Active', $value);
|
115 |
+
}
|
116 |
+
|
117 |
+
public function getTrackingLastSend() {
|
118 |
+
return $this->getOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', 0);
|
119 |
+
}
|
120 |
+
public function setTrackingLastSend($value) {
|
121 |
+
$this->setOption('TrackingLastSend['.IRP_PLUGIN_SLUG.']', $value);
|
122 |
+
}
|
123 |
+
public function getPluginInstallDate() {
|
124 |
+
return $this->getOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', 0);
|
125 |
+
}
|
126 |
+
public function setPluginInstallDate($value) {
|
127 |
+
$this->setOption('PluginInstallDate['.IRP_PLUGIN_SLUG.']', $value);
|
128 |
+
}
|
129 |
+
public function getPluginUpdateDate() {
|
130 |
+
return $this->getOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', 0);
|
131 |
+
}
|
132 |
+
public function setPluginUpdateDate($value) {
|
133 |
+
$this->setOption('PluginUpdateDate['.IRP_PLUGIN_SLUG.']', $value);
|
134 |
+
}
|
135 |
+
|
136 |
+
public function isPluginFirstInstall() {
|
137 |
+
return $this->getOption('PluginFirstInstall', FALSE);
|
138 |
+
}
|
139 |
+
public function setPluginFirstInstall($value) {
|
140 |
+
$this->setOption('PluginFirstInstall', $value);
|
141 |
+
}
|
142 |
+
public function isShowActivationNotice() {
|
143 |
+
return $this->getOption('ShowActivationNotice', FALSE);
|
144 |
+
}
|
145 |
+
public function setShowActivationNotice($value) {
|
146 |
+
$this->setOption('ShowActivationNotice', $value);
|
147 |
+
}
|
148 |
+
|
149 |
+
//LoggerEnable
|
150 |
+
public function isLoggerEnable() {
|
151 |
+
return ($this->getOption('LoggerEnable', FALSE) || (defined('IRP_LOGGER') && IRP_LOGGER));
|
152 |
+
}
|
153 |
+
public function setLoggerEnable($value) {
|
154 |
+
$this->setOption('LoggerEnable', $value);
|
155 |
+
}
|
156 |
+
|
157 |
+
//Cache
|
158 |
+
public function getCache($name, $id) {
|
159 |
+
return $this->getRequest('Cache_'.$name.'_'.$id);
|
160 |
+
}
|
161 |
+
public function setCache($name, $id, $value) {
|
162 |
+
$this->setRequest('Cache_'.$name.'_'.$id, $value);
|
163 |
+
}
|
164 |
+
|
165 |
+
public function getFeedbackEmail() {
|
166 |
+
return $this->getOption('FeedbackEmail', get_bloginfo('admin_email'));
|
167 |
+
}
|
168 |
+
public function setFeedbackEmail($value) {
|
169 |
+
$this->setOption('FeedbackEmail', $value);
|
170 |
+
}
|
171 |
+
|
172 |
+
private function hasGenericMessages($type) {
|
173 |
+
$result=$this->getRequest($type.'Messages', NULL);
|
174 |
+
return (is_array($result) && count($result)>0);
|
175 |
+
}
|
176 |
+
|
177 |
+
private function pushGenericMessage($type, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
178 |
+
global $irp;
|
179 |
+
$array=$this->getRequest($type.'Messages', array());
|
180 |
+
$array[]=$irp->Lang->L($message, $v1, $v2, $v3, $v4, $v5);
|
181 |
+
$this->setRequest($type.'Messages', $array);
|
182 |
+
}
|
183 |
+
private function writeGenericMessages($type, $clean=TRUE) {
|
184 |
+
$result=FALSE;
|
185 |
+
$array=$this->getRequest($type.'Messages', array());
|
186 |
+
if(is_array($array) && count($array)>0) {
|
187 |
+
$result=TRUE;
|
188 |
+
?>
|
189 |
+
<div class="irp-box-<?php echo strtolower($type)?>"><?php echo wpautop(implode("\n", $array)); ?></div>
|
190 |
+
<?php }
|
191 |
+
if($clean) {
|
192 |
+
$this->removeRequest($type.'Messages');
|
193 |
+
}
|
194 |
+
return $result;
|
195 |
+
}
|
196 |
+
//WarningMessages
|
197 |
+
public function hasWarningMessages() {
|
198 |
+
return $this->hasGenericMessages('Warning');
|
199 |
+
}
|
200 |
+
public function pushWarningMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
201 |
+
return $this->pushGenericMessage('Warning', $message, $v1, $v2, $v3, $v4, $v5);
|
202 |
+
}
|
203 |
+
public function writeWarningMessages($clean=TRUE) {
|
204 |
+
return $this->writeGenericMessages('Warning', $clean);
|
205 |
+
}
|
206 |
+
//SuccessMessages
|
207 |
+
public function hasSuccessMessages() {
|
208 |
+
return $this->hasGenericMessages('Success');
|
209 |
+
}
|
210 |
+
public function pushSuccessMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
211 |
+
return $this->pushGenericMessage('Success', $message, $v1, $v2, $v3, $v4, $v5);
|
212 |
+
}
|
213 |
+
public function writeSuccessMessages($clean=TRUE) {
|
214 |
+
return $this->writeGenericMessages('Success', $clean);
|
215 |
+
}
|
216 |
+
//InfoMessages
|
217 |
+
public function hasInfoMessages() {
|
218 |
+
return $this->hasGenericMessages('Info');
|
219 |
+
}
|
220 |
+
public function pushInfoMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
221 |
+
return $this->pushGenericMessage('Info', $message, $v1, $v2, $v3, $v4, $v5);
|
222 |
+
}
|
223 |
+
public function writeInfoMessages($clean=TRUE) {
|
224 |
+
return $this->writeGenericMessages('Info', $clean);
|
225 |
+
}
|
226 |
+
//ErrorMessages
|
227 |
+
public function hasErrorMessages() {
|
228 |
+
return $this->hasGenericMessages('Error');
|
229 |
+
}
|
230 |
+
public function pushErrorMessage($message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
231 |
+
return $this->pushGenericMessage('Error', $message, $v1, $v2, $v3, $v4, $v5);
|
232 |
+
}
|
233 |
+
public function writeErrorMessages($clean=TRUE) {
|
234 |
+
return $this->writeGenericMessages('Error', $clean);
|
235 |
+
}
|
236 |
+
|
237 |
+
public function writeMessages($clean=TRUE) {
|
238 |
+
$result=FALSE;
|
239 |
+
if($this->writeInfoMessages($clean)) {
|
240 |
+
$result=TRUE;
|
241 |
+
}
|
242 |
+
if($this->writeSuccessMessages($clean)) {
|
243 |
+
$result=TRUE;
|
244 |
+
}
|
245 |
+
if($this->writeWarningMessages($clean)) {
|
246 |
+
$result=TRUE;
|
247 |
+
}
|
248 |
+
if($this->writeErrorMessages($clean)) {
|
249 |
+
$result=TRUE;
|
250 |
+
}
|
251 |
+
|
252 |
+
return $result;
|
253 |
+
}
|
254 |
+
public function pushMessage($success, $message, $v1=NULL, $v2=NULL, $v3=NULL, $v4=NULL, $v5=NULL) {
|
255 |
+
if($success) {
|
256 |
+
$this->pushSuccessMessage($message.'Success', $v1, $v2, $v3, $v4, $v5);
|
257 |
+
} else {
|
258 |
+
$this->pushErrorMessage($message.'Error', $v1, $v2, $v3, $v4, $v5);
|
259 |
+
}
|
260 |
+
}
|
261 |
}
|
includes/classes/utils/Plugin.php
CHANGED
@@ -1,263 +1,263 @@
|
|
1 |
-
<?php
|
2 |
-
if (!defined('ABSPATH')) exit;
|
3 |
-
|
4 |
-
define('IRP_PLUGINS_NO_PLUGINS', 10000);
|
5 |
-
define('IRP_PLUGINS_WOOCOMMERCE', 10001);
|
6 |
-
define('IRP_PLUGINS_EDD', 10002);
|
7 |
-
define('IRP_PLUGINS_WP_ECOMMERCE', 10003);
|
8 |
-
define('IRP_PLUGINS_WP_SPSC', 10004);
|
9 |
-
define('IRP_PLUGINS_S2MEMBER', 10005);
|
10 |
-
define('IRP_PLUGINS_MEMBERS', 10006);
|
11 |
-
define('IRP_PLUGINS_CART66', 10007);
|
12 |
-
define('IRP_PLUGINS_ESHOP', 10008);
|
13 |
-
define('IRP_PLUGINS_JIGOSHOP', 10009);
|
14 |
-
define('IRP_PLUGINS_MARKETPRESS', 10010);
|
15 |
-
define('IRP_PLUGINS_SHOPP', 10011);
|
16 |
-
define('IRP_PLUGINS_SIMPLE_WP_ECOMMERCE', 10012);
|
17 |
-
define('IRP_PLUGINS_CF7', 10013);
|
18 |
-
define('IRP_PLUGINS_GRAVITY', 10014);
|
19 |
-
define('IRP_PLUGINS_TRACKING_CODE_MANAGER', 10015);
|
20 |
-
define('IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO', 10016);
|
21 |
-
define('IRP_PLUGINS_INTELLY_RELATED_POSTS', 10017);
|
22 |
-
define('IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO', 10018);
|
23 |
-
|
24 |
-
class IRP_Plugin {
|
25 |
-
function __construct() {
|
26 |
-
}
|
27 |
-
|
28 |
-
function getName($pluginId) {
|
29 |
-
$result='';
|
30 |
-
switch ($pluginId) {
|
31 |
-
case IRP_PLUGINS_WOOCOMMERCE:
|
32 |
-
$result='WooCommerce';
|
33 |
-
break;
|
34 |
-
case IRP_PLUGINS_EDD:
|
35 |
-
$result='Easy Digital Download';
|
36 |
-
break;
|
37 |
-
case IRP_PLUGINS_WP_ECOMMERCE:
|
38 |
-
$result='WP eCommerce';
|
39 |
-
break;
|
40 |
-
case IRP_PLUGINS_WP_SPSC:
|
41 |
-
$result='WordPress Simple Paypal Shopping Cart';
|
42 |
-
break;
|
43 |
-
case IRP_PLUGINS_S2MEMBER:
|
44 |
-
$result='s2member';
|
45 |
-
break;
|
46 |
-
case IRP_PLUGINS_MEMBERS:
|
47 |
-
$result='Members';
|
48 |
-
break;
|
49 |
-
case IRP_PLUGINS_CART66:
|
50 |
-
$result='Cart66 Lite :: WordPress Ecommerce';
|
51 |
-
break;
|
52 |
-
case IRP_PLUGINS_ESHOP:
|
53 |
-
$result='eShop';
|
54 |
-
break;
|
55 |
-
case IRP_PLUGINS_JIGOSHOP:
|
56 |
-
$result='Jigoshop';
|
57 |
-
break;
|
58 |
-
case IRP_PLUGINS_MARKETPRESS:
|
59 |
-
$result='MarketPress - WordPress eCommerce';
|
60 |
-
break;
|
61 |
-
case IRP_PLUGINS_SHOPP:
|
62 |
-
$result='Shopp';
|
63 |
-
break;
|
64 |
-
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
65 |
-
$result='iThemes Exchange: Simple WP Ecommerce';
|
66 |
-
break;
|
67 |
-
case IRP_PLUGINS_CF7:
|
68 |
-
$result='Contact Form 7';
|
69 |
-
break;
|
70 |
-
case IRP_PLUGINS_GRAVITY:
|
71 |
-
$result='Gravity Form';
|
72 |
-
break;
|
73 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
74 |
-
$result='Tracking Code Manager';
|
75 |
-
break;
|
76 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
77 |
-
$result='Tracking Code Manager PRO';
|
78 |
-
break;
|
79 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
80 |
-
$result='Inline Related Posts';
|
81 |
-
break;
|
82 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
83 |
-
$result='Inline Related Posts PRO';
|
84 |
-
break;
|
85 |
-
}
|
86 |
-
return $result;
|
87 |
-
}
|
88 |
-
function isActive($pluginId) {
|
89 |
-
global $tcm;
|
90 |
-
|
91 |
-
$php='';
|
92 |
-
$class='';
|
93 |
-
$constant='';
|
94 |
-
switch ($pluginId) {
|
95 |
-
case IRP_PLUGINS_WOOCOMMERCE:
|
96 |
-
$php='woocommerce/woocommerce.php';
|
97 |
-
$class='WooCommerce';
|
98 |
-
$constant='WOOCOMMERCE_VERSION';
|
99 |
-
break;
|
100 |
-
case IRP_PLUGINS_EDD:
|
101 |
-
$php='easy-digital-downloads/easy-digital-downloads.php';
|
102 |
-
$class='Easy_Digital_Downloads';
|
103 |
-
$constant='EDD_SL_VERSION';
|
104 |
-
break;
|
105 |
-
case IRP_PLUGINS_WP_ECOMMERCE:
|
106 |
-
$class='WP_eCommerce';
|
107 |
-
$constant='WPSC_VERSION';
|
108 |
-
break;
|
109 |
-
case IRP_PLUGINS_WP_SPSC:
|
110 |
-
$constant='WP_CART_VERSION';
|
111 |
-
break;
|
112 |
-
case IRP_PLUGINS_S2MEMBER:
|
113 |
-
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
114 |
-
break;
|
115 |
-
case IRP_PLUGINS_MEMBERS:
|
116 |
-
$constant='MEMBERS_VERSION';
|
117 |
-
break;
|
118 |
-
case IRP_PLUGINS_CART66:
|
119 |
-
$class='Cart66';
|
120 |
-
$constant='CART66_VERSION_NUMBER';
|
121 |
-
break;
|
122 |
-
case IRP_PLUGINS_ESHOP:
|
123 |
-
$constant='ESHOP_VERSION';
|
124 |
-
break;
|
125 |
-
case IRP_PLUGINS_JIGOSHOP:
|
126 |
-
$constant='JIGOSHOP_VERSION';
|
127 |
-
break;
|
128 |
-
case IRP_PLUGINS_MARKETPRESS:
|
129 |
-
$class='MarketPress';
|
130 |
-
$constant='MP_LITE';
|
131 |
-
break;
|
132 |
-
case IRP_PLUGINS_SHOPP:
|
133 |
-
$constant='ESHOP_VERSION';
|
134 |
-
break;
|
135 |
-
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
136 |
-
$class='IT_Exchange';
|
137 |
-
$constant='';
|
138 |
-
break;
|
139 |
-
case IRP_PLUGINS_CF7:
|
140 |
-
$constant='WPCF7_VERSION';
|
141 |
-
break;
|
142 |
-
case IRP_PLUGINS_GRAVITY:
|
143 |
-
$constant='';
|
144 |
-
break;
|
145 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
146 |
-
$constant='TCM_PLUGIN_VERSION';
|
147 |
-
break;
|
148 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
149 |
-
$constant='TCMP_PLUGIN_VERSION';
|
150 |
-
break;
|
151 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
152 |
-
$constant='IRP_PLUGIN_VERSION';
|
153 |
-
break;
|
154 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
155 |
-
$constant='IRPP_PLUGIN_VERSION';
|
156 |
-
break;
|
157 |
-
}
|
158 |
-
$result=$this->isPluginActive($class, $constant, $php);
|
159 |
-
return $result;
|
160 |
-
}
|
161 |
-
|
162 |
-
private function isPluginActive($class='', $constant='', $plugin='') {
|
163 |
-
$result=FALSE;
|
164 |
-
$result=($result || ($class!='' && class_exists($class)));
|
165 |
-
$result=($result || ($constant!='' && defined($constant)));
|
166 |
-
//require plugin.php
|
167 |
-
//$result=($result || ($plugin!='' && is_plugin_active($plugin)));
|
168 |
-
return $result;
|
169 |
-
}
|
170 |
-
|
171 |
-
function getVersion($pluginId) {
|
172 |
-
$constant='';
|
173 |
-
$version='';
|
174 |
-
switch ($pluginId) {
|
175 |
-
case IRP_PLUGINS_WOOCOMMERCE:
|
176 |
-
$constant='WOOCOMMERCE_VERSION';
|
177 |
-
break;
|
178 |
-
case IRP_PLUGINS_EDD:
|
179 |
-
$constant='EDD_SL_VERSION';
|
180 |
-
break;
|
181 |
-
case IRP_PLUGINS_WP_ECOMMERCE:
|
182 |
-
$constant='WPSC_VERSION';
|
183 |
-
break;
|
184 |
-
case IRP_PLUGINS_WP_SPSC:
|
185 |
-
$constant='WP_CART_VERSION';
|
186 |
-
break;
|
187 |
-
case IRP_PLUGINS_S2MEMBER:
|
188 |
-
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
189 |
-
break;
|
190 |
-
case IRP_PLUGINS_MEMBERS:
|
191 |
-
$constant='MEMBERS_VERSION';
|
192 |
-
break;
|
193 |
-
case IRP_PLUGINS_CART66:
|
194 |
-
$constant='CART66_VERSION_NUMBER';
|
195 |
-
break;
|
196 |
-
case IRP_PLUGINS_ESHOP:
|
197 |
-
$constant='ESHOP_VERSION';
|
198 |
-
break;
|
199 |
-
case IRP_PLUGINS_JIGOSHOP:
|
200 |
-
$constant='JIGOSHOP_VERSION';
|
201 |
-
break;
|
202 |
-
case IRP_PLUGINS_MARKETPRESS:
|
203 |
-
global $mp;
|
204 |
-
$version=$mp->version;
|
205 |
-
break;
|
206 |
-
case IRP_PLUGINS_SHOPP:
|
207 |
-
$constant='ESHOP_VERSION';
|
208 |
-
break;
|
209 |
-
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
210 |
-
$version=$GLOBALS['it_exchange']['version'];
|
211 |
-
break;
|
212 |
-
case IRP_PLUGINS_CF7:
|
213 |
-
$constant='WPCF7_VERSION';
|
214 |
-
break;
|
215 |
-
case IRP_PLUGINS_GRAVITY:
|
216 |
-
$constant='';
|
217 |
-
break;
|
218 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
219 |
-
$constant='TCM_PLUGIN_VERSION';
|
220 |
-
break;
|
221 |
-
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
222 |
-
$constant='TCMP_PLUGIN_VERSION';
|
223 |
-
break;
|
224 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
225 |
-
$constant='IRP_PLUGIN_VERSION';
|
226 |
-
break;
|
227 |
-
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
228 |
-
$constant='IRPP_PLUGIN_VERSION';
|
229 |
-
break;
|
230 |
-
}
|
231 |
-
if($version=='' && $constant!='') {
|
232 |
-
$version=(defined($constant) ? constant($constant) : '');
|
233 |
-
}
|
234 |
-
return $version;
|
235 |
-
}
|
236 |
-
|
237 |
-
function getActivePlugins($ids) {
|
238 |
-
return $this->getActivePlugins($ids, TRUE);
|
239 |
-
}
|
240 |
-
function getPlugins($ids, $onlyActive=TRUE) {
|
241 |
-
$array=array();
|
242 |
-
if(!is_array($ids)) {
|
243 |
-
$ids=array(intval($ids));
|
244 |
-
}
|
245 |
-
|
246 |
-
foreach($ids as $id) {
|
247 |
-
if(!$onlyActive || $this->isActive($id)) {
|
248 |
-
$name=$this->getName($id);
|
249 |
-
$version=$this->getVersion($id);
|
250 |
-
|
251 |
-
$v=array(
|
252 |
-
'id'=>$id
|
253 |
-
, 'name'=>$name
|
254 |
-
, 'version'=>$version
|
255 |
-
, 'active'=>$this->isActive($id)
|
256 |
-
);
|
257 |
-
$array[$name]=$v;
|
258 |
-
}
|
259 |
-
}
|
260 |
-
ksort($array);
|
261 |
-
return $array;
|
262 |
-
}
|
263 |
-
}
|
1 |
+
<?php
|
2 |
+
if (!defined('ABSPATH')) exit;
|
3 |
+
|
4 |
+
define('IRP_PLUGINS_NO_PLUGINS', 10000);
|
5 |
+
define('IRP_PLUGINS_WOOCOMMERCE', 10001);
|
6 |
+
define('IRP_PLUGINS_EDD', 10002);
|
7 |
+
define('IRP_PLUGINS_WP_ECOMMERCE', 10003);
|
8 |
+
define('IRP_PLUGINS_WP_SPSC', 10004);
|
9 |
+
define('IRP_PLUGINS_S2MEMBER', 10005);
|
10 |
+
define('IRP_PLUGINS_MEMBERS', 10006);
|
11 |
+
define('IRP_PLUGINS_CART66', 10007);
|
12 |
+
define('IRP_PLUGINS_ESHOP', 10008);
|
13 |
+
define('IRP_PLUGINS_JIGOSHOP', 10009);
|
14 |
+
define('IRP_PLUGINS_MARKETPRESS', 10010);
|
15 |
+
define('IRP_PLUGINS_SHOPP', 10011);
|
16 |
+
define('IRP_PLUGINS_SIMPLE_WP_ECOMMERCE', 10012);
|
17 |
+
define('IRP_PLUGINS_CF7', 10013);
|
18 |
+
define('IRP_PLUGINS_GRAVITY', 10014);
|
19 |
+
define('IRP_PLUGINS_TRACKING_CODE_MANAGER', 10015);
|
20 |
+
define('IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO', 10016);
|
21 |
+
define('IRP_PLUGINS_INTELLY_RELATED_POSTS', 10017);
|
22 |
+
define('IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO', 10018);
|
23 |
+
|
24 |
+
class IRP_Plugin {
|
25 |
+
function __construct() {
|
26 |
+
}
|
27 |
+
|
28 |
+
function getName($pluginId) {
|
29 |
+
$result='';
|
30 |
+
switch ($pluginId) {
|
31 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
32 |
+
$result='WooCommerce';
|
33 |
+
break;
|
34 |
+
case IRP_PLUGINS_EDD:
|
35 |
+
$result='Easy Digital Download';
|
36 |
+
break;
|
37 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
38 |
+
$result='WP eCommerce';
|
39 |
+
break;
|
40 |
+
case IRP_PLUGINS_WP_SPSC:
|
41 |
+
$result='WordPress Simple Paypal Shopping Cart';
|
42 |
+
break;
|
43 |
+
case IRP_PLUGINS_S2MEMBER:
|
44 |
+
$result='s2member';
|
45 |
+
break;
|
46 |
+
case IRP_PLUGINS_MEMBERS:
|
47 |
+
$result='Members';
|
48 |
+
break;
|
49 |
+
case IRP_PLUGINS_CART66:
|
50 |
+
$result='Cart66 Lite :: WordPress Ecommerce';
|
51 |
+
break;
|
52 |
+
case IRP_PLUGINS_ESHOP:
|
53 |
+
$result='eShop';
|
54 |
+
break;
|
55 |
+
case IRP_PLUGINS_JIGOSHOP:
|
56 |
+
$result='Jigoshop';
|
57 |
+
break;
|
58 |
+
case IRP_PLUGINS_MARKETPRESS:
|
59 |
+
$result='MarketPress - WordPress eCommerce';
|
60 |
+
break;
|
61 |
+
case IRP_PLUGINS_SHOPP:
|
62 |
+
$result='Shopp';
|
63 |
+
break;
|
64 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
65 |
+
$result='iThemes Exchange: Simple WP Ecommerce';
|
66 |
+
break;
|
67 |
+
case IRP_PLUGINS_CF7:
|
68 |
+
$result='Contact Form 7';
|
69 |
+
break;
|
70 |
+
case IRP_PLUGINS_GRAVITY:
|
71 |
+
$result='Gravity Form';
|
72 |
+
break;
|
73 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
74 |
+
$result='Tracking Code Manager';
|
75 |
+
break;
|
76 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
77 |
+
$result='Tracking Code Manager PRO';
|
78 |
+
break;
|
79 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
80 |
+
$result='Inline Related Posts';
|
81 |
+
break;
|
82 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
83 |
+
$result='Inline Related Posts PRO';
|
84 |
+
break;
|
85 |
+
}
|
86 |
+
return $result;
|
87 |
+
}
|
88 |
+
function isActive($pluginId) {
|
89 |
+
global $tcm;
|
90 |
+
|
91 |
+
$php='';
|
92 |
+
$class='';
|
93 |
+
$constant='';
|
94 |
+
switch ($pluginId) {
|
95 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
96 |
+
$php='woocommerce/woocommerce.php';
|
97 |
+
$class='WooCommerce';
|
98 |
+
$constant='WOOCOMMERCE_VERSION';
|
99 |
+
break;
|
100 |
+
case IRP_PLUGINS_EDD:
|
101 |
+
$php='easy-digital-downloads/easy-digital-downloads.php';
|
102 |
+
$class='Easy_Digital_Downloads';
|
103 |
+
$constant='EDD_SL_VERSION';
|
104 |
+
break;
|
105 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
106 |
+
$class='WP_eCommerce';
|
107 |
+
$constant='WPSC_VERSION';
|
108 |
+
break;
|
109 |
+
case IRP_PLUGINS_WP_SPSC:
|
110 |
+
$constant='WP_CART_VERSION';
|
111 |
+
break;
|
112 |
+
case IRP_PLUGINS_S2MEMBER:
|
113 |
+
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
114 |
+
break;
|
115 |
+
case IRP_PLUGINS_MEMBERS:
|
116 |
+
$constant='MEMBERS_VERSION';
|
117 |
+
break;
|
118 |
+
case IRP_PLUGINS_CART66:
|
119 |
+
$class='Cart66';
|
120 |
+
$constant='CART66_VERSION_NUMBER';
|
121 |
+
break;
|
122 |
+
case IRP_PLUGINS_ESHOP:
|
123 |
+
$constant='ESHOP_VERSION';
|
124 |
+
break;
|
125 |
+
case IRP_PLUGINS_JIGOSHOP:
|
126 |
+
$constant='JIGOSHOP_VERSION';
|
127 |
+
break;
|
128 |
+
case IRP_PLUGINS_MARKETPRESS:
|
129 |
+
$class='MarketPress';
|
130 |
+
$constant='MP_LITE';
|
131 |
+
break;
|
132 |
+
case IRP_PLUGINS_SHOPP:
|
133 |
+
$constant='ESHOP_VERSION';
|
134 |
+
break;
|
135 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
136 |
+
$class='IT_Exchange';
|
137 |
+
$constant='';
|
138 |
+
break;
|
139 |
+
case IRP_PLUGINS_CF7:
|
140 |
+
$constant='WPCF7_VERSION';
|
141 |
+
break;
|
142 |
+
case IRP_PLUGINS_GRAVITY:
|
143 |
+
$constant='';
|
144 |
+
break;
|
145 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
146 |
+
$constant='TCM_PLUGIN_VERSION';
|
147 |
+
break;
|
148 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
149 |
+
$constant='TCMP_PLUGIN_VERSION';
|
150 |
+
break;
|
151 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
152 |
+
$constant='IRP_PLUGIN_VERSION';
|
153 |
+
break;
|
154 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
155 |
+
$constant='IRPP_PLUGIN_VERSION';
|
156 |
+
break;
|
157 |
+
}
|
158 |
+
$result=$this->isPluginActive($class, $constant, $php);
|
159 |
+
return $result;
|
160 |
+
}
|
161 |
+
|
162 |
+
private function isPluginActive($class='', $constant='', $plugin='') {
|
163 |
+
$result=FALSE;
|
164 |
+
$result=($result || ($class!='' && class_exists($class)));
|
165 |
+
$result=($result || ($constant!='' && defined($constant)));
|
166 |
+
//require plugin.php
|
167 |
+
//$result=($result || ($plugin!='' && is_plugin_active($plugin)));
|
168 |
+
return $result;
|
169 |
+
}
|
170 |
+
|
171 |
+
function getVersion($pluginId) {
|
172 |
+
$constant='';
|
173 |
+
$version='';
|
174 |
+
switch ($pluginId) {
|
175 |
+
case IRP_PLUGINS_WOOCOMMERCE:
|
176 |
+
$constant='WOOCOMMERCE_VERSION';
|
177 |
+
break;
|
178 |
+
case IRP_PLUGINS_EDD:
|
179 |
+
$constant='EDD_SL_VERSION';
|
180 |
+
break;
|
181 |
+
case IRP_PLUGINS_WP_ECOMMERCE:
|
182 |
+
$constant='WPSC_VERSION';
|
183 |
+
break;
|
184 |
+
case IRP_PLUGINS_WP_SPSC:
|
185 |
+
$constant='WP_CART_VERSION';
|
186 |
+
break;
|
187 |
+
case IRP_PLUGINS_S2MEMBER:
|
188 |
+
$constant='WS_PLUGIN__S2MEMBER_VERSION';
|
189 |
+
break;
|
190 |
+
case IRP_PLUGINS_MEMBERS:
|
191 |
+
$constant='MEMBERS_VERSION';
|
192 |
+
break;
|
193 |
+
case IRP_PLUGINS_CART66:
|
194 |
+
$constant='CART66_VERSION_NUMBER';
|
195 |
+
break;
|
196 |
+
case IRP_PLUGINS_ESHOP:
|
197 |
+
$constant='ESHOP_VERSION';
|
198 |
+
break;
|
199 |
+
case IRP_PLUGINS_JIGOSHOP:
|
200 |
+
$constant='JIGOSHOP_VERSION';
|
201 |
+
break;
|
202 |
+
case IRP_PLUGINS_MARKETPRESS:
|
203 |
+
global $mp;
|
204 |
+
$version=$mp->version;
|
205 |
+
break;
|
206 |
+
case IRP_PLUGINS_SHOPP:
|
207 |
+
$constant='ESHOP_VERSION';
|
208 |
+
break;
|
209 |
+
case IRP_PLUGINS_SIMPLE_WP_ECOMMERCE:
|
210 |
+
$version=$GLOBALS['it_exchange']['version'];
|
211 |
+
break;
|
212 |
+
case IRP_PLUGINS_CF7:
|
213 |
+
$constant='WPCF7_VERSION';
|
214 |
+
break;
|
215 |
+
case IRP_PLUGINS_GRAVITY:
|
216 |
+
$constant='';
|
217 |
+
break;
|
218 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER:
|
219 |
+
$constant='TCM_PLUGIN_VERSION';
|
220 |
+
break;
|
221 |
+
case IRP_PLUGINS_TRACKING_CODE_MANAGER_PRO:
|
222 |
+
$constant='TCMP_PLUGIN_VERSION';
|
223 |
+
break;
|
224 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS:
|
225 |
+
$constant='IRP_PLUGIN_VERSION';
|
226 |
+
break;
|
227 |
+
case IRP_PLUGINS_INTELLY_RELATED_POSTS_PRO:
|
228 |
+
$constant='IRPP_PLUGIN_VERSION';
|
229 |
+
break;
|
230 |
+
}
|
231 |
+
if($version=='' && $constant!='') {
|
232 |
+
$version=(defined($constant) ? constant($constant) : '');
|
233 |
+
}
|
234 |
+
return $version;
|
235 |
+
}
|
236 |
+
|
237 |
+
function getActivePlugins($ids) {
|
238 |
+
return $this->getActivePlugins($ids, TRUE);
|
239 |
+
}
|
240 |
+
function getPlugins($ids, $onlyActive=TRUE) {
|
241 |
+
$array=array();
|
242 |
+
if(!is_array($ids)) {
|
243 |
+
$ids=array(intval($ids));
|
244 |
+
}
|
245 |
+
|
246 |
+
foreach($ids as $id) {
|
247 |
+
if(!$onlyActive || $this->isActive($id)) {
|
248 |
+
$name=$this->getName($id);
|
249 |
+
$version=$this->getVersion($id);
|
250 |
+
|
251 |
+
$v=array(
|
252 |
+
'id'=>$id
|
253 |
+
, 'name'=>$name
|
254 |
+
, 'version'=>$version
|
255 |
+
, 'active'=>$this->isActive($id)
|
256 |
+
);
|
257 |
+
$array[$name]=$v;
|
258 |
+
}
|
259 |
+
}
|
260 |
+
ksort($array);
|
261 |
+
return $array;
|
262 |
+
}
|
263 |
+
}
|
includes/classes/utils/Tracking.php
CHANGED
@@ -1,191 +1,191 @@
|
|
1 |
-
<?php
|
2 |
-
|
3 |
-
// Exit if accessed directly
|
4 |
-
if (!defined('ABSPATH')) exit;
|
5 |
-
|
6 |
-
/**
|
7 |
-
* Usage tracking
|
8 |
-
*
|
9 |
-
* @access public
|
10 |
-
* @since 1.8.2
|
11 |
-
* @return void
|
12 |
-
*/
|
13 |
-
class IRP_Tracking {
|
14 |
-
|
15 |
-
public function __construct() {
|
16 |
-
//We send once a week (while tracking is allowed) to check in which can be used
|
17 |
-
//to determine active sites
|
18 |
-
add_action('irp_weekly_scheduled_events', array($this, 'sendTracking'));
|
19 |
-
|
20 |
-
//add_action('irp_tracking_on', array($this, 'enableTracking'));
|
21 |
-
//add_action('irp_tracking_off', array($this, 'disableTracking'));
|
22 |
-
//add_action('admin_notices', array($this, 'admin_notice'));
|
23 |
-
}
|
24 |
-
|
25 |
-
private function getThemeData() {
|
26 |
-
$theme_data = wp_get_theme();
|
27 |
-
$theme = array(
|
28 |
-
'name' => $theme_data->display( 'Name', false, false ),
|
29 |
-
'theme_uri' => $theme_data->display( 'ThemeURI', false, false ),
|
30 |
-
'version' => $theme_data->display( 'Version', false, false ),
|
31 |
-
'author' => $theme_data->display( 'Author', false, false ),
|
32 |
-
'author_uri' => $theme_data->display( 'AuthorURI', false, false ),
|
33 |
-
);
|
34 |
-
$theme_template = $theme_data->get_template();
|
35 |
-
if ( $theme_template !== '' && $theme_data->parent() ) {
|
36 |
-
$theme['template'] = array(
|
37 |
-
'version' => $theme_data->parent()->display( 'Version', false, false ),
|
38 |
-
'name' => $theme_data->parent()->display( 'Name', false, false ),
|
39 |
-
'theme_uri' => $theme_data->parent()->display( 'ThemeURI', false, false ),
|
40 |
-
'author' => $theme_data->parent()->display( 'Author', false, false ),
|
41 |
-
'author_uri' => $theme_data->parent()->display( 'AuthorURI', false, false ),
|
42 |
-
);
|
43 |
-
}
|
44 |
-
else {
|
45 |
-
$theme['template'] = '';
|
46 |
-
}
|
47 |
-
unset( $theme_template );
|
48 |
-
return $theme;
|
49 |
-
}
|
50 |
-
private function getPluginData() {
|
51 |
-
//retrieve plugins (active/inactive) list
|
52 |
-
if(!function_exists('get_plugins')) {
|
53 |
-
include ABSPATH . '/wp-admin/includes/plugin.php';
|
54 |
-
}
|
55 |
-
|
56 |
-
$plugins=array();
|
57 |
-
$active_plugin = get_option( 'active_plugins' );
|
58 |
-
foreach ( $active_plugin as $plugin_path ) {
|
59 |
-
if ( ! function_exists( 'get_plugin_data' ) ) {
|
60 |
-
require_once(ABSPATH . 'wp-admin/includes/plugin.php');
|
61 |
-
}
|
62 |
-
|
63 |
-
$plugin_info = get_plugin_data( WP_PLUGIN_DIR . '/' . $plugin_path );
|
64 |
-
|
65 |
-
$slug= str_replace( '/' . basename( $plugin_path ), '', $plugin_path );
|
66 |
-
$plugins[ $slug ] = array(
|
67 |
-
'version' => $plugin_info['Version'],
|
68 |
-
'name' => $plugin_info['Name'],
|
69 |
-
'plugin_uri' => $plugin_info['PluginURI'],
|
70 |
-
'author' => $plugin_info['AuthorName'],
|
71 |
-
'author_uri' => $plugin_info['AuthorURI'],
|
72 |
-
);
|
73 |
-
}
|
74 |
-
unset( $active_plugins, $plugin_path );
|
75 |
-
return $plugins;
|
76 |
-
}
|
77 |
-
//obtain tracking data into an associative array
|
78 |
-
public function getData() {
|
79 |
-
global $irp;
|
80 |
-
|
81 |
-
//retrieve blog info
|
82 |
-
$result['wp_url']=home_url();
|
83 |
-
$result['wp_version']=get_bloginfo('version');
|
84 |
-
$result['wp_language']=get_bloginfo('language');
|
85 |
-
$result['wp_wpurl']=get_bloginfo('wpurl');
|
86 |
-
$result['wp_admin_email']=get_bloginfo('admin_email');
|
87 |
-
|
88 |
-
$result['plugins']=$this->getPluginData();
|
89 |
-
$result['theme']=$this->getThemeData();
|
90 |
-
|
91 |
-
//to obtain for each post type its count
|
92 |
-
$post_types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
93 |
-
$data=array();
|
94 |
-
foreach ($post_types as $v) {
|
95 |
-
$v=$v['name'];
|
96 |
-
$data[$v]=intval(wp_count_posts($v)->publish);
|
97 |
-
}
|
98 |
-
$result['post_types']=$data;
|
99 |
-
|
100 |
-
$data=array(
|
101 |
-
'debug'=>(defined('WP_DEBUG') && WP_DEBUG)
|
102 |
-
, 'maxTime'=>$irp->Options->getMaxExecutionTime()
|
103 |
-
, 'active'=>$irp->Options->isActive()
|
104 |
-
, 'engineSearch'=>$irp->Options->getEngineSearch()
|
105 |
-
, 'rewriteAtEnd'=>$irp->Options->isRewriteAtEnd()
|
106 |
-
, 'rewriteThresold'=>$irp->Options->getRewriteThreshold()
|
107 |
-
, 'rewriteBoxesCount'=>$irp->Options->getRewriteBoxesCount()
|
108 |
-
, 'rewriteActive'=>$irp->Options->isRewriteActive()
|
109 |
-
, 'metaboxPostTypes'=>$irp->Options->getMetaboxPostTypes()
|
110 |
-
, 'rewritePostTypes'=>$irp->Options->getRewritePostTypes()
|
111 |
-
);
|
112 |
-
$data=$irp->Utils->parseArgs($irp->Options->getTemplateStyle(), $data);
|
113 |
-
$result['iwpm_plugin_name']=IRP_PLUGIN_SLUG;
|
114 |
-
$result['iwpm_plugin_version']=IRP_PLUGIN_VERSION;
|
115 |
-
$result['iwpm_plugin_data']=$data;
|
116 |
-
$result['iwpm_plugin_install_date']=$irp->Options->getPluginInstallDate();
|
117 |
-
$result['iwpm_plugin_update_date']=$irp->Options->getPluginUpdateDate();
|
118 |
-
|
119 |
-
$result['iwpm_tracking_enable']=$irp->Options->isTrackingEnable();
|
120 |
-
$result['iwpm_logger_enable']=$irp->Options->isLoggerEnable();
|
121 |
-
$result['iwpm_feedback_email']=$irp->Options->getFeedbackEmail();
|
122 |
-
|
123 |
-
return $result;
|
124 |
-
}
|
125 |
-
|
126 |
-
//send tracking data info to our server
|
127 |
-
public function sendTracking($override = FALSE) {
|
128 |
-
global $irp;
|
129 |
-
|
130 |
-
$result=-1;
|
131 |
-
if(!$override && !$irp->Options->isTrackingEnable())
|
132 |
-
return $result;
|
133 |
-
|
134 |
-
// Send a maximum of once per week
|
135 |
-
$last_send=$irp->Options->getTrackingLastSend();
|
136 |
-
if(!$override && $last_send>strtotime('-1 week'))
|
137 |
-
return $result;
|
138 |
-
|
139 |
-
//add_filter('https_local_ssl_verify', '__return_false');
|
140 |
-
//add_filter('https_ssl_verify', '__return_false');
|
141 |
-
//add_filter('block_local_requests', '__return_false');
|
142 |
-
$data=$irp->Utils->remotePost('usage', $this->getData());
|
143 |
-
if($data) {
|
144 |
-
$result=intval($data['id']);
|
145 |
-
$irp->Options->setTrackingLastSend(time());
|
146 |
-
}
|
147 |
-
return $result;
|
148 |
-
}
|
149 |
-
|
150 |
-
public function enableTracking() {
|
151 |
-
global $irp;
|
152 |
-
|
153 |
-
$irp->Options->setTrackingEnable(TRUE);
|
154 |
-
$irp->Options->setTrackingNotice(FALSE);
|
155 |
-
$this->sendTracking(TRUE);
|
156 |
-
}
|
157 |
-
public function disableTracking() {
|
158 |
-
global $irp;
|
159 |
-
|
160 |
-
$irp->Options->setTrackingEnable(FALSE);
|
161 |
-
$irp->Options->setTrackingNotice(FALSE);
|
162 |
-
$this->sendTracking(TRUE);
|
163 |
-
}
|
164 |
-
|
165 |
-
public function admin_notice() {
|
166 |
-
global $irp;
|
167 |
-
|
168 |
-
if(!$irp->Options->isTrackingNotice() || $irp->Options->isTrackingEnable() || !current_user_can('manage_options'))
|
169 |
-
return;
|
170 |
-
|
171 |
-
if(FALSE && (
|
172 |
-
stristr(network_site_url('/'), 'dev' ) !== false ||
|
173 |
-
stristr(network_site_url('/'), 'localhost') !== false ||
|
174 |
-
stristr(network_site_url('/'), ':8888' ) !== false // This is common with MAMP on OS X
|
175 |
-
)) {
|
176 |
-
$irp->Options->setTrackingNotice(TRUE);
|
177 |
-
} else {
|
178 |
-
|
179 |
-
$no_url=add_query_arg('irp_action', 'manager_trackingOff');
|
180 |
-
|
181 |
-
?>
|
182 |
-
<div class="updated">
|
183 |
-
<p>
|
184 |
-
<?php $irp->Lang->P('Allow IntellyWP to track plugin usage?');?>
|
185 |
-
<a href="<?php echo esc_url($yes_url)?>" class="button-primary"><?php $irp->Lang->P('Oh yes :)')?></a>
|
186 |
-
<a href="<?php echo esc_url($no_url)?>" class="button-secondary"><?php $irp->Lang->P('Refuse!')?></a>
|
187 |
-
</p>
|
188 |
-
</div>
|
189 |
-
<?php }
|
190 |
-
}
|
1 |
+
<?php
|
2 |
+
|
3 |
+
// Exit if accessed directly
|
4 |
+
if (!defined('ABSPATH')) exit;
|
5 |
+
|
6 |
+
/**
|
7 |
+
* Usage tracking
|
8 |
+
*
|
9 |
+
* @access public
|
10 |
+
* @since 1.8.2
|
11 |
+
* @return void
|
12 |
+
*/
|
13 |
+
class IRP_Tracking {
|
14 |
+
|
15 |
+
public function __construct() {
|
16 |
+
//We send once a week (while tracking is allowed) to check in which can be used
|
17 |
+
//to determine active sites
|
18 |
+
add_action('irp_weekly_scheduled_events', array($this, 'sendTracking'));
|
19 |
+
|
20 |
+
//add_action('irp_tracking_on', array($this, 'enableTracking'));
|
21 |
+
//add_action('irp_tracking_off', array($this, 'disableTracking'));
|
22 |
+
//add_action('admin_notices', array($this, 'admin_notice'));
|
23 |
+
}
|
24 |
+
|
25 |
+
private function getThemeData() {
|
26 |
+
$theme_data = wp_get_theme();
|
27 |
+
$theme = array(
|
28 |
+
'name' => $theme_data->display( 'Name', false, false ),
|
29 |
+
'theme_uri' => $theme_data->display( 'ThemeURI', false, false ),
|
30 |
+
'version' => $theme_data->display( 'Version', false, false ),
|
31 |
+
'author' => $theme_data->display( 'Author', false, false ),
|
32 |
+
'author_uri' => $theme_data->display( 'AuthorURI', false, false ),
|
33 |
+
);
|
34 |
+
$theme_template = $theme_data->get_template();
|
35 |
+
if ( $theme_template !== '' && $theme_data->parent() ) {
|
36 |
+
$theme['template'] = array(
|
37 |
+
'version' => $theme_data->parent()->display( 'Version', false, false ),
|
38 |
+
'name' => $theme_data->parent()->display( 'Name', false, false ),
|
39 |
+
'theme_uri' => $theme_data->parent()->display( 'ThemeURI', false, false ),
|
40 |
+
'author' => $theme_data->parent()->display( 'Author', false, false ),
|
41 |
+
'author_uri' => $theme_data->parent()->display( 'AuthorURI', false, false ),
|
42 |
+
);
|
43 |
+
}
|
44 |
+
else {
|
45 |
+
$theme['template'] = '';
|
46 |
+
}
|
47 |
+
unset( $theme_template );
|
48 |
+
return $theme;
|
49 |
+
}
|
50 |
+
private function getPluginData() {
|
51 |
+
//retrieve plugins (active/inactive) list
|
52 |
+
if(!function_exists('get_plugins')) {
|
53 |
+
include ABSPATH . '/wp-admin/includes/plugin.php';
|
54 |
+
}
|
55 |
+
|
56 |
+
$plugins=array();
|
57 |
+
$active_plugin = get_option( 'active_plugins' );
|
58 |
+
foreach ( $active_plugin as $plugin_path ) {
|
59 |
+
if ( ! function_exists( 'get_plugin_data' ) ) {
|
60 |
+
require_once(ABSPATH . 'wp-admin/includes/plugin.php');
|
61 |
+
}
|
62 |
+
|
63 |
+
$plugin_info = get_plugin_data( WP_PLUGIN_DIR . '/' . $plugin_path );
|
64 |
+
|
65 |
+
$slug= str_replace( '/' . basename( $plugin_path ), '', $plugin_path );
|
66 |
+
$plugins[ $slug ] = array(
|
67 |
+
'version' => $plugin_info['Version'],
|
68 |
+
'name' => $plugin_info['Name'],
|
69 |
+
'plugin_uri' => $plugin_info['PluginURI'],
|
70 |
+
'author' => $plugin_info['AuthorName'],
|
71 |
+
'author_uri' => $plugin_info['AuthorURI'],
|
72 |
+
);
|
73 |
+
}
|
74 |
+
unset( $active_plugins, $plugin_path );
|
75 |
+
return $plugins;
|
76 |
+
}
|
77 |
+
//obtain tracking data into an associative array
|
78 |
+
public function getData() {
|
79 |
+
global $irp;
|
80 |
+
|
81 |
+
//retrieve blog info
|
82 |
+
$result['wp_url']=home_url();
|
83 |
+
$result['wp_version']=get_bloginfo('version');
|
84 |
+
$result['wp_language']=get_bloginfo('language');
|
85 |
+
$result['wp_wpurl']=get_bloginfo('wpurl');
|
86 |
+
$result['wp_admin_email']=get_bloginfo('admin_email');
|
87 |
+
|
88 |
+
$result['plugins']=$this->getPluginData();
|
89 |
+
$result['theme']=$this->getThemeData();
|
90 |
+
|
91 |
+
//to obtain for each post type its count
|
92 |
+
$post_types=$irp->Utils->query(IRP_QUERY_POST_TYPES);
|
93 |
+
$data=array();
|
94 |
+
foreach ($post_types as $v) {
|
95 |
+
$v=$v['name'];
|
96 |
+
$data[$v]=intval(wp_count_posts($v)->publish);
|
97 |
+
}
|
98 |
+
$result['post_types']=$data;
|
99 |
+
|
100 |
+
$data=array(
|
101 |
+
'debug'=>(defined('WP_DEBUG') && WP_DEBUG)
|
102 |
+
, 'maxTime'=>$irp->Options->getMaxExecutionTime()
|
103 |
+
, 'active'=>$irp->Options->isActive()
|
104 |
+
, 'engineSearch'=>$irp->Options->getEngineSearch()
|
105 |
+
, 'rewriteAtEnd'=>$irp->Options->isRewriteAtEnd()
|
106 |
+
, 'rewriteThresold'=>$irp->Options->getRewriteThreshold()
|
107 |
+
, 'rewriteBoxesCount'=>$irp->Options->getRewriteBoxesCount()
|
108 |
+
, 'rewriteActive'=>$irp->Options->isRewriteActive()
|
109 |
+
, 'metaboxPostTypes'=>$irp->Options->getMetaboxPostTypes()
|
110 |
+
, 'rewritePostTypes'=>$irp->Options->getRewritePostTypes()
|
111 |
+
);
|
112 |
+
$data=$irp->Utils->parseArgs($irp->Options->getTemplateStyle(), $data);
|
113 |
+
$result['iwpm_plugin_name']=IRP_PLUGIN_SLUG;
|
114 |
+
$result['iwpm_plugin_version']=IRP_PLUGIN_VERSION;
|
115 |
+
$result['iwpm_plugin_data']=$data;
|
116 |
+
$result['iwpm_plugin_install_date']=$irp->Options->getPluginInstallDate();
|
117 |
+
$result['iwpm_plugin_update_date']=$irp->Options->getPluginUpdateDate();
|
118 |
+
|
119 |
+
$result['iwpm_tracking_enable']=$irp->Options->isTrackingEnable();
|
120 |
+
$result['iwpm_logger_enable']=$irp->Options->isLoggerEnable();
|
121 |
+
$result['iwpm_feedback_email']=$irp->Options->getFeedbackEmail();
|
122 |
+
|
123 |
+
return $result;
|
124 |
+
}
|
125 |
+
|
126 |
+
//send tracking data info to our server
|
127 |
+
public function sendTracking($override = FALSE) {
|
128 |
+
global $irp;
|
129 |
+
|
130 |
+
$result=-1;
|
131 |
+
if(!$override && !$irp->Options->isTrackingEnable())
|
132 |
+
return $result;
|
133 |
+
|
134 |
+
// Send a maximum of once per week
|
135 |
+
$last_send=$irp->Options->getTrackingLastSend();
|
136 |
+
if(!$override && $last_send>strtotime('-1 week'))
|
137 |
+
return $result;
|
138 |
+
|
139 |
+
//add_filter('https_local_ssl_verify', '__return_false');
|
140 |
+
//add_filter('https_ssl_verify', '__return_false');
|
141 |
+
//add_filter('block_local_requests', '__return_false');
|
142 |
+
$data=$irp->Utils->remotePost('usage', $this->getData());
|
143 |
+
if($data) {
|
144 |
+
$result=intval($data['id']);
|
145 |
+
$irp->Options->setTrackingLastSend(time());
|
146 |
+
}
|
147 |
+
return $result;
|
148 |
+
}
|
149 |
+
|
150 |
+
public function enableTracking() {
|
151 |
+
global $irp;
|
152 |
+
|
153 |
+
$irp->Options->setTrackingEnable(TRUE);
|
154 |
+
$irp->Options->setTrackingNotice(FALSE);
|
155 |
+
$this->sendTracking(TRUE);
|
156 |
+
}
|
157 |
+
public function disableTracking() {
|
158 |
+
global $irp;
|
159 |
+
|
160 |
+
$irp->Options->setTrackingEnable(FALSE);
|
161 |
+
$irp->Options->setTrackingNotice(FALSE);
|
162 |
+
$this->sendTracking(TRUE);
|
163 |
+
}
|
164 |
+
|
165 |
+
public function admin_notice() {
|
166 |
+
global $irp;
|
167 |
+
|
168 |
+
if(!$irp->Options->isTrackingNotice() || $irp->Options->isTrackingEnable() || !current_user_can('manage_options'))
|
169 |
+
return;
|
170 |
+
|
171 |
+
if(FALSE && (
|
172 |
+
stristr(network_site_url('/'), 'dev' ) !== false ||
|
173 |
+
stristr(network_site_url('/'), 'localhost') !== false ||
|
174 |
+
stristr(network_site_url('/'), ':8888' ) !== false // This is common with MAMP on OS X
|
175 |
+
)) {
|
176 |
+
$irp->Options->setTrackingNotice(TRUE);
|
177 |
+
} else {
|
178 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|