Version Description
- Added Google Analytics Custom Event Tracking for form submissions
- Added Ability: automatically sort leads into lists on form completions
- Added Ability: Send lead notification emails to multiple people. Use comma separated values
- Improved Social Media Buttons called with lp_social_media() function
- Fixed qTranslate plugin bug
- Fixed Genesis Title tag conflict
- Added improved asset loader
- Updated main docs.inboundnow.com site. Check it out!
Download this release
Release Info
| Developer | DavidWells |
| Plugin |  WordPress Landing Pages |
| Version | 1.4.8 |
| Comparing to | |
| See all releases | |
Code changes from version 1.4.7 to 1.4.8
- css/admin-style.css +13 -7
- css/new-customizer-admin.css +2 -5
- js/admin/admin.post-edit.js +110 -91
- js/admin/admin.post-new.js +4 -0
- landing-pages.php +10 -4
- modules/module.ab-testing.metaboxes.php +1 -1
- modules/module.activate.php +15 -19
- modules/module.ajax-setup.php +1 -1
- modules/module.global-settings.php +2 -2
- modules/module.javascript-admin.php +8 -20
- modules/module.javascript-frontend.php +25 -77
- modules/module.metaboxes.php +1 -1
- modules/module.post-type.php +7 -43
- modules/module.redirect-ab-testing.php +8 -2
- modules/module.templates.php +1 -1
- modules/module.track.php +1 -1
- modules/module.track.php.orig +1 -0
- modules/module.utils.php +39 -27
- modules/module.welcome.php +3 -3
- modules/module.widgets.php +4 -4
- readme.txt +16 -2
- shared/.SyncIgnore +22 -12
- shared/assets/admin/css/global-inbound-admin.css +136 -0
- shared/assets/admin/images/inbound-now-logo.png +0 -0
- shared/assets/admin/js/select2.js +3137 -0
- shared/assets/admin/js/select2.min.js +22 -0
- shared/assets/assets.loader.class.php +148 -0
- shared/assets/frontend/js/page-tracking.js +508 -0
- shared/assets/frontend/js/store.lead.ajax.js +495 -0
- shared/assets/global/fonts/fontawesome/FontAwesome.otf +0 -0
- shared/assets/global/fonts/fontawesome/README.md +17 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot +0 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot~HEAD +0 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.svg +414 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.svg~HEAD +414 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.ttf +0 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.ttf~HEAD +0 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.woff +0 -0
- shared/assets/global/fonts/fontawesome/fontawesome-webfont.woff~HEAD +0 -0
- shared/assets/global/images/leads.png +0 -0
- shared/assets/global/images/shortcodes-blue.png +0 -0
- shared/assets/global/js/jquery.cookie.js +1 -0
- shared/assets/global/js/jquery.total-storage.min.js +22 -0
- shared/assets/readme.txt +7 -0
- shared/classes/chart.class.php +290 -290
- shared/classes/compatibility.class.php +133 -133
- shared/classes/debug.class.php +382 -378
- shared/classes/feedback.class.php +380 -380
- shared/classes/form.class.php +24 -8
- shared/classes/js/debug.js +36 -36
- shared/classes/js/inbound-dequeue-scripts.js +49 -49
- shared/classes/menu.class.php +661 -784
- shared/functions.templates.php +110 -110
- shared/functions/global.leads.cpt.php +221 -0
- shared/functions/global.shared.functions.php +209 -0
- shared/inbound-shortcodes/css/form-cpt.css +133 -133
- shared/inbound-shortcodes/css/frontend-render.css +965 -1065
css/admin-style.css
CHANGED
|
@@ -25,13 +25,16 @@
|
|
| 25 |
padding-top: 5px;
|
| 26 |
padding-left: 10px;
|
| 27 |
|
|
|
|
|
|
|
|
|
|
| 28 |
}
|
| 29 |
@font-face {
|
| 30 |
font-family: 'FontAwesome';
|
| 31 |
-
src: url('../shared/fonts/fontawesome/fontawesome-webfont.eot?v=3.0.2');
|
| 32 |
-
src: url('../shared/fonts/fontawesome/fontawesome-webfont.eot?#iefix&v=3.0.2') format('embedded-opentype'),
|
| 33 |
-
url('../shared/fonts/fontawesome/fontawesome-webfont.woff?v=3.0.2') format('woff'),
|
| 34 |
-
url('../shared/fonts/fontawesome/fontawesome-webfont.ttf?v=3.0.2') format('truetype');
|
| 35 |
font-weight: normal;
|
| 36 |
font-style: normal;
|
| 37 |
}
|
|
@@ -243,9 +246,12 @@ th.landing-page-table-header {width:230px; line-height: 22px;}
|
|
| 243 |
#lp_template_change h2 {display: inline-block;}
|
| 244 |
|
| 245 |
#lp_template_change {
|
| 246 |
-
margin-left: 17px;
|
| 247 |
-
margin-top: -20px;
|
| 248 |
-
float: right;
|
|
|
|
|
|
|
|
|
|
| 249 |
}
|
| 250 |
|
| 251 |
/* Split Testing Splash */
|
| 25 |
padding-top: 5px;
|
| 26 |
padding-left: 10px;
|
| 27 |
|
| 28 |
+
}
|
| 29 |
+
#menu-posts-landing-page .wp-submenu.wp-submenu-wrap {
|
| 30 |
+
z-index: 99999999999;
|
| 31 |
}
|
| 32 |
@font-face {
|
| 33 |
font-family: 'FontAwesome';
|
| 34 |
+
src: url('../shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot?v=3.0.2');
|
| 35 |
+
src: url('../shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot?#iefix&v=3.0.2') format('embedded-opentype'),
|
| 36 |
+
url('../shared/assets/global/fonts/fontawesome/fontawesome-webfont.woff?v=3.0.2') format('woff'),
|
| 37 |
+
url('../shared/assets/global/fonts/fontawesome/fontawesome-webfont.ttf?v=3.0.2') format('truetype');
|
| 38 |
font-weight: normal;
|
| 39 |
font-style: normal;
|
| 40 |
}
|
| 246 |
#lp_template_change h2 {display: inline-block;}
|
| 247 |
|
| 248 |
#lp_template_change {
|
| 249 |
+
margin-left: 17px;
|
| 250 |
+
margin-top: -20px;
|
| 251 |
+
float: right;
|
| 252 |
+
position: absolute;
|
| 253 |
+
top: 0px;
|
| 254 |
+
right: 10px;
|
| 255 |
}
|
| 256 |
|
| 257 |
/* Split Testing Splash */
|
css/new-customizer-admin.css
CHANGED
|
@@ -10,7 +10,7 @@ html.wp-toolbar {
|
|
| 10 |
.auto-fold #wpcontent, .auto-fold #wpfooter {
|
| 11 |
margin-left: 10px !important;
|
| 12 |
}
|
| 13 |
-
|
| 14 |
padding-bottom: 90px !important;
|
| 15 |
width: 100% !important;
|
| 16 |
}
|
|
@@ -41,10 +41,7 @@ margin-left: 0px !important;
|
|
| 41 |
width: 105%;
|
| 42 |
margin-left: -6px;
|
| 43 |
}
|
| 44 |
-
|
| 45 |
-
padding-bottom: 60px !important;
|
| 46 |
-
width: 76% !important;
|
| 47 |
-
}
|
| 48 |
@media screen and (max-width: 600px) {
|
| 49 |
.version-3-8 #wpbody {
|
| 50 |
padding-top: 5px !important;
|
| 10 |
.auto-fold #wpcontent, .auto-fold #wpfooter {
|
| 11 |
margin-left: 10px !important;
|
| 12 |
}
|
| 13 |
+
#wpbody-content {
|
| 14 |
padding-bottom: 90px !important;
|
| 15 |
width: 100% !important;
|
| 16 |
}
|
| 41 |
width: 105%;
|
| 42 |
margin-left: -6px;
|
| 43 |
}
|
| 44 |
+
|
|
|
|
|
|
|
|
|
|
| 45 |
@media screen and (max-width: 600px) {
|
| 46 |
.version-3-8 #wpbody {
|
| 47 |
padding-top: 5px !important;
|
js/admin/admin.post-edit.js
CHANGED
|
@@ -1,41 +1,63 @@
|
|
| 1 |
-
jQuery(document).ready(function
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2 |
|
| 3 |
|
| 4 |
-
//
|
| 5 |
jQuery('#template-filter li').first().addClass('button-primary');
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
jQuery(this).parent().addClass('button-primary');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 11 |
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
inDuration : 600,
|
| 20 |
-
});
|
| 21 |
-
*/
|
| 22 |
-
|
| 23 |
-
jQuery("body").on('click', '#content-tmce, .wp-switch-editor.switch-tmce', function () {
|
| 24 |
-
$.cookie("lp-edit-view-choice", "editor", { path: '/', expires: 7 });
|
| 25 |
-
});
|
| 26 |
-
|
| 27 |
-
jQuery("body").on('click', '#content-html, .wp-switch-editor.switch-html', function () {
|
| 28 |
-
$.cookie("lp-edit-view-choice", "html", { path: '/', expires: 7 });
|
| 29 |
-
});
|
| 30 |
-
|
| 31 |
-
var which_editor = $.cookie("lp-edit-view-choice");
|
| 32 |
-
if(which_editor === null){
|
| 33 |
-
setTimeout(function() {
|
| 34 |
-
//jQuery("#content-tmce").click();
|
| 35 |
-
//jQuery(".wp-switch-editor.switch-tmce").click();
|
| 36 |
-
}, 1000);
|
| 37 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 38 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 39 |
/*
|
| 40 |
|
| 41 |
var chtml= jQuery('#content-html');
|
|
@@ -46,16 +68,16 @@ jQuery(document).ready(function ($) {
|
|
| 46 |
switchEditors.switchto(ctmce[0]); // switch to tinymce
|
| 47 |
|
| 48 |
*/
|
| 49 |
-
|
| 50 |
-
|
| 51 |
|
| 52 |
var ctmce= jQuery('#content-tmce');
|
| 53 |
switchEditors.switchto(ctmce[0]); // switch to tinymce
|
| 54 |
|
| 55 |
var conversion_area = jQuery("#landing-page-myeditor-tmce");
|
| 56 |
switchEditors.switchto(conversion_area[0]); // switch to tinymce
|
| 57 |
-
|
| 58 |
-
|
| 59 |
jQuery('.inbound-wysiwyg-option textarea').each(function(){
|
| 60 |
var chtml= "#" + jQuery(this).attr('id') + '-html';
|
| 61 |
var ctmce= "#" + jQuery(this).attr('id') + '-tmce';
|
|
@@ -63,8 +85,8 @@ jQuery(document).ready(function ($) {
|
|
| 63 |
var tinymce_box = jQuery(ctmce);
|
| 64 |
switchEditors.switchto(tinymce_box[0]); // switch to tinymce
|
| 65 |
});
|
| 66 |
-
|
| 67 |
-
|
| 68 |
|
| 69 |
/* Tour Start JS */
|
| 70 |
var tourbutton = '<a class="" id="lp-tour" style="font-size:13px;">Need help? Take the tour</a>';
|
|
@@ -90,10 +112,10 @@ jQuery(document).ready(function ($) {
|
|
| 90 |
// Fix inactivate theme display
|
| 91 |
jQuery("#template-box a").live('click', function () {
|
| 92 |
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
|
| 97 |
|
| 98 |
});
|
| 99 |
|
|
@@ -177,62 +199,59 @@ jQuery(document).ready(function ($) {
|
|
| 177 |
jQuery('.lp_select_template').click(function(){
|
| 178 |
var template = jQuery(this).attr('id');
|
| 179 |
var label = jQuery(this).attr('label');
|
| 180 |
-
|
| 181 |
-
|
| 182 |
-
|
| 183 |
var current_template_meta = "#lp_" + current_template + "_custom_meta_box";
|
| 184 |
var current_template_h3 = "#lp_" + current_template + "_custom_meta_box h3";
|
| 185 |
var current_template_div = "#lp_" + current_template + "_custom_meta_box .handlediv";
|
| 186 |
var open_variation = jQuery("#open_variation").val();
|
| 187 |
|
| 188 |
-
|
| 189 |
-
|
| 190 |
-
|
| 191 |
-
|
| 192 |
-
|
| 193 |
-
{
|
| 194 |
-
var variation_tag = "";
|
| 195 |
-
}
|
| 196 |
|
| 197 |
-
|
| 198 |
|
| 199 |
jQuery(selected_template_id).parent().addClass("default_template_highlight").prepend(currentlabel);
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
|
| 229 |
-
jQuery(
|
| 230 |
-
|
| 231 |
-
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
jQuery(".wrap").fadeIn(500, function(){
|
| 237 |
});
|
| 238 |
});
|
|
@@ -329,7 +348,7 @@ jQuery(document).ready(function ($) {
|
|
| 329 |
jQuery(".currently_selected").show();
|
| 330 |
jQuery('#lp-cancel-selection').show();
|
| 331 |
});
|
| 332 |
-
|
| 333 |
});
|
| 334 |
});
|
| 335 |
|
|
@@ -474,7 +493,7 @@ jQuery(document).ready(function ($) {
|
|
| 474 |
*/
|
| 475 |
|
| 476 |
|
| 477 |
-
|
| 478 |
var nonce_val = lp_post_edit_ui.wp_landing_page_meta_nonce; // NEED CORRECT NONCE
|
| 479 |
jQuery(document).on('mousedown', '.new-save-lp', function () {
|
| 480 |
var type_input = jQuery(this).parent().find("input").attr("type");
|
| 1 |
+
jQuery(document).ready(function($) {
|
| 2 |
+
|
| 3 |
+
var cookies = (typeof (jQuery.cookie) != "undefined" ? true : false); // Check for JQuery Cookie
|
| 4 |
+
function cookie_notice() {
|
| 5 |
+
alert('Oh no! jQuery Cookie not loaded. Your Server Might be Blocking this. Some functionality may be impaired');
|
| 6 |
+
}
|
| 7 |
|
| 8 |
|
| 9 |
+
// Filter Styling
|
| 10 |
jQuery('#template-filter li').first().addClass('button-primary');
|
| 11 |
+
// filter items when filter link is clicked
|
| 12 |
+
jQuery('#template-filter a').click(function(){
|
| 13 |
+
var selector = jQuery(this).attr('data-filter');
|
| 14 |
+
jQuery("ul#template-filter li").removeClass('button-primary');
|
| 15 |
jQuery(this).parent().addClass('button-primary');
|
| 16 |
+
$(".template-item-boxes").fadeOut(500);
|
| 17 |
+
setTimeout(function() {
|
| 18 |
+
$(selector).fadeIn(500);
|
| 19 |
+
}, 500);
|
| 20 |
+
|
| 21 |
+
return false;
|
| 22 |
+
});
|
| 23 |
+
|
| 24 |
+
/* Ajax loading tabs
|
| 25 |
+
jQuery.koolSwap({
|
| 26 |
+
swapBox : '#poststuff',
|
| 27 |
+
outDuration : 550,
|
| 28 |
+
inDuration : 600,
|
| 29 |
+
});
|
| 30 |
+
*/
|
| 31 |
+
|
| 32 |
+
jQuery("body").on('click', '#content-tmce, .wp-switch-editor.switch-tmce', function () {
|
| 33 |
+
if(cookies) {
|
| 34 |
+
$.cookie("lp-edit-view-choice", "editor", { path: '/', expires: 7 });
|
| 35 |
+
} else {
|
| 36 |
+
cookie_notice();
|
| 37 |
+
}
|
| 38 |
+
});
|
| 39 |
|
| 40 |
+
jQuery("body").on('click', '#content-html, .wp-switch-editor.switch-html', function () {
|
| 41 |
+
if(cookies) {
|
| 42 |
+
$.cookie("lp-edit-view-choice", "html", { path: '/', expires: 7 });
|
| 43 |
+
} else {
|
| 44 |
+
cookie_notice();
|
| 45 |
+
}
|
| 46 |
+
});
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 47 |
|
| 48 |
+
if(cookies) {
|
| 49 |
+
var which_editor = $.cookie("lp-edit-view-choice");
|
| 50 |
+
} else {
|
| 51 |
+
var which_editor = 'editor';
|
| 52 |
+
cookie_notice();
|
| 53 |
}
|
| 54 |
+
if(which_editor === null){
|
| 55 |
+
setTimeout(function() {
|
| 56 |
+
//jQuery("#content-tmce").click();
|
| 57 |
+
//jQuery(".wp-switch-editor.switch-tmce").click();
|
| 58 |
+
}, 1000);
|
| 59 |
+
|
| 60 |
+
}
|
| 61 |
/*
|
| 62 |
|
| 63 |
var chtml= jQuery('#content-html');
|
| 68 |
switchEditors.switchto(ctmce[0]); // switch to tinymce
|
| 69 |
|
| 70 |
*/
|
| 71 |
+
if(which_editor === 'editor'){
|
| 72 |
+
setTimeout(function() {
|
| 73 |
|
| 74 |
var ctmce= jQuery('#content-tmce');
|
| 75 |
switchEditors.switchto(ctmce[0]); // switch to tinymce
|
| 76 |
|
| 77 |
var conversion_area = jQuery("#landing-page-myeditor-tmce");
|
| 78 |
switchEditors.switchto(conversion_area[0]); // switch to tinymce
|
| 79 |
+
//jQuery("#content-tmce").click();
|
| 80 |
+
//jQuery(".wp-switch-editor.switch-tmce").click();
|
| 81 |
jQuery('.inbound-wysiwyg-option textarea').each(function(){
|
| 82 |
var chtml= "#" + jQuery(this).attr('id') + '-html';
|
| 83 |
var ctmce= "#" + jQuery(this).attr('id') + '-tmce';
|
| 85 |
var tinymce_box = jQuery(ctmce);
|
| 86 |
switchEditors.switchto(tinymce_box[0]); // switch to tinymce
|
| 87 |
});
|
| 88 |
+
}, 1000);
|
| 89 |
+
}
|
| 90 |
|
| 91 |
/* Tour Start JS */
|
| 92 |
var tourbutton = '<a class="" id="lp-tour" style="font-size:13px;">Need help? Take the tour</a>';
|
| 112 |
// Fix inactivate theme display
|
| 113 |
jQuery("#template-box a").live('click', function () {
|
| 114 |
|
| 115 |
+
setTimeout(function() {
|
| 116 |
+
jQuery('#TB_window iframe').contents().find("#customize-controls").hide();
|
| 117 |
+
jQuery('#TB_window iframe').contents().find(".wp-full-overlay.expanded").css("margin-left", "0px");
|
| 118 |
+
}, 600);
|
| 119 |
|
| 120 |
});
|
| 121 |
|
| 199 |
jQuery('.lp_select_template').click(function(){
|
| 200 |
var template = jQuery(this).attr('id');
|
| 201 |
var label = jQuery(this).attr('label');
|
| 202 |
+
var selected_template_id = "#" + template;
|
| 203 |
+
var currentlabel = jQuery(".currently_selected").show();
|
| 204 |
+
var current_template = jQuery("input#lp_select_template ").val();
|
| 205 |
var current_template_meta = "#lp_" + current_template + "_custom_meta_box";
|
| 206 |
var current_template_h3 = "#lp_" + current_template + "_custom_meta_box h3";
|
| 207 |
var current_template_div = "#lp_" + current_template + "_custom_meta_box .handlediv";
|
| 208 |
var open_variation = jQuery("#open_variation").val();
|
| 209 |
|
| 210 |
+
if (open_variation>0) {
|
| 211 |
+
var variation_tag = "-"+open_variation;
|
| 212 |
+
} else {
|
| 213 |
+
var variation_tag = "";
|
| 214 |
+
}
|
|
|
|
|
|
|
|
|
|
| 215 |
|
| 216 |
+
jQuery("#template-box.default_template_highlight").removeClass("default_template_highlight");
|
| 217 |
|
| 218 |
jQuery(selected_template_id).parent().addClass("default_template_highlight").prepend(currentlabel);
|
| 219 |
+
function capitaliseFirstLetter(string) {
|
| 220 |
+
return string.charAt(0).toUpperCase() + string.slice(1);
|
| 221 |
+
}
|
| 222 |
+
jQuery(".lp-template-selector-container").fadeOut(500,function(){
|
| 223 |
+
jQuery('#lp_metabox_select_template input').remove();
|
| 224 |
+
jQuery('#lp_metabox_select_template .form-table').remove();
|
| 225 |
+
|
| 226 |
+
var ajax_data = {
|
| 227 |
+
action: 'lp_get_template_meta',
|
| 228 |
+
selected_template: template,
|
| 229 |
+
post_id: lp_post_edit_ui.post_id,
|
| 230 |
+
};
|
| 231 |
+
|
| 232 |
+
jQuery.ajax({
|
| 233 |
+
type: "POST",
|
| 234 |
+
url: lp_post_edit_ui.ajaxurl,
|
| 235 |
+
data: ajax_data,
|
| 236 |
+
dataType: 'html',
|
| 237 |
+
timeout: 7000,
|
| 238 |
+
success: function (response) {
|
| 239 |
+
//alert(response);
|
| 240 |
+
var html = '<input id="lp_select_template" type="hidden" value="'+template+'" name="lp-selected-template'+variation_tag+'">'
|
| 241 |
+
+ '<input type="hidden" value="'+lp_post_edit_ui.lp_template_nonce+'" name="lp_lp_custom_fields_nonce">'
|
| 242 |
+
+ response;
|
| 243 |
+
|
| 244 |
+
jQuery('#lp_metabox_select_template #template-display-options').html(html);
|
| 245 |
+
jQuery('.time-picker').timepicker({ 'timeFormat': 'H:i' });
|
| 246 |
+
var template_name = capitaliseFirstLetter(template).replace("-", " ");
|
| 247 |
+
var template_name = template_name.replace("_", " ");
|
| 248 |
+
jQuery("#lp_metabox_select_template .hndle").first().text(template_name + " Template Options");
|
| 249 |
+
|
| 250 |
+
},
|
| 251 |
+
error: function(request, status, err) {
|
| 252 |
+
alert(status);
|
| 253 |
+
}
|
| 254 |
+
});
|
| 255 |
jQuery(".wrap").fadeIn(500, function(){
|
| 256 |
});
|
| 257 |
});
|
| 348 |
jQuery(".currently_selected").show();
|
| 349 |
jQuery('#lp-cancel-selection').show();
|
| 350 |
});
|
| 351 |
+
|
| 352 |
});
|
| 353 |
});
|
| 354 |
|
| 493 |
*/
|
| 494 |
|
| 495 |
|
| 496 |
+
// SAVE META
|
| 497 |
var nonce_val = lp_post_edit_ui.wp_landing_page_meta_nonce; // NEED CORRECT NONCE
|
| 498 |
jQuery(document).on('mousedown', '.new-save-lp', function () {
|
| 499 |
var type_input = jQuery(this).parent().find("input").attr("type");
|
js/admin/admin.post-new.js
CHANGED
|
@@ -65,6 +65,10 @@ jQuery(document).ready(function ($) {
|
|
| 65 |
var selector = jQuery(this).attr('data-filter');
|
| 66 |
jQuery("ul#template-filter li").removeClass('button-primary');
|
| 67 |
jQuery(this).parent().addClass('button-primary');
|
|
|
|
|
|
|
|
|
|
|
|
|
| 68 |
|
| 69 |
return false;
|
| 70 |
});
|
| 65 |
var selector = jQuery(this).attr('data-filter');
|
| 66 |
jQuery("ul#template-filter li").removeClass('button-primary');
|
| 67 |
jQuery(this).parent().addClass('button-primary');
|
| 68 |
+
$(".template-item-boxes").fadeOut(500);
|
| 69 |
+
setTimeout(function() {
|
| 70 |
+
$(selector).fadeIn(500);
|
| 71 |
+
}, 500);
|
| 72 |
|
| 73 |
return false;
|
| 74 |
});
|
landing-pages.php
CHANGED
|
@@ -3,19 +3,19 @@
|
|
| 3 |
Plugin Name: Landing Pages
|
| 4 |
Plugin URI: http://www.inboundnow.com/landing-pages/
|
| 5 |
Description: The first true all-in-one Landing Page solution for WordPress, including ongoing conversion metrics, a/b split testing, unlimited design options and so much more!
|
| 6 |
-
Version: 1.4.
|
| 7 |
Author: Inbound Now
|
| 8 |
Author URI: http://www.inboundnow.com/
|
| 9 |
Text Domain: landing-pages
|
| 10 |
Domain Path: shared/languages/landing-pages/
|
| 11 |
*/
|
| 12 |
|
| 13 |
-
define('LANDINGPAGES_CURRENT_VERSION', '1.4.
|
| 14 |
define('LANDINGPAGES_URLPATH', WP_PLUGIN_URL.'/'.plugin_basename( dirname(__FILE__) ).'/' );
|
| 15 |
define('LANDINGPAGES_PATH', WP_PLUGIN_DIR.'/'.plugin_basename( dirname(__FILE__) ).'/' );
|
| 16 |
define('LANDINGPAGES_PLUGIN_SLUG', plugin_basename( dirname(__FILE__) ) );
|
| 17 |
define('LANDINGPAGES_FILE', __FILE__ );
|
| 18 |
-
define('LANDINGPAGES_STORE_URL', 'http://www.inboundnow.com/
|
| 19 |
$uploads = wp_upload_dir();
|
| 20 |
define('LANDINGPAGES_UPLOADS_PATH', $uploads['basedir'].'/landing-pages/templates/' );
|
| 21 |
define('LANDINGPAGES_UPLOADS_URLPATH', $uploads['baseurl'].'/landing-pages/templates/' );
|
|
@@ -82,6 +82,10 @@ switch (is_admin()) :
|
|
| 82 |
BREAK;
|
| 83 |
endswitch;
|
| 84 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 85 |
|
| 86 |
|
| 87 |
/* Inbound Core Shared Files. Lead files take presidence */
|
|
@@ -107,7 +111,9 @@ function inbound_load_shared_landing_pages(){
|
|
| 107 |
include_once('shared/inboundnow/inboundnow.extension-licensing.php'); // Inboundnow Package Licensing
|
| 108 |
include_once('shared/inboundnow/inboundnow.extension-updating.php'); // Inboundnow Package Updating
|
| 109 |
include_once('shared/inboundnow/inboundnow.global-settings.php'); // Inboundnow Global Settings
|
| 110 |
-
|
|
|
|
|
|
|
| 111 |
|
| 112 |
}
|
| 113 |
|
| 3 |
Plugin Name: Landing Pages
|
| 4 |
Plugin URI: http://www.inboundnow.com/landing-pages/
|
| 5 |
Description: The first true all-in-one Landing Page solution for WordPress, including ongoing conversion metrics, a/b split testing, unlimited design options and so much more!
|
| 6 |
+
Version: 1.4.8
|
| 7 |
Author: Inbound Now
|
| 8 |
Author URI: http://www.inboundnow.com/
|
| 9 |
Text Domain: landing-pages
|
| 10 |
Domain Path: shared/languages/landing-pages/
|
| 11 |
*/
|
| 12 |
|
| 13 |
+
define('LANDINGPAGES_CURRENT_VERSION', '1.4.8' );
|
| 14 |
define('LANDINGPAGES_URLPATH', WP_PLUGIN_URL.'/'.plugin_basename( dirname(__FILE__) ).'/' );
|
| 15 |
define('LANDINGPAGES_PATH', WP_PLUGIN_DIR.'/'.plugin_basename( dirname(__FILE__) ).'/' );
|
| 16 |
define('LANDINGPAGES_PLUGIN_SLUG', plugin_basename( dirname(__FILE__) ) );
|
| 17 |
define('LANDINGPAGES_FILE', __FILE__ );
|
| 18 |
+
define('LANDINGPAGES_STORE_URL', 'http://www.inboundnow.com/' );
|
| 19 |
$uploads = wp_upload_dir();
|
| 20 |
define('LANDINGPAGES_UPLOADS_PATH', $uploads['basedir'].'/landing-pages/templates/' );
|
| 21 |
define('LANDINGPAGES_UPLOADS_URLPATH', $uploads['baseurl'].'/landing-pages/templates/' );
|
| 82 |
BREAK;
|
| 83 |
endswitch;
|
| 84 |
|
| 85 |
+
add_action( 'init', 'inbound_load_shared_lp_init' , 11 );
|
| 86 |
+
function inbound_load_shared_lp_init(){
|
| 87 |
+
|
| 88 |
+
}
|
| 89 |
|
| 90 |
|
| 91 |
/* Inbound Core Shared Files. Lead files take presidence */
|
| 111 |
include_once('shared/inboundnow/inboundnow.extension-licensing.php'); // Inboundnow Package Licensing
|
| 112 |
include_once('shared/inboundnow/inboundnow.extension-updating.php'); // Inboundnow Package Updating
|
| 113 |
include_once('shared/inboundnow/inboundnow.global-settings.php'); // Inboundnow Global Settings
|
| 114 |
+
include_once('shared/assets/assets.loader.class.php'); // Load Shared CSS and JS Assets
|
| 115 |
+
include_once('shared/functions/global.shared.functions.php'); // Global Shared Utility functions
|
| 116 |
+
include_once('shared/functions/global.leads.cpt.php'); // Shared Lead functionality
|
| 117 |
|
| 118 |
}
|
| 119 |
|
modules/module.ab-testing.metaboxes.php
CHANGED
|
@@ -193,7 +193,7 @@ function lp_ab_testing_add_tabs()
|
|
| 193 |
}
|
| 194 |
|
| 195 |
echo '<h2 class="nav-tab-wrapper a_b_tabs">';
|
| 196 |
-
echo '<a href="?post='.$post->ID.'&lp-variation-id=0&action=edit" class="lp-ab-tab nav-tab nav-tab-special-'.$first_class.'" id="tabs-0">'.__("A",LANDINGPAGES_TEXT_DOMAIN).'</a>';
|
| 197 |
|
| 198 |
$var_id_marker = 1;
|
| 199 |
|
| 193 |
}
|
| 194 |
|
| 195 |
echo '<h2 class="nav-tab-wrapper a_b_tabs">';
|
| 196 |
+
echo '<a href="?post='.$post->ID.'&lp-variation-id=0&action=edit" class="lp-ab-tab nav-tab nav-tab-special-'.$first_class.'" id="tabs-0">'.__("<span>Version</span> <b>A</b>",LANDINGPAGES_TEXT_DOMAIN).'</a>';
|
| 197 |
|
| 198 |
$var_id_marker = 1;
|
| 199 |
|
modules/module.activate.php
CHANGED
|
@@ -7,36 +7,26 @@ register_activation_hook( LANDINGPAGES_FILE , 'landing_page_activate');
|
|
| 7 |
function landing_page_activate($wp = '3.6', $php = '5.3', $cta = '1.2.1', $leads = '1.2.1')
|
| 8 |
{
|
| 9 |
global $wp_version;
|
| 10 |
-
if ( version_compare( phpversion(), $php, '<' ) )
|
| 11 |
-
{
|
| 12 |
$flag = 'PHP';
|
| 13 |
-
|
| 14 |
-
|
|
|
|
| 15 |
deactivate_plugins( basename( __FILE__ ) );
|
| 16 |
-
}
|
| 17 |
-
elseif ( version_compare( $wp_version, $wp, '<' ) )
|
| 18 |
-
{
|
| 19 |
$flag = 'WordPress';
|
| 20 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires'.$flag.' version '.$wp.' or greater.</p>' , LANDINGPAGES_TEXT_DOMAIN), __('Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN), array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 21 |
deactivate_plugins( basename( __FILE__ ) );
|
| 22 |
-
}
|
| 23 |
-
elseif (defined('WP_CTA_CURRENT_VERSION') && version_compare( WP_CTA_CURRENT_VERSION, $cta, '<' ))
|
| 24 |
-
{
|
| 25 |
$flag = __('WordPress Calls to Action' , LANDINGPAGES_TEXT_DOMAIN);
|
| 26 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version '.$cta.' or greater. <br><br>Please Update WordPress Call to Action Plugin to update & install WordPress Landing Pages</p>' , LANDINGPAGES_TEXT_DOMAIN) , __('Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 27 |
-
}
|
| 28 |
-
elseif (defined('WPL_CURRENT_VERSION') && version_compare( WPL_CURRENT_VERSION, $leads, '<' ))
|
| 29 |
-
{
|
| 30 |
$flag = 'WordPress Leads';
|
| 31 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version '.$leads.' or greater. <br><br>Please Update WordPress Leads Plugin to update & install WordPress Landing Pages</p>' , INBOUDNOW_LABEL ) , __( 'Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 32 |
-
}
|
| 33 |
-
elseif (defined('LP_HOMEPAGE_CURRENT_VERSION') && version_compare( LP_HOMEPAGE_CURRENT_VERSION, '1.0.8', '<' ))
|
| 34 |
-
{
|
| 35 |
$flag = 'Homepage Addon';
|
| 36 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version 1.0.8 or greater. <br><br>Please Update Homepage Addon to update & install WordPress Landing Pages</p>' , INBOUDNOW_LABEL ) , __( 'Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 37 |
-
}
|
| 38 |
-
else
|
| 39 |
-
{
|
| 40 |
// Activate Plugin
|
| 41 |
// Add Upgraded From Option
|
| 42 |
$current_version = get_option( 'landing_page_version' );
|
|
@@ -54,6 +44,12 @@ function landing_page_activate($wp = '3.6', $php = '5.3', $cta = '1.2.1', $leads
|
|
| 54 |
//$wp_rewrite->flush_rules();
|
| 55 |
}
|
| 56 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 57 |
do_action('lp_activate_update_db');
|
| 58 |
}
|
| 59 |
|
| 7 |
function landing_page_activate($wp = '3.6', $php = '5.3', $cta = '1.2.1', $leads = '1.2.1')
|
| 8 |
{
|
| 9 |
global $wp_version;
|
| 10 |
+
if ( version_compare( phpversion(), $php, '<' ) ) {
|
|
|
|
| 11 |
$flag = 'PHP';
|
| 12 |
+
$php_version = phpversion();
|
| 13 |
+
$version = 'PHP' == $flag ? $php : $wp;
|
| 14 |
+
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version '.$php.' or greater.</p> Your server is running version '. $php_version . '. Please Contact your hosting provider to update your PHP version. PHP 5.3 came out in December of 2010.' , LANDINGPAGES_TEXT_DOMAIN) , __( 'Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 15 |
deactivate_plugins( basename( __FILE__ ) );
|
| 16 |
+
} elseif ( version_compare( $wp_version, $wp, '<' ) ) {
|
|
|
|
|
|
|
| 17 |
$flag = 'WordPress';
|
| 18 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires'.$flag.' version '.$wp.' or greater.</p>' , LANDINGPAGES_TEXT_DOMAIN), __('Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN), array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 19 |
deactivate_plugins( basename( __FILE__ ) );
|
| 20 |
+
} elseif (defined('WP_CTA_CURRENT_VERSION') && version_compare( WP_CTA_CURRENT_VERSION, $cta, '<' )) {
|
|
|
|
|
|
|
| 21 |
$flag = __('WordPress Calls to Action' , LANDINGPAGES_TEXT_DOMAIN);
|
| 22 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version '.$cta.' or greater. <br><br>Please Update WordPress Call to Action Plugin to update & install WordPress Landing Pages</p>' , LANDINGPAGES_TEXT_DOMAIN) , __('Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 23 |
+
} elseif (defined('WPL_CURRENT_VERSION') && version_compare( WPL_CURRENT_VERSION, $leads, '<' )) {
|
|
|
|
|
|
|
| 24 |
$flag = 'WordPress Leads';
|
| 25 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version '.$leads.' or greater. <br><br>Please Update WordPress Leads Plugin to update & install WordPress Landing Pages</p>' , INBOUDNOW_LABEL ) , __( 'Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 26 |
+
} elseif (defined('LP_HOMEPAGE_CURRENT_VERSION') && version_compare( LP_HOMEPAGE_CURRENT_VERSION, '1.0.8', '<' )) {
|
|
|
|
|
|
|
| 27 |
$flag = 'Homepage Addon';
|
| 28 |
wp_die( __('<p>The <strong>WordPress Landing Pages</strong> plugin requires '.$flag.' version 1.0.8 or greater. <br><br>Please Update Homepage Addon to update & install WordPress Landing Pages</p>' , INBOUDNOW_LABEL ) , __( 'Plugin Activation Error' , LANDINGPAGES_TEXT_DOMAIN) , array( 'response'=>200, 'back_link'=>TRUE ) );
|
| 29 |
+
} else {
|
|
|
|
|
|
|
| 30 |
// Activate Plugin
|
| 31 |
// Add Upgraded From Option
|
| 32 |
$current_version = get_option( 'landing_page_version' );
|
| 44 |
//$wp_rewrite->flush_rules();
|
| 45 |
}
|
| 46 |
|
| 47 |
+
if (is_plugin_active('leads/wordpress-leads.php')) {
|
| 48 |
+
add_option( 'Leads_Activated', true );
|
| 49 |
+
} else {
|
| 50 |
+
delete_option( 'Leads_Activated');
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
do_action('lp_activate_update_db');
|
| 54 |
}
|
| 55 |
|
modules/module.ajax-setup.php
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
<?php
|
| 2 |
* Adds Ajax for Clear Stats button
|
| 3 |
* clear stats for all variations
|
| 4 |
*/
|
| 5 |
* Adds Ajax for Clear Stats button
|
| 6 |
* clear stats for single variations
|
| 7 |
*/
|
| 8 |
* Click tracking moved to module.click-tracking.php
|
| 9 |
* Adds ajax to record landing page impressions
|
| 10 |
* future plans to integrate with google analytics
|
| 11 |
* Adds Ajax Template Selection
|
| 12 |
* @return prints out landing page meta options
|
| 13 |
*/
|
| 14 |
* Add ajax for post meta save options
|
| 15 |
*/
|
| 16 |
|
|
|
|
| 17 |
* Adds Ajax for Clear Stats button
|
| 18 |
* clear stats for all variations
|
| 19 |
*/
|
| 20 |
* Adds Ajax for Clear Stats button
|
| 21 |
* clear stats for single variations
|
| 22 |
*/
|
| 23 |
* Click tracking moved to module.click-tracking.php
|
| 24 |
* Adds ajax to record landing page impressions
|
| 25 |
* future plans to integrate with google analytics
|
| 26 |
* Adds Ajax Template Selection
|
| 27 |
* @return prints out landing page meta options
|
| 28 |
*/
|
| 29 |
* Add ajax for post meta save options
|
| 30 |
*/
|
|
|
|
| 1 |
* Adds Ajax for Clear Stats button
|
| 2 |
* clear stats for all variations
|
| 3 |
*/
|
| 4 |
* Adds Ajax for Clear Stats button
|
| 5 |
* clear stats for single variations
|
| 6 |
*/
|
| 7 |
* Click tracking moved to module.click-tracking.php
|
| 8 |
* Adds ajax to record landing page impressions
|
| 9 |
* future plans to integrate with google analytics
|
| 10 |
* Adds Ajax Template Selection
|
| 11 |
* @return prints out landing page meta options
|
| 12 |
*/
|
| 13 |
* Add ajax for post meta save options
|
| 14 |
*/
|
| 15 |
|
| 16 |
+
<?php
|
| 17 |
* Adds Ajax for Clear Stats button
|
| 18 |
* clear stats for all variations
|
| 19 |
*/
|
| 20 |
* Adds Ajax for Clear Stats button
|
| 21 |
* clear stats for single variations
|
| 22 |
*/
|
| 23 |
* Click tracking moved to module.click-tracking.php
|
| 24 |
* Adds ajax to record landing page impressions
|
| 25 |
* future plans to integrate with google analytics
|
| 26 |
* Adds Ajax Template Selection
|
| 27 |
* @return prints out landing page meta options
|
| 28 |
*/
|
| 29 |
* Add ajax for post meta save options
|
| 30 |
*/
|
modules/module.global-settings.php
CHANGED
|
@@ -279,13 +279,13 @@ function lp_display_global_settings()
|
|
| 279 |
<hr>
|
| 280 |
<div id="more-templates">
|
| 281 |
<center>
|
| 282 |
-
<a href="http://www.inboundnow.com/landing-pages/
|
| 283 |
|
| 284 |
</center>
|
| 285 |
</div>
|
| 286 |
<div id="more-addons">
|
| 287 |
<center>
|
| 288 |
-
<a href="http://www.inboundnow.com/landing-pages/
|
| 289 |
</center>
|
| 290 |
</div>
|
| 291 |
<div id="custom-templates">
|
| 279 |
<hr>
|
| 280 |
<div id="more-templates">
|
| 281 |
<center>
|
| 282 |
+
<a href="http://www.inboundnow.com/products/landing-pages/templates/" target="_blank"><img src="<?php echo LANDINGPAGES_URLPATH;?>/images/templates-image.png"></a>
|
| 283 |
|
| 284 |
</center>
|
| 285 |
</div>
|
| 286 |
<div id="more-addons">
|
| 287 |
<center>
|
| 288 |
+
<a href="http://www.inboundnow.com/products/landing-pages/extensions/" target="_blank"><img src="<?php echo LANDINGPAGES_URLPATH;?>/images/add-on-image.png"></a>
|
| 289 |
</center>
|
| 290 |
</div>
|
| 291 |
<div id="custom-templates">
|
modules/module.javascript-admin.php
CHANGED
|
@@ -10,31 +10,27 @@ function lp_admin_enqueue($hook)
|
|
| 10 |
//enqueue styles and scripts
|
| 11 |
wp_enqueue_style('lp-admin-css', LANDINGPAGES_URLPATH . 'css/admin-style.css');
|
| 12 |
|
| 13 |
-
|
| 14 |
-
wp_dequeue_script('jquery-cookie');
|
| 15 |
-
wp_enqueue_script('jquery-cookie', LANDINGPAGES_URLPATH . 'js/jquery.lp.cookie.js');
|
| 16 |
|
| 17 |
// Frontend Editor
|
| 18 |
if ((isset($_GET['page']) == 'lp-frontend-editor')) {
|
| 19 |
// scripts soon
|
| 20 |
}
|
|
|
|
| 21 |
if ((isset($_GET['page']) == 'install-inbound-plugins')) {
|
| 22 |
wp_enqueue_script('inbound-install-plugins', LANDINGPAGES_URLPATH . 'js/admin/admin.install-plugins.js');
|
| 23 |
wp_enqueue_style('inbound-install-plugins-css', LANDINGPAGES_URLPATH . 'css/admin-install-plugins.css');
|
| 24 |
}
|
| 25 |
|
| 26 |
// Store Options Page
|
| 27 |
-
if (isset($_GET['page']) && (($_GET['page'] == 'lp_store') || ($_GET['page'] == 'lp_addons')))
|
| 28 |
-
{
|
| 29 |
wp_dequeue_script('easyXDM');
|
| 30 |
wp_enqueue_script('easyXDM', LANDINGPAGES_URLPATH . 'js/libraries/easyXDM.debug.js');
|
| 31 |
//wp_enqueue_script('lp-js-store', LANDINGPAGES_URLPATH . 'js/admin/admin.store.js');
|
| 32 |
}
|
| 33 |
|
| 34 |
-
|
| 35 |
-
|
| 36 |
// Admin enqueue - Landing Page CPT only
|
| 37 |
-
if (
|
| 38 |
{
|
| 39 |
|
| 40 |
wp_enqueue_script('jpicker', LANDINGPAGES_URLPATH . 'js/libraries/jpicker/jpicker-1.1.6.min.js');
|
|
@@ -49,8 +45,7 @@ function lp_admin_enqueue($hook)
|
|
| 49 |
wp_localize_script( 'lp-admin-clear-stats-ajax-request', 'ajaxadmin', array( 'ajaxurl' => admin_url('admin-ajax.php'), 'lp_clear_nonce' => wp_create_nonce('lp-clear-nonce') ) );
|
| 50 |
|
| 51 |
// Add New and Edit Screens
|
| 52 |
-
if ( $hook == 'post-new.php' || $hook == 'post.php' )
|
| 53 |
-
{
|
| 54 |
add_filter( 'wp_default_editor', 'lp_ab_testing_force_default_editor' ); // force html view
|
| 55 |
//admin.metaboxes.js - Template Selector - Media Uploader
|
| 56 |
wp_enqueue_script('lp-js-metaboxes', LANDINGPAGES_URLPATH . 'js/admin/admin.metaboxes.js');
|
|
@@ -63,8 +58,6 @@ function lp_admin_enqueue($hook)
|
|
| 63 |
$params = array('selected_template'=>$template, 'templates'=>$template_data);
|
| 64 |
wp_localize_script('lp-js-metaboxes', 'data', $params);
|
| 65 |
|
| 66 |
-
|
| 67 |
-
|
| 68 |
// Conditional TINYMCE for landing pages
|
| 69 |
wp_dequeue_script('jquery-tinymce');
|
| 70 |
wp_enqueue_script('jquery-tinymce', LANDINGPAGES_URLPATH . 'js/libraries/tiny_mce/jquery.tinymce.js');
|
|
@@ -76,16 +69,13 @@ function lp_admin_enqueue($hook)
|
|
| 76 |
wp_enqueue_script('lp-settings-js', LANDINGPAGES_URLPATH . 'js/admin/admin.global-settings.js');
|
| 77 |
}
|
| 78 |
// Edit Screen
|
| 79 |
-
if ( $hook == 'post.php' )
|
| 80 |
-
{
|
| 81 |
wp_enqueue_script('lp-post-edit-ui', LANDINGPAGES_URLPATH . 'js/admin/admin.post-edit.js');
|
| 82 |
wp_localize_script( 'lp-post-edit-ui', 'lp_post_edit_ui', array( 'ajaxurl' => admin_url( 'admin-ajax.php' ), 'post_id' => $post->ID , 'wp_landing_page_meta_nonce' => wp_create_nonce('wp-landing-page-meta-nonce'), 'lp_template_nonce' => wp_create_nonce('lp-nonce') ) );
|
| 83 |
wp_enqueue_style('admin-post-edit-css', LANDINGPAGES_URLPATH . 'css/admin-post-edit.css');
|
| 84 |
-
|
| 85 |
wp_enqueue_script('jqueryui');
|
| 86 |
// jquery datepicker
|
| 87 |
wp_enqueue_script('jquery-datepicker', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/jquery.timepicker.min.js');
|
| 88 |
-
|
| 89 |
wp_enqueue_script('jquery-datepicker-base', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/lib/base.js');
|
| 90 |
wp_enqueue_script('jquery-datepicker-datepair', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/lib/datepair.js');
|
| 91 |
wp_localize_script( 'jquery-datepicker', 'jquery_datepicker', array( 'thispath' => LANDINGPAGES_URLPATH.'js/libraries/jquery-datepicker/' ));
|
|
@@ -101,8 +91,7 @@ function lp_admin_enqueue($hook)
|
|
| 101 |
}
|
| 102 |
|
| 103 |
// Add New Screen
|
| 104 |
-
if ( $hook == 'post-new.php' )
|
| 105 |
-
{
|
| 106 |
// Create New Landing Jquery UI
|
| 107 |
wp_enqueue_script('lp-js-create-new-lander', LANDINGPAGES_URLPATH . 'js/admin/admin.post-new.js', array('jquery'), '1.0', true );
|
| 108 |
wp_localize_script( 'lp-js-create-new-lander', 'lp_post_new_ui', array( 'ajaxurl' => admin_url( 'admin-ajax.php' ), 'post_id' => $post->ID , 'wp_landing_page_meta_nonce' => wp_create_nonce('lp_nonce') , 'LANDINGPAGES_URLPATH' => LANDINGPAGES_URLPATH ) );
|
|
@@ -110,8 +99,7 @@ function lp_admin_enqueue($hook)
|
|
| 110 |
}
|
| 111 |
|
| 112 |
// List Screen
|
| 113 |
-
if ( $screen->id == 'edit-landing-page' )
|
| 114 |
-
{
|
| 115 |
wp_enqueue_script(array('jquery', 'editor', 'thickbox', 'media-upload'));
|
| 116 |
wp_enqueue_script('landing-page-list', LANDINGPAGES_URLPATH . 'js/admin/admin.landing-page-list.js');
|
| 117 |
wp_enqueue_style('landing-page-list-css', LANDINGPAGES_URLPATH.'css/admin-landing-page-list.css');
|
| 10 |
//enqueue styles and scripts
|
| 11 |
wp_enqueue_style('lp-admin-css', LANDINGPAGES_URLPATH . 'css/admin-style.css');
|
| 12 |
|
| 13 |
+
/* Globally used scripts moved to /shared/assets loader */
|
|
|
|
|
|
|
| 14 |
|
| 15 |
// Frontend Editor
|
| 16 |
if ((isset($_GET['page']) == 'lp-frontend-editor')) {
|
| 17 |
// scripts soon
|
| 18 |
}
|
| 19 |
+
|
| 20 |
if ((isset($_GET['page']) == 'install-inbound-plugins')) {
|
| 21 |
wp_enqueue_script('inbound-install-plugins', LANDINGPAGES_URLPATH . 'js/admin/admin.install-plugins.js');
|
| 22 |
wp_enqueue_style('inbound-install-plugins-css', LANDINGPAGES_URLPATH . 'css/admin-install-plugins.css');
|
| 23 |
}
|
| 24 |
|
| 25 |
// Store Options Page
|
| 26 |
+
if (isset($_GET['page']) && (($_GET['page'] == 'lp_store') || ($_GET['page'] == 'lp_addons'))) {
|
|
|
|
| 27 |
wp_dequeue_script('easyXDM');
|
| 28 |
wp_enqueue_script('easyXDM', LANDINGPAGES_URLPATH . 'js/libraries/easyXDM.debug.js');
|
| 29 |
//wp_enqueue_script('lp-js-store', LANDINGPAGES_URLPATH . 'js/admin/admin.store.js');
|
| 30 |
}
|
| 31 |
|
|
|
|
|
|
|
| 32 |
// Admin enqueue - Landing Page CPT only
|
| 33 |
+
if (( isset($post) && 'landing-page' == $post->post_type ) || ( isset($_GET['post_type']) && $_GET['post_type']=='landing-page' ))
|
| 34 |
{
|
| 35 |
|
| 36 |
wp_enqueue_script('jpicker', LANDINGPAGES_URLPATH . 'js/libraries/jpicker/jpicker-1.1.6.min.js');
|
| 45 |
wp_localize_script( 'lp-admin-clear-stats-ajax-request', 'ajaxadmin', array( 'ajaxurl' => admin_url('admin-ajax.php'), 'lp_clear_nonce' => wp_create_nonce('lp-clear-nonce') ) );
|
| 46 |
|
| 47 |
// Add New and Edit Screens
|
| 48 |
+
if ( $hook == 'post-new.php' || $hook == 'post.php' ) {
|
|
|
|
| 49 |
add_filter( 'wp_default_editor', 'lp_ab_testing_force_default_editor' ); // force html view
|
| 50 |
//admin.metaboxes.js - Template Selector - Media Uploader
|
| 51 |
wp_enqueue_script('lp-js-metaboxes', LANDINGPAGES_URLPATH . 'js/admin/admin.metaboxes.js');
|
| 58 |
$params = array('selected_template'=>$template, 'templates'=>$template_data);
|
| 59 |
wp_localize_script('lp-js-metaboxes', 'data', $params);
|
| 60 |
|
|
|
|
|
|
|
| 61 |
// Conditional TINYMCE for landing pages
|
| 62 |
wp_dequeue_script('jquery-tinymce');
|
| 63 |
wp_enqueue_script('jquery-tinymce', LANDINGPAGES_URLPATH . 'js/libraries/tiny_mce/jquery.tinymce.js');
|
| 69 |
wp_enqueue_script('lp-settings-js', LANDINGPAGES_URLPATH . 'js/admin/admin.global-settings.js');
|
| 70 |
}
|
| 71 |
// Edit Screen
|
| 72 |
+
if ( $hook == 'post.php' ){
|
|
|
|
| 73 |
wp_enqueue_script('lp-post-edit-ui', LANDINGPAGES_URLPATH . 'js/admin/admin.post-edit.js');
|
| 74 |
wp_localize_script( 'lp-post-edit-ui', 'lp_post_edit_ui', array( 'ajaxurl' => admin_url( 'admin-ajax.php' ), 'post_id' => $post->ID , 'wp_landing_page_meta_nonce' => wp_create_nonce('wp-landing-page-meta-nonce'), 'lp_template_nonce' => wp_create_nonce('lp-nonce') ) );
|
| 75 |
wp_enqueue_style('admin-post-edit-css', LANDINGPAGES_URLPATH . 'css/admin-post-edit.css');
|
|
|
|
| 76 |
wp_enqueue_script('jqueryui');
|
| 77 |
// jquery datepicker
|
| 78 |
wp_enqueue_script('jquery-datepicker', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/jquery.timepicker.min.js');
|
|
|
|
| 79 |
wp_enqueue_script('jquery-datepicker-base', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/lib/base.js');
|
| 80 |
wp_enqueue_script('jquery-datepicker-datepair', LANDINGPAGES_URLPATH . 'js/libraries/jquery-datepicker/lib/datepair.js');
|
| 81 |
wp_localize_script( 'jquery-datepicker', 'jquery_datepicker', array( 'thispath' => LANDINGPAGES_URLPATH.'js/libraries/jquery-datepicker/' ));
|
| 91 |
}
|
| 92 |
|
| 93 |
// Add New Screen
|
| 94 |
+
if ( $hook == 'post-new.php' ) {
|
|
|
|
| 95 |
// Create New Landing Jquery UI
|
| 96 |
wp_enqueue_script('lp-js-create-new-lander', LANDINGPAGES_URLPATH . 'js/admin/admin.post-new.js', array('jquery'), '1.0', true );
|
| 97 |
wp_localize_script( 'lp-js-create-new-lander', 'lp_post_new_ui', array( 'ajaxurl' => admin_url( 'admin-ajax.php' ), 'post_id' => $post->ID , 'wp_landing_page_meta_nonce' => wp_create_nonce('lp_nonce') , 'LANDINGPAGES_URLPATH' => LANDINGPAGES_URLPATH ) );
|
| 99 |
}
|
| 100 |
|
| 101 |
// List Screen
|
| 102 |
+
if ( $screen->id == 'edit-landing-page' ) {
|
|
|
|
| 103 |
wp_enqueue_script(array('jquery', 'editor', 'thickbox', 'media-upload'));
|
| 104 |
wp_enqueue_script('landing-page-list', LANDINGPAGES_URLPATH . 'js/admin/admin.landing-page-list.js');
|
| 105 |
wp_enqueue_style('landing-page-list-css', LANDINGPAGES_URLPATH.'css/admin-landing-page-list.css');
|
modules/module.javascript-frontend.php
CHANGED
|
@@ -2,88 +2,31 @@
|
|
| 2 |
|
| 3 |
add_action('wp_enqueue_scripts','lp_fontend_enqueue_scripts');
|
| 4 |
|
| 5 |
-
function lp_fontend_enqueue_scripts($hook)
|
| 6 |
-
{
|
| 7 |
global $post;
|
| 8 |
|
| 9 |
if (!isset($post))
|
| 10 |
return;
|
| 11 |
|
| 12 |
$post_type = $post->post_type;
|
| 13 |
-
$post_id = $post->ID;
|
| 14 |
-
(isset($_SERVER['REMOTE_ADDR'])) ? $ip_address = $_SERVER['REMOTE_ADDR'] : $ip_address = '0.0.0.0.0';
|
| 15 |
-
$current_page = "http://".$_SERVER["HTTP_HOST"].$_SERVER["REQUEST_URI"];
|
| 16 |
-
|
| 17 |
wp_enqueue_script('jquery');
|
| 18 |
|
| 19 |
-
|
| 20 |
-
wp_dequeue_script('jquery-cookie');
|
| 21 |
-
wp_enqueue_script('jquery-cookie', LANDINGPAGES_URLPATH . 'js/jquery.lp.cookie.js', array( 'jquery' ));
|
| 22 |
-
|
| 23 |
-
// load local storage script
|
| 24 |
-
wp_register_script('jquery-total-storage',LANDINGPAGES_URLPATH . 'js/jquery.total-storage.min.js', array( 'jquery' ));
|
| 25 |
-
wp_enqueue_script('jquery-total-storage');
|
| 26 |
-
|
| 27 |
-
// Load funnel tracking. Force Leads to load its version if active
|
| 28 |
-
if ($post_type!=='wp-call-to-action')
|
| 29 |
-
{
|
| 30 |
-
/* Global Lead Data */
|
| 31 |
-
$lead_cpt_id = (isset($_COOKIE['wp_lead_id'])) ? $_COOKIE['wp_lead_id'] : false;
|
| 32 |
-
$lead_email = (isset($_COOKIE['wp_lead_email'])) ? $_COOKIE['wp_lead_email'] : false;
|
| 33 |
-
$lead_unique_key = (isset($_COOKIE['wp_lead_uid'])) ? $_COOKIE['wp_lead_uid'] : false;
|
| 34 |
-
$lead_data_array = array();
|
| 35 |
-
if ($lead_cpt_id) {
|
| 36 |
-
$lead_data_array['lead_id'] = $lead_cpt_id;
|
| 37 |
-
$type = 'wplid';}
|
| 38 |
-
if ($lead_email) {
|
| 39 |
-
$lead_data_array['lead_email'] = $lead_email;
|
| 40 |
-
$type = 'wplemail';}
|
| 41 |
-
if ($lead_unique_key) {
|
| 42 |
-
$lead_data_array['lead_uid'] = $lead_unique_key;
|
| 43 |
-
$type = 'wpluid';
|
| 44 |
-
}
|
| 45 |
-
wp_register_script('funnel-tracking',LANDINGPAGES_URLPATH . 'shared/tracking/page-tracking.js', array( 'jquery', 'jquery-cookie'));
|
| 46 |
-
wp_enqueue_script('funnel-tracking');
|
| 47 |
-
$time = current_time( 'timestamp', 0 ); // Current wordpress time from settings
|
| 48 |
-
$wordpress_date_time = date("Y-m-d G:i:s T", $time);
|
| 49 |
-
wp_localize_script( 'funnel-tracking' , 'wplft', array( 'post_id' => $post_id, 'ip_address' => $ip_address, 'wp_lead_data' => $lead_data_array, 'admin_url' => admin_url( 'admin-ajax.php' ), 'track_time' => $wordpress_date_time));
|
| 50 |
-
/* End Global Lead Data */
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
if (isset($post)&&$post->post_type=='landing-page')
|
| 54 |
-
{
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
// Shared Core Inbound Scripts
|
| 58 |
-
if (@function_exists('wpleads_check_active'))
|
| 59 |
-
{
|
| 60 |
-
wp_enqueue_script( 'store-lead-ajax', WPL_URL . '/shared/tracking/js/store.lead.ajax.js', array( 'jquery','jquery-cookie', 'funnel-tracking'));
|
| 61 |
-
}
|
| 62 |
-
else
|
| 63 |
-
{
|
| 64 |
-
wp_enqueue_script( 'store-lead-ajax', LANDINGPAGES_URLPATH .'shared/tracking/js/store.lead.ajax.js', array( 'jquery','jquery-cookie'));
|
| 65 |
-
}
|
| 66 |
-
wp_localize_script( 'store-lead-ajax' , 'inbound_ajax', array( 'admin_url' => admin_url( 'admin-ajax.php' ), 'post_id' => $post_id, 'post_type' => $post_type));
|
| 67 |
-
|
| 68 |
-
$variation = (isset($_GET['lp-variation-id'])) ? $_GET['lp-variation-id'] : '0';
|
| 69 |
-
wp_enqueue_script( 'landing-page-view-track' , LANDINGPAGES_URLPATH . 'js/page_view_track.js', array( 'jquery','jquery-cookie'));
|
| 70 |
-
wp_localize_script( 'landing-page-view-track' , 'landing_path_info', array( 'variation' => $variation, 'admin_url' => admin_url( 'admin-ajax.php' )));
|
| 71 |
-
|
| 72 |
-
$form_prepopulation = get_option( 'lp-main-landing-page-prepopulate-forms' , 1);
|
| 73 |
-
|
| 74 |
-
// load form pre-population script
|
| 75 |
-
if ($form_prepopulation)
|
| 76 |
-
{
|
| 77 |
-
wp_register_script('form-population',LANDINGPAGES_URLPATH . 'js/jquery.form-population.js', array( 'jquery', 'jquery-cookie' ));
|
| 78 |
-
wp_enqueue_script('form-population');
|
| 79 |
-
}
|
| 80 |
|
|
|
|
| 81 |
|
|
|
|
|
|
|
|
|
|
| 82 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 83 |
|
| 84 |
if (isset($_GET['template-customize']) &&$_GET['template-customize']=='on') {
|
| 85 |
-
// wp_register_script('lp-customizer-load-js', LANDINGPAGES_URLPATH . 'js/customizer.load.js', array('jquery'));
|
| 86 |
-
// wp_enqueue_script('lp-customizer-load-js');
|
| 87 |
echo "<style type='text/css'>#variation-list{background:#eaeaea !important; top: 26px !important; height: 35px !important;padding-top: 10px !important;}#wpadminbar {height: 29px !important;}</style>"; // enqueue styles not firing
|
| 88 |
}
|
| 89 |
if (isset($_GET['live-preview-area'])) {
|
|
@@ -91,7 +34,7 @@ function lp_fontend_enqueue_scripts($hook)
|
|
| 91 |
wp_register_script('lp-customizer-load-js', LANDINGPAGES_URLPATH . 'js/customizer.load.js', array('jquery'));
|
| 92 |
wp_enqueue_script('lp-customizer-load-js');
|
| 93 |
// wp_enqueue_style('lp-customizer-load-css', LANDINGPAGES_URLPATH . 'css/customizer-load.css'); doesn't work
|
| 94 |
-
/* Almost working
|
| 95 |
define("QUICK_CACHE_ALLOWED", false);
|
| 96 |
define("DONOTCACHEPAGE", true);
|
| 97 |
define('DONOTCACHCEOBJECT', true);
|
|
@@ -154,20 +97,25 @@ function lp_fontend_enqueue_scripts($hook)
|
|
| 154 |
|
| 155 |
}
|
| 156 |
|
| 157 |
-
|
| 158 |
/* CLEAN URL OF VARIATION GET TAGS */
|
| 159 |
add_action('wp_head', 'lp_header_load');
|
| 160 |
function lp_header_load(){
|
| 161 |
global $post;
|
| 162 |
-
if (isset($post)
|
| 163 |
-
{
|
| 164 |
wp_enqueue_style('inbound-wordpress-base', LANDINGPAGES_URLPATH . 'css/frontend/global-landing-page-style.css');
|
| 165 |
wp_enqueue_style('inbound-shortcodes', INBOUND_FORMS.'css/frontend-render.css');
|
| 166 |
-
if (isset($_GET['lp-variation-id']) && !isset($_GET['template-customize']) && !isset($_GET['iframe_window']) && !isset($_GET['live-preview-area'])) {
|
|
|
|
|
|
|
| 167 |
<script type="text/javascript">
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 171 |
}</script>
|
| 172 |
<?php }
|
| 173 |
}
|
| 2 |
|
| 3 |
add_action('wp_enqueue_scripts','lp_fontend_enqueue_scripts');
|
| 4 |
|
| 5 |
+
function lp_fontend_enqueue_scripts($hook) {
|
|
|
|
| 6 |
global $post;
|
| 7 |
|
| 8 |
if (!isset($post))
|
| 9 |
return;
|
| 10 |
|
| 11 |
$post_type = $post->post_type;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 12 |
wp_enqueue_script('jquery');
|
| 13 |
|
| 14 |
+
/* Globally used scripts moved to /shared/assets loader */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 15 |
|
| 16 |
+
if (isset($post)&&$post->post_type=='landing-page') {
|
| 17 |
|
| 18 |
+
$variation = (isset($_GET['lp-variation-id'])) ? $_GET['lp-variation-id'] : '0';
|
| 19 |
+
wp_enqueue_script( 'landing-page-view-track' , LANDINGPAGES_URLPATH . 'js/page_view_track.js', array( 'jquery','jquery-cookie'));
|
| 20 |
+
wp_localize_script( 'landing-page-view-track' , 'landing_path_info', array( 'variation' => $variation, 'admin_url' => admin_url( 'admin-ajax.php' )));
|
| 21 |
|
| 22 |
+
$form_prepopulation = get_option( 'lp-main-landing-page-prepopulate-forms' , 1);
|
| 23 |
+
// load form pre-population script
|
| 24 |
+
if ($form_prepopulation) {
|
| 25 |
+
wp_register_script('form-population',LANDINGPAGES_URLPATH . 'js/jquery.form-population.js', array( 'jquery', 'jquery-cookie' ));
|
| 26 |
+
wp_enqueue_script('form-population');
|
| 27 |
+
}
|
| 28 |
|
| 29 |
if (isset($_GET['template-customize']) &&$_GET['template-customize']=='on') {
|
|
|
|
|
|
|
| 30 |
echo "<style type='text/css'>#variation-list{background:#eaeaea !important; top: 26px !important; height: 35px !important;padding-top: 10px !important;}#wpadminbar {height: 29px !important;}</style>"; // enqueue styles not firing
|
| 31 |
}
|
| 32 |
if (isset($_GET['live-preview-area'])) {
|
| 34 |
wp_register_script('lp-customizer-load-js', LANDINGPAGES_URLPATH . 'js/customizer.load.js', array('jquery'));
|
| 35 |
wp_enqueue_script('lp-customizer-load-js');
|
| 36 |
// wp_enqueue_style('lp-customizer-load-css', LANDINGPAGES_URLPATH . 'css/customizer-load.css'); doesn't work
|
| 37 |
+
/* Almost working look into this again TODO
|
| 38 |
define("QUICK_CACHE_ALLOWED", false);
|
| 39 |
define("DONOTCACHEPAGE", true);
|
| 40 |
define('DONOTCACHCEOBJECT', true);
|
| 97 |
|
| 98 |
}
|
| 99 |
|
|
|
|
| 100 |
/* CLEAN URL OF VARIATION GET TAGS */
|
| 101 |
add_action('wp_head', 'lp_header_load');
|
| 102 |
function lp_header_load(){
|
| 103 |
global $post;
|
| 104 |
+
if (isset($post) && $post->post_type=='landing-page') {
|
|
|
|
| 105 |
wp_enqueue_style('inbound-wordpress-base', LANDINGPAGES_URLPATH . 'css/frontend/global-landing-page-style.css');
|
| 106 |
wp_enqueue_style('inbound-shortcodes', INBOUND_FORMS.'css/frontend-render.css');
|
| 107 |
+
if (isset($_GET['lp-variation-id']) && !isset($_GET['template-customize']) && !isset($_GET['iframe_window']) && !isset($_GET['live-preview-area'])) {
|
| 108 |
+
do_action('landing_page_header_script');
|
| 109 |
+
?>
|
| 110 |
<script type="text/javascript">
|
| 111 |
+
//var inbound_param_overide = 'off';
|
| 112 |
+
// Automation pass params to GA. Look for documentation
|
| 113 |
+
if (typeof (inbound_param_overide) === "undefined" || inbound_param_overide === null || inbound_param_overide === "") {
|
| 114 |
+
var inbound_param_overide = 'on';
|
| 115 |
+
}
|
| 116 |
+
var inbound_show_params = inbound_param_overide || true;
|
| 117 |
+
if (typeof window.history.pushState == 'function' && inbound_show_params != 'off') {
|
| 118 |
+
var current=window.location.href;var cleanparams=current.split("?");var clean_url=cleanparams[0];history.replaceState({},"landing page",clean_url);
|
| 119 |
}</script>
|
| 120 |
<?php }
|
| 121 |
}
|
modules/module.metaboxes.php
CHANGED
|
@@ -348,7 +348,7 @@ function lp_display_meta_box_select_template_container() {
|
|
| 348 |
}
|
| 349 |
$demo_link = (isset($data['info']['demo'])) ? $data['info']['demo'] : '';
|
| 350 |
?>
|
| 351 |
-
<div id='template-item' class="<?php echo $cat_slug; ?>">
|
| 352 |
<div id="template-box">
|
| 353 |
<div class="lp_tooltip_templates" title="<?php echo $data['info']['description']; ?>"></div>
|
| 354 |
<a class='lp_select_template' href='#' label='<?php echo $data['info']['label']; ?>' id='<?php echo $this_extension; ?>'>
|
| 348 |
}
|
| 349 |
$demo_link = (isset($data['info']['demo'])) ? $data['info']['demo'] : '';
|
| 350 |
?>
|
| 351 |
+
<div id='template-item' class="<?php echo $cat_slug; ?> template-item-boxes">
|
| 352 |
<div id="template-box">
|
| 353 |
<div class="lp_tooltip_templates" title="<?php echo $data['info']['description']; ?>"></div>
|
| 354 |
<a class='lp_select_template' href='#' label='<?php echo $data['info']['label']; ?>' id='<?php echo $this_extension; ?>'>
|
modules/module.post-type.php
CHANGED
|
@@ -1,12 +1,10 @@
|
|
| 1 |
<?php
|
| 2 |
|
| 3 |
add_action('admin_init', 'lp_rebuild_permalinks');
|
| 4 |
-
function lp_rebuild_permalinks()
|
| 5 |
-
{
|
| 6 |
$activation_check = get_option('lp_activate_rewrite_check',0);
|
| 7 |
|
| 8 |
-
if ($activation_check)
|
| 9 |
-
{
|
| 10 |
global $wp_rewrite;
|
| 11 |
$wp_rewrite->flush_rules();
|
| 12 |
update_option( 'lp_activate_rewrite_check', '0');
|
|
@@ -88,8 +86,7 @@ function lp_change_excerpt_to_summary() {
|
|
| 88 |
|
| 89 |
/* This piece is for the customizer? I'm not sure - H */
|
| 90 |
add_filter('admin_url','lp_add_fullscreen_param');
|
| 91 |
-
function lp_add_fullscreen_param( $link )
|
| 92 |
-
{
|
| 93 |
if (isset($_GET['page']))
|
| 94 |
return $link;
|
| 95 |
|
|
@@ -110,8 +107,7 @@ function lp_add_fullscreen_param( $link )
|
|
| 110 |
}
|
| 111 |
|
| 112 |
/*********PREPARE COLUMNS FOR IMPRESSIONS AND CONVERSIONS***************/
|
| 113 |
-
if (is_admin())
|
| 114 |
-
{
|
| 115 |
|
| 116 |
//include_once(LANDINGPAGES_PATH.'filters/filters.post-type.php');
|
| 117 |
|
|
@@ -491,39 +487,7 @@ if (is_admin())
|
|
| 491 |
|
| 492 |
}
|
| 493 |
|
| 494 |
-
if (!post_type_exists('wp-lead'))
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
function lp_wpleads_register() {
|
| 498 |
-
//echo $slug;exit;
|
| 499 |
-
$labels = array(
|
| 500 |
-
'name' => _x('Leads', 'post type general name'),
|
| 501 |
-
'singular_name' => _x('Lead', 'post type singular name' , LANDINGPAGES_TEXT_DOMAIN),
|
| 502 |
-
'add_new' => _x('Add New', 'Lead' , LANDINGPAGES_TEXT_DOMAIN),
|
| 503 |
-
'add_new_item' => __('Add New Lead' , LANDINGPAGES_TEXT_DOMAIN),
|
| 504 |
-
'edit_item' => __('Edit Lead' , LANDINGPAGES_TEXT_DOMAIN),
|
| 505 |
-
'new_item' => __('New Leads' , LANDINGPAGES_TEXT_DOMAIN),
|
| 506 |
-
'view_item' => __('View Leads' , LANDINGPAGES_TEXT_DOMAIN),
|
| 507 |
-
'search_items' => __('Search Leads' , LANDINGPAGES_TEXT_DOMAIN),
|
| 508 |
-
'not_found' => __('Nothing found' , LANDINGPAGES_TEXT_DOMAIN),
|
| 509 |
-
'not_found_in_trash' => __('Nothing found in Trash' , LANDINGPAGES_TEXT_DOMAIN),
|
| 510 |
-
'parent_item_colon' => ''
|
| 511 |
-
);
|
| 512 |
-
|
| 513 |
-
$args = array(
|
| 514 |
-
'labels' => $labels,
|
| 515 |
-
'public' => false,
|
| 516 |
-
'publicly_queryable' => false,
|
| 517 |
-
'show_ui' => false,
|
| 518 |
-
'query_var' => true,
|
| 519 |
-
'capability_type' => 'post',
|
| 520 |
-
'hierarchical' => false,
|
| 521 |
-
'menu_position' => null,
|
| 522 |
-
'supports' => array('custom-fields','thumbnail')
|
| 523 |
-
);
|
| 524 |
-
|
| 525 |
-
register_post_type( 'wp-lead' , $args );
|
| 526 |
-
//flush_rewrite_rules( false );
|
| 527 |
-
|
| 528 |
-
}
|
| 529 |
}
|
| 1 |
<?php
|
| 2 |
|
| 3 |
add_action('admin_init', 'lp_rebuild_permalinks');
|
| 4 |
+
function lp_rebuild_permalinks() {
|
|
|
|
| 5 |
$activation_check = get_option('lp_activate_rewrite_check',0);
|
| 6 |
|
| 7 |
+
if ($activation_check) {
|
|
|
|
| 8 |
global $wp_rewrite;
|
| 9 |
$wp_rewrite->flush_rules();
|
| 10 |
update_option( 'lp_activate_rewrite_check', '0');
|
| 86 |
|
| 87 |
/* This piece is for the customizer? I'm not sure - H */
|
| 88 |
add_filter('admin_url','lp_add_fullscreen_param');
|
| 89 |
+
function lp_add_fullscreen_param( $link ) {
|
|
|
|
| 90 |
if (isset($_GET['page']))
|
| 91 |
return $link;
|
| 92 |
|
| 107 |
}
|
| 108 |
|
| 109 |
/*********PREPARE COLUMNS FOR IMPRESSIONS AND CONVERSIONS***************/
|
| 110 |
+
if (is_admin()) {
|
|
|
|
| 111 |
|
| 112 |
//include_once(LANDINGPAGES_PATH.'filters/filters.post-type.php');
|
| 113 |
|
| 487 |
|
| 488 |
}
|
| 489 |
|
| 490 |
+
if (!post_type_exists('wp-lead')) {
|
| 491 |
+
//add_action('plugins_loaded', 'inbound_leads_register');
|
| 492 |
+
// moved to /shared/functions/lead.cpt.php
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 493 |
}
|
modules/module.redirect-ab-testing.php
CHANGED
|
@@ -62,10 +62,16 @@ else
|
|
| 62 |
{
|
| 63 |
$variation_status = get_post_meta( $pid , 'lp_ab_variation_status-'.$vid , true );
|
| 64 |
}
|
| 65 |
-
|
| 66 |
-
//echo "<br>";
|
| 67 |
if (!is_numeric($variation_status)||$variation_status==1)
|
|
|
|
| 68 |
$live_variations[] = $vid;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 69 |
}
|
| 70 |
|
| 71 |
$keys_as_values = array_flip($live_variations);
|
| 62 |
{
|
| 63 |
$variation_status = get_post_meta( $pid , 'lp_ab_variation_status-'.$vid , true );
|
| 64 |
}
|
| 65 |
+
|
|
|
|
| 66 |
if (!is_numeric($variation_status)||$variation_status==1)
|
| 67 |
+
{
|
| 68 |
$live_variations[] = $vid;
|
| 69 |
+
}
|
| 70 |
+
}
|
| 71 |
+
|
| 72 |
+
if (!$live_variations)
|
| 73 |
+
{
|
| 74 |
+
$live_variations[] = 0;
|
| 75 |
}
|
| 76 |
|
| 77 |
$keys_as_values = array_flip($live_variations);
|
modules/module.templates.php
CHANGED
|
@@ -76,7 +76,7 @@ else if (isset($_GET['page'])&&$_GET['page']=='lp_manage_templates')
|
|
| 76 |
( array_key_exists('info',$data) ) ? $this_data['description'] = $data['info']['description'] : $this_data['description'] = $data['description'];
|
| 77 |
|
| 78 |
$this_data['thumbnail'] = $thumbnail;
|
| 79 |
-
if (isset($data['version'])&&!empty($data['info']['version']))
|
| 80 |
{
|
| 81 |
$this_data['version'] = $data['info']['version'];
|
| 82 |
}
|
| 76 |
( array_key_exists('info',$data) ) ? $this_data['description'] = $data['info']['description'] : $this_data['description'] = $data['description'];
|
| 77 |
|
| 78 |
$this_data['thumbnail'] = $thumbnail;
|
| 79 |
+
if (isset($data['info']['version'])&&!empty($data['info']['version']))
|
| 80 |
{
|
| 81 |
$this_data['version'] = $data['info']['version'];
|
| 82 |
}
|
modules/module.track.php
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
<?php
|
| 2 |
$count_key = 'lp_page_views_count';
|
| 3 |
$count = get_post_meta($postID, $count_key, true);
|
| 4 |
if($count==''){
|
| 5 |
delete_post_meta($postID, $count_key);
|
| 6 |
add_post_meta($postID, $count_key, '0');
|
| 7 |
return;
|
| 8 |
}
|
| 9 |
return $count;
|
| 10 |
$count_key = 'lp_page_views_count';
|
| 11 |
$count = get_post_meta($postID, $count_key, true);
|
| 12 |
if($count==''){
|
| 13 |
$count = 0;
|
| 14 |
delete_post_meta($postID, $count_key);
|
| 15 |
add_post_meta($postID, $count_key, '0');
|
| 16 |
}else{
|
| 17 |
$count++;
|
| 18 |
update_post_meta($postID, $count_key, $count);
|
| 19 |
}
|
| 20 |
$count_key = 'lp_page_conversions_count';
|
| 21 |
$count = get_post_meta($postID, $count_key, true);
|
| 22 |
if($count==''){
|
| 23 |
delete_post_meta($postID, $count_key);
|
| 24 |
add_post_meta($postID, $count_key, '0');
|
| 25 |
return "0";
|
| 26 |
}
|
| 27 |
return $count;
|
| 28 |
$count_key = 'lp_page_conversions_count';
|
| 29 |
$count = get_post_meta($postID, $count_key, true);
|
| 30 |
if($count==''){
|
| 31 |
$count = 0;
|
| 32 |
delete_post_meta($postID, $count_key);
|
| 33 |
add_post_meta($postID, $count_key, '0');
|
| 34 |
}else{
|
| 35 |
$count++;
|
| 36 |
update_post_meta($postID, $count_key, $count);
|
| 37 |
}
|
|
|
|
| 38 |
$count_key = 'lp_page_views_count';
|
| 39 |
$count = get_post_meta($postID, $count_key, true);
|
| 40 |
if($count==''){
|
| 41 |
delete_post_meta($postID, $count_key);
|
| 42 |
add_post_meta($postID, $count_key, '0');
|
| 43 |
return;
|
| 44 |
}
|
| 45 |
return $count;
|
| 46 |
$count_key = 'lp_page_views_count';
|
| 47 |
$count = get_post_meta($postID, $count_key, true);
|
| 48 |
if($count==''){
|
| 49 |
$count = 0;
|
| 50 |
delete_post_meta($postID, $count_key);
|
| 51 |
add_post_meta($postID, $count_key, '0');
|
| 52 |
}else{
|
| 53 |
$count++;
|
| 54 |
update_post_meta($postID, $count_key, $count);
|
| 55 |
}
|
| 56 |
$count_key = 'lp_page_conversions_count';
|
| 57 |
$count = get_post_meta($postID, $count_key, true);
|
| 58 |
if($count==''){
|
| 59 |
delete_post_meta($postID, $count_key);
|
| 60 |
add_post_meta($postID, $count_key, '0');
|
| 61 |
return "0";
|
| 62 |
}
|
| 63 |
return $count;
|
| 64 |
$count_key = 'lp_page_conversions_count';
|
| 65 |
$count = get_post_meta($postID, $count_key, true);
|
| 66 |
if($count==''){
|
| 67 |
$count = 0;
|
| 68 |
delete_post_meta($postID, $count_key);
|
| 69 |
add_post_meta($postID, $count_key, '0');
|
| 70 |
}else{
|
| 71 |
$count++;
|
| 72 |
update_post_meta($postID, $count_key, $count);
|
| 73 |
}
|
|
|
|
| 1 |
$count_key = 'lp_page_views_count';
|
| 2 |
$count = get_post_meta($postID, $count_key, true);
|
| 3 |
if($count==''){
|
| 4 |
delete_post_meta($postID, $count_key);
|
| 5 |
add_post_meta($postID, $count_key, '0');
|
| 6 |
return;
|
| 7 |
}
|
| 8 |
return $count;
|
| 9 |
$count_key = 'lp_page_views_count';
|
| 10 |
$count = get_post_meta($postID, $count_key, true);
|
| 11 |
if($count==''){
|
| 12 |
$count = 0;
|
| 13 |
delete_post_meta($postID, $count_key);
|
| 14 |
add_post_meta($postID, $count_key, '0');
|
| 15 |
}else{
|
| 16 |
$count++;
|
| 17 |
update_post_meta($postID, $count_key, $count);
|
| 18 |
}
|
| 19 |
$count_key = 'lp_page_conversions_count';
|
| 20 |
$count = get_post_meta($postID, $count_key, true);
|
| 21 |
if($count==''){
|
| 22 |
delete_post_meta($postID, $count_key);
|
| 23 |
add_post_meta($postID, $count_key, '0');
|
| 24 |
return "0";
|
| 25 |
}
|
| 26 |
return $count;
|
| 27 |
$count_key = 'lp_page_conversions_count';
|
| 28 |
$count = get_post_meta($postID, $count_key, true);
|
| 29 |
if($count==''){
|
| 30 |
$count = 0;
|
| 31 |
delete_post_meta($postID, $count_key);
|
| 32 |
add_post_meta($postID, $count_key, '0');
|
| 33 |
}else{
|
| 34 |
$count++;
|
| 35 |
update_post_meta($postID, $count_key, $count);
|
| 36 |
}
|
| 37 |
+
<?php
|
| 38 |
$count_key = 'lp_page_views_count';
|
| 39 |
$count = get_post_meta($postID, $count_key, true);
|
| 40 |
if($count==''){
|
| 41 |
delete_post_meta($postID, $count_key);
|
| 42 |
add_post_meta($postID, $count_key, '0');
|
| 43 |
return;
|
| 44 |
}
|
| 45 |
return $count;
|
| 46 |
$count_key = 'lp_page_views_count';
|
| 47 |
$count = get_post_meta($postID, $count_key, true);
|
| 48 |
if($count==''){
|
| 49 |
$count = 0;
|
| 50 |
delete_post_meta($postID, $count_key);
|
| 51 |
add_post_meta($postID, $count_key, '0');
|
| 52 |
}else{
|
| 53 |
$count++;
|
| 54 |
update_post_meta($postID, $count_key, $count);
|
| 55 |
}
|
| 56 |
$count_key = 'lp_page_conversions_count';
|
| 57 |
$count = get_post_meta($postID, $count_key, true);
|
| 58 |
if($count==''){
|
| 59 |
delete_post_meta($postID, $count_key);
|
| 60 |
add_post_meta($postID, $count_key, '0');
|
| 61 |
return "0";
|
| 62 |
}
|
| 63 |
return $count;
|
| 64 |
$count_key = 'lp_page_conversions_count';
|
| 65 |
$count = get_post_meta($postID, $count_key, true);
|
| 66 |
if($count==''){
|
| 67 |
$count = 0;
|
| 68 |
delete_post_meta($postID, $count_key);
|
| 69 |
add_post_meta($postID, $count_key, '0');
|
| 70 |
}else{
|
| 71 |
$count++;
|
| 72 |
update_post_meta($postID, $count_key, $count);
|
| 73 |
}
|
modules/module.track.php.orig
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
| 0 |
$count_key = 'lp_page_views_count';
|
| 1 |
$count = get_post_meta($postID, $count_key, true);
|
| 2 |
if($count==''){
|
| 3 |
delete_post_meta($postID, $count_key);
|
| 4 |
add_post_meta($postID, $count_key, '0');
|
| 5 |
return;
|
| 6 |
}
|
| 7 |
return $count;
|
| 8 |
$count_key = 'lp_page_views_count';
|
| 9 |
$count = get_post_meta($postID, $count_key, true);
|
| 10 |
if($count==''){
|
| 11 |
$count = 0;
|
| 12 |
delete_post_meta($postID, $count_key);
|
| 13 |
add_post_meta($postID, $count_key, '0');
|
| 14 |
}else{
|
| 15 |
$count++;
|
| 16 |
update_post_meta($postID, $count_key, $count);
|
| 17 |
}
|
| 18 |
$count_key = 'lp_page_conversions_count';
|
| 19 |
$count = get_post_meta($postID, $count_key, true);
|
| 20 |
if($count==''){
|
| 21 |
delete_post_meta($postID, $count_key);
|
| 22 |
add_post_meta($postID, $count_key, '0');
|
| 23 |
return "0";
|
| 24 |
}
|
| 25 |
return $count;
|
| 26 |
$count_key = 'lp_page_conversions_count';
|
| 27 |
$count = get_post_meta($postID, $count_key, true);
|
| 28 |
if($count==''){
|
| 29 |
$count = 0;
|
| 30 |
delete_post_meta($postID, $count_key);
|
| 31 |
add_post_meta($postID, $count_key, '0');
|
| 32 |
}else{
|
| 33 |
$count++;
|
| 34 |
update_post_meta($postID, $count_key, $count);
|
| 35 |
}
|
| 1 |
+
<?php
|
| 2 |
$count_key = 'lp_page_views_count';
|
| 3 |
$count = get_post_meta($postID, $count_key, true);
|
| 4 |
if($count==''){
|
| 5 |
delete_post_meta($postID, $count_key);
|
| 6 |
add_post_meta($postID, $count_key, '0');
|
| 7 |
return;
|
| 8 |
}
|
| 9 |
return $count;
|
| 10 |
$count_key = 'lp_page_views_count';
|
| 11 |
$count = get_post_meta($postID, $count_key, true);
|
| 12 |
if($count==''){
|
| 13 |
$count = 0;
|
| 14 |
delete_post_meta($postID, $count_key);
|
| 15 |
add_post_meta($postID, $count_key, '0');
|
| 16 |
}else{
|
| 17 |
$count++;
|
| 18 |
update_post_meta($postID, $count_key, $count);
|
| 19 |
}
|
| 20 |
$count_key = 'lp_page_conversions_count';
|
| 21 |
$count = get_post_meta($postID, $count_key, true);
|
| 22 |
if($count==''){
|
| 23 |
delete_post_meta($postID, $count_key);
|
| 24 |
add_post_meta($postID, $count_key, '0');
|
| 25 |
return "0";
|
| 26 |
}
|
| 27 |
return $count;
|
| 28 |
$count_key = 'lp_page_conversions_count';
|
| 29 |
$count = get_post_meta($postID, $count_key, true);
|
| 30 |
if($count==''){
|
| 31 |
$count = 0;
|
| 32 |
delete_post_meta($postID, $count_key);
|
| 33 |
add_post_meta($postID, $count_key, '0');
|
| 34 |
}else{
|
| 35 |
$count++;
|
| 36 |
update_post_meta($postID, $count_key, $count);
|
| 37 |
}
|
modules/module.utils.php
CHANGED
|
@@ -127,20 +127,20 @@ function landingpage_fix_known_wp_title_isses() {
|
|
| 127 |
remove_filter( 'wp_title', 'genesis_doctitle_wrap' , 20 );
|
| 128 |
remove_filter( 'wp_title', 'genesis_default_title' , 10 );
|
| 129 |
}
|
| 130 |
-
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
|
| 137 |
-
|
| 138 |
-
|
| 139 |
-
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
}
|
| 143 |
}
|
|
|
|
| 144 |
|
| 145 |
function lp_fix_seo_title()
|
| 146 |
{
|
|
@@ -183,30 +183,42 @@ function lp_wp_nav_menu_args( $args = '' )
|
|
| 183 |
///////// Remove all base css from the current active wordpress theme in landing pages
|
| 184 |
//currently removes all css from wp_head and re-enqueues the admin bar css.
|
| 185 |
add_action('wp_print_styles', 'lp_remove_all_styles', 100);
|
| 186 |
-
function lp_remove_all_styles()
|
| 187 |
-
{
|
| 188 |
-
|
| 189 |
-
{
|
| 190 |
-
if ( 'landing-page' == get_post_type() )
|
| 191 |
-
{
|
| 192 |
global $post;
|
| 193 |
$template = get_post_meta($post->ID, 'lp-selected-template', true);
|
| 194 |
|
| 195 |
-
if (strstr($template,'-slash-'))
|
| 196 |
-
{
|
| 197 |
$template = str_replace('-slash-','/',$template);
|
| 198 |
}
|
| 199 |
|
| 200 |
$my_theme = wp_get_theme($template);
|
| 201 |
|
| 202 |
-
if ($my_theme->exists()||$template=='default')
|
| 203 |
-
{
|
| 204 |
return;
|
| 205 |
-
}
|
| 206 |
-
else
|
| 207 |
-
{
|
| 208 |
global $wp_styles;
|
| 209 |
-
$wp_styles
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 210 |
//wp_register_style( 'admin-bar' );
|
| 211 |
wp_enqueue_style( 'admin-bar' );
|
| 212 |
}
|
| 127 |
remove_filter( 'wp_title', 'genesis_doctitle_wrap' , 20 );
|
| 128 |
remove_filter( 'wp_title', 'genesis_default_title' , 10 );
|
| 129 |
}
|
| 130 |
+
// Fix qtranslate issues
|
| 131 |
+
if (!function_exists('inbound_qtrans_disable')) {
|
| 132 |
+
function inbound_qtrans_disable() {
|
| 133 |
+
global $typenow, $pagenow;
|
| 134 |
+
|
| 135 |
+
if (in_array($typenow, array('landing-page'||'wp-call-to-action')) && // post_types where qTranslate should be disabled
|
| 136 |
+
in_array($pagenow, array('post-new.php', 'post.php'))) {
|
| 137 |
+
remove_action('admin_head', 'qtrans_adminHeader');
|
| 138 |
+
remove_filter('admin_footer', 'qtrans_modifyExcerpt');
|
| 139 |
+
remove_filter('the_editor', 'qtrans_modifyRichEditor');
|
| 140 |
+
}
|
| 141 |
+
}
|
|
|
|
| 142 |
}
|
| 143 |
+
add_action('current_screen', 'inbound_qtrans_disable');
|
| 144 |
|
| 145 |
function lp_fix_seo_title()
|
| 146 |
{
|
| 183 |
///////// Remove all base css from the current active wordpress theme in landing pages
|
| 184 |
//currently removes all css from wp_head and re-enqueues the admin bar css.
|
| 185 |
add_action('wp_print_styles', 'lp_remove_all_styles', 100);
|
| 186 |
+
function lp_remove_all_styles() {
|
| 187 |
+
if (!is_admin()) {
|
| 188 |
+
if ( 'landing-page' == get_post_type() ) {
|
|
|
|
|
|
|
|
|
|
| 189 |
global $post;
|
| 190 |
$template = get_post_meta($post->ID, 'lp-selected-template', true);
|
| 191 |
|
| 192 |
+
if (strstr($template,'-slash-')) {
|
|
|
|
| 193 |
$template = str_replace('-slash-','/',$template);
|
| 194 |
}
|
| 195 |
|
| 196 |
$my_theme = wp_get_theme($template);
|
| 197 |
|
| 198 |
+
if ($my_theme->exists()||$template=='default') {
|
|
|
|
| 199 |
return;
|
| 200 |
+
} else {
|
|
|
|
|
|
|
| 201 |
global $wp_styles;
|
| 202 |
+
//print_r($wp_styles);
|
| 203 |
+
$registered_scripts = $wp_styles->registered;
|
| 204 |
+
$inbound_white_list = array();
|
| 205 |
+
foreach ($registered_scripts as $handle) {
|
| 206 |
+
if(preg_match("/\/plugins\/leads\//", $handle->src)) {
|
| 207 |
+
//echo $handle->handle;
|
| 208 |
+
$inbound_white_list[] = $handle->handle;
|
| 209 |
+
}
|
| 210 |
+
if(preg_match("/\/plugins\/cta\//", $handle->src)) {
|
| 211 |
+
//echo $handle->handle;
|
| 212 |
+
$inbound_white_list[]= $handle->handle;
|
| 213 |
+
}
|
| 214 |
+
if(preg_match("/\/plugins\/landing-pages\//", $handle->src)) {
|
| 215 |
+
//echo $handle->handle;
|
| 216 |
+
$inbound_white_list[]= $handle->handle;
|
| 217 |
+
}
|
| 218 |
+
}
|
| 219 |
+
//print_r($inbound_white_list);
|
| 220 |
+
$wp_styles->queue = $inbound_white_list;
|
| 221 |
+
//$wp_styles->queue = array(''); // removes all styles
|
| 222 |
//wp_register_style( 'admin-bar' );
|
| 223 |
wp_enqueue_style( 'admin-bar' );
|
| 224 |
}
|
modules/module.welcome.php
CHANGED
|
@@ -14,13 +14,13 @@
|
|
| 14 |
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 15 |
|
| 16 |
/**
|
| 17 |
-
*
|
| 18 |
*
|
| 19 |
* A general class for About and Credits page.
|
| 20 |
*
|
| 21 |
* @since 1.4
|
| 22 |
*/
|
| 23 |
-
class
|
| 24 |
|
| 25 |
/**
|
| 26 |
* @var string The capability users should have to view the page
|
|
@@ -614,4 +614,4 @@ class LANDINGPAGES_Welcome {
|
|
| 614 |
wp_safe_redirect( admin_url( 'index.php?page=lp-quick-start' ) ); exit;
|
| 615 |
}
|
| 616 |
}
|
| 617 |
-
new
|
| 14 |
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 15 |
|
| 16 |
/**
|
| 17 |
+
* LandingPages_Welcome Class
|
| 18 |
*
|
| 19 |
* A general class for About and Credits page.
|
| 20 |
*
|
| 21 |
* @since 1.4
|
| 22 |
*/
|
| 23 |
+
class LandingPages_Welcome {
|
| 24 |
|
| 25 |
/**
|
| 26 |
* @var string The capability users should have to view the page
|
| 614 |
wp_safe_redirect( admin_url( 'index.php?page=lp-quick-start' ) ); exit;
|
| 615 |
}
|
| 616 |
}
|
| 617 |
+
new LandingPages_Welcome();
|
modules/module.widgets.php
CHANGED
|
@@ -4,17 +4,17 @@ add_action( 'widgets_init', 'lp_load_widgets' );
|
|
| 4 |
|
| 5 |
function lp_load_widgets() {
|
| 6 |
|
| 7 |
-
register_widget( '
|
| 8 |
|
| 9 |
}
|
| 10 |
|
| 11 |
-
class
|
| 12 |
{
|
| 13 |
|
| 14 |
-
function
|
| 15 |
|
| 16 |
/* Widget settings. */
|
| 17 |
-
$widget_ops = array( 'classname' => '
|
| 18 |
|
| 19 |
/* Widget control settings. */
|
| 20 |
$control_ops = array( 'width' => 300, 'height' => 350, 'id_base' => 'id_lp_conversion_area_widget' );
|
| 4 |
|
| 5 |
function lp_load_widgets() {
|
| 6 |
|
| 7 |
+
register_widget( 'LandingPages_Widget_ConversionArea' );
|
| 8 |
|
| 9 |
}
|
| 10 |
|
| 11 |
+
class LandingPages_Widget_ConversionArea extends WP_Widget
|
| 12 |
{
|
| 13 |
|
| 14 |
+
function LandingPages_Widget_ConversionArea() {
|
| 15 |
|
| 16 |
/* Widget settings. */
|
| 17 |
+
$widget_ops = array( 'classname' => 'class_LandingPages_Widget_ConversionArea', 'description' => __('Use this widget on your landing page sidebar. This sidebar replaces the normal sidebar while using your default theme as a template, or other inactive themes as landing page templates.', LANDINGPAGES_TEXT_DOMAIN) );
|
| 18 |
|
| 19 |
/* Widget control settings. */
|
| 20 |
$control_ops = array( 'width' => 300, 'height' => 350, 'id_base' => 'id_lp_conversion_area_widget' );
|
readme.txt
CHANGED
|
@@ -7,7 +7,7 @@ License URI: http://www.gnu.org/licenses/gpl-2.0.html
|
|
| 7 |
Tags: landing pages, inbound marketing, conversion pages, split testing, a b test, a b testing, a/b test, a/b testing, coming soon page, email list, landing page, list building, maintenance page, squeeze page, inbound now, landing-pages, splash pages, cpa, click tracking, goal tracking, analytics, free landing page templates
|
| 8 |
Requires at least: 3.7
|
| 9 |
Tested up to: 3.8
|
| 10 |
-
Stable Tag: 1.4.
|
| 11 |
|
| 12 |
Create landing pages for your WordPress site. Monitor and improve conversion rates, run A/B split tests, customize your own templates and more.
|
| 13 |
|
|
@@ -58,7 +58,7 @@ The plugin is also fully extendable and has a number of <a href='http://docs.inb
|
|
| 58 |
|
| 59 |
== Frequently Asked Questions ==
|
| 60 |
*Can I create my own landing page designs?,
|
| 61 |
-
*Yes! You can learn how to <a href="http://docs.inboundnow.com/
|
| 62 |
|
| 63 |
== Screenshots ==
|
| 64 |
|
|
@@ -68,6 +68,20 @@ The plugin is also fully extendable and has a number of <a href='http://docs.inb
|
|
| 68 |
4. Choose from a ton of pre-made templates, use your existing design, or design your own theme!
|
| 69 |
|
| 70 |
== Changelog ==
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 71 |
= 1.4.6 =
|
| 72 |
* New Feature: Bulk Lead management with leads plugin wordpress.org/plugins/leads/
|
| 73 |
* Added tags to lead profiles for improved management/categorization
|
| 7 |
Tags: landing pages, inbound marketing, conversion pages, split testing, a b test, a b testing, a/b test, a/b testing, coming soon page, email list, landing page, list building, maintenance page, squeeze page, inbound now, landing-pages, splash pages, cpa, click tracking, goal tracking, analytics, free landing page templates
|
| 8 |
Requires at least: 3.7
|
| 9 |
Tested up to: 3.8
|
| 10 |
+
Stable Tag: 1.4.8
|
| 11 |
|
| 12 |
Create landing pages for your WordPress site. Monitor and improve conversion rates, run A/B split tests, customize your own templates and more.
|
| 13 |
|
| 58 |
|
| 59 |
== Frequently Asked Questions ==
|
| 60 |
*Can I create my own landing page designs?,
|
| 61 |
+
*Yes! You can learn how to <a href="http://docs.inboundnow.com/guide/creating-landing-page-templates/">create your own landing page template here</a>.
|
| 62 |
|
| 63 |
== Screenshots ==
|
| 64 |
|
| 68 |
4. Choose from a ton of pre-made templates, use your existing design, or design your own theme!
|
| 69 |
|
| 70 |
== Changelog ==
|
| 71 |
+
|
| 72 |
+
= 1.4.8 =
|
| 73 |
+
* Added Google Analytics Custom Event Tracking for form submissions
|
| 74 |
+
* Added Ability: automatically sort leads into lists on form completions
|
| 75 |
+
* Added Ability: Send lead notification emails to multiple people. Use comma separated values
|
| 76 |
+
* Improved Social Media Buttons called with lp_social_media() function
|
| 77 |
+
* Fixed qTranslate plugin bug
|
| 78 |
+
* Fixed Genesis Title tag conflict
|
| 79 |
+
* Added improved asset loader
|
| 80 |
+
* Updated main docs.inboundnow.com site. Check it out!
|
| 81 |
+
|
| 82 |
+
= 1.4.7 =
|
| 83 |
+
* GPL fix with js library
|
| 84 |
+
|
| 85 |
= 1.4.6 =
|
| 86 |
* New Feature: Bulk Lead management with leads plugin wordpress.org/plugins/leads/
|
| 87 |
* Added tags to lead profiles for improved management/categorization
|
shared/.SyncIgnore
CHANGED
|
@@ -1,13 +1,23 @@
|
|
| 1 |
-
# .SyncIgnore is a UTF-8 encoded .txt file that helps you specify single files, paths and rules
|
| 2 |
-
# for ignoring during the synchronization job. It supports
|
| 3 |
-
#
|
| 4 |
-
#
|
| 5 |
-
#
|
| 6 |
-
|
| 7 |
-
.
|
| 8 |
-
|
| 9 |
-
.
|
| 10 |
-
.
|
| 11 |
-
|
| 12 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 13 |
Thumbs.db
|
| 1 |
+
# .SyncIgnore is a UTF-8 encoded .txt file that helps you specify single files, paths and rules
|
| 2 |
+
# for ignoring during the synchronization job. It supports ‘?’ and ‘*‘ wildcard symbols.
|
| 3 |
+
#
|
| 4 |
+
# Note that .SyncIgnore is applied only to the folder where it is contained and
|
| 5 |
+
# will not work with the files that have already been synced.
|
| 6 |
+
#
|
| 7 |
+
# If you add indexed files to .SyncIgnore, they will be deleted on other syncing devices.
|
| 8 |
+
# In order to avoid this:
|
| 9 |
+
# 1. Quit BitTorrent Sync or remove the folder from sync on all the devices.
|
| 10 |
+
# 2. Modify .SyncIgnore file on all of them so that it contains same info.
|
| 11 |
+
# 3. Run BitTorrent Sync or re-add the modified folders.
|
| 12 |
+
#
|
| 13 |
+
#
|
| 14 |
+
# OS generated files #
|
| 15 |
+
.DS_Store
|
| 16 |
+
.DS_Store?
|
| 17 |
+
._*
|
| 18 |
+
.Spotlight-V100
|
| 19 |
+
.Trashes
|
| 20 |
+
Icon?
|
| 21 |
+
ehthumbs.db
|
| 22 |
+
desktop.ini
|
| 23 |
Thumbs.db
|
shared/assets/admin/css/global-inbound-admin.css
ADDED
|
@@ -0,0 +1,136 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#wpadminbar.nojs .ab-top-menu > li.menupop.icon-edd:hover > .ab-item,
|
| 2 |
+
#wpadminbar .ab-top-menu > li.menupop.icon-edd.hover > .ab-item,
|
| 3 |
+
#wpadminbar.nojs .ab-top-menu > li.menupop.icon-edd > .ab-item,
|
| 4 |
+
#wpadminbar .ab-top-menu > li.menupop.icon-edd > .ab-item {
|
| 5 |
+
|
| 6 |
+
background-image: url('../../global/images/shortcodes-blue.png');
|
| 7 |
+
|
| 8 |
+
background-repeat: no-repeat;
|
| 9 |
+
background-position: 0.15em 50%;
|
| 10 |
+
padding-left: 22px;
|
| 11 |
+
}
|
| 12 |
+
#wp-admin-bar-ddw-edd-languages-de > .ab-item:before,
|
| 13 |
+
#wp-admin-bar-ddw-edd-translations-forum > .ab-item:before {
|
| 14 |
+
color: #ff9900;
|
| 15 |
+
content: '• ';
|
| 16 |
+
}
|
| 17 |
+
#wpadminbar .eddtb-search-input {
|
| 18 |
+
width: 140px;
|
| 19 |
+
}
|
| 20 |
+
#wp-admin-bar-ddw-edd-inboundsupportsections .ab-item,
|
| 21 |
+
#wp-admin-bar-ddw-edd-inbounddocsquick .ab-item,
|
| 22 |
+
#wp-admin-bar-ddw-edd-inbounddocssections .ab-item,
|
| 23 |
+
#wpadminbar .eddtb-search-input,
|
| 24 |
+
#wpadminbar .eddtb-search-go {
|
| 25 |
+
color: #21759b !important;
|
| 26 |
+
text-shadow: none;
|
| 27 |
+
}
|
| 28 |
+
#wpadminbar .eddtb-search-input,
|
| 29 |
+
#wpadminbar .eddtb-search-go {
|
| 30 |
+
background-color: #fff;
|
| 31 |
+
height: 18px;
|
| 32 |
+
line-height: 18px;
|
| 33 |
+
padding: 1px 4px;
|
| 34 |
+
}
|
| 35 |
+
#wpadminbar .eddtb-search-go {
|
| 36 |
+
-webkit-border-radius: 11px;
|
| 37 |
+
-moz-border-radius: 11px;
|
| 38 |
+
border-radius: 11px;
|
| 39 |
+
font-size: 0.67em;
|
| 40 |
+
margin: 0 0 0 2px;
|
| 41 |
+
}
|
| 42 |
+
@font-face {
|
| 43 |
+
font-family: 'FontAwesome';
|
| 44 |
+
src: url('../../global/fonts/fontawesome/fontawesome-webfont.eot');
|
| 45 |
+
src: url('../../global/fonts/fontawesome/fontawesome-webfont.eot') format('embedded-opentype'),
|
| 46 |
+
url('../../global/fonts/fontawesome/fontawesome-webfont.woff?v=3.0.2') format('woff'),
|
| 47 |
+
url('../../global/fonts/fontawesome/fontawesome-webfont.ttf?v=3.0.2') format('truetype');
|
| 48 |
+
font-weight: normal;
|
| 49 |
+
font-style: normal;
|
| 50 |
+
}
|
| 51 |
+
#adminmenu .menu-icon-wp-lead div.wp-menu-image:before {
|
| 52 |
+
font-family: "FontAwesome" !important;
|
| 53 |
+
content: "\f0c0";
|
| 54 |
+
|
| 55 |
+
}
|
| 56 |
+
.branch-3-7 #adminmenu .menu-icon-wp-lead div.wp-menu-image:before {
|
| 57 |
+
display: none;
|
| 58 |
+
}
|
| 59 |
+
#adminmenu .menu-icon-wp-lead div.wp-menu-image img{
|
| 60 |
+
display: none;
|
| 61 |
+
}
|
| 62 |
+
.branch-3-7 #adminmenu .menu-icon-wp-lead div.wp-menu-image img {
|
| 63 |
+
display: block;
|
| 64 |
+
}
|
| 65 |
+
#wp-admin-bar-inbound-cta a:first-child, #wp-admin-bar-inbound-inboundtemplates .ab-item.ab-empty-item, #wp-admin-bar-inbound-inboundsettings .ab-item.ab-empty-item, #wp-admin-bar-inbound-inboundreports a:first-child {
|
| 66 |
+
padding-left: 30px !important;
|
| 67 |
+
}
|
| 68 |
+
#wp-admin-bar-inbound-inboundtemplates .ab-item.ab-empty-item:hover, #wp-admin-bar-inbound-inboundsettings .ab-item.ab-empty-item:hover {
|
| 69 |
+
color: #2ea2cc;
|
| 70 |
+
}
|
| 71 |
+
#wp-admin-bar-inbound-leads a:first-child, #wp-admin-bar-inbound-inboundseo a:first-child, #wp-admin-bar-inbound-landingpages a:first-child, #wp-admin-bar-inbound-inboundforms a:first-child {
|
| 72 |
+
padding-left: 31px !important;
|
| 73 |
+
}
|
| 74 |
+
#search-inbound-menu {
|
| 75 |
+
max-height: 22px !important;
|
| 76 |
+
padding: 0px !important;
|
| 77 |
+
min-height: 23px !important;
|
| 78 |
+
padding-left: 3px !important;
|
| 79 |
+
margin-bottom: 1px !important;
|
| 80 |
+
}
|
| 81 |
+
#wp-admin-bar-inbound-inbounddocs-searchform, #wp-admin-bar-inbound-leads-search{
|
| 82 |
+
margin-bottom: 10px !important;
|
| 83 |
+
}
|
| 84 |
+
#wp-admin-bar-inbound-cta .ab-submenu a, #wp-admin-bar-inbound-leads .ab-submenu a, #wp-admin-bar-inbound-landingpages .ab-submenu a , #wp-admin-bar-inbound-inboundforms .ab-submenu a, #wp-admin-bar-inbound-inboundtemplates .ab-submenu a, #wp-admin-bar-inbound-inboundreports .ab-submenu a, #wp-admin-bar-inbound-inboundseo .ab-submenu a{
|
| 85 |
+
padding-left: 10px !important;
|
| 86 |
+
}
|
| 87 |
+
#wp-admin-bar-inbound-cta:before, #wp-admin-bar-inbound-leads:before, #wp-admin-bar-inbound-landingpages:before, #wp-admin-bar-inbound-inboundforms:before, #wp-admin-bar-inbound-inboundtemplates:before, #wp-admin-bar-inbound-inboundsettings:before, #wp-admin-bar-inbound-inboundreports:before, #wp-admin-bar-inbound-inboundseo:before {
|
| 88 |
+
font-family: "FontAwesome" !important;
|
| 89 |
+
content: "\f05b" !important;
|
| 90 |
+
font: 100 19px/1 "FontAwesome" !important;
|
| 91 |
+
padding-top: 4px;
|
| 92 |
+
width: 30px;
|
| 93 |
+
display: inline-block;
|
| 94 |
+
height: 30px;
|
| 95 |
+
position: absolute;
|
| 96 |
+
left: 6px;
|
| 97 |
+
}
|
| 98 |
+
#wp-admin-bar-inbound-leads:before {
|
| 99 |
+
content: "\f0c0" !important;
|
| 100 |
+
font: 100 17px/1 "FontAwesome" !important;
|
| 101 |
+
}
|
| 102 |
+
#wp-admin-bar-inbound-landingpages:before {
|
| 103 |
+
content: "\f15c" !important;
|
| 104 |
+
left: 7px;
|
| 105 |
+
font-size: 21px !important;
|
| 106 |
+
}
|
| 107 |
+
#wp-admin-bar-inbound-inboundforms:before {
|
| 108 |
+
font: 400 18px/1 dashicons!important;
|
| 109 |
+
content: "\f163" !important;
|
| 110 |
+
}
|
| 111 |
+
#wp-admin-bar-inbound-inboundtemplates:before {
|
| 112 |
+
content: "\f0c5" !important;
|
| 113 |
+
font-size: 18px !important;
|
| 114 |
+
}
|
| 115 |
+
#wp-admin-bar-inbound-inboundsettings:before {
|
| 116 |
+
content: "\f013" !important;
|
| 117 |
+
left: 7px !important;
|
| 118 |
+
}
|
| 119 |
+
#wp-admin-bar-inbound-inboundreports:before {
|
| 120 |
+
content: "\f012" !important;
|
| 121 |
+
font-size: 17px !important;
|
| 122 |
+
}
|
| 123 |
+
#wp-admin-bar-inbound-inboundseo:before {
|
| 124 |
+
content: "\f002" !important;
|
| 125 |
+
font-size: 17px !important;
|
| 126 |
+
}
|
| 127 |
+
#wp-admin-bar-inbound-cta a {
|
| 128 |
+
vertical-align: top;
|
| 129 |
+
}
|
| 130 |
+
#adminmenu .menu-icon-wp-call-to-action div.wp-menu-image:before {
|
| 131 |
+
font-family: "FontAwesome" !important;
|
| 132 |
+
content: "\f05b";
|
| 133 |
+
font: 400 24px/1 "FontAwesome" !important;
|
| 134 |
+
padding-top: 6px;
|
| 135 |
+
|
| 136 |
+
}
|
shared/assets/admin/images/inbound-now-logo.png
ADDED
|
Binary file
|
shared/assets/admin/js/select2.js
ADDED
|
@@ -0,0 +1,3137 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2012 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.4.1 Timestamp: Thu Jun 27 18:02:10 PDT 2013
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the
|
| 17 |
+
Apache License or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
|
| 18 |
+
CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
|
| 19 |
+
the specific language governing permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
(function ($) {
|
| 22 |
+
if(typeof $.fn.each2 == "undefined") {
|
| 23 |
+
$.fn.extend({
|
| 24 |
+
/*
|
| 25 |
+
* 4-10 times faster .each replacement
|
| 26 |
+
* use it carefully, as it overrides jQuery context of element on each iteration
|
| 27 |
+
*/
|
| 28 |
+
each2 : function (c) {
|
| 29 |
+
var j = $([0]), i = -1, l = this.length;
|
| 30 |
+
while (
|
| 31 |
+
++i < l
|
| 32 |
+
&& (j.context = j[0] = this[i])
|
| 33 |
+
&& c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
|
| 34 |
+
);
|
| 35 |
+
return this;
|
| 36 |
+
}
|
| 37 |
+
});
|
| 38 |
+
}
|
| 39 |
+
})(jQuery);
|
| 40 |
+
|
| 41 |
+
(function ($, undefined) {
|
| 42 |
+
"use strict";
|
| 43 |
+
/*global document, window, jQuery, console */
|
| 44 |
+
|
| 45 |
+
if (window.Select2 !== undefined) {
|
| 46 |
+
return;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
var KEY, AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
|
| 50 |
+
lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
|
| 51 |
+
|
| 52 |
+
KEY = {
|
| 53 |
+
TAB: 9,
|
| 54 |
+
ENTER: 13,
|
| 55 |
+
ESC: 27,
|
| 56 |
+
SPACE: 32,
|
| 57 |
+
LEFT: 37,
|
| 58 |
+
UP: 38,
|
| 59 |
+
RIGHT: 39,
|
| 60 |
+
DOWN: 40,
|
| 61 |
+
SHIFT: 16,
|
| 62 |
+
CTRL: 17,
|
| 63 |
+
ALT: 18,
|
| 64 |
+
PAGE_UP: 33,
|
| 65 |
+
PAGE_DOWN: 34,
|
| 66 |
+
HOME: 36,
|
| 67 |
+
END: 35,
|
| 68 |
+
BACKSPACE: 8,
|
| 69 |
+
DELETE: 46,
|
| 70 |
+
isArrow: function (k) {
|
| 71 |
+
k = k.which ? k.which : k;
|
| 72 |
+
switch (k) {
|
| 73 |
+
case KEY.LEFT:
|
| 74 |
+
case KEY.RIGHT:
|
| 75 |
+
case KEY.UP:
|
| 76 |
+
case KEY.DOWN:
|
| 77 |
+
return true;
|
| 78 |
+
}
|
| 79 |
+
return false;
|
| 80 |
+
},
|
| 81 |
+
isControl: function (e) {
|
| 82 |
+
var k = e.which;
|
| 83 |
+
switch (k) {
|
| 84 |
+
case KEY.SHIFT:
|
| 85 |
+
case KEY.CTRL:
|
| 86 |
+
case KEY.ALT:
|
| 87 |
+
return true;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
if (e.metaKey) return true;
|
| 91 |
+
|
| 92 |
+
return false;
|
| 93 |
+
},
|
| 94 |
+
isFunctionKey: function (k) {
|
| 95 |
+
k = k.which ? k.which : k;
|
| 96 |
+
return k >= 112 && k <= 123;
|
| 97 |
+
}
|
| 98 |
+
},
|
| 99 |
+
MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>";
|
| 100 |
+
|
| 101 |
+
$document = $(document);
|
| 102 |
+
|
| 103 |
+
nextUid=(function() { var counter=1; return function() { return counter++; }; }());
|
| 104 |
+
|
| 105 |
+
function indexOf(value, array) {
|
| 106 |
+
var i = 0, l = array.length;
|
| 107 |
+
for (; i < l; i = i + 1) {
|
| 108 |
+
if (equal(value, array[i])) return i;
|
| 109 |
+
}
|
| 110 |
+
return -1;
|
| 111 |
+
}
|
| 112 |
+
|
| 113 |
+
function measureScrollbar () {
|
| 114 |
+
var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
|
| 115 |
+
$template.appendTo('body');
|
| 116 |
+
|
| 117 |
+
var dim = {
|
| 118 |
+
width: $template.width() - $template[0].clientWidth,
|
| 119 |
+
height: $template.height() - $template[0].clientHeight
|
| 120 |
+
};
|
| 121 |
+
$template.remove();
|
| 122 |
+
|
| 123 |
+
return dim;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
/**
|
| 127 |
+
* Compares equality of a and b
|
| 128 |
+
* @param a
|
| 129 |
+
* @param b
|
| 130 |
+
*/
|
| 131 |
+
function equal(a, b) {
|
| 132 |
+
if (a === b) return true;
|
| 133 |
+
if (a === undefined || b === undefined) return false;
|
| 134 |
+
if (a === null || b === null) return false;
|
| 135 |
+
// Check whether 'a' or 'b' is a string (primitive or object).
|
| 136 |
+
// The concatenation of an empty string (+'') converts its argument to a string's primitive.
|
| 137 |
+
if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
|
| 138 |
+
if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
|
| 139 |
+
return false;
|
| 140 |
+
}
|
| 141 |
+
|
| 142 |
+
/**
|
| 143 |
+
* Splits the string into an array of values, trimming each value. An empty array is returned for nulls or empty
|
| 144 |
+
* strings
|
| 145 |
+
* @param string
|
| 146 |
+
* @param separator
|
| 147 |
+
*/
|
| 148 |
+
function splitVal(string, separator) {
|
| 149 |
+
var val, i, l;
|
| 150 |
+
if (string === null || string.length < 1) return [];
|
| 151 |
+
val = string.split(separator);
|
| 152 |
+
for (i = 0, l = val.length; i < l; i = i + 1) val[i] = $.trim(val[i]);
|
| 153 |
+
return val;
|
| 154 |
+
}
|
| 155 |
+
|
| 156 |
+
function getSideBorderPadding(element) {
|
| 157 |
+
return element.outerWidth(false) - element.width();
|
| 158 |
+
}
|
| 159 |
+
|
| 160 |
+
function installKeyUpChangeEvent(element) {
|
| 161 |
+
var key="keyup-change-value";
|
| 162 |
+
element.on("keydown", function () {
|
| 163 |
+
if ($.data(element, key) === undefined) {
|
| 164 |
+
$.data(element, key, element.val());
|
| 165 |
+
}
|
| 166 |
+
});
|
| 167 |
+
element.on("keyup", function () {
|
| 168 |
+
var val= $.data(element, key);
|
| 169 |
+
if (val !== undefined && element.val() !== val) {
|
| 170 |
+
$.removeData(element, key);
|
| 171 |
+
element.trigger("keyup-change");
|
| 172 |
+
}
|
| 173 |
+
});
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
$document.on("mousemove", function (e) {
|
| 177 |
+
lastMousePosition.x = e.pageX;
|
| 178 |
+
lastMousePosition.y = e.pageY;
|
| 179 |
+
});
|
| 180 |
+
|
| 181 |
+
/**
|
| 182 |
+
* filters mouse events so an event is fired only if the mouse moved.
|
| 183 |
+
*
|
| 184 |
+
* filters out mouse events that occur when mouse is stationary but
|
| 185 |
+
* the elements under the pointer are scrolled.
|
| 186 |
+
*/
|
| 187 |
+
function installFilteredMouseMove(element) {
|
| 188 |
+
element.on("mousemove", function (e) {
|
| 189 |
+
var lastpos = lastMousePosition;
|
| 190 |
+
if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
|
| 191 |
+
$(e.target).trigger("mousemove-filtered", e);
|
| 192 |
+
}
|
| 193 |
+
});
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
/**
|
| 197 |
+
* Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
|
| 198 |
+
* within the last quietMillis milliseconds.
|
| 199 |
+
*
|
| 200 |
+
* @param quietMillis number of milliseconds to wait before invoking fn
|
| 201 |
+
* @param fn function to be debounced
|
| 202 |
+
* @param ctx object to be used as this reference within fn
|
| 203 |
+
* @return debounced version of fn
|
| 204 |
+
*/
|
| 205 |
+
function debounce(quietMillis, fn, ctx) {
|
| 206 |
+
ctx = ctx || undefined;
|
| 207 |
+
var timeout;
|
| 208 |
+
return function () {
|
| 209 |
+
var args = arguments;
|
| 210 |
+
window.clearTimeout(timeout);
|
| 211 |
+
timeout = window.setTimeout(function() {
|
| 212 |
+
fn.apply(ctx, args);
|
| 213 |
+
}, quietMillis);
|
| 214 |
+
};
|
| 215 |
+
}
|
| 216 |
+
|
| 217 |
+
/**
|
| 218 |
+
* A simple implementation of a thunk
|
| 219 |
+
* @param formula function used to lazily initialize the thunk
|
| 220 |
+
* @return {Function}
|
| 221 |
+
*/
|
| 222 |
+
function thunk(formula) {
|
| 223 |
+
var evaluated = false,
|
| 224 |
+
value;
|
| 225 |
+
return function() {
|
| 226 |
+
if (evaluated === false) { value = formula(); evaluated = true; }
|
| 227 |
+
return value;
|
| 228 |
+
};
|
| 229 |
+
};
|
| 230 |
+
|
| 231 |
+
function installDebouncedScroll(threshold, element) {
|
| 232 |
+
var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
|
| 233 |
+
element.on("scroll", function (e) {
|
| 234 |
+
if (indexOf(e.target, element.get()) >= 0) notify(e);
|
| 235 |
+
});
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
function focus($el) {
|
| 239 |
+
if ($el[0] === document.activeElement) return;
|
| 240 |
+
|
| 241 |
+
/* set the focus in a 0 timeout - that way the focus is set after the processing
|
| 242 |
+
of the current event has finished - which seems like the only reliable way
|
| 243 |
+
to set focus */
|
| 244 |
+
window.setTimeout(function() {
|
| 245 |
+
var el=$el[0], pos=$el.val().length, range;
|
| 246 |
+
|
| 247 |
+
$el.focus();
|
| 248 |
+
|
| 249 |
+
/* make sure el received focus so we do not error out when trying to manipulate the caret.
|
| 250 |
+
sometimes modals or others listeners may steal it after its set */
|
| 251 |
+
if ($el.is(":visible") && el === document.activeElement) {
|
| 252 |
+
|
| 253 |
+
/* after the focus is set move the caret to the end, necessary when we val()
|
| 254 |
+
just before setting focus */
|
| 255 |
+
if(el.setSelectionRange)
|
| 256 |
+
{
|
| 257 |
+
el.setSelectionRange(pos, pos);
|
| 258 |
+
}
|
| 259 |
+
else if (el.createTextRange) {
|
| 260 |
+
range = el.createTextRange();
|
| 261 |
+
range.collapse(false);
|
| 262 |
+
range.select();
|
| 263 |
+
}
|
| 264 |
+
}
|
| 265 |
+
}, 0);
|
| 266 |
+
}
|
| 267 |
+
|
| 268 |
+
function getCursorInfo(el) {
|
| 269 |
+
el = $(el)[0];
|
| 270 |
+
var offset = 0;
|
| 271 |
+
var length = 0;
|
| 272 |
+
if ('selectionStart' in el) {
|
| 273 |
+
offset = el.selectionStart;
|
| 274 |
+
length = el.selectionEnd - offset;
|
| 275 |
+
} else if ('selection' in document) {
|
| 276 |
+
el.focus();
|
| 277 |
+
var sel = document.selection.createRange();
|
| 278 |
+
length = document.selection.createRange().text.length;
|
| 279 |
+
sel.moveStart('character', -el.value.length);
|
| 280 |
+
offset = sel.text.length - length;
|
| 281 |
+
}
|
| 282 |
+
return { offset: offset, length: length };
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
function killEvent(event) {
|
| 286 |
+
event.preventDefault();
|
| 287 |
+
event.stopPropagation();
|
| 288 |
+
}
|
| 289 |
+
function killEventImmediately(event) {
|
| 290 |
+
event.preventDefault();
|
| 291 |
+
event.stopImmediatePropagation();
|
| 292 |
+
}
|
| 293 |
+
|
| 294 |
+
function measureTextWidth(e) {
|
| 295 |
+
if (!sizer){
|
| 296 |
+
var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
|
| 297 |
+
sizer = $(document.createElement("div")).css({
|
| 298 |
+
position: "absolute",
|
| 299 |
+
left: "-10000px",
|
| 300 |
+
top: "-10000px",
|
| 301 |
+
display: "none",
|
| 302 |
+
fontSize: style.fontSize,
|
| 303 |
+
fontFamily: style.fontFamily,
|
| 304 |
+
fontStyle: style.fontStyle,
|
| 305 |
+
fontWeight: style.fontWeight,
|
| 306 |
+
letterSpacing: style.letterSpacing,
|
| 307 |
+
textTransform: style.textTransform,
|
| 308 |
+
whiteSpace: "nowrap"
|
| 309 |
+
});
|
| 310 |
+
sizer.attr("class","select2-sizer");
|
| 311 |
+
$("body").append(sizer);
|
| 312 |
+
}
|
| 313 |
+
sizer.text(e.val());
|
| 314 |
+
return sizer.width();
|
| 315 |
+
}
|
| 316 |
+
|
| 317 |
+
function syncCssClasses(dest, src, adapter) {
|
| 318 |
+
var classes, replacements = [], adapted;
|
| 319 |
+
|
| 320 |
+
classes = dest.attr("class");
|
| 321 |
+
if (classes) {
|
| 322 |
+
classes = '' + classes; // for IE which returns object
|
| 323 |
+
$(classes.split(" ")).each2(function() {
|
| 324 |
+
if (this.indexOf("select2-") === 0) {
|
| 325 |
+
replacements.push(this);
|
| 326 |
+
}
|
| 327 |
+
});
|
| 328 |
+
}
|
| 329 |
+
classes = src.attr("class");
|
| 330 |
+
if (classes) {
|
| 331 |
+
classes = '' + classes; // for IE which returns object
|
| 332 |
+
$(classes.split(" ")).each2(function() {
|
| 333 |
+
if (this.indexOf("select2-") !== 0) {
|
| 334 |
+
adapted = adapter(this);
|
| 335 |
+
if (adapted) {
|
| 336 |
+
replacements.push(this);
|
| 337 |
+
}
|
| 338 |
+
}
|
| 339 |
+
});
|
| 340 |
+
}
|
| 341 |
+
dest.attr("class", replacements.join(" "));
|
| 342 |
+
}
|
| 343 |
+
|
| 344 |
+
|
| 345 |
+
function markMatch(text, term, markup, escapeMarkup) {
|
| 346 |
+
var match=text.toUpperCase().indexOf(term.toUpperCase()),
|
| 347 |
+
tl=term.length;
|
| 348 |
+
|
| 349 |
+
if (match<0) {
|
| 350 |
+
markup.push(escapeMarkup(text));
|
| 351 |
+
return;
|
| 352 |
+
}
|
| 353 |
+
|
| 354 |
+
markup.push(escapeMarkup(text.substring(0, match)));
|
| 355 |
+
markup.push("<span class='select2-match'>");
|
| 356 |
+
markup.push(escapeMarkup(text.substring(match, match + tl)));
|
| 357 |
+
markup.push("</span>");
|
| 358 |
+
markup.push(escapeMarkup(text.substring(match + tl, text.length)));
|
| 359 |
+
}
|
| 360 |
+
|
| 361 |
+
function defaultEscapeMarkup(markup) {
|
| 362 |
+
var replace_map = {
|
| 363 |
+
'\\': '\',
|
| 364 |
+
'&': '&',
|
| 365 |
+
'<': '<',
|
| 366 |
+
'>': '>',
|
| 367 |
+
'"': '"',
|
| 368 |
+
"'": ''',
|
| 369 |
+
"/": '/'
|
| 370 |
+
};
|
| 371 |
+
|
| 372 |
+
return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
|
| 373 |
+
return replace_map[match];
|
| 374 |
+
});
|
| 375 |
+
}
|
| 376 |
+
|
| 377 |
+
/**
|
| 378 |
+
* Produces an ajax-based query function
|
| 379 |
+
*
|
| 380 |
+
* @param options object containing configuration paramters
|
| 381 |
+
* @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
|
| 382 |
+
* @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
|
| 383 |
+
* @param options.url url for the data
|
| 384 |
+
* @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
|
| 385 |
+
* @param options.dataType request data type: ajax, jsonp, other datatatypes supported by jQuery's $.ajax function or the transport function if specified
|
| 386 |
+
* @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
|
| 387 |
+
* @param options.results a function(remoteData, pageNumber) that converts data returned form the remote request to the format expected by Select2.
|
| 388 |
+
* The expected format is an object containing the following keys:
|
| 389 |
+
* results array of objects that will be used as choices
|
| 390 |
+
* more (optional) boolean indicating whether there are more results available
|
| 391 |
+
* Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
|
| 392 |
+
*/
|
| 393 |
+
function ajax(options) {
|
| 394 |
+
var timeout, // current scheduled but not yet executed request
|
| 395 |
+
requestSequence = 0, // sequence used to drop out-of-order responses
|
| 396 |
+
handler = null,
|
| 397 |
+
quietMillis = options.quietMillis || 100,
|
| 398 |
+
ajaxUrl = options.url,
|
| 399 |
+
self = this;
|
| 400 |
+
|
| 401 |
+
return function (query) {
|
| 402 |
+
window.clearTimeout(timeout);
|
| 403 |
+
timeout = window.setTimeout(function () {
|
| 404 |
+
requestSequence += 1; // increment the sequence
|
| 405 |
+
var requestNumber = requestSequence, // this request's sequence number
|
| 406 |
+
data = options.data, // ajax data function
|
| 407 |
+
url = ajaxUrl, // ajax url string or function
|
| 408 |
+
transport = options.transport || $.fn.select2.ajaxDefaults.transport,
|
| 409 |
+
// deprecated - to be removed in 4.0 - use params instead
|
| 410 |
+
deprecated = {
|
| 411 |
+
type: options.type || 'GET', // set type of request (GET or POST)
|
| 412 |
+
cache: options.cache || false,
|
| 413 |
+
jsonpCallback: options.jsonpCallback||undefined,
|
| 414 |
+
dataType: options.dataType||"json"
|
| 415 |
+
},
|
| 416 |
+
params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
|
| 417 |
+
|
| 418 |
+
data = data ? data.call(self, query.term, query.page, query.context) : null;
|
| 419 |
+
url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
|
| 420 |
+
|
| 421 |
+
if (handler) { handler.abort(); }
|
| 422 |
+
|
| 423 |
+
if (options.params) {
|
| 424 |
+
if ($.isFunction(options.params)) {
|
| 425 |
+
$.extend(params, options.params.call(self));
|
| 426 |
+
} else {
|
| 427 |
+
$.extend(params, options.params);
|
| 428 |
+
}
|
| 429 |
+
}
|
| 430 |
+
|
| 431 |
+
$.extend(params, {
|
| 432 |
+
url: url,
|
| 433 |
+
dataType: options.dataType,
|
| 434 |
+
data: data,
|
| 435 |
+
success: function (data) {
|
| 436 |
+
if (requestNumber < requestSequence) {
|
| 437 |
+
return;
|
| 438 |
+
}
|
| 439 |
+
// TODO - replace query.page with query so users have access to term, page, etc.
|
| 440 |
+
var results = options.results(data, query.page);
|
| 441 |
+
query.callback(results);
|
| 442 |
+
}
|
| 443 |
+
});
|
| 444 |
+
handler = transport.call(self, params);
|
| 445 |
+
}, quietMillis);
|
| 446 |
+
};
|
| 447 |
+
}
|
| 448 |
+
|
| 449 |
+
/**
|
| 450 |
+
* Produces a query function that works with a local array
|
| 451 |
+
*
|
| 452 |
+
* @param options object containing configuration parameters. The options parameter can either be an array or an
|
| 453 |
+
* object.
|
| 454 |
+
*
|
| 455 |
+
* If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
|
| 456 |
+
*
|
| 457 |
+
* If the object form is used ti is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
|
| 458 |
+
* an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
|
| 459 |
+
* key can either be a String in which case it is expected that each element in the 'data' array has a key with the
|
| 460 |
+
* value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
|
| 461 |
+
* the text.
|
| 462 |
+
*/
|
| 463 |
+
function local(options) {
|
| 464 |
+
var data = options, // data elements
|
| 465 |
+
dataText,
|
| 466 |
+
tmp,
|
| 467 |
+
text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
|
| 468 |
+
|
| 469 |
+
if ($.isArray(data)) {
|
| 470 |
+
tmp = data;
|
| 471 |
+
data = { results: tmp };
|
| 472 |
+
}
|
| 473 |
+
|
| 474 |
+
if ($.isFunction(data) === false) {
|
| 475 |
+
tmp = data;
|
| 476 |
+
data = function() { return tmp; };
|
| 477 |
+
}
|
| 478 |
+
|
| 479 |
+
var dataItem = data();
|
| 480 |
+
if (dataItem.text) {
|
| 481 |
+
text = dataItem.text;
|
| 482 |
+
// if text is not a function we assume it to be a key name
|
| 483 |
+
if (!$.isFunction(text)) {
|
| 484 |
+
dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
|
| 485 |
+
text = function (item) { return item[dataText]; };
|
| 486 |
+
}
|
| 487 |
+
}
|
| 488 |
+
|
| 489 |
+
return function (query) {
|
| 490 |
+
var t = query.term, filtered = { results: [] }, process;
|
| 491 |
+
if (t === "") {
|
| 492 |
+
query.callback(data());
|
| 493 |
+
return;
|
| 494 |
+
}
|
| 495 |
+
|
| 496 |
+
process = function(datum, collection) {
|
| 497 |
+
var group, attr;
|
| 498 |
+
datum = datum[0];
|
| 499 |
+
if (datum.children) {
|
| 500 |
+
group = {};
|
| 501 |
+
for (attr in datum) {
|
| 502 |
+
if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
|
| 503 |
+
}
|
| 504 |
+
group.children=[];
|
| 505 |
+
$(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
|
| 506 |
+
if (group.children.length || query.matcher(t, text(group), datum)) {
|
| 507 |
+
collection.push(group);
|
| 508 |
+
}
|
| 509 |
+
} else {
|
| 510 |
+
if (query.matcher(t, text(datum), datum)) {
|
| 511 |
+
collection.push(datum);
|
| 512 |
+
}
|
| 513 |
+
}
|
| 514 |
+
};
|
| 515 |
+
|
| 516 |
+
$(data().results).each2(function(i, datum) { process(datum, filtered.results); });
|
| 517 |
+
query.callback(filtered);
|
| 518 |
+
};
|
| 519 |
+
}
|
| 520 |
+
|
| 521 |
+
// TODO javadoc
|
| 522 |
+
function tags(data) {
|
| 523 |
+
var isFunc = $.isFunction(data);
|
| 524 |
+
return function (query) {
|
| 525 |
+
var t = query.term, filtered = {results: []};
|
| 526 |
+
$(isFunc ? data() : data).each(function () {
|
| 527 |
+
var isObject = this.text !== undefined,
|
| 528 |
+
text = isObject ? this.text : this;
|
| 529 |
+
if (t === "" || query.matcher(t, text)) {
|
| 530 |
+
filtered.results.push(isObject ? this : {id: this, text: this});
|
| 531 |
+
}
|
| 532 |
+
});
|
| 533 |
+
query.callback(filtered);
|
| 534 |
+
};
|
| 535 |
+
}
|
| 536 |
+
|
| 537 |
+
/**
|
| 538 |
+
* Checks if the formatter function should be used.
|
| 539 |
+
*
|
| 540 |
+
* Throws an error if it is not a function. Returns true if it should be used,
|
| 541 |
+
* false if no formatting should be performed.
|
| 542 |
+
*
|
| 543 |
+
* @param formatter
|
| 544 |
+
*/
|
| 545 |
+
function checkFormatter(formatter, formatterName) {
|
| 546 |
+
if ($.isFunction(formatter)) return true;
|
| 547 |
+
if (!formatter) return false;
|
| 548 |
+
throw new Error(formatterName +" must be a function or a falsy value");
|
| 549 |
+
}
|
| 550 |
+
|
| 551 |
+
function evaluate(val) {
|
| 552 |
+
return $.isFunction(val) ? val() : val;
|
| 553 |
+
}
|
| 554 |
+
|
| 555 |
+
function countResults(results) {
|
| 556 |
+
var count = 0;
|
| 557 |
+
$.each(results, function(i, item) {
|
| 558 |
+
if (item.children) {
|
| 559 |
+
count += countResults(item.children);
|
| 560 |
+
} else {
|
| 561 |
+
count++;
|
| 562 |
+
}
|
| 563 |
+
});
|
| 564 |
+
return count;
|
| 565 |
+
}
|
| 566 |
+
|
| 567 |
+
/**
|
| 568 |
+
* Default tokenizer. This function uses breaks the input on substring match of any string from the
|
| 569 |
+
* opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
|
| 570 |
+
* two options have to be defined in order for the tokenizer to work.
|
| 571 |
+
*
|
| 572 |
+
* @param input text user has typed so far or pasted into the search field
|
| 573 |
+
* @param selection currently selected choices
|
| 574 |
+
* @param selectCallback function(choice) callback tho add the choice to selection
|
| 575 |
+
* @param opts select2's opts
|
| 576 |
+
* @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
|
| 577 |
+
*/
|
| 578 |
+
function defaultTokenizer(input, selection, selectCallback, opts) {
|
| 579 |
+
var original = input, // store the original so we can compare and know if we need to tell the search to update its text
|
| 580 |
+
dupe = false, // check for whether a token we extracted represents a duplicate selected choice
|
| 581 |
+
token, // token
|
| 582 |
+
index, // position at which the separator was found
|
| 583 |
+
i, l, // looping variables
|
| 584 |
+
separator; // the matched separator
|
| 585 |
+
|
| 586 |
+
if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
|
| 587 |
+
|
| 588 |
+
while (true) {
|
| 589 |
+
index = -1;
|
| 590 |
+
|
| 591 |
+
for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
|
| 592 |
+
separator = opts.tokenSeparators[i];
|
| 593 |
+
index = input.indexOf(separator);
|
| 594 |
+
if (index >= 0) break;
|
| 595 |
+
}
|
| 596 |
+
|
| 597 |
+
if (index < 0) break; // did not find any token separator in the input string, bail
|
| 598 |
+
|
| 599 |
+
token = input.substring(0, index);
|
| 600 |
+
input = input.substring(index + separator.length);
|
| 601 |
+
|
| 602 |
+
if (token.length > 0) {
|
| 603 |
+
token = opts.createSearchChoice.call(this, token, selection);
|
| 604 |
+
if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
|
| 605 |
+
dupe = false;
|
| 606 |
+
for (i = 0, l = selection.length; i < l; i++) {
|
| 607 |
+
if (equal(opts.id(token), opts.id(selection[i]))) {
|
| 608 |
+
dupe = true; break;
|
| 609 |
+
}
|
| 610 |
+
}
|
| 611 |
+
|
| 612 |
+
if (!dupe) selectCallback(token);
|
| 613 |
+
}
|
| 614 |
+
}
|
| 615 |
+
}
|
| 616 |
+
|
| 617 |
+
if (original!==input) return input;
|
| 618 |
+
}
|
| 619 |
+
|
| 620 |
+
/**
|
| 621 |
+
* Creates a new class
|
| 622 |
+
*
|
| 623 |
+
* @param superClass
|
| 624 |
+
* @param methods
|
| 625 |
+
*/
|
| 626 |
+
function clazz(SuperClass, methods) {
|
| 627 |
+
var constructor = function () {};
|
| 628 |
+
constructor.prototype = new SuperClass;
|
| 629 |
+
constructor.prototype.constructor = constructor;
|
| 630 |
+
constructor.prototype.parent = SuperClass.prototype;
|
| 631 |
+
constructor.prototype = $.extend(constructor.prototype, methods);
|
| 632 |
+
return constructor;
|
| 633 |
+
}
|
| 634 |
+
|
| 635 |
+
AbstractSelect2 = clazz(Object, {
|
| 636 |
+
|
| 637 |
+
// abstract
|
| 638 |
+
bind: function (func) {
|
| 639 |
+
var self = this;
|
| 640 |
+
return function () {
|
| 641 |
+
func.apply(self, arguments);
|
| 642 |
+
};
|
| 643 |
+
},
|
| 644 |
+
|
| 645 |
+
// abstract
|
| 646 |
+
init: function (opts) {
|
| 647 |
+
var results, search, resultsSelector = ".select2-results", disabled, readonly;
|
| 648 |
+
|
| 649 |
+
// prepare options
|
| 650 |
+
this.opts = opts = this.prepareOpts(opts);
|
| 651 |
+
|
| 652 |
+
this.id=opts.id;
|
| 653 |
+
|
| 654 |
+
// destroy if called on an existing component
|
| 655 |
+
if (opts.element.data("select2") !== undefined &&
|
| 656 |
+
opts.element.data("select2") !== null) {
|
| 657 |
+
opts.element.data("select2").destroy();
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
this.container = this.createContainer();
|
| 661 |
+
|
| 662 |
+
this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
|
| 663 |
+
this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
|
| 664 |
+
this.container.attr("id", this.containerId);
|
| 665 |
+
|
| 666 |
+
// cache the body so future lookups are cheap
|
| 667 |
+
this.body = thunk(function() { return opts.element.closest("body"); });
|
| 668 |
+
|
| 669 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 670 |
+
|
| 671 |
+
this.container.css(evaluate(opts.containerCss));
|
| 672 |
+
this.container.addClass(evaluate(opts.containerCssClass));
|
| 673 |
+
|
| 674 |
+
this.elementTabIndex = this.opts.element.attr("tabindex");
|
| 675 |
+
|
| 676 |
+
// swap container for the element
|
| 677 |
+
this.opts.element
|
| 678 |
+
.data("select2", this)
|
| 679 |
+
.attr("tabindex", "-1")
|
| 680 |
+
.before(this.container);
|
| 681 |
+
this.container.data("select2", this);
|
| 682 |
+
|
| 683 |
+
this.dropdown = this.container.find(".select2-drop");
|
| 684 |
+
this.dropdown.addClass(evaluate(opts.dropdownCssClass));
|
| 685 |
+
this.dropdown.data("select2", this);
|
| 686 |
+
|
| 687 |
+
this.results = results = this.container.find(resultsSelector);
|
| 688 |
+
this.search = search = this.container.find("input.select2-input");
|
| 689 |
+
|
| 690 |
+
this.resultsPage = 0;
|
| 691 |
+
this.context = null;
|
| 692 |
+
|
| 693 |
+
// initialize the container
|
| 694 |
+
this.initContainer();
|
| 695 |
+
|
| 696 |
+
installFilteredMouseMove(this.results);
|
| 697 |
+
this.dropdown.on("mousemove-filtered touchstart touchmove touchend", resultsSelector, this.bind(this.highlightUnderEvent));
|
| 698 |
+
|
| 699 |
+
installDebouncedScroll(80, this.results);
|
| 700 |
+
this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
|
| 701 |
+
|
| 702 |
+
// do not propagate change event from the search field out of the component
|
| 703 |
+
$(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 704 |
+
$(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
|
| 705 |
+
|
| 706 |
+
// if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
|
| 707 |
+
if ($.fn.mousewheel) {
|
| 708 |
+
results.mousewheel(function (e, delta, deltaX, deltaY) {
|
| 709 |
+
var top = results.scrollTop(), height;
|
| 710 |
+
if (deltaY > 0 && top - deltaY <= 0) {
|
| 711 |
+
results.scrollTop(0);
|
| 712 |
+
killEvent(e);
|
| 713 |
+
} else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
|
| 714 |
+
results.scrollTop(results.get(0).scrollHeight - results.height());
|
| 715 |
+
killEvent(e);
|
| 716 |
+
}
|
| 717 |
+
});
|
| 718 |
+
}
|
| 719 |
+
|
| 720 |
+
installKeyUpChangeEvent(search);
|
| 721 |
+
search.on("keyup-change input paste", this.bind(this.updateResults));
|
| 722 |
+
search.on("focus", function () { search.addClass("select2-focused"); });
|
| 723 |
+
search.on("blur", function () { search.removeClass("select2-focused");});
|
| 724 |
+
|
| 725 |
+
this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
|
| 726 |
+
if ($(e.target).closest(".select2-result-selectable").length > 0) {
|
| 727 |
+
this.highlightUnderEvent(e);
|
| 728 |
+
this.selectHighlighted(e);
|
| 729 |
+
}
|
| 730 |
+
}));
|
| 731 |
+
|
| 732 |
+
// trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
|
| 733 |
+
// for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
|
| 734 |
+
// dom it will trigger the popup close, which is not what we want
|
| 735 |
+
this.dropdown.on("click mouseup mousedown", function (e) { e.stopPropagation(); });
|
| 736 |
+
|
| 737 |
+
if ($.isFunction(this.opts.initSelection)) {
|
| 738 |
+
// initialize selection based on the current value of the source element
|
| 739 |
+
this.initSelection();
|
| 740 |
+
|
| 741 |
+
// if the user has provided a function that can set selection based on the value of the source element
|
| 742 |
+
// we monitor the change event on the element and trigger it, allowing for two way synchronization
|
| 743 |
+
this.monitorSource();
|
| 744 |
+
}
|
| 745 |
+
|
| 746 |
+
if (opts.maximumInputLength !== null) {
|
| 747 |
+
this.search.attr("maxlength", opts.maximumInputLength);
|
| 748 |
+
}
|
| 749 |
+
|
| 750 |
+
var disabled = opts.element.prop("disabled");
|
| 751 |
+
if (disabled === undefined) disabled = false;
|
| 752 |
+
this.enable(!disabled);
|
| 753 |
+
|
| 754 |
+
var readonly = opts.element.prop("readonly");
|
| 755 |
+
if (readonly === undefined) readonly = false;
|
| 756 |
+
this.readonly(readonly);
|
| 757 |
+
|
| 758 |
+
// Calculate size of scrollbar
|
| 759 |
+
scrollBarDimensions = scrollBarDimensions || measureScrollbar();
|
| 760 |
+
|
| 761 |
+
this.autofocus = opts.element.prop("autofocus")
|
| 762 |
+
opts.element.prop("autofocus", false);
|
| 763 |
+
if (this.autofocus) this.focus();
|
| 764 |
+
},
|
| 765 |
+
|
| 766 |
+
// abstract
|
| 767 |
+
destroy: function () {
|
| 768 |
+
var element=this.opts.element, select2 = element.data("select2");
|
| 769 |
+
|
| 770 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 771 |
+
|
| 772 |
+
if (select2 !== undefined) {
|
| 773 |
+
select2.container.remove();
|
| 774 |
+
select2.dropdown.remove();
|
| 775 |
+
element
|
| 776 |
+
.removeClass("select2-offscreen")
|
| 777 |
+
.removeData("select2")
|
| 778 |
+
.off(".select2")
|
| 779 |
+
.prop("autofocus", this.autofocus || false);
|
| 780 |
+
if (this.elementTabIndex) {
|
| 781 |
+
element.attr({tabindex: this.elementTabIndex});
|
| 782 |
+
} else {
|
| 783 |
+
element.removeAttr("tabindex");
|
| 784 |
+
}
|
| 785 |
+
element.show();
|
| 786 |
+
}
|
| 787 |
+
},
|
| 788 |
+
|
| 789 |
+
// abstract
|
| 790 |
+
optionToData: function(element) {
|
| 791 |
+
if (element.is("option")) {
|
| 792 |
+
return {
|
| 793 |
+
id:element.prop("value"),
|
| 794 |
+
text:element.text(),
|
| 795 |
+
element: element.get(),
|
| 796 |
+
css: element.attr("class"),
|
| 797 |
+
disabled: element.prop("disabled"),
|
| 798 |
+
locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
|
| 799 |
+
};
|
| 800 |
+
} else if (element.is("optgroup")) {
|
| 801 |
+
return {
|
| 802 |
+
text:element.attr("label"),
|
| 803 |
+
children:[],
|
| 804 |
+
element: element.get(),
|
| 805 |
+
css: element.attr("class")
|
| 806 |
+
};
|
| 807 |
+
}
|
| 808 |
+
},
|
| 809 |
+
|
| 810 |
+
// abstract
|
| 811 |
+
prepareOpts: function (opts) {
|
| 812 |
+
var element, select, idKey, ajaxUrl, self = this;
|
| 813 |
+
|
| 814 |
+
element = opts.element;
|
| 815 |
+
|
| 816 |
+
if (element.get(0).tagName.toLowerCase() === "select") {
|
| 817 |
+
this.select = select = opts.element;
|
| 818 |
+
}
|
| 819 |
+
|
| 820 |
+
if (select) {
|
| 821 |
+
// these options are not allowed when attached to a select because they are picked up off the element itself
|
| 822 |
+
$.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
|
| 823 |
+
if (this in opts) {
|
| 824 |
+
throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
|
| 825 |
+
}
|
| 826 |
+
});
|
| 827 |
+
}
|
| 828 |
+
|
| 829 |
+
opts = $.extend({}, {
|
| 830 |
+
populateResults: function(container, results, query) {
|
| 831 |
+
var populate, data, result, children, id=this.opts.id;
|
| 832 |
+
|
| 833 |
+
populate=function(results, container, depth) {
|
| 834 |
+
|
| 835 |
+
var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
|
| 836 |
+
|
| 837 |
+
results = opts.sortResults(results, container, query);
|
| 838 |
+
|
| 839 |
+
for (i = 0, l = results.length; i < l; i = i + 1) {
|
| 840 |
+
|
| 841 |
+
result=results[i];
|
| 842 |
+
|
| 843 |
+
disabled = (result.disabled === true);
|
| 844 |
+
selectable = (!disabled) && (id(result) !== undefined);
|
| 845 |
+
|
| 846 |
+
compound=result.children && result.children.length > 0;
|
| 847 |
+
|
| 848 |
+
node=$("<li></li>");
|
| 849 |
+
node.addClass("select2-results-dept-"+depth);
|
| 850 |
+
node.addClass("select2-result");
|
| 851 |
+
node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
|
| 852 |
+
if (disabled) { node.addClass("select2-disabled"); }
|
| 853 |
+
if (compound) { node.addClass("select2-result-with-children"); }
|
| 854 |
+
node.addClass(self.opts.formatResultCssClass(result));
|
| 855 |
+
|
| 856 |
+
label=$(document.createElement("div"));
|
| 857 |
+
label.addClass("select2-result-label");
|
| 858 |
+
|
| 859 |
+
formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
|
| 860 |
+
if (formatted!==undefined) {
|
| 861 |
+
label.html(formatted);
|
| 862 |
+
}
|
| 863 |
+
|
| 864 |
+
node.append(label);
|
| 865 |
+
|
| 866 |
+
if (compound) {
|
| 867 |
+
|
| 868 |
+
innerContainer=$("<ul></ul>");
|
| 869 |
+
innerContainer.addClass("select2-result-sub");
|
| 870 |
+
populate(result.children, innerContainer, depth+1);
|
| 871 |
+
node.append(innerContainer);
|
| 872 |
+
}
|
| 873 |
+
|
| 874 |
+
node.data("select2-data", result);
|
| 875 |
+
container.append(node);
|
| 876 |
+
}
|
| 877 |
+
};
|
| 878 |
+
|
| 879 |
+
populate(results, container, 0);
|
| 880 |
+
}
|
| 881 |
+
}, $.fn.select2.defaults, opts);
|
| 882 |
+
|
| 883 |
+
if (typeof(opts.id) !== "function") {
|
| 884 |
+
idKey = opts.id;
|
| 885 |
+
opts.id = function (e) { return e[idKey]; };
|
| 886 |
+
}
|
| 887 |
+
|
| 888 |
+
if ($.isArray(opts.element.data("select2Tags"))) {
|
| 889 |
+
if ("tags" in opts) {
|
| 890 |
+
throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
|
| 891 |
+
}
|
| 892 |
+
opts.tags=opts.element.data("select2Tags");
|
| 893 |
+
}
|
| 894 |
+
|
| 895 |
+
if (select) {
|
| 896 |
+
opts.query = this.bind(function (query) {
|
| 897 |
+
var data = { results: [], more: false },
|
| 898 |
+
term = query.term,
|
| 899 |
+
children, placeholderOption, process;
|
| 900 |
+
|
| 901 |
+
process=function(element, collection) {
|
| 902 |
+
var group;
|
| 903 |
+
if (element.is("option")) {
|
| 904 |
+
if (query.matcher(term, element.text(), element)) {
|
| 905 |
+
collection.push(self.optionToData(element));
|
| 906 |
+
}
|
| 907 |
+
} else if (element.is("optgroup")) {
|
| 908 |
+
group=self.optionToData(element);
|
| 909 |
+
element.children().each2(function(i, elm) { process(elm, group.children); });
|
| 910 |
+
if (group.children.length>0) {
|
| 911 |
+
collection.push(group);
|
| 912 |
+
}
|
| 913 |
+
}
|
| 914 |
+
};
|
| 915 |
+
|
| 916 |
+
children=element.children();
|
| 917 |
+
|
| 918 |
+
// ignore the placeholder option if there is one
|
| 919 |
+
if (this.getPlaceholder() !== undefined && children.length > 0) {
|
| 920 |
+
placeholderOption = this.getPlaceholderOption();
|
| 921 |
+
if (placeholderOption) {
|
| 922 |
+
children=children.not(placeholderOption);
|
| 923 |
+
}
|
| 924 |
+
}
|
| 925 |
+
|
| 926 |
+
children.each2(function(i, elm) { process(elm, data.results); });
|
| 927 |
+
|
| 928 |
+
query.callback(data);
|
| 929 |
+
});
|
| 930 |
+
// this is needed because inside val() we construct choices from options and there id is hardcoded
|
| 931 |
+
opts.id=function(e) { return e.id; };
|
| 932 |
+
opts.formatResultCssClass = function(data) { return data.css; };
|
| 933 |
+
} else {
|
| 934 |
+
if (!("query" in opts)) {
|
| 935 |
+
|
| 936 |
+
if ("ajax" in opts) {
|
| 937 |
+
ajaxUrl = opts.element.data("ajax-url");
|
| 938 |
+
if (ajaxUrl && ajaxUrl.length > 0) {
|
| 939 |
+
opts.ajax.url = ajaxUrl;
|
| 940 |
+
}
|
| 941 |
+
opts.query = ajax.call(opts.element, opts.ajax);
|
| 942 |
+
} else if ("data" in opts) {
|
| 943 |
+
opts.query = local(opts.data);
|
| 944 |
+
} else if ("tags" in opts) {
|
| 945 |
+
opts.query = tags(opts.tags);
|
| 946 |
+
if (opts.createSearchChoice === undefined) {
|
| 947 |
+
opts.createSearchChoice = function (term) { return {id: term, text: term}; };
|
| 948 |
+
}
|
| 949 |
+
if (opts.initSelection === undefined) {
|
| 950 |
+
opts.initSelection = function (element, callback) {
|
| 951 |
+
var data = [];
|
| 952 |
+
$(splitVal(element.val(), opts.separator)).each(function () {
|
| 953 |
+
var id = this, text = this, tags=opts.tags;
|
| 954 |
+
if ($.isFunction(tags)) tags=tags();
|
| 955 |
+
$(tags).each(function() { if (equal(this.id, id)) { text = this.text; return false; } });
|
| 956 |
+
data.push({id: id, text: text});
|
| 957 |
+
});
|
| 958 |
+
|
| 959 |
+
callback(data);
|
| 960 |
+
};
|
| 961 |
+
}
|
| 962 |
+
}
|
| 963 |
+
}
|
| 964 |
+
}
|
| 965 |
+
if (typeof(opts.query) !== "function") {
|
| 966 |
+
throw "query function not defined for Select2 " + opts.element.attr("id");
|
| 967 |
+
}
|
| 968 |
+
|
| 969 |
+
return opts;
|
| 970 |
+
},
|
| 971 |
+
|
| 972 |
+
/**
|
| 973 |
+
* Monitor the original element for changes and update select2 accordingly
|
| 974 |
+
*/
|
| 975 |
+
// abstract
|
| 976 |
+
monitorSource: function () {
|
| 977 |
+
var el = this.opts.element, sync;
|
| 978 |
+
|
| 979 |
+
el.on("change.select2", this.bind(function (e) {
|
| 980 |
+
if (this.opts.element.data("select2-change-triggered") !== true) {
|
| 981 |
+
this.initSelection();
|
| 982 |
+
}
|
| 983 |
+
}));
|
| 984 |
+
|
| 985 |
+
sync = this.bind(function () {
|
| 986 |
+
|
| 987 |
+
var enabled, readonly, self = this;
|
| 988 |
+
|
| 989 |
+
// sync enabled state
|
| 990 |
+
var disabled = el.prop("disabled");
|
| 991 |
+
if (disabled === undefined) disabled = false;
|
| 992 |
+
this.enable(!disabled);
|
| 993 |
+
|
| 994 |
+
var readonly = el.prop("readonly");
|
| 995 |
+
if (readonly === undefined) readonly = false;
|
| 996 |
+
this.readonly(readonly);
|
| 997 |
+
|
| 998 |
+
syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
|
| 999 |
+
this.container.addClass(evaluate(this.opts.containerCssClass));
|
| 1000 |
+
|
| 1001 |
+
syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
|
| 1002 |
+
this.dropdown.addClass(evaluate(this.opts.dropdownCssClass));
|
| 1003 |
+
|
| 1004 |
+
});
|
| 1005 |
+
|
| 1006 |
+
// mozilla and IE
|
| 1007 |
+
el.on("propertychange.select2 DOMAttrModified.select2", sync);
|
| 1008 |
+
|
| 1009 |
+
|
| 1010 |
+
// hold onto a reference of the callback to work around a chromium bug
|
| 1011 |
+
if (this.mutationCallback === undefined) {
|
| 1012 |
+
this.mutationCallback = function (mutations) {
|
| 1013 |
+
mutations.forEach(sync);
|
| 1014 |
+
}
|
| 1015 |
+
}
|
| 1016 |
+
|
| 1017 |
+
// safari and chrome
|
| 1018 |
+
if (typeof WebKitMutationObserver !== "undefined") {
|
| 1019 |
+
if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
|
| 1020 |
+
this.propertyObserver = new WebKitMutationObserver(this.mutationCallback);
|
| 1021 |
+
this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
|
| 1022 |
+
}
|
| 1023 |
+
},
|
| 1024 |
+
|
| 1025 |
+
// abstract
|
| 1026 |
+
triggerSelect: function(data) {
|
| 1027 |
+
var evt = $.Event("select2-selecting", { val: this.id(data), object: data });
|
| 1028 |
+
this.opts.element.trigger(evt);
|
| 1029 |
+
return !evt.isDefaultPrevented();
|
| 1030 |
+
},
|
| 1031 |
+
|
| 1032 |
+
/**
|
| 1033 |
+
* Triggers the change event on the source element
|
| 1034 |
+
*/
|
| 1035 |
+
// abstract
|
| 1036 |
+
triggerChange: function (details) {
|
| 1037 |
+
|
| 1038 |
+
details = details || {};
|
| 1039 |
+
details= $.extend({}, details, { type: "change", val: this.val() });
|
| 1040 |
+
// prevents recursive triggering
|
| 1041 |
+
this.opts.element.data("select2-change-triggered", true);
|
| 1042 |
+
this.opts.element.trigger(details);
|
| 1043 |
+
this.opts.element.data("select2-change-triggered", false);
|
| 1044 |
+
|
| 1045 |
+
// some validation frameworks ignore the change event and listen instead to keyup, click for selects
|
| 1046 |
+
// so here we trigger the click event manually
|
| 1047 |
+
this.opts.element.click();
|
| 1048 |
+
|
| 1049 |
+
// ValidationEngine ignorea the change event and listens instead to blur
|
| 1050 |
+
// so here we trigger the blur event manually if so desired
|
| 1051 |
+
if (this.opts.blurOnChange)
|
| 1052 |
+
this.opts.element.blur();
|
| 1053 |
+
},
|
| 1054 |
+
|
| 1055 |
+
//abstract
|
| 1056 |
+
isInterfaceEnabled: function()
|
| 1057 |
+
{
|
| 1058 |
+
return this.enabledInterface === true;
|
| 1059 |
+
},
|
| 1060 |
+
|
| 1061 |
+
// abstract
|
| 1062 |
+
enableInterface: function() {
|
| 1063 |
+
var enabled = this._enabled && !this._readonly,
|
| 1064 |
+
disabled = !enabled;
|
| 1065 |
+
|
| 1066 |
+
if (enabled === this.enabledInterface) return false;
|
| 1067 |
+
|
| 1068 |
+
this.container.toggleClass("select2-container-disabled", disabled);
|
| 1069 |
+
this.close();
|
| 1070 |
+
this.enabledInterface = enabled;
|
| 1071 |
+
|
| 1072 |
+
return true;
|
| 1073 |
+
},
|
| 1074 |
+
|
| 1075 |
+
// abstract
|
| 1076 |
+
enable: function(enabled) {
|
| 1077 |
+
if (enabled === undefined) enabled = true;
|
| 1078 |
+
if (this._enabled === enabled) return false;
|
| 1079 |
+
this._enabled = enabled;
|
| 1080 |
+
|
| 1081 |
+
this.opts.element.prop("disabled", !enabled);
|
| 1082 |
+
this.enableInterface();
|
| 1083 |
+
return true;
|
| 1084 |
+
},
|
| 1085 |
+
|
| 1086 |
+
// abstract
|
| 1087 |
+
readonly: function(enabled) {
|
| 1088 |
+
if (enabled === undefined) enabled = false;
|
| 1089 |
+
if (this._readonly === enabled) return false;
|
| 1090 |
+
this._readonly = enabled;
|
| 1091 |
+
|
| 1092 |
+
this.opts.element.prop("readonly", enabled);
|
| 1093 |
+
this.enableInterface();
|
| 1094 |
+
return true;
|
| 1095 |
+
},
|
| 1096 |
+
|
| 1097 |
+
// abstract
|
| 1098 |
+
opened: function () {
|
| 1099 |
+
return this.container.hasClass("select2-dropdown-open");
|
| 1100 |
+
},
|
| 1101 |
+
|
| 1102 |
+
// abstract
|
| 1103 |
+
positionDropdown: function() {
|
| 1104 |
+
var $dropdown = this.dropdown,
|
| 1105 |
+
offset = this.container.offset(),
|
| 1106 |
+
height = this.container.outerHeight(false),
|
| 1107 |
+
width = this.container.outerWidth(false),
|
| 1108 |
+
dropHeight = $dropdown.outerHeight(false),
|
| 1109 |
+
viewPortRight = $(window).scrollLeft() + $(window).width(),
|
| 1110 |
+
viewportBottom = $(window).scrollTop() + $(window).height(),
|
| 1111 |
+
dropTop = offset.top + height,
|
| 1112 |
+
dropLeft = offset.left,
|
| 1113 |
+
enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
|
| 1114 |
+
enoughRoomAbove = (offset.top - dropHeight) >= this.body().scrollTop(),
|
| 1115 |
+
dropWidth = $dropdown.outerWidth(false),
|
| 1116 |
+
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight,
|
| 1117 |
+
aboveNow = $dropdown.hasClass("select2-drop-above"),
|
| 1118 |
+
bodyOffset,
|
| 1119 |
+
above,
|
| 1120 |
+
css,
|
| 1121 |
+
resultsListNode;
|
| 1122 |
+
|
| 1123 |
+
if (this.opts.dropdownAutoWidth) {
|
| 1124 |
+
resultsListNode = $('.select2-results', $dropdown)[0];
|
| 1125 |
+
$dropdown.addClass('select2-drop-auto-width');
|
| 1126 |
+
$dropdown.css('width', '');
|
| 1127 |
+
// Add scrollbar width to dropdown if vertical scrollbar is present
|
| 1128 |
+
dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
|
| 1129 |
+
dropWidth > width ? width = dropWidth : dropWidth = width;
|
| 1130 |
+
enoughRoomOnRight = dropLeft + dropWidth <= viewPortRight;
|
| 1131 |
+
}
|
| 1132 |
+
else {
|
| 1133 |
+
this.container.removeClass('select2-drop-auto-width');
|
| 1134 |
+
}
|
| 1135 |
+
|
| 1136 |
+
//console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
|
| 1137 |
+
//console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body().scrollTop(), "enough?", enoughRoomAbove);
|
| 1138 |
+
|
| 1139 |
+
// fix positioning when body has an offset and is not position: static
|
| 1140 |
+
if (this.body().css('position') !== 'static') {
|
| 1141 |
+
bodyOffset = this.body().offset();
|
| 1142 |
+
dropTop -= bodyOffset.top;
|
| 1143 |
+
dropLeft -= bodyOffset.left;
|
| 1144 |
+
}
|
| 1145 |
+
|
| 1146 |
+
// always prefer the current above/below alignment, unless there is not enough room
|
| 1147 |
+
if (aboveNow) {
|
| 1148 |
+
above = true;
|
| 1149 |
+
if (!enoughRoomAbove && enoughRoomBelow) above = false;
|
| 1150 |
+
} else {
|
| 1151 |
+
above = false;
|
| 1152 |
+
if (!enoughRoomBelow && enoughRoomAbove) above = true;
|
| 1153 |
+
}
|
| 1154 |
+
|
| 1155 |
+
if (!enoughRoomOnRight) {
|
| 1156 |
+
dropLeft = offset.left + width - dropWidth;
|
| 1157 |
+
}
|
| 1158 |
+
|
| 1159 |
+
if (above) {
|
| 1160 |
+
dropTop = offset.top - dropHeight;
|
| 1161 |
+
this.container.addClass("select2-drop-above");
|
| 1162 |
+
$dropdown.addClass("select2-drop-above");
|
| 1163 |
+
}
|
| 1164 |
+
else {
|
| 1165 |
+
this.container.removeClass("select2-drop-above");
|
| 1166 |
+
$dropdown.removeClass("select2-drop-above");
|
| 1167 |
+
}
|
| 1168 |
+
|
| 1169 |
+
css = $.extend({
|
| 1170 |
+
top: dropTop,
|
| 1171 |
+
left: dropLeft,
|
| 1172 |
+
width: width
|
| 1173 |
+
}, evaluate(this.opts.dropdownCss));
|
| 1174 |
+
|
| 1175 |
+
$dropdown.css(css);
|
| 1176 |
+
},
|
| 1177 |
+
|
| 1178 |
+
// abstract
|
| 1179 |
+
shouldOpen: function() {
|
| 1180 |
+
var event;
|
| 1181 |
+
|
| 1182 |
+
if (this.opened()) return false;
|
| 1183 |
+
|
| 1184 |
+
if (this._enabled === false || this._readonly === true) return false;
|
| 1185 |
+
|
| 1186 |
+
event = $.Event("select2-opening");
|
| 1187 |
+
this.opts.element.trigger(event);
|
| 1188 |
+
return !event.isDefaultPrevented();
|
| 1189 |
+
},
|
| 1190 |
+
|
| 1191 |
+
// abstract
|
| 1192 |
+
clearDropdownAlignmentPreference: function() {
|
| 1193 |
+
// clear the classes used to figure out the preference of where the dropdown should be opened
|
| 1194 |
+
this.container.removeClass("select2-drop-above");
|
| 1195 |
+
this.dropdown.removeClass("select2-drop-above");
|
| 1196 |
+
},
|
| 1197 |
+
|
| 1198 |
+
/**
|
| 1199 |
+
* Opens the dropdown
|
| 1200 |
+
*
|
| 1201 |
+
* @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
|
| 1202 |
+
* the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
|
| 1203 |
+
*/
|
| 1204 |
+
// abstract
|
| 1205 |
+
open: function () {
|
| 1206 |
+
|
| 1207 |
+
if (!this.shouldOpen()) return false;
|
| 1208 |
+
|
| 1209 |
+
this.opening();
|
| 1210 |
+
|
| 1211 |
+
return true;
|
| 1212 |
+
},
|
| 1213 |
+
|
| 1214 |
+
/**
|
| 1215 |
+
* Performs the opening of the dropdown
|
| 1216 |
+
*/
|
| 1217 |
+
// abstract
|
| 1218 |
+
opening: function() {
|
| 1219 |
+
var cid = this.containerId,
|
| 1220 |
+
scroll = "scroll." + cid,
|
| 1221 |
+
resize = "resize."+cid,
|
| 1222 |
+
orient = "orientationchange."+cid,
|
| 1223 |
+
mask, maskCss;
|
| 1224 |
+
|
| 1225 |
+
this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
|
| 1226 |
+
|
| 1227 |
+
this.clearDropdownAlignmentPreference();
|
| 1228 |
+
|
| 1229 |
+
if(this.dropdown[0] !== this.body().children().last()[0]) {
|
| 1230 |
+
this.dropdown.detach().appendTo(this.body());
|
| 1231 |
+
}
|
| 1232 |
+
|
| 1233 |
+
// create the dropdown mask if doesnt already exist
|
| 1234 |
+
mask = $("#select2-drop-mask");
|
| 1235 |
+
if (mask.length == 0) {
|
| 1236 |
+
mask = $(document.createElement("div"));
|
| 1237 |
+
mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
|
| 1238 |
+
mask.hide();
|
| 1239 |
+
mask.appendTo(this.body());
|
| 1240 |
+
mask.on("mousedown touchstart click", function (e) {
|
| 1241 |
+
var dropdown = $("#select2-drop"), self;
|
| 1242 |
+
if (dropdown.length > 0) {
|
| 1243 |
+
self=dropdown.data("select2");
|
| 1244 |
+
if (self.opts.selectOnBlur) {
|
| 1245 |
+
self.selectHighlighted({noFocus: true});
|
| 1246 |
+
}
|
| 1247 |
+
self.close();
|
| 1248 |
+
e.preventDefault();
|
| 1249 |
+
e.stopPropagation();
|
| 1250 |
+
}
|
| 1251 |
+
});
|
| 1252 |
+
}
|
| 1253 |
+
|
| 1254 |
+
// ensure the mask is always right before the dropdown
|
| 1255 |
+
if (this.dropdown.prev()[0] !== mask[0]) {
|
| 1256 |
+
this.dropdown.before(mask);
|
| 1257 |
+
}
|
| 1258 |
+
|
| 1259 |
+
// move the global id to the correct dropdown
|
| 1260 |
+
$("#select2-drop").removeAttr("id");
|
| 1261 |
+
this.dropdown.attr("id", "select2-drop");
|
| 1262 |
+
|
| 1263 |
+
// show the elements
|
| 1264 |
+
maskCss=_makeMaskCss();
|
| 1265 |
+
|
| 1266 |
+
mask.css(maskCss).show();
|
| 1267 |
+
|
| 1268 |
+
this.dropdown.show();
|
| 1269 |
+
this.positionDropdown();
|
| 1270 |
+
|
| 1271 |
+
this.dropdown.addClass("select2-drop-active");
|
| 1272 |
+
|
| 1273 |
+
// attach listeners to events that can change the position of the container and thus require
|
| 1274 |
+
// the position of the dropdown to be updated as well so it does not come unglued from the container
|
| 1275 |
+
var that = this;
|
| 1276 |
+
this.container.parents().add(window).each(function () {
|
| 1277 |
+
$(this).on(resize+" "+scroll+" "+orient, function (e) {
|
| 1278 |
+
var maskCss=_makeMaskCss();
|
| 1279 |
+
$("#select2-drop-mask").css(maskCss);
|
| 1280 |
+
that.positionDropdown();
|
| 1281 |
+
});
|
| 1282 |
+
});
|
| 1283 |
+
|
| 1284 |
+
function _makeMaskCss() {
|
| 1285 |
+
return {
|
| 1286 |
+
width : Math.max(document.documentElement.scrollWidth, $(window).width()),
|
| 1287 |
+
height : Math.max(document.documentElement.scrollHeight, $(window).height())
|
| 1288 |
+
}
|
| 1289 |
+
}
|
| 1290 |
+
},
|
| 1291 |
+
|
| 1292 |
+
// abstract
|
| 1293 |
+
close: function () {
|
| 1294 |
+
if (!this.opened()) return;
|
| 1295 |
+
|
| 1296 |
+
var cid = this.containerId,
|
| 1297 |
+
scroll = "scroll." + cid,
|
| 1298 |
+
resize = "resize."+cid,
|
| 1299 |
+
orient = "orientationchange."+cid;
|
| 1300 |
+
|
| 1301 |
+
// unbind event listeners
|
| 1302 |
+
this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
|
| 1303 |
+
|
| 1304 |
+
this.clearDropdownAlignmentPreference();
|
| 1305 |
+
|
| 1306 |
+
$("#select2-drop-mask").hide();
|
| 1307 |
+
this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
|
| 1308 |
+
this.dropdown.hide();
|
| 1309 |
+
this.container.removeClass("select2-dropdown-open");
|
| 1310 |
+
this.results.empty();
|
| 1311 |
+
|
| 1312 |
+
|
| 1313 |
+
this.clearSearch();
|
| 1314 |
+
this.search.removeClass("select2-active");
|
| 1315 |
+
this.opts.element.trigger($.Event("select2-close"));
|
| 1316 |
+
},
|
| 1317 |
+
|
| 1318 |
+
/**
|
| 1319 |
+
* Opens control, sets input value, and updates results.
|
| 1320 |
+
*/
|
| 1321 |
+
// abstract
|
| 1322 |
+
externalSearch: function (term) {
|
| 1323 |
+
this.open();
|
| 1324 |
+
this.search.val(term);
|
| 1325 |
+
this.updateResults(false);
|
| 1326 |
+
},
|
| 1327 |
+
|
| 1328 |
+
// abstract
|
| 1329 |
+
clearSearch: function () {
|
| 1330 |
+
|
| 1331 |
+
},
|
| 1332 |
+
|
| 1333 |
+
//abstract
|
| 1334 |
+
getMaximumSelectionSize: function() {
|
| 1335 |
+
return evaluate(this.opts.maximumSelectionSize);
|
| 1336 |
+
},
|
| 1337 |
+
|
| 1338 |
+
// abstract
|
| 1339 |
+
ensureHighlightVisible: function () {
|
| 1340 |
+
var results = this.results, children, index, child, hb, rb, y, more;
|
| 1341 |
+
|
| 1342 |
+
index = this.highlight();
|
| 1343 |
+
|
| 1344 |
+
if (index < 0) return;
|
| 1345 |
+
|
| 1346 |
+
if (index == 0) {
|
| 1347 |
+
|
| 1348 |
+
// if the first element is highlighted scroll all the way to the top,
|
| 1349 |
+
// that way any unselectable headers above it will also be scrolled
|
| 1350 |
+
// into view
|
| 1351 |
+
|
| 1352 |
+
results.scrollTop(0);
|
| 1353 |
+
return;
|
| 1354 |
+
}
|
| 1355 |
+
|
| 1356 |
+
children = this.findHighlightableChoices().find('.select2-result-label');
|
| 1357 |
+
|
| 1358 |
+
child = $(children[index]);
|
| 1359 |
+
|
| 1360 |
+
hb = child.offset().top + child.outerHeight(true);
|
| 1361 |
+
|
| 1362 |
+
// if this is the last child lets also make sure select2-more-results is visible
|
| 1363 |
+
if (index === children.length - 1) {
|
| 1364 |
+
more = results.find("li.select2-more-results");
|
| 1365 |
+
if (more.length > 0) {
|
| 1366 |
+
hb = more.offset().top + more.outerHeight(true);
|
| 1367 |
+
}
|
| 1368 |
+
}
|
| 1369 |
+
|
| 1370 |
+
rb = results.offset().top + results.outerHeight(true);
|
| 1371 |
+
if (hb > rb) {
|
| 1372 |
+
results.scrollTop(results.scrollTop() + (hb - rb));
|
| 1373 |
+
}
|
| 1374 |
+
y = child.offset().top - results.offset().top;
|
| 1375 |
+
|
| 1376 |
+
// make sure the top of the element is visible
|
| 1377 |
+
if (y < 0 && child.css('display') != 'none' ) {
|
| 1378 |
+
results.scrollTop(results.scrollTop() + y); // y is negative
|
| 1379 |
+
}
|
| 1380 |
+
},
|
| 1381 |
+
|
| 1382 |
+
// abstract
|
| 1383 |
+
findHighlightableChoices: function() {
|
| 1384 |
+
return this.results.find(".select2-result-selectable:not(.select2-selected):not(.select2-disabled)");
|
| 1385 |
+
},
|
| 1386 |
+
|
| 1387 |
+
// abstract
|
| 1388 |
+
moveHighlight: function (delta) {
|
| 1389 |
+
var choices = this.findHighlightableChoices(),
|
| 1390 |
+
index = this.highlight();
|
| 1391 |
+
|
| 1392 |
+
while (index > -1 && index < choices.length) {
|
| 1393 |
+
index += delta;
|
| 1394 |
+
var choice = $(choices[index]);
|
| 1395 |
+
if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
|
| 1396 |
+
this.highlight(index);
|
| 1397 |
+
break;
|
| 1398 |
+
}
|
| 1399 |
+
}
|
| 1400 |
+
},
|
| 1401 |
+
|
| 1402 |
+
// abstract
|
| 1403 |
+
highlight: function (index) {
|
| 1404 |
+
var choices = this.findHighlightableChoices(),
|
| 1405 |
+
choice,
|
| 1406 |
+
data;
|
| 1407 |
+
|
| 1408 |
+
if (arguments.length === 0) {
|
| 1409 |
+
return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
|
| 1410 |
+
}
|
| 1411 |
+
|
| 1412 |
+
if (index >= choices.length) index = choices.length - 1;
|
| 1413 |
+
if (index < 0) index = 0;
|
| 1414 |
+
|
| 1415 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1416 |
+
|
| 1417 |
+
choice = $(choices[index]);
|
| 1418 |
+
choice.addClass("select2-highlighted");
|
| 1419 |
+
|
| 1420 |
+
this.ensureHighlightVisible();
|
| 1421 |
+
|
| 1422 |
+
data = choice.data("select2-data");
|
| 1423 |
+
if (data) {
|
| 1424 |
+
this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
|
| 1425 |
+
}
|
| 1426 |
+
},
|
| 1427 |
+
|
| 1428 |
+
// abstract
|
| 1429 |
+
countSelectableResults: function() {
|
| 1430 |
+
return this.findHighlightableChoices().length;
|
| 1431 |
+
},
|
| 1432 |
+
|
| 1433 |
+
// abstract
|
| 1434 |
+
highlightUnderEvent: function (event) {
|
| 1435 |
+
var el = $(event.target).closest(".select2-result-selectable");
|
| 1436 |
+
if (el.length > 0 && !el.is(".select2-highlighted")) {
|
| 1437 |
+
var choices = this.findHighlightableChoices();
|
| 1438 |
+
this.highlight(choices.index(el));
|
| 1439 |
+
} else if (el.length == 0) {
|
| 1440 |
+
// if we are over an unselectable item remove al highlights
|
| 1441 |
+
this.results.find(".select2-highlighted").removeClass("select2-highlighted");
|
| 1442 |
+
}
|
| 1443 |
+
},
|
| 1444 |
+
|
| 1445 |
+
// abstract
|
| 1446 |
+
loadMoreIfNeeded: function () {
|
| 1447 |
+
var results = this.results,
|
| 1448 |
+
more = results.find("li.select2-more-results"),
|
| 1449 |
+
below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
|
| 1450 |
+
offset = -1, // index of first element without data
|
| 1451 |
+
page = this.resultsPage + 1,
|
| 1452 |
+
self=this,
|
| 1453 |
+
term=this.search.val(),
|
| 1454 |
+
context=this.context;
|
| 1455 |
+
|
| 1456 |
+
if (more.length === 0) return;
|
| 1457 |
+
below = more.offset().top - results.offset().top - results.height();
|
| 1458 |
+
|
| 1459 |
+
if (below <= this.opts.loadMorePadding) {
|
| 1460 |
+
more.addClass("select2-active");
|
| 1461 |
+
this.opts.query({
|
| 1462 |
+
element: this.opts.element,
|
| 1463 |
+
term: term,
|
| 1464 |
+
page: page,
|
| 1465 |
+
context: context,
|
| 1466 |
+
matcher: this.opts.matcher,
|
| 1467 |
+
callback: this.bind(function (data) {
|
| 1468 |
+
|
| 1469 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1470 |
+
if (!self.opened()) return;
|
| 1471 |
+
|
| 1472 |
+
|
| 1473 |
+
self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
|
| 1474 |
+
self.postprocessResults(data, false, false);
|
| 1475 |
+
|
| 1476 |
+
if (data.more===true) {
|
| 1477 |
+
more.detach().appendTo(results).text(self.opts.formatLoadMore(page+1));
|
| 1478 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1479 |
+
} else {
|
| 1480 |
+
more.remove();
|
| 1481 |
+
}
|
| 1482 |
+
self.positionDropdown();
|
| 1483 |
+
self.resultsPage = page;
|
| 1484 |
+
self.context = data.context;
|
| 1485 |
+
})});
|
| 1486 |
+
}
|
| 1487 |
+
},
|
| 1488 |
+
|
| 1489 |
+
/**
|
| 1490 |
+
* Default tokenizer function which does nothing
|
| 1491 |
+
*/
|
| 1492 |
+
tokenize: function() {
|
| 1493 |
+
|
| 1494 |
+
},
|
| 1495 |
+
|
| 1496 |
+
/**
|
| 1497 |
+
* @param initial whether or not this is the call to this method right after the dropdown has been opened
|
| 1498 |
+
*/
|
| 1499 |
+
// abstract
|
| 1500 |
+
updateResults: function (initial) {
|
| 1501 |
+
var search = this.search,
|
| 1502 |
+
results = this.results,
|
| 1503 |
+
opts = this.opts,
|
| 1504 |
+
data,
|
| 1505 |
+
self = this,
|
| 1506 |
+
input,
|
| 1507 |
+
term = search.val(),
|
| 1508 |
+
lastTerm=$.data(this.container, "select2-last-term");
|
| 1509 |
+
|
| 1510 |
+
// prevent duplicate queries against the same term
|
| 1511 |
+
if (initial !== true && lastTerm && equal(term, lastTerm)) return;
|
| 1512 |
+
|
| 1513 |
+
$.data(this.container, "select2-last-term", term);
|
| 1514 |
+
|
| 1515 |
+
// if the search is currently hidden we do not alter the results
|
| 1516 |
+
if (initial !== true && (this.showSearchInput === false || !this.opened())) {
|
| 1517 |
+
return;
|
| 1518 |
+
}
|
| 1519 |
+
|
| 1520 |
+
function postRender() {
|
| 1521 |
+
search.removeClass("select2-active");
|
| 1522 |
+
self.positionDropdown();
|
| 1523 |
+
}
|
| 1524 |
+
|
| 1525 |
+
function render(html) {
|
| 1526 |
+
results.html(html);
|
| 1527 |
+
postRender();
|
| 1528 |
+
}
|
| 1529 |
+
|
| 1530 |
+
var maxSelSize = this.getMaximumSelectionSize();
|
| 1531 |
+
if (maxSelSize >=1) {
|
| 1532 |
+
data = this.data();
|
| 1533 |
+
if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
|
| 1534 |
+
render("<li class='select2-selection-limit'>" + opts.formatSelectionTooBig(maxSelSize) + "</li>");
|
| 1535 |
+
return;
|
| 1536 |
+
}
|
| 1537 |
+
}
|
| 1538 |
+
|
| 1539 |
+
if (search.val().length < opts.minimumInputLength) {
|
| 1540 |
+
if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
|
| 1541 |
+
render("<li class='select2-no-results'>" + opts.formatInputTooShort(search.val(), opts.minimumInputLength) + "</li>");
|
| 1542 |
+
} else {
|
| 1543 |
+
render("");
|
| 1544 |
+
}
|
| 1545 |
+
if (initial && this.showSearch) this.showSearch(true);
|
| 1546 |
+
return;
|
| 1547 |
+
}
|
| 1548 |
+
|
| 1549 |
+
if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
|
| 1550 |
+
if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
|
| 1551 |
+
render("<li class='select2-no-results'>" + opts.formatInputTooLong(search.val(), opts.maximumInputLength) + "</li>");
|
| 1552 |
+
} else {
|
| 1553 |
+
render("");
|
| 1554 |
+
}
|
| 1555 |
+
return;
|
| 1556 |
+
}
|
| 1557 |
+
|
| 1558 |
+
if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
|
| 1559 |
+
render("<li class='select2-searching'>" + opts.formatSearching() + "</li>");
|
| 1560 |
+
}
|
| 1561 |
+
|
| 1562 |
+
search.addClass("select2-active");
|
| 1563 |
+
|
| 1564 |
+
// give the tokenizer a chance to pre-process the input
|
| 1565 |
+
input = this.tokenize();
|
| 1566 |
+
if (input != undefined && input != null) {
|
| 1567 |
+
search.val(input);
|
| 1568 |
+
}
|
| 1569 |
+
|
| 1570 |
+
this.resultsPage = 1;
|
| 1571 |
+
|
| 1572 |
+
opts.query({
|
| 1573 |
+
element: opts.element,
|
| 1574 |
+
term: search.val(),
|
| 1575 |
+
page: this.resultsPage,
|
| 1576 |
+
context: null,
|
| 1577 |
+
matcher: opts.matcher,
|
| 1578 |
+
callback: this.bind(function (data) {
|
| 1579 |
+
var def; // default choice
|
| 1580 |
+
|
| 1581 |
+
// ignore a response if the select2 has been closed before it was received
|
| 1582 |
+
if (!this.opened()) {
|
| 1583 |
+
this.search.removeClass("select2-active");
|
| 1584 |
+
return;
|
| 1585 |
+
}
|
| 1586 |
+
|
| 1587 |
+
// save context, if any
|
| 1588 |
+
this.context = (data.context===undefined) ? null : data.context;
|
| 1589 |
+
// create a default choice and prepend it to the list
|
| 1590 |
+
if (this.opts.createSearchChoice && search.val() !== "") {
|
| 1591 |
+
def = this.opts.createSearchChoice.call(self, search.val(), data.results);
|
| 1592 |
+
if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
|
| 1593 |
+
if ($(data.results).filter(
|
| 1594 |
+
function () {
|
| 1595 |
+
return equal(self.id(this), self.id(def));
|
| 1596 |
+
}).length === 0) {
|
| 1597 |
+
data.results.unshift(def);
|
| 1598 |
+
}
|
| 1599 |
+
}
|
| 1600 |
+
}
|
| 1601 |
+
|
| 1602 |
+
if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
|
| 1603 |
+
render("<li class='select2-no-results'>" + opts.formatNoMatches(search.val()) + "</li>");
|
| 1604 |
+
return;
|
| 1605 |
+
}
|
| 1606 |
+
|
| 1607 |
+
results.empty();
|
| 1608 |
+
self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
|
| 1609 |
+
|
| 1610 |
+
if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
|
| 1611 |
+
results.append("<li class='select2-more-results'>" + self.opts.escapeMarkup(opts.formatLoadMore(this.resultsPage)) + "</li>");
|
| 1612 |
+
window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
|
| 1613 |
+
}
|
| 1614 |
+
|
| 1615 |
+
this.postprocessResults(data, initial);
|
| 1616 |
+
|
| 1617 |
+
postRender();
|
| 1618 |
+
|
| 1619 |
+
this.opts.element.trigger({ type: "select2-loaded", items: data });
|
| 1620 |
+
})});
|
| 1621 |
+
},
|
| 1622 |
+
|
| 1623 |
+
// abstract
|
| 1624 |
+
cancel: function () {
|
| 1625 |
+
this.close();
|
| 1626 |
+
},
|
| 1627 |
+
|
| 1628 |
+
// abstract
|
| 1629 |
+
blur: function () {
|
| 1630 |
+
// if selectOnBlur == true, select the currently highlighted option
|
| 1631 |
+
if (this.opts.selectOnBlur)
|
| 1632 |
+
this.selectHighlighted({noFocus: true});
|
| 1633 |
+
|
| 1634 |
+
this.close();
|
| 1635 |
+
this.container.removeClass("select2-container-active");
|
| 1636 |
+
// synonymous to .is(':focus'), which is available in jquery >= 1.6
|
| 1637 |
+
if (this.search[0] === document.activeElement) { this.search.blur(); }
|
| 1638 |
+
this.clearSearch();
|
| 1639 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 1640 |
+
},
|
| 1641 |
+
|
| 1642 |
+
// abstract
|
| 1643 |
+
focusSearch: function () {
|
| 1644 |
+
focus(this.search);
|
| 1645 |
+
},
|
| 1646 |
+
|
| 1647 |
+
// abstract
|
| 1648 |
+
selectHighlighted: function (options) {
|
| 1649 |
+
var index=this.highlight(),
|
| 1650 |
+
highlighted=this.results.find(".select2-highlighted"),
|
| 1651 |
+
data = highlighted.closest('.select2-result').data("select2-data");
|
| 1652 |
+
|
| 1653 |
+
if (data) {
|
| 1654 |
+
this.highlight(index);
|
| 1655 |
+
this.onSelect(data, options);
|
| 1656 |
+
} else if (options && options.noFocus) {
|
| 1657 |
+
this.close();
|
| 1658 |
+
}
|
| 1659 |
+
},
|
| 1660 |
+
|
| 1661 |
+
// abstract
|
| 1662 |
+
getPlaceholder: function () {
|
| 1663 |
+
var placeholderOption;
|
| 1664 |
+
return this.opts.element.attr("placeholder") ||
|
| 1665 |
+
this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
|
| 1666 |
+
this.opts.element.data("placeholder") ||
|
| 1667 |
+
this.opts.placeholder ||
|
| 1668 |
+
((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
|
| 1669 |
+
},
|
| 1670 |
+
|
| 1671 |
+
// abstract
|
| 1672 |
+
getPlaceholderOption: function() {
|
| 1673 |
+
if (this.select) {
|
| 1674 |
+
var firstOption = this.select.children().first();
|
| 1675 |
+
if (this.opts.placeholderOption !== undefined ) {
|
| 1676 |
+
//Determine the placeholder option based on the specified placeholderOption setting
|
| 1677 |
+
return (this.opts.placeholderOption === "first" && firstOption) ||
|
| 1678 |
+
(typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
|
| 1679 |
+
} else if (firstOption.text() === "" && firstOption.val() === "") {
|
| 1680 |
+
//No explicit placeholder option specified, use the first if it's blank
|
| 1681 |
+
return firstOption;
|
| 1682 |
+
}
|
| 1683 |
+
}
|
| 1684 |
+
},
|
| 1685 |
+
|
| 1686 |
+
/**
|
| 1687 |
+
* Get the desired width for the container element. This is
|
| 1688 |
+
* derived first from option `width` passed to select2, then
|
| 1689 |
+
* the inline 'style' on the original element, and finally
|
| 1690 |
+
* falls back to the jQuery calculated element width.
|
| 1691 |
+
*/
|
| 1692 |
+
// abstract
|
| 1693 |
+
initContainerWidth: function () {
|
| 1694 |
+
function resolveContainerWidth() {
|
| 1695 |
+
var style, attrs, matches, i, l;
|
| 1696 |
+
|
| 1697 |
+
if (this.opts.width === "off") {
|
| 1698 |
+
return null;
|
| 1699 |
+
} else if (this.opts.width === "element"){
|
| 1700 |
+
return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
|
| 1701 |
+
} else if (this.opts.width === "copy" || this.opts.width === "resolve") {
|
| 1702 |
+
// check if there is inline style on the element that contains width
|
| 1703 |
+
style = this.opts.element.attr('style');
|
| 1704 |
+
if (style !== undefined) {
|
| 1705 |
+
attrs = style.split(';');
|
| 1706 |
+
for (i = 0, l = attrs.length; i < l; i = i + 1) {
|
| 1707 |
+
matches = attrs[i].replace(/\s/g, '')
|
| 1708 |
+
.match(/width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
|
| 1709 |
+
if (matches !== null && matches.length >= 1)
|
| 1710 |
+
return matches[1];
|
| 1711 |
+
}
|
| 1712 |
+
}
|
| 1713 |
+
|
| 1714 |
+
if (this.opts.width === "resolve") {
|
| 1715 |
+
// next check if css('width') can resolve a width that is percent based, this is sometimes possible
|
| 1716 |
+
// when attached to input type=hidden or elements hidden via css
|
| 1717 |
+
style = this.opts.element.css('width');
|
| 1718 |
+
if (style.indexOf("%") > 0) return style;
|
| 1719 |
+
|
| 1720 |
+
// finally, fallback on the calculated width of the element
|
| 1721 |
+
return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
|
| 1722 |
+
}
|
| 1723 |
+
|
| 1724 |
+
return null;
|
| 1725 |
+
} else if ($.isFunction(this.opts.width)) {
|
| 1726 |
+
return this.opts.width();
|
| 1727 |
+
} else {
|
| 1728 |
+
return this.opts.width;
|
| 1729 |
+
}
|
| 1730 |
+
};
|
| 1731 |
+
|
| 1732 |
+
var width = resolveContainerWidth.call(this);
|
| 1733 |
+
if (width !== null) {
|
| 1734 |
+
this.container.css("width", width);
|
| 1735 |
+
}
|
| 1736 |
+
}
|
| 1737 |
+
});
|
| 1738 |
+
|
| 1739 |
+
SingleSelect2 = clazz(AbstractSelect2, {
|
| 1740 |
+
|
| 1741 |
+
// single
|
| 1742 |
+
|
| 1743 |
+
createContainer: function () {
|
| 1744 |
+
var container = $(document.createElement("div")).attr({
|
| 1745 |
+
"class": "select2-container"
|
| 1746 |
+
}).html([
|
| 1747 |
+
"<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>",
|
| 1748 |
+
" <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>",
|
| 1749 |
+
" <span class='select2-arrow'><b></b></span>",
|
| 1750 |
+
"</a>",
|
| 1751 |
+
"<input class='select2-focusser select2-offscreen' type='text'/>",
|
| 1752 |
+
"<div class='select2-drop select2-display-none'>",
|
| 1753 |
+
" <div class='select2-search'>",
|
| 1754 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>",
|
| 1755 |
+
" </div>",
|
| 1756 |
+
" <ul class='select2-results'>",
|
| 1757 |
+
" </ul>",
|
| 1758 |
+
"</div>"].join(""));
|
| 1759 |
+
return container;
|
| 1760 |
+
},
|
| 1761 |
+
|
| 1762 |
+
// single
|
| 1763 |
+
enableInterface: function() {
|
| 1764 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 1765 |
+
this.focusser.prop("disabled", !this.isInterfaceEnabled());
|
| 1766 |
+
}
|
| 1767 |
+
},
|
| 1768 |
+
|
| 1769 |
+
// single
|
| 1770 |
+
opening: function () {
|
| 1771 |
+
var el, range, len;
|
| 1772 |
+
|
| 1773 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1774 |
+
this.showSearch(true);
|
| 1775 |
+
}
|
| 1776 |
+
|
| 1777 |
+
this.parent.opening.apply(this, arguments);
|
| 1778 |
+
|
| 1779 |
+
if (this.showSearchInput !== false) {
|
| 1780 |
+
// IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
|
| 1781 |
+
// all other browsers handle this just fine
|
| 1782 |
+
|
| 1783 |
+
this.search.val(this.focusser.val());
|
| 1784 |
+
}
|
| 1785 |
+
this.search.focus();
|
| 1786 |
+
// move the cursor to the end after focussing, otherwise it will be at the beginning and
|
| 1787 |
+
// new text will appear *before* focusser.val()
|
| 1788 |
+
el = this.search.get(0);
|
| 1789 |
+
if (el.createTextRange) {
|
| 1790 |
+
range = el.createTextRange();
|
| 1791 |
+
range.collapse(false);
|
| 1792 |
+
range.select();
|
| 1793 |
+
} else if (el.setSelectionRange) {
|
| 1794 |
+
len = this.search.val().length;
|
| 1795 |
+
el.setSelectionRange(len, len);
|
| 1796 |
+
}
|
| 1797 |
+
|
| 1798 |
+
this.focusser.prop("disabled", true).val("");
|
| 1799 |
+
this.updateResults(true);
|
| 1800 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 1801 |
+
},
|
| 1802 |
+
|
| 1803 |
+
// single
|
| 1804 |
+
close: function () {
|
| 1805 |
+
if (!this.opened()) return;
|
| 1806 |
+
this.parent.close.apply(this, arguments);
|
| 1807 |
+
this.focusser.removeAttr("disabled");
|
| 1808 |
+
this.focusser.focus();
|
| 1809 |
+
},
|
| 1810 |
+
|
| 1811 |
+
// single
|
| 1812 |
+
focus: function () {
|
| 1813 |
+
if (this.opened()) {
|
| 1814 |
+
this.close();
|
| 1815 |
+
} else {
|
| 1816 |
+
this.focusser.removeAttr("disabled");
|
| 1817 |
+
this.focusser.focus();
|
| 1818 |
+
}
|
| 1819 |
+
},
|
| 1820 |
+
|
| 1821 |
+
// single
|
| 1822 |
+
isFocused: function () {
|
| 1823 |
+
return this.container.hasClass("select2-container-active");
|
| 1824 |
+
},
|
| 1825 |
+
|
| 1826 |
+
// single
|
| 1827 |
+
cancel: function () {
|
| 1828 |
+
this.parent.cancel.apply(this, arguments);
|
| 1829 |
+
this.focusser.removeAttr("disabled");
|
| 1830 |
+
this.focusser.focus();
|
| 1831 |
+
},
|
| 1832 |
+
|
| 1833 |
+
// single
|
| 1834 |
+
initContainer: function () {
|
| 1835 |
+
|
| 1836 |
+
var selection,
|
| 1837 |
+
container = this.container,
|
| 1838 |
+
dropdown = this.dropdown;
|
| 1839 |
+
|
| 1840 |
+
if (this.opts.minimumResultsForSearch < 0) {
|
| 1841 |
+
this.showSearch(false);
|
| 1842 |
+
} else {
|
| 1843 |
+
this.showSearch(true);
|
| 1844 |
+
}
|
| 1845 |
+
|
| 1846 |
+
this.selection = selection = container.find(".select2-choice");
|
| 1847 |
+
|
| 1848 |
+
this.focusser = container.find(".select2-focusser");
|
| 1849 |
+
|
| 1850 |
+
// rewrite labels from original element to focusser
|
| 1851 |
+
this.focusser.attr("id", "s2id_autogen"+nextUid());
|
| 1852 |
+
|
| 1853 |
+
$("label[for='" + this.opts.element.attr("id") + "']")
|
| 1854 |
+
.attr('for', this.focusser.attr('id'));
|
| 1855 |
+
|
| 1856 |
+
this.focusser.attr("tabindex", this.elementTabIndex);
|
| 1857 |
+
|
| 1858 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 1859 |
+
if (!this.isInterfaceEnabled()) return;
|
| 1860 |
+
|
| 1861 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 1862 |
+
// prevent the page from scrolling
|
| 1863 |
+
killEvent(e);
|
| 1864 |
+
return;
|
| 1865 |
+
}
|
| 1866 |
+
|
| 1867 |
+
switch (e.which) {
|
| 1868 |
+
case KEY.UP:
|
| 1869 |
+
case KEY.DOWN:
|
| 1870 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 1871 |
+
killEvent(e);
|
| 1872 |
+
return;
|
| 1873 |
+
case KEY.ENTER:
|
| 1874 |
+
this.selectHighlighted();
|
| 1875 |
+
killEvent(e);
|
| 1876 |
+
return;
|
| 1877 |
+
case KEY.TAB:
|
| 1878 |
+
this.selectHighlighted({noFocus: true});
|
| 1879 |
+
return;
|
| 1880 |
+
case KEY.ESC:
|
| 1881 |
+
this.cancel(e);
|
| 1882 |
+
killEvent(e);
|
| 1883 |
+
return;
|
| 1884 |
+
}
|
| 1885 |
+
}));
|
| 1886 |
+
|
| 1887 |
+
this.search.on("blur", this.bind(function(e) {
|
| 1888 |
+
// a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
|
| 1889 |
+
// without this the search field loses focus which is annoying
|
| 1890 |
+
if (document.activeElement === this.body().get(0)) {
|
| 1891 |
+
window.setTimeout(this.bind(function() {
|
| 1892 |
+
this.search.focus();
|
| 1893 |
+
}), 0);
|
| 1894 |
+
}
|
| 1895 |
+
}));
|
| 1896 |
+
|
| 1897 |
+
this.focusser.on("keydown", this.bind(function (e) {
|
| 1898 |
+
if (!this.isInterfaceEnabled()) return;
|
| 1899 |
+
|
| 1900 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
|
| 1901 |
+
return;
|
| 1902 |
+
}
|
| 1903 |
+
|
| 1904 |
+
if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
|
| 1905 |
+
killEvent(e);
|
| 1906 |
+
return;
|
| 1907 |
+
}
|
| 1908 |
+
|
| 1909 |
+
if (e.which == KEY.DOWN || e.which == KEY.UP
|
| 1910 |
+
|| (e.which == KEY.ENTER && this.opts.openOnEnter)) {
|
| 1911 |
+
|
| 1912 |
+
if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
|
| 1913 |
+
|
| 1914 |
+
this.open();
|
| 1915 |
+
killEvent(e);
|
| 1916 |
+
return;
|
| 1917 |
+
}
|
| 1918 |
+
|
| 1919 |
+
if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
|
| 1920 |
+
if (this.opts.allowClear) {
|
| 1921 |
+
this.clear();
|
| 1922 |
+
}
|
| 1923 |
+
killEvent(e);
|
| 1924 |
+
return;
|
| 1925 |
+
}
|
| 1926 |
+
}));
|
| 1927 |
+
|
| 1928 |
+
|
| 1929 |
+
installKeyUpChangeEvent(this.focusser);
|
| 1930 |
+
this.focusser.on("keyup-change input", this.bind(function(e) {
|
| 1931 |
+
if (this.opts.minimumResultsForSearch >= 0) {
|
| 1932 |
+
e.stopPropagation();
|
| 1933 |
+
if (this.opened()) return;
|
| 1934 |
+
this.open();
|
| 1935 |
+
}
|
| 1936 |
+
}));
|
| 1937 |
+
|
| 1938 |
+
selection.on("mousedown", "abbr", this.bind(function (e) {
|
| 1939 |
+
if (!this.isInterfaceEnabled()) return;
|
| 1940 |
+
this.clear();
|
| 1941 |
+
killEventImmediately(e);
|
| 1942 |
+
this.close();
|
| 1943 |
+
this.selection.focus();
|
| 1944 |
+
}));
|
| 1945 |
+
|
| 1946 |
+
selection.on("mousedown", this.bind(function (e) {
|
| 1947 |
+
|
| 1948 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 1949 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 1950 |
+
}
|
| 1951 |
+
|
| 1952 |
+
if (this.opened()) {
|
| 1953 |
+
this.close();
|
| 1954 |
+
} else if (this.isInterfaceEnabled()) {
|
| 1955 |
+
this.open();
|
| 1956 |
+
}
|
| 1957 |
+
|
| 1958 |
+
killEvent(e);
|
| 1959 |
+
}));
|
| 1960 |
+
|
| 1961 |
+
dropdown.on("mousedown", this.bind(function() { this.search.focus(); }));
|
| 1962 |
+
|
| 1963 |
+
selection.on("focus", this.bind(function(e) {
|
| 1964 |
+
killEvent(e);
|
| 1965 |
+
}));
|
| 1966 |
+
|
| 1967 |
+
this.focusser.on("focus", this.bind(function(){
|
| 1968 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 1969 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 1970 |
+
}
|
| 1971 |
+
this.container.addClass("select2-container-active");
|
| 1972 |
+
})).on("blur", this.bind(function() {
|
| 1973 |
+
if (!this.opened()) {
|
| 1974 |
+
this.container.removeClass("select2-container-active");
|
| 1975 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 1976 |
+
}
|
| 1977 |
+
}));
|
| 1978 |
+
this.search.on("focus", this.bind(function(){
|
| 1979 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 1980 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 1981 |
+
}
|
| 1982 |
+
this.container.addClass("select2-container-active");
|
| 1983 |
+
}));
|
| 1984 |
+
|
| 1985 |
+
this.initContainerWidth();
|
| 1986 |
+
this.opts.element.addClass("select2-offscreen");
|
| 1987 |
+
this.setPlaceholder();
|
| 1988 |
+
|
| 1989 |
+
},
|
| 1990 |
+
|
| 1991 |
+
// single
|
| 1992 |
+
clear: function(triggerChange) {
|
| 1993 |
+
var data=this.selection.data("select2-data");
|
| 1994 |
+
if (data) { // guard against queued quick consecutive clicks
|
| 1995 |
+
var placeholderOption = this.getPlaceholderOption();
|
| 1996 |
+
this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
|
| 1997 |
+
this.selection.find(".select2-chosen").empty();
|
| 1998 |
+
this.selection.removeData("select2-data");
|
| 1999 |
+
this.setPlaceholder();
|
| 2000 |
+
|
| 2001 |
+
if (triggerChange !== false){
|
| 2002 |
+
this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
|
| 2003 |
+
this.triggerChange({removed:data});
|
| 2004 |
+
}
|
| 2005 |
+
}
|
| 2006 |
+
},
|
| 2007 |
+
|
| 2008 |
+
/**
|
| 2009 |
+
* Sets selection based on source element's value
|
| 2010 |
+
*/
|
| 2011 |
+
// single
|
| 2012 |
+
initSelection: function () {
|
| 2013 |
+
var selected;
|
| 2014 |
+
if (this.isPlaceholderOptionSelected()) {
|
| 2015 |
+
this.updateSelection([]);
|
| 2016 |
+
this.close();
|
| 2017 |
+
this.setPlaceholder();
|
| 2018 |
+
} else {
|
| 2019 |
+
var self = this;
|
| 2020 |
+
this.opts.initSelection.call(null, this.opts.element, function(selected){
|
| 2021 |
+
if (selected !== undefined && selected !== null) {
|
| 2022 |
+
self.updateSelection(selected);
|
| 2023 |
+
self.close();
|
| 2024 |
+
self.setPlaceholder();
|
| 2025 |
+
}
|
| 2026 |
+
});
|
| 2027 |
+
}
|
| 2028 |
+
},
|
| 2029 |
+
|
| 2030 |
+
isPlaceholderOptionSelected: function() {
|
| 2031 |
+
var placeholderOption;
|
| 2032 |
+
return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.is(':selected')) ||
|
| 2033 |
+
(this.opts.element.val() === "") ||
|
| 2034 |
+
(this.opts.element.val() === undefined) ||
|
| 2035 |
+
(this.opts.element.val() === null);
|
| 2036 |
+
},
|
| 2037 |
+
|
| 2038 |
+
// single
|
| 2039 |
+
prepareOpts: function () {
|
| 2040 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2041 |
+
self=this;
|
| 2042 |
+
|
| 2043 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2044 |
+
// install the selection initializer
|
| 2045 |
+
opts.initSelection = function (element, callback) {
|
| 2046 |
+
var selected = element.find(":selected");
|
| 2047 |
+
// a single select box always has a value, no need to null check 'selected'
|
| 2048 |
+
callback(self.optionToData(selected));
|
| 2049 |
+
};
|
| 2050 |
+
} else if ("data" in opts) {
|
| 2051 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2052 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2053 |
+
var id = element.val();
|
| 2054 |
+
//search in data by id, storing the actual matching item
|
| 2055 |
+
var match = null;
|
| 2056 |
+
opts.query({
|
| 2057 |
+
matcher: function(term, text, el){
|
| 2058 |
+
var is_match = equal(id, opts.id(el));
|
| 2059 |
+
if (is_match) {
|
| 2060 |
+
match = el;
|
| 2061 |
+
}
|
| 2062 |
+
return is_match;
|
| 2063 |
+
},
|
| 2064 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2065 |
+
callback(match);
|
| 2066 |
+
}
|
| 2067 |
+
});
|
| 2068 |
+
};
|
| 2069 |
+
}
|
| 2070 |
+
|
| 2071 |
+
return opts;
|
| 2072 |
+
},
|
| 2073 |
+
|
| 2074 |
+
// single
|
| 2075 |
+
getPlaceholder: function() {
|
| 2076 |
+
// if a placeholder is specified on a single select without a valid placeholder option ignore it
|
| 2077 |
+
if (this.select) {
|
| 2078 |
+
if (this.getPlaceholderOption() === undefined) {
|
| 2079 |
+
return undefined;
|
| 2080 |
+
}
|
| 2081 |
+
}
|
| 2082 |
+
|
| 2083 |
+
return this.parent.getPlaceholder.apply(this, arguments);
|
| 2084 |
+
},
|
| 2085 |
+
|
| 2086 |
+
// single
|
| 2087 |
+
setPlaceholder: function () {
|
| 2088 |
+
var placeholder = this.getPlaceholder();
|
| 2089 |
+
|
| 2090 |
+
if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
|
| 2091 |
+
|
| 2092 |
+
// check for a placeholder option if attached to a select
|
| 2093 |
+
if (this.select && this.getPlaceholderOption() === undefined) return;
|
| 2094 |
+
|
| 2095 |
+
this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
|
| 2096 |
+
|
| 2097 |
+
this.selection.addClass("select2-default");
|
| 2098 |
+
|
| 2099 |
+
this.container.removeClass("select2-allowclear");
|
| 2100 |
+
}
|
| 2101 |
+
},
|
| 2102 |
+
|
| 2103 |
+
// single
|
| 2104 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2105 |
+
var selected = 0, self = this, showSearchInput = true;
|
| 2106 |
+
|
| 2107 |
+
// find the selected element in the result list
|
| 2108 |
+
|
| 2109 |
+
this.findHighlightableChoices().each2(function (i, elm) {
|
| 2110 |
+
if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
|
| 2111 |
+
selected = i;
|
| 2112 |
+
return false;
|
| 2113 |
+
}
|
| 2114 |
+
});
|
| 2115 |
+
|
| 2116 |
+
// and highlight it
|
| 2117 |
+
if (noHighlightUpdate !== false) {
|
| 2118 |
+
if (initial === true && selected >= 0) {
|
| 2119 |
+
this.highlight(selected);
|
| 2120 |
+
} else {
|
| 2121 |
+
this.highlight(0);
|
| 2122 |
+
}
|
| 2123 |
+
}
|
| 2124 |
+
|
| 2125 |
+
// hide the search box if this is the first we got the results and there are enough of them for search
|
| 2126 |
+
|
| 2127 |
+
if (initial === true) {
|
| 2128 |
+
var min = this.opts.minimumResultsForSearch;
|
| 2129 |
+
if (min >= 0) {
|
| 2130 |
+
this.showSearch(countResults(data.results) >= min);
|
| 2131 |
+
}
|
| 2132 |
+
}
|
| 2133 |
+
},
|
| 2134 |
+
|
| 2135 |
+
// single
|
| 2136 |
+
showSearch: function(showSearchInput) {
|
| 2137 |
+
if (this.showSearchInput === showSearchInput) return;
|
| 2138 |
+
|
| 2139 |
+
this.showSearchInput = showSearchInput;
|
| 2140 |
+
|
| 2141 |
+
this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
|
| 2142 |
+
this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
|
| 2143 |
+
//add "select2-with-searchbox" to the container if search box is shown
|
| 2144 |
+
$(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
|
| 2145 |
+
},
|
| 2146 |
+
|
| 2147 |
+
// single
|
| 2148 |
+
onSelect: function (data, options) {
|
| 2149 |
+
|
| 2150 |
+
if (!this.triggerSelect(data)) { return; }
|
| 2151 |
+
|
| 2152 |
+
var old = this.opts.element.val(),
|
| 2153 |
+
oldData = this.data();
|
| 2154 |
+
|
| 2155 |
+
this.opts.element.val(this.id(data));
|
| 2156 |
+
this.updateSelection(data);
|
| 2157 |
+
|
| 2158 |
+
this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
|
| 2159 |
+
|
| 2160 |
+
this.close();
|
| 2161 |
+
|
| 2162 |
+
if (!options || !options.noFocus)
|
| 2163 |
+
this.selection.focus();
|
| 2164 |
+
|
| 2165 |
+
if (!equal(old, this.id(data))) { this.triggerChange({added:data,removed:oldData}); }
|
| 2166 |
+
},
|
| 2167 |
+
|
| 2168 |
+
// single
|
| 2169 |
+
updateSelection: function (data) {
|
| 2170 |
+
|
| 2171 |
+
var container=this.selection.find(".select2-chosen"), formatted, cssClass;
|
| 2172 |
+
|
| 2173 |
+
this.selection.data("select2-data", data);
|
| 2174 |
+
|
| 2175 |
+
container.empty();
|
| 2176 |
+
formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
|
| 2177 |
+
if (formatted !== undefined) {
|
| 2178 |
+
container.append(formatted);
|
| 2179 |
+
}
|
| 2180 |
+
cssClass=this.opts.formatSelectionCssClass(data, container);
|
| 2181 |
+
if (cssClass !== undefined) {
|
| 2182 |
+
container.addClass(cssClass);
|
| 2183 |
+
}
|
| 2184 |
+
|
| 2185 |
+
this.selection.removeClass("select2-default");
|
| 2186 |
+
|
| 2187 |
+
if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
|
| 2188 |
+
this.container.addClass("select2-allowclear");
|
| 2189 |
+
}
|
| 2190 |
+
},
|
| 2191 |
+
|
| 2192 |
+
// single
|
| 2193 |
+
val: function () {
|
| 2194 |
+
var val,
|
| 2195 |
+
triggerChange = false,
|
| 2196 |
+
data = null,
|
| 2197 |
+
self = this,
|
| 2198 |
+
oldData = this.data();
|
| 2199 |
+
|
| 2200 |
+
if (arguments.length === 0) {
|
| 2201 |
+
return this.opts.element.val();
|
| 2202 |
+
}
|
| 2203 |
+
|
| 2204 |
+
val = arguments[0];
|
| 2205 |
+
|
| 2206 |
+
if (arguments.length > 1) {
|
| 2207 |
+
triggerChange = arguments[1];
|
| 2208 |
+
}
|
| 2209 |
+
|
| 2210 |
+
if (this.select) {
|
| 2211 |
+
this.select
|
| 2212 |
+
.val(val)
|
| 2213 |
+
.find(":selected").each2(function (i, elm) {
|
| 2214 |
+
data = self.optionToData(elm);
|
| 2215 |
+
return false;
|
| 2216 |
+
});
|
| 2217 |
+
this.updateSelection(data);
|
| 2218 |
+
this.setPlaceholder();
|
| 2219 |
+
if (triggerChange) {
|
| 2220 |
+
this.triggerChange({added: data, removed:oldData});
|
| 2221 |
+
}
|
| 2222 |
+
} else {
|
| 2223 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2224 |
+
if (!val && val !== 0) {
|
| 2225 |
+
this.clear(triggerChange);
|
| 2226 |
+
return;
|
| 2227 |
+
}
|
| 2228 |
+
if (this.opts.initSelection === undefined) {
|
| 2229 |
+
throw new Error("cannot call val() if initSelection() is not defined");
|
| 2230 |
+
}
|
| 2231 |
+
this.opts.element.val(val);
|
| 2232 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 2233 |
+
self.opts.element.val(!data ? "" : self.id(data));
|
| 2234 |
+
self.updateSelection(data);
|
| 2235 |
+
self.setPlaceholder();
|
| 2236 |
+
if (triggerChange) {
|
| 2237 |
+
self.triggerChange({added: data, removed:oldData});
|
| 2238 |
+
}
|
| 2239 |
+
});
|
| 2240 |
+
}
|
| 2241 |
+
},
|
| 2242 |
+
|
| 2243 |
+
// single
|
| 2244 |
+
clearSearch: function () {
|
| 2245 |
+
this.search.val("");
|
| 2246 |
+
this.focusser.val("");
|
| 2247 |
+
},
|
| 2248 |
+
|
| 2249 |
+
// single
|
| 2250 |
+
data: function(value, triggerChange) {
|
| 2251 |
+
var data;
|
| 2252 |
+
|
| 2253 |
+
if (arguments.length === 0) {
|
| 2254 |
+
data = this.selection.data("select2-data");
|
| 2255 |
+
if (data == undefined) data = null;
|
| 2256 |
+
return data;
|
| 2257 |
+
} else {
|
| 2258 |
+
if (!value || value === "") {
|
| 2259 |
+
this.clear(triggerChange);
|
| 2260 |
+
} else {
|
| 2261 |
+
data = this.data();
|
| 2262 |
+
this.opts.element.val(!value ? "" : this.id(value));
|
| 2263 |
+
this.updateSelection(value);
|
| 2264 |
+
if (triggerChange) {
|
| 2265 |
+
this.triggerChange({added: value, removed:data});
|
| 2266 |
+
}
|
| 2267 |
+
}
|
| 2268 |
+
}
|
| 2269 |
+
}
|
| 2270 |
+
});
|
| 2271 |
+
|
| 2272 |
+
MultiSelect2 = clazz(AbstractSelect2, {
|
| 2273 |
+
|
| 2274 |
+
// multi
|
| 2275 |
+
createContainer: function () {
|
| 2276 |
+
var container = $(document.createElement("div")).attr({
|
| 2277 |
+
"class": "select2-container select2-container-multi"
|
| 2278 |
+
}).html([
|
| 2279 |
+
"<ul class='select2-choices'>",
|
| 2280 |
+
" <li class='select2-search-field'>",
|
| 2281 |
+
" <input type='text' autocomplete='off' autocorrect='off' autocapitilize='off' spellcheck='false' class='select2-input'>",
|
| 2282 |
+
" </li>",
|
| 2283 |
+
"</ul>",
|
| 2284 |
+
"<div class='select2-drop select2-drop-multi select2-display-none'>",
|
| 2285 |
+
" <ul class='select2-results'>",
|
| 2286 |
+
" </ul>",
|
| 2287 |
+
"</div>"].join(""));
|
| 2288 |
+
return container;
|
| 2289 |
+
},
|
| 2290 |
+
|
| 2291 |
+
// multi
|
| 2292 |
+
prepareOpts: function () {
|
| 2293 |
+
var opts = this.parent.prepareOpts.apply(this, arguments),
|
| 2294 |
+
self=this;
|
| 2295 |
+
|
| 2296 |
+
// TODO validate placeholder is a string if specified
|
| 2297 |
+
|
| 2298 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 2299 |
+
// install sthe selection initializer
|
| 2300 |
+
opts.initSelection = function (element, callback) {
|
| 2301 |
+
|
| 2302 |
+
var data = [];
|
| 2303 |
+
|
| 2304 |
+
element.find(":selected").each2(function (i, elm) {
|
| 2305 |
+
data.push(self.optionToData(elm));
|
| 2306 |
+
});
|
| 2307 |
+
callback(data);
|
| 2308 |
+
};
|
| 2309 |
+
} else if ("data" in opts) {
|
| 2310 |
+
// install default initSelection when applied to hidden input and data is local
|
| 2311 |
+
opts.initSelection = opts.initSelection || function (element, callback) {
|
| 2312 |
+
var ids = splitVal(element.val(), opts.separator);
|
| 2313 |
+
//search in data by array of ids, storing matching items in a list
|
| 2314 |
+
var matches = [];
|
| 2315 |
+
opts.query({
|
| 2316 |
+
matcher: function(term, text, el){
|
| 2317 |
+
var is_match = $.grep(ids, function(id) {
|
| 2318 |
+
return equal(id, opts.id(el));
|
| 2319 |
+
}).length;
|
| 2320 |
+
if (is_match) {
|
| 2321 |
+
matches.push(el);
|
| 2322 |
+
}
|
| 2323 |
+
return is_match;
|
| 2324 |
+
},
|
| 2325 |
+
callback: !$.isFunction(callback) ? $.noop : function() {
|
| 2326 |
+
// reorder matches based on the order they appear in the ids array because right now
|
| 2327 |
+
// they are in the order in which they appear in data array
|
| 2328 |
+
var ordered = [];
|
| 2329 |
+
for (var i = 0; i < ids.length; i++) {
|
| 2330 |
+
var id = ids[i];
|
| 2331 |
+
for (var j = 0; j < matches.length; j++) {
|
| 2332 |
+
var match = matches[j];
|
| 2333 |
+
if (equal(id, opts.id(match))) {
|
| 2334 |
+
ordered.push(match);
|
| 2335 |
+
matches.splice(j, 1);
|
| 2336 |
+
break;
|
| 2337 |
+
}
|
| 2338 |
+
}
|
| 2339 |
+
}
|
| 2340 |
+
callback(ordered);
|
| 2341 |
+
}
|
| 2342 |
+
});
|
| 2343 |
+
};
|
| 2344 |
+
}
|
| 2345 |
+
|
| 2346 |
+
return opts;
|
| 2347 |
+
},
|
| 2348 |
+
|
| 2349 |
+
selectChoice: function (choice) {
|
| 2350 |
+
|
| 2351 |
+
var selected = this.container.find(".select2-search-choice-focus");
|
| 2352 |
+
if (selected.length && choice && choice[0] == selected[0]) {
|
| 2353 |
+
|
| 2354 |
+
} else {
|
| 2355 |
+
if (selected.length) {
|
| 2356 |
+
this.opts.element.trigger("choice-deselected", selected);
|
| 2357 |
+
}
|
| 2358 |
+
selected.removeClass("select2-search-choice-focus");
|
| 2359 |
+
if (choice && choice.length) {
|
| 2360 |
+
this.close();
|
| 2361 |
+
choice.addClass("select2-search-choice-focus");
|
| 2362 |
+
this.opts.element.trigger("choice-selected", choice);
|
| 2363 |
+
}
|
| 2364 |
+
}
|
| 2365 |
+
},
|
| 2366 |
+
|
| 2367 |
+
// multi
|
| 2368 |
+
initContainer: function () {
|
| 2369 |
+
|
| 2370 |
+
var selector = ".select2-choices", selection;
|
| 2371 |
+
|
| 2372 |
+
this.searchContainer = this.container.find(".select2-search-field");
|
| 2373 |
+
this.selection = selection = this.container.find(selector);
|
| 2374 |
+
|
| 2375 |
+
var _this = this;
|
| 2376 |
+
this.selection.on("mousedown", ".select2-search-choice", function (e) {
|
| 2377 |
+
//killEvent(e);
|
| 2378 |
+
_this.search[0].focus();
|
| 2379 |
+
_this.selectChoice($(this));
|
| 2380 |
+
})
|
| 2381 |
+
|
| 2382 |
+
// rewrite labels from original element to focusser
|
| 2383 |
+
this.search.attr("id", "s2id_autogen"+nextUid());
|
| 2384 |
+
$("label[for='" + this.opts.element.attr("id") + "']")
|
| 2385 |
+
.attr('for', this.search.attr('id'));
|
| 2386 |
+
|
| 2387 |
+
this.search.on("input paste", this.bind(function() {
|
| 2388 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2389 |
+
if (!this.opened()) {
|
| 2390 |
+
this.open();
|
| 2391 |
+
}
|
| 2392 |
+
}));
|
| 2393 |
+
|
| 2394 |
+
this.search.attr("tabindex", this.elementTabIndex);
|
| 2395 |
+
|
| 2396 |
+
this.keydowns = 0;
|
| 2397 |
+
this.search.on("keydown", this.bind(function (e) {
|
| 2398 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2399 |
+
|
| 2400 |
+
++this.keydowns;
|
| 2401 |
+
var selected = selection.find(".select2-search-choice-focus");
|
| 2402 |
+
var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
|
| 2403 |
+
var next = selected.next(".select2-search-choice:not(.select2-locked)");
|
| 2404 |
+
var pos = getCursorInfo(this.search);
|
| 2405 |
+
|
| 2406 |
+
if (selected.length &&
|
| 2407 |
+
(e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
|
| 2408 |
+
var selectedChoice = selected;
|
| 2409 |
+
if (e.which == KEY.LEFT && prev.length) {
|
| 2410 |
+
selectedChoice = prev;
|
| 2411 |
+
}
|
| 2412 |
+
else if (e.which == KEY.RIGHT) {
|
| 2413 |
+
selectedChoice = next.length ? next : null;
|
| 2414 |
+
}
|
| 2415 |
+
else if (e.which === KEY.BACKSPACE) {
|
| 2416 |
+
this.unselect(selected.first());
|
| 2417 |
+
this.search.width(10);
|
| 2418 |
+
selectedChoice = prev.length ? prev : next;
|
| 2419 |
+
} else if (e.which == KEY.DELETE) {
|
| 2420 |
+
this.unselect(selected.first());
|
| 2421 |
+
this.search.width(10);
|
| 2422 |
+
selectedChoice = next.length ? next : null;
|
| 2423 |
+
} else if (e.which == KEY.ENTER) {
|
| 2424 |
+
selectedChoice = null;
|
| 2425 |
+
}
|
| 2426 |
+
|
| 2427 |
+
this.selectChoice(selectedChoice);
|
| 2428 |
+
killEvent(e);
|
| 2429 |
+
if (!selectedChoice || !selectedChoice.length) {
|
| 2430 |
+
this.open();
|
| 2431 |
+
}
|
| 2432 |
+
return;
|
| 2433 |
+
} else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
|
| 2434 |
+
|| e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
|
| 2435 |
+
|
| 2436 |
+
this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
|
| 2437 |
+
killEvent(e);
|
| 2438 |
+
return;
|
| 2439 |
+
} else {
|
| 2440 |
+
this.selectChoice(null);
|
| 2441 |
+
}
|
| 2442 |
+
|
| 2443 |
+
if (this.opened()) {
|
| 2444 |
+
switch (e.which) {
|
| 2445 |
+
case KEY.UP:
|
| 2446 |
+
case KEY.DOWN:
|
| 2447 |
+
this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
|
| 2448 |
+
killEvent(e);
|
| 2449 |
+
return;
|
| 2450 |
+
case KEY.ENTER:
|
| 2451 |
+
this.selectHighlighted();
|
| 2452 |
+
killEvent(e);
|
| 2453 |
+
return;
|
| 2454 |
+
case KEY.TAB:
|
| 2455 |
+
this.selectHighlighted({noFocus:true});
|
| 2456 |
+
this.close();
|
| 2457 |
+
return;
|
| 2458 |
+
case KEY.ESC:
|
| 2459 |
+
this.cancel(e);
|
| 2460 |
+
killEvent(e);
|
| 2461 |
+
return;
|
| 2462 |
+
}
|
| 2463 |
+
}
|
| 2464 |
+
|
| 2465 |
+
if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
|
| 2466 |
+
|| e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
|
| 2467 |
+
return;
|
| 2468 |
+
}
|
| 2469 |
+
|
| 2470 |
+
if (e.which === KEY.ENTER) {
|
| 2471 |
+
if (this.opts.openOnEnter === false) {
|
| 2472 |
+
return;
|
| 2473 |
+
} else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
|
| 2474 |
+
return;
|
| 2475 |
+
}
|
| 2476 |
+
}
|
| 2477 |
+
|
| 2478 |
+
this.open();
|
| 2479 |
+
|
| 2480 |
+
if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
|
| 2481 |
+
// prevent the page from scrolling
|
| 2482 |
+
killEvent(e);
|
| 2483 |
+
}
|
| 2484 |
+
|
| 2485 |
+
if (e.which === KEY.ENTER) {
|
| 2486 |
+
// prevent form from being submitted
|
| 2487 |
+
killEvent(e);
|
| 2488 |
+
}
|
| 2489 |
+
|
| 2490 |
+
}));
|
| 2491 |
+
|
| 2492 |
+
this.search.on("keyup", this.bind(function (e) {
|
| 2493 |
+
this.keydowns = 0;
|
| 2494 |
+
this.resizeSearch();
|
| 2495 |
+
})
|
| 2496 |
+
);
|
| 2497 |
+
|
| 2498 |
+
this.search.on("blur", this.bind(function(e) {
|
| 2499 |
+
this.container.removeClass("select2-container-active");
|
| 2500 |
+
this.search.removeClass("select2-focused");
|
| 2501 |
+
this.selectChoice(null);
|
| 2502 |
+
if (!this.opened()) this.clearSearch();
|
| 2503 |
+
e.stopImmediatePropagation();
|
| 2504 |
+
this.opts.element.trigger($.Event("select2-blur"));
|
| 2505 |
+
}));
|
| 2506 |
+
|
| 2507 |
+
this.container.on("click", selector, this.bind(function (e) {
|
| 2508 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2509 |
+
if ($(e.target).closest(".select2-search-choice").length > 0) {
|
| 2510 |
+
// clicked inside a select2 search choice, do not open
|
| 2511 |
+
return;
|
| 2512 |
+
}
|
| 2513 |
+
this.selectChoice(null);
|
| 2514 |
+
this.clearPlaceholder();
|
| 2515 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2516 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2517 |
+
}
|
| 2518 |
+
this.open();
|
| 2519 |
+
this.focusSearch();
|
| 2520 |
+
e.preventDefault();
|
| 2521 |
+
}));
|
| 2522 |
+
|
| 2523 |
+
this.container.on("focus", selector, this.bind(function () {
|
| 2524 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2525 |
+
if (!this.container.hasClass("select2-container-active")) {
|
| 2526 |
+
this.opts.element.trigger($.Event("select2-focus"));
|
| 2527 |
+
}
|
| 2528 |
+
this.container.addClass("select2-container-active");
|
| 2529 |
+
this.dropdown.addClass("select2-drop-active");
|
| 2530 |
+
this.clearPlaceholder();
|
| 2531 |
+
}));
|
| 2532 |
+
|
| 2533 |
+
this.initContainerWidth();
|
| 2534 |
+
this.opts.element.addClass("select2-offscreen");
|
| 2535 |
+
|
| 2536 |
+
// set the placeholder if necessary
|
| 2537 |
+
this.clearSearch();
|
| 2538 |
+
},
|
| 2539 |
+
|
| 2540 |
+
// multi
|
| 2541 |
+
enableInterface: function() {
|
| 2542 |
+
if (this.parent.enableInterface.apply(this, arguments)) {
|
| 2543 |
+
this.search.prop("disabled", !this.isInterfaceEnabled());
|
| 2544 |
+
}
|
| 2545 |
+
},
|
| 2546 |
+
|
| 2547 |
+
// multi
|
| 2548 |
+
initSelection: function () {
|
| 2549 |
+
var data;
|
| 2550 |
+
if (this.opts.element.val() === "" && this.opts.element.text() === "") {
|
| 2551 |
+
this.updateSelection([]);
|
| 2552 |
+
this.close();
|
| 2553 |
+
// set the placeholder if necessary
|
| 2554 |
+
this.clearSearch();
|
| 2555 |
+
}
|
| 2556 |
+
if (this.select || this.opts.element.val() !== "") {
|
| 2557 |
+
var self = this;
|
| 2558 |
+
this.opts.initSelection.call(null, this.opts.element, function(data){
|
| 2559 |
+
if (data !== undefined && data !== null) {
|
| 2560 |
+
self.updateSelection(data);
|
| 2561 |
+
self.close();
|
| 2562 |
+
// set the placeholder if necessary
|
| 2563 |
+
self.clearSearch();
|
| 2564 |
+
}
|
| 2565 |
+
});
|
| 2566 |
+
}
|
| 2567 |
+
},
|
| 2568 |
+
|
| 2569 |
+
// multi
|
| 2570 |
+
clearSearch: function () {
|
| 2571 |
+
var placeholder = this.getPlaceholder(),
|
| 2572 |
+
maxWidth = this.getMaxSearchWidth();
|
| 2573 |
+
|
| 2574 |
+
if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
|
| 2575 |
+
this.search.val(placeholder).addClass("select2-default");
|
| 2576 |
+
// stretch the search box to full width of the container so as much of the placeholder is visible as possible
|
| 2577 |
+
// we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
|
| 2578 |
+
this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
|
| 2579 |
+
} else {
|
| 2580 |
+
this.search.val("").width(10);
|
| 2581 |
+
}
|
| 2582 |
+
},
|
| 2583 |
+
|
| 2584 |
+
// multi
|
| 2585 |
+
clearPlaceholder: function () {
|
| 2586 |
+
if (this.search.hasClass("select2-default")) {
|
| 2587 |
+
this.search.val("").removeClass("select2-default");
|
| 2588 |
+
}
|
| 2589 |
+
},
|
| 2590 |
+
|
| 2591 |
+
// multi
|
| 2592 |
+
opening: function () {
|
| 2593 |
+
this.clearPlaceholder(); // should be done before super so placeholder is not used to search
|
| 2594 |
+
this.resizeSearch();
|
| 2595 |
+
|
| 2596 |
+
this.parent.opening.apply(this, arguments);
|
| 2597 |
+
|
| 2598 |
+
this.focusSearch();
|
| 2599 |
+
|
| 2600 |
+
this.updateResults(true);
|
| 2601 |
+
this.search.focus();
|
| 2602 |
+
this.opts.element.trigger($.Event("select2-open"));
|
| 2603 |
+
},
|
| 2604 |
+
|
| 2605 |
+
// multi
|
| 2606 |
+
close: function () {
|
| 2607 |
+
if (!this.opened()) return;
|
| 2608 |
+
this.parent.close.apply(this, arguments);
|
| 2609 |
+
},
|
| 2610 |
+
|
| 2611 |
+
// multi
|
| 2612 |
+
focus: function () {
|
| 2613 |
+
this.close();
|
| 2614 |
+
this.search.focus();
|
| 2615 |
+
},
|
| 2616 |
+
|
| 2617 |
+
// multi
|
| 2618 |
+
isFocused: function () {
|
| 2619 |
+
return this.search.hasClass("select2-focused");
|
| 2620 |
+
},
|
| 2621 |
+
|
| 2622 |
+
// multi
|
| 2623 |
+
updateSelection: function (data) {
|
| 2624 |
+
var ids = [], filtered = [], self = this;
|
| 2625 |
+
|
| 2626 |
+
// filter out duplicates
|
| 2627 |
+
$(data).each(function () {
|
| 2628 |
+
if (indexOf(self.id(this), ids) < 0) {
|
| 2629 |
+
ids.push(self.id(this));
|
| 2630 |
+
filtered.push(this);
|
| 2631 |
+
}
|
| 2632 |
+
});
|
| 2633 |
+
data = filtered;
|
| 2634 |
+
|
| 2635 |
+
this.selection.find(".select2-search-choice").remove();
|
| 2636 |
+
$(data).each(function () {
|
| 2637 |
+
self.addSelectedChoice(this);
|
| 2638 |
+
});
|
| 2639 |
+
self.postprocessResults();
|
| 2640 |
+
},
|
| 2641 |
+
|
| 2642 |
+
// multi
|
| 2643 |
+
tokenize: function() {
|
| 2644 |
+
var input = this.search.val();
|
| 2645 |
+
input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
|
| 2646 |
+
if (input != null && input != undefined) {
|
| 2647 |
+
this.search.val(input);
|
| 2648 |
+
if (input.length > 0) {
|
| 2649 |
+
this.open();
|
| 2650 |
+
}
|
| 2651 |
+
}
|
| 2652 |
+
|
| 2653 |
+
},
|
| 2654 |
+
|
| 2655 |
+
// multi
|
| 2656 |
+
onSelect: function (data, options) {
|
| 2657 |
+
|
| 2658 |
+
if (!this.triggerSelect(data)) { return; }
|
| 2659 |
+
|
| 2660 |
+
this.addSelectedChoice(data);
|
| 2661 |
+
|
| 2662 |
+
this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
|
| 2663 |
+
|
| 2664 |
+
if (this.select || !this.opts.closeOnSelect) this.postprocessResults();
|
| 2665 |
+
|
| 2666 |
+
if (this.opts.closeOnSelect) {
|
| 2667 |
+
this.close();
|
| 2668 |
+
this.search.width(10);
|
| 2669 |
+
} else {
|
| 2670 |
+
if (this.countSelectableResults()>0) {
|
| 2671 |
+
this.search.width(10);
|
| 2672 |
+
this.resizeSearch();
|
| 2673 |
+
if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
|
| 2674 |
+
// if we reached max selection size repaint the results so choices
|
| 2675 |
+
// are replaced with the max selection reached message
|
| 2676 |
+
this.updateResults(true);
|
| 2677 |
+
}
|
| 2678 |
+
this.positionDropdown();
|
| 2679 |
+
} else {
|
| 2680 |
+
// if nothing left to select close
|
| 2681 |
+
this.close();
|
| 2682 |
+
this.search.width(10);
|
| 2683 |
+
}
|
| 2684 |
+
}
|
| 2685 |
+
|
| 2686 |
+
// since its not possible to select an element that has already been
|
| 2687 |
+
// added we do not need to check if this is a new element before firing change
|
| 2688 |
+
this.triggerChange({ added: data });
|
| 2689 |
+
|
| 2690 |
+
if (!options || !options.noFocus)
|
| 2691 |
+
this.focusSearch();
|
| 2692 |
+
},
|
| 2693 |
+
|
| 2694 |
+
// multi
|
| 2695 |
+
cancel: function () {
|
| 2696 |
+
this.close();
|
| 2697 |
+
this.focusSearch();
|
| 2698 |
+
},
|
| 2699 |
+
|
| 2700 |
+
addSelectedChoice: function (data) {
|
| 2701 |
+
var enableChoice = !data.locked,
|
| 2702 |
+
enabledItem = $(
|
| 2703 |
+
"<li class='select2-search-choice'>" +
|
| 2704 |
+
" <div></div>" +
|
| 2705 |
+
" <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a>" +
|
| 2706 |
+
"</li>"),
|
| 2707 |
+
disabledItem = $(
|
| 2708 |
+
"<li class='select2-search-choice select2-locked'>" +
|
| 2709 |
+
"<div></div>" +
|
| 2710 |
+
"</li>");
|
| 2711 |
+
var choice = enableChoice ? enabledItem : disabledItem,
|
| 2712 |
+
id = this.id(data),
|
| 2713 |
+
val = this.getVal(),
|
| 2714 |
+
formatted,
|
| 2715 |
+
cssClass;
|
| 2716 |
+
|
| 2717 |
+
formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
|
| 2718 |
+
if (formatted != undefined) {
|
| 2719 |
+
choice.find("div").replaceWith("<div>"+formatted+"</div>");
|
| 2720 |
+
}
|
| 2721 |
+
cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
|
| 2722 |
+
if (cssClass != undefined) {
|
| 2723 |
+
choice.addClass(cssClass);
|
| 2724 |
+
}
|
| 2725 |
+
|
| 2726 |
+
if(enableChoice){
|
| 2727 |
+
choice.find(".select2-search-choice-close")
|
| 2728 |
+
.on("mousedown", killEvent)
|
| 2729 |
+
.on("click dblclick", this.bind(function (e) {
|
| 2730 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2731 |
+
|
| 2732 |
+
$(e.target).closest(".select2-search-choice").fadeOut('fast', this.bind(function(){
|
| 2733 |
+
this.unselect($(e.target));
|
| 2734 |
+
this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
|
| 2735 |
+
this.close();
|
| 2736 |
+
this.focusSearch();
|
| 2737 |
+
})).dequeue();
|
| 2738 |
+
killEvent(e);
|
| 2739 |
+
})).on("focus", this.bind(function () {
|
| 2740 |
+
if (!this.isInterfaceEnabled()) return;
|
| 2741 |
+
this.container.addClass("select2-container-active");
|
| 2742 |
+
this.dropdown.addClass("select2-drop-active");
|
| 2743 |
+
}));
|
| 2744 |
+
}
|
| 2745 |
+
|
| 2746 |
+
choice.data("select2-data", data);
|
| 2747 |
+
choice.insertBefore(this.searchContainer);
|
| 2748 |
+
|
| 2749 |
+
val.push(id);
|
| 2750 |
+
this.setVal(val);
|
| 2751 |
+
},
|
| 2752 |
+
|
| 2753 |
+
// multi
|
| 2754 |
+
unselect: function (selected) {
|
| 2755 |
+
var val = this.getVal(),
|
| 2756 |
+
data,
|
| 2757 |
+
index;
|
| 2758 |
+
|
| 2759 |
+
selected = selected.closest(".select2-search-choice");
|
| 2760 |
+
|
| 2761 |
+
if (selected.length === 0) {
|
| 2762 |
+
throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
|
| 2763 |
+
}
|
| 2764 |
+
|
| 2765 |
+
data = selected.data("select2-data");
|
| 2766 |
+
|
| 2767 |
+
if (!data) {
|
| 2768 |
+
// prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
|
| 2769 |
+
// and invoked on an element already removed
|
| 2770 |
+
return;
|
| 2771 |
+
}
|
| 2772 |
+
|
| 2773 |
+
index = indexOf(this.id(data), val);
|
| 2774 |
+
|
| 2775 |
+
if (index >= 0) {
|
| 2776 |
+
val.splice(index, 1);
|
| 2777 |
+
this.setVal(val);
|
| 2778 |
+
if (this.select) this.postprocessResults();
|
| 2779 |
+
}
|
| 2780 |
+
selected.remove();
|
| 2781 |
+
|
| 2782 |
+
this.opts.element.trigger({ type: "removed", val: this.id(data), choice: data });
|
| 2783 |
+
this.triggerChange({ removed: data });
|
| 2784 |
+
},
|
| 2785 |
+
|
| 2786 |
+
// multi
|
| 2787 |
+
postprocessResults: function (data, initial, noHighlightUpdate) {
|
| 2788 |
+
var val = this.getVal(),
|
| 2789 |
+
choices = this.results.find(".select2-result"),
|
| 2790 |
+
compound = this.results.find(".select2-result-with-children"),
|
| 2791 |
+
self = this;
|
| 2792 |
+
|
| 2793 |
+
choices.each2(function (i, choice) {
|
| 2794 |
+
var id = self.id(choice.data("select2-data"));
|
| 2795 |
+
if (indexOf(id, val) >= 0) {
|
| 2796 |
+
choice.addClass("select2-selected");
|
| 2797 |
+
// mark all children of the selected parent as selected
|
| 2798 |
+
choice.find(".select2-result-selectable").addClass("select2-selected");
|
| 2799 |
+
}
|
| 2800 |
+
});
|
| 2801 |
+
|
| 2802 |
+
compound.each2(function(i, choice) {
|
| 2803 |
+
// hide an optgroup if it doesnt have any selectable children
|
| 2804 |
+
if (!choice.is('.select2-result-selectable')
|
| 2805 |
+
&& choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
|
| 2806 |
+
choice.addClass("select2-selected");
|
| 2807 |
+
}
|
| 2808 |
+
});
|
| 2809 |
+
|
| 2810 |
+
if (this.highlight() == -1 && noHighlightUpdate !== false){
|
| 2811 |
+
self.highlight(0);
|
| 2812 |
+
}
|
| 2813 |
+
|
| 2814 |
+
//If all results are chosen render formatNoMAtches
|
| 2815 |
+
if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
|
| 2816 |
+
if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
|
| 2817 |
+
if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
|
| 2818 |
+
this.results.append("<li class='select2-no-results'>" + self.opts.formatNoMatches(self.search.val()) + "</li>");
|
| 2819 |
+
}
|
| 2820 |
+
}
|
| 2821 |
+
}
|
| 2822 |
+
|
| 2823 |
+
},
|
| 2824 |
+
|
| 2825 |
+
// multi
|
| 2826 |
+
getMaxSearchWidth: function() {
|
| 2827 |
+
return this.selection.width() - getSideBorderPadding(this.search);
|
| 2828 |
+
},
|
| 2829 |
+
|
| 2830 |
+
// multi
|
| 2831 |
+
resizeSearch: function () {
|
| 2832 |
+
var minimumWidth, left, maxWidth, containerLeft, searchWidth,
|
| 2833 |
+
sideBorderPadding = getSideBorderPadding(this.search);
|
| 2834 |
+
|
| 2835 |
+
minimumWidth = measureTextWidth(this.search) + 10;
|
| 2836 |
+
|
| 2837 |
+
left = this.search.offset().left;
|
| 2838 |
+
|
| 2839 |
+
maxWidth = this.selection.width();
|
| 2840 |
+
containerLeft = this.selection.offset().left;
|
| 2841 |
+
|
| 2842 |
+
searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
|
| 2843 |
+
|
| 2844 |
+
if (searchWidth < minimumWidth) {
|
| 2845 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 2846 |
+
}
|
| 2847 |
+
|
| 2848 |
+
if (searchWidth < 40) {
|
| 2849 |
+
searchWidth = maxWidth - sideBorderPadding;
|
| 2850 |
+
}
|
| 2851 |
+
|
| 2852 |
+
if (searchWidth <= 0) {
|
| 2853 |
+
searchWidth = minimumWidth;
|
| 2854 |
+
}
|
| 2855 |
+
|
| 2856 |
+
this.search.width(searchWidth);
|
| 2857 |
+
},
|
| 2858 |
+
|
| 2859 |
+
// multi
|
| 2860 |
+
getVal: function () {
|
| 2861 |
+
var val;
|
| 2862 |
+
if (this.select) {
|
| 2863 |
+
val = this.select.val();
|
| 2864 |
+
return val === null ? [] : val;
|
| 2865 |
+
} else {
|
| 2866 |
+
val = this.opts.element.val();
|
| 2867 |
+
return splitVal(val, this.opts.separator);
|
| 2868 |
+
}
|
| 2869 |
+
},
|
| 2870 |
+
|
| 2871 |
+
// multi
|
| 2872 |
+
setVal: function (val) {
|
| 2873 |
+
var unique;
|
| 2874 |
+
if (this.select) {
|
| 2875 |
+
this.select.val(val);
|
| 2876 |
+
} else {
|
| 2877 |
+
unique = [];
|
| 2878 |
+
// filter out duplicates
|
| 2879 |
+
$(val).each(function () {
|
| 2880 |
+
if (indexOf(this, unique) < 0) unique.push(this);
|
| 2881 |
+
});
|
| 2882 |
+
this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
|
| 2883 |
+
}
|
| 2884 |
+
},
|
| 2885 |
+
|
| 2886 |
+
// multi
|
| 2887 |
+
buildChangeDetails: function (old, current) {
|
| 2888 |
+
var current = current.slice(0),
|
| 2889 |
+
old = old.slice(0);
|
| 2890 |
+
|
| 2891 |
+
// remove intersection from each array
|
| 2892 |
+
for (var i = 0; i < current.length; i++) {
|
| 2893 |
+
for (var j = 0; j < old.length; j++) {
|
| 2894 |
+
if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
|
| 2895 |
+
current.splice(i, 1);
|
| 2896 |
+
i--;
|
| 2897 |
+
old.splice(j, 1);
|
| 2898 |
+
j--;
|
| 2899 |
+
}
|
| 2900 |
+
}
|
| 2901 |
+
}
|
| 2902 |
+
|
| 2903 |
+
return {added: current, removed: old};
|
| 2904 |
+
},
|
| 2905 |
+
|
| 2906 |
+
|
| 2907 |
+
// multi
|
| 2908 |
+
val: function (val, triggerChange) {
|
| 2909 |
+
var oldData, self=this, changeDetails;
|
| 2910 |
+
|
| 2911 |
+
if (arguments.length === 0) {
|
| 2912 |
+
return this.getVal();
|
| 2913 |
+
}
|
| 2914 |
+
|
| 2915 |
+
oldData=this.data();
|
| 2916 |
+
if (!oldData.length) oldData=[];
|
| 2917 |
+
|
| 2918 |
+
// val is an id. !val is true for [undefined,null,'',0] - 0 is legal
|
| 2919 |
+
if (!val && val !== 0) {
|
| 2920 |
+
this.opts.element.val("");
|
| 2921 |
+
this.updateSelection([]);
|
| 2922 |
+
this.clearSearch();
|
| 2923 |
+
if (triggerChange) {
|
| 2924 |
+
this.triggerChange({added: this.data(), removed: oldData});
|
| 2925 |
+
}
|
| 2926 |
+
return;
|
| 2927 |
+
}
|
| 2928 |
+
|
| 2929 |
+
// val is a list of ids
|
| 2930 |
+
this.setVal(val);
|
| 2931 |
+
|
| 2932 |
+
if (this.select) {
|
| 2933 |
+
this.opts.initSelection(this.select, this.bind(this.updateSelection));
|
| 2934 |
+
if (triggerChange) {
|
| 2935 |
+
this.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 2936 |
+
}
|
| 2937 |
+
} else {
|
| 2938 |
+
if (this.opts.initSelection === undefined) {
|
| 2939 |
+
throw new Error("val() cannot be called if initSelection() is not defined");
|
| 2940 |
+
}
|
| 2941 |
+
|
| 2942 |
+
this.opts.initSelection(this.opts.element, function(data){
|
| 2943 |
+
var ids=$.map(data, self.id);
|
| 2944 |
+
self.setVal(ids);
|
| 2945 |
+
self.updateSelection(data);
|
| 2946 |
+
self.clearSearch();
|
| 2947 |
+
if (triggerChange) {
|
| 2948 |
+
self.triggerChange(this.buildChangeDetails(oldData, this.data()));
|
| 2949 |
+
}
|
| 2950 |
+
});
|
| 2951 |
+
}
|
| 2952 |
+
this.clearSearch();
|
| 2953 |
+
},
|
| 2954 |
+
|
| 2955 |
+
// multi
|
| 2956 |
+
onSortStart: function() {
|
| 2957 |
+
if (this.select) {
|
| 2958 |
+
throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
|
| 2959 |
+
}
|
| 2960 |
+
|
| 2961 |
+
// collapse search field into 0 width so its container can be collapsed as well
|
| 2962 |
+
this.search.width(0);
|
| 2963 |
+
// hide the container
|
| 2964 |
+
this.searchContainer.hide();
|
| 2965 |
+
},
|
| 2966 |
+
|
| 2967 |
+
// multi
|
| 2968 |
+
onSortEnd:function() {
|
| 2969 |
+
|
| 2970 |
+
var val=[], self=this;
|
| 2971 |
+
|
| 2972 |
+
// show search and move it to the end of the list
|
| 2973 |
+
this.searchContainer.show();
|
| 2974 |
+
// make sure the search container is the last item in the list
|
| 2975 |
+
this.searchContainer.appendTo(this.searchContainer.parent());
|
| 2976 |
+
// since we collapsed the width in dragStarted, we resize it here
|
| 2977 |
+
this.resizeSearch();
|
| 2978 |
+
|
| 2979 |
+
// update selection
|
| 2980 |
+
this.selection.find(".select2-search-choice").each(function() {
|
| 2981 |
+
val.push(self.opts.id($(this).data("select2-data")));
|
| 2982 |
+
});
|
| 2983 |
+
this.setVal(val);
|
| 2984 |
+
this.triggerChange();
|
| 2985 |
+
},
|
| 2986 |
+
|
| 2987 |
+
// multi
|
| 2988 |
+
data: function(values, triggerChange) {
|
| 2989 |
+
var self=this, ids, old;
|
| 2990 |
+
if (arguments.length === 0) {
|
| 2991 |
+
return this.selection
|
| 2992 |
+
.find(".select2-search-choice")
|
| 2993 |
+
.map(function() { return $(this).data("select2-data"); })
|
| 2994 |
+
.get();
|
| 2995 |
+
} else {
|
| 2996 |
+
old = this.data();
|
| 2997 |
+
if (!values) { values = []; }
|
| 2998 |
+
ids = $.map(values, function(e) { return self.opts.id(e); });
|
| 2999 |
+
this.setVal(ids);
|
| 3000 |
+
this.updateSelection(values);
|
| 3001 |
+
this.clearSearch();
|
| 3002 |
+
if (triggerChange) {
|
| 3003 |
+
this.triggerChange(this.buildChangeDetails(old, this.data()));
|
| 3004 |
+
}
|
| 3005 |
+
}
|
| 3006 |
+
}
|
| 3007 |
+
});
|
| 3008 |
+
|
| 3009 |
+
$.fn.select2 = function () {
|
| 3010 |
+
|
| 3011 |
+
var args = Array.prototype.slice.call(arguments, 0),
|
| 3012 |
+
opts,
|
| 3013 |
+
select2,
|
| 3014 |
+
method, value, multiple,
|
| 3015 |
+
allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "readonly", "positionDropdown", "data", "search"],
|
| 3016 |
+
valueMethods = ["val", "opened", "isFocused", "container", "data"],
|
| 3017 |
+
methodsMap = { search: "externalSearch" };
|
| 3018 |
+
|
| 3019 |
+
this.each(function () {
|
| 3020 |
+
if (args.length === 0 || typeof(args[0]) === "object") {
|
| 3021 |
+
opts = args.length === 0 ? {} : $.extend({}, args[0]);
|
| 3022 |
+
opts.element = $(this);
|
| 3023 |
+
|
| 3024 |
+
if (opts.element.get(0).tagName.toLowerCase() === "select") {
|
| 3025 |
+
multiple = opts.element.prop("multiple");
|
| 3026 |
+
} else {
|
| 3027 |
+
multiple = opts.multiple || false;
|
| 3028 |
+
if ("tags" in opts) {opts.multiple = multiple = true;}
|
| 3029 |
+
}
|
| 3030 |
+
|
| 3031 |
+
select2 = multiple ? new MultiSelect2() : new SingleSelect2();
|
| 3032 |
+
select2.init(opts);
|
| 3033 |
+
} else if (typeof(args[0]) === "string") {
|
| 3034 |
+
|
| 3035 |
+
if (indexOf(args[0], allowedMethods) < 0) {
|
| 3036 |
+
throw "Unknown method: " + args[0];
|
| 3037 |
+
}
|
| 3038 |
+
|
| 3039 |
+
value = undefined;
|
| 3040 |
+
select2 = $(this).data("select2");
|
| 3041 |
+
if (select2 === undefined) return;
|
| 3042 |
+
|
| 3043 |
+
method=args[0];
|
| 3044 |
+
|
| 3045 |
+
if (method === "container") {
|
| 3046 |
+
value = select2.container;
|
| 3047 |
+
} else if (method === "dropdown") {
|
| 3048 |
+
value = select2.dropdown;
|
| 3049 |
+
} else {
|
| 3050 |
+
if (methodsMap[method]) method = methodsMap[method];
|
| 3051 |
+
|
| 3052 |
+
value = select2[method].apply(select2, args.slice(1));
|
| 3053 |
+
}
|
| 3054 |
+
if (indexOf(args[0], valueMethods) >= 0) {
|
| 3055 |
+
return false;
|
| 3056 |
+
}
|
| 3057 |
+
} else {
|
| 3058 |
+
throw "Invalid arguments to select2 plugin: " + args;
|
| 3059 |
+
}
|
| 3060 |
+
});
|
| 3061 |
+
return (value === undefined) ? this : value;
|
| 3062 |
+
};
|
| 3063 |
+
|
| 3064 |
+
// plugin defaults, accessible to users
|
| 3065 |
+
$.fn.select2.defaults = {
|
| 3066 |
+
width: "copy",
|
| 3067 |
+
loadMorePadding: 0,
|
| 3068 |
+
closeOnSelect: true,
|
| 3069 |
+
openOnEnter: true,
|
| 3070 |
+
containerCss: {},
|
| 3071 |
+
dropdownCss: {},
|
| 3072 |
+
containerCssClass: "",
|
| 3073 |
+
dropdownCssClass: "",
|
| 3074 |
+
formatResult: function(result, container, query, escapeMarkup) {
|
| 3075 |
+
var markup=[];
|
| 3076 |
+
markMatch(result.text, query.term, markup, escapeMarkup);
|
| 3077 |
+
return markup.join("");
|
| 3078 |
+
},
|
| 3079 |
+
formatSelection: function (data, container, escapeMarkup) {
|
| 3080 |
+
return data ? escapeMarkup(data.text) : undefined;
|
| 3081 |
+
},
|
| 3082 |
+
sortResults: function (results, container, query) {
|
| 3083 |
+
return results;
|
| 3084 |
+
},
|
| 3085 |
+
formatResultCssClass: function(data) {return undefined;},
|
| 3086 |
+
formatSelectionCssClass: function(data, container) {return undefined;},
|
| 3087 |
+
formatNoMatches: function () { return "No matches found"; },
|
| 3088 |
+
formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " more character" + (n == 1? "" : "s"); },
|
| 3089 |
+
formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1? "" : "s"); },
|
| 3090 |
+
formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
|
| 3091 |
+
formatLoadMore: function (pageNumber) { return "Loading more results..."; },
|
| 3092 |
+
formatSearching: function () { return "Searching..."; },
|
| 3093 |
+
minimumResultsForSearch: 0,
|
| 3094 |
+
minimumInputLength: 0,
|
| 3095 |
+
maximumInputLength: null,
|
| 3096 |
+
maximumSelectionSize: 0,
|
| 3097 |
+
id: function (e) { return e.id; },
|
| 3098 |
+
matcher: function(term, text) {
|
| 3099 |
+
return (''+text).toUpperCase().indexOf((''+term).toUpperCase()) >= 0;
|
| 3100 |
+
},
|
| 3101 |
+
separator: ",",
|
| 3102 |
+
tokenSeparators: [],
|
| 3103 |
+
tokenizer: defaultTokenizer,
|
| 3104 |
+
escapeMarkup: defaultEscapeMarkup,
|
| 3105 |
+
blurOnChange: false,
|
| 3106 |
+
selectOnBlur: false,
|
| 3107 |
+
adaptContainerCssClass: function(c) { return c; },
|
| 3108 |
+
adaptDropdownCssClass: function(c) { return null; }
|
| 3109 |
+
};
|
| 3110 |
+
|
| 3111 |
+
$.fn.select2.ajaxDefaults = {
|
| 3112 |
+
transport: $.ajax,
|
| 3113 |
+
params: {
|
| 3114 |
+
type: "GET",
|
| 3115 |
+
cache: false,
|
| 3116 |
+
dataType: "json"
|
| 3117 |
+
}
|
| 3118 |
+
};
|
| 3119 |
+
|
| 3120 |
+
// exports
|
| 3121 |
+
window.Select2 = {
|
| 3122 |
+
query: {
|
| 3123 |
+
ajax: ajax,
|
| 3124 |
+
local: local,
|
| 3125 |
+
tags: tags
|
| 3126 |
+
}, util: {
|
| 3127 |
+
debounce: debounce,
|
| 3128 |
+
markMatch: markMatch,
|
| 3129 |
+
escapeMarkup: defaultEscapeMarkup
|
| 3130 |
+
}, "class": {
|
| 3131 |
+
"abstract": AbstractSelect2,
|
| 3132 |
+
"single": SingleSelect2,
|
| 3133 |
+
"multi": MultiSelect2
|
| 3134 |
+
}
|
| 3135 |
+
};
|
| 3136 |
+
|
| 3137 |
+
}(jQuery));
|
shared/assets/admin/js/select2.min.js
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
Copyright 2012 Igor Vaynberg
|
| 3 |
+
|
| 4 |
+
Version: 3.4.1 Timestamp: Thu Jun 27 18:02:10 PDT 2013
|
| 5 |
+
|
| 6 |
+
This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
|
| 7 |
+
General Public License version 2 (the "GPL License"). You may choose either license to govern your
|
| 8 |
+
use of this software only upon the condition that you accept all of the terms of either the Apache
|
| 9 |
+
License or the GPL License.
|
| 10 |
+
|
| 11 |
+
You may obtain a copy of the Apache License and the GPL License at:
|
| 12 |
+
|
| 13 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 14 |
+
http://www.gnu.org/licenses/gpl-2.0.html
|
| 15 |
+
|
| 16 |
+
Unless required by applicable law or agreed to in writing, software distributed under the Apache License
|
| 17 |
+
or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
|
| 18 |
+
either express or implied. See the Apache License and the GPL License for the specific language governing
|
| 19 |
+
permissions and limitations under the Apache License and the GPL License.
|
| 20 |
+
*/
|
| 21 |
+
(function(a){a.fn.each2===void 0&&a.fn.extend({each2:function(b){for(var c=a([0]),d=-1,e=this.length;e>++d&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})})(jQuery),function(a,b){"use strict";function m(a,b){for(var c=0,d=b.length;d>c;c+=1)if(o(a,b[c]))return c;return-1}function n(){var b=a(l);b.appendTo("body");var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function o(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function p(b,c){var d,e,f;if(null===b||1>b.length)return[];for(d=b.split(c),e=0,f=d.length;f>e;e+=1)d[e]=a.trim(d[e]);return d}function q(a){return a.outerWidth(!1)-a.width()}function r(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function s(c){c.on("mousemove",function(c){var d=i;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function t(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function u(a){var c,b=!1;return function(){return b===!1&&(c=a(),b=!0),c}}function v(a,b){var c=t(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){m(a.target,b.get())>=0&&c(a)})}function w(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus(),a.is(":visible")&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function x(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function y(a){a.preventDefault(),a.stopPropagation()}function z(a){a.preventDefault(),a.stopImmediatePropagation()}function A(b){if(!h){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);h=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),h.attr("class","select2-sizer"),a("body").append(h)}return h.text(b.val()),h.width()}function B(b,c,d){var e,g,f=[];e=b.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=c.attr("class"),e&&(e=""+e,a(e.split(" ")).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(this))})),b.attr("class",f.join(" "))}function C(a,c,d,e){var f=a.toUpperCase().indexOf(c.toUpperCase()),g=c.length;return 0>f?(d.push(e(a)),b):(d.push(e(a.substring(0,f))),d.push("<span class='select2-match'>"),d.push(e(a.substring(f,f+g))),d.push("</span>"),d.push(e(a.substring(f+g,a.length))),b)}function D(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return(a+"").replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function E(c){var d,e=0,f=null,g=c.quietMillis||100,h=c.url,i=this;return function(j){window.clearTimeout(d),d=window.setTimeout(function(){e+=1;var d=e,g=c.data,k=h,l=c.transport||a.fn.select2.ajaxDefaults.transport,m={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},n=a.extend({},a.fn.select2.ajaxDefaults.params,m);g=g?g.call(i,j.term,j.page,j.context):null,k="function"==typeof k?k.call(i,j.term,j.page,j.context):k,f&&f.abort(),c.params&&(a.isFunction(c.params)?a.extend(n,c.params.call(i)):a.extend(n,c.params)),a.extend(n,{url:k,dataType:c.dataType,data:g,success:function(a){if(!(e>d)){var b=c.results(a,j.page);j.callback(b)}}}),f=l.call(i,n)},g)}}function F(c){var e,f,d=c,g=function(a){return""+a.text};a.isArray(d)&&(f=d,d={results:f}),a.isFunction(d)===!1&&(f=d,d=function(){return f});var h=d();return h.text&&(g=h.text,a.isFunction(g)||(e=h.text,g=function(a){return a[e]})),function(c){var h,e=c.term,f={results:[]};return""===e?(c.callback(d()),b):(h=function(b,d){var f,i;if(b=b[0],b.children){f={};for(i in b)b.hasOwnProperty(i)&&(f[i]=b[i]);f.children=[],a(b.children).each2(function(a,b){h(b,f.children)}),(f.children.length||c.matcher(e,g(f),b))&&d.push(f)}else c.matcher(e,g(b),b)&&d.push(b)},a(d().results).each2(function(a,b){h(b,f.results)}),c.callback(f),b)}}function G(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]};a(d?c():c).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g)}}function H(b,c){if(a.isFunction(b))return!0;if(!b)return!1;throw Error(c+" must be a function or a falsy value")}function I(b){return a.isFunction(b)?b():b}function J(b){var c=0;return a.each(b,function(a,b){b.children?c+=J(b.children):c++}),c}function K(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||1>e.tokenSeparators.length)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(o(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:b}function L(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,h,j,k,i={x:0,y:0},c={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case c.LEFT:case c.RIGHT:case c.UP:case c.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case c.SHIFT:case c.CTRL:case c.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>";j=a(document),g=function(){var a=1;return function(){return a++}}(),j.on("mousemove",function(a){i.x=a.pageX,i.y=a.pageY}),d=L(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,h,i,f=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+g()),this.containerSelector="#"+this.containerId.replace(/([;&,\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.body=u(function(){return c.element.closest("body")}),B(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.css(I(c.containerCss)),this.container.addClass(I(c.containerCssClass)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),this.dropdown.addClass(I(c.dropdownCssClass)),this.dropdown.data("select2",this),this.results=d=this.container.find(f),this.search=e=this.container.find("input.select2-input"),this.resultsPage=0,this.context=null,this.initContainer(),s(this.results),this.dropdown.on("mousemove-filtered touchstart touchmove touchend",f,this.bind(this.highlightUnderEvent)),v(80,this.results),this.dropdown.on("scroll-debounced",f,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),y(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),y(a))}),r(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",f,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown",function(a){a.stopPropagation()}),a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),k=k||n(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus()},destroy:function(){var a=this.opts.element,c=a.data("select2");this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),c!==b&&(c.container.remove(),c.dropdown.remove(),a.removeClass("select2-offscreen").removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:o(a.attr("locked"),"locked")||o(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:b},prepareOpts:function(c){var d,e,f,g,h=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,f){var g,l=this.opts.id;g=function(d,e,i){var j,k,m,n,o,p,q,r,s,t;for(d=c.sortResults(d,e,f),j=0,k=d.length;k>j;j+=1)m=d[j],o=m.disabled===!0,n=!o&&l(m)!==b,p=m.children&&m.children.length>0,q=a("<li></li>"),q.addClass("select2-results-dept-"+i),q.addClass("select2-result"),q.addClass(n?"select2-result-selectable":"select2-result-unselectable"),o&&q.addClass("select2-disabled"),p&&q.addClass("select2-result-with-children"),q.addClass(h.opts.formatResultCssClass(m)),r=a(document.createElement("div")),r.addClass("select2-result-label"),t=c.formatResult(m,r,f,h.opts.escapeMarkup),t!==b&&r.html(t),q.append(r),p&&(s=a("<ul></ul>"),s.addClass("select2-result-sub"),g(m.children,s,i+1),q.append(s)),q.data("select2-data",m),e.append(q)},g(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(f=c.id,c.id=function(a){return a[f]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,i,c={results:[],more:!1},e=a.term;i=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(h.optionToData(b)):b.is("optgroup")&&(d=h.optionToData(b),b.children().each2(function(a,b){i(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){i(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id},c.formatResultCssClass=function(a){return a.css}):"query"in c||("ajax"in c?(g=c.element.data("ajax-url"),g&&g.length>0&&(c.ajax.url=g),c.query=E.call(c.element,c.ajax)):"data"in c?c.query=F(c.data):"tags"in c&&(c.query=G(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(a){return{id:a,text:a}}),c.initSelection===b&&(c.initSelection=function(d,e){var f=[];a(p(d.val(),c.separator)).each(function(){var d=this,e=this,g=c.tags;a.isFunction(g)&&(g=g()),a(g).each(function(){return o(this.id,d)?(e=this.text,!1):b}),f.push({id:d,text:e})}),e(f)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");return c},monitorSource:function(){var c,a=this.opts.element;a.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),c=this.bind(function(){var d,f=a.prop("disabled");f===b&&(f=!1),this.enable(!f);var d=a.prop("readonly");d===b&&(d=!1),this.readonly(d),B(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(I(this.opts.containerCssClass)),B(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(I(this.opts.dropdownCssClass))}),a.on("propertychange.select2 DOMAttrModified.select2",c),this.mutationCallback===b&&(this.mutationCallback=function(a){a.forEach(c)}),"undefined"!=typeof WebKitMutationObserver&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new WebKitMutationObserver(this.mutationCallback),this.propertyObserver.observe(a.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){return a===b&&(a=!0),this._enabled===a?!1:(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface(),!0)},readonly:function(a){return a===b&&(a=!1),this._readonly===a?!1:(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface(),!0)},opened:function(){return this.container.hasClass("select2-dropdown-open")},positionDropdown:function(){var q,r,s,t,b=this.dropdown,c=this.container.offset(),d=this.container.outerHeight(!1),e=this.container.outerWidth(!1),f=b.outerHeight(!1),g=a(window).scrollLeft()+a(window).width(),h=a(window).scrollTop()+a(window).height(),i=c.top+d,j=c.left,l=h>=i+f,m=c.top-f>=this.body().scrollTop(),n=b.outerWidth(!1),o=g>=j+n,p=b.hasClass("select2-drop-above");this.opts.dropdownAutoWidth?(t=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),n=b.outerWidth(!1)+(t.scrollHeight===t.clientHeight?0:k.width),n>e?e=n:n=e,o=g>=j+n):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body().css("position")&&(q=this.body().offset(),i-=q.top,j-=q.left),p?(r=!0,!m&&l&&(r=!1)):(r=!1,!l&&m&&(r=!0)),o||(j=c.left+e-n),r?(i=c.top-f,this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),s=a.extend({top:i,left:j,width:e},I(this.opts.dropdownCss)),b.css(s)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),!0):!1},opening:function(){function i(){return{width:Math.max(document.documentElement.scrollWidth,a(window).width()),height:Math.max(document.documentElement.scrollHeight,a(window).height())}}var f,g,b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body().children().last()[0]&&this.dropdown.detach().appendTo(this.body()),f=a("#select2-drop-mask"),0==f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body()),f.on("mousedown touchstart click",function(b){var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),g=i(),f.css(g).show(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var h=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){var c=i();a("#select2-drop-mask").css(c),h.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerId,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open"),this.results.empty(),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return I(this.opts.maximumSelectionSize)},ensureHighlightVisible:function(){var d,e,f,g,h,i,j,c=this.results;if(e=this.highlight(),!(0>e)){if(0==e)return c.scrollTop(0),b;d=this.findHighlightableChoices().find(".select2-result-label"),f=a(d[e]),g=f.offset().top+f.outerHeight(!0),e===d.length-1&&(j=c.find("li.select2-more-results"),j.length>0&&(g=j.offset().top+j.outerHeight(!0))),h=c.offset().top+c.outerHeight(!0),g>h&&c.scrollTop(c.scrollTop()+(g-h)),i=f.offset().top-c.offset().top,0>i&&"none"!=f.css("display")&&c.scrollTop(c.scrollTop()+i)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-selected):not(.select2-disabled)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&c.length>d;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(c){var e,f,d=this.findHighlightableChoices();return 0===arguments.length?m(d.filter(".select2-highlighted")[0],d.get()):(c>=d.length&&(c=d.length-1),0>c&&(c=0),this.results.find(".select2-highlighted").removeClass("select2-highlighted"),e=a(d[c]),e.addClass("select2-highlighted"),this.ensureHighlightVisible(),f=e.data("select2-data"),f&&this.opts.element.trigger({type:"select2-highlight",val:this.id(f),choice:f}),b)},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.results.find(".select2-highlighted").removeClass("select2-highlighted")},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),e=this.resultsPage+1,f=this,g=this.search.val(),h=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),this.opts.loadMorePadding>=c&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:g,page:e,context:h,matcher:this.opts.matcher,callback:this.bind(function(c){f.opened()&&(f.opts.populateResults.call(this,a,c.results,{term:g,page:e,context:h}),f.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).text(f.opts.formatLoadMore(e+1)),window.setTimeout(function(){f.loadMoreIfNeeded()},10)):b.remove(),f.positionDropdown(),f.resultsPage=e,f.context=c.context)})})))},tokenize:function(){},updateResults:function(c){function l(){d.removeClass("select2-active"),h.positionDropdown()}function m(a){e.html(a),l()}var g,i,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!o(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){var n=this.getMaximumSelectionSize();if(n>=1&&(g=this.data(),a.isArray(g)&&g.length>=n&&H(f.formatSelectionTooBig,"formatSelectionTooBig")))return m("<li class='select2-selection-limit'>"+f.formatSelectionTooBig(n)+"</li>"),b;if(d.val().length<f.minimumInputLength)return H(f.formatInputTooShort,"formatInputTooShort")?m("<li class='select2-no-results'>"+f.formatInputTooShort(d.val(),f.minimumInputLength)+"</li>"):m(""),c&&this.showSearch&&this.showSearch(!0),b;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return H(f.formatInputTooLong,"formatInputTooLong")?m("<li class='select2-no-results'>"+f.formatInputTooLong(d.val(),f.maximumInputLength)+"</li>"):m(""),b;f.formatSearching&&0===this.findHighlightableChoices().length&&m("<li class='select2-searching'>"+f.formatSearching()+"</li>"),d.addClass("select2-active"),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;return this.opened()?(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return o(h.id(this),h.id(i))}).length&&g.results.unshift(i)),0===g.results.length&&H(f.formatNoMatches,"formatNoMatches")?(m("<li class='select2-no-results'>"+f.formatNoMatches(d.val())+"</li>"),b):(e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&H(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+h.opts.escapeMarkup(f.formatLoadMore(this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),l(),this.opts.element.trigger({type:"select2-loaded",items:g}),b)):(this.search.removeClass("select2-active"),b)})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){w(this.search)},selectHighlighted:function(a){var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var a=this.select.children().first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&a||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.text()&&""===a.val())return a}},initContainerWidth:function(){function c(){var c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(e=d[f].replace(/\s/g,"").match(/width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),e=L(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' onclick='return false;' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow'><b></b></span>","</a>","<input class='select2-focusser select2-offscreen' type='text'/>","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'/>"," </div>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var b,c,d;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.search.focus(),b=this.search.get(0),b.createTextRange?(c=b.createTextRange(),c.collapse(!1),c.select()):b.setSelectionRange&&(d=this.search.val().length,b.setSelectionRange(d,d)),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.removeAttr("disabled"),this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.removeAttr("disabled"),this.focusser.focus()},initContainer:function(){var d,e=this.container,f=this.dropdown;0>this.opts.minimumResultsForSearch?this.showSearch(!1):this.showSearch(!0),this.selection=d=e.find(".select2-choice"),this.focusser=e.find(".select2-focusser"),this.focusser.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.focusser.attr("id")),this.focusser.attr("tabindex",this.elementTabIndex),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){if(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)return y(a),b;switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),y(a),b;case c.ENTER:return this.selectHighlighted(),y(a),b;case c.TAB:return this.selectHighlighted({noFocus:!0}),b;case c.ESC:return this.cancel(a),y(a),b}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body().get(0)&&window.setTimeout(this.bind(function(){this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.ESC){if(this.opts.openOnEnter===!1&&a.which===c.ENTER)return y(a),b;if(a.which==c.DOWN||a.which==c.UP||a.which==c.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),y(a),b}return a.which==c.DELETE||a.which==c.BACKSPACE?(this.opts.allowClear&&this.clear(),y(a),b):b}})),r(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),d.on("mousedown","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),z(a),this.close(),this.selection.focus())})),d.on("mousedown",this.bind(function(b){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),y(b)})),f.on("mousedown",this.bind(function(){this.search.focus()})),d.on("focus",this.bind(function(a){y(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.setPlaceholder()},clear:function(a){var b=this.selection.data("select2-data");if(b){var c=this.getPlaceholderOption();this.opts.element.val(c?c.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),a!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(b),choice:b}),this.triggerChange({removed:b}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection([]),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder())})}},isPlaceholderOptionSelected:function(){var a;return(a=this.getPlaceholderOption())!==b&&a.is(":selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find(":selected");b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=o(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,c,d){var e=0,f=this;if(this.findHighlightableChoices().each2(function(a,c){return o(f.id(c.data("select2-data")),f.opts.element.val())?(e=a,!1):b}),d!==!1&&(c===!0&&e>=0?this.highlight(e):this.highlight(0)),c===!0){var h=this.opts.minimumResultsForSearch;h>=0&&this.showSearch(J(a.results)>=h)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.close(),b&&b.noFocus||this.selection.focus(),o(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),d=this.opts.formatSelection(a,c,this.opts.escapeMarkup),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")
|
| 22 |
+
},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find(":selected").each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),b;if(this.opts.initSelection===b)throw Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a,c){var d;return 0===arguments.length?(d=this.selection.data("select2-data"),d==b&&(d=null),d):(a&&""!==a?(d=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),c&&this.triggerChange({added:a,removed:d})):this.clear(c),b)}}),f=L(d,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <input type='text' autocomplete='off' autocorrect='off' autocapitilize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find(":selected").each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=p(c.val(),b.separator),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return o(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;e.length>c;c++)for(var g=e[c],h=0;f.length>h;h++){var i=f[h];if(o(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},initContainer:function(){var e,d=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=e=this.container.find(d);var f=this;this.selection.on("mousedown",".select2-search-choice",function(){f.search[0].focus(),f.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+g()),a("label[for='"+this.opts.element.attr("id")+"']").attr("for",this.search.attr("id")),this.search.on("input paste",this.bind(function(){this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var d=e.find(".select2-search-choice-focus"),f=d.prev(".select2-search-choice:not(.select2-locked)"),g=d.next(".select2-search-choice:not(.select2-locked)"),h=x(this.search);if(d.length&&(a.which==c.LEFT||a.which==c.RIGHT||a.which==c.BACKSPACE||a.which==c.DELETE||a.which==c.ENTER)){var i=d;return a.which==c.LEFT&&f.length?i=f:a.which==c.RIGHT?i=g.length?g:null:a.which===c.BACKSPACE?(this.unselect(d.first()),this.search.width(10),i=f.length?f:g):a.which==c.DELETE?(this.unselect(d.first()),this.search.width(10),i=g.length?g:null):a.which==c.ENTER&&(i=null),this.selectChoice(i),y(a),i&&i.length||this.open(),b}if((a.which===c.BACKSPACE&&1==this.keydowns||a.which==c.LEFT)&&0==h.offset&&!h.length)return this.selectChoice(e.find(".select2-search-choice:not(.select2-locked)").last()),y(a),b;if(this.selectChoice(null),this.opened())switch(a.which){case c.UP:case c.DOWN:return this.moveHighlight(a.which===c.UP?-1:1),y(a),b;case c.ENTER:return this.selectHighlighted(),y(a),b;case c.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),b;case c.ESC:return this.cancel(a),y(a),b}if(a.which!==c.TAB&&!c.isControl(a)&&!c.isFunctionKey(a)&&a.which!==c.BACKSPACE&&a.which!==c.ESC){if(a.which===c.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===c.PAGE_UP||a.which===c.PAGE_DOWN)&&y(a),a.which===c.ENTER&&y(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",d,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",d,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.addClass("select2-offscreen"),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.updateResults(!0),this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){0>m(e.id(this),c)&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()&&this.updateResults(!0),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' onclick='return false;' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith("<div>"+j+"</div>"),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",y).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").fadeOut("fast",this.bind(function(){this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),this.close(),this.focusSearch()})).dequeue(),y(b))})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(a){var c,d,b=this.getVal();if(a=a.closest(".select2-search-choice"),0===a.length)throw"Invalid argument: "+a+". Must be .select2-search-choice";c=a.data("select2-data"),c&&(d=m(this.id(c),b),d>=0&&(b.splice(d,1),this.setVal(b),this.select&&this.postprocessResults()),a.remove(),this.opts.element.trigger({type:"removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));m(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&H(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+g.opts.formatNoMatches(g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-q(this.search)},resizeSearch:function(){var a,b,c,d,e,f=q(this.search);a=A(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(e)},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),p(a,this.opts.separator))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){0>m(this,c)&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;b.length>c;c++)for(var d=0;a.length>d;d++)o(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),b;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(this.buildChangeDetails(e,this.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(c,d){var f,g,e=this;return 0===arguments.length?this.selection.find(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(g=this.data(),c||(c=[]),f=a.map(c,function(a){return e.opts.id(a)}),this.setVal(f),this.updateSelection(c),this.clearSearch(),d&&this.triggerChange(this.buildChangeDetails(g,this.data())),b)}}),a.fn.select2=function(){var d,g,h,i,j,c=Array.prototype.slice.call(arguments,0),k=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","readonly","positionDropdown","data","search"],l=["val","opened","isFocused","container","data"],n={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?j=d.element.prop("multiple"):(j=d.multiple||!1,"tags"in d&&(d.multiple=j=!0)),g=j?new f:new e,g.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(0>m(c[0],k))throw"Unknown method: "+c[0];if(i=b,g=a(this).data("select2"),g===b)return;if(h=c[0],"container"===h?i=g.container:"dropdown"===h?i=g.dropdown:(n[h]&&(h=n[h]),i=g[h].apply(g,c.slice(1))),m(c[0],l)>=0)return!1}}),i===b?this:i},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return C(a.text,c.term,e,d),e.join("")},formatSelection:function(a,c,d){return a?d(a.text):b},sortResults:function(a){return a},formatResultCssClass:function(){return b},formatSelectionCssClass:function(){return b},formatNoMatches:function(){return"No matches found"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results..."},formatSearching:function(){return"Searching..."},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a.id},matcher:function(a,b){return(""+b).toUpperCase().indexOf((""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:K,escapeMarkup:D,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null}},a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:E,local:F,tags:G},util:{debounce:t,markMatch:C,escapeMarkup:D},"class":{"abstract":d,single:e,multi:f}}}}(jQuery);
|
shared/assets/assets.loader.class.php
ADDED
|
@@ -0,0 +1,148 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/*
|
| 3 |
+
Inbound Scripts and CSS Enqueue
|
| 4 |
+
*/
|
| 5 |
+
|
| 6 |
+
if (!defined('INBOUND_SHARED_ASSETS')) {
|
| 7 |
+
define('INBOUND_SHARED_ASSETS', plugin_dir_url(__FILE__));
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
if (!defined('INBOUND_SHARED_ASSETS_PATH')) {
|
| 11 |
+
define('INBOUND_SHARED_ASSETS_PATH', WP_PLUGIN_DIR.'/'.plugin_basename( dirname(__FILE__) ).'/' );
|
| 12 |
+
}
|
| 13 |
+
|
| 14 |
+
if (!class_exists('Inbound_Asset_Loader')) {
|
| 15 |
+
class Inbound_Asset_Loader {
|
| 16 |
+
static $load_assets;
|
| 17 |
+
|
| 18 |
+
static function load_inbound_assets() {
|
| 19 |
+
self::$load_assets = true;
|
| 20 |
+
add_action('wp_enqueue_scripts', array(__CLASS__, 'register_scripts_and_styles'), 101);
|
| 21 |
+
add_action('admin_enqueue_scripts', array(__CLASS__, 'register_scripts_and_styles'), 101);
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
/**
|
| 25 |
+
* Registers and enqueues stylesheets for the administration panel and the
|
| 26 |
+
* public facing site.
|
| 27 |
+
*
|
| 28 |
+
* Example:
|
| 29 |
+
* self::load_file('SCRIPT-ID', 'frontend/js/path-in-shared-assets.js', 'localized_var_name', $localized_array_values, $dependancies_array );
|
| 30 |
+
*/
|
| 31 |
+
static function register_scripts_and_styles() {
|
| 32 |
+
/* Frontent and Backend Files */
|
| 33 |
+
self::load_file('jquery-cookie', 'global/js/jquery.cookie.js', array( 'jquery' ));
|
| 34 |
+
self::load_file('jquery-total-storage', 'global/js/jquery.total-storage.min.js', array( 'jquery' ));
|
| 35 |
+
|
| 36 |
+
if(is_user_logged_in()){
|
| 37 |
+
self::load_file('inbound-admin', 'admin/css/global-inbound-admin.css');
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
/* Conditionals for admin or frontend */
|
| 41 |
+
if(is_admin()) {
|
| 42 |
+
|
| 43 |
+
$inbound_now_screens = InboundCompatibility::return_inbound_now_screens(); // list of inbound now screens
|
| 44 |
+
$screen = get_current_screen();
|
| 45 |
+
//echo $screen->id;
|
| 46 |
+
/* Target Specific screen with // echo $screen->id;
|
| 47 |
+
if ( $screen->id != 'landing-page_page_lp_global_settings') {
|
| 48 |
+
|
| 49 |
+
} */
|
| 50 |
+
//self::load_file('script-test', 'admin/js/test.js');
|
| 51 |
+
} else {
|
| 52 |
+
|
| 53 |
+
self::load_file('funnel-tracking', 'frontend/js/page-tracking.js', array(), 'wplft', self::localize_lead_data());
|
| 54 |
+
// TODO: Merge Localize of wplft into inbound_ajax
|
| 55 |
+
self::load_file('store-lead-ajax', 'frontend/js/store.lead.ajax.js', array( 'jquery','jquery-cookie'), 'inbound_ajax', self::localize_lead_data());
|
| 56 |
+
/* Target Specific post type with
|
| 57 |
+
if ( is_singular( 'landing-page' ) ) {
|
| 58 |
+
|
| 59 |
+
} */
|
| 60 |
+
//self::load_file('test-css', 'frontend/css/test.css');
|
| 61 |
+
}
|
| 62 |
+
} // end register_scripts_and_styles
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Helper function for registering and enqueueing scripts and styles.
|
| 66 |
+
*
|
| 67 |
+
* @name The ID to register with WordPress
|
| 68 |
+
* @file_path The path to the actual file inside /shared/assets/
|
| 69 |
+
* @localize_array Optional argument for the localized array
|
| 70 |
+
* @deps js dependancies by name example 'jquery'
|
| 71 |
+
* @localize_var the localized variable name
|
| 72 |
+
*/
|
| 73 |
+
static function load_file($name, $file_name, $deps = array(), $localize_var = null, $localize_array = array()) {
|
| 74 |
+
$is_script = false;
|
| 75 |
+
$deps = (empty($deps)) ? array() : $deps;
|
| 76 |
+
$url = INBOUND_SHARED_ASSETS . $file_name;
|
| 77 |
+
$file = INBOUND_SHARED_ASSETS_PATH . $file_name;
|
| 78 |
+
$file_type = strpos($file_name, '.js');
|
| 79 |
+
if (!(false === $file_type)) { $is_script = true; }
|
| 80 |
+
|
| 81 |
+
if(file_exists($file)) {
|
| 82 |
+
if($is_script) {
|
| 83 |
+
// wp_register_script( $handle, $src, $deps, $ver, $in_footer );
|
| 84 |
+
// $deps = array(), $ver = false, $in_footer = false
|
| 85 |
+
wp_register_script($name, $url, $deps);
|
| 86 |
+
wp_enqueue_script($name);
|
| 87 |
+
if ($localize_var != null) {
|
| 88 |
+
wp_localize_script( $name , $localize_var, $localize_array );
|
| 89 |
+
}
|
| 90 |
+
} else {
|
| 91 |
+
wp_register_style($name, $url);
|
| 92 |
+
wp_enqueue_style($name);
|
| 93 |
+
}
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
} // end load_file
|
| 97 |
+
|
| 98 |
+
/* Global Specific localize functions */
|
| 99 |
+
static function localize_lead_data() {
|
| 100 |
+
global $post;
|
| 101 |
+
$post_id = null;
|
| 102 |
+
$id_check = false;
|
| 103 |
+
$page_tracking = 'on';
|
| 104 |
+
$post_type = isset($post) ? get_post_type( $post ) : null;
|
| 105 |
+
$current_page = "http://".$_SERVER["HTTP_HOST"].$_SERVER["REQUEST_URI"];
|
| 106 |
+
$ip_address = (isset($_SERVER['REMOTE_ADDR'])) ? $_SERVER['REMOTE_ADDR'] : '0.0.0.0.0';
|
| 107 |
+
$lead_id = (isset($_COOKIE['wp_lead_id'])) ? $_COOKIE['wp_lead_id'] : false;
|
| 108 |
+
$lead_email = (isset($_COOKIE['wp_lead_email'])) ? $_COOKIE['wp_lead_email'] : false;
|
| 109 |
+
$lead_uid = (isset($_COOKIE['wp_lead_uid'])) ? $_COOKIE['wp_lead_uid'] : false;
|
| 110 |
+
$custom_map_values = array();
|
| 111 |
+
$custom_map_values = apply_filters( 'inboundnow_custom_map_values_filter' , $custom_map_values);
|
| 112 |
+
// Get correct post ID
|
| 113 |
+
if (!is_archive()){
|
| 114 |
+
$post_id = (isset($post)) ? $post->ID : false;
|
| 115 |
+
$id_check = ($post_id != null) ? true : false;
|
| 116 |
+
}
|
| 117 |
+
if (!$id_check) {
|
| 118 |
+
$post_id = wpl_url_to_postid($current_page);
|
| 119 |
+
$id_check = ($post_id != null) ? true : false;
|
| 120 |
+
}
|
| 121 |
+
if(!$id_check){
|
| 122 |
+
$post_id = wp_leads_get_page_final_id();
|
| 123 |
+
$id_check = ($post_id != null) ? true : false;
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
// If page tracking on
|
| 127 |
+
$lead_page_view_tracking = get_option( 'wpl-main-page-view-tracking');
|
| 128 |
+
if (!$lead_page_view_tracking) {
|
| 129 |
+
$page_tracking = 'off';
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
// Localize lead data
|
| 133 |
+
$lead_data_array = array();
|
| 134 |
+
$lead_data_array['lead_id'] = ($lead_id) ? $lead_id : null;
|
| 135 |
+
$lead_data_array['lead_email'] = ($lead_email) ? $lead_email : null;
|
| 136 |
+
$lead_data_array['lead_uid'] = ($lead_uid) ? $lead_uid : null;
|
| 137 |
+
$time = current_time( 'timestamp', 0 ); // Current wordpress time from settings
|
| 138 |
+
$wordpress_date_time = date("Y-m-d G:i:s T", $time);
|
| 139 |
+
|
| 140 |
+
$inbound_localized_data = array( 'post_id' => $post_id, 'ip_address' => $ip_address, 'wp_lead_data' => $lead_data_array, 'admin_url' => admin_url( 'admin-ajax.php' ), 'track_time' => $wordpress_date_time, 'post_type' => $post_type, 'page_tracking' => $page_tracking, 'custom_mapping' => $custom_map_values);
|
| 141 |
+
|
| 142 |
+
return $inbound_localized_data;
|
| 143 |
+
} // end localize lead data
|
| 144 |
+
|
| 145 |
+
} // end class
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
Inbound_Asset_Loader::load_inbound_assets();
|
shared/assets/frontend/js/page-tracking.js
ADDED
|
@@ -0,0 +1,508 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/* Console.log fix for old browsers */
|
| 2 |
+
(function() {
|
| 3 |
+
if (!window.console) {
|
| 4 |
+
window.console = {};
|
| 5 |
+
}
|
| 6 |
+
// union of Chrome, FF, IE, and Safari console methods
|
| 7 |
+
var m = [
|
| 8 |
+
"log", "info", "warn", "error", "debug", "trace", "dir", "group",
|
| 9 |
+
"groupCollapsed", "groupEnd", "time", "timeEnd", "profile", "profileEnd",
|
| 10 |
+
"dirxml", "assert", "count", "markTimeline", "timeStamp", "clear"
|
| 11 |
+
];
|
| 12 |
+
// define undefined methods as noops to prevent errors
|
| 13 |
+
for (var i = 0; i < m.length; i++) {
|
| 14 |
+
if (!window.console[m[i]]) {
|
| 15 |
+
window.console[m[i]] = function() {};
|
| 16 |
+
}
|
| 17 |
+
}
|
| 18 |
+
})();
|
| 19 |
+
|
| 20 |
+
/** Fixes for Safari Date errors
|
| 21 |
+
* Version: 1.0 Alpha-1
|
| 22 |
+
* Build Date: 13-Nov-2007
|
| 23 |
+
* Copyright (c) 2006-2007, Coolite Inc. (http://www.coolite.com/). All rights reserved.
|
| 24 |
+
* License: Licensed under The MIT License. See license.txt and http://www.datejs.com/license/.
|
| 25 |
+
* Website: http://www.datejs.com/ or http://www.coolite.com/datejs/
|
| 26 |
+
*/
|
| 27 |
+
Date.CultureInfo={name:"en-US",englishName:"English (United States)",nativeName:"English (United States)",dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],abbreviatedDayNames:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],shortestDayNames:["Su","Mo","Tu","We","Th","Fr","Sa"],firstLetterDayNames:["S","M","T","W","T","F","S"],monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],abbreviatedMonthNames:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],amDesignator:"AM",pmDesignator:"PM",firstDayOfWeek:0,twoDigitYearMax:2029,dateElementOrder:"mdy",formatPatterns:{shortDate:"M/d/yyyy",longDate:"dddd, MMMM dd, yyyy",shortTime:"h:mm tt",longTime:"h:mm:ss tt",fullDateTime:"dddd, MMMM dd, yyyy h:mm:ss tt",sortableDateTime:"yyyy-MM-ddTHH:mm:ss",universalSortableDateTime:"yyyy-MM-dd HH:mm:ssZ",rfc1123:"ddd, dd MMM yyyy HH:mm:ss GMT",monthDay:"MMMM dd",yearMonth:"MMMM, yyyy"},regexPatterns:{jan:/^jan(uary)?/i,feb:/^feb(ruary)?/i,mar:/^mar(ch)?/i,apr:/^apr(il)?/i,may:/^may/i,jun:/^jun(e)?/i,jul:/^jul(y)?/i,aug:/^aug(ust)?/i,sep:/^sep(t(ember)?)?/i,oct:/^oct(ober)?/i,nov:/^nov(ember)?/i,dec:/^dec(ember)?/i,sun:/^su(n(day)?)?/i,mon:/^mo(n(day)?)?/i,tue:/^tu(e(s(day)?)?)?/i,wed:/^we(d(nesday)?)?/i,thu:/^th(u(r(s(day)?)?)?)?/i,fri:/^fr(i(day)?)?/i,sat:/^sa(t(urday)?)?/i,future:/^next/i,past:/^last|past|prev(ious)?/i,add:/^(\+|after|from)/i,subtract:/^(\-|before|ago)/i,yesterday:/^yesterday/i,today:/^t(oday)?/i,tomorrow:/^tomorrow/i,now:/^n(ow)?/i,millisecond:/^ms|milli(second)?s?/i,second:/^sec(ond)?s?/i,minute:/^min(ute)?s?/i,hour:/^h(ou)?rs?/i,week:/^w(ee)?k/i,month:/^m(o(nth)?s?)?/i,day:/^d(ays?)?/i,year:/^y((ea)?rs?)?/i,shortMeridian:/^(a|p)/i,longMeridian:/^(a\.?m?\.?|p\.?m?\.?)/i,timezone:/^((e(s|d)t|c(s|d)t|m(s|d)t|p(s|d)t)|((gmt)?\s*(\+|\-)\s*\d\d\d\d?)|gmt)/i,ordinalSuffix:/^\s*(st|nd|rd|th)/i,timeContext:/^\s*(\:|a|p)/i},abbreviatedTimeZoneStandard:{GMT:"-000",EST:"-0400",CST:"-0500",MST:"-0600",PST:"-0700"},abbreviatedTimeZoneDST:{GMT:"-000",EDT:"-0500",CDT:"-0600",MDT:"-0700",PDT:"-0800"}};
|
| 28 |
+
Date.getMonthNumberFromName=function(name){var n=Date.CultureInfo.monthNames,m=Date.CultureInfo.abbreviatedMonthNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s||m[i].toLowerCase()==s){return i;}}
|
| 29 |
+
return-1;};Date.getDayNumberFromName=function(name){var n=Date.CultureInfo.dayNames,m=Date.CultureInfo.abbreviatedDayNames,o=Date.CultureInfo.shortestDayNames,s=name.toLowerCase();for(var i=0;i<n.length;i++){if(n[i].toLowerCase()==s||m[i].toLowerCase()==s){return i;}}
|
| 30 |
+
return-1;};Date.isLeapYear=function(year){return(((year%4===0)&&(year%100!==0))||(year%400===0));};Date.getDaysInMonth=function(year,month){return[31,(Date.isLeapYear(year)?29:28),31,30,31,30,31,31,30,31,30,31][month];};Date.getTimezoneOffset=function(s,dst){return(dst||false)?Date.CultureInfo.abbreviatedTimeZoneDST[s.toUpperCase()]:Date.CultureInfo.abbreviatedTimeZoneStandard[s.toUpperCase()];};Date.getTimezoneAbbreviation=function(offset,dst){var n=(dst||false)?Date.CultureInfo.abbreviatedTimeZoneDST:Date.CultureInfo.abbreviatedTimeZoneStandard,p;for(p in n){if(n[p]===offset){return p;}}
|
| 31 |
+
return null;};Date.prototype.clone=function(){return new Date(this.getTime());};Date.prototype.compareTo=function(date){if(isNaN(this)){throw new Error(this);}
|
| 32 |
+
if(date instanceof Date&&!isNaN(date)){return(this>date)?1:(this<date)?-1:0;}else{throw new TypeError(date);}};Date.prototype.equals=function(date){return(this.compareTo(date)===0);};Date.prototype.between=function(start,end){var t=this.getTime();return t>=start.getTime()&&t<=end.getTime();};Date.prototype.addMilliseconds=function(value){this.setMilliseconds(this.getMilliseconds()+value);return this;};Date.prototype.addSeconds=function(value){return this.addMilliseconds(value*1000);};Date.prototype.addMinutes=function(value){return this.addMilliseconds(value*60000);};Date.prototype.addHours=function(value){return this.addMilliseconds(value*3600000);};Date.prototype.addDays=function(value){return this.addMilliseconds(value*86400000);};Date.prototype.addWeeks=function(value){return this.addMilliseconds(value*604800000);};Date.prototype.addMonths=function(value){var n=this.getDate();this.setDate(1);this.setMonth(this.getMonth()+value);this.setDate(Math.min(n,this.getDaysInMonth()));return this;};Date.prototype.addYears=function(value){return this.addMonths(value*12);};Date.prototype.add=function(config){if(typeof config=="number"){this._orient=config;return this;}
|
| 33 |
+
var x=config;if(x.millisecond||x.milliseconds){this.addMilliseconds(x.millisecond||x.milliseconds);}
|
| 34 |
+
if(x.second||x.seconds){this.addSeconds(x.second||x.seconds);}
|
| 35 |
+
if(x.minute||x.minutes){this.addMinutes(x.minute||x.minutes);}
|
| 36 |
+
if(x.hour||x.hours){this.addHours(x.hour||x.hours);}
|
| 37 |
+
if(x.month||x.months){this.addMonths(x.month||x.months);}
|
| 38 |
+
if(x.year||x.years){this.addYears(x.year||x.years);}
|
| 39 |
+
if(x.day||x.days){this.addDays(x.day||x.days);}
|
| 40 |
+
return this;};Date._validate=function(value,min,max,name){if(typeof value!="number"){throw new TypeError(value+" is not a Number.");}else if(value<min||value>max){throw new RangeError(value+" is not a valid value for "+name+".");}
|
| 41 |
+
return true;};Date.validateMillisecond=function(n){return Date._validate(n,0,999,"milliseconds");};Date.validateSecond=function(n){return Date._validate(n,0,59,"seconds");};Date.validateMinute=function(n){return Date._validate(n,0,59,"minutes");};Date.validateHour=function(n){return Date._validate(n,0,23,"hours");};Date.validateDay=function(n,year,month){return Date._validate(n,1,Date.getDaysInMonth(year,month),"days");};Date.validateMonth=function(n){return Date._validate(n,0,11,"months");};Date.validateYear=function(n){return Date._validate(n,1,9999,"seconds");};Date.prototype.set=function(config){var x=config;if(!x.millisecond&&x.millisecond!==0){x.millisecond=-1;}
|
| 42 |
+
if(!x.second&&x.second!==0){x.second=-1;}
|
| 43 |
+
if(!x.minute&&x.minute!==0){x.minute=-1;}
|
| 44 |
+
if(!x.hour&&x.hour!==0){x.hour=-1;}
|
| 45 |
+
if(!x.day&&x.day!==0){x.day=-1;}
|
| 46 |
+
if(!x.month&&x.month!==0){x.month=-1;}
|
| 47 |
+
if(!x.year&&x.year!==0){x.year=-1;}
|
| 48 |
+
if(x.millisecond!=-1&&Date.validateMillisecond(x.millisecond)){this.addMilliseconds(x.millisecond-this.getMilliseconds());}
|
| 49 |
+
if(x.second!=-1&&Date.validateSecond(x.second)){this.addSeconds(x.second-this.getSeconds());}
|
| 50 |
+
if(x.minute!=-1&&Date.validateMinute(x.minute)){this.addMinutes(x.minute-this.getMinutes());}
|
| 51 |
+
if(x.hour!=-1&&Date.validateHour(x.hour)){this.addHours(x.hour-this.getHours());}
|
| 52 |
+
if(x.month!==-1&&Date.validateMonth(x.month)){this.addMonths(x.month-this.getMonth());}
|
| 53 |
+
if(x.year!=-1&&Date.validateYear(x.year)){this.addYears(x.year-this.getFullYear());}
|
| 54 |
+
if(x.day!=-1&&Date.validateDay(x.day,this.getFullYear(),this.getMonth())){this.addDays(x.day-this.getDate());}
|
| 55 |
+
if(x.timezone){this.setTimezone(x.timezone);}
|
| 56 |
+
if(x.timezoneOffset){this.setTimezoneOffset(x.timezoneOffset);}
|
| 57 |
+
return this;};Date.prototype.clearTime=function(){this.setHours(0);this.setMinutes(0);this.setSeconds(0);this.setMilliseconds(0);return this;};Date.prototype.isLeapYear=function(){var y=this.getFullYear();return(((y%4===0)&&(y%100!==0))||(y%400===0));};Date.prototype.isWeekday=function(){return!(this.is().sat()||this.is().sun());};Date.prototype.getDaysInMonth=function(){return Date.getDaysInMonth(this.getFullYear(),this.getMonth());};Date.prototype.moveToFirstDayOfMonth=function(){return this.set({day:1});};Date.prototype.moveToLastDayOfMonth=function(){return this.set({day:this.getDaysInMonth()});};Date.prototype.moveToDayOfWeek=function(day,orient){var diff=(day-this.getDay()+7*(orient||+1))%7;return this.addDays((diff===0)?diff+=7*(orient||+1):diff);};Date.prototype.moveToMonth=function(month,orient){var diff=(month-this.getMonth()+12*(orient||+1))%12;return this.addMonths((diff===0)?diff+=12*(orient||+1):diff);};Date.prototype.getDayOfYear=function(){return Math.floor((this-new Date(this.getFullYear(),0,1))/86400000);};Date.prototype.getWeekOfYear=function(firstDayOfWeek){var y=this.getFullYear(),m=this.getMonth(),d=this.getDate();var dow=firstDayOfWeek||Date.CultureInfo.firstDayOfWeek;var offset=7+1-new Date(y,0,1).getDay();if(offset==8){offset=1;}
|
| 58 |
+
var daynum=((Date.UTC(y,m,d,0,0,0)-Date.UTC(y,0,1,0,0,0))/86400000)+1;var w=Math.floor((daynum-offset+7)/7);if(w===dow){y--;var prevOffset=7+1-new Date(y,0,1).getDay();if(prevOffset==2||prevOffset==8){w=53;}else{w=52;}}
|
| 59 |
+
return w;};Date.prototype.isDST=function(){console.log('isDST');return this.toString().match(/(E|C|M|P)(S|D)T/)[2]=="D";};Date.prototype.getTimezone=function(){return Date.getTimezoneAbbreviation(this.getUTCOffset,this.isDST());};Date.prototype.setTimezoneOffset=function(s){var here=this.getTimezoneOffset(),there=Number(s)*-6/10;this.addMinutes(there-here);return this;};Date.prototype.setTimezone=function(s){return this.setTimezoneOffset(Date.getTimezoneOffset(s));};Date.prototype.getUTCOffset=function(){var n=this.getTimezoneOffset()*-10/6,r;if(n<0){r=(n-10000).toString();return r[0]+r.substr(2);}else{r=(n+10000).toString();return"+"+r.substr(1);}};Date.prototype.getDayName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedDayNames[this.getDay()]:Date.CultureInfo.dayNames[this.getDay()];};Date.prototype.getMonthName=function(abbrev){return abbrev?Date.CultureInfo.abbreviatedMonthNames[this.getMonth()]:Date.CultureInfo.monthNames[this.getMonth()];};Date.prototype._toString=Date.prototype.toString;Date.prototype.toString=function(format){var self=this;var p=function p(s){return(s.toString().length==1)?"0"+s:s;};return format?format.replace(/dd?d?d?|MM?M?M?|yy?y?y?|hh?|HH?|mm?|ss?|tt?|zz?z?/g,function(format){switch(format){case"hh":return p(self.getHours()<13?self.getHours():(self.getHours()-12));case"h":return self.getHours()<13?self.getHours():(self.getHours()-12);case"HH":return p(self.getHours());case"H":return self.getHours();case"mm":return p(self.getMinutes());case"m":return self.getMinutes();case"ss":return p(self.getSeconds());case"s":return self.getSeconds();case"yyyy":return self.getFullYear();case"yy":return self.getFullYear().toString().substring(2,4);case"dddd":return self.getDayName();case"ddd":return self.getDayName(true);case"dd":return p(self.getDate());case"d":return self.getDate().toString();case"MMMM":return self.getMonthName();case"MMM":return self.getMonthName(true);case"MM":return p((self.getMonth()+1));case"M":return self.getMonth()+1;case"t":return self.getHours()<12?Date.CultureInfo.amDesignator.substring(0,1):Date.CultureInfo.pmDesignator.substring(0,1);case"tt":return self.getHours()<12?Date.CultureInfo.amDesignator:Date.CultureInfo.pmDesignator;case"zzz":case"zz":case"z":return"";}}):this._toString();};
|
| 60 |
+
Date.now=function(){return new Date();};Date.today=function(){return Date.now().clearTime();};Date.prototype._orient=+1;Date.prototype.next=function(){this._orient=+1;return this;};Date.prototype.last=Date.prototype.prev=Date.prototype.previous=function(){this._orient=-1;return this;};Date.prototype._is=false;Date.prototype.is=function(){this._is=true;return this;};Number.prototype._dateElement="day";Number.prototype.fromNow=function(){var c={};c[this._dateElement]=this;return Date.now().add(c);};Number.prototype.ago=function(){var c={};c[this._dateElement]=this*-1;return Date.now().add(c);};(function(){var $D=Date.prototype,$N=Number.prototype;var dx=("sunday monday tuesday wednesday thursday friday saturday").split(/\s/),mx=("january february march april may june july august september october november december").split(/\s/),px=("Millisecond Second Minute Hour Day Week Month Year").split(/\s/),de;var df=function(n){return function(){if(this._is){this._is=false;return this.getDay()==n;}
|
| 61 |
+
return this.moveToDayOfWeek(n,this._orient);};};for(var i=0;i<dx.length;i++){$D[dx[i]]=$D[dx[i].substring(0,3)]=df(i);}
|
| 62 |
+
var mf=function(n){return function(){if(this._is){this._is=false;return this.getMonth()===n;}
|
| 63 |
+
return this.moveToMonth(n,this._orient);};};for(var j=0;j<mx.length;j++){$D[mx[j]]=$D[mx[j].substring(0,3)]=mf(j);}
|
| 64 |
+
var ef=function(j){return function(){if(j.substring(j.length-1)!="s"){j+="s";}
|
| 65 |
+
return this["add"+j](this._orient);};};var nf=function(n){return function(){this._dateElement=n;return this;};};for(var k=0;k<px.length;k++){de=px[k].toLowerCase();$D[de]=$D[de+"s"]=ef(px[k]);$N[de]=$N[de+"s"]=nf(de);}}());Date.prototype.toJSONString=function(){return this.toString("yyyy-MM-ddThh:mm:ssZ");};Date.prototype.toShortDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortDatePattern);};Date.prototype.toLongDateString=function(){return this.toString(Date.CultureInfo.formatPatterns.longDatePattern);};Date.prototype.toShortTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.shortTimePattern);};Date.prototype.toLongTimeString=function(){return this.toString(Date.CultureInfo.formatPatterns.longTimePattern);};Date.prototype.getOrdinal=function(){switch(this.getDate()){case 1:case 21:case 31:return"st";case 2:case 22:return"nd";case 3:case 23:return"rd";default:return"th";}};
|
| 66 |
+
(function(){Date.Parsing={Exception:function(s){this.message="Parse error at '"+s.substring(0,10)+" ...'";}};var $P=Date.Parsing;var _=$P.Operators={rtoken:function(r){return function(s){var mx=s.match(r);if(mx){return([mx[0],s.substring(mx[0].length)]);}else{throw new $P.Exception(s);}};},token:function(s){return function(s){return _.rtoken(new RegExp("^\s*"+s+"\s*"))(s);};},stoken:function(s){return _.rtoken(new RegExp("^"+s));},until:function(p){return function(s){var qx=[],rx=null;while(s.length){try{rx=p.call(this,s);}catch(e){qx.push(rx[0]);s=rx[1];continue;}
|
| 67 |
+
break;}
|
| 68 |
+
return[qx,s];};},many:function(p){return function(s){var rx=[],r=null;while(s.length){try{r=p.call(this,s);}catch(e){return[rx,s];}
|
| 69 |
+
rx.push(r[0]);s=r[1];}
|
| 70 |
+
return[rx,s];};},optional:function(p){return function(s){var r=null;try{r=p.call(this,s);}catch(e){return[null,s];}
|
| 71 |
+
return[r[0],r[1]];};},not:function(p){return function(s){try{p.call(this,s);}catch(e){return[null,s];}
|
| 72 |
+
throw new $P.Exception(s);};},ignore:function(p){return p?function(s){var r=null;r=p.call(this,s);return[null,r[1]];}:null;},product:function(){var px=arguments[0],qx=Array.prototype.slice.call(arguments,1),rx=[];for(var i=0;i<px.length;i++){rx.push(_.each(px[i],qx));}
|
| 73 |
+
return rx;},cache:function(rule){var cache={},r=null;return function(s){try{r=cache[s]=(cache[s]||rule.call(this,s));}catch(e){r=cache[s]=e;}
|
| 74 |
+
if(r instanceof $P.Exception){throw r;}else{return r;}};},any:function(){var px=arguments;return function(s){var r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
|
| 75 |
+
try{r=(px[i].call(this,s));}catch(e){r=null;}
|
| 76 |
+
if(r){return r;}}
|
| 77 |
+
throw new $P.Exception(s);};},each:function(){var px=arguments;return function(s){var rx=[],r=null;for(var i=0;i<px.length;i++){if(px[i]==null){continue;}
|
| 78 |
+
try{r=(px[i].call(this,s));}catch(e){throw new $P.Exception(s);}
|
| 79 |
+
rx.push(r[0]);s=r[1];}
|
| 80 |
+
return[rx,s];};},all:function(){var px=arguments,_=_;return _.each(_.optional(px));},sequence:function(px,d,c){d=d||_.rtoken(/^\s*/);c=c||null;if(px.length==1){return px[0];}
|
| 81 |
+
return function(s){var r=null,q=null;var rx=[];for(var i=0;i<px.length;i++){try{r=px[i].call(this,s);}catch(e){break;}
|
| 82 |
+
rx.push(r[0]);try{q=d.call(this,r[1]);}catch(ex){q=null;break;}
|
| 83 |
+
s=q[1];}
|
| 84 |
+
if(!r){throw new $P.Exception(s);}
|
| 85 |
+
if(q){throw new $P.Exception(q[1]);}
|
| 86 |
+
if(c){try{r=c.call(this,r[1]);}catch(ey){throw new $P.Exception(r[1]);}}
|
| 87 |
+
return[rx,(r?r[1]:s)];};},between:function(d1,p,d2){d2=d2||d1;var _fn=_.each(_.ignore(d1),p,_.ignore(d2));return function(s){var rx=_fn.call(this,s);return[[rx[0][0],r[0][2]],rx[1]];};},list:function(p,d,c){d=d||_.rtoken(/^\s*/);c=c||null;return(p instanceof Array?_.each(_.product(p.slice(0,-1),_.ignore(d)),p.slice(-1),_.ignore(c)):_.each(_.many(_.each(p,_.ignore(d))),px,_.ignore(c)));},set:function(px,d,c){d=d||_.rtoken(/^\s*/);c=c||null;return function(s){var r=null,p=null,q=null,rx=null,best=[[],s],last=false;for(var i=0;i<px.length;i++){q=null;p=null;r=null;last=(px.length==1);try{r=px[i].call(this,s);}catch(e){continue;}
|
| 88 |
+
rx=[[r[0]],r[1]];if(r[1].length>0&&!last){try{q=d.call(this,r[1]);}catch(ex){last=true;}}else{last=true;}
|
| 89 |
+
if(!last&&q[1].length===0){last=true;}
|
| 90 |
+
if(!last){var qx=[];for(var j=0;j<px.length;j++){if(i!=j){qx.push(px[j]);}}
|
| 91 |
+
p=_.set(qx,d).call(this,q[1]);if(p[0].length>0){rx[0]=rx[0].concat(p[0]);rx[1]=p[1];}}
|
| 92 |
+
if(rx[1].length<best[1].length){best=rx;}
|
| 93 |
+
if(best[1].length===0){break;}}
|
| 94 |
+
if(best[0].length===0){return best;}
|
| 95 |
+
if(c){try{q=c.call(this,best[1]);}catch(ey){throw new $P.Exception(best[1]);}
|
| 96 |
+
best[1]=q[1];}
|
| 97 |
+
return best;};},forward:function(gr,fname){return function(s){return gr[fname].call(this,s);};},replace:function(rule,repl){return function(s){var r=rule.call(this,s);return[repl,r[1]];};},process:function(rule,fn){return function(s){var r=rule.call(this,s);return[fn.call(this,r[0]),r[1]];};},min:function(min,rule){return function(s){var rx=rule.call(this,s);if(rx[0].length<min){throw new $P.Exception(s);}
|
| 98 |
+
return rx;};}};var _generator=function(op){return function(){var args=null,rx=[];if(arguments.length>1){args=Array.prototype.slice.call(arguments);}else if(arguments[0]instanceof Array){args=arguments[0];}
|
| 99 |
+
if(args){for(var i=0,px=args.shift();i<px.length;i++){args.unshift(px[i]);rx.push(op.apply(null,args));args.shift();return rx;}}else{return op.apply(null,arguments);}};};var gx="optional not ignore cache".split(/\s/);for(var i=0;i<gx.length;i++){_[gx[i]]=_generator(_[gx[i]]);}
|
| 100 |
+
var _vector=function(op){return function(){if(arguments[0]instanceof Array){return op.apply(null,arguments[0]);}else{return op.apply(null,arguments);}};};var vx="each any all".split(/\s/);for(var j=0;j<vx.length;j++){_[vx[j]]=_vector(_[vx[j]]);}}());(function(){var flattenAndCompact=function(ax){var rx=[];for(var i=0;i<ax.length;i++){if(ax[i]instanceof Array){rx=rx.concat(flattenAndCompact(ax[i]));}else{if(ax[i]){rx.push(ax[i]);}}}
|
| 101 |
+
return rx;};Date.Grammar={};Date.Translator={hour:function(s){return function(){this.hour=Number(s);};},minute:function(s){return function(){this.minute=Number(s);};},second:function(s){return function(){this.second=Number(s);};},meridian:function(s){return function(){this.meridian=s.slice(0,1).toLowerCase();};},timezone:function(s){return function(){var n=s.replace(/[^\d\+\-]/g,"");if(n.length){this.timezoneOffset=Number(n);}else{this.timezone=s.toLowerCase();}};},day:function(x){var s=x[0];return function(){this.day=Number(s.match(/\d+/)[0]);};},month:function(s){return function(){this.month=((s.length==3)?Date.getMonthNumberFromName(s):(Number(s)-1));};},year:function(s){return function(){var n=Number(s);this.year=((s.length>2)?n:(n+(((n+2000)<Date.CultureInfo.twoDigitYearMax)?2000:1900)));};},rday:function(s){return function(){switch(s){case"yesterday":this.days=-1;break;case"tomorrow":this.days=1;break;case"today":this.days=0;break;case"now":this.days=0;this.now=true;break;}};},finishExact:function(x){x=(x instanceof Array)?x:[x];var now=new Date();this.year=now.getFullYear();this.month=now.getMonth();this.day=1;this.hour=0;this.minute=0;this.second=0;for(var i=0;i<x.length;i++){if(x[i]){x[i].call(this);}}
|
| 102 |
+
this.hour=(this.meridian=="p"&&this.hour<13)?this.hour+12:this.hour;if(this.day>Date.getDaysInMonth(this.year,this.month)){throw new RangeError(this.day+" is not a valid value for days.");}
|
| 103 |
+
var r=new Date(this.year,this.month,this.day,this.hour,this.minute,this.second);if(this.timezone){r.set({timezone:this.timezone});}else if(this.timezoneOffset){r.set({timezoneOffset:this.timezoneOffset});}
|
| 104 |
+
return r;},finish:function(x){x=(x instanceof Array)?flattenAndCompact(x):[x];if(x.length===0){return null;}
|
| 105 |
+
for(var i=0;i<x.length;i++){if(typeof x[i]=="function"){x[i].call(this);}}
|
| 106 |
+
if(this.now){return new Date();}
|
| 107 |
+
var today=Date.today();var method=null;var expression=!!(this.days!=null||this.orient||this.operator);if(expression){var gap,mod,orient;orient=((this.orient=="past"||this.operator=="subtract")?-1:1);if(this.weekday){this.unit="day";gap=(Date.getDayNumberFromName(this.weekday)-today.getDay());mod=7;this.days=gap?((gap+(orient*mod))%mod):(orient*mod);}
|
| 108 |
+
if(this.month){this.unit="month";gap=(this.month-today.getMonth());mod=12;this.months=gap?((gap+(orient*mod))%mod):(orient*mod);this.month=null;}
|
| 109 |
+
if(!this.unit){this.unit="day";}
|
| 110 |
+
if(this[this.unit+"s"]==null||this.operator!=null){if(!this.value){this.value=1;}
|
| 111 |
+
if(this.unit=="week"){this.unit="day";this.value=this.value*7;}
|
| 112 |
+
this[this.unit+"s"]=this.value*orient;}
|
| 113 |
+
return today.add(this);}else{if(this.meridian&&this.hour){this.hour=(this.hour<13&&this.meridian=="p")?this.hour+12:this.hour;}
|
| 114 |
+
if(this.weekday&&!this.day){this.day=(today.addDays((Date.getDayNumberFromName(this.weekday)-today.getDay()))).getDate();}
|
| 115 |
+
if(this.month&&!this.day){this.day=1;}
|
| 116 |
+
return today.set(this);}}};var _=Date.Parsing.Operators,g=Date.Grammar,t=Date.Translator,_fn;g.datePartDelimiter=_.rtoken(/^([\s\-\.\,\/\x27]+)/);g.timePartDelimiter=_.stoken(":");g.whiteSpace=_.rtoken(/^\s*/);g.generalDelimiter=_.rtoken(/^(([\s\,]|at|on)+)/);var _C={};g.ctoken=function(keys){var fn=_C[keys];if(!fn){var c=Date.CultureInfo.regexPatterns;var kx=keys.split(/\s+/),px=[];for(var i=0;i<kx.length;i++){px.push(_.replace(_.rtoken(c[kx[i]]),kx[i]));}
|
| 117 |
+
fn=_C[keys]=_.any.apply(null,px);}
|
| 118 |
+
return fn;};g.ctoken2=function(key){return _.rtoken(Date.CultureInfo.regexPatterns[key]);};g.h=_.cache(_.process(_.rtoken(/^(0[0-9]|1[0-2]|[1-9])/),t.hour));g.hh=_.cache(_.process(_.rtoken(/^(0[0-9]|1[0-2])/),t.hour));g.H=_.cache(_.process(_.rtoken(/^([0-1][0-9]|2[0-3]|[0-9])/),t.hour));g.HH=_.cache(_.process(_.rtoken(/^([0-1][0-9]|2[0-3])/),t.hour));g.m=_.cache(_.process(_.rtoken(/^([0-5][0-9]|[0-9])/),t.minute));g.mm=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.minute));g.s=_.cache(_.process(_.rtoken(/^([0-5][0-9]|[0-9])/),t.second));g.ss=_.cache(_.process(_.rtoken(/^[0-5][0-9]/),t.second));g.hms=_.cache(_.sequence([g.H,g.mm,g.ss],g.timePartDelimiter));g.t=_.cache(_.process(g.ctoken2("shortMeridian"),t.meridian));g.tt=_.cache(_.process(g.ctoken2("longMeridian"),t.meridian));g.z=_.cache(_.process(_.rtoken(/^(\+|\-)?\s*\d\d\d\d?/),t.timezone));g.zz=_.cache(_.process(_.rtoken(/^(\+|\-)\s*\d\d\d\d/),t.timezone));g.zzz=_.cache(_.process(g.ctoken2("timezone"),t.timezone));g.timeSuffix=_.each(_.ignore(g.whiteSpace),_.set([g.tt,g.zzz]));g.time=_.each(_.optional(_.ignore(_.stoken("T"))),g.hms,g.timeSuffix);g.d=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d|3[0-1]|\d)/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.dd=_.cache(_.process(_.each(_.rtoken(/^([0-2]\d|3[0-1])/),_.optional(g.ctoken2("ordinalSuffix"))),t.day));g.ddd=g.dddd=_.cache(_.process(g.ctoken("sun mon tue wed thu fri sat"),function(s){return function(){this.weekday=s;};}));g.M=_.cache(_.process(_.rtoken(/^(1[0-2]|0\d|\d)/),t.month));g.MM=_.cache(_.process(_.rtoken(/^(1[0-2]|0\d)/),t.month));g.MMM=g.MMMM=_.cache(_.process(g.ctoken("jan feb mar apr may jun jul aug sep oct nov dec"),t.month));g.y=_.cache(_.process(_.rtoken(/^(\d\d?)/),t.year));g.yy=_.cache(_.process(_.rtoken(/^(\d\d)/),t.year));g.yyy=_.cache(_.process(_.rtoken(/^(\d\d?\d?\d?)/),t.year));g.yyyy=_.cache(_.process(_.rtoken(/^(\d\d\d\d)/),t.year));_fn=function(){return _.each(_.any.apply(null,arguments),_.not(g.ctoken2("timeContext")));};g.day=_fn(g.d,g.dd);g.month=_fn(g.M,g.MMM);g.year=_fn(g.yyyy,g.yy);g.orientation=_.process(g.ctoken("past future"),function(s){return function(){this.orient=s;};});g.operator=_.process(g.ctoken("add subtract"),function(s){return function(){this.operator=s;};});g.rday=_.process(g.ctoken("yesterday tomorrow today now"),t.rday);g.unit=_.process(g.ctoken("minute hour day week month year"),function(s){return function(){this.unit=s;};});g.value=_.process(_.rtoken(/^\d\d?(st|nd|rd|th)?/),function(s){return function(){this.value=s.replace(/\D/g,"");};});g.expression=_.set([g.rday,g.operator,g.value,g.unit,g.orientation,g.ddd,g.MMM]);_fn=function(){return _.set(arguments,g.datePartDelimiter);};g.mdy=_fn(g.ddd,g.month,g.day,g.year);g.ymd=_fn(g.ddd,g.year,g.month,g.day);g.dmy=_fn(g.ddd,g.day,g.month,g.year);g.date=function(s){return((g[Date.CultureInfo.dateElementOrder]||g.mdy).call(this,s));};g.format=_.process(_.many(_.any(_.process(_.rtoken(/^(dd?d?d?|MM?M?M?|yy?y?y?|hh?|HH?|mm?|ss?|tt?|zz?z?)/),function(fmt){if(g[fmt]){return g[fmt];}else{throw Date.Parsing.Exception(fmt);}}),_.process(_.rtoken(/^[^dMyhHmstz]+/),function(s){return _.ignore(_.stoken(s));}))),function(rules){return _.process(_.each.apply(null,rules),t.finishExact);});var _F={};var _get=function(f){return _F[f]=(_F[f]||g.format(f)[0]);};g.formats=function(fx){if(fx instanceof Array){var rx=[];for(var i=0;i<fx.length;i++){rx.push(_get(fx[i]));}
|
| 119 |
+
return _.any.apply(null,rx);}else{return _get(fx);}};g._formats=g.formats(["yyyy-MM-ddTHH:mm:ss","ddd, MMM dd, yyyy H:mm:ss tt","ddd MMM d yyyy HH:mm:ss zzz","d"]);g._start=_.process(_.set([g.date,g.time,g.expression],g.generalDelimiter,g.whiteSpace),t.finish);g.start=function(s){try{var r=g._formats.call({},s);if(r[1].length===0){return r;}}catch(e){}
|
| 120 |
+
return g._start.call({},s);};}());Date._parse=Date.parse;Date.parse=function(s){var r=null;if(!s){return null;}
|
| 121 |
+
try{r=Date.Grammar.start.call({},s);}catch(e){return null;}
|
| 122 |
+
return((r[1].length===0)?r[0]:null);};Date.getParseFunction=function(fx){var fn=Date.Grammar.formats(fx);return function(s){var r=null;try{r=fn.call({},s);}catch(e){return null;}
|
| 123 |
+
return((r[1].length===0)?r[0]:null);};};Date.parseExact=function(s,fx){return Date.getParseFunction(fx)(s);};
|
| 124 |
+
/* End Safari Date fixes */
|
| 125 |
+
|
| 126 |
+
/* Count number of session visits */
|
| 127 |
+
function countProperties(obj) {
|
| 128 |
+
var count = 0;
|
| 129 |
+
|
| 130 |
+
for(var prop in obj) {
|
| 131 |
+
if(obj.hasOwnProperty(prop))
|
| 132 |
+
++count;
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
return count;
|
| 136 |
+
}
|
| 137 |
+
|
| 138 |
+
/* Generate tracking uid */
|
| 139 |
+
function generate_session_id(length) {
|
| 140 |
+
var chars = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXTZabcdefghiklmnopqrstuvwxyz'.split('');
|
| 141 |
+
|
| 142 |
+
if (! length) {
|
| 143 |
+
length = Math.floor(Math.random() * chars.length);
|
| 144 |
+
}
|
| 145 |
+
|
| 146 |
+
var str = '';
|
| 147 |
+
for (var i = 0; i < length; i++) {
|
| 148 |
+
str += chars[Math.floor(Math.random() * chars.length)];
|
| 149 |
+
}
|
| 150 |
+
return str;
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
/* Function for adding minutes to current time */
|
| 154 |
+
function add_page_timeout(date, minutes) {
|
| 155 |
+
return new Date(date.getTime() + minutes*60000);
|
| 156 |
+
}
|
| 157 |
+
|
| 158 |
+
/* Date Format 1.2.3 */
|
| 159 |
+
var dateFormat = function () {
|
| 160 |
+
var token = /d{1,4}|m{1,4}|yy(?:yy)?|([HhMsTt])\1?|[LloSZ]|"[^"]*"|'[^']*'/g,
|
| 161 |
+
timezone = /\b(?:[PMCEA][SDP]T|(?:Pacific|Mountain|Central|Eastern|Atlantic) (?:Standard|Daylight|Prevailing) Time|(?:GMT|UTC)(?:[-+]\d{4})?)\b/g,
|
| 162 |
+
timezoneClip = /[^-+\dA-Z]/g,
|
| 163 |
+
pad = function (val, len) {
|
| 164 |
+
val = String(val);
|
| 165 |
+
len = len || 2;
|
| 166 |
+
while (val.length < len) val = "0" + val;
|
| 167 |
+
return val;
|
| 168 |
+
};
|
| 169 |
+
|
| 170 |
+
// Regexes and supporting functions are cached through closure
|
| 171 |
+
return function (date, mask, utc) {
|
| 172 |
+
var dF = dateFormat;
|
| 173 |
+
|
| 174 |
+
// You can't provide utc if you skip other args (use the "UTC:" mask prefix)
|
| 175 |
+
if (arguments.length == 1 && Object.prototype.toString.call(date) == "[object String]" && !/\d/.test(date)) {
|
| 176 |
+
mask = date;
|
| 177 |
+
date = undefined;
|
| 178 |
+
}
|
| 179 |
+
|
| 180 |
+
// Passing date through Date applies Date.parse, if necessary
|
| 181 |
+
date = date ? new Date(date) : new Date;
|
| 182 |
+
if (isNaN(date)) throw SyntaxError("invalid date");
|
| 183 |
+
|
| 184 |
+
mask = String(dF.masks[mask] || mask || dF.masks["default"]);
|
| 185 |
+
|
| 186 |
+
// Allow setting the utc argument via the mask
|
| 187 |
+
if (mask.slice(0, 4) == "UTC:") {
|
| 188 |
+
mask = mask.slice(4);
|
| 189 |
+
utc = true;
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
var _ = utc ? "getUTC" : "get",
|
| 193 |
+
d = date[_ + "Date"](),
|
| 194 |
+
D = date[_ + "Day"](),
|
| 195 |
+
m = date[_ + "Month"](),
|
| 196 |
+
y = date[_ + "FullYear"](),
|
| 197 |
+
H = date[_ + "Hours"](),
|
| 198 |
+
M = date[_ + "Minutes"](),
|
| 199 |
+
s = date[_ + "Seconds"](),
|
| 200 |
+
L = date[_ + "Milliseconds"](),
|
| 201 |
+
o = utc ? 0 : date.getTimezoneOffset(),
|
| 202 |
+
flags = {
|
| 203 |
+
d: d,
|
| 204 |
+
dd: pad(d),
|
| 205 |
+
ddd: dF.i18n.dayNames[D],
|
| 206 |
+
dddd: dF.i18n.dayNames[D + 7],
|
| 207 |
+
m: m + 1,
|
| 208 |
+
mm: pad(m + 1),
|
| 209 |
+
mmm: dF.i18n.monthNames[m],
|
| 210 |
+
mmmm: dF.i18n.monthNames[m + 12],
|
| 211 |
+
yy: String(y).slice(2),
|
| 212 |
+
yyyy: y,
|
| 213 |
+
h: H % 12 || 12,
|
| 214 |
+
hh: pad(H % 12 || 12),
|
| 215 |
+
H: H,
|
| 216 |
+
HH: pad(H),
|
| 217 |
+
M: M,
|
| 218 |
+
MM: pad(M),
|
| 219 |
+
s: s,
|
| 220 |
+
ss: pad(s),
|
| 221 |
+
l: pad(L, 3),
|
| 222 |
+
L: pad(L > 99 ? Math.round(L / 10) : L),
|
| 223 |
+
t: H < 12 ? "a" : "p",
|
| 224 |
+
tt: H < 12 ? "am" : "pm",
|
| 225 |
+
T: H < 12 ? "A" : "P",
|
| 226 |
+
TT: H < 12 ? "AM" : "PM",
|
| 227 |
+
Z: utc ? "UTC" : (String(date).match(timezone) || [""]).pop().replace(timezoneClip, ""),
|
| 228 |
+
o: (o > 0 ? "-" : "+") + pad(Math.floor(Math.abs(o) / 60) * 100 + Math.abs(o) % 60, 4),
|
| 229 |
+
S: ["th", "st", "nd", "rd"][d % 10 > 3 ? 0 : (d % 100 - d % 10 != 10) * d % 10]
|
| 230 |
+
};
|
| 231 |
+
|
| 232 |
+
return mask.replace(token, function ($0) {
|
| 233 |
+
return $0 in flags ? flags[$0] : $0.slice(1, $0.length - 1);
|
| 234 |
+
});
|
| 235 |
+
};
|
| 236 |
+
}();
|
| 237 |
+
|
| 238 |
+
// Some common format strings
|
| 239 |
+
dateFormat.masks = {
|
| 240 |
+
"default": "ddd mmm dd yyyy HH:MM:ss",
|
| 241 |
+
shortDate: "m/d/yy",
|
| 242 |
+
mediumDate: "mmm d, yyyy",
|
| 243 |
+
longDate: "mmmm d, yyyy",
|
| 244 |
+
fullDate: "dddd, mmmm d, yyyy",
|
| 245 |
+
shortTime: "h:MM TT",
|
| 246 |
+
mediumTime: "h:MM:ss TT",
|
| 247 |
+
longTime: "h:MM:ss TT Z",
|
| 248 |
+
isoDate: "yyyy-mm-dd",
|
| 249 |
+
isoTime: "HH:MM:ss",
|
| 250 |
+
isoDateTime: "yyyy-mm-dd'T'HH:MM:ss",
|
| 251 |
+
isoUtcDateTime: "UTC:yyyy-mm-dd'T'HH:MM:ss'Z'"
|
| 252 |
+
};
|
| 253 |
+
|
| 254 |
+
// Internationalization strings
|
| 255 |
+
dateFormat.i18n = {
|
| 256 |
+
dayNames: [
|
| 257 |
+
"Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat",
|
| 258 |
+
"Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"
|
| 259 |
+
],
|
| 260 |
+
monthNames: [
|
| 261 |
+
"Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec",
|
| 262 |
+
"January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"
|
| 263 |
+
]
|
| 264 |
+
};
|
| 265 |
+
|
| 266 |
+
// For convenience...
|
| 267 |
+
Date.prototype.format = function (mask, utc) {
|
| 268 |
+
return dateFormat(this, mask, utc);
|
| 269 |
+
};
|
| 270 |
+
// Query String for utm params
|
| 271 |
+
/* Query String Stuff
|
| 272 |
+
|
| 273 |
+
var inbound_urlParams = {};
|
| 274 |
+
|
| 275 |
+
(function () {
|
| 276 |
+
var e,
|
| 277 |
+
d = function (s) { return decodeURIComponent(s).replace(/\+/g, " "); },
|
| 278 |
+
q = window.location.search.substring(1),
|
| 279 |
+
r = /([^&=]+)=?([^&]*)/g;
|
| 280 |
+
|
| 281 |
+
while (e = r.exec(q)) {
|
| 282 |
+
if (e[1].indexOf("[") == "-1")
|
| 283 |
+
inbound_urlParams[d(e[1])] = d(e[2]);
|
| 284 |
+
else {
|
| 285 |
+
var b1 = e[1].indexOf("["),
|
| 286 |
+
aN = e[1].slice(b1+1, e[1].indexOf("]", b1)),
|
| 287 |
+
pN = d(e[1].slice(0, b1));
|
| 288 |
+
|
| 289 |
+
if (typeof inbound_urlParams[pN] != "object")
|
| 290 |
+
inbound_urlParams[d(pN)] = {},
|
| 291 |
+
inbound_urlParams[d(pN)].length = 0;
|
| 292 |
+
|
| 293 |
+
if (aN)
|
| 294 |
+
inbound_urlParams[d(pN)][d(aN)] = d(e[2]);
|
| 295 |
+
else
|
| 296 |
+
Array.prototype.push.call(inbound_urlParams[d(pN)], d(e[2]));
|
| 297 |
+
|
| 298 |
+
}
|
| 299 |
+
}
|
| 300 |
+
})();
|
| 301 |
+
|
| 302 |
+
if (JSON) {
|
| 303 |
+
result = JSON.stringify(inbound_urlParams, null, 4);
|
| 304 |
+
|
| 305 |
+
for (var k in inbound_urlParams) {
|
| 306 |
+
if (typeof inbound_urlParams[k] == "object") {
|
| 307 |
+
for (var k2 in inbound_urlParams[k])
|
| 308 |
+
jQuery.cookie(k2, inbound_urlParams[k][k2], { expires: 365 });
|
| 309 |
+
console.log(k2);
|
| 310 |
+
console.log(inbound_urlParams[k][k2]);
|
| 311 |
+
} else {
|
| 312 |
+
jQuery.cookie(k, inbound_urlParams[k], { expires: 365 }); }
|
| 313 |
+
console.log(k);
|
| 314 |
+
console.log(inbound_urlParams[k]);
|
| 315 |
+
}
|
| 316 |
+
|
| 317 |
+
}
|
| 318 |
+
*/
|
| 319 |
+
|
| 320 |
+
/* Set Lead UID */
|
| 321 |
+
if(jQuery.cookie("wp_lead_uid") === null) {
|
| 322 |
+
var wp_lead_uid_val = generate_session_id(35);
|
| 323 |
+
jQuery.cookie("wp_lead_uid", wp_lead_uid_val, { path: '/', expires: 365 });
|
| 324 |
+
}
|
| 325 |
+
|
| 326 |
+
/* define vars */
|
| 327 |
+
var referrer = document.referrer;
|
| 328 |
+
var current_page = window.location.href;
|
| 329 |
+
var current_page_parts = current_page.split('#');
|
| 330 |
+
current_page = current_page_parts[0];
|
| 331 |
+
var parts = location.hostname.split('.');
|
| 332 |
+
var subdomain = parts.shift();
|
| 333 |
+
var upperleveldomain = parts.join('.');
|
| 334 |
+
var data_block = jQuery.parseJSON(jQuery.cookie('user_data_json'));
|
| 335 |
+
var date = new Date(wplft.track_time);
|
| 336 |
+
var datetime = wplft.track_time;
|
| 337 |
+
var the_time_out = add_page_timeout(date, .1);
|
| 338 |
+
var lead_uid = jQuery.cookie("wp_lead_uid");
|
| 339 |
+
var lead_id = jQuery.cookie("wp_lead_id");
|
| 340 |
+
var lead_email = jQuery.cookie("wp_lead_email");
|
| 341 |
+
|
| 342 |
+
/* Page View Object
|
| 343 |
+
This is a sessionless object with a 30 second timeout on identical page views */
|
| 344 |
+
var pageviewObj = jQuery.totalStorage('page_views');
|
| 345 |
+
var current_page_id = wplft.post_id;
|
| 346 |
+
if (typeof pageviewObj =='object' && pageviewObj)
|
| 347 |
+
{
|
| 348 |
+
// If pageviewObj exists, do this
|
| 349 |
+
var page_seen = pageviewObj[current_page_id];
|
| 350 |
+
if(typeof(page_seen) != "undefined" && page_seen !== null) {
|
| 351 |
+
var view_count = pageviewObj[current_page_id].length - 1;
|
| 352 |
+
var last_view = pageviewObj[current_page_id][view_count];
|
| 353 |
+
//console.log("last view" + last_view);
|
| 354 |
+
|
| 355 |
+
// Safari Timezone cleaners
|
| 356 |
+
var last_view = last_view.replace(/ UTC/);
|
| 357 |
+
var last_view = last_view.replace(/-/g, "/");
|
| 358 |
+
var last_view = last_view.replace(/undefined/g, "");
|
| 359 |
+
var datetime = datetime.replace(/ UTC/);
|
| 360 |
+
var datetime = datetime.replace(/-/g, "/");
|
| 361 |
+
var datetime = datetime.replace(/undefined/g, "");
|
| 362 |
+
|
| 363 |
+
|
| 364 |
+
var timeout = new Date(last_view).getTime() + 30*1000;
|
| 365 |
+
//console.log("timeout " + timeout);
|
| 366 |
+
var timeout = dateFormat(timeout, "yyyy-mm-dd hh:MM:ss");
|
| 367 |
+
var wait_time = Math.abs(Date.parse(last_view) - Date.parse(timeout)) // output timeout time 30sec;
|
| 368 |
+
var current_date = dateFormat(datetime, "yyyy-mm-dd hh:MM:ss");
|
| 369 |
+
var time_check = Math.abs(Date.parse(last_view) - Date.parse(current_date));
|
| 370 |
+
//console.log("Wait Time:" + wait_time);
|
| 371 |
+
//console.log("Time Check:" + time_check);
|
| 372 |
+
var page_tracking = wplft.page_tracking;
|
| 373 |
+
if (time_check < wait_time ){
|
| 374 |
+
console.log('time out happened');
|
| 375 |
+
pageviewObj[current_page_id].push(datetime); // log page view
|
| 376 |
+
// run page view update for timeout
|
| 377 |
+
if (typeof (lead_id) != "undefined" && lead_id != null && lead_id != "" && page_tracking == 'on') {
|
| 378 |
+
jQuery.ajax({
|
| 379 |
+
type: 'POST',
|
| 380 |
+
url: wplft.admin_url,
|
| 381 |
+
data: {
|
| 382 |
+
action: 'wpl_track_user',
|
| 383 |
+
wp_lead_uid: lead_uid,
|
| 384 |
+
wp_lead_id: lead_id,
|
| 385 |
+
page_id: current_page_id,
|
| 386 |
+
current_url: window.location.href,
|
| 387 |
+
json: '0'
|
| 388 |
+
},
|
| 389 |
+
success: function(user_id){
|
| 390 |
+
console.log('Page View Fired');
|
| 391 |
+
},
|
| 392 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 393 |
+
//alert(MLHttpRequest+' '+errorThrown+' '+textStatus);
|
| 394 |
+
//die();
|
| 395 |
+
}
|
| 396 |
+
|
| 397 |
+
});
|
| 398 |
+
}
|
| 399 |
+
// Check if refferrer not main site log the referall data in lead record
|
| 400 |
+
|
| 401 |
+
} else {
|
| 402 |
+
console.log('30 sec timeout not done: ' + Math.abs(wait_time - time_check)*.001 + " seconds left");
|
| 403 |
+
}
|
| 404 |
+
|
| 405 |
+
} else {
|
| 406 |
+
pageviewObj[current_page_id] = [];
|
| 407 |
+
pageviewObj[current_page_id].push(datetime);
|
| 408 |
+
if (typeof (lead_id) != "undefined" && lead_id != null && lead_id != "") {
|
| 409 |
+
jQuery.ajax({
|
| 410 |
+
type: 'POST',
|
| 411 |
+
url: wplft.admin_url,
|
| 412 |
+
data: {
|
| 413 |
+
action: 'wpl_track_user',
|
| 414 |
+
wp_lead_uid: lead_uid,
|
| 415 |
+
wp_lead_id: lead_id,
|
| 416 |
+
page_id: current_page_id,
|
| 417 |
+
current_url: window.location.href,
|
| 418 |
+
json: '0'
|
| 419 |
+
},
|
| 420 |
+
success: function(user_id){
|
| 421 |
+
console.log('Page View Fired');
|
| 422 |
+
},
|
| 423 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 424 |
+
//alert(MLHttpRequest+' '+errorThrown+' '+textStatus);
|
| 425 |
+
//die();
|
| 426 |
+
}
|
| 427 |
+
|
| 428 |
+
});
|
| 429 |
+
}
|
| 430 |
+
}
|
| 431 |
+
|
| 432 |
+
} else {
|
| 433 |
+
// Create initial pageviewObj
|
| 434 |
+
var pageviewObj = {};
|
| 435 |
+
pageviewObj[current_page_id] = [];
|
| 436 |
+
pageviewObj[current_page_id].push(datetime);
|
| 437 |
+
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
jQuery.totalStorage('page_views', pageviewObj);
|
| 441 |
+
// console.log(JSON.stringify(pageviewObj)) // output the pages viewed
|
| 442 |
+
/* End local storage */
|
| 443 |
+
|
| 444 |
+
/* Start Legacy Cookie Storage */
|
| 445 |
+
if (typeof data_block =='object' && data_block) {
|
| 446 |
+
var count = countProperties(data_block);
|
| 447 |
+
data_block.items.push({ id : count+1, current_page: current_page, timestamp: datetime, referrer: referrer});
|
| 448 |
+
jQuery.cookie('user_data_json', JSON.stringify(data_block), { expires: 1, path: '/' });
|
| 449 |
+
} else {
|
| 450 |
+
data_block = {items: [{id: '1', current_page: current_page,timestamp: datetime, referrer: referrer, original_referrer: referrer},]};
|
| 451 |
+
jQuery.cookie('user_data_json', JSON.stringify(data_block), { expires: 1, path: '/' });
|
| 452 |
+
}
|
| 453 |
+
/* run on ready */
|
| 454 |
+
jQuery(document).ready(function($) {
|
| 455 |
+
|
| 456 |
+
//record non conversion status
|
| 457 |
+
var wp_lead_uid = jQuery.cookie("wp_lead_uid");
|
| 458 |
+
var wp_lead_id = jQuery.cookie("wp_lead_id");
|
| 459 |
+
//var data_block = jQuery.parseJSON(trackObj);
|
| 460 |
+
var json = 0;
|
| 461 |
+
var page_id = inbound_ajax.page_id;
|
| 462 |
+
//console.log(page_id);
|
| 463 |
+
|
| 464 |
+
// Page view trigging moved to /shared/tracking/page-tracking.js
|
| 465 |
+
|
| 466 |
+
// Check for Lead lists
|
| 467 |
+
var expired = jQuery.cookie("lead_session_list_check"); // check for session
|
| 468 |
+
if (expired != "true") {
|
| 469 |
+
//var data_to_lookup = global-localized-vars;
|
| 470 |
+
if (typeof (wp_lead_id) != "undefined" && wp_lead_id != null && wp_lead_id != "") {
|
| 471 |
+
jQuery.ajax({
|
| 472 |
+
type: 'POST',
|
| 473 |
+
url: inbound_ajax.admin_url,
|
| 474 |
+
data: {
|
| 475 |
+
action: 'wpl_check_lists',
|
| 476 |
+
wp_lead_id: wp_lead_id,
|
| 477 |
+
|
| 478 |
+
},
|
| 479 |
+
success: function(user_id){
|
| 480 |
+
jQuery.cookie("lead_session_list_check", true, { path: '/', expires: 1 });
|
| 481 |
+
console.log("Lists checked");
|
| 482 |
+
},
|
| 483 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 484 |
+
|
| 485 |
+
}
|
| 486 |
+
|
| 487 |
+
});
|
| 488 |
+
}
|
| 489 |
+
}
|
| 490 |
+
/* end list check */
|
| 491 |
+
|
| 492 |
+
/* Set Expiration Date of Session Logging */
|
| 493 |
+
var e_date = new Date(); // Current date/time
|
| 494 |
+
var e_minutes = 30; // 30 minute timeout to reset sessions
|
| 495 |
+
e_date.setTime(e_date.getTime() + (e_minutes * 60 * 1000)); // Calc 30 minutes from now
|
| 496 |
+
jQuery.cookie("lead_session_expire", false, {expires: e_date, path: '/' }); // Set cookie on page loads
|
| 497 |
+
var expire_time = jQuery.cookie("lead_session_expire"); //
|
| 498 |
+
//console.log(expire_time);
|
| 499 |
+
var referrer_cookie = jQuery.cookie("wp_lead_referral_site");
|
| 500 |
+
if (typeof (referrer_cookie) === "undefined" || referrer_cookie === null || referrer_cookie === "") {
|
| 501 |
+
var referrer = document.referrer || "NA";
|
| 502 |
+
jQuery.cookie("wp_lead_referral_site", referrer, {expires: e_date, path: '/' }); // Set referral cookie
|
| 503 |
+
}
|
| 504 |
+
|
| 505 |
+
});
|
| 506 |
+
|
| 507 |
+
|
| 508 |
+
/* End Legacy Cookie Storage */
|
shared/assets/frontend/js/store.lead.ajax.js
ADDED
|
@@ -0,0 +1,495 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
var inbound_form_data = inbound_form_data || {};
|
| 2 |
+
// Ensure global _gaq Google Analytics queue has been initialized.
|
| 3 |
+
var _gaq = _gaq || [];
|
| 4 |
+
|
| 5 |
+
function add_inbound_form_class(el, value) {
|
| 6 |
+
//var value = value.replace(" ", "_");
|
| 7 |
+
//var value = value.replace("-", "_");
|
| 8 |
+
//el.addClass('inbound_map_value');
|
| 9 |
+
//el.attr('data-inbound-form-map', 'inbound_map_' + value);
|
| 10 |
+
}
|
| 11 |
+
|
| 12 |
+
function get_inbound_form_value(el) {
|
| 13 |
+
var value = el.value;
|
| 14 |
+
return value;
|
| 15 |
+
}
|
| 16 |
+
|
| 17 |
+
// Build Form Object
|
| 18 |
+
function inbound_map_fields(el, value, Obj) {
|
| 19 |
+
var formObj = [];
|
| 20 |
+
var $this = el;
|
| 21 |
+
var clean_output = value;
|
| 22 |
+
var label = $this.closest('label').text();
|
| 23 |
+
var exclude = ['credit-card']; // exlcude values from formObj
|
| 24 |
+
var inarray = jQuery.inArray(clean_output, exclude);
|
| 25 |
+
if(inarray == 0){
|
| 26 |
+
return null;
|
| 27 |
+
}
|
| 28 |
+
// Add items to formObj
|
| 29 |
+
formObj.push({
|
| 30 |
+
field_label: label,
|
| 31 |
+
field_name: $this.attr("name"),
|
| 32 |
+
field_value: $this.attr("value"),
|
| 33 |
+
field_id: $this.attr("id"),
|
| 34 |
+
field_class: $this.attr("class"),
|
| 35 |
+
field_type: $this.attr("type"),
|
| 36 |
+
match: clean_output,
|
| 37 |
+
js_selector: $this.attr("data-js-selector")
|
| 38 |
+
});
|
| 39 |
+
return formObj;
|
| 40 |
+
}
|
| 41 |
+
|
| 42 |
+
// Trim Whitespace
|
| 43 |
+
function trim(s) {
|
| 44 |
+
s = s.replace(/(^\s*)|(\s*$)/gi,"");
|
| 45 |
+
s = s.replace(/[ ]{2,}/gi," ");
|
| 46 |
+
s = s.replace(/\n /,"\n"); return s;
|
| 47 |
+
}
|
| 48 |
+
|
| 49 |
+
function inbound_ga_log_event(category, action, label) {
|
| 50 |
+
_gaq.push(['_trackEvent', category, action, label]);
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
// Run Form Mapper
|
| 54 |
+
// TODO check for already processesed fields via in_object_already
|
| 55 |
+
// check on the dupe value
|
| 56 |
+
function run_field_map_function(el, lookingfor) {
|
| 57 |
+
var return_form;
|
| 58 |
+
var formObj = new Array();
|
| 59 |
+
var $this = el;
|
| 60 |
+
var body = jQuery("body");
|
| 61 |
+
var this_val = $this.attr("value");
|
| 62 |
+
var array = lookingfor.split(",");
|
| 63 |
+
var array_length = array.length - 1;
|
| 64 |
+
|
| 65 |
+
// Main Loop
|
| 66 |
+
for (var i = 0; i < array.length; i++) {
|
| 67 |
+
var clean_output = trim(array[i]);
|
| 68 |
+
var nice_name = clean_output.replace(/^\s+|\s+$/g,'');
|
| 69 |
+
var nice_name = nice_name.replace(" ",'_');
|
| 70 |
+
var in_object_already = nice_name in inbound_form_data;
|
| 71 |
+
//console.log(clean_output);
|
| 72 |
+
|
| 73 |
+
// Look for attr name match
|
| 74 |
+
if ($this.attr("name").toLowerCase().indexOf(clean_output)>-1) {
|
| 75 |
+
var the_map = inbound_map_fields($this, clean_output, formObj);
|
| 76 |
+
add_inbound_form_class($this, clean_output);
|
| 77 |
+
console.log('match name: ' + clean_output);
|
| 78 |
+
console.log(nice_name in inbound_form_data);
|
| 79 |
+
if (!in_object_already) {
|
| 80 |
+
inbound_form_data[nice_name] = this_val;
|
| 81 |
+
}
|
| 82 |
+
}
|
| 83 |
+
// look for id match
|
| 84 |
+
else if ($this.attr("id").toLowerCase().indexOf(clean_output)>-1) {
|
| 85 |
+
var the_map = inbound_map_fields($this, clean_output, formObj);
|
| 86 |
+
add_inbound_form_class($this, clean_output);
|
| 87 |
+
console.log('match id: ' + clean_output);
|
| 88 |
+
if (!in_object_already) {
|
| 89 |
+
inbound_form_data[nice_name] = this_val;
|
| 90 |
+
}
|
| 91 |
+
}
|
| 92 |
+
// Look for label name match
|
| 93 |
+
else if ($this.closest('li').children('label').length>0)
|
| 94 |
+
{
|
| 95 |
+
if ($this.closest('li').children('label').html().toLowerCase().indexOf(clean_output)>-1)
|
| 96 |
+
{
|
| 97 |
+
var the_map = inbound_map_fields($this, clean_output, formObj);
|
| 98 |
+
add_inbound_form_class($this, clean_output);
|
| 99 |
+
console.log($this.context);
|
| 100 |
+
|
| 101 |
+
var exists_in_dom = body.find("[data-inbound-form-map='inbound_map_" + nice_name + "']").length;
|
| 102 |
+
console.log(exists_in_dom);
|
| 103 |
+
console.log('match li: ' + clean_output);
|
| 104 |
+
if (!in_object_already) {
|
| 105 |
+
inbound_form_data[nice_name] = this_val;
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
}
|
| 109 |
+
}
|
| 110 |
+
// Look for closest div label name match
|
| 111 |
+
else if ($this.closest('div').children('label').length>0)
|
| 112 |
+
{
|
| 113 |
+
if ($this.closest('div').children('label').html().toLowerCase().indexOf(clean_output)>-1)
|
| 114 |
+
{
|
| 115 |
+
var the_map = inbound_map_fields($this, clean_output, formObj);
|
| 116 |
+
add_inbound_form_class($this, clean_output);
|
| 117 |
+
console.log('match div: ' + clean_output);
|
| 118 |
+
if (!in_object_already) {
|
| 119 |
+
inbound_form_data[nice_name] = this_val;
|
| 120 |
+
}
|
| 121 |
+
}
|
| 122 |
+
} else {
|
| 123 |
+
// regex check?
|
| 124 |
+
return false;
|
| 125 |
+
}
|
| 126 |
+
}
|
| 127 |
+
return_form = the_map;
|
| 128 |
+
|
| 129 |
+
return inbound_form_data;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
+
function return_mapped_values(this_form) {
|
| 133 |
+
// Map form fields
|
| 134 |
+
jQuery(this_form).find('input[type=text],input[type=email],textarea,select').each(function() {
|
| 135 |
+
var this_input = jQuery(this);
|
| 136 |
+
if (this.value) {
|
| 137 |
+
var inbound_form_data = run_field_map_function( this_input, "name, first name, last name, email, e-mail, phone, website, job title, company, tele, address");
|
| 138 |
+
}
|
| 139 |
+
return inbound_form_data;
|
| 140 |
+
});
|
| 141 |
+
return inbound_form_data;
|
| 142 |
+
}
|
| 143 |
+
|
| 144 |
+
function merge_form_options(obj1,obj2){
|
| 145 |
+
var obj3 = {};
|
| 146 |
+
for (var attrname in obj1) { obj3[attrname] = obj1[attrname]; }
|
| 147 |
+
for (var attrname in obj2) { obj3[attrname] = obj2[attrname]; }
|
| 148 |
+
return obj3;
|
| 149 |
+
}
|
| 150 |
+
|
| 151 |
+
function release_form_sub(this_form, element_type){
|
| 152 |
+
jQuery('body, button, input, input[type="button"]').css('cursor', 'default');
|
| 153 |
+
|
| 154 |
+
if (element_type=='FORM') {
|
| 155 |
+
this_form.unbind('submit');
|
| 156 |
+
this_form.submit();
|
| 157 |
+
}
|
| 158 |
+
|
| 159 |
+
if (element_type=='A') {
|
| 160 |
+
this_form.unbind('wpl-track-me');
|
| 161 |
+
|
| 162 |
+
if (a_href) {
|
| 163 |
+
window.location = a_href;
|
| 164 |
+
} else {
|
| 165 |
+
location.reload();
|
| 166 |
+
}
|
| 167 |
+
}
|
| 168 |
+
}
|
| 169 |
+
|
| 170 |
+
jQuery(document).ready(function($) {
|
| 171 |
+
/* Core Inbound Form Tracking Script */
|
| 172 |
+
jQuery("body").on('submit', '.wpl-track-me', function (e) {
|
| 173 |
+
|
| 174 |
+
this_form = jQuery(this);
|
| 175 |
+
element_type = 'FORM';
|
| 176 |
+
|
| 177 |
+
// process form only once
|
| 178 |
+
processed = this_form.hasClass('lead_processed');
|
| 179 |
+
if (processed === true) {
|
| 180 |
+
return;
|
| 181 |
+
}
|
| 182 |
+
// halt normal form submission
|
| 183 |
+
$('body, button, input[type="button"], input').css('cursor', 'wait');
|
| 184 |
+
e.preventDefault();
|
| 185 |
+
|
| 186 |
+
// Email Validation Check
|
| 187 |
+
var inbound_form_exists = $("#inbound-form-wrapper").length;
|
| 188 |
+
var email_validation = $(".inbound-email.invalid-email").length;
|
| 189 |
+
if (email_validation > 0 && inbound_form_exists > 0) {
|
| 190 |
+
jQuery(".inbound-email.invalid-email").focus();
|
| 191 |
+
alert("Please enter a valid email address");
|
| 192 |
+
return false;
|
| 193 |
+
}
|
| 194 |
+
|
| 195 |
+
/* Define Variables */
|
| 196 |
+
// Dynamic JS object for passing custom values. This can be hooked into by third parties by using the below syntax.
|
| 197 |
+
var inbound_form_data = inbound_form_data || {};
|
| 198 |
+
inbound_form_data['page_view_count'] = countProperties(pageviewObj);
|
| 199 |
+
inbound_form_data['leads_list'] = jQuery(this_form).find('#inbound_form_lists').val();
|
| 200 |
+
inbound_form_data['source'] = jQuery.cookie("wp_lead_referral_site") || "NA";
|
| 201 |
+
inbound_form_data['page_id'] = inbound_ajax.post_id;
|
| 202 |
+
|
| 203 |
+
// Map form fields
|
| 204 |
+
var returned_form_data = return_mapped_values(this_form);
|
| 205 |
+
var inbound_form_data = merge_form_options(inbound_form_data,returned_form_data);
|
| 206 |
+
//console.log(inbound_form_data);
|
| 207 |
+
|
| 208 |
+
// Set variables
|
| 209 |
+
var email = inbound_form_data['email'] || false; // back fallback
|
| 210 |
+
if (!email) {
|
| 211 |
+
var email = this_form.find('.inbound-email').val() || false; // email fallback
|
| 212 |
+
inbound_form_data['email'] = email;
|
| 213 |
+
}
|
| 214 |
+
|
| 215 |
+
|
| 216 |
+
var form_name = this_form.find('.inbound_form_name').val() || "Not Found";
|
| 217 |
+
inbound_form_data['form_name'] = form_name;
|
| 218 |
+
var firstname = inbound_form_data['first_name'] || false;
|
| 219 |
+
var lastname = inbound_form_data['last_name'] || false;
|
| 220 |
+
var phone = inbound_form_data['phone'] || "";
|
| 221 |
+
var company = inbound_form_data['company'] || "";
|
| 222 |
+
var address = inbound_form_data['address'] || "";
|
| 223 |
+
|
| 224 |
+
if (firstname && lastname) {
|
| 225 |
+
inbound_form_data['name'] = firstname + " " + lastname;
|
| 226 |
+
}
|
| 227 |
+
|
| 228 |
+
if(!firstname){
|
| 229 |
+
var firstname = inbound_form_data['name'] || false;
|
| 230 |
+
}
|
| 231 |
+
|
| 232 |
+
if (!lastname && firstname) {
|
| 233 |
+
var parts = firstname.split(" ");
|
| 234 |
+
firstname = parts[0];
|
| 235 |
+
lastname = parts[1];
|
| 236 |
+
}
|
| 237 |
+
|
| 238 |
+
var form_inputs = jQuery('.wpl-track-me').find('input[type=text],input[type=hidden],textarea,select');
|
| 239 |
+
var post_values = {};
|
| 240 |
+
|
| 241 |
+
// unset values with exclude array
|
| 242 |
+
var inbound_exclude = inbound_exclude || [];
|
| 243 |
+
inbound_exclude.push('inbound_furl', 'inbound_current_page_url', 'inbound_notify', 'inbound_submitted', 'post_type', 'post_status', 's', 'inbound_form_name', 'inbound_form_id', 'inbound_form_lists');
|
| 244 |
+
|
| 245 |
+
form_inputs.each(function() {
|
| 246 |
+
if (jQuery.inArray(this.name, inbound_exclude) === -1){
|
| 247 |
+
post_values[this.name] = jQuery(this).val();
|
| 248 |
+
}
|
| 249 |
+
if (this.value.indexOf('@')>-1&&!email){
|
| 250 |
+
email = jQuery(this).val();
|
| 251 |
+
inbound_form_data['email'] = email;
|
| 252 |
+
}
|
| 253 |
+
});
|
| 254 |
+
|
| 255 |
+
var all_form_fields = JSON.stringify(post_values);
|
| 256 |
+
|
| 257 |
+
var page_views = JSON.stringify(pageviewObj);
|
| 258 |
+
|
| 259 |
+
if (typeof (landing_path_info) != "undefined" && landing_path_info != null && landing_path_info != "") {
|
| 260 |
+
var lp_variation = landing_path_info.variation;
|
| 261 |
+
} else if (typeof (cta_path_info) != "undefined" && cta_path_info != null && cta_path_info != "") {
|
| 262 |
+
var lp_variation = cta_path_info.variation;
|
| 263 |
+
} else {
|
| 264 |
+
var lp_variation = 0;
|
| 265 |
+
}
|
| 266 |
+
|
| 267 |
+
inbound_form_data['variation'] = lp_variation;
|
| 268 |
+
inbound_form_data['post_type'] = inbound_ajax.post_type;
|
| 269 |
+
inbound_form_data['wp_lead_uid'] = jQuery.cookie("wp_lead_uid") || null;
|
| 270 |
+
inbound_form_data['ip_address'] = inbound_ajax.ip_address;
|
| 271 |
+
|
| 272 |
+
var lp_check = (inbound_ajax.post_type === 'landing-page') ? 'Landing Page' : "";
|
| 273 |
+
var cta_check = (inbound_ajax.post_type === 'wp-call-to-action') ? 'Call to Action' : "";
|
| 274 |
+
var page_type = (!cta_check && !lp_check) ? inbound_ajax.post_type : lp_check + cta_check;
|
| 275 |
+
|
| 276 |
+
// jsonify inbound_form_data
|
| 277 |
+
var post_form_data = JSON.stringify(inbound_form_data);
|
| 278 |
+
console.log(post_form_data);
|
| 279 |
+
|
| 280 |
+
jQuery.cookie("wp_lead_email", email, { path: '/', expires: 365 }); // save email
|
| 281 |
+
|
| 282 |
+
jQuery.ajax({
|
| 283 |
+
type: 'POST',
|
| 284 |
+
url: inbound_ajax.admin_url,
|
| 285 |
+
timeout: 10000,
|
| 286 |
+
data: {
|
| 287 |
+
action: 'inbound_store_lead',
|
| 288 |
+
emailTo: email,
|
| 289 |
+
first_name: firstname,
|
| 290 |
+
last_name: lastname,
|
| 291 |
+
phone: phone,
|
| 292 |
+
address: address,
|
| 293 |
+
company_name: company,
|
| 294 |
+
page_views: page_views,
|
| 295 |
+
form_input_values: all_form_fields,
|
| 296 |
+
Mapped_Data: post_form_data
|
| 297 |
+
/* Replace with jquery hook
|
| 298 |
+
do_action('wpl-lead-collection-add-ajax-data');
|
| 299 |
+
*/
|
| 300 |
+
},
|
| 301 |
+
success: function(user_id){
|
| 302 |
+
jQuery(this_form).trigger("inbound_form_complete"); // Trigger custom hook
|
| 303 |
+
jQuery.cookie("wp_lead_id", user_id, { path: '/', expires: 365 });
|
| 304 |
+
jQuery.totalStorage('wp_lead_id', user_id);
|
| 305 |
+
this_form.addClass('lead_processed');
|
| 306 |
+
inbound_ga_log_event('Inbound Form Conversions', 'Conversion', "Conversion on '"+ form_name + "' form on page '" + document.title + "' on url '" + window.location.href + "'"); // GA push
|
| 307 |
+
//console.log(_gaq);
|
| 308 |
+
|
| 309 |
+
// Unbind form
|
| 310 |
+
release_form_sub(this_form, 'FORM');
|
| 311 |
+
|
| 312 |
+
$('body, button, input[type="button"], input').css('cursor', 'default');
|
| 313 |
+
|
| 314 |
+
jQuery.totalStorage.deleteItem('page_views'); // remove pageviews
|
| 315 |
+
jQuery.totalStorage.deleteItem('tracking_events'); // remove events
|
| 316 |
+
//jQuery.totalStorage.deleteItem('cta_clicks'); // remove cta
|
| 317 |
+
|
| 318 |
+
|
| 319 |
+
},
|
| 320 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 321 |
+
//console.log(MLHttpRequest+' '+errorThrown+' '+textStatus); // debug
|
| 322 |
+
|
| 323 |
+
// Create fallback localstorage object
|
| 324 |
+
var conversionObj = new Array();
|
| 325 |
+
conversionObj.push({
|
| 326 |
+
action: 'inbound_store_lead',
|
| 327 |
+
emailTo: email,
|
| 328 |
+
first_name: firstname,
|
| 329 |
+
last_name: lastname,
|
| 330 |
+
wp_lead_uid: wp_lead_uid,
|
| 331 |
+
page_view_count: page_view_count,
|
| 332 |
+
page_views: page_views,
|
| 333 |
+
post_type: inbound_ajax.post_type,
|
| 334 |
+
lp_variation: lp_variation,
|
| 335 |
+
// type: 'form-completion',
|
| 336 |
+
form_input_values : all_form_fields,
|
| 337 |
+
lp_id: page_id
|
| 338 |
+
});
|
| 339 |
+
|
| 340 |
+
jQuery.totalStorage('failed_conversion', conversionObj); // store failed data
|
| 341 |
+
jQuery.cookie("failed_conversion", true, { path: '/', expires: 365 });
|
| 342 |
+
|
| 343 |
+
// If fail, cookie form data and ajax submit on next page load
|
| 344 |
+
console.log('ajax fail');
|
| 345 |
+
release_form_sub( this_form , element_type );
|
| 346 |
+
|
| 347 |
+
}
|
| 348 |
+
});
|
| 349 |
+
|
| 350 |
+
});
|
| 351 |
+
|
| 352 |
+
jQuery("body").on('click', '.wpl-track-me-link', function (e) {
|
| 353 |
+
|
| 354 |
+
this_form = jQuery(this);
|
| 355 |
+
|
| 356 |
+
var element_type='A';
|
| 357 |
+
var a_href = jQuery(this).attr("href");
|
| 358 |
+
|
| 359 |
+
// process form only once
|
| 360 |
+
processed = this_form.hasClass('lead_processed');
|
| 361 |
+
if (processed === true) {
|
| 362 |
+
return;
|
| 363 |
+
}
|
| 364 |
+
|
| 365 |
+
form_id = jQuery(this).attr('id');
|
| 366 |
+
form_class = jQuery(this).attr('class');
|
| 367 |
+
|
| 368 |
+
jQuery(this).css('cursor', 'wait');
|
| 369 |
+
jQuery('body').css('cursor', 'wait');
|
| 370 |
+
|
| 371 |
+
|
| 372 |
+
e.preventDefault(); // halt normal form
|
| 373 |
+
|
| 374 |
+
var tracking_obj = "";
|
| 375 |
+
var page_view_count = countProperties(pageviewObj);
|
| 376 |
+
//console.log("view count" + page_view_count);
|
| 377 |
+
|
| 378 |
+
var wp_lead_uid = jQuery.cookie("wp_lead_uid");
|
| 379 |
+
var page_views = JSON.stringify(pageviewObj);
|
| 380 |
+
|
| 381 |
+
var page_id = inbound_ajax.post_id;
|
| 382 |
+
if (typeof (landing_path_info) != "undefined" && landing_path_info != null && landing_path_info != "") {
|
| 383 |
+
var lp_variation = landing_path_info.variation;
|
| 384 |
+
} else if (typeof (cta_path_info) != "undefined" && cta_path_info != null && cta_path_info != "") {
|
| 385 |
+
var lp_variation = cta_path_info.variation;
|
| 386 |
+
} else {
|
| 387 |
+
var lp_variation = null;
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
jQuery.ajax({
|
| 391 |
+
type: 'POST',
|
| 392 |
+
url: inbound_ajax.admin_url,
|
| 393 |
+
timeout: 10000,
|
| 394 |
+
data: {
|
| 395 |
+
action: 'inbound_store_lead',
|
| 396 |
+
wp_lead_uid: wp_lead_uid,
|
| 397 |
+
page_views: page_views,
|
| 398 |
+
post_type: inbound_ajax.post_type,
|
| 399 |
+
lp_variation: lp_variation,
|
| 400 |
+
lp_id: page_id
|
| 401 |
+
/* Replace with jquery hook
|
| 402 |
+
do_action('wpl-lead-collection-add-ajax-data');
|
| 403 |
+
*/
|
| 404 |
+
},
|
| 405 |
+
success: function(user_id){
|
| 406 |
+
jQuery(this_form).trigger("inbound_form_complete"); // Trigger custom hook
|
| 407 |
+
jQuery.cookie("wp_lead_id", user_id, { path: '/', expires: 365 });
|
| 408 |
+
jQuery.totalStorage('wp_lead_id', user_id);
|
| 409 |
+
this_form.addClass('lead_processed');
|
| 410 |
+
|
| 411 |
+
// Unbind form
|
| 412 |
+
release_form_sub(this_form, 'A');
|
| 413 |
+
|
| 414 |
+
jQuery.totalStorage.deleteItem('page_views'); // remove pageviews
|
| 415 |
+
jQuery.totalStorage.deleteItem('tracking_events'); // remove events
|
| 416 |
+
//jQuery.totalStorage.deleteItem('cta_clicks'); // remove cta
|
| 417 |
+
},
|
| 418 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 419 |
+
//console.log(MLHttpRequest+' '+errorThrown+' '+textStatus); // debug
|
| 420 |
+
|
| 421 |
+
// Create fallback localstorage object
|
| 422 |
+
var conversionObj = new Array();
|
| 423 |
+
conversionObj.push({
|
| 424 |
+
action: 'inbound_store_lead',
|
| 425 |
+
emailTo: email,
|
| 426 |
+
first_name: firstname,
|
| 427 |
+
last_name: lastname,
|
| 428 |
+
wp_lead_uid: wp_lead_uid,
|
| 429 |
+
|
| 430 |
+
page_views: page_views,
|
| 431 |
+
post_type: inbound_ajax.post_type,
|
| 432 |
+
lp_variation: lp_variation,
|
| 433 |
+
// type: 'form-completion',
|
| 434 |
+
form_input_values : all_form_fields,
|
| 435 |
+
lp_id: page_id
|
| 436 |
+
});
|
| 437 |
+
|
| 438 |
+
jQuery.totalStorage('failed_conversion', conversionObj); // store failed data
|
| 439 |
+
jQuery.cookie("failed_conversion", true, { path: '/', expires: 365 });
|
| 440 |
+
|
| 441 |
+
// If fail, cookie form data and ajax submit on next page load
|
| 442 |
+
console.log('ajax fail');
|
| 443 |
+
release_form_sub( this_form , element_type );
|
| 444 |
+
|
| 445 |
+
}
|
| 446 |
+
});
|
| 447 |
+
|
| 448 |
+
|
| 449 |
+
|
| 450 |
+
});
|
| 451 |
+
|
| 452 |
+
|
| 453 |
+
/* Fallback for lead storage if ajax fails */
|
| 454 |
+
var failed_conversion = jQuery.cookie("failed_conversion");
|
| 455 |
+
var fallback_obj = jQuery.totalStorage('failed_conversion');
|
| 456 |
+
|
| 457 |
+
if (typeof (failed_conversion) != "undefined" && failed_conversion == 'true' ) {
|
| 458 |
+
if (typeof fallback_obj == 'object' && fallback_obj) {
|
| 459 |
+
//console.log('fallback ran');
|
| 460 |
+
jQuery.ajax({
|
| 461 |
+
type: 'POST',
|
| 462 |
+
url: inbound_ajax.admin_url,
|
| 463 |
+
data: {
|
| 464 |
+
action: fallback_obj[0].action,
|
| 465 |
+
emailTo: fallback_obj[0].emailTo,
|
| 466 |
+
first_name: fallback_obj[0].first_name,
|
| 467 |
+
last_name: fallback_obj[0].last_name,
|
| 468 |
+
wp_lead_uid: fallback_obj[0].wp_lead_uid,
|
| 469 |
+
|
| 470 |
+
page_views: fallback_obj[0].page_views,
|
| 471 |
+
post_type: fallback_obj[0].post_type,
|
| 472 |
+
lp_variation: fallback_obj[0].lp_variation,
|
| 473 |
+
json: fallback_obj[0].json, // replace with page_view_obj
|
| 474 |
+
// type: 'form-completion',
|
| 475 |
+
form_input_values: fallback_obj[0].raw_post_values_json,
|
| 476 |
+
lp_id: fallback_obj[0].lp_id
|
| 477 |
+
/* Replace with jquery hook
|
| 478 |
+
do_action('wpl-lead-collection-add-ajax-data');
|
| 479 |
+
*/
|
| 480 |
+
},
|
| 481 |
+
success: function(user_id){
|
| 482 |
+
//console.log('Fallback fired');
|
| 483 |
+
jQuery.removeCookie("failed_conversion"); // remove failed cookie
|
| 484 |
+
jQuery.totalStorage.deleteItem('failed_conversion'); // remove failed data
|
| 485 |
+
},
|
| 486 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 487 |
+
//alert(MLHttpRequest+' '+errorThrown+' '+textStatus);
|
| 488 |
+
//die();
|
| 489 |
+
}
|
| 490 |
+
|
| 491 |
+
});
|
| 492 |
+
}
|
| 493 |
+
}
|
| 494 |
+
|
| 495 |
+
});
|
shared/assets/global/fonts/fontawesome/FontAwesome.otf
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/README.md
ADDED
|
@@ -0,0 +1,17 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#Font Awesome 3.0
|
| 2 |
+
##the iconic font designed for use with Twitter Bootstrap
|
| 3 |
+
|
| 4 |
+
The full suite of pictographic icons, examples, and documentation can be found at:
|
| 5 |
+
http://fortawesome.github.com/Font-Awesome/
|
| 6 |
+
|
| 7 |
+
|
| 8 |
+
##License
|
| 9 |
+
- The Font Awesome font is licensed under the SIL Open Font License - http://scripts.sil.org/OFL
|
| 10 |
+
- Font Awesome CSS, LESS, and SASS files are licensed under the MIT License - http://opensource.org/licenses/mit-license.html
|
| 11 |
+
- The Font Awesome pictograms are licensed under the CC BY 3.0 License - http://creativecommons.org/licenses/by/3.0/
|
| 12 |
+
- Attribution is no longer required in Font Awesome 3.0, but much appreciated: "Font Awesome by Dave Gandy - http://fortawesome.github.com/Font-Awesome"
|
| 13 |
+
|
| 14 |
+
##Contact
|
| 15 |
+
- Email: dave@davegandy.com
|
| 16 |
+
- Twitter: http://twitter.com/fortaweso_me
|
| 17 |
+
- Work: Lead Product Designer @ http://kyru.us
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.eot~HEAD
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.svg
ADDED
|
@@ -0,0 +1,414 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" standalone="no"?>
|
| 2 |
+
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
| 3 |
+
<svg xmlns="http://www.w3.org/2000/svg">
|
| 4 |
+
<metadata></metadata>
|
| 5 |
+
<defs>
|
| 6 |
+
<font id="fontawesomeregular" horiz-adv-x="1536" >
|
| 7 |
+
<font-face units-per-em="1792" ascent="1536" descent="-256" />
|
| 8 |
+
<missing-glyph horiz-adv-x="448" />
|
| 9 |
+
<glyph unicode=" " horiz-adv-x="448" />
|
| 10 |
+
<glyph unicode="	" horiz-adv-x="448" />
|
| 11 |
+
<glyph unicode=" " horiz-adv-x="448" />
|
| 12 |
+
<glyph unicode="¨" horiz-adv-x="1792" />
|
| 13 |
+
<glyph unicode="©" horiz-adv-x="1792" />
|
| 14 |
+
<glyph unicode="®" horiz-adv-x="1792" />
|
| 15 |
+
<glyph unicode="´" horiz-adv-x="1792" />
|
| 16 |
+
<glyph unicode="Æ" horiz-adv-x="1792" />
|
| 17 |
+
<glyph unicode=" " horiz-adv-x="768" />
|
| 18 |
+
<glyph unicode=" " />
|
| 19 |
+
<glyph unicode=" " horiz-adv-x="768" />
|
| 20 |
+
<glyph unicode=" " />
|
| 21 |
+
<glyph unicode=" " horiz-adv-x="512" />
|
| 22 |
+
<glyph unicode=" " horiz-adv-x="384" />
|
| 23 |
+
<glyph unicode=" " horiz-adv-x="256" />
|
| 24 |
+
<glyph unicode=" " horiz-adv-x="256" />
|
| 25 |
+
<glyph unicode=" " horiz-adv-x="192" />
|
| 26 |
+
<glyph unicode=" " horiz-adv-x="307" />
|
| 27 |
+
<glyph unicode=" " horiz-adv-x="85" />
|
| 28 |
+
<glyph unicode=" " horiz-adv-x="307" />
|
| 29 |
+
<glyph unicode=" " horiz-adv-x="384" />
|
| 30 |
+
<glyph unicode="™" horiz-adv-x="1792" />
|
| 31 |
+
<glyph unicode="∞" horiz-adv-x="1792" />
|
| 32 |
+
<glyph unicode="≠" horiz-adv-x="1792" />
|
| 33 |
+
<glyph unicode="" horiz-adv-x="500" d="M0 0z" />
|
| 34 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
|
| 35 |
+
<glyph unicode="" d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
|
| 36 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
| 37 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
|
| 38 |
+
<glyph unicode="" horiz-adv-x="1792" d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 q-18 -18 -44 -18z" />
|
| 39 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 l502 -73q56 -9 56 -46z" />
|
| 40 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
|
| 41 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 131q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q9 0 42 -21.5t74.5 -48t108 -48t133.5 -21.5t133.5 21.5t108 48t74.5 48t42 21.5q61 0 111.5 -20t85.5 -53.5t62 -81 t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
|
| 42 |
+
<glyph unicode="" horiz-adv-x="1920" d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 43 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
| 44 |
+
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
|
| 45 |
+
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
|
| 46 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
|
| 47 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
|
| 48 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
| 49 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z " />
|
| 50 |
+
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
|
| 51 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
|
| 52 |
+
<glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
|
| 53 |
+
<glyph unicode="" horiz-adv-x="1408" d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
|
| 54 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
|
| 55 |
+
<glyph unicode="" horiz-adv-x="1280" d="M128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280zM768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z " />
|
| 56 |
+
<glyph unicode="" d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 57 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
|
| 58 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
|
| 59 |
+
<glyph unicode="" d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 60 |
+
<glyph unicode="" d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 61 |
+
<glyph unicode="" d="M1023 576h316q-1 3 -2.5 8t-2.5 8l-212 496h-708l-212 -496q-1 -2 -2.5 -8t-2.5 -8h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 q25 -61 25 -123z" />
|
| 62 |
+
<glyph unicode="" d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 63 |
+
<glyph unicode="" d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q14 0 25 -9 l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
|
| 64 |
+
<glyph unicode="" d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
|
| 65 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 t47 -113z" />
|
| 66 |
+
<glyph unicode="" horiz-adv-x="1152" d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
|
| 67 |
+
<glyph unicode="" horiz-adv-x="1792" d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
|
| 68 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
|
| 69 |
+
<glyph unicode="" horiz-adv-x="768" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
|
| 70 |
+
<glyph unicode="" horiz-adv-x="1152" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
|
| 71 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
|
| 72 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
|
| 73 |
+
<glyph unicode="" horiz-adv-x="1792" d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
|
| 74 |
+
<glyph unicode="" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91z" />
|
| 75 |
+
<glyph unicode="" horiz-adv-x="1920" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
|
| 76 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
|
| 77 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
| 78 |
+
<glyph unicode="" horiz-adv-x="1664" d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
|
| 79 |
+
<glyph unicode="" horiz-adv-x="1920" d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
|
| 80 |
+
<glyph unicode="" horiz-adv-x="1664" d="M725 977l-170 -450q73 -1 153.5 -2t119 -1.5t52.5 -0.5l29 2q-32 95 -92 241q-53 132 -92 211zM21 -128h-21l2 79q22 7 80 18q89 16 110 31q20 16 48 68l237 616l280 724h75h53l11 -21l205 -480q103 -242 124 -297q39 -102 96 -235q26 -58 65 -164q24 -67 65 -149 q22 -49 35 -57q22 -19 69 -23q47 -6 103 -27q6 -39 6 -57q0 -14 -1 -26q-80 0 -192 8q-93 8 -189 8q-79 0 -135 -2l-200 -11l-58 -2q0 45 4 78l131 28q56 13 68 23q12 12 12 27t-6 32l-47 114l-92 228l-450 2q-29 -65 -104 -274q-23 -64 -23 -84q0 -31 17 -43 q26 -21 103 -32q3 0 13.5 -2t30 -5t40.5 -6q1 -28 1 -58q0 -17 -2 -27q-66 0 -349 20l-48 -8q-81 -14 -167 -14z" />
|
| 81 |
+
<glyph unicode="" horiz-adv-x="1408" d="M555 15q76 -32 140 -32q131 0 216 41t122 113q38 70 38 181q0 114 -41 180q-58 94 -141 126q-80 32 -247 32q-74 0 -101 -10v-144l-1 -173l3 -270q0 -15 12 -44zM541 761q43 -7 109 -7q175 0 264 65t89 224q0 112 -85 187q-84 75 -255 75q-52 0 -130 -13q0 -44 2 -77 q7 -122 6 -279l-1 -98q0 -43 1 -77zM0 -128l2 94q45 9 68 12q77 12 123 31q17 27 21 51q9 66 9 194l-2 497q-5 256 -9 404q-1 87 -11 109q-1 4 -12 12q-18 12 -69 15q-30 2 -114 13l-4 83l260 6l380 13l45 1q5 0 14 0.5t14 0.5q1 0 21.5 -0.5t40.5 -0.5h74q88 0 191 -27 q43 -13 96 -39q57 -29 102 -76q44 -47 65 -104t21 -122q0 -70 -32 -128t-95 -105q-26 -20 -150 -77q177 -41 267 -146q92 -106 92 -236q0 -76 -29 -161q-21 -62 -71 -117q-66 -72 -140 -108q-73 -36 -203 -60q-82 -15 -198 -11l-197 4q-84 2 -298 -11q-33 -3 -272 -11z" />
|
| 82 |
+
<glyph unicode="" horiz-adv-x="1024" d="M0 -126l17 85q4 1 77 20q76 19 116 39q29 37 41 101l27 139l56 268l12 64q8 44 17 84.5t16 67t12.5 46.5t9 30.5t3.5 11.5l29 157l16 63l22 135l8 50v38q-41 22 -144 28q-28 2 -38 4l19 103l317 -14q39 -2 73 -2q66 0 214 9q33 2 68 4.5t36 2.5q-2 -19 -6 -38 q-7 -29 -13 -51q-55 -19 -109 -31q-64 -16 -101 -31q-12 -31 -24 -88q-9 -44 -13 -82q-44 -199 -66 -306l-61 -311l-38 -158l-43 -235l-12 -45q-2 -7 1 -27q64 -15 119 -21q36 -5 66 -10q-1 -29 -7 -58q-7 -31 -9 -41q-18 0 -23 -1q-24 -2 -42 -2q-9 0 -28 3q-19 4 -145 17 l-198 2q-41 1 -174 -11q-74 -7 -98 -9z" />
|
| 83 |
+
<glyph unicode="" horiz-adv-x="1792" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l215 -1h293l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -42.5 2t-103.5 -1t-111 -1 q-34 0 -67 -5q-10 -97 -8 -136l1 -152v-332l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-88 0 -233 -14q-48 -4 -70 -4q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q8 192 6 433l-5 428q-1 62 -0.5 118.5t0.5 102.5t-2 57t-6 15q-6 5 -14 6q-38 6 -148 6q-43 0 -100 -13.5t-73 -24.5q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1744 128q33 0 42 -18.5t-11 -44.5 l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80z" />
|
| 84 |
+
<glyph unicode="" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l446 -1h318l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -58.5 2t-138.5 -1t-128 -1 q-94 0 -127 -5q-10 -97 -8 -136l1 -152v52l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-82 0 -233 -13q-45 -5 -70 -5q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q6 137 6 433l-5 44q0 265 -2 278q-2 11 -6 15q-6 5 -14 6q-38 6 -148 6q-50 0 -168.5 -14t-132.5 -24q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1505 113q26 -20 26 -49t-26 -49l-162 -126 q-26 -20 -44.5 -11t-18.5 42v80h-1024v-80q0 -33 -18.5 -42t-44.5 11l-162 126q-26 20 -26 49t26 49l162 126q26 20 44.5 11t18.5 -42v-80h1024v80q0 33 18.5 42t44.5 -11z" />
|
| 85 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 86 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
|
| 87 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 88 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
| 89 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 90 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 91 |
+
<glyph unicode="" horiz-adv-x="1792" d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 92 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 q39 -17 39 -59z" />
|
| 93 |
+
<glyph unicode="" horiz-adv-x="1920" d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 94 |
+
<glyph unicode="" d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 q53 0 91 -38l235 -234q37 -39 37 -91z" />
|
| 95 |
+
<glyph unicode="" horiz-adv-x="1024" d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
|
| 96 |
+
<glyph unicode="" d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 97 |
+
<glyph unicode="" horiz-adv-x="1024" d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
|
| 98 |
+
<glyph unicode="" horiz-adv-x="1792" d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
|
| 99 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
|
| 100 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 q24 -24 24 -57t-24 -57z" />
|
| 101 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 102 |
+
<glyph unicode="" horiz-adv-x="1024" d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19z" />
|
| 103 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19l710 710 q19 19 32 13t13 -32v-710q4 11 13 19z" />
|
| 104 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-8 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q5 11 13 19z" />
|
| 105 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
|
| 106 |
+
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
|
| 107 |
+
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 108 |
+
<glyph unicode="" horiz-adv-x="1664" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
| 109 |
+
<glyph unicode="" horiz-adv-x="1792" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19l-710 -710 q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
| 110 |
+
<glyph unicode="" horiz-adv-x="1024" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19z" />
|
| 111 |
+
<glyph unicode="" horiz-adv-x="1538" d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
|
| 112 |
+
<glyph unicode="" horiz-adv-x="1152" d="M742 -37l-652 651q-37 37 -37 90.5t37 90.5l652 651q37 37 90.5 37t90.5 -37l75 -75q37 -37 37 -90.5t-37 -90.5l-486 -486l486 -485q37 -38 37 -91t-37 -90l-75 -75q-37 -37 -90.5 -37t-90.5 37z" />
|
| 113 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1099 704q0 -52 -37 -91l-652 -651q-37 -37 -90 -37t-90 37l-76 75q-37 39 -37 91q0 53 37 90l486 486l-486 485q-37 39 -37 91q0 53 37 90l76 75q36 38 90 38t90 -38l652 -651q37 -37 37 -90z" />
|
| 114 |
+
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 115 |
+
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" />
|
| 116 |
+
<glyph unicode="" d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 117 |
+
<glyph unicode="" d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 118 |
+
<glyph unicode="" d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 119 |
+
<glyph unicode="" d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 120 |
+
<glyph unicode="" d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
|
| 121 |
+
<glyph unicode="" d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 122 |
+
<glyph unicode="" d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 123 |
+
<glyph unicode="" d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
|
| 124 |
+
<glyph unicode="" d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 t32.5 -90.5z" />
|
| 125 |
+
<glyph unicode="" d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
|
| 126 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 q37 -39 37 -91z" />
|
| 127 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
| 128 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
|
| 129 |
+
<glyph unicode="" d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
|
| 130 |
+
<glyph unicode="" d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
|
| 131 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
|
| 132 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
|
| 133 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
|
| 134 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
|
| 135 |
+
<glyph unicode="" d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
|
| 136 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-30 0 -51 11t-31 24t-27 42q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
|
| 137 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
|
| 138 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
|
| 139 |
+
<glyph unicode="" horiz-adv-x="1792" d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 q-105 -188 -315 -566t-316 -567l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z " />
|
| 140 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
|
| 141 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
|
| 142 |
+
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
| 143 |
+
<glyph unicode="" horiz-adv-x="1792" d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
| 144 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
|
| 145 |
+
<glyph unicode="" d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
|
| 146 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 320q0 -53 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-486 485l-486 -485q-36 -38 -90 -38t-90 38l-75 75q-38 36 -38 90q0 53 38 91l651 651q37 37 90 37q52 0 91 -37l650 -651q38 -38 38 -91z" />
|
| 147 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 832q0 -53 -37 -90l-651 -651q-38 -38 -91 -38q-54 0 -90 38l-651 651q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l486 -486l486 486q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
| 148 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -11 7 -21 zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z " />
|
| 149 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5 l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5 t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
|
| 150 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
| 151 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
|
| 152 |
+
<glyph unicode="" horiz-adv-x="768" d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 153 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 154 |
+
<glyph unicode="" horiz-adv-x="1920" d="M512 512v-384h-256v384h256zM896 1024v-896h-256v896h256zM1280 768v-640h-256v640h256zM1664 1152v-1024h-256v1024h256zM1792 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5z M1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 155 |
+
<glyph unicode="" d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 156 |
+
<glyph unicode="" d="M1307 618l23 219h-198v109q0 49 15.5 68.5t71.5 19.5h110v219h-175q-152 0 -218 -72t-66 -213v-131h-131v-219h131v-635h262v635h175zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 157 |
+
<glyph unicode="" horiz-adv-x="1792" d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 158 |
+
<glyph unicode="" horiz-adv-x="1792" d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
|
| 159 |
+
<glyph unicode="" horiz-adv-x="1920" d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -10 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -9 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
|
| 160 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
|
| 161 |
+
<glyph unicode="" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
|
| 162 |
+
<glyph unicode="" d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 32 18 69t-17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -74 49 -163z" />
|
| 163 |
+
<glyph unicode="" horiz-adv-x="896" d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
|
| 164 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 q224 0 351 -124t127 -344z" />
|
| 165 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
|
| 166 |
+
<glyph unicode="" d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 167 |
+
<glyph unicode="" horiz-adv-x="1152" d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
|
| 168 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
|
| 169 |
+
<glyph unicode="" d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 170 |
+
<glyph unicode="" horiz-adv-x="1664" d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
|
| 171 |
+
<glyph unicode="" d="M394 184q-8 -9 -20 3q-13 11 -4 19q8 9 20 -3q12 -11 4 -19zM352 245q9 -12 0 -19q-8 -6 -17 7t0 18q9 7 17 -6zM291 305q-5 -7 -13 -2q-10 5 -7 12q3 5 13 2q10 -5 7 -12zM322 271q-6 -7 -16 3q-9 11 -2 16q6 6 16 -3q9 -11 2 -16zM451 159q-4 -12 -19 -6q-17 4 -13 15 t19 7q16 -5 13 -16zM514 154q0 -11 -16 -11q-17 -2 -17 11q0 11 16 11q17 2 17 -11zM572 164q2 -10 -14 -14t-18 8t14 15q16 2 18 -9zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-224q-16 0 -24.5 1t-19.5 5t-16 14.5t-5 27.5v239q0 97 -52 142q57 6 102.5 18t94 39 t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103 q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -103t0.5 -68q0 -22 -11 -33.5t-22 -13t-33 -1.5 h-224q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 172 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
|
| 173 |
+
<glyph unicode="" d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -10 1 -18.5t3 -17t4 -13.5t6.5 -16t6.5 -17q16 -40 25 -118.5t9 -136.5z" />
|
| 174 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -52.5 3.5t-57.5 12.5t-47.5 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-128 79 -264.5 215.5t-215.5 264.5q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47.5t-12.5 57.5t-3.5 52.5 q0 92 51 186q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174 q2 -1 19 -11.5t24 -14t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
|
| 175 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 176 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
| 177 |
+
<glyph unicode="" d="M1280 343q0 11 -2 16q-3 8 -38.5 29.5t-88.5 49.5l-53 29q-5 3 -19 13t-25 15t-21 5q-18 0 -47 -32.5t-57 -65.5t-44 -33q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170.5 126.5t-126.5 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5t-3.5 16.5q0 13 20.5 33.5t45 38.5 t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5t320.5 -216.5q6 -2 30 -11t33 -12.5 t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 178 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
|
| 179 |
+
<glyph unicode="" horiz-adv-x="768" d="M511 980h257l-30 -284h-227v-824h-341v824h-170v284h170v171q0 182 86 275.5t283 93.5h227v-284h-142q-39 0 -62.5 -6.5t-34 -23.5t-13.5 -34.5t-3 -49.5v-142z" />
|
| 180 |
+
<glyph unicode="" d="M1536 640q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -39.5 7t-12.5 30v211q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5 q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23 q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -89t0.5 -54q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 181 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 t316.5 -131.5t131.5 -316.5z" />
|
| 182 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
|
| 183 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 q187 -186 294 -425.5t120 -501.5z" />
|
| 184 |
+
<glyph unicode="" d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
|
| 185 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
|
| 186 |
+
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM183 128h1298q-164 181 -246.5 411.5t-82.5 484.5q0 256 -320 256t-320 -256q0 -254 -82.5 -484.5t-246.5 -411.5zM1664 128q0 -52 -38 -90t-90 -38 h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
| 187 |
+
<glyph unicode="" d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
|
| 188 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
|
| 189 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-2 3 -3.5 4.5t-4 4.5t-4.5 5q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576 q-50 0 -89 -38.5t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45 t45 -19t45 19t19 45zM1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128 q0 122 81.5 189t206.5 67q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 190 |
+
<glyph unicode="" d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
|
| 191 |
+
<glyph unicode="" d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
|
| 192 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 193 |
+
<glyph unicode="" d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 194 |
+
<glyph unicode="" d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 195 |
+
<glyph unicode="" d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 196 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 10.5t-9.5 10.5q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-5 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10t17 -20q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q7 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
|
| 197 |
+
<glyph unicode="" horiz-adv-x="1664" d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
|
| 198 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
| 199 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
|
| 200 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
|
| 201 |
+
<glyph unicode="" d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z " />
|
| 202 |
+
<glyph unicode="" horiz-adv-x="1920" d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
|
| 203 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
|
| 204 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z " />
|
| 205 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
|
| 206 |
+
<glyph unicode="" horiz-adv-x="1792" d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
|
| 207 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
|
| 208 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 z" />
|
| 209 |
+
<glyph unicode="" d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
|
| 210 |
+
<glyph unicode="" d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 211 |
+
<glyph unicode="" d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 212 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 213 |
+
<glyph unicode="" horiz-adv-x="1792" d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 122t0.5 121v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5 t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 214 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 97 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -55 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
|
| 215 |
+
<glyph unicode="" d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
|
| 216 |
+
<glyph unicode="" horiz-adv-x="1664" d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 z" />
|
| 217 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
|
| 218 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
|
| 219 |
+
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 220 |
+
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
|
| 221 |
+
<glyph unicode="" d="M678 -57q0 -38 -10 -71h-380q-95 0 -171.5 56.5t-103.5 147.5q24 45 69 77.5t100 49.5t107 24t107 7q32 0 49 -2q6 -4 30.5 -21t33 -23t31 -23t32 -25.5t27.5 -25.5t26.5 -29.5t21 -30.5t17.5 -34.5t9.5 -36t4.5 -40.5zM385 294q-234 -7 -385 -85v433q103 -118 273 -118 q32 0 70 5q-21 -61 -21 -86q0 -67 63 -149zM558 805q0 -100 -43.5 -160.5t-140.5 -60.5q-51 0 -97 26t-78 67.5t-56 93.5t-35.5 104t-11.5 99q0 96 51.5 165t144.5 69q66 0 119 -41t84 -104t47 -130t16 -128zM1536 896v-736q0 -119 -84.5 -203.5t-203.5 -84.5h-468 q39 73 39 157q0 66 -22 122.5t-55.5 93t-72 71t-72 59.5t-55.5 54.5t-22 59.5q0 36 23 68t56 61.5t65.5 64.5t55.5 93t23 131t-26.5 145.5t-75.5 118.5q-6 6 -14 11t-12.5 7.5t-10 9.5t-10.5 17h135l135 64h-437q-138 0 -244.5 -38.5t-182.5 -133.5q0 126 81 213t207 87h960 q119 0 203.5 -84.5t84.5 -203.5v-96h-256v256h-128v-256h-256v-128h256v-256h128v256h256z" />
|
| 222 |
+
<glyph unicode="" horiz-adv-x="1664" d="M876 71q0 21 -4.5 40.5t-9.5 36t-17.5 34.5t-21 30.5t-26.5 29.5t-27.5 25.5t-32 25.5t-31 23t-33 23t-30.5 21q-17 2 -50 2q-54 0 -106 -7t-108 -25t-98 -46t-69 -75t-27 -107q0 -68 35.5 -121.5t93 -84t120.5 -45.5t127 -15q59 0 112.5 12.5t100.5 39t74.5 73.5 t27.5 110zM756 933q0 60 -16.5 127.5t-47 130.5t-84 104t-119.5 41q-93 0 -144 -69t-51 -165q0 -47 11.5 -99t35.5 -104t56 -93.5t78 -67.5t97 -26q97 0 140.5 60.5t43.5 160.5zM625 1408h437l-135 -79h-135q71 -45 110 -126t39 -169q0 -74 -23 -131.5t-56 -92.5t-66 -64.5 t-56 -61t-23 -67.5q0 -26 16.5 -51t43 -48t58.5 -48t64 -55.5t58.5 -66t43 -85t16.5 -106.5q0 -160 -140 -282q-152 -131 -420 -131q-59 0 -119.5 10t-122 33.5t-108.5 58t-77 89t-30 121.5q0 61 37 135q32 64 96 110.5t145 71t155 36t150 13.5q-64 83 -64 149q0 12 2 23.5 t5 19.5t8 21.5t7 21.5q-40 -5 -70 -5q-149 0 -255.5 98t-106.5 246q0 140 95 250.5t234 141.5q94 20 187 20zM1664 1152v-128h-256v-256h-128v256h-256v128h256v256h128v-256h256z" />
|
| 223 |
+
<glyph unicode="" horiz-adv-x="1920" d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
|
| 224 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
| 225 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 226 |
+
<glyph unicode="" horiz-adv-x="640" d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
|
| 227 |
+
<glyph unicode="" horiz-adv-x="640" d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 228 |
+
<glyph unicode="" horiz-adv-x="1664" d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
|
| 229 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 230 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
| 231 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 232 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
|
| 233 |
+
<glyph unicode="" d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
|
| 234 |
+
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
|
| 235 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
|
| 236 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
|
| 237 |
+
<glyph unicode="" horiz-adv-x="1792" d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
|
| 238 |
+
<glyph unicode="" horiz-adv-x="1792" d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
|
| 239 |
+
<glyph unicode="" horiz-adv-x="896" d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
|
| 240 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 z" />
|
| 241 |
+
<glyph unicode="" horiz-adv-x="1664" d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
|
| 242 |
+
<glyph unicode="" horiz-adv-x="1792" d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
|
| 243 |
+
<glyph unicode="" horiz-adv-x="1024" d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
|
| 244 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
| 245 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
| 246 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
| 247 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" />
|
| 248 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
|
| 249 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 t66 -158z" />
|
| 250 |
+
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1664 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5 q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
| 251 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
|
| 252 |
+
<glyph unicode="" horiz-adv-x="1408" d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
|
| 253 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1024 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1024 608v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280z M768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z" />
|
| 254 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
|
| 255 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
|
| 256 |
+
<glyph unicode="" horiz-adv-x="1920" d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 257 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
|
| 258 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q261 -58 287 -93z" />
|
| 259 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
|
| 260 |
+
<glyph unicode="" d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 261 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 262 |
+
<glyph unicode="" horiz-adv-x="1024" d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
|
| 263 |
+
<glyph unicode="" horiz-adv-x="1024" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 264 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 265 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 266 |
+
<glyph unicode="" horiz-adv-x="640" d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 267 |
+
<glyph unicode="" horiz-adv-x="640" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 268 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 269 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 270 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 271 |
+
<glyph unicode="" horiz-adv-x="1920" d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
|
| 272 |
+
<glyph unicode="" horiz-adv-x="1152" d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
|
| 273 |
+
<glyph unicode="" horiz-adv-x="768" d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
| 274 |
+
<glyph unicode="" d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 t279.5 -279.5t103 -385.5z" />
|
| 275 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
|
| 276 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
|
| 277 |
+
<glyph unicode="" horiz-adv-x="1568" d="M496 192q0 -60 -42.5 -102t-101.5 -42q-60 0 -102 42t-42 102t42 102t102 42q59 0 101.5 -42t42.5 -102zM928 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -66 -47 -113t-113 -47t-113 47t-47 113 t47 113t113 47t113 -47t47 -113zM1360 192q0 -46 -33 -79t-79 -33t-79 33t-33 79t33 79t79 33t79 -33t33 -79zM528 1088q0 -73 -51.5 -124.5t-124.5 -51.5t-124.5 51.5t-51.5 124.5t51.5 124.5t124.5 51.5t124.5 -51.5t51.5 -124.5zM992 1280q0 -80 -56 -136t-136 -56 t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1536 640q0 -40 -28 -68t-68 -28t-68 28t-28 68t28 68t68 28t68 -28t28 -68zM1328 1088q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5z" />
|
| 278 |
+
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 279 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
|
| 280 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 q0 -87 -27 -168q136 -160 136 -398z" />
|
| 281 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
| 282 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z " />
|
| 283 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 284 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 285 |
+
<glyph unicode="" d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 286 |
+
<glyph unicode="" d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 287 |
+
<glyph unicode="" d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 288 |
+
<glyph unicode="" horiz-adv-x="1920" d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
|
| 289 |
+
<glyph unicode="" horiz-adv-x="1920" d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 290 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
| 291 |
+
<glyph unicode="" horiz-adv-x="1792" d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
| 292 |
+
<glyph unicode="" horiz-adv-x="1664" d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 t9 -23z" />
|
| 293 |
+
<glyph unicode="" horiz-adv-x="1920" d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
|
| 294 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
|
| 295 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
|
| 296 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
|
| 297 |
+
<glyph unicode="" horiz-adv-x="1664" d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
|
| 298 |
+
<glyph unicode="" horiz-adv-x="1024" d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 q-2 -287 -226 -414q-68 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
|
| 299 |
+
<glyph unicode="" horiz-adv-x="1664" d="M439 265l-256 -256q-10 -9 -23 -9q-12 0 -23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
|
| 300 |
+
<glyph unicode="" horiz-adv-x="1024" d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
|
| 301 |
+
<glyph unicode="" horiz-adv-x="640" d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
|
| 302 |
+
<glyph unicode="" horiz-adv-x="640" d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
|
| 303 |
+
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1534 846v-206h-514l-3 27 q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5t-65.5 -51.5t-30.5 -63h232v80 h126z" />
|
| 304 |
+
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1536 -50v-206h-514l-4 27 q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73h232v80h126z" />
|
| 305 |
+
<glyph unicode="" horiz-adv-x="1920" d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
|
| 306 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
|
| 307 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
|
| 308 |
+
<glyph unicode="" horiz-adv-x="1408" d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
|
| 309 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 310 |
+
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
| 311 |
+
<glyph unicode="" horiz-adv-x="1408" d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
|
| 312 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
|
| 313 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" />
|
| 314 |
+
<glyph unicode="" d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 315 |
+
<glyph unicode="" d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 316 |
+
<glyph unicode="" d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 317 |
+
<glyph unicode="" d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 318 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
|
| 319 |
+
<glyph unicode="" horiz-adv-x="1792" d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
|
| 320 |
+
<glyph unicode="" horiz-adv-x="1792" d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-13 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
|
| 321 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 v-320h736z" />
|
| 322 |
+
<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 323 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
| 324 |
+
<glyph unicode="" horiz-adv-x="384" d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
| 325 |
+
<glyph unicode="" d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 232 -177 396t-396 177q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128q13 0 23 10 t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 326 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 q16 -8 32 -8q17 0 32 9z" />
|
| 327 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
|
| 328 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" />
|
| 329 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 330 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
|
| 331 |
+
<glyph unicode="" horiz-adv-x="1024" d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
|
| 332 |
+
<glyph unicode="" d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 333 |
+
<glyph unicode="" d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 334 |
+
<glyph unicode="" d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 335 |
+
<glyph unicode="" d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q10 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 336 |
+
<glyph unicode="" d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 337 |
+
<glyph unicode="" d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 338 |
+
<glyph unicode="" d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 339 |
+
<glyph unicode="" d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 340 |
+
<glyph unicode="" horiz-adv-x="1024" d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
|
| 341 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
|
| 342 |
+
<glyph unicode="" horiz-adv-x="1024" d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 t53 -63.5t31.5 -76.5t13 -94z" />
|
| 343 |
+
<glyph unicode="" horiz-adv-x="898" d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
|
| 344 |
+
<glyph unicode="" horiz-adv-x="1027" d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
|
| 345 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128 q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" />
|
| 346 |
+
<glyph unicode="" horiz-adv-x="1792" d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
|
| 347 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
|
| 348 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
| 349 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1024 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1024 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28 t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
| 350 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 l230 -662h70z" />
|
| 351 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 v119h121z" />
|
| 352 |
+
<glyph unicode="" horiz-adv-x="1792" d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
|
| 353 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
|
| 354 |
+
<glyph unicode="" d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
|
| 355 |
+
<glyph unicode="" d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
|
| 356 |
+
<glyph unicode="" horiz-adv-x="1664" d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
|
| 357 |
+
<glyph unicode="" horiz-adv-x="1664" d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
|
| 358 |
+
<glyph unicode="" d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 16 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 q21 -28 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78l24 -69t23 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38q-51 0 -78 -38 q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 359 |
+
<glyph unicode="" d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-37 -51 -106 -51q-67 0 -105 51 q-28 38 -28 118v175q0 80 28 117q38 51 105 51q69 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
|
| 360 |
+
<glyph unicode="" horiz-adv-x="1408" d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 q25 45 64 45h241q22 0 31 -15z" />
|
| 361 |
+
<glyph unicode="" d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 362 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 640q0 37 -30 54l-512 320q-31 20 -65 2q-33 -18 -33 -56v-640q0 -38 33 -56q16 -8 31 -8q20 0 34 10l512 320q30 17 30 54zM1792 640q0 -96 -1 -150t-8.5 -136.5t-22.5 -147.5q-16 -73 -69 -123t-124 -58q-222 -25 -671 -25t-671 25q-71 8 -124.5 58t-69.5 123 q-14 65 -21.5 147.5t-8.5 136.5t-1 150t1 150t8.5 136.5t22.5 147.5q16 73 69 123t124 58q222 25 671 25t671 -25q71 -8 124.5 -58t69.5 -123q14 -65 21.5 -147.5t8.5 -136.5t1 -150z" />
|
| 363 |
+
<glyph unicode="" horiz-adv-x="1792" d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
|
| 364 |
+
<glyph unicode="" horiz-adv-x="1408" d="M928 135v-151l-707 -1v151zM1169 481v-701l-1 -35v-1h-1132l-35 1h-1v736h121v-618h928v618h120zM241 393l704 -65l-13 -150l-705 65zM309 709l683 -183l-39 -146l-683 183zM472 1058l609 -360l-77 -130l-609 360zM832 1389l398 -585l-124 -85l-399 584zM1285 1536 l121 -697l-149 -26l-121 697z" />
|
| 365 |
+
<glyph unicode="" d="M1362 110v648h-135q20 -63 20 -131q0 -126 -64 -232.5t-174 -168.5t-240 -62q-197 0 -337 135.5t-140 327.5q0 68 20 131h-141v-648q0 -26 17.5 -43.5t43.5 -17.5h1069q25 0 43 17.5t18 43.5zM1078 643q0 124 -90.5 211.5t-218.5 87.5q-127 0 -217.5 -87.5t-90.5 -211.5 t90.5 -211.5t217.5 -87.5q128 0 218.5 87.5t90.5 211.5zM1362 1003v165q0 28 -20 48.5t-49 20.5h-174q-29 0 -49 -20.5t-20 -48.5v-165q0 -29 20 -49t49 -20h174q29 0 49 20t20 49zM1536 1211v-1142q0 -81 -58 -139t-139 -58h-1142q-81 0 -139 58t-58 139v1142q0 81 58 139 t139 58h1142q81 0 139 -58t58 -139z" />
|
| 366 |
+
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
|
| 367 |
+
<glyph unicode="" d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 368 |
+
<glyph unicode="" horiz-adv-x="1408" d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
|
| 369 |
+
<glyph unicode="" d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 370 |
+
<glyph unicode="" horiz-adv-x="1024" d="M390 1408h219v-388h364v-241h-364v-394q0 -136 14 -172q13 -37 52 -60q50 -31 117 -31q117 0 232 76v-242q-102 -48 -178 -65q-77 -19 -173 -19q-105 0 -186 27q-78 25 -138 75q-58 51 -79 105q-22 54 -22 161v539h-170v217q91 30 155 84q64 55 103 132q39 78 54 196z " />
|
| 371 |
+
<glyph unicode="" d="M1123 127v181q-88 -56 -174 -56q-51 0 -88 23q-29 17 -39 45q-11 30 -11 129v295h274v181h-274v291h-164q-11 -90 -40 -147t-78 -99q-48 -40 -116 -63v-163h127v-404q0 -78 17 -121q17 -42 59 -78q43 -37 104 -57q62 -20 140 -20q67 0 129 14q57 13 134 49zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 372 |
+
<glyph unicode="" horiz-adv-x="768" d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
|
| 373 |
+
<glyph unicode="" horiz-adv-x="768" d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
|
| 374 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
|
| 375 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
|
| 376 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q112 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
|
| 377 |
+
<glyph unicode="" horiz-adv-x="1664" d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
|
| 378 |
+
<glyph unicode="" horiz-adv-x="1408" d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
|
| 379 |
+
<glyph unicode="" d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-7 -10 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18l-4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-14 -1 -7 -7l4 -2 q14 -4 18 -31q0 -3 8 2zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5t-30 -18.5 t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43q-19 4 -51 9.5 t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49t-14 -48 q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54q110 143 124 195 q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5t-40.5 -33.5t-61 -14 q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5t15.5 47.5q1 -31 8 -56.5 t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
|
| 380 |
+
<glyph unicode="" d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -6 6.5 -17.5t7.5 -16.5q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 381 |
+
<glyph unicode="" d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
|
| 382 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1483 512l-587 -587q-52 -53 -127.5 -53t-128.5 53l-587 587q-53 53 -53 128t53 128l587 587q53 53 128 53t128 -53l265 -265l-398 -399l-188 188q-42 42 -99 42q-59 0 -100 -41l-120 -121q-42 -40 -42 -99q0 -58 42 -100l406 -408q30 -28 67 -37l6 -4h28q60 0 99 41 l619 619l2 -3q53 -53 53 -128t-53 -128zM1406 1138l120 -120q14 -15 14 -36t-14 -36l-730 -730q-17 -15 -37 -15v0q-4 0 -6 1q-18 2 -30 14l-407 408q-14 15 -14 36t14 35l121 120q13 15 35 15t36 -15l252 -252l574 575q15 15 36 15t36 -15z" />
|
| 383 |
+
<glyph unicode="" d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 384 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
| 385 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
| 386 |
+
<glyph unicode="" d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 387 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
|
| 388 |
+
<glyph unicode="" d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
|
| 389 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
|
| 390 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
|
| 391 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-78 -100 -90 -131q-17 -41 14 -81q17 -21 81 -82h1l1 -1l1 -1l2 -2q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q17 19 38 30q53 26 239 24 q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 q39 5 64 -2.5t31 -16.5z" />
|
| 392 |
+
<glyph unicode="" horiz-adv-x="1792" d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
|
| 393 |
+
<glyph unicode="" d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495 q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" />
|
| 394 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5 t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56 t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -5 1 -50.5t-1 -71.5q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5 t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" />
|
| 395 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z " />
|
| 396 |
+
<glyph unicode="" d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 397 |
+
<glyph unicode="" d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 398 |
+
<glyph unicode="" d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 399 |
+
<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5 t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 400 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128 q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 16 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" />
|
| 401 |
+
<glyph unicode="" d="M1254 899q16 85 -21 132q-52 65 -187 45q-17 -3 -41 -12.5t-57.5 -30.5t-64.5 -48.5t-59.5 -70t-44.5 -91.5q80 7 113.5 -16t26.5 -99q-5 -52 -52 -143q-43 -78 -71 -99q-44 -32 -87 14q-23 24 -37.5 64.5t-19 73t-10 84t-8.5 71.5q-23 129 -34 164q-12 37 -35.5 69 t-50.5 40q-57 16 -127 -25q-54 -32 -136.5 -106t-122.5 -102v-7q16 -8 25.5 -26t21.5 -20q21 -3 54.5 8.5t58 10.5t41.5 -30q11 -18 18.5 -38.5t15 -48t12.5 -40.5q17 -46 53 -187q36 -146 57 -197q42 -99 103 -125q43 -12 85 -1.5t76 31.5q131 77 250 237 q104 139 172.5 292.5t82.5 226.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 402 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160 q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
|
| 403 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832 q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 404 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 405 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 406 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 407 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 408 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 409 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 410 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 411 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 412 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 413 |
+
</font>
|
| 414 |
+
</defs></svg>
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.svg~HEAD
ADDED
|
@@ -0,0 +1,414 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?xml version="1.0" standalone="no"?>
|
| 2 |
+
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
| 3 |
+
<svg xmlns="http://www.w3.org/2000/svg">
|
| 4 |
+
<metadata></metadata>
|
| 5 |
+
<defs>
|
| 6 |
+
<font id="fontawesomeregular" horiz-adv-x="1536" >
|
| 7 |
+
<font-face units-per-em="1792" ascent="1536" descent="-256" />
|
| 8 |
+
<missing-glyph horiz-adv-x="448" />
|
| 9 |
+
<glyph unicode=" " horiz-adv-x="448" />
|
| 10 |
+
<glyph unicode="	" horiz-adv-x="448" />
|
| 11 |
+
<glyph unicode=" " horiz-adv-x="448" />
|
| 12 |
+
<glyph unicode="¨" horiz-adv-x="1792" />
|
| 13 |
+
<glyph unicode="©" horiz-adv-x="1792" />
|
| 14 |
+
<glyph unicode="®" horiz-adv-x="1792" />
|
| 15 |
+
<glyph unicode="´" horiz-adv-x="1792" />
|
| 16 |
+
<glyph unicode="Æ" horiz-adv-x="1792" />
|
| 17 |
+
<glyph unicode=" " horiz-adv-x="768" />
|
| 18 |
+
<glyph unicode=" " />
|
| 19 |
+
<glyph unicode=" " horiz-adv-x="768" />
|
| 20 |
+
<glyph unicode=" " />
|
| 21 |
+
<glyph unicode=" " horiz-adv-x="512" />
|
| 22 |
+
<glyph unicode=" " horiz-adv-x="384" />
|
| 23 |
+
<glyph unicode=" " horiz-adv-x="256" />
|
| 24 |
+
<glyph unicode=" " horiz-adv-x="256" />
|
| 25 |
+
<glyph unicode=" " horiz-adv-x="192" />
|
| 26 |
+
<glyph unicode=" " horiz-adv-x="307" />
|
| 27 |
+
<glyph unicode=" " horiz-adv-x="85" />
|
| 28 |
+
<glyph unicode=" " horiz-adv-x="307" />
|
| 29 |
+
<glyph unicode=" " horiz-adv-x="384" />
|
| 30 |
+
<glyph unicode="™" horiz-adv-x="1792" />
|
| 31 |
+
<glyph unicode="∞" horiz-adv-x="1792" />
|
| 32 |
+
<glyph unicode="≠" horiz-adv-x="1792" />
|
| 33 |
+
<glyph unicode="" horiz-adv-x="500" d="M0 0z" />
|
| 34 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
|
| 35 |
+
<glyph unicode="" d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
|
| 36 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
| 37 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
|
| 38 |
+
<glyph unicode="" horiz-adv-x="1792" d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 q-18 -18 -44 -18z" />
|
| 39 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 l502 -73q56 -9 56 -46z" />
|
| 40 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
|
| 41 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 131q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q9 0 42 -21.5t74.5 -48t108 -48t133.5 -21.5t133.5 21.5t108 48t74.5 48t42 21.5q61 0 111.5 -20t85.5 -53.5t62 -81 t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
|
| 42 |
+
<glyph unicode="" horiz-adv-x="1920" d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 43 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
| 44 |
+
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
|
| 45 |
+
<glyph unicode="" horiz-adv-x="1792" d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
|
| 46 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
|
| 47 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
|
| 48 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
|
| 49 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z " />
|
| 50 |
+
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
|
| 51 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
|
| 52 |
+
<glyph unicode="" d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
|
| 53 |
+
<glyph unicode="" horiz-adv-x="1408" d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
|
| 54 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
|
| 55 |
+
<glyph unicode="" horiz-adv-x="1280" d="M128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280zM768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z " />
|
| 56 |
+
<glyph unicode="" d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 57 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
|
| 58 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
|
| 59 |
+
<glyph unicode="" d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 60 |
+
<glyph unicode="" d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 61 |
+
<glyph unicode="" d="M1023 576h316q-1 3 -2.5 8t-2.5 8l-212 496h-708l-212 -496q-1 -2 -2.5 -8t-2.5 -8h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 q25 -61 25 -123z" />
|
| 62 |
+
<glyph unicode="" d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 63 |
+
<glyph unicode="" d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q14 0 25 -9 l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
|
| 64 |
+
<glyph unicode="" d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
|
| 65 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 t47 -113z" />
|
| 66 |
+
<glyph unicode="" horiz-adv-x="1152" d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
|
| 67 |
+
<glyph unicode="" horiz-adv-x="1792" d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
|
| 68 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
|
| 69 |
+
<glyph unicode="" horiz-adv-x="768" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
|
| 70 |
+
<glyph unicode="" horiz-adv-x="1152" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
|
| 71 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 35.5 t12 57t-12 57t-29 35.5t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
|
| 72 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
|
| 73 |
+
<glyph unicode="" horiz-adv-x="1792" d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
|
| 74 |
+
<glyph unicode="" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91z" />
|
| 75 |
+
<glyph unicode="" horiz-adv-x="1920" d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
|
| 76 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
|
| 77 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
| 78 |
+
<glyph unicode="" horiz-adv-x="1664" d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
|
| 79 |
+
<glyph unicode="" horiz-adv-x="1920" d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
|
| 80 |
+
<glyph unicode="" horiz-adv-x="1664" d="M725 977l-170 -450q73 -1 153.5 -2t119 -1.5t52.5 -0.5l29 2q-32 95 -92 241q-53 132 -92 211zM21 -128h-21l2 79q22 7 80 18q89 16 110 31q20 16 48 68l237 616l280 724h75h53l11 -21l205 -480q103 -242 124 -297q39 -102 96 -235q26 -58 65 -164q24 -67 65 -149 q22 -49 35 -57q22 -19 69 -23q47 -6 103 -27q6 -39 6 -57q0 -14 -1 -26q-80 0 -192 8q-93 8 -189 8q-79 0 -135 -2l-200 -11l-58 -2q0 45 4 78l131 28q56 13 68 23q12 12 12 27t-6 32l-47 114l-92 228l-450 2q-29 -65 -104 -274q-23 -64 -23 -84q0 -31 17 -43 q26 -21 103 -32q3 0 13.5 -2t30 -5t40.5 -6q1 -28 1 -58q0 -17 -2 -27q-66 0 -349 20l-48 -8q-81 -14 -167 -14z" />
|
| 81 |
+
<glyph unicode="" horiz-adv-x="1408" d="M555 15q76 -32 140 -32q131 0 216 41t122 113q38 70 38 181q0 114 -41 180q-58 94 -141 126q-80 32 -247 32q-74 0 -101 -10v-144l-1 -173l3 -270q0 -15 12 -44zM541 761q43 -7 109 -7q175 0 264 65t89 224q0 112 -85 187q-84 75 -255 75q-52 0 -130 -13q0 -44 2 -77 q7 -122 6 -279l-1 -98q0 -43 1 -77zM0 -128l2 94q45 9 68 12q77 12 123 31q17 27 21 51q9 66 9 194l-2 497q-5 256 -9 404q-1 87 -11 109q-1 4 -12 12q-18 12 -69 15q-30 2 -114 13l-4 83l260 6l380 13l45 1q5 0 14 0.5t14 0.5q1 0 21.5 -0.5t40.5 -0.5h74q88 0 191 -27 q43 -13 96 -39q57 -29 102 -76q44 -47 65 -104t21 -122q0 -70 -32 -128t-95 -105q-26 -20 -150 -77q177 -41 267 -146q92 -106 92 -236q0 -76 -29 -161q-21 -62 -71 -117q-66 -72 -140 -108q-73 -36 -203 -60q-82 -15 -198 -11l-197 4q-84 2 -298 -11q-33 -3 -272 -11z" />
|
| 82 |
+
<glyph unicode="" horiz-adv-x="1024" d="M0 -126l17 85q4 1 77 20q76 19 116 39q29 37 41 101l27 139l56 268l12 64q8 44 17 84.5t16 67t12.5 46.5t9 30.5t3.5 11.5l29 157l16 63l22 135l8 50v38q-41 22 -144 28q-28 2 -38 4l19 103l317 -14q39 -2 73 -2q66 0 214 9q33 2 68 4.5t36 2.5q-2 -19 -6 -38 q-7 -29 -13 -51q-55 -19 -109 -31q-64 -16 -101 -31q-12 -31 -24 -88q-9 -44 -13 -82q-44 -199 -66 -306l-61 -311l-38 -158l-43 -235l-12 -45q-2 -7 1 -27q64 -15 119 -21q36 -5 66 -10q-1 -29 -7 -58q-7 -31 -9 -41q-18 0 -23 -1q-24 -2 -42 -2q-9 0 -28 3q-19 4 -145 17 l-198 2q-41 1 -174 -11q-74 -7 -98 -9z" />
|
| 83 |
+
<glyph unicode="" horiz-adv-x="1792" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l215 -1h293l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -42.5 2t-103.5 -1t-111 -1 q-34 0 -67 -5q-10 -97 -8 -136l1 -152v-332l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-88 0 -233 -14q-48 -4 -70 -4q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q8 192 6 433l-5 428q-1 62 -0.5 118.5t0.5 102.5t-2 57t-6 15q-6 5 -14 6q-38 6 -148 6q-43 0 -100 -13.5t-73 -24.5q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1744 128q33 0 42 -18.5t-11 -44.5 l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80z" />
|
| 84 |
+
<glyph unicode="" d="M81 1407l54 -27q20 -5 211 -5h130l19 3l115 1l446 -1h318l34 -2q14 -1 28 7t21 16l7 8l42 1q15 0 28 -1v-104.5t1 -131.5l1 -100l-1 -58q0 -32 -4 -51q-39 -15 -68 -18q-25 43 -54 128q-8 24 -15.5 62.5t-11.5 65.5t-6 29q-13 15 -27 19q-7 2 -58.5 2t-138.5 -1t-128 -1 q-94 0 -127 -5q-10 -97 -8 -136l1 -152v52l3 -359l-1 -147q-1 -46 11 -85q49 -25 89 -32q2 0 18 -5t44 -13t43 -12q30 -8 50 -18q5 -45 5 -50q0 -10 -3 -29q-14 -1 -34 -1q-110 0 -187 10q-72 8 -238 8q-82 0 -233 -13q-45 -5 -70 -5q-2 22 -2 26l-1 26v9q21 33 79 49 q139 38 159 50q9 21 12 56q6 137 6 433l-5 44q0 265 -2 278q-2 11 -6 15q-6 5 -14 6q-38 6 -148 6q-50 0 -168.5 -14t-132.5 -24q-13 -9 -22 -33t-22 -75t-24 -84q-6 -19 -19.5 -32t-20.5 -13q-44 27 -56 44v297v86zM1505 113q26 -20 26 -49t-26 -49l-162 -126 q-26 -20 -44.5 -11t-18.5 42v80h-1024v-80q0 -33 -18.5 -42t-44.5 11l-162 126q-26 20 -26 49t26 49l162 126q26 20 44.5 11t18.5 -42v-80h1024v80q0 33 18.5 42t44.5 -11z" />
|
| 85 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 86 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
|
| 87 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 88 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
| 89 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 90 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 91 |
+
<glyph unicode="" horiz-adv-x="1792" d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 92 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 q39 -17 39 -59z" />
|
| 93 |
+
<glyph unicode="" horiz-adv-x="1920" d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 94 |
+
<glyph unicode="" d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 q53 0 91 -38l235 -234q37 -39 37 -91z" />
|
| 95 |
+
<glyph unicode="" horiz-adv-x="1024" d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
|
| 96 |
+
<glyph unicode="" d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 97 |
+
<glyph unicode="" horiz-adv-x="1024" d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
|
| 98 |
+
<glyph unicode="" horiz-adv-x="1792" d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
|
| 99 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
|
| 100 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 q24 -24 24 -57t-24 -57z" />
|
| 101 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 102 |
+
<glyph unicode="" horiz-adv-x="1024" d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19z" />
|
| 103 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 11 13 19l710 710 q19 19 32 13t13 -32v-710q4 11 13 19z" />
|
| 104 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-8 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q5 11 13 19z" />
|
| 105 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
|
| 106 |
+
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
|
| 107 |
+
<glyph unicode="" d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 108 |
+
<glyph unicode="" horiz-adv-x="1664" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
| 109 |
+
<glyph unicode="" horiz-adv-x="1792" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v710q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19l-710 -710 q-19 -19 -32 -13t-13 32v710q-5 -10 -13 -19z" />
|
| 110 |
+
<glyph unicode="" horiz-adv-x="1024" d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q8 -8 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-5 -10 -13 -19z" />
|
| 111 |
+
<glyph unicode="" horiz-adv-x="1538" d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
|
| 112 |
+
<glyph unicode="" horiz-adv-x="1152" d="M742 -37l-652 651q-37 37 -37 90.5t37 90.5l652 651q37 37 90.5 37t90.5 -37l75 -75q37 -37 37 -90.5t-37 -90.5l-486 -486l486 -485q37 -38 37 -91t-37 -90l-75 -75q-37 -37 -90.5 -37t-90.5 37z" />
|
| 113 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1099 704q0 -52 -37 -91l-652 -651q-37 -37 -90 -37t-90 37l-76 75q-37 39 -37 91q0 53 37 90l486 486l-486 485q-37 39 -37 91q0 53 37 90l76 75q36 38 90 38t90 -38l652 -651q37 -37 37 -90z" />
|
| 114 |
+
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 115 |
+
<glyph unicode="" d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 t103 -385.5z" />
|
| 116 |
+
<glyph unicode="" d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 117 |
+
<glyph unicode="" d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 118 |
+
<glyph unicode="" d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 119 |
+
<glyph unicode="" d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 120 |
+
<glyph unicode="" d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
|
| 121 |
+
<glyph unicode="" d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 122 |
+
<glyph unicode="" d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 123 |
+
<glyph unicode="" d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
|
| 124 |
+
<glyph unicode="" d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 t32.5 -90.5z" />
|
| 125 |
+
<glyph unicode="" d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
|
| 126 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 q37 -39 37 -91z" />
|
| 127 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
| 128 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
|
| 129 |
+
<glyph unicode="" d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
|
| 130 |
+
<glyph unicode="" d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
|
| 131 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
|
| 132 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
|
| 133 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
|
| 134 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
|
| 135 |
+
<glyph unicode="" d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
|
| 136 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-30 0 -51 11t-31 24t-27 42q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
|
| 137 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
|
| 138 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
|
| 139 |
+
<glyph unicode="" horiz-adv-x="1792" d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 q-105 -188 -315 -566t-316 -567l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z " />
|
| 140 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
|
| 141 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
|
| 142 |
+
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
| 143 |
+
<glyph unicode="" horiz-adv-x="1792" d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
| 144 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
|
| 145 |
+
<glyph unicode="" d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
|
| 146 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 320q0 -53 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-486 485l-486 -485q-36 -38 -90 -38t-90 38l-75 75q-38 36 -38 90q0 53 38 91l651 651q37 37 90 37q52 0 91 -37l650 -651q38 -38 38 -91z" />
|
| 147 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1611 832q0 -53 -37 -90l-651 -651q-38 -38 -91 -38q-54 0 -90 38l-651 651q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l486 -486l486 486q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
|
| 148 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -11 7 -21 zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z " />
|
| 149 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5 l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5 t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
|
| 150 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
| 151 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
|
| 152 |
+
<glyph unicode="" horiz-adv-x="768" d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 153 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
|
| 154 |
+
<glyph unicode="" horiz-adv-x="1920" d="M512 512v-384h-256v384h256zM896 1024v-896h-256v896h256zM1280 768v-640h-256v640h256zM1664 1152v-1024h-256v1024h256zM1792 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5z M1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 155 |
+
<glyph unicode="" d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 156 |
+
<glyph unicode="" d="M1307 618l23 219h-198v109q0 49 15.5 68.5t71.5 19.5h110v219h-175q-152 0 -218 -72t-66 -213v-131h-131v-219h131v-635h262v635h175zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 157 |
+
<glyph unicode="" horiz-adv-x="1792" d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 158 |
+
<glyph unicode="" horiz-adv-x="1792" d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
|
| 159 |
+
<glyph unicode="" horiz-adv-x="1920" d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -10 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -9 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
|
| 160 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
|
| 161 |
+
<glyph unicode="" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
|
| 162 |
+
<glyph unicode="" d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 32 18 69t-17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -74 49 -163z" />
|
| 163 |
+
<glyph unicode="" horiz-adv-x="896" d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
|
| 164 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 q224 0 351 -124t127 -344z" />
|
| 165 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
|
| 166 |
+
<glyph unicode="" d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 167 |
+
<glyph unicode="" horiz-adv-x="1152" d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
|
| 168 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
|
| 169 |
+
<glyph unicode="" d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 170 |
+
<glyph unicode="" horiz-adv-x="1664" d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
|
| 171 |
+
<glyph unicode="" d="M394 184q-8 -9 -20 3q-13 11 -4 19q8 9 20 -3q12 -11 4 -19zM352 245q9 -12 0 -19q-8 -6 -17 7t0 18q9 7 17 -6zM291 305q-5 -7 -13 -2q-10 5 -7 12q3 5 13 2q10 -5 7 -12zM322 271q-6 -7 -16 3q-9 11 -2 16q6 6 16 -3q9 -11 2 -16zM451 159q-4 -12 -19 -6q-17 4 -13 15 t19 7q16 -5 13 -16zM514 154q0 -11 -16 -11q-17 -2 -17 11q0 11 16 11q17 2 17 -11zM572 164q2 -10 -14 -14t-18 8t14 15q16 2 18 -9zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-224q-16 0 -24.5 1t-19.5 5t-16 14.5t-5 27.5v239q0 97 -52 142q57 6 102.5 18t94 39 t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103 q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -103t0.5 -68q0 -22 -11 -33.5t-22 -13t-33 -1.5 h-224q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 172 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
|
| 173 |
+
<glyph unicode="" d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -10 1 -18.5t3 -17t4 -13.5t6.5 -16t6.5 -17q16 -40 25 -118.5t9 -136.5z" />
|
| 174 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -52.5 3.5t-57.5 12.5t-47.5 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-128 79 -264.5 215.5t-215.5 264.5q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47.5t-12.5 57.5t-3.5 52.5 q0 92 51 186q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174 q2 -1 19 -11.5t24 -14t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
|
| 175 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 176 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
|
| 177 |
+
<glyph unicode="" d="M1280 343q0 11 -2 16q-3 8 -38.5 29.5t-88.5 49.5l-53 29q-5 3 -19 13t-25 15t-21 5q-18 0 -47 -32.5t-57 -65.5t-44 -33q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170.5 126.5t-126.5 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5t-3.5 16.5q0 13 20.5 33.5t45 38.5 t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5t320.5 -216.5q6 -2 30 -11t33 -12.5 t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 178 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
|
| 179 |
+
<glyph unicode="" horiz-adv-x="768" d="M511 980h257l-30 -284h-227v-824h-341v824h-170v284h170v171q0 182 86 275.5t283 93.5h227v-284h-142q-39 0 -62.5 -6.5t-34 -23.5t-13.5 -34.5t-3 -49.5v-142z" />
|
| 180 |
+
<glyph unicode="" d="M1536 640q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -39.5 7t-12.5 30v211q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 121 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-86 13.5 q-44 -113 -7 -204q-79 -85 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-40 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23 q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -89t0.5 -54q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 181 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 t316.5 -131.5t131.5 -316.5z" />
|
| 182 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
|
| 183 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 q187 -186 294 -425.5t120 -501.5z" />
|
| 184 |
+
<glyph unicode="" d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
|
| 185 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
|
| 186 |
+
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM183 128h1298q-164 181 -246.5 411.5t-82.5 484.5q0 256 -320 256t-320 -256q0 -254 -82.5 -484.5t-246.5 -411.5zM1664 128q0 -52 -38 -90t-90 -38 h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
| 187 |
+
<glyph unicode="" d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
|
| 188 |
+
<glyph unicode="" horiz-adv-x="1792" d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
|
| 189 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-2 3 -3.5 4.5t-4 4.5t-4.5 5q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576 q-50 0 -89 -38.5t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45 t45 -19t45 19t19 45zM1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128 q0 122 81.5 189t206.5 67q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 190 |
+
<glyph unicode="" d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
|
| 191 |
+
<glyph unicode="" d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
|
| 192 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 193 |
+
<glyph unicode="" d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 194 |
+
<glyph unicode="" d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 195 |
+
<glyph unicode="" d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 196 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 10.5t-9.5 10.5q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-5 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10t17 -20q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q7 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
|
| 197 |
+
<glyph unicode="" horiz-adv-x="1664" d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
|
| 198 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
|
| 199 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
|
| 200 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
|
| 201 |
+
<glyph unicode="" d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z " />
|
| 202 |
+
<glyph unicode="" horiz-adv-x="1920" d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
|
| 203 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
|
| 204 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z " />
|
| 205 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
|
| 206 |
+
<glyph unicode="" horiz-adv-x="1792" d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
|
| 207 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
|
| 208 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 z" />
|
| 209 |
+
<glyph unicode="" d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
|
| 210 |
+
<glyph unicode="" d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 211 |
+
<glyph unicode="" d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 212 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 213 |
+
<glyph unicode="" horiz-adv-x="1792" d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 122t0.5 121v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5 t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
|
| 214 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 97 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -55 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
|
| 215 |
+
<glyph unicode="" d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
|
| 216 |
+
<glyph unicode="" horiz-adv-x="1664" d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 z" />
|
| 217 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
|
| 218 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
|
| 219 |
+
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 220 |
+
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
|
| 221 |
+
<glyph unicode="" d="M678 -57q0 -38 -10 -71h-380q-95 0 -171.5 56.5t-103.5 147.5q24 45 69 77.5t100 49.5t107 24t107 7q32 0 49 -2q6 -4 30.5 -21t33 -23t31 -23t32 -25.5t27.5 -25.5t26.5 -29.5t21 -30.5t17.5 -34.5t9.5 -36t4.5 -40.5zM385 294q-234 -7 -385 -85v433q103 -118 273 -118 q32 0 70 5q-21 -61 -21 -86q0 -67 63 -149zM558 805q0 -100 -43.5 -160.5t-140.5 -60.5q-51 0 -97 26t-78 67.5t-56 93.5t-35.5 104t-11.5 99q0 96 51.5 165t144.5 69q66 0 119 -41t84 -104t47 -130t16 -128zM1536 896v-736q0 -119 -84.5 -203.5t-203.5 -84.5h-468 q39 73 39 157q0 66 -22 122.5t-55.5 93t-72 71t-72 59.5t-55.5 54.5t-22 59.5q0 36 23 68t56 61.5t65.5 64.5t55.5 93t23 131t-26.5 145.5t-75.5 118.5q-6 6 -14 11t-12.5 7.5t-10 9.5t-10.5 17h135l135 64h-437q-138 0 -244.5 -38.5t-182.5 -133.5q0 126 81 213t207 87h960 q119 0 203.5 -84.5t84.5 -203.5v-96h-256v256h-128v-256h-256v-128h256v-256h128v256h256z" />
|
| 222 |
+
<glyph unicode="" horiz-adv-x="1664" d="M876 71q0 21 -4.5 40.5t-9.5 36t-17.5 34.5t-21 30.5t-26.5 29.5t-27.5 25.5t-32 25.5t-31 23t-33 23t-30.5 21q-17 2 -50 2q-54 0 -106 -7t-108 -25t-98 -46t-69 -75t-27 -107q0 -68 35.5 -121.5t93 -84t120.5 -45.5t127 -15q59 0 112.5 12.5t100.5 39t74.5 73.5 t27.5 110zM756 933q0 60 -16.5 127.5t-47 130.5t-84 104t-119.5 41q-93 0 -144 -69t-51 -165q0 -47 11.5 -99t35.5 -104t56 -93.5t78 -67.5t97 -26q97 0 140.5 60.5t43.5 160.5zM625 1408h437l-135 -79h-135q71 -45 110 -126t39 -169q0 -74 -23 -131.5t-56 -92.5t-66 -64.5 t-56 -61t-23 -67.5q0 -26 16.5 -51t43 -48t58.5 -48t64 -55.5t58.5 -66t43 -85t16.5 -106.5q0 -160 -140 -282q-152 -131 -420 -131q-59 0 -119.5 10t-122 33.5t-108.5 58t-77 89t-30 121.5q0 61 37 135q32 64 96 110.5t145 71t155 36t150 13.5q-64 83 -64 149q0 12 2 23.5 t5 19.5t8 21.5t7 21.5q-40 -5 -70 -5q-149 0 -255.5 98t-106.5 246q0 140 95 250.5t234 141.5q94 20 187 20zM1664 1152v-128h-256v-256h-128v256h-256v128h256v256h128v-256h256z" />
|
| 223 |
+
<glyph unicode="" horiz-adv-x="1920" d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
|
| 224 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
| 225 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 226 |
+
<glyph unicode="" horiz-adv-x="640" d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
|
| 227 |
+
<glyph unicode="" horiz-adv-x="640" d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 228 |
+
<glyph unicode="" horiz-adv-x="1664" d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
|
| 229 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 230 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
|
| 231 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
|
| 232 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
|
| 233 |
+
<glyph unicode="" d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
|
| 234 |
+
<glyph unicode="" d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
|
| 235 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
|
| 236 |
+
<glyph unicode="" horiz-adv-x="1792" d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
|
| 237 |
+
<glyph unicode="" horiz-adv-x="1792" d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
|
| 238 |
+
<glyph unicode="" horiz-adv-x="1792" d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
|
| 239 |
+
<glyph unicode="" horiz-adv-x="896" d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
|
| 240 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 z" />
|
| 241 |
+
<glyph unicode="" horiz-adv-x="1664" d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
|
| 242 |
+
<glyph unicode="" horiz-adv-x="1792" d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
|
| 243 |
+
<glyph unicode="" horiz-adv-x="1024" d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
|
| 244 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
|
| 245 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
| 246 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
|
| 247 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 t271.5 -112.5t112.5 -271.5z" />
|
| 248 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
|
| 249 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 t66 -158z" />
|
| 250 |
+
<glyph unicode="" horiz-adv-x="1664" d="M848 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1664 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q190 161 287 397.5t97 498.5 q0 165 96 262t264 117q-8 18 -8 37q0 40 28 68t68 28t68 -28t28 -68q0 -19 -8 -37q168 -20 264 -117t96 -262q0 -262 97 -498.5t287 -397.5z" />
|
| 251 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
|
| 252 |
+
<glyph unicode="" horiz-adv-x="1408" d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
|
| 253 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1024 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1024 608v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM128 0h1024v768h-416q-40 0 -68 28t-28 68v416h-512v-1280z M768 896h376q-10 29 -22 41l-313 313q-12 12 -41 22v-376zM1280 864v-896q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h640q40 0 88 -20t76 -48l312 -312q28 -28 48 -76t20 -88z" />
|
| 254 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
|
| 255 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
|
| 256 |
+
<glyph unicode="" horiz-adv-x="1920" d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 257 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
|
| 258 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q261 -58 287 -93z" />
|
| 259 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
|
| 260 |
+
<glyph unicode="" d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 261 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 262 |
+
<glyph unicode="" horiz-adv-x="1024" d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
|
| 263 |
+
<glyph unicode="" horiz-adv-x="1024" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 264 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 265 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 266 |
+
<glyph unicode="" horiz-adv-x="640" d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 267 |
+
<glyph unicode="" horiz-adv-x="640" d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 268 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
|
| 269 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
|
| 270 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
|
| 271 |
+
<glyph unicode="" horiz-adv-x="1920" d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
|
| 272 |
+
<glyph unicode="" horiz-adv-x="1152" d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
|
| 273 |
+
<glyph unicode="" horiz-adv-x="768" d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
|
| 274 |
+
<glyph unicode="" d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 t279.5 -279.5t103 -385.5z" />
|
| 275 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
|
| 276 |
+
<glyph unicode="" horiz-adv-x="1664" d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
|
| 277 |
+
<glyph unicode="" horiz-adv-x="1568" d="M496 192q0 -60 -42.5 -102t-101.5 -42q-60 0 -102 42t-42 102t42 102t102 42q59 0 101.5 -42t42.5 -102zM928 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -66 -47 -113t-113 -47t-113 47t-47 113 t47 113t113 47t113 -47t47 -113zM1360 192q0 -46 -33 -79t-79 -33t-79 33t-33 79t33 79t79 33t79 -33t33 -79zM528 1088q0 -73 -51.5 -124.5t-124.5 -51.5t-124.5 51.5t-51.5 124.5t51.5 124.5t124.5 51.5t124.5 -51.5t51.5 -124.5zM992 1280q0 -80 -56 -136t-136 -56 t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1536 640q0 -40 -28 -68t-68 -28t-68 28t-28 68t28 68t68 28t68 -28t28 -68zM1328 1088q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5z" />
|
| 278 |
+
<glyph unicode="" d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 279 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
|
| 280 |
+
<glyph unicode="" horiz-adv-x="1664" d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 q0 -87 -27 -168q136 -160 136 -398z" />
|
| 281 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
|
| 282 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z " />
|
| 283 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 284 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 285 |
+
<glyph unicode="" d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 286 |
+
<glyph unicode="" d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 287 |
+
<glyph unicode="" d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 288 |
+
<glyph unicode="" horiz-adv-x="1920" d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
|
| 289 |
+
<glyph unicode="" horiz-adv-x="1920" d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
|
| 290 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
| 291 |
+
<glyph unicode="" horiz-adv-x="1792" d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
|
| 292 |
+
<glyph unicode="" horiz-adv-x="1664" d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 t9 -23z" />
|
| 293 |
+
<glyph unicode="" horiz-adv-x="1920" d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
|
| 294 |
+
<glyph unicode="" horiz-adv-x="1792" d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
|
| 295 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
|
| 296 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
|
| 297 |
+
<glyph unicode="" horiz-adv-x="1664" d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
|
| 298 |
+
<glyph unicode="" horiz-adv-x="1024" d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 q-2 -287 -226 -414q-68 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
|
| 299 |
+
<glyph unicode="" horiz-adv-x="1664" d="M439 265l-256 -256q-10 -9 -23 -9q-12 0 -23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
|
| 300 |
+
<glyph unicode="" horiz-adv-x="1024" d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
|
| 301 |
+
<glyph unicode="" horiz-adv-x="640" d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
|
| 302 |
+
<glyph unicode="" horiz-adv-x="640" d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
|
| 303 |
+
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1534 846v-206h-514l-3 27 q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5t-65.5 -51.5t-30.5 -63h232v80 h126z" />
|
| 304 |
+
<glyph unicode="" d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3l-9 -21q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109zM1536 -50v-206h-514l-4 27 q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73h232v80h126z" />
|
| 305 |
+
<glyph unicode="" horiz-adv-x="1920" d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
|
| 306 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
|
| 307 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
|
| 308 |
+
<glyph unicode="" horiz-adv-x="1408" d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
|
| 309 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
|
| 310 |
+
<glyph unicode="" horiz-adv-x="1664" d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
|
| 311 |
+
<glyph unicode="" horiz-adv-x="1408" d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
|
| 312 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
|
| 313 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" />
|
| 314 |
+
<glyph unicode="" d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 315 |
+
<glyph unicode="" d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 316 |
+
<glyph unicode="" d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 317 |
+
<glyph unicode="" d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 318 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
|
| 319 |
+
<glyph unicode="" horiz-adv-x="1792" d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
|
| 320 |
+
<glyph unicode="" horiz-adv-x="1792" d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-13 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
|
| 321 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 v-320h736z" />
|
| 322 |
+
<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 323 |
+
<glyph unicode="" horiz-adv-x="1408" d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
| 324 |
+
<glyph unicode="" horiz-adv-x="384" d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
|
| 325 |
+
<glyph unicode="" d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 232 -177 396t-396 177q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128q13 0 23 10 t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 326 |
+
<glyph unicode="" d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 q16 -8 32 -8q17 0 32 9z" />
|
| 327 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
|
| 328 |
+
<glyph unicode="" d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 t84.5 -203.5z" />
|
| 329 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 330 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
|
| 331 |
+
<glyph unicode="" horiz-adv-x="1024" d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
|
| 332 |
+
<glyph unicode="" d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 333 |
+
<glyph unicode="" d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 334 |
+
<glyph unicode="" d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 335 |
+
<glyph unicode="" d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q10 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 336 |
+
<glyph unicode="" d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 337 |
+
<glyph unicode="" d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 338 |
+
<glyph unicode="" d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 339 |
+
<glyph unicode="" d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 340 |
+
<glyph unicode="" horiz-adv-x="1024" d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
|
| 341 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
|
| 342 |
+
<glyph unicode="" horiz-adv-x="1024" d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 t53 -63.5t31.5 -76.5t13 -94z" />
|
| 343 |
+
<glyph unicode="" horiz-adv-x="898" d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
|
| 344 |
+
<glyph unicode="" horiz-adv-x="1027" d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
|
| 345 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128 q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" />
|
| 346 |
+
<glyph unicode="" horiz-adv-x="1792" d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
|
| 347 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
|
| 348 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
| 349 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1024 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1024 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1280 768v-800q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28 t-28 68v1344q0 40 28 68t68 28h544v-544q0 -40 28 -68t68 -28h544zM1277 896h-509v509q82 -15 132 -65l312 -312q50 -50 65 -132z" />
|
| 350 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 l230 -662h70z" />
|
| 351 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 v119h121z" />
|
| 352 |
+
<glyph unicode="" horiz-adv-x="1792" d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
|
| 353 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
|
| 354 |
+
<glyph unicode="" d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
|
| 355 |
+
<glyph unicode="" d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
|
| 356 |
+
<glyph unicode="" horiz-adv-x="1664" d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
|
| 357 |
+
<glyph unicode="" horiz-adv-x="1664" d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
|
| 358 |
+
<glyph unicode="" d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 16 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 q21 -28 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78l24 -69t23 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38q-51 0 -78 -38 q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 359 |
+
<glyph unicode="" d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-37 -51 -106 -51q-67 0 -105 51 q-28 38 -28 118v175q0 80 28 117q38 51 105 51q69 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
|
| 360 |
+
<glyph unicode="" horiz-adv-x="1408" d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 q25 45 64 45h241q22 0 31 -15z" />
|
| 361 |
+
<glyph unicode="" d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 362 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1280 640q0 37 -30 54l-512 320q-31 20 -65 2q-33 -18 -33 -56v-640q0 -38 33 -56q16 -8 31 -8q20 0 34 10l512 320q30 17 30 54zM1792 640q0 -96 -1 -150t-8.5 -136.5t-22.5 -147.5q-16 -73 -69 -123t-124 -58q-222 -25 -671 -25t-671 25q-71 8 -124.5 58t-69.5 123 q-14 65 -21.5 147.5t-8.5 136.5t-1 150t1 150t8.5 136.5t22.5 147.5q16 73 69 123t124 58q222 25 671 25t671 -25q71 -8 124.5 -58t69.5 -123q14 -65 21.5 -147.5t8.5 -136.5t1 -150z" />
|
| 363 |
+
<glyph unicode="" horiz-adv-x="1792" d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
|
| 364 |
+
<glyph unicode="" horiz-adv-x="1408" d="M928 135v-151l-707 -1v151zM1169 481v-701l-1 -35v-1h-1132l-35 1h-1v736h121v-618h928v618h120zM241 393l704 -65l-13 -150l-705 65zM309 709l683 -183l-39 -146l-683 183zM472 1058l609 -360l-77 -130l-609 360zM832 1389l398 -585l-124 -85l-399 584zM1285 1536 l121 -697l-149 -26l-121 697z" />
|
| 365 |
+
<glyph unicode="" d="M1362 110v648h-135q20 -63 20 -131q0 -126 -64 -232.5t-174 -168.5t-240 -62q-197 0 -337 135.5t-140 327.5q0 68 20 131h-141v-648q0 -26 17.5 -43.5t43.5 -17.5h1069q25 0 43 17.5t18 43.5zM1078 643q0 124 -90.5 211.5t-218.5 87.5q-127 0 -217.5 -87.5t-90.5 -211.5 t90.5 -211.5t217.5 -87.5q128 0 218.5 87.5t90.5 211.5zM1362 1003v165q0 28 -20 48.5t-49 20.5h-174q-29 0 -49 -20.5t-20 -48.5v-165q0 -29 20 -49t49 -20h174q29 0 49 20t20 49zM1536 1211v-1142q0 -81 -58 -139t-139 -58h-1142q-81 0 -139 58t-58 139v1142q0 81 58 139 t139 58h1142q81 0 139 -58t58 -139z" />
|
| 366 |
+
<glyph unicode="" d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
|
| 367 |
+
<glyph unicode="" d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 368 |
+
<glyph unicode="" horiz-adv-x="1408" d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
|
| 369 |
+
<glyph unicode="" d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 370 |
+
<glyph unicode="" horiz-adv-x="1024" d="M390 1408h219v-388h364v-241h-364v-394q0 -136 14 -172q13 -37 52 -60q50 -31 117 -31q117 0 232 76v-242q-102 -48 -178 -65q-77 -19 -173 -19q-105 0 -186 27q-78 25 -138 75q-58 51 -79 105q-22 54 -22 161v539h-170v217q91 30 155 84q64 55 103 132q39 78 54 196z " />
|
| 371 |
+
<glyph unicode="" d="M1123 127v181q-88 -56 -174 -56q-51 0 -88 23q-29 17 -39 45q-11 30 -11 129v295h274v181h-274v291h-164q-11 -90 -40 -147t-78 -99q-48 -40 -116 -63v-163h127v-404q0 -78 17 -121q17 -42 59 -78q43 -37 104 -57q62 -20 140 -20q67 0 129 14q57 13 134 49zM1536 1120 v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 372 |
+
<glyph unicode="" horiz-adv-x="768" d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
|
| 373 |
+
<glyph unicode="" horiz-adv-x="768" d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
|
| 374 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
|
| 375 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
|
| 376 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q112 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
|
| 377 |
+
<glyph unicode="" horiz-adv-x="1664" d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
|
| 378 |
+
<glyph unicode="" horiz-adv-x="1408" d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
|
| 379 |
+
<glyph unicode="" d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-7 -10 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18l-4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-14 -1 -7 -7l4 -2 q14 -4 18 -31q0 -3 8 2zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5t-30 -18.5 t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43q-19 4 -51 9.5 t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49t-14 -48 q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54q110 143 124 195 q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5t-40.5 -33.5t-61 -14 q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5t15.5 47.5q1 -31 8 -56.5 t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
|
| 380 |
+
<glyph unicode="" d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -6 6.5 -17.5t7.5 -16.5q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 381 |
+
<glyph unicode="" d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
|
| 382 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1483 512l-587 -587q-52 -53 -127.5 -53t-128.5 53l-587 587q-53 53 -53 128t53 128l587 587q53 53 128 53t128 -53l265 -265l-398 -399l-188 188q-42 42 -99 42q-59 0 -100 -41l-120 -121q-42 -40 -42 -99q0 -58 42 -100l406 -408q30 -28 67 -37l6 -4h28q60 0 99 41 l619 619l2 -3q53 -53 53 -128t-53 -128zM1406 1138l120 -120q14 -15 14 -36t-14 -36l-730 -730q-17 -15 -37 -15v0q-4 0 -6 1q-18 2 -30 14l-407 408q-14 15 -14 36t14 35l121 120q13 15 35 15t36 -15l252 -252l574 575q15 15 36 15t36 -15z" />
|
| 383 |
+
<glyph unicode="" d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
|
| 384 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
| 385 |
+
<glyph unicode="" horiz-adv-x="1024" d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
|
| 386 |
+
<glyph unicode="" d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 387 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
|
| 388 |
+
<glyph unicode="" d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
|
| 389 |
+
<glyph unicode="" horiz-adv-x="1792" d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
|
| 390 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
|
| 391 |
+
<glyph unicode="" horiz-adv-x="1920" d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-78 -100 -90 -131q-17 -41 14 -81q17 -21 81 -82h1l1 -1l1 -1l2 -2q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q17 19 38 30q53 26 239 24 q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 q39 5 64 -2.5t31 -16.5z" />
|
| 392 |
+
<glyph unicode="" horiz-adv-x="1792" d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
|
| 393 |
+
<glyph unicode="" d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495 q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" />
|
| 394 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5 t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56 t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -5 1 -50.5t-1 -71.5q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5 t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" />
|
| 395 |
+
<glyph unicode="" horiz-adv-x="1280" d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z " />
|
| 396 |
+
<glyph unicode="" d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 397 |
+
<glyph unicode="" d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 398 |
+
<glyph unicode="" d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 399 |
+
<glyph unicode="" d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5 t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
|
| 400 |
+
<glyph unicode="" horiz-adv-x="1664" d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128 q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 16 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" />
|
| 401 |
+
<glyph unicode="" d="M1254 899q16 85 -21 132q-52 65 -187 45q-17 -3 -41 -12.5t-57.5 -30.5t-64.5 -48.5t-59.5 -70t-44.5 -91.5q80 7 113.5 -16t26.5 -99q-5 -52 -52 -143q-43 -78 -71 -99q-44 -32 -87 14q-23 24 -37.5 64.5t-19 73t-10 84t-8.5 71.5q-23 129 -34 164q-12 37 -35.5 69 t-50.5 40q-57 16 -127 -25q-54 -32 -136.5 -106t-122.5 -102v-7q16 -8 25.5 -26t21.5 -20q21 -3 54.5 8.5t58 10.5t41.5 -30q11 -18 18.5 -38.5t15 -48t12.5 -40.5q17 -46 53 -187q36 -146 57 -197q42 -99 103 -125q43 -12 85 -1.5t76 31.5q131 77 250 237 q104 139 172.5 292.5t82.5 226.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 402 |
+
<glyph unicode="" horiz-adv-x="1152" d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160 q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
|
| 403 |
+
<glyph unicode="" horiz-adv-x="1408" d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832 q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
|
| 404 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 405 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 406 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 407 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 408 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 409 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 410 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 411 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 412 |
+
<glyph unicode="" horiz-adv-x="1792" />
|
| 413 |
+
</font>
|
| 414 |
+
</defs></svg>
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.ttf
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.ttf~HEAD
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.woff
ADDED
|
Binary file
|
shared/assets/global/fonts/fontawesome/fontawesome-webfont.woff~HEAD
ADDED
|
Binary file
|
shared/assets/global/images/leads.png
ADDED
|
Binary file
|
shared/assets/global/images/shortcodes-blue.png
ADDED
|
Binary file
|
shared/assets/global/js/jquery.cookie.js
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
| 1 |
+
/*!
|
shared/assets/global/js/jquery.total-storage.min.js
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* TotalStorage
|
| 3 |
+
*
|
| 4 |
+
* Copyright (c) 2012 Jared Novack & Upstatement (upstatement.com)
|
| 5 |
+
* Dual licensed under the MIT and GPL licenses:
|
| 6 |
+
* http://www.opensource.org/licenses/mit-license.php
|
| 7 |
+
* http://www.gnu.org/licenses/gpl.html
|
| 8 |
+
*
|
| 9 |
+
* Total Storage is the conceptual the love child of jStorage by Andris Reinman,
|
| 10 |
+
* and Cookie by Klaus Hartl -- though this is not connected to either project.
|
| 11 |
+
*
|
| 12 |
+
* @name $.totalStorage
|
| 13 |
+
* @cat Plugins/Cookie
|
| 14 |
+
* @author Jared Novack/jared@upstatement.com
|
| 15 |
+
* @version 1.1.2
|
| 16 |
+
* @url http://upstatement.com/blog/2012/01/jquery-local-storage-done-right-and-easy/
|
| 17 |
+
*/
|
| 18 |
+
|
| 19 |
+
(function(c,h){var e,d;if("localStorage"in window)try{d="undefined"===typeof window.localStorage?h:window.localStorage,e="undefined"==typeof d||"undefined"==typeof window.JSON?!1:!0}catch(j){e=!1}c.totalStorage=function(b,a){return c.totalStorage.impl.init(b,a)};c.totalStorage.setItem=function(b,a){return c.totalStorage.impl.setItem(b,a)};c.totalStorage.getItem=function(b){return c.totalStorage.impl.getItem(b)};c.totalStorage.getAll=function(){return c.totalStorage.impl.getAll()};c.totalStorage.deleteItem=
|
| 20 |
+
function(b){return c.totalStorage.impl.deleteItem(b)};c.totalStorage.impl={init:function(b,a){return"undefined"!=typeof a?this.setItem(b,a):this.getItem(b)},setItem:function(b,a){if(!e)try{return c.cookie(b,a),a}catch(g){console.log("Local Storage not supported by this browser. Install the cookie plugin on your site to take advantage of the same functionality. You can get it at https://github.com/carhartl/jquery-cookie")}var f=JSON.stringify(a);d.setItem(b,f);return this.parseResult(f)},getItem:function(b){if(!e)try{return this.parseResult(c.cookie(b))}catch(a){return null}b=
|
| 21 |
+
d.getItem(b);return this.parseResult(b)},deleteItem:function(b){if(!e)try{return c.cookie(b,null),!0}catch(a){return!1}d.removeItem(b);return!0},getAll:function(){var b=[];if(e)for(var a in d)a.length&&b.push({key:a,value:this.parseResult(d.getItem(a))});else try{var g=document.cookie.split(";");for(a=0;a<g.length;a++){var f=g[a].split("=")[0];b.push({key:f,value:this.parseResult(c.cookie(f))})}}catch(h){return null}return b},parseResult:function(b){var a;try{a=JSON.parse(b),"undefined"==typeof a&&
|
| 22 |
+
(a=b),"true"==a&&(a=!0),"false"==a&&(a=!1),parseFloat(a)==a&&"object"!=typeof a&&(a=parseFloat(a))}catch(c){a=b}return a}}})(jQuery);
|
shared/assets/readme.txt
ADDED
|
@@ -0,0 +1,7 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
For Globally Shared css and JS
|
| 2 |
+
|
| 3 |
+
Admin js/css goes in admin
|
| 4 |
+
|
| 5 |
+
Frontend js/css goes in frontend
|
| 6 |
+
|
| 7 |
+
If used in both frontend and backend use global folder
|
shared/classes/chart.class.php
CHANGED
|
@@ -1,291 +1,291 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* NOT currently in use but will be soon
|
| 4 |
-
*
|
| 5 |
-
* Graphs
|
| 6 |
-
*
|
| 7 |
-
* This class handles building pretty report graphs
|
| 8 |
-
*
|
| 9 |
-
* @package EDD
|
| 10 |
-
* @subpackage Admin/Reports
|
| 11 |
-
* @copyright Copyright (c) 2012, Pippin Williamson
|
| 12 |
-
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 13 |
-
* @since 1.9
|
| 14 |
-
*/
|
| 15 |
-
|
| 16 |
-
// Exit if accessed directly
|
| 17 |
-
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 18 |
-
|
| 19 |
-
/**
|
| 20 |
-
* EDD_Graph Class
|
| 21 |
-
*
|
| 22 |
-
* @since 1.9
|
| 23 |
-
*/
|
| 24 |
-
if (!function_exists('Inbound_Graph')) {
|
| 25 |
-
class Inbound_Graph {
|
| 26 |
-
|
| 27 |
-
/*
|
| 28 |
-
|
| 29 |
-
Simple example:
|
| 30 |
-
|
| 31 |
-
data format for each point: array( location on x, location on y )
|
| 32 |
-
|
| 33 |
-
// Example with options set to other than default:
|
| 34 |
-
$data = array(
|
| 35 |
-
|
| 36 |
-
'Line Label' => array(
|
| 37 |
-
array( 1, 5 ),
|
| 38 |
-
array( 3, 8 ),
|
| 39 |
-
array( 10, 2 )
|
| 40 |
-
),
|
| 41 |
-
|
| 42 |
-
'Second Line Label' => array(
|
| 43 |
-
array( 1, 7 ),
|
| 44 |
-
array( 4, 5 ),
|
| 45 |
-
array( 12, 8 )
|
| 46 |
-
)
|
| 47 |
-
);
|
| 48 |
-
|
| 49 |
-
$graph = new Inbound_Graph( $data );
|
| 50 |
-
$graph->set( 'bgcolor' => '#000' );
|
| 51 |
-
$graph->set( 'color' => '#fff' );
|
| 52 |
-
$graph->display();
|
| 53 |
-
|
| 54 |
-
*/
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Data to graph
|
| 58 |
-
*
|
| 59 |
-
* @var array
|
| 60 |
-
* @since 1.9
|
| 61 |
-
*/
|
| 62 |
-
private $data;
|
| 63 |
-
|
| 64 |
-
/**
|
| 65 |
-
* Unique ID for the graph
|
| 66 |
-
*
|
| 67 |
-
* @var string
|
| 68 |
-
* @since 1.9
|
| 69 |
-
*/
|
| 70 |
-
private $id = '';
|
| 71 |
-
|
| 72 |
-
/**
|
| 73 |
-
* Graph options
|
| 74 |
-
*
|
| 75 |
-
* @var array
|
| 76 |
-
* @since 1.9
|
| 77 |
-
*/
|
| 78 |
-
private $options = array();
|
| 79 |
-
|
| 80 |
-
/**
|
| 81 |
-
* Get things started
|
| 82 |
-
*
|
| 83 |
-
* @since 1.9
|
| 84 |
-
*/
|
| 85 |
-
public function __construct( $_data ) {
|
| 86 |
-
|
| 87 |
-
$this->data = $_data;
|
| 88 |
-
|
| 89 |
-
// Generate unique ID
|
| 90 |
-
$this->id = md5( rand() );
|
| 91 |
-
|
| 92 |
-
// Setup default options;
|
| 93 |
-
$this->options = array(
|
| 94 |
-
'y_mode' => null,
|
| 95 |
-
'x_mode' => null,
|
| 96 |
-
'y_decimals' => 0,
|
| 97 |
-
'x_decimals' => 0,
|
| 98 |
-
'y_position' => 'right',
|
| 99 |
-
'time_format' => '%d/%b',
|
| 100 |
-
'ticksize_unit' => 'day',
|
| 101 |
-
'ticksize_num' => 1,
|
| 102 |
-
'multiple_y_axes' => false,
|
| 103 |
-
'bgcolor' => '#f9f9f9',
|
| 104 |
-
'bordercolor' => '#ccc',
|
| 105 |
-
'color' => '#bbb',
|
| 106 |
-
'borderwidth' => 2,
|
| 107 |
-
'bars' => false,
|
| 108 |
-
'lines' => true,
|
| 109 |
-
'points' => true
|
| 110 |
-
);
|
| 111 |
-
|
| 112 |
-
}
|
| 113 |
-
|
| 114 |
-
/**
|
| 115 |
-
* Set an option
|
| 116 |
-
*
|
| 117 |
-
* @param $key The option key to set
|
| 118 |
-
* @param $value The value to assign to the key
|
| 119 |
-
* @since 1.9
|
| 120 |
-
*/
|
| 121 |
-
public function set( $key, $value ) {
|
| 122 |
-
$this->options[ $key ] = $value;
|
| 123 |
-
}
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* Get an option
|
| 127 |
-
*
|
| 128 |
-
* @param $key The option key to get
|
| 129 |
-
* @since 1.9
|
| 130 |
-
*/
|
| 131 |
-
public function get( $key ) {
|
| 132 |
-
return isset( $this->options[ $key ] ) ? $this->options[ $key ] : false;
|
| 133 |
-
}
|
| 134 |
-
|
| 135 |
-
/**
|
| 136 |
-
* Get graph data
|
| 137 |
-
*
|
| 138 |
-
* @since 1.9
|
| 139 |
-
*/
|
| 140 |
-
public function get_data() {
|
| 141 |
-
return apply_filters( 'edd_get_graph_data', $this->data, $this );
|
| 142 |
-
}
|
| 143 |
-
|
| 144 |
-
/**
|
| 145 |
-
* Load the graphing library script
|
| 146 |
-
*
|
| 147 |
-
* @since 1.9
|
| 148 |
-
*/
|
| 149 |
-
public function load_scripts() {
|
| 150 |
-
// Use minified libraries if SCRIPT_DEBUG is turned off
|
| 151 |
-
$suffix = ( defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ) ? '' : '.min';
|
| 152 |
-
wp_enqueue_script( 'jquery-flot', EDD_PLUGIN_URL . 'assets/js/jquery.flot' . $suffix . '.js' );
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
/**
|
| 156 |
-
* Build the graph and return it as a string
|
| 157 |
-
*
|
| 158 |
-
* @var array
|
| 159 |
-
* @since 1.9
|
| 160 |
-
* @return string
|
| 161 |
-
*/
|
| 162 |
-
public function build_graph() {
|
| 163 |
-
|
| 164 |
-
$yaxis_count = 1;
|
| 165 |
-
|
| 166 |
-
$this->load_scripts();
|
| 167 |
-
|
| 168 |
-
ob_start();
|
| 169 |
-
|
| 170 |
-
?>
|
| 171 |
-
<script type="text/javascript">
|
| 172 |
-
jQuery( document ).ready( function($) {
|
| 173 |
-
$.plot(
|
| 174 |
-
$("#edd-graph-<?php echo $this->id; ?>"),
|
| 175 |
-
[
|
| 176 |
-
<?php foreach( $this->get_data() as $label => $data ) : ?>
|
| 177 |
-
{
|
| 178 |
-
label: "<?php echo esc_attr( $label ); ?>",
|
| 179 |
-
id: "<?php echo sanitize_key( $label ); ?>",
|
| 180 |
-
// data format is: [ point on x, value on y ]
|
| 181 |
-
data: [<?php foreach( $data as $point ) { echo '[' . implode( ',', $point ) . '],'; } ?>],
|
| 182 |
-
points: {
|
| 183 |
-
show: <?php echo $this->options['points'] ? 'true' : 'false'; ?>,
|
| 184 |
-
},
|
| 185 |
-
bars: {
|
| 186 |
-
show: <?php echo $this->options['bars'] ? 'true' : 'false'; ?>,
|
| 187 |
-
barWidth: 12,
|
| 188 |
-
aling: 'center'
|
| 189 |
-
},
|
| 190 |
-
lines: {
|
| 191 |
-
show: <?php echo $this->options['lines'] ? 'true' : 'false'; ?>
|
| 192 |
-
},
|
| 193 |
-
<?php if( $this->options[ 'multiple_y_axes' ] ) : ?>
|
| 194 |
-
yaxis: <?php echo $yaxis_count; ?>
|
| 195 |
-
<?php endif; ?>
|
| 196 |
-
},
|
| 197 |
-
<?php $yaxis_count++; endforeach; ?>
|
| 198 |
-
],
|
| 199 |
-
{
|
| 200 |
-
// Options
|
| 201 |
-
grid: {
|
| 202 |
-
show: true,
|
| 203 |
-
aboveData: false,
|
| 204 |
-
color: "<?php echo $this->options[ 'color' ]; ?>",
|
| 205 |
-
backgroundColor: "<?php echo $this->options[ 'bgcolor' ]; ?>",
|
| 206 |
-
borderColor: "<?php echo $this->options[ 'bordercolor' ]; ?>",
|
| 207 |
-
borderWidth: <?php echo absint( $this->options[ 'borderwidth' ] ); ?>,
|
| 208 |
-
clickable: false,
|
| 209 |
-
hoverable: true
|
| 210 |
-
},
|
| 211 |
-
xaxis: {
|
| 212 |
-
mode: "<?php echo $this->options['x_mode']; ?>",
|
| 213 |
-
timeFormat: "<?php echo $this->options['x_mode'] == 'time' ? $this->options['time_format'] : ''; ?>",
|
| 214 |
-
tickSize: "<?php echo $this->options['x_mode'] == 'time' ? '' : 1; ?>",
|
| 215 |
-
<?php if( $this->options['x_mode'] != 'time' ) : ?>
|
| 216 |
-
tickDecimals: <?php echo $this->options['x_decimals']; ?>
|
| 217 |
-
<?php endif; ?>
|
| 218 |
-
},
|
| 219 |
-
yaxis: {
|
| 220 |
-
position: 'right',
|
| 221 |
-
min: 0,
|
| 222 |
-
mode: "<?php echo $this->options['y_mode']; ?>",
|
| 223 |
-
timeFormat: "<?php echo $this->options['y_mode'] == 'time' ? $this->options['time_format'] : ''; ?>",
|
| 224 |
-
<?php if( $this->options['y_mode'] != 'time' ) : ?>
|
| 225 |
-
tickDecimals: <?php echo $this->options['y_decimals']; ?>
|
| 226 |
-
<?php endif; ?>
|
| 227 |
-
}
|
| 228 |
-
}
|
| 229 |
-
|
| 230 |
-
);
|
| 231 |
-
|
| 232 |
-
function edd_flot_tooltip(x, y, contents) {
|
| 233 |
-
$('<div id="edd-flot-tooltip">' + contents + '</div>').css( {
|
| 234 |
-
position: 'absolute',
|
| 235 |
-
display: 'none',
|
| 236 |
-
top: y + 5,
|
| 237 |
-
left: x + 5,
|
| 238 |
-
border: '1px solid #fdd',
|
| 239 |
-
padding: '2px',
|
| 240 |
-
'background-color': '#fee',
|
| 241 |
-
opacity: 0.80
|
| 242 |
-
}).appendTo("body").fadeIn(200);
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
var previousPoint = null;
|
| 246 |
-
$("#edd-graph-<?php echo $this->id; ?>").bind("plothover", function (event, pos, item) {
|
| 247 |
-
$("#x").text(pos.x.toFixed(2));
|
| 248 |
-
$("#y").text(pos.y.toFixed(2));
|
| 249 |
-
if (item) {
|
| 250 |
-
if (previousPoint != item.dataIndex) {
|
| 251 |
-
previousPoint = item.dataIndex;
|
| 252 |
-
$("#edd-flot-tooltip").remove();
|
| 253 |
-
var x = item.datapoint[0].toFixed(2),
|
| 254 |
-
y = item.datapoint[1].toFixed(2);
|
| 255 |
-
if( item.series.id == 'earnings' ) {
|
| 256 |
-
if( edd_vars.currency_pos == 'before' ) {
|
| 257 |
-
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + edd_vars.currency_sign + y );
|
| 258 |
-
} else {
|
| 259 |
-
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + y + edd_vars.currency_sign );
|
| 260 |
-
}
|
| 261 |
-
} else {
|
| 262 |
-
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + y.replace( '.00', '' ) );
|
| 263 |
-
}
|
| 264 |
-
}
|
| 265 |
-
} else {
|
| 266 |
-
$("#edd-flot-tooltip").remove();
|
| 267 |
-
previousPoint = null;
|
| 268 |
-
}
|
| 269 |
-
});
|
| 270 |
-
|
| 271 |
-
});
|
| 272 |
-
|
| 273 |
-
</script>
|
| 274 |
-
<div id="edd-graph-<?php echo $this->id; ?>" style="height: 300px;"></div>
|
| 275 |
-
<?php
|
| 276 |
-
return ob_get_clean();
|
| 277 |
-
}
|
| 278 |
-
|
| 279 |
-
/**
|
| 280 |
-
* Output the final graph
|
| 281 |
-
*
|
| 282 |
-
* @since 1.9
|
| 283 |
-
*/
|
| 284 |
-
public function display() {
|
| 285 |
-
do_action( 'edd_before_graph', $this );
|
| 286 |
-
echo $this->build_graph();
|
| 287 |
-
do_action( 'edd_after_graph', $this );
|
| 288 |
-
}
|
| 289 |
-
|
| 290 |
-
}
|
| 291 |
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* NOT currently in use but will be soon
|
| 4 |
+
*
|
| 5 |
+
* Graphs
|
| 6 |
+
*
|
| 7 |
+
* This class handles building pretty report graphs
|
| 8 |
+
*
|
| 9 |
+
* @package EDD
|
| 10 |
+
* @subpackage Admin/Reports
|
| 11 |
+
* @copyright Copyright (c) 2012, Pippin Williamson
|
| 12 |
+
* @license http://opensource.org/licenses/gpl-2.0.php GNU Public License
|
| 13 |
+
* @since 1.9
|
| 14 |
+
*/
|
| 15 |
+
|
| 16 |
+
// Exit if accessed directly
|
| 17 |
+
if ( ! defined( 'ABSPATH' ) ) exit;
|
| 18 |
+
|
| 19 |
+
/**
|
| 20 |
+
* EDD_Graph Class
|
| 21 |
+
*
|
| 22 |
+
* @since 1.9
|
| 23 |
+
*/
|
| 24 |
+
if (!function_exists('Inbound_Graph')) {
|
| 25 |
+
class Inbound_Graph {
|
| 26 |
+
|
| 27 |
+
/*
|
| 28 |
+
|
| 29 |
+
Simple example:
|
| 30 |
+
|
| 31 |
+
data format for each point: array( location on x, location on y )
|
| 32 |
+
|
| 33 |
+
// Example with options set to other than default:
|
| 34 |
+
$data = array(
|
| 35 |
+
|
| 36 |
+
'Line Label' => array(
|
| 37 |
+
array( 1, 5 ),
|
| 38 |
+
array( 3, 8 ),
|
| 39 |
+
array( 10, 2 )
|
| 40 |
+
),
|
| 41 |
+
|
| 42 |
+
'Second Line Label' => array(
|
| 43 |
+
array( 1, 7 ),
|
| 44 |
+
array( 4, 5 ),
|
| 45 |
+
array( 12, 8 )
|
| 46 |
+
)
|
| 47 |
+
);
|
| 48 |
+
|
| 49 |
+
$graph = new Inbound_Graph( $data );
|
| 50 |
+
$graph->set( 'bgcolor' => '#000' );
|
| 51 |
+
$graph->set( 'color' => '#fff' );
|
| 52 |
+
$graph->display();
|
| 53 |
+
|
| 54 |
+
*/
|
| 55 |
+
|
| 56 |
+
/**
|
| 57 |
+
* Data to graph
|
| 58 |
+
*
|
| 59 |
+
* @var array
|
| 60 |
+
* @since 1.9
|
| 61 |
+
*/
|
| 62 |
+
private $data;
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Unique ID for the graph
|
| 66 |
+
*
|
| 67 |
+
* @var string
|
| 68 |
+
* @since 1.9
|
| 69 |
+
*/
|
| 70 |
+
private $id = '';
|
| 71 |
+
|
| 72 |
+
/**
|
| 73 |
+
* Graph options
|
| 74 |
+
*
|
| 75 |
+
* @var array
|
| 76 |
+
* @since 1.9
|
| 77 |
+
*/
|
| 78 |
+
private $options = array();
|
| 79 |
+
|
| 80 |
+
/**
|
| 81 |
+
* Get things started
|
| 82 |
+
*
|
| 83 |
+
* @since 1.9
|
| 84 |
+
*/
|
| 85 |
+
public function __construct( $_data ) {
|
| 86 |
+
|
| 87 |
+
$this->data = $_data;
|
| 88 |
+
|
| 89 |
+
// Generate unique ID
|
| 90 |
+
$this->id = md5( rand() );
|
| 91 |
+
|
| 92 |
+
// Setup default options;
|
| 93 |
+
$this->options = array(
|
| 94 |
+
'y_mode' => null,
|
| 95 |
+
'x_mode' => null,
|
| 96 |
+
'y_decimals' => 0,
|
| 97 |
+
'x_decimals' => 0,
|
| 98 |
+
'y_position' => 'right',
|
| 99 |
+
'time_format' => '%d/%b',
|
| 100 |
+
'ticksize_unit' => 'day',
|
| 101 |
+
'ticksize_num' => 1,
|
| 102 |
+
'multiple_y_axes' => false,
|
| 103 |
+
'bgcolor' => '#f9f9f9',
|
| 104 |
+
'bordercolor' => '#ccc',
|
| 105 |
+
'color' => '#bbb',
|
| 106 |
+
'borderwidth' => 2,
|
| 107 |
+
'bars' => false,
|
| 108 |
+
'lines' => true,
|
| 109 |
+
'points' => true
|
| 110 |
+
);
|
| 111 |
+
|
| 112 |
+
}
|
| 113 |
+
|
| 114 |
+
/**
|
| 115 |
+
* Set an option
|
| 116 |
+
*
|
| 117 |
+
* @param $key The option key to set
|
| 118 |
+
* @param $value The value to assign to the key
|
| 119 |
+
* @since 1.9
|
| 120 |
+
*/
|
| 121 |
+
public function set( $key, $value ) {
|
| 122 |
+
$this->options[ $key ] = $value;
|
| 123 |
+
}
|
| 124 |
+
|
| 125 |
+
/**
|
| 126 |
+
* Get an option
|
| 127 |
+
*
|
| 128 |
+
* @param $key The option key to get
|
| 129 |
+
* @since 1.9
|
| 130 |
+
*/
|
| 131 |
+
public function get( $key ) {
|
| 132 |
+
return isset( $this->options[ $key ] ) ? $this->options[ $key ] : false;
|
| 133 |
+
}
|
| 134 |
+
|
| 135 |
+
/**
|
| 136 |
+
* Get graph data
|
| 137 |
+
*
|
| 138 |
+
* @since 1.9
|
| 139 |
+
*/
|
| 140 |
+
public function get_data() {
|
| 141 |
+
return apply_filters( 'edd_get_graph_data', $this->data, $this );
|
| 142 |
+
}
|
| 143 |
+
|
| 144 |
+
/**
|
| 145 |
+
* Load the graphing library script
|
| 146 |
+
*
|
| 147 |
+
* @since 1.9
|
| 148 |
+
*/
|
| 149 |
+
public function load_scripts() {
|
| 150 |
+
// Use minified libraries if SCRIPT_DEBUG is turned off
|
| 151 |
+
$suffix = ( defined( 'SCRIPT_DEBUG' ) && SCRIPT_DEBUG ) ? '' : '.min';
|
| 152 |
+
wp_enqueue_script( 'jquery-flot', EDD_PLUGIN_URL . 'assets/js/jquery.flot' . $suffix . '.js' );
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
/**
|
| 156 |
+
* Build the graph and return it as a string
|
| 157 |
+
*
|
| 158 |
+
* @var array
|
| 159 |
+
* @since 1.9
|
| 160 |
+
* @return string
|
| 161 |
+
*/
|
| 162 |
+
public function build_graph() {
|
| 163 |
+
|
| 164 |
+
$yaxis_count = 1;
|
| 165 |
+
|
| 166 |
+
$this->load_scripts();
|
| 167 |
+
|
| 168 |
+
ob_start();
|
| 169 |
+
|
| 170 |
+
?>
|
| 171 |
+
<script type="text/javascript">
|
| 172 |
+
jQuery( document ).ready( function($) {
|
| 173 |
+
$.plot(
|
| 174 |
+
$("#edd-graph-<?php echo $this->id; ?>"),
|
| 175 |
+
[
|
| 176 |
+
<?php foreach( $this->get_data() as $label => $data ) : ?>
|
| 177 |
+
{
|
| 178 |
+
label: "<?php echo esc_attr( $label ); ?>",
|
| 179 |
+
id: "<?php echo sanitize_key( $label ); ?>",
|
| 180 |
+
// data format is: [ point on x, value on y ]
|
| 181 |
+
data: [<?php foreach( $data as $point ) { echo '[' . implode( ',', $point ) . '],'; } ?>],
|
| 182 |
+
points: {
|
| 183 |
+
show: <?php echo $this->options['points'] ? 'true' : 'false'; ?>,
|
| 184 |
+
},
|
| 185 |
+
bars: {
|
| 186 |
+
show: <?php echo $this->options['bars'] ? 'true' : 'false'; ?>,
|
| 187 |
+
barWidth: 12,
|
| 188 |
+
aling: 'center'
|
| 189 |
+
},
|
| 190 |
+
lines: {
|
| 191 |
+
show: <?php echo $this->options['lines'] ? 'true' : 'false'; ?>
|
| 192 |
+
},
|
| 193 |
+
<?php if( $this->options[ 'multiple_y_axes' ] ) : ?>
|
| 194 |
+
yaxis: <?php echo $yaxis_count; ?>
|
| 195 |
+
<?php endif; ?>
|
| 196 |
+
},
|
| 197 |
+
<?php $yaxis_count++; endforeach; ?>
|
| 198 |
+
],
|
| 199 |
+
{
|
| 200 |
+
// Options
|
| 201 |
+
grid: {
|
| 202 |
+
show: true,
|
| 203 |
+
aboveData: false,
|
| 204 |
+
color: "<?php echo $this->options[ 'color' ]; ?>",
|
| 205 |
+
backgroundColor: "<?php echo $this->options[ 'bgcolor' ]; ?>",
|
| 206 |
+
borderColor: "<?php echo $this->options[ 'bordercolor' ]; ?>",
|
| 207 |
+
borderWidth: <?php echo absint( $this->options[ 'borderwidth' ] ); ?>,
|
| 208 |
+
clickable: false,
|
| 209 |
+
hoverable: true
|
| 210 |
+
},
|
| 211 |
+
xaxis: {
|
| 212 |
+
mode: "<?php echo $this->options['x_mode']; ?>",
|
| 213 |
+
timeFormat: "<?php echo $this->options['x_mode'] == 'time' ? $this->options['time_format'] : ''; ?>",
|
| 214 |
+
tickSize: "<?php echo $this->options['x_mode'] == 'time' ? '' : 1; ?>",
|
| 215 |
+
<?php if( $this->options['x_mode'] != 'time' ) : ?>
|
| 216 |
+
tickDecimals: <?php echo $this->options['x_decimals']; ?>
|
| 217 |
+
<?php endif; ?>
|
| 218 |
+
},
|
| 219 |
+
yaxis: {
|
| 220 |
+
position: 'right',
|
| 221 |
+
min: 0,
|
| 222 |
+
mode: "<?php echo $this->options['y_mode']; ?>",
|
| 223 |
+
timeFormat: "<?php echo $this->options['y_mode'] == 'time' ? $this->options['time_format'] : ''; ?>",
|
| 224 |
+
<?php if( $this->options['y_mode'] != 'time' ) : ?>
|
| 225 |
+
tickDecimals: <?php echo $this->options['y_decimals']; ?>
|
| 226 |
+
<?php endif; ?>
|
| 227 |
+
}
|
| 228 |
+
}
|
| 229 |
+
|
| 230 |
+
);
|
| 231 |
+
|
| 232 |
+
function edd_flot_tooltip(x, y, contents) {
|
| 233 |
+
$('<div id="edd-flot-tooltip">' + contents + '</div>').css( {
|
| 234 |
+
position: 'absolute',
|
| 235 |
+
display: 'none',
|
| 236 |
+
top: y + 5,
|
| 237 |
+
left: x + 5,
|
| 238 |
+
border: '1px solid #fdd',
|
| 239 |
+
padding: '2px',
|
| 240 |
+
'background-color': '#fee',
|
| 241 |
+
opacity: 0.80
|
| 242 |
+
}).appendTo("body").fadeIn(200);
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
var previousPoint = null;
|
| 246 |
+
$("#edd-graph-<?php echo $this->id; ?>").bind("plothover", function (event, pos, item) {
|
| 247 |
+
$("#x").text(pos.x.toFixed(2));
|
| 248 |
+
$("#y").text(pos.y.toFixed(2));
|
| 249 |
+
if (item) {
|
| 250 |
+
if (previousPoint != item.dataIndex) {
|
| 251 |
+
previousPoint = item.dataIndex;
|
| 252 |
+
$("#edd-flot-tooltip").remove();
|
| 253 |
+
var x = item.datapoint[0].toFixed(2),
|
| 254 |
+
y = item.datapoint[1].toFixed(2);
|
| 255 |
+
if( item.series.id == 'earnings' ) {
|
| 256 |
+
if( edd_vars.currency_pos == 'before' ) {
|
| 257 |
+
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + edd_vars.currency_sign + y );
|
| 258 |
+
} else {
|
| 259 |
+
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + y + edd_vars.currency_sign );
|
| 260 |
+
}
|
| 261 |
+
} else {
|
| 262 |
+
edd_flot_tooltip( item.pageX, item.pageY, item.series.label + ' ' + y.replace( '.00', '' ) );
|
| 263 |
+
}
|
| 264 |
+
}
|
| 265 |
+
} else {
|
| 266 |
+
$("#edd-flot-tooltip").remove();
|
| 267 |
+
previousPoint = null;
|
| 268 |
+
}
|
| 269 |
+
});
|
| 270 |
+
|
| 271 |
+
});
|
| 272 |
+
|
| 273 |
+
</script>
|
| 274 |
+
<div id="edd-graph-<?php echo $this->id; ?>" style="height: 300px;"></div>
|
| 275 |
+
<?php
|
| 276 |
+
return ob_get_clean();
|
| 277 |
+
}
|
| 278 |
+
|
| 279 |
+
/**
|
| 280 |
+
* Output the final graph
|
| 281 |
+
*
|
| 282 |
+
* @since 1.9
|
| 283 |
+
*/
|
| 284 |
+
public function display() {
|
| 285 |
+
do_action( 'edd_before_graph', $this );
|
| 286 |
+
echo $this->build_graph();
|
| 287 |
+
do_action( 'edd_after_graph', $this );
|
| 288 |
+
}
|
| 289 |
+
|
| 290 |
+
}
|
| 291 |
}
|
shared/classes/compatibility.class.php
CHANGED
|
@@ -1,134 +1,134 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Compability Mode Deregisters All Third party scripts not in the whitelist
|
| 4 |
-
* - The class was made to cut down on third party support requests
|
| 5 |
-
*
|
| 6 |
-
* Call the dequeue manually InboundCompatibility::inbound_compatibilities_mode();
|
| 7 |
-
*/
|
| 8 |
-
|
| 9 |
-
/* From Global Settings if compat mode toggled on turn off third party scripts */
|
| 10 |
-
add_action('admin_enqueue_scripts', 'inbound_turn_on_compatiblity', 110);
|
| 11 |
-
if (!function_exists('inbound_turn_on_compatiblity')) {
|
| 12 |
-
function inbound_turn_on_compatiblity() {
|
| 13 |
-
$screen = get_current_screen();
|
| 14 |
-
|
| 15 |
-
// Add all Plugin Screens to Array
|
| 16 |
-
$inbound_screens = InboundCompatibility::return_inbound_now_screens(); // grabs our plugin screen ids
|
| 17 |
-
|
| 18 |
-
// If Not Inbound Now Screen Exit function
|
| 19 |
-
if (!in_array($screen->id, $inbound_screens)) {
|
| 20 |
-
return;
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
$lead_compatiblity = get_option( 'wpl-main-inbound_compatibility_mode', $default = false );
|
| 24 |
-
$cta_compatiblity = get_option( 'wp-cta-main-inbound_compatibility_mode', $default = false );
|
| 25 |
-
$lp_compatiblity = get_option( 'lp-main-inbound_compatibility_mode', $default = false );
|
| 26 |
-
if ( $lead_compatiblity || $cta_compatiblity || $lp_compatiblity ) {
|
| 27 |
-
InboundCompatibility::inbound_compatibilities_mode(); // kill third party scripts
|
| 28 |
-
}
|
| 29 |
-
}
|
| 30 |
-
}
|
| 31 |
-
|
| 32 |
-
add_action('admin_notices', 'inbound_compability_admin_notice'); // disable compat notice
|
| 33 |
-
if (!function_exists('inbound_compability_admin_notice')) {
|
| 34 |
-
function inbound_compability_admin_notice(){
|
| 35 |
-
$lead_compatiblity = get_option( 'wpl-main-inbound_compatibility_mode', $default = false );
|
| 36 |
-
$cta_compatiblity = get_option( 'wp-cta-main-inbound_compatibility_mode', $default = false );
|
| 37 |
-
$lp_compatiblity = get_option( 'lp-main-inbound_compatibility_mode', $default = false );
|
| 38 |
-
if ($lead_compatiblity) {
|
| 39 |
-
$link = admin_url( 'edit.php?post_type=wp-lead&page=wpleads_global_settings' );
|
| 40 |
-
} elseif ($cta_compatiblity) {
|
| 41 |
-
$link = admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' );
|
| 42 |
-
} elseif ($lp_compatiblity) {
|
| 43 |
-
$link = admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' );
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
if ( $lead_compatiblity || $cta_compatiblity || $lp_compatiblity ) {
|
| 47 |
-
echo '<div class="updated">
|
| 48 |
-
<p>Inbound Now Compatibility Mode is currently activated. To turn off go to <a href="'.$link.'">global settings</a> and toggle off</p>
|
| 49 |
-
</div>';
|
| 50 |
-
}
|
| 51 |
-
}
|
| 52 |
-
}
|
| 53 |
-
|
| 54 |
-
if (!class_exists('InboundCompatibility')) {
|
| 55 |
-
class InboundCompatibility {
|
| 56 |
-
static $add_inbound_compatibility;
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* Dequeue all third party scripts on page
|
| 60 |
-
* @return [type] [description]
|
| 61 |
-
*/
|
| 62 |
-
static function inbound_compatibilities_mode() {
|
| 63 |
-
|
| 64 |
-
if (is_admin()){
|
| 65 |
-
$screen = get_current_screen();
|
| 66 |
-
} else {
|
| 67 |
-
$screen = '';
|
| 68 |
-
}
|
| 69 |
-
global $wp_scripts;
|
| 70 |
-
|
| 71 |
-
// Match our plugins and whitelist them
|
| 72 |
-
$registered_scripts = $wp_scripts->registered;
|
| 73 |
-
$inbound_white_list = array();
|
| 74 |
-
foreach ($registered_scripts as $handle) {
|
| 75 |
-
if(preg_match("/\/plugins\/leads\//", $handle->src)) {
|
| 76 |
-
//echo $handle->handle;
|
| 77 |
-
$inbound_white_list[] = $handle->handle;
|
| 78 |
-
}
|
| 79 |
-
if(preg_match("/\/plugins\/cta\//", $handle->src)) {
|
| 80 |
-
//echo $handle->handle;
|
| 81 |
-
$inbound_white_list[]= $handle->handle;
|
| 82 |
-
}
|
| 83 |
-
if(preg_match("/\/plugins\/landing-pages\//", $handle->src)) {
|
| 84 |
-
//echo $handle->handle;
|
| 85 |
-
$inbound_white_list[]= $handle->handle;
|
| 86 |
-
}
|
| 87 |
-
}
|
| 88 |
-
//print_r($inbound_white_list);
|
| 89 |
-
|
| 90 |
-
/* NEED Filter for ADDONs */
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
$scripts_queued = $wp_scripts->queue; /* All Queued Scripts */ //print_r($wp_scripts->queue);
|
| 94 |
-
|
| 95 |
-
// Wordpress Core Scripts List
|
| 96 |
-
$wp_core_scripts = array("jcrop", "swfobject", "swfupload", "swfupload-degrade", "swfupload-queue", "swfupload-handlers", "jquery", "jquery-form", "jquery-color", "jquery-masonry", "jquery-ui-core", "jquery-ui-widget", "jquery-ui-mouse", "jquery-ui-accordion", "jquery-ui-autocomplete", "jquery-ui-slider", "jquery-ui-progressbar", "jquery-ui-tabs", "jquery-ui-sortable", "jquery-ui-draggable", "jquery-ui-droppable", "jquery-ui-selectable", "jquery-ui-position", "jquery-ui-datepicker", "jquery-ui-tooltip", "jquery-ui-resizable", "jquery-ui-dialog", "jquery-ui-button", "jquery-effects-core", "jquery-effects-blind", "jquery-effects-bounce", "jquery-effects-clip", "jquery-effects-drop", "jquery-effects-explode", "jquery-effects-fade", "jquery-effects-fold", "jquery-effects-highlight", "jquery-effects-pulsate", "jquery-effects-scale", "jquery-effects-shake", "jquery-effects-slide", "jquery-effects-transfer", "wp-mediaelement", "schedule", "suggest", "thickbox", "hoverIntent", "jquery-hotkeys", "sack", "quicktags", "iris", "farbtastic", "colorpicker", "tiny_mce", "autosave", "wp-ajax-response", "wp-lists", "common", "editorremov", "editor-functions", "ajaxcat", "admin-categories", "admin-tags", "admin-custom-fields", "password-strength-meter", "admin-comments", "admin-users", "admin-forms", "xfn", "upload", "postbox", "slug", "post", "page", "link", "comment", "comment-reply", "admin-gallery", "media-upload", "admin-widgets", "word-count", "theme-preview", "json2", "plupload", "plupload-all", "plupload-html4", "plupload-html5", "plupload-flash", "plupload-silverlight", "underscore", "backbone");
|
| 97 |
-
|
| 98 |
-
|
| 99 |
-
foreach ($scripts_queued as $key => $value) {
|
| 100 |
-
//echo $key . $value;
|
| 101 |
-
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 102 |
-
wp_dequeue_script( $value );
|
| 103 |
-
//echo $key . $value;
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
static function return_inbound_now_screens(){
|
| 109 |
-
$inbound_screens = array(
|
| 110 |
-
'wp-lead_page_wpleads_global_settings',
|
| 111 |
-
'wp-lead_page_lead_management',
|
| 112 |
-
'edit-list',
|
| 113 |
-
'edit-wp-lead',
|
| 114 |
-
'wp-lead',
|
| 115 |
-
'edit-wplead_list_category',
|
| 116 |
-
'edit-inbound-forms',
|
| 117 |
-
'inbound-forms',
|
| 118 |
-
'edit-landing-page',
|
| 119 |
-
'landing-page',
|
| 120 |
-
'edit-landing_page_category',
|
| 121 |
-
'landing-page_page_lp_manage_templates',
|
| 122 |
-
'landing-page_page_lp_global_settings',
|
| 123 |
-
'landing-page_page_lp_store',
|
| 124 |
-
'edit-wp-call-to-action',
|
| 125 |
-
'edit-wp_call_to_action_category',
|
| 126 |
-
'wp-call-to-action',
|
| 127 |
-
'wp-call-to-action_page_wp_cta_manage_templates',
|
| 128 |
-
'wp-call-to-action_page_wp_cta_global_settings',
|
| 129 |
-
);
|
| 130 |
-
// add filter
|
| 131 |
-
return $inbound_screens;
|
| 132 |
-
}
|
| 133 |
-
}
|
| 134 |
}
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Compability Mode Deregisters All Third party scripts not in the whitelist
|
| 4 |
+
* - The class was made to cut down on third party support requests
|
| 5 |
+
*
|
| 6 |
+
* Call the dequeue manually InboundCompatibility::inbound_compatibilities_mode();
|
| 7 |
+
*/
|
| 8 |
+
|
| 9 |
+
/* From Global Settings if compat mode toggled on turn off third party scripts */
|
| 10 |
+
add_action('admin_enqueue_scripts', 'inbound_turn_on_compatiblity', 110);
|
| 11 |
+
if (!function_exists('inbound_turn_on_compatiblity')) {
|
| 12 |
+
function inbound_turn_on_compatiblity() {
|
| 13 |
+
$screen = get_current_screen();
|
| 14 |
+
|
| 15 |
+
// Add all Plugin Screens to Array
|
| 16 |
+
$inbound_screens = InboundCompatibility::return_inbound_now_screens(); // grabs our plugin screen ids
|
| 17 |
+
|
| 18 |
+
// If Not Inbound Now Screen Exit function
|
| 19 |
+
if (!in_array($screen->id, $inbound_screens)) {
|
| 20 |
+
return;
|
| 21 |
+
}
|
| 22 |
+
|
| 23 |
+
$lead_compatiblity = get_option( 'wpl-main-inbound_compatibility_mode', $default = false );
|
| 24 |
+
$cta_compatiblity = get_option( 'wp-cta-main-inbound_compatibility_mode', $default = false );
|
| 25 |
+
$lp_compatiblity = get_option( 'lp-main-inbound_compatibility_mode', $default = false );
|
| 26 |
+
if ( $lead_compatiblity || $cta_compatiblity || $lp_compatiblity ) {
|
| 27 |
+
InboundCompatibility::inbound_compatibilities_mode(); // kill third party scripts
|
| 28 |
+
}
|
| 29 |
+
}
|
| 30 |
+
}
|
| 31 |
+
|
| 32 |
+
add_action('admin_notices', 'inbound_compability_admin_notice'); // disable compat notice
|
| 33 |
+
if (!function_exists('inbound_compability_admin_notice')) {
|
| 34 |
+
function inbound_compability_admin_notice(){
|
| 35 |
+
$lead_compatiblity = get_option( 'wpl-main-inbound_compatibility_mode', $default = false );
|
| 36 |
+
$cta_compatiblity = get_option( 'wp-cta-main-inbound_compatibility_mode', $default = false );
|
| 37 |
+
$lp_compatiblity = get_option( 'lp-main-inbound_compatibility_mode', $default = false );
|
| 38 |
+
if ($lead_compatiblity) {
|
| 39 |
+
$link = admin_url( 'edit.php?post_type=wp-lead&page=wpleads_global_settings' );
|
| 40 |
+
} elseif ($cta_compatiblity) {
|
| 41 |
+
$link = admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' );
|
| 42 |
+
} elseif ($lp_compatiblity) {
|
| 43 |
+
$link = admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' );
|
| 44 |
+
}
|
| 45 |
+
|
| 46 |
+
if ( $lead_compatiblity || $cta_compatiblity || $lp_compatiblity ) {
|
| 47 |
+
echo '<div class="updated">
|
| 48 |
+
<p>Inbound Now Compatibility Mode is currently activated. To turn off go to <a href="'.$link.'">global settings</a> and toggle off</p>
|
| 49 |
+
</div>';
|
| 50 |
+
}
|
| 51 |
+
}
|
| 52 |
+
}
|
| 53 |
+
|
| 54 |
+
if (!class_exists('InboundCompatibility')) {
|
| 55 |
+
class InboundCompatibility {
|
| 56 |
+
static $add_inbound_compatibility;
|
| 57 |
+
|
| 58 |
+
/**
|
| 59 |
+
* Dequeue all third party scripts on page
|
| 60 |
+
* @return [type] [description]
|
| 61 |
+
*/
|
| 62 |
+
static function inbound_compatibilities_mode() {
|
| 63 |
+
|
| 64 |
+
if (is_admin()){
|
| 65 |
+
$screen = get_current_screen();
|
| 66 |
+
} else {
|
| 67 |
+
$screen = '';
|
| 68 |
+
}
|
| 69 |
+
global $wp_scripts;
|
| 70 |
+
|
| 71 |
+
// Match our plugins and whitelist them
|
| 72 |
+
$registered_scripts = $wp_scripts->registered;
|
| 73 |
+
$inbound_white_list = array();
|
| 74 |
+
foreach ($registered_scripts as $handle) {
|
| 75 |
+
if(preg_match("/\/plugins\/leads\//", $handle->src)) {
|
| 76 |
+
//echo $handle->handle;
|
| 77 |
+
$inbound_white_list[] = $handle->handle;
|
| 78 |
+
}
|
| 79 |
+
if(preg_match("/\/plugins\/cta\//", $handle->src)) {
|
| 80 |
+
//echo $handle->handle;
|
| 81 |
+
$inbound_white_list[]= $handle->handle;
|
| 82 |
+
}
|
| 83 |
+
if(preg_match("/\/plugins\/landing-pages\//", $handle->src)) {
|
| 84 |
+
//echo $handle->handle;
|
| 85 |
+
$inbound_white_list[]= $handle->handle;
|
| 86 |
+
}
|
| 87 |
+
}
|
| 88 |
+
//print_r($inbound_white_list);
|
| 89 |
+
|
| 90 |
+
/* NEED Filter for ADDONs */
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
$scripts_queued = $wp_scripts->queue; /* All Queued Scripts */ //print_r($wp_scripts->queue);
|
| 94 |
+
|
| 95 |
+
// Wordpress Core Scripts List
|
| 96 |
+
$wp_core_scripts = array("jcrop", "swfobject", "swfupload", "swfupload-degrade", "swfupload-queue", "swfupload-handlers", "jquery", "jquery-form", "jquery-color", "jquery-masonry", "jquery-ui-core", "jquery-ui-widget", "jquery-ui-mouse", "jquery-ui-accordion", "jquery-ui-autocomplete", "jquery-ui-slider", "jquery-ui-progressbar", "jquery-ui-tabs", "jquery-ui-sortable", "jquery-ui-draggable", "jquery-ui-droppable", "jquery-ui-selectable", "jquery-ui-position", "jquery-ui-datepicker", "jquery-ui-tooltip", "jquery-ui-resizable", "jquery-ui-dialog", "jquery-ui-button", "jquery-effects-core", "jquery-effects-blind", "jquery-effects-bounce", "jquery-effects-clip", "jquery-effects-drop", "jquery-effects-explode", "jquery-effects-fade", "jquery-effects-fold", "jquery-effects-highlight", "jquery-effects-pulsate", "jquery-effects-scale", "jquery-effects-shake", "jquery-effects-slide", "jquery-effects-transfer", "wp-mediaelement", "schedule", "suggest", "thickbox", "hoverIntent", "jquery-hotkeys", "sack", "quicktags", "iris", "farbtastic", "colorpicker", "tiny_mce", "autosave", "wp-ajax-response", "wp-lists", "common", "editorremov", "editor-functions", "ajaxcat", "admin-categories", "admin-tags", "admin-custom-fields", "password-strength-meter", "admin-comments", "admin-users", "admin-forms", "xfn", "upload", "postbox", "slug", "post", "page", "link", "comment", "comment-reply", "admin-gallery", "media-upload", "admin-widgets", "word-count", "theme-preview", "json2", "plupload", "plupload-all", "plupload-html4", "plupload-html5", "plupload-flash", "plupload-silverlight", "underscore", "backbone");
|
| 97 |
+
|
| 98 |
+
|
| 99 |
+
foreach ($scripts_queued as $key => $value) {
|
| 100 |
+
//echo $key . $value;
|
| 101 |
+
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 102 |
+
wp_dequeue_script( $value );
|
| 103 |
+
//echo $key . $value;
|
| 104 |
+
}
|
| 105 |
+
}
|
| 106 |
+
}
|
| 107 |
+
|
| 108 |
+
static function return_inbound_now_screens(){
|
| 109 |
+
$inbound_screens = array(
|
| 110 |
+
'wp-lead_page_wpleads_global_settings',
|
| 111 |
+
'wp-lead_page_lead_management',
|
| 112 |
+
'edit-list',
|
| 113 |
+
'edit-wp-lead',
|
| 114 |
+
'wp-lead',
|
| 115 |
+
'edit-wplead_list_category',
|
| 116 |
+
'edit-inbound-forms',
|
| 117 |
+
'inbound-forms',
|
| 118 |
+
'edit-landing-page',
|
| 119 |
+
'landing-page',
|
| 120 |
+
'edit-landing_page_category',
|
| 121 |
+
'landing-page_page_lp_manage_templates',
|
| 122 |
+
'landing-page_page_lp_global_settings',
|
| 123 |
+
'landing-page_page_lp_store',
|
| 124 |
+
'edit-wp-call-to-action',
|
| 125 |
+
'edit-wp_call_to_action_category',
|
| 126 |
+
'wp-call-to-action',
|
| 127 |
+
'wp-call-to-action_page_wp_cta_manage_templates',
|
| 128 |
+
'wp-call-to-action_page_wp_cta_global_settings',
|
| 129 |
+
);
|
| 130 |
+
// add filter
|
| 131 |
+
return $inbound_screens;
|
| 132 |
+
}
|
| 133 |
+
}
|
| 134 |
}
|
shared/classes/debug.class.php
CHANGED
|
@@ -1,379 +1,383 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/* Inbound Now Debug Class
|
| 3 |
-
*
|
| 4 |
-
* This class enabled users to dequeue third party javascript from pages to stop JS errors
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
if (!defined('INBOUND_CLASS_URL'))
|
| 8 |
-
define('INBOUND_CLASS_URL', plugin_dir_url(__FILE__));
|
| 9 |
-
|
| 10 |
-
//update_option( 'inbound_global_dequeue', "" );
|
| 11 |
-
/*
|
| 12 |
-
$global_array = get_option( 'inbound_global_dequeue' );
|
| 13 |
-
print_r($global_array);
|
| 14 |
-
/**/
|
| 15 |
-
|
| 16 |
-
if (!class_exists('InboundDebugScripts')) {
|
| 17 |
-
class InboundDebugScripts {
|
| 18 |
-
static $add_debug;
|
| 19 |
-
|
| 20 |
-
/* Contruct
|
| 21 |
-
* --------------------------------------------------------- */
|
| 22 |
-
static function init() {
|
| 23 |
-
self::$add_debug = true;
|
| 24 |
-
//add_action('wp_loaded', array(__CLASS__, 'inbound_check_for_error'));
|
| 25 |
-
//add_action('wp_footer', array(__CLASS__, 'display_errors'));
|
| 26 |
-
//add_action('init', array(__CLASS__, 'admin_display_errors'));
|
| 27 |
-
add_action('wp_enqueue_scripts', array(__CLASS__, 'inbound_kill_bogus_scripts'), 100);
|
| 28 |
-
add_action('wp_enqueue_scripts', array(__CLASS__, 'inbound_compatibilities'), 101);
|
| 29 |
-
add_action('admin_enqueue_scripts', array(__CLASS__, 'inbound_compatibilities'), 101);
|
| 30 |
-
add_action('admin_enqueue_scripts', array(__CLASS__, 'inbound_kill_bogus_admin_scripts'), 100);
|
| 31 |
-
add_action('wp_ajax_inbound_dequeue_js', array(__CLASS__, 'inbound_dequeue_js'));
|
| 32 |
-
add_action('wp_ajax_nopriv_inbound_dequeue_js', array(__CLASS__, 'inbound_dequeue_js'));
|
| 33 |
-
add_action('wp_ajax_inbound_dequeue_admin_js', array(__CLASS__, 'inbound_dequeue_admin_js'));
|
| 34 |
-
add_action('wp_ajax_nopriv_inbound_dequeue_admin_js', array(__CLASS__, 'inbound_dequeue_admin_js'));
|
| 35 |
-
if (isset($_GET['inbound_js'])){
|
| 36 |
-
add_action('wp_enqueue_scripts', array(__CLASS__, 'run_debug_script'), 102);
|
| 37 |
-
add_action('admin_enqueue_scripts', array(__CLASS__, 'run_debug_script'), 102);
|
| 38 |
-
}
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
// dequeue all js and set first script, then requeue scripts
|
| 42 |
-
static function run_debug_script() {
|
| 43 |
-
global $wp_scripts;
|
| 44 |
-
|
| 45 |
-
if ( !empty( $wp_scripts->queue ) ) {
|
| 46 |
-
$store = $wp_scripts->queue; // store the scripts
|
| 47 |
-
foreach ( $wp_scripts->queue as $handle ) {
|
| 48 |
-
wp_dequeue_script( $handle );
|
| 49 |
-
}
|
| 50 |
-
//wp_enqueue_script( 'jquery' );
|
| 51 |
-
wp_register_script('inbound-debug', WP_CTA_URLPATH . 'shared/classes/js/debug.js', array('jquery'));
|
| 52 |
-
wp_enqueue_script( 'inbound-debug' );
|
| 53 |
-
|
| 54 |
-
foreach ( $store as $handle ) {
|
| 55 |
-
wp_enqueue_script( $handle );
|
| 56 |
-
}
|
| 57 |
-
}
|
| 58 |
-
|
| 59 |
-
}
|
| 60 |
-
|
| 61 |
-
static function inbound_dequeue_js() {
|
| 62 |
-
if ( ! self::$add_debug )
|
| 63 |
-
return;
|
| 64 |
-
|
| 65 |
-
// Post Values
|
| 66 |
-
$post_id = (isset( $_POST['post_id'] )) ? $_POST['post_id'] : "";
|
| 67 |
-
$the_script = (isset( $_POST['the_script'] )) ? $_POST['the_script'] : "";
|
| 68 |
-
$status = (isset( $_POST['status'] )) ? $_POST['status'] : "";
|
| 69 |
-
$admin_screen = (isset( $_POST['admin_screen'] )) ? $_POST['admin_screen'] : "";
|
| 70 |
-
|
| 71 |
-
/* Store Script Data to Post */
|
| 72 |
-
$script_data = get_post_meta( $post_id, 'inbound_dequeue_js', TRUE );
|
| 73 |
-
$script_data = json_decode($script_data,true);
|
| 74 |
-
if(is_array($script_data)) {
|
| 75 |
-
|
| 76 |
-
if($status === 'off') {
|
| 77 |
-
// add or remove from list
|
| 78 |
-
$script_data[$the_script] = $status;
|
| 79 |
-
} else {
|
| 80 |
-
unset($script_data[$the_script]);
|
| 81 |
-
}
|
| 82 |
-
|
| 83 |
-
} else {
|
| 84 |
-
// Create the first item in array
|
| 85 |
-
if($status === 'off') {
|
| 86 |
-
$script_data[$the_script] = $status;
|
| 87 |
-
}
|
| 88 |
-
}
|
| 89 |
-
$script_save = json_encode($script_data);
|
| 90 |
-
|
| 91 |
-
update_post_meta( $post_id, 'inbound_dequeue_js', $script_save );
|
| 92 |
-
|
| 93 |
-
// Set global option inbound_global_dequeue_js
|
| 94 |
-
|
| 95 |
-
$output = array('encode'=> $script_save );
|
| 96 |
-
|
| 97 |
-
echo json_encode($output,JSON_FORCE_OBJECT);
|
| 98 |
-
wp_die();
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
static function inbound_dequeue_admin_js() {
|
| 102 |
-
if ( ! self::$add_debug )
|
| 103 |
-
return;
|
| 104 |
-
|
| 105 |
-
// Post Values
|
| 106 |
-
$post_id = (isset( $_POST['post_id'] )) ? $_POST['post_id'] : "";
|
| 107 |
-
$the_script = (isset( $_POST['the_script'] )) ? $_POST['the_script'] : "";
|
| 108 |
-
$status = (isset( $_POST['status'] )) ? $_POST['status'] : "";
|
| 109 |
-
$admin_screen = (isset( $_POST['admin_screen'] )) ? $_POST['admin_screen'] : "";
|
| 110 |
-
|
| 111 |
-
/* Store Script Data to Post */
|
| 112 |
-
$script_data = get_option( 'inbound_global_dequeue' );
|
| 113 |
-
|
| 114 |
-
if(is_array($script_data)) {
|
| 115 |
-
|
| 116 |
-
if($status === 'off') {
|
| 117 |
-
// add or remove from list
|
| 118 |
-
$script_data[$the_script] = $admin_screen;
|
| 119 |
-
} else {
|
| 120 |
-
unset($script_data[$the_script]);
|
| 121 |
-
}
|
| 122 |
-
|
| 123 |
-
} else {
|
| 124 |
-
// Create the first item in array
|
| 125 |
-
if($status === 'off') {
|
| 126 |
-
$script_data[$the_script] = $admin_screen;
|
| 127 |
-
}
|
| 128 |
-
}
|
| 129 |
-
update_option( 'inbound_global_dequeue', $script_data );
|
| 130 |
-
|
| 131 |
-
// Set global option inbound_global_dequeue_js
|
| 132 |
-
|
| 133 |
-
$output = array('encode'=> $script_data );
|
| 134 |
-
|
| 135 |
-
echo json_encode($output,JSON_FORCE_OBJECT);
|
| 136 |
-
wp_die();
|
| 137 |
-
}
|
| 138 |
-
|
| 139 |
-
static function wp_core_script_whitelist() {
|
| 140 |
-
// Wordpress Core Scripts List
|
| 141 |
-
$wp_core_scripts = array("jcrop", "swfobject", "swfupload", "swfupload-degrade", "swfupload-queue", "swfupload-handlers", "jquery", "jquery-form", "jquery-color", "jquery-masonry", "jquery-ui-core", "jquery-ui-widget", "jquery-ui-mouse", "jquery-ui-accordion", "jquery-ui-autocomplete", "jquery-ui-slider", "jquery-ui-progressbar", "jquery-ui-tabs", "jquery-ui-sortable", "jquery-ui-draggable", "jquery-ui-droppable", "jquery-ui-selectable", "jquery-ui-position", "jquery-ui-datepicker", "jquery-ui-tooltip", "jquery-ui-resizable", "jquery-ui-dialog", "jquery-ui-button", "jquery-effects-core", "jquery-effects-blind", "jquery-effects-bounce", "jquery-effects-clip", "jquery-effects-drop", "jquery-effects-explode", "jquery-effects-fade", "jquery-effects-fold", "jquery-effects-highlight", "jquery-effects-pulsate", "jquery-effects-scale", "jquery-effects-shake", "jquery-effects-slide", "jquery-effects-transfer", "wp-mediaelement", "schedule", "suggest", "thickbox", "hoverIntent", "jquery-hotkeys", "sack", "quicktags", "iris", "farbtastic", "colorpicker", "tiny_mce", "autosave", "wp-ajax-response", "wp-lists", "common", "editorremov", "editor-functions", "ajaxcat", "admin-categories", "admin-tags", "admin-custom-fields", "password-strength-meter", "admin-comments", "admin-users", "admin-forms", "xfn", "upload", "postbox", "slug", "post", "page", "link", "comment", "comment-reply", "admin-gallery", "media-upload", "admin-widgets", "word-count", "theme-preview", "json2", "plupload", "plupload-all", "plupload-html4", "plupload-html5", "plupload-flash", "plupload-silverlight", "underscore", "backbone", 'admin-bar', 'media-editor', 'svg-painter', 'wp-auth-check', 'editor', 'utils', 'customize-controls', 'plugin-install', 'customize-loader', 'dashboard');
|
| 142 |
-
|
| 143 |
-
// add filter;
|
| 144 |
-
|
| 145 |
-
return $wp_core_scripts;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
static function inbound_now_script_whitelist() {
|
| 149 |
-
global $wp_scripts;
|
| 150 |
-
// Match our plugins and whitelist them
|
| 151 |
-
$registered_scripts = $wp_scripts->registered;
|
| 152 |
-
$inbound_white_list = array();
|
| 153 |
-
foreach ($registered_scripts as $handle) {
|
| 154 |
-
if(preg_match("/\/plugins\/leads\//", $handle->src)) {
|
| 155 |
-
//echo $handle->handle;
|
| 156 |
-
$inbound_white_list[] = $handle->handle;
|
| 157 |
-
}
|
| 158 |
-
if(preg_match("/\/plugins\/cta\//", $handle->src)) {
|
| 159 |
-
//echo $handle->handle;
|
| 160 |
-
$inbound_white_list[]= $handle->handle;
|
| 161 |
-
}
|
| 162 |
-
if(preg_match("/\/plugins\/landing-pages\//", $handle->src)) {
|
| 163 |
-
//echo $handle->handle;
|
| 164 |
-
$inbound_white_list[]= $handle->handle;
|
| 165 |
-
}
|
| 166 |
-
}
|
| 167 |
-
//print_r($inbound_white_list);
|
| 168 |
-
return $inbound_white_list;
|
| 169 |
-
}
|
| 170 |
-
// Destroy all bad frontend scripts
|
| 171 |
-
static function inbound_kill_bogus_scripts() {
|
| 172 |
-
if (!isset($_GET['inbound-dequeue-scripts'])) {
|
| 173 |
-
global $wp_scripts, $wp_query;
|
| 174 |
-
$script_list = $wp_scripts->queue; // All enqueued scripts
|
| 175 |
-
$current_page_id = $wp_query->get_queried_object_id();
|
| 176 |
-
$script_data = get_post_meta( $current_page_id , 'inbound_dequeue_js', TRUE );
|
| 177 |
-
$script_data = json_decode($script_data,true);
|
| 178 |
-
|
| 179 |
-
$inbound_white_list = self::inbound_now_script_whitelist();
|
| 180 |
-
$wp_core_scripts = self::wp_core_script_whitelist();
|
| 181 |
-
|
| 182 |
-
// dequeue frontent scripts
|
| 183 |
-
foreach ($script_list as $key => $value) {
|
| 184 |
-
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 185 |
-
// Kill bad scripts
|
| 186 |
-
if (isset($script_data[$value]) && in_array($script_data[$value], $script_data)) {
|
| 187 |
-
wp_dequeue_script( $value ); // Kill bad script
|
| 188 |
-
}
|
| 189 |
-
}
|
| 190 |
-
}
|
| 191 |
-
|
| 192 |
-
}
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
// Destroy all bad admin scripts
|
| 196 |
-
static function inbound_kill_bogus_admin_scripts() {
|
| 197 |
-
if (!isset($_GET['inbound-dequeue-scripts'])) {
|
| 198 |
-
// dequeue admin scripts
|
| 199 |
-
$screen = get_current_screen();
|
| 200 |
-
|
| 201 |
-
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
|
| 205 |
-
|
| 206 |
-
|
| 207 |
-
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
|
| 218 |
-
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
|
| 222 |
-
|
| 223 |
-
|
| 224 |
-
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
|
| 228 |
-
$
|
| 229 |
-
$
|
| 230 |
-
$page_id = $
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
|
| 243 |
-
|
| 244 |
-
|
| 245 |
-
$
|
| 246 |
-
$
|
| 247 |
-
|
| 248 |
-
|
| 249 |
-
$
|
| 250 |
-
|
| 251 |
-
|
| 252 |
-
|
| 253 |
-
|
| 254 |
-
|
| 255 |
-
|
| 256 |
-
|
| 257 |
-
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
|
| 261 |
-
|
| 262 |
-
|
| 263 |
-
|
| 264 |
-
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
|
| 268 |
-
|
| 269 |
-
|
| 270 |
-
|
| 271 |
-
|
| 272 |
-
|
| 273 |
-
|
| 274 |
-
.
|
| 275 |
-
|
| 276 |
-
|
| 277 |
-
|
| 278 |
-
|
| 279 |
-
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
|
| 284 |
-
|
| 285 |
-
|
| 286 |
-
|
| 287 |
-
|
| 288 |
-
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
|
| 293 |
-
|
| 294 |
-
|
| 295 |
-
|
| 296 |
-
|
| 297 |
-
|
| 298 |
-
|
| 299 |
-
|
| 300 |
-
|
| 301 |
-
|
| 302 |
-
|
| 303 |
-
|
| 304 |
-
|
| 305 |
-
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
|
| 309 |
-
|
| 310 |
-
|
| 311 |
-
|
| 312 |
-
|
| 313 |
-
|
| 314 |
-
|
| 315 |
-
|
| 316 |
-
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
|
| 321 |
-
|
| 322 |
-
|
| 323 |
-
|
| 324 |
-
|
| 325 |
-
|
| 326 |
-
|
| 327 |
-
|
| 328 |
-
|
| 329 |
-
|
| 330 |
-
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
|
| 337 |
-
|
| 338 |
-
|
| 339 |
-
|
| 340 |
-
|
| 341 |
-
|
| 342 |
-
|
| 343 |
-
|
| 344 |
-
|
| 345 |
-
|
| 346 |
-
|
| 347 |
-
|
| 348 |
-
|
| 349 |
-
|
| 350 |
-
<
|
| 351 |
-
|
| 352 |
-
|
| 353 |
-
|
| 354 |
-
|
| 355 |
-
|
| 356 |
-
|
| 357 |
-
|
| 358 |
-
|
| 359 |
-
|
| 360 |
-
|
| 361 |
-
|
| 362 |
-
|
| 363 |
-
|
| 364 |
-
|
| 365 |
-
|
| 366 |
-
|
| 367 |
-
|
| 368 |
-
|
| 369 |
-
|
| 370 |
-
|
| 371 |
-
|
| 372 |
-
}
|
| 373 |
-
}
|
| 374 |
-
|
| 375 |
-
|
| 376 |
-
|
| 377 |
-
|
| 378 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 379 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
/* Inbound Now Debug Class
|
| 3 |
+
*
|
| 4 |
+
* This class enabled users to dequeue third party javascript from pages to stop JS errors
|
| 5 |
+
*/
|
| 6 |
+
|
| 7 |
+
if (!defined('INBOUND_CLASS_URL'))
|
| 8 |
+
define('INBOUND_CLASS_URL', plugin_dir_url(__FILE__));
|
| 9 |
+
|
| 10 |
+
//update_option( 'inbound_global_dequeue', "" );
|
| 11 |
+
/*
|
| 12 |
+
$global_array = get_option( 'inbound_global_dequeue' );
|
| 13 |
+
print_r($global_array);
|
| 14 |
+
/**/
|
| 15 |
+
|
| 16 |
+
if (!class_exists('InboundDebugScripts')) {
|
| 17 |
+
class InboundDebugScripts {
|
| 18 |
+
static $add_debug;
|
| 19 |
+
|
| 20 |
+
/* Contruct
|
| 21 |
+
* --------------------------------------------------------- */
|
| 22 |
+
static function init() {
|
| 23 |
+
self::$add_debug = true;
|
| 24 |
+
//add_action('wp_loaded', array(__CLASS__, 'inbound_check_for_error'));
|
| 25 |
+
//add_action('wp_footer', array(__CLASS__, 'display_errors'));
|
| 26 |
+
//add_action('init', array(__CLASS__, 'admin_display_errors'));
|
| 27 |
+
add_action('wp_enqueue_scripts', array(__CLASS__, 'inbound_kill_bogus_scripts'), 100);
|
| 28 |
+
add_action('wp_enqueue_scripts', array(__CLASS__, 'inbound_compatibilities'), 101);
|
| 29 |
+
add_action('admin_enqueue_scripts', array(__CLASS__, 'inbound_compatibilities'), 101);
|
| 30 |
+
add_action('admin_enqueue_scripts', array(__CLASS__, 'inbound_kill_bogus_admin_scripts'), 100);
|
| 31 |
+
add_action('wp_ajax_inbound_dequeue_js', array(__CLASS__, 'inbound_dequeue_js'));
|
| 32 |
+
add_action('wp_ajax_nopriv_inbound_dequeue_js', array(__CLASS__, 'inbound_dequeue_js'));
|
| 33 |
+
add_action('wp_ajax_inbound_dequeue_admin_js', array(__CLASS__, 'inbound_dequeue_admin_js'));
|
| 34 |
+
add_action('wp_ajax_nopriv_inbound_dequeue_admin_js', array(__CLASS__, 'inbound_dequeue_admin_js'));
|
| 35 |
+
if (isset($_GET['inbound_js'])){
|
| 36 |
+
add_action('wp_enqueue_scripts', array(__CLASS__, 'run_debug_script'), 102);
|
| 37 |
+
add_action('admin_enqueue_scripts', array(__CLASS__, 'run_debug_script'), 102);
|
| 38 |
+
}
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
// dequeue all js and set first script, then requeue scripts
|
| 42 |
+
static function run_debug_script() {
|
| 43 |
+
global $wp_scripts;
|
| 44 |
+
|
| 45 |
+
if ( !empty( $wp_scripts->queue ) ) {
|
| 46 |
+
$store = $wp_scripts->queue; // store the scripts
|
| 47 |
+
foreach ( $wp_scripts->queue as $handle ) {
|
| 48 |
+
wp_dequeue_script( $handle );
|
| 49 |
+
}
|
| 50 |
+
//wp_enqueue_script( 'jquery' );
|
| 51 |
+
wp_register_script('inbound-debug', WP_CTA_URLPATH . 'shared/classes/js/debug.js', array('jquery'));
|
| 52 |
+
wp_enqueue_script( 'inbound-debug' );
|
| 53 |
+
|
| 54 |
+
foreach ( $store as $handle ) {
|
| 55 |
+
wp_enqueue_script( $handle );
|
| 56 |
+
}
|
| 57 |
+
}
|
| 58 |
+
|
| 59 |
+
}
|
| 60 |
+
|
| 61 |
+
static function inbound_dequeue_js() {
|
| 62 |
+
if ( ! self::$add_debug )
|
| 63 |
+
return;
|
| 64 |
+
|
| 65 |
+
// Post Values
|
| 66 |
+
$post_id = (isset( $_POST['post_id'] )) ? $_POST['post_id'] : "";
|
| 67 |
+
$the_script = (isset( $_POST['the_script'] )) ? $_POST['the_script'] : "";
|
| 68 |
+
$status = (isset( $_POST['status'] )) ? $_POST['status'] : "";
|
| 69 |
+
$admin_screen = (isset( $_POST['admin_screen'] )) ? $_POST['admin_screen'] : "";
|
| 70 |
+
|
| 71 |
+
/* Store Script Data to Post */
|
| 72 |
+
$script_data = get_post_meta( $post_id, 'inbound_dequeue_js', TRUE );
|
| 73 |
+
$script_data = json_decode($script_data,true);
|
| 74 |
+
if(is_array($script_data)) {
|
| 75 |
+
|
| 76 |
+
if($status === 'off') {
|
| 77 |
+
// add or remove from list
|
| 78 |
+
$script_data[$the_script] = $status;
|
| 79 |
+
} else {
|
| 80 |
+
unset($script_data[$the_script]);
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
+
} else {
|
| 84 |
+
// Create the first item in array
|
| 85 |
+
if($status === 'off') {
|
| 86 |
+
$script_data[$the_script] = $status;
|
| 87 |
+
}
|
| 88 |
+
}
|
| 89 |
+
$script_save = json_encode($script_data);
|
| 90 |
+
|
| 91 |
+
update_post_meta( $post_id, 'inbound_dequeue_js', $script_save );
|
| 92 |
+
|
| 93 |
+
// Set global option inbound_global_dequeue_js
|
| 94 |
+
|
| 95 |
+
$output = array('encode'=> $script_save );
|
| 96 |
+
|
| 97 |
+
echo json_encode($output,JSON_FORCE_OBJECT);
|
| 98 |
+
wp_die();
|
| 99 |
+
}
|
| 100 |
+
|
| 101 |
+
static function inbound_dequeue_admin_js() {
|
| 102 |
+
if ( ! self::$add_debug )
|
| 103 |
+
return;
|
| 104 |
+
|
| 105 |
+
// Post Values
|
| 106 |
+
$post_id = (isset( $_POST['post_id'] )) ? $_POST['post_id'] : "";
|
| 107 |
+
$the_script = (isset( $_POST['the_script'] )) ? $_POST['the_script'] : "";
|
| 108 |
+
$status = (isset( $_POST['status'] )) ? $_POST['status'] : "";
|
| 109 |
+
$admin_screen = (isset( $_POST['admin_screen'] )) ? $_POST['admin_screen'] : "";
|
| 110 |
+
|
| 111 |
+
/* Store Script Data to Post */
|
| 112 |
+
$script_data = get_option( 'inbound_global_dequeue' );
|
| 113 |
+
|
| 114 |
+
if(is_array($script_data)) {
|
| 115 |
+
|
| 116 |
+
if($status === 'off') {
|
| 117 |
+
// add or remove from list
|
| 118 |
+
$script_data[$the_script] = $admin_screen;
|
| 119 |
+
} else {
|
| 120 |
+
unset($script_data[$the_script]);
|
| 121 |
+
}
|
| 122 |
+
|
| 123 |
+
} else {
|
| 124 |
+
// Create the first item in array
|
| 125 |
+
if($status === 'off') {
|
| 126 |
+
$script_data[$the_script] = $admin_screen;
|
| 127 |
+
}
|
| 128 |
+
}
|
| 129 |
+
update_option( 'inbound_global_dequeue', $script_data );
|
| 130 |
+
|
| 131 |
+
// Set global option inbound_global_dequeue_js
|
| 132 |
+
|
| 133 |
+
$output = array('encode'=> $script_data );
|
| 134 |
+
|
| 135 |
+
echo json_encode($output,JSON_FORCE_OBJECT);
|
| 136 |
+
wp_die();
|
| 137 |
+
}
|
| 138 |
+
|
| 139 |
+
static function wp_core_script_whitelist() {
|
| 140 |
+
// Wordpress Core Scripts List
|
| 141 |
+
$wp_core_scripts = array("jcrop", "swfobject", "swfupload", "swfupload-degrade", "swfupload-queue", "swfupload-handlers", "jquery", "jquery-form", "jquery-color", "jquery-masonry", "jquery-ui-core", "jquery-ui-widget", "jquery-ui-mouse", "jquery-ui-accordion", "jquery-ui-autocomplete", "jquery-ui-slider", "jquery-ui-progressbar", "jquery-ui-tabs", "jquery-ui-sortable", "jquery-ui-draggable", "jquery-ui-droppable", "jquery-ui-selectable", "jquery-ui-position", "jquery-ui-datepicker", "jquery-ui-tooltip", "jquery-ui-resizable", "jquery-ui-dialog", "jquery-ui-button", "jquery-effects-core", "jquery-effects-blind", "jquery-effects-bounce", "jquery-effects-clip", "jquery-effects-drop", "jquery-effects-explode", "jquery-effects-fade", "jquery-effects-fold", "jquery-effects-highlight", "jquery-effects-pulsate", "jquery-effects-scale", "jquery-effects-shake", "jquery-effects-slide", "jquery-effects-transfer", "wp-mediaelement", "schedule", "suggest", "thickbox", "hoverIntent", "jquery-hotkeys", "sack", "quicktags", "iris", "farbtastic", "colorpicker", "tiny_mce", "autosave", "wp-ajax-response", "wp-lists", "common", "editorremov", "editor-functions", "ajaxcat", "admin-categories", "admin-tags", "admin-custom-fields", "password-strength-meter", "admin-comments", "admin-users", "admin-forms", "xfn", "upload", "postbox", "slug", "post", "page", "link", "comment", "comment-reply", "admin-gallery", "media-upload", "admin-widgets", "word-count", "theme-preview", "json2", "plupload", "plupload-all", "plupload-html4", "plupload-html5", "plupload-flash", "plupload-silverlight", "underscore", "backbone", 'admin-bar', 'media-editor', 'svg-painter', 'wp-auth-check', 'editor', 'utils', 'customize-controls', 'plugin-install', 'customize-loader', 'dashboard');
|
| 142 |
+
|
| 143 |
+
// add filter;
|
| 144 |
+
|
| 145 |
+
return $wp_core_scripts;
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
static function inbound_now_script_whitelist() {
|
| 149 |
+
global $wp_scripts;
|
| 150 |
+
// Match our plugins and whitelist them
|
| 151 |
+
$registered_scripts = $wp_scripts->registered;
|
| 152 |
+
$inbound_white_list = array();
|
| 153 |
+
foreach ($registered_scripts as $handle) {
|
| 154 |
+
if(preg_match("/\/plugins\/leads\//", $handle->src)) {
|
| 155 |
+
//echo $handle->handle;
|
| 156 |
+
$inbound_white_list[] = $handle->handle;
|
| 157 |
+
}
|
| 158 |
+
if(preg_match("/\/plugins\/cta\//", $handle->src)) {
|
| 159 |
+
//echo $handle->handle;
|
| 160 |
+
$inbound_white_list[]= $handle->handle;
|
| 161 |
+
}
|
| 162 |
+
if(preg_match("/\/plugins\/landing-pages\//", $handle->src)) {
|
| 163 |
+
//echo $handle->handle;
|
| 164 |
+
$inbound_white_list[]= $handle->handle;
|
| 165 |
+
}
|
| 166 |
+
}
|
| 167 |
+
//print_r($inbound_white_list);
|
| 168 |
+
return $inbound_white_list;
|
| 169 |
+
}
|
| 170 |
+
// Destroy all bad frontend scripts
|
| 171 |
+
static function inbound_kill_bogus_scripts() {
|
| 172 |
+
if (!isset($_GET['inbound-dequeue-scripts'])) {
|
| 173 |
+
global $wp_scripts, $wp_query;
|
| 174 |
+
$script_list = $wp_scripts->queue; // All enqueued scripts
|
| 175 |
+
$current_page_id = $wp_query->get_queried_object_id();
|
| 176 |
+
$script_data = get_post_meta( $current_page_id , 'inbound_dequeue_js', TRUE );
|
| 177 |
+
$script_data = json_decode($script_data,true);
|
| 178 |
+
|
| 179 |
+
$inbound_white_list = self::inbound_now_script_whitelist();
|
| 180 |
+
$wp_core_scripts = self::wp_core_script_whitelist();
|
| 181 |
+
|
| 182 |
+
// dequeue frontent scripts
|
| 183 |
+
foreach ($script_list as $key => $value) {
|
| 184 |
+
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 185 |
+
// Kill bad scripts
|
| 186 |
+
if (isset($script_data[$value]) && in_array($script_data[$value], $script_data)) {
|
| 187 |
+
wp_dequeue_script( $value ); // Kill bad script
|
| 188 |
+
}
|
| 189 |
+
}
|
| 190 |
+
}
|
| 191 |
+
|
| 192 |
+
}
|
| 193 |
+
}
|
| 194 |
+
|
| 195 |
+
// Destroy all bad admin scripts
|
| 196 |
+
static function inbound_kill_bogus_admin_scripts() {
|
| 197 |
+
if (!isset($_GET['inbound-dequeue-scripts'])) {
|
| 198 |
+
// dequeue admin scripts
|
| 199 |
+
$screen = get_current_screen();
|
| 200 |
+
|
| 201 |
+
$array = array('load-qtip' => 'wp-call-to-action');
|
| 202 |
+
//update_option( 'inbound_global_dequeue', $array );
|
| 203 |
+
$global_array = get_option( 'inbound_global_dequeue' );
|
| 204 |
+
//print_r($global_array);
|
| 205 |
+
|
| 206 |
+
|
| 207 |
+
if (!$global_array){
|
| 208 |
+
return;
|
| 209 |
+
}
|
| 210 |
+
|
| 211 |
+
foreach ($global_array as $key => $value) {
|
| 212 |
+
if ( $screen->id === $value) {
|
| 213 |
+
wp_dequeue_script( $key );
|
| 214 |
+
}
|
| 215 |
+
}
|
| 216 |
+
}
|
| 217 |
+
}
|
| 218 |
+
|
| 219 |
+
static function inbound_compatibilities() {
|
| 220 |
+
|
| 221 |
+
if (isset($_GET['inbound-dequeue-scripts']) && current_user_can( 'manage_options' ) ) {
|
| 222 |
+
|
| 223 |
+
global $wp_query;
|
| 224 |
+
$current_page_id = $wp_query->get_queried_object_id();
|
| 225 |
+
$global_array = get_option( 'inbound_global_dequeue' );
|
| 226 |
+
if( is_admin() ) {
|
| 227 |
+
global $post;
|
| 228 |
+
$screen = get_current_screen();
|
| 229 |
+
$current = $screen->id;
|
| 230 |
+
$page_id = (isset($post->ID)) ? $post->ID : '';
|
| 231 |
+
} else {
|
| 232 |
+
$current = '';
|
| 233 |
+
$screen = '';
|
| 234 |
+
$page_id = $current_page_id;
|
| 235 |
+
}
|
| 236 |
+
|
| 237 |
+
//show_admin_bar( false );
|
| 238 |
+
wp_enqueue_script('inbound-dequeue-scripts', INBOUND_CLASS_URL . 'js/inbound-dequeue-scripts.js', array( 'jquery' ));
|
| 239 |
+
wp_localize_script( 'inbound-dequeue-scripts' , 'inbound_debug' , array( 'admin_url' => admin_url( 'admin-ajax.php' ), 'admin_screen' => $current, 'page_id' => $page_id));
|
| 240 |
+
|
| 241 |
+
global $wp_scripts;
|
| 242 |
+
|
| 243 |
+
$scripts_registers = $wp_scripts->registered;
|
| 244 |
+
//echo "<pre>";
|
| 245 |
+
//print_r($scripts_registers);
|
| 246 |
+
//echo $scripts_registers['common']->src;
|
| 247 |
+
|
| 248 |
+
|
| 249 |
+
$script_list = $wp_scripts->queue; // All enqueued scripts
|
| 250 |
+
$inbound_white_list = self::inbound_now_script_whitelist();
|
| 251 |
+
$wp_core_scripts = self::wp_core_script_whitelist();
|
| 252 |
+
// TURN OFF ALL OTHER SCRIPTS FOR DISABLING
|
| 253 |
+
$count = 0;
|
| 254 |
+
foreach ($script_list as $key => $value) {
|
| 255 |
+
// echo $key . $value;
|
| 256 |
+
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 257 |
+
wp_dequeue_script( $value );
|
| 258 |
+
$count++;
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
}
|
| 262 |
+
// If no scripts third party enqueued scripts leave
|
| 263 |
+
|
| 264 |
+
/* echo "<pre>";
|
| 265 |
+
print_r($wp_scripts->queue);
|
| 266 |
+
echo "</pre>"; */
|
| 267 |
+
|
| 268 |
+
echo '<style type="text/css" media="screen">
|
| 269 |
+
#launch-feedback {
|
| 270 |
+
display:none;
|
| 271 |
+
}
|
| 272 |
+
#group{text-align: left;border-bottom: 1px solid #fff;position:relative;margin:0 auto;padding:6px 10px 10px;background-image:linear-gradient(top,rgba(255,255,255,.1),rgba(0,0,0,.1));background-color:#555;width:300px}#group:after{content:" ";position:absolute;z-index:1;top:0;left:0;right:0;bottom:0;border-radius:5px}.switch{margin: 0px;position:relative;border:0;padding:0;width:245px;font-family:helvetica;font-weight:700;font-size:22px;color:#222;text-shadow:0 1px 0 rgba(255,255,255,.3)}.switch legend{float:left;width: 98px;padding:7px 10% 3px 0;text-align:left;}.switch input{position:absolute;opacity:0}.switch legend:after{content:"";position:absolute;top:0;left:50%;z-index:0;width:50%;height:100%;padding:2px;background-color:#222;border-radius:3px;box-shadow:inset -1px 2px 5px rgba(0,0,0,.8),0 1px 0 rgba(255,255,255,.2)}.switch label{position:relative;z-index:2;float:left;width:25%;margin-top:2px;padding:5px 0 3px;text-align:center;color:#64676b;text-shadow:0 1px 0 #000;cursor:pointer;transition:color 0s ease .1s}.switch input:checked+label{color:#fff}.switch input:focus+label{outline:0}.switch .switch-button{clear:both;position:absolute;top:-1px;left:50%;z-index:1;width:25%;height:100%;margin:2px;background-color:#70c66b;background-image:linear-gradient(top,rgba(255,255,255,.2),rgba(0,0,0,0));border-radius:3px;box-shadow:0 0 0 2px #70c66b,-2px 3px 2px #000;transition:all .3s ease-out}.switch .switch-button:after{content:" ";position:absolute;z-index:1;top:0;left:0;right:0;bottom:0;border-radius:3px;border:1px dashed #fff}#inbound-dequeue-id{display:none}.switch input:last-of-type:checked~.switch-button{left:75%}.switch .switch-button.status-off{background-color:red;box-shadow:0 0 0 3px red,-2px 3px 5px #000}.switch label.turn-on{color:#fff}
|
| 273 |
+
.script-info {padding-left:5px; position: absolute; z-index:999999999;}
|
| 274 |
+
.debug-plugin-name { font-size:13px; color:#fff; text-shadow:none; padding-bottom: 6px;
|
| 275 |
+
display: inline-block; }
|
| 276 |
+
.debug-plugin-name span.debug-head, .debug-script-head {color:#ccc; width: 45px;
|
| 277 |
+
display: inline-block;}
|
| 278 |
+
.js-title { display:block; margin-bottom: 7px; color:#fff;}
|
| 279 |
+
.fa-info-circle:before{ content: "\f05a"; font-family: FontAwesome !important; font-style:normal;}
|
| 280 |
+
#group:last-of-type {
|
| 281 |
+
padding-bottom:80px;
|
| 282 |
+
}
|
| 283 |
+
#main-debug-title {
|
| 284 |
+
font-family: helvetica;
|
| 285 |
+
font-weight: 700;
|
| 286 |
+
font-size: 22px;
|
| 287 |
+
color: #222;
|
| 288 |
+
background: #ccc;
|
| 289 |
+
padding: 10px;
|
| 290 |
+
text-align: center;
|
| 291 |
+
text-shadow: 0 1px 0 rgba(255,255,255,.3);
|
| 292 |
+
}
|
| 293 |
+
#no-js-to-turn-off {width: 286px;}
|
| 294 |
+
#no-js-to-turn-off span {font-size:22px; line-height:25px; padding:10px; display:inline-block;}
|
| 295 |
+
#debug-close-link { color:red; float:right; font-size:10px; text-decoration:none;}
|
| 296 |
+
</style>';
|
| 297 |
+
|
| 298 |
+
$script_data = get_post_meta( $current_page_id , 'inbound_dequeue_js', TRUE );
|
| 299 |
+
$script_data = json_decode($script_data,true);
|
| 300 |
+
$close_link = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 301 |
+
$close_link = str_replace(array("&inbound-dequeue-scripts", "?inbound-dequeue-scripts"), "", $close_link);
|
| 302 |
+
|
| 303 |
+
echo '<div id="inbound-fix-page" class="'.$current_page_id.'" data-page-id="'.$page_id.'" data-admin-screen="'.$current.'" style="position:fixed; right:0px; padding-bottom: 80px; background-color: #555; overflow:auto; height: 100%; top: 32px; background:#fff; border: 1px solid; z-index: 999999999999; line-height: 1; width: 317px;">';
|
| 304 |
+
echo "<div id='main-debug-title'>Turn off Javascript<a id='debug-close-link' href='".$close_link."'>Close</a></div>";
|
| 305 |
+
if ($count === 0) {
|
| 306 |
+
echo "<div id='no-js-to-turn-off'><span style=''>No javascript files found to dequeue</span></div></div>";
|
| 307 |
+
return;
|
| 308 |
+
}
|
| 309 |
+
echo "<span id='inbound-dequeue-id'>".$current_page_id."</span>";
|
| 310 |
+
|
| 311 |
+
foreach ($script_list as $key => $value) {
|
| 312 |
+
if (!in_array($value, $inbound_white_list) && !in_array($value, $wp_core_scripts)){
|
| 313 |
+
$checked = "";
|
| 314 |
+
$status_class = "";
|
| 315 |
+
// Kill bad frontend script
|
| 316 |
+
if (isset($script_data[$value]) && in_array($script_data[$value], $script_data)){
|
| 317 |
+
$checked = "checked";
|
| 318 |
+
$status_class = "status-off";
|
| 319 |
+
wp_dequeue_script( $value ); // Kill bad script
|
| 320 |
+
}
|
| 321 |
+
// Kill bad admin script
|
| 322 |
+
if (is_array($global_array)) {
|
| 323 |
+
if (is_admin() && array_key_exists($value, $global_array)) {
|
| 324 |
+
|
| 325 |
+
if ($current === $global_array[$value] ) {
|
| 326 |
+
$checked = "checked";
|
| 327 |
+
$status_class = "status-off";
|
| 328 |
+
wp_dequeue_script( $value ); // Kill bad script
|
| 329 |
+
}
|
| 330 |
+
}
|
| 331 |
+
}
|
| 332 |
+
|
| 333 |
+
$actual_link = $scripts_registers[$value]->src;
|
| 334 |
+
str_replace("?frontend=false", "", $actual_link);
|
| 335 |
+
preg_match('/plugins\/([^\/]+?)\/(?:[^\/]+\/)?(.+)/', $actual_link, $matches);
|
| 336 |
+
preg_match('/themes\/([^\/]+?)\/(?:[^\/]+\/)?(.+)/', $actual_link, $matches_two);
|
| 337 |
+
|
| 338 |
+
$name_of_file = (isset($matches_two[1])) ? "<span class='debug-head'>Theme:</span> " . $matches_two[1] : '';
|
| 339 |
+
if ($name_of_file === "") {
|
| 340 |
+
$name_of_file = (isset($matches[1])) ? "<span class='debug-head'>Plugin:</span> " . $matches[1] : '<span class="debug-head">From:</span> Wordpress Core Script <span style="color:#db3d3d; font-size:12px;">(Don\'t turn off)</span>';
|
| 341 |
+
}
|
| 342 |
+
|
| 343 |
+
|
| 344 |
+
echo '<div id="group">';
|
| 345 |
+
echo '<span class="debug-plugin-name">'.$name_of_file.'</span>';
|
| 346 |
+
echo "<div class='js-title'><span class='debug-script-head'>Script:</span> ". $value ."<span title='".$scripts_registers[$value]->src."' class='script-info'><i class='fa fa-info-circle'></i></span></div>";
|
| 347 |
+
echo '<fieldset class="switch" id="'.$value.'">
|
| 348 |
+
<legend>Status:</legend>
|
| 349 |
+
|
| 350 |
+
<input id="'.$value.'-on" name="'.$value.'-status" type="radio" '.$checked.'>
|
| 351 |
+
<label for="'.$value.'-on" class="turn-on">On</label>
|
| 352 |
+
|
| 353 |
+
<input id="'.$value.'-off" name="'.$value.'-status" type="radio" '.$checked.'>
|
| 354 |
+
<label for="'.$value.'-off" class="turn-off">Off</label>
|
| 355 |
+
|
| 356 |
+
<span class="switch-button '.$status_class.'"></span>
|
| 357 |
+
</fieldset>
|
| 358 |
+
|
| 359 |
+
</div>';
|
| 360 |
+
}
|
| 361 |
+
}
|
| 362 |
+
echo "</div>";
|
| 363 |
+
|
| 364 |
+
// This will control the dequing
|
| 365 |
+
/*
|
| 366 |
+
foreach ($scripts_queued as $key => $value) {
|
| 367 |
+
//echo $key . $value;
|
| 368 |
+
if (!in_array($value, $white_list_scripts)){
|
| 369 |
+
wp_dequeue_script( $value );
|
| 370 |
+
}
|
| 371 |
+
|
| 372 |
+
} */
|
| 373 |
+
}
|
| 374 |
+
|
| 375 |
+
}
|
| 376 |
+
}
|
| 377 |
+
}
|
| 378 |
+
/* Initialize InboundNow Debug
|
| 379 |
+
* --------------------------------------------------------- */
|
| 380 |
+
|
| 381 |
+
InboundDebugScripts::init();
|
| 382 |
+
|
| 383 |
?>
|
shared/classes/feedback.class.php
CHANGED
|
@@ -1,381 +1,381 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/* Inbound Now Menu Class */
|
| 3 |
-
|
| 4 |
-
if (!class_exists('InboundFeedback')) {
|
| 5 |
-
class InboundFeedback {
|
| 6 |
-
static $add_feedback;
|
| 7 |
-
|
| 8 |
-
/* Contruct
|
| 9 |
-
* --------------------------------------------------------- */
|
| 10 |
-
static function init() {
|
| 11 |
-
self::$add_feedback = true;
|
| 12 |
-
// add_action('admin_bar_menu', array( __CLASS__, 'loads' ), 98);
|
| 13 |
-
//add_action( 'wp_head', array(__CLASS__, 'menu_admin_head'));
|
| 14 |
-
add_action( 'admin_footer', array(__CLASS__, 'show_feedback'));
|
| 15 |
-
add_action('wp_ajax_send_inbound_feedback', array(__CLASS__, 'send_inbound_feedback'));
|
| 16 |
-
add_action('wp_ajax_send_inbound_feedback', array(__CLASS__, 'send_inbound_feedback'));
|
| 17 |
-
}
|
| 18 |
-
|
| 19 |
-
/* Loads
|
| 20 |
-
* --------------------------------------------------------- */
|
| 21 |
-
static function loads($hook) {
|
| 22 |
-
if ( ! self::$add_feedback )
|
| 23 |
-
return;
|
| 24 |
-
global $wp_admin_bar;
|
| 25 |
-
// CHECK FOR ACTIVE PLUGINS
|
| 26 |
-
$leads_status = FALSE; $landing_page_status = FALSE; $cta_status = FALSE;
|
| 27 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('leads/wordpress-leads.php')) {
|
| 28 |
-
$leads_status = TRUE;
|
| 29 |
-
$leads_version_number = defined( 'WPL_CURRENT_VERSION' ) ? 'v' . WPL_CURRENT_VERSION : '';
|
| 30 |
-
}
|
| 31 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('landing-pages/landing-pages.php')) {
|
| 32 |
-
$landing_page_status = TRUE;
|
| 33 |
-
$landing_page_version_number = defined( 'LANDINGPAGES_CURRENT_VERSION' ) ? 'v' . LANDINGPAGES_CURRENT_VERSION : '';
|
| 34 |
-
|
| 35 |
-
}
|
| 36 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('cta/wordpress-cta.php')) {
|
| 37 |
-
$cta_status = TRUE;
|
| 38 |
-
$cta_number = defined( 'WP_CTA_CURRENT_VERSION' ) ? 'v' . WP_CTA_CURRENT_VERSION : '';
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
-
if ( $leads_status == FALSE && $landing_page_status == FALSE && $cta_status == FALSE ) {
|
| 42 |
-
|
| 43 |
-
return; // end plugin is
|
| 44 |
-
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
|
| 48 |
-
// Exit if admin bar not there
|
| 49 |
-
if ( ! is_user_logged_in() || ! is_admin_bar_showing() ) {
|
| 50 |
-
return;
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
/** Show these items only if Inbound Now plugin is actually installed */
|
| 54 |
-
if ( $leads_status == TRUE || $landing_page_status == TRUE || $cta_status == TRUE ) {
|
| 55 |
-
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
}
|
| 59 |
-
static function send_inbound_feedback(){
|
| 60 |
-
// process feedback
|
| 61 |
-
if (isset($_POST['feedback'])) {
|
| 62 |
-
$firstname= 'anonymous';
|
| 63 |
-
$lastname= 'anonymous';
|
| 64 |
-
$email = (isset($_POST['email'])) ? $_POST['email'] : 'anonymous';
|
| 65 |
-
$feedback= $_POST['feedback'];
|
| 66 |
-
$page = $_POST['page'];
|
| 67 |
-
$plugin = (isset($_POST['plugin'])) ? $_POST['plugin'] : 'na';
|
| 68 |
-
|
| 69 |
-
$context = array(
|
| 70 |
-
'hutk' => 'anonymous',
|
| 71 |
-
'ipAddress' => 'anonymous',
|
| 72 |
-
'pageUrl' => 'anonymous',
|
| 73 |
-
'pageTitle' => $page
|
| 74 |
-
);
|
| 75 |
-
$context_json = json_encode($context);
|
| 76 |
-
//Need to populate these varilables with values from the form.
|
| 77 |
-
$str_post2 = "message=" . urlencode($feedback)
|
| 78 |
-
. "&email=" . urlencode($email)
|
| 79 |
-
. "&plugin=" . urlencode($plugin)
|
| 80 |
-
. "&page=" . urlencode($page)
|
| 81 |
-
. "&hs_context=" . urlencode($context_json);
|
| 82 |
-
$endpoint2 = 'https://forms.hubspot.com/uploads/form/v2/24784/4c6efedd-40b4-438e-bb4c-050a1944c974';
|
| 83 |
-
|
| 84 |
-
$ch2 = @curl_init();
|
| 85 |
-
@curl_setopt($ch2, CURLOPT_POST, true);
|
| 86 |
-
@curl_setopt($ch2, CURLOPT_POSTFIELDS, $str_post2);
|
| 87 |
-
@curl_setopt($ch2, CURLOPT_URL, $endpoint2);
|
| 88 |
-
@curl_setopt($ch2, CURLOPT_HTTPHEADER, array('application/x-www-form-urlencoded'));
|
| 89 |
-
@curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
|
| 90 |
-
$response2 = @curl_exec($ch2); //Log the response from HubSpot as needed.
|
| 91 |
-
@curl_close($ch2);
|
| 92 |
-
echo $response2;
|
| 93 |
-
|
| 94 |
-
}
|
| 95 |
-
}
|
| 96 |
-
static function show_feedback() {
|
| 97 |
-
if ( ! self::$add_feedback || ! is_admin())
|
| 98 |
-
return;
|
| 99 |
-
$screen = get_current_screen();
|
| 100 |
-
|
| 101 |
-
$show_array = array("edit-landing-page",
|
| 102 |
-
"landing-page_page_lp_global_settings",
|
| 103 |
-
"landing-page",
|
| 104 |
-
"landing-page_page_lp_manage_templates",
|
| 105 |
-
"edit-landing_page_category",
|
| 106 |
-
"edit-inbound-forms",
|
| 107 |
-
"wp-lead",
|
| 108 |
-
"edit-wp-lead",
|
| 109 |
-
"edit-list",
|
| 110 |
-
"wp-lead_page_wpleads_global_settings",
|
| 111 |
-
"edit-wp-call-to-action",
|
| 112 |
-
"wp-call-to-action",
|
| 113 |
-
"edit-wp_call_to_action_category",
|
| 114 |
-
"wp-call-to-action_page_wp_cta_manage_templates",
|
| 115 |
-
"wp-call-to-action_page_wp_cta_global_settings"
|
| 116 |
-
);
|
| 117 |
-
$lp_page_array = array("edit-landing-page",
|
| 118 |
-
"landing-page_page_lp_global_settings",
|
| 119 |
-
"landing-page",
|
| 120 |
-
"landing-page_page_lp_manage_templates",
|
| 121 |
-
"edit-landing_page_category"
|
| 122 |
-
);
|
| 123 |
-
$leads_page_array = array("wp-lead",
|
| 124 |
-
"edit-wp-lead",
|
| 125 |
-
"edit-list",
|
| 126 |
-
"wp-lead_page_wpleads_global_settings",
|
| 127 |
-
);
|
| 128 |
-
$cta_page_array = array(
|
| 129 |
-
"edit-wp-call-to-action",
|
| 130 |
-
"wp-call-to-action",
|
| 131 |
-
"edit-wp_call_to_action_category",
|
| 132 |
-
"wp-call-to-action_page_wp_cta_manage_templates",
|
| 133 |
-
"wp-call-to-action_page_wp_cta_global_settings"
|
| 134 |
-
);
|
| 135 |
-
if (!in_array($screen->id, $show_array))
|
| 136 |
-
return; // exit if not an inbound now plugin screen
|
| 137 |
-
if ( defined( 'WPL_URL' )) {
|
| 138 |
-
$final_path = WPL_URL . "/";
|
| 139 |
-
} else if (defined( 'LANDINGPAGES_URLPATH' )){
|
| 140 |
-
$final_path = LANDINGPAGES_URLPATH;
|
| 141 |
-
} else if (defined( 'WP_CTA_URLPATH' )){
|
| 142 |
-
$final_path = WP_CTA_URLPATH;
|
| 143 |
-
} else {
|
| 144 |
-
$final_path = preg_replace("/\/shared\/inbound-shortcodes\//", "/", INBOUND_FORMS);
|
| 145 |
-
}
|
| 146 |
-
$plugin_name = "Inbound Now Marketing Plugins"; // default
|
| 147 |
-
if (in_array($screen->id, $lp_page_array)) {
|
| 148 |
-
$plugin_name = "Landing Pages plugin";
|
| 149 |
-
} else if (in_array($screen->id, $cta_page_array)) {
|
| 150 |
-
$plugin_name = "Calls to Action plugin";
|
| 151 |
-
} else if (in_array($screen->id, $leads_page_array)) {
|
| 152 |
-
$plugin_name = "Leads Pages plugin";
|
| 153 |
-
}
|
| 154 |
-
|
| 155 |
-
?>
|
| 156 |
-
<div id="launch-feedback" style='z-index:9999999999999; background:gray; position:fixed; bottom:0px; right:20px; width:200px; height:30px;'>
|
| 157 |
-
<div id="inbound-fb-request">
|
| 158 |
-
<div class="inbound-close-fb">close</div>
|
| 159 |
-
<div id="lp-slide-toggle">
|
| 160 |
-
<header id="header" class='inbound-customhead'>
|
| 161 |
-
<img src="<?php echo $final_path . 'shared/images/inbound-now-logo.png';?>" width="315px">
|
| 162 |
-
<h3 class="main-feedback-header" >We love hearing from You!</h3>
|
| 163 |
-
<h4>Please leave your <strong>idea/feature request</strong> to make the <?php echo $plugin_name;?> better below!</h4>
|
| 164 |
-
</header>
|
| 165 |
-
<section id="inbound-rules-main">
|
| 166 |
-
<form accept-charset="UTF-8" method="POST" id="inbound-feedback">
|
| 167 |
-
<div class="hs_message field hs-form-field">
|
| 168 |
-
<label placeholder="Enter your Feature Request" for="message-4c6efedd-40b4-438e-bb4c-050a1944c974">Feature Request<span class="hs-form-required"> * </span>
|
| 169 |
-
</label>
|
| 170 |
-
<div class="input">
|
| 171 |
-
<textarea required="required" id="inbound-feedback-message" name="message" value=""></textarea>
|
| 172 |
-
</div>
|
| 173 |
-
<div class="input">
|
| 174 |
-
<input id="inbound-feedback-email-field" name="email" value="" placeholder="Your Email (optional field)"></textarea>
|
| 175 |
-
</div>
|
| 176 |
-
</div>
|
| 177 |
-
|
| 178 |
-
<div class="inbound-feedback-actions">
|
| 179 |
-
<input class="submit-inbound-feedback" type="submit" value="Send Feedback/Feature Request">
|
| 180 |
-
</div>
|
| 181 |
-
<div class="inbound-feedback-desc" style="display: block;"><strong>Please note:</strong> Support requests will not be handled through this form</div>
|
| 182 |
-
</form>
|
| 183 |
-
</section>
|
| 184 |
-
</div>
|
| 185 |
-
<div id="inbound-
|
| 186 |
-
</div>
|
| 187 |
-
<style type="text/css">
|
| 188 |
-
#wpfooter {
|
| 189 |
-
display: none;
|
| 190 |
-
}
|
| 191 |
-
.main-feedback-header {
|
| 192 |
-
font-size: 21px;
|
| 193 |
-
padding-top: 0px;
|
| 194 |
-
margin-top: 14px;
|
| 195 |
-
margin-bottom: 10px;
|
| 196 |
-
padding-bottom: 0px;
|
| 197 |
-
}
|
| 198 |
-
.inbound-close-fb {
|
| 199 |
-
font-size: 10px;
|
| 200 |
-
position: absolute;
|
| 201 |
-
right: 5px;
|
| 202 |
-
top: -17px;
|
| 203 |
-
cursor: pointer;
|
| 204 |
-
}
|
| 205 |
-
.inbound-customhead {
|
| 206 |
-
text-align: center;
|
| 207 |
-
}
|
| 208 |
-
#inbound-fb-request {
|
| 209 |
-
background: #fff;
|
| 210 |
-
background: rgba(255, 255, 255, 1);
|
| 211 |
-
margin: 0px;
|
| 212 |
-
padding: 10px;
|
| 213 |
-
margin-bottom: -1px;
|
| 214 |
-
border: 1px solid #ccc;
|
| 215 |
-
position: relative;
|
| 216 |
-
border-top-left-radius: 2px;
|
| 217 |
-
border-top-right-radius: 2px;
|
| 218 |
-
box-shadow: 0 2px 6px 0 rgba(0, 0, 0, 0.2), 0 25px 50px 0 rgba(0, 0, 0, 0.15);
|
| 219 |
-
}
|
| 220 |
-
#inbound-feedback h1 {
|
| 221 |
-
font-size: 20px;
|
| 222 |
-
color: green;
|
| 223 |
-
}
|
| 224 |
-
#inbound-feedback h3 {
|
| 225 |
-
font-size: 13px;
|
| 226 |
-
padding-bottom: 15px;
|
| 227 |
-
}
|
| 228 |
-
#inbound-fb-request h4{
|
| 229 |
-
padding-right: 5px;
|
| 230 |
-
text-align: left;
|
| 231 |
-
font-weight: 300;
|
| 232 |
-
font-size: 16px;
|
| 233 |
-
line-height: 22px;
|
| 234 |
-
margin-top: 13px;
|
| 235 |
-
margin-bottom: 7px;
|
| 236 |
-
}
|
| 237 |
-
.inbound-feedback-actions {
|
| 238 |
-
text-align: center;
|
| 239 |
-
margin-top: 10px;
|
| 240 |
-
margin-bottom: 5px;
|
| 241 |
-
}
|
| 242 |
-
.inbound-feedback-desc {
|
| 243 |
-
color:#000;
|
| 244 |
-
font-weight: 300;
|
| 245 |
-
padding-bottom: 5px;
|
| 246 |
-
padding-top: 5px;
|
| 247 |
-
}
|
| 248 |
-
#inbound-fb-request {
|
| 249 |
-
position: fixed !important;
|
| 250 |
-
right: 10px;
|
| 251 |
-
bottom: 0px;
|
| 252 |
-
width: 330px;
|
| 253 |
-
}
|
| 254 |
-
#lp-slide-toggle {
|
| 255 |
-
margin-bottom: 30px;
|
| 256 |
-
}
|
| 257 |
-
#lp-slide-toggle {
|
| 258 |
-
display: none;
|
| 259 |
-
}
|
| 260 |
-
#inbound-
|
| 261 |
-
color: #777;
|
| 262 |
-
font-size: 20px;
|
| 263 |
-
padding: 0 15px !important;
|
| 264 |
-
cursor: pointer;
|
| 265 |
-
padding-bottom: 0px !important;
|
| 266 |
-
padding-top: 11px !important;
|
| 267 |
-
position: absolute !important;
|
| 268 |
-
right: 0 !important;
|
| 269 |
-
bottom: 0px !important;
|
| 270 |
-
left: 0 !important;
|
| 271 |
-
background: #E9E9E9 !important;
|
| 272 |
-
height: 26px !important;
|
| 273 |
-
z-index: 8 !important;
|
| 274 |
-
text-align: center;
|
| 275 |
-
box-shadow: 0 1px 1px rgba(0, 0, 0, 0.3);
|
| 276 |
-
}
|
| 277 |
-
.submit-inbound-feedback {
|
| 278 |
-
position: relative;
|
| 279 |
-
display: block;
|
| 280 |
-
line-height: 40px;
|
| 281 |
-
font-size: 18px;
|
| 282 |
-
font-weight: 500;
|
| 283 |
-
color: white;
|
| 284 |
-
cursor: pointer;
|
| 285 |
-
text-align: center;
|
| 286 |
-
text-decoration: none;
|
| 287 |
-
text-shadow: 0 1px rgba(0, 0, 0, 0.1);
|
| 288 |
-
background: #fd935c;
|
| 289 |
-
border-bottom: 2px solid #cf7e3b;
|
| 290 |
-
border-color: rgba(0, 0, 0, 0.15);
|
| 291 |
-
border-radius: 4px;
|
| 292 |
-
width: 95%;
|
| 293 |
-
margin: auto;
|
| 294 |
-
}
|
| 295 |
-
#lp-slide-toggle textarea, #inbound-feedback-email-field {
|
| 296 |
-
width: 100%;
|
| 297 |
-
|
| 298 |
-
padding: 6px 12px;
|
| 299 |
-
font-size: 14px;
|
| 300 |
-
line-height: 1.428571429;
|
| 301 |
-
color: #555;
|
| 302 |
-
vertical-align: middle;
|
| 303 |
-
background-color: #fff;
|
| 304 |
-
background-image: none;
|
| 305 |
-
border: 1px solid #ccc;
|
| 306 |
-
border-radius: 4px;
|
| 307 |
-
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.075);
|
| 308 |
-
box-shadow: inset 0 1px 1px rgba(0,0,0,0.075);
|
| 309 |
-
-webkit-transition: border-color ease-in-out .15s,box-shadow ease-in-out .15s;
|
| 310 |
-
transition: border-color ease-in-out .15s,box-shadow ease-in-out .15s;
|
| 311 |
-
|
| 312 |
-
}
|
| 313 |
-
#inbound-feedback-email-field {
|
| 314 |
-
margin-top: 5px;
|
| 315 |
-
}
|
| 316 |
-
#lp-slide-toggle textarea {
|
| 317 |
-
min-height: 125px;
|
| 318 |
-
}
|
| 319 |
-
|
| 320 |
-
#lp-slide-toggle textarea:focus, #inbound-feedback-email-field:focus {
|
| 321 |
-
border-color: #66afe9;
|
| 322 |
-
outline: 0;
|
| 323 |
-
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(102,175,233,0.6);
|
| 324 |
-
box-shadow: inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(102,175,233,0.6);}
|
| 325 |
-
|
| 326 |
-
<script type="text/javascript">
|
| 327 |
-
jQuery(document).ready(function($) {
|
| 328 |
-
jQuery("body").on('click', '#inbound-
|
| 329 |
-
|
| 330 |
-
jQuery("#lp-slide-toggle").slideToggle();
|
| 331 |
-
jQuery("#lp-open-close").toggleClass("lp-options-up");
|
| 332 |
-
|
| 333 |
-
jQuery("#footer").toggleClass("lp-options-on");
|
| 334 |
-
});
|
| 335 |
-
jQuery("body").on('click', '.inbound-close-fb', function () {
|
| 336 |
-
jQuery("#lp-slide-toggle").slideToggle();
|
| 337 |
-
});
|
| 338 |
-
jQuery("body").on('submit', '#inbound-feedback', function (e) {
|
| 339 |
-
e.preventDefault(); // halt normal form
|
| 340 |
-
var feedback = jQuery('#inbound-feedback-message').val();
|
| 341 |
-
var email = jQuery('#inbound-feedback-email-field').val();
|
| 342 |
-
if (typeof (feedback) != "undefined" && feedback != null && feedback != "") {
|
| 343 |
-
jQuery.ajax({
|
| 344 |
-
type: 'POST',
|
| 345 |
-
url: ajaxurl,
|
| 346 |
-
timeout: 10000,
|
| 347 |
-
data: {
|
| 348 |
-
feedback : feedback,
|
| 349 |
-
email: email,
|
| 350 |
-
page: document.title,
|
| 351 |
-
plugin: "<?php echo $plugin_name;?>",
|
| 352 |
-
action: 'send_inbound_feedback'
|
| 353 |
-
},
|
| 354 |
-
success: function(user_id){
|
| 355 |
-
console.log('feedback sent');
|
| 356 |
-
$(".inbound-customhead").hide();
|
| 357 |
-
$("#inbound-feedback").html('<h1>Thank You for your feedback!</h1><h3>Our team is hard at work to improve things for you!</h3>');
|
| 358 |
-
},
|
| 359 |
-
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 360 |
-
//alert(MLHttpRequest+' '+errorThrown+' '+textStatus); // debug
|
| 361 |
-
|
| 362 |
-
}
|
| 363 |
-
});
|
| 364 |
-
} else {
|
| 365 |
-
$("#lp-slide-toggle textarea").css('border', 'red');
|
| 366 |
-
}
|
| 367 |
-
});
|
| 368 |
-
});
|
| 369 |
-
|
| 370 |
-
</script>
|
| 371 |
-
|
| 372 |
-
<?php }
|
| 373 |
-
|
| 374 |
-
}
|
| 375 |
-
}
|
| 376 |
-
/* Initialize InboundNow Menu
|
| 377 |
-
* --------------------------------------------------------- */
|
| 378 |
-
|
| 379 |
-
InboundFeedback::init();
|
| 380 |
-
|
| 381 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
/* Inbound Now Menu Class */
|
| 3 |
+
|
| 4 |
+
if (!class_exists('InboundFeedback')) {
|
| 5 |
+
class InboundFeedback {
|
| 6 |
+
static $add_feedback;
|
| 7 |
+
|
| 8 |
+
/* Contruct
|
| 9 |
+
* --------------------------------------------------------- */
|
| 10 |
+
static function init() {
|
| 11 |
+
self::$add_feedback = true;
|
| 12 |
+
// add_action('admin_bar_menu', array( __CLASS__, 'loads' ), 98);
|
| 13 |
+
//add_action( 'wp_head', array(__CLASS__, 'menu_admin_head'));
|
| 14 |
+
add_action( 'admin_footer', array(__CLASS__, 'show_feedback'));
|
| 15 |
+
add_action('wp_ajax_send_inbound_feedback', array(__CLASS__, 'send_inbound_feedback'));
|
| 16 |
+
add_action('wp_ajax_send_inbound_feedback', array(__CLASS__, 'send_inbound_feedback'));
|
| 17 |
+
}
|
| 18 |
+
|
| 19 |
+
/* Loads
|
| 20 |
+
* --------------------------------------------------------- */
|
| 21 |
+
static function loads($hook) {
|
| 22 |
+
if ( ! self::$add_feedback )
|
| 23 |
+
return;
|
| 24 |
+
global $wp_admin_bar;
|
| 25 |
+
// CHECK FOR ACTIVE PLUGINS
|
| 26 |
+
$leads_status = FALSE; $landing_page_status = FALSE; $cta_status = FALSE;
|
| 27 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('leads/wordpress-leads.php')) {
|
| 28 |
+
$leads_status = TRUE;
|
| 29 |
+
$leads_version_number = defined( 'WPL_CURRENT_VERSION' ) ? 'v' . WPL_CURRENT_VERSION : '';
|
| 30 |
+
}
|
| 31 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('landing-pages/landing-pages.php')) {
|
| 32 |
+
$landing_page_status = TRUE;
|
| 33 |
+
$landing_page_version_number = defined( 'LANDINGPAGES_CURRENT_VERSION' ) ? 'v' . LANDINGPAGES_CURRENT_VERSION : '';
|
| 34 |
+
|
| 35 |
+
}
|
| 36 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('cta/wordpress-cta.php')) {
|
| 37 |
+
$cta_status = TRUE;
|
| 38 |
+
$cta_number = defined( 'WP_CTA_CURRENT_VERSION' ) ? 'v' . WP_CTA_CURRENT_VERSION : '';
|
| 39 |
+
}
|
| 40 |
+
|
| 41 |
+
if ( $leads_status == FALSE && $landing_page_status == FALSE && $cta_status == FALSE ) {
|
| 42 |
+
|
| 43 |
+
return; // end plugin is
|
| 44 |
+
|
| 45 |
+
}
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
// Exit if admin bar not there
|
| 49 |
+
if ( ! is_user_logged_in() || ! is_admin_bar_showing() ) {
|
| 50 |
+
return;
|
| 51 |
+
}
|
| 52 |
+
|
| 53 |
+
/** Show these items only if Inbound Now plugin is actually installed */
|
| 54 |
+
if ( $leads_status == TRUE || $landing_page_status == TRUE || $cta_status == TRUE ) {
|
| 55 |
+
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
+
}
|
| 59 |
+
static function send_inbound_feedback(){
|
| 60 |
+
// process feedback
|
| 61 |
+
if (isset($_POST['feedback'])) {
|
| 62 |
+
$firstname= 'anonymous';
|
| 63 |
+
$lastname= 'anonymous';
|
| 64 |
+
$email = (isset($_POST['email'])) ? $_POST['email'] : 'anonymous';
|
| 65 |
+
$feedback= $_POST['feedback'];
|
| 66 |
+
$page = $_POST['page'];
|
| 67 |
+
$plugin = (isset($_POST['plugin'])) ? $_POST['plugin'] : 'na';
|
| 68 |
+
|
| 69 |
+
$context = array(
|
| 70 |
+
'hutk' => 'anonymous',
|
| 71 |
+
'ipAddress' => 'anonymous',
|
| 72 |
+
'pageUrl' => 'anonymous',
|
| 73 |
+
'pageTitle' => $page
|
| 74 |
+
);
|
| 75 |
+
$context_json = json_encode($context);
|
| 76 |
+
//Need to populate these varilables with values from the form.
|
| 77 |
+
$str_post2 = "message=" . urlencode($feedback)
|
| 78 |
+
. "&email=" . urlencode($email)
|
| 79 |
+
. "&plugin=" . urlencode($plugin)
|
| 80 |
+
. "&page=" . urlencode($page)
|
| 81 |
+
. "&hs_context=" . urlencode($context_json);
|
| 82 |
+
$endpoint2 = 'https://forms.hubspot.com/uploads/form/v2/24784/4c6efedd-40b4-438e-bb4c-050a1944c974';
|
| 83 |
+
|
| 84 |
+
$ch2 = @curl_init();
|
| 85 |
+
@curl_setopt($ch2, CURLOPT_POST, true);
|
| 86 |
+
@curl_setopt($ch2, CURLOPT_POSTFIELDS, $str_post2);
|
| 87 |
+
@curl_setopt($ch2, CURLOPT_URL, $endpoint2);
|
| 88 |
+
@curl_setopt($ch2, CURLOPT_HTTPHEADER, array('application/x-www-form-urlencoded'));
|
| 89 |
+
@curl_setopt($ch, CURLOPT_RETURNTRANSFER, true);
|
| 90 |
+
$response2 = @curl_exec($ch2); //Log the response from HubSpot as needed.
|
| 91 |
+
@curl_close($ch2);
|
| 92 |
+
echo $response2;
|
| 93 |
+
|
| 94 |
+
}
|
| 95 |
+
}
|
| 96 |
+
static function show_feedback() {
|
| 97 |
+
if ( ! self::$add_feedback || ! is_admin())
|
| 98 |
+
return;
|
| 99 |
+
$screen = get_current_screen();
|
| 100 |
+
|
| 101 |
+
$show_array = array("edit-landing-page",
|
| 102 |
+
"landing-page_page_lp_global_settings",
|
| 103 |
+
"landing-page",
|
| 104 |
+
"landing-page_page_lp_manage_templates",
|
| 105 |
+
"edit-landing_page_category",
|
| 106 |
+
"edit-inbound-forms",
|
| 107 |
+
"wp-lead",
|
| 108 |
+
"edit-wp-lead",
|
| 109 |
+
"edit-list",
|
| 110 |
+
"wp-lead_page_wpleads_global_settings",
|
| 111 |
+
"edit-wp-call-to-action",
|
| 112 |
+
"wp-call-to-action",
|
| 113 |
+
"edit-wp_call_to_action_category",
|
| 114 |
+
"wp-call-to-action_page_wp_cta_manage_templates",
|
| 115 |
+
"wp-call-to-action_page_wp_cta_global_settings"
|
| 116 |
+
);
|
| 117 |
+
$lp_page_array = array("edit-landing-page",
|
| 118 |
+
"landing-page_page_lp_global_settings",
|
| 119 |
+
"landing-page",
|
| 120 |
+
"landing-page_page_lp_manage_templates",
|
| 121 |
+
"edit-landing_page_category"
|
| 122 |
+
);
|
| 123 |
+
$leads_page_array = array("wp-lead",
|
| 124 |
+
"edit-wp-lead",
|
| 125 |
+
"edit-list",
|
| 126 |
+
"wp-lead_page_wpleads_global_settings",
|
| 127 |
+
);
|
| 128 |
+
$cta_page_array = array(
|
| 129 |
+
"edit-wp-call-to-action",
|
| 130 |
+
"wp-call-to-action",
|
| 131 |
+
"edit-wp_call_to_action_category",
|
| 132 |
+
"wp-call-to-action_page_wp_cta_manage_templates",
|
| 133 |
+
"wp-call-to-action_page_wp_cta_global_settings"
|
| 134 |
+
);
|
| 135 |
+
if (!in_array($screen->id, $show_array))
|
| 136 |
+
return; // exit if not an inbound now plugin screen
|
| 137 |
+
if ( defined( 'WPL_URL' )) {
|
| 138 |
+
$final_path = WPL_URL . "/";
|
| 139 |
+
} else if (defined( 'LANDINGPAGES_URLPATH' )){
|
| 140 |
+
$final_path = LANDINGPAGES_URLPATH;
|
| 141 |
+
} else if (defined( 'WP_CTA_URLPATH' )){
|
| 142 |
+
$final_path = WP_CTA_URLPATH;
|
| 143 |
+
} else {
|
| 144 |
+
$final_path = preg_replace("/\/shared\/inbound-shortcodes\//", "/", INBOUND_FORMS);
|
| 145 |
+
}
|
| 146 |
+
$plugin_name = "Inbound Now Marketing Plugins"; // default
|
| 147 |
+
if (in_array($screen->id, $lp_page_array)) {
|
| 148 |
+
$plugin_name = "Landing Pages plugin";
|
| 149 |
+
} else if (in_array($screen->id, $cta_page_array)) {
|
| 150 |
+
$plugin_name = "Calls to Action plugin";
|
| 151 |
+
} else if (in_array($screen->id, $leads_page_array)) {
|
| 152 |
+
$plugin_name = "Leads Pages plugin";
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
?>
|
| 156 |
+
<div id="launch-feedback" style='z-index:9999999999999; background:gray; position:fixed; bottom:0px; right:20px; width:200px; height:30px;'>
|
| 157 |
+
<div id="inbound-fb-request">
|
| 158 |
+
<div class="inbound-close-fb">close</div>
|
| 159 |
+
<div id="lp-slide-toggle">
|
| 160 |
+
<header id="header" class='inbound-customhead'>
|
| 161 |
+
<img src="<?php echo $final_path . 'shared/assets/admin/images/inbound-now-logo.png';?>" width="315px">
|
| 162 |
+
<h3 class="main-feedback-header" >We love hearing from You!</h3>
|
| 163 |
+
<h4>Please leave your <strong>idea/feature request</strong> to make the <?php echo $plugin_name;?> better below!</h4>
|
| 164 |
+
</header>
|
| 165 |
+
<section id="inbound-rules-main">
|
| 166 |
+
<form accept-charset="UTF-8" method="POST" id="inbound-feedback">
|
| 167 |
+
<div class="hs_message field hs-form-field">
|
| 168 |
+
<label placeholder="Enter your Feature Request" for="message-4c6efedd-40b4-438e-bb4c-050a1944c974">Feature Request<span class="hs-form-required"> * </span>
|
| 169 |
+
</label>
|
| 170 |
+
<div class="input">
|
| 171 |
+
<textarea required="required" id="inbound-feedback-message" name="message" value=""></textarea>
|
| 172 |
+
</div>
|
| 173 |
+
<div class="input">
|
| 174 |
+
<input id="inbound-feedback-email-field" name="email" value="" placeholder="Your Email (optional field)"></textarea>
|
| 175 |
+
</div>
|
| 176 |
+
</div>
|
| 177 |
+
|
| 178 |
+
<div class="inbound-feedback-actions">
|
| 179 |
+
<input class="submit-inbound-feedback" type="submit" value="Send Feedback/Feature Request">
|
| 180 |
+
</div>
|
| 181 |
+
<div class="inbound-feedback-desc" style="display: block;"><strong>Please note:</strong> Support requests will not be handled through this form</div>
|
| 182 |
+
</form>
|
| 183 |
+
</section>
|
| 184 |
+
</div>
|
| 185 |
+
<div id="inbound-automation-footer" class="inbound-selectron-foot"><?php //echo $screen->id;?>Submit a Feature Request</div>
|
| 186 |
+
</div>
|
| 187 |
+
<style type="text/css">
|
| 188 |
+
#wpfooter {
|
| 189 |
+
display: none;
|
| 190 |
+
}
|
| 191 |
+
.main-feedback-header {
|
| 192 |
+
font-size: 21px;
|
| 193 |
+
padding-top: 0px;
|
| 194 |
+
margin-top: 14px;
|
| 195 |
+
margin-bottom: 10px;
|
| 196 |
+
padding-bottom: 0px;
|
| 197 |
+
}
|
| 198 |
+
.inbound-close-fb {
|
| 199 |
+
font-size: 10px;
|
| 200 |
+
position: absolute;
|
| 201 |
+
right: 5px;
|
| 202 |
+
top: -17px;
|
| 203 |
+
cursor: pointer;
|
| 204 |
+
}
|
| 205 |
+
.inbound-customhead {
|
| 206 |
+
text-align: center;
|
| 207 |
+
}
|
| 208 |
+
#inbound-fb-request {
|
| 209 |
+
background: #fff;
|
| 210 |
+
background: rgba(255, 255, 255, 1);
|
| 211 |
+
margin: 0px;
|
| 212 |
+
padding: 10px;
|
| 213 |
+
margin-bottom: -1px;
|
| 214 |
+
border: 1px solid #ccc;
|
| 215 |
+
position: relative;
|
| 216 |
+
border-top-left-radius: 2px;
|
| 217 |
+
border-top-right-radius: 2px;
|
| 218 |
+
box-shadow: 0 2px 6px 0 rgba(0, 0, 0, 0.2), 0 25px 50px 0 rgba(0, 0, 0, 0.15);
|
| 219 |
+
}
|
| 220 |
+
#inbound-feedback h1 {
|
| 221 |
+
font-size: 20px;
|
| 222 |
+
color: green;
|
| 223 |
+
}
|
| 224 |
+
#inbound-feedback h3 {
|
| 225 |
+
font-size: 13px;
|
| 226 |
+
padding-bottom: 15px;
|
| 227 |
+
}
|
| 228 |
+
#inbound-fb-request h4{
|
| 229 |
+
padding-right: 5px;
|
| 230 |
+
text-align: left;
|
| 231 |
+
font-weight: 300;
|
| 232 |
+
font-size: 16px;
|
| 233 |
+
line-height: 22px;
|
| 234 |
+
margin-top: 13px;
|
| 235 |
+
margin-bottom: 7px;
|
| 236 |
+
}
|
| 237 |
+
.inbound-feedback-actions {
|
| 238 |
+
text-align: center;
|
| 239 |
+
margin-top: 10px;
|
| 240 |
+
margin-bottom: 5px;
|
| 241 |
+
}
|
| 242 |
+
.inbound-feedback-desc {
|
| 243 |
+
color:#000;
|
| 244 |
+
font-weight: 300;
|
| 245 |
+
padding-bottom: 5px;
|
| 246 |
+
padding-top: 5px;
|
| 247 |
+
}
|
| 248 |
+
#inbound-fb-request {
|
| 249 |
+
position: fixed !important;
|
| 250 |
+
right: 10px;
|
| 251 |
+
bottom: 0px;
|
| 252 |
+
width: 330px;
|
| 253 |
+
}
|
| 254 |
+
#lp-slide-toggle {
|
| 255 |
+
margin-bottom: 30px;
|
| 256 |
+
}
|
| 257 |
+
#lp-slide-toggle {
|
| 258 |
+
display: none;
|
| 259 |
+
}
|
| 260 |
+
#inbound-automation-footer.inbound-selectron-foot {
|
| 261 |
+
color: #777;
|
| 262 |
+
font-size: 20px;
|
| 263 |
+
padding: 0 15px !important;
|
| 264 |
+
cursor: pointer;
|
| 265 |
+
padding-bottom: 0px !important;
|
| 266 |
+
padding-top: 11px !important;
|
| 267 |
+
position: absolute !important;
|
| 268 |
+
right: 0 !important;
|
| 269 |
+
bottom: 0px !important;
|
| 270 |
+
left: 0 !important;
|
| 271 |
+
background: #E9E9E9 !important;
|
| 272 |
+
height: 26px !important;
|
| 273 |
+
z-index: 8 !important;
|
| 274 |
+
text-align: center;
|
| 275 |
+
box-shadow: 0 1px 1px rgba(0, 0, 0, 0.3);
|
| 276 |
+
}
|
| 277 |
+
.submit-inbound-feedback {
|
| 278 |
+
position: relative;
|
| 279 |
+
display: block;
|
| 280 |
+
line-height: 40px;
|
| 281 |
+
font-size: 18px;
|
| 282 |
+
font-weight: 500;
|
| 283 |
+
color: white;
|
| 284 |
+
cursor: pointer;
|
| 285 |
+
text-align: center;
|
| 286 |
+
text-decoration: none;
|
| 287 |
+
text-shadow: 0 1px rgba(0, 0, 0, 0.1);
|
| 288 |
+
background: #fd935c;
|
| 289 |
+
border-bottom: 2px solid #cf7e3b;
|
| 290 |
+
border-color: rgba(0, 0, 0, 0.15);
|
| 291 |
+
border-radius: 4px;
|
| 292 |
+
width: 95%;
|
| 293 |
+
margin: auto;
|
| 294 |
+
}
|
| 295 |
+
#lp-slide-toggle textarea, #inbound-feedback-email-field {
|
| 296 |
+
width: 100%;
|
| 297 |
+
|
| 298 |
+
padding: 6px 12px;
|
| 299 |
+
font-size: 14px;
|
| 300 |
+
line-height: 1.428571429;
|
| 301 |
+
color: #555;
|
| 302 |
+
vertical-align: middle;
|
| 303 |
+
background-color: #fff;
|
| 304 |
+
background-image: none;
|
| 305 |
+
border: 1px solid #ccc;
|
| 306 |
+
border-radius: 4px;
|
| 307 |
+
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.075);
|
| 308 |
+
box-shadow: inset 0 1px 1px rgba(0,0,0,0.075);
|
| 309 |
+
-webkit-transition: border-color ease-in-out .15s,box-shadow ease-in-out .15s;
|
| 310 |
+
transition: border-color ease-in-out .15s,box-shadow ease-in-out .15s;
|
| 311 |
+
|
| 312 |
+
}
|
| 313 |
+
#inbound-feedback-email-field {
|
| 314 |
+
margin-top: 5px;
|
| 315 |
+
}
|
| 316 |
+
#lp-slide-toggle textarea {
|
| 317 |
+
min-height: 125px;
|
| 318 |
+
}
|
| 319 |
+
|
| 320 |
+
#lp-slide-toggle textarea:focus, #inbound-feedback-email-field:focus {
|
| 321 |
+
border-color: #66afe9;
|
| 322 |
+
outline: 0;
|
| 323 |
+
-webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(102,175,233,0.6);
|
| 324 |
+
box-shadow: inset 0 1px 1px rgba(0,0,0,0.075),0 0 8px rgba(102,175,233,0.6);}
|
| 325 |
+
</style>
|
| 326 |
+
<script type="text/javascript">
|
| 327 |
+
jQuery(document).ready(function($) {
|
| 328 |
+
jQuery("body").on('click', '#inbound-automation-footer', function () {
|
| 329 |
+
|
| 330 |
+
jQuery("#lp-slide-toggle").slideToggle();
|
| 331 |
+
jQuery("#lp-open-close").toggleClass("lp-options-up");
|
| 332 |
+
|
| 333 |
+
jQuery("#footer").toggleClass("lp-options-on");
|
| 334 |
+
});
|
| 335 |
+
jQuery("body").on('click', '.inbound-close-fb', function () {
|
| 336 |
+
jQuery("#lp-slide-toggle").slideToggle();
|
| 337 |
+
});
|
| 338 |
+
jQuery("body").on('submit', '#inbound-feedback', function (e) {
|
| 339 |
+
e.preventDefault(); // halt normal form
|
| 340 |
+
var feedback = jQuery('#inbound-feedback-message').val();
|
| 341 |
+
var email = jQuery('#inbound-feedback-email-field').val();
|
| 342 |
+
if (typeof (feedback) != "undefined" && feedback != null && feedback != "") {
|
| 343 |
+
jQuery.ajax({
|
| 344 |
+
type: 'POST',
|
| 345 |
+
url: ajaxurl,
|
| 346 |
+
timeout: 10000,
|
| 347 |
+
data: {
|
| 348 |
+
feedback : feedback,
|
| 349 |
+
email: email,
|
| 350 |
+
page: document.title,
|
| 351 |
+
plugin: "<?php echo $plugin_name;?>",
|
| 352 |
+
action: 'send_inbound_feedback'
|
| 353 |
+
},
|
| 354 |
+
success: function(user_id){
|
| 355 |
+
console.log('feedback sent');
|
| 356 |
+
$(".inbound-customhead").hide();
|
| 357 |
+
$("#inbound-feedback").html('<h1>Thank You for your feedback!</h1><h3>Our team is hard at work to improve things for you!</h3>');
|
| 358 |
+
},
|
| 359 |
+
error: function(MLHttpRequest, textStatus, errorThrown){
|
| 360 |
+
//alert(MLHttpRequest+' '+errorThrown+' '+textStatus); // debug
|
| 361 |
+
|
| 362 |
+
}
|
| 363 |
+
});
|
| 364 |
+
} else {
|
| 365 |
+
$("#lp-slide-toggle textarea").css('border', 'red');
|
| 366 |
+
}
|
| 367 |
+
});
|
| 368 |
+
});
|
| 369 |
+
|
| 370 |
+
</script>
|
| 371 |
+
|
| 372 |
+
<?php }
|
| 373 |
+
|
| 374 |
+
}
|
| 375 |
+
}
|
| 376 |
+
/* Initialize InboundNow Menu
|
| 377 |
+
* --------------------------------------------------------- */
|
| 378 |
+
|
| 379 |
+
InboundFeedback::init();
|
| 380 |
+
|
| 381 |
?>
|
shared/classes/form.class.php
CHANGED
|
@@ -39,6 +39,7 @@ class InboundForms {
|
|
| 39 |
'width' => '',
|
| 40 |
'redirect' => '',
|
| 41 |
'icon' => '',
|
|
|
|
| 42 |
'submit' => 'Submit'
|
| 43 |
), $atts));
|
| 44 |
|
|
@@ -47,6 +48,7 @@ class InboundForms {
|
|
| 47 |
|
| 48 |
|
| 49 |
$form_name = $name;
|
|
|
|
| 50 |
$form_layout = $layout;
|
| 51 |
$form_labels = $labels;
|
| 52 |
$form_labels_class = (isset($form_labels)) ? "inbound-label-".$form_labels : 'inbound-label-inline';
|
|
@@ -231,8 +233,12 @@ class InboundForms {
|
|
| 231 |
else
|
| 232 |
{
|
| 233 |
$hidden_param = (isset($matches[3][$i]['dynamic'])) ? $matches[3][$i]['dynamic'] : '';
|
|
|
|
| 234 |
$dynamic_value = (isset($_GET[$hidden_param])) ? $_GET[$hidden_param] : '';
|
| 235 |
-
|
|
|
|
|
|
|
|
|
|
| 236 |
}
|
| 237 |
if ($type != 'hidden' && $form_labels === "bottom" && $type != "radio" && $type != "html-block" && $type != "divider")
|
| 238 |
{
|
|
@@ -251,11 +257,8 @@ class InboundForms {
|
|
| 251 |
$form .= '<div class="inbound-field '.$main_layout.' inbound-submit-area"><button type="submit" class="inbound-button-submit inbound-submit-action" value="'.$submit_button.'" name="send" id="inbound_form_submit" style="'.$font_size.'">
|
| 252 |
'.$icon_insert.''.$submit_button.'</button></div><input type="hidden" name="inbound_submitted" value="1">';
|
| 253 |
// <!--<input type="submit" '.$submit_button_type.' class="button" value="'.$submit_button.'" name="send" id="inbound_form_submit" />-->
|
| 254 |
-
if( $redirect != ""){
|
| 255 |
-
$form .= '<input type="hidden" id="inbound_redirect" name="inbound_redirect" value="'.$redirect.'">';
|
| 256 |
-
}
|
| 257 |
|
| 258 |
-
$form .= '<input type="hidden" name="inbound_form_name" value="'.$form_name.'"><input type="hidden" name="inbound_form_id" value="'.$id.'"><input type="hidden" name="inbound_current_page_url" value="'.$current_page.'"><input type="hidden" name="inbound_furl" value="'. base64_encode($redirect) .'"><input type="hidden" name="inbound_notify" value="'. base64_encode($notify) .'"></form></div>';
|
| 259 |
|
| 260 |
$form = preg_replace('/<br class="inbr".\/>/', '', $form); // remove editor br tags
|
| 261 |
|
|
@@ -389,6 +392,7 @@ class InboundForms {
|
|
| 389 |
// defaults
|
| 390 |
$notification_status = "off";
|
| 391 |
$email_to = false;
|
|
|
|
| 392 |
|
| 393 |
if (isset($form_meta_data['inbound_email_send_notification'][0])){
|
| 394 |
$notification_status = $form_meta_data['inbound_email_send_notification'][0];
|
|
@@ -396,10 +400,14 @@ class InboundForms {
|
|
| 396 |
|
| 397 |
if (isset($form_meta_data['inbound_notify_email'])){
|
| 398 |
$email_to = $form_meta_data['inbound_notify_email'];
|
|
|
|
|
|
|
|
|
|
|
|
|
| 399 |
}
|
| 400 |
|
| 401 |
-
|
| 402 |
-
|
| 403 |
|
| 404 |
$form_email = false;
|
| 405 |
foreach ($form_data as $key => $value) {
|
|
@@ -688,7 +696,15 @@ class InboundForms {
|
|
| 688 |
$headers = "From: " . $from_name . " <" . $form_email . ">\n";
|
| 689 |
$headers .= 'Content-type: text/html';
|
| 690 |
// send the e-mail with the shortcode attribute named 'email' and the POSTed data
|
| 691 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 692 |
// and set the result text to the shortcode attribute named 'success'
|
| 693 |
//$result = $success;
|
| 694 |
// ...and switch the $sent variable to TRUE
|
| 39 |
'width' => '',
|
| 40 |
'redirect' => '',
|
| 41 |
'icon' => '',
|
| 42 |
+
'lists' => '',
|
| 43 |
'submit' => 'Submit'
|
| 44 |
), $atts));
|
| 45 |
|
| 48 |
|
| 49 |
|
| 50 |
$form_name = $name;
|
| 51 |
+
//$form_name = strtolower(str_replace(array(' ','_', '"', "'"),'-',$form_name));
|
| 52 |
$form_layout = $layout;
|
| 53 |
$form_labels = $labels;
|
| 54 |
$form_labels_class = (isset($form_labels)) ? "inbound-label-".$form_labels : 'inbound-label-inline';
|
| 233 |
else
|
| 234 |
{
|
| 235 |
$hidden_param = (isset($matches[3][$i]['dynamic'])) ? $matches[3][$i]['dynamic'] : '';
|
| 236 |
+
$fill_value = (isset($matches[3][$i]['default'])) ? $matches[3][$i]['default'] : '';
|
| 237 |
$dynamic_value = (isset($_GET[$hidden_param])) ? $_GET[$hidden_param] : '';
|
| 238 |
+
if ($type === 'hidden' && $dynamic_value != "") {
|
| 239 |
+
$fill_value = $dynamic_value;
|
| 240 |
+
}
|
| 241 |
+
$form .= '<input class="inbound-input inbound-input-text '.$formatted_label . $input_classes.'" name="'.$field_name.'" '.$form_placeholder.' id="'.$formatted_label.'" value="'.$fill_value.'" type="'.$type.'" '.$req.'/>';
|
| 242 |
}
|
| 243 |
if ($type != 'hidden' && $form_labels === "bottom" && $type != "radio" && $type != "html-block" && $type != "divider")
|
| 244 |
{
|
| 257 |
$form .= '<div class="inbound-field '.$main_layout.' inbound-submit-area"><button type="submit" class="inbound-button-submit inbound-submit-action" value="'.$submit_button.'" name="send" id="inbound_form_submit" style="'.$font_size.'">
|
| 258 |
'.$icon_insert.''.$submit_button.'</button></div><input type="hidden" name="inbound_submitted" value="1">';
|
| 259 |
// <!--<input type="submit" '.$submit_button_type.' class="button" value="'.$submit_button.'" name="send" id="inbound_form_submit" />-->
|
|
|
|
|
|
|
|
|
|
| 260 |
|
| 261 |
+
$form .= '<input type="hidden" name="inbound_form_name" class="inbound_form_name" value="'.$form_name.'"><input type="hidden" name="inbound_form_lists" id="inbound_form_lists" value="'.$lists.'"><input type="hidden" name="inbound_form_id" value="'.$id.'"><input type="hidden" name="inbound_current_page_url" value="'.$current_page.'"><input type="hidden" name="inbound_furl" value="'. base64_encode($redirect) .'"><input type="hidden" name="inbound_notify" value="'. base64_encode($notify) .'"></form></div>';
|
| 262 |
|
| 263 |
$form = preg_replace('/<br class="inbr".\/>/', '', $form); // remove editor br tags
|
| 264 |
|
| 392 |
// defaults
|
| 393 |
$notification_status = "off";
|
| 394 |
$email_to = false;
|
| 395 |
+
$multi_send = false;
|
| 396 |
|
| 397 |
if (isset($form_meta_data['inbound_email_send_notification'][0])){
|
| 398 |
$notification_status = $form_meta_data['inbound_email_send_notification'][0];
|
| 400 |
|
| 401 |
if (isset($form_meta_data['inbound_notify_email'])){
|
| 402 |
$email_to = $form_meta_data['inbound_notify_email'];
|
| 403 |
+
$email_addresses = explode(",", $email_to[0]);
|
| 404 |
+
if(is_array($email_addresses) && count($email_addresses) > 1) {
|
| 405 |
+
$multi_send = true;
|
| 406 |
+
}
|
| 407 |
}
|
| 408 |
|
| 409 |
+
/* print_r($form_meta_data); exit; */
|
| 410 |
+
/* print_r($form_data); exit; */
|
| 411 |
|
| 412 |
$form_email = false;
|
| 413 |
foreach ($form_data as $key => $value) {
|
| 696 |
$headers = "From: " . $from_name . " <" . $form_email . ">\n";
|
| 697 |
$headers .= 'Content-type: text/html';
|
| 698 |
// send the e-mail with the shortcode attribute named 'email' and the POSTed data
|
| 699 |
+
if($multi_send) {
|
| 700 |
+
foreach ($email_addresses as $key => $recipient) {
|
| 701 |
+
wp_mail( $recipient, $email_subject, $email_message, $headers );
|
| 702 |
+
}
|
| 703 |
+
} else {
|
| 704 |
+
|
| 705 |
+
wp_mail( $to, $email_subject, $email_message, $headers );
|
| 706 |
+
}
|
| 707 |
+
|
| 708 |
// and set the result text to the shortcode attribute named 'success'
|
| 709 |
//$result = $success;
|
| 710 |
// ...and switch the $sent variable to TRUE
|
shared/classes/js/debug.js
CHANGED
|
@@ -1,37 +1,37 @@
|
|
| 1 |
-
var errors = [];
|
| 2 |
-
window.onerror = function(msg, url, linenumber) {
|
| 3 |
-
//alert('Error message: '+msg+' URL: '+url+' Line Number: '+linenumber);
|
| 4 |
-
errors.push(msg + ' from ' + url + ' on line ' +linenumber);
|
| 5 |
-
}
|
| 6 |
-
jQuery(document).ready(function($) {
|
| 7 |
-
var url = window.location.href;
|
| 8 |
-
var match = url.match(/\?inbound_js/);
|
| 9 |
-
var param = "?";
|
| 10 |
-
if(match) {
|
| 11 |
-
var param = "?";
|
| 12 |
-
}
|
| 13 |
-
var url = url.replace('?inbound_js', '');
|
| 14 |
-
var url = url.replace('&inbound_js', '') + param + "inbound-dequeue-scripts";
|
| 15 |
-
setTimeout(function() {
|
| 16 |
-
document.write("<strong>Below are the javascript errors on this page</strong> " + "<br>");
|
| 17 |
-
/*if (errors.length === 0 ) {
|
| 18 |
-
document.write("<strong style="color:green;">None Detected</strong> " + "<br>");
|
| 19 |
-
}*/
|
| 20 |
-
document.write("<div id='errors-here'>");
|
| 21 |
-
for (var i=0,len=errors.length; i<len; i++){
|
| 22 |
-
document.write(i + 1 + ". " + errors[i] + "<br>");
|
| 23 |
-
}
|
| 24 |
-
document.write("</div>");
|
| 25 |
-
document.write("<div style=\'margin-top:20px;\'><strong>You need to fix these errors for things to work. There are 3 options:</strong> " + "<br>");
|
| 26 |
-
document.write("<strong>1. <a href=\'" +url+ "\'>Click here and dequeue (turn off) the broken javascript files</a> from this page.</strong> " + "<br>");
|
| 27 |
-
document.write("<strong>2. Contact the original developer of the plugin/theme causing the error.</strong> " + "<br>");
|
| 28 |
-
document.write("<strong>3. Disable the plugin or theme causing the conflict.</strong> " + "<br></div>");
|
| 29 |
-
}, 500);
|
| 30 |
-
setTimeout(function() {
|
| 31 |
-
var theDiv = document.getElementById("errors-here");
|
| 32 |
-
if(theDiv.innerHTML.length == 0){
|
| 33 |
-
theDiv.innerHTML = "<strong style='color:green;''>No JS Errors Detected</strong> " + "<br><br>" + "Sometimes errors are not detectatble by this handy tool, to double check please <a href='http://www.youtube.com/watch?v=x19VOytW9DM'>follow these instructions</a>";
|
| 34 |
-
theDiv.style.display="inline";
|
| 35 |
-
}
|
| 36 |
-
}, 1000);
|
| 37 |
});
|
| 1 |
+
var errors = [];
|
| 2 |
+
window.onerror = function(msg, url, linenumber) {
|
| 3 |
+
//alert('Error message: '+msg+' URL: '+url+' Line Number: '+linenumber);
|
| 4 |
+
errors.push(msg + ' from ' + url + ' on line ' +linenumber);
|
| 5 |
+
}
|
| 6 |
+
jQuery(document).ready(function($) {
|
| 7 |
+
var url = window.location.href;
|
| 8 |
+
var match = url.match(/\?inbound_js/);
|
| 9 |
+
var param = "?";
|
| 10 |
+
if(match) {
|
| 11 |
+
var param = "?";
|
| 12 |
+
}
|
| 13 |
+
var url = url.replace('?inbound_js', '');
|
| 14 |
+
var url = url.replace('&inbound_js', '') + param + "inbound-dequeue-scripts";
|
| 15 |
+
setTimeout(function() {
|
| 16 |
+
document.write("<strong>Below are the javascript errors on this page</strong> " + "<br>");
|
| 17 |
+
/*if (errors.length === 0 ) {
|
| 18 |
+
document.write("<strong style="color:green;">None Detected</strong> " + "<br>");
|
| 19 |
+
}*/
|
| 20 |
+
document.write("<div id='errors-here'>");
|
| 21 |
+
for (var i=0,len=errors.length; i<len; i++){
|
| 22 |
+
document.write(i + 1 + ". " + errors[i] + "<br>");
|
| 23 |
+
}
|
| 24 |
+
document.write("</div>");
|
| 25 |
+
document.write("<div style=\'margin-top:20px;\'><strong>You need to fix these errors for things to work. There are 3 options:</strong> " + "<br>");
|
| 26 |
+
document.write("<strong>1. <a href=\'" +url+ "\'>Click here and dequeue (turn off) the broken javascript files</a> from this page.</strong> " + "<br>");
|
| 27 |
+
document.write("<strong>2. Contact the original developer of the plugin/theme causing the error.</strong> " + "<br>");
|
| 28 |
+
document.write("<strong>3. Disable the plugin or theme causing the conflict.</strong> " + "<br></div>");
|
| 29 |
+
}, 500);
|
| 30 |
+
setTimeout(function() {
|
| 31 |
+
var theDiv = document.getElementById("errors-here");
|
| 32 |
+
if(theDiv.innerHTML.length == 0){
|
| 33 |
+
theDiv.innerHTML = "<strong style='color:green;''>No JS Errors Detected</strong> " + "<br><br>" + "Sometimes errors are not detectatble by this handy tool, to double check please <a href='http://www.youtube.com/watch?v=x19VOytW9DM'>follow these instructions</a>";
|
| 34 |
+
theDiv.style.display="inline";
|
| 35 |
+
}
|
| 36 |
+
}, 1000);
|
| 37 |
});
|
shared/classes/js/inbound-dequeue-scripts.js
CHANGED
|
@@ -1,49 +1,49 @@
|
|
| 1 |
-
jQuery(document).ready(function($) {
|
| 2 |
-
jQuery("body").on('click', 'label', function () {
|
| 3 |
-
|
| 4 |
-
var status = jQuery(this).attr('class');
|
| 5 |
-
var status = status.replace('turn-', "");
|
| 6 |
-
if (status === 'off') {
|
| 7 |
-
jQuery(this).parent().find('.switch-button').addClass('status-off');
|
| 8 |
-
} else {
|
| 9 |
-
jQuery(this).parent().find('.switch-button').removeClass('status-off');
|
| 10 |
-
}
|
| 11 |
-
var the_script = jQuery(this).parent().attr('id');
|
| 12 |
-
var post_id = $('#inbound-dequeue-id').text();
|
| 13 |
-
var admin_screen = $('#inbound-fix-page').attr('data-admin-screen');
|
| 14 |
-
if (typeof (admin_screen) != "undefined" && admin_screen != null && admin_screen != "") {
|
| 15 |
-
var admin_screen = admin_screen;
|
| 16 |
-
var action = 'inbound_dequeue_admin_js'
|
| 17 |
-
} else {
|
| 18 |
-
var admin_screen = "";
|
| 19 |
-
var action = 'inbound_dequeue_js'
|
| 20 |
-
}
|
| 21 |
-
console.log(the_script);
|
| 22 |
-
console.log(status);
|
| 23 |
-
|
| 24 |
-
jQuery.ajax({
|
| 25 |
-
type: 'POST',
|
| 26 |
-
url: inbound_debug.admin_url,
|
| 27 |
-
context: this,
|
| 28 |
-
data: {
|
| 29 |
-
action: action,
|
| 30 |
-
post_id: post_id,
|
| 31 |
-
status: status,
|
| 32 |
-
the_script: the_script,
|
| 33 |
-
admin_screen: admin_screen
|
| 34 |
-
},
|
| 35 |
-
|
| 36 |
-
success: function (data) {
|
| 37 |
-
console.log("The script " + the_script + " has been turned " + status);
|
| 38 |
-
var self = this;
|
| 39 |
-
var str = data;
|
| 40 |
-
var obj = JSON.parse(str);
|
| 41 |
-
console.log(obj);
|
| 42 |
-
},
|
| 43 |
-
|
| 44 |
-
error: function (MLHttpRequest, textStatus, errorThrown) {
|
| 45 |
-
alert("Ajax not enabled");
|
| 46 |
-
}
|
| 47 |
-
});
|
| 48 |
-
});
|
| 49 |
-
});
|
| 1 |
+
jQuery(document).ready(function($) {
|
| 2 |
+
jQuery("body").on('click', 'label', function () {
|
| 3 |
+
|
| 4 |
+
var status = jQuery(this).attr('class');
|
| 5 |
+
var status = status.replace('turn-', "");
|
| 6 |
+
if (status === 'off') {
|
| 7 |
+
jQuery(this).parent().find('.switch-button').addClass('status-off');
|
| 8 |
+
} else {
|
| 9 |
+
jQuery(this).parent().find('.switch-button').removeClass('status-off');
|
| 10 |
+
}
|
| 11 |
+
var the_script = jQuery(this).parent().attr('id');
|
| 12 |
+
var post_id = $('#inbound-dequeue-id').text();
|
| 13 |
+
var admin_screen = $('#inbound-fix-page').attr('data-admin-screen');
|
| 14 |
+
if (typeof (admin_screen) != "undefined" && admin_screen != null && admin_screen != "") {
|
| 15 |
+
var admin_screen = admin_screen;
|
| 16 |
+
var action = 'inbound_dequeue_admin_js'
|
| 17 |
+
} else {
|
| 18 |
+
var admin_screen = "";
|
| 19 |
+
var action = 'inbound_dequeue_js'
|
| 20 |
+
}
|
| 21 |
+
console.log(the_script);
|
| 22 |
+
console.log(status);
|
| 23 |
+
|
| 24 |
+
jQuery.ajax({
|
| 25 |
+
type: 'POST',
|
| 26 |
+
url: inbound_debug.admin_url,
|
| 27 |
+
context: this,
|
| 28 |
+
data: {
|
| 29 |
+
action: action,
|
| 30 |
+
post_id: post_id,
|
| 31 |
+
status: status,
|
| 32 |
+
the_script: the_script,
|
| 33 |
+
admin_screen: admin_screen
|
| 34 |
+
},
|
| 35 |
+
|
| 36 |
+
success: function (data) {
|
| 37 |
+
console.log("The script " + the_script + " has been turned " + status);
|
| 38 |
+
var self = this;
|
| 39 |
+
var str = data;
|
| 40 |
+
var obj = JSON.parse(str);
|
| 41 |
+
console.log(obj);
|
| 42 |
+
},
|
| 43 |
+
|
| 44 |
+
error: function (MLHttpRequest, textStatus, errorThrown) {
|
| 45 |
+
alert("Ajax not enabled");
|
| 46 |
+
}
|
| 47 |
+
});
|
| 48 |
+
});
|
| 49 |
+
});
|
shared/classes/menu.class.php
CHANGED
|
@@ -1,785 +1,662 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/* Inbound Now Menu Class */
|
| 3 |
-
if ( ! defined( 'LANDINGPAGES_TEXT_DOMAIN' ) ) {
|
| 4 |
-
define('LANDINGPAGES_TEXT_DOMAIN', 'landing-pages' );
|
| 5 |
-
}
|
| 6 |
-
if (!class_exists('InboundMenu')) {
|
| 7 |
-
class InboundMenu {
|
| 8 |
-
static $add_menu;
|
| 9 |
-
|
| 10 |
-
/* Contruct
|
| 11 |
-
* --------------------------------------------------------- */
|
| 12 |
-
static function init() {
|
| 13 |
-
self::$add_menu = true;
|
| 14 |
-
|
| 15 |
-
add_action('admin_bar_menu', array( __CLASS__, 'loads' ), 98);
|
| 16 |
-
add_action( 'wp_head', array(__CLASS__, 'menu_admin_head'));
|
| 17 |
-
add_action( 'admin_head', array(__CLASS__, 'menu_admin_head'));
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
/* Loads
|
| 21 |
-
* --------------------------------------------------------- */
|
| 22 |
-
static function loads($hook) {
|
| 23 |
-
if ( ! self::$add_menu )
|
| 24 |
-
return;
|
| 25 |
-
global $wp_admin_bar, $locale, $edd_options, $eddtb_edd_name, $eddtb_edd_name_tooltip;
|
| 26 |
-
|
| 27 |
-
/** Get the proper 'Download' post type ID/tag */
|
| 28 |
-
if ( post_type_exists( 'landing-page' ) ) {
|
| 29 |
-
$eddtb_download_cpt = 'landing-page';
|
| 30 |
-
} elseif ( post_type_exists( 'landing-page' ) ) {
|
| 31 |
-
$eddtb_download_cpt = 'landing-page';
|
| 32 |
-
} else {
|
| 33 |
-
$eddtb_download_cpt = '';
|
| 34 |
-
}
|
| 35 |
-
|
| 36 |
-
// CHECK FOR ACTIVE PLUGINS
|
| 37 |
-
$leads_status = FALSE; $landing_page_status = FALSE; $cta_status = FALSE;
|
| 38 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('leads/wordpress-leads.php')) {
|
| 39 |
-
$leads_status = TRUE;
|
| 40 |
-
$leads_version_number = defined( 'WPL_CURRENT_VERSION' ) ? 'v' . WPL_CURRENT_VERSION : '';
|
| 41 |
-
}
|
| 42 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('landing-pages/landing-pages.php')) {
|
| 43 |
-
$landing_page_status = TRUE;
|
| 44 |
-
$landing_page_version_number = defined( 'LANDINGPAGES_CURRENT_VERSION' ) ? 'v' . LANDINGPAGES_CURRENT_VERSION : '';
|
| 45 |
-
|
| 46 |
-
}
|
| 47 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('cta/wordpress-cta.php')) {
|
| 48 |
-
$cta_status = TRUE;
|
| 49 |
-
$cta_number = defined( 'WP_CTA_CURRENT_VERSION' ) ? 'v' . WP_CTA_CURRENT_VERSION : '';
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
if ( $leads_status == FALSE && $landing_page_status == FALSE && $cta_status == FALSE ) {
|
| 53 |
-
|
| 54 |
-
return; // end plugin is
|
| 55 |
-
|
| 56 |
-
}
|
| 57 |
-
/** EDD version number for later use */
|
| 58 |
-
$edd_version_number = defined( 'EDD_VERSION' ) ? 'v' . EDD_VERSION : '';
|
| 59 |
-
|
| 60 |
-
/** Resources links EDD settings check*/
|
| 61 |
-
$eddtb_resources_check = 'default';
|
| 62 |
-
|
| 63 |
-
if ( ( ! isset( $edd_options['eddtb_remove_resources'] ) && ! isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 64 |
-
|| ( isset( $edd_options['eddtb_remove_resources'] ) && ! isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 65 |
-
|| ( ! isset( $edd_options['eddtb_remove_resources'] ) && isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 66 |
-
|
| 67 |
-
) {
|
| 68 |
-
|
| 69 |
-
$eddtb_resources_check = 'eddtb_resources_yes';
|
| 70 |
-
|
| 71 |
-
} // end-if resources settings check
|
| 72 |
-
|
| 73 |
-
|
| 74 |
-
/**
|
| 75 |
-
* Allows for filtering the general user role/capability to display main & sub-level items
|
| 76 |
-
*
|
| 77 |
-
* Default capability: 'edit_posts' (we need this for the "Downloads" post type set by EDD itself!)
|
| 78 |
-
*
|
| 79 |
-
* @since 1.0.0
|
| 80 |
-
*/
|
| 81 |
-
$eddtb_cap_default = class_exists( 'EDD_Roles' ) ? 'edit_products' : 'edit_posts';
|
| 82 |
-
$eddtb_filter_capability = apply_filters( 'eddtb_filter_capability_all', $eddtb_cap_default );
|
| 83 |
-
|
| 84 |
-
// Exit if admin bar not there
|
| 85 |
-
if ( ! is_user_logged_in() || ! is_admin_bar_showing() ) {
|
| 86 |
-
return;
|
| 87 |
-
}
|
| 88 |
-
|
| 89 |
-
/** Set unique prefix */
|
| 90 |
-
$prefix = 'inbound-';
|
| 91 |
-
/** Create parent menu item references */
|
| 92 |
-
$inbounddocs = $prefix . 'inbounddocs'; // sub level: edd docs
|
| 93 |
-
$inbounddocsquick = $prefix . 'inbounddocsquick'; // third level: docs quick links
|
| 94 |
-
$inbounddocssections = $prefix . 'inbounddocssections'; // third level: docs sections
|
| 95 |
-
$inboundreports = $prefix . 'inboundreports'; // sub level: edd reports
|
| 96 |
-
$inboundgroup = $prefix . 'inboundgroup'; // sub level: edd group (resources)
|
| 97 |
-
$inboundbar = $prefix . 'admin-bar'; // root level
|
| 98 |
-
$inboundsupport = $prefix . 'inboundsupport'; // sub level: edd support
|
| 99 |
-
$inboundsupportsections = $prefix . 'inboundsupportsections'; // third level: support sections
|
| 100 |
-
$inboundsupportaccount = $prefix . 'inboundsupportaccount'; // third level: support user account
|
| 101 |
-
$inboundsites = $prefix . 'inboundsites'; // sub level: edd sites
|
| 102 |
-
$inbounddebug = $prefix . 'inbounddebug';
|
| 103 |
-
$inboundsitesaccount = $prefix . 'inboundsitesaccount';
|
| 104 |
-
$inboundsitesextensions = $prefix . 'inboundsitesextensions'; // third level: edd extensions
|
| 105 |
-
$landingpages_menu = $prefix . 'landingpages';
|
| 106 |
-
$cta_menu = $prefix . 'cta';
|
| 107 |
-
$leads_menu = $prefix . 'leads';
|
| 108 |
-
$form_menu = $prefix . 'inboundforms';
|
| 109 |
-
$settings_menu = $prefix . 'inboundsettings';
|
| 110 |
-
$templates_menu = $prefix . 'inboundtemplates';
|
| 111 |
-
$landingpagesettings = $prefix . 'landingpagesettings';
|
| 112 |
-
$ctasettings = $prefix . 'ctasettings';
|
| 113 |
-
$landing_pages_templates = $prefix . 'landingpagetemplates';
|
| 114 |
-
$cta_templates = $prefix . 'ctatemplates';
|
| 115 |
-
|
| 116 |
-
/** Make the "EDD" name filterable within menu items */
|
| 117 |
-
$eddtb_edd_name = apply_filters( 'eddtb_filter_edd_name', __( 'EDD', 'edd-toolbar' ) );
|
| 118 |
-
|
| 119 |
-
/** Make the "Easy Digital Downloads" name's tooltip filterable within menu items */
|
| 120 |
-
$eddtb_edd_name_tooltip = apply_filters( 'eddtb_filter_edd_name_tooltip', _x( 'Easy Digital Downloads', 'Translators: For the tooltip', 'edd-toolbar' ) );
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
/** "Sub Forum" string */
|
| 124 |
-
$eddtb_sub_forum = __( 'Sub Forum', 'edd-toolbar' ) . ': ';
|
| 125 |
-
|
| 126 |
-
/** For the Documentation search */
|
| 127 |
-
$eddtb_search_docs = __( 'Search Docs', 'edd-toolbar' );
|
| 128 |
-
$eddtb_go_button = '<input type="submit" value="' . __( 'GO', 'edd-toolbar' ) . '" class="eddtb-search-go" /></form>';
|
| 129 |
-
|
| 130 |
-
/** Show these items only if Inbound Now plugin is actually installed */
|
| 131 |
-
if ( $leads_status == TRUE || $landing_page_status == TRUE || $cta_status == TRUE ) {
|
| 132 |
-
|
| 133 |
-
/** Set EDD active variable for later user */
|
| 134 |
-
$edd_active = 'edd_is_active';
|
| 135 |
-
|
| 136 |
-
/** EDD main downloads section */
|
| 137 |
-
if ( current_user_can( 'edit_posts' ) && $landing_page_status) {
|
| 138 |
-
|
| 139 |
-
$menu_items['landingpages'] = array(
|
| 140 |
-
'parent' => $inboundbar,
|
| 141 |
-
'title' => __( 'Landing Pages', LANDINGPAGES_TEXT_DOMAIN ),
|
| 142 |
-
'href' => admin_url( 'edit.php?post_type=landing-page' ),
|
| 143 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 144 |
-
);
|
| 145 |
-
$menu_items['landingpages-view'] = array(
|
| 146 |
-
'parent' => $landingpages_menu,
|
| 147 |
-
'title' => __( 'View Landing Pages List', LANDINGPAGES_TEXT_DOMAIN ),
|
| 148 |
-
'href' => admin_url( 'edit.php?post_type=landing-page' ),
|
| 149 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 150 |
-
);
|
| 151 |
-
$menu_items['landingpages-add'] = array(
|
| 152 |
-
'parent' => $landingpages_menu,
|
| 153 |
-
'title' => __( 'Add New Landing Page', LANDINGPAGES_TEXT_DOMAIN ),
|
| 154 |
-
'href' => admin_url( 'post-new.php?post_type=landing-page' ),
|
| 155 |
-
'meta' => array( 'target' => '', 'title' => __( 'Add new Landing Page', 'edd-toolbar' ) )
|
| 156 |
-
);
|
| 157 |
-
|
| 158 |
-
$menu_items['landingpages-categories'] = array(
|
| 159 |
-
'parent' => $landingpages_menu,
|
| 160 |
-
'title' => __( 'Categories', LANDINGPAGES_TEXT_DOMAIN ),
|
| 161 |
-
'href' => admin_url( 'edit-tags.php?taxonomy=landing_page_category&post_type=landing-page' ),
|
| 162 |
-
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Categories', 'edd-toolbar' ) )
|
| 163 |
-
);
|
| 164 |
-
if ( current_user_can( 'manage_options' )) {
|
| 165 |
-
$menu_items['landingpages-settings'] = array(
|
| 166 |
-
'parent' => $landingpages_menu,
|
| 167 |
-
'title' => __( 'Settings', LANDINGPAGES_TEXT_DOMAIN ),
|
| 168 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 169 |
-
'meta' => array( 'target' => '', 'title' => __( 'Manage Landing Page Settings', 'edd-toolbar' ) )
|
| 170 |
-
);
|
| 171 |
-
}
|
| 172 |
-
//
|
| 173 |
-
}
|
| 174 |
-
|
| 175 |
-
/** EDD main downloads section */
|
| 176 |
-
if ( current_user_can( 'edit_posts' ) && $cta_status) {
|
| 177 |
-
|
| 178 |
-
$menu_items['cta'] = array(
|
| 179 |
-
'parent' => $inboundbar,
|
| 180 |
-
'title' => __( 'Call to Actions', LANDINGPAGES_TEXT_DOMAIN ),
|
| 181 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action' ),
|
| 182 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 183 |
-
);
|
| 184 |
-
$menu_items['cta-view'] = array(
|
| 185 |
-
'parent' => $cta_menu,
|
| 186 |
-
'title' => __( 'View Calls to Action List', LANDINGPAGES_TEXT_DOMAIN ),
|
| 187 |
-
'href' => admin_url( 'post-new.php?post_type=wp-call-to-action' ),
|
| 188 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 189 |
-
);
|
| 190 |
-
$menu_items['cta-add'] = array(
|
| 191 |
-
'parent' => $cta_menu,
|
| 192 |
-
'title' => __( 'Add New Call to Action', LANDINGPAGES_TEXT_DOMAIN ),
|
| 193 |
-
'href' => admin_url( 'post-new.php?post_type=wp-call-to-action' ),
|
| 194 |
-
'meta' => array( 'target' => '', 'title' => __( 'Add new call to action', 'edd-toolbar' ) )
|
| 195 |
-
);
|
| 196 |
-
|
| 197 |
-
$menu_items['cta-categories'] = array(
|
| 198 |
-
'parent' => $cta_menu,
|
| 199 |
-
'title' => __( 'Categories', LANDINGPAGES_TEXT_DOMAIN ),
|
| 200 |
-
'href' => admin_url( 'edit-tags.php?taxonomy=wp_call_to_action_category&post_type=wp-call-to-action' ),
|
| 201 |
-
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Categories', 'edd-toolbar' ) )
|
| 202 |
-
);
|
| 203 |
-
if ( current_user_can( 'manage_options' )) {
|
| 204 |
-
$menu_items['cta-settings'] = array(
|
| 205 |
-
'parent' => $cta_menu,
|
| 206 |
-
'title' => __( 'Settings', LANDINGPAGES_TEXT_DOMAIN ),
|
| 207 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 208 |
-
'meta' => array( 'target' => '', 'title' => __( 'Manage Call to Action Settings', 'edd-toolbar' ) )
|
| 209 |
-
);
|
| 210 |
-
}
|
| 211 |
-
|
| 212 |
-
}
|
| 213 |
-
|
| 214 |
-
/** admin settings sections */
|
| 215 |
-
if ( current_user_can( 'manage_options' )) {
|
| 216 |
-
// Leads Menu
|
| 217 |
-
if ($leads_status) {
|
| 218 |
-
$menu_items['leads'] = array(
|
| 219 |
-
'parent' => $inboundbar,
|
| 220 |
-
'title' => __( 'Leads', 'edd-toolbar' ),
|
| 221 |
-
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 222 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Manage Forms', 'edd-toolbar' ) )
|
| 223 |
-
);
|
| 224 |
-
/** Leads search form */
|
| 225 |
-
$leads_search_text = "Search All Leads";
|
| 226 |
-
$menu_items['leads-search'] = array(
|
| 227 |
-
'parent' => $leads_menu,
|
| 228 |
-
'title' => '<form method="get" action="'.admin_url( 'edit.php?post_type=wp-lead' ).'" class=" " target="_blank">
|
| 229 |
-
<input type="text" placeholder="' . $leads_search_text . '" onblur="this.value=(this.value==\'\') ? \'' . $leads_search_text . '\' : this.value;" onfocus="this.value=(this.value==\'' . $leads_search_text . '\') ? \'\' : this.value;" value="' . $leads_search_text . '" name="s" value="' . esc_attr( 'Search Leads', 'edd-toolbar' ) . '" class="text eddtb-search-input" />
|
| 230 |
-
<input type="hidden" name="post_type" value="wp-lead" />
|
| 231 |
-
<input type="hidden" name="post_status" value="all" />
|
| 232 |
-
' . $eddtb_go_button,
|
| 233 |
-
'href' => false,
|
| 234 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Search Leads', 'Translators: For the tooltip', 'edd-toolbar' ) )
|
| 235 |
-
);
|
| 236 |
-
$menu_items['leads-view'] = array(
|
| 237 |
-
'parent' => $leads_menu,
|
| 238 |
-
'title' => __( 'View All Leads', LANDINGPAGES_TEXT_DOMAIN ),
|
| 239 |
-
'href' => admin_url( 'edit.php?post_type=wp-lead' ),
|
| 240 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Forms', 'edd-toolbar' ) )
|
| 241 |
-
);
|
| 242 |
-
$menu_items['leads-list'] = array(
|
| 243 |
-
'parent' => $leads_menu,
|
| 244 |
-
'title' => __( 'View Lead Lists', LANDINGPAGES_TEXT_DOMAIN ),
|
| 245 |
-
'href' => admin_url( 'edit.php?post_type=list' ),
|
| 246 |
-
'meta' => array( 'target' => '', 'title' => __( 'View Lead Lists', 'edd-toolbar' ) )
|
| 247 |
-
);
|
| 248 |
-
$menu_items['leads-add'] = array(
|
| 249 |
-
'parent' => $leads_menu,
|
| 250 |
-
'title' => __( 'Create New Lead', LANDINGPAGES_TEXT_DOMAIN ),
|
| 251 |
-
'href' => admin_url( 'post-new.php?post_type=wp-lead' ),
|
| 252 |
-
'meta' => array( 'target' => '', 'title' => __( 'Add new lead', 'edd-toolbar' ) )
|
| 253 |
-
);
|
| 254 |
-
}
|
| 255 |
-
|
| 256 |
-
|
| 257 |
-
$menu_items['inboundforms'] = array(
|
| 258 |
-
'parent' => $inboundbar,
|
| 259 |
-
'title' => __( 'Manage Forms', 'edd-toolbar' ),
|
| 260 |
-
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 261 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Manage Forms', 'edd-toolbar' ) )
|
| 262 |
-
);
|
| 263 |
-
$menu_items['inboundforms-view'] = array(
|
| 264 |
-
'parent' => $form_menu,
|
| 265 |
-
'title' => __( 'View All Forms', LANDINGPAGES_TEXT_DOMAIN ),
|
| 266 |
-
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 267 |
-
'meta' => array( 'target' => '', 'title' => __( 'View All Forms', 'edd-toolbar' ) )
|
| 268 |
-
);
|
| 269 |
-
$menu_items['inboundforms-add'] = array(
|
| 270 |
-
'parent' => $form_menu,
|
| 271 |
-
'title' => __( 'Create New Form', LANDINGPAGES_TEXT_DOMAIN ),
|
| 272 |
-
'href' => admin_url( 'post-new.php?post_type=inbound-forms' ),
|
| 273 |
-
'meta' => array( 'target' => '', 'title' => __( 'Add new call to action', 'edd-toolbar' ) )
|
| 274 |
-
);
|
| 275 |
-
/** Template Setup */
|
| 276 |
-
if ($landing_page_status || $cta_status) {
|
| 277 |
-
|
| 278 |
-
$menu_items['inboundtemplates'] = array(
|
| 279 |
-
'parent' => $inboundbar,
|
| 280 |
-
'title' => __( 'Manage Templates', 'edd-toolbar' ),
|
| 281 |
-
'href' => "",
|
| 282 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Manage Templates', 'edd-toolbar' ) )
|
| 283 |
-
);
|
| 284 |
-
$menu_items['getmoretemplates'] = array(
|
| 285 |
-
'parent' => $templates_menu,
|
| 286 |
-
'title' => __( 'Download More Templates', 'edd-toolbar' ),
|
| 287 |
-
'href' => "http://www.inboundnow.com/market",
|
| 288 |
-
'meta' => array( 'target' => '', 'title' => __( 'Download More Templates', 'edd-toolbar' ) )
|
| 289 |
-
);
|
| 290 |
-
if ($landing_page_status){
|
| 291 |
-
$menu_items['landingpagetemplates'] = array(
|
| 292 |
-
'parent' => $templates_menu,
|
| 293 |
-
'title' => __( 'Landing Page Templates', 'edd-toolbar' ),
|
| 294 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_manage_templates' ),
|
| 295 |
-
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Settings', 'edd-toolbar' ) )
|
| 296 |
-
);
|
| 297 |
-
|
| 298 |
-
$menu_items['landingpagetemplates-main'] = array(
|
| 299 |
-
'parent' => $landing_pages_templates,
|
| 300 |
-
'title' => __( 'Add New Landing Page Templates', 'edd-toolbar' ),
|
| 301 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_manage_templates' ),
|
| 302 |
-
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 303 |
-
);
|
| 304 |
-
}
|
| 305 |
-
if ($cta_status){
|
| 306 |
-
$menu_items['ctatemplates'] = array(
|
| 307 |
-
'parent' => $templates_menu,
|
| 308 |
-
'title' => __( 'Call to Action Templates', 'edd-toolbar' ),
|
| 309 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_manage_templates' ),
|
| 310 |
-
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 311 |
-
);
|
| 312 |
-
|
| 313 |
-
$menu_items['ctatemplates-main'] = array(
|
| 314 |
-
'parent' => $cta_templates,
|
| 315 |
-
'title' => __( 'Add New CTA Templates', 'edd-toolbar' ),
|
| 316 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_manage_templates' ),
|
| 317 |
-
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 318 |
-
);
|
| 319 |
-
}
|
| 320 |
-
|
| 321 |
-
}
|
| 322 |
-
/** Settings Items */
|
| 323 |
-
$menu_items['inboundsettings'] = array(
|
| 324 |
-
'parent' => $inboundbar,
|
| 325 |
-
'title' => __( 'Global Settings', 'edd-toolbar' ),
|
| 326 |
-
'href' => "",
|
| 327 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Manage Settings', 'edd-toolbar' ) )
|
| 328 |
-
);
|
| 329 |
-
if ($landing_page_status){
|
| 330 |
-
$menu_items['landingpagesettings'] = array(
|
| 331 |
-
'parent' => $settings_menu,
|
| 332 |
-
'title' => __( 'Landing Page Settings', 'edd-toolbar' ),
|
| 333 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 334 |
-
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Settings', 'edd-toolbar' ) )
|
| 335 |
-
);
|
| 336 |
-
/*
|
| 337 |
-
$menu_items['landingpagesettings-main'] = array(
|
| 338 |
-
'parent' => $landingpagesettings,
|
| 339 |
-
'title' => __( 'Main', 'edd-toolbar' ),
|
| 340 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 341 |
-
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 342 |
-
); */
|
| 343 |
-
}
|
| 344 |
-
if ($cta_status){
|
| 345 |
-
$menu_items['ctasettings'] = array(
|
| 346 |
-
'parent' => $settings_menu,
|
| 347 |
-
'title' => __( 'Call to Action Settings', 'edd-toolbar' ),
|
| 348 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 349 |
-
'meta' => array( 'target' => '', 'title' => __( 'Call to Action Settings', 'edd-toolbar' ) )
|
| 350 |
-
);
|
| 351 |
-
/*
|
| 352 |
-
$menu_items['ctasettings-main'] = array(
|
| 353 |
-
'parent' => $ctasettings,
|
| 354 |
-
'title' => __( 'Main', 'edd-toolbar' ),
|
| 355 |
-
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 356 |
-
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 357 |
-
); */
|
| 358 |
-
}
|
| 359 |
-
if ($leads_status){
|
| 360 |
-
$menu_items['leadssettings'] = array(
|
| 361 |
-
'parent' => $settings_menu,
|
| 362 |
-
'title' => __( 'Lead Settings', 'edd-toolbar' ),
|
| 363 |
-
'href' => admin_url( 'edit.php?post_type=wp-lead&page=wpleads_global_settings' ),
|
| 364 |
-
'meta' => array( 'target' => '', 'title' => __( 'Lead Settings', 'edd-toolbar' ) )
|
| 365 |
-
);
|
| 366 |
-
}
|
| 367 |
-
|
| 368 |
-
$menu_items['inboundreports'] = array(
|
| 369 |
-
'parent' => $inboundbar,
|
| 370 |
-
'title' => __( 'Analytics (coming soon)', 'edd-toolbar' ),
|
| 371 |
-
'href' => '#',
|
| 372 |
-
'meta' => array( 'target' => '', 'title' => __( 'Analytics (coming soon)', 'edd-toolbar' ) )
|
| 373 |
-
);
|
| 374 |
-
|
| 375 |
-
if (function_exists( 'is_plugin_active' ) && is_plugin_active('wordpress-seo/wp-seo.php')) {
|
| 376 |
-
$menu_items['inboundseo'] = array(
|
| 377 |
-
'parent' => $inboundbar,
|
| 378 |
-
'title' => __( 'SEO by Yoast', 'edd-toolbar' ),
|
| 379 |
-
'href' => admin_url( 'admin.php?page=wpseo_dashboard' ),
|
| 380 |
-
'meta' => array( 'target' => '', 'title' => __( 'Manage SEO Settings', 'edd-toolbar' ) )
|
| 381 |
-
);
|
| 382 |
-
}
|
| 383 |
-
|
| 384 |
-
$inboundsecondary_menu_items['inboundsupport'] = array(
|
| 385 |
-
'parent' => $inboundgroup,
|
| 386 |
-
'title' => __( 'Support Forum', 'edd-toolbar' ),
|
| 387 |
-
'href' => 'https://www.inboundnow.com/support/',
|
| 388 |
-
'meta' => array( 'target' => '_blank' , 'title' => __( 'Support Forum', 'edd-toolbar' ) )
|
| 389 |
-
);
|
| 390 |
-
|
| 391 |
-
/** Documentation menu items */
|
| 392 |
-
$inboundsecondary_menu_items['inbounddocs'] = array(
|
| 393 |
-
'parent' => $inboundgroup,
|
| 394 |
-
'title' => __( 'Documentation', 'edd-toolbar' ),
|
| 395 |
-
'href' => 'http://docs.inboundnow.com/',
|
| 396 |
-
'meta' => array( 'title' => __( 'Documentation', 'edd-toolbar' ) )
|
| 397 |
-
);
|
| 398 |
-
|
| 399 |
-
/** Docs search form */
|
| 400 |
-
$inboundsecondary_menu_items['inbounddocs-searchform'] = array(
|
| 401 |
-
'parent' => $inboundgroup,
|
| 402 |
-
'title' => '<form method="get" action="http://www.inboundnow.com/support/search/?action=bbp-search-request" class=" " target="_blank">
|
| 403 |
-
<input type="text" placeholder="' . $eddtb_search_docs . '" onblur="this.value=(this.value==\'\') ? \'' . $eddtb_search_docs . '\' : this.value;" onfocus="this.value=(this.value==\'' . $eddtb_search_docs . '\') ? \'\' : this.value;" value="' . $eddtb_search_docs . '" name="bbp_search" value="' . esc_attr( 'Search Docs', 'edd-toolbar' ) . '" class="text eddtb-search-input" />
|
| 404 |
-
<input type="hidden" name="post_type[]" value="docs" />
|
| 405 |
-
<input type="hidden" name="post_type[]" value="page" />' . $eddtb_go_button,
|
| 406 |
-
'href' => false,
|
| 407 |
-
'meta' => array( 'target' => '', 'title' => _x( 'Search Docs', 'Translators: For the tooltip', 'edd-toolbar' ) )
|
| 408 |
-
);
|
| 409 |
-
|
| 410 |
-
/** Easy Digital Downloads HQ menu items */
|
| 411 |
-
$inboundsecondary_menu_items['inboundsites'] = array(
|
| 412 |
-
'parent' => $inboundgroup,
|
| 413 |
-
'title' => __( 'Inbound Now Plugin HQ', 'edd-toolbar' ),
|
| 414 |
-
'href' => 'https://www.inboundnow.com/',
|
| 415 |
-
'meta' => array( 'title' => $eddtb_edd_name_tooltip . ' ' . __( 'Plugin HQ', 'edd-toolbar' ) )
|
| 416 |
-
);
|
| 417 |
-
|
| 418 |
-
/** Easy Digital Downloads HQ menu items */
|
| 419 |
-
$actual_link = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 420 |
-
|
| 421 |
-
$param = (preg_match("/\?/", $actual_link)) ? "&" : '?';
|
| 422 |
-
if (preg_match("/inbound-dequeue-scripts/", $actual_link)) {
|
| 423 |
-
$actual_link = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 424 |
-
} else {
|
| 425 |
-
$actual_link = $actual_link . $param .'inbound-dequeue-scripts';
|
| 426 |
-
}
|
| 427 |
-
$actual_link_two = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 428 |
-
$param_two = (preg_match("/\?/", $actual_link_two)) ? "&" : '?';
|
| 429 |
-
if (preg_match("/inbound_js/", $actual_link_two)) {
|
| 430 |
-
$actual_link_two = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 431 |
-
} else {
|
| 432 |
-
$actual_link_two = $actual_link_two . $param_two .'inbound_js';
|
| 433 |
-
}
|
| 434 |
-
$inboundsecondary_menu_items['inbounddebug'] = array(
|
| 435 |
-
'parent' => $inboundgroup,
|
| 436 |
-
'title' => __( '<span style="color:
|
| 437 |
-
'href' => "#",
|
| 438 |
-
'meta' => ""
|
| 439 |
-
);
|
| 440 |
-
$inboundsecondary_menu_items['inbounddebug-checkjs'] = array(
|
| 441 |
-
'parent' => $inbounddebug,
|
| 442 |
-
'title' => __( 'Check for Javascript Errors', 'edd-toolbar' ),
|
| 443 |
-
'href' => $actual_link_two,
|
| 444 |
-
'meta' => array( 'title' => __( 'Click here to check javascript errors on this page', 'edd-toolbar' ) )
|
| 445 |
-
);
|
| 446 |
-
|
| 447 |
-
$inboundsecondary_menu_items['inbounddebug-turnoffscripts'] = array(
|
| 448 |
-
'parent' => $inbounddebug,
|
| 449 |
-
'title' => __( 'Remove Javascript Errors', 'edd-toolbar' ),
|
| 450 |
-
'href' => $actual_link,
|
| 451 |
-
'meta' => array( 'title' => __( 'Click here to remove broken javascript to fix issues', 'edd-toolbar' ) )
|
| 452 |
-
);
|
| 453 |
-
|
| 454 |
-
/** HQ: GitHub */
|
| 455 |
-
$inboundsecondary_menu_items['inboundsites-dev'] = array(
|
| 456 |
-
'parent' => $inboundsites,
|
| 457 |
-
'title' => __( 'GitHub Repository Developer Center', 'edd-toolbar' ),
|
| 458 |
-
'href' => 'https://github.com/inboundnow',
|
| 459 |
-
'meta' => array( 'title' => __( 'GitHub Repository Developer Center', 'edd-toolbar' ) )
|
| 460 |
-
);
|
| 461 |
-
|
| 462 |
-
/** HQ: Blog */
|
| 463 |
-
$inboundsecondary_menu_items['inboundsites-blog'] = array(
|
| 464 |
-
'parent' => $inboundsites,
|
| 465 |
-
'title' => __( 'Official Blog', 'edd-toolbar' ),
|
| 466 |
-
'href' => 'https://www.inboundnow.com/blog/',
|
| 467 |
-
'meta' => array( 'title' => __( 'Official Blog', 'edd-toolbar' ) )
|
| 468 |
-
);
|
| 469 |
-
|
| 470 |
-
/** HQ: Site Account */
|
| 471 |
-
$inboundsecondary_menu_items['inboundsitesaccount'] = array(
|
| 472 |
-
'parent' => $inboundsites,
|
| 473 |
-
'title' => __( 'My Account', 'edd-toolbar' ),
|
| 474 |
-
'href' => 'https://www.inboundnow.com/marketplace/account/',
|
| 475 |
-
'meta' => array( 'title' => __( 'My Account', 'edd-toolbar' ) )
|
| 476 |
-
);
|
| 477 |
-
|
| 478 |
-
$inboundsecondary_menu_items['inboundsitesaccount-history'] = array(
|
| 479 |
-
'parent' => $inboundsitesaccount,
|
| 480 |
-
'title' => __( 'Purchase History', 'edd-toolbar' ),
|
| 481 |
-
'href' => 'https://www.inboundnow.com/marketplace/account/purchase-history/',
|
| 482 |
-
'meta' => array( 'title' => __( 'Purchase History', 'edd-toolbar' ) )
|
| 483 |
-
);
|
| 484 |
-
/*
|
| 485 |
-
$menu_items['edd-systeminfo'] = array(
|
| 486 |
-
'parent' => $inboundgroup,
|
| 487 |
-
'title' => __( 'System Info (Debug)', 'edd-toolbar' ),
|
| 488 |
-
'href' => admin_url( 'edit.php?post_type=landing-page&page=edd-system-info' ),
|
| 489 |
-
'meta' => array( 'target' => '', 'title' => __( 'System Info (Debug)', 'edd-toolbar' ) )
|
| 490 |
-
);
|
| 491 |
-
*/
|
| 492 |
-
|
| 493 |
-
|
| 494 |
-
} // end-if global settings/options cap checks (including backward compatibility)
|
| 495 |
-
|
| 496 |
-
} else {
|
| 497 |
-
|
| 498 |
-
/** If Easy Digital Downloads is not active, to avoid PHP notices */
|
| 499 |
-
if ( 'eddtb_resources_yes' == $eddtb_resources_check && $inboundsecondary_menu_items ) {
|
| 500 |
-
$menu_items = $inboundsecondary_menu_items;
|
| 501 |
-
}
|
| 502 |
-
|
| 503 |
-
/** If Easy Digital Downloads is not active and no icon filter is active, then display no icon */
|
| 504 |
-
if ( ! has_filter( 'eddtb_filter_main_icon' ) ) {
|
| 505 |
-
add_filter( 'eddtb_filter_main_item_icon_display', '__eddtb_no_icon_display' );
|
| 506 |
-
}
|
| 507 |
-
|
| 508 |
-
}
|
| 509 |
-
|
| 510 |
-
|
| 511 |
-
|
| 512 |
-
/** Allow menu items to be filtered, but pass in parent menu item IDs */
|
| 513 |
-
$menu_items = (array) apply_filters( 'ddw_eddtb_menu_items', $menu_items, ( 'eddtb_resources_yes' == $eddtb_resources_check ) ? $inboundsecondary_menu_items : '',
|
| 514 |
-
$prefix,
|
| 515 |
-
$inboundbar,
|
| 516 |
-
$inboundsupport,
|
| 517 |
-
$inboundsupportsections,
|
| 518 |
-
$inboundsupportaccount,
|
| 519 |
-
$inbounddocs,
|
| 520 |
-
$inbounddocsquick,
|
| 521 |
-
$inbounddocssections,
|
| 522 |
-
$inboundsites,
|
| 523 |
-
$inboundsitesaccount,
|
| 524 |
-
$inboundsitesextensions,
|
| 525 |
-
$inboundreports,
|
| 526 |
-
$inboundgroup,
|
| 527 |
-
// NEW PREFIXES
|
| 528 |
-
$landingpages_menu,
|
| 529 |
-
$cta_menu,
|
| 530 |
-
$form_menu,
|
| 531 |
-
$settings_menu,
|
| 532 |
-
$templates_menu,
|
| 533 |
-
$landingpagesettings,
|
| 534 |
-
$ctasettings,
|
| 535 |
-
$landing_pages_templates,
|
| 536 |
-
$cta_templates
|
| 537 |
-
); // end of array
|
| 538 |
-
|
| 539 |
-
|
| 540 |
-
/** Filter the main item icon's class/display */
|
| 541 |
-
$eddtb_main_item_icon_display = apply_filters( 'eddtb_filter_main_item_icon_display', 'icon-edd' );
|
| 542 |
-
|
| 543 |
-
$wp_admin_bar->add_menu( array(
|
| 544 |
-
'id' => $inboundbar,
|
| 545 |
-
'title' => __( ' Marketing', 'edd-toolbar' ),
|
| 546 |
-
'href' => "",
|
| 547 |
-
'meta' => array( 'class' => $eddtb_main_item_icon_display, 'title' => 'Inbound Marketing Admin' )
|
| 548 |
-
) );
|
| 549 |
-
|
| 550 |
-
|
| 551 |
-
/** Loop through the menu items */
|
| 552 |
-
foreach ( $menu_items as $id => $menu_item ) {
|
| 553 |
-
|
| 554 |
-
/** Add in the item ID */
|
| 555 |
-
$menu_item['id'] = $prefix . $id;
|
| 556 |
-
|
| 557 |
-
/** Add meta target to each item where it's not already set, so links open in new window/tab */
|
| 558 |
-
if ( ! isset( $menu_item['meta']['target'] ) )
|
| 559 |
-
$menu_item['meta']['target'] = '_blank';
|
| 560 |
-
|
| 561 |
-
/** Add class to links that open up in a new window/tab */
|
| 562 |
-
if ( '_blank' === $menu_item['meta']['target'] ) {
|
| 563 |
-
if ( ! isset( $menu_item['meta']['class'] ) )
|
| 564 |
-
$menu_item['meta']['class'] = '';
|
| 565 |
-
$menu_item['meta']['class'] .= $prefix . 'eddtb-new-tab';
|
| 566 |
-
}
|
| 567 |
-
|
| 568 |
-
/** Add menu items */
|
| 569 |
-
$wp_admin_bar->add_menu( $menu_item );
|
| 570 |
-
|
| 571 |
-
} // end foreach menu items
|
| 572 |
-
|
| 573 |
-
|
| 574 |
-
/**
|
| 575 |
-
* Action Hook 'eddtb_custom_main_items'
|
| 576 |
-
* allows for hooking other main items in
|
| 577 |
-
*
|
| 578 |
-
* @since 1.2.0
|
| 579 |
-
*/
|
| 580 |
-
do_action( 'eddtb_custom_main_items' );
|
| 581 |
-
|
| 582 |
-
|
| 583 |
-
/** add special blue links
|
| 584 |
-
$wp_admin_bar->add_group( array(
|
| 585 |
-
'parent' => $eddsettings,
|
| 586 |
-
'id' => $eddspecials
|
| 587 |
-
) );
|
| 588 |
-
*/
|
| 589 |
-
|
| 590 |
-
/** Adds search box and sub */
|
| 591 |
-
$wp_admin_bar->add_group( array(
|
| 592 |
-
'parent' => $inboundbar,
|
| 593 |
-
'id' => $inboundgroup,
|
| 594 |
-
'meta' => array( 'class' => 'ab-sub-secondary' )
|
| 595 |
-
) );
|
| 596 |
-
|
| 597 |
-
if (is_array($inboundsecondary_menu_items)) {
|
| 598 |
-
// Load grey secondary items
|
| 599 |
-
foreach ( $inboundsecondary_menu_items as $id => $inboundgroup_menu_item ) {
|
| 600 |
-
|
| 601 |
-
/** EDD Group: Add in the item ID */
|
| 602 |
-
$inboundgroup_menu_item['id'] = $prefix . $id;
|
| 603 |
-
|
| 604 |
-
/** EDD Group: Add meta target to each item where it's not already set, so links open in new window/tab */
|
| 605 |
-
if ( ! isset( $inboundgroup_menu_item['meta']['target'] ) )
|
| 606 |
-
$inboundgroup_menu_item['meta']['target'] = '_blank';
|
| 607 |
-
|
| 608 |
-
/** EDD Group: Add class to links that open up in a new window/tab */
|
| 609 |
-
if ( '_blank' === $inboundgroup_menu_item['meta']['target'] ) {
|
| 610 |
-
|
| 611 |
-
if ( ! isset( $inboundgroup_menu_item['meta']['class'] ) ) {
|
| 612 |
-
$inboundgroup_menu_item['meta']['class'] = '';
|
| 613 |
-
}
|
| 614 |
-
|
| 615 |
-
$inboundgroup_menu_item['meta']['class'] .= $prefix . 'eddtb-new-tab';
|
| 616 |
-
|
| 617 |
-
}
|
| 618 |
-
|
| 619 |
-
/** EDD Group: Add menu items */
|
| 620 |
-
$wp_admin_bar->add_menu( $inboundgroup_menu_item );
|
| 621 |
-
|
| 622 |
-
} // end foreach EDD Group
|
| 623 |
-
}
|
| 624 |
-
|
| 625 |
-
/**
|
| 626 |
-
* Action Hook 'eddtb_custom_group_items'
|
| 627 |
-
* allows for hooking other EDD Group items in
|
| 628 |
-
*
|
| 629 |
-
* @since 1.2.0
|
| 630 |
-
*/
|
| 631 |
-
// do_action( 'eddtb_custom_group_items' );
|
| 632 |
-
|
| 633 |
-
}
|
| 634 |
-
|
| 635 |
-
static function menu_admin_head() {
|
| 636 |
-
/** No styles if admin bar is disabled or user is not logged in or items are disabled via constant */
|
| 637 |
-
if ( ! is_admin_bar_showing() || ! is_user_logged_in() ) {
|
| 638 |
-
return;
|
| 639 |
-
}
|
| 640 |
-
if ( defined( 'WPL_URL' )) {
|
| 641 |
-
$final_path = WPL_URL . "/";
|
| 642 |
-
} else if (defined( 'LANDINGPAGES_URLPATH' )){
|
| 643 |
-
$final_path = LANDINGPAGES_URLPATH;
|
| 644 |
-
} else if (defined( 'WP_CTA_URLPATH' )){
|
| 645 |
-
$final_path = WP_CTA_URLPATH;
|
| 646 |
-
} else {
|
| 647 |
-
$final_path = preg_replace("/\/shared\/inbound-shortcodes\//", "/", INBOUND_FORMS);
|
| 648 |
-
}
|
| 649 |
-
|
| 650 |
-
?>
|
| 651 |
-
|
| 652 |
-
|
| 653 |
-
|
| 654 |
-
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
|
| 658 |
-
|
| 659 |
-
|
| 660 |
-
|
| 661 |
-
|
| 662 |
-
|
| 663 |
-
background-image: url(<?php echo $final_path . 'shared/inbound-shortcodes/shortcodes-blue.png';?>);
|
| 664 |
-
|
| 665 |
-
background-repeat: no-repeat;
|
| 666 |
-
background-position: 0.15em 50%;
|
| 667 |
-
padding-left: 22px;
|
| 668 |
-
}
|
| 669 |
-
#wp-admin-bar-ddw-edd-languages-de > .ab-item:before,
|
| 670 |
-
#wp-admin-bar-ddw-edd-translations-forum > .ab-item:before {
|
| 671 |
-
color: #ff9900;
|
| 672 |
-
content: '• ';
|
| 673 |
-
}
|
| 674 |
-
#wpadminbar .eddtb-search-input {
|
| 675 |
-
width: 140px;
|
| 676 |
-
}
|
| 677 |
-
#wp-admin-bar-ddw-edd-inboundsupportsections .ab-item,
|
| 678 |
-
#wp-admin-bar-ddw-edd-inbounddocsquick .ab-item,
|
| 679 |
-
#wp-admin-bar-ddw-edd-inbounddocssections .ab-item,
|
| 680 |
-
#wpadminbar .eddtb-search-input,
|
| 681 |
-
#wpadminbar .eddtb-search-go {
|
| 682 |
-
color: #21759b !important;
|
| 683 |
-
text-shadow: none;
|
| 684 |
-
}
|
| 685 |
-
#wpadminbar .eddtb-search-input,
|
| 686 |
-
#wpadminbar .eddtb-search-go {
|
| 687 |
-
background-color: #fff;
|
| 688 |
-
height: 18px;
|
| 689 |
-
line-height: 18px;
|
| 690 |
-
padding: 1px 4px;
|
| 691 |
-
}
|
| 692 |
-
#wpadminbar .eddtb-search-go {
|
| 693 |
-
-webkit-border-radius: 11px;
|
| 694 |
-
-moz-border-radius: 11px;
|
| 695 |
-
border-radius: 11px;
|
| 696 |
-
font-size: 0.67em;
|
| 697 |
-
margin: 0 0 0 2px;
|
| 698 |
-
}
|
| 699 |
-
@font-face {
|
| 700 |
-
font-family: 'FontAwesome';
|
| 701 |
-
src: url('<?php echo $final_path . "shared/fonts/fontawesome/fontawesome-webfont.eot";?>');
|
| 702 |
-
src: url('<?php echo $final_path . "shared/fonts/fontawesome/fontawesome-webfont.eot";?>') format('embedded-opentype'),
|
| 703 |
-
url('<?php echo $final_path . "shared/fonts/fontawesome/fontawesome-webfont.woff?v=3.0.2"?>') format('woff'),
|
| 704 |
-
url('<?php echo $final_path . "shared/fonts/fontawesome/fontawesome-webfont.ttf?v=3.0.2"?>') format('truetype');
|
| 705 |
-
font-weight: normal;
|
| 706 |
-
font-style: normal;
|
| 707 |
-
}
|
| 708 |
-
#wp-admin-bar-inbound-cta a:first-child, #wp-admin-bar-inbound-inboundtemplates .ab-item.ab-empty-item, #wp-admin-bar-inbound-inboundsettings .ab-item.ab-empty-item, #wp-admin-bar-inbound-inboundreports a:first-child {
|
| 709 |
-
padding-left: 30px;
|
| 710 |
-
}
|
| 711 |
-
#wp-admin-bar-inbound-inboundtemplates .ab-item.ab-empty-item:hover, #wp-admin-bar-inbound-inboundsettings .ab-item.ab-empty-item:hover {
|
| 712 |
-
color: #2ea2cc;
|
| 713 |
-
}
|
| 714 |
-
#wp-admin-bar-inbound-leads a:first-child, #wp-admin-bar-inbound-inboundseo a:first-child {
|
| 715 |
-
padding-left: 31px;
|
| 716 |
-
}
|
| 717 |
-
#wp-admin-bar-inbound-landingpages a:first-child, #wp-admin-bar-inbound-inboundforms a:first-child{
|
| 718 |
-
padding-left: 31px;
|
| 719 |
-
}
|
| 720 |
-
#wp-admin-bar-inbound-cta .ab-submenu a, #wp-admin-bar-inbound-leads .ab-submenu a, #wp-admin-bar-inbound-landingpages .ab-submenu a , #wp-admin-bar-inbound-inboundforms .ab-submenu a, #wp-admin-bar-inbound-inboundtemplates .ab-submenu a, #wp-admin-bar-inbound-inboundreports .ab-submenu a, #wp-admin-bar-inbound-inboundseo .ab-submenu a{
|
| 721 |
-
padding-left: 10px;
|
| 722 |
-
}
|
| 723 |
-
#wp-admin-bar-inbound-cta:before, #wp-admin-bar-inbound-leads:before, #wp-admin-bar-inbound-landingpages:before, #wp-admin-bar-inbound-inboundforms:before, #wp-admin-bar-inbound-inboundtemplates:before, #wp-admin-bar-inbound-inboundsettings:before, #wp-admin-bar-inbound-inboundreports:before, #wp-admin-bar-inbound-inboundseo:before {
|
| 724 |
-
font-family: "FontAwesome" !important;
|
| 725 |
-
content: "\f05b" !important;
|
| 726 |
-
font: 100 19px/1 "FontAwesome" !important;
|
| 727 |
-
padding-top: 4px;
|
| 728 |
-
width: 30px;
|
| 729 |
-
display: inline-block;
|
| 730 |
-
height: 30px;
|
| 731 |
-
position: absolute;
|
| 732 |
-
left: 6px;
|
| 733 |
-
}
|
| 734 |
-
#wp-admin-bar-inbound-leads:before {
|
| 735 |
-
content: "\f0c0" !important;
|
| 736 |
-
font: 100 17px/1 "FontAwesome" !important;
|
| 737 |
-
}
|
| 738 |
-
#wp-admin-bar-inbound-landingpages:before {
|
| 739 |
-
content: "\f15c" !important;
|
| 740 |
-
left: 7px;
|
| 741 |
-
font-size: 21px !important;
|
| 742 |
-
}
|
| 743 |
-
#wp-admin-bar-inbound-inboundforms:before {
|
| 744 |
-
font: 400 18px/1 dashicons!important;
|
| 745 |
-
content: "\f163" !important;
|
| 746 |
-
}
|
| 747 |
-
#wp-admin-bar-inbound-inboundtemplates:before {
|
| 748 |
-
content: "\f0c5" !important;
|
| 749 |
-
font-size: 18px !important;
|
| 750 |
-
}
|
| 751 |
-
#wp-admin-bar-inbound-inboundsettings:before {
|
| 752 |
-
content: "\f013" !important;
|
| 753 |
-
left: 7px !important;
|
| 754 |
-
}
|
| 755 |
-
#wp-admin-bar-inbound-inboundreports:before {
|
| 756 |
-
content: "\f012" !important;
|
| 757 |
-
font-size: 17px !important;
|
| 758 |
-
}
|
| 759 |
-
#wp-admin-bar-inbound-inboundseo:before {
|
| 760 |
-
content: "\f002" !important;
|
| 761 |
-
font-size: 17px !important;
|
| 762 |
-
}
|
| 763 |
-
#wp-admin-bar-inbound-cta a {
|
| 764 |
-
vertical-align: top;
|
| 765 |
-
}
|
| 766 |
-
#adminmenu .menu-icon-wp-call-to-action div.wp-menu-image:before {
|
| 767 |
-
font-family: "FontAwesome" !important;
|
| 768 |
-
content: "\f05b";
|
| 769 |
-
font: 400 24px/1 "FontAwesome" !important;
|
| 770 |
-
padding-top: 6px;
|
| 771 |
-
|
| 772 |
-
}
|
| 773 |
-
</style>
|
| 774 |
-
<?php }
|
| 775 |
-
|
| 776 |
-
|
| 777 |
-
|
| 778 |
-
}
|
| 779 |
-
}
|
| 780 |
-
/* Initialize InboundNow Menu
|
| 781 |
-
* --------------------------------------------------------- */
|
| 782 |
-
|
| 783 |
-
InboundMenu::init();
|
| 784 |
-
|
| 785 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
/* Inbound Now Menu Class */
|
| 3 |
+
if ( ! defined( 'LANDINGPAGES_TEXT_DOMAIN' ) ) {
|
| 4 |
+
define('LANDINGPAGES_TEXT_DOMAIN', 'landing-pages' );
|
| 5 |
+
}
|
| 6 |
+
if (!class_exists('InboundMenu')) {
|
| 7 |
+
class InboundMenu {
|
| 8 |
+
static $add_menu;
|
| 9 |
+
|
| 10 |
+
/* Contruct
|
| 11 |
+
* --------------------------------------------------------- */
|
| 12 |
+
static function init() {
|
| 13 |
+
self::$add_menu = true;
|
| 14 |
+
|
| 15 |
+
add_action('admin_bar_menu', array( __CLASS__, 'loads' ), 98);
|
| 16 |
+
add_action( 'wp_head', array(__CLASS__, 'menu_admin_head'));
|
| 17 |
+
add_action( 'admin_head', array(__CLASS__, 'menu_admin_head'));
|
| 18 |
+
}
|
| 19 |
+
|
| 20 |
+
/* Loads
|
| 21 |
+
* --------------------------------------------------------- */
|
| 22 |
+
static function loads($hook) {
|
| 23 |
+
if ( ! self::$add_menu )
|
| 24 |
+
return;
|
| 25 |
+
global $wp_admin_bar, $locale, $edd_options, $eddtb_edd_name, $eddtb_edd_name_tooltip;
|
| 26 |
+
|
| 27 |
+
/** Get the proper 'Download' post type ID/tag */
|
| 28 |
+
if ( post_type_exists( 'landing-page' ) ) {
|
| 29 |
+
$eddtb_download_cpt = 'landing-page';
|
| 30 |
+
} elseif ( post_type_exists( 'landing-page' ) ) {
|
| 31 |
+
$eddtb_download_cpt = 'landing-page';
|
| 32 |
+
} else {
|
| 33 |
+
$eddtb_download_cpt = '';
|
| 34 |
+
}
|
| 35 |
+
|
| 36 |
+
// CHECK FOR ACTIVE PLUGINS
|
| 37 |
+
$leads_status = FALSE; $landing_page_status = FALSE; $cta_status = FALSE;
|
| 38 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('leads/wordpress-leads.php')) {
|
| 39 |
+
$leads_status = TRUE;
|
| 40 |
+
$leads_version_number = defined( 'WPL_CURRENT_VERSION' ) ? 'v' . WPL_CURRENT_VERSION : '';
|
| 41 |
+
}
|
| 42 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('landing-pages/landing-pages.php')) {
|
| 43 |
+
$landing_page_status = TRUE;
|
| 44 |
+
$landing_page_version_number = defined( 'LANDINGPAGES_CURRENT_VERSION' ) ? 'v' . LANDINGPAGES_CURRENT_VERSION : '';
|
| 45 |
+
|
| 46 |
+
}
|
| 47 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('cta/wordpress-cta.php')) {
|
| 48 |
+
$cta_status = TRUE;
|
| 49 |
+
$cta_number = defined( 'WP_CTA_CURRENT_VERSION' ) ? 'v' . WP_CTA_CURRENT_VERSION : '';
|
| 50 |
+
}
|
| 51 |
+
|
| 52 |
+
if ( $leads_status == FALSE && $landing_page_status == FALSE && $cta_status == FALSE ) {
|
| 53 |
+
|
| 54 |
+
return; // end plugin is
|
| 55 |
+
|
| 56 |
+
}
|
| 57 |
+
/** EDD version number for later use */
|
| 58 |
+
$edd_version_number = defined( 'EDD_VERSION' ) ? 'v' . EDD_VERSION : '';
|
| 59 |
+
|
| 60 |
+
/** Resources links EDD settings check*/
|
| 61 |
+
$eddtb_resources_check = 'default';
|
| 62 |
+
|
| 63 |
+
if ( ( ! isset( $edd_options['eddtb_remove_resources'] ) && ! isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 64 |
+
|| ( isset( $edd_options['eddtb_remove_resources'] ) && ! isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 65 |
+
|| ( ! isset( $edd_options['eddtb_remove_resources'] ) && isset( $edd_options['eddtb_remove_translation_resources'] ) )
|
| 66 |
+
|
| 67 |
+
) {
|
| 68 |
+
|
| 69 |
+
$eddtb_resources_check = 'eddtb_resources_yes';
|
| 70 |
+
|
| 71 |
+
} // end-if resources settings check
|
| 72 |
+
|
| 73 |
+
|
| 74 |
+
/**
|
| 75 |
+
* Allows for filtering the general user role/capability to display main & sub-level items
|
| 76 |
+
*
|
| 77 |
+
* Default capability: 'edit_posts' (we need this for the "Downloads" post type set by EDD itself!)
|
| 78 |
+
*
|
| 79 |
+
* @since 1.0.0
|
| 80 |
+
*/
|
| 81 |
+
$eddtb_cap_default = class_exists( 'EDD_Roles' ) ? 'edit_products' : 'edit_posts';
|
| 82 |
+
$eddtb_filter_capability = apply_filters( 'eddtb_filter_capability_all', $eddtb_cap_default );
|
| 83 |
+
|
| 84 |
+
// Exit if admin bar not there
|
| 85 |
+
if ( ! is_user_logged_in() || ! is_admin_bar_showing() ) {
|
| 86 |
+
return;
|
| 87 |
+
}
|
| 88 |
+
|
| 89 |
+
/** Set unique prefix */
|
| 90 |
+
$prefix = 'inbound-';
|
| 91 |
+
/** Create parent menu item references */
|
| 92 |
+
$inbounddocs = $prefix . 'inbounddocs'; // sub level: edd docs
|
| 93 |
+
$inbounddocsquick = $prefix . 'inbounddocsquick'; // third level: docs quick links
|
| 94 |
+
$inbounddocssections = $prefix . 'inbounddocssections'; // third level: docs sections
|
| 95 |
+
$inboundreports = $prefix . 'inboundreports'; // sub level: edd reports
|
| 96 |
+
$inboundgroup = $prefix . 'inboundgroup'; // sub level: edd group (resources)
|
| 97 |
+
$inboundbar = $prefix . 'admin-bar'; // root level
|
| 98 |
+
$inboundsupport = $prefix . 'inboundsupport'; // sub level: edd support
|
| 99 |
+
$inboundsupportsections = $prefix . 'inboundsupportsections'; // third level: support sections
|
| 100 |
+
$inboundsupportaccount = $prefix . 'inboundsupportaccount'; // third level: support user account
|
| 101 |
+
$inboundsites = $prefix . 'inboundsites'; // sub level: edd sites
|
| 102 |
+
$inbounddebug = $prefix . 'inbounddebug';
|
| 103 |
+
$inboundsitesaccount = $prefix . 'inboundsitesaccount';
|
| 104 |
+
$inboundsitesextensions = $prefix . 'inboundsitesextensions'; // third level: edd extensions
|
| 105 |
+
$landingpages_menu = $prefix . 'landingpages';
|
| 106 |
+
$cta_menu = $prefix . 'cta';
|
| 107 |
+
$leads_menu = $prefix . 'leads';
|
| 108 |
+
$form_menu = $prefix . 'inboundforms';
|
| 109 |
+
$settings_menu = $prefix . 'inboundsettings';
|
| 110 |
+
$templates_menu = $prefix . 'inboundtemplates';
|
| 111 |
+
$landingpagesettings = $prefix . 'landingpagesettings';
|
| 112 |
+
$ctasettings = $prefix . 'ctasettings';
|
| 113 |
+
$landing_pages_templates = $prefix . 'landingpagetemplates';
|
| 114 |
+
$cta_templates = $prefix . 'ctatemplates';
|
| 115 |
+
|
| 116 |
+
/** Make the "EDD" name filterable within menu items */
|
| 117 |
+
$eddtb_edd_name = apply_filters( 'eddtb_filter_edd_name', __( 'EDD', 'edd-toolbar' ) );
|
| 118 |
+
|
| 119 |
+
/** Make the "Easy Digital Downloads" name's tooltip filterable within menu items */
|
| 120 |
+
$eddtb_edd_name_tooltip = apply_filters( 'eddtb_filter_edd_name_tooltip', _x( 'Easy Digital Downloads', 'Translators: For the tooltip', 'edd-toolbar' ) );
|
| 121 |
+
|
| 122 |
+
|
| 123 |
+
/** "Sub Forum" string */
|
| 124 |
+
$eddtb_sub_forum = __( 'Sub Forum', 'edd-toolbar' ) . ': ';
|
| 125 |
+
|
| 126 |
+
/** For the Documentation search */
|
| 127 |
+
$eddtb_search_docs = __( 'Search Docs', 'edd-toolbar' );
|
| 128 |
+
$eddtb_go_button = '<input type="submit" value="' . __( 'GO', 'edd-toolbar' ) . '" class="eddtb-search-go" /></form>';
|
| 129 |
+
|
| 130 |
+
/** Show these items only if Inbound Now plugin is actually installed */
|
| 131 |
+
if ( $leads_status == TRUE || $landing_page_status == TRUE || $cta_status == TRUE ) {
|
| 132 |
+
|
| 133 |
+
/** Set EDD active variable for later user */
|
| 134 |
+
$edd_active = 'edd_is_active';
|
| 135 |
+
|
| 136 |
+
/** EDD main downloads section */
|
| 137 |
+
if ( current_user_can( 'edit_posts' ) && $landing_page_status) {
|
| 138 |
+
|
| 139 |
+
$menu_items['landingpages'] = array(
|
| 140 |
+
'parent' => $inboundbar,
|
| 141 |
+
'title' => __( 'Landing Pages', LANDINGPAGES_TEXT_DOMAIN ),
|
| 142 |
+
'href' => admin_url( 'edit.php?post_type=landing-page' ),
|
| 143 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 144 |
+
);
|
| 145 |
+
$menu_items['landingpages-view'] = array(
|
| 146 |
+
'parent' => $landingpages_menu,
|
| 147 |
+
'title' => __( 'View Landing Pages List', LANDINGPAGES_TEXT_DOMAIN ),
|
| 148 |
+
'href' => admin_url( 'edit.php?post_type=landing-page' ),
|
| 149 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 150 |
+
);
|
| 151 |
+
$menu_items['landingpages-add'] = array(
|
| 152 |
+
'parent' => $landingpages_menu,
|
| 153 |
+
'title' => __( 'Add New Landing Page', LANDINGPAGES_TEXT_DOMAIN ),
|
| 154 |
+
'href' => admin_url( 'post-new.php?post_type=landing-page' ),
|
| 155 |
+
'meta' => array( 'target' => '', 'title' => __( 'Add new Landing Page', 'edd-toolbar' ) )
|
| 156 |
+
);
|
| 157 |
+
|
| 158 |
+
$menu_items['landingpages-categories'] = array(
|
| 159 |
+
'parent' => $landingpages_menu,
|
| 160 |
+
'title' => __( 'Categories', LANDINGPAGES_TEXT_DOMAIN ),
|
| 161 |
+
'href' => admin_url( 'edit-tags.php?taxonomy=landing_page_category&post_type=landing-page' ),
|
| 162 |
+
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Categories', 'edd-toolbar' ) )
|
| 163 |
+
);
|
| 164 |
+
if ( current_user_can( 'manage_options' )) {
|
| 165 |
+
$menu_items['landingpages-settings'] = array(
|
| 166 |
+
'parent' => $landingpages_menu,
|
| 167 |
+
'title' => __( 'Settings', LANDINGPAGES_TEXT_DOMAIN ),
|
| 168 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 169 |
+
'meta' => array( 'target' => '', 'title' => __( 'Manage Landing Page Settings', 'edd-toolbar' ) )
|
| 170 |
+
);
|
| 171 |
+
}
|
| 172 |
+
//
|
| 173 |
+
}
|
| 174 |
+
|
| 175 |
+
/** EDD main downloads section */
|
| 176 |
+
if ( current_user_can( 'edit_posts' ) && $cta_status) {
|
| 177 |
+
|
| 178 |
+
$menu_items['cta'] = array(
|
| 179 |
+
'parent' => $inboundbar,
|
| 180 |
+
'title' => __( 'Call to Actions', LANDINGPAGES_TEXT_DOMAIN ),
|
| 181 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action' ),
|
| 182 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 183 |
+
);
|
| 184 |
+
$menu_items['cta-view'] = array(
|
| 185 |
+
'parent' => $cta_menu,
|
| 186 |
+
'title' => __( 'View Calls to Action List', LANDINGPAGES_TEXT_DOMAIN ),
|
| 187 |
+
'href' => admin_url( 'post-new.php?post_type=wp-call-to-action' ),
|
| 188 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Landing Pages', 'edd-toolbar' ) )
|
| 189 |
+
);
|
| 190 |
+
$menu_items['cta-add'] = array(
|
| 191 |
+
'parent' => $cta_menu,
|
| 192 |
+
'title' => __( 'Add New Call to Action', LANDINGPAGES_TEXT_DOMAIN ),
|
| 193 |
+
'href' => admin_url( 'post-new.php?post_type=wp-call-to-action' ),
|
| 194 |
+
'meta' => array( 'target' => '', 'title' => __( 'Add new call to action', 'edd-toolbar' ) )
|
| 195 |
+
);
|
| 196 |
+
|
| 197 |
+
$menu_items['cta-categories'] = array(
|
| 198 |
+
'parent' => $cta_menu,
|
| 199 |
+
'title' => __( 'Categories', LANDINGPAGES_TEXT_DOMAIN ),
|
| 200 |
+
'href' => admin_url( 'edit-tags.php?taxonomy=wp_call_to_action_category&post_type=wp-call-to-action' ),
|
| 201 |
+
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Categories', 'edd-toolbar' ) )
|
| 202 |
+
);
|
| 203 |
+
if ( current_user_can( 'manage_options' )) {
|
| 204 |
+
$menu_items['cta-settings'] = array(
|
| 205 |
+
'parent' => $cta_menu,
|
| 206 |
+
'title' => __( 'Settings', LANDINGPAGES_TEXT_DOMAIN ),
|
| 207 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 208 |
+
'meta' => array( 'target' => '', 'title' => __( 'Manage Call to Action Settings', 'edd-toolbar' ) )
|
| 209 |
+
);
|
| 210 |
+
}
|
| 211 |
+
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
/** admin settings sections */
|
| 215 |
+
if ( current_user_can( 'manage_options' )) {
|
| 216 |
+
// Leads Menu
|
| 217 |
+
if ($leads_status) {
|
| 218 |
+
$menu_items['leads'] = array(
|
| 219 |
+
'parent' => $inboundbar,
|
| 220 |
+
'title' => __( 'Leads', 'edd-toolbar' ),
|
| 221 |
+
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 222 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Manage Forms', 'edd-toolbar' ) )
|
| 223 |
+
);
|
| 224 |
+
/** Leads search form */
|
| 225 |
+
$leads_search_text = "Search All Leads";
|
| 226 |
+
$menu_items['leads-search'] = array(
|
| 227 |
+
'parent' => $leads_menu,
|
| 228 |
+
'title' => '<form id="inbound-menu-form" method="get" action="'.admin_url( 'edit.php?post_type=wp-lead' ).'" class=" " target="_blank">
|
| 229 |
+
<input id="search-inbound-menu" type="text" placeholder="' . $leads_search_text . '" onblur="this.value=(this.value==\'\') ? \'' . $leads_search_text . '\' : this.value;" onfocus="this.value=(this.value==\'' . $leads_search_text . '\') ? \'\' : this.value;" value="' . $leads_search_text . '" name="s" value="' . esc_attr( 'Search Leads', 'edd-toolbar' ) . '" class="text eddtb-search-input" />
|
| 230 |
+
<input type="hidden" name="post_type" value="wp-lead" />
|
| 231 |
+
<input type="hidden" name="post_status" value="all" />
|
| 232 |
+
' . $eddtb_go_button,
|
| 233 |
+
'href' => false,
|
| 234 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Search Leads', 'Translators: For the tooltip', 'edd-toolbar' ) )
|
| 235 |
+
);
|
| 236 |
+
$menu_items['leads-view'] = array(
|
| 237 |
+
'parent' => $leads_menu,
|
| 238 |
+
'title' => __( 'View All Leads', LANDINGPAGES_TEXT_DOMAIN ),
|
| 239 |
+
'href' => admin_url( 'edit.php?post_type=wp-lead' ),
|
| 240 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Forms', 'edd-toolbar' ) )
|
| 241 |
+
);
|
| 242 |
+
$menu_items['leads-list'] = array(
|
| 243 |
+
'parent' => $leads_menu,
|
| 244 |
+
'title' => __( 'View Lead Lists', LANDINGPAGES_TEXT_DOMAIN ),
|
| 245 |
+
'href' => admin_url( 'edit.php?post_type=list' ),
|
| 246 |
+
'meta' => array( 'target' => '', 'title' => __( 'View Lead Lists', 'edd-toolbar' ) )
|
| 247 |
+
);
|
| 248 |
+
$menu_items['leads-add'] = array(
|
| 249 |
+
'parent' => $leads_menu,
|
| 250 |
+
'title' => __( 'Create New Lead', LANDINGPAGES_TEXT_DOMAIN ),
|
| 251 |
+
'href' => admin_url( 'post-new.php?post_type=wp-lead' ),
|
| 252 |
+
'meta' => array( 'target' => '', 'title' => __( 'Add new lead', 'edd-toolbar' ) )
|
| 253 |
+
);
|
| 254 |
+
}
|
| 255 |
+
|
| 256 |
+
|
| 257 |
+
$menu_items['inboundforms'] = array(
|
| 258 |
+
'parent' => $inboundbar,
|
| 259 |
+
'title' => __( 'Manage Forms', 'edd-toolbar' ),
|
| 260 |
+
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 261 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Manage Forms', 'edd-toolbar' ) )
|
| 262 |
+
);
|
| 263 |
+
$menu_items['inboundforms-view'] = array(
|
| 264 |
+
'parent' => $form_menu,
|
| 265 |
+
'title' => __( 'View All Forms', LANDINGPAGES_TEXT_DOMAIN ),
|
| 266 |
+
'href' => admin_url( 'edit.php?post_type=inbound-forms' ),
|
| 267 |
+
'meta' => array( 'target' => '', 'title' => __( 'View All Forms', 'edd-toolbar' ) )
|
| 268 |
+
);
|
| 269 |
+
$menu_items['inboundforms-add'] = array(
|
| 270 |
+
'parent' => $form_menu,
|
| 271 |
+
'title' => __( 'Create New Form', LANDINGPAGES_TEXT_DOMAIN ),
|
| 272 |
+
'href' => admin_url( 'post-new.php?post_type=inbound-forms' ),
|
| 273 |
+
'meta' => array( 'target' => '', 'title' => __( 'Add new call to action', 'edd-toolbar' ) )
|
| 274 |
+
);
|
| 275 |
+
/** Template Setup */
|
| 276 |
+
if ($landing_page_status || $cta_status) {
|
| 277 |
+
|
| 278 |
+
$menu_items['inboundtemplates'] = array(
|
| 279 |
+
'parent' => $inboundbar,
|
| 280 |
+
'title' => __( 'Manage Templates', 'edd-toolbar' ),
|
| 281 |
+
'href' => "",
|
| 282 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Manage Templates', 'edd-toolbar' ) )
|
| 283 |
+
);
|
| 284 |
+
$menu_items['getmoretemplates'] = array(
|
| 285 |
+
'parent' => $templates_menu,
|
| 286 |
+
'title' => __( 'Download More Templates', 'edd-toolbar' ),
|
| 287 |
+
'href' => "http://www.inboundnow.com/market",
|
| 288 |
+
'meta' => array( 'target' => '', 'title' => __( 'Download More Templates', 'edd-toolbar' ) )
|
| 289 |
+
);
|
| 290 |
+
if ($landing_page_status){
|
| 291 |
+
$menu_items['landingpagetemplates'] = array(
|
| 292 |
+
'parent' => $templates_menu,
|
| 293 |
+
'title' => __( 'Landing Page Templates', 'edd-toolbar' ),
|
| 294 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_manage_templates' ),
|
| 295 |
+
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Settings', 'edd-toolbar' ) )
|
| 296 |
+
);
|
| 297 |
+
|
| 298 |
+
$menu_items['landingpagetemplates-main'] = array(
|
| 299 |
+
'parent' => $landing_pages_templates,
|
| 300 |
+
'title' => __( 'Add New Landing Page Templates', 'edd-toolbar' ),
|
| 301 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_manage_templates' ),
|
| 302 |
+
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 303 |
+
);
|
| 304 |
+
}
|
| 305 |
+
if ($cta_status){
|
| 306 |
+
$menu_items['ctatemplates'] = array(
|
| 307 |
+
'parent' => $templates_menu,
|
| 308 |
+
'title' => __( 'Call to Action Templates', 'edd-toolbar' ),
|
| 309 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_manage_templates' ),
|
| 310 |
+
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 311 |
+
);
|
| 312 |
+
|
| 313 |
+
$menu_items['ctatemplates-main'] = array(
|
| 314 |
+
'parent' => $cta_templates,
|
| 315 |
+
'title' => __( 'Add New CTA Templates', 'edd-toolbar' ),
|
| 316 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_manage_templates' ),
|
| 317 |
+
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 318 |
+
);
|
| 319 |
+
}
|
| 320 |
+
|
| 321 |
+
}
|
| 322 |
+
/** Settings Items */
|
| 323 |
+
$menu_items['inboundsettings'] = array(
|
| 324 |
+
'parent' => $inboundbar,
|
| 325 |
+
'title' => __( 'Global Settings', 'edd-toolbar' ),
|
| 326 |
+
'href' => "",
|
| 327 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Manage Settings', 'edd-toolbar' ) )
|
| 328 |
+
);
|
| 329 |
+
if ($landing_page_status){
|
| 330 |
+
$menu_items['landingpagesettings'] = array(
|
| 331 |
+
'parent' => $settings_menu,
|
| 332 |
+
'title' => __( 'Landing Page Settings', 'edd-toolbar' ),
|
| 333 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 334 |
+
'meta' => array( 'target' => '', 'title' => __( 'Landing Page Settings', 'edd-toolbar' ) )
|
| 335 |
+
);
|
| 336 |
+
/*
|
| 337 |
+
$menu_items['landingpagesettings-main'] = array(
|
| 338 |
+
'parent' => $landingpagesettings,
|
| 339 |
+
'title' => __( 'Main', 'edd-toolbar' ),
|
| 340 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=lp_global_settings' ),
|
| 341 |
+
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 342 |
+
); */
|
| 343 |
+
}
|
| 344 |
+
if ($cta_status){
|
| 345 |
+
$menu_items['ctasettings'] = array(
|
| 346 |
+
'parent' => $settings_menu,
|
| 347 |
+
'title' => __( 'Call to Action Settings', 'edd-toolbar' ),
|
| 348 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 349 |
+
'meta' => array( 'target' => '', 'title' => __( 'Call to Action Settings', 'edd-toolbar' ) )
|
| 350 |
+
);
|
| 351 |
+
/*
|
| 352 |
+
$menu_items['ctasettings-main'] = array(
|
| 353 |
+
'parent' => $ctasettings,
|
| 354 |
+
'title' => __( 'Main', 'edd-toolbar' ),
|
| 355 |
+
'href' => admin_url( 'edit.php?post_type=wp-call-to-action&page=wp_cta_global_settings' ),
|
| 356 |
+
'meta' => array( 'target' => '', 'title' => __( 'Global Settings', 'edd-toolbar' ) )
|
| 357 |
+
); */
|
| 358 |
+
}
|
| 359 |
+
if ($leads_status){
|
| 360 |
+
$menu_items['leadssettings'] = array(
|
| 361 |
+
'parent' => $settings_menu,
|
| 362 |
+
'title' => __( 'Lead Settings', 'edd-toolbar' ),
|
| 363 |
+
'href' => admin_url( 'edit.php?post_type=wp-lead&page=wpleads_global_settings' ),
|
| 364 |
+
'meta' => array( 'target' => '', 'title' => __( 'Lead Settings', 'edd-toolbar' ) )
|
| 365 |
+
);
|
| 366 |
+
}
|
| 367 |
+
|
| 368 |
+
$menu_items['inboundreports'] = array(
|
| 369 |
+
'parent' => $inboundbar,
|
| 370 |
+
'title' => __( 'Analytics (coming soon)', 'edd-toolbar' ),
|
| 371 |
+
'href' => '#',
|
| 372 |
+
'meta' => array( 'target' => '', 'title' => __( 'Analytics (coming soon)', 'edd-toolbar' ) )
|
| 373 |
+
);
|
| 374 |
+
|
| 375 |
+
if (function_exists( 'is_plugin_active' ) && is_plugin_active('wordpress-seo/wp-seo.php')) {
|
| 376 |
+
$menu_items['inboundseo'] = array(
|
| 377 |
+
'parent' => $inboundbar,
|
| 378 |
+
'title' => __( 'SEO by Yoast', 'edd-toolbar' ),
|
| 379 |
+
'href' => admin_url( 'admin.php?page=wpseo_dashboard' ),
|
| 380 |
+
'meta' => array( 'target' => '', 'title' => __( 'Manage SEO Settings', 'edd-toolbar' ) )
|
| 381 |
+
);
|
| 382 |
+
}
|
| 383 |
+
|
| 384 |
+
$inboundsecondary_menu_items['inboundsupport'] = array(
|
| 385 |
+
'parent' => $inboundgroup,
|
| 386 |
+
'title' => __( 'Support Forum', 'edd-toolbar' ),
|
| 387 |
+
'href' => 'https://www.inboundnow.com/support/',
|
| 388 |
+
'meta' => array( 'target' => '_blank' , 'title' => __( 'Support Forum', 'edd-toolbar' ) )
|
| 389 |
+
);
|
| 390 |
+
|
| 391 |
+
/** Documentation menu items */
|
| 392 |
+
$inboundsecondary_menu_items['inbounddocs'] = array(
|
| 393 |
+
'parent' => $inboundgroup,
|
| 394 |
+
'title' => __( 'Documentation', 'edd-toolbar' ),
|
| 395 |
+
'href' => 'http://docs.inboundnow.com/',
|
| 396 |
+
'meta' => array( 'title' => __( 'Documentation', 'edd-toolbar' ) )
|
| 397 |
+
);
|
| 398 |
+
|
| 399 |
+
/** Docs search form */
|
| 400 |
+
$inboundsecondary_menu_items['inbounddocs-searchform'] = array(
|
| 401 |
+
'parent' => $inboundgroup,
|
| 402 |
+
'title' => '<form method="get" id="inbound-menu-form" action="http://www.inboundnow.com/support/search/?action=bbp-search-request" class=" " target="_blank">
|
| 403 |
+
<input id="search-inbound-menu" type="text" placeholder="' . $eddtb_search_docs . '" onblur="this.value=(this.value==\'\') ? \'' . $eddtb_search_docs . '\' : this.value;" onfocus="this.value=(this.value==\'' . $eddtb_search_docs . '\') ? \'\' : this.value;" value="' . $eddtb_search_docs . '" name="bbp_search" value="' . esc_attr( 'Search Docs', 'edd-toolbar' ) . '" class="text eddtb-search-input" />
|
| 404 |
+
<input type="hidden" name="post_type[]" value="docs" />
|
| 405 |
+
<input type="hidden" name="post_type[]" value="page" />' . $eddtb_go_button,
|
| 406 |
+
'href' => false,
|
| 407 |
+
'meta' => array( 'target' => '', 'title' => _x( 'Search Docs', 'Translators: For the tooltip', 'edd-toolbar' ) )
|
| 408 |
+
);
|
| 409 |
+
|
| 410 |
+
/** Easy Digital Downloads HQ menu items */
|
| 411 |
+
$inboundsecondary_menu_items['inboundsites'] = array(
|
| 412 |
+
'parent' => $inboundgroup,
|
| 413 |
+
'title' => __( 'Inbound Now Plugin HQ', 'edd-toolbar' ),
|
| 414 |
+
'href' => 'https://www.inboundnow.com/',
|
| 415 |
+
'meta' => array( 'title' => $eddtb_edd_name_tooltip . ' ' . __( 'Plugin HQ', 'edd-toolbar' ) )
|
| 416 |
+
);
|
| 417 |
+
|
| 418 |
+
/** Easy Digital Downloads HQ menu items */
|
| 419 |
+
$actual_link = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 420 |
+
|
| 421 |
+
$param = (preg_match("/\?/", $actual_link)) ? "&" : '?';
|
| 422 |
+
if (preg_match("/inbound-dequeue-scripts/", $actual_link)) {
|
| 423 |
+
$actual_link = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 424 |
+
} else {
|
| 425 |
+
$actual_link = $actual_link . $param .'inbound-dequeue-scripts';
|
| 426 |
+
}
|
| 427 |
+
$actual_link_two = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 428 |
+
$param_two = (preg_match("/\?/", $actual_link_two)) ? "&" : '?';
|
| 429 |
+
if (preg_match("/inbound_js/", $actual_link_two)) {
|
| 430 |
+
$actual_link_two = "http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]";
|
| 431 |
+
} else {
|
| 432 |
+
$actual_link_two = $actual_link_two . $param_two .'inbound_js';
|
| 433 |
+
}
|
| 434 |
+
$inboundsecondary_menu_items['inbounddebug'] = array(
|
| 435 |
+
'parent' => $inboundgroup,
|
| 436 |
+
'title' => __( '<span style="color:#fff;font-size: 13px;margin-top: -1px;display: inline-block;">Debug Tools</span>', 'edd-toolbar' ),
|
| 437 |
+
'href' => "#",
|
| 438 |
+
'meta' => ""
|
| 439 |
+
);
|
| 440 |
+
$inboundsecondary_menu_items['inbounddebug-checkjs'] = array(
|
| 441 |
+
'parent' => $inbounddebug,
|
| 442 |
+
'title' => __( 'Check for Javascript Errors', 'edd-toolbar' ),
|
| 443 |
+
'href' => $actual_link_two,
|
| 444 |
+
'meta' => array( 'title' => __( 'Click here to check javascript errors on this page', 'edd-toolbar' ) )
|
| 445 |
+
);
|
| 446 |
+
|
| 447 |
+
$inboundsecondary_menu_items['inbounddebug-turnoffscripts'] = array(
|
| 448 |
+
'parent' => $inbounddebug,
|
| 449 |
+
'title' => __( 'Remove Javascript Errors', 'edd-toolbar' ),
|
| 450 |
+
'href' => $actual_link,
|
| 451 |
+
'meta' => array( 'title' => __( 'Click here to remove broken javascript to fix issues', 'edd-toolbar' ) )
|
| 452 |
+
);
|
| 453 |
+
|
| 454 |
+
/** HQ: GitHub */
|
| 455 |
+
$inboundsecondary_menu_items['inboundsites-dev'] = array(
|
| 456 |
+
'parent' => $inboundsites,
|
| 457 |
+
'title' => __( 'GitHub Repository Developer Center', 'edd-toolbar' ),
|
| 458 |
+
'href' => 'https://github.com/inboundnow',
|
| 459 |
+
'meta' => array( 'title' => __( 'GitHub Repository Developer Center', 'edd-toolbar' ) )
|
| 460 |
+
);
|
| 461 |
+
|
| 462 |
+
/** HQ: Blog */
|
| 463 |
+
$inboundsecondary_menu_items['inboundsites-blog'] = array(
|
| 464 |
+
'parent' => $inboundsites,
|
| 465 |
+
'title' => __( 'Official Blog', 'edd-toolbar' ),
|
| 466 |
+
'href' => 'https://www.inboundnow.com/blog/',
|
| 467 |
+
'meta' => array( 'title' => __( 'Official Blog', 'edd-toolbar' ) )
|
| 468 |
+
);
|
| 469 |
+
|
| 470 |
+
/** HQ: Site Account */
|
| 471 |
+
$inboundsecondary_menu_items['inboundsitesaccount'] = array(
|
| 472 |
+
'parent' => $inboundsites,
|
| 473 |
+
'title' => __( 'My Account', 'edd-toolbar' ),
|
| 474 |
+
'href' => 'https://www.inboundnow.com/marketplace/account/',
|
| 475 |
+
'meta' => array( 'title' => __( 'My Account', 'edd-toolbar' ) )
|
| 476 |
+
);
|
| 477 |
+
|
| 478 |
+
$inboundsecondary_menu_items['inboundsitesaccount-history'] = array(
|
| 479 |
+
'parent' => $inboundsitesaccount,
|
| 480 |
+
'title' => __( 'Purchase History', 'edd-toolbar' ),
|
| 481 |
+
'href' => 'https://www.inboundnow.com/marketplace/account/purchase-history/',
|
| 482 |
+
'meta' => array( 'title' => __( 'Purchase History', 'edd-toolbar' ) )
|
| 483 |
+
);
|
| 484 |
+
/*
|
| 485 |
+
$menu_items['edd-systeminfo'] = array(
|
| 486 |
+
'parent' => $inboundgroup,
|
| 487 |
+
'title' => __( 'System Info (Debug)', 'edd-toolbar' ),
|
| 488 |
+
'href' => admin_url( 'edit.php?post_type=landing-page&page=edd-system-info' ),
|
| 489 |
+
'meta' => array( 'target' => '', 'title' => __( 'System Info (Debug)', 'edd-toolbar' ) )
|
| 490 |
+
);
|
| 491 |
+
*/
|
| 492 |
+
|
| 493 |
+
|
| 494 |
+
} // end-if global settings/options cap checks (including backward compatibility)
|
| 495 |
+
|
| 496 |
+
} else {
|
| 497 |
+
|
| 498 |
+
/** If Easy Digital Downloads is not active, to avoid PHP notices */
|
| 499 |
+
if ( 'eddtb_resources_yes' == $eddtb_resources_check && $inboundsecondary_menu_items ) {
|
| 500 |
+
$menu_items = $inboundsecondary_menu_items;
|
| 501 |
+
}
|
| 502 |
+
|
| 503 |
+
/** If Easy Digital Downloads is not active and no icon filter is active, then display no icon */
|
| 504 |
+
if ( ! has_filter( 'eddtb_filter_main_icon' ) ) {
|
| 505 |
+
add_filter( 'eddtb_filter_main_item_icon_display', '__eddtb_no_icon_display' );
|
| 506 |
+
}
|
| 507 |
+
|
| 508 |
+
}
|
| 509 |
+
|
| 510 |
+
|
| 511 |
+
|
| 512 |
+
/** Allow menu items to be filtered, but pass in parent menu item IDs */
|
| 513 |
+
$menu_items = (array) apply_filters( 'ddw_eddtb_menu_items', $menu_items, ( 'eddtb_resources_yes' == $eddtb_resources_check ) ? $inboundsecondary_menu_items : '',
|
| 514 |
+
$prefix,
|
| 515 |
+
$inboundbar,
|
| 516 |
+
$inboundsupport,
|
| 517 |
+
$inboundsupportsections,
|
| 518 |
+
$inboundsupportaccount,
|
| 519 |
+
$inbounddocs,
|
| 520 |
+
$inbounddocsquick,
|
| 521 |
+
$inbounddocssections,
|
| 522 |
+
$inboundsites,
|
| 523 |
+
$inboundsitesaccount,
|
| 524 |
+
$inboundsitesextensions,
|
| 525 |
+
$inboundreports,
|
| 526 |
+
$inboundgroup,
|
| 527 |
+
// NEW PREFIXES
|
| 528 |
+
$landingpages_menu,
|
| 529 |
+
$cta_menu,
|
| 530 |
+
$form_menu,
|
| 531 |
+
$settings_menu,
|
| 532 |
+
$templates_menu,
|
| 533 |
+
$landingpagesettings,
|
| 534 |
+
$ctasettings,
|
| 535 |
+
$landing_pages_templates,
|
| 536 |
+
$cta_templates
|
| 537 |
+
); // end of array
|
| 538 |
+
|
| 539 |
+
|
| 540 |
+
/** Filter the main item icon's class/display */
|
| 541 |
+
$eddtb_main_item_icon_display = apply_filters( 'eddtb_filter_main_item_icon_display', 'icon-edd' );
|
| 542 |
+
|
| 543 |
+
$wp_admin_bar->add_menu( array(
|
| 544 |
+
'id' => $inboundbar,
|
| 545 |
+
'title' => __( ' Marketing', 'edd-toolbar' ),
|
| 546 |
+
'href' => "",
|
| 547 |
+
'meta' => array( 'class' => $eddtb_main_item_icon_display, 'title' => 'Inbound Marketing Admin' )
|
| 548 |
+
) );
|
| 549 |
+
|
| 550 |
+
|
| 551 |
+
/** Loop through the menu items */
|
| 552 |
+
foreach ( $menu_items as $id => $menu_item ) {
|
| 553 |
+
|
| 554 |
+
/** Add in the item ID */
|
| 555 |
+
$menu_item['id'] = $prefix . $id;
|
| 556 |
+
|
| 557 |
+
/** Add meta target to each item where it's not already set, so links open in new window/tab */
|
| 558 |
+
if ( ! isset( $menu_item['meta']['target'] ) )
|
| 559 |
+
$menu_item['meta']['target'] = '_blank';
|
| 560 |
+
|
| 561 |
+
/** Add class to links that open up in a new window/tab */
|
| 562 |
+
if ( '_blank' === $menu_item['meta']['target'] ) {
|
| 563 |
+
if ( ! isset( $menu_item['meta']['class'] ) )
|
| 564 |
+
$menu_item['meta']['class'] = '';
|
| 565 |
+
$menu_item['meta']['class'] .= $prefix . 'eddtb-new-tab';
|
| 566 |
+
}
|
| 567 |
+
|
| 568 |
+
/** Add menu items */
|
| 569 |
+
$wp_admin_bar->add_menu( $menu_item );
|
| 570 |
+
|
| 571 |
+
} // end foreach menu items
|
| 572 |
+
|
| 573 |
+
|
| 574 |
+
/**
|
| 575 |
+
* Action Hook 'eddtb_custom_main_items'
|
| 576 |
+
* allows for hooking other main items in
|
| 577 |
+
*
|
| 578 |
+
* @since 1.2.0
|
| 579 |
+
*/
|
| 580 |
+
do_action( 'eddtb_custom_main_items' );
|
| 581 |
+
|
| 582 |
+
|
| 583 |
+
/** add special blue links
|
| 584 |
+
$wp_admin_bar->add_group( array(
|
| 585 |
+
'parent' => $eddsettings,
|
| 586 |
+
'id' => $eddspecials
|
| 587 |
+
) );
|
| 588 |
+
*/
|
| 589 |
+
|
| 590 |
+
/** Adds search box and sub */
|
| 591 |
+
$wp_admin_bar->add_group( array(
|
| 592 |
+
'parent' => $inboundbar,
|
| 593 |
+
'id' => $inboundgroup,
|
| 594 |
+
'meta' => array( 'class' => 'ab-sub-secondary' )
|
| 595 |
+
) );
|
| 596 |
+
|
| 597 |
+
if (is_array($inboundsecondary_menu_items)) {
|
| 598 |
+
// Load grey secondary items
|
| 599 |
+
foreach ( $inboundsecondary_menu_items as $id => $inboundgroup_menu_item ) {
|
| 600 |
+
|
| 601 |
+
/** EDD Group: Add in the item ID */
|
| 602 |
+
$inboundgroup_menu_item['id'] = $prefix . $id;
|
| 603 |
+
|
| 604 |
+
/** EDD Group: Add meta target to each item where it's not already set, so links open in new window/tab */
|
| 605 |
+
if ( ! isset( $inboundgroup_menu_item['meta']['target'] ) )
|
| 606 |
+
$inboundgroup_menu_item['meta']['target'] = '_blank';
|
| 607 |
+
|
| 608 |
+
/** EDD Group: Add class to links that open up in a new window/tab */
|
| 609 |
+
if ( '_blank' === $inboundgroup_menu_item['meta']['target'] ) {
|
| 610 |
+
|
| 611 |
+
if ( ! isset( $inboundgroup_menu_item['meta']['class'] ) ) {
|
| 612 |
+
$inboundgroup_menu_item['meta']['class'] = '';
|
| 613 |
+
}
|
| 614 |
+
|
| 615 |
+
$inboundgroup_menu_item['meta']['class'] .= $prefix . 'eddtb-new-tab';
|
| 616 |
+
|
| 617 |
+
}
|
| 618 |
+
|
| 619 |
+
/** EDD Group: Add menu items */
|
| 620 |
+
$wp_admin_bar->add_menu( $inboundgroup_menu_item );
|
| 621 |
+
|
| 622 |
+
} // end foreach EDD Group
|
| 623 |
+
}
|
| 624 |
+
|
| 625 |
+
/**
|
| 626 |
+
* Action Hook 'eddtb_custom_group_items'
|
| 627 |
+
* allows for hooking other EDD Group items in
|
| 628 |
+
*
|
| 629 |
+
* @since 1.2.0
|
| 630 |
+
*/
|
| 631 |
+
// do_action( 'eddtb_custom_group_items' );
|
| 632 |
+
|
| 633 |
+
}
|
| 634 |
+
|
| 635 |
+
static function menu_admin_head() {
|
| 636 |
+
/** No styles if admin bar is disabled or user is not logged in or items are disabled via constant */
|
| 637 |
+
if ( ! is_admin_bar_showing() || ! is_user_logged_in() ) {
|
| 638 |
+
return;
|
| 639 |
+
}
|
| 640 |
+
if ( defined( 'WPL_URL' )) {
|
| 641 |
+
$final_path = WPL_URL . "/";
|
| 642 |
+
} else if (defined( 'LANDINGPAGES_URLPATH' )){
|
| 643 |
+
$final_path = LANDINGPAGES_URLPATH;
|
| 644 |
+
} else if (defined( 'WP_CTA_URLPATH' )){
|
| 645 |
+
$final_path = WP_CTA_URLPATH;
|
| 646 |
+
} else {
|
| 647 |
+
$final_path = preg_replace("/\/shared\/inbound-shortcodes\//", "/", INBOUND_FORMS);
|
| 648 |
+
}
|
| 649 |
+
|
| 650 |
+
?>
|
| 651 |
+
<?php }
|
| 652 |
+
|
| 653 |
+
|
| 654 |
+
|
| 655 |
+
}
|
| 656 |
+
}
|
| 657 |
+
/* Initialize InboundNow Menu
|
| 658 |
+
* --------------------------------------------------------- */
|
| 659 |
+
|
| 660 |
+
InboundMenu::init();
|
| 661 |
+
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 662 |
?>
|
shared/functions.templates.php
CHANGED
|
@@ -1,111 +1,111 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
|
| 3 |
-
// Convert Hex to RGB Value for submit button
|
| 4 |
-
if (!function_exists('inbound_Hex_2_RGB')) {
|
| 5 |
-
function inbound_Hex_2_RGB($hex) {
|
| 6 |
-
$hex = preg_replace("/#/", "", $hex);
|
| 7 |
-
$color = array();
|
| 8 |
-
|
| 9 |
-
if(strlen($hex) == 3) {
|
| 10 |
-
$color['r'] = hexdec(substr($hex, 0, 1) . $r);
|
| 11 |
-
$color['g'] = hexdec(substr($hex, 1, 1) . $g);
|
| 12 |
-
$color['b'] = hexdec(substr($hex, 2, 1) . $b);
|
| 13 |
-
}
|
| 14 |
-
else if(strlen($hex) == 6) {
|
| 15 |
-
$color['r'] = hexdec(substr($hex, 0, 2));
|
| 16 |
-
$color['g'] = hexdec(substr($hex, 2, 2));
|
| 17 |
-
$color['b'] = hexdec(substr($hex, 4, 2));
|
| 18 |
-
}
|
| 19 |
-
return $color;
|
| 20 |
-
}
|
| 21 |
-
}
|
| 22 |
-
/**
|
| 23 |
-
* Grabs Color Scheme from Hex Color. Returns lighter & darker versions of the orignal hex color
|
| 24 |
-
*
|
| 25 |
-
* @access public
|
| 26 |
-
* @since 1.5
|
| 27 |
-
* @param string $hex_color hexidemical color
|
| 28 |
-
* @return array $return_scheme Color Schemes
|
| 29 |
-
*/
|
| 30 |
-
if (!function_exists('inbound_color_scheme')) {
|
| 31 |
-
function inbound_color_scheme($hex_color, $format = 'hex' ){
|
| 32 |
-
if (strpos($hex_color,'#') !== false) {
|
| 33 |
-
$input = $hex_color;
|
| 34 |
-
} else {
|
| 35 |
-
$input = "#" . $hex_color;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
$col = Array(
|
| 39 |
-
hexdec(substr($input,1,2)),
|
| 40 |
-
hexdec(substr($input,3,2)),
|
| 41 |
-
hexdec(substr($input,5,2))
|
| 42 |
-
);
|
| 43 |
-
|
| 44 |
-
$color_scheme_array =
|
| 45 |
-
array(
|
| 46 |
-
100 => array( $col[0]/4, $col[1]/4, $col[2]/4),
|
| 47 |
-
95 => array( $col[0]/3, $col[1]/3, $col[2]/3),
|
| 48 |
-
90 => array( $col[0]/2.7, $col[1]/2.7, $col[2]/2.7),
|
| 49 |
-
85 => array( $col[0]/2.5, $col[1]/2.5, $col[2]/2.5),
|
| 50 |
-
80 => array( $col[0]/2.2, $col[1]/2.2, $col[2]/2.2),
|
| 51 |
-
75 => array( $col[0]/2, $col[1]/2, $col[2]/2),
|
| 52 |
-
70 => array( $col[0]/1.7, $col[1]/1.7, $col[2]/1.7),
|
| 53 |
-
65 => array( $col[0]/1.5, $col[1]/1.5, $col[2]/1.5),
|
| 54 |
-
60 => array( $col[0]/1.3,$col[1]/1.3,$col[2]/1.3),
|
| 55 |
-
55 => array( $col[0]/1.1,$col[1]/1.1,$col[2]/1.1),
|
| 56 |
-
50 => array( $col[0],$col[1],$col[2]),
|
| 57 |
-
45 => array( 255-(255-$col[0])/1.1, 255-(255-$col[1])/1.1, 255-(255-$col[2])/1.1),
|
| 58 |
-
40 => array( 255-(255-$col[0])/1.3, 255-(255-$col[1])/1.3, 255-(255-$col[2])/1.3),
|
| 59 |
-
35 => array( 255-(255-$col[0])/1.5, 255-(255-$col[1])/1.5, 255-(255-$col[2])/1.5),
|
| 60 |
-
30 => array( 255-(255-$col[0])/1.7, 255-(255-$col[1])/1.7, 255-(255-$col[2])/1.7),
|
| 61 |
-
25 => array( 255-(255-$col[0])/2, 255-(255-$col[1])/2, 255-(255-$col[2])/2),
|
| 62 |
-
20 => array( 255-(255-$col[0])/2.2, 255-(255-$col[1])/2.2, 255-(255-$col[2])/2.2),
|
| 63 |
-
15 => array( 255-(255-$col[0])/3, 255-(255-$col[1])/2.7, 255-(255-$col[2])/3),
|
| 64 |
-
10 => array(255-(255-$col[0])/5, 255-(255-$col[1])/5, 255-(255-$col[2])/5),
|
| 65 |
-
5 => array(255-(255-$col[0])/10, 255-(255-$col[1])/10, 255-(255-$col[2])/10),
|
| 66 |
-
0 => array(255-(255-$col[0])/15, 255-(255-$col[1])/15, 255-(255-$col[2])/15)
|
| 67 |
-
);
|
| 68 |
-
|
| 69 |
-
($format === 'hex') ? $sign = "#" : $sign = '';
|
| 70 |
-
$return_scheme = array();
|
| 71 |
-
foreach ($color_scheme_array as $key => $val) {
|
| 72 |
-
|
| 73 |
-
$each_color_return = $sign.sprintf("%02X%02X%02X", $val[0], $val[1], $val[2]);
|
| 74 |
-
$return_scheme[$key] = $each_color_return;
|
| 75 |
-
|
| 76 |
-
}
|
| 77 |
-
//return $closest;
|
| 78 |
-
if(isset($_GET['color_scheme'])) {
|
| 79 |
-
foreach ($return_scheme as $key => $hex_value) {
|
| 80 |
-
echo "<div style='background:$hex_value; display:block; width:100%;'>$key</div>";
|
| 81 |
-
}
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
return $return_scheme;
|
| 85 |
-
|
| 86 |
-
}
|
| 87 |
-
}
|
| 88 |
-
/**
|
| 89 |
-
* Grabs Specific Color from Lighter/Darker Hex Color Scheme
|
| 90 |
-
*
|
| 91 |
-
* @access public
|
| 92 |
-
* @since 1.5
|
| 93 |
-
* @param array $color_scheme_array from inbound_color_scheme() function
|
| 94 |
-
* @param int $value Light/darkness 1-100
|
| 95 |
-
* @return string $color returns Hex Colors with #
|
| 96 |
-
*/
|
| 97 |
-
if (!function_exists('inbound_color')) {
|
| 98 |
-
function inbound_color($color_scheme_array, $value) {
|
| 99 |
-
|
| 100 |
-
//print_r($color_scheme_array);
|
| 101 |
-
foreach ($color_scheme_array as $key => $val) {
|
| 102 |
-
$closest[$key] = abs($key - $value);
|
| 103 |
-
}
|
| 104 |
-
asort($closest);
|
| 105 |
-
$return_hex_val = key($closest);
|
| 106 |
-
$color = $color_scheme_array[$return_hex_val];
|
| 107 |
-
|
| 108 |
-
return $color;
|
| 109 |
-
}
|
| 110 |
-
}
|
| 111 |
?>
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
// Convert Hex to RGB Value for submit button
|
| 4 |
+
if (!function_exists('inbound_Hex_2_RGB')) {
|
| 5 |
+
function inbound_Hex_2_RGB($hex) {
|
| 6 |
+
$hex = preg_replace("/#/", "", $hex);
|
| 7 |
+
$color = array();
|
| 8 |
+
|
| 9 |
+
if(strlen($hex) == 3) {
|
| 10 |
+
$color['r'] = hexdec(substr($hex, 0, 1) . $r);
|
| 11 |
+
$color['g'] = hexdec(substr($hex, 1, 1) . $g);
|
| 12 |
+
$color['b'] = hexdec(substr($hex, 2, 1) . $b);
|
| 13 |
+
}
|
| 14 |
+
else if(strlen($hex) == 6) {
|
| 15 |
+
$color['r'] = hexdec(substr($hex, 0, 2));
|
| 16 |
+
$color['g'] = hexdec(substr($hex, 2, 2));
|
| 17 |
+
$color['b'] = hexdec(substr($hex, 4, 2));
|
| 18 |
+
}
|
| 19 |
+
return $color;
|
| 20 |
+
}
|
| 21 |
+
}
|
| 22 |
+
/**
|
| 23 |
+
* Grabs Color Scheme from Hex Color. Returns lighter & darker versions of the orignal hex color
|
| 24 |
+
*
|
| 25 |
+
* @access public
|
| 26 |
+
* @since 1.5
|
| 27 |
+
* @param string $hex_color hexidemical color
|
| 28 |
+
* @return array $return_scheme Color Schemes
|
| 29 |
+
*/
|
| 30 |
+
if (!function_exists('inbound_color_scheme')) {
|
| 31 |
+
function inbound_color_scheme($hex_color, $format = 'hex' ){
|
| 32 |
+
if (strpos($hex_color,'#') !== false) {
|
| 33 |
+
$input = $hex_color;
|
| 34 |
+
} else {
|
| 35 |
+
$input = "#" . $hex_color;
|
| 36 |
+
}
|
| 37 |
+
|
| 38 |
+
$col = Array(
|
| 39 |
+
hexdec(substr($input,1,2)),
|
| 40 |
+
hexdec(substr($input,3,2)),
|
| 41 |
+
hexdec(substr($input,5,2))
|
| 42 |
+
);
|
| 43 |
+
|
| 44 |
+
$color_scheme_array =
|
| 45 |
+
array(
|
| 46 |
+
100 => array( $col[0]/4, $col[1]/4, $col[2]/4),
|
| 47 |
+
95 => array( $col[0]/3, $col[1]/3, $col[2]/3),
|
| 48 |
+
90 => array( $col[0]/2.7, $col[1]/2.7, $col[2]/2.7),
|
| 49 |
+
85 => array( $col[0]/2.5, $col[1]/2.5, $col[2]/2.5),
|
| 50 |
+
80 => array( $col[0]/2.2, $col[1]/2.2, $col[2]/2.2),
|
| 51 |
+
75 => array( $col[0]/2, $col[1]/2, $col[2]/2),
|
| 52 |
+
70 => array( $col[0]/1.7, $col[1]/1.7, $col[2]/1.7),
|
| 53 |
+
65 => array( $col[0]/1.5, $col[1]/1.5, $col[2]/1.5),
|
| 54 |
+
60 => array( $col[0]/1.3,$col[1]/1.3,$col[2]/1.3),
|
| 55 |
+
55 => array( $col[0]/1.1,$col[1]/1.1,$col[2]/1.1),
|
| 56 |
+
50 => array( $col[0],$col[1],$col[2]),
|
| 57 |
+
45 => array( 255-(255-$col[0])/1.1, 255-(255-$col[1])/1.1, 255-(255-$col[2])/1.1),
|
| 58 |
+
40 => array( 255-(255-$col[0])/1.3, 255-(255-$col[1])/1.3, 255-(255-$col[2])/1.3),
|
| 59 |
+
35 => array( 255-(255-$col[0])/1.5, 255-(255-$col[1])/1.5, 255-(255-$col[2])/1.5),
|
| 60 |
+
30 => array( 255-(255-$col[0])/1.7, 255-(255-$col[1])/1.7, 255-(255-$col[2])/1.7),
|
| 61 |
+
25 => array( 255-(255-$col[0])/2, 255-(255-$col[1])/2, 255-(255-$col[2])/2),
|
| 62 |
+
20 => array( 255-(255-$col[0])/2.2, 255-(255-$col[1])/2.2, 255-(255-$col[2])/2.2),
|
| 63 |
+
15 => array( 255-(255-$col[0])/3, 255-(255-$col[1])/2.7, 255-(255-$col[2])/3),
|
| 64 |
+
10 => array(255-(255-$col[0])/5, 255-(255-$col[1])/5, 255-(255-$col[2])/5),
|
| 65 |
+
5 => array(255-(255-$col[0])/10, 255-(255-$col[1])/10, 255-(255-$col[2])/10),
|
| 66 |
+
0 => array(255-(255-$col[0])/15, 255-(255-$col[1])/15, 255-(255-$col[2])/15)
|
| 67 |
+
);
|
| 68 |
+
|
| 69 |
+
($format === 'hex') ? $sign = "#" : $sign = '';
|
| 70 |
+
$return_scheme = array();
|
| 71 |
+
foreach ($color_scheme_array as $key => $val) {
|
| 72 |
+
|
| 73 |
+
$each_color_return = $sign.sprintf("%02X%02X%02X", $val[0], $val[1], $val[2]);
|
| 74 |
+
$return_scheme[$key] = $each_color_return;
|
| 75 |
+
|
| 76 |
+
}
|
| 77 |
+
//return $closest;
|
| 78 |
+
if(isset($_GET['color_scheme'])) {
|
| 79 |
+
foreach ($return_scheme as $key => $hex_value) {
|
| 80 |
+
echo "<div style='background:$hex_value; display:block; width:100%;'>$key</div>";
|
| 81 |
+
}
|
| 82 |
+
}
|
| 83 |
+
|
| 84 |
+
return $return_scheme;
|
| 85 |
+
|
| 86 |
+
}
|
| 87 |
+
}
|
| 88 |
+
/**
|
| 89 |
+
* Grabs Specific Color from Lighter/Darker Hex Color Scheme
|
| 90 |
+
*
|
| 91 |
+
* @access public
|
| 92 |
+
* @since 1.5
|
| 93 |
+
* @param array $color_scheme_array from inbound_color_scheme() function
|
| 94 |
+
* @param int $value Light/darkness 1-100
|
| 95 |
+
* @return string $color returns Hex Colors with #
|
| 96 |
+
*/
|
| 97 |
+
if (!function_exists('inbound_color')) {
|
| 98 |
+
function inbound_color($color_scheme_array, $value) {
|
| 99 |
+
|
| 100 |
+
//print_r($color_scheme_array);
|
| 101 |
+
foreach ($color_scheme_array as $key => $val) {
|
| 102 |
+
$closest[$key] = abs($key - $value);
|
| 103 |
+
}
|
| 104 |
+
asort($closest);
|
| 105 |
+
$return_hex_val = key($closest);
|
| 106 |
+
$color = $color_scheme_array[$return_hex_val];
|
| 107 |
+
|
| 108 |
+
return $color;
|
| 109 |
+
}
|
| 110 |
+
}
|
| 111 |
?>
|
shared/functions/global.leads.cpt.php
ADDED
|
@@ -0,0 +1,221 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Lead CPT functionality used across plugins
|
| 4 |
+
*/
|
| 5 |
+
|
| 6 |
+
add_action( 'init', 'inbound_leads_register' , 11 );
|
| 7 |
+
if (!function_exists('inbound_leads_register')) {
|
| 8 |
+
function inbound_leads_register() {
|
| 9 |
+
|
| 10 |
+
$lead_active = get_option( 'Leads_Activated' ); // Check if leads is activated
|
| 11 |
+
//delete_option( 'Leads_Activated');
|
| 12 |
+
//add_option( 'Leads_Activated', true );
|
| 13 |
+
|
| 14 |
+
$labels = array(
|
| 15 |
+
'name' => _x('Leads', 'post type general name'),
|
| 16 |
+
'singular_name' => _x('Lead', 'post type singular name'),
|
| 17 |
+
'add_new' => _x('Add New', 'Lead'),
|
| 18 |
+
'add_new_item' => __('Add New Lead'),
|
| 19 |
+
'edit_item' => __('Edit Lead'),
|
| 20 |
+
'new_item' => __('New Leads'),
|
| 21 |
+
'view_item' => __('View Leads'),
|
| 22 |
+
'search_items' => __('Search Leads'),
|
| 23 |
+
'not_found' => __('Nothing found'),
|
| 24 |
+
'not_found_in_trash' => __('Nothing found in Trash'),
|
| 25 |
+
'parent_item_colon' => ''
|
| 26 |
+
);
|
| 27 |
+
|
| 28 |
+
$args = array(
|
| 29 |
+
'labels' => $labels,
|
| 30 |
+
'public' => false,
|
| 31 |
+
'publicly_queryable' => true,
|
| 32 |
+
'show_ui' => true,
|
| 33 |
+
'query_var' => true,
|
| 34 |
+
'menu_icon' => INBOUND_SHARED_ASSETS_PATH . '/global/images/leads.png',
|
| 35 |
+
'capability_type' => 'post',
|
| 36 |
+
'hierarchical' => false,
|
| 37 |
+
'menu_position' => null,
|
| 38 |
+
'supports' => array('custom-fields','thumbnail')
|
| 39 |
+
);
|
| 40 |
+
|
| 41 |
+
$args['show_in_menu'] = ($lead_active) ? true : false;
|
| 42 |
+
|
| 43 |
+
register_post_type( 'wp-lead' , $args );
|
| 44 |
+
|
| 45 |
+
// Lead Lists
|
| 46 |
+
$list_labels = array(
|
| 47 |
+
'name' => _x( 'Lead Lists', 'taxonomy general name' ),
|
| 48 |
+
'singular_name' => _x( 'Lead List', 'taxonomy singular name' ),
|
| 49 |
+
'search_items' => __( 'Search Lead Lists' ),
|
| 50 |
+
'popular_items' => __( 'Popular Lead Lists' ),
|
| 51 |
+
'all_items' => __( 'All Lead Lists' ),
|
| 52 |
+
'parent_item' => null,
|
| 53 |
+
'parent_item_colon' => null,
|
| 54 |
+
'edit_item' => __( 'Edit Lead List' ),
|
| 55 |
+
'update_item' => __( 'Update Lead List' ),
|
| 56 |
+
'add_new_item' => __( 'Add New Lead List' ),
|
| 57 |
+
'new_item_name' => __( 'New Lead List' ),
|
| 58 |
+
'separate_items_with_commas' => __( 'Separate Lead Lists with commas' ),
|
| 59 |
+
'add_or_remove_items' => __( 'Add or remove Lead Lists' ),
|
| 60 |
+
'choose_from_most_used' => __( 'Choose from the most used lead List' ),
|
| 61 |
+
'not_found' => __( 'No Lead Lists found.' ),
|
| 62 |
+
'menu_name' => __( 'Lead Lists' ),
|
| 63 |
+
);
|
| 64 |
+
|
| 65 |
+
$list_args = array(
|
| 66 |
+
'hierarchical' => true,
|
| 67 |
+
'labels' => $list_labels,
|
| 68 |
+
'singular_label' => "List Management",
|
| 69 |
+
'show_ui' => true,
|
| 70 |
+
'show_in_menu' => true,
|
| 71 |
+
'show_in_nav_menus' => true,
|
| 72 |
+
'show_admin_column' => true,
|
| 73 |
+
'query_var' => true,
|
| 74 |
+
'rewrite' => false,
|
| 75 |
+
);
|
| 76 |
+
|
| 77 |
+
register_taxonomy('wplead_list_category','wp-lead', $list_args );
|
| 78 |
+
|
| 79 |
+
// Lead Tags
|
| 80 |
+
$labels = array(
|
| 81 |
+
'name' => _x( 'Lead Tags', 'taxonomy general name' ),
|
| 82 |
+
'singular_name' => _x( 'Lead Tag', 'taxonomy singular name' ),
|
| 83 |
+
'search_items' => __( 'Search Lead Tags' ),
|
| 84 |
+
'popular_items' => __( 'Popular Lead Tags' ),
|
| 85 |
+
'all_items' => __( 'All Lead Tags' ),
|
| 86 |
+
'parent_item' => null,
|
| 87 |
+
'parent_item_colon' => null,
|
| 88 |
+
'edit_item' => __( 'Edit Lead Tag' ),
|
| 89 |
+
'update_item' => __( 'Update Lead Tag' ),
|
| 90 |
+
'add_new_item' => __( 'Add New Lead Tag' ),
|
| 91 |
+
'new_item_name' => __( 'New Lead Tag' ),
|
| 92 |
+
'separate_items_with_commas' => __( 'Separate Lead Tags with commas' ),
|
| 93 |
+
'add_or_remove_items' => __( 'Add or remove Lead Tags' ),
|
| 94 |
+
'choose_from_most_used' => __( 'Choose from the most used lead tags' ),
|
| 95 |
+
'not_found' => __( 'No lead tags found.' ),
|
| 96 |
+
'menu_name' => __( 'Lead Tags' ),
|
| 97 |
+
);
|
| 98 |
+
|
| 99 |
+
$args = array(
|
| 100 |
+
'hierarchical' => false,
|
| 101 |
+
'labels' => $labels,
|
| 102 |
+
'show_ui' => true,
|
| 103 |
+
'show_admin_column' => true,
|
| 104 |
+
'update_count_callback' => '_update_post_term_count',
|
| 105 |
+
'query_var' => true,
|
| 106 |
+
'rewrite' => array( 'slug' => 'lead-tag' ),
|
| 107 |
+
);
|
| 108 |
+
|
| 109 |
+
register_taxonomy( 'lead-tags', 'wp-lead', $args );
|
| 110 |
+
|
| 111 |
+
add_action('admin_menu', 'remove_lead_tag_menu');
|
| 112 |
+
function remove_lead_tag_menu() {
|
| 113 |
+
global $submenu;
|
| 114 |
+
unset($submenu['edit.php?post_type=wp-lead'][16]);
|
| 115 |
+
//print_r($submenu); exit;
|
| 116 |
+
}
|
| 117 |
+
}
|
| 118 |
+
}
|
| 119 |
+
|
| 120 |
+
/* Top Metabox */
|
| 121 |
+
add_action( 'edit_form_after_title', 'inbound_leads_install_notice' );
|
| 122 |
+
if (!function_exists('inbound_leads_install_notice')) {
|
| 123 |
+
function inbound_leads_install_notice() {
|
| 124 |
+
global $post;
|
| 125 |
+
|
| 126 |
+
$first_name = get_post_meta( $post->ID , 'wpleads_first_name', true );
|
| 127 |
+
$last_name = get_post_meta( $post->ID , 'wpleads_last_name', true );
|
| 128 |
+
|
| 129 |
+
if ( empty ( $post ) || 'wp-lead' !== get_post_type( $GLOBALS['post'] ) )
|
| 130 |
+
return;
|
| 131 |
+
|
| 132 |
+
// Lead Screen if leads not installed
|
| 133 |
+
if (!is_plugin_active('leads/wordpress-leads.php')) {
|
| 134 |
+
echo "WordPress leads is not currently installed/activated to view and manage leads please turn it on.";
|
| 135 |
+
}
|
| 136 |
+
|
| 137 |
+
}
|
| 138 |
+
}
|
| 139 |
+
|
| 140 |
+
// Set Leads to list from form tool. Need to consolidate into add_lead_to_list_tax
|
| 141 |
+
if (!function_exists('add_lead_lists_ajax')) {
|
| 142 |
+
function add_lead_lists_ajax($lead_id, $list_id, $tax = 'wplead_list_category') {
|
| 143 |
+
|
| 144 |
+
$current_lists = wp_get_post_terms( $lead_id, $tax, 'id' );
|
| 145 |
+
$all_term_ids = array();
|
| 146 |
+
$all_term_slugs = array();
|
| 147 |
+
foreach ($current_lists as $term ) {
|
| 148 |
+
$add = $term->term_id;
|
| 149 |
+
$slug = $term->slug;
|
| 150 |
+
$all_term_ids[] = $add;
|
| 151 |
+
$all_term_slugs[] = $slug;
|
| 152 |
+
}
|
| 153 |
+
// Set terms for lead tags taxomony
|
| 154 |
+
$list_array = $list_id;
|
| 155 |
+
if(is_array($list_array)) {
|
| 156 |
+
foreach ($list_array as $key => $value) {
|
| 157 |
+
$num = intval($value);
|
| 158 |
+
if ( !in_array($num, $all_term_ids) ) {
|
| 159 |
+
$all_term_ids[] = $num;
|
| 160 |
+
wp_set_object_terms( $lead_id, $all_term_ids, $tax);
|
| 161 |
+
}
|
| 162 |
+
}
|
| 163 |
+
}
|
| 164 |
+
}
|
| 165 |
+
}
|
| 166 |
+
/* merge add functions as switch case
|
| 167 |
+
function add_lead_to_list_tax($lead_id, $list_id, $tax = 'wplead_list_category') {
|
| 168 |
+
|
| 169 |
+
$current_lists = wp_get_post_terms( $lead_id, $tax, 'id' );
|
| 170 |
+
|
| 171 |
+
$all_term_ids = array();
|
| 172 |
+
$all_term_slugs = array();
|
| 173 |
+
foreach ($current_lists as $term ) {
|
| 174 |
+
$add = $term->term_id;
|
| 175 |
+
$slug = $term->slug;
|
| 176 |
+
$all_term_ids[] = $add;
|
| 177 |
+
$all_term_slugs[] = $slug;
|
| 178 |
+
}
|
| 179 |
+
|
| 180 |
+
$tag_check = strpos($list_id, ",");
|
| 181 |
+
if ($tag_check !== false) {
|
| 182 |
+
// Set terms for lead tags taxomony
|
| 183 |
+
$list_array = explode(",", $list_id);
|
| 184 |
+
if(is_array($list_array)) {
|
| 185 |
+
foreach ($list_array as $key => $value) {
|
| 186 |
+
$trim = trim(strtolower($value));
|
| 187 |
+
$add_slug = preg_replace('/\s+/', '-', $trim);
|
| 188 |
+
if ( !in_array($add_slug, $all_term_slugs) ) {
|
| 189 |
+
$all_term_slugs[] = $add_slug;
|
| 190 |
+
wp_set_object_terms( $lead_id, $all_term_slugs, $tax);
|
| 191 |
+
}
|
| 192 |
+
}
|
| 193 |
+
}
|
| 194 |
+
} else {
|
| 195 |
+
// Set terms for list taxomony
|
| 196 |
+
if ( !in_array($list_id, $all_term_ids) ) {
|
| 197 |
+
$all_term_ids[] = $list_id;
|
| 198 |
+
wp_set_object_terms( $lead_id, $all_term_ids, $tax);
|
| 199 |
+
}
|
| 200 |
+
}
|
| 201 |
+
}
|
| 202 |
+
|
| 203 |
+
function remove_lead_from_list_tax($lead_id, $list_id, $tax = 'wplead_list_category') {
|
| 204 |
+
$current_terms = wp_get_post_terms( $lead_id, $tax, 'id' );
|
| 205 |
+
|
| 206 |
+
$all_remove_terms = '';
|
| 207 |
+
foreach ($current_terms as $term ) {
|
| 208 |
+
$add = $term->term_id;
|
| 209 |
+
$all_remove_terms .= $add . ' ,';
|
| 210 |
+
}
|
| 211 |
+
$final = explode(' ,', $all_remove_terms);
|
| 212 |
+
$final = array_filter($final, 'strlen');
|
| 213 |
+
|
| 214 |
+
if (in_array($list_id, $final) ) {
|
| 215 |
+
$new = array_flip ( $final );
|
| 216 |
+
unset($new[$list_id]);
|
| 217 |
+
$save = array_flip ( $new );
|
| 218 |
+
wp_set_object_terms( $lead_id, $save, $tax);
|
| 219 |
+
}
|
| 220 |
+
}
|
| 221 |
+
*/
|
shared/functions/global.shared.functions.php
ADDED
|
@@ -0,0 +1,209 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
/**
|
| 3 |
+
* Global Shared function for all inbound now plugins
|
| 4 |
+
*/
|
| 5 |
+
|
| 6 |
+
/* Get Page Id for Lead Tracking, fallback if $post->ID fails */
|
| 7 |
+
if (!function_exists('wpl_url_to_postid')) {
|
| 8 |
+
function wpl_url_to_postid($url) {
|
| 9 |
+
global $wp_rewrite;
|
| 10 |
+
|
| 11 |
+
$url = apply_filters('url_to_postid', $url);
|
| 12 |
+
|
| 13 |
+
$id = url_to_postid($url);
|
| 14 |
+
if (isset($id)&&$id>0)
|
| 15 |
+
return $id;
|
| 16 |
+
|
| 17 |
+
// First, check to see if there is a 'p=N' or 'page_id=N' to match against
|
| 18 |
+
if ( preg_match('#[?&](p|page_id|attachment_id)=(\d+)#', $url, $values) ) {
|
| 19 |
+
$id = absint($values[2]);
|
| 20 |
+
if ( $id )
|
| 21 |
+
return $id;
|
| 22 |
+
}
|
| 23 |
+
|
| 24 |
+
//first check if URL is homepage
|
| 25 |
+
$wordpress_url = get_bloginfo('url');
|
| 26 |
+
if (substr($wordpress_url, -1, -1)!='/') {
|
| 27 |
+
$wordpress_url = $wordpress_url."/";
|
| 28 |
+
}
|
| 29 |
+
|
| 30 |
+
if (str_replace('/','',$url)==str_replace('/','',$wordpress_url)) {
|
| 31 |
+
return get_option('page_on_front');
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
// Check to see if we are using rewrite rules
|
| 35 |
+
$rewrite = $wp_rewrite->wp_rewrite_rules();
|
| 36 |
+
|
| 37 |
+
// Not using rewrite rules, and 'p=N' and 'page_id=N' methods failed, so we're out of options
|
| 38 |
+
if ( empty($rewrite) )
|
| 39 |
+
return 0;
|
| 40 |
+
|
| 41 |
+
// Get rid of the #anchor
|
| 42 |
+
$url_split = explode('#', $url);
|
| 43 |
+
$url = $url_split[0];
|
| 44 |
+
|
| 45 |
+
// Get rid of URL ?query=string
|
| 46 |
+
$url_split = explode('?', $url);
|
| 47 |
+
$url = $url_split[0];
|
| 48 |
+
|
| 49 |
+
// Add 'www.' if it is absent and should be there
|
| 50 |
+
if ( false !== strpos(home_url(), '://www.') && false === strpos($url, '://www.') )
|
| 51 |
+
$url = str_replace('://', '://www.', $url);
|
| 52 |
+
|
| 53 |
+
// Strip 'www.' if it is present and shouldn't be
|
| 54 |
+
if ( false === strpos(home_url(), '://www.') )
|
| 55 |
+
$url = str_replace('://www.', '://', $url);
|
| 56 |
+
|
| 57 |
+
// Strip 'index.php/' if we're not using path info permalinks
|
| 58 |
+
if ( !$wp_rewrite->using_index_permalinks() )
|
| 59 |
+
$url = str_replace('index.php/', '', $url);
|
| 60 |
+
|
| 61 |
+
if ( false !== strpos($url, home_url()) ) {
|
| 62 |
+
// Chop off http://domain.com
|
| 63 |
+
$url = str_replace(home_url(), '', $url);
|
| 64 |
+
} else {
|
| 65 |
+
// Chop off /path/to/blog
|
| 66 |
+
$home_path = parse_url(home_url());
|
| 67 |
+
$home_path = isset( $home_path['path'] ) ? $home_path['path'] : '' ;
|
| 68 |
+
$url = str_replace($home_path, '', $url);
|
| 69 |
+
}
|
| 70 |
+
|
| 71 |
+
// Trim leading and lagging slashes
|
| 72 |
+
$url = trim($url, '/');
|
| 73 |
+
|
| 74 |
+
$request = $url;
|
| 75 |
+
// Look for matches.
|
| 76 |
+
$request_match = $request;
|
| 77 |
+
foreach ( (array)$rewrite as $match => $query) {
|
| 78 |
+
// If the requesting file is the anchor of the match, prepend it
|
| 79 |
+
// to the path info.
|
| 80 |
+
if ( !empty($url) && ($url != $request) && (strpos($match, $url) === 0) )
|
| 81 |
+
$request_match = $url . '/' . $request;
|
| 82 |
+
|
| 83 |
+
if ( preg_match("!^$match!", $request_match, $matches) ) {
|
| 84 |
+
// Got a match.
|
| 85 |
+
// Trim the query of everything up to the '?'.
|
| 86 |
+
$query = preg_replace("!^.+\?!", '', $query);
|
| 87 |
+
|
| 88 |
+
// Substitute the substring matches into the query.
|
| 89 |
+
$query = addslashes(WP_MatchesMapRegex::apply($query, $matches));
|
| 90 |
+
|
| 91 |
+
// Filter out non-public query vars
|
| 92 |
+
global $wp;
|
| 93 |
+
parse_str($query, $query_vars);
|
| 94 |
+
$query = array();
|
| 95 |
+
foreach ( (array) $query_vars as $key => $value ) {
|
| 96 |
+
if ( in_array($key, $wp->public_query_vars) )
|
| 97 |
+
$query[$key] = $value;
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
// Taken from class-wp.php
|
| 101 |
+
foreach ( $GLOBALS['wp_post_types'] as $post_type => $t )
|
| 102 |
+
if ( $t->query_var )
|
| 103 |
+
$post_type_query_vars[$t->query_var] = $post_type;
|
| 104 |
+
|
| 105 |
+
foreach ( $wp->public_query_vars as $wpvar ) {
|
| 106 |
+
if ( isset( $wp->extra_query_vars[$wpvar] ) )
|
| 107 |
+
$query[$wpvar] = $wp->extra_query_vars[$wpvar];
|
| 108 |
+
elseif ( isset( $_POST[$wpvar] ) )
|
| 109 |
+
$query[$wpvar] = $_POST[$wpvar];
|
| 110 |
+
elseif ( isset( $_GET[$wpvar] ) )
|
| 111 |
+
$query[$wpvar] = $_GET[$wpvar];
|
| 112 |
+
elseif ( isset( $query_vars[$wpvar] ) )
|
| 113 |
+
$query[$wpvar] = $query_vars[$wpvar];
|
| 114 |
+
|
| 115 |
+
if ( !empty( $query[$wpvar] ) ) {
|
| 116 |
+
if ( ! is_array( $query[$wpvar] ) ) {
|
| 117 |
+
$query[$wpvar] = (string) $query[$wpvar];
|
| 118 |
+
} else {
|
| 119 |
+
foreach ( $query[$wpvar] as $vkey => $v ) {
|
| 120 |
+
if ( !is_object( $v ) ) {
|
| 121 |
+
$query[$wpvar][$vkey] = (string) $v;
|
| 122 |
+
}
|
| 123 |
+
}
|
| 124 |
+
}
|
| 125 |
+
|
| 126 |
+
if ( isset($post_type_query_vars[$wpvar] ) ) {
|
| 127 |
+
$query['post_type'] = $post_type_query_vars[$wpvar];
|
| 128 |
+
$query['name'] = $query[$wpvar];
|
| 129 |
+
}
|
| 130 |
+
}
|
| 131 |
+
}
|
| 132 |
+
|
| 133 |
+
// Do the query
|
| 134 |
+
$query = new WP_Query($query);
|
| 135 |
+
if ( !empty($query->posts) && $query->is_singular )
|
| 136 |
+
return $query->post->ID;
|
| 137 |
+
else
|
| 138 |
+
return 0;
|
| 139 |
+
}
|
| 140 |
+
}
|
| 141 |
+
return 0;
|
| 142 |
+
}
|
| 143 |
+
}
|
| 144 |
+
// Get Page Id for Lead Tracking, fallback if wpl_url_to_postid() fails
|
| 145 |
+
if (!function_exists('wp_leads_get_page_final_id')) {
|
| 146 |
+
function wp_leads_get_page_final_id(){
|
| 147 |
+
global $post;
|
| 148 |
+
if (!isset($post))
|
| 149 |
+
return;
|
| 150 |
+
$current_url = "http://" . $_SERVER['HTTP_HOST'] . $_SERVER['REQUEST_URI'];
|
| 151 |
+
$current_url = preg_replace('/\?.*/', '', $current_url);
|
| 152 |
+
$page_id = wpl_url_to_postid($current_url);
|
| 153 |
+
$site_url = get_option('siteurl');
|
| 154 |
+
$clean_current_url = rtrim($current_url,"/");
|
| 155 |
+
|
| 156 |
+
// If homepage
|
| 157 |
+
if($clean_current_url === $site_url){
|
| 158 |
+
$page_id = get_option('page_on_front'); //
|
| 159 |
+
}
|
| 160 |
+
// If category page
|
| 161 |
+
if (is_category() || is_archive()) {
|
| 162 |
+
$cat = get_category_by_path(get_query_var('category_name'),false);
|
| 163 |
+
$page_id = "cat_" . $cat->cat_ID;
|
| 164 |
+
$post_type = "category";
|
| 165 |
+
}
|
| 166 |
+
// If tag page
|
| 167 |
+
if (is_tag()){
|
| 168 |
+
$page_id = "tag_" . get_query_var('tag_id');
|
| 169 |
+
}
|
| 170 |
+
|
| 171 |
+
if(is_home()) { $page_id = get_option( 'page_for_posts' ); }
|
| 172 |
+
|
| 173 |
+
elseif(is_front_page()){ $page_id = get_option('page_on_front'); }
|
| 174 |
+
|
| 175 |
+
if ($page_id === 0) {
|
| 176 |
+
$page_id = $post->ID;
|
| 177 |
+
}
|
| 178 |
+
|
| 179 |
+
return $page_id;
|
| 180 |
+
}
|
| 181 |
+
}
|
| 182 |
+
|
| 183 |
+
/* Potentially Legacy is this being used anywhere?
|
| 184 |
+
if (!function_exists('wpl_url_to_postid_final')) {
|
| 185 |
+
function wpl_url_to_postid_final($url) {
|
| 186 |
+
global $wpdb;
|
| 187 |
+
$parsed = parse_url($url);
|
| 188 |
+
$url = $parsed['path'];
|
| 189 |
+
$parts = explode('/',$url);
|
| 190 |
+
$count = count($parts);
|
| 191 |
+
$count = $count -1;
|
| 192 |
+
|
| 193 |
+
if (empty($parts[$count])) {
|
| 194 |
+
$i = $count-1;
|
| 195 |
+
$slug = $parts[$i];
|
| 196 |
+
} else {
|
| 197 |
+
$slug = $parts[$count];
|
| 198 |
+
}
|
| 199 |
+
|
| 200 |
+
$my_id = $wpdb->get_var("SELECT ID FROM $wpdb->posts WHERE post_name = '$slug'");
|
| 201 |
+
|
| 202 |
+
if ($my_id) {
|
| 203 |
+
return $my_id;
|
| 204 |
+
} else {
|
| 205 |
+
return 0;
|
| 206 |
+
}
|
| 207 |
+
}
|
| 208 |
+
}
|
| 209 |
+
*/
|
shared/inbound-shortcodes/css/form-cpt.css
CHANGED
|
@@ -1,134 +1,134 @@
|
|
| 1 |
-
#side-sortables, #cpt-form-serialize, #inbound-shortcodes-form-wrap #inbound-shortcodes-form-head, #inbound_insert_shortcode_two, #shortcode_cancel, #entire-form-area, .inbound_tbody.parent-inbound_shortcode_helper-block-one, #postdivrich, #inbound-email-response, #postcustom, #cpt-form-serialize-default {
|
| 2 |
-
display: none;
|
| 3 |
-
}
|
| 4 |
-
#inbound-email-response h2{
|
| 5 |
-
margin-bottom: 0px;
|
| 6 |
-
margin-top: 5px;
|
| 7 |
-
}
|
| 8 |
-
.inbound_tbody.parent-inbound_shortcode_helper-block-one, #local-storage-notice, #setting-error-tgmpa, #screen-options-link-wrap, #notice, .updated.inbound-shortcode-trigger {
|
| 9 |
-
display: none !important;
|
| 10 |
-
}
|
| 11 |
-
#cpt-form-shortcode {
|
| 12 |
-
display: none;
|
| 13 |
-
}
|
| 14 |
-
#view-email-response {
|
| 15 |
-
margin-left: 10px;
|
| 16 |
-
}
|
| 17 |
-
#cpt-form-serialize {
|
| 18 |
-
word-wrap: break-word;
|
| 19 |
-
}
|
| 20 |
-
.step-item {
|
| 21 |
-
|
| 22 |
-
width: 29%;}
|
| 23 |
-
.step-item:after {
|
| 24 |
-
width: 25px;
|
| 25 |
-
height: 25px;}
|
| 26 |
-
#inbound_confirmation_subject {
|
| 27 |
-
display: block;
|
| 28 |
-
padding: 3px 8px;
|
| 29 |
-
font-size: 1.7em;
|
| 30 |
-
line-height: 1.7em;
|
| 31 |
-
height: 1.7em;
|
| 32 |
-
width: 100%;
|
| 33 |
-
outline: 0;
|
| 34 |
-
margin: 1px 0;
|
| 35 |
-
margin-bottom: 10px;
|
| 36 |
-
margin-top: 5px;
|
| 37 |
-
}
|
| 38 |
-
/*
|
| 39 |
-
#postbox-container-2 {
|
| 40 |
-
display: none;
|
| 41 |
-
}*/
|
| 42 |
-
#form-leads-list {
|
| 43 |
-
display: none;
|
| 44 |
-
font-size: 12px;
|
| 45 |
-
margin-bottom: 10px;
|
| 46 |
-
margin-top: 15px;
|
| 47 |
-
text-align: left;
|
| 48 |
-
border: 1px solid #CECDCA;
|
| 49 |
-
-webkit-box-shadow: 0px 0px 15px rgba(0, 0, 0, 0.1);
|
| 50 |
-
-moz-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 51 |
-
box-shadow: 0px 0px 15px rgba(0, 0, 0, 0.1);
|
| 52 |
-
z-index: 200;
|
| 53 |
-
width: 97%;
|
| 54 |
-
margin-left: 8px;
|
| 55 |
-
}
|
| 56 |
-
#form-leads-list h2 {
|
| 57 |
-
font-size: 20px;
|
| 58 |
-
font-weight: bold;
|
| 59 |
-
margin-bottom: 0px;
|
| 60 |
-
margin-top: 3px;
|
| 61 |
-
padding: 0 0 3px;
|
| 62 |
-
clear: left;
|
| 63 |
-
padding-left: 10px;
|
| 64 |
-
border-bottom: 1px solid #C9C9C9;
|
| 65 |
-
}
|
| 66 |
-
#form-lead-ul li {
|
| 67 |
-
border-bottom: 1px solid #EBEBEA;
|
| 68 |
-
padding: 12px 0px;
|
| 69 |
-
position: relative;
|
| 70 |
-
font-size: 13px;
|
| 71 |
-
margin: 0;
|
| 72 |
-
}
|
| 73 |
-
#no-conversions {
|
| 74 |
-
display: block;
|
| 75 |
-
margin-left: -23px;
|
| 76 |
-
padding-top: 10px;
|
| 77 |
-
padding-bottom: 10px;
|
| 78 |
-
padding-right: 10px;
|
| 79 |
-
font-size: 17px;
|
| 80 |
-
}
|
| 81 |
-
#form-lead-ul {
|
| 82 |
-
|
| 83 |
-
padding-left: 10px;
|
| 84 |
-
}
|
| 85 |
-
#poststuff #post-body.columns-2 {
|
| 86 |
-
margin-right: 0px;
|
| 87 |
-
}
|
| 88 |
-
#view-leads-list {
|
| 89 |
-
margin-left: 10px;
|
| 90 |
-
}
|
| 91 |
-
#inbound-shortcodes-preview {
|
| 92 |
-
width: 31.7%;
|
| 93 |
-
max-height: 100%;
|
| 94 |
-
position: fixed;
|
| 95 |
-
margin-top: 42px;}
|
| 96 |
-
#inbound-shortcodes-preview-wrap #inbound-shortcodes-preview-head {
|
| 97 |
-
width: 100%;
|
| 98 |
-
position: fixed;}
|
| 99 |
-
#popup-controls {
|
| 100 |
-
position: fixed !important;
|
| 101 |
-
border-top: 1px solid #CCC;
|
| 102 |
-
bottom: 0px !important;
|
| 103 |
-
width: 100%;
|
| 104 |
-
margin-left: -19px;
|
| 105 |
-
padding-left: 20px;
|
| 106 |
-
z-index: 9999;}
|
| 107 |
-
#inbound-shortcodes-form-table tbody tr.form-row.has-child {
|
| 108 |
-
display: block;
|
| 109 |
-
padding: 10px 0 0;
|
| 110 |
-
border-bottom: none;
|
| 111 |
-
padding-left: 10px;
|
| 112 |
-
}
|
| 113 |
-
.form-field-row-number {
|
| 114 |
-
position: absolute;
|
| 115 |
-
left: 0px; }
|
| 116 |
-
#inbound-shortcodes-popup {
|
| 117 |
-
width: 100%;
|
| 118 |
-
overflow: visible;}
|
| 119 |
-
#inbound-shortcodes-preview-wrap {
|
| 120 |
-
position: fixed;
|
| 121 |
-
width: 31%;
|
| 122 |
-
right: 0px;
|
| 123 |
-
top: 31px;
|
| 124 |
-
}
|
| 125 |
-
#titlediv #title {
|
| 126 |
-
background-color: #FFF;
|
| 127 |
-
width: 64%;
|
| 128 |
-
}
|
| 129 |
-
#inbound-shortcodes-preview {
|
| 130 |
-
|
| 131 |
-
height: 85%;}
|
| 132 |
-
#inbound-shortcodes-form-wrap #inbound-shortcodes-form {
|
| 133 |
-
|
| 134 |
padding-left: 5px; }
|
| 1 |
+
#side-sortables, #cpt-form-serialize, #inbound-shortcodes-form-wrap #inbound-shortcodes-form-head, #inbound_insert_shortcode_two, #shortcode_cancel, #entire-form-area, .inbound_tbody.parent-inbound_shortcode_helper-block-one, #postdivrich, #inbound-email-response, #postcustom, #cpt-form-serialize-default {
|
| 2 |
+
display: none;
|
| 3 |
+
}
|
| 4 |
+
#inbound-email-response h2{
|
| 5 |
+
margin-bottom: 0px;
|
| 6 |
+
margin-top: 5px;
|
| 7 |
+
}
|
| 8 |
+
.inbound_tbody.parent-inbound_shortcode_helper-block-one, #local-storage-notice, #setting-error-tgmpa, #screen-options-link-wrap, #notice, .updated.inbound-shortcode-trigger {
|
| 9 |
+
display: none !important;
|
| 10 |
+
}
|
| 11 |
+
#cpt-form-shortcode {
|
| 12 |
+
display: none;
|
| 13 |
+
}
|
| 14 |
+
#view-email-response {
|
| 15 |
+
margin-left: 10px;
|
| 16 |
+
}
|
| 17 |
+
#cpt-form-serialize {
|
| 18 |
+
word-wrap: break-word;
|
| 19 |
+
}
|
| 20 |
+
.step-item {
|
| 21 |
+
|
| 22 |
+
width: 29%;}
|
| 23 |
+
.step-item:after {
|
| 24 |
+
width: 25px;
|
| 25 |
+
height: 25px;}
|
| 26 |
+
#inbound_confirmation_subject {
|
| 27 |
+
display: block;
|
| 28 |
+
padding: 3px 8px;
|
| 29 |
+
font-size: 1.7em;
|
| 30 |
+
line-height: 1.7em;
|
| 31 |
+
height: 1.7em;
|
| 32 |
+
width: 100%;
|
| 33 |
+
outline: 0;
|
| 34 |
+
margin: 1px 0;
|
| 35 |
+
margin-bottom: 10px;
|
| 36 |
+
margin-top: 5px;
|
| 37 |
+
}
|
| 38 |
+
/*
|
| 39 |
+
#postbox-container-2 {
|
| 40 |
+
display: none;
|
| 41 |
+
}*/
|
| 42 |
+
#form-leads-list {
|
| 43 |
+
display: none;
|
| 44 |
+
font-size: 12px;
|
| 45 |
+
margin-bottom: 10px;
|
| 46 |
+
margin-top: 15px;
|
| 47 |
+
text-align: left;
|
| 48 |
+
border: 1px solid #CECDCA;
|
| 49 |
+
-webkit-box-shadow: 0px 0px 15px rgba(0, 0, 0, 0.1);
|
| 50 |
+
-moz-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 51 |
+
box-shadow: 0px 0px 15px rgba(0, 0, 0, 0.1);
|
| 52 |
+
z-index: 200;
|
| 53 |
+
width: 97%;
|
| 54 |
+
margin-left: 8px;
|
| 55 |
+
}
|
| 56 |
+
#form-leads-list h2 {
|
| 57 |
+
font-size: 20px;
|
| 58 |
+
font-weight: bold;
|
| 59 |
+
margin-bottom: 0px;
|
| 60 |
+
margin-top: 3px;
|
| 61 |
+
padding: 0 0 3px;
|
| 62 |
+
clear: left;
|
| 63 |
+
padding-left: 10px;
|
| 64 |
+
border-bottom: 1px solid #C9C9C9;
|
| 65 |
+
}
|
| 66 |
+
#form-lead-ul li {
|
| 67 |
+
border-bottom: 1px solid #EBEBEA;
|
| 68 |
+
padding: 12px 0px;
|
| 69 |
+
position: relative;
|
| 70 |
+
font-size: 13px;
|
| 71 |
+
margin: 0;
|
| 72 |
+
}
|
| 73 |
+
#no-conversions {
|
| 74 |
+
display: block;
|
| 75 |
+
margin-left: -23px;
|
| 76 |
+
padding-top: 10px;
|
| 77 |
+
padding-bottom: 10px;
|
| 78 |
+
padding-right: 10px;
|
| 79 |
+
font-size: 17px;
|
| 80 |
+
}
|
| 81 |
+
#form-lead-ul {
|
| 82 |
+
|
| 83 |
+
padding-left: 10px;
|
| 84 |
+
}
|
| 85 |
+
#poststuff #post-body.columns-2 {
|
| 86 |
+
margin-right: 0px;
|
| 87 |
+
}
|
| 88 |
+
#view-leads-list {
|
| 89 |
+
margin-left: 10px;
|
| 90 |
+
}
|
| 91 |
+
#inbound-shortcodes-preview {
|
| 92 |
+
width: 31.7%;
|
| 93 |
+
max-height: 100%;
|
| 94 |
+
position: fixed;
|
| 95 |
+
margin-top: 42px;}
|
| 96 |
+
#inbound-shortcodes-preview-wrap #inbound-shortcodes-preview-head {
|
| 97 |
+
width: 100%;
|
| 98 |
+
position: fixed;}
|
| 99 |
+
#popup-controls {
|
| 100 |
+
position: fixed !important;
|
| 101 |
+
border-top: 1px solid #CCC;
|
| 102 |
+
bottom: 0px !important;
|
| 103 |
+
width: 100%;
|
| 104 |
+
margin-left: -19px;
|
| 105 |
+
padding-left: 20px;
|
| 106 |
+
z-index: 9999;}
|
| 107 |
+
#inbound-shortcodes-form-table tbody tr.form-row.has-child {
|
| 108 |
+
display: block;
|
| 109 |
+
padding: 10px 0 0;
|
| 110 |
+
border-bottom: none;
|
| 111 |
+
padding-left: 10px;
|
| 112 |
+
}
|
| 113 |
+
.form-field-row-number {
|
| 114 |
+
position: absolute;
|
| 115 |
+
left: 0px; }
|
| 116 |
+
#inbound-shortcodes-popup {
|
| 117 |
+
width: 100%;
|
| 118 |
+
overflow: visible;}
|
| 119 |
+
#inbound-shortcodes-preview-wrap {
|
| 120 |
+
position: fixed;
|
| 121 |
+
width: 31%;
|
| 122 |
+
right: 0px;
|
| 123 |
+
top: 31px;
|
| 124 |
+
}
|
| 125 |
+
#titlediv #title {
|
| 126 |
+
background-color: #FFF;
|
| 127 |
+
width: 64%;
|
| 128 |
+
}
|
| 129 |
+
#inbound-shortcodes-preview {
|
| 130 |
+
|
| 131 |
+
height: 85%;}
|
| 132 |
+
#inbound-shortcodes-form-wrap #inbound-shortcodes-form {
|
| 133 |
+
|
| 134 |
padding-left: 5px; }
|
shared/inbound-shortcodes/css/frontend-render.css
CHANGED
|
@@ -1,1065 +1,1065 @@
|
|
| 1 |
-
a.inbound-button.inbound-special-class i:before, button.inbound-button-submit.inbound-submit-action i:before{font-family:'FontAwesome'; font-style: normal; font-weight: 300; padding-right: 5px;}
|
| 2 |
-
|
| 3 |
-
.inbound-label.inbound-label-top, .inbound-label.inbound-label-bottom {
|
| 4 |
-
display: block;
|
| 5 |
-
}
|
| 6 |
-
#inbound-form-wrapper .inbound-label.inbound-label-bottom {
|
| 7 |
-
margin: 0px 0 10px 0;
|
| 8 |
-
}
|
| 9 |
-
#inbound-form-wrapper .inbound-label.inbound-label-inline {
|
| 10 |
-
min-width: 80px;
|
| 11 |
-
display: inline-block;
|
| 12 |
-
padding-right: 10px;
|
| 13 |
-
}
|
| 14 |
-
.radio-inbound-vertical.radio-inbound-label-bottom, #inbound-form-wrapper .inbound-label.inbound-label-inline.inbound-input-radio, .radio-inbound-vertical.radio-inbound-label-top {
|
| 15 |
-
display: block;
|
| 16 |
-
}
|
| 17 |
-
.radio-inbound-vertical.radio-inbound-label-bottom:last-child {
|
| 18 |
-
margin: 0px 0 10px 0;
|
| 19 |
-
}
|
| 20 |
-
.radio-inbound-vertical.radio-inbound-label-inline {
|
| 21 |
-
padding-right: 5px;
|
| 22 |
-
}
|
| 23 |
-
.inbound-label.inbound-label-placeholder {
|
| 24 |
-
display: none;
|
| 25 |
-
}
|
| 26 |
-
.inbound-label.inbound-label-placeholder.inbound-input-dropdown {
|
| 27 |
-
display: block;
|
| 28 |
-
}
|
| 29 |
-
.inbound-horizontal {
|
| 30 |
-
display: inline-block;
|
| 31 |
-
}
|
| 32 |
-
#inbound_form_submit {
|
| 33 |
-
text-transform: none;
|
| 34 |
-
}
|
| 35 |
-
/* global fixes */
|
| 36 |
-
.inbound-field {
|
| 37 |
-
margin-left: 0 !important;
|
| 38 |
-
list-style-type: none !important;
|
| 39 |
-
list-style-image: none !important;
|
| 40 |
-
list-style: none !important;
|
| 41 |
-
overflow: visible;
|
| 42 |
-
}
|
| 43 |
-
.inbound-field label {
|
| 44 |
-
margin: 10px 0 4px 0;
|
| 45 |
-
font-weight: bold;
|
| 46 |
-
line-height: 1.3em;
|
| 47 |
-
clear: both;
|
| 48 |
-
}
|
| 49 |
-
.inbound-field input[type=radio] {
|
| 50 |
-
margin-top: 4px;
|
| 51 |
-
width: auto !important;
|
| 52 |
-
}
|
| 53 |
-
.inbound-field.inbound-submit-area {
|
| 54 |
-
padding: 0px 0 10px 0;
|
| 55 |
-
margin: 15px 0 0 0;
|
| 56 |
-
clear: both;
|
| 57 |
-
}
|
| 58 |
-
.inbound-field.inbound-submit-area input.inbound-button, .inbound-field.inbound-submit-area input[type=submit] {
|
| 59 |
-
font-size: 1em;
|
| 60 |
-
}
|
| 61 |
-
.inbound-description {
|
| 62 |
-
font-size: 0.85em;
|
| 63 |
-
line-height: 1.5em;
|
| 64 |
-
clear: both;
|
| 65 |
-
font-family: sans-serif;
|
| 66 |
-
letter-spacing: normal;
|
| 67 |
-
padding: 10px 0 0 0;
|
| 68 |
-
width: 99.8%;
|
| 69 |
-
}
|
| 70 |
-
textarea.inbound-input-textarea {
|
| 71 |
-
height: 150px;
|
| 72 |
-
width: 99.2%;
|
| 73 |
-
}
|
| 74 |
-
#inbound-form-wrapper {
|
| 75 |
-
overflow: inherit;
|
| 76 |
-
margin: 10px 0;
|
| 77 |
-
max-width: 98%;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
.inbound-field input[type=text], .inbound-field input[type=url], .inbound-field input[type=email], .inbound-field input[type=tel], .inbound-field input[type=number], .inbound-field input[type=password] {
|
| 81 |
-
width: 47%;
|
| 82 |
-
}
|
| 83 |
-
/*
|
| 84 |
-
#inbound-form-wrapper input[type=text], #inbound-form-wrapper input[type=url], #inbound-form-wrapper input[type=email], #inbound-form-wrapper input[type=tel], #inbound-form-wrapper input[type=number], #inbound-form-wrapper input[type=password] {
|
| 85 |
-
width: 47%;
|
| 86 |
-
}
|
| 87 |
-
*/
|
| 88 |
-
#inbound-form-wrapper .inbound-horizontal input[type=text], #inbound-form-wrapper .inbound-horizontal input[type=url], #inbound-form-wrapper .inbound-horizontal input[type=email], #inbound-form-wrapper .inbound-horizontal input[type=tel], #inbound-form-wrapper .inbound-horizontal input[type=number], #inbound-form-wrapper .inbound-horizontal input[type=password] {
|
| 89 |
-
width: 88%;
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
#inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=text], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=url], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=email], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=tel], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=number], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=password] {
|
| 93 |
-
width: 130px;
|
| 94 |
-
}
|
| 95 |
-
|
| 96 |
-
#inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline .inbound-label.inbound-label-inline {
|
| 97 |
-
min-width: 60px;
|
| 98 |
-
display: inline-block;
|
| 99 |
-
padding-right: 10px;
|
| 100 |
-
text-align: right;
|
| 101 |
-
}
|
| 102 |
-
|
| 103 |
-
.inbound-label.inbound-input-radio {
|
| 104 |
-
display: block;
|
| 105 |
-
}
|
| 106 |
-
.
|
| 107 |
-
margin-top: 4px;
|
| 108 |
-
width: auto !important;
|
| 109 |
-
float: left;
|
| 110 |
-
}
|
| 111 |
-
.radionotdonelabel {
|
| 112 |
-
display: block;
|
| 113 |
-
margin: 0 0 0 24px;
|
| 114 |
-
padding: 0;
|
| 115 |
-
width: auto;
|
| 116 |
-
line-height: 1.5;
|
| 117 |
-
vertical-align: top;
|
| 118 |
-
}
|
| 119 |
-
/* Grid
|
| 120 |
-
* ------------------------------------------*/
|
| 121 |
-
.inbound-clear{
|
| 122 |
-
clear:both;
|
| 123 |
-
display:block;
|
| 124 |
-
overflow:hidden;
|
| 125 |
-
width:0;
|
| 126 |
-
height:0
|
| 127 |
-
}
|
| 128 |
-
.inbound-clearfix:before, .inbound-clearfix:after,
|
| 129 |
-
.inbound-row:before, .inbound-row:after,
|
| 130 |
-
.inbound-row_30:before, .inbound-row_30:after{
|
| 131 |
-
content:'\0020';
|
| 132 |
-
display:block;
|
| 133 |
-
overflow:hidden;
|
| 134 |
-
width:0;
|
| 135 |
-
height:0
|
| 136 |
-
}
|
| 137 |
-
.inbound-clearfix:after, .inbound-row:after, .inbound-row_30:after{
|
| 138 |
-
clear:both
|
| 139 |
-
}
|
| 140 |
-
.inbound-clearfix{
|
| 141 |
-
zoom:1
|
| 142 |
-
}
|
| 143 |
-
.inbound-row{
|
| 144 |
-
margin-left:-10px;
|
| 145 |
-
margin-right:-10px;
|
| 146 |
-
}
|
| 147 |
-
.inbound-row_30{
|
| 148 |
-
margin-left:-15px;
|
| 149 |
-
margin-right:-15px;
|
| 150 |
-
}
|
| 151 |
-
.inbound-grid{
|
| 152 |
-
float:left;
|
| 153 |
-
min-height:1px;
|
| 154 |
-
padding-right: 5px;
|
| 155 |
-
padding-left: 0px;
|
| 156 |
-
position:relative;
|
| 157 |
-
}
|
| 158 |
-
#inbound-list {
|
| 159 |
-
overflow: hidden;
|
| 160 |
-
margin-bottom: 10px;
|
| 161 |
-
}
|
| 162 |
-
.row_30 .inbound-grid{
|
| 163 |
-
padding-left:15px;
|
| 164 |
-
padding-right:15px;
|
| 165 |
-
}
|
| 166 |
-
.inbound-grid.full{
|
| 167 |
-
width:100%;
|
| 168 |
-
}
|
| 169 |
-
.inbound-grid.one-half, .inbound-grid.inbound-2-col{
|
| 170 |
-
width:48%;
|
| 171 |
-
}
|
| 172 |
-
.inbound-grid.one-third, .inbound-grid.inbound-3-col{
|
| 173 |
-
width:31.333333%;
|
| 174 |
-
|
| 175 |
-
}
|
| 176 |
-
.inbound-grid.two-third{
|
| 177 |
-
width:66.666667%;
|
| 178 |
-
}
|
| 179 |
-
.inbound-grid.one-fourth, .inbound-grid.inbound-4-col{
|
| 180 |
-
width:23%;
|
| 181 |
-
}
|
| 182 |
-
.inbound-grid.three-fourth{
|
| 183 |
-
width:75%;
|
| 184 |
-
}
|
| 185 |
-
.inbound-grid.one-fifth{
|
| 186 |
-
width:18%;
|
| 187 |
-
}
|
| 188 |
-
.inbound-grid.two-fifth{
|
| 189 |
-
width:40%;
|
| 190 |
-
}
|
| 191 |
-
.inbound-grid.three-fifth{
|
| 192 |
-
width:60%;
|
| 193 |
-
}
|
| 194 |
-
.inbound-grid.four-fifth{
|
| 195 |
-
width:80%;
|
| 196 |
-
}
|
| 197 |
-
|
| 198 |
-
|
| 199 |
-
|
| 200 |
-
/* Social Icons
|
| 201 |
-
* ----------------------------------------------------- */
|
| 202 |
-
ul.social-links{
|
| 203 |
-
list-style: none;
|
| 204 |
-
margin: 0;
|
| 205 |
-
padding: 0;
|
| 206 |
-
}
|
| 207 |
-
ul.social-links li{
|
| 208 |
-
display: inline-block;
|
| 209 |
-
list-style: none;
|
| 210 |
-
margin: 0;
|
| 211 |
-
padding: 7px 0;
|
| 212 |
-
}
|
| 213 |
-
ul.social-links li a{
|
| 214 |
-
background: #f2f2f2;
|
| 215 |
-
border: 1px solid #EBEBEA;
|
| 216 |
-
-webkit-border-radius: 2px;
|
| 217 |
-
-moz-border-radius: 2px;
|
| 218 |
-
border-radius: 2px;
|
| 219 |
-
display: inline-block;
|
| 220 |
-
width: 32px;
|
| 221 |
-
height: 32px;
|
| 222 |
-
line-height: 32px;
|
| 223 |
-
text-align: center;
|
| 224 |
-
color: #696763;
|
| 225 |
-
margin: 0px 1px;
|
| 226 |
-
}
|
| 227 |
-
ul.social-links li a:hover{
|
| 228 |
-
background-color: #c8232b;
|
| 229 |
-
border-color: rgba(0,0,0,0.2);
|
| 230 |
-
color: #fff;
|
| 231 |
-
}
|
| 232 |
-
#footer-wrapper ul.social-links{
|
| 233 |
-
float: right;
|
| 234 |
-
}
|
| 235 |
-
#footer-wrapper ul.social-links li a{
|
| 236 |
-
background-color: #4A4845;
|
| 237 |
-
border: none;
|
| 238 |
-
color: #9C9A96;
|
| 239 |
-
}
|
| 240 |
-
#footer-wrapper ul.social-links li a:hover{
|
| 241 |
-
background-color: #c8232b;
|
| 242 |
-
color: #fff;
|
| 243 |
-
}
|
| 244 |
-
|
| 245 |
-
/* About Widget
|
| 246 |
-
* ----------------------------------------------------- */
|
| 247 |
-
.widget-about{
|
| 248 |
-
background: url('images/map.png') no-repeat 0 0;
|
| 249 |
-
background-size: 100%;
|
| 250 |
-
}
|
| 251 |
-
.widget-about .address,
|
| 252 |
-
.widget-about .telephone,
|
| 253 |
-
.widget-about .email{
|
| 254 |
-
/*font-size: 85%;*/
|
| 255 |
-
}
|
| 256 |
-
.widget-about i{
|
| 257 |
-
color: #9C9A96;
|
| 258 |
-
margin-right: 5px;
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
/* Divider
|
| 262 |
-
* ----------------------------------------------------- */
|
| 263 |
-
.divider{
|
| 264 |
-
border-top: 1px solid #EBEBEA;
|
| 265 |
-
height: 1px;
|
| 266 |
-
margin: 0px;
|
| 267 |
-
position: relative;
|
| 268 |
-
}
|
| 269 |
-
.divider.none{
|
| 270 |
-
border:none
|
| 271 |
-
}
|
| 272 |
-
.divider.solid{
|
| 273 |
-
border-top: 1px solid #EBEBEA;
|
| 274 |
-
}
|
| 275 |
-
.divider.dashed{
|
| 276 |
-
border-top: 1px dashed #EBEBEA;
|
| 277 |
-
}
|
| 278 |
-
.divider.dotted{
|
| 279 |
-
border-top: 1px dotted #EBEBEA;
|
| 280 |
-
}
|
| 281 |
-
.divider.double{
|
| 282 |
-
border-top: 3px double #EBEBEA;
|
| 283 |
-
}
|
| 284 |
-
|
| 285 |
-
/* Teaser
|
| 286 |
-
* ----------------------------------------------------- */
|
| 287 |
-
.teaser{
|
| 288 |
-
margin-bottom: 20px;
|
| 289 |
-
}
|
| 290 |
-
.teaser .teaser-header{
|
| 291 |
-
margin: 0px 0px 10px 56px;
|
| 292 |
-
}
|
| 293 |
-
.teaser .teaser-title{
|
| 294 |
-
margin: 0px;
|
| 295 |
-
}
|
| 296 |
-
.teaser .teaser-subtitle{
|
| 297 |
-
color: #9C9A96;
|
| 298 |
-
}
|
| 299 |
-
.teaser .teaser-icon{
|
| 300 |
-
background: #4A4845;
|
| 301 |
-
-webkit-border-radius: 2px;
|
| 302 |
-
-moz-border-radius: 2px;
|
| 303 |
-
border-radius: 2px;
|
| 304 |
-
color: #fff;
|
| 305 |
-
font-size: 16px;
|
| 306 |
-
float: left;
|
| 307 |
-
line-height: 36px;
|
| 308 |
-
height: 36px;
|
| 309 |
-
width: 36px;
|
| 310 |
-
margin-top: 5px;
|
| 311 |
-
text-align: center;
|
| 312 |
-
}
|
| 313 |
-
.teaser .teaser-image{
|
| 314 |
-
float: left;
|
| 315 |
-
height: 36px;
|
| 316 |
-
width: 36px;
|
| 317 |
-
margin-top: 5px;
|
| 318 |
-
}
|
| 319 |
-
.teaser:hover .teaser-icon{
|
| 320 |
-
background-color: #c8232b;
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
/* Nested teaser */
|
| 324 |
-
.teaser.nested .teaser-content{
|
| 325 |
-
margin-left: 56px
|
| 326 |
-
}
|
| 327 |
-
|
| 328 |
-
/* Centered teaser */
|
| 329 |
-
.teaser.centered{
|
| 330 |
-
text-align: center;
|
| 331 |
-
}
|
| 332 |
-
.teaser.centered .teaser-icon{
|
| 333 |
-
background: none;
|
| 334 |
-
color: #696763;
|
| 335 |
-
float: none;
|
| 336 |
-
font-size: 64px;
|
| 337 |
-
line-height: 64px;
|
| 338 |
-
width: 64px;
|
| 339 |
-
height: 64px;
|
| 340 |
-
margin: 0px auto 5px auto;
|
| 341 |
-
}
|
| 342 |
-
.teaser.centered .teaser-header{
|
| 343 |
-
margin-left: 0px;
|
| 344 |
-
}
|
| 345 |
-
|
| 346 |
-
/* Call Out
|
| 347 |
-
* ----------------------------------------------------- */
|
| 348 |
-
.callout{
|
| 349 |
-
background: #f2f2f2;
|
| 350 |
-
border: 1px solid #EBEBEA;
|
| 351 |
-
-webkit-box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 352 |
-
-moz-box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 353 |
-
box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 354 |
-
padding: 20px 25px 0px;
|
| 355 |
-
margin-bottom: 20px;
|
| 356 |
-
}
|
| 357 |
-
.callout .left, .callout .right{
|
| 358 |
-
margin-bottom: 15px;
|
| 359 |
-
}
|
| 360 |
-
.callout h2{
|
| 361 |
-
font-size: 24px;
|
| 362 |
-
line-height: 24px;
|
| 363 |
-
margin: 0px 0px 5px;
|
| 364 |
-
text-shadow: 1px 1px 1px #fff;
|
| 365 |
-
}
|
| 366 |
-
.callout .subtitle{
|
| 367 |
-
font-size: 16px;
|
| 368 |
-
line-height: 22px;
|
| 369 |
-
text-shadow: 1px 1px 1px #fff;
|
| 370 |
-
margin: 0px 0px 5px;
|
| 371 |
-
}
|
| 372 |
-
.callout .inbound-button{
|
| 373 |
-
margin: 7px 0px 5px 0px
|
| 374 |
-
}
|
| 375 |
-
|
| 376 |
-
/* Intro
|
| 377 |
-
* ----------------------------------------------------- */
|
| 378 |
-
.intro{
|
| 379 |
-
margin-bottom: 20px;
|
| 380 |
-
}
|
| 381 |
-
.intro h1{
|
| 382 |
-
margin-bottom: 10px;
|
| 383 |
-
}
|
| 384 |
-
.intro .intro-content{
|
| 385 |
-
font-size: 16px;
|
| 386 |
-
line-height: 24px;
|
| 387 |
-
margin-bottom: 20px;
|
| 388 |
-
}
|
| 389 |
-
|
| 390 |
-
/* Tabs
|
| 391 |
-
* ----------------------------------------------------- */
|
| 392 |
-
.tabs-content{
|
| 393 |
-
margin-bottom: 20px;
|
| 394 |
-
}
|
| 395 |
-
ul.tabs-nav{
|
| 396 |
-
border-bottom: 1px solid #EBEBEA;
|
| 397 |
-
list-style: none;
|
| 398 |
-
margin: 0;
|
| 399 |
-
padding: 0;
|
| 400 |
-
}
|
| 401 |
-
ul.tabs-nav li{
|
| 402 |
-
display: inline-block;
|
| 403 |
-
margin: 0;
|
| 404 |
-
padding: 0;
|
| 405 |
-
}
|
| 406 |
-
ul.tabs-nav li a{
|
| 407 |
-
background: #f2f2f2 url('images/gradient.png');
|
| 408 |
-
border: 1px solid #EBEBEA;
|
| 409 |
-
border-right: none;
|
| 410 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 411 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 412 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 413 |
-
color: #696763;
|
| 414 |
-
display: inline-block;
|
| 415 |
-
font-weight: bold;
|
| 416 |
-
padding: 10px 20px;
|
| 417 |
-
position: relative;
|
| 418 |
-
margin-bottom: -1px;
|
| 419 |
-
text-shadow: 1px 1px 1px #fff;
|
| 420 |
-
}
|
| 421 |
-
ul.tabs-nav li a span{
|
| 422 |
-
display: inline-block;
|
| 423 |
-
margin-left: 5px;
|
| 424 |
-
}
|
| 425 |
-
ul.tabs-nav li a.active{
|
| 426 |
-
background-color: #fff;
|
| 427 |
-
border-bottom-color: #fff;
|
| 428 |
-
color: #4A4845;
|
| 429 |
-
}
|
| 430 |
-
ul.tabs-nav li:last-child{
|
| 431 |
-
border-right: 1px solid #EBEBEA;
|
| 432 |
-
}
|
| 433 |
-
|
| 434 |
-
.tabs > div{
|
| 435 |
-
border: 1px solid #EBEBEA;;
|
| 436 |
-
border-top: none;
|
| 437 |
-
padding: 20px;
|
| 438 |
-
}
|
| 439 |
-
|
| 440 |
-
/* Accordion
|
| 441 |
-
* ----------------------------------------------------- */
|
| 442 |
-
.accordion{
|
| 443 |
-
margin-bottom: 20px
|
| 444 |
-
}
|
| 445 |
-
.accordion .pane-title{
|
| 446 |
-
background: #f2f2f2;
|
| 447 |
-
border: 1px solid #EBEBEA;
|
| 448 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 449 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 450 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 451 |
-
font-size: 110%;
|
| 452 |
-
display: block;
|
| 453 |
-
font-weight: bold;
|
| 454 |
-
padding: 12px 20px;
|
| 455 |
-
position: relative;
|
| 456 |
-
margin-bottom: -1px;
|
| 457 |
-
text-shadow: 1px 1px 1px #fff;
|
| 458 |
-
}
|
| 459 |
-
.accordion .pane-title.active{
|
| 460 |
-
color: #4A4845;
|
| 461 |
-
}
|
| 462 |
-
.accordion .pane-title .pane-icon{
|
| 463 |
-
width: 16px;
|
| 464 |
-
margin-right: 10px;
|
| 465 |
-
text-align: center;
|
| 466 |
-
}
|
| 467 |
-
.accordion .pane-title .status-off,
|
| 468 |
-
.accordion .pane-title .status-on{
|
| 469 |
-
color: #CECDCA;
|
| 470 |
-
cursor: pointer;
|
| 471 |
-
float: right;
|
| 472 |
-
font-family: Verdana;
|
| 473 |
-
font-size: 14px;
|
| 474 |
-
font-weight: bold;
|
| 475 |
-
}
|
| 476 |
-
.accordion .pane-title .status-off{
|
| 477 |
-
display: block;
|
| 478 |
-
}
|
| 479 |
-
.accordion .pane-title .status-on{
|
| 480 |
-
display: none;
|
| 481 |
-
}
|
| 482 |
-
.accordion .pane-title.active .status-off{
|
| 483 |
-
display: none;
|
| 484 |
-
}
|
| 485 |
-
.accordion .pane-title.active .status-on{
|
| 486 |
-
display: block;
|
| 487 |
-
}
|
| 488 |
-
.accordion .pane{
|
| 489 |
-
border: 1px solid #EBEBEA;
|
| 490 |
-
padding: 20px;
|
| 491 |
-
margin: 0px 0px 20px 0px;
|
| 492 |
-
}
|
| 493 |
-
.accordion .pane.last{
|
| 494 |
-
margin: 0px;
|
| 495 |
-
}
|
| 496 |
-
|
| 497 |
-
/* Fancy quote
|
| 498 |
-
* ----------------------------------------------------- */
|
| 499 |
-
.fancy-quote{
|
| 500 |
-
margin: 0 0 20px;
|
| 501 |
-
}
|
| 502 |
-
.fancy-quote .quote-text{
|
| 503 |
-
background: #f2f2f2;
|
| 504 |
-
border: 1px solid #EBEBEA;
|
| 505 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 506 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 507 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 508 |
-
color: #555;
|
| 509 |
-
font: normal 16px/22px Georgia, serif;
|
| 510 |
-
margin: 0px 0px 15px;
|
| 511 |
-
padding: 20px;
|
| 512 |
-
position: relative;
|
| 513 |
-
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 514 |
-
}
|
| 515 |
-
.fancy-quote .quote-text p{
|
| 516 |
-
margin: 0;
|
| 517 |
-
}
|
| 518 |
-
.fancy-quote .quote-text .triangle{
|
| 519 |
-
background: #f2f2f2;
|
| 520 |
-
border: 1px solid;
|
| 521 |
-
border-color: #f2f2f2 #EBEBEA #EBEBEA #f2f2f2;
|
| 522 |
-
display: block;
|
| 523 |
-
width: 16px;
|
| 524 |
-
height: 16px;
|
| 525 |
-
position: absolute;
|
| 526 |
-
bottom: -8px; left: 25px;
|
| 527 |
-
-webkit-transform: rotate(45deg);
|
| 528 |
-
-moz-transform: rotate(45deg);
|
| 529 |
-
-ms-transform: rotate(45deg);
|
| 530 |
-
-o-transform: rotate(45deg);
|
| 531 |
-
transform: rotate(45deg);
|
| 532 |
-
}
|
| 533 |
-
.fancy-quote .quote-author{
|
| 534 |
-
padding: 0px 0px;
|
| 535 |
-
position: relative;
|
| 536 |
-
}
|
| 537 |
-
.fancy-quote .quote-author .quote-author-name{
|
| 538 |
-
font-weight: bold;
|
| 539 |
-
}
|
| 540 |
-
.fancy-quote .quote-author .quote-author-name:before{
|
| 541 |
-
content: "\2014 \0020";
|
| 542 |
-
color: #CECDCA;
|
| 543 |
-
font-weight: normal;
|
| 544 |
-
}
|
| 545 |
-
.fancy-quote .quote-author .quote-author-meta{
|
| 546 |
-
color: #9C9A96;
|
| 547 |
-
}
|
| 548 |
-
|
| 549 |
-
/* Pricing
|
| 550 |
-
* ----------------------------------------------------- */
|
| 551 |
-
.pricing{
|
| 552 |
-
border-left: 1px solid #fff;
|
| 553 |
-
margin-bottom: 30px;
|
| 554 |
-
margin-top: 10px;
|
| 555 |
-
}
|
| 556 |
-
.pricing .plan{
|
| 557 |
-
background: #fff;
|
| 558 |
-
border: 1px solid #EBEBEA;
|
| 559 |
-
float: left;
|
| 560 |
-
padding: 0;
|
| 561 |
-
text-align: center;
|
| 562 |
-
position: relative;
|
| 563 |
-
margin-left: -1px;
|
| 564 |
-
}
|
| 565 |
-
.pricing .plan-header{
|
| 566 |
-
background: #f2f2f2;
|
| 567 |
-
border-bottom: 1px solid #EBEBEA;
|
| 568 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 569 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 570 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 571 |
-
padding: 20px;
|
| 572 |
-
text-shadow: 1px 1px 1px #fff;
|
| 573 |
-
}
|
| 574 |
-
.pricing .plan-header h2{
|
| 575 |
-
font-size: 16px;
|
| 576 |
-
line-height: 22px;
|
| 577 |
-
margin: 0;
|
| 578 |
-
}
|
| 579 |
-
.pricing .plan-price{
|
| 580 |
-
background: #fcfcfc;
|
| 581 |
-
border-bottom: 1px solid #EBEBEA;
|
| 582 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 583 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 584 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 585 |
-
padding: 20px;
|
| 586 |
-
text-shadow: 1px 1px 1px #fff;
|
| 587 |
-
}
|
| 588 |
-
.pricing .plan-price strong{
|
| 589 |
-
display: block;
|
| 590 |
-
font-size: 40px;
|
| 591 |
-
line-height: 40px;
|
| 592 |
-
}
|
| 593 |
-
.pricing .plan-price span{
|
| 594 |
-
color: #9C9A96;
|
| 595 |
-
}
|
| 596 |
-
.pricing .plan-content{
|
| 597 |
-
background: #fff;
|
| 598 |
-
}
|
| 599 |
-
.pricing .plan-content ul,
|
| 600 |
-
.pricing .plan-content ol{
|
| 601 |
-
list-style: none;
|
| 602 |
-
padding: 0;
|
| 603 |
-
margin: 0;
|
| 604 |
-
}
|
| 605 |
-
.pricing .plan-content ul li,
|
| 606 |
-
.pricing .plan-content ol li{
|
| 607 |
-
border-bottom: 1px solid #EBEBEA;
|
| 608 |
-
padding: 10px 20px;
|
| 609 |
-
margin: 0;
|
| 610 |
-
}
|
| 611 |
-
.pricing .plan-footer{
|
| 612 |
-
background: #f9f9f9;
|
| 613 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 614 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 615 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 616 |
-
padding: 20px;
|
| 617 |
-
}
|
| 618 |
-
.pricing .plan-footer .inbound-button{
|
| 619 |
-
padding: 5px 20px;
|
| 620 |
-
}
|
| 621 |
-
|
| 622 |
-
/* Featured Plan */
|
| 623 |
-
.pricing .plan.featured{
|
| 624 |
-
border-color: #CECDCA;
|
| 625 |
-
-webkit-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 626 |
-
-moz-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 627 |
-
box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 628 |
-
z-index: 200;
|
| 629 |
-
margin-top: -10px;
|
| 630 |
-
}
|
| 631 |
-
.pricing .plan.featured .plan-header{
|
| 632 |
-
background-color: #e0e0e0;
|
| 633 |
-
border-color: #CECDCA;
|
| 634 |
-
padding: 25px 0px;
|
| 635 |
-
}
|
| 636 |
-
.pricing .plan.featured .plan-header h2{
|
| 637 |
-
}
|
| 638 |
-
.pricing .plan.featured .plan-price{
|
| 639 |
-
background-color: #f2f2f2;
|
| 640 |
-
}
|
| 641 |
-
.pricing .plan.featured .plan-content{
|
| 642 |
-
}
|
| 643 |
-
.pricing .plan.featured .plan-footer{
|
| 644 |
-
padding: 25px 0px;
|
| 645 |
-
background-color: #f2f2f2;
|
| 646 |
-
border-color: #CECDCA;
|
| 647 |
-
}
|
| 648 |
-
|
| 649 |
-
/* Dropcap
|
| 650 |
-
* ----------------------------------------------------- */
|
| 651 |
-
.dropcap{
|
| 652 |
-
font-size: 48px;
|
| 653 |
-
font-weight: bold;
|
| 654 |
-
float: left;
|
| 655 |
-
margin: 10px 10px 10px 0;
|
| 656 |
-
}
|
| 657 |
-
.dropcap.square{
|
| 658 |
-
background: #696763;
|
| 659 |
-
color: #fff;
|
| 660 |
-
font-size: 24px;
|
| 661 |
-
width: 48px;
|
| 662 |
-
height: 48px;
|
| 663 |
-
line-height: 48px;
|
| 664 |
-
text-align: center;
|
| 665 |
-
margin: 6px 10px 0px 0
|
| 666 |
-
}
|
| 667 |
-
.dropcap.circle{
|
| 668 |
-
background: #696763;
|
| 669 |
-
border-radius: 50%;
|
| 670 |
-
color: #fff;
|
| 671 |
-
font-size: 24px;
|
| 672 |
-
width: 48px;
|
| 673 |
-
height: 48px;
|
| 674 |
-
line-height: 48px;
|
| 675 |
-
text-align: center;
|
| 676 |
-
margin: 6px 10px 0px 0
|
| 677 |
-
}
|
| 678 |
-
|
| 679 |
-
/* Alert message
|
| 680 |
-
* ----------------------------------------------------- */
|
| 681 |
-
.alert-message{
|
| 682 |
-
background: #FFF;
|
| 683 |
-
border: 1px solid #EBEBEA;
|
| 684 |
-
padding: 8px 50px 8px 20px;
|
| 685 |
-
-webkit-border-radius: 3px;
|
| 686 |
-
-moz-border-radius: 3px;
|
| 687 |
-
border-radius: 3px;
|
| 688 |
-
position: relative;
|
| 689 |
-
margin-bottom: 20px;
|
| 690 |
-
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 691 |
-
}
|
| 692 |
-
.alert-message span.close{
|
| 693 |
-
position: absolute;
|
| 694 |
-
color: #CECDCA;
|
| 695 |
-
display: inline-block;
|
| 696 |
-
font-size: 14px;
|
| 697 |
-
line-height: 100%;
|
| 698 |
-
font-weight: 700;
|
| 699 |
-
width: 14px;
|
| 700 |
-
height: 14px;
|
| 701 |
-
text-align: center;
|
| 702 |
-
cursor: pointer;
|
| 703 |
-
right: 10px;
|
| 704 |
-
top: 11px;
|
| 705 |
-
}
|
| 706 |
-
.alert-message span.close:hover{
|
| 707 |
-
color: #9C9A96;
|
| 708 |
-
}
|
| 709 |
-
.alert-message.blue{
|
| 710 |
-
background: #dbf3f9;
|
| 711 |
-
border: 1px solid #c5e3ea;
|
| 712 |
-
}
|
| 713 |
-
.alert-message.green{
|
| 714 |
-
background: #e2ffc9;
|
| 715 |
-
border: 1px solid #c5eda3;
|
| 716 |
-
}
|
| 717 |
-
.alert-message.red{
|
| 718 |
-
background: #ffe2e2;
|
| 719 |
-
border: 1px solid #fcd1d1;
|
| 720 |
-
}
|
| 721 |
-
.alert-message.yellow{
|
| 722 |
-
background: #fcf7d1;
|
| 723 |
-
border: 1px solid #f2ebba;
|
| 724 |
-
}
|
| 725 |
-
|
| 726 |
-
/* Content Box
|
| 727 |
-
* ----------------------------------------------------- */
|
| 728 |
-
.inbound-content-box{
|
| 729 |
-
background: #f2f2f2;
|
| 730 |
-
border: 1px solid #EBEBEA;
|
| 731 |
-
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 732 |
-
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 733 |
-
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 734 |
-
margin: 0px 0px 20px;
|
| 735 |
-
padding: 20px 20px 20px;
|
| 736 |
-
position: relative;
|
| 737 |
-
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 738 |
-
}
|
| 739 |
-
.inbound-content-box > p:last-child{
|
| 740 |
-
margin-bottom: 0;
|
| 741 |
-
}
|
| 742 |
-
.inbound-content-box.blue{
|
| 743 |
-
background: #EEF9FC;
|
| 744 |
-
border: 1px solid #dfecf9;
|
| 745 |
-
}
|
| 746 |
-
.inbound-content-box.green{
|
| 747 |
-
background: #E9FFD6;
|
| 748 |
-
border: 1px solid #D4F2BB;
|
| 749 |
-
}
|
| 750 |
-
.inbound-content-box.red{
|
| 751 |
-
background: #FCE3E3;
|
| 752 |
-
border: 1px solid #fcd1d1;
|
| 753 |
-
}
|
| 754 |
-
.inbound-content-box.yellow{
|
| 755 |
-
background: #fcf7d1;
|
| 756 |
-
border: 1px solid #f2ebba;
|
| 757 |
-
}
|
| 758 |
-
.inbound-content-box h1,
|
| 759 |
-
.inbound-content-box h2,
|
| 760 |
-
.inbound-content-box h3,
|
| 761 |
-
.inbound-content-box h4,
|
| 762 |
-
.inbound-content-box h5,
|
| 763 |
-
.inbound-content-box h6{
|
| 764 |
-
margin-bottom: 10px;
|
| 765 |
-
}
|
| 766 |
-
|
| 767 |
-
/* Profile Box
|
| 768 |
-
* ----------------------------------------------------- */
|
| 769 |
-
.profile-box{
|
| 770 |
-
margin-bottom: 20px;
|
| 771 |
-
}
|
| 772 |
-
.profile-box .profile-img{
|
| 773 |
-
margin-bottom: 15px;
|
| 774 |
-
}
|
| 775 |
-
.profile-box .profile-img img{
|
| 776 |
-
display: block;
|
| 777 |
-
width: 100%;
|
| 778 |
-
height: auto;
|
| 779 |
-
margin: -1px;
|
| 780 |
-
}
|
| 781 |
-
.profile-box .profile-name{
|
| 782 |
-
margin-bottom: 0;
|
| 783 |
-
}
|
| 784 |
-
.profile-box .profile-meta{
|
| 785 |
-
color: #9C9A96;
|
| 786 |
-
margin-bottom: 15px;
|
| 787 |
-
}
|
| 788 |
-
.profile-box .profile-desc p:last-child{
|
| 789 |
-
margin-bottom: 0px;
|
| 790 |
-
}
|
| 791 |
-
.profile-box .profile-footer{
|
| 792 |
-
margin-top: 15px;
|
| 793 |
-
}
|
| 794 |
-
.profile-box .profile-footer a{
|
| 795 |
-
color: #9C9A96;
|
| 796 |
-
font-size: 12px;
|
| 797 |
-
margin-right: 10px;
|
| 798 |
-
}
|
| 799 |
-
|
| 800 |
-
/* Client Box
|
| 801 |
-
* ----------------------------------------------------- */
|
| 802 |
-
.client_box{
|
| 803 |
-
margin-bottom: 20px;
|
| 804 |
-
}
|
| 805 |
-
.client_box ul{
|
| 806 |
-
list-style: none;
|
| 807 |
-
margin: 0;
|
| 808 |
-
padding: 0;
|
| 809 |
-
}
|
| 810 |
-
.client_box ul li.inbound-grid{
|
| 811 |
-
border: 1px solid #EBEBEA;
|
| 812 |
-
margin: 0px -1px -1px 0px;
|
| 813 |
-
padding: 0;
|
| 814 |
-
}
|
| 815 |
-
.client_box ul li a{
|
| 816 |
-
display: block;
|
| 817 |
-
text-align: center;
|
| 818 |
-
}
|
| 819 |
-
.client_box ul li:hover{
|
| 820 |
-
border-color: #CECDCA;
|
| 821 |
-
-webkit-box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 822 |
-
-moz-box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 823 |
-
box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 824 |
-
z-index: 200
|
| 825 |
-
}
|
| 826 |
-
|
| 827 |
-
/* Google Map
|
| 828 |
-
* ----------------------------------------------------- */
|
| 829 |
-
.google_map{
|
| 830 |
-
max-width: 100%;
|
| 831 |
-
margin-bottom: 20px;
|
| 832 |
-
}
|
| 833 |
-
|
| 834 |
-
/* Buttons
|
| 835 |
-
* ------------------------------------------*/
|
| 836 |
-
a.inbound-button, a.inbound-button.inbound-special-class{
|
| 837 |
-
background:#c8232b;
|
| 838 |
-
border:1px solid rgba(0,0,0,0.15);
|
| 839 |
-
-webkit-border-radius:2px;
|
| 840 |
-
-moz-border-radius:2px;
|
| 841 |
-
border-radius:2px;
|
| 842 |
-
-webkit-box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 843 |
-
-moz-box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 844 |
-
box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 845 |
-
color:#fff;
|
| 846 |
-
cursor:pointer;
|
| 847 |
-
display:inline-block;
|
| 848 |
-
font-family:inherit;
|
| 849 |
-
font-size:14px;
|
| 850 |
-
font-weight:bold;
|
| 851 |
-
padding:8px 15px;
|
| 852 |
-
text-shadow:-1px -1px 1px rgba(0,0,0,0.15);
|
| 853 |
-
text-decoration: none;
|
| 854 |
-
text-align: center;
|
| 855 |
-
}
|
| 856 |
-
.inbound-button:hover{
|
| 857 |
-
color:#fff;
|
| 858 |
-
}
|
| 859 |
-
.inbound-button.small{
|
| 860 |
-
font-size: 100%;
|
| 861 |
-
padding:4px 10px;
|
| 862 |
-
}
|
| 863 |
-
.inbound-button.large{
|
| 864 |
-
font-size:18px;
|
| 865 |
-
padding:12px 30px;
|
| 866 |
-
}
|
| 867 |
-
input[type=submit].inbound-button, button.inbound-button{
|
| 868 |
-
-webkit-appearance:none;
|
| 869 |
-
}
|
| 870 |
-
.inbound-button.black{
|
| 871 |
-
background-color: #4A4845;
|
| 872 |
-
}
|
| 873 |
-
.inbound-button.blue{
|
| 874 |
-
background-color: #707ef9;
|
| 875 |
-
}
|
| 876 |
-
.inbound-button.brown{
|
| 877 |
-
background-color: #5e3d1d;
|
| 878 |
-
}
|
| 879 |
-
.inbound-button.green{
|
| 880 |
-
background-color: #65b20e;
|
| 881 |
-
}
|
| 882 |
-
.inbound-button.orange{
|
| 883 |
-
background-color: #ff9900;
|
| 884 |
-
}
|
| 885 |
-
.inbound-button.pink{
|
| 886 |
-
background-color: #fc149f;
|
| 887 |
-
}
|
| 888 |
-
.inbound-button.purple{
|
| 889 |
-
background-color: #993d9e;
|
| 890 |
-
}
|
| 891 |
-
.inbound-button.red{
|
| 892 |
-
background-color: #fc5a5a;
|
| 893 |
-
}
|
| 894 |
-
.inbound-button.silver{
|
| 895 |
-
background-color: #858585;
|
| 896 |
-
}
|
| 897 |
-
.inbound-button.yellow{
|
| 898 |
-
background-color: #f7c707;
|
| 899 |
-
}
|
| 900 |
-
.inbound-button.white{
|
| 901 |
-
background-color: #f4f4f4;
|
| 902 |
-
border-color: #ccc;
|
| 903 |
-
-webkit-box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 904 |
-
-moz-box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 905 |
-
box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 906 |
-
color: #666;
|
| 907 |
-
text-shadow: none;
|
| 908 |
-
}
|
| 909 |
-
.inbound-button.white:hover{
|
| 910 |
-
color: #4A4845;
|
| 911 |
-
}
|
| 912 |
-
|
| 913 |
-
/*!
|
| 914 |
-
* Font Awesome 4.0.3 by @davegandy - http://fontawesome.io - @fontawesome
|
| 915 |
-
* License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
|
| 916 |
-
*/
|
| 917 |
-
@font-face {
|
| 918 |
-
font-family: 'FontAwesome';
|
| 919 |
-
src: url('
|
| 920 |
-
src: url('
|
| 921 |
-
url('
|
| 922 |
-
url('
|
| 923 |
-
font-weight: normal;
|
| 924 |
-
font-style: normal;
|
| 925 |
-
}format('svg');font-weight:normal;font-style:normal}.fa{display:inline-block;font-family:FontAwesome;font-style:normal;font-weight:normal;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857142858em;text-align:center}.fa-ul{padding-left:0;margin-left:2.142857142857143em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.142857142857143em;width:2.142857142857143em;top:.14285714285714285em;text-align:center}.fa-li.fa-lg{left:-1.8571428571428572em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{-webkit-animation:spin 2s infinite linear;-moz-animation:spin 2s infinite linear;-o-animation:spin 2s infinite linear;animation:spin 2s infinite linear}@-moz-keyframes spin{0%{-moz-transform:rotate(0deg)}100%{-moz-transform:rotate(359deg)}}@-webkit-keyframes spin{0%{-webkit-transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg)}}@-o-keyframes spin{0%{-o-transform:rotate(0deg)}100%{-o-transform:rotate(359deg)}}@-ms-keyframes spin{0%{-ms-transform:rotate(0deg)}100%{-ms-transform:rotate(359deg)}}@keyframes spin{0%{transform:rotate(0deg)}100%{transform:rotate(359deg)}}.fa-rotate-90{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=1);-webkit-transform:rotate(90deg);-moz-transform:rotate(90deg);-ms-transform:rotate(90deg);-o-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=2);-webkit-transform:rotate(180deg);-moz-transform:rotate(180deg);-ms-transform:rotate(180deg);-o-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=3);-webkit-transform:rotate(270deg);-moz-transform:rotate(270deg);-ms-transform:rotate(270deg);-o-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=0,mirror=1);-webkit-transform:scale(-1,1);-moz-transform:scale(-1,1);-ms-transform:scale(-1,1);-o-transform:scale(-1,1);transform:scale(-1,1)}.fa-flip-vertical{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=2,mirror=1);-webkit-transform:scale(1,-1);-moz-transform:scale(1,-1);-ms-transform:scale(1,-1);-o-transform:scale(1,-1);transform:scale(1,-1)}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:"\f000"}.fa-music:before{content:"\f001"}.fa-search:before{content:"\f002"}.fa-envelope-o:before{content:"\f003"}.fa-heart:before{content:"\f004"}.fa-star:before{content:"\f005"}.fa-star-o:before{content:"\f006"}.fa-user:before{content:"\f007"}.fa-film:before{content:"\f008"}.fa-th-large:before{content:"\f009"}.fa-th:before{content:"\f00a"}.fa-th-list:before{content:"\f00b"}.fa-check:before{content:"\f00c"}.fa-times:before{content:"\f00d"}.fa-search-plus:before{content:"\f00e"}.fa-search-minus:before{content:"\f010"}.fa-power-off:before{content:"\f011"}.fa-signal:before{content:"\f012"}.fa-gear:before,.fa-cog:before{content:"\f013"}.fa-trash-o:before{content:"\f014"}.fa-home:before{content:"\f015"}.fa-file-o:before{content:"\f016"}.fa-clock-o:before{content:"\f017"}.fa-road:before{content:"\f018"}.fa-download:before{content:"\f019"}.fa-arrow-circle-o-down:before{content:"\f01a"}.fa-arrow-circle-o-up:before{content:"\f01b"}.fa-inbox:before{content:"\f01c"}.fa-play-circle-o:before{content:"\f01d"}.fa-rotate-right:before,.fa-repeat:before{content:"\f01e"}.fa-refresh:before{content:"\f021"}.fa-list-alt:before{content:"\f022"}.fa-lock:before{content:"\f023"}.fa-flag:before{content:"\f024"}.fa-headphones:before{content:"\f025"}.fa-volume-off:before{content:"\f026"}.fa-volume-down:before{content:"\f027"}.fa-volume-up:before{content:"\f028"}.fa-qrcode:before{content:"\f029"}.fa-barcode:before{content:"\f02a"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-book:before{content:"\f02d"}.fa-bookmark:before{content:"\f02e"}.fa-print:before{content:"\f02f"}.fa-camera:before{content:"\f030"}.fa-font:before{content:"\f031"}.fa-bold:before{content:"\f032"}.fa-italic:before{content:"\f033"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-align-left:before{content:"\f036"}.fa-align-center:before{content:"\f037"}.fa-align-right:before{content:"\f038"}.fa-align-justify:before{content:"\f039"}.fa-list:before{content:"\f03a"}.fa-dedent:before,.fa-outdent:before{content:"\f03b"}.fa-indent:before{content:"\f03c"}.fa-video-camera:before{content:"\f03d"}.fa-picture-o:before{content:"\f03e"}.fa-pencil:before{content:"\f040"}.fa-map-marker:before{content:"\f041"}.fa-adjust:before{content:"\f042"}.fa-tint:before{content:"\f043"}.fa-edit:before,.fa-pencil-square-o:before{content:"\f044"}.fa-share-square-o:before{content:"\f045"}.fa-check-square-o:before{content:"\f046"}.fa-arrows:before{content:"\f047"}.fa-step-backward:before{content:"\f048"}.fa-fast-backward:before{content:"\f049"}.fa-backward:before{content:"\f04a"}.fa-play:before{content:"\f04b"}.fa-pause:before{content:"\f04c"}.fa-stop:before{content:"\f04d"}.fa-forward:before{content:"\f04e"}.fa-fast-forward:before{content:"\f050"}.fa-step-forward:before{content:"\f051"}.fa-eject:before{content:"\f052"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-plus-circle:before{content:"\f055"}.fa-minus-circle:before{content:"\f056"}.fa-times-circle:before{content:"\f057"}.fa-check-circle:before{content:"\f058"}.fa-question-circle:before{content:"\f059"}.fa-info-circle:before{content:"\f05a"}.fa-crosshairs:before{content:"\f05b"}.fa-times-circle-o:before{content:"\f05c"}.fa-check-circle-o:before{content:"\f05d"}.fa-ban:before{content:"\f05e"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrow-down:before{content:"\f063"}.fa-mail-forward:before,.fa-share:before{content:"\f064"}.fa-expand:before{content:"\f065"}.fa-compress:before{content:"\f066"}.fa-plus:before{content:"\f067"}.fa-minus:before{content:"\f068"}.fa-asterisk:before{content:"\f069"}.fa-exclamation-circle:before{content:"\f06a"}.fa-gift:before{content:"\f06b"}.fa-leaf:before{content:"\f06c"}.fa-fire:before{content:"\f06d"}.fa-eye:before{content:"\f06e"}.fa-eye-slash:before{content:"\f070"}.fa-warning:before,.fa-exclamation-triangle:before{content:"\f071"}.fa-plane:before{content:"\f072"}.fa-calendar:before{content:"\f073"}.fa-random:before{content:"\f074"}.fa-comment:before{content:"\f075"}.fa-magnet:before{content:"\f076"}.fa-chevron-up:before{content:"\f077"}.fa-chevron-down:before{content:"\f078"}.fa-retweet:before{content:"\f079"}.fa-shopping-cart:before{content:"\f07a"}.fa-folder:before{content:"\f07b"}.fa-folder-open:before{content:"\f07c"}.fa-arrows-v:before{content:"\f07d"}.fa-arrows-h:before{content:"\f07e"}.fa-bar-chart-o:before{content:"\f080"}.fa-twitter-square:before{content:"\f081"}.fa-facebook-square:before{content:"\f082"}.fa-camera-retro:before{content:"\f083"}.fa-key:before{content:"\f084"}.fa-gears:before,.fa-cogs:before{content:"\f085"}.fa-comments:before{content:"\f086"}.fa-thumbs-o-up:before{content:"\f087"}.fa-thumbs-o-down:before{content:"\f088"}.fa-star-half:before{content:"\f089"}.fa-heart-o:before{content:"\f08a"}.fa-sign-out:before{content:"\f08b"}.fa-linkedin-square:before{content:"\f08c"}.fa-thumb-tack:before{content:"\f08d"}.fa-external-link:before{content:"\f08e"}.fa-sign-in:before{content:"\f090"}.fa-trophy:before{content:"\f091"}.fa-github-square:before{content:"\f092"}.fa-upload:before{content:"\f093"}.fa-lemon-o:before{content:"\f094"}.fa-phone:before{content:"\f095"}.fa-square-o:before{content:"\f096"}.fa-bookmark-o:before{content:"\f097"}.fa-phone-square:before{content:"\f098"}.fa-twitter:before{content:"\f099"}.fa-facebook:before{content:"\f09a"}.fa-github:before{content:"\f09b"}.fa-unlock:before{content:"\f09c"}.fa-credit-card:before{content:"\f09d"}.fa-rss:before{content:"\f09e"}.fa-hdd-o:before{content:"\f0a0"}.fa-bullhorn:before{content:"\f0a1"}.fa-bell:before{content:"\f0f3"}.fa-certificate:before{content:"\f0a3"}.fa-hand-o-right:before{content:"\f0a4"}.fa-hand-o-left:before{content:"\f0a5"}.fa-hand-o-up:before{content:"\f0a6"}.fa-hand-o-down:before{content:"\f0a7"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-globe:before{content:"\f0ac"}.fa-wrench:before{content:"\f0ad"}.fa-tasks:before{content:"\f0ae"}.fa-filter:before{content:"\f0b0"}.fa-briefcase:before{content:"\f0b1"}.fa-arrows-alt:before{content:"\f0b2"}.fa-group:before,.fa-users:before{content:"\f0c0"}.fa-chain:before,.fa-link:before{content:"\f0c1"}.fa-cloud:before{content:"\f0c2"}.fa-flask:before{content:"\f0c3"}.fa-cut:before,.fa-scissors:before{content:"\f0c4"}.fa-copy:before,.fa-files-o:before{content:"\f0c5"}.fa-paperclip:before{content:"\f0c6"}.fa-save:before,.fa-floppy-o:before{content:"\f0c7"}.fa-square:before{content:"\f0c8"}.fa-bars:before{content:"\f0c9"}.fa-list-ul:before{content:"\f0ca"}.fa-list-ol:before{content:"\f0cb"}.fa-strikethrough:before{content:"\f0cc"}.fa-underline:before{content:"\f0cd"}.fa-table:before{content:"\f0ce"}.fa-magic:before{content:"\f0d0"}.fa-truck:before{content:"\f0d1"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-square:before{content:"\f0d3"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-plus:before{content:"\f0d5"}.fa-money:before{content:"\f0d6"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-up:before{content:"\f0d8"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-columns:before{content:"\f0db"}.fa-unsorted:before,.fa-sort:before{content:"\f0dc"}.fa-sort-down:before,.fa-sort-asc:before{content:"\f0dd"}.fa-sort-up:before,.fa-sort-desc:before{content:"\f0de"}.fa-envelope:before{content:"\f0e0"}.fa-linkedin:before{content:"\f0e1"}.fa-rotate-left:before,.fa-undo:before{content:"\f0e2"}.fa-legal:before,.fa-gavel:before{content:"\f0e3"}.fa-dashboard:before,.fa-tachometer:before{content:"\f0e4"}.fa-comment-o:before{content:"\f0e5"}.fa-comments-o:before{content:"\f0e6"}.fa-flash:before,.fa-bolt:before{content:"\f0e7"}.fa-sitemap:before{content:"\f0e8"}.fa-umbrella:before{content:"\f0e9"}.fa-paste:before,.fa-clipboard:before{content:"\f0ea"}.fa-lightbulb-o:before{content:"\f0eb"}.fa-exchange:before{content:"\f0ec"}.fa-cloud-download:before{content:"\f0ed"}.fa-cloud-upload:before{content:"\f0ee"}.fa-user-md:before{content:"\f0f0"}.fa-stethoscope:before{content:"\f0f1"}.fa-suitcase:before{content:"\f0f2"}.fa-bell-o:before{content:"\f0a2"}.fa-coffee:before{content:"\f0f4"}.fa-cutlery:before{content:"\f0f5"}.fa-file-text-o:before{content:"\f0f6"}.fa-building-o:before{content:"\f0f7"}.fa-hospital-o:before{content:"\f0f8"}.fa-ambulance:before{content:"\f0f9"}.fa-medkit:before{content:"\f0fa"}.fa-fighter-jet:before{content:"\f0fb"}.fa-beer:before{content:"\f0fc"}.fa-h-square:before{content:"\f0fd"}.fa-plus-square:before{content:"\f0fe"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angle-down:before{content:"\f107"}.fa-desktop:before{content:"\f108"}.fa-laptop:before{content:"\f109"}.fa-tablet:before{content:"\f10a"}.fa-mobile-phone:before,.fa-mobile:before{content:"\f10b"}.fa-circle-o:before{content:"\f10c"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-spinner:before{content:"\f110"}.fa-circle:before{content:"\f111"}.fa-mail-reply:before,.fa-reply:before{content:"\f112"}.fa-github-alt:before{content:"\f113"}.fa-folder-o:before{content:"\f114"}.fa-folder-open-o:before{content:"\f115"}.fa-smile-o:before{content:"\f118"}.fa-frown-o:before{content:"\f119"}.fa-meh-o:before{content:"\f11a"}.fa-gamepad:before{content:"\f11b"}.fa-keyboard-o:before{content:"\f11c"}.fa-flag-o:before{content:"\f11d"}.fa-flag-checkered:before{content:"\f11e"}.fa-terminal:before{content:"\f120"}.fa-code:before{content:"\f121"}.fa-reply-all:before{content:"\f122"}.fa-mail-reply-all:before{content:"\f122"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:"\f123"}.fa-location-arrow:before{content:"\f124"}.fa-crop:before{content:"\f125"}.fa-code-fork:before{content:"\f126"}.fa-unlink:before,.fa-chain-broken:before{content:"\f127"}.fa-question:before{content:"\f128"}.fa-info:before{content:"\f129"}.fa-exclamation:before{content:"\f12a"}.fa-superscript:before{content:"\f12b"}.fa-subscript:before{content:"\f12c"}.fa-eraser:before{content:"\f12d"}.fa-puzzle-piece:before{content:"\f12e"}.fa-microphone:before{content:"\f130"}.fa-microphone-slash:before{content:"\f131"}.fa-shield:before{content:"\f132"}.fa-calendar-o:before{content:"\f133"}.fa-fire-extinguisher:before{content:"\f134"}.fa-rocket:before{content:"\f135"}.fa-maxcdn:before{content:"\f136"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-html5:before{content:"\f13b"}.fa-css3:before{content:"\f13c"}.fa-anchor:before{content:"\f13d"}.fa-unlock-alt:before{content:"\f13e"}.fa-bullseye:before{content:"\f140"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-rss-square:before{content:"\f143"}.fa-play-circle:before{content:"\f144"}.fa-ticket:before{content:"\f145"}.fa-minus-square:before{content:"\f146"}.fa-minus-square-o:before{content:"\f147"}.fa-level-up:before{content:"\f148"}.fa-level-down:before{content:"\f149"}.fa-check-square:before{content:"\f14a"}.fa-pencil-square:before{content:"\f14b"}.fa-external-link-square:before{content:"\f14c"}.fa-share-square:before{content:"\f14d"}.fa-compass:before{content:"\f14e"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:"\f150"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:"\f151"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:"\f152"}.fa-euro:before,.fa-eur:before{content:"\f153"}.fa-gbp:before{content:"\f154"}.fa-dollar:before,.fa-usd:before{content:"\f155"}.fa-rupee:before,.fa-inr:before{content:"\f156"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:"\f157"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:"\f158"}.fa-won:before,.fa-krw:before{content:"\f159"}.fa-bitcoin:before,.fa-btc:before{content:"\f15a"}.fa-file:before{content:"\f15b"}.fa-file-text:before{content:"\f15c"}.fa-sort-alpha-asc:before{content:"\f15d"}.fa-sort-alpha-desc:before{content:"\f15e"}.fa-sort-amount-asc:before{content:"\f160"}.fa-sort-amount-desc:before{content:"\f161"}.fa-sort-numeric-asc:before{content:"\f162"}.fa-sort-numeric-desc:before{content:"\f163"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbs-down:before{content:"\f165"}.fa-youtube-square:before{content:"\f166"}.fa-youtube:before{content:"\f167"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-youtube-play:before{content:"\f16a"}.fa-dropbox:before{content:"\f16b"}.fa-stack-overflow:before{content:"\f16c"}.fa-instagram:before{content:"\f16d"}.fa-flickr:before{content:"\f16e"}.fa-adn:before{content:"\f170"}.fa-bitbucket:before{content:"\f171"}.fa-bitbucket-square:before{content:"\f172"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-long-arrow-down:before{content:"\f175"}.fa-long-arrow-up:before{content:"\f176"}.fa-long-arrow-left:before{content:"\f177"}.fa-long-arrow-right:before{content:"\f178"}.fa-apple:before{content:"\f179"}.fa-windows:before{content:"\f17a"}.fa-android:before{content:"\f17b"}.fa-linux:before{content:"\f17c"}.fa-dribbble:before{content:"\f17d"}.fa-skype:before{content:"\f17e"}.fa-foursquare:before{content:"\f180"}.fa-trello:before{content:"\f181"}.fa-female:before{content:"\f182"}.fa-male:before{content:"\f183"}.fa-gittip:before{content:"\f184"}.fa-sun-o:before{content:"\f185"}.fa-moon-o:before{content:"\f186"}.fa-archive:before{content:"\f187"}.fa-bug:before{content:"\f188"}.fa-vk:before{content:"\f189"}.fa-weibo:before{content:"\f18a"}.fa-renren:before{content:"\f18b"}.fa-pagelines:before{content:"\f18c"}.fa-stack-exchange:before{content:"\f18d"}.fa-arrow-circle-o-right:before{content:"\f18e"}.fa-arrow-circle-o-left:before{content:"\f190"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:"\f191"}.fa-dot-circle-o:before{content:"\f192"}.fa-wheelchair:before{content:"\f193"}.fa-vimeo-square:before{content:"\f194"}.fa-turkish-lira:before,.fa-try:before{content:"\f195"}.fa-plus-square-o:before{content:"\f196"}
|
| 926 |
-
|
| 927 |
-
/* List ICON Rules */
|
| 928 |
-
/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
|
| 929 |
-
readers do not read off random characters that represent icons */
|
| 930 |
-
#inbound-list.list-icon-glass li:before { content: "\f000"; }
|
| 931 |
-
|
| 932 |
-
#inbound-list.fa-list-glass li:before{content:"\f000"}#inbound-list.fa-list-music li:before{content:"\f001"}#inbound-list.fa-list-search li:before{content:"\f002"}#inbound-list.fa-list-envelope-o li:before{content:"\f003"}#inbound-list.fa-list-heart li:before{content:"\f004"}#inbound-list.fa-list-star li:before{content:"\f005"}#inbound-list.fa-list-star-o li:before{content:"\f006"}#inbound-list.fa-list-user li:before{content:"\f007"}#inbound-list.fa-list-film li:before{content:"\f008"}#inbound-list.fa-list-th-large li:before{content:"\f009"}#inbound-list.fa-list-th li:before{content:"\f00a"}#inbound-list.fa-list-th-list li:before{content:"\f00b"}#inbound-list.fa-list-check li:before{content:"\f00c"}#inbound-list.fa-list-times li:before{content:"\f00d"}#inbound-list.fa-list-search-plus li:before{content:"\f00e"}#inbound-list.fa-list-search-minus li:before{content:"\f010"}#inbound-list.fa-list-power-off li:before{content:"\f011"}#inbound-list.fa-list-signal li:before{content:"\f012"}#inbound-list.fa-list-gear li:before,#inbound-list.fa-list-cog li:before{content:"\f013"}#inbound-list.fa-list-trash-o li:before{content:"\f014"}#inbound-list.fa-list-home li:before{content:"\f015"}#inbound-list.fa-list-file-o li:before{content:"\f016"}#inbound-list.fa-list-clock-o li:before{content:"\f017"}#inbound-list.fa-list-road li:before{content:"\f018"}#inbound-list.fa-list-download li:before{content:"\f019"}#inbound-list.fa-list-arrow-circle-o-down li:before{content:"\f01a"}#inbound-list.fa-list-arrow-circle-o-up li:before{content:"\f01b"}#inbound-list.fa-list-inbox li:before{content:"\f01c"}#inbound-list.fa-list-play-circle-o li:before{content:"\f01d"}#inbound-list.fa-list-rotate-right li:before,#inbound-list.fa-list-repeat li:before{content:"\f01e"}#inbound-list.fa-list-refresh li:before{content:"\f021"}#inbound-list.fa-list-list-alt li:before{content:"\f022"}#inbound-list.fa-list-lock li:before{content:"\f023"}#inbound-list.fa-list-flag li:before{content:"\f024"}#inbound-list.fa-list-headphones li:before{content:"\f025"}#inbound-list.fa-list-volume-off li:before{content:"\f026"}#inbound-list.fa-list-volume-down li:before{content:"\f027"}#inbound-list.fa-list-volume-up li:before{content:"\f028"}#inbound-list.fa-list-qrcode li:before{content:"\f029"}#inbound-list.fa-list-barcode li:before{content:"\f02a"}#inbound-list.fa-list-tag li:before{content:"\f02b"}#inbound-list.fa-list-tags li:before{content:"\f02c"}#inbound-list.fa-list-book li:before{content:"\f02d"}#inbound-list.fa-list-bookmark li:before{content:"\f02e"}#inbound-list.fa-list-print li:before{content:"\f02f"}#inbound-list.fa-list-camera li:before{content:"\f030"}#inbound-list.fa-list-font li:before{content:"\f031"}#inbound-list.fa-list-bold li:before{content:"\f032"}#inbound-list.fa-list-italic li:before{content:"\f033"}#inbound-list.fa-list-text-height li:before{content:"\f034"}#inbound-list.fa-list-text-width li:before{content:"\f035"}#inbound-list.fa-list-align-left li:before{content:"\f036"}#inbound-list.fa-list-align-center li:before{content:"\f037"}#inbound-list.fa-list-align-right li:before{content:"\f038"}#inbound-list.fa-list-align-justify li:before{content:"\f039"}#inbound-list.fa-list-list li:before{content:"\f03a"}#inbound-list.fa-list-dedent li:before,#inbound-list.fa-list-outdent li:before{content:"\f03b"}#inbound-list.fa-list-indent li:before{content:"\f03c"}#inbound-list.fa-list-video-camera li:before{content:"\f03d"}#inbound-list.fa-list-picture-o li:before{content:"\f03e"}#inbound-list.fa-list-pencil li:before{content:"\f040"}#inbound-list.fa-list-map-marker li:before{content:"\f041"}#inbound-list.fa-list-adjust li:before{content:"\f042"}#inbound-list.fa-list-tint li:before{content:"\f043"}#inbound-list.fa-list-edit li:before,#inbound-list.fa-list-pencil-square-o li:before{content:"\f044"}#inbound-list.fa-list-share-square-o li:before{content:"\f045"}#inbound-list.fa-list-check-square-o li:before{content:"\f046"}#inbound-list.fa-list-arrows li:before{content:"\f047"}#inbound-list.fa-list-step-backward li:before{content:"\f048"}#inbound-list.fa-list-fast-backward li:before{content:"\f049"}#inbound-list.fa-list-backward li:before{content:"\f04a"}#inbound-list.fa-list-play li:before{content:"\f04b"}#inbound-list.fa-list-pause li:before{content:"\f04c"}#inbound-list.fa-list-stop li:before{content:"\f04d"}#inbound-list.fa-list-forward li:before{content:"\f04e"}#inbound-list.fa-list-fast-forward li:before{content:"\f050"}#inbound-list.fa-list-step-forward li:before{content:"\f051"}#inbound-list.fa-list-eject li:before{content:"\f052"}#inbound-list.fa-list-chevron-left li:before{content:"\f053"}#inbound-list.fa-list-chevron-right li:before{content:"\f054"}#inbound-list.fa-list-plus-circle li:before{content:"\f055"}#inbound-list.fa-list-minus-circle li:before{content:"\f056"}#inbound-list.fa-list-times-circle li:before{content:"\f057"}#inbound-list.fa-list-check-circle li:before{content:"\f058"}#inbound-list.fa-list-question-circle li:before{content:"\f059"}#inbound-list.fa-list-info-circle li:before{content:"\f05a"}#inbound-list.fa-list-crosshairs li:before{content:"\f05b"}#inbound-list.fa-list-times-circle-o li:before{content:"\f05c"}#inbound-list.fa-list-check-circle-o li:before{content:"\f05d"}#inbound-list.fa-list-ban li:before{content:"\f05e"}#inbound-list.fa-list-arrow-left li:before{content:"\f060"}#inbound-list.fa-list-arrow-right li:before{content:"\f061"}#inbound-list.fa-list-arrow-up li:before{content:"\f062"}#inbound-list.fa-list-arrow-down li:before{content:"\f063"}#inbound-list.fa-list-mail-forward li:before,#inbound-list.fa-list-share li:before{content:"\f064"}#inbound-list.fa-list-expand li:before{content:"\f065"}#inbound-list.fa-list-compress li:before{content:"\f066"}#inbound-list.fa-list-plus li:before{content:"\f067"}#inbound-list.fa-list-minus li:before{content:"\f068"}#inbound-list.fa-list-asterisk li:before{content:"\f069"}#inbound-list.fa-list-exclamation-circle li:before{content:"\f06a"}#inbound-list.fa-list-gift li:before{content:"\f06b"}#inbound-list.fa-list-leaf li:before{content:"\f06c"}#inbound-list.fa-list-fire li:before{content:"\f06d"}#inbound-list.fa-list-eye li:before{content:"\f06e"}#inbound-list.fa-list-eye-slash li:before{content:"\f070"}#inbound-list.fa-list-warning li:before,#inbound-list.fa-list-exclamation-triangle li:before{content:"\f071"}#inbound-list.fa-list-plane li:before{content:"\f072"}#inbound-list.fa-list-calendar li:before{content:"\f073"}#inbound-list.fa-list-random li:before{content:"\f074"}#inbound-list.fa-list-comment li:before{content:"\f075"}#inbound-list.fa-list-magnet li:before{content:"\f076"}#inbound-list.fa-list-chevron-up li:before{content:"\f077"}#inbound-list.fa-list-chevron-down li:before{content:"\f078"}#inbound-list.fa-list-retweet li:before{content:"\f079"}#inbound-list.fa-list-shopping-cart li:before{content:"\f07a"}#inbound-list.fa-list-folder li:before{content:"\f07b"}#inbound-list.fa-list-folder-open li:before{content:"\f07c"}#inbound-list.fa-list-arrows-v li:before{content:"\f07d"}#inbound-list.fa-list-arrows-h li:before{content:"\f07e"}#inbound-list.fa-list-bar-chart-o li:before{content:"\f080"}#inbound-list.fa-list-twitter-square li:before{content:"\f081"}#inbound-list.fa-list-facebook-square li:before{content:"\f082"}#inbound-list.fa-list-camera-retro li:before{content:"\f083"}#inbound-list.fa-list-key li:before{content:"\f084"}#inbound-list.fa-list-gears li:before,#inbound-list.fa-list-cogs li:before{content:"\f085"}#inbound-list.fa-list-comments li:before{content:"\f086"}#inbound-list.fa-list-thumbs-o-up li:before{content:"\f087"}#inbound-list.fa-list-thumbs-o-down li:before{content:"\f088"}#inbound-list.fa-list-star-half li:before{content:"\f089"}#inbound-list.fa-list-heart-o li:before{content:"\f08a"}#inbound-list.fa-list-sign-out li:before{content:"\f08b"}#inbound-list.fa-list-linkedin-square li:before{content:"\f08c"}#inbound-list.fa-list-thumb-tack li:before{content:"\f08d"}#inbound-list.fa-list-external-link li:before{content:"\f08e"}#inbound-list.fa-list-sign-in li:before{content:"\f090"}#inbound-list.fa-list-trophy li:before{content:"\f091"}#inbound-list.fa-list-github-square li:before{content:"\f092"}#inbound-list.fa-list-upload li:before{content:"\f093"}#inbound-list.fa-list-lemon-o li:before{content:"\f094"}#inbound-list.fa-list-phone li:before{content:"\f095"}#inbound-list.fa-list-square-o li:before{content:"\f096"}#inbound-list.fa-list-bookmark-o li:before{content:"\f097"}#inbound-list.fa-list-phone-square li:before{content:"\f098"}#inbound-list.fa-list-twitter li:before{content:"\f099"}#inbound-list.fa-list-facebook li:before{content:"\f09a"}#inbound-list.fa-list-github li:before{content:"\f09b"}#inbound-list.fa-list-unlock li:before{content:"\f09c"}#inbound-list.fa-list-credit-card li:before{content:"\f09d"}#inbound-list.fa-list-rss li:before{content:"\f09e"}#inbound-list.fa-list-hdd-o li:before{content:"\f0a0"}#inbound-list.fa-list-bullhorn li:before{content:"\f0a1"}#inbound-list.fa-list-bell li:before{content:"\f0f3"}#inbound-list.fa-list-certificate li:before{content:"\f0a3"}#inbound-list.fa-list-hand-o-right li:before{content:"\f0a4"}#inbound-list.fa-list-hand-o-left li:before{content:"\f0a5"}#inbound-list.fa-list-hand-o-up li:before{content:"\f0a6"}#inbound-list.fa-list-hand-o-down li:before{content:"\f0a7"}#inbound-list.fa-list-arrow-circle-left li:before{content:"\f0a8"}#inbound-list.fa-list-arrow-circle-right li:before{content:"\f0a9"}#inbound-list.fa-list-arrow-circle-up li:before{content:"\f0aa"}#inbound-list.fa-list-arrow-circle-down li:before{content:"\f0ab"}#inbound-list.fa-list-globe li:before{content:"\f0ac"}#inbound-list.fa-list-wrench li:before{content:"\f0ad"}#inbound-list.fa-list-tasks li:before{content:"\f0ae"}#inbound-list.fa-list-filter li:before{content:"\f0b0"}#inbound-list.fa-list-briefcase li:before{content:"\f0b1"}#inbound-list.fa-list-arrows-alt li:before{content:"\f0b2"}#inbound-list.fa-list-group li:before,#inbound-list.fa-list-users li:before{content:"\f0c0"}#inbound-list.fa-list-chain li:before,#inbound-list.fa-list-link li:before{content:"\f0c1"}#inbound-list.fa-list-cloud li:before{content:"\f0c2"}#inbound-list.fa-list-flask li:before{content:"\f0c3"}#inbound-list.fa-list-cut li:before,#inbound-list.fa-list-scissors li:before{content:"\f0c4"}#inbound-list.fa-list-copy li:before,#inbound-list.fa-list-files-o li:before{content:"\f0c5"}#inbound-list.fa-list-paperclip li:before{content:"\f0c6"}#inbound-list.fa-list-save li:before,#inbound-list.fa-list-floppy-o li:before{content:"\f0c7"}#inbound-list.fa-list-square li:before{content:"\f0c8"}#inbound-list.fa-list-bars li:before{content:"\f0c9"}#inbound-list.fa-list-list-ul li:before{content:"\f0ca"}#inbound-list.fa-list-list-ol li:before{content:"\f0cb"}#inbound-list.fa-list-strikethrough li:before{content:"\f0cc"}#inbound-list.fa-list-underline li:before{content:"\f0cd"}#inbound-list.fa-list-table li:before{content:"\f0ce"}#inbound-list.fa-list-magic li:before{content:"\f0d0"}#inbound-list.fa-list-truck li:before{content:"\f0d1"}#inbound-list.fa-list-pinterest li:before{content:"\f0d2"}#inbound-list.fa-list-pinterest-square li:before{content:"\f0d3"}#inbound-list.fa-list-google-plus-square li:before{content:"\f0d4"}#inbound-list.fa-list-google-plus li:before{content:"\f0d5"}#inbound-list.fa-list-money li:before{content:"\f0d6"}#inbound-list.fa-list-caret-down li:before{content:"\f0d7"}#inbound-list.fa-list-caret-up li:before{content:"\f0d8"}#inbound-list.fa-list-caret-left li:before{content:"\f0d9"}#inbound-list.fa-list-caret-right li:before{content:"\f0da"}#inbound-list.fa-list-columns li:before{content:"\f0db"}#inbound-list.fa-list-unsorted li:before,#inbound-list.fa-list-sort li:before{content:"\f0dc"}#inbound-list.fa-list-sort-down li:before,#inbound-list.fa-list-sort-asc li:before{content:"\f0dd"}#inbound-list.fa-list-sort-up li:before,#inbound-list.fa-list-sort-desc li:before{content:"\f0de"}#inbound-list.fa-list-envelope li:before{content:"\f0e0"}#inbound-list.fa-list-linkedin li:before{content:"\f0e1"}#inbound-list.fa-list-rotate-left li:before,#inbound-list.fa-list-undo li:before{content:"\f0e2"}#inbound-list.fa-list-legal li:before,#inbound-list.fa-list-gavel li:before{content:"\f0e3"}#inbound-list.fa-list-dashboard li:before,#inbound-list.fa-list-tachometer li:before{content:"\f0e4"}#inbound-list.fa-list-comment-o li:before{content:"\f0e5"}#inbound-list.fa-list-comments-o li:before{content:"\f0e6"}#inbound-list.fa-list-flash li:before,#inbound-list.fa-list-bolt li:before{content:"\f0e7"}#inbound-list.fa-list-sitemap li:before{content:"\f0e8"}#inbound-list.fa-list-umbrella li:before{content:"\f0e9"}#inbound-list.fa-list-paste li:before,#inbound-list.fa-list-clipboard li:before{content:"\f0ea"}#inbound-list.fa-list-lightbulb-o li:before{content:"\f0eb"}#inbound-list.fa-list-exchange li:before{content:"\f0ec"}#inbound-list.fa-list-cloud-download li:before{content:"\f0ed"}#inbound-list.fa-list-cloud-upload li:before{content:"\f0ee"}#inbound-list.fa-list-user-md li:before{content:"\f0f0"}#inbound-list.fa-list-stethoscope li:before{content:"\f0f1"}#inbound-list.fa-list-suitcase li:before{content:"\f0f2"}#inbound-list.fa-list-bell-o li:before{content:"\f0a2"}#inbound-list.fa-list-coffee li:before{content:"\f0f4"}#inbound-list.fa-list-cutlery li:before{content:"\f0f5"}#inbound-list.fa-list-file-text-o li:before{content:"\f0f6"}#inbound-list.fa-list-building-o li:before{content:"\f0f7"}#inbound-list.fa-list-hospital-o li:before{content:"\f0f8"}#inbound-list.fa-list-ambulance li:before{content:"\f0f9"}#inbound-list.fa-list-medkit li:before{content:"\f0fa"}#inbound-list.fa-list-fighter-jet li:before{content:"\f0fb"}#inbound-list.fa-list-beer li:before{content:"\f0fc"}#inbound-list.fa-list-h-square li:before{content:"\f0fd"}#inbound-list.fa-list-plus-square li:before{content:"\f0fe"}#inbound-list.fa-list-angle-double-left li:before{content:"\f100"}#inbound-list.fa-list-angle-double-right li:before{content:"\f101"}#inbound-list.fa-list-angle-double-up li:before{content:"\f102"}#inbound-list.fa-list-angle-double-down li:before{content:"\f103"}#inbound-list.fa-list-angle-left li:before{content:"\f104"}#inbound-list.fa-list-angle-right li:before{content:"\f105"}#inbound-list.fa-list-angle-up li:before{content:"\f106"}#inbound-list.fa-list-angle-down li:before{content:"\f107"}#inbound-list.fa-list-desktop li:before{content:"\f108"}#inbound-list.fa-list-laptop li:before{content:"\f109"}#inbound-list.fa-list-tablet li:before{content:"\f10a"}#inbound-list.fa-list-mobile-phone li:before,#inbound-list.fa-list-mobile li:before{content:"\f10b"}#inbound-list.fa-list-circle-o li:before{content:"\f10c"}#inbound-list.fa-list-quote-left li:before{content:"\f10d"}#inbound-list.fa-list-quote-right li:before{content:"\f10e"}#inbound-list.fa-list-spinner li:before{content:"\f110"}#inbound-list.fa-list-circle li:before{content:"\f111"}#inbound-list.fa-list-mail-reply li:before,#inbound-list.fa-list-reply li:before{content:"\f112"}#inbound-list.fa-list-github-alt li:before{content:"\f113"}#inbound-list.fa-list-folder-o li:before{content:"\f114"}#inbound-list.fa-list-folder-open-o li:before{content:"\f115"}#inbound-list.fa-list-smile-o li:before{content:"\f118"}#inbound-list.fa-list-frown-o li:before{content:"\f119"}#inbound-list.fa-list-meh-o li:before{content:"\f11a"}#inbound-list.fa-list-gamepad li:before{content:"\f11b"}#inbound-list.fa-list-keyboard-o li:before{content:"\f11c"}#inbound-list.fa-list-flag-o li:before{content:"\f11d"}#inbound-list.fa-list-flag-checkered li:before{content:"\f11e"}#inbound-list.fa-list-terminal li:before{content:"\f120"}#inbound-list.fa-list-code li:before{content:"\f121"}#inbound-list.fa-list-reply-all li:before{content:"\f122"}#inbound-list.fa-list-mail-reply-all li:before{content:"\f122"}#inbound-list.fa-list-star-half-empty li:before,#inbound-list.fa-list-star-half-full li:before,#inbound-list.fa-list-star-half-o li:before{content:"\f123"}#inbound-list.fa-list-location-arrow li:before{content:"\f124"}#inbound-list.fa-list-crop li:before{content:"\f125"}#inbound-list.fa-list-code-fork li:before{content:"\f126"}#inbound-list.fa-list-unlink li:before,#inbound-list.fa-list-chain-broken li:before{content:"\f127"}#inbound-list.fa-list-question li:before{content:"\f128"}#inbound-list.fa-list-info li:before{content:"\f129"}#inbound-list.fa-list-exclamation li:before{content:"\f12a"}#inbound-list.fa-list-superscript li:before{content:"\f12b"}#inbound-list.fa-list-subscript li:before{content:"\f12c"}#inbound-list.fa-list-eraser li:before{content:"\f12d"}#inbound-list.fa-list-puzzle-piece li:before{content:"\f12e"}#inbound-list.fa-list-microphone li:before{content:"\f130"}#inbound-list.fa-list-microphone-slash li:before{content:"\f131"}#inbound-list.fa-list-shield li:before{content:"\f132"}#inbound-list.fa-list-calendar-o li:before{content:"\f133"}#inbound-list.fa-list-fire-extinguisher li:before{content:"\f134"}#inbound-list.fa-list-rocket li:before{content:"\f135"}#inbound-list.fa-list-maxcdn li:before{content:"\f136"}#inbound-list.fa-list-chevron-circle-left li:before{content:"\f137"}#inbound-list.fa-list-chevron-circle-right li:before{content:"\f138"}#inbound-list.fa-list-chevron-circle-up li:before{content:"\f139"}#inbound-list.fa-list-chevron-circle-down li:before{content:"\f13a"}#inbound-list.fa-list-html5 li:before{content:"\f13b"}#inbound-list.fa-list-css3 li:before{content:"\f13c"}#inbound-list.fa-list-anchor li:before{content:"\f13d"}#inbound-list.fa-list-unlock-alt li:before{content:"\f13e"}#inbound-list.fa-list-bullseye li:before{content:"\f140"}#inbound-list.fa-list-ellipsis-h li:before{content:"\f141"}#inbound-list.fa-list-ellipsis-v li:before{content:"\f142"}#inbound-list.fa-list-rss-square li:before{content:"\f143"}#inbound-list.fa-list-play-circle li:before{content:"\f144"}#inbound-list.fa-list-ticket li:before{content:"\f145"}#inbound-list.fa-list-minus-square li:before{content:"\f146"}#inbound-list.fa-list-minus-square-o li:before{content:"\f147"}#inbound-list.fa-list-level-up li:before{content:"\f148"}#inbound-list.fa-list-level-down li:before{content:"\f149"}#inbound-list.fa-list-check-square li:before{content:"\f14a"}#inbound-list.fa-list-pencil-square li:before{content:"\f14b"}#inbound-list.fa-list-external-link-square li:before{content:"\f14c"}#inbound-list.fa-list-share-square li:before{content:"\f14d"}#inbound-list.fa-list-compass li:before{content:"\f14e"}#inbound-list.fa-list-toggle-down li:before,#inbound-list.fa-list-caret-square-o-down li:before{content:"\f150"}#inbound-list.fa-list-toggle-up li:before,#inbound-list.fa-list-caret-square-o-up li:before{content:"\f151"}#inbound-list.fa-list-toggle-right li:before,#inbound-list.fa-list-caret-square-o-right li:before{content:"\f152"}#inbound-list.fa-list-euro li:before,#inbound-list.fa-list-eur li:before{content:"\f153"}#inbound-list.fa-list-gbp li:before{content:"\f154"}#inbound-list.fa-list-dollar li:before,#inbound-list.fa-list-usd li:before{content:"\f155"}#inbound-list.fa-list-rupee li:before,#inbound-list.fa-list-inr li:before{content:"\f156"}#inbound-list.fa-list-cny li:before,#inbound-list.fa-list-rmb li:before,#inbound-list.fa-list-yen li:before,#inbound-list.fa-list-jpy li:before{content:"\f157"}#inbound-list.fa-list-ruble li:before,#inbound-list.fa-list-rouble li:before,#inbound-list.fa-list-rub li:before{content:"\f158"}#inbound-list.fa-list-won li:before,#inbound-list.fa-list-krw li:before{content:"\f159"}#inbound-list.fa-list-bitcoin li:before,#inbound-list.fa-list-btc li:before{content:"\f15a"}#inbound-list.fa-list-file li:before{content:"\f15b"}#inbound-list.fa-list-file-text li:before{content:"\f15c"}#inbound-list.fa-list-sort-alpha-asc li:before{content:"\f15d"}#inbound-list.fa-list-sort-alpha-desc li:before{content:"\f15e"}#inbound-list.fa-list-sort-amount-asc li:before{content:"\f160"}#inbound-list.fa-list-sort-amount-desc li:before{content:"\f161"}#inbound-list.fa-list-sort-numeric-asc li:before{content:"\f162"}#inbound-list.fa-list-sort-numeric-desc li:before{content:"\f163"}#inbound-list.fa-list-thumbs-up li:before{content:"\f164"}#inbound-list.fa-list-thumbs-down li:before{content:"\f165"}#inbound-list.fa-list-youtube-square li:before{content:"\f166"}#inbound-list.fa-list-youtube li:before{content:"\f167"}#inbound-list.fa-list-xing li:before{content:"\f168"}#inbound-list.fa-list-xing-square li:before{content:"\f169"}#inbound-list.fa-list-youtube-play li:before{content:"\f16a"}#inbound-list.fa-list-dropbox li:before{content:"\f16b"}#inbound-list.fa-list-stack-overflow li:before{content:"\f16c"}#inbound-list.fa-list-instagram li:before{content:"\f16d"}#inbound-list.fa-list-flickr li:before{content:"\f16e"}#inbound-list.fa-list-adn li:before{content:"\f170"}#inbound-list.fa-list-bitbucket li:before{content:"\f171"}#inbound-list.fa-list-bitbucket-square li:before{content:"\f172"}#inbound-list.fa-list-tumblr li:before{content:"\f173"}#inbound-list.fa-list-tumblr-square li:before{content:"\f174"}#inbound-list.fa-list-long-arrow-down li:before{content:"\f175"}#inbound-list.fa-list-long-arrow-up li:before{content:"\f176"}#inbound-list.fa-list-long-arrow-left li:before{content:"\f177"}#inbound-list.fa-list-long-arrow-right li:before{content:"\f178"}#inbound-list.fa-list-apple li:before{content:"\f179"}#inbound-list.fa-list-windows li:before{content:"\f17a"}#inbound-list.fa-list-android li:before{content:"\f17b"}#inbound-list.fa-list-linux li:before{content:"\f17c"}#inbound-list.fa-list-dribbble li:before{content:"\f17d"}#inbound-list.fa-list-skype li:before{content:"\f17e"}#inbound-list.fa-list-foursquare li:before{content:"\f180"}#inbound-list.fa-list-trello li:before{content:"\f181"}#inbound-list.fa-list-female li:before{content:"\f182"}#inbound-list.fa-list-male li:before{content:"\f183"}#inbound-list.fa-list-gittip li:before{content:"\f184"}#inbound-list.fa-list-sun-o li:before{content:"\f185"}#inbound-list.fa-list-moon-o li:before{content:"\f186"}#inbound-list.fa-list-archive li:before{content:"\f187"}#inbound-list.fa-list-bug li:before{content:"\f188"}#inbound-list.fa-list-vk li:before{content:"\f189"}#inbound-list.fa-list-weibo li:before{content:"\f18a"}#inbound-list.fa-list-renren li:before{content:"\f18b"}#inbound-list.fa-list-pagelines li:before{content:"\f18c"}#inbound-list.fa-list-stack-exchange li:before{content:"\f18d"}#inbound-list.fa-list-arrow-circle-o-right li:before{content:"\f18e"}#inbound-list.fa-list-arrow-circle-o-left li:before{content:"\f190"}#inbound-list.fa-list-toggle-left li:before,#inbound-list.fa-list-caret-square-o-left li:before{content:"\f191"}#inbound-list.fa-list-dot-circle-o li:before{content:"\f192"}#inbound-list.fa-list-wheelchair li:before{content:"\f193"}#inbound-list.fa-list-vimeo-square li:before{content:"\f194"}#inbound-list.fa-list-turkish-lira li:before,#inbound-list.fa-list-try li:before{content:"\f195"}#inbound-list.fa-list-plus-square-o li:before{content:"\f196"}
|
| 933 |
-
|
| 934 |
-
/* Button Pack - Flat */
|
| 935 |
-
|
| 936 |
-
.inbound-flat-btn{
|
| 937 |
-
display:block;
|
| 938 |
-
float:left;
|
| 939 |
-
padding:.6em .6em;
|
| 940 |
-
font-size:1.1em;
|
| 941 |
-
margin:1em .5em;
|
| 942 |
-
color:#fff;
|
| 943 |
-
width:16em;
|
| 944 |
-
text-decoration:none;
|
| 945 |
-
cursor:pointer;
|
| 946 |
-
font-family:helvetica;
|
| 947 |
-
line-height:2;
|
| 948 |
-
position:relative;
|
| 949 |
-
z-index:2;
|
| 950 |
-
overflow:hidden;
|
| 951 |
-
text-shadow:0 -1px 0 rgba(0,0,0,.35);
|
| 952 |
-
}
|
| 953 |
-
.inbound-flat-btn span.icon{
|
| 954 |
-
display:block;
|
| 955 |
-
float:left;
|
| 956 |
-
margin:-.38em;
|
| 957 |
-
font-size:1.6em;
|
| 958 |
-
width:20%;
|
| 959 |
-
height:56px;
|
| 960 |
-
text-align:center;
|
| 961 |
-
line-height:2.2;
|
| 962 |
-
margin-right:1em;
|
| 963 |
-
}
|
| 964 |
-
|
| 965 |
-
.inbound-
|
| 966 |
-
background:#2ecc71;
|
| 967 |
-
}
|
| 968 |
-
.inbound-flat-btn.download span.icon{
|
| 969 |
-
background:#27ae60
|
| 970 |
-
}
|
| 971 |
-
.inbound-flat-btn.dribbble{
|
| 972 |
-
background:#ea4c89
|
| 973 |
-
}
|
| 974 |
-
.inbound-flat-btn.dribbble span.icon{
|
| 975 |
-
background:#c24879
|
| 976 |
-
}
|
| 977 |
-
.inbound-flat-btn.facebook{
|
| 978 |
-
background:#4d69a2
|
| 979 |
-
}
|
| 980 |
-
.inbound-flat-btn.facebook span.icon{
|
| 981 |
-
background:#2f477a
|
| 982 |
-
}
|
| 983 |
-
|
| 984 |
-
.inbound-flat-btn:after{content:'';
|
| 985 |
-
display:block;
|
| 986 |
-
width:100%;
|
| 987 |
-
height:100%;
|
| 988 |
-
box-shadow:inset 0 -2px 0 rgba(0,0,0,.25);
|
| 989 |
-
position:absolute;
|
| 990 |
-
margin:-2.6em -.6em;}
|
| 991 |
-
|
| 992 |
-
.inbound-flat-btn:active{
|
| 993 |
-
height:54px;
|
| 994 |
-
top:2px;
|
| 995 |
-
}
|
| 996 |
-
.inbound-flat-btn:active:after{
|
| 997 |
-
box-shadow:inset 0 -2px 0 rgba(0,0,0,0);
|
| 998 |
-
}
|
| 999 |
-
/* Button Pack - Sunk */
|
| 1000 |
-
.inbound-sunk-button-wrapper {
|
| 1001 |
-
width: 165px;
|
| 1002 |
-
background: #E0E0E0;
|
| 1003 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#E9E9E9', endColorstr='#D7D7D7');
|
| 1004 |
-
background: -webkit-gradient(linear, left top, left bottom, from(#E9E9E9), to(#D7D7D7));
|
| 1005 |
-
background: -moz-linear-gradient(top, #E9E9E9, #D7D7D7);
|
| 1006 |
-
padding: 8px;
|
| 1007 |
-
-webkit-box-shadow: inset 0px 2px 2px #B2B3B5, 0px 1px 0 #fff;
|
| 1008 |
-
-moz-box-shadow: inset 0px 2px 2px #B2B3B5, 0px 1px 0 #fff;
|
| 1009 |
-
-o-box-shadow: inset 0px 2px 2px #B2B3B5, 0px 1px 0 #fff;
|
| 1010 |
-
-khtml-box-shadow: inset 0px 2px 2px #B2B3B5, 0px 1px 0 #fff;
|
| 1011 |
-
box-shadow: inset 0px 2px 2px #B2B3B5, 0px 1px 0 #fff;
|
| 1012 |
-
-webkit-border-radius: 50px;
|
| 1013 |
-
-moz-border-radius: 50px;
|
| 1014 |
-
-o-border-radius: 50px;
|
| 1015 |
-
-khtml-border-radius: 50px;
|
| 1016 |
-
border-radius: 50px;
|
| 1017 |
-
}
|
| 1018 |
-
a.inbound-sunk-button {
|
| 1019 |
-
display: block;
|
| 1020 |
-
width: 165px;
|
| 1021 |
-
height: 35px;
|
| 1022 |
-
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
|
| 1023 |
-
font-size: 14px;
|
| 1024 |
-
text-align: center;
|
| 1025 |
-
line-height: 34px;
|
| 1026 |
-
text-decoration: none;
|
| 1027 |
-
-webkit-border-radius: 50px;
|
| 1028 |
-
-moz-border-radius: 50px;
|
| 1029 |
-
-o-border-radius: 50px;
|
| 1030 |
-
-khtml-border-radius: 50px;
|
| 1031 |
-
border-radius: 50px;
|
| 1032 |
-
font-weight: bold;
|
| 1033 |
-
}
|
| 1034 |
-
a.inbound-sunk-button:hover, a.inbound-sunk-button:active {
|
| 1035 |
-
border: none;
|
| 1036 |
-
}
|
| 1037 |
-
a.inbound-sunk-light {
|
| 1038 |
-
background: #F5F5F5;
|
| 1039 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFF', endColorstr='#ECECEC');
|
| 1040 |
-
background: -webkit-gradient(linear, left top, left bottom, from(#FFF), to(#ECECEC));
|
| 1041 |
-
background: -moz-linear-gradient(top, #FFFFFF, #ECECEC);
|
| 1042 |
-
color: #858585;
|
| 1043 |
-
text-shadow: 0px 1px 0px #FFF;
|
| 1044 |
-
-webkit-box-shadow: inset 0px 1px 0 #FFF, 0px 1px 0 #B5B5B5;
|
| 1045 |
-
-moz-box-shadow: inset 0px 1px 0 #fff, 0px 1px 0 #B5B5B5;
|
| 1046 |
-
-o-box-shadow: inset 0px 1px 0 #fff, 0px 1px 0 #B5B5B5;
|
| 1047 |
-
-khtml-box-shadow: inset 0px 1px 0 #fff, 0px 1px 0 #B5B5B5;
|
| 1048 |
-
box-shadow: inset 0px 1px 0 #FFF, 0px 1px 0 #B5B5B5;
|
| 1049 |
-
}
|
| 1050 |
-
a.inbound-sunk-light:hover {
|
| 1051 |
-
background: #FFF;
|
| 1052 |
-
filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFF', endColorstr='#F7F7F7');
|
| 1053 |
-
background: -webkit-gradient(linear, left top, left bottom, from(#FFF), to(#F7F7F7));
|
| 1054 |
-
background: -moz-linear-gradient(top, #FFFFFF, #F7F7F7);
|
| 1055 |
-
color: #717171;
|
| 1056 |
-
}
|
| 1057 |
-
a.inbound-sunk-light:active {
|
| 1058 |
-
background: #EEE;
|
| 1059 |
-
color: #717171;
|
| 1060 |
-
-webkit-box-shadow: inset 0px 2px 3px #AAA, 0px 1px 0 #B5B5B5;
|
| 1061 |
-
-moz-box-shadow: inset 0px 2px 3px #aaa, 0px 1px 0 #B5B5B5;
|
| 1062 |
-
-o-box-shadow: inset 0px 2px 3px #aaa, 0px 1px 0 #B5B5B5;
|
| 1063 |
-
-khtml-box-shadow: inset 0px 2px 3px #aaa, 0px 1px 0 #B5B5B5;
|
| 1064 |
-
box-shadow: inset 0px 2px 3px #AAA, 0px 1px 0 #B5B5B5;
|
| 1065 |
-
}
|
| 1 |
+
a.inbound-button.inbound-special-class i:before, button.inbound-button-submit.inbound-submit-action i:before{font-family:'FontAwesome'; font-style: normal; font-weight: 300; padding-right: 5px;}
|
| 2 |
+
|
| 3 |
+
.inbound-label.inbound-label-top, .inbound-label.inbound-label-bottom {
|
| 4 |
+
display: block;
|
| 5 |
+
}
|
| 6 |
+
#inbound-form-wrapper .inbound-label.inbound-label-bottom {
|
| 7 |
+
margin: 0px 0 10px 0;
|
| 8 |
+
}
|
| 9 |
+
#inbound-form-wrapper .inbound-label.inbound-label-inline {
|
| 10 |
+
min-width: 80px;
|
| 11 |
+
display: inline-block;
|
| 12 |
+
padding-right: 10px;
|
| 13 |
+
}
|
| 14 |
+
.radio-inbound-vertical.radio-inbound-label-bottom, #inbound-form-wrapper .inbound-label.inbound-label-inline.inbound-input-radio, .radio-inbound-vertical.radio-inbound-label-top {
|
| 15 |
+
display: block;
|
| 16 |
+
}
|
| 17 |
+
.radio-inbound-vertical.radio-inbound-label-bottom:last-child {
|
| 18 |
+
margin: 0px 0 10px 0;
|
| 19 |
+
}
|
| 20 |
+
.radio-inbound-vertical.radio-inbound-label-inline {
|
| 21 |
+
padding-right: 5px;
|
| 22 |
+
}
|
| 23 |
+
.inbound-label.inbound-label-placeholder {
|
| 24 |
+
display: none;
|
| 25 |
+
}
|
| 26 |
+
.inbound-label.inbound-label-placeholder.inbound-input-dropdown {
|
| 27 |
+
display: block;
|
| 28 |
+
}
|
| 29 |
+
.inbound-horizontal {
|
| 30 |
+
display: inline-block;
|
| 31 |
+
}
|
| 32 |
+
#inbound_form_submit {
|
| 33 |
+
text-transform: none;
|
| 34 |
+
}
|
| 35 |
+
/* global fixes */
|
| 36 |
+
.inbound-field {
|
| 37 |
+
margin-left: 0 !important;
|
| 38 |
+
list-style-type: none !important;
|
| 39 |
+
list-style-image: none !important;
|
| 40 |
+
list-style: none !important;
|
| 41 |
+
overflow: visible;
|
| 42 |
+
}
|
| 43 |
+
.inbound-field label {
|
| 44 |
+
margin: 10px 0 4px 0;
|
| 45 |
+
font-weight: bold;
|
| 46 |
+
line-height: 1.3em;
|
| 47 |
+
clear: both;
|
| 48 |
+
}
|
| 49 |
+
.inbound-field input[type=radio] {
|
| 50 |
+
margin-top: 4px;
|
| 51 |
+
width: auto !important;
|
| 52 |
+
}
|
| 53 |
+
.inbound-field.inbound-submit-area {
|
| 54 |
+
padding: 0px 0 10px 0;
|
| 55 |
+
margin: 15px 0 0 0;
|
| 56 |
+
clear: both;
|
| 57 |
+
}
|
| 58 |
+
.inbound-field.inbound-submit-area input.inbound-button, .inbound-field.inbound-submit-area input[type=submit] {
|
| 59 |
+
font-size: 1em;
|
| 60 |
+
}
|
| 61 |
+
.inbound-description {
|
| 62 |
+
font-size: 0.85em;
|
| 63 |
+
line-height: 1.5em;
|
| 64 |
+
clear: both;
|
| 65 |
+
font-family: sans-serif;
|
| 66 |
+
letter-spacing: normal;
|
| 67 |
+
padding: 10px 0 0 0;
|
| 68 |
+
width: 99.8%;
|
| 69 |
+
}
|
| 70 |
+
textarea.inbound-input-textarea {
|
| 71 |
+
height: 150px;
|
| 72 |
+
width: 99.2%;
|
| 73 |
+
}
|
| 74 |
+
#inbound-form-wrapper {
|
| 75 |
+
overflow: inherit;
|
| 76 |
+
margin: 10px 0;
|
| 77 |
+
max-width: 98%;
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
.inbound-field input[type=text], .inbound-field input[type=url], .inbound-field input[type=email], .inbound-field input[type=tel], .inbound-field input[type=number], .inbound-field input[type=password] {
|
| 81 |
+
width: 47%;
|
| 82 |
+
}
|
| 83 |
+
/*
|
| 84 |
+
#inbound-form-wrapper input[type=text], #inbound-form-wrapper input[type=url], #inbound-form-wrapper input[type=email], #inbound-form-wrapper input[type=tel], #inbound-form-wrapper input[type=number], #inbound-form-wrapper input[type=password] {
|
| 85 |
+
width: 47%;
|
| 86 |
+
}
|
| 87 |
+
*/
|
| 88 |
+
#inbound-form-wrapper .inbound-horizontal input[type=text], #inbound-form-wrapper .inbound-horizontal input[type=url], #inbound-form-wrapper .inbound-horizontal input[type=email], #inbound-form-wrapper .inbound-horizontal input[type=tel], #inbound-form-wrapper .inbound-horizontal input[type=number], #inbound-form-wrapper .inbound-horizontal input[type=password] {
|
| 89 |
+
width: 88%;
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
#inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=text], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=url], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=email], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=tel], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=number], #inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline input[type=password] {
|
| 93 |
+
width: 130px;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
#inbound-form-wrapper .inbound-horizontal.label-inbound-label-inline .inbound-label.inbound-label-inline {
|
| 97 |
+
min-width: 60px;
|
| 98 |
+
display: inline-block;
|
| 99 |
+
padding-right: 10px;
|
| 100 |
+
text-align: right;
|
| 101 |
+
}
|
| 102 |
+
|
| 103 |
+
.inbound-label.inbound-input-radio {
|
| 104 |
+
display: block;
|
| 105 |
+
}
|
| 106 |
+
.automation-done {
|
| 107 |
+
margin-top: 4px;
|
| 108 |
+
width: auto !important;
|
| 109 |
+
float: left;
|
| 110 |
+
}
|
| 111 |
+
.radionotdonelabel {
|
| 112 |
+
display: block;
|
| 113 |
+
margin: 0 0 0 24px;
|
| 114 |
+
padding: 0;
|
| 115 |
+
width: auto;
|
| 116 |
+
line-height: 1.5;
|
| 117 |
+
vertical-align: top;
|
| 118 |
+
}
|
| 119 |
+
/* Grid
|
| 120 |
+
* ------------------------------------------*/
|
| 121 |
+
.inbound-clear{
|
| 122 |
+
clear:both;
|
| 123 |
+
display:block;
|
| 124 |
+
overflow:hidden;
|
| 125 |
+
width:0;
|
| 126 |
+
height:0
|
| 127 |
+
}
|
| 128 |
+
.inbound-clearfix:before, .inbound-clearfix:after,
|
| 129 |
+
.inbound-row:before, .inbound-row:after,
|
| 130 |
+
.inbound-row_30:before, .inbound-row_30:after{
|
| 131 |
+
content:'\0020';
|
| 132 |
+
display:block;
|
| 133 |
+
overflow:hidden;
|
| 134 |
+
width:0;
|
| 135 |
+
height:0
|
| 136 |
+
}
|
| 137 |
+
.inbound-clearfix:after, .inbound-row:after, .inbound-row_30:after{
|
| 138 |
+
clear:both
|
| 139 |
+
}
|
| 140 |
+
.inbound-clearfix{
|
| 141 |
+
zoom:1
|
| 142 |
+
}
|
| 143 |
+
.inbound-row{
|
| 144 |
+
margin-left:-10px;
|
| 145 |
+
margin-right:-10px;
|
| 146 |
+
}
|
| 147 |
+
.inbound-row_30{
|
| 148 |
+
margin-left:-15px;
|
| 149 |
+
margin-right:-15px;
|
| 150 |
+
}
|
| 151 |
+
.inbound-grid{
|
| 152 |
+
float:left;
|
| 153 |
+
min-height:1px;
|
| 154 |
+
padding-right: 5px;
|
| 155 |
+
padding-left: 0px;
|
| 156 |
+
position:relative;
|
| 157 |
+
}
|
| 158 |
+
#inbound-list {
|
| 159 |
+
overflow: hidden;
|
| 160 |
+
margin-bottom: 10px;
|
| 161 |
+
}
|
| 162 |
+
.row_30 .inbound-grid{
|
| 163 |
+
padding-left:15px;
|
| 164 |
+
padding-right:15px;
|
| 165 |
+
}
|
| 166 |
+
.inbound-grid.full{
|
| 167 |
+
width:100%;
|
| 168 |
+
}
|
| 169 |
+
.inbound-grid.one-half, .inbound-grid.inbound-2-col{
|
| 170 |
+
width:48%;
|
| 171 |
+
}
|
| 172 |
+
.inbound-grid.one-third, .inbound-grid.inbound-3-col{
|
| 173 |
+
width:31.333333%;
|
| 174 |
+
|
| 175 |
+
}
|
| 176 |
+
.inbound-grid.two-third{
|
| 177 |
+
width:66.666667%;
|
| 178 |
+
}
|
| 179 |
+
.inbound-grid.one-fourth, .inbound-grid.inbound-4-col{
|
| 180 |
+
width:23%;
|
| 181 |
+
}
|
| 182 |
+
.inbound-grid.three-fourth{
|
| 183 |
+
width:75%;
|
| 184 |
+
}
|
| 185 |
+
.inbound-grid.one-fifth{
|
| 186 |
+
width:18%;
|
| 187 |
+
}
|
| 188 |
+
.inbound-grid.two-fifth{
|
| 189 |
+
width:40%;
|
| 190 |
+
}
|
| 191 |
+
.inbound-grid.three-fifth{
|
| 192 |
+
width:60%;
|
| 193 |
+
}
|
| 194 |
+
.inbound-grid.four-fifth{
|
| 195 |
+
width:80%;
|
| 196 |
+
}
|
| 197 |
+
|
| 198 |
+
|
| 199 |
+
|
| 200 |
+
/* Social Icons
|
| 201 |
+
* ----------------------------------------------------- */
|
| 202 |
+
ul.social-links{
|
| 203 |
+
list-style: none;
|
| 204 |
+
margin: 0;
|
| 205 |
+
padding: 0;
|
| 206 |
+
}
|
| 207 |
+
ul.social-links li{
|
| 208 |
+
display: inline-block;
|
| 209 |
+
list-style: none;
|
| 210 |
+
margin: 0;
|
| 211 |
+
padding: 7px 0;
|
| 212 |
+
}
|
| 213 |
+
ul.social-links li a{
|
| 214 |
+
background: #f2f2f2;
|
| 215 |
+
border: 1px solid #EBEBEA;
|
| 216 |
+
-webkit-border-radius: 2px;
|
| 217 |
+
-moz-border-radius: 2px;
|
| 218 |
+
border-radius: 2px;
|
| 219 |
+
display: inline-block;
|
| 220 |
+
width: 32px;
|
| 221 |
+
height: 32px;
|
| 222 |
+
line-height: 32px;
|
| 223 |
+
text-align: center;
|
| 224 |
+
color: #696763;
|
| 225 |
+
margin: 0px 1px;
|
| 226 |
+
}
|
| 227 |
+
ul.social-links li a:hover{
|
| 228 |
+
background-color: #c8232b;
|
| 229 |
+
border-color: rgba(0,0,0,0.2);
|
| 230 |
+
color: #fff;
|
| 231 |
+
}
|
| 232 |
+
#footer-wrapper ul.social-links{
|
| 233 |
+
float: right;
|
| 234 |
+
}
|
| 235 |
+
#footer-wrapper ul.social-links li a{
|
| 236 |
+
background-color: #4A4845;
|
| 237 |
+
border: none;
|
| 238 |
+
color: #9C9A96;
|
| 239 |
+
}
|
| 240 |
+
#footer-wrapper ul.social-links li a:hover{
|
| 241 |
+
background-color: #c8232b;
|
| 242 |
+
color: #fff;
|
| 243 |
+
}
|
| 244 |
+
|
| 245 |
+
/* About Widget
|
| 246 |
+
* ----------------------------------------------------- */
|
| 247 |
+
.widget-about{
|
| 248 |
+
background: url('images/map.png') no-repeat 0 0;
|
| 249 |
+
background-size: 100%;
|
| 250 |
+
}
|
| 251 |
+
.widget-about .address,
|
| 252 |
+
.widget-about .telephone,
|
| 253 |
+
.widget-about .email{
|
| 254 |
+
/*font-size: 85%;*/
|
| 255 |
+
}
|
| 256 |
+
.widget-about i{
|
| 257 |
+
color: #9C9A96;
|
| 258 |
+
margin-right: 5px;
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
/* Divider
|
| 262 |
+
* ----------------------------------------------------- */
|
| 263 |
+
.divider{
|
| 264 |
+
border-top: 1px solid #EBEBEA;
|
| 265 |
+
height: 1px;
|
| 266 |
+
margin: 0px;
|
| 267 |
+
position: relative;
|
| 268 |
+
}
|
| 269 |
+
.divider.none{
|
| 270 |
+
border:none
|
| 271 |
+
}
|
| 272 |
+
.divider.solid{
|
| 273 |
+
border-top: 1px solid #EBEBEA;
|
| 274 |
+
}
|
| 275 |
+
.divider.dashed{
|
| 276 |
+
border-top: 1px dashed #EBEBEA;
|
| 277 |
+
}
|
| 278 |
+
.divider.dotted{
|
| 279 |
+
border-top: 1px dotted #EBEBEA;
|
| 280 |
+
}
|
| 281 |
+
.divider.double{
|
| 282 |
+
border-top: 3px double #EBEBEA;
|
| 283 |
+
}
|
| 284 |
+
|
| 285 |
+
/* Teaser
|
| 286 |
+
* ----------------------------------------------------- */
|
| 287 |
+
.teaser{
|
| 288 |
+
margin-bottom: 20px;
|
| 289 |
+
}
|
| 290 |
+
.teaser .teaser-header{
|
| 291 |
+
margin: 0px 0px 10px 56px;
|
| 292 |
+
}
|
| 293 |
+
.teaser .teaser-title{
|
| 294 |
+
margin: 0px;
|
| 295 |
+
}
|
| 296 |
+
.teaser .teaser-subtitle{
|
| 297 |
+
color: #9C9A96;
|
| 298 |
+
}
|
| 299 |
+
.teaser .teaser-icon{
|
| 300 |
+
background: #4A4845;
|
| 301 |
+
-webkit-border-radius: 2px;
|
| 302 |
+
-moz-border-radius: 2px;
|
| 303 |
+
border-radius: 2px;
|
| 304 |
+
color: #fff;
|
| 305 |
+
font-size: 16px;
|
| 306 |
+
float: left;
|
| 307 |
+
line-height: 36px;
|
| 308 |
+
height: 36px;
|
| 309 |
+
width: 36px;
|
| 310 |
+
margin-top: 5px;
|
| 311 |
+
text-align: center;
|
| 312 |
+
}
|
| 313 |
+
.teaser .teaser-image{
|
| 314 |
+
float: left;
|
| 315 |
+
height: 36px;
|
| 316 |
+
width: 36px;
|
| 317 |
+
margin-top: 5px;
|
| 318 |
+
}
|
| 319 |
+
.teaser:hover .teaser-icon{
|
| 320 |
+
background-color: #c8232b;
|
| 321 |
+
}
|
| 322 |
+
|
| 323 |
+
/* Nested teaser */
|
| 324 |
+
.teaser.nested .teaser-content{
|
| 325 |
+
margin-left: 56px
|
| 326 |
+
}
|
| 327 |
+
|
| 328 |
+
/* Centered teaser */
|
| 329 |
+
.teaser.centered{
|
| 330 |
+
text-align: center;
|
| 331 |
+
}
|
| 332 |
+
.teaser.centered .teaser-icon{
|
| 333 |
+
background: none;
|
| 334 |
+
color: #696763;
|
| 335 |
+
float: none;
|
| 336 |
+
font-size: 64px;
|
| 337 |
+
line-height: 64px;
|
| 338 |
+
width: 64px;
|
| 339 |
+
height: 64px;
|
| 340 |
+
margin: 0px auto 5px auto;
|
| 341 |
+
}
|
| 342 |
+
.teaser.centered .teaser-header{
|
| 343 |
+
margin-left: 0px;
|
| 344 |
+
}
|
| 345 |
+
|
| 346 |
+
/* Call Out
|
| 347 |
+
* ----------------------------------------------------- */
|
| 348 |
+
.callout{
|
| 349 |
+
background: #f2f2f2;
|
| 350 |
+
border: 1px solid #EBEBEA;
|
| 351 |
+
-webkit-box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 352 |
+
-moz-box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 353 |
+
box-shadow: inset 1px 1px 1px #f9f9f9;
|
| 354 |
+
padding: 20px 25px 0px;
|
| 355 |
+
margin-bottom: 20px;
|
| 356 |
+
}
|
| 357 |
+
.callout .left, .callout .right{
|
| 358 |
+
margin-bottom: 15px;
|
| 359 |
+
}
|
| 360 |
+
.callout h2{
|
| 361 |
+
font-size: 24px;
|
| 362 |
+
line-height: 24px;
|
| 363 |
+
margin: 0px 0px 5px;
|
| 364 |
+
text-shadow: 1px 1px 1px #fff;
|
| 365 |
+
}
|
| 366 |
+
.callout .subtitle{
|
| 367 |
+
font-size: 16px;
|
| 368 |
+
line-height: 22px;
|
| 369 |
+
text-shadow: 1px 1px 1px #fff;
|
| 370 |
+
margin: 0px 0px 5px;
|
| 371 |
+
}
|
| 372 |
+
.callout .inbound-button{
|
| 373 |
+
margin: 7px 0px 5px 0px
|
| 374 |
+
}
|
| 375 |
+
|
| 376 |
+
/* Intro
|
| 377 |
+
* ----------------------------------------------------- */
|
| 378 |
+
.intro{
|
| 379 |
+
margin-bottom: 20px;
|
| 380 |
+
}
|
| 381 |
+
.intro h1{
|
| 382 |
+
margin-bottom: 10px;
|
| 383 |
+
}
|
| 384 |
+
.intro .intro-content{
|
| 385 |
+
font-size: 16px;
|
| 386 |
+
line-height: 24px;
|
| 387 |
+
margin-bottom: 20px;
|
| 388 |
+
}
|
| 389 |
+
|
| 390 |
+
/* Tabs
|
| 391 |
+
* ----------------------------------------------------- */
|
| 392 |
+
.tabs-content{
|
| 393 |
+
margin-bottom: 20px;
|
| 394 |
+
}
|
| 395 |
+
ul.tabs-nav{
|
| 396 |
+
border-bottom: 1px solid #EBEBEA;
|
| 397 |
+
list-style: none;
|
| 398 |
+
margin: 0;
|
| 399 |
+
padding: 0;
|
| 400 |
+
}
|
| 401 |
+
ul.tabs-nav li{
|
| 402 |
+
display: inline-block;
|
| 403 |
+
margin: 0;
|
| 404 |
+
padding: 0;
|
| 405 |
+
}
|
| 406 |
+
ul.tabs-nav li a{
|
| 407 |
+
background: #f2f2f2 url('images/gradient.png');
|
| 408 |
+
border: 1px solid #EBEBEA;
|
| 409 |
+
border-right: none;
|
| 410 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 411 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 412 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 413 |
+
color: #696763;
|
| 414 |
+
display: inline-block;
|
| 415 |
+
font-weight: bold;
|
| 416 |
+
padding: 10px 20px;
|
| 417 |
+
position: relative;
|
| 418 |
+
margin-bottom: -1px;
|
| 419 |
+
text-shadow: 1px 1px 1px #fff;
|
| 420 |
+
}
|
| 421 |
+
ul.tabs-nav li a span{
|
| 422 |
+
display: inline-block;
|
| 423 |
+
margin-left: 5px;
|
| 424 |
+
}
|
| 425 |
+
ul.tabs-nav li a.active{
|
| 426 |
+
background-color: #fff;
|
| 427 |
+
border-bottom-color: #fff;
|
| 428 |
+
color: #4A4845;
|
| 429 |
+
}
|
| 430 |
+
ul.tabs-nav li:last-child{
|
| 431 |
+
border-right: 1px solid #EBEBEA;
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
.tabs > div{
|
| 435 |
+
border: 1px solid #EBEBEA;;
|
| 436 |
+
border-top: none;
|
| 437 |
+
padding: 20px;
|
| 438 |
+
}
|
| 439 |
+
|
| 440 |
+
/* Accordion
|
| 441 |
+
* ----------------------------------------------------- */
|
| 442 |
+
.accordion{
|
| 443 |
+
margin-bottom: 20px
|
| 444 |
+
}
|
| 445 |
+
.accordion .pane-title{
|
| 446 |
+
background: #f2f2f2;
|
| 447 |
+
border: 1px solid #EBEBEA;
|
| 448 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 449 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 450 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 451 |
+
font-size: 110%;
|
| 452 |
+
display: block;
|
| 453 |
+
font-weight: bold;
|
| 454 |
+
padding: 12px 20px;
|
| 455 |
+
position: relative;
|
| 456 |
+
margin-bottom: -1px;
|
| 457 |
+
text-shadow: 1px 1px 1px #fff;
|
| 458 |
+
}
|
| 459 |
+
.accordion .pane-title.active{
|
| 460 |
+
color: #4A4845;
|
| 461 |
+
}
|
| 462 |
+
.accordion .pane-title .pane-icon{
|
| 463 |
+
width: 16px;
|
| 464 |
+
margin-right: 10px;
|
| 465 |
+
text-align: center;
|
| 466 |
+
}
|
| 467 |
+
.accordion .pane-title .status-off,
|
| 468 |
+
.accordion .pane-title .status-on{
|
| 469 |
+
color: #CECDCA;
|
| 470 |
+
cursor: pointer;
|
| 471 |
+
float: right;
|
| 472 |
+
font-family: Verdana;
|
| 473 |
+
font-size: 14px;
|
| 474 |
+
font-weight: bold;
|
| 475 |
+
}
|
| 476 |
+
.accordion .pane-title .status-off{
|
| 477 |
+
display: block;
|
| 478 |
+
}
|
| 479 |
+
.accordion .pane-title .status-on{
|
| 480 |
+
display: none;
|
| 481 |
+
}
|
| 482 |
+
.accordion .pane-title.active .status-off{
|
| 483 |
+
display: none;
|
| 484 |
+
}
|
| 485 |
+
.accordion .pane-title.active .status-on{
|
| 486 |
+
display: block;
|
| 487 |
+
}
|
| 488 |
+
.accordion .pane{
|
| 489 |
+
border: 1px solid #EBEBEA;
|
| 490 |
+
padding: 20px;
|
| 491 |
+
margin: 0px 0px 20px 0px;
|
| 492 |
+
}
|
| 493 |
+
.accordion .pane.last{
|
| 494 |
+
margin: 0px;
|
| 495 |
+
}
|
| 496 |
+
|
| 497 |
+
/* Fancy quote
|
| 498 |
+
* ----------------------------------------------------- */
|
| 499 |
+
.fancy-quote{
|
| 500 |
+
margin: 0 0 20px;
|
| 501 |
+
}
|
| 502 |
+
.fancy-quote .quote-text{
|
| 503 |
+
background: #f2f2f2;
|
| 504 |
+
border: 1px solid #EBEBEA;
|
| 505 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 506 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 507 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 508 |
+
color: #555;
|
| 509 |
+
font: normal 16px/22px Georgia, serif;
|
| 510 |
+
margin: 0px 0px 15px;
|
| 511 |
+
padding: 20px;
|
| 512 |
+
position: relative;
|
| 513 |
+
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 514 |
+
}
|
| 515 |
+
.fancy-quote .quote-text p{
|
| 516 |
+
margin: 0;
|
| 517 |
+
}
|
| 518 |
+
.fancy-quote .quote-text .triangle{
|
| 519 |
+
background: #f2f2f2;
|
| 520 |
+
border: 1px solid;
|
| 521 |
+
border-color: #f2f2f2 #EBEBEA #EBEBEA #f2f2f2;
|
| 522 |
+
display: block;
|
| 523 |
+
width: 16px;
|
| 524 |
+
height: 16px;
|
| 525 |
+
position: absolute;
|
| 526 |
+
bottom: -8px; left: 25px;
|
| 527 |
+
-webkit-transform: rotate(45deg);
|
| 528 |
+
-moz-transform: rotate(45deg);
|
| 529 |
+
-ms-transform: rotate(45deg);
|
| 530 |
+
-o-transform: rotate(45deg);
|
| 531 |
+
transform: rotate(45deg);
|
| 532 |
+
}
|
| 533 |
+
.fancy-quote .quote-author{
|
| 534 |
+
padding: 0px 0px;
|
| 535 |
+
position: relative;
|
| 536 |
+
}
|
| 537 |
+
.fancy-quote .quote-author .quote-author-name{
|
| 538 |
+
font-weight: bold;
|
| 539 |
+
}
|
| 540 |
+
.fancy-quote .quote-author .quote-author-name:before{
|
| 541 |
+
content: "\2014 \0020";
|
| 542 |
+
color: #CECDCA;
|
| 543 |
+
font-weight: normal;
|
| 544 |
+
}
|
| 545 |
+
.fancy-quote .quote-author .quote-author-meta{
|
| 546 |
+
color: #9C9A96;
|
| 547 |
+
}
|
| 548 |
+
|
| 549 |
+
/* Pricing
|
| 550 |
+
* ----------------------------------------------------- */
|
| 551 |
+
.pricing{
|
| 552 |
+
border-left: 1px solid #fff;
|
| 553 |
+
margin-bottom: 30px;
|
| 554 |
+
margin-top: 10px;
|
| 555 |
+
}
|
| 556 |
+
.pricing .plan{
|
| 557 |
+
background: #fff;
|
| 558 |
+
border: 1px solid #EBEBEA;
|
| 559 |
+
float: left;
|
| 560 |
+
padding: 0;
|
| 561 |
+
text-align: center;
|
| 562 |
+
position: relative;
|
| 563 |
+
margin-left: -1px;
|
| 564 |
+
}
|
| 565 |
+
.pricing .plan-header{
|
| 566 |
+
background: #f2f2f2;
|
| 567 |
+
border-bottom: 1px solid #EBEBEA;
|
| 568 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 569 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 570 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 571 |
+
padding: 20px;
|
| 572 |
+
text-shadow: 1px 1px 1px #fff;
|
| 573 |
+
}
|
| 574 |
+
.pricing .plan-header h2{
|
| 575 |
+
font-size: 16px;
|
| 576 |
+
line-height: 22px;
|
| 577 |
+
margin: 0;
|
| 578 |
+
}
|
| 579 |
+
.pricing .plan-price{
|
| 580 |
+
background: #fcfcfc;
|
| 581 |
+
border-bottom: 1px solid #EBEBEA;
|
| 582 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 583 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 584 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 585 |
+
padding: 20px;
|
| 586 |
+
text-shadow: 1px 1px 1px #fff;
|
| 587 |
+
}
|
| 588 |
+
.pricing .plan-price strong{
|
| 589 |
+
display: block;
|
| 590 |
+
font-size: 40px;
|
| 591 |
+
line-height: 40px;
|
| 592 |
+
}
|
| 593 |
+
.pricing .plan-price span{
|
| 594 |
+
color: #9C9A96;
|
| 595 |
+
}
|
| 596 |
+
.pricing .plan-content{
|
| 597 |
+
background: #fff;
|
| 598 |
+
}
|
| 599 |
+
.pricing .plan-content ul,
|
| 600 |
+
.pricing .plan-content ol{
|
| 601 |
+
list-style: none;
|
| 602 |
+
padding: 0;
|
| 603 |
+
margin: 0;
|
| 604 |
+
}
|
| 605 |
+
.pricing .plan-content ul li,
|
| 606 |
+
.pricing .plan-content ol li{
|
| 607 |
+
border-bottom: 1px solid #EBEBEA;
|
| 608 |
+
padding: 10px 20px;
|
| 609 |
+
margin: 0;
|
| 610 |
+
}
|
| 611 |
+
.pricing .plan-footer{
|
| 612 |
+
background: #f9f9f9;
|
| 613 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 614 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 615 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.3);
|
| 616 |
+
padding: 20px;
|
| 617 |
+
}
|
| 618 |
+
.pricing .plan-footer .inbound-button{
|
| 619 |
+
padding: 5px 20px;
|
| 620 |
+
}
|
| 621 |
+
|
| 622 |
+
/* Featured Plan */
|
| 623 |
+
.pricing .plan.featured{
|
| 624 |
+
border-color: #CECDCA;
|
| 625 |
+
-webkit-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 626 |
+
-moz-box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 627 |
+
box-shadow: 0px 0px 15px rgba(0,0,0,0.1);
|
| 628 |
+
z-index: 200;
|
| 629 |
+
margin-top: -10px;
|
| 630 |
+
}
|
| 631 |
+
.pricing .plan.featured .plan-header{
|
| 632 |
+
background-color: #e0e0e0;
|
| 633 |
+
border-color: #CECDCA;
|
| 634 |
+
padding: 25px 0px;
|
| 635 |
+
}
|
| 636 |
+
.pricing .plan.featured .plan-header h2{
|
| 637 |
+
}
|
| 638 |
+
.pricing .plan.featured .plan-price{
|
| 639 |
+
background-color: #f2f2f2;
|
| 640 |
+
}
|
| 641 |
+
.pricing .plan.featured .plan-content{
|
| 642 |
+
}
|
| 643 |
+
.pricing .plan.featured .plan-footer{
|
| 644 |
+
padding: 25px 0px;
|
| 645 |
+
background-color: #f2f2f2;
|
| 646 |
+
border-color: #CECDCA;
|
| 647 |
+
}
|
| 648 |
+
|
| 649 |
+
/* Dropcap
|
| 650 |
+
* ----------------------------------------------------- */
|
| 651 |
+
.dropcap{
|
| 652 |
+
font-size: 48px;
|
| 653 |
+
font-weight: bold;
|
| 654 |
+
float: left;
|
| 655 |
+
margin: 10px 10px 10px 0;
|
| 656 |
+
}
|
| 657 |
+
.dropcap.square{
|
| 658 |
+
background: #696763;
|
| 659 |
+
color: #fff;
|
| 660 |
+
font-size: 24px;
|
| 661 |
+
width: 48px;
|
| 662 |
+
height: 48px;
|
| 663 |
+
line-height: 48px;
|
| 664 |
+
text-align: center;
|
| 665 |
+
margin: 6px 10px 0px 0
|
| 666 |
+
}
|
| 667 |
+
.dropcap.circle{
|
| 668 |
+
background: #696763;
|
| 669 |
+
border-radius: 50%;
|
| 670 |
+
color: #fff;
|
| 671 |
+
font-size: 24px;
|
| 672 |
+
width: 48px;
|
| 673 |
+
height: 48px;
|
| 674 |
+
line-height: 48px;
|
| 675 |
+
text-align: center;
|
| 676 |
+
margin: 6px 10px 0px 0
|
| 677 |
+
}
|
| 678 |
+
|
| 679 |
+
/* Alert message
|
| 680 |
+
* ----------------------------------------------------- */
|
| 681 |
+
.alert-message{
|
| 682 |
+
background: #FFF;
|
| 683 |
+
border: 1px solid #EBEBEA;
|
| 684 |
+
padding: 8px 50px 8px 20px;
|
| 685 |
+
-webkit-border-radius: 3px;
|
| 686 |
+
-moz-border-radius: 3px;
|
| 687 |
+
border-radius: 3px;
|
| 688 |
+
position: relative;
|
| 689 |
+
margin-bottom: 20px;
|
| 690 |
+
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 691 |
+
}
|
| 692 |
+
.alert-message span.close{
|
| 693 |
+
position: absolute;
|
| 694 |
+
color: #CECDCA;
|
| 695 |
+
display: inline-block;
|
| 696 |
+
font-size: 14px;
|
| 697 |
+
line-height: 100%;
|
| 698 |
+
font-weight: 700;
|
| 699 |
+
width: 14px;
|
| 700 |
+
height: 14px;
|
| 701 |
+
text-align: center;
|
| 702 |
+
cursor: pointer;
|
| 703 |
+
right: 10px;
|
| 704 |
+
top: 11px;
|
| 705 |
+
}
|
| 706 |
+
.alert-message span.close:hover{
|
| 707 |
+
color: #9C9A96;
|
| 708 |
+
}
|
| 709 |
+
.alert-message.blue{
|
| 710 |
+
background: #dbf3f9;
|
| 711 |
+
border: 1px solid #c5e3ea;
|
| 712 |
+
}
|
| 713 |
+
.alert-message.green{
|
| 714 |
+
background: #e2ffc9;
|
| 715 |
+
border: 1px solid #c5eda3;
|
| 716 |
+
}
|
| 717 |
+
.alert-message.red{
|
| 718 |
+
background: #ffe2e2;
|
| 719 |
+
border: 1px solid #fcd1d1;
|
| 720 |
+
}
|
| 721 |
+
.alert-message.yellow{
|
| 722 |
+
background: #fcf7d1;
|
| 723 |
+
border: 1px solid #f2ebba;
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
/* Content Box
|
| 727 |
+
* ----------------------------------------------------- */
|
| 728 |
+
.inbound-content-box{
|
| 729 |
+
background: #f2f2f2;
|
| 730 |
+
border: 1px solid #EBEBEA;
|
| 731 |
+
-webkit-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 732 |
+
-moz-box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 733 |
+
box-shadow: inset 1px 1px 1px rgba(255,255,255,0.5);
|
| 734 |
+
margin: 0px 0px 20px;
|
| 735 |
+
padding: 20px 20px 20px;
|
| 736 |
+
position: relative;
|
| 737 |
+
text-shadow: 1px 1px 1px rgba(255,255,255,0.5);
|
| 738 |
+
}
|
| 739 |
+
.inbound-content-box > p:last-child{
|
| 740 |
+
margin-bottom: 0;
|
| 741 |
+
}
|
| 742 |
+
.inbound-content-box.blue{
|
| 743 |
+
background: #EEF9FC;
|
| 744 |
+
border: 1px solid #dfecf9;
|
| 745 |
+
}
|
| 746 |
+
.inbound-content-box.green{
|
| 747 |
+
background: #E9FFD6;
|
| 748 |
+
border: 1px solid #D4F2BB;
|
| 749 |
+
}
|
| 750 |
+
.inbound-content-box.red{
|
| 751 |
+
background: #FCE3E3;
|
| 752 |
+
border: 1px solid #fcd1d1;
|
| 753 |
+
}
|
| 754 |
+
.inbound-content-box.yellow{
|
| 755 |
+
background: #fcf7d1;
|
| 756 |
+
border: 1px solid #f2ebba;
|
| 757 |
+
}
|
| 758 |
+
.inbound-content-box h1,
|
| 759 |
+
.inbound-content-box h2,
|
| 760 |
+
.inbound-content-box h3,
|
| 761 |
+
.inbound-content-box h4,
|
| 762 |
+
.inbound-content-box h5,
|
| 763 |
+
.inbound-content-box h6{
|
| 764 |
+
margin-bottom: 10px;
|
| 765 |
+
}
|
| 766 |
+
|
| 767 |
+
/* Profile Box
|
| 768 |
+
* ----------------------------------------------------- */
|
| 769 |
+
.profile-box{
|
| 770 |
+
margin-bottom: 20px;
|
| 771 |
+
}
|
| 772 |
+
.profile-box .profile-img{
|
| 773 |
+
margin-bottom: 15px;
|
| 774 |
+
}
|
| 775 |
+
.profile-box .profile-img img{
|
| 776 |
+
display: block;
|
| 777 |
+
width: 100%;
|
| 778 |
+
height: auto;
|
| 779 |
+
margin: -1px;
|
| 780 |
+
}
|
| 781 |
+
.profile-box .profile-name{
|
| 782 |
+
margin-bottom: 0;
|
| 783 |
+
}
|
| 784 |
+
.profile-box .profile-meta{
|
| 785 |
+
color: #9C9A96;
|
| 786 |
+
margin-bottom: 15px;
|
| 787 |
+
}
|
| 788 |
+
.profile-box .profile-desc p:last-child{
|
| 789 |
+
margin-bottom: 0px;
|
| 790 |
+
}
|
| 791 |
+
.profile-box .profile-footer{
|
| 792 |
+
margin-top: 15px;
|
| 793 |
+
}
|
| 794 |
+
.profile-box .profile-footer a{
|
| 795 |
+
color: #9C9A96;
|
| 796 |
+
font-size: 12px;
|
| 797 |
+
margin-right: 10px;
|
| 798 |
+
}
|
| 799 |
+
|
| 800 |
+
/* Client Box
|
| 801 |
+
* ----------------------------------------------------- */
|
| 802 |
+
.client_box{
|
| 803 |
+
margin-bottom: 20px;
|
| 804 |
+
}
|
| 805 |
+
.client_box ul{
|
| 806 |
+
list-style: none;
|
| 807 |
+
margin: 0;
|
| 808 |
+
padding: 0;
|
| 809 |
+
}
|
| 810 |
+
.client_box ul li.inbound-grid{
|
| 811 |
+
border: 1px solid #EBEBEA;
|
| 812 |
+
margin: 0px -1px -1px 0px;
|
| 813 |
+
padding: 0;
|
| 814 |
+
}
|
| 815 |
+
.client_box ul li a{
|
| 816 |
+
display: block;
|
| 817 |
+
text-align: center;
|
| 818 |
+
}
|
| 819 |
+
.client_box ul li:hover{
|
| 820 |
+
border-color: #CECDCA;
|
| 821 |
+
-webkit-box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 822 |
+
-moz-box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 823 |
+
box-shadow: 0px 0px 8px rgba(0,0,0,0.1);
|
| 824 |
+
z-index: 200
|
| 825 |
+
}
|
| 826 |
+
|
| 827 |
+
/* Google Map
|
| 828 |
+
* ----------------------------------------------------- */
|
| 829 |
+
.google_map{
|
| 830 |
+
max-width: 100%;
|
| 831 |
+
margin-bottom: 20px;
|
| 832 |
+
}
|
| 833 |
+
|
| 834 |
+
/* Buttons
|
| 835 |
+
* ------------------------------------------*/
|
| 836 |
+
a.inbound-button, a.inbound-button.inbound-special-class{
|
| 837 |
+
background:#c8232b;
|
| 838 |
+
border:1px solid rgba(0,0,0,0.15);
|
| 839 |
+
-webkit-border-radius:2px;
|
| 840 |
+
-moz-border-radius:2px;
|
| 841 |
+
border-radius:2px;
|
| 842 |
+
-webkit-box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 843 |
+
-moz-box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 844 |
+
box-shadow:0px 2px 3px rgba(0,0,0,0.15), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 845 |
+
color:#fff;
|
| 846 |
+
cursor:pointer;
|
| 847 |
+
display:inline-block;
|
| 848 |
+
font-family:inherit;
|
| 849 |
+
font-size:14px;
|
| 850 |
+
font-weight:bold;
|
| 851 |
+
padding:8px 15px;
|
| 852 |
+
text-shadow:-1px -1px 1px rgba(0,0,0,0.15);
|
| 853 |
+
text-decoration: none;
|
| 854 |
+
text-align: center;
|
| 855 |
+
}
|
| 856 |
+
.inbound-button:hover{
|
| 857 |
+
color:#fff;
|
| 858 |
+
}
|
| 859 |
+
.inbound-button.small{
|
| 860 |
+
font-size: 100%;
|
| 861 |
+
padding:4px 10px;
|
| 862 |
+
}
|
| 863 |
+
.inbound-button.large{
|
| 864 |
+
font-size:18px;
|
| 865 |
+
padding:12px 30px;
|
| 866 |
+
}
|
| 867 |
+
input[type=submit].inbound-button, button.inbound-button{
|
| 868 |
+
-webkit-appearance:none;
|
| 869 |
+
}
|
| 870 |
+
.inbound-button.black{
|
| 871 |
+
background-color: #4A4845;
|
| 872 |
+
}
|
| 873 |
+
.inbound-button.blue{
|
| 874 |
+
background-color: #707ef9;
|
| 875 |
+
}
|
| 876 |
+
.inbound-button.brown{
|
| 877 |
+
background-color: #5e3d1d;
|
| 878 |
+
}
|
| 879 |
+
.inbound-button.green{
|
| 880 |
+
background-color: #65b20e;
|
| 881 |
+
}
|
| 882 |
+
.inbound-button.orange{
|
| 883 |
+
background-color: #ff9900;
|
| 884 |
+
}
|
| 885 |
+
.inbound-button.pink{
|
| 886 |
+
background-color: #fc149f;
|
| 887 |
+
}
|
| 888 |
+
.inbound-button.purple{
|
| 889 |
+
background-color: #993d9e;
|
| 890 |
+
}
|
| 891 |
+
.inbound-button.red{
|
| 892 |
+
background-color: #fc5a5a;
|
| 893 |
+
}
|
| 894 |
+
.inbound-button.silver{
|
| 895 |
+
background-color: #858585;
|
| 896 |
+
}
|
| 897 |
+
.inbound-button.yellow{
|
| 898 |
+
background-color: #f7c707;
|
| 899 |
+
}
|
| 900 |
+
.inbound-button.white{
|
| 901 |
+
background-color: #f4f4f4;
|
| 902 |
+
border-color: #ccc;
|
| 903 |
+
-webkit-box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 904 |
+
-moz-box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 905 |
+
box-shadow:0px 1px 2px rgba(0,0,0,0.08), inset 1px 1px 1px rgba(255,255,255,0.2);
|
| 906 |
+
color: #666;
|
| 907 |
+
text-shadow: none;
|
| 908 |
+
}
|
| 909 |
+
.inbound-button.white:hover{
|
| 910 |
+
color: #4A4845;
|
| 911 |
+
}
|
| 912 |
+
|
| 913 |
+
/*!
|
| 914 |
+
* Font Awesome 4.0.3 by @davegandy - http://fontawesome.io - @fontawesome
|
| 915 |
+
* License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
|
| 916 |
+
*/
|
| 917 |
+
@font-face {
|
| 918 |
+
font-family: 'FontAwesome';
|
| 919 |
+
src: url('../../assets/global/fonts/fontawesome/fontawesome-webfont.eot?v=3.0.2');
|
| 920 |
+
src: url('../../assets/global/fonts/fontawesome/fontawesome-webfont.eot?#iefix&v=3.0.2') format('embedded-opentype'),
|
| 921 |
+
url('../../assets/global/fonts/fontawesome/fontawesome-webfont.woff?v=3.0.2') format('woff'),
|
| 922 |
+
url('../../assets/global/fonts/fontawesome/fontawesome-webfont.ttf?v=3.0.2') format('truetype');
|
| 923 |
+
font-weight: normal;
|
| 924 |
+
font-style: normal;
|
| 925 |
+
}format('svg');font-weight:normal;font-style:normal}.fa{display:inline-block;font-family:FontAwesome;font-style:normal;font-weight:normal;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.fa-lg{font-size:1.3333333333333333em;line-height:.75em;vertical-align:-15%}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-fw{width:1.2857142857142858em;text-align:center}.fa-ul{padding-left:0;margin-left:2.142857142857143em;list-style-type:none}.fa-ul>li{position:relative}.fa-li{position:absolute;left:-2.142857142857143em;width:2.142857142857143em;top:.14285714285714285em;text-align:center}.fa-li.fa-lg{left:-1.8571428571428572em}.fa-border{padding:.2em .25em .15em;border:solid .08em #eee;border-radius:.1em}.pull-right{float:right}.pull-left{float:left}.fa.pull-left{margin-right:.3em}.fa.pull-right{margin-left:.3em}.fa-spin{-webkit-animation:spin 2s infinite linear;-moz-animation:spin 2s infinite linear;-o-animation:spin 2s infinite linear;animation:spin 2s infinite linear}@-moz-keyframes spin{0%{-moz-transform:rotate(0deg)}100%{-moz-transform:rotate(359deg)}}@-webkit-keyframes spin{0%{-webkit-transform:rotate(0deg)}100%{-webkit-transform:rotate(359deg)}}@-o-keyframes spin{0%{-o-transform:rotate(0deg)}100%{-o-transform:rotate(359deg)}}@-ms-keyframes spin{0%{-ms-transform:rotate(0deg)}100%{-ms-transform:rotate(359deg)}}@keyframes spin{0%{transform:rotate(0deg)}100%{transform:rotate(359deg)}}.fa-rotate-90{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=1);-webkit-transform:rotate(90deg);-moz-transform:rotate(90deg);-ms-transform:rotate(90deg);-o-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=2);-webkit-transform:rotate(180deg);-moz-transform:rotate(180deg);-ms-transform:rotate(180deg);-o-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=3);-webkit-transform:rotate(270deg);-moz-transform:rotate(270deg);-ms-transform:rotate(270deg);-o-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=0,mirror=1);-webkit-transform:scale(-1,1);-moz-transform:scale(-1,1);-ms-transform:scale(-1,1);-o-transform:scale(-1,1);transform:scale(-1,1)}.fa-flip-vertical{filter:progid:DXImageTransform.Microsoft.BasicImage(rotation=2,mirror=1);-webkit-transform:scale(1,-1);-moz-transform:scale(1,-1);-ms-transform:scale(1,-1);-o-transform:scale(1,-1);transform:scale(1,-1)}.fa-stack{position:relative;display:inline-block;width:2em;height:2em;line-height:2em;vertical-align:middle}.fa-stack-1x,.fa-stack-2x{position:absolute;left:0;width:100%;text-align:center}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-glass:before{content:"\f000"}.fa-music:before{content:"\f001"}.fa-search:before{content:"\f002"}.fa-envelope-o:before{content:"\f003"}.fa-heart:before{content:"\f004"}.fa-star:before{content:"\f005"}.fa-star-o:before{content:"\f006"}.fa-user:before{content:"\f007"}.fa-film:before{content:"\f008"}.fa-th-large:before{content:"\f009"}.fa-th:before{content:"\f00a"}.fa-th-list:before{content:"\f00b"}.fa-check:before{content:"\f00c"}.fa-times:before{content:"\f00d"}.fa-search-plus:before{content:"\f00e"}.fa-search-minus:before{content:"\f010"}.fa-power-off:before{content:"\f011"}.fa-signal:before{content:"\f012"}.fa-gear:before,.fa-cog:before{content:"\f013"}.fa-trash-o:before{content:"\f014"}.fa-home:before{content:"\f015"}.fa-file-o:before{content:"\f016"}.fa-clock-o:before{content:"\f017"}.fa-road:before{content:"\f018"}.fa-download:before{content:"\f019"}.fa-arrow-circle-o-down:before{content:"\f01a"}.fa-arrow-circle-o-up:before{content:"\f01b"}.fa-inbox:before{content:"\f01c"}.fa-play-circle-o:before{content:"\f01d"}.fa-rotate-right:before,.fa-repeat:before{content:"\f01e"}.fa-refresh:before{content:"\f021"}.fa-list-alt:before{content:"\f022"}.fa-lock:before{content:"\f023"}.fa-flag:before{content:"\f024"}.fa-headphones:before{content:"\f025"}.fa-volume-off:before{content:"\f026"}.fa-volume-down:before{content:"\f027"}.fa-volume-up:before{content:"\f028"}.fa-qrcode:before{content:"\f029"}.fa-barcode:before{content:"\f02a"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-book:before{content:"\f02d"}.fa-bookmark:before{content:"\f02e"}.fa-print:before{content:"\f02f"}.fa-camera:before{content:"\f030"}.fa-font:before{content:"\f031"}.fa-bold:before{content:"\f032"}.fa-italic:before{content:"\f033"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-align-left:before{content:"\f036"}.fa-align-center:before{content:"\f037"}.fa-align-right:before{content:"\f038"}.fa-align-justify:before{content:"\f039"}.fa-list:before{content:"\f03a"}.fa-dedent:before,.fa-outdent:before{content:"\f03b"}.fa-indent:before{content:"\f03c"}.fa-video-camera:before{content:"\f03d"}.fa-picture-o:before{content:"\f03e"}.fa-pencil:before{content:"\f040"}.fa-map-marker:before{content:"\f041"}.fa-adjust:before{content:"\f042"}.fa-tint:before{content:"\f043"}.fa-edit:before,.fa-pencil-square-o:before{content:"\f044"}.fa-share-square-o:before{content:"\f045"}.fa-check-square-o:before{content:"\f046"}.fa-arrows:before{content:"\f047"}.fa-step-backward:before{content:"\f048"}.fa-fast-backward:before{content:"\f049"}.fa-backward:before{content:"\f04a"}.fa-play:before{content:"\f04b"}.fa-pause:before{content:"\f04c"}.fa-stop:before{content:"\f04d"}.fa-forward:before{content:"\f04e"}.fa-fast-forward:before{content:"\f050"}.fa-step-forward:before{content:"\f051"}.fa-eject:before{content:"\f052"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-plus-circle:before{content:"\f055"}.fa-minus-circle:before{content:"\f056"}.fa-times-circle:before{content:"\f057"}.fa-check-circle:before{content:"\f058"}.fa-question-circle:before{content:"\f059"}.fa-info-circle:before{content:"\f05a"}.fa-crosshairs:before{content:"\f05b"}.fa-times-circle-o:before{content:"\f05c"}.fa-check-circle-o:before{content:"\f05d"}.fa-ban:before{content:"\f05e"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrow-down:before{content:"\f063"}.fa-mail-forward:before,.fa-share:before{content:"\f064"}.fa-expand:before{content:"\f065"}.fa-compress:before{content:"\f066"}.fa-plus:before{content:"\f067"}.fa-minus:before{content:"\f068"}.fa-asterisk:before{content:"\f069"}.fa-exclamation-circle:before{content:"\f06a"}.fa-gift:before{content:"\f06b"}.fa-leaf:before{content:"\f06c"}.fa-fire:before{content:"\f06d"}.fa-eye:before{content:"\f06e"}.fa-eye-slash:before{content:"\f070"}.fa-warning:before,.fa-exclamation-triangle:before{content:"\f071"}.fa-plane:before{content:"\f072"}.fa-calendar:before{content:"\f073"}.fa-random:before{content:"\f074"}.fa-comment:before{content:"\f075"}.fa-magnet:before{content:"\f076"}.fa-chevron-up:before{content:"\f077"}.fa-chevron-down:before{content:"\f078"}.fa-retweet:before{content:"\f079"}.fa-shopping-cart:before{content:"\f07a"}.fa-folder:before{content:"\f07b"}.fa-folder-open:before{content:"\f07c"}.fa-arrows-v:before{content:"\f07d"}.fa-arrows-h:before{content:"\f07e"}.fa-bar-chart-o:before{content:"\f080"}.fa-twitter-square:before{content:"\f081"}.fa-facebook-square:before{content:"\f082"}.fa-camera-retro:before{content:"\f083"}.fa-key:before{content:"\f084"}.fa-gears:before,.fa-cogs:before{content:"\f085"}.fa-comments:before{content:"\f086"}.fa-thumbs-o-up:before{content:"\f087"}.fa-thumbs-o-down:before{content:"\f088"}.fa-star-half:before{content:"\f089"}.fa-heart-o:before{content:"\f08a"}.fa-sign-out:before{content:"\f08b"}.fa-linkedin-square:before{content:"\f08c"}.fa-thumb-tack:before{content:"\f08d"}.fa-external-link:before{content:"\f08e"}.fa-sign-in:before{content:"\f090"}.fa-trophy:before{content:"\f091"}.fa-github-square:before{content:"\f092"}.fa-upload:before{content:"\f093"}.fa-lemon-o:before{content:"\f094"}.fa-phone:before{content:"\f095"}.fa-square-o:before{content:"\f096"}.fa-bookmark-o:before{content:"\f097"}.fa-phone-square:before{content:"\f098"}.fa-twitter:before{content:"\f099"}.fa-facebook:before{content:"\f09a"}.fa-github:before{content:"\f09b"}.fa-unlock:before{content:"\f09c"}.fa-credit-card:before{content:"\f09d"}.fa-rss:before{content:"\f09e"}.fa-hdd-o:before{content:"\f0a0"}.fa-bullhorn:before{content:"\f0a1"}.fa-bell:before{content:"\f0f3"}.fa-certificate:before{content:"\f0a3"}.fa-hand-o-right:before{content:"\f0a4"}.fa-hand-o-left:before{content:"\f0a5"}.fa-hand-o-up:before{content:"\f0a6"}.fa-hand-o-down:before{content:"\f0a7"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-globe:before{content:"\f0ac"}.fa-wrench:before{content:"\f0ad"}.fa-tasks:before{content:"\f0ae"}.fa-filter:before{content:"\f0b0"}.fa-briefcase:before{content:"\f0b1"}.fa-arrows-alt:before{content:"\f0b2"}.fa-group:before,.fa-users:before{content:"\f0c0"}.fa-chain:before,.fa-link:before{content:"\f0c1"}.fa-cloud:before{content:"\f0c2"}.fa-flask:before{content:"\f0c3"}.fa-cut:before,.fa-scissors:before{content:"\f0c4"}.fa-copy:before,.fa-files-o:before{content:"\f0c5"}.fa-paperclip:before{content:"\f0c6"}.fa-save:before,.fa-floppy-o:before{content:"\f0c7"}.fa-square:before{content:"\f0c8"}.fa-bars:before{content:"\f0c9"}.fa-list-ul:before{content:"\f0ca"}.fa-list-ol:before{content:"\f0cb"}.fa-strikethrough:before{content:"\f0cc"}.fa-underline:before{content:"\f0cd"}.fa-table:before{content:"\f0ce"}.fa-magic:before{content:"\f0d0"}.fa-truck:before{content:"\f0d1"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-square:before{content:"\f0d3"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-plus:before{content:"\f0d5"}.fa-money:before{content:"\f0d6"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-up:before{content:"\f0d8"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-columns:before{content:"\f0db"}.fa-unsorted:before,.fa-sort:before{content:"\f0dc"}.fa-sort-down:before,.fa-sort-asc:before{content:"\f0dd"}.fa-sort-up:before,.fa-sort-desc:before{content:"\f0de"}.fa-envelope:before{content:"\f0e0"}.fa-linkedin:before{content:"\f0e1"}.fa-rotate-left:before,.fa-undo:before{content:"\f0e2"}.fa-legal:before,.fa-gavel:before{content:"\f0e3"}.fa-dashboard:before,.fa-tachometer:before{content:"\f0e4"}.fa-comment-o:before{content:"\f0e5"}.fa-comments-o:before{content:"\f0e6"}.fa-flash:before,.fa-bolt:before{content:"\f0e7"}.fa-sitemap:before{content:"\f0e8"}.fa-umbrella:before{content:"\f0e9"}.fa-paste:before,.fa-clipboard:before{content:"\f0ea"}.fa-lightbulb-o:before{content:"\f0eb"}.fa-exchange:before{content:"\f0ec"}.fa-cloud-download:before{content:"\f0ed"}.fa-cloud-upload:before{content:"\f0ee"}.fa-user-md:before{content:"\f0f0"}.fa-stethoscope:before{content:"\f0f1"}.fa-suitcase:before{content:"\f0f2"}.fa-bell-o:before{content:"\f0a2"}.fa-coffee:before{content:"\f0f4"}.fa-cutlery:before{content:"\f0f5"}.fa-file-text-o:before{content:"\f0f6"}.fa-building-o:before{content:"\f0f7"}.fa-hospital-o:before{content:"\f0f8"}.fa-ambulance:before{content:"\f0f9"}.fa-medkit:before{content:"\f0fa"}.fa-fighter-jet:before{content:"\f0fb"}.fa-beer:before{content:"\f0fc"}.fa-h-square:before{content:"\f0fd"}.fa-plus-square:before{content:"\f0fe"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angle-down:before{content:"\f107"}.fa-desktop:before{content:"\f108"}.fa-laptop:before{content:"\f109"}.fa-tablet:before{content:"\f10a"}.fa-mobile-phone:before,.fa-mobile:before{content:"\f10b"}.fa-circle-o:before{content:"\f10c"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-spinner:before{content:"\f110"}.fa-circle:before{content:"\f111"}.fa-mail-reply:before,.fa-reply:before{content:"\f112"}.fa-github-alt:before{content:"\f113"}.fa-folder-o:before{content:"\f114"}.fa-folder-open-o:before{content:"\f115"}.fa-smile-o:before{content:"\f118"}.fa-frown-o:before{content:"\f119"}.fa-meh-o:before{content:"\f11a"}.fa-gamepad:before{content:"\f11b"}.fa-keyboard-o:before{content:"\f11c"}.fa-flag-o:before{content:"\f11d"}.fa-flag-checkered:before{content:"\f11e"}.fa-terminal:before{content:"\f120"}.fa-code:before{content:"\f121"}.fa-reply-all:before{content:"\f122"}.fa-mail-reply-all:before{content:"\f122"}.fa-star-half-empty:before,.fa-star-half-full:before,.fa-star-half-o:before{content:"\f123"}.fa-location-arrow:before{content:"\f124"}.fa-crop:before{content:"\f125"}.fa-code-fork:before{content:"\f126"}.fa-unlink:before,.fa-chain-broken:before{content:"\f127"}.fa-question:before{content:"\f128"}.fa-info:before{content:"\f129"}.fa-exclamation:before{content:"\f12a"}.fa-superscript:before{content:"\f12b"}.fa-subscript:before{content:"\f12c"}.fa-eraser:before{content:"\f12d"}.fa-puzzle-piece:before{content:"\f12e"}.fa-microphone:before{content:"\f130"}.fa-microphone-slash:before{content:"\f131"}.fa-shield:before{content:"\f132"}.fa-calendar-o:before{content:"\f133"}.fa-fire-extinguisher:before{content:"\f134"}.fa-rocket:before{content:"\f135"}.fa-maxcdn:before{content:"\f136"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-html5:before{content:"\f13b"}.fa-css3:before{content:"\f13c"}.fa-anchor:before{content:"\f13d"}.fa-unlock-alt:before{content:"\f13e"}.fa-bullseye:before{content:"\f140"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-rss-square:before{content:"\f143"}.fa-play-circle:before{content:"\f144"}.fa-ticket:before{content:"\f145"}.fa-minus-square:before{content:"\f146"}.fa-minus-square-o:before{content:"\f147"}.fa-level-up:before{content:"\f148"}.fa-level-down:before{content:"\f149"}.fa-check-square:before{content:"\f14a"}.fa-pencil-square:before{content:"\f14b"}.fa-external-link-square:before{content:"\f14c"}.fa-share-square:before{content:"\f14d"}.fa-compass:before{content:"\f14e"}.fa-toggle-down:before,.fa-caret-square-o-down:before{content:"\f150"}.fa-toggle-up:before,.fa-caret-square-o-up:before{content:"\f151"}.fa-toggle-right:before,.fa-caret-square-o-right:before{content:"\f152"}.fa-euro:before,.fa-eur:before{content:"\f153"}.fa-gbp:before{content:"\f154"}.fa-dollar:before,.fa-usd:before{content:"\f155"}.fa-rupee:before,.fa-inr:before{content:"\f156"}.fa-cny:before,.fa-rmb:before,.fa-yen:before,.fa-jpy:before{content:"\f157"}.fa-ruble:before,.fa-rouble:before,.fa-rub:before{content:"\f158"}.fa-won:before,.fa-krw:before{content:"\f159"}.fa-bitcoin:before,.fa-btc:before{content:"\f15a"}.fa-file:before{content:"\f15b"}.fa-file-text:before{content:"\f15c"}.fa-sort-alpha-asc:before{content:"\f15d"}.fa-sort-alpha-desc:before{content:"\f15e"}.fa-sort-amount-asc:before{content:"\f160"}.fa-sort-amount-desc:before{content:"\f161"}.fa-sort-numeric-asc:before{content:"\f162"}.fa-sort-numeric-desc:before{content:"\f163"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbs-down:before{content:"\f165"}.fa-youtube-square:before{content:"\f166"}.fa-youtube:before{content:"\f167"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-youtube-play:before{content:"\f16a"}.fa-dropbox:before{content:"\f16b"}.fa-stack-overflow:before{content:"\f16c"}.fa-instagram:before{content:"\f16d"}.fa-flickr:before{content:"\f16e"}.fa-adn:before{content:"\f170"}.fa-bitbucket:before{content:"\f171"}.fa-bitbucket-square:before{content:"\f172"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-long-arrow-down:before{content:"\f175"}.fa-long-arrow-up:before{content:"\f176"}.fa-long-arrow-left:before{content:"\f177"}.fa-long-arrow-right:before{content:"\f178"}.fa-apple:before{content:"\f179"}.fa-windows:before{content:"\f17a"}.fa-android:before{content:"\f17b"}.fa-linux:before{content:"\f17c"}.fa-dribbble:before{content:"\f17d"}.fa-skype:before{content:"\f17e"}.fa-foursquare:before{content:"\f180"}.fa-trello:before{content:"\f181"}.fa-female:before{content:"\f182"}.fa-male:before{content:"\f183"}.fa-gittip:before{content:"\f184"}.fa-sun-o:before{content:"\f185"}.fa-moon-o:before{content:"\f186"}.fa-archive:before{content:"\f187"}.fa-bug:before{content:"\f188"}.fa-vk:before{content:"\f189"}.fa-weibo:before{content:"\f18a"}.fa-renren:before{content:"\f18b"}.fa-pagelines:before{content:"\f18c"}.fa-stack-exchange:before{content:"\f18d"}.fa-arrow-circle-o-right:before{content:"\f18e"}.fa-arrow-circle-o-left:before{content:"\f190"}.fa-toggle-left:before,.fa-caret-square-o-left:before{content:"\f191"}.fa-dot-circle-o:before{content:"\f192"}.fa-wheelchair:before{content:"\f193"}.fa-vimeo-square:before{content:"\f194"}.fa-turkish-lira:before,.fa-try:before{content:"\f195"}.fa-plus-square-o:before{content:"\f196"}
|
| 926 |
+
|
| 927 |
+
/* List ICON Rules */
|
| 928 |
+
/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
|
| 929 |
+
readers do not read off random characters that represent icons */
|
| 930 |
+
#inbound-list.list-icon-glass li:before { content: "\f000"; }
|
| 931 |
+
|
| 932 |
+
#inbound-list.fa-list-glass li:before{content:"\f000"}#inbound-list.fa-list-music li:before{content:"\f001"}#inbound-list.fa-list-search li:before{content:"\f002"}#inbound-list.fa-list-envelope-o li:before{content:"\f003"}#inbound-list.fa-list-heart li:before{content:"\f004"}#inbound-list.fa-list-star li:before{content:"\f005"}#inbound-list.fa-list-star-o li:before{content:"\f006"}#inbound-list.fa-list-user li:before{content:"\f007"}#inbound-list.fa-list-film li:before{content:"\f008"}#inbound-list.fa-list-th-large li:before{content:"\f009"}#inbound-list.fa-list-th li:before{content:"\f00a"}#inbound-list.fa-list-th-list li:before{content:"\f00b"}#inbound-list.fa-list-check li:before{content:"\f00c"}#inbound-list.fa-list-times li:before{content:"\f00d"}#inbound-list.fa-list-search-plus li:before{content:"\f00e"}#inbound-list.fa-list-search-minus li:before{content:"\f010"}#inbound-list.fa-list-power-off li:before{content:"\f011"}#inbound-list.fa-list-signal li:before{content:"\f012"}#inbound-list.fa-list-gear li:before,#inbound-list.fa-list-cog li:before{content:"\f013"}#inbound-list.fa-list-trash-o li:before{content:"\f014"}#inbound-list.fa-list-home li:before{content:"\f015"}#inbound-list.fa-list-file-o li:before{content:"\f016"}#inbound-list.fa-list-clock-o li:before{content:"\f017"}#inbound-list.fa-list-road li:before{content:"\f018"}#inbound-list.fa-list-download li:before{content:"\f019"}#inbound-list.fa-list-arrow-circle-o-down li:before{content:"\f01a"}#inbound-list.fa-list-arrow-circle-o-up li:before{content:"\f01b"}#inbound-list.fa-list-inbox li:before{content:"\f01c"}#inbound-list.fa-list-play-circle-o li:before{content:"\f01d"}#inbound-list.fa-list-rotate-right li:before,#inbound-list.fa-list-repeat li:before{content:"\f01e"}#inbound-list.fa-list-refresh li:before{content:"\f021"}#inbound-list.fa-list-list-alt li:before{content:"\f022"}#inbound-list.fa-list-lock li:before{content:"\f023"}#inbound-list.fa-list-flag li:before{content:"\f024"}#inbound-list.fa-list-headphones li:before{content:"\f025"}#inbound-list.fa-list-volume-off li:before{content:"\f026"}#inbound-list.fa-list-volume-down li:before{content:"\f027"}#inbound-list.fa-list-volume-up li:before{content:"\f028"}#inbound-list.fa-list-qrcode li:before{content:"\f029"}#inbound-list.fa-list-barcode li:before{content:"\f02a"}#inbound-list.fa-list-tag li:before{content:"\f02b"}#inbound-list.fa-list-tags li:before{content:"\f02c"}#inbound-list.fa-list-book li:before{content:"\f02d"}#inbound-list.fa-list-bookmark li:before{content:"\f02e"}#inbound-list.fa-list-print li:before{content:"\f02f"}#inbound-list.fa-list-camera li:before{content:"\f030"}#inbound-list.fa-list-font li:before{content:"\f031"}#inbound-list.fa-list-bold li:before{content:"\f032"}#inbound-list.fa-list-italic li:before{content:"\f033"}#inbound-list.fa-list-text-height li:before{content:"\f034"}#inbound-list.fa-list-text-width li:before{content:"\f035"}#inbound-list.fa-list-align-left li:before{content:"\f036"}#inbound-list.fa-list-align-center li:before{content:"\f037"}#inbound-list.fa-list-align-right li:before{content:"\f038"}#inbound-list.fa-list-align-justify li:before{content:"\f039"}#inbound-list.fa-list-list li:before{content:"\f03a"}#inbound-list.fa-list-dedent li:before,#inbound-list.fa-list-outdent li:before{content:"\f03b"}#inbound-list.fa-list-indent li:before{content:"\f03c"}#inbound-list.fa-list-video-camera li:before{content:"\f03d"}#inbound-list.fa-list-picture-o li:before{content:"\f03e"}#inbound-list.fa-list-pencil li:before{content:"\f040"}#inbound-list.fa-list-map-marker li:before{content:"\f041"}#inbound-list.fa-list-adjust li:before{content:"\f042"}#inbound-list.fa-list-tint li:before{content:"\f043"}#inbound-list.fa-list-edit li:before,#inbound-list.fa-list-pencil-square-o li:before{content:"\f044"}#inbound-list.fa-list-share-square-o li:before{content:"\f045"}#inbound-list.fa-list-check-square-o li:before{content:"\f046"}#inbound-list.fa-list-arrows li:before{content:"\f047"}#inbound-list.fa-list-step-backward li:before{content:"\f048"}#inbound-list.fa-list-fast-backward li:before{content:"\f049"}#inbound-list.fa-list-backward li:before{content:"\f04a"}#inbound-list.fa-list-play li:before{content:"\f04b"}#inbound-list.fa-list-pause li:before{content:"\f04c"}#inbound-list.fa-list-stop li:before{content:"\f04d"}#inbound-list.fa-list-forward li:before{content:"\f04e"}#inbound-list.fa-list-fast-forward li:before{content:"\f050"}#inbound-list.fa-list-step-forward li:before{content:"\f051"}#inbound-list.fa-list-eject li:before{content:"\f052"}#inbound-list.fa-list-chevron-left li:before{content:"\f053"}#inbound-list.fa-list-chevron-right li:before{content:"\f054"}#inbound-list.fa-list-plus-circle li:before{content:"\f055"}#inbound-list.fa-list-minus-circle li:before{content:"\f056"}#inbound-list.fa-list-times-circle li:before{content:"\f057"}#inbound-list.fa-list-check-circle li:before{content:"\f058"}#inbound-list.fa-list-question-circle li:before{content:"\f059"}#inbound-list.fa-list-info-circle li:before{content:"\f05a"}#inbound-list.fa-list-crosshairs li:before{content:"\f05b"}#inbound-list.fa-list-times-circle-o li:before{content:"\f05c"}#inbound-list.fa-list-check-circle-o li:before{content:"\f05d"}#inbound-list.fa-list-ban li:before{content:"\f05e"}#inbound-list.fa-list-arrow-left li:before{content:"\f060"}#inbound-list.fa-list-arrow-right li:before{content:"\f061"}#inbound-list.fa-list-arrow-up li:before{content:"\f062"}#inbound-list.fa-list-arrow-down li:before{content:"\f063"}#inbound-list.fa-list-mail-forward li:before,#inbound-list.fa-list-share li:before{content:"\f064"}#inbound-list.fa-list-expand li:before{content:"\f065"}#inbound-list.fa-list-compress li:before{content:"\f066"}#inbound-list.fa-list-plus li:before{content:"\f067"}#inbound-list.fa-list-minus li:before{content:"\f068"}#inbound-list.fa-list-asterisk li:before{content:"\f069"}#inbound-list.fa-list-exclamation-circle li:before{content:"\f06a"}#inbound-list.fa-list-gift li:before{content:"\f06b"}#inbound-list.fa-list-leaf li:before{content:"\f06c"}#inbound-list.fa-list-fire li:before{content:"\f06d"}#inbound-list.fa-list-eye li:before{content:"\f06e"}#inbound-list.fa-list-eye-slash li:before{content:"\f070"}#inbound-list.fa-list-warning li:before,#inbound-list.fa-list-exclamation-triangle li:before{content:"\f071"}#inbound-list.fa-list-plane li:before{content:"\f072"}#inbound-list.fa-list-calendar li:before{content:"\f073"}#inbound-list.fa-list-random li:before{content:"\f074"}#inbound-list.fa-list-comment li:before{content:"\f075"}#inbound-list.fa-list-magnet li:before{content:"\f076"}#inbound-list.fa-list-chevron-up li:before{content:"\f077"}#inbound-list.fa-list-chevron-down li:before{content:"\f078"}#inbound-list.fa-list-retweet li:before{content:"\f079"}#inbound-list.fa-list-shopping-cart li:before{content:"\f07a"}#inbound-list.fa-list-folder li:before{content:"\f07b"}#inbound-list.fa-list-folder-open li:before{content:"\f07c"}#inbound-list.fa-list-arrows-v li:before{content:"\f07d"}#inbound-list.fa-list-arrows-h li:before{content:"\f07e"}#inbound-list.fa-list-bar-chart-o li:before{content:"\f080"}#inbound-list.fa-list-twitter-square li:before{content:"\f081"}#inbound-list.fa-list-facebook-square li:before{content:"\f082"}#inbound-list.fa-list-camera-retro li:before{content:"\f083"}#inbound-list.fa-list-key li:before{content:"\f084"}#inbound-list.fa-list-gears li:before,#inbound-list.fa-list-cogs li:before{content:"\f085"}#inbound-list.fa-list-comments li:before{content:"\f086"}#inbound-list.fa-list-thumbs-o-up li:before{content:"\f087"}#inbound-list.fa-list-thumbs-o-down li:before{content:"\f088"}#inbound-list.fa-list-star-half li:before{content:"\f089"}#inbound-list.fa-list-heart-o li:before{content:"\f08a"}#inbound-list.fa-list-sign-out li:before{content:"\f08b"}#inbound-list.fa-list-linkedin-square li:before{content:"\f08c"}#inbound-list.fa-list-thumb-tack li:before{content:"\f08d"}#inbound-list.fa-list-external-link li:before{content:"\f08e"}#inbound-list.fa-list-sign-in li:before{content:"\f090"}#inbound-list.fa-list-trophy li:before{content:"\f091"}#inbound-list.fa-list-github-square li:before{content:"\f092"}#inbound-list.fa-list-upload li:before{content:"\f093"}#inbound-list.fa-list-lemon-o li:before{content:"\f094"}#inbound-list.fa-list-phone li:before{content:"\f095"}#inbound-list.fa-list-square-o li:before{content:"\f096"}#inbound-list.fa-list-bookmark-o li:before{content:"\f097"}#inbound-list.fa-list-phone-square li:before{content:"\f098"}#inbound-list.fa-list-twitter li:before{content:"\f099"}#inbound-list.fa-list-facebook li:before{content:"\f09a"}#inbound-list.fa-list-github li:before{content:"\f09b"}#inbound-list.fa-list-unlock li:before{content:"\f09c"}#inbound-list.fa-list-credit-card li:before{content:"\f09d"}#inbound-list.fa-list-rss li:before{content:"\f09e"}#inbound-list.fa-list-hdd-o li:before{content:"\f0a0"}#inbound-list.fa-list-bullhorn li:before{content:"\f0a1"}#inbound-list.fa-list-bell li:before{content:"\f0f3"}#inbound-list.fa-list-certificate li:before{content:"\f0a3"}#inbound-list.fa-list-hand-o-right li:before{content:"\f0a4"}#inbound-list.fa-list-hand-o-left li:before{content:"\f0a5"}#inbound-list.fa-list-hand-o-up li:before{content:"\f0a6"}#inbound-list.fa-list-hand-o-down li:before{content:"\f0a7"}#inbound-list.fa-list-arrow-circle-left li:before{content:"\f0a8"}#inbound-list.fa-list-arrow-circle-right li:before{content:"\f0a9"}#inbound-list.fa-list-arrow-circle-up li:before{content:"\f0aa"}#inbound-list.fa-list-arrow-circle-down li:before{content:"\f0ab"}#inbound-list.fa-list-globe li:before{content:"\f0ac"}#inbound-list.fa-list-wrench li:before{content:"\f0ad"}#inbound-list.fa-list-tasks li:before{content:"\f0ae"}#inbound-list.fa-list-filter li:before{content:"\f0b0"}#inbound-list.fa-list-briefcase li:before{content:"\f0b1"}#inbound-list.fa-list-arrows-alt li:before{content:"\f0b2"}#inbound-list.fa-list-group li:before,#inbound-list.fa-list-users li:before{content:"\f0c0"}#inbound-list.fa-list-chain li:before,#inbound-list.fa-list-link li:before{content:"\f0c1"}#inbound-list.fa-list-cloud li:before{content:"\f0c2"}#inbound-list.fa-list-flask li:before{content:"\f0c3"}#inbound-list.fa-list-cut li:before,#inbound-list.fa-list-scissors li:before{content:"\f0c4"}#inbound-list.fa-list-copy li:before,#inbound-list.fa-list-files-o li:before{content:"\f0c5"}#inbound-list.fa-list-paperclip li:before{content:"\f0c6"}#inbound-list.fa-list-save li:before,#inbound-list.fa-list-floppy-o li:before{content:"\f0c7"}#inbound-list.fa-list-square li:before{content:"\f0c8"}#inbound-list.fa-list-bars li:before{content:"\f0c9"}#inbound-list.fa-list-list-ul li:before{content:"\f0ca"}#inbound-list.fa-list-list-ol li:before{content:"\f0cb"}#inbound-list.fa-list-strikethrough li:before{content:"\f0cc"}#inbound-list.fa-list-underline li:before{content:"\f0cd"}#inbound-list.fa-list-table li:before{content:"\f0ce"}#inbound-list.fa-list-magic li:before{content:"\f0d0"}#inbound-list.fa-list-truck li:before{content:"\f0d1"}#inbound-list.fa-list-pinterest li:before{content:"\f0d2"}#inbound-list.fa-list-pinterest-square li:before{content:"\f0d3"}#inbound-list.fa-list-google-plus-square li:before{content:"\f0d4"}#inbound-list.fa-list-google-plus li:before{content:"\f0d5"}#inbound-list.fa-list-money li:before{content:"\f0d6"}#inbound-list.fa-list-caret-down li:before{content:"\f0d7"}#inbound-list.fa-list-caret-up li:before{content:"\f0d8"}#inbound-list.fa-list-caret-left li:before{content:"\f0d9"}#inbound-list.fa-list-caret-right li:before{content:"\f0da"}#inbound-list.fa-list-columns li:before{content:"\f0db"}#inbound-list.fa-list-unsorted li:before,#inbound-list.fa-list-sort li:before{content:"\f0dc"}#inbound-list.fa-list-sort-down li:before,#inbound-list.fa-list-sort-asc li:before{content:"\f0dd"}#inbound-list.fa-list-sort-up li:before,#inbound-list.fa-list-sort-desc li:before{content:"\f0de"}#inbound-list.fa-list-envelope li:before{content:"\f0e0"}#inbound-list.fa-list-linkedin li:before{content:"\f0e1"}#inbound-list.fa-list-rotate-left li:before,#inbound-list.fa-list-undo li:before{content:"\f0e2"}#inbound-list.fa-list-legal li:before,#inbound-list.fa-list-gavel li:before{content:"\f0e3"}#inbound-list.fa-list-dashboard li:before,#inbound-list.fa-list-tachometer li:before{content:"\f0e4"}#inbound-list.fa-list-comment-o li:before{content:"\f0e5"}#inbound-list.fa-list-comments-o li:before{content:"\f0e6"}#inbound-list.fa-list-flash li:before,#inbound-list.fa-list-bolt li:before{content:"\f0e7"}#inbound-list.fa-list-sitemap li:before{content:"\f0e8"}#inbound-list.fa-list-umbrella li:before{content:"\f0e9"}#inbound-list.fa-list-paste li:before,#inbound-list.fa-list-clipboard li:before{content:"\f0ea"}#inbound-list.fa-list-lightbulb-o li:before{content:"\f0eb"}#inbound-list.fa-list-exchange li:before{content:"\f0ec"}#inbound-list.fa-list-cloud-download li:before{content:"\f0ed"}#inbound-list.fa-list-cloud-upload li:before{content:"\f0ee"}#inbound-list.fa-list-user-md li:before{content:"\f0f0"}#inbound-list.fa-list-stethoscope li:before{content:"\f0f1"}#inbound-list.fa-list-suitcase li:before{content:"\f0f2"}#inbound-list.fa-list-bell-o li:before{content:"\f0a2"}#inbound-list.fa-list-coffee li:before{content:"\f0f4"}#inbound-list.fa-list-cutlery li:before{content:"\f0f5"}#inbound-list.fa-list-file-text-o li:before{content:"\f0f6"}#inbound-list.fa-list-building-o li:before{content:"\f0f7"}#inbound-list.fa-list-hospital-o li:before{content:"\f0f8"}#inbound-list.fa-list-ambulance li:before{content:"\f0f9"}#inbound-list.fa-list-medkit li:before{content:"\f0fa"}#inbound-list.fa-list-fighter-jet li:before{content:"\f0fb"}#inbound-list.fa-list-beer li:before{content:"\f0fc"}#inbound-list.fa-list-h-square li:before{content:"\f0fd"}#inbound-list.fa-list-plus-square li:before{content:"\f0fe"}#inbound-list.fa-list-angle-double-left li:before{content:"\f100"}#inbound-list.fa-list-angle-double-right li:before{content:"\f101"}#inbound-list.fa-list-angle-double-up li:before{content:"\f102"}#inbound-list.fa-list-angle-double-down li:before{content:"\f103"}#inbound-list.fa-list-angle-left li:before{content:"\f104"}#inbound-list.fa-list-angle-right li:before{content:"\f105"}#inbound-list.fa-list-angle-up li:before{content:"\f106"}#inbound-list.fa-list-angle-down li:before{content:"\f107"}#inbound-list.fa-list-desktop li:before{content:"\f108"}#inbound-list.fa-list-laptop li:before{content:"\f109"}#inbound-list.fa-list-tablet li:before{content:"\f10a"}#inbound-list.fa-list-mobile-phone li:before,#inbound-list.fa-list-mobile li:before{content:"\f10b"}#inbound-list.fa-list-circle-o li:before{content:"\f10c"}#inbound-list.fa-list-quote-left li:before{content:"\f10d"}#inbound-list.fa-list-quote-right li:before{content:"\f10e"}#inbound-list.fa-list-spinner li:before{content:"\f110"}#inbound-list.fa-list-circle li:before{content:"\f111"}#inbound-list.fa-list-mail-reply li:before,#inbound-list.fa-list-reply li:before{content:"\f112"}#inbound-list.fa-list-github-alt li:before{content:"\f113"}#inbound-list.fa-list-folder-o li:before{content:"\f114"}#inbound-list.fa-list-folder-open-o li:before{content:"\f115"}#inbound-list.fa-list-smile-o li:before{content:"\f118"}#inbound-list.fa-list-frown-o li:before{content:"\f119"}#inbound-list.fa-list-meh-o li:before{content:"\f11a"}#inbound-list.fa-list-gamepad li:before{content:"\f11b"}#inbound-list.fa-list-keyboard-o li:before{content:"\f11c"}#inbound-list.fa-list-flag-o li:before{content:"\f11d"}#inbound-list.fa-list-flag-checkered li:before{content:"\f11e"}#inbound-list.fa-list-terminal li:before{content:"\f120"}#inbound-list.fa-list-code li:before{content:"\f121"}#inbound-list.fa-list-reply-all li:before{content:"\f122"}#inbound-list.fa-list-mail-reply-all li:before{content:"\f122"}#inbound-list.fa-list-star-half-empty li:before,#inbound-list.fa-list-star-half-full li:before,#inbound-list.fa-list-star-half-o li:before{content:"\f123"}#inbound-list.fa-list-location-arrow li:before{content:"\f124"}#inbound-list.fa-list-crop li:before{content:"\f125"}#inbound-list.fa-list-code-fork li:before{content:"\f126"}#inbound-list.fa-list-unlink li:before,#inbound-list.fa-list-chain-broken li:before{content:"\f127"}#inbound-list.fa-list-question li:before{content:"\f128"}#inbound-list.fa-list-info li:before{content:"\f129"}#inbound-list.fa-list-exclamation li:before{content:"\f12a"}#inbound-list.fa-list-superscript li:before{content:"\f12b"}#inbound-list.fa-list-subscript li:before{content:"\f12c"}#inbound-list.fa-list-eraser li:before{content:"\f12d"}#inbound-list.fa-list-puzzle-piece li:before{content:"\f12e"}#inbound-list.fa-list-microphone li:before{content:"\f130"}#inbound-list.fa-list-microphone-slash li:before{content:"\f131"}#inbound-list.fa-list-shield li:before{content:"\f132"}#inbound-list.fa-list-calendar-o li:before{content:"\f133"}#inbound-list.fa-list-fire-extinguisher li:before{content:"\f134"}#inbound-list.fa-list-rocket li:before{content:"\f135"}#inbound-list.fa-list-maxcdn li:before{content:"\f136"}#inbound-list.fa-list-chevron-circle-left li:before{content:"\f137"}#inbound-list.fa-list-chevron-circle-right li:before{content:"\f138"}#inbound-list.fa-list-chevron-circle-up li:before{content:"\f139"}#inbound-list.fa-list-chevron-circle-down li:before{content:"\f13a"}#inbound-list.fa-list-html5 li:before{content:"\f13b"}#inbound-list.fa-list-css3 li:before{content:"\f13c"}#inbound-list.fa-list-anchor li:before{content:"\f13d"}#inbound-list.fa-list-unlock-alt li:before{content:"\f13e"}#inbound-list.fa-list-bullseye li:before{content:"\f140"}#inbound-list.fa-list-ellipsis-h li:before{content:"\f141"}#inbound-list.fa-list-ellipsis-v li:before{content:"\f142"}#inbound-list.fa-list-rss-square li:before{content:"\f143"}#inbound-list.fa-list-play-circle li:before{content:"\f144"}#inbound-list.fa-list-ticket li:before{content:"\f145"}#inbound-list.fa-list-minus-square li:before{content:"\f146"}#inbound-list.fa-list-minus-square-o li:before{content:"\f147"}#inbound-list.fa-list-level-up li:before{content:"\f148"}#inbound-list.fa-list-level-down li:before{content:"\f149"}#inbound-list.fa-list-check-square li:before{content:"\f14a"}#inbound-list.fa-list-pencil-square li:before{content:"\f14b"}#inbound-list.fa-list-external-link-square li:before{content:"\f14c"}#inbound-list.fa-list-share-square li:before{content:"\f14d"}#inbound-list.fa-list-compass li:before{content:"\f14e"}#inbound-list.fa-list-toggle-down li:before,#inbound-list.fa-list-caret-square-o-down li:before{content:"\f150"}#inbound-list.fa-list-toggle-up li:before,#inbound-list.fa-list-caret-square-o-up li:before{content:"\f151"}#inbound-list.fa-list-toggle-right li:before,#inbound-list.fa-list-caret-square-o-right li:before{content:"\f152"}#inbound-list.fa-list-euro li:before,#inbound-list.fa-list-eur li:before{content:"\f153"}#inbound-list.fa-list-gbp li:before{content:"\f154"}#inbound-list.fa-list-dollar li:before,#inbound-list.fa-list-usd li:before{content:"\f155"}#inbound-list.fa-list-rupee li:before,#inbound-list.fa-list-inr li:before{content:"\f156"}#inbound-list.fa-list-cny li:before,#inbound-list.fa-list-rmb li:before,#inbound-list.fa-list-yen li:before,#inbound-list.fa-list-jpy li:before{content:"\f157"}#inbound-list.fa-list-ruble li:before,#inbound-list.fa-list-rouble li:before,#inbound-list.fa-list-rub li:before{content:"\f158"}#inbound-list.fa-list-won li:before,#inbound-list.fa-list-krw li:before{content:"\f159"}#inbound-list.fa-list-bitcoin li:before,#inbound-list.fa-list-btc li:before{content:"\f15a"}#inbound-list.fa-list-file li:before{content:"\f15b"}#inbound-list.fa-list-file-text li:before{content:"\f15c"}#inbound-list.fa-list-sort-alpha-asc li:before{content:"\f15d"}#inbound-list.fa-list-sort-alpha-desc li:before{content:"\f15e"}#inbound-list.fa-list-sort-amount-asc li:before{content:"\f160"}#inbound-list.fa-list-sort-amount-desc li:before{content:"\f161"}#inbound-list.fa-list-sort-numeric-asc li:before{content:"\f162"}#inbound-list.fa-list-sort-numeric-desc li:before{content:"\f163"}#inbound-list.fa-list-thumbs-up li:before{content:"\f164"}#inbound-list.fa-list-thumbs-down li:before{content:"\f165"}#inbound-list.fa-list-youtube-square li:before{content:"\f166"}#inbound-list.fa-list-youtube li:before{content:"\f167"}#inbound-list.fa-list-xing li:before{content:"\f168"}#inbound-list.fa-list-xing-square li:before{content:"\f169"}#inbound-list.fa-list-youtube-play li:before{content:"\f16a"}#inbound-list.fa-list-dropbox li:before{content:"\f16b"}#inbound-list.fa-list-stack-overflow li:before{content:"\f16c"}#inbound-list.fa-list-instagram li:before{content:"\f16d"}#inbound-list.fa-list-flickr li:before{content:"\f16e"}#inbound-list.fa-list-adn li:before{content:"\f170"}#inbound-list.fa-list-bitbucket li:before{content:"\f171"}#inbound-list.fa-list-bitbucket-square li:before{content:"\f172"}#inbound-list.fa-list-tumblr li:before{content:"\f173"}#inbound-list.fa-list-tumblr-square li:before{content:"\f174"}#inbound-list.fa-list-long-arrow-down li:before{content:"\f175"}#inbound-list.fa-list-long-arrow-up li:before{content:"\f176"}#inbound-list.fa-list-long-arrow-left li:before{content:"\f177"}#inbound-list.fa-list-long-arrow-right li:before{content:"\f178"}#inbound-list.fa-list-apple li:before{content:"\f179"}#inbound-list.fa-list-windows li:before{content:"\f17a"}#inbound-list.fa-list-android li:before{content:"\f17b"}#inbound-list.fa-list-linux li:before{content:"\f17c"}#inbound-list.fa-list-dribbble li:before{content:"\f17d"}#inbound-list.fa-list-skype li:before{content:"\f17e"}#inbound-list.fa-list-foursquare li:before{content:"\f180"}#inbound-list.fa-list-trello li:before{content:"\f181"}#inbound-list.fa-list-female li:before{content:"\f182"}#inbound-list.fa-list-male li:before{content:"\f183"}#inbound-list.fa-list-gittip li:before{content:"\f184"}#inbound-list.fa-list-sun-o li:before{content:"\f185"}#inbound-list.fa-list-moon-o li:before{content:"\f186"}#inbound-list.fa-list-archive li:before{content:"\f187"}#inbound-list.fa-list-bug li:before{content:"\f188"}#inbound-list.fa-list-vk li:before{content:"\f189"}#inbound-list.fa-list-weibo li:before{content:"\f18a"}#inbound-list.fa-list-renren li:before{content:"\f18b"}#inbound-list.fa-list-pagelines li:before{content:"\f18c"}#inbound-list.fa-list-stack-exchange li:before{content:"\f18d"}#inbound-list.fa-list-arrow-circle-o-right li:before{content:"\f18e"}#inbound-list.fa-list-arrow-circle-o-left li:before{content:"\f190"}#inbound-list.fa-list-toggle-left li:before,#inbound-list.fa-list-caret-square-o-left li:before{content:"\f191"}#inbound-list.fa-list-dot-circle-o li:before{content:"\f192"}#inbound-list.fa-list-wheelchair li:before{content:"\f193"}#inbound-list.fa-list-vimeo-square li:before{content:"\f194"}#inbound-list.fa-list-turkish-lira li:before,#inbound-list.fa-list-try li:before{content:"\f195"}#inbound-list.fa-list-plus-square-o li:before{content:"\f196"}
|
| 933 |
+
|
| 934 |
+
/* Button Pack - Flat */
|
| 935 |
+
|
| 936 |
+
.inbound-flat-btn{
|
| 937 |
+
display:block;
|
| 938 |
+
float:left;
|
| 939 |
+
padding:.6em .6em;
|
| 940 |
+
font-size:1.1em;
|
| 941 |
+
margin:1em .5em;
|
| 942 |
+
color:#fff;
|
| 943 |
+
width:16em;
|
| 944 |
+
text-decoration:none;
|
| 945 |
+
cursor:pointer;
|
| 946 |
+
font-family:helvetica;
|
| 947 |
+
line-height:2;
|
| 948 |
+
position:relative;
|
| 949 |
+
z-index:2;
|
| 950 |
+
overflow:hidden;
|
| 951 |
+
text-shadow:0 -1px 0 rgba(0,0,0,.35);
|
| 952 |
+
}
|
| 953 |
+
.inbound-flat-btn span.icon{
|
| 954 |
+
display:block;
|
| 955 |
+
float:left;
|
| 956 |
+
margin:-.38em;
|
| 957 |
+
font-size:1.6em;
|
| 958 |
+
width:20%;
|
| 959 |
+
height:56px;
|
| 960 |
+
text-align:center;
|
| 961 |
+
line-height:2.2;
|
| 962 |
+
margin-right:1em;
|
| 963 |
+
}
|
| 964 |
+
|
| 965 |
+
.inbound-fla
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
