Version Description
- Mar 7 2018 =
- [NEW FEATURE] Image Optimization Added level up guidance.
- [REFACTOR] Image Optimization Refactored Image Optimization class.
- [IAPI] Image Optimization New European Image Optimization server (EU2).
- [IMPROVEMENT] Image Optimization Manual pull action continues pulling until complete.
- [IMPROVEMENT] CDN Multiple CDNs can now be randomized for a single resource.
- [IMPROVEMENT] Image Optimization Improved compatibility of long src images.
- [IMPROVEMENT] Image Optimization Reduced runtime load.
- [IMPROVEMENT] Image Optimization Avoid potential loss/reset of notified images status when pulling.
- [IMPROVEMENT] Image Optimization Avoid duplicated optimization for multiple records in Media that have the same image source.
- [IMPROVEMENT] Image Optimization Fixed issue where phantom images continued to show in not-yet-requested queue.
- [BUGFIX] Core Improved compatibility when upgrading outside of WP Admin. (@jikatal @TylorB)
- [BUGFIX] Crawler Improved HTTP/2 compatibility to avoid erroneous blacklisting.
- [BUGFIX] Crawler Changing Delay setting will use server variable for min value validation if set.
- [UPDATE] Crawler Added HTTP/2 protocol switch in the Crawler settings.
- [UPDATE] Removed unnecessary translation strings.
- [GUI] Display translated role group name string instead of English values. (@Richard Hordern)
- [GUI] Added Join LiteSpeed Slack link.
- [GUI] Import / Export Cosmetic changes to Import Settings file field.
- [INTEGRATION] Improved compatibility with WPML Media for Image Optimization. (@szmigieldesign)
Download this release
Release Info
| Developer | LiteSpeedTech |
| Plugin |  LiteSpeed Cache |
| Version | 2.0 |
| Comparing to | |
| See all releases | |
Code changes from version 1.9.1.1 to 2.0
- admin/admin-api.class.php +18 -18
- admin/litespeed-cache-admin-display.class.php +76 -0
- admin/litespeed-cache-admin-error.class.php +0 -7
- admin/litespeed-cache-admin-settings.class.php +30 -11
- admin/litespeed-cache-admin.class.php +18 -20
- admin/tpl/image_optimization.php +79 -20
- admin/tpl/inc/admin_footer.php +14 -12
- admin/tpl/manage/manage_purge.php +1 -1
- admin/tpl/setting/settings_advanced.php +2 -2
- admin/tpl/setting/settings_cdn.php +43 -21
- admin/tpl/setting/settings_crawler.php +24 -8
- admin/tpl/setting/settings_esi.php +2 -2
- admin/tpl/setting/settings_excludes.php +4 -4
- admin/tpl/setting/settings_inc.cache_browser.php +1 -1
- admin/tpl/setting/settings_inc.cache_favicon.php +1 -1
- admin/tpl/setting/settings_inc.cache_mobile.php +2 -2
- admin/tpl/setting/settings_inc.cache_object.php +18 -18
- admin/tpl/setting/settings_inc.cache_resources.php +1 -1
- admin/tpl/setting/settings_inc.exclude_cookies.php +1 -1
- admin/tpl/setting/settings_inc.exclude_useragent.php +1 -1
- admin/tpl/setting/settings_inc.media_webp.php +1 -1
- admin/tpl/setting/settings_media.php +1 -1
- admin/tpl/setting/settings_optimize.php +2 -2
- admin/tpl/setting/settings_purge.php +1 -1
- admin/tpl/setting/settings_tuning.php +9 -9
- admin/tpl/settings.php +5 -2
- cli/litespeed-cache-cli-admin.class.php +2 -0
- css/iziModal.min.css +6 -0
- css/litespeed.css +142 -30
- inc/activation.class.php +10 -0
- inc/cdn.class.php +37 -2
- inc/config.class.php +16 -5
- inc/crawler.class.php +2 -0
- inc/data.class.php +149 -17
- inc/data_structure/img_optm.sql +20 -0
- inc/data_structure/optm.sql +8 -0
- inc/gui.class.php +6 -4
- inc/img_optm.class.php +1640 -0
- inc/import.class.php +1 -1
- inc/litespeed-cache.class.php +11 -1
- inc/litespeed.autoload.php +2 -0
- inc/media.class.php +4 -1247
- inc/router.class.php +17 -15
- inc/task.class.php +2 -2
- inc/vary.class.php +13 -13
- includes/litespeed-cache-activation.class.php +10 -0
- includes/litespeed-cache-cdn.class.php +37 -2
- includes/litespeed-cache-config.class.php +16 -5
- includes/litespeed-cache-crawler.class.php +2 -0
- includes/litespeed-cache-gui.class.php +6 -4
- includes/litespeed-cache-router.class.php +17 -15
- includes/litespeed-cache-task.class.php +2 -2
- includes/litespeed-cache-vary.class.php +13 -13
- includes/litespeed-cache.class.php +11 -1
- includes/litespeed.autoload.php +2 -0
- js/iziModal.min.js +6 -0
- languages/litespeed-cache.pot +337 -309
- lib/litespeed/litespeed-crawler.class.php +44 -7
- litespeed-cache.php +1 -1
- readme.txt +30 -6
- thirdparty/lscwp-3rd-woocommerce.cls.php +1 -1
admin/admin-api.class.php
CHANGED
|
@@ -79,16 +79,16 @@ class LiteSpeed_Cache_Admin_API
|
|
| 79 |
|
| 80 |
switch ( LiteSpeed_Cache_Router::verify_type() ) {
|
| 81 |
case self::TYPE_NOTIFY_IMG :
|
| 82 |
-
|
| 83 |
break ;
|
| 84 |
|
| 85 |
case self::TYPE_CHECK_IMG :
|
| 86 |
$instance->validate_lsserver() ;
|
| 87 |
-
|
| 88 |
break ;
|
| 89 |
|
| 90 |
case self::TYPE_IMG_DESTROY_CALLBACK :
|
| 91 |
-
|
| 92 |
break ;
|
| 93 |
|
| 94 |
default:
|
|
@@ -143,7 +143,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 143 |
private function _request_callback()
|
| 144 |
{
|
| 145 |
$key_hash = get_option( self::DB_API_KEY_HASH ) ;
|
| 146 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback request hash: ' . $key_hash ) ;
|
| 147 |
exit( $key_hash ) ;
|
| 148 |
}
|
| 149 |
|
|
@@ -157,7 +157,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 157 |
public static function sapi_valiate_passive_callback()
|
| 158 |
{
|
| 159 |
if ( empty( $_REQUEST[ 'hash' ] ) ) {
|
| 160 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback bypassed passive check' ) ;
|
| 161 |
return false ;
|
| 162 |
}
|
| 163 |
$instance = self::get_instance() ;
|
|
@@ -166,7 +166,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 166 |
$key_hash = get_option( self::DB_API_KEY_HASH ) ;
|
| 167 |
$hash_check = md5( $key_hash ) === $_REQUEST[ 'hash' ] ;
|
| 168 |
|
| 169 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback hash check ' . $key_hash . ': ' . ( $hash_check ? 'passed' : 'failed' ) ) ;
|
| 170 |
|
| 171 |
return $hash_check ;
|
| 172 |
}
|
|
@@ -184,18 +184,18 @@ class LiteSpeed_Cache_Admin_API
|
|
| 184 |
|
| 185 |
// don't have auth_key yet
|
| 186 |
if ( ! $instance->_iapi_key ) {
|
| 187 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback aggressive check failed: No init key' ) ;
|
| 188 |
return false ;
|
| 189 |
}
|
| 190 |
|
| 191 |
// Once client has auth_key, each time when callback to check, need to carry on this key
|
| 192 |
if ( empty( $_REQUEST[ 'auth_key' ] ) ) {
|
| 193 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback aggressive check failed: lack of auth_key' ) ;
|
| 194 |
return false ;
|
| 195 |
}
|
| 196 |
|
| 197 |
$res = md5( $instance->_iapi_key ) === $_REQUEST[ 'auth_key' ] ;
|
| 198 |
-
LiteSpeed_Cache_Log::debug( 'IAPI __callback aggressive auth_key check: ' . ( $res ? 'passed' : 'failed' ) ) ;
|
| 199 |
return $res ;
|
| 200 |
}
|
| 201 |
|
|
@@ -234,7 +234,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 234 |
|
| 235 |
// Check if get key&server correctly
|
| 236 |
if ( empty( $json[ 'auth_key' ] ) ) {
|
| 237 |
-
LiteSpeed_Cache_Log::debug( 'IAPI request key failed: ', $json ) ;
|
| 238 |
$msg = sprintf( __( 'IAPI Error %s', 'litespeed-cache' ), $json ) ;
|
| 239 |
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 240 |
return ;
|
|
@@ -242,7 +242,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 242 |
|
| 243 |
// store data into option locally
|
| 244 |
update_option( self::DB_API_KEY, $json[ 'auth_key' ] ) ;
|
| 245 |
-
LiteSpeed_Cache_Log::debug( 'IAPI applied auth_key' ) ;
|
| 246 |
|
| 247 |
$this->_iapi_key = $json[ 'auth_key' ] ;
|
| 248 |
}
|
|
@@ -256,7 +256,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 256 |
private function _reset_key()
|
| 257 |
{
|
| 258 |
delete_option( self::DB_API_KEY ) ;
|
| 259 |
-
LiteSpeed_Cache_Log::debug( 'IAPI delete auth_key' ) ;
|
| 260 |
|
| 261 |
$msg = __( 'Reset IAPI key successfully.', 'litespeed-cache' ) ;
|
| 262 |
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
|
@@ -281,7 +281,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 281 |
|
| 282 |
$url = $server . '/' . $action ;
|
| 283 |
|
| 284 |
-
LiteSpeed_Cache_Log::debug( 'IAPI posting to : ' . $url ) ;
|
| 285 |
|
| 286 |
$param = array(
|
| 287 |
'auth_key' => $this->_iapi_key,
|
|
@@ -297,7 +297,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 297 |
|
| 298 |
if ( is_wp_error( $response ) ) {
|
| 299 |
$error_message = $response->get_error_message() ;
|
| 300 |
-
LiteSpeed_Cache_Log::debug( 'IAPI failed to post: ' . $error_message ) ;
|
| 301 |
return $error_message ;
|
| 302 |
}
|
| 303 |
|
|
@@ -305,12 +305,12 @@ class LiteSpeed_Cache_Admin_API
|
|
| 305 |
$json = json_decode( $response[ 'body' ], true ) ;
|
| 306 |
|
| 307 |
if ( ! is_array( $json ) ) {
|
| 308 |
-
LiteSpeed_Cache_Log::debug( 'IAPI failed to decode post json: ' . $response[ 'body' ] ) ;
|
| 309 |
return $response[ 'body' ] ;
|
| 310 |
}
|
| 311 |
|
| 312 |
if ( ! empty( $json[ '_err' ] ) ) {
|
| 313 |
-
LiteSpeed_Cache_Log::debug( 'IAPI _err: ' . $json[ '_err' ] ) ;
|
| 314 |
$msg = __( 'Failed to communicate with LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_err' ] ;
|
| 315 |
$msg .= $this->_parse_link( $json ) ;
|
| 316 |
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
|
@@ -318,7 +318,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 318 |
}
|
| 319 |
|
| 320 |
if ( ! empty( $json[ '_info' ] ) ) {
|
| 321 |
-
LiteSpeed_Cache_Log::debug( 'IAPI _info: ' . $json[ '_info' ] ) ;
|
| 322 |
$msg = __( 'Message from LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_info' ] ;
|
| 323 |
$msg .= $this->_parse_link( $json ) ;
|
| 324 |
LiteSpeed_Cache_Admin_Display::info( $msg ) ;
|
|
@@ -326,7 +326,7 @@ class LiteSpeed_Cache_Admin_API
|
|
| 326 |
}
|
| 327 |
|
| 328 |
if ( ! empty( $json[ '_note' ] ) ) {
|
| 329 |
-
LiteSpeed_Cache_Log::debug( 'IAPI _note: ' . $json[ '_note' ] ) ;
|
| 330 |
$msg = __( 'Message from LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_note' ] ;
|
| 331 |
$msg .= $this->_parse_link( $json ) ;
|
| 332 |
LiteSpeed_Cache_Admin_Display::note( $msg ) ;
|
| 79 |
|
| 80 |
switch ( LiteSpeed_Cache_Router::verify_type() ) {
|
| 81 |
case self::TYPE_NOTIFY_IMG :
|
| 82 |
+
LiteSpeed_Cache_Img_Optm::get_instance()->notify_img() ;
|
| 83 |
break ;
|
| 84 |
|
| 85 |
case self::TYPE_CHECK_IMG :
|
| 86 |
$instance->validate_lsserver() ;
|
| 87 |
+
LiteSpeed_Cache_Img_Optm::get_instance()->check_img() ;
|
| 88 |
break ;
|
| 89 |
|
| 90 |
case self::TYPE_IMG_DESTROY_CALLBACK :
|
| 91 |
+
LiteSpeed_Cache_Img_Optm::get_instance()->img_optimize_destroy_callback() ;
|
| 92 |
break ;
|
| 93 |
|
| 94 |
default:
|
| 143 |
private function _request_callback()
|
| 144 |
{
|
| 145 |
$key_hash = get_option( self::DB_API_KEY_HASH ) ;
|
| 146 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback request hash: ' . $key_hash ) ;
|
| 147 |
exit( $key_hash ) ;
|
| 148 |
}
|
| 149 |
|
| 157 |
public static function sapi_valiate_passive_callback()
|
| 158 |
{
|
| 159 |
if ( empty( $_REQUEST[ 'hash' ] ) ) {
|
| 160 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback bypassed passive check' ) ;
|
| 161 |
return false ;
|
| 162 |
}
|
| 163 |
$instance = self::get_instance() ;
|
| 166 |
$key_hash = get_option( self::DB_API_KEY_HASH ) ;
|
| 167 |
$hash_check = md5( $key_hash ) === $_REQUEST[ 'hash' ] ;
|
| 168 |
|
| 169 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback hash check ' . $key_hash . ': ' . ( $hash_check ? 'passed' : 'failed' ) ) ;
|
| 170 |
|
| 171 |
return $hash_check ;
|
| 172 |
}
|
| 184 |
|
| 185 |
// don't have auth_key yet
|
| 186 |
if ( ! $instance->_iapi_key ) {
|
| 187 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback aggressive check failed: No init key' ) ;
|
| 188 |
return false ;
|
| 189 |
}
|
| 190 |
|
| 191 |
// Once client has auth_key, each time when callback to check, need to carry on this key
|
| 192 |
if ( empty( $_REQUEST[ 'auth_key' ] ) ) {
|
| 193 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback aggressive check failed: lack of auth_key' ) ;
|
| 194 |
return false ;
|
| 195 |
}
|
| 196 |
|
| 197 |
$res = md5( $instance->_iapi_key ) === $_REQUEST[ 'auth_key' ] ;
|
| 198 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] __callback aggressive auth_key check: ' . ( $res ? 'passed' : 'failed' ) ) ;
|
| 199 |
return $res ;
|
| 200 |
}
|
| 201 |
|
| 234 |
|
| 235 |
// Check if get key&server correctly
|
| 236 |
if ( empty( $json[ 'auth_key' ] ) ) {
|
| 237 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] request key failed: ', $json ) ;
|
| 238 |
$msg = sprintf( __( 'IAPI Error %s', 'litespeed-cache' ), $json ) ;
|
| 239 |
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 240 |
return ;
|
| 242 |
|
| 243 |
// store data into option locally
|
| 244 |
update_option( self::DB_API_KEY, $json[ 'auth_key' ] ) ;
|
| 245 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] applied auth_key' ) ;
|
| 246 |
|
| 247 |
$this->_iapi_key = $json[ 'auth_key' ] ;
|
| 248 |
}
|
| 256 |
private function _reset_key()
|
| 257 |
{
|
| 258 |
delete_option( self::DB_API_KEY ) ;
|
| 259 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] delete auth_key' ) ;
|
| 260 |
|
| 261 |
$msg = __( 'Reset IAPI key successfully.', 'litespeed-cache' ) ;
|
| 262 |
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 281 |
|
| 282 |
$url = $server . '/' . $action ;
|
| 283 |
|
| 284 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] posting to : ' . $url ) ;
|
| 285 |
|
| 286 |
$param = array(
|
| 287 |
'auth_key' => $this->_iapi_key,
|
| 297 |
|
| 298 |
if ( is_wp_error( $response ) ) {
|
| 299 |
$error_message = $response->get_error_message() ;
|
| 300 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] failed to post: ' . $error_message ) ;
|
| 301 |
return $error_message ;
|
| 302 |
}
|
| 303 |
|
| 305 |
$json = json_decode( $response[ 'body' ], true ) ;
|
| 306 |
|
| 307 |
if ( ! is_array( $json ) ) {
|
| 308 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] failed to decode post json: ' . $response[ 'body' ] ) ;
|
| 309 |
return $response[ 'body' ] ;
|
| 310 |
}
|
| 311 |
|
| 312 |
if ( ! empty( $json[ '_err' ] ) ) {
|
| 313 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] _err: ' . $json[ '_err' ] ) ;
|
| 314 |
$msg = __( 'Failed to communicate with LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_err' ] ;
|
| 315 |
$msg .= $this->_parse_link( $json ) ;
|
| 316 |
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 318 |
}
|
| 319 |
|
| 320 |
if ( ! empty( $json[ '_info' ] ) ) {
|
| 321 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] _info: ' . $json[ '_info' ] ) ;
|
| 322 |
$msg = __( 'Message from LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_info' ] ;
|
| 323 |
$msg .= $this->_parse_link( $json ) ;
|
| 324 |
LiteSpeed_Cache_Admin_Display::info( $msg ) ;
|
| 326 |
}
|
| 327 |
|
| 328 |
if ( ! empty( $json[ '_note' ] ) ) {
|
| 329 |
+
LiteSpeed_Cache_Log::debug( '[IAPI] _note: ' . $json[ '_note' ] ) ;
|
| 330 |
$msg = __( 'Message from LiteSpeed image server', 'litespeed-cache' ) . ': ' . $json[ '_note' ] ;
|
| 331 |
$msg .= $this->_parse_link( $json ) ;
|
| 332 |
LiteSpeed_Cache_Admin_Display::note( $msg ) ;
|
admin/litespeed-cache-admin-display.class.php
CHANGED
|
@@ -71,6 +71,15 @@ class LiteSpeed_Cache_Admin_Display
|
|
| 71 |
add_action('admin_enqueue_scripts', array($this, 'check_messages')) ;// We can do this bcos admin_notices hook is after admin_enqueue_scripts hook in wp-admin/admin-header.php
|
| 72 |
}
|
| 73 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 74 |
// add menus ( Also check for mu-plugins)
|
| 75 |
if ( $is_network_admin && ( is_plugin_active_for_network( LSCWP_BASENAME ) || defined( 'LSCWP_MU_PLUGIN' ) ) ) {
|
| 76 |
add_action('network_admin_menu', array($this, 'register_admin_menu')) ;
|
|
@@ -931,6 +940,73 @@ class LiteSpeed_Cache_Admin_Display
|
|
| 931 |
. '</a>' ;
|
| 932 |
}
|
| 933 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 934 |
/**
|
| 935 |
* Get the current instance object.
|
| 936 |
*
|
| 71 |
add_action('admin_enqueue_scripts', array($this, 'check_messages')) ;// We can do this bcos admin_notices hook is after admin_enqueue_scripts hook in wp-admin/admin-header.php
|
| 72 |
}
|
| 73 |
|
| 74 |
+
/**
|
| 75 |
+
* In case this is called outside the admin page
|
| 76 |
+
* @see https://codex.wordpress.org/Function_Reference/is_plugin_active_for_network
|
| 77 |
+
* @since 2.0
|
| 78 |
+
*/
|
| 79 |
+
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 80 |
+
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;
|
| 81 |
+
}
|
| 82 |
+
|
| 83 |
// add menus ( Also check for mu-plugins)
|
| 84 |
if ( $is_network_admin && ( is_plugin_active_for_network( LSCWP_BASENAME ) || defined( 'LSCWP_MU_PLUGIN' ) ) ) {
|
| 85 |
add_action('network_admin_menu', array($this, 'register_admin_menu')) ;
|
| 940 |
. '</a>' ;
|
| 941 |
}
|
| 942 |
|
| 943 |
+
/**
|
| 944 |
+
* Return groups string
|
| 945 |
+
*
|
| 946 |
+
* @since 2.0
|
| 947 |
+
* @access public
|
| 948 |
+
*/
|
| 949 |
+
public static function print_plural( $num, $kind = 'group' )
|
| 950 |
+
{
|
| 951 |
+
if ( $num > 1 ) {
|
| 952 |
+
switch ( $kind ) {
|
| 953 |
+
case 'group' :
|
| 954 |
+
return sprintf( __( '%s groups', 'litespeed-cache' ), $num ) ;
|
| 955 |
+
|
| 956 |
+
case 'image' :
|
| 957 |
+
return sprintf( __( '%s images', 'litespeed-cache' ), $num ) ;
|
| 958 |
+
|
| 959 |
+
default:
|
| 960 |
+
return $num ;
|
| 961 |
+
}
|
| 962 |
+
|
| 963 |
+
}
|
| 964 |
+
|
| 965 |
+
switch ( $kind ) {
|
| 966 |
+
case 'group' :
|
| 967 |
+
return sprintf( __( '%s group', 'litespeed-cache' ), $num ) ;
|
| 968 |
+
|
| 969 |
+
case 'image' :
|
| 970 |
+
return sprintf( __( '%s image', 'litespeed-cache' ), $num ) ;
|
| 971 |
+
|
| 972 |
+
default:
|
| 973 |
+
return $num ;
|
| 974 |
+
}
|
| 975 |
+
}
|
| 976 |
+
|
| 977 |
+
/**
|
| 978 |
+
* Return guidance html
|
| 979 |
+
*
|
| 980 |
+
* @since 2.0
|
| 981 |
+
* @access public
|
| 982 |
+
*/
|
| 983 |
+
public static function guidance( $title, $steps, $current_step )
|
| 984 |
+
{
|
| 985 |
+
if ( $current_step === 'done' ) {
|
| 986 |
+
$current_step = count( $steps ) + 1 ;
|
| 987 |
+
}
|
| 988 |
+
|
| 989 |
+
$percentage = ' (' . floor( ( $current_step - 1 ) * 100 / count( $steps ) ) . '%)' ;
|
| 990 |
+
|
| 991 |
+
$html = '<div class="litespeed-guide">'
|
| 992 |
+
. '<h2>' . $title . $percentage . '</h2>'
|
| 993 |
+
. '<ol>' ;
|
| 994 |
+
foreach ( $steps as $k => $v ) {
|
| 995 |
+
$step = $k + 1 ;
|
| 996 |
+
if ( $current_step > $step ) {
|
| 997 |
+
$html .= '<li class="litespeed-guide-done">' ;
|
| 998 |
+
}
|
| 999 |
+
else {
|
| 1000 |
+
$html .= '<li>' ;
|
| 1001 |
+
}
|
| 1002 |
+
$html .= $v . '</li>' ;
|
| 1003 |
+
}
|
| 1004 |
+
|
| 1005 |
+
$html .= '</ol></div>' ;
|
| 1006 |
+
|
| 1007 |
+
return $html ;
|
| 1008 |
+
}
|
| 1009 |
+
|
| 1010 |
/**
|
| 1011 |
* Get the current instance object.
|
| 1012 |
*
|
admin/litespeed-cache-admin-error.class.php
CHANGED
|
@@ -41,7 +41,6 @@ class LiteSpeed_Cache_Admin_Error
|
|
| 41 |
const E_SETTING_CUSTOM_SITEMAP_READ = 3030 ;
|
| 42 |
const E_SETTING_CUSTOM_SITEMAP_PARSE = 3031 ;
|
| 43 |
|
| 44 |
-
const E_SETTING_NUMERIC = 3500 ;
|
| 45 |
const E_SETTING_CAT = 3510 ;
|
| 46 |
const E_SETTING_TAG = 3520 ;
|
| 47 |
const E_SETTING_LC = 3530 ; // login cookie setting
|
|
@@ -155,12 +154,6 @@ class LiteSpeed_Cache_Admin_Error
|
|
| 155 |
return __('Can not parse custom sitemap xml file: %s.', 'litespeed-cache') . ' '
|
| 156 |
. sprintf(__('Please make sure the file is xml format and the %s extension is installed on the server.', 'litespeed-cache'), 'php-xml') ;
|
| 157 |
|
| 158 |
-
// Admin settings with expected parameters for message.
|
| 159 |
-
case self::E_SETTING_NUMERIC:
|
| 160 |
-
// %1 is the name of the option, %2 is the minimum integer allowed.
|
| 161 |
-
return __('%1$s must be an integer between %2$d and %3$d',
|
| 162 |
-
'litespeed-cache') ;
|
| 163 |
-
|
| 164 |
case self::E_SETTING_CAT:
|
| 165 |
// %s is the category attempted to be added.
|
| 166 |
return __('Removed category "%s" from list, ID does not exist.',
|
| 41 |
const E_SETTING_CUSTOM_SITEMAP_READ = 3030 ;
|
| 42 |
const E_SETTING_CUSTOM_SITEMAP_PARSE = 3031 ;
|
| 43 |
|
|
|
|
| 44 |
const E_SETTING_CAT = 3510 ;
|
| 45 |
const E_SETTING_TAG = 3520 ;
|
| 46 |
const E_SETTING_LC = 3530 ; // login cookie setting
|
| 154 |
return __('Can not parse custom sitemap xml file: %s.', 'litespeed-cache') . ' '
|
| 155 |
. sprintf(__('Please make sure the file is xml format and the %s extension is installed on the server.', 'litespeed-cache'), 'php-xml') ;
|
| 156 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 157 |
case self::E_SETTING_CAT:
|
| 158 |
// %s is the category attempted to be added.
|
| 159 |
return __('Removed category "%s" from list, ID does not exist.',
|
admin/litespeed-cache-admin-settings.class.php
CHANGED
|
@@ -16,8 +16,6 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 16 |
private $_options ;
|
| 17 |
private $_err ;
|
| 18 |
|
| 19 |
-
private $_err_msg_numeric ;
|
| 20 |
-
|
| 21 |
private $_max_int = 2147483647 ;
|
| 22 |
|
| 23 |
/**
|
|
@@ -28,7 +26,21 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 28 |
*/
|
| 29 |
private function __construct()
|
| 30 |
{
|
| 31 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 32 |
}
|
| 33 |
|
| 34 |
/**
|
|
@@ -343,14 +355,14 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 343 |
LiteSpeed_Cache_Config::OPID_PRIVATE_TTL => array( __( 'Default Private Cache', 'litespeed-cache' ), 60, 3600 ),
|
| 344 |
LiteSpeed_Cache_Config::OPID_FRONT_PAGE_TTL => array( __( 'Default Front Page', 'litespeed-cache' ), 30, $this->_max_int ),
|
| 345 |
LiteSpeed_Cache_Config::OPID_FEED_TTL => array( __( 'Feed', 'litespeed-cache' ), 0, $this->_max_int, 30 ),
|
| 346 |
-
LiteSpeed_Cache_Config::OPID_404_TTL => array(
|
| 347 |
-
LiteSpeed_Cache_Config::OPID_403_TTL => array(
|
| 348 |
-
LiteSpeed_Cache_Config::OPID_500_TTL => array(
|
| 349 |
) ;
|
| 350 |
foreach ( $ids as $id => $v ) {
|
| 351 |
list( $desc, $min, $max ) = $v ;
|
| 352 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 353 |
-
$this->_err[] =
|
| 354 |
}
|
| 355 |
else {
|
| 356 |
if ( ! empty( $v[ 3 ] ) && $this->_input[ $id ] < $v[ 3 ] ) {
|
|
@@ -841,7 +853,7 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 841 |
|
| 842 |
$id = LiteSpeed_Cache_Config::OPID_LOG_FILE_SIZE ;
|
| 843 |
if ( ! $this->_check_ttl( $this->_input, $id, 3, 3000 ) ) {
|
| 844 |
-
$this->_err[] =
|
| 845 |
}
|
| 846 |
else {
|
| 847 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
|
@@ -881,6 +893,7 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 881 |
LiteSpeed_Cache_Config::CRWL_PAGES,
|
| 882 |
LiteSpeed_Cache_Config::CRWL_CATS,
|
| 883 |
LiteSpeed_Cache_Config::CRWL_TAGS,
|
|
|
|
| 884 |
) ;
|
| 885 |
foreach ( $ids as $id ) {
|
| 886 |
$this->_options[ $id ] = self::parse_onoff( $this->_input, $id ) ;
|
|
@@ -906,8 +919,14 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 906 |
}
|
| 907 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
| 908 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 909 |
$ids = array(
|
| 910 |
-
LiteSpeed_Cache_Config::CRWL_USLEEP => array( __( 'Delay', 'litespeed-cache' ),
|
| 911 |
LiteSpeed_Cache_Config::CRWL_RUN_DURATION => array( __( 'Run Duration', 'litespeed-cache' ), 0, $this->_max_int ),
|
| 912 |
LiteSpeed_Cache_Config::CRWL_RUN_INTERVAL => array( __( 'Cron Interval', 'litespeed-cache' ), 60, $this->_max_int ),
|
| 913 |
LiteSpeed_Cache_Config::CRWL_CRAWL_INTERVAL => array( __( 'Whole Interval', 'litespeed-cache' ), 0, $this->_max_int ),
|
|
@@ -916,7 +935,7 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 916 |
foreach ( $ids as $id => $v ) {
|
| 917 |
list( $desc, $min, $max ) = $v ;
|
| 918 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 919 |
-
$this->_err[] =
|
| 920 |
}
|
| 921 |
else {
|
| 922 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
|
@@ -989,7 +1008,7 @@ class LiteSpeed_Cache_Admin_Settings
|
|
| 989 |
foreach ( $ids as $id => $v ) {
|
| 990 |
list( $desc, $min, $max ) = $v ;
|
| 991 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 992 |
-
$this->_err[] =
|
| 993 |
}
|
| 994 |
else {
|
| 995 |
$new_options[ $id ] = $this->_input[ $id ] ;
|
| 16 |
private $_options ;
|
| 17 |
private $_err ;
|
| 18 |
|
|
|
|
|
|
|
| 19 |
private $_max_int = 2147483647 ;
|
| 20 |
|
| 21 |
/**
|
| 26 |
*/
|
| 27 |
private function __construct()
|
| 28 |
{
|
| 29 |
+
}
|
| 30 |
+
|
| 31 |
+
/**
|
| 32 |
+
* Display err msg for ttl
|
| 33 |
+
*
|
| 34 |
+
* @since 2.0
|
| 35 |
+
* @access private
|
| 36 |
+
*/
|
| 37 |
+
private function _show_ttl_err( $desc, $min, $max )
|
| 38 |
+
{
|
| 39 |
+
if ( ! $max ) {
|
| 40 |
+
return sprintf( __( '%1$s must be an integer larger than %2$d', 'litespeed-cache' ), $desc, $min ) ;
|
| 41 |
+
}
|
| 42 |
+
|
| 43 |
+
return sprintf( __( '%1$s must be an integer between %2$d and %3$d', 'litespeed-cache' ), $desc, $min, $max ) ;
|
| 44 |
}
|
| 45 |
|
| 46 |
/**
|
| 355 |
LiteSpeed_Cache_Config::OPID_PRIVATE_TTL => array( __( 'Default Private Cache', 'litespeed-cache' ), 60, 3600 ),
|
| 356 |
LiteSpeed_Cache_Config::OPID_FRONT_PAGE_TTL => array( __( 'Default Front Page', 'litespeed-cache' ), 30, $this->_max_int ),
|
| 357 |
LiteSpeed_Cache_Config::OPID_FEED_TTL => array( __( 'Feed', 'litespeed-cache' ), 0, $this->_max_int, 30 ),
|
| 358 |
+
LiteSpeed_Cache_Config::OPID_404_TTL => array( '404', 0, $this->_max_int, 30 ),
|
| 359 |
+
LiteSpeed_Cache_Config::OPID_403_TTL => array( '403', 0, $this->_max_int, 30 ),
|
| 360 |
+
LiteSpeed_Cache_Config::OPID_500_TTL => array( '500', 0, $this->_max_int, 30 ),
|
| 361 |
) ;
|
| 362 |
foreach ( $ids as $id => $v ) {
|
| 363 |
list( $desc, $min, $max ) = $v ;
|
| 364 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 365 |
+
$this->_err[] = $this->_show_ttl_err( $desc, $min, $max ) ;
|
| 366 |
}
|
| 367 |
else {
|
| 368 |
if ( ! empty( $v[ 3 ] ) && $this->_input[ $id ] < $v[ 3 ] ) {
|
| 853 |
|
| 854 |
$id = LiteSpeed_Cache_Config::OPID_LOG_FILE_SIZE ;
|
| 855 |
if ( ! $this->_check_ttl( $this->_input, $id, 3, 3000 ) ) {
|
| 856 |
+
$this->_err[] = $this->_show_ttl_err( __( 'Log File Size Limit', 'litespeed-cache' ), 3, 3000 ) ;
|
| 857 |
}
|
| 858 |
else {
|
| 859 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
| 893 |
LiteSpeed_Cache_Config::CRWL_PAGES,
|
| 894 |
LiteSpeed_Cache_Config::CRWL_CATS,
|
| 895 |
LiteSpeed_Cache_Config::CRWL_TAGS,
|
| 896 |
+
LiteSpeed_Cache_Config::CRWL_HTTP2,
|
| 897 |
) ;
|
| 898 |
foreach ( $ids as $id ) {
|
| 899 |
$this->_options[ $id ] = self::parse_onoff( $this->_input, $id ) ;
|
| 919 |
}
|
| 920 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
| 921 |
|
| 922 |
+
$usleep_min = 0 ;
|
| 923 |
+
$usleep_max = 30000 ;
|
| 924 |
+
if ( ! empty( $_SERVER[ LiteSpeed_Cache_Config::ENV_CRAWLER_USLEEP ] ) ) {
|
| 925 |
+
$usleep_min = $_SERVER[ LiteSpeed_Cache_Config::ENV_CRAWLER_USLEEP ] ;
|
| 926 |
+
$usleep_max = null ;
|
| 927 |
+
}
|
| 928 |
$ids = array(
|
| 929 |
+
LiteSpeed_Cache_Config::CRWL_USLEEP => array( __( 'Delay', 'litespeed-cache' ), $usleep_min, $usleep_max ),
|
| 930 |
LiteSpeed_Cache_Config::CRWL_RUN_DURATION => array( __( 'Run Duration', 'litespeed-cache' ), 0, $this->_max_int ),
|
| 931 |
LiteSpeed_Cache_Config::CRWL_RUN_INTERVAL => array( __( 'Cron Interval', 'litespeed-cache' ), 60, $this->_max_int ),
|
| 932 |
LiteSpeed_Cache_Config::CRWL_CRAWL_INTERVAL => array( __( 'Whole Interval', 'litespeed-cache' ), 0, $this->_max_int ),
|
| 935 |
foreach ( $ids as $id => $v ) {
|
| 936 |
list( $desc, $min, $max ) = $v ;
|
| 937 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 938 |
+
$this->_err[] = $this->_show_ttl_err( $desc, $min, $max ) ;
|
| 939 |
}
|
| 940 |
else {
|
| 941 |
$this->_options[ $id ] = $this->_input[ $id ] ;
|
| 1008 |
foreach ( $ids as $id => $v ) {
|
| 1009 |
list( $desc, $min, $max ) = $v ;
|
| 1010 |
if ( ! $this->_check_ttl( $this->_input, $id, $min, $max ) ) {
|
| 1011 |
+
$this->_err[] = $this->_show_ttl_err( $desc, $min, $max ) ;
|
| 1012 |
}
|
| 1013 |
else {
|
| 1014 |
$new_options[ $id ] = $this->_input[ $id ] ;
|
admin/litespeed-cache-admin.class.php
CHANGED
|
@@ -34,10 +34,6 @@ class LiteSpeed_Cache_Admin
|
|
| 34 |
|
| 35 |
$this->config = LiteSpeed_Cache_Config::get_instance() ;
|
| 36 |
|
| 37 |
-
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 38 |
-
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;//todo: check if needed
|
| 39 |
-
}
|
| 40 |
-
|
| 41 |
// initialize admin actions
|
| 42 |
add_action( 'admin_init', array( $this, 'admin_init' ) ) ;
|
| 43 |
// add link to plugin list page
|
|
@@ -239,29 +235,31 @@ class LiteSpeed_Cache_Admin
|
|
| 239 |
* @access public
|
| 240 |
* @global string $pagenow
|
| 241 |
*/
|
| 242 |
-
public static function redirect()
|
| 243 |
{
|
| 244 |
global $pagenow ;
|
| 245 |
$qs = '' ;
|
| 246 |
-
|
| 247 |
-
|
| 248 |
-
|
| 249 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 250 |
}
|
| 251 |
-
if (
|
| 252 |
-
|
| 253 |
}
|
| 254 |
-
|
| 255 |
-
$
|
| 256 |
}
|
| 257 |
}
|
| 258 |
-
|
| 259 |
-
|
| 260 |
-
}
|
| 261 |
-
else {
|
| 262 |
-
$url = admin_url($pagenow . $qs) ;
|
| 263 |
-
}
|
| 264 |
-
wp_redirect($url) ;
|
| 265 |
exit() ;
|
| 266 |
}
|
| 267 |
|
| 34 |
|
| 35 |
$this->config = LiteSpeed_Cache_Config::get_instance() ;
|
| 36 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 37 |
// initialize admin actions
|
| 38 |
add_action( 'admin_init', array( $this, 'admin_init' ) ) ;
|
| 39 |
// add link to plugin list page
|
| 235 |
* @access public
|
| 236 |
* @global string $pagenow
|
| 237 |
*/
|
| 238 |
+
public static function redirect( $url = false )
|
| 239 |
{
|
| 240 |
global $pagenow ;
|
| 241 |
$qs = '' ;
|
| 242 |
+
if ( ! $url ) {
|
| 243 |
+
if ( ! empty( $_GET ) ) {
|
| 244 |
+
if ( isset( $_GET[ LiteSpeed_Cache::ACTION_KEY ] ) ) {
|
| 245 |
+
unset( $_GET[ LiteSpeed_Cache::ACTION_KEY ] ) ;
|
| 246 |
+
}
|
| 247 |
+
if ( isset( $_GET[ LiteSpeed_Cache::NONCE_NAME ] ) ) {
|
| 248 |
+
unset( $_GET[ LiteSpeed_Cache::NONCE_NAME ] ) ;
|
| 249 |
+
}
|
| 250 |
+
if ( ! empty( $_GET ) ) {
|
| 251 |
+
$qs = '?' . http_build_query( $_GET ) ;
|
| 252 |
+
}
|
| 253 |
}
|
| 254 |
+
if ( is_network_admin() ) {
|
| 255 |
+
$url = network_admin_url( $pagenow . $qs ) ;
|
| 256 |
}
|
| 257 |
+
else {
|
| 258 |
+
$url = admin_url( $pagenow . $qs ) ;
|
| 259 |
}
|
| 260 |
}
|
| 261 |
+
|
| 262 |
+
wp_redirect( $url ) ;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 263 |
exit() ;
|
| 264 |
}
|
| 265 |
|
admin/tpl/image_optimization.php
CHANGED
|
@@ -1,12 +1,15 @@
|
|
| 1 |
<?php
|
| 2 |
if ( ! defined( 'WPINC' ) ) die ;
|
| 3 |
|
| 4 |
-
|
|
|
|
| 5 |
|
| 6 |
-
$
|
| 7 |
-
$optm_summary = $media->summary_info() ;
|
| 8 |
|
| 9 |
-
|
|
|
|
|
|
|
|
|
|
| 10 |
|
| 11 |
$_optm_summary_list = array(
|
| 12 |
'level' => array(
|
|
@@ -40,6 +43,24 @@ $_optm_summary_list = array(
|
|
| 40 |
),
|
| 41 |
) ;
|
| 42 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 43 |
|
| 44 |
include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
| 45 |
?>
|
|
@@ -58,6 +79,10 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 58 |
|
| 59 |
<div class="litespeed-wrap">
|
| 60 |
<div class="litespeed-body">
|
|
|
|
|
|
|
|
|
|
|
|
|
| 61 |
<h3 class="litespeed-title"><?php echo __('Optimization Summary', 'litespeed-cache') ; ?></h3>
|
| 62 |
|
| 63 |
<?php foreach ( $_optm_summary_list as $k => $v ) : ?>
|
|
@@ -87,8 +112,8 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 87 |
<?php endif ; ?>
|
| 88 |
<?php endforeach ; ?>
|
| 89 |
|
| 90 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 91 |
-
<?php echo __( 'Update
|
| 92 |
</a>
|
| 93 |
<span class="litespeed-desc">
|
| 94 |
<?php echo __( 'This will communicate with LiteSpeed\'s Image Optimization Server and retrieve the most recent status.', 'litespeed-cache' ) ; ?>
|
|
@@ -100,19 +125,35 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 100 |
<span class="litespeed-desc"><?php echo __('Beta Version', 'litespeed-cache') ; ?></span>
|
| 101 |
</h3>
|
| 102 |
|
| 103 |
-
<
|
| 104 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 105 |
<?php if ( $img_count[ 'total_not_requested' ] ) : ?>
|
| 106 |
<?php if ( empty( $optm_summary[ 'level' ] ) ) : ?>
|
| 107 |
<a href="#" class="litespeed-btn-default disabled">
|
| 108 |
<?php echo __( 'Send Optimization Request', 'litespeed-cache' ) ; ?>
|
| 109 |
</a>
|
| 110 |
<span class="litespeed-desc">
|
| 111 |
-
<?php echo sprintf( __( 'Please press the %s button before sending a new request.', 'litespeed-cache' ), __( 'Update
|
| 112 |
</span>
|
| 113 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:image-optimization#image_optimization_in_litespeed_cache_for_wordpress" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 114 |
<?php else : ?>
|
| 115 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 116 |
<?php echo __( 'Send Optimization Request', 'litespeed-cache' ) ; ?>
|
| 117 |
</a>
|
| 118 |
<span class="litespeed-desc">
|
|
@@ -125,17 +166,31 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 125 |
<hr />
|
| 126 |
|
| 127 |
<p>
|
| 128 |
-
<?php echo __('
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 129 |
</p>
|
| 130 |
-
<p><?php echo __('Image groups failed to optimize', 'litespeed-cache') ; ?>: <b><?php echo $img_count[ 'total_err' ] ; ?></b></p>
|
| 131 |
<p class="litespeed-desc">
|
| 132 |
<?php echo __( 'After LiteSpeed\'s Image Optimization Server finishes optimization, it will notify your site to pull the optimized images.', 'litespeed-cache' ) ; ?>
|
| 133 |
<?php echo __( 'This process is automatic.', 'litespeed-cache' ) ; ?>
|
| 134 |
</p>
|
| 135 |
<p>
|
| 136 |
-
<?php echo __('
|
|
|
|
|
|
|
|
|
|
| 137 |
<?php if ( $img_count[ 'total_server_finished' ] && ! $is_running ) : ?>
|
| 138 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 139 |
<?php echo __( 'Pull Images', 'litespeed-cache' ) ; ?>
|
| 140 |
</a>
|
| 141 |
<span class="litespeed-desc">
|
|
@@ -148,7 +203,11 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 148 |
</span>
|
| 149 |
<?php endif ; ?>
|
| 150 |
</p>
|
| 151 |
-
<p
|
|
|
|
|
|
|
|
|
|
|
|
|
| 152 |
<p><a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:image-optimization#image_optimization_in_litespeed_cache_for_wordpress" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a></p>
|
| 153 |
|
| 154 |
<hr />
|
|
@@ -162,7 +221,7 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 162 |
|
| 163 |
<br />
|
| 164 |
|
| 165 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 166 |
<?php echo __( 'Undo Optimization', 'litespeed-cache' ) ; ?>
|
| 167 |
</a>
|
| 168 |
<span class="litespeed-desc">
|
|
@@ -171,7 +230,7 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 171 |
|
| 172 |
<br />
|
| 173 |
|
| 174 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 175 |
<?php echo __( 'Re-do Optimization', 'litespeed-cache' ) ; ?>
|
| 176 |
</a>
|
| 177 |
<span class="litespeed-desc">
|
|
@@ -183,7 +242,7 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 183 |
<?php echo sprintf( __( 'Results can be checked in <a %s>Media Library</a>.', 'litespeed-cache' ), 'href="upload.php?mode=list"' ) ; ?>
|
| 184 |
</p>
|
| 185 |
|
| 186 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 187 |
<?php echo __( 'Send New Thumbnail Requests', 'litespeed-cache' ) ; ?>
|
| 188 |
</a>
|
| 189 |
<span class="litespeed-desc">
|
|
@@ -199,13 +258,13 @@ include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
|
| 199 |
</span>
|
| 200 |
|
| 201 |
<br />
|
| 202 |
-
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 203 |
<?php echo __( 'Destroy All Optimization Data!', 'litespeed-cache' ) ; ?>
|
| 204 |
</a>
|
| 205 |
<span class="litespeed-desc">
|
| 206 |
<?php echo __( 'Remove all previous image optimization requests/results, revert completed optimizations, and delete all optimization files.', 'litespeed-cache' ) ; ?>
|
| 207 |
<font class="litespeed-warning">
|
| 208 |
-
<?php echo __('NOTE
|
| 209 |
<?php echo sprintf( __( 'If there are unfinished requests in progress, the requests\' credits will NOT be recovered.', 'litespeed-cache' ), 'jQuery', __( 'JS Combine', 'litespeed-cache' ) ) ; ?>
|
| 210 |
</font>
|
| 211 |
|
| 1 |
<?php
|
| 2 |
if ( ! defined( 'WPINC' ) ) die ;
|
| 3 |
|
| 4 |
+
// Update table data for upgrading
|
| 5 |
+
LiteSpeed_Cache_Data::get_instance() ;
|
| 6 |
|
| 7 |
+
$img_optm = LiteSpeed_Cache_Img_Optm::get_instance() ;
|
|
|
|
| 8 |
|
| 9 |
+
$img_count = $img_optm->img_count() ;
|
| 10 |
+
$optm_summary = $img_optm->summary_info() ;
|
| 11 |
+
|
| 12 |
+
list( $last_run, $is_running ) = $img_optm->cron_running( false ) ;
|
| 13 |
|
| 14 |
$_optm_summary_list = array(
|
| 15 |
'level' => array(
|
| 43 |
),
|
| 44 |
) ;
|
| 45 |
|
| 46 |
+
// Guidance check
|
| 47 |
+
$current_step = false ;
|
| 48 |
+
if ( empty( $optm_summary[ 'level' ] ) || $optm_summary[ 'level' ] < 2 ) {
|
| 49 |
+
$current_step = $img_optm->get_guidance_pos() ;
|
| 50 |
+
}
|
| 51 |
+
$guidance_steps = array(
|
| 52 |
+
sprintf( __( 'Click the %s button.', 'litespeed-cache' ), '<font class="litespeed-success">' . __( 'Update Status', 'litespeed-cache' ) . '</font>' ),
|
| 53 |
+
sprintf( __( 'Click the %s button.', 'litespeed-cache' ), '<font class="litespeed-success">' . __( 'Send Optimization Request', 'litespeed-cache' ) . '</font>' ),
|
| 54 |
+
sprintf( __( 'Click the %s button or wait for the cron job to finish the pull action.', 'litespeed-cache' ), '<font class="litespeed-success">' . __( 'Pull Images', 'litespeed-cache' ) . '</font>' ),
|
| 55 |
+
__( 'Repeat the above steps until you have leveled up.', 'litespeed-cache' )
|
| 56 |
+
) ;
|
| 57 |
+
|
| 58 |
+
if ( ! empty( $img_count[ 'total_img' ] ) ) {
|
| 59 |
+
$finished_percentage = 100 - floor( $img_count[ 'total_not_requested' ] * 100 / $img_count[ 'total_img' ] ) ;
|
| 60 |
+
}
|
| 61 |
+
else {
|
| 62 |
+
$finished_percentage = 0 ;
|
| 63 |
+
}
|
| 64 |
|
| 65 |
include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
| 66 |
?>
|
| 79 |
|
| 80 |
<div class="litespeed-wrap">
|
| 81 |
<div class="litespeed-body">
|
| 82 |
+
<?php if ( $current_step ) : ?>
|
| 83 |
+
<?php echo LiteSpeed_Cache_Admin_Display::guidance( __( 'How to Level Up', 'litespeed-cache' ), $guidance_steps, $current_step ) ; ?>
|
| 84 |
+
<?php endif ; ?>
|
| 85 |
+
|
| 86 |
<h3 class="litespeed-title"><?php echo __('Optimization Summary', 'litespeed-cache') ; ?></h3>
|
| 87 |
|
| 88 |
<?php foreach ( $_optm_summary_list as $k => $v ) : ?>
|
| 112 |
<?php endif ; ?>
|
| 113 |
<?php endforeach ; ?>
|
| 114 |
|
| 115 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_SYNC_DATA ) ; ?>" class="litespeed-btn-success">
|
| 116 |
+
<?php echo __( 'Update Status', 'litespeed-cache' ) ; ?>
|
| 117 |
</a>
|
| 118 |
<span class="litespeed-desc">
|
| 119 |
<?php echo __( 'This will communicate with LiteSpeed\'s Image Optimization Server and retrieve the most recent status.', 'litespeed-cache' ) ; ?>
|
| 125 |
<span class="litespeed-desc"><?php echo __('Beta Version', 'litespeed-cache') ; ?></span>
|
| 126 |
</h3>
|
| 127 |
|
| 128 |
+
<div class="litespeed-block-tiny">
|
| 129 |
+
<div class="litespeed-col-auto">
|
| 130 |
+
<?php echo LiteSpeed_Cache_GUI::pie( $finished_percentage, 100, true ) ; ?>
|
| 131 |
+
</div>
|
| 132 |
+
|
| 133 |
+
<div class="litespeed-col-auto">
|
| 134 |
+
<p>
|
| 135 |
+
<?php echo __( 'Images total', 'litespeed-cache') ; ?>:
|
| 136 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_img' ] ) ; ?></b>
|
| 137 |
+
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:image-optimization:image-groups" target="_blank" class="litespeed-desc litespeed-left20"><?php echo __( 'What is a group?', 'litespeed-cache') ; ?></a>
|
| 138 |
+
</p>
|
| 139 |
+
<p>
|
| 140 |
+
<?php echo __('Images not yet requested', 'litespeed-cache') ; ?>:
|
| 141 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_not_requested' ] ) ; ?></b>
|
| 142 |
+
</p>
|
| 143 |
+
</div>
|
| 144 |
+
</div>
|
| 145 |
+
|
| 146 |
<?php if ( $img_count[ 'total_not_requested' ] ) : ?>
|
| 147 |
<?php if ( empty( $optm_summary[ 'level' ] ) ) : ?>
|
| 148 |
<a href="#" class="litespeed-btn-default disabled">
|
| 149 |
<?php echo __( 'Send Optimization Request', 'litespeed-cache' ) ; ?>
|
| 150 |
</a>
|
| 151 |
<span class="litespeed-desc">
|
| 152 |
+
<?php echo sprintf( __( 'Please press the %s button before sending a new request.', 'litespeed-cache' ), __( 'Update Status', 'litespeed-cache' ) ) ; ?>
|
| 153 |
</span>
|
| 154 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:image-optimization#image_optimization_in_litespeed_cache_for_wordpress" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 155 |
<?php else : ?>
|
| 156 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_OPTIMIZE ) ; ?>" class="litespeed-btn-success">
|
| 157 |
<?php echo __( 'Send Optimization Request', 'litespeed-cache' ) ; ?>
|
| 158 |
</a>
|
| 159 |
<span class="litespeed-desc">
|
| 166 |
<hr />
|
| 167 |
|
| 168 |
<p>
|
| 169 |
+
<?php echo __('Images requested', 'litespeed-cache') ; ?>:
|
| 170 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_requested_groups' ] ) ; ?></b>
|
| 171 |
+
(<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_requested' ], 'image' ) ; ?></b>)
|
| 172 |
+
</p>
|
| 173 |
+
<p>
|
| 174 |
+
<?php echo __('Images failed to optimize', 'litespeed-cache') ; ?>:
|
| 175 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_err_groups' ] ) ; ?></b>
|
| 176 |
+
(<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_err' ], 'image' ) ; ?></b>)
|
| 177 |
+
</p>
|
| 178 |
+
<p>
|
| 179 |
+
<?php echo __('Image files missing', 'litespeed-cache') ; ?>:
|
| 180 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_miss_groups' ] ) ; ?></b>
|
| 181 |
+
(<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_miss' ], 'image' ) ; ?></b>)
|
| 182 |
</p>
|
|
|
|
| 183 |
<p class="litespeed-desc">
|
| 184 |
<?php echo __( 'After LiteSpeed\'s Image Optimization Server finishes optimization, it will notify your site to pull the optimized images.', 'litespeed-cache' ) ; ?>
|
| 185 |
<?php echo __( 'This process is automatic.', 'litespeed-cache' ) ; ?>
|
| 186 |
</p>
|
| 187 |
<p>
|
| 188 |
+
<?php echo __('Images notified to pull', 'litespeed-cache') ; ?>:
|
| 189 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_server_finished_groups' ] ) ; ?></b>
|
| 190 |
+
(<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_server_finished' ], 'image' ) ; ?></b>)
|
| 191 |
+
|
| 192 |
<?php if ( $img_count[ 'total_server_finished' ] && ! $is_running ) : ?>
|
| 193 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_PULL ) ; ?>" class="litespeed-btn-success">
|
| 194 |
<?php echo __( 'Pull Images', 'litespeed-cache' ) ; ?>
|
| 195 |
</a>
|
| 196 |
<span class="litespeed-desc">
|
| 203 |
</span>
|
| 204 |
<?php endif ; ?>
|
| 205 |
</p>
|
| 206 |
+
<p>
|
| 207 |
+
<?php echo __('Images optimized and pulled', 'litespeed-cache') ; ?>:
|
| 208 |
+
<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_pulled_groups' ] ) ; ?></b>
|
| 209 |
+
(<b><?php echo LiteSpeed_Cache_Admin_Display::print_plural( $img_count[ 'total_pulled' ], 'image' ) ; ?></b>)
|
| 210 |
+
</p>
|
| 211 |
<p><a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:image-optimization#image_optimization_in_litespeed_cache_for_wordpress" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a></p>
|
| 212 |
|
| 213 |
<hr />
|
| 221 |
|
| 222 |
<br />
|
| 223 |
|
| 224 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_BATCH_SWITCH_ORI ) ; ?>" class="litespeed-btn-danger">
|
| 225 |
<?php echo __( 'Undo Optimization', 'litespeed-cache' ) ; ?>
|
| 226 |
</a>
|
| 227 |
<span class="litespeed-desc">
|
| 230 |
|
| 231 |
<br />
|
| 232 |
|
| 233 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_BATCH_SWITCH_OPTM ) ; ?>" class="litespeed-btn-warning">
|
| 234 |
<?php echo __( 'Re-do Optimization', 'litespeed-cache' ) ; ?>
|
| 235 |
</a>
|
| 236 |
<span class="litespeed-desc">
|
| 242 |
<?php echo sprintf( __( 'Results can be checked in <a %s>Media Library</a>.', 'litespeed-cache' ), 'href="upload.php?mode=list"' ) ; ?>
|
| 243 |
</p>
|
| 244 |
|
| 245 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_OPTIMIZE_RESCAN ) ; ?>" class="litespeed-btn-success">
|
| 246 |
<?php echo __( 'Send New Thumbnail Requests', 'litespeed-cache' ) ; ?>
|
| 247 |
</a>
|
| 248 |
<span class="litespeed-desc">
|
| 258 |
</span>
|
| 259 |
|
| 260 |
<br />
|
| 261 |
+
<a href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_OPTIMIZE_DESTROY ) ; ?>" class="litespeed-btn-danger">
|
| 262 |
<?php echo __( 'Destroy All Optimization Data!', 'litespeed-cache' ) ; ?>
|
| 263 |
</a>
|
| 264 |
<span class="litespeed-desc">
|
| 265 |
<?php echo __( 'Remove all previous image optimization requests/results, revert completed optimizations, and delete all optimization files.', 'litespeed-cache' ) ; ?>
|
| 266 |
<font class="litespeed-warning">
|
| 267 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 268 |
<?php echo sprintf( __( 'If there are unfinished requests in progress, the requests\' credits will NOT be recovered.', 'litespeed-cache' ), 'jQuery', __( 'JS Combine', 'litespeed-cache' ) ) ; ?>
|
| 269 |
</font>
|
| 270 |
|
admin/tpl/inc/admin_footer.php
CHANGED
|
@@ -1,19 +1,21 @@
|
|
| 1 |
<?php
|
| 2 |
if (!defined('WPINC')) die;
|
| 3 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 4 |
|
| 5 |
-
$rate_us = sprintf(__('Rate <strong>LiteSpeed Cache</strong> with %s on WordPress.org if you like us!', 'litespeed-cache'),
|
| 6 |
-
'<a href="https://wordpress.org/support/plugin/litespeed-cache/reviews/?filter=5#new-post" rel="noopener noreferer" target="_blank">✮✮✮✮✮</a>'
|
| 7 |
-
);
|
| 8 |
-
$questions = sprintf(__('If there are any questions that are not answered in the <a %s>FAQs</a>, do not hesitate to ask them on the <a %s>support forum</a>.', 'litespeed-cache'),
|
| 9 |
-
'href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp" target="_blank"',
|
| 10 |
-
'href="https://wordpress.org/support/plugin/litespeed-cache" rel="noopener noreferrer" target="_blank"');
|
| 11 |
// Change the footer text
|
| 12 |
-
if ( !is_multisite()
|
| 13 |
-
|
| 14 |
-
{
|
| 15 |
-
$footer_text = $rate_us . ' ' . $questions;
|
| 16 |
}
|
| 17 |
-
else{
|
| 18 |
-
$footer_text = $
|
| 19 |
}
|
| 1 |
<?php
|
| 2 |
if (!defined('WPINC')) die;
|
| 3 |
|
| 4 |
+
// ✮✮✮✮✮
|
| 5 |
+
$rate_us = '<a href="https://wordpress.org/support/plugin/litespeed-cache/reviews/?filter=5#new-post" rel="noopener noreferer" target="_blank">'
|
| 6 |
+
. sprintf( __( 'Rate %s on %s', 'litespeed-cache' ), '<strong>' . __( 'LiteSpeed Cache', 'litespeed-cache' ) . '</strong>', 'WordPress.org' )
|
| 7 |
+
. '</a>' ;
|
| 8 |
+
|
| 9 |
+
$wiki = '<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp" target="_blank">' . __( 'Read LiteSpeed Wiki', 'litespeed-cache' ) . '</a>' ;
|
| 10 |
+
|
| 11 |
+
$forum = '<a href="https://wordpress.org/support/plugin/litespeed-cache" target="_blank">' . __( 'Visit LSCWP support forum', 'litespeed-cache' ) . '</a>' ;
|
| 12 |
+
|
| 13 |
+
$community = '<a href="https://goo.gl/FG9S4N" target="_blank">' . __( 'Join LiteSpeed Slack community', 'litespeed-cache' ) . '</a>' ;
|
| 14 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 15 |
// Change the footer text
|
| 16 |
+
if ( ! is_multisite() || is_network_admin() ) {
|
| 17 |
+
$footer_text = $rate_us . ' | ' . $wiki . ' | ' . $forum . ' | ' . $community ;
|
|
|
|
|
|
|
| 18 |
}
|
| 19 |
+
else {
|
| 20 |
+
$footer_text = $wiki . ' | ' . $forum . ' | ' . $community ;
|
| 21 |
}
|
admin/tpl/manage/manage_purge.php
CHANGED
|
@@ -100,7 +100,7 @@ if ( ! is_multisite() || is_network_admin() ) {
|
|
| 100 |
<?php foreach ( $_panels as $v ): ?>
|
| 101 |
|
| 102 |
<?php if ( ! empty( $v[ 'newline' ] ) ) : ?>
|
| 103 |
-
<div class='litespeed-
|
| 104 |
<?php endif; ?>
|
| 105 |
|
| 106 |
<a class="litespeed-panel"
|
| 100 |
<?php foreach ( $_panels as $v ): ?>
|
| 101 |
|
| 102 |
<?php if ( ! empty( $v[ 'newline' ] ) ) : ?>
|
| 103 |
+
<div class='litespeed-col-br'></div>
|
| 104 |
<?php endif; ?>
|
| 105 |
|
| 106 |
<a class="litespeed-panel"
|
admin/tpl/setting/settings_advanced.php
CHANGED
|
@@ -47,7 +47,7 @@ if (!defined('WPINC')) die;
|
|
| 47 |
<?php echo __( 'When a vistor hovers over a page link, preload that page. This will speed up the visit to that link.', 'litespeed-cache' ) ; ?>
|
| 48 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:advanced#instant_click" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 49 |
<br /><font class="litespeed-danger">
|
| 50 |
-
<?php echo __('NOTE
|
| 51 |
<?php echo __('This will generate extra requests to the server, which will increase server load.', 'litespeed-cache'); ?>
|
| 52 |
</font>
|
| 53 |
|
|
@@ -65,7 +65,7 @@ if (!defined('WPINC')) die;
|
|
| 65 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:advanced#favicon" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 66 |
|
| 67 |
</div>
|
| 68 |
-
<div class="litespeed-
|
| 69 |
<div class='litespeed-cdn-mapping-col1'>
|
| 70 |
<h4><?php echo __( 'Frontend Favicon File', 'litespeed-cache' ) ; ?></h4>
|
| 71 |
|
| 47 |
<?php echo __( 'When a vistor hovers over a page link, preload that page. This will speed up the visit to that link.', 'litespeed-cache' ) ; ?>
|
| 48 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:advanced#instant_click" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 49 |
<br /><font class="litespeed-danger">
|
| 50 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 51 |
<?php echo __('This will generate extra requests to the server, which will increase server load.', 'litespeed-cache'); ?>
|
| 52 |
</font>
|
| 53 |
|
| 65 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:advanced#favicon" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 66 |
|
| 67 |
</div>
|
| 68 |
+
<div class="litespeed-block">
|
| 69 |
<div class='litespeed-cdn-mapping-col1'>
|
| 70 |
<h4><?php echo __( 'Frontend Favicon File', 'litespeed-cache' ) ; ?></h4>
|
| 71 |
|
admin/tpl/setting/settings_cdn.php
CHANGED
|
@@ -41,7 +41,7 @@ if ( ! $cdn_mapping ) {
|
|
| 41 |
<td>
|
| 42 |
<?php foreach ( $cdn_mapping as $v ) : ?>
|
| 43 |
|
| 44 |
-
<div class="litespeed-
|
| 45 |
<div class='litespeed-cdn-mapping-col1'>
|
| 46 |
<h4><?php echo __( 'CDN URL', 'litespeed-cache' ) ; ?>
|
| 47 |
<button type="button" class="litespeed-btn-danger" data-litespeed-cdn-mapping-del="1">X</button>
|
|
@@ -94,8 +94,8 @@ if ( ! $cdn_mapping ) {
|
|
| 94 |
<p><button type="button" class="litespeed-btn-success litespeed-btn-tiny" id="litespeed-cdn-mapping-add">+</button></p>
|
| 95 |
|
| 96 |
<div class="litespeed-warning">
|
| 97 |
-
<?php echo __('NOTE
|
| 98 |
-
<?php echo __( '
|
| 99 |
</div>
|
| 100 |
|
| 101 |
<div class="litespeed-desc">
|
|
@@ -157,13 +157,13 @@ if ( ! $cdn_mapping ) {
|
|
| 157 |
<?php echo $this->build_radio(
|
| 158 |
LiteSpeed_Cache_Config::OPID_CDN_REMOTE_JQUERY,
|
| 159 |
LiteSpeed_Cache_Config::VAL_ON,
|
| 160 |
-
|
| 161 |
) ; ?>
|
| 162 |
|
| 163 |
<?php echo $this->build_radio(
|
| 164 |
LiteSpeed_Cache_Config::OPID_CDN_REMOTE_JQUERY,
|
| 165 |
LiteSpeed_Cache_Config::VAL_ON2,
|
| 166 |
-
|
| 167 |
) ; ?>
|
| 168 |
</div>
|
| 169 |
<div class="litespeed-desc">
|
|
@@ -177,30 +177,52 @@ if ( ! $cdn_mapping ) {
|
|
| 177 |
<td>
|
| 178 |
<?php $this->build_switch( LiteSpeed_Cache_Config::OPID_CDN_QUIC ) ; ?>
|
| 179 |
<div class="litespeed-desc">
|
| 180 |
-
<?php echo __( 'Use
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 181 |
<?php echo sprintf( __( 'This can be managed from <a %2$s>%1$s</a>.', 'litespeed-cache' ), '<b>' . __( 'Manage', 'litespeed-cache' ) . '</b> -> <b>' . __( 'CDN', 'litespeed-cache' ) . '</b>', 'href="admin.php?page=lscache-dash#cdn"' ) ; ?>
|
| 182 |
</div>
|
| 183 |
-
<div class="litespeed-
|
| 184 |
-
<div class='litespeed-
|
| 185 |
<h4><?php echo __( 'Email Address', 'litespeed-cache' ) ; ?></h4>
|
| 186 |
|
| 187 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_QUIC_EMAIL ) ; ?>
|
| 188 |
<div class="litespeed-desc">
|
| 189 |
-
<?php echo __( 'Your Email address on
|
| 190 |
</div>
|
| 191 |
</div>
|
| 192 |
|
| 193 |
-
<div class='litespeed-
|
| 194 |
<h4><?php echo __( 'User API Key', 'litespeed-cache' ) ; ?></h4>
|
| 195 |
|
| 196 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_QUIC_KEY ) ; ?>
|
| 197 |
<div class="litespeed-desc">
|
| 198 |
-
<?php echo __( 'Your API key is used to access
|
| 199 |
-
<?php echo sprintf( __( 'Get it from <a %s
|
| 200 |
</div>
|
| 201 |
</div>
|
| 202 |
|
| 203 |
-
<div class='litespeed-
|
| 204 |
<h4><?php echo __( 'Site Domain', 'litespeed-cache' ) ; ?></h4>
|
| 205 |
|
| 206 |
<?php
|
|
@@ -220,30 +242,30 @@ if ( ! $cdn_mapping ) {
|
|
| 220 |
<td>
|
| 221 |
<?php $this->build_switch( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE ) ; ?>
|
| 222 |
<div class="litespeed-desc">
|
| 223 |
-
<?php echo __( 'Use
|
| 224 |
<?php echo sprintf( __( 'This can be managed from <a %2$s>%1$s</a>.', 'litespeed-cache' ), '<b>' . __( 'Manage', 'litespeed-cache' ) . '</b> -> <b>' . __( 'CDN', 'litespeed-cache' ) . '</b>', 'href="admin.php?page=lscache-dash#cdn"' ) ; ?>
|
| 225 |
</div>
|
| 226 |
-
<div class="litespeed-
|
| 227 |
-
<div class='litespeed-
|
| 228 |
<h4><?php echo __( 'Email Address', 'litespeed-cache' ) ; ?></h4>
|
| 229 |
|
| 230 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE_EMAIL ) ; ?>
|
| 231 |
<div class="litespeed-desc">
|
| 232 |
-
<?php echo __( 'Your Email address on
|
| 233 |
</div>
|
| 234 |
</div>
|
| 235 |
|
| 236 |
-
<div class='litespeed-
|
| 237 |
<h4><?php echo __( 'Global API Key', 'litespeed-cache' ) ; ?></h4>
|
| 238 |
|
| 239 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE_KEY ) ; ?>
|
| 240 |
<div class="litespeed-desc">
|
| 241 |
-
<?php echo __( 'Your API key is used to access
|
| 242 |
-
<?php echo sprintf( __( 'Get it from <a %s
|
| 243 |
</div>
|
| 244 |
</div>
|
| 245 |
|
| 246 |
-
<div class='litespeed-
|
| 247 |
<h4><?php echo __( 'Domain', 'litespeed-cache' ) ; ?></h4>
|
| 248 |
|
| 249 |
<?php
|
| 41 |
<td>
|
| 42 |
<?php foreach ( $cdn_mapping as $v ) : ?>
|
| 43 |
|
| 44 |
+
<div class="litespeed-block" data-litespeed-cdn-mapping="1">
|
| 45 |
<div class='litespeed-cdn-mapping-col1'>
|
| 46 |
<h4><?php echo __( 'CDN URL', 'litespeed-cache' ) ; ?>
|
| 47 |
<button type="button" class="litespeed-btn-danger" data-litespeed-cdn-mapping-del="1">X</button>
|
| 94 |
<p><button type="button" class="litespeed-btn-success litespeed-btn-tiny" id="litespeed-cdn-mapping-add">+</button></p>
|
| 95 |
|
| 96 |
<div class="litespeed-warning">
|
| 97 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 98 |
+
<?php echo __( 'To randomize CDN hostname, define multiple hostnames for the same resources.', 'litespeed-cache' ) ; ?>
|
| 99 |
</div>
|
| 100 |
|
| 101 |
<div class="litespeed-desc">
|
| 157 |
<?php echo $this->build_radio(
|
| 158 |
LiteSpeed_Cache_Config::OPID_CDN_REMOTE_JQUERY,
|
| 159 |
LiteSpeed_Cache_Config::VAL_ON,
|
| 160 |
+
'Google'
|
| 161 |
) ; ?>
|
| 162 |
|
| 163 |
<?php echo $this->build_radio(
|
| 164 |
LiteSpeed_Cache_Config::OPID_CDN_REMOTE_JQUERY,
|
| 165 |
LiteSpeed_Cache_Config::VAL_ON2,
|
| 166 |
+
'Cdnjs'
|
| 167 |
) ; ?>
|
| 168 |
</div>
|
| 169 |
<div class="litespeed-desc">
|
| 177 |
<td>
|
| 178 |
<?php $this->build_switch( LiteSpeed_Cache_Config::OPID_CDN_QUIC ) ; ?>
|
| 179 |
<div class="litespeed-desc">
|
| 180 |
+
<?php echo sprintf( __( 'Use %s API functionality.', 'litespeed-cache' ), 'Quic Cloud' ) ; ?>
|
| 181 |
+
|
| 182 |
+
<a id='litespeed_modal_href' href="<?php echo LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_QUIC_CLOUD ) ; ?>">
|
| 183 |
+
<?php if ( ! empty( $_options[ LiteSpeed_Cache_Config::OPID_CDN_QUIC_EMAIL ] ) ) : ?>
|
| 184 |
+
Login API
|
| 185 |
+
<?php else : ?>
|
| 186 |
+
Free Register!
|
| 187 |
+
<?php endif ; ?>
|
| 188 |
+
</a>
|
| 189 |
+
|
| 190 |
+
<link rel="stylesheet" href="<?php echo LSWCP_PLUGIN_URL ; ?>css/iziModal.min.css">
|
| 191 |
+
<script type="text/javascript" src="<?php echo LSWCP_PLUGIN_URL ; ?>js/iziModal.min.js"></script>
|
| 192 |
+
<div id="litespeed_modal"></div>
|
| 193 |
+
<script type="text/javascript">
|
| 194 |
+
var litespeed_modal = jQuery("#litespeed_modal").iziModal({iframe: true});
|
| 195 |
+
jQuery("#litespeed_modal_href").click(function(event) {
|
| 196 |
+
event.preventDefault();
|
| 197 |
+
litespeed_modal.iziModal('open', event);
|
| 198 |
+
});;
|
| 199 |
+
</script>
|
| 200 |
+
<?php
|
| 201 |
+
|
| 202 |
+
?>
|
| 203 |
<?php echo sprintf( __( 'This can be managed from <a %2$s>%1$s</a>.', 'litespeed-cache' ), '<b>' . __( 'Manage', 'litespeed-cache' ) . '</b> -> <b>' . __( 'CDN', 'litespeed-cache' ) . '</b>', 'href="admin.php?page=lscache-dash#cdn"' ) ; ?>
|
| 204 |
</div>
|
| 205 |
+
<div class="litespeed-block">
|
| 206 |
+
<div class='litespeed-col'>
|
| 207 |
<h4><?php echo __( 'Email Address', 'litespeed-cache' ) ; ?></h4>
|
| 208 |
|
| 209 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_QUIC_EMAIL ) ; ?>
|
| 210 |
<div class="litespeed-desc">
|
| 211 |
+
<?php echo sprintf( __( 'Your Email address on %s.', 'litespeed-cache' ), 'Quic Cloud' ) ; ?>
|
| 212 |
</div>
|
| 213 |
</div>
|
| 214 |
|
| 215 |
+
<div class='litespeed-col'>
|
| 216 |
<h4><?php echo __( 'User API Key', 'litespeed-cache' ) ; ?></h4>
|
| 217 |
|
| 218 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_QUIC_KEY ) ; ?>
|
| 219 |
<div class="litespeed-desc">
|
| 220 |
+
<?php echo sprintf( __( 'Your API key is used to access %s APIs.', 'litespeed-cache' ), 'Quic Cloud' ) ; ?>
|
| 221 |
+
<?php echo sprintf( __( 'Get it from <a %1$s>%2$s</a>.', 'litespeed-cache' ), 'href="https://quic.cloud/dashboard" target="_blank"', 'Quic Cloud' ) ; ?>
|
| 222 |
</div>
|
| 223 |
</div>
|
| 224 |
|
| 225 |
+
<div class='litespeed-col'>
|
| 226 |
<h4><?php echo __( 'Site Domain', 'litespeed-cache' ) ; ?></h4>
|
| 227 |
|
| 228 |
<?php
|
| 242 |
<td>
|
| 243 |
<?php $this->build_switch( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE ) ; ?>
|
| 244 |
<div class="litespeed-desc">
|
| 245 |
+
<?php echo sprintf( __( 'Use %s API functionality.', 'litespeed-cache' ), 'Cloudflare' ) ; ?>
|
| 246 |
<?php echo sprintf( __( 'This can be managed from <a %2$s>%1$s</a>.', 'litespeed-cache' ), '<b>' . __( 'Manage', 'litespeed-cache' ) . '</b> -> <b>' . __( 'CDN', 'litespeed-cache' ) . '</b>', 'href="admin.php?page=lscache-dash#cdn"' ) ; ?>
|
| 247 |
</div>
|
| 248 |
+
<div class="litespeed-block">
|
| 249 |
+
<div class='litespeed-col'>
|
| 250 |
<h4><?php echo __( 'Email Address', 'litespeed-cache' ) ; ?></h4>
|
| 251 |
|
| 252 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE_EMAIL ) ; ?>
|
| 253 |
<div class="litespeed-desc">
|
| 254 |
+
<?php echo sprintf( __( 'Your Email address on %s.', 'litespeed-cache' ), 'Cloudflare' ) ; ?>
|
| 255 |
</div>
|
| 256 |
</div>
|
| 257 |
|
| 258 |
+
<div class='litespeed-col'>
|
| 259 |
<h4><?php echo __( 'Global API Key', 'litespeed-cache' ) ; ?></h4>
|
| 260 |
|
| 261 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CDN_CLOUDFLARE_KEY ) ; ?>
|
| 262 |
<div class="litespeed-desc">
|
| 263 |
+
<?php echo sprintf( __( 'Your API key is used to access %s APIs.', 'litespeed-cache' ), 'Cloudflare' ) ; ?>
|
| 264 |
+
<?php echo sprintf( __( 'Get it from <a %1$s>%2$s</a>.', 'litespeed-cache' ), 'href="https://www.cloudflare.com/a/profile" target="_blank"', 'Cloudflare' ) ; ?>
|
| 265 |
</div>
|
| 266 |
</div>
|
| 267 |
|
| 268 |
+
<div class='litespeed-col'>
|
| 269 |
<h4><?php echo __( 'Domain', 'litespeed-cache' ) ; ?></h4>
|
| 270 |
|
| 271 |
<?php
|
admin/tpl/setting/settings_crawler.php
CHANGED
|
@@ -135,6 +135,22 @@ if ( !defined('WPINC') ) die;
|
|
| 135 |
</td>
|
| 136 |
</tr>
|
| 137 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 138 |
<tr>
|
| 139 |
<th><?php echo __('Custom Sitemap', 'litespeed-cache'); ?></th>
|
| 140 |
<td>
|
|
@@ -149,31 +165,31 @@ if ( !defined('WPINC') ) die;
|
|
| 149 |
<tr>
|
| 150 |
<th><?php echo __('Sitemap Generation', 'litespeed-cache'); ?></th>
|
| 151 |
<td>
|
| 152 |
-
<div class="litespeed-
|
| 153 |
<div class='litespeed-cdn-mapping-col2'>
|
| 154 |
<div class="litespeed-row">
|
| 155 |
-
<div class="litespeed-
|
| 156 |
<?php
|
| 157 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_POSTS ) ;
|
| 158 |
?>
|
| 159 |
</div>
|
| 160 |
|
| 161 |
<div class="litespeed-row">
|
| 162 |
-
<div class="litespeed-
|
| 163 |
<?php
|
| 164 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_PAGES ) ;
|
| 165 |
?>
|
| 166 |
</div>
|
| 167 |
|
| 168 |
<div class="litespeed-row">
|
| 169 |
-
<div class="litespeed-
|
| 170 |
<?php
|
| 171 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_CATS ) ;
|
| 172 |
?>
|
| 173 |
</div>
|
| 174 |
|
| 175 |
<div class="litespeed-row">
|
| 176 |
-
<div class="litespeed-
|
| 177 |
<?php
|
| 178 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_TAGS ) ;
|
| 179 |
?>
|
|
@@ -181,7 +197,7 @@ if ( !defined('WPINC') ) die;
|
|
| 181 |
|
| 182 |
</div>
|
| 183 |
|
| 184 |
-
<div class='litespeed-
|
| 185 |
<h4><?php echo __('Exclude Custom Post Types', 'litespeed-cache'); ?></h4>
|
| 186 |
|
| 187 |
<?php $this->build_textarea( LiteSpeed_Cache_Config::CRWL_EXCLUDES_CPT, 40 ) ; ?>
|
|
@@ -191,7 +207,7 @@ if ( !defined('WPINC') ) die;
|
|
| 191 |
</div>
|
| 192 |
</div>
|
| 193 |
|
| 194 |
-
<div class='litespeed-
|
| 195 |
<div class="litespeed-callout-warning">
|
| 196 |
<h4><?php echo __('Available Custom Post Type','litespeed-cache'); ?></h4>
|
| 197 |
<p>
|
|
@@ -200,7 +216,7 @@ if ( !defined('WPINC') ) die;
|
|
| 200 |
</div>
|
| 201 |
</div>
|
| 202 |
|
| 203 |
-
<div class='litespeed-
|
| 204 |
<h4><?php echo __('Order links by', 'litespeed-cache'); ?></h4>
|
| 205 |
|
| 206 |
<div class="litespeed-switch">
|
| 135 |
</td>
|
| 136 |
</tr>
|
| 137 |
|
| 138 |
+
<tr>
|
| 139 |
+
<th><?php echo __( 'HTTP/2 Crawl', 'litespeed-cache' ) ; ?></th>
|
| 140 |
+
<td>
|
| 141 |
+
<?php $this->build_switch( LiteSpeed_Cache_Config::CRWL_HTTP2 ) ; ?>
|
| 142 |
+
<div class="litespeed-desc">
|
| 143 |
+
<?php echo __( 'Crawl using the HTTP/2 protocal.', 'litespeed-cache' ) ; ?>
|
| 144 |
+
<?php echo __( 'Current curl HTTP/2 extension status', 'litespeed-cache' ) ; ?>:
|
| 145 |
+
<?php if ( defined( 'CURL_HTTP_VERSION_2' ) ) : ?>
|
| 146 |
+
<font class="litespeed-warning"><?php echo __( 'Enabled', 'litespeed-cache' ) ; ?></font>
|
| 147 |
+
<?php else : ?>
|
| 148 |
+
<font class="litespeed-warning"><?php echo __( 'Disabled', 'litespeed-cache' ) ; ?></font>
|
| 149 |
+
<?php endif ; ?>
|
| 150 |
+
</div>
|
| 151 |
+
</td>
|
| 152 |
+
</tr>
|
| 153 |
+
|
| 154 |
<tr>
|
| 155 |
<th><?php echo __('Custom Sitemap', 'litespeed-cache'); ?></th>
|
| 156 |
<td>
|
| 165 |
<tr>
|
| 166 |
<th><?php echo __('Sitemap Generation', 'litespeed-cache'); ?></th>
|
| 167 |
<td>
|
| 168 |
+
<div class="litespeed-block">
|
| 169 |
<div class='litespeed-cdn-mapping-col2'>
|
| 170 |
<div class="litespeed-row">
|
| 171 |
+
<div class="litespeed-col-inc"><?php echo __( 'Include Posts', 'litespeed-cache' ) ; ?></div>
|
| 172 |
<?php
|
| 173 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_POSTS ) ;
|
| 174 |
?>
|
| 175 |
</div>
|
| 176 |
|
| 177 |
<div class="litespeed-row">
|
| 178 |
+
<div class="litespeed-col-inc"><?php echo __( 'Include Pages', 'litespeed-cache' ) ; ?></div>
|
| 179 |
<?php
|
| 180 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_PAGES ) ;
|
| 181 |
?>
|
| 182 |
</div>
|
| 183 |
|
| 184 |
<div class="litespeed-row">
|
| 185 |
+
<div class="litespeed-col-inc"><?php echo __( 'Include Categories', 'litespeed-cache' ) ; ?></div>
|
| 186 |
<?php
|
| 187 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_CATS ) ;
|
| 188 |
?>
|
| 189 |
</div>
|
| 190 |
|
| 191 |
<div class="litespeed-row">
|
| 192 |
+
<div class="litespeed-col-inc"><?php echo __( 'Include Tags', 'litespeed-cache' ) ; ?></div>
|
| 193 |
<?php
|
| 194 |
$this->build_toggle( LiteSpeed_Cache_Config::CRWL_TAGS ) ;
|
| 195 |
?>
|
| 197 |
|
| 198 |
</div>
|
| 199 |
|
| 200 |
+
<div class='litespeed-col-auto'>
|
| 201 |
<h4><?php echo __('Exclude Custom Post Types', 'litespeed-cache'); ?></h4>
|
| 202 |
|
| 203 |
<?php $this->build_textarea( LiteSpeed_Cache_Config::CRWL_EXCLUDES_CPT, 40 ) ; ?>
|
| 207 |
</div>
|
| 208 |
</div>
|
| 209 |
|
| 210 |
+
<div class='litespeed-col-auto'>
|
| 211 |
<div class="litespeed-callout-warning">
|
| 212 |
<h4><?php echo __('Available Custom Post Type','litespeed-cache'); ?></h4>
|
| 213 |
<p>
|
| 216 |
</div>
|
| 217 |
</div>
|
| 218 |
|
| 219 |
+
<div class='litespeed-col-auto'>
|
| 220 |
<h4><?php echo __('Order links by', 'litespeed-cache'); ?></h4>
|
| 221 |
|
| 222 |
<div class="litespeed-switch">
|
admin/tpl/setting/settings_esi.php
CHANGED
|
@@ -66,9 +66,9 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 66 |
<th><?php echo __('Vary Group', 'litespeed-cache'); ?></th>
|
| 67 |
<td>
|
| 68 |
<table class="litespeed-vary-table"><tbody>
|
| 69 |
-
<?php foreach ( $roles as $role ): ?>
|
| 70 |
<tr>
|
| 71 |
-
<td class='litespeed-vary-title'><?php echo $
|
| 72 |
<td class='litespeed-vary-val'>
|
| 73 |
<input type="text" class="litespeed-input-short"
|
| 74 |
name="<?php echo LiteSpeed_Cache_Config::VARY_GROUP ; ?>[<?php echo $role ; ?>]"
|
| 66 |
<th><?php echo __('Vary Group', 'litespeed-cache'); ?></th>
|
| 67 |
<td>
|
| 68 |
<table class="litespeed-vary-table"><tbody>
|
| 69 |
+
<?php foreach ( $roles as $role => $title ): ?>
|
| 70 |
<tr>
|
| 71 |
+
<td class='litespeed-vary-title'><?php echo $title ; ?></td>
|
| 72 |
<td class='litespeed-vary-val'>
|
| 73 |
<input type="text" class="litespeed-input-short"
|
| 74 |
name="<?php echo LiteSpeed_Cache_Config::VARY_GROUP ; ?>[<?php echo $role ; ?>]"
|
admin/tpl/setting/settings_excludes.php
CHANGED
|
@@ -60,7 +60,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 60 |
</i>
|
| 61 |
</div>
|
| 62 |
<div class="litespeed-callout-warning">
|
| 63 |
-
<h4><?php echo __('NOTE
|
| 64 |
<ol>
|
| 65 |
<li><?php echo __('If the category slug is not found, the category will be removed from the list on save.', 'litespeed-cache'); ?></li>
|
| 66 |
<li><?php echo sprintf(__('To exclude %1$s, insert %2$s.', 'litespeed-cache'),
|
|
@@ -98,7 +98,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 98 |
</i>
|
| 99 |
</div>
|
| 100 |
<div class="litespeed-callout-warning">
|
| 101 |
-
<h4><?php echo __('NOTE
|
| 102 |
<ol>
|
| 103 |
<li><?php echo __('If the tag slug is not found, the tag will be removed from the list on save.', 'litespeed-cache'); ?></li>
|
| 104 |
<li><?php echo sprintf(__('To exclude %1$s, insert %2$s.', 'litespeed-cache'),
|
|
@@ -123,8 +123,8 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 123 |
<tr>
|
| 124 |
<th><?php echo __('Do Not Cache Roles', 'litespeed-cache'); ?></th>
|
| 125 |
<td>
|
| 126 |
-
<?php foreach ( $roles as $role ): ?>
|
| 127 |
-
<?php $this->build_checkbox( LiteSpeed_Cache_Config::EXCLUDE_CACHE_ROLES . "][", $
|
| 128 |
<?php endforeach; ?>
|
| 129 |
<div class="litespeed-desc">
|
| 130 |
<?php echo __( 'Selected roles will be excluded from cache.', 'litespeed-cache' ) ; ?>
|
| 60 |
</i>
|
| 61 |
</div>
|
| 62 |
<div class="litespeed-callout-warning">
|
| 63 |
+
<h4><?php echo __('NOTE', 'litespeed-cache'); ?>:</h4>
|
| 64 |
<ol>
|
| 65 |
<li><?php echo __('If the category slug is not found, the category will be removed from the list on save.', 'litespeed-cache'); ?></li>
|
| 66 |
<li><?php echo sprintf(__('To exclude %1$s, insert %2$s.', 'litespeed-cache'),
|
| 98 |
</i>
|
| 99 |
</div>
|
| 100 |
<div class="litespeed-callout-warning">
|
| 101 |
+
<h4><?php echo __('NOTE', 'litespeed-cache'); ?>:</h4>
|
| 102 |
<ol>
|
| 103 |
<li><?php echo __('If the tag slug is not found, the tag will be removed from the list on save.', 'litespeed-cache'); ?></li>
|
| 104 |
<li><?php echo sprintf(__('To exclude %1$s, insert %2$s.', 'litespeed-cache'),
|
| 123 |
<tr>
|
| 124 |
<th><?php echo __('Do Not Cache Roles', 'litespeed-cache'); ?></th>
|
| 125 |
<td>
|
| 126 |
+
<?php foreach ( $roles as $role => $title ): ?>
|
| 127 |
+
<?php $this->build_checkbox( LiteSpeed_Cache_Config::EXCLUDE_CACHE_ROLES . "][", $title, $this->config->in_exclude_cache_roles( $role ), $role ) ; ?>
|
| 128 |
<?php endforeach; ?>
|
| 129 |
<div class="litespeed-desc">
|
| 130 |
<?php echo __( 'Selected roles will be excluded from cache.', 'litespeed-cache' ) ; ?>
|
admin/tpl/setting/settings_inc.cache_browser.php
CHANGED
|
@@ -9,7 +9,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 9 |
<div class="litespeed-desc">
|
| 10 |
<?php echo __( 'Browser caching stores static files locally in the user\'s browser. Turn on this setting to reduce repeated requests for static files.', 'litespeed-cache' ) ; ?>
|
| 11 |
<br /><font class="litespeed-warning">
|
| 12 |
-
<?php echo __('NOTE
|
| 13 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 14 |
</font>
|
| 15 |
<br /><?php echo sprintf( __( 'You can turn on browser caching in server admin too. <a %s>Learn more about LiteSpeed browser cache setting</a>.', 'litespeed-cache' ), 'href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:browser_cache" target="_blank"' ) ; ?>
|
| 9 |
<div class="litespeed-desc">
|
| 10 |
<?php echo __( 'Browser caching stores static files locally in the user\'s browser. Turn on this setting to reduce repeated requests for static files.', 'litespeed-cache' ) ; ?>
|
| 11 |
<br /><font class="litespeed-warning">
|
| 12 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 13 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 14 |
</font>
|
| 15 |
<br /><?php echo sprintf( __( 'You can turn on browser caching in server admin too. <a %s>Learn more about LiteSpeed browser cache setting</a>.', 'litespeed-cache' ), 'href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:browser_cache" target="_blank"' ) ; ?>
|
admin/tpl/setting/settings_inc.cache_favicon.php
CHANGED
|
@@ -10,7 +10,7 @@ if (!defined('WPINC')) die;
|
|
| 10 |
<?php echo __('favicon.ico is requested on most pages.', 'litespeed-cache'); ?>
|
| 11 |
<?php echo __('Caching this resource may improve server performance by avoiding unnecessary PHP calls.', 'litespeed-cache'); ?>
|
| 12 |
<br /><font class="litespeed-warning">
|
| 13 |
-
<?php echo __('NOTE
|
| 14 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 15 |
</font>
|
| 16 |
</div>
|
| 10 |
<?php echo __('favicon.ico is requested on most pages.', 'litespeed-cache'); ?>
|
| 11 |
<?php echo __('Caching this resource may improve server performance by avoiding unnecessary PHP calls.', 'litespeed-cache'); ?>
|
| 12 |
<br /><font class="litespeed-warning">
|
| 13 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 14 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 15 |
</font>
|
| 16 |
</div>
|
admin/tpl/setting/settings_inc.cache_mobile.php
CHANGED
|
@@ -14,7 +14,7 @@ if (!defined('WPINC')) die;
|
|
| 14 |
<?php echo __('When enabled, mobile views will be cached separately.', 'litespeed-cache'); ?>
|
| 15 |
<?php echo __('A site built with responsive design does not need to check this.', 'litespeed-cache'); ?>
|
| 16 |
<br /><font class="litespeed-warning">
|
| 17 |
-
<?php echo __( 'NOTE
|
| 18 |
<?php echo __( 'This setting will edit the .htaccess file.', 'litespeed-cache' ) ; ?>
|
| 19 |
</font>
|
| 20 |
</div>
|
|
@@ -63,7 +63,7 @@ if (!defined('WPINC')) die;
|
|
| 63 |
<br />
|
| 64 |
<?php echo sprintf( __( 'The default list WordPress uses is %s', 'litespeed-cache' ), "<code>$wp_default_mobile</code>" ) ; ?>
|
| 65 |
<br /><font class="litespeed-warning">
|
| 66 |
-
<?php echo __( 'NOTE
|
| 67 |
<?php echo sprintf( __( 'If %1$s is %2$s, then %3$s must be populated!', 'litespeed-cache' ), '<code>' . __('Cache Mobile', 'litespeed-cache') . '</code>', '<code>' . __('ON', 'litespeed-cache') . '</code>', '<code>' . __('List of Mobile User Agents', 'litespeed-cache') . '</code>' ) ; ?>
|
| 68 |
</font>
|
| 69 |
</div>
|
| 14 |
<?php echo __('When enabled, mobile views will be cached separately.', 'litespeed-cache'); ?>
|
| 15 |
<?php echo __('A site built with responsive design does not need to check this.', 'litespeed-cache'); ?>
|
| 16 |
<br /><font class="litespeed-warning">
|
| 17 |
+
<?php echo __( 'NOTE', 'litespeed-cache' ) ; ?>:
|
| 18 |
<?php echo __( 'This setting will edit the .htaccess file.', 'litespeed-cache' ) ; ?>
|
| 19 |
</font>
|
| 20 |
</div>
|
| 63 |
<br />
|
| 64 |
<?php echo sprintf( __( 'The default list WordPress uses is %s', 'litespeed-cache' ), "<code>$wp_default_mobile</code>" ) ; ?>
|
| 65 |
<br /><font class="litespeed-warning">
|
| 66 |
+
<?php echo __( 'NOTE', 'litespeed-cache' ) ; ?>:
|
| 67 |
<?php echo sprintf( __( 'If %1$s is %2$s, then %3$s must be populated!', 'litespeed-cache' ), '<code>' . __('Cache Mobile', 'litespeed-cache') . '</code>', '<code>' . __('ON', 'litespeed-cache') . '</code>', '<code>' . __('List of Mobile User Agents', 'litespeed-cache') . '</code>' ) ; ?>
|
| 68 |
</font>
|
| 69 |
</div>
|
admin/tpl/setting/settings_inc.cache_object.php
CHANGED
|
@@ -32,8 +32,8 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 32 |
<?php echo __( 'Use object cache functionality.', 'litespeed-cache' ) ; ?>
|
| 33 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:cache:object_cache" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 34 |
</div>
|
| 35 |
-
<div class="litespeed-
|
| 36 |
-
<div class='litespeed-
|
| 37 |
<h4><?php echo __( 'Method', 'litespeed-cache' ) ; ?></h4>
|
| 38 |
|
| 39 |
<div class="litespeed-switch">
|
|
@@ -42,7 +42,7 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 42 |
</div>
|
| 43 |
</div>
|
| 44 |
|
| 45 |
-
<div class='litespeed-
|
| 46 |
<h4><?php echo __( 'Host', 'litespeed-cache' ) ; ?></h4>
|
| 47 |
|
| 48 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_HOST ) ; ?>
|
|
@@ -51,13 +51,13 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 51 |
</div>
|
| 52 |
</div>
|
| 53 |
|
| 54 |
-
<div class='litespeed-
|
| 55 |
<h4><?php echo __( 'Port', 'litespeed-cache' ) ; ?></h4>
|
| 56 |
|
| 57 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PORT, 'litespeed-input-short2' ) ; ?>
|
| 58 |
</div>
|
| 59 |
|
| 60 |
-
<div class='litespeed-
|
| 61 |
<h4><?php echo __( 'Default Object Lifetime', 'litespeed-cache' ) ; ?></h4>
|
| 62 |
|
| 63 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_LIFE, 'litespeed-input-short2' ) ; ?> <?php echo __( 'seconds', 'litespeed-cache' ) ; ?>
|
|
@@ -66,7 +66,7 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 66 |
</div>
|
| 67 |
</div>
|
| 68 |
|
| 69 |
-
<div class='litespeed-
|
| 70 |
<h4><?php echo __( 'Status', 'litespeed-cache' ) ; ?></h4>
|
| 71 |
|
| 72 |
<?php echo sprintf( __( '%s Extension', 'litespeed-cache' ), 'Memcached' ) ; ?>: <?php echo $mem_enabled ; ?><br />
|
|
@@ -75,9 +75,9 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 75 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:cache:object_cache#how_to_debug" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 76 |
</div>
|
| 77 |
|
| 78 |
-
<div class='litespeed-
|
| 79 |
|
| 80 |
-
<div class='litespeed-
|
| 81 |
<h4><?php echo __( 'Username', 'litespeed-cache' ) ; ?></h4>
|
| 82 |
|
| 83 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_USER ) ; ?>
|
|
@@ -86,7 +86,7 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 86 |
</div>
|
| 87 |
</div>
|
| 88 |
|
| 89 |
-
<div class='litespeed-
|
| 90 |
<h4><?php echo __( 'Password', 'litespeed-cache' ) ; ?></h4>
|
| 91 |
|
| 92 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PSWD ) ; ?>
|
|
@@ -95,7 +95,7 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 95 |
</div>
|
| 96 |
</div>
|
| 97 |
|
| 98 |
-
<div class='litespeed-
|
| 99 |
<h4><?php echo __( 'Redis Database ID', 'litespeed-cache' ) ; ?></h4>
|
| 100 |
|
| 101 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_DB_ID, 'litespeed-input-short' ) ; ?>
|
|
@@ -104,9 +104,9 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 104 |
</div>
|
| 105 |
</div>
|
| 106 |
|
| 107 |
-
<div class='litespeed-
|
| 108 |
|
| 109 |
-
<div class='litespeed-
|
| 110 |
<h4><?php echo __( 'Global Groups', 'litespeed-cache' ) ; ?></h4>
|
| 111 |
<?php $this->build_textarea2( LiteSpeed_Cache_Config::ITEM_OBJECT_GLOBAL_GROUPS, 30 ) ; ?>
|
| 112 |
<div class="litespeed-desc">
|
|
@@ -115,7 +115,7 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 115 |
</div>
|
| 116 |
</div>
|
| 117 |
|
| 118 |
-
<div class='litespeed-
|
| 119 |
<h4><?php echo __( 'Do Not Cache Groups', 'litespeed-cache' ) ; ?></h4>
|
| 120 |
<?php $this->build_textarea2( LiteSpeed_Cache_Config::ITEM_OBJECT_NON_PERSISTENT_GROUPS, 30 ) ; ?>
|
| 121 |
<div class="litespeed-desc">
|
|
@@ -123,16 +123,16 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 123 |
</div>
|
| 124 |
</div>
|
| 125 |
|
| 126 |
-
<div class='litespeed-
|
| 127 |
<div class="litespeed-row">
|
| 128 |
-
<div class="litespeed-
|
| 129 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PERSISTENT ) ; ?>
|
| 130 |
</div>
|
| 131 |
<div class="litespeed-desc">
|
| 132 |
<?php echo __( 'Use keep-alive connections to speed up cache operations.', 'litespeed-cache' ) ; ?>
|
| 133 |
</div>
|
| 134 |
<div class="litespeed-row litespeed-top30">
|
| 135 |
-
<div class="litespeed-
|
| 136 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_ADMIN ) ; ?>
|
| 137 |
</div>
|
| 138 |
<div class="litespeed-desc">
|
|
@@ -140,9 +140,9 @@ $hide_redis_options = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_CACH
|
|
| 140 |
</div>
|
| 141 |
</div>
|
| 142 |
|
| 143 |
-
<div class='litespeed-
|
| 144 |
<div class="litespeed-row">
|
| 145 |
-
<div class="litespeed-
|
| 146 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_TRANSIENTS ) ; ?>
|
| 147 |
</div>
|
| 148 |
<div class="litespeed-desc">
|
| 32 |
<?php echo __( 'Use object cache functionality.', 'litespeed-cache' ) ; ?>
|
| 33 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:cache:object_cache" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 34 |
</div>
|
| 35 |
+
<div class="litespeed-block">
|
| 36 |
+
<div class='litespeed-col-auto'>
|
| 37 |
<h4><?php echo __( 'Method', 'litespeed-cache' ) ; ?></h4>
|
| 38 |
|
| 39 |
<div class="litespeed-switch">
|
| 42 |
</div>
|
| 43 |
</div>
|
| 44 |
|
| 45 |
+
<div class='litespeed-col-auto'>
|
| 46 |
<h4><?php echo __( 'Host', 'litespeed-cache' ) ; ?></h4>
|
| 47 |
|
| 48 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_HOST ) ; ?>
|
| 51 |
</div>
|
| 52 |
</div>
|
| 53 |
|
| 54 |
+
<div class='litespeed-col-auto'>
|
| 55 |
<h4><?php echo __( 'Port', 'litespeed-cache' ) ; ?></h4>
|
| 56 |
|
| 57 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PORT, 'litespeed-input-short2' ) ; ?>
|
| 58 |
</div>
|
| 59 |
|
| 60 |
+
<div class='litespeed-col-auto'>
|
| 61 |
<h4><?php echo __( 'Default Object Lifetime', 'litespeed-cache' ) ; ?></h4>
|
| 62 |
|
| 63 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_LIFE, 'litespeed-input-short2' ) ; ?> <?php echo __( 'seconds', 'litespeed-cache' ) ; ?>
|
| 66 |
</div>
|
| 67 |
</div>
|
| 68 |
|
| 69 |
+
<div class='litespeed-col-auto'>
|
| 70 |
<h4><?php echo __( 'Status', 'litespeed-cache' ) ; ?></h4>
|
| 71 |
|
| 72 |
<?php echo sprintf( __( '%s Extension', 'litespeed-cache' ), 'Memcached' ) ; ?>: <?php echo $mem_enabled ; ?><br />
|
| 75 |
<a href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:configuration:cache:object_cache#how_to_debug" target="_blank"><?php echo __('Learn More', 'litespeed-cache') ; ?></a>
|
| 76 |
</div>
|
| 77 |
|
| 78 |
+
<div class='litespeed-col-br'></div>
|
| 79 |
|
| 80 |
+
<div class='litespeed-col-auto <?php echo $hide_mem_options ; ?>' data="litespeed-mem-divs">
|
| 81 |
<h4><?php echo __( 'Username', 'litespeed-cache' ) ; ?></h4>
|
| 82 |
|
| 83 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_USER ) ; ?>
|
| 86 |
</div>
|
| 87 |
</div>
|
| 88 |
|
| 89 |
+
<div class='litespeed-col-auto'>
|
| 90 |
<h4><?php echo __( 'Password', 'litespeed-cache' ) ; ?></h4>
|
| 91 |
|
| 92 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PSWD ) ; ?>
|
| 95 |
</div>
|
| 96 |
</div>
|
| 97 |
|
| 98 |
+
<div class='litespeed-col-auto <?php echo $hide_redis_options ; ?>' data="litespeed-redis-divs">
|
| 99 |
<h4><?php echo __( 'Redis Database ID', 'litespeed-cache' ) ; ?></h4>
|
| 100 |
|
| 101 |
<?php $this->build_input( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_DB_ID, 'litespeed-input-short' ) ; ?>
|
| 104 |
</div>
|
| 105 |
</div>
|
| 106 |
|
| 107 |
+
<div class='litespeed-col-br'></div>
|
| 108 |
|
| 109 |
+
<div class='litespeed-col-auto'>
|
| 110 |
<h4><?php echo __( 'Global Groups', 'litespeed-cache' ) ; ?></h4>
|
| 111 |
<?php $this->build_textarea2( LiteSpeed_Cache_Config::ITEM_OBJECT_GLOBAL_GROUPS, 30 ) ; ?>
|
| 112 |
<div class="litespeed-desc">
|
| 115 |
</div>
|
| 116 |
</div>
|
| 117 |
|
| 118 |
+
<div class='litespeed-col-auto'>
|
| 119 |
<h4><?php echo __( 'Do Not Cache Groups', 'litespeed-cache' ) ; ?></h4>
|
| 120 |
<?php $this->build_textarea2( LiteSpeed_Cache_Config::ITEM_OBJECT_NON_PERSISTENT_GROUPS, 30 ) ; ?>
|
| 121 |
<div class="litespeed-desc">
|
| 123 |
</div>
|
| 124 |
</div>
|
| 125 |
|
| 126 |
+
<div class='litespeed-col-auto'>
|
| 127 |
<div class="litespeed-row">
|
| 128 |
+
<div class="litespeed-col-inc"><?php echo __( 'Persistent Connection', 'litespeed-cache' ) ; ?></div>
|
| 129 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_PERSISTENT ) ; ?>
|
| 130 |
</div>
|
| 131 |
<div class="litespeed-desc">
|
| 132 |
<?php echo __( 'Use keep-alive connections to speed up cache operations.', 'litespeed-cache' ) ; ?>
|
| 133 |
</div>
|
| 134 |
<div class="litespeed-row litespeed-top30">
|
| 135 |
+
<div class="litespeed-col-inc"><?php echo __( 'Cache Wp-Admin', 'litespeed-cache' ) ; ?></div>
|
| 136 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_ADMIN ) ; ?>
|
| 137 |
</div>
|
| 138 |
<div class="litespeed-desc">
|
| 140 |
</div>
|
| 141 |
</div>
|
| 142 |
|
| 143 |
+
<div class='litespeed-col-auto'>
|
| 144 |
<div class="litespeed-row">
|
| 145 |
+
<div class="litespeed-col-inc"><?php echo __( 'Store Transients', 'litespeed-cache' ) ; ?></div>
|
| 146 |
<?php $this->build_toggle( LiteSpeed_Cache_Config::OPID_CACHE_OBJECT_TRANSIENTS ) ; ?>
|
| 147 |
</div>
|
| 148 |
<div class="litespeed-desc">
|
admin/tpl/setting/settings_inc.cache_resources.php
CHANGED
|
@@ -11,7 +11,7 @@ if (!defined('WPINC')) die;
|
|
| 11 |
<?php echo __('Some themes and plugins add resources via a PHP request.', 'litespeed-cache'); ?>
|
| 12 |
<?php echo __('Caching these pages may improve server performance by avoiding unnecessary PHP calls.', 'litespeed-cache'); ?>
|
| 13 |
<br /><font class="litespeed-warning">
|
| 14 |
-
<?php echo __('NOTE
|
| 15 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 16 |
</font>
|
| 17 |
</div>
|
| 11 |
<?php echo __('Some themes and plugins add resources via a PHP request.', 'litespeed-cache'); ?>
|
| 12 |
<?php echo __('Caching these pages may improve server performance by avoiding unnecessary PHP calls.', 'litespeed-cache'); ?>
|
| 13 |
<br /><font class="litespeed-warning">
|
| 14 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 15 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 16 |
</font>
|
| 17 |
</div>
|
admin/tpl/setting/settings_inc.exclude_cookies.php
CHANGED
|
@@ -19,7 +19,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 19 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 20 |
</i>
|
| 21 |
<br /><font class="litespeed-warning">
|
| 22 |
-
<?php echo __('NOTE
|
| 23 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 24 |
</font>
|
| 25 |
</div>
|
| 19 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 20 |
</i>
|
| 21 |
<br /><font class="litespeed-warning">
|
| 22 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 23 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 24 |
</font>
|
| 25 |
</div>
|
admin/tpl/setting/settings_inc.exclude_useragent.php
CHANGED
|
@@ -18,7 +18,7 @@ if (!defined('WPINC')) die;
|
|
| 18 |
<?php echo sprintf( __( 'Spaces should have a backslash in front of them, %s.', 'litespeed-cache' ), '<code>\</code>' ) ; ?>
|
| 19 |
</i>
|
| 20 |
<br /><font class="litespeed-warning">
|
| 21 |
-
<?php echo __('NOTE
|
| 22 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 23 |
</font>
|
| 24 |
</div>
|
| 18 |
<?php echo sprintf( __( 'Spaces should have a backslash in front of them, %s.', 'litespeed-cache' ), '<code>\</code>' ) ; ?>
|
| 19 |
</i>
|
| 20 |
<br /><font class="litespeed-warning">
|
| 21 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 22 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 23 |
</font>
|
| 24 |
</div>
|
admin/tpl/setting/settings_inc.media_webp.php
CHANGED
|
@@ -9,7 +9,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 9 |
<div class="litespeed-desc">
|
| 10 |
<?php echo sprintf( __( 'Significantly improve load time by replacing images with their optimized %s versions.', 'litespeed-cache' ), '.webp' ) ; ?>
|
| 11 |
<br /><font class="litespeed-warning">
|
| 12 |
-
<?php echo __('NOTE
|
| 13 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 14 |
</font>
|
| 15 |
</div>
|
| 9 |
<div class="litespeed-desc">
|
| 10 |
<?php echo sprintf( __( 'Significantly improve load time by replacing images with their optimized %s versions.', 'litespeed-cache' ), '.webp' ) ; ?>
|
| 11 |
<br /><font class="litespeed-warning">
|
| 12 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 13 |
<?php echo __('This setting will edit the .htaccess file.', 'litespeed-cache'); ?>
|
| 14 |
</font>
|
| 15 |
</div>
|
admin/tpl/setting/settings_media.php
CHANGED
|
@@ -33,7 +33,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 33 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 34 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 35 |
<br /><font class="litespeed-success">
|
| 36 |
-
<?php echo __('API
|
| 37 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_media_lazy_img_excludes</code>' ) ; ?>
|
| 38 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-lazy="1"</code>' ) ; ?>
|
| 39 |
</font>
|
| 33 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 34 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 35 |
<br /><font class="litespeed-success">
|
| 36 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 37 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_media_lazy_img_excludes</code>' ) ; ?>
|
| 38 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-lazy="1"</code>' ) ; ?>
|
| 39 |
</font>
|
admin/tpl/setting/settings_optimize.php
CHANGED
|
@@ -134,7 +134,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 134 |
<?php echo __( 'Optimize CSS delivery. This will load Google Fonts asynchronously too.', 'litespeed-cache' ) ; ?>
|
| 135 |
<?php echo __( 'This can improve your speed score in services like Pingdom, GTmetrix and PageSpeed.', 'litespeed-cache' ) ; ?>
|
| 136 |
<br /><font class="litespeed-success">
|
| 137 |
-
<?php echo __('API
|
| 138 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-async="1"</code>' ) ; ?>
|
| 139 |
</font>
|
| 140 |
</div>
|
|
@@ -159,7 +159,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 159 |
<div class="litespeed-desc">
|
| 160 |
<?php echo sprintf( __( 'Improve compatibility with inline JS by preventing jQuery optimization. (Recommended Setting: %s)', 'litespeed-cache' ), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 161 |
<br /><font class="litespeed-warning">
|
| 162 |
-
<?php echo __('NOTE
|
| 163 |
<?php echo sprintf( __( 'If there is any JS error related to %1$s when enabled %2$s, please try this option.', 'litespeed-cache' ), 'jQuery', __( 'JS Combine', 'litespeed-cache' ) ) ; ?>
|
| 164 |
</font>
|
| 165 |
</div>
|
| 134 |
<?php echo __( 'Optimize CSS delivery. This will load Google Fonts asynchronously too.', 'litespeed-cache' ) ; ?>
|
| 135 |
<?php echo __( 'This can improve your speed score in services like Pingdom, GTmetrix and PageSpeed.', 'litespeed-cache' ) ; ?>
|
| 136 |
<br /><font class="litespeed-success">
|
| 137 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 138 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-async="1"</code>' ) ; ?>
|
| 139 |
</font>
|
| 140 |
</div>
|
| 159 |
<div class="litespeed-desc">
|
| 160 |
<?php echo sprintf( __( 'Improve compatibility with inline JS by preventing jQuery optimization. (Recommended Setting: %s)', 'litespeed-cache' ), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 161 |
<br /><font class="litespeed-warning">
|
| 162 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 163 |
<?php echo sprintf( __( 'If there is any JS error related to %1$s when enabled %2$s, please try this option.', 'litespeed-cache' ), 'jQuery', __( 'JS Combine', 'litespeed-cache' ) ) ; ?>
|
| 164 |
</font>
|
| 165 |
</div>
|
admin/tpl/setting/settings_purge.php
CHANGED
|
@@ -48,7 +48,7 @@ $breakArr = array(
|
|
| 48 |
<th><?php echo __('Auto Purge Rules For Publish/Update', 'litespeed-cache'); ?></th>
|
| 49 |
<td>
|
| 50 |
<div class="litespeed-callout-warning">
|
| 51 |
-
<h4><?php echo __('Note
|
| 52 |
<i>
|
| 53 |
<?php echo __('Select "All" if there are dynamic widgets linked to posts on pages other than the front or home pages.', 'litespeed-cache'); ?><br />
|
| 54 |
<?php echo __('Other checkboxes will be ignored.', 'litespeed-cache'); ?><br />
|
| 48 |
<th><?php echo __('Auto Purge Rules For Publish/Update', 'litespeed-cache'); ?></th>
|
| 49 |
<td>
|
| 50 |
<div class="litespeed-callout-warning">
|
| 51 |
+
<h4><?php echo __('Note', 'litespeed-cache'); ?></h4>:
|
| 52 |
<i>
|
| 53 |
<?php echo __('Select "All" if there are dynamic widgets linked to posts on pages other than the front or home pages.', 'litespeed-cache'); ?><br />
|
| 54 |
<?php echo __('Other checkboxes will be ignored.', 'litespeed-cache'); ?><br />
|
admin/tpl/setting/settings_tuning.php
CHANGED
|
@@ -17,11 +17,11 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 17 |
<?php echo __( 'Load combined CSS files before other CSS files.', 'litespeed-cache' ) ; ?>
|
| 18 |
<?php echo sprintf( __( 'Set to %s by default.', 'litespeed-cache' ), __( 'OFF', 'litespeed-cache' ) ) ; ?>
|
| 19 |
<br /><font class="litespeed-warning">
|
| 20 |
-
<?php echo __('NOTE
|
| 21 |
<?php echo sprintf( __( 'Only set to %s when changing the order of combined and uncombined CSS is needed.', 'litespeed-cache'), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 22 |
</font>
|
| 23 |
<br /><font class="litespeed-success">
|
| 24 |
-
<?php echo __('API
|
| 25 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded from moving to top.', 'litespeed-cache' ), '<code>data-optimized="0"</code>' ) ; ?>
|
| 26 |
</font>
|
| 27 |
</div>
|
|
@@ -37,7 +37,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 37 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 38 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 39 |
<br /><font class="litespeed-success">
|
| 40 |
-
<?php echo __('API
|
| 41 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_optimize_css_excludes</code>' ) ; ?>
|
| 42 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-optimize="1"</code>' ) ; ?>
|
| 43 |
</font>
|
|
@@ -53,11 +53,11 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 53 |
<?php echo __( 'Load combined JS files before other JS files.', 'litespeed-cache' ) ; ?>
|
| 54 |
<?php echo sprintf( __( 'Set to %s by default.', 'litespeed-cache' ), __( 'OFF', 'litespeed-cache' ) ) ; ?>
|
| 55 |
<br /><font class="litespeed-warning">
|
| 56 |
-
<?php echo __('NOTE
|
| 57 |
<?php echo sprintf( __( 'Only set to %s when changing the order of combined and uncombined JS is needed.', 'litespeed-cache'), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 58 |
</font>
|
| 59 |
<br /><font class="litespeed-success">
|
| 60 |
-
<?php echo __('API
|
| 61 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded from moving to top/bottom.', 'litespeed-cache' ), '<code>data-optimized="0"</code>' ) ; ?>
|
| 62 |
</font>
|
| 63 |
</div>
|
|
@@ -73,7 +73,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 73 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 74 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 75 |
<br /><font class="litespeed-success">
|
| 76 |
-
<?php echo __('API
|
| 77 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_optimize_js_excludes</code>' ) ; ?>
|
| 78 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-optimize="1"</code>' ) ; ?>
|
| 79 |
</font>
|
|
@@ -145,7 +145,7 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 145 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 146 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 147 |
<br /><font class="litespeed-success">
|
| 148 |
-
<?php echo __('API
|
| 149 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_optm_js_defer_exc</code>' ) ; ?>
|
| 150 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-defer="1"</code>' ) ; ?>
|
| 151 |
</font>
|
|
@@ -180,8 +180,8 @@ if ( ! defined( 'WPINC' ) ) die ;
|
|
| 180 |
<tr>
|
| 181 |
<th><?php echo __('Role Excludes', 'litespeed-cache'); ?></th>
|
| 182 |
<td>
|
| 183 |
-
<?php foreach ( $roles as $role ): ?>
|
| 184 |
-
<?php $this->build_checkbox( LiteSpeed_Cache_Config::EXCLUDE_OPTIMIZATION_ROLES . "][", $
|
| 185 |
<?php endforeach; ?>
|
| 186 |
<div class="litespeed-desc">
|
| 187 |
<?php echo __( 'Selected roles will be excluded from all optimizations.', 'litespeed-cache' ) ; ?>
|
| 17 |
<?php echo __( 'Load combined CSS files before other CSS files.', 'litespeed-cache' ) ; ?>
|
| 18 |
<?php echo sprintf( __( 'Set to %s by default.', 'litespeed-cache' ), __( 'OFF', 'litespeed-cache' ) ) ; ?>
|
| 19 |
<br /><font class="litespeed-warning">
|
| 20 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 21 |
<?php echo sprintf( __( 'Only set to %s when changing the order of combined and uncombined CSS is needed.', 'litespeed-cache'), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 22 |
</font>
|
| 23 |
<br /><font class="litespeed-success">
|
| 24 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 25 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded from moving to top.', 'litespeed-cache' ), '<code>data-optimized="0"</code>' ) ; ?>
|
| 26 |
</font>
|
| 27 |
</div>
|
| 37 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 38 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 39 |
<br /><font class="litespeed-success">
|
| 40 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 41 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_optimize_css_excludes</code>' ) ; ?>
|
| 42 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-optimize="1"</code>' ) ; ?>
|
| 43 |
</font>
|
| 53 |
<?php echo __( 'Load combined JS files before other JS files.', 'litespeed-cache' ) ; ?>
|
| 54 |
<?php echo sprintf( __( 'Set to %s by default.', 'litespeed-cache' ), __( 'OFF', 'litespeed-cache' ) ) ; ?>
|
| 55 |
<br /><font class="litespeed-warning">
|
| 56 |
+
<?php echo __('NOTE', 'litespeed-cache'); ?>:
|
| 57 |
<?php echo sprintf( __( 'Only set to %s when changing the order of combined and uncombined JS is needed.', 'litespeed-cache'), __( 'ON', 'litespeed-cache' ) ) ; ?>
|
| 58 |
</font>
|
| 59 |
<br /><font class="litespeed-success">
|
| 60 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 61 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded from moving to top/bottom.', 'litespeed-cache' ), '<code>data-optimized="0"</code>' ) ; ?>
|
| 62 |
</font>
|
| 63 |
</div>
|
| 73 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 74 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 75 |
<br /><font class="litespeed-success">
|
| 76 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 77 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_cache_optimize_js_excludes</code>' ) ; ?>
|
| 78 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-optimize="1"</code>' ) ; ?>
|
| 79 |
</font>
|
| 145 |
<?php echo __( 'Both full URLs and partial strings can be used.', 'litespeed-cache' ) ; ?>
|
| 146 |
<?php echo __('One per line.', 'litespeed-cache'); ?>
|
| 147 |
<br /><font class="litespeed-success">
|
| 148 |
+
<?php echo __('API', 'litespeed-cache'); ?>:
|
| 149 |
<?php echo sprintf( __( 'Filter %s is supported.', 'litespeed-cache' ), '<code>litespeed_optm_js_defer_exc</code>' ) ; ?>
|
| 150 |
<?php echo sprintf( __( 'Elements with attribute %s in html code will be excluded.', 'litespeed-cache' ), '<code>data-no-defer="1"</code>' ) ; ?>
|
| 151 |
</font>
|
| 180 |
<tr>
|
| 181 |
<th><?php echo __('Role Excludes', 'litespeed-cache'); ?></th>
|
| 182 |
<td>
|
| 183 |
+
<?php foreach ( $roles as $role => $title ): ?>
|
| 184 |
+
<?php $this->build_checkbox( LiteSpeed_Cache_Config::EXCLUDE_OPTIMIZATION_ROLES . "][", $title, $this->config->in_exclude_optimization_roles( $role ), $role ) ; ?>
|
| 185 |
<?php endforeach; ?>
|
| 186 |
<div class="litespeed-desc">
|
| 187 |
<?php echo __( 'Selected roles will be excluded from all optimizations.', 'litespeed-cache' ) ; ?>
|
admin/tpl/settings.php
CHANGED
|
@@ -80,9 +80,12 @@ global $wp_roles ;
|
|
| 80 |
if ( !isset( $wp_roles ) ) {
|
| 81 |
$wp_roles = new WP_Roles() ;
|
| 82 |
}
|
| 83 |
-
$roles = array_keys( $wp_roles->roles ) ;
|
| 84 |
|
| 85 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 86 |
|
| 87 |
include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
| 88 |
|
| 80 |
if ( !isset( $wp_roles ) ) {
|
| 81 |
$wp_roles = new WP_Roles() ;
|
| 82 |
}
|
|
|
|
| 83 |
|
| 84 |
+
$roles = array() ;
|
| 85 |
+
foreach ( $wp_roles->roles as $k => $v ) {
|
| 86 |
+
$roles[ $k ] = $v[ 'name' ] ;
|
| 87 |
+
}
|
| 88 |
+
ksort( $roles ) ;
|
| 89 |
|
| 90 |
include_once LSCWP_DIR . "admin/tpl/inc/banner_promo.php" ;
|
| 91 |
|
cli/litespeed-cache-cli-admin.class.php
CHANGED
|
@@ -31,6 +31,7 @@ class LiteSpeed_Cache_Cli_Admin
|
|
| 31 |
LiteSpeed_Cache_Config::CRWL_PAGES,
|
| 32 |
LiteSpeed_Cache_Config::CRWL_CATS,
|
| 33 |
LiteSpeed_Cache_Config::CRWL_TAGS,
|
|
|
|
| 34 |
LiteSpeed_Cache_Config::CRWL_CRON_ACTIVE,
|
| 35 |
LiteSpeed_Cache_Config::OPID_DEBUG_LEVEL,
|
| 36 |
LiteSpeed_Cache_Config::OPID_HEARTBEAT,
|
|
@@ -144,6 +145,7 @@ class LiteSpeed_Cache_Cli_Admin
|
|
| 144 |
case LiteSpeed_Cache_Config::CRWL_PAGES:
|
| 145 |
case LiteSpeed_Cache_Config::CRWL_CATS:
|
| 146 |
case LiteSpeed_Cache_Config::CRWL_TAGS:
|
|
|
|
| 147 |
case LiteSpeed_Cache_Config::CRWL_CRON_ACTIVE:
|
| 148 |
case LiteSpeed_Cache_Config::OPID_DEBUG_LEVEL:
|
| 149 |
case LiteSpeed_Cache_Config::OPID_HEARTBEAT:
|
| 31 |
LiteSpeed_Cache_Config::CRWL_PAGES,
|
| 32 |
LiteSpeed_Cache_Config::CRWL_CATS,
|
| 33 |
LiteSpeed_Cache_Config::CRWL_TAGS,
|
| 34 |
+
LiteSpeed_Cache_Config::CRWL_HTTP2,
|
| 35 |
LiteSpeed_Cache_Config::CRWL_CRON_ACTIVE,
|
| 36 |
LiteSpeed_Cache_Config::OPID_DEBUG_LEVEL,
|
| 37 |
LiteSpeed_Cache_Config::OPID_HEARTBEAT,
|
| 145 |
case LiteSpeed_Cache_Config::CRWL_PAGES:
|
| 146 |
case LiteSpeed_Cache_Config::CRWL_CATS:
|
| 147 |
case LiteSpeed_Cache_Config::CRWL_TAGS:
|
| 148 |
+
case LiteSpeed_Cache_Config::CRWL_HTTP2:
|
| 149 |
case LiteSpeed_Cache_Config::CRWL_CRON_ACTIVE:
|
| 150 |
case LiteSpeed_Cache_Config::OPID_DEBUG_LEVEL:
|
| 151 |
case LiteSpeed_Cache_Config::OPID_HEARTBEAT:
|
css/iziModal.min.css
ADDED
|
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* iziModal | v1.5.1
|
| 3 |
+
* http://izimodal.marcelodolce.com
|
| 4 |
+
* by Marcelo Dolce.
|
| 5 |
+
*/
|
| 6 |
+
.iziModal{display:none;position:fixed;top:0;bottom:0;left:0;right:0;margin:auto;background:#fff;box-shadow:0 0 8px rgba(0,0,0,.3);transition:margin-top .3s ease,height .3s ease;transform:translateZ(0)}.iziModal *{-webkit-font-smoothing:antialiased}.iziModal::after{content:'';width:100%;height:0;opacity:0;position:absolute;left:0;bottom:0;z-index:1;background:-moz-linear-gradient(top,transparent 0%,rgba(0,0,0,.35) 100%);background:-webkit-gradient(linear,left top,left bottom,color-stop(0%,transparent),color-stop(100%,rgba(0,0,0,.35)));background:-webkit-linear-gradient(top,transparent 0%,rgba(0,0,0,.35) 100%);background:-o-linear-gradient(top,transparent 0%,rgba(0,0,0,.35) 100%);background:-ms-linear-gradient(top,transparent 0%,rgba(0,0,0,.35) 100%);background:linear-gradient(to bottom,transparent 0%,rgba(0,0,0,.35) 100%);filter:progid:DXImageTransform.Microsoft.gradient( startColorstr='#00000000', endColorstr='#59000000',GradientType=0 );transition:height .3s ease-in-out,opacity .3s ease-in-out;pointer-events:none}.iziModal.hasShadow::after{height:30px;opacity:1}.iziModal .iziModal-progressbar{position:absolute;left:0;top:0;width:100%;z-index:1}.iziModal .iziModal-progressbar>div{height:2px;width:100%}.iziModal .iziModal-header{background:#88a0b9;padding:14px 18px 15px;box-shadow:inset 0 -10px 15px -12px rgba(0,0,0,.3),0 0 0 #555;overflow:hidden;position:relative;z-index:10}.iziModal .iziModal-header-icon{font-size:40px;color:rgba(255,255,255,.5);padding:0 15px 0 0;margin:0;float:left}.iziModal .iziModal-header-title{color:#fff;font-size:18px;font-weight:600;line-height:1.3}.iziModal .iziModal-header-subtitle{color:rgba(255,255,255,.6);font-size:12px;line-height:1.45}.iziModal .iziModal-header-subtitle,.iziModal .iziModal-header-title{display:block;margin:0;padding:0;font-family:'Lato',Arial;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;text-align:left}.iziModal .iziModal-header-buttons{position:absolute;top:50%;right:10px;margin:-17px 0 0}.iziModal .iziModal-button{display:block;float:right;z-index:2;outline:0;height:34px;width:34px;border:0;padding:0;margin:0;opacity:.3;border-radius:50%;transition:transform .5s cubic-bezier(.16,.81,.32,1),opacity .5s ease;background-size:67%!important;-webkit-tap-highlight-color:transparent}.iziModal .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6ODZCQkIzQ0I0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6ODZCQkIzQ0M0RTg0MTFFNjlBODI4QTFBRTRBMkFCMDQiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDo4NkJCQjNDOTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDo4NkJCQjNDQTRFODQxMUU2OUE4MjhBMUFFNEEyQUIwNCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PsgTJLcAAALJSURBVHja3JnLS1VBHMfvQ7g9dBXRRrwEFRciAhMi1JRW1aIHVEIYEkW0iVpUhOD/ICK6cFMgSbUpC6VFkQa9NtpjkauriRY9Noa3pHT8/mIODMM5Or85o87pC5/NPf5mvmc8M7+Z36SFEKkY2gj2gUawF2wHW8A6+fwv+A6KYAQMg+dg2rbDtKXhGnAaHJIms4zYz9J4HxgAf1g9k2EGteAhWBBuNApaQNrUg6nRTaAbzIuV0RCocWW4DoyJlVcJXI5ruFk2tJqi/2TWxvA5sXbqA2Ucw01i7dVjargazAo/dE33p6/DlAheg50pP0SJpwG8CH7IaH/Q5pFZUhnoArkwwwVwJeWfdoMLYYZvqG+yTGo9CerAoIWBT+A4qAdPDWOugwo1NVcxJtpFZRLkwH3GJCqCghJfxVjnz1JMMMKnwAbGRAg0B5rAA4O4CblZ+qj8tkBjZthvSzDCtFIMM0ZpQhslk5Eej4jpZ/T7G+ygwG1ghrk+jjNMFy1eMPJzpOAzlou6iWmXZkm91EBHjEwUZXoQTDk2SxqhRh7HTJ9hpstB3rFZ0ldq6J2DnB9m2rXZfxOPlrX1DrJRXiaBXSHPaMHvB0cd9JPLpBImMvzLQTuUFA6A9yHPfoIjhsllOc1l5N4grtmDWgYrl5+JTUZcSjNkeMyxWdpA3ZN72IJj01OJTByJS82J2/wQVxmB5y1HK8x0JWMf/kzdD98FJcY5S51gdwyTQl6eUAraspo27PeWXgy8afim0+CELAwOWHyH9EkdkyWwJ4Yxk6BCP+bTm48anutWW5dAp34IpbW03UOzb0FPVEHbx0LKfvAyqpAyKw97JU8Mt6pml6rAJ6oY6Eu5NfvfF7QTeWWQyEsZr6694lwsNoPD8mKRo29gCNwGj7gXi7aGA1EBcY+8vq0GW8FmJb3Pgx9gEnwAr8Ab8MW2w0UBBgAVyyyaohV7ewAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6RTBBOUI4RUM0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6RTBBOUI4RUQ0RTg0MTFFNjk0NTY4NUNFRkZFNEFEQzIiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpFMEE5QjhFQTRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDpFMEE5QjhFQjRFODQxMUU2OTQ1Njg1Q0VGRkU0QURDMiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PrQO6gAAAANmSURBVHjazJlbSBRRGMd3x92i0ForRRMiKiUoX4ouiFlJkRVBDxW9GJERwUasvdRT9FD00osRQtAFqegGBUHRBY0uaCVKEkSRpVR0tSwrQtp1+p/4Bk7D7M45M/Ot/uGHu+Psmf+c+eY753wnbJpmyIfGgvmgiv6WgkKQBwzwE3wBr0AnuAta6ZgnhT0aFuY2ghoyGdH4bS+4Dc6CZjCkdWVhWIPF4JoZnB6CDToeVE8sBidNPt0E5UEZrgG9Jr8GwHa/huMgaWZXDSDsxfBuc/jUBAwdw3Fz+NWoang5SJkjQwm7P3seLqQEX2LLfgfBdZcMORMcBqNDwekPqASP0uXhpjR3Ok0x/fUw9HIHGGVdw5DuRtzJpgxDsJui2qOWmuaAOuuLbHivz4YLwLgQj/aAXNmwuItlHhtbA7pAG5jEZHgKWCcbrhUTIY+NPQVjqFFObbYMi/hc6aOhl2AJ9TKnFoIyYXgemKEzJQXVVkyR3oFVzKZFuqw2qHdyFPKhrHPgMoWC3fRjRtNVVg+7SR5IiqmXxUt60cG0CK/vTIZniZVCmcKJF0C3ZNjKBqvJ9Hrwm46tsN1EkCoRQ/M3fBjvs6GrYAvdwHEfGcd1qBaGkwoxrKI+xjz83yJ0iLFHApd46X4xX+M+WECh4lepCNUIcpnMijrEWtAvTRHrbOd8FZNG8uA2Nf0hpmwtjBPwpQ5T0GPS/+tBAZhIq+b3Lu09EyHRwRgO+0C+7dhWcII+PwCf6Sk/Aa9d2vtn+A7nyASugJiD6YSDQcOlvVbxiCaAN8xrs3sgprBiac/QhlhnzjUo6JuZM0UlDS5FPtoQIdNlPYJTWUihFaDex+9Pg6T1KHJAJ2NI7ASllA28hEQ/KJIXoSlwgKlnh+jFe+GjLtwIPtjfyktUt+UaUZWqvw7H3oJD1peI7eQdoF1xWa+zQikHH13OmwqmOxxP0EiZtgK/DRwNuIcHwSeXc2K01WAPhbhKBb5hBNTVbskVH7fqpZGhbJUNtYF83fqwQSXPbOsGjb6etwx2gcEsmT3iFAZeNmUqaMeHSz2qu0k6W15Rqsx3B2i0D+xXGAHTFrRVlEeFuVoqH+ku6VNUbDkPzlAtg30nVK66i8rRIjAbTKaSQVQyN0DD6nOqcLZQld9TLfmvAAMAeMcvp3eCFqQAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MkFFRTU5NDA0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MkFFRTU5NDE0RTg1MTFFNjk0NEZFQzBGMkVBMDYyRDkiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDoyQUVFNTkzRTRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyQUVFNTkzRjRFODUxMUU2OTQ0RkVDMEYyRUEwNjJEOSIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuDFfX8AAANASURBVHjazJlZSBVRGMfHcWlB0xZM68GKukQLYaGkmEUR2EsvRfQS+BSJPUQE+lTR8hqIZY8hFS0ERVCRoW3gpUApghYpszLTVnCB3O70/+K7MAwzc78Z58z4hx8XzpzvzJ+Zc+d85ztphmFoU9BsUAoq+XcFyAc5QAfD4BfoBp3gCWjnNl9K82mYzO0FVWwyw0NsD3gIroBWkPB0ZzLsgc3grhGcnoE9XjxIOxaCC4Y6tYC1QRmuAj2Geg2CA1M1XAsmjHDVANL8GK4zolMz0L0YrjWiV5PU8HYw6TBIf8imD6UynA96HYKPg3mgMUTDY6DUzXCzQ+AxSz+r6QEQZz4HbLoDZNkZrnAIoOlRZjN1Gk3XS0zty/gTFaRq7Ay3uAR8BcU2ps/z9QJTWw74HrDhTyDbbHg9SKQI+sb9rKa3mV8ZmAt+KJjP1TS+zinFPkqEUqQdBeAOKLa0UwIzpqlXtcYpIKWIO4RBZPoRKNfC10YQI8MlYLkwaAB8ABsiMDwDbKU8dgtIFwRMgJ3guRadKpNPWBMa7tOi1WoyHJPuTsC4oN+IQsOLM3gPJlEWqOE/neMGBqwDeYoMz6G8c0I4h6eFyHBC8A2eVoaH8JutaPwuUA/+uvSht1sHKgTjTWZwjUCVYdrK3xT0iwkND+lc5FClUQ9fINHCRYY7FBrWPSz5Er2lAR9H9P+hpfYGl64OCmPadQ7ojcDwOJetysBMQX/6mrWS4d+cIoYtMnAEnBT2fwVeJufYxZBMFoKFlrajQtOX/uczvEtIB50Kdgn1lt3JGdANltjsXE64jPMnuQ1LPuFJcFrBE11gzQXAUnAPFNk86esO4zSBfmu5lVa9toCf8DC4Ba6C22DEdO01KDLdP5fLr1Z94X2ibV1ilWVQ1XrDpvPAU4c+u1KVqvaHXI7q43ltp3PSYmDDNCgGPrCUD1wN6y5lqzAUN89baX1Y55Jn2LrPRUffRwaHwWhIZs/aTQM/hzLlDp+coPRReprk5cgrkyvz7wM0+hOcAvOlPvwcLNIp526ux1H5aJbHeFpVX4Br4LLXWoffk9CkVnLlaBNYAxaBXJBpMjfIy+o7EAdtfIyb8HPDfwIMAM1WPs8F9tcxAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-button-close:hover{transform:rotate(180deg)}.iziModal .iziModal-button:hover{opacity:.8}.iziModal .iziModal-header.iziModal-noSubtitle{height:auto;padding:10px 15px 12px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{font-size:23px;padding-right:13px}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-title{font-size:15px;margin:3px 0 0;font-weight:400}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-header-buttons{right:6px;margin:-16px 0 0}.iziModal .iziModal-header.iziModal-noSubtitle .iziModal-button{height:30px;width:30px}.iziModal-rtl{direction:rtl}.iziModal-rtl .iziModal-header{padding:14px 18px 15px 40px}.iziModal-rtl .iziModal-header-icon{float:right;padding:0 0 0 15px}.iziModal-rtl .iziModal-header-buttons{right:initial;left:10px}.iziModal-rtl .iziModal-button{float:left}.iziModal-rtl .iziModal-header-subtitle,.iziModal-rtl .iziModal-header-title{text-align:right;font-family:Tahoma,'Lato',Arial;font-weight:500}.iziModal-rtl .iziModal-header.iziModal-noSubtitle{padding:10px 15px 12px 40px}.iziModal-rtl .iziModal-header.iziModal-noSubtitle .iziModal-header-icon{padding:0 0 0 13px}.iziModal.iziModal-light .iziModal-header-icon{color:rgba(0,0,0,.5)}.iziModal.iziModal-light .iziModal-header-title{color:#000}.iziModal.iziModal-light .iziModal-header-subtitle{color:rgba(0,0,0,.6)}.iziModal.iziModal-light .iziModal-button-close{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyQTU1RUZDNzRFODQxMUU2ODAxOEUwQzg0QjBDQjI3OSIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo1NEM4MTU1MEI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENDMkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjZjYzMwMmE1LWFlMjEtNDI3ZS1hMmE4LTJlYjhlMmZlY2E3NSIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjdmYmU3NGE3LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Po24QssAAANtSURBVHja3JlJaBRBFIa7ZxyTSXADHUkikuAawZNLEOOGGrwJQYko8R4RBQ+OICoqghJQUVwPYjzFY0QUBQU1kogoKO6CG0pcIwbiNibj/8JraNvu6Xo9NTOtP3xzSKe6/65+Ve9VlWlkp2IwGUwFE0E5GA4G8/U+0APegWfgHrgPuq0bpNNp0QPNgEYngHlgGpuMCNp2s+kr4BYM/8ql4WqwHEzP4mXteg7awOW0YlerPnQIaARLNBl1ikLlBDw/1WF4ClgHKozc6idogekz2RheANbaBlE+dB4chfF+qeHF3LOF0FWwF6b7nBe8RvecApolzQVr3C64GR4H1huFV51pmvV+hikRbABFRji0GqarMxluAGON8CgKmmA65mZ4DFhqhE9VPP//ZXgZiCmm1t1gI6XWAAY+gF0gCe4qtqlHL8fthkeBWsXGreA6eMgPviEw+x5sBZ3gAdjPCcNPI8Fsu+FawUCzz40psEfRNJndBl7b/pZmVLTQMkzJo0bQSys43iWm3cxS+DUJOmoSwqKCRmEZWKkYv6RSMBPc5lqXRGm0A1Q6XiaT2aSwo8jrK/qZwZlFIlXTusxa6iXDddTdARpnMj2ek9AWjWYH7h/lubcs4A28THdyAdOl0ezAmKNBNyLLiT0Btjti9zuHg06zpJKIprohwXNypcu1OIdGjYbnxCLGPyYy/EPDfejzbwYvXK59AzuFGdFLKTL8WYNZ59RVzGESJCNm0teI40E6zNIA2wSaA2REP32iaW0omKXRbJKTUVyYEVV0J8oxvEiQmiUZrFSz6XNkuJe3nBKCelaSbjOZrhLsd1BInYxweSeJq9YA6dYtuZCBI4JZ6jGW/W+sebhd0DAaMIO5mTYFW1+X6GeQ7TO3W0WyQj3cw0ulBg4nSUbcAY7zPVYp7ip95FXOH29Hb35AOPjypWMIh7PORSjFZVsIzdKW7AWvfYnTVNWHyCytHw+jd1Nehqks3KepvtChUzD7yGvE2/cduqxldQF1EWZb/PbWLF3jAVgo0WrlkN+c6hSd+rzlaSuaR7O0oX0wyIa2pVAdGaj0HCUVOqIq4dVwrg5lmmG2w+8f/9tjL6foYHE+Gy8Xtv3CPUpf7WauDxadKuIwoeNbOmoYDYbZ0ns/1wxUC7ykigs8sS/LpEe3vwUYALiKDDDSgEiSAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4JpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDpEQTg1NTA2NTRFODQxMUU2OTQ0N0VERjY2Q0M5ODYwRCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCQkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCQUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjFlNTQwYzczLTVhZmEtNDJlYi04YzJlLWMwMzFlYmFiYmIyNiIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOmVkYmRiMzM1LTAxMDUtMTE3YS1hYmM3LWEzNWNkOWU1Yzc4NyIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PvIicdUAAAOvSURBVHjaxJlZbA1hFMe/qaItUUsspakg1laJ7UUisQuRvvTFA15sQSRCLBFrQryhHqxNHxEPtaQ8CCUkIrVVRbVBJdZYSrXVonr9/3pGxnTunZk78/X+k1+aO+1899/vnnvO+c4YKpi6ghEgW34OBD1BKjBAM6gH78Fz8BhUyrW/ikQivt7QiNMozU0DE8RkJx/3fgCPwA1QHvHp2K/hHJAPJqpwVA2K4flW2IZ7gyVgptKjh6AQxl+GYZi7uRr0U3rVBIpg+nIQwwvACpCkOk4XwYlosR3LMGN1qUqMroGDTqaNGDu7SiVWl+D3iP2i00c9HqxUidd8wzDy3HY4HRwCfWzXz4L7Lm+QKfHeOUTTLWAzdro6muH1YIbDjculWrmpUEM2YYXcCNMt9pAYE8WsWYLdlAxaNYTGMDDHKYYXBVy4B0jTFM/5iOcUc1fM/2JcnItNAYtBNzGtQ33BVHDV3OHpARqhV6CLLKpTs8yQYHxOCrDQO7AV1Gg2PBJhMYiGh4MMnx1eLkixXKsFuzSbZrrMpeGxHnqFFtvrTWCbhILd9AuNpnPMHXaTtZD0kl1mRdwSxXSjJsNZfONjcmqIJR5p3lp6Y+sXrAzsBz/lNXvmtZYMFKbqafi0pKQgKpOSPhmsC5BxXEs1Fz4fUr/7TWMe/q9bC2s3tJs1Df/Q/B5PwAZwJYS1WpPlo0zRZJZziL2gQU7I1GyHL7QSD26taVOytI26DpinxKypApvpk+C6dHlMnXskbUbT1yTpN3WJHWB327UCS3hUoc+tA/VyxP/ost5rGq7QWZnAdoe0eZgnYweDbgmgkoafgk8aTfNgsMNmmqfhC+Czj3V4T3mSBH255kxB0ztd4tNNDJkas2CUdkAKHQ3yAtxfijj/bdb7Cumyhmoyexzcs6Qwv2qUbPKvJDOtnNFklrF3R5qneA2XYHe/2A+ht1Xb3FZXRY1XTAjFTgtxJ45qKtWDpZK1g6dhIQuvBzjcy8FgQ6y8Nw+sCdnwL1Dn8jdMe6m2a+3ma9ESNUdOC1VixSH3bnPiYyraswnO0fqDIQkyW8WmCWab7b+I9TCF3+x0j2e+MPUA7LPGrVfD1F3VNsrPVR0zhS8BB5x21muzYa1Sy1Tb4y4d4qOwIi9Pk/wcj1gV50p5zQjJKAsJH8KcY4vpdYrjV0w9HMxxHjfKNpfwdMyRNuAmyy2M1vq5OegBNFMmR9lSHDizSLPMJGjuO2BZfSOtLKvpMylUvh/d/hFgAOH4+ibxGTZuAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal.iziModal-light.isFullscreen .iziModal-button-fullscreen{background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAsCAYAAAAehFoBAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA3BpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTM4IDc5LjE1OTgyNCwgMjAxNi8wOS8xNC0wMTowOTowMSAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0RTNFNENCRkI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0RTNFNENCRUI4QUExMUU2QjNGOEVBMjg4OTRBRTg2NyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNyAoTWFjaW50b3NoKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOjgzM2MwOWZiLWJjOTEtNGVlZS05MDM1LTRkMmU2ZmE1ZjBmMiIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoyRUUxMkYxODRFODUxMUU2Qjc3RDk0MUUzMzJDRjBEOCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Pv1Q9Z8AAAOXSURBVHjaxJlLbA1RGMfPjIs+EvoIRYt4FVUl2EkkRTxKUqQbG0SEho2FjUQ8YtEICbEgTdFYeK1KaGvVeoUltyStt0UlNE17aWhV2+v/9X5XJpMzc8/0zpn5kl+aO3Nm7r/fnPu9xhDp2URQDJbw3xkgB2QCAwyAPvANfARvQDsfG7V4PO7pC40xCiVxa8AKFjnOw7VdoA08BtG4R8VeBZeCKrBS+GPvQAM0P/NbcB7YBdYJPfYKXIXwL34IJm8eBFOFXusH9RDdnI7gLWA/MEVwdh/UOe1tN8G0V3eLcKwFXJCJNl08G5ZYsrWgWnZCJng5OOBwo1iAoisMw6hMJXgyOOywVW7xj+9BgKL3QHSxm+C9IF9y4U2GMlStRPQP8Jbp9lFwhJwE0RHrgaSV8N6xG238l7Zjtfx3K58/Bd7zsWngIqdnP2we2ACa7B7e6RL6joK5EtHNfL7b5u1Bn7dGFbycYRVM/8WyFJnuJK+z2iVwzFrMcF1h+Cx4ClhtFVyu8CW54ITE01EwFMAPcH1SMJWIqxQvItE1YHEIsXkhtkUhCV4ApiteFOPadn4IgseDMooSSxVrhWFwmkvCsKw06WGhKLhHhGuzSHChh9pZ5cc1oFFwfoTTsWrWqQCvXdZQEpkDsjUJziSv3Qu43k3LTA1BXqvRY/4DMjTd/yu4niJVm9wslCjcb4QE/9Qo+Al44baAmgpKCIqC+01OBLrsr8/de8zkiYwuUxWSq7iuM8JhantIqfYItkOepKBysnbycIfPXYKqURL6DhaBCQrrKcZHTa5loyEIJgHXwG3F9TQV+pxMGK0BiaTHn2OLEjcURbdi7XBSMO3jTxoEjtg+7wDnhG3spSD6F3hk7Tjoxnc0CJ5k+5wFCrhplYl2mmI24nyvvWumAE9z2zIfBW8WifnxIHc2yb6xiHtEoms0/hlGtpAPHCkgNDjFyZngPN88COvkPpEe+XGHbFcD7z53C+ybwKEAo0UPZ8QCybkmiL3sNvkheygSI08RYOSQiaUhd52sUpIZLWwJsYqkkdcZeHfIS66nc9XcZQRpNBY7C7F9Yy1OtonErDgSgNhGcEXmWa/VFA1O9onE6y4dRqGtXuVtkpf2iDy8EVR6GLykMnrsNFC867QF0hH8v3MVicFcuYdKy56uqQx4SukWQj3NOtJtQIt4ckSvbmdziMqy7HcS9xv0cn/Xwdn0A1drnl/d/hNgAGQa6Lgarp6BAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal .iziModal-loader{background:#fff url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%;position:absolute;left:0;right:0;top:0;bottom:0;z-index:9}.iziModal .iziModal-content-loader{background:url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iNDQiIGhlaWdodD0iNDQiIHZpZXdCb3g9IjAgMCA0NCA0NCIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiBzdHJva2U9IiM5OTkiPiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHN0cm9rZS13aWR0aD0iMiI+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iMHMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49IjBzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgICAgICA8Y2lyY2xlIGN4PSIyMiIgY3k9IjIyIiByPSIxIj4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJyIiAgICAgICAgICAgICAgICBiZWdpbj0iLTAuOXMiIGR1cj0iMS40cyIgICAgICAgICAgICAgICAgdmFsdWVzPSIxOyAyMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMTY1LCAwLjg0LCAwLjQ0LCAxIiAgICAgICAgICAgICAgICByZXBlYXRDb3VudD0iaW5kZWZpbml0ZSIgLz4gICAgICAgICAgICA8YW5pbWF0ZSBhdHRyaWJ1dGVOYW1lPSJzdHJva2Utb3BhY2l0eSIgICAgICAgICAgICAgICAgYmVnaW49Ii0wLjlzIiBkdXI9IjEuNHMiICAgICAgICAgICAgICAgIHZhbHVlcz0iMTsgMCIgICAgICAgICAgICAgICAgY2FsY01vZGU9InNwbGluZSIgICAgICAgICAgICAgICAga2V5VGltZXM9IjA7IDEiICAgICAgICAgICAgICAgIGtleVNwbGluZXM9IjAuMywgMC42MSwgMC4zNTUsIDEiICAgICAgICAgICAgICAgIHJlcGVhdENvdW50PSJpbmRlZmluaXRlIiAvPiAgICAgICAgPC9jaXJjbGU+ICAgIDwvZz48L3N2Zz4=) no-repeat 50% 50%}.iziModal .iziModal-content:after,.iziModal .iziModal-content:before{content:'';display:table}.iziModal .iziModal-content:after{clear:both}.iziModal .iziModal-content{zoom:1;width:100%;-webkit-overflow-scrolling:touch}.iziModal .iziModal-wrap{width:100%;position:relative;-webkit-overflow-scrolling:touch;overflow-scrolling:touch}.iziModal .iziModal-iframe{border:0;margin:0 0 -6px;width:100%;transition:height .3s ease}.iziModal-overlay{display:block;position:fixed;top:0;left:0;height:100%;width:100%}.iziModal-navigate{position:fixed;left:0;right:0;top:0;bottom:0;pointer-events:none}.iziModal-navigate-caption{position:absolute;left:10px;top:10px;color:#fff;line-height:16px;font-size:9px;font-family:'Lato',Arial;letter-spacing:.1em;text-indent:0;text-align:center;width:70px;padding:5px 0;text-transform:uppercase;display:none}.iziModal-navigate-caption::after,.iziModal-navigate-caption::before{position:absolute;top:2px;width:20px;height:20px;text-align:center;line-height:14px;font-size:12px;content:'';background-size:100%!important}.iziModal-navigate-caption:before{left:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4ZpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMTMyIDc5LjE1OTI4NCwgMjAxNi8wNC8xOS0xMzoxMzo0MCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDoyNmFjNjAyMy04OWU0LWE0NDAtYmMxMy1kOTA5MTQ3MmYzYjAiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6NDREQ0YwRjA1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6NDREQ0YwRUY1MzQzMTFFNkE5NUNDRDkyQzEwMzM5RTMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cykiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpmNmM0Nzk3Ni1mNzE3LTk5NDAtYTgyYS1mNTdjNmNiYmU0NWMiIHN0UmVmOmRvY3VtZW50SUQ9ImFkb2JlOmRvY2lkOnBob3Rvc2hvcDowZGVmYTEyZC01MzM0LTExZTYtYWRkYi04Y2NmYjI5ZTAxNjYiLz4gPC9yZGY6RGVzY3JpcHRpb24+IDwvcmRmOlJERj4gPC94OnhtcG1ldGE+IDw/eHBhY2tldCBlbmQ9InIiPz7oo0ptAAACWklEQVR42uyZTWsTYRSFZybxo4kWk5g2NC5qTAU3Kq30A9udi1oXolV/hWuhv6R/Q6utioi4LbbVFHemamlRU0OCEk0wZjwXzwtDoBDopHMHcuFJMplZnLm5ue+589qu61qeOApyYAjEgG0FEyLqN/gKiqBuTtgewWlwCZw056xgwwirgU3wxSv4NJgCUV5YBRXQDEhsBJwCSSauBVZFdJRlIJk9Av7wbj577jDIOENtRmPVwcsw6KfAAvikRKzEDlhnhuU/lRPBWaa9wsxqC6ndPX7OiOA4D8qW3vjO9z7H0w3+KhZstNmOFbLoCQ6DYGmL+bAInmGfLFC4asFXwRJIgB+goVmw+I7HXO+/gevGnGgUPEGxktkSmAMbWmt4HDwBKS6XN1jDKrvEFYoVK7oLroE3h93Woh1eNwqWafJ/gQV65vM+ail34mc6EZwBK2CAx8fAIjjeBYMzDT4cVHCEXtRbRvEu/Nr9HCIOnGGp15vgEec9KYn74B0nAT/CZnv86FcNvwK3wENwAjwAs2Bbs5d4CW5zir0AXvv8p+tKH34B5lkW4h2egRHtbu05uMMHHWfB0zC4NRF5l09kzvE4rd2tyUJyjy4tz7akZqXbL8QETbJ/FsMgWOJtb6brCQ5YsBsC8Uab63DVkkgqFpzie93h8OhScFah2LTHi5ccWroaLd5l6//+hpYQoWP05LKqFs2WQYbTsNxAi+5fxpWmdfh7HS7XhwSzG+H3a2JnvZsyktmLbdOFhpDMvrf4sN1u2/aK0cwMcmYLcturweceW+CnOfFPgAEA8uWFFylBJYoAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal-navigate-caption:after{right:0;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACwAAAAoCAYAAACFFRgXAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAZdEVYdFNvZnR3YXJlAEFkb2JlIEltYWdlUmVhZHlxyWU8AAADhmlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4gPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPiA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPiA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIgeG1wTU06T3JpZ2luYWxEb2N1bWVudElEPSJ4bXAuZGlkOjI2YWM2MDIzLTg5ZTQtYTQ0MC1iYzEzLWQ5MDkxNDcyZjNiMCIgeG1wTU06RG9jdW1lbnRJRD0ieG1wLmRpZDo0NERDRjBGMDUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wTU06SW5zdGFuY2VJRD0ieG1wLmlpZDo0NERDRjBFRjUzNDMxMUU2QTk1Q0NEOTJDMTAzMzlFMyIgeG1wOkNyZWF0b3JUb29sPSJBZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKSI+IDx4bXBNTTpEZXJpdmVkRnJvbSBzdFJlZjppbnN0YW5jZUlEPSJ4bXAuaWlkOmY2YzQ3OTc2LWY3MTctOTk0MC1hODJhLWY1N2M2Y2JiZTQ1YyIgc3RSZWY6ZG9jdW1lbnRJRD0iYWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjBkZWZhMTJkLTUzMzQtMTFlNi1hZGRiLThjY2ZiMjllMDE2NiIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PuijSm0AAAKbSURBVFhH7ZnJj0xRGEerzFoIMTaCZmOIedhaiJj55yz8DaYdNhIJEUMQbCTG3rQ02hDSiEY553XdTpHS3nv96taV9ElO6lVt6peb7933fffVG41GrYW5uBaX4EysYzcw1Fd8hc/wM2a0Bl6Nm3BW9i0dDPsQX/olBF6FO72AH/gG3+N3jL3KBpqGC3ERTsGfeAsHDTyHi71oCXzBe/gaU2A5bscZOIxXTb8OLQNX9i6mElYsg/voqruwfQb2BhODWgqpMYDv0NLsNXC4yd42P1PEwNJj4HBTWdipErLVDfxfMRm408QMvBu3jV6WJ1Zg9/rbeBOP+UNZYgX+iE/Rp+lpPIKliBXYB9IhtPNy3z/T/F6YmDXsChvyBc7Gs3gACxEzsDzBg9iPPXgO92NuYgeWx2h3+AhtaM7jPsyF7aV37XR8gNZYO/pwKY51+xPkG27Fk2joT3gCr2A7NuJ6HMkTeAPadlp3VeMChF7G0P6X3dmfjAXOUxIj6LZkv1ylNuStDZejkL+PS96ScFzRqnDAtI5PoTefvbg7iNNOOwqVRCfYghdxBbpHH8Y7+DcKlUTV7MLLaNghPIrjhf2N2IF34AVcjE44hrXHyE3MwE6/loEzpEcIlqKjeyFiBe7FS+he/gENewMLEyuwXdo8dGWP43UsRazA9g7uDNbwNX8oS8watlsz+ISIGbgSJgN3GgOHlnFq8zNFQraGgT1iFc9iUyU0XsMGHhy9zh6XbvCp4ZuBBWglDBj4OdqLeu0+uRJTwMZ+Dbp/e21P3m97yWe2snsw1LTHmz5C/9lQdwhfGbiq89GwvrrwUT4UAouhN6MzloTRpVuEYI5O9urZYXtrYPGQw2OlZegM163QhrJMfWVgyTq0Qq32C/N7uPz9OknWAAAAAElFTkSuQmCC) no-repeat 50% 50%}.iziModal-navigate>button{position:fixed;bottom:0;top:0;border:0;height:100%;width:84px;background-size:100%!important;cursor:pointer;padding:0;opacity:.2;transition:opacity .3s ease;pointer-events:all;margin:0;outline:0}.iziModal-navigate>button:hover{opacity:1}.iziModal-navigate-prev{left:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5sGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiCiAgICAgICAgICAgIHhtbG5zOnN0RXZ0PSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VFdmVudCMiCiAgICAgICAgICAgIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+eG1wLmRpZDo2NDkyYzcxMy05ZDM0LTZlNGQtYmUwNi1hMDMyY2Q4NDVjNGU8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkRvY3VtZW50SUQ+eG1wLmRpZDo1QjIzMUMxODU3RjcxMUU2ODUzRkRBRjE5RDhDQjZBRDwveG1wTU06RG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDpjZmMwNzVmNC1kODA3LWI0NDMtYWIwYS02YWVhZjRjMDgxZWE8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEZXJpdmVkRnJvbSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgIDxzdFJlZjppbnN0YW5jZUlEPnhtcC5paWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RSZWY6ZG9jdW1lbnRJRD4KICAgICAgICAgPC94bXBNTTpEZXJpdmVkRnJvbT4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmNmYzA3NWY0LWQ4MDctYjQ0My1hYjBhLTZhZWFmNGMwODFlYTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDo1Ni0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjA0LTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODowNC0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFhEaW1lbnNpb24+CiAgICAgICAgIDxleGlmOlBpeGVsWURpbWVuc2lvbj4xODg8L2V4aWY6UGl4ZWxZRGltZW5zaW9uPgogICAgICA8L3JkZjpEZXNjcmlwdGlvbj4KICAgPC9yZGY6UkRGPgo8L3g6eG1wbWV0YT4KICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAKPD94cGFja2V0IGVuZD0idyI/PvAvv7QAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAAmdJREFUeNrs1LsJQkEQhtH/mtmBgQ8QA7tQK1e7MBBBMbADwzUZEyuQveeDCXbD4TBDay3SWJpYgYCXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXv/WJskpyQJ4jQH7Mcmu0C+BV+/Y5/VeF/oV8Ood+7dpDfDqHvsrySHJBXjBDrxgB16wAy/YgRfswAt24AU78IIdeMEOPOywAw+7gIcdeMEOvGAHXrADL9iBF+zAC3bgBTvwsMMOPOwCHnYBD7uAhx14wQ68YAdesAMv2IEX7MDDDjvwsAt42AU87AIedgEPu4CHXcDDDrxgB16wAw877MDDDjvwsAt42AU87AIedgEPu4CHXcDDLuBhB16wAw877MDDLuBhF/CwC3jYBTzsAh52AQ+7gIddwEtjB3+tS/78+Z/V5d9iATz0Ah56AQ+9gIdewEMv4KEX8NALeOgFPPQCHnoBDz3wgh54QQ889NADDz30wEMv4KEX8NALeOgFPPQCHnoBD72Ahx54QQ+8oAde0AMv6IEX9MBDDz3w0EMPPPQCHnoBD72Ah17AQw+8FUAPvKAHXtADL+iBF/TAC3rgBT3wgh546KEHHnrogYdewEMv4KEHXtADL+iBF/TAC3rgBT3wgh54QQ+8oAde0AMv6IGHHnrgoU/yrgFe3aO/JdknuQOv3tGfC/tjjEsYWmsoyIWXgJeAl4CXgJeAl4CXgJeAl4CXgJeAF/AS8BLwEvAS8BLwEvAS8BLwEvAS8BLwAl4CXgJeAl4CXvqnPgAAAP//AwCEcoCBRabYzAAAAABJRU5ErkJggg==) no-repeat 50% 50%}.iziModal-navigate-next{right:50%;background:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALwAAAC8CAYAAADCScSrAAAACXBIWXMAAB3SAAAd0gEUasEwAAA7pGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS42LWMxMzIgNzkuMTU5Mjg0LCAyMDE2LzA0LzE5LTEzOjEzOjQwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmRjPSJodHRwOi8vcHVybC5vcmcvZGMvZWxlbWVudHMvMS4xLyIKICAgICAgICAgICAgeG1sbnM6cGhvdG9zaG9wPSJodHRwOi8vbnMuYWRvYmUuY29tL3Bob3Rvc2hvcC8xLjAvIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6dGlmZj0iaHR0cDovL25zLmFkb2JlLmNvbS90aWZmLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOmV4aWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vZXhpZi8xLjAvIj4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNS41IChXaW5kb3dzKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE2LTA4LTAxVDExOjU4OjEyLTAzOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDphZjljN2Q2MC00MTg2LWE3NGQtYTBiMS1mMGU5ODUwYzg2ZGY8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6NjQ5MmM3MTMtOWQzNC02ZTRkLWJlMDYtYTAzMmNkODQ1YzRlPC94bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+CiAgICAgICAgIDx4bXBNTTpIaXN0b3J5PgogICAgICAgICAgICA8cmRmOlNlcT4KICAgICAgICAgICAgICAgPHJkZjpsaSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDphY3Rpb24+Y3JlYXRlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjY0OTJjNzEzLTlkMzQtNmU0ZC1iZTA2LWEwMzJjZDg0NWM0ZTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQwOTo0MDoxNC0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjAxNjJjMmE3LWZmMjYtYzE0ZC05Yjg4LTc2MGM2NzAxYjYzNzwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1MTowNy0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmFmOWM3ZDYwLTQxODYtYTc0ZC1hMGIxLWYwZTk4NTBjODZkZjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNi0wOC0wMVQxMTo1ODoxMi0wMzowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTUuNSAoV2luZG93cyk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpYUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6WVJlc29sdXRpb24+MTkzOTAzNi8xMDAwMDwvdGlmZjpZUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6UmVzb2x1dGlvblVuaXQ+MjwvdGlmZjpSZXNvbHV0aW9uVW5pdD4KICAgICAgICAgPGV4aWY6Q29sb3JTcGFjZT42NTUzNTwvZXhpZjpDb2xvclNwYWNlPgogICAgICAgICA8ZXhpZjpQaXhlbFhEaW1lbnNpb24+MTg4PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjE4ODwvZXhpZjpQaXhlbFlEaW1lbnNpb24+CiAgICAgIDwvcmRmOkRlc2NyaXB0aW9uPgogICA8L3JkZjpSREY+CjwveDp4bXBtZXRhPgogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgIAo8P3hwYWNrZXQgZW5kPSJ3Ij8+nbt1mgAAACBjSFJNAAB6JQAAgIMAAPn/AACA6QAAdTAAAOpgAAA6mAAAF2+SX8VGAAACQklEQVR42uzSsQ3CQAAEQTdiOyGg/wrciJ0QUMYSECEKAP3PSdvAaZZqkWbJCQJeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXsBLwEvAS8BLwEvAS8BLwEvAS8BLwEvAC3gJeAl4CXgJ+D9vrY7qBgLwo7dVZ+89oAd+5Pbq6nPQAz9s9+rZ96AHHnoBD72Ah17AQy/goRfw0At46AU89AIeegEPvYCHHnhBD7ygBx566IGHHnrgoRfw0At46AU89AIeegEPvYCHXsBDL+ChB17QAy/ogRf0wAt64KGHHnjooQceegEPvYCHXsBDL+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADDz30wEPvI+ChF/DQAy/ogRf0wAt64AU98IIeeEEPvKAHXtADL+iBF/TAC3rgoZ8ePRDAAy/YgRfswAt24AU78IIdeMEOvGAHXrADL9iBhx124GEX8LADL9iBF+zAC3bgBTvwgh14wQ68YAcedtiBh13Awy7gYRfwsAMv2IEX7MALduAFO/CCHXjYYQcedgEPu4CHXcDDLuBhF/CwA+8E2IEX7MALduAFO/Cwww487AIedgEPu4CHXcDDLuBhF/CwC3jYgRfswMMOO/CwC3jYBTzsAh52AQ+7gIddwMMu4GEX8LBravB7dcEO/Ext1Qk78DO1VgfswEvAS8BLwEvAS8BLwEvAS8BLwEvAS8ALeAl4CXgJeAl4CXgJeAl4CXgJeAl4CXgBLwEvAS8BLwEvAS/9shcAAAD//wMAtAygvJrkwJUAAAAASUVORK5CYII=) no-repeat 50% 50%}.iziModal.isAttachedTop .iziModal-header{border-top-left-radius:0;border-top-right-radius:0}.iziModal.isAttachedTop{margin-top:0!important;margin-bottom:auto!important;border-top-left-radius:0!important;border-top-right-radius:0!important}.iziModal.isAttachedBottom{margin-top:auto!important;margin-bottom:0!important;border-bottom-left-radius:0!important;border-bottom-right-radius:0!important}.iziModal.isFullscreen{max-width:100%!important;margin:0!important;height:100%!important}.iziModal.isAttached,.iziModal.isFullscreen{border-radius:0!important}.iziModal.hasScroll .iziModal-wrap{overflow-y:auto;overflow-x:hidden}html.iziModal-isAttached,html.iziModal-isOverflow{overflow:hidden}html.iziModal-isAttached body,html.iziModal-isOverflow body{overflow-y:scroll;position:relative}.iziModal ::-webkit-scrollbar{overflow:visible;height:7px;width:7px}.iziModal ::-webkit-scrollbar-thumb{background-color:rgba(0,0,0,.2);background-clip:padding-box;border:solid transparent;border-width:0;min-height:28px;padding:100px 0 0;box-shadow:inset 1px 1px 0 rgba(0,0,0,.1),inset 0 -1px 0 rgba(0,0,0,.07)}.iziModal ::-webkit-scrollbar-thumb:active{background-color:rgba(0,0,0,.4)}.iziModal ::-webkit-scrollbar-button{height:0;width:0}.iziModal ::-webkit-scrollbar-track{background-clip:padding-box;border:solid transparent;border-width:0 0 0 2px}.iziModal.transitionIn .iziModal-header{-webkit-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1);animation:iziM-slideDown .7s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-header .iziModal-header-icon{-webkit-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-revealIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;-moz-animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both;animation:iziM-slideIn 1s cubic-bezier(.16,.81,.32,1) both}.iziModal.transitionIn .iziModal-header .iziModal-button{-webkit-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);-moz-animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1);animation:iziM-revealIn 1.2s cubic-bezier(.7,0,.3,1)}.iziModal.transitionIn .iziModal-iframe,.iziModal.transitionIn .iziModal-wrap{-webkit-animation:iziM-fadeIn 1.3s;-moz-animation:iziM-fadeIn 1.3s;animation:iziM-fadeIn 1.3s}.iziModal.transitionIn .iziModal-header{-webkit-animation-delay:0s;-moz-animation:0s;animation-delay:0s}.iziModal.transitionIn .iziModal-header .iziModal-header-icon,.iziModal.transitionIn .iziModal-header .iziModal-header-title{-webkit-animation-delay:.4s;-moz-animation:.4s;animation-delay:.4s}.iziModal.transitionIn .iziModal-header .iziModal-header-subtitle{-webkit-animation-delay:.5s;-moz-animation:.5s;animation-delay:.5s}.iziModal.transitionOut .iziModal-header,.iziModal.transitionOut .iziModal-header *{transition:none!important}.iziModal .fadeOut,.iziModal-navigate.fadeOut,.iziModal-overlay.fadeOut,.iziModal.fadeOut{-webkit-animation:iziM-fadeOut .5s;-moz-animation:iziM-fadeOut .5s;animation:iziM-fadeOut .5s;animation-fill-mode:forwards}.iziModal .fadeIn,.iziModal-navigate.fadeIn,.iziModal-overlay.fadeIn,.iziModal.fadeIn{-webkit-animation:iziM-fadeIn .5s;-moz-animation:iziM-fadeIn .5s;animation:iziM-fadeIn .5s}.iziModal-overlay.comingIn,.iziModal.comingIn{-webkit-animation:iziM-comingIn .5s ease;-moz-animation:iziM-comingIn .5s ease;animation:iziM-comingIn .5s ease}.iziModal-overlay.comingOut,.iziModal.comingOut{-webkit-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);-moz-animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation:iziM-comingOut .5s cubic-bezier(.16,.81,.32,1);animation-fill-mode:forwards}.iziModal-overlay.bounceInDown,.iziModal.bounceInDown{-webkit-animation:iziM-bounceInDown .7s ease;animation:iziM-bounceInDown .7s ease}.iziModal-overlay.bounceOutDown,.iziModal.bounceOutDown{-webkit-animation:iziM-bounceOutDown .7s ease;animation:iziM-bounceOutDown .7s ease}.iziModal-overlay.bounceInUp,.iziModal.bounceInUp{-webkit-animation:iziM-bounceInUp .7s ease;animation:iziM-bounceInUp .7s ease}.iziModal-overlay.bounceOutUp,.iziModal.bounceOutUp{-webkit-animation:iziM-bounceOutUp .7s ease;animation:iziM-bounceOutUp .7s ease}.iziModal-overlay.fadeInDown,.iziModal.fadeInDown{-webkit-animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInDown .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutDown,.iziModal.fadeOutDown{-webkit-animation:iziM-fadeOutDown .5s ease;animation:iziM-fadeOutDown .5s ease}.iziModal-overlay.fadeInUp,.iziModal.fadeInUp{-webkit-animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInUp .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutUp,.iziModal.fadeOutUp{-webkit-animation:iziM-fadeOutUp .5s ease;animation:iziM-fadeOutUp .5s ease}.iziModal-overlay.fadeInLeft,.iziModal.fadeInLeft{-webkit-animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInLeft .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutLeft,.iziModal.fadeOutLeft{-webkit-animation:iziM-fadeOutLeft .5s ease;animation:iziM-fadeOutLeft .5s ease}.iziModal-overlay.fadeInRight,.iziModal.fadeInRight{-webkit-animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1);animation:iziM-fadeInRight .7s cubic-bezier(.16,.81,.32,1)}.iziModal-overlay.fadeOutRight,.iziModal.fadeOutRight{-webkit-animation:iziM-fadeOutRight .5s ease;animation:iziM-fadeOutRight .5s ease}.iziModal-overlay.flipInX,.iziModal.flipInX{-webkit-animation:iziM-flipInX .7s ease;animation:iziM-flipInX .7s ease}.iziModal-overlay.flipOutX,.iziModal.flipOutX{-webkit-animation:iziM-flipOutX .7s ease;animation:iziM-flipOutX .7s ease}@-webkit-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-moz-keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@keyframes iziM-comingIn{0%{opacity:0;transform:scale(.9) translateY(-20px) perspective(600px) rotateX(10deg)}to{opacity:1;transform:scale(1) translateY(0) perspective(600px) rotateX(0)}}@-webkit-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-moz-keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@keyframes iziM-comingOut{0%{opacity:1;transform:scale(1)}to{opacity:0;transform:scale(.9)}}@-webkit-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-moz-keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@keyframes iziM-fadeOut{0%{opacity:1}to{opacity:0}}@-webkit-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-moz-keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@keyframes iziM-fadeIn{0%{opacity:0}to{opacity:1}}@-webkit-keyframes iziM-slideIn{0%{opacity:0;-webkit-transform:translateX(50px)}to{opacity:1;-webkit-transform:translateX(0)}}@-moz-keyframes iziM-slideIn{0%{opacity:0;-moz-transform:translateX(50px)}to{opacity:1;-moz-transform:translateX(0)}}@keyframes iziM-slideIn{0%{opacity:0;transform:translateX(50px)}to{opacity:1;transform:translateX(0)}}@-webkit-keyframes iziM-slideDown{0%{opacity:0;-webkit-transform:scale(1,0) translateY(-40px);-webkit-transform-origin:center top}}@-moz-keyframes iziM-slideDown{0%{opacity:0;-moz-transform:scale(1,0) translateY(-40px);-moz-transform-origin:center top}}@keyframes iziM-slideDown{0%{opacity:0;transform:scale(1,0) translateY(-40px);transform-origin:center top}}@-webkit-keyframes iziM-revealIn{0%{opacity:0;-webkit-transform:scale3d(.3,.3,1)}}@-moz-keyframes iziM-revealIn{0%{opacity:0;-moz-transform:scale3d(.3,.3,1)}}@keyframes iziM-revealIn{0%{opacity:0;transform:scale3d(.3,.3,1)}}@-webkit-keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@keyframes iziM-bounceInDown{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,25px,0);transform:translate3d(0,25px,0)}75%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}90%{-webkit-transform:translate3d(0,5px,0);transform:translate3d(0,5px,0)}to{-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@keyframes iziM-bounceOutDown{20%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}to{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}}@-webkit-keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@keyframes iziM-bounceInUp{0%,60%,75%,90%,to{-webkit-animation-timing-function:cubic-bezier(.215,.61,.355,1);animation-timing-function:cubic-bezier(.215,.61,.355,1)}0%{opacity:0;-webkit-transform:translate3d(0,1000px,0);transform:translate3d(0,1000px,0)}60%{opacity:1;-webkit-transform:translate3d(0,-20px,0);transform:translate3d(0,-20px,0)}75%{-webkit-transform:translate3d(0,10px,0);transform:translate3d(0,10px,0)}90%{-webkit-transform:translate3d(0,-5px,0);transform:translate3d(0,-5px,0)}to{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}@-webkit-keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-2000px,0);transform:translate3d(0,-2000px,0)}}@keyframes iziM-bounceOutUp{20%{-webkit-transform:translate3d(0,-10px,0);transform:translate3d(0,-10px,0)}40%,45%{opacity:1;-webkit-transform:translate3d(0,20px,0);transform:translate3d(0,20px,0)}to{opacity:0;-webkit-transform:translate3d(0,-1000px,0);transform:translate3d(0,-1000px,0)}}@-webkit-keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInDown{0%{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@keyframes iziM-fadeOutDown{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}}@-webkit-keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInUp{0%{opacity:0;-webkit-transform:translate3d(0,100px,0);transform:translate3d(0,100px,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@keyframes iziM-fadeOutUp{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(0,-100px,0);transform:translate3d(0,-100px,0)}}@-webkit-keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInLeft{0%{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@keyframes iziM-fadeOutLeft{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(-200px,0,0);transform:translate3d(-200px,0,0)}}@-webkit-keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@keyframes iziM-fadeInRight{0%{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}to{opacity:1;-webkit-transform:none;transform:none}}@-webkit-keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@keyframes iziM-fadeOutRight{0%{opacity:1}to{opacity:0;-webkit-transform:translate3d(200px,0,0);transform:translate3d(200px,0,0)}}@-webkit-keyframes iziM-flipInX{0%{-webkit-transform:perspective(400px) rotateX(60deg);opacity:0}40%{-webkit-transform:perspective(400px) rotateX(-10deg)}70%{-webkit-transform:perspective(400px) rotateX(10deg)}to{-webkit-transform:perspective(400px) rotateX(0deg);opacity:1}}@keyframes iziM-flipInX{0%{transform:perspective(400px) rotateX(60deg);opacity:0}40%{transform:perspective(400px) rotateX(-10deg)}70%{transform:perspective(400px) rotateX(10deg)}to{transform:perspective(400px) rotateX(0deg);opacity:1}}@-webkit-keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}}@keyframes iziM-flipOutX{0%{-webkit-transform:perspective(400px);transform:perspective(400px)}30%{-webkit-transform:perspective(400px) rotate3d(1,0,0,-20deg);transform:perspective(400px) rotate3d(1,0,0,-20deg);opacity:1}to{-webkit-transform:perspective(400px) rotate3d(1,0,0,40deg);transform:perspective(400px) rotate3d(1,0,0,40deg);opacity:0}}
|
css/litespeed.css
CHANGED
|
@@ -3,6 +3,15 @@
|
|
| 3 |
content: '[' attr(litespeed-accesskey) '] ';
|
| 4 |
}
|
| 5 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 6 |
.litespeed-row {
|
| 7 |
display: block;
|
| 8 |
margin-top: 5px;
|
|
@@ -45,6 +54,7 @@
|
|
| 45 |
margin-top: 30px;
|
| 46 |
}
|
| 47 |
|
|
|
|
| 48 |
.litespeed-left20 {
|
| 49 |
margin-left: 20px;
|
| 50 |
}
|
|
@@ -143,10 +153,13 @@ h3 .litespeed-learn-more {
|
|
| 143 |
overflow: auto;
|
| 144 |
padding: 10px 15px 15px 15px;
|
| 145 |
position: relative;
|
| 146 |
-
border-top: none;
|
| 147 |
color: #264d73;
|
| 148 |
}
|
| 149 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 150 |
.litespeed-body code{
|
| 151 |
color: #998c85 ;
|
| 152 |
background-color: #dde9f5;
|
|
@@ -186,6 +199,7 @@ h3 .litespeed-learn-more {
|
|
| 186 |
display: table;
|
| 187 |
padding-right: 50px;
|
| 188 |
padding-left: 3px;
|
|
|
|
| 189 |
}
|
| 190 |
|
| 191 |
.litespeed-title a,
|
|
@@ -388,6 +402,7 @@ h3 .litespeed-learn-more {
|
|
| 388 |
}
|
| 389 |
|
| 390 |
/********************************* btn *******************************/
|
|
|
|
| 391 |
.litespeed-wrap [class*="litespeed-btn-"],
|
| 392 |
[class*="litespeed-btn-"] {
|
| 393 |
padding: 5px 10px;
|
|
@@ -404,6 +419,7 @@ h3 .litespeed-learn-more {
|
|
| 404 |
height: initial;
|
| 405 |
}
|
| 406 |
|
|
|
|
| 407 |
.litespeed-wrap [class*="litespeed-btn-"]:hover,
|
| 408 |
[class*="litespeed-btn-"]:hover {
|
| 409 |
font-weight: 400;
|
|
@@ -413,6 +429,7 @@ h3 .litespeed-learn-more {
|
|
| 413 |
box-shadow: none;
|
| 414 |
}
|
| 415 |
|
|
|
|
| 416 |
.litespeed-wrap .litespeed-btn-danger,
|
| 417 |
.litespeed-btn-danger {
|
| 418 |
color: #cc3d6a;
|
|
@@ -422,11 +439,13 @@ h3 .litespeed-learn-more {
|
|
| 422 |
box-shadow: 0 0 0 1px rgba(204, 61, 106, 0.25);
|
| 423 |
}
|
| 424 |
|
|
|
|
| 425 |
.litespeed-wrap .litespeed-btn-danger:hover,
|
| 426 |
.litespeed-btn-danger:hover {
|
| 427 |
background: #cc3d6a;
|
| 428 |
}
|
| 429 |
|
|
|
|
| 430 |
.litespeed-wrap .litespeed-btn-warning,
|
| 431 |
.litespeed-btn-warning {
|
| 432 |
color: #e59544;
|
|
@@ -436,11 +455,13 @@ h3 .litespeed-learn-more {
|
|
| 436 |
box-shadow: 0 0 0 1px rgba(230, 150, 69, 0.25);
|
| 437 |
}
|
| 438 |
|
|
|
|
| 439 |
.litespeed-wrap .litespeed-btn-warning:hover,
|
| 440 |
.litespeed-btn-warning:hover {
|
| 441 |
background: #e59544;
|
| 442 |
}
|
| 443 |
|
|
|
|
| 444 |
.litespeed-wrap .litespeed-btn-success,
|
| 445 |
.litespeed-btn-success {
|
| 446 |
color: #36b0b0;
|
|
@@ -450,11 +471,13 @@ h3 .litespeed-learn-more {
|
|
| 450 |
box-shadow: 0 0 0 1px rgba(54, 176, 176, 0.25);
|
| 451 |
}
|
| 452 |
|
|
|
|
| 453 |
.litespeed-wrap .litespeed-btn-success:hover,
|
| 454 |
.litespeed-btn-success:hover {
|
| 455 |
background: #36b0b0;
|
| 456 |
}
|
| 457 |
|
|
|
|
| 458 |
.litespeed-wrap .litespeed-btn-primary,
|
| 459 |
.litespeed-btn-primary {
|
| 460 |
color: #538ac6;
|
|
@@ -464,12 +487,14 @@ h3 .litespeed-learn-more {
|
|
| 464 |
box-shadow: 0 0 0 1px rgba(83, 138, 198, 0.25);
|
| 465 |
}
|
| 466 |
|
|
|
|
| 467 |
.litespeed-wrap .litespeed-btn-primary:hover,
|
| 468 |
.litespeed-btn-primary:hover {
|
| 469 |
background: #538ac6;
|
| 470 |
border-color: #538ac6;
|
| 471 |
}
|
| 472 |
|
|
|
|
| 473 |
.litespeed-wrap .litespeed-btn-default,
|
| 474 |
.litespeed-btn-default {
|
| 475 |
color: #a7a7a7;
|
|
@@ -479,11 +504,13 @@ h3 .litespeed-learn-more {
|
|
| 479 |
box-shadow: 0 0 0 1px rgba(158, 158, 158, 0.25);
|
| 480 |
}
|
| 481 |
|
|
|
|
| 482 |
.litespeed-wrap .litespeed-btn-default:hover,
|
| 483 |
.litespeed-btn-default:hover {
|
| 484 |
background: #a7a7a7;
|
| 485 |
}
|
| 486 |
|
|
|
|
| 487 |
.litespeed-wrap .litespeed-btn-default.disabled:hover,
|
| 488 |
.litespeed-btn-default.disabled:hover {
|
| 489 |
color: #a7a7a7;
|
|
@@ -496,6 +523,7 @@ h3 .litespeed-learn-more {
|
|
| 496 |
border-color: #adadad;
|
| 497 |
}
|
| 498 |
|
|
|
|
| 499 |
.litespeed-wrap .litespeed-btn-xs,
|
| 500 |
.litespeed-btn-xs {
|
| 501 |
padding: 1px 8px;
|
|
@@ -505,6 +533,7 @@ h3 .litespeed-learn-more {
|
|
| 505 |
min-width: 100px;
|
| 506 |
}
|
| 507 |
|
|
|
|
| 508 |
.litespeed-wrap .litespeed-btn-tiny,
|
| 509 |
.litespeed-btn-tiny {
|
| 510 |
padding: 1px 8px;
|
|
@@ -1233,12 +1262,9 @@ g.litespeed-pie_info text{
|
|
| 1233 |
text-anchor: middle;
|
| 1234 |
}
|
| 1235 |
|
| 1236 |
-
/*********************************
|
| 1237 |
-
|
| 1238 |
-
|
| 1239 |
-
}
|
| 1240 |
-
|
| 1241 |
-
.litespeed-cdn-mapping-block {
|
| 1242 |
border: 1px dotted #6699cc;
|
| 1243 |
border-radius:5px;
|
| 1244 |
display: flex;
|
|
@@ -1247,6 +1273,37 @@ g.litespeed-pie_info text{
|
|
| 1247 |
margin-bottom: 5px;
|
| 1248 |
}
|
| 1249 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1250 |
.litespeed-cdn-mapping-col1 {
|
| 1251 |
flex: 0 0 35%;
|
| 1252 |
padding-left: 17px;
|
|
@@ -1299,28 +1356,6 @@ g.litespeed-pie_info text{
|
|
| 1299 |
margin-right: 10px;
|
| 1300 |
}
|
| 1301 |
|
| 1302 |
-
.litespeed-child-col{
|
| 1303 |
-
flex: 0 0 30%;
|
| 1304 |
-
padding-left: 17px;
|
| 1305 |
-
}
|
| 1306 |
-
|
| 1307 |
-
.litespeed-child-col-auto{
|
| 1308 |
-
padding-left: 17px;
|
| 1309 |
-
}
|
| 1310 |
-
|
| 1311 |
-
.litespeed-child-col-br{
|
| 1312 |
-
flex: 0 0 100% ;
|
| 1313 |
-
border-top: 1px dotted #6699cc;
|
| 1314 |
-
}
|
| 1315 |
-
|
| 1316 |
-
.litespeed-child-col-inc{
|
| 1317 |
-
display: inline-block;
|
| 1318 |
-
margin-top: 16px ;
|
| 1319 |
-
min-width: 150px ;
|
| 1320 |
-
font-weight: bold;
|
| 1321 |
-
}
|
| 1322 |
-
|
| 1323 |
-
|
| 1324 |
/********************************* toggle *******************************/
|
| 1325 |
|
| 1326 |
.litespeed-toggle {
|
|
@@ -1475,7 +1510,77 @@ g.litespeed-pie_info text{
|
|
| 1475 |
top: -7px ;
|
| 1476 |
}
|
| 1477 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1478 |
/********************************* todo *******************************/
|
|
|
|
| 1479 |
/* input field */
|
| 1480 |
.litespeed-textarea {
|
| 1481 |
width: 60% ;
|
|
@@ -1527,7 +1632,9 @@ g.litespeed-pie_info text{
|
|
| 1527 |
margin-top: 0;
|
| 1528 |
}
|
| 1529 |
|
| 1530 |
-
.litespeed
|
|
|
|
|
|
|
| 1531 |
border: 1px solid #6699cc;
|
| 1532 |
border-radius: 3px;
|
| 1533 |
background: #fff;
|
|
@@ -1537,6 +1644,7 @@ g.litespeed-pie_info text{
|
|
| 1537 |
font-family: "Open Sans", Arial, sans-serif;
|
| 1538 |
}
|
| 1539 |
|
|
|
|
| 1540 |
.litespeed-regular-text {
|
| 1541 |
padding-left: 5px;
|
| 1542 |
width: 25em;
|
|
@@ -1544,6 +1652,10 @@ g.litespeed-pie_info text{
|
|
| 1544 |
font-family: "Open Sans", Arial, sans-serif;
|
| 1545 |
}
|
| 1546 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1547 |
.litespeed-input-long {
|
| 1548 |
width: 99%;
|
| 1549 |
}
|
| 3 |
content: '[' attr(litespeed-accesskey) '] ';
|
| 4 |
}
|
| 5 |
|
| 6 |
+
.litespeed-modal{
|
| 7 |
+
margin-top: -8px;
|
| 8 |
+
}
|
| 9 |
+
|
| 10 |
+
.litespeed-modal .litespeed-progress{
|
| 11 |
+
margin-left: -8px;
|
| 12 |
+
margin-right: -8px;
|
| 13 |
+
}
|
| 14 |
+
|
| 15 |
.litespeed-row {
|
| 16 |
display: block;
|
| 17 |
margin-top: 5px;
|
| 54 |
margin-top: 30px;
|
| 55 |
}
|
| 56 |
|
| 57 |
+
.litespeed-wrap .litespeed-left20,
|
| 58 |
.litespeed-left20 {
|
| 59 |
margin-left: 20px;
|
| 60 |
}
|
| 153 |
overflow: auto;
|
| 154 |
padding: 10px 15px 15px 15px;
|
| 155 |
position: relative;
|
|
|
|
| 156 |
color: #264d73;
|
| 157 |
}
|
| 158 |
|
| 159 |
+
.litespeed-header + .litespeed-body {
|
| 160 |
+
border-top: none;
|
| 161 |
+
}
|
| 162 |
+
|
| 163 |
.litespeed-body code{
|
| 164 |
color: #998c85 ;
|
| 165 |
background-color: #dde9f5;
|
| 199 |
display: table;
|
| 200 |
padding-right: 50px;
|
| 201 |
padding-left: 3px;
|
| 202 |
+
padding-bottom: 3px;
|
| 203 |
}
|
| 204 |
|
| 205 |
.litespeed-title a,
|
| 402 |
}
|
| 403 |
|
| 404 |
/********************************* btn *******************************/
|
| 405 |
+
.litespeed [class*="litespeed-btn-"],
|
| 406 |
.litespeed-wrap [class*="litespeed-btn-"],
|
| 407 |
[class*="litespeed-btn-"] {
|
| 408 |
padding: 5px 10px;
|
| 419 |
height: initial;
|
| 420 |
}
|
| 421 |
|
| 422 |
+
.litespeed [class*="litespeed-btn-"]:hover,
|
| 423 |
.litespeed-wrap [class*="litespeed-btn-"]:hover,
|
| 424 |
[class*="litespeed-btn-"]:hover {
|
| 425 |
font-weight: 400;
|
| 429 |
box-shadow: none;
|
| 430 |
}
|
| 431 |
|
| 432 |
+
.litespeed .litespeed-btn-danger,
|
| 433 |
.litespeed-wrap .litespeed-btn-danger,
|
| 434 |
.litespeed-btn-danger {
|
| 435 |
color: #cc3d6a;
|
| 439 |
box-shadow: 0 0 0 1px rgba(204, 61, 106, 0.25);
|
| 440 |
}
|
| 441 |
|
| 442 |
+
.litespeed .litespeed-btn-danger:hover,
|
| 443 |
.litespeed-wrap .litespeed-btn-danger:hover,
|
| 444 |
.litespeed-btn-danger:hover {
|
| 445 |
background: #cc3d6a;
|
| 446 |
}
|
| 447 |
|
| 448 |
+
.litespeed .litespeed-btn-warning,
|
| 449 |
.litespeed-wrap .litespeed-btn-warning,
|
| 450 |
.litespeed-btn-warning {
|
| 451 |
color: #e59544;
|
| 455 |
box-shadow: 0 0 0 1px rgba(230, 150, 69, 0.25);
|
| 456 |
}
|
| 457 |
|
| 458 |
+
.litespeed .litespeed-btn-warning:hover,
|
| 459 |
.litespeed-wrap .litespeed-btn-warning:hover,
|
| 460 |
.litespeed-btn-warning:hover {
|
| 461 |
background: #e59544;
|
| 462 |
}
|
| 463 |
|
| 464 |
+
.litespeed .litespeed-btn-success,
|
| 465 |
.litespeed-wrap .litespeed-btn-success,
|
| 466 |
.litespeed-btn-success {
|
| 467 |
color: #36b0b0;
|
| 471 |
box-shadow: 0 0 0 1px rgba(54, 176, 176, 0.25);
|
| 472 |
}
|
| 473 |
|
| 474 |
+
.litespeed .litespeed-btn-success:hover,
|
| 475 |
.litespeed-wrap .litespeed-btn-success:hover,
|
| 476 |
.litespeed-btn-success:hover {
|
| 477 |
background: #36b0b0;
|
| 478 |
}
|
| 479 |
|
| 480 |
+
.litespeed .litespeed-btn-primary,
|
| 481 |
.litespeed-wrap .litespeed-btn-primary,
|
| 482 |
.litespeed-btn-primary {
|
| 483 |
color: #538ac6;
|
| 487 |
box-shadow: 0 0 0 1px rgba(83, 138, 198, 0.25);
|
| 488 |
}
|
| 489 |
|
| 490 |
+
.litespeed .litespeed-btn-primary:hover,
|
| 491 |
.litespeed-wrap .litespeed-btn-primary:hover,
|
| 492 |
.litespeed-btn-primary:hover {
|
| 493 |
background: #538ac6;
|
| 494 |
border-color: #538ac6;
|
| 495 |
}
|
| 496 |
|
| 497 |
+
.litespeed .litespeed-btn-default,
|
| 498 |
.litespeed-wrap .litespeed-btn-default,
|
| 499 |
.litespeed-btn-default {
|
| 500 |
color: #a7a7a7;
|
| 504 |
box-shadow: 0 0 0 1px rgba(158, 158, 158, 0.25);
|
| 505 |
}
|
| 506 |
|
| 507 |
+
.litespeed .litespeed-btn-default:hover,
|
| 508 |
.litespeed-wrap .litespeed-btn-default:hover,
|
| 509 |
.litespeed-btn-default:hover {
|
| 510 |
background: #a7a7a7;
|
| 511 |
}
|
| 512 |
|
| 513 |
+
.litespeed .litespeed-btn-default.disabled:hover,
|
| 514 |
.litespeed-wrap .litespeed-btn-default.disabled:hover,
|
| 515 |
.litespeed-btn-default.disabled:hover {
|
| 516 |
color: #a7a7a7;
|
| 523 |
border-color: #adadad;
|
| 524 |
}
|
| 525 |
|
| 526 |
+
.litespeed .litespeed-btn-xs,
|
| 527 |
.litespeed-wrap .litespeed-btn-xs,
|
| 528 |
.litespeed-btn-xs {
|
| 529 |
padding: 1px 8px;
|
| 533 |
min-width: 100px;
|
| 534 |
}
|
| 535 |
|
| 536 |
+
.litespeed .litespeed-btn-tiny,
|
| 537 |
.litespeed-wrap .litespeed-btn-tiny,
|
| 538 |
.litespeed-btn-tiny {
|
| 539 |
padding: 1px 8px;
|
| 1262 |
text-anchor: middle;
|
| 1263 |
}
|
| 1264 |
|
| 1265 |
+
/********************************* block and columns *******************************/
|
| 1266 |
+
.litespeed-block,
|
| 1267 |
+
.litespeed-block-tiny {
|
|
|
|
|
|
|
|
|
|
| 1268 |
border: 1px dotted #6699cc;
|
| 1269 |
border-radius:5px;
|
| 1270 |
display: flex;
|
| 1273 |
margin-bottom: 5px;
|
| 1274 |
}
|
| 1275 |
|
| 1276 |
+
.litespeed-block-tiny {
|
| 1277 |
+
max-width: 670px ;
|
| 1278 |
+
}
|
| 1279 |
+
|
| 1280 |
+
.litespeed-col{
|
| 1281 |
+
flex: 0 0 30%;
|
| 1282 |
+
padding-left: 17px;
|
| 1283 |
+
}
|
| 1284 |
+
|
| 1285 |
+
.litespeed-col-auto{
|
| 1286 |
+
padding-left: 17px;
|
| 1287 |
+
}
|
| 1288 |
+
|
| 1289 |
+
.litespeed-col-br{
|
| 1290 |
+
flex: 0 0 100% ;
|
| 1291 |
+
border-top: 1px dotted #6699cc;
|
| 1292 |
+
}
|
| 1293 |
+
|
| 1294 |
+
.litespeed-col-inc{
|
| 1295 |
+
display: inline-block;
|
| 1296 |
+
margin-top: 16px ;
|
| 1297 |
+
min-width: 150px ;
|
| 1298 |
+
font-weight: bold;
|
| 1299 |
+
}
|
| 1300 |
+
|
| 1301 |
+
|
| 1302 |
+
/********************************* multiple cdn mapping styling *******************************/
|
| 1303 |
+
[data-litespeed-cdn-mapping]:first-child [data-litespeed-cdn-mapping-del]{
|
| 1304 |
+
display: none;
|
| 1305 |
+
}
|
| 1306 |
+
|
| 1307 |
.litespeed-cdn-mapping-col1 {
|
| 1308 |
flex: 0 0 35%;
|
| 1309 |
padding-left: 17px;
|
| 1356 |
margin-right: 10px;
|
| 1357 |
}
|
| 1358 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1359 |
/********************************* toggle *******************************/
|
| 1360 |
|
| 1361 |
.litespeed-toggle {
|
| 1510 |
top: -7px ;
|
| 1511 |
}
|
| 1512 |
|
| 1513 |
+
/********************************* Progress bar *******************************/
|
| 1514 |
+
.litespeed-progress-bar {
|
| 1515 |
+
display: -webkit-box;
|
| 1516 |
+
display: -ms-flexbox;
|
| 1517 |
+
display: flex;
|
| 1518 |
+
-webkit-box-orient: vertical;
|
| 1519 |
+
-webkit-box-direction: normal;
|
| 1520 |
+
-ms-flex-direction: column;
|
| 1521 |
+
flex-direction: column;
|
| 1522 |
+
-webkit-box-pack: center;
|
| 1523 |
+
-ms-flex-pack: center;
|
| 1524 |
+
justify-content: center;
|
| 1525 |
+
color: #fff;
|
| 1526 |
+
text-align: center;
|
| 1527 |
+
background-color: #007bff;
|
| 1528 |
+
transition: width .6s ease;
|
| 1529 |
+
}
|
| 1530 |
+
|
| 1531 |
+
.litespeed-progress {
|
| 1532 |
+
display: -webkit-box;
|
| 1533 |
+
display: -ms-flexbox;
|
| 1534 |
+
display: flex;
|
| 1535 |
+
height: 2px;
|
| 1536 |
+
overflow: hidden;
|
| 1537 |
+
font-size: .75rem;
|
| 1538 |
+
background-color: #e9ecef;
|
| 1539 |
+
}
|
| 1540 |
+
|
| 1541 |
+
/********************************* form input *******************************/
|
| 1542 |
+
input.litespeed-input[type="file"]{
|
| 1543 |
+
padding: 9px ;
|
| 1544 |
+
min-width: 500px ;
|
| 1545 |
+
}
|
| 1546 |
+
|
| 1547 |
+
/********************************* guidance *******************************/
|
| 1548 |
+
.litespeed-guide {
|
| 1549 |
+
border:1px solid #73b38d;
|
| 1550 |
+
max-width: 50%;
|
| 1551 |
+
padding: 20px;
|
| 1552 |
+
}
|
| 1553 |
+
|
| 1554 |
+
.litespeed-guide h2 {
|
| 1555 |
+
color: #73b38d;
|
| 1556 |
+
border-bottom:1px solid #73b38d;
|
| 1557 |
+
display: table;
|
| 1558 |
+
padding-right: 50px;
|
| 1559 |
+
padding-left: 3px;
|
| 1560 |
+
padding-bottom: 3px;
|
| 1561 |
+
}
|
| 1562 |
+
|
| 1563 |
+
.litespeed-guide li {
|
| 1564 |
+
font-size: 15px;
|
| 1565 |
+
line-height: 30px;
|
| 1566 |
+
margin: 10px 10px 10px 16px ;
|
| 1567 |
+
}
|
| 1568 |
+
|
| 1569 |
+
.litespeed-guide li.litespeed-guide-done:before{
|
| 1570 |
+
content: '\2713' ;
|
| 1571 |
+
font-size: 26px ;
|
| 1572 |
+
color: #73b38d ;
|
| 1573 |
+
margin-left: -37px ;
|
| 1574 |
+
margin-right: 18px ;
|
| 1575 |
+
opacity: 1 ;
|
| 1576 |
+
}
|
| 1577 |
+
|
| 1578 |
+
.litespeed-guide li.litespeed-guide-done {
|
| 1579 |
+
opacity: .9 ;
|
| 1580 |
+
}
|
| 1581 |
+
|
| 1582 |
/********************************* todo *******************************/
|
| 1583 |
+
|
| 1584 |
/* input field */
|
| 1585 |
.litespeed-textarea {
|
| 1586 |
width: 60% ;
|
| 1632 |
margin-top: 0;
|
| 1633 |
}
|
| 1634 |
|
| 1635 |
+
.litespeed input,
|
| 1636 |
+
.litespeed-body input,
|
| 1637 |
+
.litespeed-body textarea {
|
| 1638 |
border: 1px solid #6699cc;
|
| 1639 |
border-radius: 3px;
|
| 1640 |
background: #fff;
|
| 1644 |
font-family: "Open Sans", Arial, sans-serif;
|
| 1645 |
}
|
| 1646 |
|
| 1647 |
+
.litespeed .litespeed-regular-text,
|
| 1648 |
.litespeed-regular-text {
|
| 1649 |
padding-left: 5px;
|
| 1650 |
width: 25em;
|
| 1652 |
font-family: "Open Sans", Arial, sans-serif;
|
| 1653 |
}
|
| 1654 |
|
| 1655 |
+
.litespeed .litespeed-input-large {
|
| 1656 |
+
font-size: 20px ;
|
| 1657 |
+
}
|
| 1658 |
+
|
| 1659 |
.litespeed-input-long {
|
| 1660 |
width: 99%;
|
| 1661 |
}
|
inc/activation.class.php
CHANGED
|
@@ -119,6 +119,16 @@ class LiteSpeed_Cache_Activation
|
|
| 119 |
$count++ ;
|
| 120 |
}
|
| 121 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 122 |
if ( is_plugin_active_for_network( LSCWP_BASENAME ) ) {
|
| 123 |
$count++ ;
|
| 124 |
}
|
| 119 |
$count++ ;
|
| 120 |
}
|
| 121 |
}
|
| 122 |
+
|
| 123 |
+
/**
|
| 124 |
+
* In case this is called outside the admin page
|
| 125 |
+
* @see https://codex.wordpress.org/Function_Reference/is_plugin_active_for_network
|
| 126 |
+
* @since 2.0
|
| 127 |
+
*/
|
| 128 |
+
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 129 |
+
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
if ( is_plugin_active_for_network( LSCWP_BASENAME ) ) {
|
| 133 |
$count++ ;
|
| 134 |
}
|
inc/cdn.class.php
CHANGED
|
@@ -80,21 +80,29 @@ class LiteSpeed_Cache_CDN
|
|
| 80 |
}
|
| 81 |
$this_url = $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_URL ] ;
|
| 82 |
$this_host = parse_url( $this_url, PHP_URL_HOST ) ;
|
|
|
|
| 83 |
foreach ( $mapping_to_check as $to_check ) {
|
| 84 |
if ( $v[ $to_check ] ) {
|
| 85 |
LiteSpeed_Cache_Log::debug2( 'CDN: mapping ' . $to_check . ' -> ' . $this_url ) ;
|
| 86 |
-
|
|
|
|
|
|
|
|
|
|
| 87 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 88 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 89 |
}
|
| 90 |
}
|
| 91 |
}
|
|
|
|
| 92 |
if ( $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) {
|
| 93 |
$filetypes = array_map( 'trim', explode( "\n", $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) ) ;
|
| 94 |
foreach ( $filetypes as $v2 ) {
|
| 95 |
if ( $v2 ) {
|
| 96 |
$this->cfg_cdn_mapping[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] = true ;
|
| 97 |
-
|
|
|
|
|
|
|
|
|
|
| 98 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 99 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 100 |
}
|
|
@@ -141,6 +149,28 @@ class LiteSpeed_Cache_CDN
|
|
| 141 |
|
| 142 |
}
|
| 143 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 144 |
/**
|
| 145 |
* Handle all request actions from main cls
|
| 146 |
*
|
|
@@ -515,6 +545,11 @@ class LiteSpeed_Cache_CDN
|
|
| 515 |
$final_url = $this->cfg_cdn_mapping[ $postfix ] ;
|
| 516 |
}
|
| 517 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 518 |
// Now lets replace CDN url
|
| 519 |
if ( strpos( $this->cfg_url_ori, '*' ) !== false ) {
|
| 520 |
$url = preg_replace( '#' . $scheme . $this->cfg_url_ori . '#iU', $final_url, $url ) ;
|
| 80 |
}
|
| 81 |
$this_url = $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_URL ] ;
|
| 82 |
$this_host = parse_url( $this_url, PHP_URL_HOST ) ;
|
| 83 |
+
// Check img/css/js
|
| 84 |
foreach ( $mapping_to_check as $to_check ) {
|
| 85 |
if ( $v[ $to_check ] ) {
|
| 86 |
LiteSpeed_Cache_Log::debug2( 'CDN: mapping ' . $to_check . ' -> ' . $this_url ) ;
|
| 87 |
+
|
| 88 |
+
// If filetype to url is one to many, make url be an array
|
| 89 |
+
$this->_append_cdn_mapping( $to_check, $this_url ) ;
|
| 90 |
+
|
| 91 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 92 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 93 |
}
|
| 94 |
}
|
| 95 |
}
|
| 96 |
+
// Check file types
|
| 97 |
if ( $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) {
|
| 98 |
$filetypes = array_map( 'trim', explode( "\n", $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) ) ;
|
| 99 |
foreach ( $filetypes as $v2 ) {
|
| 100 |
if ( $v2 ) {
|
| 101 |
$this->cfg_cdn_mapping[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] = true ;
|
| 102 |
+
|
| 103 |
+
// If filetype to url is one to many, make url be an array
|
| 104 |
+
$this->_append_cdn_mapping( $v2, $this_url ) ;
|
| 105 |
+
|
| 106 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 107 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 108 |
}
|
| 149 |
|
| 150 |
}
|
| 151 |
|
| 152 |
+
/**
|
| 153 |
+
* Associate all filetypes with url
|
| 154 |
+
*
|
| 155 |
+
* @since 2.0
|
| 156 |
+
* @access private
|
| 157 |
+
*/
|
| 158 |
+
private function _append_cdn_mapping( $filetype, $url )
|
| 159 |
+
{
|
| 160 |
+
// If filetype to url is one to many, make url be an array
|
| 161 |
+
if ( empty( $this->cfg_cdn_mapping[ $filetype ] ) ) {
|
| 162 |
+
$this->cfg_cdn_mapping[ $filetype ] = $url ;
|
| 163 |
+
}
|
| 164 |
+
elseif ( is_array( $this->cfg_cdn_mapping[ $filetype ] ) ) {
|
| 165 |
+
// Append url to filetype
|
| 166 |
+
$this->cfg_cdn_mapping[ $filetype ][] = $url ;
|
| 167 |
+
}
|
| 168 |
+
else {
|
| 169 |
+
// Convert cfg_cdn_mapping from string to array
|
| 170 |
+
$this->cfg_cdn_mapping[ $filetype ] = array( $this->cfg_cdn_mapping[ $filetype ], $url ) ;
|
| 171 |
+
}
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
/**
|
| 175 |
* Handle all request actions from main cls
|
| 176 |
*
|
| 545 |
$final_url = $this->cfg_cdn_mapping[ $postfix ] ;
|
| 546 |
}
|
| 547 |
|
| 548 |
+
// If filetype to url is one to many, need to random one
|
| 549 |
+
if ( is_array( $final_url ) ) {
|
| 550 |
+
$final_url = $final_url[ mt_rand( 0, count( $final_url ) - 1 ) ] ;
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
// Now lets replace CDN url
|
| 554 |
if ( strpos( $this->cfg_url_ori, '*' ) !== false ) {
|
| 555 |
$url = preg_replace( '#' . $scheme . $this->cfg_url_ori . '#iU', $final_url, $url ) ;
|
inc/config.class.php
CHANGED
|
@@ -21,7 +21,7 @@ class LiteSpeed_Cache_Config
|
|
| 21 |
const ITEM_OPTM_CSS = 'litespeed-optm-css' ;// separate critical css that should be stored in option table
|
| 22 |
const ITEM_OPTM_JS_DEFER_EXC = 'litespeed-optm-js-defer-excludes' ;
|
| 23 |
const ITEM_MEDIA_LAZY_IMG_EXC = 'litespeed-media-lazy-img-excludes' ;
|
| 24 |
-
const
|
| 25 |
const ITEM_ENV_REF = 'litespeed-env-ref' ;
|
| 26 |
const ITEM_CACHE_DROP_QS = 'litespeed-cache-drop_qs' ;
|
| 27 |
const ITEM_CDN_MAPPING = 'litespeed-cache-cdn_mapping' ;
|
|
@@ -35,6 +35,7 @@ class LiteSpeed_Cache_Config
|
|
| 35 |
|
| 36 |
const ITEM_SETTING_MODE = 'litespeed-setting-mode' ;
|
| 37 |
const ITEM_CRAWLER_HASH = 'litespeed-crawler-hash' ;
|
|
|
|
| 38 |
|
| 39 |
// Server variables
|
| 40 |
const ENV_CRAWLER_USLEEP = 'CRAWLER_USLEEP' ;
|
|
@@ -200,6 +201,7 @@ class LiteSpeed_Cache_Config
|
|
| 200 |
const CRWL_LOAD_LIMIT = 'crawler_load_limit' ;
|
| 201 |
const CRWL_DOMAIN_IP = 'crawler_domain_ip' ;
|
| 202 |
const CRWL_CUSTOM_SITEMAP = 'crawler_custom_sitemap' ;
|
|
|
|
| 203 |
|
| 204 |
const CRWL_CRON_ACTIVE = 'crawler_cron_active' ;
|
| 205 |
|
|
@@ -271,12 +273,17 @@ class LiteSpeed_Cache_Config
|
|
| 271 |
{
|
| 272 |
$site_options = get_site_option( self::OPTION_NAME ) ;
|
| 273 |
|
| 274 |
-
if ( ! function_exists('is_plugin_active_for_network') ) { // todo: check if needed
|
| 275 |
-
require_once(ABSPATH . '/wp-admin/includes/plugin.php') ;
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
$options = get_option( self::OPTION_NAME, $this->get_default_options() ) ;
|
| 279 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 280 |
// If don't have site options
|
| 281 |
if ( ! $site_options || ! is_array( $site_options ) || ! is_plugin_active_for_network( 'litespeed-cache/litespeed-cache.php' ) ) {
|
| 282 |
if ( $options[ self::OPID_ENABLED_RADIO ] === self::VAL_ON2 ) { // Default to cache on
|
|
@@ -661,6 +668,7 @@ class LiteSpeed_Cache_Config
|
|
| 661 |
self::CRWL_DOMAIN_IP => '',
|
| 662 |
self::CRWL_CUSTOM_SITEMAP => '',
|
| 663 |
self::CRWL_CRON_ACTIVE => false,
|
|
|
|
| 664 |
) ;
|
| 665 |
|
| 666 |
if ( LSWCP_ESI_SUPPORT ) {
|
|
@@ -891,6 +899,9 @@ class LiteSpeed_Cache_Config
|
|
| 891 |
define( 'LSWCP_EMPTYCACHE', true ) ;// clear all sites caches
|
| 892 |
LiteSpeed_Cache_Purge::purge_all() ;
|
| 893 |
LiteSpeed_Cache_Log::debug( "Config: plugin_upgrade option changed = $res" ) ;
|
|
|
|
|
|
|
|
|
|
| 894 |
}
|
| 895 |
|
| 896 |
/**
|
| 21 |
const ITEM_OPTM_CSS = 'litespeed-optm-css' ;// separate critical css that should be stored in option table
|
| 22 |
const ITEM_OPTM_JS_DEFER_EXC = 'litespeed-optm-js-defer-excludes' ;
|
| 23 |
const ITEM_MEDIA_LAZY_IMG_EXC = 'litespeed-media-lazy-img-excludes' ;
|
| 24 |
+
const ITEM_IMG_OPTM_NEED_PULL = 'litespeed-media-need-pull' ;
|
| 25 |
const ITEM_ENV_REF = 'litespeed-env-ref' ;
|
| 26 |
const ITEM_CACHE_DROP_QS = 'litespeed-cache-drop_qs' ;
|
| 27 |
const ITEM_CDN_MAPPING = 'litespeed-cache-cdn_mapping' ;
|
| 35 |
|
| 36 |
const ITEM_SETTING_MODE = 'litespeed-setting-mode' ;
|
| 37 |
const ITEM_CRAWLER_HASH = 'litespeed-crawler-hash' ;
|
| 38 |
+
const ITEM_GUIDE = 'litespeed-guide' ; // Array of each guidance tag as key, step as val
|
| 39 |
|
| 40 |
// Server variables
|
| 41 |
const ENV_CRAWLER_USLEEP = 'CRAWLER_USLEEP' ;
|
| 201 |
const CRWL_LOAD_LIMIT = 'crawler_load_limit' ;
|
| 202 |
const CRWL_DOMAIN_IP = 'crawler_domain_ip' ;
|
| 203 |
const CRWL_CUSTOM_SITEMAP = 'crawler_custom_sitemap' ;
|
| 204 |
+
const CRWL_HTTP2 = 'crawler_http2' ;
|
| 205 |
|
| 206 |
const CRWL_CRON_ACTIVE = 'crawler_cron_active' ;
|
| 207 |
|
| 273 |
{
|
| 274 |
$site_options = get_site_option( self::OPTION_NAME ) ;
|
| 275 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 276 |
$options = get_option( self::OPTION_NAME, $this->get_default_options() ) ;
|
| 277 |
|
| 278 |
+
/**
|
| 279 |
+
* In case this is called outside the admin page
|
| 280 |
+
* @see https://codex.wordpress.org/Function_Reference/is_plugin_active_for_network
|
| 281 |
+
* @since 2.0
|
| 282 |
+
*/
|
| 283 |
+
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 284 |
+
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
// If don't have site options
|
| 288 |
if ( ! $site_options || ! is_array( $site_options ) || ! is_plugin_active_for_network( 'litespeed-cache/litespeed-cache.php' ) ) {
|
| 289 |
if ( $options[ self::OPID_ENABLED_RADIO ] === self::VAL_ON2 ) { // Default to cache on
|
| 668 |
self::CRWL_DOMAIN_IP => '',
|
| 669 |
self::CRWL_CUSTOM_SITEMAP => '',
|
| 670 |
self::CRWL_CRON_ACTIVE => false,
|
| 671 |
+
self::CRWL_HTTP2 => true,
|
| 672 |
) ;
|
| 673 |
|
| 674 |
if ( LSWCP_ESI_SUPPORT ) {
|
| 899 |
define( 'LSWCP_EMPTYCACHE', true ) ;// clear all sites caches
|
| 900 |
LiteSpeed_Cache_Purge::purge_all() ;
|
| 901 |
LiteSpeed_Cache_Log::debug( "Config: plugin_upgrade option changed = $res" ) ;
|
| 902 |
+
|
| 903 |
+
// Update img_optm table data for upgrading
|
| 904 |
+
LiteSpeed_Cache_Data::get_instance() ;
|
| 905 |
}
|
| 906 |
|
| 907 |
/**
|
inc/crawler.class.php
CHANGED
|
@@ -384,6 +384,8 @@ class LiteSpeed_Cache_Crawler
|
|
| 384 |
$crawler->set_base_url($this->_home_url) ;
|
| 385 |
$crawler->set_run_duration($options[LiteSpeed_Cache_Config::CRWL_RUN_DURATION]) ;
|
| 386 |
|
|
|
|
|
|
|
| 387 |
/**
|
| 388 |
* Limit delay to use server setting
|
| 389 |
* @since 1.8.3
|
| 384 |
$crawler->set_base_url($this->_home_url) ;
|
| 385 |
$crawler->set_run_duration($options[LiteSpeed_Cache_Config::CRWL_RUN_DURATION]) ;
|
| 386 |
|
| 387 |
+
$crawler->set_http2( $options[ LiteSpeed_Cache_Config::CRWL_HTTP2 ] ) ;
|
| 388 |
+
|
| 389 |
/**
|
| 390 |
* Limit delay to use server setting
|
| 391 |
* @since 1.8.3
|
inc/data.class.php
CHANGED
|
@@ -15,9 +15,11 @@ class LiteSpeed_Cache_Data
|
|
| 15 |
private static $_instance ;
|
| 16 |
|
| 17 |
const TB_OPTIMIZER = 'litespeed_optimizer' ;
|
|
|
|
| 18 |
|
| 19 |
private $_charset_collate ;
|
| 20 |
private $_tb_optm ;
|
|
|
|
| 21 |
|
| 22 |
/**
|
| 23 |
* Init
|
|
@@ -33,8 +35,21 @@ class LiteSpeed_Cache_Data
|
|
| 33 |
$this->_charset_collate = $wpdb->get_charset_collate() ;
|
| 34 |
|
| 35 |
$this->_tb_optm = $wpdb->base_prefix . self::TB_OPTIMIZER ;
|
|
|
|
| 36 |
|
| 37 |
-
$this->
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 38 |
}
|
| 39 |
|
| 40 |
/**
|
|
@@ -61,13 +76,136 @@ class LiteSpeed_Cache_Data
|
|
| 61 |
return $wpdb->get_var( "SHOW TABLES LIKE '$instance->_tb_optm'" ) ;
|
| 62 |
}
|
| 63 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 64 |
/**
|
| 65 |
* Create optimizer table
|
| 66 |
*
|
| 67 |
* @since 1.3.1
|
| 68 |
* @access private
|
| 69 |
*/
|
| 70 |
-
private function
|
| 71 |
{
|
| 72 |
if ( defined( 'LITESPEED_DID_' . __FUNCTION__ ) ) {
|
| 73 |
return ;
|
|
@@ -76,32 +214,26 @@ class LiteSpeed_Cache_Data
|
|
| 76 |
|
| 77 |
global $wpdb ;
|
| 78 |
|
| 79 |
-
LiteSpeed_Cache_Log::debug2( 'Data
|
| 80 |
|
| 81 |
// Check if table exists first
|
| 82 |
if ( $wpdb->get_var( "SHOW TABLES LIKE '$this->_tb_optm'" ) ) {
|
| 83 |
-
LiteSpeed_Cache_Log::debug2( 'Data
|
| 84 |
return ;
|
| 85 |
}
|
| 86 |
|
| 87 |
-
LiteSpeed_Cache_Log::debug( 'Data
|
| 88 |
|
| 89 |
$sql = sprintf(
|
| 90 |
-
'CREATE TABLE IF NOT EXISTS `%1$s` (
|
| 91 |
-
`id` int(11) NOT NULL AUTO_INCREMENT,
|
| 92 |
-
`hash_name` varchar(60) NOT NULL COMMENT "hash.filetype",
|
| 93 |
-
`src` text NOT NULL COMMENT "full url array set",
|
| 94 |
-
`dateline` int(11) NOT NULL,
|
| 95 |
-
`refer` varchar(255) NOT NULL COMMENT "The container page url",
|
| 96 |
-
PRIMARY KEY (`id`),
|
| 97 |
-
UNIQUE KEY `hash_name` (`hash_name`),
|
| 98 |
-
KEY `dateline` (`dateline`)
|
| 99 |
-
) %2$s;',
|
| 100 |
$this->_tb_optm,
|
| 101 |
$this->_charset_collate
|
| 102 |
) ;
|
| 103 |
|
| 104 |
-
$wpdb->query( $sql ) ;
|
|
|
|
|
|
|
|
|
|
| 105 |
|
| 106 |
// Move data from wp_options to here
|
| 107 |
$hashes = get_option( 'litespeed-cache-optimized' ) ;
|
|
@@ -169,7 +301,7 @@ class LiteSpeed_Cache_Data
|
|
| 169 |
$sql = $wpdb->prepare( 'SELECT src FROM `' . $this->_tb_optm . '` WHERE `hash_name` = %s', $filename ) ;
|
| 170 |
$res = $wpdb->get_var( $sql ) ;
|
| 171 |
|
| 172 |
-
LiteSpeed_Cache_Log::debug2( 'Data
|
| 173 |
|
| 174 |
$res = unserialize( $res ) ;
|
| 175 |
|
| 15 |
private static $_instance ;
|
| 16 |
|
| 17 |
const TB_OPTIMIZER = 'litespeed_optimizer' ;
|
| 18 |
+
const TB_IMG_OPTM = 'litespeed_img_optm' ;
|
| 19 |
|
| 20 |
private $_charset_collate ;
|
| 21 |
private $_tb_optm ;
|
| 22 |
+
private $_tb_img_optm ;
|
| 23 |
|
| 24 |
/**
|
| 25 |
* Init
|
| 35 |
$this->_charset_collate = $wpdb->get_charset_collate() ;
|
| 36 |
|
| 37 |
$this->_tb_optm = $wpdb->base_prefix . self::TB_OPTIMIZER ;
|
| 38 |
+
$this->_tb_img_optm = $wpdb->base_prefix . self::TB_IMG_OPTM ;
|
| 39 |
|
| 40 |
+
$this->_create_tb_img_optm() ;
|
| 41 |
+
$this->_create_tb_html_optm() ;
|
| 42 |
+
}
|
| 43 |
+
|
| 44 |
+
/**
|
| 45 |
+
* Get img_optm table name
|
| 46 |
+
*
|
| 47 |
+
* @since 2.0
|
| 48 |
+
* @access public
|
| 49 |
+
*/
|
| 50 |
+
public static function get_tb_img_optm()
|
| 51 |
+
{
|
| 52 |
+
return self::get_instance()->_tb_img_optm ;
|
| 53 |
}
|
| 54 |
|
| 55 |
/**
|
| 76 |
return $wpdb->get_var( "SHOW TABLES LIKE '$instance->_tb_optm'" ) ;
|
| 77 |
}
|
| 78 |
|
| 79 |
+
/**
|
| 80 |
+
* Get data structure of one table
|
| 81 |
+
*
|
| 82 |
+
* @since 2.0
|
| 83 |
+
* @access private
|
| 84 |
+
*/
|
| 85 |
+
private function _get_data_structure( $tb )
|
| 86 |
+
{
|
| 87 |
+
return Litespeed_File::read( LSCWP_DIR . 'inc/data_structure/' . $tb . '.sql' ) ;
|
| 88 |
+
}
|
| 89 |
+
|
| 90 |
+
/**
|
| 91 |
+
* Drop table img_optm
|
| 92 |
+
*
|
| 93 |
+
* @since 2.0
|
| 94 |
+
* @access private
|
| 95 |
+
*/
|
| 96 |
+
public function delete_tb_img_optm()
|
| 97 |
+
{
|
| 98 |
+
global $wpdb ;
|
| 99 |
+
|
| 100 |
+
if ( ! $wpdb->get_var( "SHOW TABLES LIKE '$this->_tb_img_optm'" ) ) {
|
| 101 |
+
return ;
|
| 102 |
+
}
|
| 103 |
+
|
| 104 |
+
LiteSpeed_Cache_Log::debug( '[Data] Deleting img_optm table' ) ;
|
| 105 |
+
|
| 106 |
+
$q = "DROP TABLE IF EXISTS $this->_tb_img_optm" ;
|
| 107 |
+
$wpdb->query( $q ) ;
|
| 108 |
+
|
| 109 |
+
delete_option( $this->_tb_img_optm ) ;
|
| 110 |
+
}
|
| 111 |
+
|
| 112 |
+
/**
|
| 113 |
+
* Create img optm table and sync data from wp_postmeta
|
| 114 |
+
*
|
| 115 |
+
* @since 2.0
|
| 116 |
+
* @access private
|
| 117 |
+
*/
|
| 118 |
+
private function _create_tb_img_optm()
|
| 119 |
+
{
|
| 120 |
+
if ( defined( 'LITESPEED_DID_' . __FUNCTION__ ) ) {
|
| 121 |
+
return ;
|
| 122 |
+
}
|
| 123 |
+
define( 'LITESPEED_DID_' . __FUNCTION__, true ) ;
|
| 124 |
+
|
| 125 |
+
global $wpdb ;
|
| 126 |
+
|
| 127 |
+
LiteSpeed_Cache_Log::debug2( '[Data] Checking img_optm table' ) ;
|
| 128 |
+
|
| 129 |
+
// Check if table exists first
|
| 130 |
+
if ( $wpdb->get_var( "SHOW TABLES LIKE '$this->_tb_img_optm'" ) ) {
|
| 131 |
+
LiteSpeed_Cache_Log::debug2( '[Data] Existed' ) ;
|
| 132 |
+
// return ;
|
| 133 |
+
}
|
| 134 |
+
else {
|
| 135 |
+
LiteSpeed_Cache_Log::debug( '[Data] Creating img_optm table' ) ;
|
| 136 |
+
|
| 137 |
+
$sql = sprintf(
|
| 138 |
+
'CREATE TABLE IF NOT EXISTS `%1$s` (' . $this->_get_data_structure( 'img_optm' ) . ') %2$s;',
|
| 139 |
+
$this->_tb_img_optm,
|
| 140 |
+
$this->_charset_collate // 'DEFAULT CHARSET=utf8'
|
| 141 |
+
) ;
|
| 142 |
+
|
| 143 |
+
$res = $wpdb->query( $sql ) ;
|
| 144 |
+
if ( $res !== true ) {
|
| 145 |
+
LiteSpeed_Cache_Log::debug( '[Data] Warning: Creating img_optm table failed!', $sql ) ;
|
| 146 |
+
}
|
| 147 |
+
|
| 148 |
+
// Clear OC to avoid get `_tb_img_optm` from option failed
|
| 149 |
+
if ( defined( 'LSCWP_OBJECT_CACHE' ) ) {
|
| 150 |
+
LiteSpeed_Cache_Object::get_instance()->flush() ;
|
| 151 |
+
}
|
| 152 |
+
|
| 153 |
+
}
|
| 154 |
+
|
| 155 |
+
// Table version only exists after all old data migrated
|
| 156 |
+
$ver = get_option( $this->_tb_img_optm ) ;
|
| 157 |
+
if ( $ver && LiteSpeed_Cache_API::v( $ver ) ) {
|
| 158 |
+
return ;
|
| 159 |
+
}
|
| 160 |
+
|
| 161 |
+
// Migrate data from `wp_postmeta` to `wp_litespeed_img_optm`
|
| 162 |
+
$mids_to_del = array() ;
|
| 163 |
+
$q = "SELECT * FROM $wpdb->postmeta WHERE meta_key = %s ORDER BY meta_id" ;
|
| 164 |
+
$meta_value_list = $wpdb->get_results( $wpdb->prepare( $q, array( LiteSpeed_Cache_Img_Optm::DB_IMG_OPTIMIZE_DATA ) ) ) ;
|
| 165 |
+
if ( $meta_value_list ) {
|
| 166 |
+
$max_k = count( $meta_value_list ) - 1 ;
|
| 167 |
+
foreach ( $meta_value_list as $k => $v ) {
|
| 168 |
+
$md52src_list = unserialize( $v->meta_value ) ;
|
| 169 |
+
foreach ( $md52src_list as $md5 => $v2 ) {
|
| 170 |
+
$f = array(
|
| 171 |
+
'post_id' => $v->post_id,
|
| 172 |
+
'optm_status' => $v2[ 1 ],
|
| 173 |
+
'src' => $v2[ 0 ],
|
| 174 |
+
'srcpath_md5' => md5( $v2[ 0 ] ),
|
| 175 |
+
'src_md5' => $md5,
|
| 176 |
+
'server' => $v2[ 2 ],
|
| 177 |
+
) ;
|
| 178 |
+
$wpdb->replace( $this->_tb_img_optm, $f ) ;
|
| 179 |
+
}
|
| 180 |
+
$mids_to_del[] = $v->meta_id ;
|
| 181 |
+
|
| 182 |
+
// Delete from postmeta
|
| 183 |
+
if ( count( $mids_to_del ) > 100 || $k == $max_k ) {
|
| 184 |
+
$q = "DELETE FROM $wpdb->postmeta WHERE meta_id IN ( " . implode( ',', array_fill( 0, count( $mids_to_del ), '%s' ) ) . " ) " ;
|
| 185 |
+
$wpdb->query( $wpdb->prepare( $q, $mids_to_del ) ) ;
|
| 186 |
+
|
| 187 |
+
$mids_to_del = array() ;
|
| 188 |
+
}
|
| 189 |
+
}
|
| 190 |
+
|
| 191 |
+
LiteSpeed_Cache_Log::debug( '[Data] img_optm inserted records: ' . $k ) ;
|
| 192 |
+
}
|
| 193 |
+
|
| 194 |
+
$q = "DELETE FROM $wpdb->postmeta WHERE meta_key = %s" ;
|
| 195 |
+
$rows = $wpdb->query( $wpdb->prepare( $q, LiteSpeed_Cache_Img_Optm::DB_IMG_OPTIMIZE_STATUS ) ) ;
|
| 196 |
+
LiteSpeed_Cache_Log::debug( '[Data] img_optm delete optm_status records: ' . $rows ) ;
|
| 197 |
+
|
| 198 |
+
// Record tb version
|
| 199 |
+
update_option( $this->_tb_img_optm, LiteSpeed_Cache::PLUGIN_VERSION ) ;
|
| 200 |
+
}
|
| 201 |
+
|
| 202 |
/**
|
| 203 |
* Create optimizer table
|
| 204 |
*
|
| 205 |
* @since 1.3.1
|
| 206 |
* @access private
|
| 207 |
*/
|
| 208 |
+
private function _create_tb_html_optm()
|
| 209 |
{
|
| 210 |
if ( defined( 'LITESPEED_DID_' . __FUNCTION__ ) ) {
|
| 211 |
return ;
|
| 214 |
|
| 215 |
global $wpdb ;
|
| 216 |
|
| 217 |
+
LiteSpeed_Cache_Log::debug2( '[Data] Checking html optm table' ) ;
|
| 218 |
|
| 219 |
// Check if table exists first
|
| 220 |
if ( $wpdb->get_var( "SHOW TABLES LIKE '$this->_tb_optm'" ) ) {
|
| 221 |
+
LiteSpeed_Cache_Log::debug2( '[Data] Existed' ) ;
|
| 222 |
return ;
|
| 223 |
}
|
| 224 |
|
| 225 |
+
LiteSpeed_Cache_Log::debug( '[Data] Creating html optm table' ) ;
|
| 226 |
|
| 227 |
$sql = sprintf(
|
| 228 |
+
'CREATE TABLE IF NOT EXISTS `%1$s` (' . $this->_get_data_structure( 'optm' ) . ') %2$s;',
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 229 |
$this->_tb_optm,
|
| 230 |
$this->_charset_collate
|
| 231 |
) ;
|
| 232 |
|
| 233 |
+
$res = $wpdb->query( $sql ) ;
|
| 234 |
+
if ( $res !== true ) {
|
| 235 |
+
LiteSpeed_Cache_Log::debug( '[Data] Warning: Creating html optm table failed!' ) ;
|
| 236 |
+
}
|
| 237 |
|
| 238 |
// Move data from wp_options to here
|
| 239 |
$hashes = get_option( 'litespeed-cache-optimized' ) ;
|
| 301 |
$sql = $wpdb->prepare( 'SELECT src FROM `' . $this->_tb_optm . '` WHERE `hash_name` = %s', $filename ) ;
|
| 302 |
$res = $wpdb->get_var( $sql ) ;
|
| 303 |
|
| 304 |
+
LiteSpeed_Cache_Log::debug2( '[Data] Loaded hash2src ' . $res ) ;
|
| 305 |
|
| 306 |
$res = unserialize( $res ) ;
|
| 307 |
|
inc/data_structure/img_optm.sql
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
`id` int(11) unsigned NOT NULL AUTO_INCREMENT,
|
| 2 |
+
`post_id` bigint(20) unsigned NOT NULL DEFAULT '0',
|
| 3 |
+
`optm_status` varchar(255) NOT NULL DEFAULT '',
|
| 4 |
+
`src` varchar(1000) NOT NULL DEFAULT '',
|
| 5 |
+
`srcpath_md5` varchar(128) NOT NULL DEFAULT '',
|
| 6 |
+
`src_md5` varchar(128) NOT NULL DEFAULT '',
|
| 7 |
+
`server` varchar(255) NOT NULL DEFAULT '',
|
| 8 |
+
`root_id` int(11) NOT NULL DEFAULT '0',
|
| 9 |
+
`src_filesize` int(11) NOT NULL DEFAULT '0',
|
| 10 |
+
`target_filesize` int(11) NOT NULL DEFAULT '0',
|
| 11 |
+
`target_saved` int(11) NOT NULL DEFAULT '0',
|
| 12 |
+
`webp_filesize` int(11) NOT NULL DEFAULT '0',
|
| 13 |
+
`webp_saved` int(11) NOT NULL DEFAULT '0',
|
| 14 |
+
PRIMARY KEY (`id`),
|
| 15 |
+
UNIQUE KEY `post_id_2` (`post_id`,`srcpath_md5`),
|
| 16 |
+
KEY `post_id` (`post_id`),
|
| 17 |
+
KEY `optm_status` (`optm_status`),
|
| 18 |
+
KEY `root_id` (`root_id`),
|
| 19 |
+
KEY `src_md5` (`src_md5`),
|
| 20 |
+
KEY `srcpath_md5` (`srcpath_md5`)
|
inc/data_structure/optm.sql
ADDED
|
@@ -0,0 +1,8 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
`id` int(11) NOT NULL AUTO_INCREMENT,
|
| 2 |
+
`hash_name` varchar(60) NOT NULL COMMENT "hash.filetype",
|
| 3 |
+
`src` text NOT NULL COMMENT "full url array set",
|
| 4 |
+
`dateline` int(11) NOT NULL,
|
| 5 |
+
`refer` varchar(255) NOT NULL COMMENT "The container page url",
|
| 6 |
+
PRIMARY KEY (`id`),
|
| 7 |
+
UNIQUE KEY `hash_name` (`hash_name`),
|
| 8 |
+
KEY `dateline` (`dateline`)
|
inc/gui.class.php
CHANGED
|
@@ -79,15 +79,17 @@ class LiteSpeed_Cache_GUI
|
|
| 79 |
*
|
| 80 |
* @since 1.6.6
|
| 81 |
*/
|
| 82 |
-
public static function pie( $percent, $width = 50 )
|
| 83 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
| 84 |
return "
|
| 85 |
<svg class='litespeed-pie' viewbox='0 0 33.83098862 33.83098862' width='$width' height='$width' xmlns='http://www.w3.org/2000/svg'>
|
| 86 |
<circle class='litespeed-pie_bg' />
|
| 87 |
<circle class='litespeed-pie_circle' stroke-dasharray='$percent,100' />
|
| 88 |
-
<g class='litespeed-pie_info'>
|
| 89 |
-
<text x='16.91549431' y='15.5'>$percent%</text>
|
| 90 |
-
</g>
|
| 91 |
</svg>
|
| 92 |
";
|
| 93 |
|
| 79 |
*
|
| 80 |
* @since 1.6.6
|
| 81 |
*/
|
| 82 |
+
public static function pie( $percent, $width = 50, $finished_tick = false )
|
| 83 |
{
|
| 84 |
+
$percentage = '<text x="16.91549431" y="15.5">' . $percent . '%</text>' ;
|
| 85 |
+
if ( $percent == 100 && $finished_tick ) {
|
| 86 |
+
$percentage = '<text x="16.91549431" y="15.5" fill="#73b38d">✓</text>' ;
|
| 87 |
+
}
|
| 88 |
return "
|
| 89 |
<svg class='litespeed-pie' viewbox='0 0 33.83098862 33.83098862' width='$width' height='$width' xmlns='http://www.w3.org/2000/svg'>
|
| 90 |
<circle class='litespeed-pie_bg' />
|
| 91 |
<circle class='litespeed-pie_circle' stroke-dasharray='$percent,100' />
|
| 92 |
+
<g class='litespeed-pie_info'>$percentage</g>
|
|
|
|
|
|
|
| 93 |
</svg>
|
| 94 |
";
|
| 95 |
|
inc/img_optm.class.php
ADDED
|
@@ -0,0 +1,1640 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
<?php
|
| 2 |
+
|
| 3 |
+
/**
|
| 4 |
+
* The class to optimize image.
|
| 5 |
+
*
|
| 6 |
+
* @since 2.0
|
| 7 |
+
* @package LiteSpeed_Cache
|
| 8 |
+
* @subpackage LiteSpeed_Cache/inc
|
| 9 |
+
* @author LiteSpeed Technologies <info@litespeedtech.com>
|
| 10 |
+
*/
|
| 11 |
+
|
| 12 |
+
class LiteSpeed_Cache_Img_Optm
|
| 13 |
+
{
|
| 14 |
+
private static $_instance ;
|
| 15 |
+
|
| 16 |
+
const TYPE_SYNC_DATA = 'sync_data' ;
|
| 17 |
+
const TYPE_IMG_OPTIMIZE = 'img_optm' ;
|
| 18 |
+
const TYPE_IMG_OPTIMIZE_RESCAN = 'img_optm_rescan' ;
|
| 19 |
+
const TYPE_IMG_OPTIMIZE_DESTROY = 'img_optm_destroy' ;
|
| 20 |
+
const TYPE_IMG_PULL = 'img_pull' ;
|
| 21 |
+
const TYPE_IMG_BATCH_SWITCH_ORI = 'img_optm_batch_switch_ori' ;
|
| 22 |
+
const TYPE_IMG_BATCH_SWITCH_OPTM = 'img_optm_batch_switch_optm' ;
|
| 23 |
+
|
| 24 |
+
const ITEM_IMG_OPTM_CRON_RUN = 'litespeed-img_optm_cron_run' ; // last cron running time
|
| 25 |
+
|
| 26 |
+
const DB_IMG_OPTIMIZE_DESTROY = 'litespeed-optimize-destroy' ;
|
| 27 |
+
const DB_IMG_OPTIMIZE_DATA = 'litespeed-optimize-data' ;
|
| 28 |
+
const DB_IMG_OPTIMIZE_STATUS = 'litespeed-optimize-status' ;
|
| 29 |
+
const DB_IMG_OPTIMIZE_STATUS_REQUESTED = 'requested' ;
|
| 30 |
+
const DB_IMG_OPTIMIZE_STATUS_NOTIFIED = 'notified' ;
|
| 31 |
+
const DB_IMG_OPTIMIZE_STATUS_PULLED = 'pulled' ;
|
| 32 |
+
const DB_IMG_OPTIMIZE_STATUS_FAILED = 'failed' ;
|
| 33 |
+
const DB_IMG_OPTIMIZE_STATUS_MISS = 'miss' ;
|
| 34 |
+
const DB_IMG_OPTIMIZE_STATUS_ERR = 'err' ;
|
| 35 |
+
const DB_IMG_OPTIMIZE_SIZE = 'litespeed-optimize-size' ;
|
| 36 |
+
|
| 37 |
+
const DB_IMG_OPTM_SUMMARY = 'litespeed_img_optm_summary' ;
|
| 38 |
+
|
| 39 |
+
private $wp_upload_dir ;
|
| 40 |
+
private $tmp_pid ;
|
| 41 |
+
private $tmp_path ;
|
| 42 |
+
private $_img_in_queue = array() ;
|
| 43 |
+
private $_img_duplicated_in_queue = array() ;
|
| 44 |
+
private $_missed_img_in_queue = array() ;
|
| 45 |
+
private $_img_srcpath_md5_array = array() ;
|
| 46 |
+
private $_img_total = 0 ;
|
| 47 |
+
private $_table_img_optm ;
|
| 48 |
+
private $_cron_ran = false ;
|
| 49 |
+
|
| 50 |
+
/**
|
| 51 |
+
* Init
|
| 52 |
+
*
|
| 53 |
+
* @since 2.0
|
| 54 |
+
* @access private
|
| 55 |
+
*/
|
| 56 |
+
private function __construct()
|
| 57 |
+
{
|
| 58 |
+
LiteSpeed_Cache_Log::debug2( 'ImgOptm init' ) ;
|
| 59 |
+
|
| 60 |
+
$this->wp_upload_dir = wp_upload_dir() ;
|
| 61 |
+
$this->_table_img_optm = LiteSpeed_Cache_Data::get_tb_img_optm() ;
|
| 62 |
+
}
|
| 63 |
+
|
| 64 |
+
/**
|
| 65 |
+
* Sync data from litespeed IAPI server
|
| 66 |
+
*
|
| 67 |
+
* @since 1.6.5
|
| 68 |
+
* @access private
|
| 69 |
+
*/
|
| 70 |
+
private function _sync_data()
|
| 71 |
+
{
|
| 72 |
+
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_MEDIA_SYNC_DATA ) ;
|
| 73 |
+
|
| 74 |
+
if ( ! is_array( $json ) ) {
|
| 75 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to post to LiteSpeed IAPI server ', $json ) ;
|
| 76 |
+
$msg = __( 'Failed to communicate with LiteSpeed IAPI server', 'litespeed-cache' ) . ': ' . $json ;
|
| 77 |
+
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 78 |
+
return ;
|
| 79 |
+
}
|
| 80 |
+
|
| 81 |
+
if ( ! empty( $json ) ) {
|
| 82 |
+
update_option( self::DB_IMG_OPTM_SUMMARY, $json ) ;
|
| 83 |
+
}
|
| 84 |
+
|
| 85 |
+
$msg = __( 'Communicated with LiteSpeed Image Optimization Server successfully.', 'litespeed-cache' ) ;
|
| 86 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 87 |
+
|
| 88 |
+
// Update guidance
|
| 89 |
+
if ( ! empty( $json[ 'level' ] ) && $json[ 'level' ] > 1 ) {
|
| 90 |
+
$this->_update_guidance_pos( 'done' ) ;
|
| 91 |
+
}
|
| 92 |
+
elseif ( $this->get_guidance_pos() == 1 ) {
|
| 93 |
+
$this->_update_guidance_pos( 2 ) ;
|
| 94 |
+
}
|
| 95 |
+
|
| 96 |
+
LiteSpeed_Cache_Admin::redirect() ;
|
| 97 |
+
|
| 98 |
+
}
|
| 99 |
+
|
| 100 |
+
/**
|
| 101 |
+
* Push raw img to LiteSpeed IAPI server
|
| 102 |
+
*
|
| 103 |
+
* @since 1.6
|
| 104 |
+
* @access private
|
| 105 |
+
*/
|
| 106 |
+
private function _request_optm()
|
| 107 |
+
{
|
| 108 |
+
global $wpdb ;
|
| 109 |
+
|
| 110 |
+
$_credit = (int) $this->summary_info( 'credit' ) ;
|
| 111 |
+
$credit_recovered = (int) $this->summary_info( 'credit_recovered' ) ;
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] preparing images to push' ) ;
|
| 115 |
+
|
| 116 |
+
// Get images
|
| 117 |
+
$q = "SELECT b.post_id, b.meta_value
|
| 118 |
+
FROM $wpdb->posts a
|
| 119 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 120 |
+
LEFT JOIN $this->_table_img_optm c ON c.post_id = a.ID
|
| 121 |
+
WHERE a.post_type = 'attachment'
|
| 122 |
+
AND a.post_status = 'inherit'
|
| 123 |
+
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 124 |
+
AND b.meta_key = '_wp_attachment_metadata'
|
| 125 |
+
AND c.id IS NULL
|
| 126 |
+
ORDER BY a.ID DESC
|
| 127 |
+
LIMIT %d
|
| 128 |
+
" ;
|
| 129 |
+
$q = $wpdb->prepare( $q, apply_filters( 'litespeed_img_optimize_max_rows', 100 ) ) ;
|
| 130 |
+
|
| 131 |
+
$img_set = array() ;
|
| 132 |
+
$list = $wpdb->get_results( $q ) ;
|
| 133 |
+
if ( ! $list ) {
|
| 134 |
+
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 135 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 136 |
+
|
| 137 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] optimize bypass: no image found' ) ;
|
| 138 |
+
return ;
|
| 139 |
+
}
|
| 140 |
+
|
| 141 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] found images: ' . count( $list ) ) ;
|
| 142 |
+
|
| 143 |
+
foreach ( $list as $v ) {
|
| 144 |
+
|
| 145 |
+
$meta_value = $this->_parse_wp_meta_value( $v ) ;
|
| 146 |
+
if ( ! $meta_value ) {
|
| 147 |
+
continue ;
|
| 148 |
+
}
|
| 149 |
+
|
| 150 |
+
/**
|
| 151 |
+
* Only send 500 images one time
|
| 152 |
+
* @since 1.6.3
|
| 153 |
+
* @since 1.6.5 use credit limit
|
| 154 |
+
*/
|
| 155 |
+
$num_will_incease = 1 ;
|
| 156 |
+
if ( ! empty( $meta_value[ 'sizes' ] ) ) {
|
| 157 |
+
$num_will_incease += count( $meta_value[ 'sizes' ] ) ;
|
| 158 |
+
}
|
| 159 |
+
if ( $this->_img_total + $num_will_incease > $_credit ) {
|
| 160 |
+
if ( ! $this->_img_total ) {
|
| 161 |
+
$msg = sprintf( __( 'Number of images in one image group (%s) exceeds the credit (%s)', 'litespeed-cache' ), $num_will_incease, $_credit ) ;
|
| 162 |
+
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 163 |
+
}
|
| 164 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] img request hit limit: [total] ' . $this->_img_total . " \t[add] $num_will_incease \t[credit] $_credit" ) ;
|
| 165 |
+
break ;
|
| 166 |
+
}
|
| 167 |
+
/**
|
| 168 |
+
* Check if need to test run ( new user only allow 1 group at first time)
|
| 169 |
+
* @since 1.6.6.1
|
| 170 |
+
*/
|
| 171 |
+
if ( $this->_img_total && ! $credit_recovered ) {
|
| 172 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] test run only allow 1 group ' ) ;
|
| 173 |
+
break ;
|
| 174 |
+
}
|
| 175 |
+
|
| 176 |
+
// push orig image to queue
|
| 177 |
+
$this->tmp_pid = $v->post_id ;
|
| 178 |
+
$this->tmp_path = pathinfo( $meta_value[ 'file' ], PATHINFO_DIRNAME ) . '/' ;
|
| 179 |
+
$this->_img_queue( $meta_value, true ) ;
|
| 180 |
+
if ( ! empty( $meta_value[ 'sizes' ] ) ) {
|
| 181 |
+
array_map( array( $this, '_img_queue' ), $meta_value[ 'sizes' ] ) ;
|
| 182 |
+
}
|
| 183 |
+
}
|
| 184 |
+
|
| 185 |
+
// Save missed images into img_optm
|
| 186 |
+
$this->_save_missed_into_img_optm() ;
|
| 187 |
+
|
| 188 |
+
if ( empty( $this->_img_in_queue ) ) {
|
| 189 |
+
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 190 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 191 |
+
|
| 192 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] optimize bypass: empty _img_in_queue' ) ;
|
| 193 |
+
return ;
|
| 194 |
+
}
|
| 195 |
+
|
| 196 |
+
// Filtered from existing data
|
| 197 |
+
$this->_filter_existing_src() ;
|
| 198 |
+
|
| 199 |
+
/**
|
| 200 |
+
* Filter same src in $this->_img_in_queue
|
| 201 |
+
*
|
| 202 |
+
* 1. Save them to tmp array $this->_img_duplicated_in_queue
|
| 203 |
+
* 2. Remove them from $this->_img_in_queue
|
| 204 |
+
* 3. After inserted $this->_img_in_queue into img_optm, insert $this->_img_duplicated_in_queue into img_optm with root_id
|
| 205 |
+
*/
|
| 206 |
+
$this->_filter_duplicated_src() ;
|
| 207 |
+
|
| 208 |
+
if ( empty( $this->_img_in_queue ) ) {
|
| 209 |
+
$msg = __( 'Optimized successfully.', 'litespeed-cache' ) ;
|
| 210 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 211 |
+
return ;
|
| 212 |
+
}
|
| 213 |
+
|
| 214 |
+
$total_groups = count( $this->_img_in_queue ) ;
|
| 215 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] prepared images to push: groups ' . $total_groups . ' images ' . $this->_img_total ) ;
|
| 216 |
+
|
| 217 |
+
// Push to LiteSpeed IAPI server
|
| 218 |
+
$json = $this->_push_img_in_queue_to_iapi() ;
|
| 219 |
+
if ( $json === null ) {
|
| 220 |
+
return ;
|
| 221 |
+
}
|
| 222 |
+
$pids = $json[ 'pids' ] ;
|
| 223 |
+
|
| 224 |
+
$data_to_add = array() ;
|
| 225 |
+
foreach ( $pids as $pid ) {
|
| 226 |
+
foreach ( $this->_img_in_queue[ $pid ] as $md5 => $src_data ) {
|
| 227 |
+
$data_to_add[] = $pid ;
|
| 228 |
+
$data_to_add[] = self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ;
|
| 229 |
+
$data_to_add[] = $src_data[ 'src' ] ;
|
| 230 |
+
$data_to_add[] = $src_data[ 'srcpath_md5' ] ;
|
| 231 |
+
$data_to_add[] = $md5 ;
|
| 232 |
+
$data_to_add[] = $src_data[ 'src_filesize' ] ;
|
| 233 |
+
}
|
| 234 |
+
}
|
| 235 |
+
$this->_insert_img_optm( $data_to_add ) ;
|
| 236 |
+
|
| 237 |
+
// Insert duplicated data
|
| 238 |
+
if ( $this->_img_duplicated_in_queue ) {
|
| 239 |
+
// Generate root_id from inserted ones
|
| 240 |
+
$srcpath_md5_to_search = array() ;
|
| 241 |
+
foreach ( $this->_img_duplicated_in_queue as $v ) {
|
| 242 |
+
$srcpath_md5_to_search[] = $v[ 'info' ][ 'srcpath_md5' ] ;
|
| 243 |
+
}
|
| 244 |
+
$existing_img_list = $this->_select_img_by_root_srcpath( $srcpath_md5_to_search ) ;
|
| 245 |
+
|
| 246 |
+
$data_to_add = array() ;
|
| 247 |
+
foreach ( $this->_img_duplicated_in_queue as $v ) {
|
| 248 |
+
$existing_info = $existing_img_list[ $v[ 'info' ][ 'srcpath_md5' ] ] ;
|
| 249 |
+
|
| 250 |
+
$data_to_add[] = $v[ 'pid' ] ;
|
| 251 |
+
$data_to_add[] = $existing_info[ 'status' ] ;
|
| 252 |
+
$data_to_add[] = $existing_info[ 'src' ] ;
|
| 253 |
+
$data_to_add[] = $existing_info[ 'srcpath_md5' ] ;
|
| 254 |
+
$data_to_add[] = $existing_info[ 'src_md5' ] ;
|
| 255 |
+
$data_to_add[] = $existing_info[ 'src_filesize' ] ;
|
| 256 |
+
$data_to_add[] = $existing_info[ 'id' ] ;
|
| 257 |
+
}
|
| 258 |
+
$this->_insert_img_optm( $data_to_add, 'post_id, optm_status, src, srcpath_md5, src_md5, src_filesize, root_id' ) ;
|
| 259 |
+
}
|
| 260 |
+
|
| 261 |
+
$accepted_groups = count( $pids ) ;
|
| 262 |
+
$accepted_imgs = $json[ 'total' ] ;
|
| 263 |
+
|
| 264 |
+
$placeholder1 = LiteSpeed_Cache_Admin_Display::print_plural( $total_groups ) . ' (' . LiteSpeed_Cache_Admin_Display::print_plural( $this->_img_total, 'image' ) . ')' ;
|
| 265 |
+
$placeholder2 = LiteSpeed_Cache_Admin_Display::print_plural( $accepted_groups ) . ' (' . LiteSpeed_Cache_Admin_Display::print_plural( $accepted_imgs, 'image' ) . ')' ;
|
| 266 |
+
$msg = sprintf( __( 'Pushed %1$s to LiteSpeed optimization server, accepted %2$s.', 'litespeed-cache' ), $placeholder1, $placeholder2 ) ;
|
| 267 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 268 |
+
|
| 269 |
+
// Update credit info
|
| 270 |
+
if ( isset( $json[ 'credit' ] ) ) {
|
| 271 |
+
$this->_update_credit( $json[ 'credit' ] ) ;
|
| 272 |
+
}
|
| 273 |
+
|
| 274 |
+
// Update guidance
|
| 275 |
+
if ( $this->get_guidance_pos() == 2 ) {
|
| 276 |
+
$this->_update_guidance_pos( 3 ) ;
|
| 277 |
+
}
|
| 278 |
+
|
| 279 |
+
}
|
| 280 |
+
|
| 281 |
+
/**
|
| 282 |
+
* Insert data into table img_optm
|
| 283 |
+
*
|
| 284 |
+
* @since 2.0
|
| 285 |
+
* @access private
|
| 286 |
+
*/
|
| 287 |
+
private function _insert_img_optm( $data, $fields = 'post_id, optm_status, src, srcpath_md5, src_md5, src_filesize' )
|
| 288 |
+
{
|
| 289 |
+
global $wpdb ;
|
| 290 |
+
|
| 291 |
+
$division = substr_count( $fields, ',' ) + 1 ;
|
| 292 |
+
|
| 293 |
+
$q = "REPLACE INTO $this->_table_img_optm ( $fields ) VALUES " ;
|
| 294 |
+
|
| 295 |
+
// Add placeholder
|
| 296 |
+
$q .= $this->_chunk_placeholder( $data, $division ) ;
|
| 297 |
+
|
| 298 |
+
// Store data
|
| 299 |
+
$wpdb->query( $wpdb->prepare( $q, $data ) ) ;
|
| 300 |
+
}
|
| 301 |
+
|
| 302 |
+
/**
|
| 303 |
+
* Get all root img data by srcpath_md5
|
| 304 |
+
*
|
| 305 |
+
* @since 2.0
|
| 306 |
+
* @access private
|
| 307 |
+
*/
|
| 308 |
+
private function _select_img_by_root_srcpath( $srcpath_md5_to_search )
|
| 309 |
+
{
|
| 310 |
+
global $wpdb ;
|
| 311 |
+
|
| 312 |
+
$existing_img_list = array() ;
|
| 313 |
+
|
| 314 |
+
$srcpath_md5_to_search = array_unique( $srcpath_md5_to_search ) ;
|
| 315 |
+
|
| 316 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE root_id=0 AND srcpath_md5 IN ( " . implode( ',', array_fill( 0, count( $srcpath_md5_to_search ), '%s' ) ) . " )" ;
|
| 317 |
+
$tmp = $wpdb->get_results( $wpdb->prepare( $q, $srcpath_md5_to_search ) ) ;
|
| 318 |
+
foreach ( $tmp as $v ) {
|
| 319 |
+
$existing_img_list[ $v->srcpath_md5 ] = array(
|
| 320 |
+
'id' => $v->id,
|
| 321 |
+
'status' => $v->optm_status,
|
| 322 |
+
'pid' => $v->post_id,
|
| 323 |
+
'src' => $v->src,
|
| 324 |
+
'srcpath_md5' => $v->srcpath_md5,
|
| 325 |
+
'src_md5' => $v->src_md5,
|
| 326 |
+
'src_filesize' => $v->src_filesize,
|
| 327 |
+
) ;
|
| 328 |
+
}
|
| 329 |
+
|
| 330 |
+
return $existing_img_list ;
|
| 331 |
+
}
|
| 332 |
+
|
| 333 |
+
/**
|
| 334 |
+
* Handle existing same src path images
|
| 335 |
+
*
|
| 336 |
+
* @since 2.0
|
| 337 |
+
* @access private
|
| 338 |
+
*/
|
| 339 |
+
private function _filter_existing_src()
|
| 340 |
+
{
|
| 341 |
+
global $wpdb ;
|
| 342 |
+
// var_dump($this->_img_in_queue);
|
| 343 |
+
// var_dump($this->_img_srcpath_md5_array);
|
| 344 |
+
$existing_img_list = $this->_select_img_by_root_srcpath( $this->_img_srcpath_md5_array ) ;
|
| 345 |
+
// var_dump($existing_img_list);
|
| 346 |
+
// Handle existing same src data
|
| 347 |
+
$existing_img_optm = array() ;
|
| 348 |
+
$size_to_store = array() ;// pulled images need to update `wp_postmeta` size info
|
| 349 |
+
foreach ( $this->_img_in_queue as $pid => $img_list ) {
|
| 350 |
+
$changed = false ;
|
| 351 |
+
foreach ( $img_list as $md5 => $v ) {
|
| 352 |
+
if ( array_key_exists( $v[ 'srcpath_md5' ], $existing_img_list ) ) {
|
| 353 |
+
$existing_info = $existing_img_list[ $v[ 'srcpath_md5' ] ] ;
|
| 354 |
+
|
| 355 |
+
// Insert into img_optm table directly
|
| 356 |
+
$existing_img_optm[] = $pid ;
|
| 357 |
+
$existing_img_optm[] = $existing_info[ 'status' ] ;
|
| 358 |
+
$existing_img_optm[] = $existing_info[ 'src' ] ;
|
| 359 |
+
$existing_img_optm[] = $existing_info[ 'srcpath_md5' ] ;
|
| 360 |
+
$existing_img_optm[] = $existing_info[ 'src_md5' ] ;
|
| 361 |
+
$existing_img_optm[] = $existing_info[ 'src_filesize' ] ;
|
| 362 |
+
$existing_img_optm[] = $existing_info[ 'id' ] ;
|
| 363 |
+
|
| 364 |
+
// Bypass IAPI posting by removing from img_in_queue
|
| 365 |
+
unset( $this->_img_in_queue[ $pid ][ $md5 ] ) ;
|
| 366 |
+
|
| 367 |
+
// Size info exists. Prepare size info for `wp_postmeta`
|
| 368 |
+
// Only pulled images have size_info
|
| 369 |
+
if ( $existing_info[ 'status' ] == self::DB_IMG_OPTIMIZE_STATUS_PULLED ) {
|
| 370 |
+
$size_to_store[ $pid ] = $existing_info[ 'pid' ] ;
|
| 371 |
+
}
|
| 372 |
+
|
| 373 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Existing pulled [pid] ' . $pid . " \t\t\t[status] " . $existing_info[ 'status' ] . " \t\t\t[src] " . $v[ 'src' ] ) ;
|
| 374 |
+
|
| 375 |
+
$changed = true ;
|
| 376 |
+
}
|
| 377 |
+
}
|
| 378 |
+
|
| 379 |
+
if ( $changed ) {
|
| 380 |
+
if ( empty( $this->_img_in_queue[ $pid ] ) ) {
|
| 381 |
+
unset( $this->_img_in_queue[ $pid ] ) ;
|
| 382 |
+
}
|
| 383 |
+
}
|
| 384 |
+
|
| 385 |
+
}
|
| 386 |
+
// var_dump($this->_img_in_queue);
|
| 387 |
+
// var_dump($existing_img_list);
|
| 388 |
+
// var_dump($existing_img_optm);//exit;
|
| 389 |
+
// Existing img needs to be inserted separately
|
| 390 |
+
if ( $existing_img_optm ) {
|
| 391 |
+
$this->_insert_img_optm( $existing_img_optm, 'post_id, optm_status, src, srcpath_md5, src_md5, src_filesize, root_id' ) ;
|
| 392 |
+
}
|
| 393 |
+
|
| 394 |
+
// These post_meta in key need to update size info to same as post_meta in val
|
| 395 |
+
if ( $size_to_store ) {
|
| 396 |
+
// Get current data
|
| 397 |
+
$pids = array_unique( $size_to_store ) ;
|
| 398 |
+
|
| 399 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Existing size info root pids', $pids ) ;
|
| 400 |
+
|
| 401 |
+
// NOTE: Separate this query while not using LEFT JOIN in SELECT * FROM $this->_table_img_optm in previous query to lower db load
|
| 402 |
+
$q = "SELECT * FROM $wpdb->postmeta WHERE meta_key = %s AND post_id IN ( " . implode( ',', array_fill( 0, count( $pids ), '%s' ) ) . " )" ;
|
| 403 |
+
$tmp = $wpdb->get_results( $wpdb->prepare( $q, array_merge( array( self::DB_IMG_OPTIMIZE_SIZE ), $pids ) ) ) ;
|
| 404 |
+
$existing_sizes = array() ;
|
| 405 |
+
foreach ( $tmp as $v ) {
|
| 406 |
+
$existing_sizes[ $v->post_id ] = $v->meta_value ;
|
| 407 |
+
}
|
| 408 |
+
|
| 409 |
+
// Get existing new data
|
| 410 |
+
$size_to_store_pids = array_keys( $size_to_store ) ;
|
| 411 |
+
$q = "SELECT * FROM $wpdb->postmeta WHERE meta_key = %s AND post_id IN ( " . implode( ',', array_fill( 0, count( $size_to_store_pids ), '%s' ) ) . " )" ;
|
| 412 |
+
$tmp = $wpdb->get_results( $wpdb->prepare( $q, array_merge( array( self::DB_IMG_OPTIMIZE_SIZE ), $size_to_store_pids ) ) ) ;
|
| 413 |
+
$q_to_update = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d" ;
|
| 414 |
+
$size_to_update_pids = array() ;
|
| 415 |
+
foreach ( $tmp as $v ) {
|
| 416 |
+
$size_to_update_pids[] = $v->post_id ;
|
| 417 |
+
$from_pid = $size_to_store[ $v->post_id ] ;
|
| 418 |
+
// Update existing data ( Replaced with existing size info wholly )
|
| 419 |
+
$wpdb->query( $wpdb->prepare( $q_to_update, array( $existing_sizes[ $from_pid ], $v->meta_id ) ) ) ;
|
| 420 |
+
|
| 421 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Updated optm_size info [pid] ' . $v->post_id . " \t\t\t[from_pid] " . $from_pid ) ;
|
| 422 |
+
}
|
| 423 |
+
|
| 424 |
+
// Insert new size info
|
| 425 |
+
$size_to_insert_pids = array_diff( $size_to_store_pids, $size_to_update_pids ) ;
|
| 426 |
+
$q = "INSERT INTO $wpdb->postmeta ( post_id, meta_key, meta_value ) VALUES " ;
|
| 427 |
+
$data = array() ;
|
| 428 |
+
foreach ( $size_to_insert_pids as $pid ) {
|
| 429 |
+
$data[] = $pid ;
|
| 430 |
+
$data[] = self::DB_IMG_OPTIMIZE_SIZE ;
|
| 431 |
+
$data[] = $existing_sizes[ $size_to_store[ $pid ] ] ;
|
| 432 |
+
}
|
| 433 |
+
|
| 434 |
+
// Add placeholder
|
| 435 |
+
$q .= $this->_chunk_placeholder( $data, 3 ) ;
|
| 436 |
+
|
| 437 |
+
// Store data
|
| 438 |
+
$wpdb->query( $wpdb->prepare( $q, $data ) ) ;
|
| 439 |
+
|
| 440 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Inserted optm_size info [total] ' . count( $size_to_insert_pids ) ) ;
|
| 441 |
+
|
| 442 |
+
}
|
| 443 |
+
|
| 444 |
+
}
|
| 445 |
+
|
| 446 |
+
/**
|
| 447 |
+
* Filter duplicated src in $this->_img_in_queue
|
| 448 |
+
*
|
| 449 |
+
* @since 2.0
|
| 450 |
+
* @access private
|
| 451 |
+
*/
|
| 452 |
+
private function _filter_duplicated_src()
|
| 453 |
+
{
|
| 454 |
+
$srcpath_md5_list = array() ;
|
| 455 |
+
$total_img_duplicated = 0 ;
|
| 456 |
+
$total_pid_unset = 0 ;
|
| 457 |
+
foreach ( $this->_img_in_queue as $pid => $img_list ) {
|
| 458 |
+
foreach ( $img_list as $md5 => $v ) {
|
| 459 |
+
if ( in_array( $v[ 'srcpath_md5' ], $srcpath_md5_list ) ) {
|
| 460 |
+
$this->_img_duplicated_in_queue[] = array(
|
| 461 |
+
'pid' => $pid,
|
| 462 |
+
'info' => $v,
|
| 463 |
+
) ;
|
| 464 |
+
|
| 465 |
+
$total_img_duplicated ++ ;
|
| 466 |
+
|
| 467 |
+
unset( $this->_img_in_queue[ $pid ][ $md5 ] ) ;
|
| 468 |
+
|
| 469 |
+
continue ;
|
| 470 |
+
}
|
| 471 |
+
|
| 472 |
+
$srcpath_md5_list[ $pid . '.' . $md5 ] = $v[ 'srcpath_md5' ] ;
|
| 473 |
+
|
| 474 |
+
}
|
| 475 |
+
|
| 476 |
+
if ( empty( $this->_img_in_queue[ $pid ] ) ) {
|
| 477 |
+
unset( $this->_img_in_queue[ $pid ] ) ;
|
| 478 |
+
$total_pid_unset ++ ;
|
| 479 |
+
}
|
| 480 |
+
}
|
| 481 |
+
|
| 482 |
+
if ( $this->_img_duplicated_in_queue ) {
|
| 483 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Found duplicated src [total_img_duplicated] ' . $total_img_duplicated . ' [total_pid_unset] ' . $total_pid_unset ) ;
|
| 484 |
+
}
|
| 485 |
+
}
|
| 486 |
+
|
| 487 |
+
/**
|
| 488 |
+
* Generate placeholder for an array to query
|
| 489 |
+
*
|
| 490 |
+
* @since 2.0
|
| 491 |
+
* @access private
|
| 492 |
+
*/
|
| 493 |
+
private function _chunk_placeholder( $data, $division )
|
| 494 |
+
{
|
| 495 |
+
$q = implode( ',', array_map(
|
| 496 |
+
function( $el ) { return '(' . implode( ',', $el ) . ')' ; },
|
| 497 |
+
array_chunk( array_fill( 0, count( $data ), '%s' ), $division )
|
| 498 |
+
) ) ;
|
| 499 |
+
|
| 500 |
+
return $q ;
|
| 501 |
+
}
|
| 502 |
+
|
| 503 |
+
/**
|
| 504 |
+
* Saved non-existed images into img_optm
|
| 505 |
+
*
|
| 506 |
+
* @since 2.0
|
| 507 |
+
* @access private
|
| 508 |
+
*/
|
| 509 |
+
private function _save_missed_into_img_optm()
|
| 510 |
+
{
|
| 511 |
+
if ( ! $this->_missed_img_in_queue ) {
|
| 512 |
+
return ;
|
| 513 |
+
}
|
| 514 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Missed img need to save [total] ' . count( $this->_missed_img_in_queue ) ) ;
|
| 515 |
+
|
| 516 |
+
$data_to_add = array() ;
|
| 517 |
+
foreach ( $this->_missed_img_in_queue as $src_data ) {
|
| 518 |
+
$data_to_add[] = $src_data[ 'pid' ] ;
|
| 519 |
+
$data_to_add[] = self::DB_IMG_OPTIMIZE_STATUS_MISS ;
|
| 520 |
+
$data_to_add[] = $src_data[ 'src' ] ;
|
| 521 |
+
$data_to_add[] = $src_data[ 'srcpath_md5' ] ;
|
| 522 |
+
}
|
| 523 |
+
$this->_insert_img_optm( $data_to_add, 'post_id, optm_status, src, srcpath_md5' ) ;
|
| 524 |
+
}
|
| 525 |
+
|
| 526 |
+
/**
|
| 527 |
+
* Add a new img to queue which will be pushed to LiteSpeed
|
| 528 |
+
*
|
| 529 |
+
* @since 1.6
|
| 530 |
+
* @access private
|
| 531 |
+
*/
|
| 532 |
+
private function _img_queue( $meta_value, $ori_file = false )
|
| 533 |
+
{
|
| 534 |
+
if ( empty( $meta_value[ 'file' ] ) || empty( $meta_value[ 'width' ] ) || empty( $meta_value[ 'height' ] ) ) {
|
| 535 |
+
LiteSpeed_Cache_Log::debug2( '[Img_Optm] bypass image due to lack of file/w/h: pid ' . $this->tmp_pid, $meta_value ) ;
|
| 536 |
+
return ;
|
| 537 |
+
}
|
| 538 |
+
|
| 539 |
+
if ( ! $ori_file ) {
|
| 540 |
+
$meta_value[ 'file' ] = $this->tmp_path . $meta_value[ 'file' ] ;
|
| 541 |
+
}
|
| 542 |
+
|
| 543 |
+
// check file exists or not
|
| 544 |
+
$real_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $meta_value[ 'file' ] ;
|
| 545 |
+
if ( ! file_exists( $real_file ) ) {
|
| 546 |
+
$this->_missed_img_in_queue[] = array(
|
| 547 |
+
'pid' => $this->tmp_pid,
|
| 548 |
+
'src' => $meta_value[ 'file' ],
|
| 549 |
+
'srcpath_md5' => md5( $meta_value[ 'file' ] ),
|
| 550 |
+
) ;
|
| 551 |
+
LiteSpeed_Cache_Log::debug2( '[Img_Optm] bypass image due to file not exist: pid ' . $this->tmp_pid . ' ' . $real_file ) ;
|
| 552 |
+
return ;
|
| 553 |
+
}
|
| 554 |
+
|
| 555 |
+
LiteSpeed_Cache_Log::debug2( '[Img_Optm] adding image: pid ' . $this->tmp_pid ) ;
|
| 556 |
+
|
| 557 |
+
$img_info = array(
|
| 558 |
+
'url' => $this->wp_upload_dir[ 'baseurl' ] . '/' . $meta_value[ 'file' ],
|
| 559 |
+
'src' => $meta_value[ 'file' ], // not needed in LiteSpeed sapi, just leave for local storage after post
|
| 560 |
+
'width' => $meta_value[ 'width' ],
|
| 561 |
+
'height' => $meta_value[ 'height' ],
|
| 562 |
+
'mime_type' => ! empty( $meta_value[ 'mime-type' ] ) ? $meta_value[ 'mime-type' ] : '' ,
|
| 563 |
+
'srcpath_md5' => md5( $meta_value[ 'file' ] ),
|
| 564 |
+
'src_filesize' => filesize( $real_file ),
|
| 565 |
+
) ;
|
| 566 |
+
$md5 = md5_file( $real_file ) ;
|
| 567 |
+
|
| 568 |
+
if ( empty( $this->_img_in_queue[ $this->tmp_pid ] ) ) {
|
| 569 |
+
$this->_img_in_queue[ $this->tmp_pid ] = array() ;
|
| 570 |
+
}
|
| 571 |
+
$this->_img_in_queue[ $this->tmp_pid ][ $md5 ] = $img_info ;
|
| 572 |
+
$this->_img_total ++ ;
|
| 573 |
+
|
| 574 |
+
// Build existing data checking array
|
| 575 |
+
$this->_img_srcpath_md5_array[] = $img_info[ 'srcpath_md5' ] ;
|
| 576 |
+
}
|
| 577 |
+
|
| 578 |
+
/**
|
| 579 |
+
* Push img to LiteSpeed IAPI server
|
| 580 |
+
*
|
| 581 |
+
* @since 1.6.7
|
| 582 |
+
* @access private
|
| 583 |
+
*/
|
| 584 |
+
private function _push_img_in_queue_to_iapi()
|
| 585 |
+
{
|
| 586 |
+
$data = array(
|
| 587 |
+
'list' => $this->_img_in_queue,
|
| 588 |
+
'webp_only' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_ONLY ),
|
| 589 |
+
'keep_exif' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_EXIF ),
|
| 590 |
+
'webp_lossless' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_LOSSLESS ),
|
| 591 |
+
) ;
|
| 592 |
+
|
| 593 |
+
// Push to LiteSpeed IAPI server
|
| 594 |
+
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_REQUEST_OPTIMIZE, LiteSpeed_Cache_Utility::arr2str( $data ) ) ;
|
| 595 |
+
|
| 596 |
+
if ( $json === null ) {// admin_api will handle common err
|
| 597 |
+
return null ;
|
| 598 |
+
}
|
| 599 |
+
|
| 600 |
+
if ( ! is_array( $json ) ) {
|
| 601 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to post to LiteSpeed IAPI server ', $json ) ;
|
| 602 |
+
$msg = sprintf( __( 'Failed to push to LiteSpeed IAPI server: %s', 'litespeed-cache' ), $json ) ;
|
| 603 |
+
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 604 |
+
return null ;
|
| 605 |
+
}
|
| 606 |
+
|
| 607 |
+
// Check data format
|
| 608 |
+
if ( empty( $json[ 'pids' ] ) || ! is_array( $json[ 'pids' ] ) ) {
|
| 609 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to parse data from LiteSpeed IAPI server ', $json[ 'pids' ] ) ;
|
| 610 |
+
$msg = sprintf( __( 'Failed to parse data from LiteSpeed IAPI server: %s', 'litespeed-cache' ), $json[ 'pids' ] ) ;
|
| 611 |
+
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 612 |
+
return null ;
|
| 613 |
+
}
|
| 614 |
+
|
| 615 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Returned data from LiteSpeed IAPI server count: ' . count( $json[ 'pids' ] ) ) ;
|
| 616 |
+
|
| 617 |
+
return $json ;
|
| 618 |
+
|
| 619 |
+
}
|
| 620 |
+
|
| 621 |
+
/**
|
| 622 |
+
* LiteSpeed Child server notify Client img status changed
|
| 623 |
+
*
|
| 624 |
+
* @since 1.6
|
| 625 |
+
* @since 1.6.5 Added err/request status free switch
|
| 626 |
+
* @access public
|
| 627 |
+
*/
|
| 628 |
+
public function notify_img()
|
| 629 |
+
{
|
| 630 |
+
global $wpdb ;
|
| 631 |
+
|
| 632 |
+
list( $notified_data, $server, $status ) = $this->_parse_notify_data() ;
|
| 633 |
+
|
| 634 |
+
$pids = array_keys( $notified_data ) ;
|
| 635 |
+
|
| 636 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE post_id IN ( " . implode( ',', array_fill( 0, count( $pids ), '%d' ) ) . " ) AND optm_status != %s" ;
|
| 637 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, array_merge( $pids, array( self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ) ) ;
|
| 638 |
+
|
| 639 |
+
$need_pull = false ;
|
| 640 |
+
$last_log_pid = 0 ;
|
| 641 |
+
|
| 642 |
+
foreach ( $list as $v ) {
|
| 643 |
+
if ( ! in_array( $v->src_md5, $notified_data[ $v->post_id ] ) ) {
|
| 644 |
+
// This image is not in notifcation
|
| 645 |
+
continue ;
|
| 646 |
+
}
|
| 647 |
+
|
| 648 |
+
// Save data
|
| 649 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s, server = %s WHERE id = %d" ;
|
| 650 |
+
$wpdb->query( $wpdb->prepare( $q, array( $status, $server, $v->id ) ) ) ;
|
| 651 |
+
|
| 652 |
+
$pid_log = $last_log_pid == $v->post_id ? '.' : $v->post_id ;
|
| 653 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] notify_img [status] ' . $status . " \t\t[pid] " . $pid_log . " \t\t[id] " . $v->id ) ;
|
| 654 |
+
$last_log_pid = $v->post_id ;
|
| 655 |
+
|
| 656 |
+
if ( $status == self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) {
|
| 657 |
+
$need_pull = true ;
|
| 658 |
+
}
|
| 659 |
+
}
|
| 660 |
+
|
| 661 |
+
if ( $need_pull ) {
|
| 662 |
+
update_option( LiteSpeed_Cache_Config::ITEM_IMG_OPTM_NEED_PULL, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ;
|
| 663 |
+
}
|
| 664 |
+
|
| 665 |
+
// redo count err
|
| 666 |
+
|
| 667 |
+
echo json_encode( array( 'count' => count( $notified_data ) ) ) ;
|
| 668 |
+
exit() ;
|
| 669 |
+
}
|
| 670 |
+
|
| 671 |
+
/**
|
| 672 |
+
* parse LiteSpeed IAPI server data
|
| 673 |
+
*
|
| 674 |
+
* @since 1.6.5
|
| 675 |
+
* @access public
|
| 676 |
+
*/
|
| 677 |
+
private function _parse_notify_data()
|
| 678 |
+
{
|
| 679 |
+
$notified_data = unserialize( base64_decode( $_POST[ 'data' ] ) ) ;
|
| 680 |
+
if ( empty( $notified_data ) || ! is_array( $notified_data ) ) {
|
| 681 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] notify exit: no notified data' ) ;
|
| 682 |
+
exit( json_encode( 'no notified data' ) ) ;
|
| 683 |
+
}
|
| 684 |
+
|
| 685 |
+
if ( empty( $_POST[ 'server' ] ) || substr( $_POST[ 'server' ], -21 ) !== 'api.litespeedtech.com' ) {
|
| 686 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] notify exit: no/wrong server' ) ;
|
| 687 |
+
exit( json_encode( 'no/wrong server' ) ) ;
|
| 688 |
+
}
|
| 689 |
+
|
| 690 |
+
$_allowed_status = array( self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED, self::DB_IMG_OPTIMIZE_STATUS_ERR, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 691 |
+
|
| 692 |
+
if ( empty( $_POST[ 'status' ] ) || ! in_array( $_POST[ 'status' ], $_allowed_status ) ) {
|
| 693 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] notify exit: no/wrong status' ) ;
|
| 694 |
+
exit( json_encode( 'no/wrong status' ) ) ;
|
| 695 |
+
}
|
| 696 |
+
|
| 697 |
+
return array( $notified_data, $_POST[ 'server' ], $_POST[ 'status' ] ) ;
|
| 698 |
+
}
|
| 699 |
+
|
| 700 |
+
/**
|
| 701 |
+
* Pull optimized img
|
| 702 |
+
*
|
| 703 |
+
* @since 1.6
|
| 704 |
+
* @access public
|
| 705 |
+
*/
|
| 706 |
+
public static function pull_optimized_img()
|
| 707 |
+
{
|
| 708 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Cron pull_optimized_img started' ) ;
|
| 709 |
+
$instance = self::get_instance() ;
|
| 710 |
+
$instance->_pull_optimized_img() ;
|
| 711 |
+
}
|
| 712 |
+
|
| 713 |
+
/**
|
| 714 |
+
* Pull optimized img
|
| 715 |
+
*
|
| 716 |
+
* @since 1.6
|
| 717 |
+
* @access private
|
| 718 |
+
*/
|
| 719 |
+
private function _pull_optimized_img()
|
| 720 |
+
{
|
| 721 |
+
if ( $this->cron_running() ) {
|
| 722 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] fetch cron is running' ) ;
|
| 723 |
+
return ;
|
| 724 |
+
}
|
| 725 |
+
|
| 726 |
+
global $wpdb ;
|
| 727 |
+
|
| 728 |
+
$q = "SELECT a.*, b.meta_id as b_meta_id, b.meta_value AS b_optm_info
|
| 729 |
+
FROM $this->_table_img_optm a
|
| 730 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.post_id AND b.meta_key = %s
|
| 731 |
+
WHERE a.root_id = 0 AND a.optm_status = %s ORDER BY a.id LIMIT 1" ;
|
| 732 |
+
$_q = $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_SIZE, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ;
|
| 733 |
+
|
| 734 |
+
$webp_only = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_ONLY ) ;
|
| 735 |
+
|
| 736 |
+
// pull 10 images each time
|
| 737 |
+
for ( $i=0 ; $i < 10 ; $i++ ) {
|
| 738 |
+
$row_img = $wpdb->get_row( $_q ) ;
|
| 739 |
+
if ( ! $row_img ) {
|
| 740 |
+
// No image
|
| 741 |
+
break ;
|
| 742 |
+
}
|
| 743 |
+
|
| 744 |
+
/**
|
| 745 |
+
* Update cron timestamp to avoid duplicated running
|
| 746 |
+
* @since 1.6.2
|
| 747 |
+
*/
|
| 748 |
+
$this->_update_cron_running() ;
|
| 749 |
+
|
| 750 |
+
// Default optm info array
|
| 751 |
+
$optm_info = array(
|
| 752 |
+
'ori_total' => 0,
|
| 753 |
+
'ori_saved' => 0,
|
| 754 |
+
'webp_total' => 0,
|
| 755 |
+
'webp_saved' => 0,
|
| 756 |
+
) ;
|
| 757 |
+
if ( ! empty( $row_img->b_meta_id ) ) {
|
| 758 |
+
$optm_info = array_merge( $optm_info, unserialize( $row_img->b_optm_info ) ) ;
|
| 759 |
+
}
|
| 760 |
+
|
| 761 |
+
// send fetch request
|
| 762 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Connecting IAPI server for [pid] ' . $row_img->post_id . ' [src_md5]' . $row_img->src_md5 ) ;
|
| 763 |
+
$server = $row_img->server ;
|
| 764 |
+
$data = array(
|
| 765 |
+
'pid' => $row_img->post_id,
|
| 766 |
+
'src_md5' => $row_img->src_md5,
|
| 767 |
+
) ;
|
| 768 |
+
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG, $data, $server ) ;
|
| 769 |
+
if ( empty( $json[ 'webp' ] ) ) {
|
| 770 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to pull optimized img: ', $json ) ;
|
| 771 |
+
return ;
|
| 772 |
+
}
|
| 773 |
+
|
| 774 |
+
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $row_img->src ;
|
| 775 |
+
|
| 776 |
+
/**
|
| 777 |
+
* Use wp orignal get func to avoid allow_url_open off issue
|
| 778 |
+
* @since 1.6.5
|
| 779 |
+
*/
|
| 780 |
+
// Fetch webp image
|
| 781 |
+
$response = wp_remote_get( $json[ 'webp' ], array( 'timeout' => 15 ) ) ;
|
| 782 |
+
if ( is_wp_error( $response ) ) {
|
| 783 |
+
$error_message = $response->get_error_message() ;
|
| 784 |
+
LiteSpeed_Cache_Log::debug( 'IAPI failed to pull image: ' . $error_message ) ;
|
| 785 |
+
return ;
|
| 786 |
+
}
|
| 787 |
+
|
| 788 |
+
file_put_contents( $local_file . '.webp', $response[ 'body' ] ) ;
|
| 789 |
+
|
| 790 |
+
if ( ! file_exists( $local_file . '.webp' ) ) {
|
| 791 |
+
return ;
|
| 792 |
+
}
|
| 793 |
+
|
| 794 |
+
// Unknown issue
|
| 795 |
+
if ( md5_file( $local_file . '.webp' ) !== $json[ 'webp_md5' ] ) {
|
| 796 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to pull optimized img WebP: file md5 dismatch, server md5: ' . $json[ 'webp_md5' ] ) ;
|
| 797 |
+
|
| 798 |
+
// update status to failed
|
| 799 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s WHERE id = %d " ;
|
| 800 |
+
$wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_FAILED, $row_img->id ) ) ) ;
|
| 801 |
+
// Update child images
|
| 802 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s WHERE root_id = %d " ;
|
| 803 |
+
$wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_FAILED, $row_img->id ) ) ) ;
|
| 804 |
+
|
| 805 |
+
// Notify server to update status
|
| 806 |
+
LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG_FAILED, $data, $server ) ;
|
| 807 |
+
|
| 808 |
+
return ;// exit from running pull process
|
| 809 |
+
}
|
| 810 |
+
|
| 811 |
+
$ori_size = $row_img->src_filesize ?: filesize( $local_file ) ;
|
| 812 |
+
|
| 813 |
+
// log webp file saved size summary
|
| 814 |
+
$webp_size = filesize( $local_file . '.webp' ) ;
|
| 815 |
+
$webp_saved = $ori_size - $webp_size ;
|
| 816 |
+
if ( $webp_saved > 0 ) {
|
| 817 |
+
$optm_info[ 'webp_total' ] += $ori_size ;
|
| 818 |
+
$optm_info[ 'webp_saved' ] += $webp_saved ;
|
| 819 |
+
}
|
| 820 |
+
else {
|
| 821 |
+
$webp_saved = 0 ;
|
| 822 |
+
}
|
| 823 |
+
|
| 824 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Pulled optimized img WebP: ' . $local_file . '.webp' ) ;
|
| 825 |
+
|
| 826 |
+
// Fetch optimized image itself
|
| 827 |
+
$target_size = 0 ;
|
| 828 |
+
$target_saved = 0 ;
|
| 829 |
+
if ( ! $webp_only && ! empty( $json[ 'target_file' ] ) ) {
|
| 830 |
+
|
| 831 |
+
// Fetch failed, unkown issue, return
|
| 832 |
+
// NOTE: if this failed more than 5 times, next time fetching webp will touch err limit on server side, whole image will be failed
|
| 833 |
+
$response = wp_remote_get( $json[ 'target_file' ], array( 'timeout' => 15 ) ) ;
|
| 834 |
+
if ( is_wp_error( $response ) ) {
|
| 835 |
+
$error_message = $response->get_error_message() ;
|
| 836 |
+
LiteSpeed_Cache_Log::debug( 'IAPI failed to pull image: ' . $error_message ) ;
|
| 837 |
+
return ;
|
| 838 |
+
}
|
| 839 |
+
|
| 840 |
+
file_put_contents( $local_file . '.tmp', $response[ 'body' ] ) ;
|
| 841 |
+
// Unknown issue
|
| 842 |
+
if ( md5_file( $local_file . '.tmp' ) !== $json[ 'target_md5' ] ) {
|
| 843 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Failed to pull optimized img iteself: file md5 dismatch, server md5: ' . $json[ 'target_md5' ] ) ;
|
| 844 |
+
|
| 845 |
+
// update status to failed
|
| 846 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s WHERE id = %d " ;
|
| 847 |
+
$wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_FAILED, $row_img->id ) ) ) ;
|
| 848 |
+
// Update child images
|
| 849 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s WHERE root_id = %d " ;
|
| 850 |
+
$wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_FAILED, $row_img->id ) ) ) ;
|
| 851 |
+
|
| 852 |
+
// Notify server to update status
|
| 853 |
+
LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG_FAILED, $data, $server ) ;
|
| 854 |
+
|
| 855 |
+
return ; // exit from running pull process
|
| 856 |
+
}
|
| 857 |
+
|
| 858 |
+
// log webp file saved size summary
|
| 859 |
+
$target_size = filesize( $local_file . '.tmp' ) ;
|
| 860 |
+
$target_saved = $ori_size - $target_size ;
|
| 861 |
+
if ( $target_saved > 0 ) {
|
| 862 |
+
$optm_info[ 'ori_total' ] += $ori_size ;
|
| 863 |
+
$optm_info[ 'ori_saved' ] += $target_saved ;
|
| 864 |
+
}
|
| 865 |
+
else {
|
| 866 |
+
$target_saved = 0 ;
|
| 867 |
+
}
|
| 868 |
+
|
| 869 |
+
// Backup ori img
|
| 870 |
+
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 871 |
+
$bk_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.' . $extension ;
|
| 872 |
+
rename( $local_file, $bk_file ) ;
|
| 873 |
+
|
| 874 |
+
// Replace ori img
|
| 875 |
+
rename( $local_file . '.tmp', $local_file ) ;
|
| 876 |
+
|
| 877 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Pulled optimized img: ' . $local_file ) ;
|
| 878 |
+
}
|
| 879 |
+
|
| 880 |
+
LiteSpeed_Cache_Log::debug2( '[Img_Optm] Update _table_img_optm record [id] ' . $row_img->id ) ;
|
| 881 |
+
|
| 882 |
+
// Update pulled status
|
| 883 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s, target_filesize = %d, target_saved = %d, webp_filesize = %d, webp_saved = %d WHERE id = %d " ;
|
| 884 |
+
$wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_PULLED, $target_size, $target_saved, $webp_size, $webp_saved, $row_img->id ) ) ) ;
|
| 885 |
+
|
| 886 |
+
// Update child images
|
| 887 |
+
$q = "UPDATE $this->_table_img_optm SET optm_status = %s, target_filesize = %d, target_saved = %d, webp_filesize = %d, webp_saved = %d WHERE root_id = %d " ;
|
| 888 |
+
$child_count = $wpdb->query( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_PULLED, $target_size, $target_saved, $webp_size, $webp_saved, $row_img->id ) ) ) ;
|
| 889 |
+
|
| 890 |
+
/**
|
| 891 |
+
* Update size saved info
|
| 892 |
+
* @since 1.6.5
|
| 893 |
+
*/
|
| 894 |
+
$optm_info = serialize( $optm_info ) ;
|
| 895 |
+
if ( ! empty( $row_img->b_meta_id ) ) {
|
| 896 |
+
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d " ;
|
| 897 |
+
$wpdb->query( $wpdb->prepare( $q, array( $optm_info, $row_img->b_meta_id ) ) ) ;
|
| 898 |
+
}
|
| 899 |
+
else {
|
| 900 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] New size info [pid] ' . $row_img->post_id ) ;
|
| 901 |
+
$q = "INSERT INTO $wpdb->postmeta ( post_id, meta_key, meta_value ) VALUES ( %d, %s, %s )" ;
|
| 902 |
+
$wpdb->query( $wpdb->prepare( $q, array( $row_img->post_id, self::DB_IMG_OPTIMIZE_SIZE, $optm_info ) ) ) ;
|
| 903 |
+
}
|
| 904 |
+
|
| 905 |
+
// Update size saved info of child images
|
| 906 |
+
if ( $child_count ) {
|
| 907 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Proceed child images [total] ' . $child_count ) ;
|
| 908 |
+
|
| 909 |
+
$q = "SELECT a.*, b.meta_id as b_meta_id
|
| 910 |
+
FROM $this->_table_img_optm a
|
| 911 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.post_id AND b.meta_key = %s
|
| 912 |
+
WHERE a.root_id = %d GROUP BY a.post_id" ;
|
| 913 |
+
$pids = array() ;
|
| 914 |
+
$tmp = $wpdb->get_results( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_SIZE, $row_img->id ) ) ) ;
|
| 915 |
+
$pids_to_update = array() ;
|
| 916 |
+
$pids_data_to_insert = array() ;
|
| 917 |
+
foreach ( $tmp as $v ) {
|
| 918 |
+
if ( $v->b_meta_id ) {
|
| 919 |
+
$pids_to_update[] = $v->post_id ;
|
| 920 |
+
}
|
| 921 |
+
else {
|
| 922 |
+
$pids_data_to_insert[] = $v->post_id ;
|
| 923 |
+
$pids_data_to_insert[] = self::DB_IMG_OPTIMIZE_SIZE ;
|
| 924 |
+
$pids_data_to_insert[] = $optm_info ;
|
| 925 |
+
}
|
| 926 |
+
}
|
| 927 |
+
|
| 928 |
+
// Update these size_info
|
| 929 |
+
if ( $pids_to_update ) {
|
| 930 |
+
$pids_to_update = array_unique( $pids_to_update ) ;
|
| 931 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Update child group size_info [total] ' . count( $pids_to_update ) ) ;
|
| 932 |
+
|
| 933 |
+
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_key = %s AND post_id IN ( " . implode( ',', array_fill( 0, count( $pids_to_update ), '%d' ) ) . " )" ;
|
| 934 |
+
$wpdb->query( $wpdb->prepare( $q, array_merge( array( $optm_info, self::DB_IMG_OPTIMIZE_SIZE ), $pids_to_update ) ) ) ;
|
| 935 |
+
}
|
| 936 |
+
|
| 937 |
+
// Insert these size_info
|
| 938 |
+
if ( $pids_data_to_insert ) {
|
| 939 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Insert child group size_info [total] ' . ( count( $pids_data_to_insert ) / 3 ) ) ;
|
| 940 |
+
|
| 941 |
+
$q = "INSERT INTO $wpdb->postmeta ( post_id, meta_key, meta_value ) VALUES " ;
|
| 942 |
+
// Add placeholder
|
| 943 |
+
$q .= $this->_chunk_placeholder( $pids_data_to_insert, 3 ) ;
|
| 944 |
+
$wpdb->query( $wpdb->prepare( $q, $pids_data_to_insert ) ) ;
|
| 945 |
+
}
|
| 946 |
+
}
|
| 947 |
+
}
|
| 948 |
+
|
| 949 |
+
// Update guidance
|
| 950 |
+
if ( $this->get_guidance_pos() == 3 ) {
|
| 951 |
+
$this->_update_guidance_pos( 4 ) ;
|
| 952 |
+
}
|
| 953 |
+
|
| 954 |
+
// Check if there is still task in queue
|
| 955 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE root_id = 0 AND optm_status = %s LIMIT 1" ;
|
| 956 |
+
$tmp = $wpdb->get_row( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ;
|
| 957 |
+
if ( $tmp ) {
|
| 958 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Task in queue, to be continued...' ) ;
|
| 959 |
+
return 'to_be_continued' ;
|
| 960 |
+
}
|
| 961 |
+
|
| 962 |
+
// If all pulled, update tag to done
|
| 963 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Marked pull status to all pulled' ) ;
|
| 964 |
+
update_option( LiteSpeed_Cache_Config::ITEM_IMG_OPTM_NEED_PULL, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ;
|
| 965 |
+
}
|
| 966 |
+
|
| 967 |
+
/**
|
| 968 |
+
* Check if need to do a pull for optimized img
|
| 969 |
+
*
|
| 970 |
+
* @since 1.6
|
| 971 |
+
* @access public
|
| 972 |
+
*/
|
| 973 |
+
public static function check_need_pull()
|
| 974 |
+
{
|
| 975 |
+
$tag = get_option( LiteSpeed_Cache_Config::ITEM_IMG_OPTM_NEED_PULL ) ;
|
| 976 |
+
return defined( 'DOING_CRON' ) && $tag && $tag === self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ;
|
| 977 |
+
}
|
| 978 |
+
|
| 979 |
+
/**
|
| 980 |
+
* Show an image's optm status
|
| 981 |
+
*
|
| 982 |
+
* @since 1.6.5
|
| 983 |
+
* @access public
|
| 984 |
+
*/
|
| 985 |
+
public function check_img()
|
| 986 |
+
{
|
| 987 |
+
$pid = $_POST[ 'data' ] ;
|
| 988 |
+
|
| 989 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Check image [ID] ' . $pid ) ;
|
| 990 |
+
|
| 991 |
+
$data = array() ;
|
| 992 |
+
|
| 993 |
+
$data[ 'img_count' ] = $this->img_count() ;
|
| 994 |
+
|
| 995 |
+
$data[ '_wp_attached_file' ] = get_post_meta( $pid, '_wp_attached_file', true ) ;
|
| 996 |
+
$data[ '_wp_attachment_metadata' ] = get_post_meta( $pid, '_wp_attachment_metadata', true ) ;
|
| 997 |
+
|
| 998 |
+
// Get img_optm data
|
| 999 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE post_id = %d" ;
|
| 1000 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, $pid ) ) ;
|
| 1001 |
+
$img_data = array() ;
|
| 1002 |
+
if ( $list ) {
|
| 1003 |
+
foreach ( $list as $v ) {
|
| 1004 |
+
$img_data[] = array(
|
| 1005 |
+
'id' => $v->id,
|
| 1006 |
+
'optm_status' => $v->optm_status,
|
| 1007 |
+
'src' => $v->src,
|
| 1008 |
+
'srcpath_md5' => $v->srcpath_md5,
|
| 1009 |
+
'src_md5' => $v->src_md5,
|
| 1010 |
+
'server' => $v->server,
|
| 1011 |
+
) ;
|
| 1012 |
+
}
|
| 1013 |
+
}
|
| 1014 |
+
$data[ 'img_data' ] = $img_data ;
|
| 1015 |
+
|
| 1016 |
+
echo json_encode( $data ) ;
|
| 1017 |
+
exit;
|
| 1018 |
+
}
|
| 1019 |
+
|
| 1020 |
+
/**
|
| 1021 |
+
* Parse wp's meta value
|
| 1022 |
+
*
|
| 1023 |
+
* @since 1.6.7
|
| 1024 |
+
* @access private
|
| 1025 |
+
*/
|
| 1026 |
+
private function _parse_wp_meta_value( $v )
|
| 1027 |
+
{
|
| 1028 |
+
if ( ! $v->meta_value ) {
|
| 1029 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] bypassed parsing meta due to no meta_value: pid ' . $v->post_id ) ;
|
| 1030 |
+
return false ;
|
| 1031 |
+
}
|
| 1032 |
+
|
| 1033 |
+
try {
|
| 1034 |
+
$meta_value = unserialize( $v->meta_value ) ;
|
| 1035 |
+
}
|
| 1036 |
+
catch ( \Exception $e ) {
|
| 1037 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] bypassed parsing meta due to meta_value not json: pid ' . $v->post_id ) ;
|
| 1038 |
+
return false ;
|
| 1039 |
+
}
|
| 1040 |
+
|
| 1041 |
+
if ( empty( $meta_value[ 'file' ] ) ) {
|
| 1042 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] bypassed parsing meta due to no ori file: pid ' . $v->post_id ) ;
|
| 1043 |
+
return false ;
|
| 1044 |
+
}
|
| 1045 |
+
|
| 1046 |
+
return $meta_value ;
|
| 1047 |
+
}
|
| 1048 |
+
|
| 1049 |
+
/**
|
| 1050 |
+
* Send destroy all requests cmd to LiteSpeed IAPI server and get the link to finish it ( avoid click by mistake )
|
| 1051 |
+
*
|
| 1052 |
+
* @since 1.6.7
|
| 1053 |
+
* @access private
|
| 1054 |
+
*/
|
| 1055 |
+
private function _img_optimize_destroy()
|
| 1056 |
+
{
|
| 1057 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] sending DESTROY cmd to LiteSpeed IAPI' ) ;
|
| 1058 |
+
|
| 1059 |
+
// Mark request time to avoid duplicated request
|
| 1060 |
+
update_option( self::DB_IMG_OPTIMIZE_DESTROY, time() ) ;
|
| 1061 |
+
|
| 1062 |
+
// Push to LiteSpeed IAPI server
|
| 1063 |
+
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_REQUEST_DESTROY ) ;
|
| 1064 |
+
|
| 1065 |
+
// confirm link will be displayed by Admin_API automatically
|
| 1066 |
+
if ( is_array( $json ) && $json ) {
|
| 1067 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] cmd result', $json ) ;
|
| 1068 |
+
}
|
| 1069 |
+
|
| 1070 |
+
}
|
| 1071 |
+
|
| 1072 |
+
/**
|
| 1073 |
+
* Callback from LiteSpeed IAPI server to destroy all optm data
|
| 1074 |
+
*
|
| 1075 |
+
* @since 1.6.7
|
| 1076 |
+
* @access private
|
| 1077 |
+
*/
|
| 1078 |
+
public function img_optimize_destroy_callback()
|
| 1079 |
+
{
|
| 1080 |
+
global $wpdb ;
|
| 1081 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] excuting DESTROY process' ) ;
|
| 1082 |
+
|
| 1083 |
+
$request_time = get_option( self::DB_IMG_OPTIMIZE_DESTROY ) ;
|
| 1084 |
+
if ( time() - $request_time > 300 ) {
|
| 1085 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] terminate DESTROY process due to timeout' ) ;
|
| 1086 |
+
exit( 'Destroy callback timeout ( 300 seconds )' ) ;
|
| 1087 |
+
}
|
| 1088 |
+
|
| 1089 |
+
// Start deleting files
|
| 1090 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE optm_status = %s" ;
|
| 1091 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ;
|
| 1092 |
+
foreach ( $list as $v ) {
|
| 1093 |
+
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $v->src ;
|
| 1094 |
+
|
| 1095 |
+
// del webp
|
| 1096 |
+
file_exists( $local_file . '.webp' ) && unlink( $local_file . '.webp' ) ;
|
| 1097 |
+
file_exists( $local_file . '.optm.webp' ) && unlink( $local_file . '.optm.webp' ) ;
|
| 1098 |
+
|
| 1099 |
+
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 1100 |
+
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 1101 |
+
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 1102 |
+
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 1103 |
+
|
| 1104 |
+
// del optimized ori
|
| 1105 |
+
if ( file_exists( $bk_file ) ) {
|
| 1106 |
+
unlink( $local_file ) ;
|
| 1107 |
+
rename( $bk_file, $local_file ) ;
|
| 1108 |
+
}
|
| 1109 |
+
file_exists( $bk_optm_file ) && unlink( $bk_optm_file ) ;
|
| 1110 |
+
}
|
| 1111 |
+
|
| 1112 |
+
// Delete optm info
|
| 1113 |
+
$q = "DELETE FROM $wpdb->postmeta WHERE meta_key LIKE 'litespeed-optimize%'" ;
|
| 1114 |
+
$wpdb->query( $q ) ;
|
| 1115 |
+
|
| 1116 |
+
// Delete img_optm table
|
| 1117 |
+
LiteSpeed_Cache_Data::get_instance()->delete_tb_img_optm() ;
|
| 1118 |
+
|
| 1119 |
+
// Clear credit info
|
| 1120 |
+
delete_option( self::DB_IMG_OPTM_SUMMARY ) ;
|
| 1121 |
+
|
| 1122 |
+
$this->_update_guidance_pos( 1 ) ;
|
| 1123 |
+
|
| 1124 |
+
exit( 'ok' ) ;
|
| 1125 |
+
}
|
| 1126 |
+
|
| 1127 |
+
/**
|
| 1128 |
+
* Resend requested img to LiteSpeed IAPI server
|
| 1129 |
+
*
|
| 1130 |
+
* @since 1.6.7
|
| 1131 |
+
* @access private
|
| 1132 |
+
*/
|
| 1133 |
+
private function _img_optimize_rescan()
|
| 1134 |
+
{return;
|
| 1135 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] resend requested images' ) ;
|
| 1136 |
+
|
| 1137 |
+
$_credit = (int) $this->summary_info( 'credit' ) ;
|
| 1138 |
+
|
| 1139 |
+
global $wpdb ;
|
| 1140 |
+
|
| 1141 |
+
$q = "SELECT a.post_id, a.meta_value, b.meta_id as bmeta_id, c.meta_id as cmeta_id, c.meta_value as cmeta_value
|
| 1142 |
+
FROM $wpdb->postmeta a
|
| 1143 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.post_id
|
| 1144 |
+
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.post_id
|
| 1145 |
+
WHERE a.meta_key = '_wp_attachment_metadata'
|
| 1146 |
+
AND b.meta_key = %s
|
| 1147 |
+
AND c.meta_key = %s
|
| 1148 |
+
LIMIT %d
|
| 1149 |
+
" ;
|
| 1150 |
+
$limit_rows = apply_filters( 'litespeed_img_optm_resend_rows', 300 ) ;
|
| 1151 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_DATA, $limit_rows ) ) ) ;
|
| 1152 |
+
if ( ! $list ) {
|
| 1153 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] resend request bypassed: no image found' ) ;
|
| 1154 |
+
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 1155 |
+
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 1156 |
+
return ;
|
| 1157 |
+
}
|
| 1158 |
+
|
| 1159 |
+
// meta list
|
| 1160 |
+
$optm_data_list = array() ;
|
| 1161 |
+
$optm_data_pid2mid_list = array() ;
|
| 1162 |
+
|
| 1163 |
+
foreach ( $list as $v ) {
|
| 1164 |
+
// wp meta
|
| 1165 |
+
$meta_value = $this->_parse_wp_meta_value( $v ) ;
|
| 1166 |
+
if ( ! $meta_value ) {
|
| 1167 |
+
continue ;
|
| 1168 |
+
}
|
| 1169 |
+
if ( empty( $meta_value[ 'sizes' ] ) ) {
|
| 1170 |
+
continue ;
|
| 1171 |
+
}
|
| 1172 |
+
|
| 1173 |
+
$optm_data_pid2mid_list[ $v->post_id ] = array( 'status_mid' => $v->bmeta_id, 'data_mid' => $v->cmeta_id ) ;
|
| 1174 |
+
|
| 1175 |
+
// prepare for pushing
|
| 1176 |
+
$this->tmp_pid = $v->post_id ;
|
| 1177 |
+
$this->tmp_path = pathinfo( $meta_value[ 'file' ], PATHINFO_DIRNAME ) . '/' ;
|
| 1178 |
+
|
| 1179 |
+
// ls optimized meta
|
| 1180 |
+
$optm_meta = $optm_data_list[ $v->post_id ] = unserialize( $v->cmeta_value ) ;
|
| 1181 |
+
$optm_list = array() ;
|
| 1182 |
+
foreach ( $optm_meta as $md5 => $optm_row ) {
|
| 1183 |
+
$optm_list[] = $optm_row[ 0 ] ;
|
| 1184 |
+
// only do for requested/notified img
|
| 1185 |
+
// if ( ! in_array( $optm_row[ 1 ], array( self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ) ) {
|
| 1186 |
+
// continue ;
|
| 1187 |
+
// }
|
| 1188 |
+
}
|
| 1189 |
+
|
| 1190 |
+
// check if there is new files from wp meta
|
| 1191 |
+
$img_queue = array() ;
|
| 1192 |
+
foreach ( $meta_value[ 'sizes' ] as $v2 ) {
|
| 1193 |
+
$curr_file = $this->tmp_path . $v2[ 'file' ] ;
|
| 1194 |
+
|
| 1195 |
+
// new child file OR not finished yet
|
| 1196 |
+
if ( ! in_array( $curr_file, $optm_list ) ) {
|
| 1197 |
+
$img_queue[] = $v2 ;
|
| 1198 |
+
}
|
| 1199 |
+
}
|
| 1200 |
+
|
| 1201 |
+
// nothing to add
|
| 1202 |
+
if ( ! $img_queue ) {
|
| 1203 |
+
continue ;
|
| 1204 |
+
}
|
| 1205 |
+
|
| 1206 |
+
$num_will_incease = count( $img_queue ) ;
|
| 1207 |
+
if ( $this->_img_total + $num_will_incease > $_credit ) {
|
| 1208 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] resend img request hit limit: [total] ' . $this->_img_total . " \t[add] $num_will_incease \t[credit] $_credit" ) ;
|
| 1209 |
+
break ;
|
| 1210 |
+
}
|
| 1211 |
+
|
| 1212 |
+
foreach ( $img_queue as $v2 ) {
|
| 1213 |
+
$this->_img_queue( $v2 ) ;
|
| 1214 |
+
}
|
| 1215 |
+
}
|
| 1216 |
+
|
| 1217 |
+
// push to LiteSpeed IAPI server
|
| 1218 |
+
if ( empty( $this->_img_in_queue ) ) {
|
| 1219 |
+
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 1220 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1221 |
+
return ;
|
| 1222 |
+
}
|
| 1223 |
+
|
| 1224 |
+
$total_groups = count( $this->_img_in_queue ) ;
|
| 1225 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] prepared images to push: groups ' . $total_groups . ' images ' . $this->_img_total ) ;
|
| 1226 |
+
|
| 1227 |
+
// Push to LiteSpeed IAPI server
|
| 1228 |
+
$json = $this->_push_img_in_queue_to_iapi() ;
|
| 1229 |
+
if ( $json === null ) {
|
| 1230 |
+
return ;
|
| 1231 |
+
}
|
| 1232 |
+
// Returned data is the requested and notifed images
|
| 1233 |
+
$pids = $json[ 'pids' ] ;
|
| 1234 |
+
|
| 1235 |
+
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d" ;
|
| 1236 |
+
|
| 1237 |
+
// Update data
|
| 1238 |
+
foreach ( $pids as $pid ) {
|
| 1239 |
+
$md52src_list = $optm_data_list[ $pid ] ;
|
| 1240 |
+
|
| 1241 |
+
foreach ( $this->_img_in_queue[ $pid ] as $md5 => $src_data ) {
|
| 1242 |
+
$md52src_list[ $md5 ] = array( $src_data[ 'src' ], self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 1243 |
+
}
|
| 1244 |
+
|
| 1245 |
+
$new_status = $this->_get_status_by_meta_data( $md52src_list, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 1246 |
+
|
| 1247 |
+
$md52src_list = serialize( $md52src_list ) ;
|
| 1248 |
+
|
| 1249 |
+
// Store data
|
| 1250 |
+
$wpdb->query( $wpdb->prepare( $q, array( $new_status, $optm_data_pid2mid_list[ $pid ][ 'status_mid' ] ) ) ) ;
|
| 1251 |
+
$wpdb->query( $wpdb->prepare( $q, array( $md52src_list, $optm_data_pid2mid_list[ $pid ][ 'data_mid' ] ) ) ) ;
|
| 1252 |
+
}
|
| 1253 |
+
|
| 1254 |
+
$accepted_groups = count( $pids ) ;
|
| 1255 |
+
$accepted_imgs = $json[ 'total' ] ;
|
| 1256 |
+
|
| 1257 |
+
$msg = sprintf( __( 'Pushed %1$s groups with %2$s images to LiteSpeed optimization server, accepted %3$s groups with %4$s images.', 'litespeed-cache' ), $total_groups, $this->_img_total, $accepted_groups, $accepted_imgs ) ;
|
| 1258 |
+
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1259 |
+
|
| 1260 |
+
// Update credit info
|
| 1261 |
+
if ( isset( $json[ 'credit' ] ) ) {
|
| 1262 |
+
$this->_update_credit( $json[ 'credit' ] ) ;
|
| 1263 |
+
}
|
| 1264 |
+
|
| 1265 |
+
}
|
| 1266 |
+
|
| 1267 |
+
/**
|
| 1268 |
+
* Update client credit info
|
| 1269 |
+
*
|
| 1270 |
+
* @since 1.6.5
|
| 1271 |
+
* @access private
|
| 1272 |
+
*/
|
| 1273 |
+
private function _update_credit( $credit )
|
| 1274 |
+
{
|
| 1275 |
+
$summary = get_option( self::DB_IMG_OPTM_SUMMARY, array() ) ;
|
| 1276 |
+
$summary[ 'credit' ] = $credit ;
|
| 1277 |
+
|
| 1278 |
+
update_option( self::DB_IMG_OPTM_SUMMARY, $summary ) ;
|
| 1279 |
+
}
|
| 1280 |
+
|
| 1281 |
+
/**
|
| 1282 |
+
* Get optm summary
|
| 1283 |
+
*
|
| 1284 |
+
* @since 1.6.5
|
| 1285 |
+
* @access public
|
| 1286 |
+
*/
|
| 1287 |
+
public function summary_info( $field = false )
|
| 1288 |
+
{
|
| 1289 |
+
$optm_summary = get_option( self::DB_IMG_OPTM_SUMMARY, array() ) ;
|
| 1290 |
+
|
| 1291 |
+
if ( ! $field ) {
|
| 1292 |
+
return $optm_summary ;
|
| 1293 |
+
}
|
| 1294 |
+
return ! empty( $optm_summary[ $field ] ) ? $optm_summary[ $field ] : 0 ;
|
| 1295 |
+
}
|
| 1296 |
+
|
| 1297 |
+
/**
|
| 1298 |
+
* Count images
|
| 1299 |
+
*
|
| 1300 |
+
* @since 1.6
|
| 1301 |
+
* @access public
|
| 1302 |
+
*/
|
| 1303 |
+
public function img_count()
|
| 1304 |
+
{
|
| 1305 |
+
global $wpdb ;
|
| 1306 |
+
$q = "SELECT count(*)
|
| 1307 |
+
FROM $wpdb->posts a
|
| 1308 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1309 |
+
WHERE a.post_type = 'attachment'
|
| 1310 |
+
AND a.post_status = 'inherit'
|
| 1311 |
+
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1312 |
+
AND b.meta_key = '_wp_attachment_metadata'
|
| 1313 |
+
" ;
|
| 1314 |
+
// $q = "SELECT count(*) FROM $wpdb->posts WHERE post_type = 'attachment' AND post_status = 'inherit' AND post_mime_type IN ('image/jpeg', 'image/png') " ;
|
| 1315 |
+
$total_img = $wpdb->get_var( $q ) ;
|
| 1316 |
+
|
| 1317 |
+
$q = "SELECT count(*)
|
| 1318 |
+
FROM $wpdb->posts a
|
| 1319 |
+
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1320 |
+
LEFT JOIN $this->_table_img_optm c ON c.post_id = a.ID
|
| 1321 |
+
WHERE a.post_type = 'attachment'
|
| 1322 |
+
AND a.post_status = 'inherit'
|
| 1323 |
+
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1324 |
+
AND b.meta_key = '_wp_attachment_metadata'
|
| 1325 |
+
AND c.id IS NULL
|
| 1326 |
+
" ;
|
| 1327 |
+
$total_not_requested = $wpdb->get_var( $q ) ;
|
| 1328 |
+
|
| 1329 |
+
// images count from img_optm table
|
| 1330 |
+
$q_groups = "SELECT count(distinct post_id) FROM $this->_table_img_optm WHERE optm_status = %s" ;
|
| 1331 |
+
$q = "SELECT count(*) FROM $this->_table_img_optm WHERE optm_status = %s" ;
|
| 1332 |
+
$total_requested_groups = $wpdb->get_var( $wpdb->prepare( $q_groups, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ) ;
|
| 1333 |
+
$total_requested = $wpdb->get_var( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ) ;
|
| 1334 |
+
$total_server_finished_groups = $wpdb->get_var( $wpdb->prepare( $q_groups, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ;
|
| 1335 |
+
$total_server_finished = $wpdb->get_var( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ;
|
| 1336 |
+
$total_pulled_groups = $wpdb->get_var( $wpdb->prepare( $q_groups, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ;
|
| 1337 |
+
$total_pulled = $wpdb->get_var( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ;
|
| 1338 |
+
$total_err_groups = $wpdb->get_var( $wpdb->prepare( $q_groups, self::DB_IMG_OPTIMIZE_STATUS_ERR ) ) ;
|
| 1339 |
+
$total_err = $wpdb->get_var( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_ERR ) ) ;
|
| 1340 |
+
$total_miss_groups = $wpdb->get_var( $wpdb->prepare( $q_groups, self::DB_IMG_OPTIMIZE_STATUS_MISS ) ) ;
|
| 1341 |
+
$total_miss = $wpdb->get_var( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_MISS ) ) ;
|
| 1342 |
+
|
| 1343 |
+
return array(
|
| 1344 |
+
'total_img' => $total_img,
|
| 1345 |
+
'total_not_requested' => $total_not_requested,
|
| 1346 |
+
'total_requested_groups' => $total_requested_groups,
|
| 1347 |
+
'total_requested' => $total_requested,
|
| 1348 |
+
'total_err_groups' => $total_err_groups,
|
| 1349 |
+
'total_err' => $total_err,
|
| 1350 |
+
'total_miss_groups' => $total_miss_groups,
|
| 1351 |
+
'total_miss' => $total_miss,
|
| 1352 |
+
'total_server_finished_groups' => $total_server_finished_groups,
|
| 1353 |
+
'total_server_finished' => $total_server_finished,
|
| 1354 |
+
'total_pulled_groups' => $total_pulled_groups,
|
| 1355 |
+
'total_pulled' => $total_pulled,
|
| 1356 |
+
) ;
|
| 1357 |
+
}
|
| 1358 |
+
|
| 1359 |
+
/**
|
| 1360 |
+
* Check if fetch cron is running
|
| 1361 |
+
*
|
| 1362 |
+
* @since 1.6.2
|
| 1363 |
+
* @access public
|
| 1364 |
+
*/
|
| 1365 |
+
public function cron_running( $bool_res = true )
|
| 1366 |
+
{
|
| 1367 |
+
$last_run = get_option( self::ITEM_IMG_OPTM_CRON_RUN ) ;
|
| 1368 |
+
|
| 1369 |
+
$is_running = $last_run && time() - $last_run < 120 ;
|
| 1370 |
+
|
| 1371 |
+
if ( $bool_res ) {
|
| 1372 |
+
return $is_running ;
|
| 1373 |
+
}
|
| 1374 |
+
|
| 1375 |
+
return array( $last_run, $is_running ) ;
|
| 1376 |
+
}
|
| 1377 |
+
|
| 1378 |
+
/**
|
| 1379 |
+
* Update fetch cron timestamp tag
|
| 1380 |
+
*
|
| 1381 |
+
* @since 1.6.2
|
| 1382 |
+
* @access private
|
| 1383 |
+
*/
|
| 1384 |
+
private function _update_cron_running( $done = false )
|
| 1385 |
+
{
|
| 1386 |
+
$ts = time() ;
|
| 1387 |
+
|
| 1388 |
+
if ( $done ) {
|
| 1389 |
+
// Only update cron tag when its from the active running cron
|
| 1390 |
+
if ( $this->_cron_ran ) {
|
| 1391 |
+
// Rollback for next running
|
| 1392 |
+
$ts -= 120 ;
|
| 1393 |
+
}
|
| 1394 |
+
else {
|
| 1395 |
+
return ;
|
| 1396 |
+
}
|
| 1397 |
+
}
|
| 1398 |
+
|
| 1399 |
+
update_option( self::ITEM_IMG_OPTM_CRON_RUN, $ts ) ;
|
| 1400 |
+
|
| 1401 |
+
$this->_cron_ran = true ;
|
| 1402 |
+
}
|
| 1403 |
+
|
| 1404 |
+
/**
|
| 1405 |
+
* Batch switch images to ori/optm version
|
| 1406 |
+
*
|
| 1407 |
+
* @since 1.6.2
|
| 1408 |
+
* @access private
|
| 1409 |
+
*/
|
| 1410 |
+
private function _batch_switch( $type )
|
| 1411 |
+
{
|
| 1412 |
+
global $wpdb ;
|
| 1413 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE optm_status = %s" ;
|
| 1414 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ;
|
| 1415 |
+
|
| 1416 |
+
$i = 0 ;
|
| 1417 |
+
foreach ( $list as $v ) {
|
| 1418 |
+
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $v->src ;
|
| 1419 |
+
|
| 1420 |
+
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 1421 |
+
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 1422 |
+
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 1423 |
+
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 1424 |
+
|
| 1425 |
+
// switch to ori
|
| 1426 |
+
if ( $type === self::TYPE_IMG_BATCH_SWITCH_ORI ) {
|
| 1427 |
+
if ( ! file_exists( $bk_file ) ) {
|
| 1428 |
+
continue ;
|
| 1429 |
+
}
|
| 1430 |
+
|
| 1431 |
+
$i ++ ;
|
| 1432 |
+
|
| 1433 |
+
rename( $local_file, $bk_optm_file ) ;
|
| 1434 |
+
rename( $bk_file, $local_file ) ;
|
| 1435 |
+
}
|
| 1436 |
+
// switch to optm
|
| 1437 |
+
elseif ( $type === self::TYPE_IMG_BATCH_SWITCH_OPTM ) {
|
| 1438 |
+
if ( ! file_exists( $bk_optm_file ) ) {
|
| 1439 |
+
continue ;
|
| 1440 |
+
}
|
| 1441 |
+
|
| 1442 |
+
$i ++ ;
|
| 1443 |
+
|
| 1444 |
+
rename( $local_file, $bk_file ) ;
|
| 1445 |
+
rename( $bk_optm_file, $local_file ) ;
|
| 1446 |
+
}
|
| 1447 |
+
}
|
| 1448 |
+
|
| 1449 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] batch switched images total: ' . $i ) ;
|
| 1450 |
+
|
| 1451 |
+
}
|
| 1452 |
+
|
| 1453 |
+
/**
|
| 1454 |
+
* Switch image between original one and optimized one
|
| 1455 |
+
*
|
| 1456 |
+
* @since 1.6.2
|
| 1457 |
+
* @access private
|
| 1458 |
+
*/
|
| 1459 |
+
private function _switch_optm_file( $type )
|
| 1460 |
+
{
|
| 1461 |
+
$pid = substr( $type, 4 ) ;
|
| 1462 |
+
$switch_type = substr( $type, 0, 4 ) ;
|
| 1463 |
+
|
| 1464 |
+
global $wpdb ;
|
| 1465 |
+
$q = "SELECT * FROM $this->_table_img_optm WHERE optm_status = %s AND post_id = %d" ;
|
| 1466 |
+
$list = $wpdb->get_results( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS_PULLED, $pid ) ) ) ;
|
| 1467 |
+
|
| 1468 |
+
$msg = 'Unknown Msg' ;
|
| 1469 |
+
|
| 1470 |
+
foreach ( $list as $v ) {
|
| 1471 |
+
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $v->src ;
|
| 1472 |
+
|
| 1473 |
+
// to switch webp file
|
| 1474 |
+
if ( $switch_type === 'webp' ) {
|
| 1475 |
+
if ( file_exists( $local_file . '.webp' ) ) {
|
| 1476 |
+
rename( $local_file . '.webp', $local_file . '.optm.webp' ) ;
|
| 1477 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Disabled WebP: ' . $local_file ) ;
|
| 1478 |
+
|
| 1479 |
+
$msg = __( 'Disabled WebP file successfully.', 'litespeed-cache' ) ;
|
| 1480 |
+
}
|
| 1481 |
+
elseif ( file_exists( $local_file . '.optm.webp' ) ) {
|
| 1482 |
+
rename( $local_file . '.optm.webp', $local_file . '.webp' ) ;
|
| 1483 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Enable WebP: ' . $local_file ) ;
|
| 1484 |
+
|
| 1485 |
+
$msg = __( 'Enabled WebP file successfully.', 'litespeed-cache' ) ;
|
| 1486 |
+
}
|
| 1487 |
+
}
|
| 1488 |
+
// to switch original file
|
| 1489 |
+
else {
|
| 1490 |
+
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 1491 |
+
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 1492 |
+
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 1493 |
+
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 1494 |
+
|
| 1495 |
+
// revert ori back
|
| 1496 |
+
if ( file_exists( $bk_file ) ) {
|
| 1497 |
+
rename( $local_file, $bk_optm_file ) ;
|
| 1498 |
+
rename( $bk_file, $local_file ) ;
|
| 1499 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Restore original img: ' . $bk_file ) ;
|
| 1500 |
+
|
| 1501 |
+
$msg = __( 'Restored original file successfully.', 'litespeed-cache' ) ;
|
| 1502 |
+
}
|
| 1503 |
+
elseif ( file_exists( $bk_optm_file ) ) {
|
| 1504 |
+
rename( $local_file, $bk_file ) ;
|
| 1505 |
+
rename( $bk_optm_file, $local_file ) ;
|
| 1506 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] Switch to optm img: ' . $local_file ) ;
|
| 1507 |
+
|
| 1508 |
+
$msg = __( 'Switched to optimized file successfully.', 'litespeed-cache' ) ;
|
| 1509 |
+
}
|
| 1510 |
+
|
| 1511 |
+
}
|
| 1512 |
+
}
|
| 1513 |
+
|
| 1514 |
+
LiteSpeed_Cache_Admin_Display::add_notice( LiteSpeed_Cache_Admin_Display::NOTICE_GREEN, $msg ) ;
|
| 1515 |
+
}
|
| 1516 |
+
|
| 1517 |
+
/**
|
| 1518 |
+
* Handle all request actions from main cls
|
| 1519 |
+
*
|
| 1520 |
+
* @since 2.0
|
| 1521 |
+
* @access public
|
| 1522 |
+
*/
|
| 1523 |
+
public static function handler()
|
| 1524 |
+
{
|
| 1525 |
+
$instance = self::get_instance() ;
|
| 1526 |
+
|
| 1527 |
+
$type = LiteSpeed_Cache_Router::verify_type() ;
|
| 1528 |
+
|
| 1529 |
+
switch ( $type ) {
|
| 1530 |
+
case self::TYPE_SYNC_DATA :
|
| 1531 |
+
$instance->_sync_data() ;
|
| 1532 |
+
break ;
|
| 1533 |
+
|
| 1534 |
+
case self::TYPE_IMG_OPTIMIZE :
|
| 1535 |
+
$instance->_request_optm() ;
|
| 1536 |
+
break ;
|
| 1537 |
+
|
| 1538 |
+
case self::TYPE_IMG_OPTIMIZE_RESCAN :
|
| 1539 |
+
$instance->_img_optimize_rescan() ;
|
| 1540 |
+
break ;
|
| 1541 |
+
|
| 1542 |
+
case self::TYPE_IMG_OPTIMIZE_DESTROY :
|
| 1543 |
+
$instance->_img_optimize_destroy() ;
|
| 1544 |
+
break ;
|
| 1545 |
+
|
| 1546 |
+
case self::TYPE_IMG_PULL :
|
| 1547 |
+
LiteSpeed_Cache_Log::debug( 'ImgOptm: Manually running Cron pull_optimized_img' ) ;
|
| 1548 |
+
$result = $instance->_pull_optimized_img( true ) ;
|
| 1549 |
+
// Manually running needs to roll back timestamp for next running
|
| 1550 |
+
$instance->_update_cron_running( true ) ;
|
| 1551 |
+
|
| 1552 |
+
// Check if need to self redirect
|
| 1553 |
+
if ( $result === 'to_be_continued' ) {
|
| 1554 |
+
$link = LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, LiteSpeed_Cache_Img_Optm::TYPE_IMG_PULL ) ;
|
| 1555 |
+
LiteSpeed_Cache_Admin::redirect( html_entity_decode( $link ) ) ;
|
| 1556 |
+
}
|
| 1557 |
+
break ;
|
| 1558 |
+
|
| 1559 |
+
/**
|
| 1560 |
+
* Batch switch
|
| 1561 |
+
* @since 1.6.3
|
| 1562 |
+
*/
|
| 1563 |
+
case self::TYPE_IMG_BATCH_SWITCH_ORI :
|
| 1564 |
+
case self::TYPE_IMG_BATCH_SWITCH_OPTM :
|
| 1565 |
+
$instance->_batch_switch( $type ) ;
|
| 1566 |
+
break ;
|
| 1567 |
+
|
| 1568 |
+
case substr( $type, 0, 4 ) === 'webp' :
|
| 1569 |
+
case substr( $type, 0, 4 ) === 'orig' :
|
| 1570 |
+
$instance->_switch_optm_file( $type ) ;
|
| 1571 |
+
break ;
|
| 1572 |
+
|
| 1573 |
+
default:
|
| 1574 |
+
break ;
|
| 1575 |
+
}
|
| 1576 |
+
|
| 1577 |
+
LiteSpeed_Cache_Admin::redirect() ;
|
| 1578 |
+
}
|
| 1579 |
+
|
| 1580 |
+
/**
|
| 1581 |
+
* Get the current guidance step
|
| 1582 |
+
*
|
| 1583 |
+
* @since 2.0
|
| 1584 |
+
* @access public
|
| 1585 |
+
*/
|
| 1586 |
+
public function get_guidance_pos()
|
| 1587 |
+
{
|
| 1588 |
+
$guide_status = get_option( LiteSpeed_Cache_Config::ITEM_GUIDE ) ;
|
| 1589 |
+
|
| 1590 |
+
$current_step = 'done' ;
|
| 1591 |
+
if ( ! $guide_status || empty( $guide_status[ 'img_optm' ] ) || $guide_status[ 'img_optm' ] !== 'done' ) {
|
| 1592 |
+
$current_step = empty( $guide_status[ 'img_optm' ] ) ? 1 : $guide_status[ 'img_optm' ] ;
|
| 1593 |
+
}
|
| 1594 |
+
|
| 1595 |
+
return $current_step ;
|
| 1596 |
+
}
|
| 1597 |
+
|
| 1598 |
+
/**
|
| 1599 |
+
* Update current guidance step
|
| 1600 |
+
*
|
| 1601 |
+
* @since 2.0
|
| 1602 |
+
* @access private
|
| 1603 |
+
*/
|
| 1604 |
+
private function _update_guidance_pos( $pos )
|
| 1605 |
+
{
|
| 1606 |
+
$guide_status = get_option( LiteSpeed_Cache_Config::ITEM_GUIDE ) ;
|
| 1607 |
+
|
| 1608 |
+
if ( ! $guide_status ) {
|
| 1609 |
+
$guide_status = array() ;
|
| 1610 |
+
}
|
| 1611 |
+
|
| 1612 |
+
if ( ! empty( $guide_status[ 'img_optm' ] ) && $guide_status[ 'img_optm' ] == $pos ) {
|
| 1613 |
+
LiteSpeed_Cache_Log::debug2( '[Img_Optm] _update_guidance_pos: bypassed due to same pos [step] ' . $pos ) ;
|
| 1614 |
+
return ;
|
| 1615 |
+
}
|
| 1616 |
+
|
| 1617 |
+
$guide_status[ 'img_optm' ] = $pos ;
|
| 1618 |
+
|
| 1619 |
+
LiteSpeed_Cache_Log::debug( '[Img_Optm] _update_guidance_pos [step] ' . $pos ) ;
|
| 1620 |
+
|
| 1621 |
+
update_option( LiteSpeed_Cache_Config::ITEM_GUIDE, $guide_status ) ;
|
| 1622 |
+
}
|
| 1623 |
+
|
| 1624 |
+
/**
|
| 1625 |
+
* Get the current instance object.
|
| 1626 |
+
*
|
| 1627 |
+
* @since 2.0
|
| 1628 |
+
* @access public
|
| 1629 |
+
* @return Current class instance.
|
| 1630 |
+
*/
|
| 1631 |
+
public static function get_instance()
|
| 1632 |
+
{
|
| 1633 |
+
if ( ! isset( self::$_instance ) ) {
|
| 1634 |
+
self::$_instance = new self() ;
|
| 1635 |
+
}
|
| 1636 |
+
|
| 1637 |
+
return self::$_instance ;
|
| 1638 |
+
}
|
| 1639 |
+
|
| 1640 |
+
}
|
inc/import.class.php
CHANGED
|
@@ -36,7 +36,7 @@ class LiteSpeed_Cache_Import
|
|
| 36 |
LiteSpeed_Cache_Config::ITEM_OPTM_CSS,
|
| 37 |
LiteSpeed_Cache_Config::ITEM_OPTM_JS_DEFER_EXC,
|
| 38 |
LiteSpeed_Cache_Config::ITEM_MEDIA_LAZY_IMG_EXC,
|
| 39 |
-
LiteSpeed_Cache_Config::
|
| 40 |
LiteSpeed_Cache_Config::ITEM_ENV_REF,
|
| 41 |
LiteSpeed_Cache_Config::ITEM_CACHE_DROP_QS,
|
| 42 |
LiteSpeed_Cache_Config::ITEM_CDN_MAPPING,
|
| 36 |
LiteSpeed_Cache_Config::ITEM_OPTM_CSS,
|
| 37 |
LiteSpeed_Cache_Config::ITEM_OPTM_JS_DEFER_EXC,
|
| 38 |
LiteSpeed_Cache_Config::ITEM_MEDIA_LAZY_IMG_EXC,
|
| 39 |
+
LiteSpeed_Cache_Config::ITEM_IMG_OPTM_NEED_PULL,
|
| 40 |
LiteSpeed_Cache_Config::ITEM_ENV_REF,
|
| 41 |
LiteSpeed_Cache_Config::ITEM_CACHE_DROP_QS,
|
| 42 |
LiteSpeed_Cache_Config::ITEM_CDN_MAPPING,
|
inc/litespeed-cache.class.php
CHANGED
|
@@ -19,7 +19,7 @@ class LiteSpeed_Cache
|
|
| 19 |
private static $_instance ;
|
| 20 |
|
| 21 |
const PLUGIN_NAME = 'litespeed-cache' ;
|
| 22 |
-
const PLUGIN_VERSION = '
|
| 23 |
|
| 24 |
const PAGE_EDIT_HTACCESS = 'lscache-edit-htaccess' ;
|
| 25 |
|
|
@@ -47,6 +47,7 @@ class LiteSpeed_Cache
|
|
| 47 |
const ACTION_CRAWLER_CRON_ENABLE = 'crawler-cron-enable' ;
|
| 48 |
const ACTION_DO_CRAWL = 'do-crawl' ;
|
| 49 |
const ACTION_BLACKLIST_SAVE = 'blacklist-save' ;
|
|
|
|
| 50 |
|
| 51 |
const ACTION_FRONT_PURGE = 'front-purge' ;
|
| 52 |
const ACTION_FRONT_EXCLUDE = 'front-exclude' ;
|
|
@@ -57,6 +58,7 @@ class LiteSpeed_Cache
|
|
| 57 |
const ACTION_IMPORT = 'import' ;
|
| 58 |
const ACTION_PURGE = 'purge' ;
|
| 59 |
const ACTION_MEDIA = 'media' ;
|
|
|
|
| 60 |
const ACTION_IAPI = 'iapi' ;
|
| 61 |
const ACTION_CDN = 'cdn' ;
|
| 62 |
const ACTION_REPORT = 'report' ;
|
|
@@ -328,6 +330,10 @@ class LiteSpeed_Cache
|
|
| 328 |
$msg = LiteSpeed_Cache_Media::handler() ;
|
| 329 |
break ;
|
| 330 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 331 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 332 |
$msg = LiteSpeed_Cache_Purge::handler() ;
|
| 333 |
break ;
|
|
@@ -352,6 +358,10 @@ class LiteSpeed_Cache
|
|
| 352 |
$msg = LiteSpeed_Cache_Import::handler() ;
|
| 353 |
break ;
|
| 354 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 355 |
default:
|
| 356 |
break ;
|
| 357 |
}
|
| 19 |
private static $_instance ;
|
| 20 |
|
| 21 |
const PLUGIN_NAME = 'litespeed-cache' ;
|
| 22 |
+
const PLUGIN_VERSION = '2.0' ;
|
| 23 |
|
| 24 |
const PAGE_EDIT_HTACCESS = 'lscache-edit-htaccess' ;
|
| 25 |
|
| 47 |
const ACTION_CRAWLER_CRON_ENABLE = 'crawler-cron-enable' ;
|
| 48 |
const ACTION_DO_CRAWL = 'do-crawl' ;
|
| 49 |
const ACTION_BLACKLIST_SAVE = 'blacklist-save' ;
|
| 50 |
+
const ACTION_QUIC_CLOUD = 'quic_cloud' ;
|
| 51 |
|
| 52 |
const ACTION_FRONT_PURGE = 'front-purge' ;
|
| 53 |
const ACTION_FRONT_EXCLUDE = 'front-exclude' ;
|
| 58 |
const ACTION_IMPORT = 'import' ;
|
| 59 |
const ACTION_PURGE = 'purge' ;
|
| 60 |
const ACTION_MEDIA = 'media' ;
|
| 61 |
+
const ACTION_IMG_OPTM = 'img_optm' ;
|
| 62 |
const ACTION_IAPI = 'iapi' ;
|
| 63 |
const ACTION_CDN = 'cdn' ;
|
| 64 |
const ACTION_REPORT = 'report' ;
|
| 330 |
$msg = LiteSpeed_Cache_Media::handler() ;
|
| 331 |
break ;
|
| 332 |
|
| 333 |
+
case LiteSpeed_Cache::ACTION_IMG_OPTM:
|
| 334 |
+
$msg = LiteSpeed_Cache_Img_Optm::handler() ;
|
| 335 |
+
break ;
|
| 336 |
+
|
| 337 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 338 |
$msg = LiteSpeed_Cache_Purge::handler() ;
|
| 339 |
break ;
|
| 358 |
$msg = LiteSpeed_Cache_Import::handler() ;
|
| 359 |
break ;
|
| 360 |
|
| 361 |
+
case LiteSpeed_Cache::ACTION_QUIC_CLOUD:
|
| 362 |
+
$msg = LiteSpeed_Cache_QUIC_CLOUD::handler() ;
|
| 363 |
+
break ;
|
| 364 |
+
|
| 365 |
default:
|
| 366 |
break ;
|
| 367 |
}
|
inc/litespeed.autoload.php
CHANGED
|
@@ -34,11 +34,13 @@ if ( !function_exists('_litespeed_autoload') ) {
|
|
| 34 |
'LiteSpeed_Cache_ESI' => 'inc/esi.class.php',
|
| 35 |
'LiteSpeed_Cache_GUI' => 'inc/gui.class.php',
|
| 36 |
'LiteSpeed_Cache_Import' => 'inc/import.class.php',
|
|
|
|
| 37 |
'LiteSpeed_Cache_Log' => 'inc/log.class.php',
|
| 38 |
'LiteSpeed_Cache_Media' => 'inc/media.class.php',
|
| 39 |
'LiteSpeed_Cache_Object' => 'inc/object.class.php',
|
| 40 |
'LiteSpeed_Cache_Optimize' => 'inc/optimize.class.php',
|
| 41 |
'LiteSpeed_Cache_Optimizer' => 'inc/optimizer.class.php',
|
|
|
|
| 42 |
'LiteSpeed_Cache_Purge' => 'inc/purge.class.php',
|
| 43 |
'LiteSpeed_Cache_Router' => 'inc/router.class.php',
|
| 44 |
'LiteSpeed_Cache_Tag' => 'inc/tag.class.php',
|
| 34 |
'LiteSpeed_Cache_ESI' => 'inc/esi.class.php',
|
| 35 |
'LiteSpeed_Cache_GUI' => 'inc/gui.class.php',
|
| 36 |
'LiteSpeed_Cache_Import' => 'inc/import.class.php',
|
| 37 |
+
'LiteSpeed_Cache_Img_Optm' => 'inc/img_optm.class.php',
|
| 38 |
'LiteSpeed_Cache_Log' => 'inc/log.class.php',
|
| 39 |
'LiteSpeed_Cache_Media' => 'inc/media.class.php',
|
| 40 |
'LiteSpeed_Cache_Object' => 'inc/object.class.php',
|
| 41 |
'LiteSpeed_Cache_Optimize' => 'inc/optimize.class.php',
|
| 42 |
'LiteSpeed_Cache_Optimizer' => 'inc/optimizer.class.php',
|
| 43 |
+
'LiteSpeed_Cache_QUIC_CLOUD' => 'inc/quic_cloud.class.php',
|
| 44 |
'LiteSpeed_Cache_Purge' => 'inc/purge.class.php',
|
| 45 |
'LiteSpeed_Cache_Router' => 'inc/router.class.php',
|
| 46 |
'LiteSpeed_Cache_Tag' => 'inc/tag.class.php',
|
inc/media.class.php
CHANGED
|
@@ -16,33 +16,8 @@ class LiteSpeed_Cache_Media
|
|
| 16 |
|
| 17 |
const LAZY_LIB = '/min/lazyload.js' ;
|
| 18 |
|
| 19 |
-
const TYPE_SYNC_DATA = 'sync_data' ;
|
| 20 |
-
const TYPE_IMG_OPTIMIZE = 'img_optm' ;
|
| 21 |
-
const TYPE_IMG_OPTIMIZE_RESCAN = 'img_optm_rescan' ;
|
| 22 |
-
const TYPE_IMG_OPTIMIZE_DESTROY = 'img_optm_destroy' ;
|
| 23 |
-
const TYPE_IMG_PULL = 'img_pull' ;
|
| 24 |
-
const TYPE_IMG_BATCH_SWITCH_ORI = 'img_optm_batch_switch_ori' ;
|
| 25 |
-
const TYPE_IMG_BATCH_SWITCH_OPTM = 'img_optm_batch_switch_optm' ;
|
| 26 |
-
const OPT_CRON_RUN = 'litespeed-img_optm_cron_run' ; // last cron running time
|
| 27 |
-
|
| 28 |
-
const DB_IMG_OPTIMIZE_DESTROY = 'litespeed-optimize-destroy' ;
|
| 29 |
-
const DB_IMG_OPTIMIZE_DATA = 'litespeed-optimize-data' ;
|
| 30 |
-
const DB_IMG_OPTIMIZE_STATUS = 'litespeed-optimize-status' ;
|
| 31 |
-
const DB_IMG_OPTIMIZE_STATUS_REQUESTED = 'requested' ;
|
| 32 |
-
const DB_IMG_OPTIMIZE_STATUS_NOTIFIED = 'notified' ;
|
| 33 |
-
const DB_IMG_OPTIMIZE_STATUS_PULLED = 'pulled' ;
|
| 34 |
-
const DB_IMG_OPTIMIZE_STATUS_FAILED = 'failed' ;
|
| 35 |
-
const DB_IMG_OPTIMIZE_STATUS_ERR = 'err' ;
|
| 36 |
-
const DB_IMG_OPTIMIZE_SIZE = 'litespeed-optimize-size' ;
|
| 37 |
-
|
| 38 |
-
const DB_IMG_OPTM_SUMMARY = 'litespeed_img_optm_summary' ;
|
| 39 |
-
|
| 40 |
private $content ;
|
| 41 |
private $wp_upload_dir ;
|
| 42 |
-
private $tmp_pid ;
|
| 43 |
-
private $tmp_path ;
|
| 44 |
-
private $_img_in_queue = array() ;
|
| 45 |
-
private $_img_total = 0 ;
|
| 46 |
|
| 47 |
private $cfg_img_webp ;
|
| 48 |
|
|
@@ -111,7 +86,7 @@ class LiteSpeed_Cache_Media
|
|
| 111 |
*/
|
| 112 |
public function after_admin_init()
|
| 113 |
{
|
| 114 |
-
if ( get_option( LiteSpeed_Cache_Config::
|
| 115 |
add_filter( 'manage_media_columns', array( $this, 'media_row_title' ) ) ;
|
| 116 |
add_filter( 'manage_media_custom_column', array( $this, 'media_row_actions' ), 10, 2 ) ;
|
| 117 |
}
|
|
@@ -144,7 +119,7 @@ class LiteSpeed_Cache_Media
|
|
| 144 |
|
| 145 |
$local_file = get_attached_file( $post_id ) ;
|
| 146 |
|
| 147 |
-
$link = LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 148 |
$desc = false ;
|
| 149 |
$cls = 'litespeed-icon-media-webp' ;
|
| 150 |
$cls_webp = '' ;
|
|
@@ -167,7 +142,7 @@ class LiteSpeed_Cache_Media
|
|
| 167 |
$bk_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.' . $extension ;
|
| 168 |
$bk_optm_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.optm.' . $extension ;
|
| 169 |
|
| 170 |
-
$link = LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::
|
| 171 |
$desc = false ;
|
| 172 |
$cls = 'litespeed-icon-media-optm' ;
|
| 173 |
$cls_ori = '' ;
|
|
@@ -187,7 +162,7 @@ class LiteSpeed_Cache_Media
|
|
| 187 |
}
|
| 188 |
|
| 189 |
$info_webp = '' ;
|
| 190 |
-
$size_meta = get_post_meta( $post_id,
|
| 191 |
if ( $size_meta && ! empty ( $size_meta[ 'webp_saved' ] ) ) {
|
| 192 |
$percent = ceil( $size_meta[ 'webp_saved' ] * 100 / $size_meta[ 'webp_total' ] ) ;
|
| 193 |
$pie_webp = LiteSpeed_Cache_GUI::pie( $percent, 30 ) ;
|
|
@@ -208,143 +183,6 @@ class LiteSpeed_Cache_Media
|
|
| 208 |
echo "<p class='litespeed-media-p $cls_webp'>$info_webp $link_webp</p><p class='litespeed-media-p $cls_ori'>$info_ori $link_ori</p>" ;
|
| 209 |
}
|
| 210 |
|
| 211 |
-
/**
|
| 212 |
-
* Batch switch images to ori/optm version
|
| 213 |
-
*
|
| 214 |
-
* @since 1.6.2
|
| 215 |
-
* @access private
|
| 216 |
-
*/
|
| 217 |
-
private function _batch_switch( $type )
|
| 218 |
-
{
|
| 219 |
-
global $wpdb ;
|
| 220 |
-
$q = "SELECT meta_value
|
| 221 |
-
FROM $wpdb->postmeta
|
| 222 |
-
WHERE meta_key = %s
|
| 223 |
-
" ;
|
| 224 |
-
$cond = array( self::DB_IMG_OPTIMIZE_DATA ) ;
|
| 225 |
-
$meta_value_lists = $wpdb->get_results( $wpdb->prepare( $q, $cond ) ) ;
|
| 226 |
-
|
| 227 |
-
$i = 0 ;
|
| 228 |
-
foreach ( $meta_value_lists as $v ) {
|
| 229 |
-
$meta_value_list = unserialize( $v->meta_value ) ;
|
| 230 |
-
|
| 231 |
-
foreach ( $meta_value_list as $v2 ) {
|
| 232 |
-
if ( $v2[ 1 ] !== 'pulled' ) {
|
| 233 |
-
continue ;
|
| 234 |
-
}
|
| 235 |
-
|
| 236 |
-
$src = $v2[ 0 ] ;
|
| 237 |
-
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $src ;
|
| 238 |
-
|
| 239 |
-
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 240 |
-
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 241 |
-
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 242 |
-
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 243 |
-
|
| 244 |
-
// switch to ori
|
| 245 |
-
if ( $type === self::TYPE_IMG_BATCH_SWITCH_ORI ) {
|
| 246 |
-
if ( ! file_exists( $bk_file ) ) {
|
| 247 |
-
continue ;
|
| 248 |
-
}
|
| 249 |
-
|
| 250 |
-
$i ++ ;
|
| 251 |
-
|
| 252 |
-
rename( $local_file, $bk_optm_file ) ;
|
| 253 |
-
rename( $bk_file, $local_file ) ;
|
| 254 |
-
}
|
| 255 |
-
// switch to optm
|
| 256 |
-
elseif ( $type === self::TYPE_IMG_BATCH_SWITCH_OPTM ) {
|
| 257 |
-
if ( ! file_exists( $bk_optm_file ) ) {
|
| 258 |
-
continue ;
|
| 259 |
-
}
|
| 260 |
-
|
| 261 |
-
$i ++ ;
|
| 262 |
-
|
| 263 |
-
rename( $local_file, $bk_file ) ;
|
| 264 |
-
rename( $bk_optm_file, $local_file ) ;
|
| 265 |
-
}
|
| 266 |
-
|
| 267 |
-
}
|
| 268 |
-
}
|
| 269 |
-
|
| 270 |
-
LiteSpeed_Cache_Log::debug( 'Media: batch switched images total: ' . $i ) ;
|
| 271 |
-
|
| 272 |
-
}
|
| 273 |
-
|
| 274 |
-
/**
|
| 275 |
-
* Switch image between original one and optimized one
|
| 276 |
-
*
|
| 277 |
-
* @since 1.6.2
|
| 278 |
-
* @access private
|
| 279 |
-
*/
|
| 280 |
-
private function _switch_optm_file( $type )
|
| 281 |
-
{
|
| 282 |
-
$pid = substr( $type, 4 ) ;
|
| 283 |
-
$switch_type = substr( $type, 0, 4 ) ;
|
| 284 |
-
|
| 285 |
-
global $wpdb ;
|
| 286 |
-
$q = "SELECT meta_value
|
| 287 |
-
FROM $wpdb->postmeta
|
| 288 |
-
WHERE post_id = %d AND meta_key = %s
|
| 289 |
-
" ;
|
| 290 |
-
$cond = array( $pid, self::DB_IMG_OPTIMIZE_DATA ) ;
|
| 291 |
-
$meta_value_list = $wpdb->get_var( $wpdb->prepare( $q, $cond ) ) ;
|
| 292 |
-
$meta_value_list = unserialize( $meta_value_list ) ;
|
| 293 |
-
|
| 294 |
-
$msg = 'Unknown Msg' ;
|
| 295 |
-
|
| 296 |
-
foreach ( $meta_value_list as $v ) {
|
| 297 |
-
if ( $v[ 1 ] !== 'pulled' ) {
|
| 298 |
-
continue ;
|
| 299 |
-
}
|
| 300 |
-
|
| 301 |
-
$src = $v[ 0 ] ;
|
| 302 |
-
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $src ;
|
| 303 |
-
|
| 304 |
-
// to switch webp file
|
| 305 |
-
if ( $switch_type === 'webp' ) {
|
| 306 |
-
if ( file_exists( $local_file . '.webp' ) ) {
|
| 307 |
-
rename( $local_file . '.webp', $local_file . '.optm.webp' ) ;
|
| 308 |
-
LiteSpeed_Cache_Log::debug( 'Media: Disabled WebP: ' . $local_file ) ;
|
| 309 |
-
|
| 310 |
-
$msg = __( 'Disabled WebP file successfully.', 'litespeed-cache' ) ;
|
| 311 |
-
}
|
| 312 |
-
elseif ( file_exists( $local_file . '.optm.webp' ) ) {
|
| 313 |
-
rename( $local_file . '.optm.webp', $local_file . '.webp' ) ;
|
| 314 |
-
LiteSpeed_Cache_Log::debug( 'Media: Enable WebP: ' . $local_file ) ;
|
| 315 |
-
|
| 316 |
-
$msg = __( 'Enabled WebP file successfully.', 'litespeed-cache' ) ;
|
| 317 |
-
}
|
| 318 |
-
}
|
| 319 |
-
// to switch original file
|
| 320 |
-
else {
|
| 321 |
-
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 322 |
-
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 323 |
-
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 324 |
-
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 325 |
-
|
| 326 |
-
// revert ori back
|
| 327 |
-
if ( file_exists( $bk_file ) ) {
|
| 328 |
-
rename( $local_file, $bk_optm_file ) ;
|
| 329 |
-
rename( $bk_file, $local_file ) ;
|
| 330 |
-
LiteSpeed_Cache_Log::debug( 'Media: Restore original img: ' . $bk_file ) ;
|
| 331 |
-
|
| 332 |
-
$msg = __( 'Restored original file successfully.', 'litespeed-cache' ) ;
|
| 333 |
-
}
|
| 334 |
-
elseif ( file_exists( $bk_optm_file ) ) {
|
| 335 |
-
rename( $local_file, $bk_file ) ;
|
| 336 |
-
rename( $bk_optm_file, $local_file ) ;
|
| 337 |
-
LiteSpeed_Cache_Log::debug( 'Media: Switch to optm img: ' . $local_file ) ;
|
| 338 |
-
|
| 339 |
-
$msg = __( 'Switched to optimized file successfully.', 'litespeed-cache' ) ;
|
| 340 |
-
}
|
| 341 |
-
|
| 342 |
-
}
|
| 343 |
-
}
|
| 344 |
-
|
| 345 |
-
LiteSpeed_Cache_Admin_Display::add_notice( LiteSpeed_Cache_Admin_Display::NOTICE_GREEN, $msg ) ;
|
| 346 |
-
}
|
| 347 |
-
|
| 348 |
/**
|
| 349 |
* Get wp size info
|
| 350 |
*
|
|
@@ -420,34 +258,6 @@ class LiteSpeed_Cache_Media
|
|
| 420 |
}
|
| 421 |
}
|
| 422 |
|
| 423 |
-
/**
|
| 424 |
-
* Sync data from litespeed IAPI server
|
| 425 |
-
*
|
| 426 |
-
* @since 1.6.5
|
| 427 |
-
* @access private
|
| 428 |
-
*/
|
| 429 |
-
private function _sync_data()
|
| 430 |
-
{
|
| 431 |
-
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_MEDIA_SYNC_DATA ) ;
|
| 432 |
-
|
| 433 |
-
if ( ! is_array( $json ) ) {
|
| 434 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to post to LiteSpeed IAPI server ', $json ) ;
|
| 435 |
-
$msg = __( 'Failed to communicate with LiteSpeed IAPI server', 'litespeed-cache' ) . ': ' . $json ;
|
| 436 |
-
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 437 |
-
return ;
|
| 438 |
-
}
|
| 439 |
-
|
| 440 |
-
if ( ! empty( $json ) ) {
|
| 441 |
-
update_option( self::DB_IMG_OPTM_SUMMARY, $json ) ;
|
| 442 |
-
}
|
| 443 |
-
|
| 444 |
-
$msg = __( 'Communicated with LiteSpeed Image Optimization Server successfully.', 'litespeed-cache' ) ;
|
| 445 |
-
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 446 |
-
|
| 447 |
-
LiteSpeed_Cache_Admin::redirect() ;
|
| 448 |
-
|
| 449 |
-
}
|
| 450 |
-
|
| 451 |
/**
|
| 452 |
* Handle all request actions from main cls
|
| 453 |
*
|
|
@@ -461,41 +271,6 @@ class LiteSpeed_Cache_Media
|
|
| 461 |
$type = LiteSpeed_Cache_Router::verify_type() ;
|
| 462 |
|
| 463 |
switch ( $type ) {
|
| 464 |
-
/**
|
| 465 |
-
* Batch switch
|
| 466 |
-
* @since 1.6.3
|
| 467 |
-
*/
|
| 468 |
-
case self::TYPE_IMG_BATCH_SWITCH_ORI :
|
| 469 |
-
case self::TYPE_IMG_BATCH_SWITCH_OPTM :
|
| 470 |
-
$instance->_batch_switch( $type ) ;
|
| 471 |
-
break ;
|
| 472 |
-
|
| 473 |
-
case self::TYPE_SYNC_DATA :
|
| 474 |
-
$instance->_sync_data() ;
|
| 475 |
-
break ;
|
| 476 |
-
|
| 477 |
-
case self::TYPE_IMG_OPTIMIZE :
|
| 478 |
-
$instance->_img_optimize() ;
|
| 479 |
-
break ;
|
| 480 |
-
|
| 481 |
-
case self::TYPE_IMG_OPTIMIZE_RESCAN :
|
| 482 |
-
$instance->_img_optimize_rescan() ;
|
| 483 |
-
break ;
|
| 484 |
-
|
| 485 |
-
case self::TYPE_IMG_OPTIMIZE_DESTROY :
|
| 486 |
-
$instance->_img_optimize_destroy() ;
|
| 487 |
-
break ;
|
| 488 |
-
|
| 489 |
-
case self::TYPE_IMG_PULL :
|
| 490 |
-
LiteSpeed_Cache_Log::debug( 'Media: Manually running Cron pull_optimized_img' ) ;
|
| 491 |
-
$instance->_pull_optimized_img() ;
|
| 492 |
-
break ;
|
| 493 |
-
|
| 494 |
-
case substr( $type, 0, 4 ) === 'webp' :
|
| 495 |
-
case substr( $type, 0, 4 ) === 'orig' :
|
| 496 |
-
$instance->_switch_optm_file( $type ) ;
|
| 497 |
-
break ;
|
| 498 |
-
|
| 499 |
default:
|
| 500 |
break ;
|
| 501 |
}
|
|
@@ -503,1024 +278,6 @@ class LiteSpeed_Cache_Media
|
|
| 503 |
LiteSpeed_Cache_Admin::redirect() ;
|
| 504 |
}
|
| 505 |
|
| 506 |
-
/**
|
| 507 |
-
* Check if fetch cron is running
|
| 508 |
-
*
|
| 509 |
-
* @since 1.6.2
|
| 510 |
-
* @access public
|
| 511 |
-
*/
|
| 512 |
-
public function cron_running( $bool_res = true )
|
| 513 |
-
{
|
| 514 |
-
$last_run = get_option( self::OPT_CRON_RUN ) ;
|
| 515 |
-
|
| 516 |
-
$is_running = $last_run && time() - $last_run <= 120 ;
|
| 517 |
-
|
| 518 |
-
if ( $bool_res ) {
|
| 519 |
-
return $is_running ;
|
| 520 |
-
}
|
| 521 |
-
|
| 522 |
-
return array( $last_run, $is_running ) ;
|
| 523 |
-
}
|
| 524 |
-
|
| 525 |
-
/**
|
| 526 |
-
* Update fetch cron timestamp tag
|
| 527 |
-
*
|
| 528 |
-
* @since 1.6.2
|
| 529 |
-
* @access private
|
| 530 |
-
*/
|
| 531 |
-
private function _update_cron_running()
|
| 532 |
-
{
|
| 533 |
-
update_option( self::OPT_CRON_RUN, time() ) ;
|
| 534 |
-
}
|
| 535 |
-
|
| 536 |
-
/**
|
| 537 |
-
* Pull optimized img
|
| 538 |
-
*
|
| 539 |
-
* @since 1.6
|
| 540 |
-
* @access public
|
| 541 |
-
*/
|
| 542 |
-
public static function pull_optimized_img()
|
| 543 |
-
{
|
| 544 |
-
LiteSpeed_Cache_Log::debug( 'Media: Cron pull_optimized_img started' ) ;
|
| 545 |
-
$instance = self::get_instance() ;
|
| 546 |
-
$instance->_pull_optimized_img() ;
|
| 547 |
-
}
|
| 548 |
-
|
| 549 |
-
/**
|
| 550 |
-
* Pull optimized img
|
| 551 |
-
*
|
| 552 |
-
* @since 1.6
|
| 553 |
-
* @access private
|
| 554 |
-
*/
|
| 555 |
-
private function _pull_optimized_img()
|
| 556 |
-
{
|
| 557 |
-
if ( $this->cron_running() ) {
|
| 558 |
-
LiteSpeed_Cache_Log::debug( 'Media: fetch cron is running' ) ;
|
| 559 |
-
return ;
|
| 560 |
-
}
|
| 561 |
-
|
| 562 |
-
global $wpdb ;
|
| 563 |
-
|
| 564 |
-
$q = "SELECT a.meta_id, a.post_id, b.meta_id as bmeta_id, b.meta_value, c.meta_id as cmeta_id, c.meta_value as cmeta_value
|
| 565 |
-
FROM $wpdb->postmeta a
|
| 566 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.post_id
|
| 567 |
-
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.post_id AND c.meta_key = %s
|
| 568 |
-
WHERE a.meta_key = %s AND a.meta_value = %s AND b.meta_key = %s
|
| 569 |
-
ORDER BY a.post_id DESC
|
| 570 |
-
LIMIT 1
|
| 571 |
-
" ;
|
| 572 |
-
$cond = array( self::DB_IMG_OPTIMIZE_SIZE, self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED, self::DB_IMG_OPTIMIZE_DATA ) ;
|
| 573 |
-
$query = $wpdb->prepare( $q, $cond ) ;
|
| 574 |
-
|
| 575 |
-
$webp_only = LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_ONLY ) ;
|
| 576 |
-
|
| 577 |
-
for ( $i=0 ; $i < 10 ; $i++ ) {
|
| 578 |
-
$meta_value_row = $wpdb->get_row( $query ) ;
|
| 579 |
-
|
| 580 |
-
if ( ! $meta_value_row ) {
|
| 581 |
-
break ;
|
| 582 |
-
}
|
| 583 |
-
|
| 584 |
-
$meta_value = unserialize( $meta_value_row->meta_value ) ;
|
| 585 |
-
|
| 586 |
-
if ( $meta_value_row->cmeta_value ) {
|
| 587 |
-
$cmeta_value = unserialize( $meta_value_row->cmeta_value ) ;
|
| 588 |
-
}
|
| 589 |
-
else {
|
| 590 |
-
$cmeta_value = array(
|
| 591 |
-
'ori_total' => 0,
|
| 592 |
-
'ori_saved' => 0,
|
| 593 |
-
'webp_total' => 0,
|
| 594 |
-
'webp_saved' => 0,
|
| 595 |
-
) ;
|
| 596 |
-
}
|
| 597 |
-
|
| 598 |
-
// Start fetching
|
| 599 |
-
foreach ( $meta_value as $md5 => $v2 ) {
|
| 600 |
-
|
| 601 |
-
/**
|
| 602 |
-
* Update cron timestamp to avoid duplicated running
|
| 603 |
-
* @since 1.6.2
|
| 604 |
-
*/
|
| 605 |
-
$this->_update_cron_running() ;
|
| 606 |
-
|
| 607 |
-
if ( $v2[ 1 ] === self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) {
|
| 608 |
-
$server = $v2[ 2 ] ;
|
| 609 |
-
// send fetch request
|
| 610 |
-
$data = array(
|
| 611 |
-
'pid' => $meta_value_row->post_id,
|
| 612 |
-
'src_md5' => $md5,
|
| 613 |
-
'meta' => $meta_value_row->meta_value,
|
| 614 |
-
) ;
|
| 615 |
-
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG, $data, $server ) ;
|
| 616 |
-
if ( empty( $json[ 'webp' ] ) ) {
|
| 617 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to pull optimized img: ', $json ) ;
|
| 618 |
-
return ;
|
| 619 |
-
}
|
| 620 |
-
|
| 621 |
-
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $v2[ 0 ] ;
|
| 622 |
-
$ori_size = filesize( $local_file ) ;
|
| 623 |
-
|
| 624 |
-
/**
|
| 625 |
-
* Use wp orignal get func to avoid allow_url_open off issue
|
| 626 |
-
* @since 1.6.5
|
| 627 |
-
*/
|
| 628 |
-
// Fetch webp image
|
| 629 |
-
$response = wp_remote_get( $json[ 'webp' ], array( 'timeout' => 15 ) ) ;
|
| 630 |
-
if ( is_wp_error( $response ) ) {
|
| 631 |
-
$error_message = $response->get_error_message() ;
|
| 632 |
-
LiteSpeed_Cache_Log::debug( 'IAPI failed to pull image: ' . $error_message ) ;
|
| 633 |
-
return ;
|
| 634 |
-
}
|
| 635 |
-
|
| 636 |
-
file_put_contents( $local_file . '.webp', $response[ 'body' ] ) ;
|
| 637 |
-
|
| 638 |
-
if ( ! file_exists( $local_file . '.webp' ) ) {
|
| 639 |
-
return ;
|
| 640 |
-
}
|
| 641 |
-
|
| 642 |
-
// Unknown issue
|
| 643 |
-
if ( md5_file( $local_file . '.webp' ) !== $json[ 'webp_md5' ] ) {
|
| 644 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to pull optimized img WebP: file md5 dismatch, server md5: ' . $json[ 'webp_md5' ] ) ;
|
| 645 |
-
|
| 646 |
-
// update status to failed
|
| 647 |
-
$meta_value[ $md5 ][ 1 ] = self::DB_IMG_OPTIMIZE_STATUS_FAILED ;
|
| 648 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d ";
|
| 649 |
-
$wpdb->query( $wpdb->prepare( $q, array( serialize( $meta_value ), $meta_value_row->bmeta_id ) ) ) ;
|
| 650 |
-
|
| 651 |
-
// Notify server to update status
|
| 652 |
-
LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG_FAILED, $data, $server ) ;
|
| 653 |
-
|
| 654 |
-
return ;// exit from running pull process
|
| 655 |
-
}
|
| 656 |
-
|
| 657 |
-
// log webp file saved size summary
|
| 658 |
-
$saved = $ori_size - filesize( $local_file . '.webp' ) ;
|
| 659 |
-
if ( $saved > 0 ) {
|
| 660 |
-
$cmeta_value[ 'webp_total' ] += $ori_size ;
|
| 661 |
-
$cmeta_value[ 'webp_saved' ] += $saved ;
|
| 662 |
-
}
|
| 663 |
-
|
| 664 |
-
LiteSpeed_Cache_Log::debug( 'Media: Pulled optimized img WebP: ' . $local_file . '.webp' ) ;
|
| 665 |
-
|
| 666 |
-
// Fetch optimized image itself
|
| 667 |
-
if ( ! $webp_only && ! empty( $json[ 'target_file' ] ) ) {
|
| 668 |
-
|
| 669 |
-
// Fetch failed, unkown issue, return
|
| 670 |
-
// NOTE: if this failed more than 5 times, next time fetching webp will touch err limit on server side, whole image will be failed
|
| 671 |
-
$response = wp_remote_get( $json[ 'target_file' ], array( 'timeout' => 15 ) ) ;
|
| 672 |
-
if ( is_wp_error( $response ) ) {
|
| 673 |
-
$error_message = $response->get_error_message() ;
|
| 674 |
-
LiteSpeed_Cache_Log::debug( 'IAPI failed to pull image: ' . $error_message ) ;
|
| 675 |
-
return ;
|
| 676 |
-
}
|
| 677 |
-
|
| 678 |
-
file_put_contents( $local_file . '.tmp', $response[ 'body' ] ) ;
|
| 679 |
-
// Unknown issue
|
| 680 |
-
if ( md5_file( $local_file . '.tmp' ) !== $json[ 'target_md5' ] ) {
|
| 681 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to pull optimized img iteself: file md5 dismatch, server md5: ' . $json[ 'target_md5' ] ) ;
|
| 682 |
-
|
| 683 |
-
// update status to failed
|
| 684 |
-
$meta_value[ $md5 ][ 1 ] = self::DB_IMG_OPTIMIZE_STATUS_FAILED ;
|
| 685 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d ";
|
| 686 |
-
$wpdb->query( $wpdb->prepare( $q, array( serialize( $meta_value ), $meta_value_row->bmeta_id ) ) ) ;
|
| 687 |
-
|
| 688 |
-
// Notify server to update status
|
| 689 |
-
LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_PULL_IMG_FAILED, $data, $server ) ;
|
| 690 |
-
|
| 691 |
-
return ; // exit from running pull process
|
| 692 |
-
}
|
| 693 |
-
|
| 694 |
-
// log webp file saved size summary
|
| 695 |
-
$saved = $ori_size - filesize( $local_file . '.tmp' ) ;
|
| 696 |
-
if ( $saved > 0 ) {
|
| 697 |
-
$cmeta_value[ 'ori_total' ] += $ori_size ;
|
| 698 |
-
$cmeta_value[ 'ori_saved' ] += $saved ;
|
| 699 |
-
}
|
| 700 |
-
|
| 701 |
-
// Backup ori img
|
| 702 |
-
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 703 |
-
$bk_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.' . $extension ;
|
| 704 |
-
rename( $local_file, $bk_file ) ;
|
| 705 |
-
|
| 706 |
-
// Replace ori img
|
| 707 |
-
rename( $local_file . '.tmp', $local_file ) ;
|
| 708 |
-
|
| 709 |
-
LiteSpeed_Cache_Log::debug( 'Media: Pulled optimized img: ' . $local_file ) ;
|
| 710 |
-
}
|
| 711 |
-
|
| 712 |
-
|
| 713 |
-
// Update meta value
|
| 714 |
-
$meta_value[ $md5 ][ 1 ] = self::DB_IMG_OPTIMIZE_STATUS_PULLED ;
|
| 715 |
-
}
|
| 716 |
-
}
|
| 717 |
-
|
| 718 |
-
LiteSpeed_Cache_Log::debug( 'Media: Pulled optimized img done, updating record pid: ' . $meta_value_row->post_id ) ;
|
| 719 |
-
|
| 720 |
-
// Update data tag
|
| 721 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d ";
|
| 722 |
-
$wpdb->query( $wpdb->prepare( $q, array( serialize( $meta_value ), $meta_value_row->bmeta_id ) ) ) ;
|
| 723 |
-
|
| 724 |
-
/**
|
| 725 |
-
* Update size saved info
|
| 726 |
-
* @since 1.6.5
|
| 727 |
-
*/
|
| 728 |
-
if ( $meta_value_row->cmeta_id ) {
|
| 729 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d ";
|
| 730 |
-
$wpdb->query( $wpdb->prepare( $q, array( serialize( $cmeta_value ), $meta_value_row->cmeta_id ) ) ) ;
|
| 731 |
-
}
|
| 732 |
-
else {
|
| 733 |
-
$q = "INSERT INTO $wpdb->postmeta SET meta_value = %s, meta_id = %d, meta_key = %s, post_id = %d ";
|
| 734 |
-
$wpdb->query( $wpdb->prepare( $q, array( serialize( $cmeta_value ), $meta_value_row->cmeta_id, self::DB_IMG_OPTIMIZE_SIZE, $meta_value_row->post_id ) ) ) ;
|
| 735 |
-
}
|
| 736 |
-
|
| 737 |
-
// Update status tag if all pulled or still has requested img
|
| 738 |
-
$has_notify = false ;// it may be bypassed in above loop
|
| 739 |
-
$has_request = false ;
|
| 740 |
-
foreach ( $meta_value as $v2 ) {
|
| 741 |
-
if ( $v2[ 1 ] === self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) {
|
| 742 |
-
$has_request = true ;
|
| 743 |
-
}
|
| 744 |
-
if ( $v2[ 1 ] === self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) {
|
| 745 |
-
$has_notify = true ;
|
| 746 |
-
}
|
| 747 |
-
}
|
| 748 |
-
|
| 749 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d ";
|
| 750 |
-
|
| 751 |
-
// Update pid status
|
| 752 |
-
if ( ! $has_notify ) {
|
| 753 |
-
$new_status = self::DB_IMG_OPTIMIZE_STATUS_PULLED ;
|
| 754 |
-
if ( $has_request ) {
|
| 755 |
-
$new_status = self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ;
|
| 756 |
-
}
|
| 757 |
-
LiteSpeed_Cache_Log::debug( 'Media: Updated pid status: ' . $new_status ) ;
|
| 758 |
-
|
| 759 |
-
$wpdb->query( $wpdb->prepare( $q, array( $new_status, $meta_value_row->meta_id ) ) ) ;
|
| 760 |
-
}
|
| 761 |
-
}
|
| 762 |
-
|
| 763 |
-
// If all pulled, update tag to done
|
| 764 |
-
$q = "SELECT * FROM $wpdb->postmeta WHERE meta_key = %s AND meta_value = %s LIMIT 1" ;
|
| 765 |
-
$meta_value_list = $wpdb->get_row( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ) ;
|
| 766 |
-
if ( ! $meta_value_list ) {
|
| 767 |
-
LiteSpeed_Cache_Log::debug( 'Media: Marked poll status to all pulled ' ) ;
|
| 768 |
-
update_option( LiteSpeed_Cache_Config::ITEM_MEDIA_NEED_PULL, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ;
|
| 769 |
-
}
|
| 770 |
-
}
|
| 771 |
-
|
| 772 |
-
/**
|
| 773 |
-
* Check if need to do a pull for optimized img
|
| 774 |
-
*
|
| 775 |
-
* @since 1.6
|
| 776 |
-
* @access public
|
| 777 |
-
*/
|
| 778 |
-
public static function check_need_pull()
|
| 779 |
-
{
|
| 780 |
-
$tag = get_option( LiteSpeed_Cache_Config::ITEM_MEDIA_NEED_PULL ) ;
|
| 781 |
-
return defined( 'DOING_CRON' ) && $tag && $tag === self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ;
|
| 782 |
-
}
|
| 783 |
-
|
| 784 |
-
/**
|
| 785 |
-
* Show an image's optm status
|
| 786 |
-
*
|
| 787 |
-
* @since 1.6.5
|
| 788 |
-
* @access public
|
| 789 |
-
*/
|
| 790 |
-
public function check_img()
|
| 791 |
-
{
|
| 792 |
-
$pid = $_POST[ 'data' ] ;
|
| 793 |
-
|
| 794 |
-
LiteSpeed_Cache_Log::debug( 'Media: Check image [ID] ' . $pid ) ;
|
| 795 |
-
|
| 796 |
-
$data = array() ;
|
| 797 |
-
|
| 798 |
-
$data[ 'img_count' ] = $this->img_count() ;
|
| 799 |
-
|
| 800 |
-
$info = get_post_meta( $pid, self::DB_IMG_OPTIMIZE_STATUS, true ) ;
|
| 801 |
-
$data[ self::DB_IMG_OPTIMIZE_STATUS ] = $info ;
|
| 802 |
-
|
| 803 |
-
$info = get_post_meta( $pid, self::DB_IMG_OPTIMIZE_DATA, true ) ;
|
| 804 |
-
$data[ self::DB_IMG_OPTIMIZE_DATA ] = $info ;
|
| 805 |
-
|
| 806 |
-
echo json_encode( $data ) ;
|
| 807 |
-
exit;
|
| 808 |
-
}
|
| 809 |
-
|
| 810 |
-
/**
|
| 811 |
-
* parse LiteSpeed IAPI server data
|
| 812 |
-
*
|
| 813 |
-
* @since 1.6.5
|
| 814 |
-
* @access public
|
| 815 |
-
*/
|
| 816 |
-
private function _parse_notify_data()
|
| 817 |
-
{
|
| 818 |
-
$notified_data = unserialize( base64_decode( $_POST[ 'data' ] ) ) ;
|
| 819 |
-
if ( empty( $notified_data ) || ! is_array( $notified_data ) ) {
|
| 820 |
-
LiteSpeed_Cache_Log::debug( 'Media: notify exit: no notified data' ) ;
|
| 821 |
-
exit( json_encode( 'no notified data' ) ) ;
|
| 822 |
-
}
|
| 823 |
-
|
| 824 |
-
if ( empty( $_POST[ 'server' ] ) || substr( $_POST[ 'server' ], -21 ) !== 'api.litespeedtech.com' ) {
|
| 825 |
-
LiteSpeed_Cache_Log::debug( 'Media: notify exit: no/wrong server' ) ;
|
| 826 |
-
exit( json_encode( 'no/wrong server' ) ) ;
|
| 827 |
-
}
|
| 828 |
-
|
| 829 |
-
$_allowed_status = array( self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED, self::DB_IMG_OPTIMIZE_STATUS_ERR, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 830 |
-
|
| 831 |
-
if ( empty( $_POST[ 'status' ] ) || ! in_array( $_POST[ 'status' ], $_allowed_status ) ) {
|
| 832 |
-
LiteSpeed_Cache_Log::debug( 'Media: notify exit: no/wrong status' ) ;
|
| 833 |
-
exit( json_encode( 'no/wrong status' ) ) ;
|
| 834 |
-
}
|
| 835 |
-
|
| 836 |
-
return array( $notified_data, $_POST[ 'server' ], $_POST[ 'status' ] ) ;
|
| 837 |
-
}
|
| 838 |
-
|
| 839 |
-
/**
|
| 840 |
-
* LiteSpeed Child server notify Client img status changed
|
| 841 |
-
*
|
| 842 |
-
* @since 1.6
|
| 843 |
-
* @since 1.6.5 Added err/request status free switch
|
| 844 |
-
* @access public
|
| 845 |
-
*/
|
| 846 |
-
public function notify_img()
|
| 847 |
-
{
|
| 848 |
-
list( $notified_data, $server, $status ) = $this->_parse_notify_data() ;
|
| 849 |
-
|
| 850 |
-
global $wpdb ;
|
| 851 |
-
|
| 852 |
-
$pids = array_keys( $notified_data ) ;
|
| 853 |
-
|
| 854 |
-
$q = "SELECT meta_id, post_id, meta_value FROM $wpdb->postmeta WHERE post_id IN ( " . implode( ',', array_fill( 0, count( $pids ), '%d' ) ) . " ) AND meta_key = %s" ;
|
| 855 |
-
$meta_value_list = $wpdb->get_results( $wpdb->prepare( $q, array_merge( $pids, array( self::DB_IMG_OPTIMIZE_DATA ) ) ) ) ;
|
| 856 |
-
|
| 857 |
-
$need_pull = false ;
|
| 858 |
-
|
| 859 |
-
foreach ( $meta_value_list as $v ) {
|
| 860 |
-
$changed = false ;
|
| 861 |
-
$md52src_list = unserialize( $v->meta_value ) ;
|
| 862 |
-
// replace src tag from requested to notified
|
| 863 |
-
foreach ( $md52src_list as $md5 => $v2 ) {
|
| 864 |
-
if ( in_array( $md5, $notified_data[ $v->post_id ] ) && $v2[ 1 ] !== self::DB_IMG_OPTIMIZE_STATUS_PULLED ) {
|
| 865 |
-
$md52src_list[ $md5 ][ 1 ] = $status ;
|
| 866 |
-
$md52src_list[ $md5 ][ 2 ] = $server ;
|
| 867 |
-
$changed = true ;
|
| 868 |
-
}
|
| 869 |
-
}
|
| 870 |
-
|
| 871 |
-
if ( ! $changed ) {
|
| 872 |
-
LiteSpeed_Cache_Log::debug( 'Media: notify_img [status] ' . $status . ' continue: no changed meta [pid] ' . $v->post_id ) ;
|
| 873 |
-
continue ;
|
| 874 |
-
}
|
| 875 |
-
|
| 876 |
-
$new_status = $this->_get_status_by_meta_data( $md52src_list, $status ) ;
|
| 877 |
-
|
| 878 |
-
// Save meta data
|
| 879 |
-
$md52src_list = serialize( $md52src_list ) ;
|
| 880 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d" ;
|
| 881 |
-
$wpdb->query( $wpdb->prepare( $q, array( $md52src_list, $v->meta_id ) ) ) ;
|
| 882 |
-
|
| 883 |
-
// Overwrite post meta status to the latest one
|
| 884 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE post_id = %d AND meta_key = %s" ;
|
| 885 |
-
// If partly needs notified to pull, notified should overwrite this post's status always
|
| 886 |
-
$wpdb->query( $wpdb->prepare( $q, array( $new_status, $v->post_id, self::DB_IMG_OPTIMIZE_STATUS ) ) ) ;
|
| 887 |
-
|
| 888 |
-
LiteSpeed_Cache_Log::debug( 'Media: notify_img [status] ' . $status . ' updated post_meta [pid] ' . $v->post_id ) ;
|
| 889 |
-
|
| 890 |
-
if ( $status == self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) {
|
| 891 |
-
$need_pull = true ;
|
| 892 |
-
}
|
| 893 |
-
}
|
| 894 |
-
|
| 895 |
-
if ( $need_pull ) {
|
| 896 |
-
update_option( LiteSpeed_Cache_Config::ITEM_MEDIA_NEED_PULL, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ;
|
| 897 |
-
}
|
| 898 |
-
|
| 899 |
-
// redo count err
|
| 900 |
-
|
| 901 |
-
echo json_encode( array( 'count' => count( $notified_data ) ) ) ;
|
| 902 |
-
exit() ;
|
| 903 |
-
}
|
| 904 |
-
|
| 905 |
-
/**
|
| 906 |
-
* Generate post's img optm status from child images meta value
|
| 907 |
-
*
|
| 908 |
-
* @since 1.6.7
|
| 909 |
-
* @access private
|
| 910 |
-
*/
|
| 911 |
-
private function _get_status_by_meta_data( $md52src_list, $default_status )
|
| 912 |
-
{
|
| 913 |
-
$has_notify = false ;
|
| 914 |
-
$has_request = false ;
|
| 915 |
-
$has_pull = false ;
|
| 916 |
-
|
| 917 |
-
foreach ( $md52src_list as $v ) {
|
| 918 |
-
if ( $v[ 1 ] == self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) {
|
| 919 |
-
$has_notify = true ;
|
| 920 |
-
}
|
| 921 |
-
if ( $v[ 1 ] == self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) {
|
| 922 |
-
$has_request = true ;
|
| 923 |
-
}
|
| 924 |
-
if ( $v[ 1 ] == self::DB_IMG_OPTIMIZE_STATUS_PULLED ) {
|
| 925 |
-
$has_pull = true ;
|
| 926 |
-
}
|
| 927 |
-
}
|
| 928 |
-
|
| 929 |
-
if ( $has_notify ) {
|
| 930 |
-
$new_status = self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ;
|
| 931 |
-
}
|
| 932 |
-
elseif ( $has_request ) {
|
| 933 |
-
$new_status = self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ;
|
| 934 |
-
}
|
| 935 |
-
elseif ( $has_pull ) {
|
| 936 |
-
$new_status = self::DB_IMG_OPTIMIZE_STATUS_PULLED ;
|
| 937 |
-
}
|
| 938 |
-
else {
|
| 939 |
-
$new_status = $default_status ;
|
| 940 |
-
}
|
| 941 |
-
|
| 942 |
-
return $new_status ;
|
| 943 |
-
|
| 944 |
-
}
|
| 945 |
-
|
| 946 |
-
/**
|
| 947 |
-
* Parse wp's meta value
|
| 948 |
-
*
|
| 949 |
-
* @since 1.6.7
|
| 950 |
-
* @access private
|
| 951 |
-
*/
|
| 952 |
-
private function _parse_wp_meta_value( $v )
|
| 953 |
-
{
|
| 954 |
-
if ( ! $v->meta_value ) {
|
| 955 |
-
LiteSpeed_Cache_Log::debug( 'Media: bypassed parsing meta due to no meta_value: pid ' . $v->post_id ) ;
|
| 956 |
-
return false ;
|
| 957 |
-
}
|
| 958 |
-
|
| 959 |
-
try {
|
| 960 |
-
$meta_value = unserialize( $v->meta_value ) ;
|
| 961 |
-
}
|
| 962 |
-
catch ( \Exception $e ) {
|
| 963 |
-
LiteSpeed_Cache_Log::debug( 'Media: bypassed parsing meta due to meta_value not json: pid ' . $v->post_id ) ;
|
| 964 |
-
return false ;
|
| 965 |
-
}
|
| 966 |
-
|
| 967 |
-
if ( empty( $meta_value[ 'file' ] ) ) {
|
| 968 |
-
LiteSpeed_Cache_Log::debug( 'Media: bypassed parsing meta due to no ori file: pid ' . $v->post_id ) ;
|
| 969 |
-
return false ;
|
| 970 |
-
}
|
| 971 |
-
|
| 972 |
-
return $meta_value ;
|
| 973 |
-
|
| 974 |
-
}
|
| 975 |
-
|
| 976 |
-
/**
|
| 977 |
-
* Push img to LiteSpeed IAPI server
|
| 978 |
-
*
|
| 979 |
-
* @since 1.6.7
|
| 980 |
-
* @access private
|
| 981 |
-
*/
|
| 982 |
-
private function _push_img_in_queue_to_ls()
|
| 983 |
-
{
|
| 984 |
-
$data = array(
|
| 985 |
-
'list' => $this->_img_in_queue,
|
| 986 |
-
'webp_only' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_ONLY ),
|
| 987 |
-
'keep_exif' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_EXIF ),
|
| 988 |
-
'webp_lossless' => LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_WEBP_LOSSLESS ),
|
| 989 |
-
) ;
|
| 990 |
-
|
| 991 |
-
// Push to LiteSpeed IAPI server
|
| 992 |
-
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_REQUEST_OPTIMIZE, LiteSpeed_Cache_Utility::arr2str( $data ) ) ;
|
| 993 |
-
|
| 994 |
-
if ( $json === null ) {// admin_api will handle common err
|
| 995 |
-
return null ;
|
| 996 |
-
}
|
| 997 |
-
|
| 998 |
-
if ( ! is_array( $json ) ) {
|
| 999 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to post to LiteSpeed IAPI server ', $json ) ;
|
| 1000 |
-
$msg = sprintf( __( 'Failed to push to LiteSpeed IAPI server: %s', 'litespeed-cache' ), $json ) ;
|
| 1001 |
-
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 1002 |
-
return null ;
|
| 1003 |
-
}
|
| 1004 |
-
|
| 1005 |
-
// Check data format
|
| 1006 |
-
if ( empty( $json[ 'pids' ] ) || ! is_array( $json[ 'pids' ] ) ) {
|
| 1007 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to parse data from LiteSpeed IAPI server ', $json[ 'pids' ] ) ;
|
| 1008 |
-
$msg = sprintf( __( 'Failed to parse data from LiteSpeed IAPI server: %s', 'litespeed-cache' ), $json[ 'pids' ] ) ;
|
| 1009 |
-
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 1010 |
-
return null ;
|
| 1011 |
-
}
|
| 1012 |
-
|
| 1013 |
-
LiteSpeed_Cache_Log::debug( 'Media: posts data from LiteSpeed IAPI server count: ' . count( $json[ 'pids' ] ) ) ;
|
| 1014 |
-
|
| 1015 |
-
return $json ;
|
| 1016 |
-
|
| 1017 |
-
}
|
| 1018 |
-
|
| 1019 |
-
/**
|
| 1020 |
-
* Send destroy all requests cmd to LiteSpeed IAPI server and get the link to finish it ( avoid click by mistake )
|
| 1021 |
-
*
|
| 1022 |
-
* @since 1.6.7
|
| 1023 |
-
* @access private
|
| 1024 |
-
*/
|
| 1025 |
-
private function _img_optimize_destroy()
|
| 1026 |
-
{
|
| 1027 |
-
LiteSpeed_Cache_Log::debug( 'Media: sending DESTROY cmd to LiteSpeed IAPI' ) ;
|
| 1028 |
-
|
| 1029 |
-
// Mark request time to avoid duplicated request
|
| 1030 |
-
update_option( self::DB_IMG_OPTIMIZE_DESTROY, time() ) ;
|
| 1031 |
-
|
| 1032 |
-
// Push to LiteSpeed IAPI server
|
| 1033 |
-
$json = LiteSpeed_Cache_Admin_API::post( LiteSpeed_Cache_Admin_API::IAPI_ACTION_REQUEST_DESTROY ) ;
|
| 1034 |
-
|
| 1035 |
-
// confirm link will be displayed by Admin_API automatically
|
| 1036 |
-
if ( is_array( $json ) && $json ) {
|
| 1037 |
-
LiteSpeed_Cache_Log::debug( 'Media: cmd result', $json ) ;
|
| 1038 |
-
}
|
| 1039 |
-
|
| 1040 |
-
}
|
| 1041 |
-
|
| 1042 |
-
/**
|
| 1043 |
-
* Callback from LiteSpeed IAPI server to destroy all optm data
|
| 1044 |
-
*
|
| 1045 |
-
* @since 1.6.7
|
| 1046 |
-
* @access private
|
| 1047 |
-
*/
|
| 1048 |
-
public function img_optimize_destroy_callback()
|
| 1049 |
-
{
|
| 1050 |
-
global $wpdb ;
|
| 1051 |
-
LiteSpeed_Cache_Log::debug( 'Media: excuting DESTROY process' ) ;
|
| 1052 |
-
|
| 1053 |
-
$request_time = get_option( self::DB_IMG_OPTIMIZE_DESTROY ) ;
|
| 1054 |
-
if ( time() - $request_time > 300 ) {
|
| 1055 |
-
LiteSpeed_Cache_Log::debug( 'Media: terminate DESTROY process due to timeout' ) ;
|
| 1056 |
-
exit( 'Destroy callback timeout ( 300 seconds )' ) ;
|
| 1057 |
-
}
|
| 1058 |
-
|
| 1059 |
-
// Start deleting files
|
| 1060 |
-
$q = "SELECT * from $wpdb->postmeta WHERE meta_key = %s" ;
|
| 1061 |
-
$list = $wpdb->get_results( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_DATA ) ) ) ;
|
| 1062 |
-
if ( $list ) {
|
| 1063 |
-
foreach ( $list as $v ) {
|
| 1064 |
-
$meta_value_list = unserialize( $v->meta_value ) ;
|
| 1065 |
-
foreach ( $meta_value_list as $v2 ) {
|
| 1066 |
-
|
| 1067 |
-
$src = $v2[ 0 ] ;
|
| 1068 |
-
$local_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $src ;
|
| 1069 |
-
|
| 1070 |
-
// del webp
|
| 1071 |
-
file_exists( $local_file . '.webp' ) && unlink( $local_file . '.webp' ) ;
|
| 1072 |
-
file_exists( $local_file . '.optm.webp' ) && unlink( $local_file . '.optm.webp' ) ;
|
| 1073 |
-
|
| 1074 |
-
$extension = pathinfo( $local_file, PATHINFO_EXTENSION ) ;
|
| 1075 |
-
$local_filename = substr( $local_file, 0, - strlen( $extension ) - 1 ) ;
|
| 1076 |
-
$bk_file = $local_filename . '.bk.' . $extension ;
|
| 1077 |
-
$bk_optm_file = $local_filename . '.bk.optm.' . $extension ;
|
| 1078 |
-
|
| 1079 |
-
// del optimized ori
|
| 1080 |
-
if ( file_exists( $bk_file ) ) {
|
| 1081 |
-
unlink( $local_file ) ;
|
| 1082 |
-
rename( $bk_file, $local_file ) ;
|
| 1083 |
-
}
|
| 1084 |
-
file_exists( $bk_optm_file ) && unlink( $bk_optm_file ) ;
|
| 1085 |
-
}
|
| 1086 |
-
}
|
| 1087 |
-
}
|
| 1088 |
-
|
| 1089 |
-
// Delete optm info
|
| 1090 |
-
$q = "DELETE FROM $wpdb->postmeta WHERE meta_key LIKE 'litespeed-optimize%'" ;
|
| 1091 |
-
$wpdb->query( $q ) ;
|
| 1092 |
-
|
| 1093 |
-
// Clear credit info
|
| 1094 |
-
delete_option( self::DB_IMG_OPTM_SUMMARY ) ;
|
| 1095 |
-
|
| 1096 |
-
exit( 'ok' ) ;
|
| 1097 |
-
}
|
| 1098 |
-
|
| 1099 |
-
/**
|
| 1100 |
-
* Resend requested img to LiteSpeed IAPI server
|
| 1101 |
-
*
|
| 1102 |
-
* @since 1.6.7
|
| 1103 |
-
* @access private
|
| 1104 |
-
*/
|
| 1105 |
-
private function _img_optimize_rescan()
|
| 1106 |
-
{
|
| 1107 |
-
LiteSpeed_Cache_Log::debug( 'Media: resend requested images' ) ;
|
| 1108 |
-
|
| 1109 |
-
$_credit = (int) $this->summary_info( 'credit' ) ;
|
| 1110 |
-
|
| 1111 |
-
global $wpdb ;
|
| 1112 |
-
|
| 1113 |
-
$q = "SELECT a.post_id, a.meta_value, b.meta_id as bmeta_id, c.meta_id as cmeta_id, c.meta_value as cmeta_value
|
| 1114 |
-
FROM $wpdb->postmeta a
|
| 1115 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.post_id
|
| 1116 |
-
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.post_id
|
| 1117 |
-
WHERE a.meta_key = '_wp_attachment_metadata'
|
| 1118 |
-
AND b.meta_key = %s
|
| 1119 |
-
AND c.meta_key = %s
|
| 1120 |
-
LIMIT %d
|
| 1121 |
-
" ;
|
| 1122 |
-
$limit_rows = apply_filters( 'litespeed_img_optm_resend_rows', 300 ) ;
|
| 1123 |
-
$list = $wpdb->get_results( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_DATA, $limit_rows ) ) ) ;
|
| 1124 |
-
if ( ! $list ) {
|
| 1125 |
-
LiteSpeed_Cache_Log::debug( 'Media: resend request bypassed: no image found' ) ;
|
| 1126 |
-
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 1127 |
-
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 1128 |
-
return ;
|
| 1129 |
-
}
|
| 1130 |
-
|
| 1131 |
-
// meta list
|
| 1132 |
-
$optm_data_list = array() ;
|
| 1133 |
-
$optm_data_pid2mid_list = array() ;
|
| 1134 |
-
|
| 1135 |
-
foreach ( $list as $v ) {
|
| 1136 |
-
// wp meta
|
| 1137 |
-
$meta_value = $this->_parse_wp_meta_value( $v ) ;
|
| 1138 |
-
if ( ! $meta_value ) {
|
| 1139 |
-
continue ;
|
| 1140 |
-
}
|
| 1141 |
-
if ( empty( $meta_value[ 'sizes' ] ) ) {
|
| 1142 |
-
continue ;
|
| 1143 |
-
}
|
| 1144 |
-
|
| 1145 |
-
$optm_data_pid2mid_list[ $v->post_id ] = array( 'status_mid' => $v->bmeta_id, 'data_mid' => $v->cmeta_id ) ;
|
| 1146 |
-
|
| 1147 |
-
// prepare for pushing
|
| 1148 |
-
$this->tmp_pid = $v->post_id ;
|
| 1149 |
-
$this->tmp_path = pathinfo( $meta_value[ 'file' ], PATHINFO_DIRNAME ) . '/' ;
|
| 1150 |
-
|
| 1151 |
-
// ls optimized meta
|
| 1152 |
-
$optm_meta = $optm_data_list[ $v->post_id ] = unserialize( $v->cmeta_value ) ;
|
| 1153 |
-
$optm_list = array() ;
|
| 1154 |
-
foreach ( $optm_meta as $md5 => $optm_row ) {
|
| 1155 |
-
$optm_list[] = $optm_row[ 0 ] ;
|
| 1156 |
-
// only do for requested/notified img
|
| 1157 |
-
// if ( ! in_array( $optm_row[ 1 ], array( self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ) ) {
|
| 1158 |
-
// continue ;
|
| 1159 |
-
// }
|
| 1160 |
-
}
|
| 1161 |
-
|
| 1162 |
-
// check if there is new files from wp meta
|
| 1163 |
-
$img_queue = array() ;
|
| 1164 |
-
foreach ( $meta_value[ 'sizes' ] as $v2 ) {
|
| 1165 |
-
$curr_file = $this->tmp_path . $v2[ 'file' ] ;
|
| 1166 |
-
|
| 1167 |
-
// new child file OR not finished yet
|
| 1168 |
-
if ( ! in_array( $curr_file, $optm_list ) ) {
|
| 1169 |
-
$img_queue[] = $v2 ;
|
| 1170 |
-
}
|
| 1171 |
-
}
|
| 1172 |
-
|
| 1173 |
-
// nothing to add
|
| 1174 |
-
if ( ! $img_queue ) {
|
| 1175 |
-
continue ;
|
| 1176 |
-
}
|
| 1177 |
-
|
| 1178 |
-
$num_will_incease = count( $img_queue ) ;
|
| 1179 |
-
if ( $this->_img_total + $num_will_incease > $_credit ) {
|
| 1180 |
-
LiteSpeed_Cache_Log::debug( 'Media: resend img request hit limit: [total] ' . $this->_img_total . " \t[add] $num_will_incease \t[credit] $_credit" ) ;
|
| 1181 |
-
break ;
|
| 1182 |
-
}
|
| 1183 |
-
|
| 1184 |
-
foreach ( $img_queue as $v2 ) {
|
| 1185 |
-
$this->_img_queue( $v2 ) ;
|
| 1186 |
-
}
|
| 1187 |
-
}
|
| 1188 |
-
|
| 1189 |
-
// push to LiteSpeed IAPI server
|
| 1190 |
-
if ( empty( $this->_img_in_queue ) ) {
|
| 1191 |
-
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 1192 |
-
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1193 |
-
return ;
|
| 1194 |
-
}
|
| 1195 |
-
|
| 1196 |
-
$total_groups = count( $this->_img_in_queue ) ;
|
| 1197 |
-
LiteSpeed_Cache_Log::debug( 'Media: prepared images to push: groups ' . $total_groups . ' images ' . $this->_img_total ) ;
|
| 1198 |
-
|
| 1199 |
-
// Push to LiteSpeed IAPI server
|
| 1200 |
-
$json = $this->_push_img_in_queue_to_ls() ;
|
| 1201 |
-
if ( $json === null ) {
|
| 1202 |
-
return ;
|
| 1203 |
-
}
|
| 1204 |
-
// Returned data is the requested and notifed images
|
| 1205 |
-
$pids = $json[ 'pids' ] ;
|
| 1206 |
-
|
| 1207 |
-
LiteSpeed_Cache_Log::debug( 'Media: returned data from LiteSpeed IAPI server count: ' . count( $pids ) ) ;
|
| 1208 |
-
|
| 1209 |
-
$q = "UPDATE $wpdb->postmeta SET meta_value = %s WHERE meta_id = %d" ;
|
| 1210 |
-
|
| 1211 |
-
// Update data
|
| 1212 |
-
foreach ( $pids as $pid ) {
|
| 1213 |
-
$md52src_list = $optm_data_list[ $pid ] ;
|
| 1214 |
-
|
| 1215 |
-
foreach ( $this->_img_in_queue[ $pid ] as $md5 => $src_data ) {
|
| 1216 |
-
$md52src_list[ $md5 ] = array( $src_data[ 'file' ], self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 1217 |
-
}
|
| 1218 |
-
|
| 1219 |
-
$new_status = $this->_get_status_by_meta_data( $md52src_list, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 1220 |
-
|
| 1221 |
-
$md52src_list = serialize( $md52src_list ) ;
|
| 1222 |
-
|
| 1223 |
-
// Store data
|
| 1224 |
-
$wpdb->query( $wpdb->prepare( $q, array( $new_status, $optm_data_pid2mid_list[ $pid ][ 'status_mid' ] ) ) ) ;
|
| 1225 |
-
$wpdb->query( $wpdb->prepare( $q, array( $md52src_list, $optm_data_pid2mid_list[ $pid ][ 'data_mid' ] ) ) ) ;
|
| 1226 |
-
}
|
| 1227 |
-
|
| 1228 |
-
$accepted_groups = count( $pids ) ;
|
| 1229 |
-
$accepted_imgs = $json[ 'total' ] ;
|
| 1230 |
-
|
| 1231 |
-
$msg = sprintf( __( 'Pushed %1$s groups with %2$s images to LiteSpeed optimization server, accepted %3$s groups with %4$s images.', 'litespeed-cache' ), $total_groups, $this->_img_total, $accepted_groups, $accepted_imgs ) ;
|
| 1232 |
-
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1233 |
-
|
| 1234 |
-
// Update credit info
|
| 1235 |
-
if ( isset( $json[ 'credit' ] ) ) {
|
| 1236 |
-
$this->_update_credit( $json[ 'credit' ] ) ;
|
| 1237 |
-
}
|
| 1238 |
-
|
| 1239 |
-
}
|
| 1240 |
-
|
| 1241 |
-
/**
|
| 1242 |
-
* Push raw img to LiteSpeed IAPI server
|
| 1243 |
-
*
|
| 1244 |
-
* @since 1.6
|
| 1245 |
-
* @access private
|
| 1246 |
-
*/
|
| 1247 |
-
private function _img_optimize()
|
| 1248 |
-
{
|
| 1249 |
-
$_credit = (int) $this->summary_info( 'credit' ) ;
|
| 1250 |
-
$credit_recovered = (int) $this->summary_info( 'credit_recovered' ) ;
|
| 1251 |
-
|
| 1252 |
-
LiteSpeed_Cache_Log::debug( 'Media preparing images to push' ) ;
|
| 1253 |
-
|
| 1254 |
-
global $wpdb ;
|
| 1255 |
-
// Get images
|
| 1256 |
-
$q = "SELECT b.post_id, b.meta_value
|
| 1257 |
-
FROM $wpdb->posts a
|
| 1258 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1259 |
-
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.ID AND c.meta_key = %s
|
| 1260 |
-
WHERE a.post_type = 'attachment'
|
| 1261 |
-
AND a.post_status = 'inherit'
|
| 1262 |
-
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1263 |
-
AND b.meta_key = '_wp_attachment_metadata'
|
| 1264 |
-
AND c.post_id IS NULL
|
| 1265 |
-
ORDER BY a.ID DESC
|
| 1266 |
-
LIMIT %d
|
| 1267 |
-
" ;
|
| 1268 |
-
$q = $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, apply_filters( 'litespeed_img_optimize_max_rows', 100 ) ) ) ;
|
| 1269 |
-
|
| 1270 |
-
$img_set = array() ;
|
| 1271 |
-
$list = $wpdb->get_results( $q ) ;
|
| 1272 |
-
if ( ! $list ) {
|
| 1273 |
-
LiteSpeed_Cache_Log::debug( 'Media optimize bypass: no image found' ) ;
|
| 1274 |
-
return ;
|
| 1275 |
-
}
|
| 1276 |
-
|
| 1277 |
-
LiteSpeed_Cache_Log::debug( 'Media found images: ' . count( $list ) ) ;
|
| 1278 |
-
|
| 1279 |
-
foreach ( $list as $v ) {
|
| 1280 |
-
|
| 1281 |
-
$meta_value = $this->_parse_wp_meta_value( $v ) ;
|
| 1282 |
-
if ( ! $meta_value ) {
|
| 1283 |
-
continue ;
|
| 1284 |
-
}
|
| 1285 |
-
|
| 1286 |
-
/**
|
| 1287 |
-
* Only send 500 images one time
|
| 1288 |
-
* @since 1.6.3
|
| 1289 |
-
* @since 1.6.5 use credit limit
|
| 1290 |
-
*/
|
| 1291 |
-
$num_will_incease = 1 ;
|
| 1292 |
-
if ( ! empty( $meta_value[ 'sizes' ] ) ) {
|
| 1293 |
-
$num_will_incease += count( $meta_value[ 'sizes' ] ) ;
|
| 1294 |
-
}
|
| 1295 |
-
if ( $this->_img_total + $num_will_incease > $_credit ) {
|
| 1296 |
-
if ( ! $this->_img_total ) {
|
| 1297 |
-
$msg = sprintf( __( 'Number of images in one image group (%s) exceeds the credit (%s)', 'litespeed-cache' ), $num_will_incease, $_credit ) ;
|
| 1298 |
-
LiteSpeed_Cache_Admin_Display::error( $msg ) ;
|
| 1299 |
-
}
|
| 1300 |
-
LiteSpeed_Cache_Log::debug( 'Media img request hit limit: [total] ' . $this->_img_total . " \t[add] $num_will_incease \t[credit] $_credit" ) ;
|
| 1301 |
-
break ;
|
| 1302 |
-
}
|
| 1303 |
-
/**
|
| 1304 |
-
* Check if need to test run ( new user only allow 1 group at first time)
|
| 1305 |
-
* @since 1.6.6.1
|
| 1306 |
-
*/
|
| 1307 |
-
if ( $this->_img_total && ! $credit_recovered ) {
|
| 1308 |
-
LiteSpeed_Cache_Log::debug( 'Media: test run only allow 1 group ' ) ;
|
| 1309 |
-
break ;
|
| 1310 |
-
}
|
| 1311 |
-
|
| 1312 |
-
// push orig image to queue
|
| 1313 |
-
$this->tmp_pid = $v->post_id ;
|
| 1314 |
-
$this->tmp_path = pathinfo( $meta_value[ 'file' ], PATHINFO_DIRNAME ) . '/' ;
|
| 1315 |
-
$this->_img_queue( $meta_value, true ) ;
|
| 1316 |
-
if ( ! empty( $meta_value[ 'sizes' ] ) ) {
|
| 1317 |
-
array_map( array( $this, '_img_queue' ), $meta_value[ 'sizes' ] ) ;
|
| 1318 |
-
}
|
| 1319 |
-
|
| 1320 |
-
}
|
| 1321 |
-
|
| 1322 |
-
// push to LiteSpeed IAPI server
|
| 1323 |
-
if ( empty( $this->_img_in_queue ) ) {
|
| 1324 |
-
$msg = __( 'No image found.', 'litespeed-cache' ) ;
|
| 1325 |
-
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1326 |
-
return ;
|
| 1327 |
-
}
|
| 1328 |
-
|
| 1329 |
-
$total_groups = count( $this->_img_in_queue ) ;
|
| 1330 |
-
LiteSpeed_Cache_Log::debug( 'Media prepared images to push: groups ' . $total_groups . ' images ' . $this->_img_total ) ;
|
| 1331 |
-
|
| 1332 |
-
// Push to LiteSpeed IAPI server
|
| 1333 |
-
$json = $this->_push_img_in_queue_to_ls() ;
|
| 1334 |
-
if ( $json === null ) {
|
| 1335 |
-
return ;
|
| 1336 |
-
}
|
| 1337 |
-
$pids = $json[ 'pids' ] ;
|
| 1338 |
-
|
| 1339 |
-
// Exclude those who have meta already
|
| 1340 |
-
$q = "SELECT post_id FROM $wpdb->postmeta WHERE meta_key = %s and post_id in ( " . implode( ',', array_fill( 0, count( $pids ), '%s' ) ) . " )" ;
|
| 1341 |
-
$tmp = $wpdb->get_results( $wpdb->prepare( $q, array_merge( array( self::DB_IMG_OPTIMIZE_STATUS ), $pids ) ) ) ;
|
| 1342 |
-
$exists_pids = array() ;
|
| 1343 |
-
foreach ( $tmp as $v ) {
|
| 1344 |
-
$exists_pids[] = $v->post_id ;
|
| 1345 |
-
}
|
| 1346 |
-
if ( $exists_pids ) {
|
| 1347 |
-
LiteSpeed_Cache_Log::debug( 'Media: existing posts data from LiteSpeed IAPI server count: ' . count( $exists_pids ) ) ;
|
| 1348 |
-
}
|
| 1349 |
-
$pids = array_diff( $pids, $exists_pids ) ;
|
| 1350 |
-
|
| 1351 |
-
if ( ! $pids ) {
|
| 1352 |
-
LiteSpeed_Cache_Log::debug( 'Media: Failed to store data from LiteSpeed IAPI server with empty pids' ) ;
|
| 1353 |
-
LiteSpeed_Cache_Admin_Display::error( __( 'Post data is empty.', 'litespeed-cache' ) ) ;
|
| 1354 |
-
return ;
|
| 1355 |
-
}
|
| 1356 |
-
|
| 1357 |
-
LiteSpeed_Cache_Log::debug( 'Media: diff posts data from LiteSpeed IAPI server count: ' . count( $pids ) ) ;
|
| 1358 |
-
|
| 1359 |
-
$q = "INSERT INTO $wpdb->postmeta ( post_id, meta_key, meta_value ) VALUES " ;
|
| 1360 |
-
$data_to_add = array() ;
|
| 1361 |
-
foreach ( $pids as $pid ) {
|
| 1362 |
-
$data_to_add[] = $pid ;
|
| 1363 |
-
$data_to_add[] = self::DB_IMG_OPTIMIZE_STATUS ;
|
| 1364 |
-
$data_to_add[] = self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ;
|
| 1365 |
-
$data_to_add[] = $pid ;
|
| 1366 |
-
$data_to_add[] = self::DB_IMG_OPTIMIZE_DATA ;
|
| 1367 |
-
$md52src_list = array() ;
|
| 1368 |
-
foreach ( $this->_img_in_queue[ $pid ] as $md5 => $src_data ) {
|
| 1369 |
-
$md52src_list[ $md5 ] = array( $src_data[ 'file' ], self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ;
|
| 1370 |
-
}
|
| 1371 |
-
$data_to_add[] = serialize( $md52src_list ) ;
|
| 1372 |
-
}
|
| 1373 |
-
// Add placeholder
|
| 1374 |
-
$q .= implode( ',', array_map(
|
| 1375 |
-
function( $el ) { return '(' . implode( ',', $el ) . ')' ; },
|
| 1376 |
-
array_chunk( array_fill( 0, count( $data_to_add ), '%s' ), 3 )
|
| 1377 |
-
) ) ;
|
| 1378 |
-
// Store data
|
| 1379 |
-
$wpdb->query( $wpdb->prepare( $q, $data_to_add ) ) ;
|
| 1380 |
-
|
| 1381 |
-
|
| 1382 |
-
$accepted_groups = count( $pids ) ;
|
| 1383 |
-
$accepted_imgs = $json[ 'total' ] ;
|
| 1384 |
-
|
| 1385 |
-
$msg = sprintf( __( 'Pushed %1$s groups with %2$s images to LiteSpeed optimization server, accepted %3$s groups with %4$s images.', 'litespeed-cache' ), $total_groups, $this->_img_total, $accepted_groups, $accepted_imgs ) ;
|
| 1386 |
-
LiteSpeed_Cache_Admin_Display::succeed( $msg ) ;
|
| 1387 |
-
|
| 1388 |
-
// Update credit info
|
| 1389 |
-
if ( isset( $json[ 'credit' ] ) ) {
|
| 1390 |
-
$this->_update_credit( $json[ 'credit' ] ) ;
|
| 1391 |
-
}
|
| 1392 |
-
}
|
| 1393 |
-
|
| 1394 |
-
/**
|
| 1395 |
-
* Add a new img to queue which will be pushed to LiteSpeed
|
| 1396 |
-
*
|
| 1397 |
-
* @since 1.6
|
| 1398 |
-
* @access private
|
| 1399 |
-
*/
|
| 1400 |
-
private function _img_queue( $meta_value, $ori_file = false )
|
| 1401 |
-
{
|
| 1402 |
-
if ( empty( $meta_value[ 'file' ] ) || empty( $meta_value[ 'width' ] ) || empty( $meta_value[ 'height' ] ) ) {
|
| 1403 |
-
LiteSpeed_Cache_Log::debug2( 'Media bypass image due to lack of file/w/h: pid ' . $this->tmp_pid, $meta_value ) ;
|
| 1404 |
-
return ;
|
| 1405 |
-
}
|
| 1406 |
-
|
| 1407 |
-
if ( ! $ori_file ) {
|
| 1408 |
-
$meta_value[ 'file' ] = $this->tmp_path . $meta_value[ 'file' ] ;
|
| 1409 |
-
}
|
| 1410 |
-
|
| 1411 |
-
// check file exists or not
|
| 1412 |
-
$real_file = $this->wp_upload_dir[ 'basedir' ] . '/' . $meta_value[ 'file' ] ;
|
| 1413 |
-
if ( ! file_exists( $real_file ) ) {
|
| 1414 |
-
LiteSpeed_Cache_Log::debug2( 'Media bypass image due to file not exist: pid ' . $this->tmp_pid . ' ' . $real_file ) ;
|
| 1415 |
-
return ;
|
| 1416 |
-
}
|
| 1417 |
-
|
| 1418 |
-
LiteSpeed_Cache_Log::debug2( 'Media adding image: pid ' . $this->tmp_pid ) ;
|
| 1419 |
-
|
| 1420 |
-
$img_info = array(
|
| 1421 |
-
'url' => $this->wp_upload_dir[ 'baseurl' ] . '/' . $meta_value[ 'file' ],
|
| 1422 |
-
'file' => $meta_value[ 'file' ], // not needed in LiteSpeed sapi, just leave for local storage after post
|
| 1423 |
-
'width' => $meta_value[ 'width' ],
|
| 1424 |
-
'height' => $meta_value[ 'height' ],
|
| 1425 |
-
'mime_type' => ! empty( $meta_value[ 'mime-type' ] ) ? $meta_value[ 'mime-type' ] : '' ,
|
| 1426 |
-
) ;
|
| 1427 |
-
$md5 = md5_file( $real_file ) ;
|
| 1428 |
-
|
| 1429 |
-
if ( empty( $this->_img_in_queue[ $this->tmp_pid ] ) ) {
|
| 1430 |
-
$this->_img_in_queue[ $this->tmp_pid ] = array() ;
|
| 1431 |
-
}
|
| 1432 |
-
$this->_img_in_queue[ $this->tmp_pid ][ $md5 ] = $img_info ;
|
| 1433 |
-
$this->_img_total ++ ;
|
| 1434 |
-
}
|
| 1435 |
-
|
| 1436 |
-
/**
|
| 1437 |
-
* Update client credit info
|
| 1438 |
-
*
|
| 1439 |
-
* @since 1.6.5
|
| 1440 |
-
* @access private
|
| 1441 |
-
*/
|
| 1442 |
-
private function _update_credit( $credit )
|
| 1443 |
-
{
|
| 1444 |
-
$summary = get_option( self::DB_IMG_OPTM_SUMMARY, array() ) ;
|
| 1445 |
-
$summary[ 'credit' ] = $credit ;
|
| 1446 |
-
|
| 1447 |
-
update_option( self::DB_IMG_OPTM_SUMMARY, $summary ) ;
|
| 1448 |
-
}
|
| 1449 |
-
|
| 1450 |
-
/**
|
| 1451 |
-
* Get optm summary
|
| 1452 |
-
*
|
| 1453 |
-
* @since 1.6.5
|
| 1454 |
-
* @access public
|
| 1455 |
-
*/
|
| 1456 |
-
public function summary_info( $field = false )
|
| 1457 |
-
{
|
| 1458 |
-
$optm_summary = get_option( self::DB_IMG_OPTM_SUMMARY, array() ) ;
|
| 1459 |
-
|
| 1460 |
-
if ( ! $field ) {
|
| 1461 |
-
return $optm_summary ;
|
| 1462 |
-
}
|
| 1463 |
-
return ! empty( $optm_summary[ $field ] ) ? $optm_summary[ $field ] : 0 ;
|
| 1464 |
-
}
|
| 1465 |
-
|
| 1466 |
-
/**
|
| 1467 |
-
* Count images
|
| 1468 |
-
*
|
| 1469 |
-
* @since 1.6
|
| 1470 |
-
* @access public
|
| 1471 |
-
*/
|
| 1472 |
-
public function img_count()
|
| 1473 |
-
{
|
| 1474 |
-
global $wpdb ;
|
| 1475 |
-
$q = "SELECT count(*)
|
| 1476 |
-
FROM $wpdb->posts a
|
| 1477 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1478 |
-
WHERE a.post_type = 'attachment'
|
| 1479 |
-
AND a.post_status = 'inherit'
|
| 1480 |
-
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1481 |
-
AND b.meta_key = '_wp_attachment_metadata'
|
| 1482 |
-
" ;
|
| 1483 |
-
// $q = "SELECT count(*) FROM $wpdb->posts WHERE post_type = 'attachment' AND post_status = 'inherit' AND post_mime_type IN ('image/jpeg', 'image/png') " ;
|
| 1484 |
-
$total_img = $wpdb->get_var( $q ) ;
|
| 1485 |
-
|
| 1486 |
-
$q = "SELECT count(*)
|
| 1487 |
-
FROM $wpdb->posts a
|
| 1488 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1489 |
-
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.ID
|
| 1490 |
-
WHERE a.post_type = 'attachment'
|
| 1491 |
-
AND a.post_status = 'inherit'
|
| 1492 |
-
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1493 |
-
AND b.meta_key = '_wp_attachment_metadata'
|
| 1494 |
-
AND c.meta_key = %s
|
| 1495 |
-
AND c.meta_value= %s
|
| 1496 |
-
" ;
|
| 1497 |
-
$total_requested = $wpdb->get_var( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_REQUESTED ) ) ) ;
|
| 1498 |
-
$total_server_finished = $wpdb->get_var( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_NOTIFIED ) ) ) ;
|
| 1499 |
-
$total_pulled = $wpdb->get_var( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_PULLED ) ) ) ;
|
| 1500 |
-
$total_err = $wpdb->get_var( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS, self::DB_IMG_OPTIMIZE_STATUS_ERR ) ) ) ;
|
| 1501 |
-
|
| 1502 |
-
$q = "SELECT count(*)
|
| 1503 |
-
FROM $wpdb->posts a
|
| 1504 |
-
LEFT JOIN $wpdb->postmeta b ON b.post_id = a.ID
|
| 1505 |
-
LEFT JOIN $wpdb->postmeta c ON c.post_id = a.ID AND c.meta_key = %s
|
| 1506 |
-
WHERE a.post_type = 'attachment'
|
| 1507 |
-
AND a.post_status = 'inherit'
|
| 1508 |
-
AND a.post_mime_type IN ('image/jpeg', 'image/png')
|
| 1509 |
-
AND b.meta_key = '_wp_attachment_metadata'
|
| 1510 |
-
AND c.post_id IS NULL
|
| 1511 |
-
" ;
|
| 1512 |
-
$total_not_requested = $wpdb->get_var( $wpdb->prepare( $q, array( self::DB_IMG_OPTIMIZE_STATUS ) ) ) ;
|
| 1513 |
-
|
| 1514 |
-
return array(
|
| 1515 |
-
'total_img' => $total_img,
|
| 1516 |
-
'total_not_requested' => $total_not_requested,
|
| 1517 |
-
'total_requested' => $total_requested,
|
| 1518 |
-
'total_err' => $total_err,
|
| 1519 |
-
'total_server_finished' => $total_server_finished,
|
| 1520 |
-
'total_pulled' => $total_pulled,
|
| 1521 |
-
) ;
|
| 1522 |
-
}
|
| 1523 |
-
|
| 1524 |
/**
|
| 1525 |
* Run lazy load process
|
| 1526 |
* NOTE: As this is after cache finalized, can NOT set any cache control anymore
|
| 16 |
|
| 17 |
const LAZY_LIB = '/min/lazyload.js' ;
|
| 18 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 19 |
private $content ;
|
| 20 |
private $wp_upload_dir ;
|
|
|
|
|
|
|
|
|
|
|
|
|
| 21 |
|
| 22 |
private $cfg_img_webp ;
|
| 23 |
|
| 86 |
*/
|
| 87 |
public function after_admin_init()
|
| 88 |
{
|
| 89 |
+
if ( get_option( LiteSpeed_Cache_Config::ITEM_IMG_OPTM_NEED_PULL ) ) {
|
| 90 |
add_filter( 'manage_media_columns', array( $this, 'media_row_title' ) ) ;
|
| 91 |
add_filter( 'manage_media_custom_column', array( $this, 'media_row_actions' ), 10, 2 ) ;
|
| 92 |
}
|
| 119 |
|
| 120 |
$local_file = get_attached_file( $post_id ) ;
|
| 121 |
|
| 122 |
+
$link = LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, 'webp' . $post_id ) ;
|
| 123 |
$desc = false ;
|
| 124 |
$cls = 'litespeed-icon-media-webp' ;
|
| 125 |
$cls_webp = '' ;
|
| 142 |
$bk_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.' . $extension ;
|
| 143 |
$bk_optm_file = substr( $local_file, 0, -strlen( $extension ) ) . 'bk.optm.' . $extension ;
|
| 144 |
|
| 145 |
+
$link = LiteSpeed_Cache_Utility::build_url( LiteSpeed_Cache::ACTION_IMG_OPTM, 'orig' . $post_id ) ;
|
| 146 |
$desc = false ;
|
| 147 |
$cls = 'litespeed-icon-media-optm' ;
|
| 148 |
$cls_ori = '' ;
|
| 162 |
}
|
| 163 |
|
| 164 |
$info_webp = '' ;
|
| 165 |
+
$size_meta = get_post_meta( $post_id, LiteSpeed_Cache_Img_Optm::DB_IMG_OPTIMIZE_SIZE, true ) ;
|
| 166 |
if ( $size_meta && ! empty ( $size_meta[ 'webp_saved' ] ) ) {
|
| 167 |
$percent = ceil( $size_meta[ 'webp_saved' ] * 100 / $size_meta[ 'webp_total' ] ) ;
|
| 168 |
$pie_webp = LiteSpeed_Cache_GUI::pie( $percent, 30 ) ;
|
| 183 |
echo "<p class='litespeed-media-p $cls_webp'>$info_webp $link_webp</p><p class='litespeed-media-p $cls_ori'>$info_ori $link_ori</p>" ;
|
| 184 |
}
|
| 185 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 186 |
/**
|
| 187 |
* Get wp size info
|
| 188 |
*
|
| 258 |
}
|
| 259 |
}
|
| 260 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 261 |
/**
|
| 262 |
* Handle all request actions from main cls
|
| 263 |
*
|
| 271 |
$type = LiteSpeed_Cache_Router::verify_type() ;
|
| 272 |
|
| 273 |
switch ( $type ) {
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 274 |
default:
|
| 275 |
break ;
|
| 276 |
}
|
| 278 |
LiteSpeed_Cache_Admin::redirect() ;
|
| 279 |
}
|
| 280 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 281 |
/**
|
| 282 |
* Run lazy load process
|
| 283 |
* NOTE: As this is after cache finalized, can NOT set any cache control anymore
|
inc/router.class.php
CHANGED
|
@@ -39,23 +39,23 @@ class LiteSpeed_Cache_Router
|
|
| 39 |
return ;
|
| 40 |
}
|
| 41 |
|
| 42 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 43 |
|
| 44 |
// Check if is from crawler
|
| 45 |
if ( empty( $_SERVER[ 'HTTP_USER_AGENT' ] ) || $_SERVER[ 'HTTP_USER_AGENT' ] !== Litespeed_Crawler::FAST_USER_AGENT ) {
|
| 46 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 47 |
return ;
|
| 48 |
}
|
| 49 |
|
| 50 |
// Hash validation
|
| 51 |
$hash = get_option( LiteSpeed_Cache_Config::ITEM_CRAWLER_HASH ) ;
|
| 52 |
if ( ! $hash || $_COOKIE[ 'litespeed_hash' ] != $hash ) {
|
| 53 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 54 |
return ;
|
| 55 |
}
|
| 56 |
|
| 57 |
$role_uid = $_COOKIE[ 'litespeed_role' ] ;
|
| 58 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 59 |
|
| 60 |
wp_set_current_user( $role_uid ) ;
|
| 61 |
}
|
|
@@ -74,7 +74,7 @@ class LiteSpeed_Cache_Router
|
|
| 74 |
$user = wp_get_current_user() ;
|
| 75 |
$user_id = $user->ID ;
|
| 76 |
|
| 77 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 78 |
|
| 79 |
define( 'LITESPEED_WP_UID', $user_id ) ;
|
| 80 |
|
|
@@ -104,11 +104,11 @@ class LiteSpeed_Cache_Router
|
|
| 104 |
$role = array_shift( $tmp ) ;
|
| 105 |
}
|
| 106 |
}
|
| 107 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 108 |
|
| 109 |
if ( ! $role ) {
|
| 110 |
// Guest user
|
| 111 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 112 |
}
|
| 113 |
|
| 114 |
define( 'LITESPEED_WP_ROLE', $role ) ;
|
|
@@ -190,7 +190,7 @@ class LiteSpeed_Cache_Router
|
|
| 190 |
self::$_action = false;
|
| 191 |
self::get_instance()->verify_action() ;
|
| 192 |
if ( self::$_action ) {
|
| 193 |
-
defined( 'LSCWP_LOG' ) && LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL verified: ' . var_export( self::$_action, true ) ) ;
|
| 194 |
}
|
| 195 |
|
| 196 |
}
|
|
@@ -264,11 +264,11 @@ class LiteSpeed_Cache_Router
|
|
| 264 |
public static function verify_type()
|
| 265 |
{
|
| 266 |
if ( empty( $_REQUEST[ 'type' ] ) ) {
|
| 267 |
-
LiteSpeed_Cache_Log::debug( 'Router no type', 2 ) ;
|
| 268 |
return false ;
|
| 269 |
}
|
| 270 |
|
| 271 |
-
LiteSpeed_Cache_Log::debug( 'Router parsed type: ' . $_REQUEST[ 'type' ], 2 ) ;
|
| 272 |
|
| 273 |
return $_REQUEST[ 'type' ] ;
|
| 274 |
}
|
|
@@ -282,7 +282,7 @@ class LiteSpeed_Cache_Router
|
|
| 282 |
private function verify_action()
|
| 283 |
{
|
| 284 |
if ( empty( $_REQUEST[ LiteSpeed_Cache::ACTION_KEY ] ) ) {
|
| 285 |
-
LiteSpeed_Cache_Log::debug2( 'LSCWP_CTRL bypassed empty' ) ;
|
| 286 |
return ;
|
| 287 |
}
|
| 288 |
|
|
@@ -294,7 +294,7 @@ class LiteSpeed_Cache_Router
|
|
| 294 |
if ( ! $this->verify_nonce( $action ) && ! $this->_verify_sapi_passive( $action ) && ! $this->_verify_sapi_aggressive( $action ) ) {
|
| 295 |
// check if it is from admin ip
|
| 296 |
if ( ! $this->is_admin_ip() ) {
|
| 297 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL query string - did not match admin IP: ' . $action ) ;
|
| 298 |
return ;
|
| 299 |
}
|
| 300 |
|
|
@@ -307,7 +307,7 @@ class LiteSpeed_Cache_Router
|
|
| 307 |
LiteSpeed_Cache::ACTION_QS_PURGE_ALL,
|
| 308 |
LiteSpeed_Cache::ACTION_QS_PURGE_EMPTYCACHE,
|
| 309 |
) ) ) {
|
| 310 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL query string - did not match admin IP Actions: ' . $action ) ;
|
| 311 |
return ;
|
| 312 |
}
|
| 313 |
|
|
@@ -315,7 +315,7 @@ class LiteSpeed_Cache_Router
|
|
| 315 |
}
|
| 316 |
|
| 317 |
/* Now it is a valid action, lets log and check the permission */
|
| 318 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL: ' . $action ) ;
|
| 319 |
|
| 320 |
// OK, as we want to do something magic, lets check if its allowed
|
| 321 |
$_is_multisite = is_multisite() ;
|
|
@@ -381,9 +381,11 @@ class LiteSpeed_Cache_Router
|
|
| 381 |
case LiteSpeed_Cache::ACTION_BLACKLIST_SAVE:
|
| 382 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 383 |
case LiteSpeed_Cache::ACTION_MEDIA:
|
|
|
|
| 384 |
case LiteSpeed_Cache::ACTION_IAPI:
|
| 385 |
case LiteSpeed_Cache::ACTION_CDN:
|
| 386 |
case LiteSpeed_Cache::ACTION_IMPORT:
|
|
|
|
| 387 |
if ( defined( 'LITESPEED_ON' ) && $_can_option && ! $_is_network_admin ) {
|
| 388 |
self::$_action = $action ;
|
| 389 |
}
|
|
@@ -413,7 +415,7 @@ class LiteSpeed_Cache_Router
|
|
| 413 |
return ;
|
| 414 |
|
| 415 |
default:
|
| 416 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL match falied: ' . $action ) ;
|
| 417 |
return ;
|
| 418 |
}
|
| 419 |
|
| 39 |
return ;
|
| 40 |
}
|
| 41 |
|
| 42 |
+
LiteSpeed_Cache_Log::debug( '[Router] starting crawler role validation' ) ;
|
| 43 |
|
| 44 |
// Check if is from crawler
|
| 45 |
if ( empty( $_SERVER[ 'HTTP_USER_AGENT' ] ) || $_SERVER[ 'HTTP_USER_AGENT' ] !== Litespeed_Crawler::FAST_USER_AGENT ) {
|
| 46 |
+
LiteSpeed_Cache_Log::debug( '[Router] user agent not match' ) ;
|
| 47 |
return ;
|
| 48 |
}
|
| 49 |
|
| 50 |
// Hash validation
|
| 51 |
$hash = get_option( LiteSpeed_Cache_Config::ITEM_CRAWLER_HASH ) ;
|
| 52 |
if ( ! $hash || $_COOKIE[ 'litespeed_hash' ] != $hash ) {
|
| 53 |
+
LiteSpeed_Cache_Log::debug( '[Router] crawler hash not match ' . $_COOKIE[ 'litespeed_hash' ] . ' != ' . $hash ) ;
|
| 54 |
return ;
|
| 55 |
}
|
| 56 |
|
| 57 |
$role_uid = $_COOKIE[ 'litespeed_role' ] ;
|
| 58 |
+
LiteSpeed_Cache_Log::debug( '[Router] role simulate litespeed_role uid ' . $role_uid ) ;
|
| 59 |
|
| 60 |
wp_set_current_user( $role_uid ) ;
|
| 61 |
}
|
| 74 |
$user = wp_get_current_user() ;
|
| 75 |
$user_id = $user->ID ;
|
| 76 |
|
| 77 |
+
LiteSpeed_Cache_Log::debug( '[Router] get_uid: ' . $user_id, 3 ) ;
|
| 78 |
|
| 79 |
define( 'LITESPEED_WP_UID', $user_id ) ;
|
| 80 |
|
| 104 |
$role = array_shift( $tmp ) ;
|
| 105 |
}
|
| 106 |
}
|
| 107 |
+
LiteSpeed_Cache_Log::debug( '[Router] get_role: ' . $role ) ;
|
| 108 |
|
| 109 |
if ( ! $role ) {
|
| 110 |
// Guest user
|
| 111 |
+
LiteSpeed_Cache_Log::debug( '[Router] role: guest' ) ;
|
| 112 |
}
|
| 113 |
|
| 114 |
define( 'LITESPEED_WP_ROLE', $role ) ;
|
| 190 |
self::$_action = false;
|
| 191 |
self::get_instance()->verify_action() ;
|
| 192 |
if ( self::$_action ) {
|
| 193 |
+
defined( 'LSCWP_LOG' ) && LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL verified: ' . var_export( self::$_action, true ) ) ;
|
| 194 |
}
|
| 195 |
|
| 196 |
}
|
| 264 |
public static function verify_type()
|
| 265 |
{
|
| 266 |
if ( empty( $_REQUEST[ 'type' ] ) ) {
|
| 267 |
+
LiteSpeed_Cache_Log::debug( '[Router] no type', 2 ) ;
|
| 268 |
return false ;
|
| 269 |
}
|
| 270 |
|
| 271 |
+
LiteSpeed_Cache_Log::debug( '[Router] parsed type: ' . $_REQUEST[ 'type' ], 2 ) ;
|
| 272 |
|
| 273 |
return $_REQUEST[ 'type' ] ;
|
| 274 |
}
|
| 282 |
private function verify_action()
|
| 283 |
{
|
| 284 |
if ( empty( $_REQUEST[ LiteSpeed_Cache::ACTION_KEY ] ) ) {
|
| 285 |
+
LiteSpeed_Cache_Log::debug2( '[Router] LSCWP_CTRL bypassed empty' ) ;
|
| 286 |
return ;
|
| 287 |
}
|
| 288 |
|
| 294 |
if ( ! $this->verify_nonce( $action ) && ! $this->_verify_sapi_passive( $action ) && ! $this->_verify_sapi_aggressive( $action ) ) {
|
| 295 |
// check if it is from admin ip
|
| 296 |
if ( ! $this->is_admin_ip() ) {
|
| 297 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL query string - did not match admin IP: ' . $action ) ;
|
| 298 |
return ;
|
| 299 |
}
|
| 300 |
|
| 307 |
LiteSpeed_Cache::ACTION_QS_PURGE_ALL,
|
| 308 |
LiteSpeed_Cache::ACTION_QS_PURGE_EMPTYCACHE,
|
| 309 |
) ) ) {
|
| 310 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL query string - did not match admin IP Actions: ' . $action ) ;
|
| 311 |
return ;
|
| 312 |
}
|
| 313 |
|
| 315 |
}
|
| 316 |
|
| 317 |
/* Now it is a valid action, lets log and check the permission */
|
| 318 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL: ' . $action ) ;
|
| 319 |
|
| 320 |
// OK, as we want to do something magic, lets check if its allowed
|
| 321 |
$_is_multisite = is_multisite() ;
|
| 381 |
case LiteSpeed_Cache::ACTION_BLACKLIST_SAVE:
|
| 382 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 383 |
case LiteSpeed_Cache::ACTION_MEDIA:
|
| 384 |
+
case LiteSpeed_Cache::ACTION_IMG_OPTM:
|
| 385 |
case LiteSpeed_Cache::ACTION_IAPI:
|
| 386 |
case LiteSpeed_Cache::ACTION_CDN:
|
| 387 |
case LiteSpeed_Cache::ACTION_IMPORT:
|
| 388 |
+
case LiteSpeed_Cache::ACTION_QUIC_CLOUD:
|
| 389 |
if ( defined( 'LITESPEED_ON' ) && $_can_option && ! $_is_network_admin ) {
|
| 390 |
self::$_action = $action ;
|
| 391 |
}
|
| 415 |
return ;
|
| 416 |
|
| 417 |
default:
|
| 418 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL match falied: ' . $action ) ;
|
| 419 |
return ;
|
| 420 |
}
|
| 421 |
|
inc/task.class.php
CHANGED
|
@@ -38,10 +38,10 @@ class LiteSpeed_Cache_Task
|
|
| 38 |
}
|
| 39 |
|
| 40 |
// Register img optimization fetch ( always fetch immediately )
|
| 41 |
-
if ( ! LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_OPTM_CRON_OFF ) &&
|
| 42 |
self::schedule_filter_imgoptm() ;
|
| 43 |
|
| 44 |
-
add_action( self::CRON_ACTION_HOOK_IMGOPTM, '
|
| 45 |
}
|
| 46 |
else {
|
| 47 |
// wp_clear_scheduled_hook( self::CRON_ACTION_HOOK_IMGOPTM ) ;
|
| 38 |
}
|
| 39 |
|
| 40 |
// Register img optimization fetch ( always fetch immediately )
|
| 41 |
+
if ( ! LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_OPTM_CRON_OFF ) && LiteSpeed_Cache_Img_Optm::check_need_pull() ) {
|
| 42 |
self::schedule_filter_imgoptm() ;
|
| 43 |
|
| 44 |
+
add_action( self::CRON_ACTION_HOOK_IMGOPTM, 'LiteSpeed_Cache_Img_Optm::pull_optimized_img' ) ;
|
| 45 |
}
|
| 46 |
else {
|
| 47 |
// wp_clear_scheduled_hook( self::CRON_ACTION_HOOK_IMGOPTM ) ;
|
inc/vary.class.php
CHANGED
|
@@ -75,7 +75,7 @@ class LiteSpeed_Cache_Vary
|
|
| 75 |
* @since 1.6.7
|
| 76 |
*/
|
| 77 |
add_action( 'rest_api_init', function(){
|
| 78 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 79 |
add_filter( 'litespeed_can_change_vary', '__return_false' ) ;
|
| 80 |
} ) ;
|
| 81 |
|
|
@@ -197,7 +197,7 @@ class LiteSpeed_Cache_Vary
|
|
| 197 |
*/
|
| 198 |
public function add_logged_in( $logged_in_cookie = false, $expire = false, $expiration = false, $uid = false )
|
| 199 |
{
|
| 200 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 201 |
// If the cookie is lost somehow, set it
|
| 202 |
$this->_update_default_vary( $uid, $expire ) ;
|
| 203 |
}
|
|
@@ -211,7 +211,7 @@ class LiteSpeed_Cache_Vary
|
|
| 211 |
*/
|
| 212 |
public function remove_logged_in()
|
| 213 |
{
|
| 214 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 215 |
// Force update vary to remove login status
|
| 216 |
$this->_update_default_vary( -1 ) ;
|
| 217 |
}
|
|
@@ -230,7 +230,7 @@ class LiteSpeed_Cache_Vary
|
|
| 230 |
* @since 1.6.6
|
| 231 |
*/
|
| 232 |
if ( LiteSpeed_Cache_Router::is_ajax() && ! apply_filters( 'litespeed_ajax_vary', false ) ) {
|
| 233 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 234 |
return false ;
|
| 235 |
}
|
| 236 |
|
|
@@ -239,12 +239,12 @@ class LiteSpeed_Cache_Vary
|
|
| 239 |
* @since 1.6.5
|
| 240 |
*/
|
| 241 |
if ( $_SERVER["REQUEST_METHOD"] !== 'GET' && $_SERVER["REQUEST_METHOD"] !== 'POST' ) {
|
| 242 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 243 |
return false ;
|
| 244 |
}
|
| 245 |
|
| 246 |
if ( ! apply_filters( 'litespeed_can_change_vary', true ) ) {
|
| 247 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 248 |
return false ;
|
| 249 |
}
|
| 250 |
|
|
@@ -265,7 +265,7 @@ class LiteSpeed_Cache_Vary
|
|
| 265 |
define( 'LITESPEED_DID_' . __FUNCTION__, true ) ;
|
| 266 |
}
|
| 267 |
else {
|
| 268 |
-
LiteSpeed_Cache_Log::debug2( "Vary
|
| 269 |
return ;
|
| 270 |
}
|
| 271 |
|
|
@@ -280,7 +280,7 @@ class LiteSpeed_Cache_Vary
|
|
| 280 |
$expire = time() + 2 * DAY_IN_SECONDS ;
|
| 281 |
}
|
| 282 |
self::_cookie( $vary, $expire ) ;
|
| 283 |
-
LiteSpeed_Cache_Log::debug( "Vary
|
| 284 |
LiteSpeed_Cache_Control::set_nocache( 'changing default vary' . " $current_vary => $vary" ) ;
|
| 285 |
}
|
| 286 |
}
|
|
@@ -314,7 +314,7 @@ class LiteSpeed_Cache_Vary
|
|
| 314 |
$uid = LiteSpeed_Cache_Router::get_uid() ;
|
| 315 |
}
|
| 316 |
else {
|
| 317 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 318 |
}
|
| 319 |
|
| 320 |
// get user's group id
|
|
@@ -336,13 +336,13 @@ class LiteSpeed_Cache_Vary
|
|
| 336 |
|
| 337 |
if ( $admin_bar ) {
|
| 338 |
$vary[ 'admin_bar' ] = 1 ;
|
| 339 |
-
LiteSpeed_Cache_Log::debug2( 'Vary
|
| 340 |
}
|
| 341 |
|
| 342 |
}
|
| 343 |
else {
|
| 344 |
// Guest user
|
| 345 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 346 |
|
| 347 |
}
|
| 348 |
|
|
@@ -437,7 +437,7 @@ class LiteSpeed_Cache_Vary
|
|
| 437 |
if ( ! empty( $_SERVER[ $tag ] ) ) {
|
| 438 |
$path = parse_url( $_SERVER[ $tag ] ) ;
|
| 439 |
$path = ! empty( $path[ 'path' ] ) ? $path[ 'path' ] : false ;
|
| 440 |
-
LiteSpeed_Cache_Log::debug( 'Cookie Vary path: ' . $path ) ;
|
| 441 |
}
|
| 442 |
return $path ;
|
| 443 |
}
|
|
@@ -499,7 +499,7 @@ class LiteSpeed_Cache_Vary
|
|
| 499 |
global $post ;
|
| 500 |
if ( ! empty($post->post_password) ) {
|
| 501 |
if ( isset($_COOKIE['wp-postpass_' . COOKIEHASH]) ) {
|
| 502 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 503 |
// If user has password cookie, do not cache
|
| 504 |
LiteSpeed_Cache_Control::set_nocache('password protected vary') ;
|
| 505 |
return ;
|
| 75 |
* @since 1.6.7
|
| 76 |
*/
|
| 77 |
add_action( 'rest_api_init', function(){
|
| 78 |
+
LiteSpeed_Cache_Log::debug( '[Vary] Rest API init disabled vary change' ) ;
|
| 79 |
add_filter( 'litespeed_can_change_vary', '__return_false' ) ;
|
| 80 |
} ) ;
|
| 81 |
|
| 197 |
*/
|
| 198 |
public function add_logged_in( $logged_in_cookie = false, $expire = false, $expiration = false, $uid = false )
|
| 199 |
{
|
| 200 |
+
LiteSpeed_Cache_Log::debug( '[Vary] add_logged_in' ) ;
|
| 201 |
// If the cookie is lost somehow, set it
|
| 202 |
$this->_update_default_vary( $uid, $expire ) ;
|
| 203 |
}
|
| 211 |
*/
|
| 212 |
public function remove_logged_in()
|
| 213 |
{
|
| 214 |
+
LiteSpeed_Cache_Log::debug( '[Vary] remove_logged_in' ) ;
|
| 215 |
// Force update vary to remove login status
|
| 216 |
$this->_update_default_vary( -1 ) ;
|
| 217 |
}
|
| 230 |
* @since 1.6.6
|
| 231 |
*/
|
| 232 |
if ( LiteSpeed_Cache_Router::is_ajax() && ! apply_filters( 'litespeed_ajax_vary', false ) ) {
|
| 233 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to ajax call' ) ;
|
| 234 |
return false ;
|
| 235 |
}
|
| 236 |
|
| 239 |
* @since 1.6.5
|
| 240 |
*/
|
| 241 |
if ( $_SERVER["REQUEST_METHOD"] !== 'GET' && $_SERVER["REQUEST_METHOD"] !== 'POST' ) {
|
| 242 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to method not get/post' ) ;
|
| 243 |
return false ;
|
| 244 |
}
|
| 245 |
|
| 246 |
if ( ! apply_filters( 'litespeed_can_change_vary', true ) ) {
|
| 247 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to litespeed_can_change_vary hook' ) ;
|
| 248 |
return false ;
|
| 249 |
}
|
| 250 |
|
| 265 |
define( 'LITESPEED_DID_' . __FUNCTION__, true ) ;
|
| 266 |
}
|
| 267 |
else {
|
| 268 |
+
LiteSpeed_Cache_Log::debug2( "[Vary] _update_default_vary bypassed due to run already" ) ;
|
| 269 |
return ;
|
| 270 |
}
|
| 271 |
|
| 280 |
$expire = time() + 2 * DAY_IN_SECONDS ;
|
| 281 |
}
|
| 282 |
self::_cookie( $vary, $expire ) ;
|
| 283 |
+
LiteSpeed_Cache_Log::debug( "[Vary] set_cookie ---> $vary" ) ;
|
| 284 |
LiteSpeed_Cache_Control::set_nocache( 'changing default vary' . " $current_vary => $vary" ) ;
|
| 285 |
}
|
| 286 |
}
|
| 314 |
$uid = LiteSpeed_Cache_Router::get_uid() ;
|
| 315 |
}
|
| 316 |
else {
|
| 317 |
+
LiteSpeed_Cache_Log::debug( '[Vary] uid: ' . $uid ) ;
|
| 318 |
}
|
| 319 |
|
| 320 |
// get user's group id
|
| 336 |
|
| 337 |
if ( $admin_bar ) {
|
| 338 |
$vary[ 'admin_bar' ] = 1 ;
|
| 339 |
+
LiteSpeed_Cache_Log::debug2( '[Vary] admin bar : true' ) ;
|
| 340 |
}
|
| 341 |
|
| 342 |
}
|
| 343 |
else {
|
| 344 |
// Guest user
|
| 345 |
+
LiteSpeed_Cache_Log::debug( '[Vary] role id: failed, guest' ) ;
|
| 346 |
|
| 347 |
}
|
| 348 |
|
| 437 |
if ( ! empty( $_SERVER[ $tag ] ) ) {
|
| 438 |
$path = parse_url( $_SERVER[ $tag ] ) ;
|
| 439 |
$path = ! empty( $path[ 'path' ] ) ? $path[ 'path' ] : false ;
|
| 440 |
+
LiteSpeed_Cache_Log::debug( '[Vary] Cookie Vary path: ' . $path ) ;
|
| 441 |
}
|
| 442 |
return $path ;
|
| 443 |
}
|
| 499 |
global $post ;
|
| 500 |
if ( ! empty($post->post_password) ) {
|
| 501 |
if ( isset($_COOKIE['wp-postpass_' . COOKIEHASH]) ) {
|
| 502 |
+
LiteSpeed_Cache_Log::debug( '[Vary] finalize bypassed due to password protected vary ' ) ;
|
| 503 |
// If user has password cookie, do not cache
|
| 504 |
LiteSpeed_Cache_Control::set_nocache('password protected vary') ;
|
| 505 |
return ;
|
includes/litespeed-cache-activation.class.php
CHANGED
|
@@ -119,6 +119,16 @@ class LiteSpeed_Cache_Activation
|
|
| 119 |
$count++ ;
|
| 120 |
}
|
| 121 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 122 |
if ( is_plugin_active_for_network( LSCWP_BASENAME ) ) {
|
| 123 |
$count++ ;
|
| 124 |
}
|
| 119 |
$count++ ;
|
| 120 |
}
|
| 121 |
}
|
| 122 |
+
|
| 123 |
+
/**
|
| 124 |
+
* In case this is called outside the admin page
|
| 125 |
+
* @see https://codex.wordpress.org/Function_Reference/is_plugin_active_for_network
|
| 126 |
+
* @since 2.0
|
| 127 |
+
*/
|
| 128 |
+
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 129 |
+
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;
|
| 130 |
+
}
|
| 131 |
+
|
| 132 |
if ( is_plugin_active_for_network( LSCWP_BASENAME ) ) {
|
| 133 |
$count++ ;
|
| 134 |
}
|
includes/litespeed-cache-cdn.class.php
CHANGED
|
@@ -80,21 +80,29 @@ class LiteSpeed_Cache_CDN
|
|
| 80 |
}
|
| 81 |
$this_url = $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_URL ] ;
|
| 82 |
$this_host = parse_url( $this_url, PHP_URL_HOST ) ;
|
|
|
|
| 83 |
foreach ( $mapping_to_check as $to_check ) {
|
| 84 |
if ( $v[ $to_check ] ) {
|
| 85 |
LiteSpeed_Cache_Log::debug2( 'CDN: mapping ' . $to_check . ' -> ' . $this_url ) ;
|
| 86 |
-
|
|
|
|
|
|
|
|
|
|
| 87 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 88 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 89 |
}
|
| 90 |
}
|
| 91 |
}
|
|
|
|
| 92 |
if ( $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) {
|
| 93 |
$filetypes = array_map( 'trim', explode( "\n", $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) ) ;
|
| 94 |
foreach ( $filetypes as $v2 ) {
|
| 95 |
if ( $v2 ) {
|
| 96 |
$this->cfg_cdn_mapping[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] = true ;
|
| 97 |
-
|
|
|
|
|
|
|
|
|
|
| 98 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 99 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 100 |
}
|
|
@@ -141,6 +149,28 @@ class LiteSpeed_Cache_CDN
|
|
| 141 |
|
| 142 |
}
|
| 143 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 144 |
/**
|
| 145 |
* Handle all request actions from main cls
|
| 146 |
*
|
|
@@ -515,6 +545,11 @@ class LiteSpeed_Cache_CDN
|
|
| 515 |
$final_url = $this->cfg_cdn_mapping[ $postfix ] ;
|
| 516 |
}
|
| 517 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 518 |
// Now lets replace CDN url
|
| 519 |
if ( strpos( $this->cfg_url_ori, '*' ) !== false ) {
|
| 520 |
$url = preg_replace( '#' . $scheme . $this->cfg_url_ori . '#iU', $final_url, $url ) ;
|
| 80 |
}
|
| 81 |
$this_url = $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_URL ] ;
|
| 82 |
$this_host = parse_url( $this_url, PHP_URL_HOST ) ;
|
| 83 |
+
// Check img/css/js
|
| 84 |
foreach ( $mapping_to_check as $to_check ) {
|
| 85 |
if ( $v[ $to_check ] ) {
|
| 86 |
LiteSpeed_Cache_Log::debug2( 'CDN: mapping ' . $to_check . ' -> ' . $this_url ) ;
|
| 87 |
+
|
| 88 |
+
// If filetype to url is one to many, make url be an array
|
| 89 |
+
$this->_append_cdn_mapping( $to_check, $this_url ) ;
|
| 90 |
+
|
| 91 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 92 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 93 |
}
|
| 94 |
}
|
| 95 |
}
|
| 96 |
+
// Check file types
|
| 97 |
if ( $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) {
|
| 98 |
$filetypes = array_map( 'trim', explode( "\n", $v[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] ) ) ;
|
| 99 |
foreach ( $filetypes as $v2 ) {
|
| 100 |
if ( $v2 ) {
|
| 101 |
$this->cfg_cdn_mapping[ LiteSpeed_Cache_Config::ITEM_CDN_MAPPING_FILETYPE ] = true ;
|
| 102 |
+
|
| 103 |
+
// If filetype to url is one to many, make url be an array
|
| 104 |
+
$this->_append_cdn_mapping( $v2, $this_url ) ;
|
| 105 |
+
|
| 106 |
if ( ! in_array( $this_host, $this->cdn_mapping_hosts ) ) {
|
| 107 |
$this->cdn_mapping_hosts[] = $this_host ;
|
| 108 |
}
|
| 149 |
|
| 150 |
}
|
| 151 |
|
| 152 |
+
/**
|
| 153 |
+
* Associate all filetypes with url
|
| 154 |
+
*
|
| 155 |
+
* @since 2.0
|
| 156 |
+
* @access private
|
| 157 |
+
*/
|
| 158 |
+
private function _append_cdn_mapping( $filetype, $url )
|
| 159 |
+
{
|
| 160 |
+
// If filetype to url is one to many, make url be an array
|
| 161 |
+
if ( empty( $this->cfg_cdn_mapping[ $filetype ] ) ) {
|
| 162 |
+
$this->cfg_cdn_mapping[ $filetype ] = $url ;
|
| 163 |
+
}
|
| 164 |
+
elseif ( is_array( $this->cfg_cdn_mapping[ $filetype ] ) ) {
|
| 165 |
+
// Append url to filetype
|
| 166 |
+
$this->cfg_cdn_mapping[ $filetype ][] = $url ;
|
| 167 |
+
}
|
| 168 |
+
else {
|
| 169 |
+
// Convert cfg_cdn_mapping from string to array
|
| 170 |
+
$this->cfg_cdn_mapping[ $filetype ] = array( $this->cfg_cdn_mapping[ $filetype ], $url ) ;
|
| 171 |
+
}
|
| 172 |
+
}
|
| 173 |
+
|
| 174 |
/**
|
| 175 |
* Handle all request actions from main cls
|
| 176 |
*
|
| 545 |
$final_url = $this->cfg_cdn_mapping[ $postfix ] ;
|
| 546 |
}
|
| 547 |
|
| 548 |
+
// If filetype to url is one to many, need to random one
|
| 549 |
+
if ( is_array( $final_url ) ) {
|
| 550 |
+
$final_url = $final_url[ mt_rand( 0, count( $final_url ) - 1 ) ] ;
|
| 551 |
+
}
|
| 552 |
+
|
| 553 |
// Now lets replace CDN url
|
| 554 |
if ( strpos( $this->cfg_url_ori, '*' ) !== false ) {
|
| 555 |
$url = preg_replace( '#' . $scheme . $this->cfg_url_ori . '#iU', $final_url, $url ) ;
|
includes/litespeed-cache-config.class.php
CHANGED
|
@@ -21,7 +21,7 @@ class LiteSpeed_Cache_Config
|
|
| 21 |
const ITEM_OPTM_CSS = 'litespeed-optm-css' ;// separate critical css that should be stored in option table
|
| 22 |
const ITEM_OPTM_JS_DEFER_EXC = 'litespeed-optm-js-defer-excludes' ;
|
| 23 |
const ITEM_MEDIA_LAZY_IMG_EXC = 'litespeed-media-lazy-img-excludes' ;
|
| 24 |
-
const
|
| 25 |
const ITEM_ENV_REF = 'litespeed-env-ref' ;
|
| 26 |
const ITEM_CACHE_DROP_QS = 'litespeed-cache-drop_qs' ;
|
| 27 |
const ITEM_CDN_MAPPING = 'litespeed-cache-cdn_mapping' ;
|
|
@@ -35,6 +35,7 @@ class LiteSpeed_Cache_Config
|
|
| 35 |
|
| 36 |
const ITEM_SETTING_MODE = 'litespeed-setting-mode' ;
|
| 37 |
const ITEM_CRAWLER_HASH = 'litespeed-crawler-hash' ;
|
|
|
|
| 38 |
|
| 39 |
// Server variables
|
| 40 |
const ENV_CRAWLER_USLEEP = 'CRAWLER_USLEEP' ;
|
|
@@ -200,6 +201,7 @@ class LiteSpeed_Cache_Config
|
|
| 200 |
const CRWL_LOAD_LIMIT = 'crawler_load_limit' ;
|
| 201 |
const CRWL_DOMAIN_IP = 'crawler_domain_ip' ;
|
| 202 |
const CRWL_CUSTOM_SITEMAP = 'crawler_custom_sitemap' ;
|
|
|
|
| 203 |
|
| 204 |
const CRWL_CRON_ACTIVE = 'crawler_cron_active' ;
|
| 205 |
|
|
@@ -271,12 +273,17 @@ class LiteSpeed_Cache_Config
|
|
| 271 |
{
|
| 272 |
$site_options = get_site_option( self::OPTION_NAME ) ;
|
| 273 |
|
| 274 |
-
if ( ! function_exists('is_plugin_active_for_network') ) { // todo: check if needed
|
| 275 |
-
require_once(ABSPATH . '/wp-admin/includes/plugin.php') ;
|
| 276 |
-
}
|
| 277 |
-
|
| 278 |
$options = get_option( self::OPTION_NAME, $this->get_default_options() ) ;
|
| 279 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 280 |
// If don't have site options
|
| 281 |
if ( ! $site_options || ! is_array( $site_options ) || ! is_plugin_active_for_network( 'litespeed-cache/litespeed-cache.php' ) ) {
|
| 282 |
if ( $options[ self::OPID_ENABLED_RADIO ] === self::VAL_ON2 ) { // Default to cache on
|
|
@@ -661,6 +668,7 @@ class LiteSpeed_Cache_Config
|
|
| 661 |
self::CRWL_DOMAIN_IP => '',
|
| 662 |
self::CRWL_CUSTOM_SITEMAP => '',
|
| 663 |
self::CRWL_CRON_ACTIVE => false,
|
|
|
|
| 664 |
) ;
|
| 665 |
|
| 666 |
if ( LSWCP_ESI_SUPPORT ) {
|
|
@@ -891,6 +899,9 @@ class LiteSpeed_Cache_Config
|
|
| 891 |
define( 'LSWCP_EMPTYCACHE', true ) ;// clear all sites caches
|
| 892 |
LiteSpeed_Cache_Purge::purge_all() ;
|
| 893 |
LiteSpeed_Cache_Log::debug( "Config: plugin_upgrade option changed = $res" ) ;
|
|
|
|
|
|
|
|
|
|
| 894 |
}
|
| 895 |
|
| 896 |
/**
|
| 21 |
const ITEM_OPTM_CSS = 'litespeed-optm-css' ;// separate critical css that should be stored in option table
|
| 22 |
const ITEM_OPTM_JS_DEFER_EXC = 'litespeed-optm-js-defer-excludes' ;
|
| 23 |
const ITEM_MEDIA_LAZY_IMG_EXC = 'litespeed-media-lazy-img-excludes' ;
|
| 24 |
+
const ITEM_IMG_OPTM_NEED_PULL = 'litespeed-media-need-pull' ;
|
| 25 |
const ITEM_ENV_REF = 'litespeed-env-ref' ;
|
| 26 |
const ITEM_CACHE_DROP_QS = 'litespeed-cache-drop_qs' ;
|
| 27 |
const ITEM_CDN_MAPPING = 'litespeed-cache-cdn_mapping' ;
|
| 35 |
|
| 36 |
const ITEM_SETTING_MODE = 'litespeed-setting-mode' ;
|
| 37 |
const ITEM_CRAWLER_HASH = 'litespeed-crawler-hash' ;
|
| 38 |
+
const ITEM_GUIDE = 'litespeed-guide' ; // Array of each guidance tag as key, step as val
|
| 39 |
|
| 40 |
// Server variables
|
| 41 |
const ENV_CRAWLER_USLEEP = 'CRAWLER_USLEEP' ;
|
| 201 |
const CRWL_LOAD_LIMIT = 'crawler_load_limit' ;
|
| 202 |
const CRWL_DOMAIN_IP = 'crawler_domain_ip' ;
|
| 203 |
const CRWL_CUSTOM_SITEMAP = 'crawler_custom_sitemap' ;
|
| 204 |
+
const CRWL_HTTP2 = 'crawler_http2' ;
|
| 205 |
|
| 206 |
const CRWL_CRON_ACTIVE = 'crawler_cron_active' ;
|
| 207 |
|
| 273 |
{
|
| 274 |
$site_options = get_site_option( self::OPTION_NAME ) ;
|
| 275 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 276 |
$options = get_option( self::OPTION_NAME, $this->get_default_options() ) ;
|
| 277 |
|
| 278 |
+
/**
|
| 279 |
+
* In case this is called outside the admin page
|
| 280 |
+
* @see https://codex.wordpress.org/Function_Reference/is_plugin_active_for_network
|
| 281 |
+
* @since 2.0
|
| 282 |
+
*/
|
| 283 |
+
if ( ! function_exists( 'is_plugin_active_for_network' ) ) {
|
| 284 |
+
require_once( ABSPATH . '/wp-admin/includes/plugin.php' ) ;
|
| 285 |
+
}
|
| 286 |
+
|
| 287 |
// If don't have site options
|
| 288 |
if ( ! $site_options || ! is_array( $site_options ) || ! is_plugin_active_for_network( 'litespeed-cache/litespeed-cache.php' ) ) {
|
| 289 |
if ( $options[ self::OPID_ENABLED_RADIO ] === self::VAL_ON2 ) { // Default to cache on
|
| 668 |
self::CRWL_DOMAIN_IP => '',
|
| 669 |
self::CRWL_CUSTOM_SITEMAP => '',
|
| 670 |
self::CRWL_CRON_ACTIVE => false,
|
| 671 |
+
self::CRWL_HTTP2 => true,
|
| 672 |
) ;
|
| 673 |
|
| 674 |
if ( LSWCP_ESI_SUPPORT ) {
|
| 899 |
define( 'LSWCP_EMPTYCACHE', true ) ;// clear all sites caches
|
| 900 |
LiteSpeed_Cache_Purge::purge_all() ;
|
| 901 |
LiteSpeed_Cache_Log::debug( "Config: plugin_upgrade option changed = $res" ) ;
|
| 902 |
+
|
| 903 |
+
// Update img_optm table data for upgrading
|
| 904 |
+
LiteSpeed_Cache_Data::get_instance() ;
|
| 905 |
}
|
| 906 |
|
| 907 |
/**
|
includes/litespeed-cache-crawler.class.php
CHANGED
|
@@ -384,6 +384,8 @@ class LiteSpeed_Cache_Crawler
|
|
| 384 |
$crawler->set_base_url($this->_home_url) ;
|
| 385 |
$crawler->set_run_duration($options[LiteSpeed_Cache_Config::CRWL_RUN_DURATION]) ;
|
| 386 |
|
|
|
|
|
|
|
| 387 |
/**
|
| 388 |
* Limit delay to use server setting
|
| 389 |
* @since 1.8.3
|
| 384 |
$crawler->set_base_url($this->_home_url) ;
|
| 385 |
$crawler->set_run_duration($options[LiteSpeed_Cache_Config::CRWL_RUN_DURATION]) ;
|
| 386 |
|
| 387 |
+
$crawler->set_http2( $options[ LiteSpeed_Cache_Config::CRWL_HTTP2 ] ) ;
|
| 388 |
+
|
| 389 |
/**
|
| 390 |
* Limit delay to use server setting
|
| 391 |
* @since 1.8.3
|
includes/litespeed-cache-gui.class.php
CHANGED
|
@@ -79,15 +79,17 @@ class LiteSpeed_Cache_GUI
|
|
| 79 |
*
|
| 80 |
* @since 1.6.6
|
| 81 |
*/
|
| 82 |
-
public static function pie( $percent, $width = 50 )
|
| 83 |
{
|
|
|
|
|
|
|
|
|
|
|
|
|
| 84 |
return "
|
| 85 |
<svg class='litespeed-pie' viewbox='0 0 33.83098862 33.83098862' width='$width' height='$width' xmlns='http://www.w3.org/2000/svg'>
|
| 86 |
<circle class='litespeed-pie_bg' />
|
| 87 |
<circle class='litespeed-pie_circle' stroke-dasharray='$percent,100' />
|
| 88 |
-
<g class='litespeed-pie_info'>
|
| 89 |
-
<text x='16.91549431' y='15.5'>$percent%</text>
|
| 90 |
-
</g>
|
| 91 |
</svg>
|
| 92 |
";
|
| 93 |
|
| 79 |
*
|
| 80 |
* @since 1.6.6
|
| 81 |
*/
|
| 82 |
+
public static function pie( $percent, $width = 50, $finished_tick = false )
|
| 83 |
{
|
| 84 |
+
$percentage = '<text x="16.91549431" y="15.5">' . $percent . '%</text>' ;
|
| 85 |
+
if ( $percent == 100 && $finished_tick ) {
|
| 86 |
+
$percentage = '<text x="16.91549431" y="15.5" fill="#73b38d">✓</text>' ;
|
| 87 |
+
}
|
| 88 |
return "
|
| 89 |
<svg class='litespeed-pie' viewbox='0 0 33.83098862 33.83098862' width='$width' height='$width' xmlns='http://www.w3.org/2000/svg'>
|
| 90 |
<circle class='litespeed-pie_bg' />
|
| 91 |
<circle class='litespeed-pie_circle' stroke-dasharray='$percent,100' />
|
| 92 |
+
<g class='litespeed-pie_info'>$percentage</g>
|
|
|
|
|
|
|
| 93 |
</svg>
|
| 94 |
";
|
| 95 |
|
includes/litespeed-cache-router.class.php
CHANGED
|
@@ -39,23 +39,23 @@ class LiteSpeed_Cache_Router
|
|
| 39 |
return ;
|
| 40 |
}
|
| 41 |
|
| 42 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 43 |
|
| 44 |
// Check if is from crawler
|
| 45 |
if ( empty( $_SERVER[ 'HTTP_USER_AGENT' ] ) || $_SERVER[ 'HTTP_USER_AGENT' ] !== Litespeed_Crawler::FAST_USER_AGENT ) {
|
| 46 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 47 |
return ;
|
| 48 |
}
|
| 49 |
|
| 50 |
// Hash validation
|
| 51 |
$hash = get_option( LiteSpeed_Cache_Config::ITEM_CRAWLER_HASH ) ;
|
| 52 |
if ( ! $hash || $_COOKIE[ 'litespeed_hash' ] != $hash ) {
|
| 53 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 54 |
return ;
|
| 55 |
}
|
| 56 |
|
| 57 |
$role_uid = $_COOKIE[ 'litespeed_role' ] ;
|
| 58 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 59 |
|
| 60 |
wp_set_current_user( $role_uid ) ;
|
| 61 |
}
|
|
@@ -74,7 +74,7 @@ class LiteSpeed_Cache_Router
|
|
| 74 |
$user = wp_get_current_user() ;
|
| 75 |
$user_id = $user->ID ;
|
| 76 |
|
| 77 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 78 |
|
| 79 |
define( 'LITESPEED_WP_UID', $user_id ) ;
|
| 80 |
|
|
@@ -104,11 +104,11 @@ class LiteSpeed_Cache_Router
|
|
| 104 |
$role = array_shift( $tmp ) ;
|
| 105 |
}
|
| 106 |
}
|
| 107 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 108 |
|
| 109 |
if ( ! $role ) {
|
| 110 |
// Guest user
|
| 111 |
-
LiteSpeed_Cache_Log::debug( 'Router
|
| 112 |
}
|
| 113 |
|
| 114 |
define( 'LITESPEED_WP_ROLE', $role ) ;
|
|
@@ -190,7 +190,7 @@ class LiteSpeed_Cache_Router
|
|
| 190 |
self::$_action = false;
|
| 191 |
self::get_instance()->verify_action() ;
|
| 192 |
if ( self::$_action ) {
|
| 193 |
-
defined( 'LSCWP_LOG' ) && LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL verified: ' . var_export( self::$_action, true ) ) ;
|
| 194 |
}
|
| 195 |
|
| 196 |
}
|
|
@@ -264,11 +264,11 @@ class LiteSpeed_Cache_Router
|
|
| 264 |
public static function verify_type()
|
| 265 |
{
|
| 266 |
if ( empty( $_REQUEST[ 'type' ] ) ) {
|
| 267 |
-
LiteSpeed_Cache_Log::debug( 'Router no type', 2 ) ;
|
| 268 |
return false ;
|
| 269 |
}
|
| 270 |
|
| 271 |
-
LiteSpeed_Cache_Log::debug( 'Router parsed type: ' . $_REQUEST[ 'type' ], 2 ) ;
|
| 272 |
|
| 273 |
return $_REQUEST[ 'type' ] ;
|
| 274 |
}
|
|
@@ -282,7 +282,7 @@ class LiteSpeed_Cache_Router
|
|
| 282 |
private function verify_action()
|
| 283 |
{
|
| 284 |
if ( empty( $_REQUEST[ LiteSpeed_Cache::ACTION_KEY ] ) ) {
|
| 285 |
-
LiteSpeed_Cache_Log::debug2( 'LSCWP_CTRL bypassed empty' ) ;
|
| 286 |
return ;
|
| 287 |
}
|
| 288 |
|
|
@@ -294,7 +294,7 @@ class LiteSpeed_Cache_Router
|
|
| 294 |
if ( ! $this->verify_nonce( $action ) && ! $this->_verify_sapi_passive( $action ) && ! $this->_verify_sapi_aggressive( $action ) ) {
|
| 295 |
// check if it is from admin ip
|
| 296 |
if ( ! $this->is_admin_ip() ) {
|
| 297 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL query string - did not match admin IP: ' . $action ) ;
|
| 298 |
return ;
|
| 299 |
}
|
| 300 |
|
|
@@ -307,7 +307,7 @@ class LiteSpeed_Cache_Router
|
|
| 307 |
LiteSpeed_Cache::ACTION_QS_PURGE_ALL,
|
| 308 |
LiteSpeed_Cache::ACTION_QS_PURGE_EMPTYCACHE,
|
| 309 |
) ) ) {
|
| 310 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL query string - did not match admin IP Actions: ' . $action ) ;
|
| 311 |
return ;
|
| 312 |
}
|
| 313 |
|
|
@@ -315,7 +315,7 @@ class LiteSpeed_Cache_Router
|
|
| 315 |
}
|
| 316 |
|
| 317 |
/* Now it is a valid action, lets log and check the permission */
|
| 318 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL: ' . $action ) ;
|
| 319 |
|
| 320 |
// OK, as we want to do something magic, lets check if its allowed
|
| 321 |
$_is_multisite = is_multisite() ;
|
|
@@ -381,9 +381,11 @@ class LiteSpeed_Cache_Router
|
|
| 381 |
case LiteSpeed_Cache::ACTION_BLACKLIST_SAVE:
|
| 382 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 383 |
case LiteSpeed_Cache::ACTION_MEDIA:
|
|
|
|
| 384 |
case LiteSpeed_Cache::ACTION_IAPI:
|
| 385 |
case LiteSpeed_Cache::ACTION_CDN:
|
| 386 |
case LiteSpeed_Cache::ACTION_IMPORT:
|
|
|
|
| 387 |
if ( defined( 'LITESPEED_ON' ) && $_can_option && ! $_is_network_admin ) {
|
| 388 |
self::$_action = $action ;
|
| 389 |
}
|
|
@@ -413,7 +415,7 @@ class LiteSpeed_Cache_Router
|
|
| 413 |
return ;
|
| 414 |
|
| 415 |
default:
|
| 416 |
-
LiteSpeed_Cache_Log::debug( 'LSCWP_CTRL match falied: ' . $action ) ;
|
| 417 |
return ;
|
| 418 |
}
|
| 419 |
|
| 39 |
return ;
|
| 40 |
}
|
| 41 |
|
| 42 |
+
LiteSpeed_Cache_Log::debug( '[Router] starting crawler role validation' ) ;
|
| 43 |
|
| 44 |
// Check if is from crawler
|
| 45 |
if ( empty( $_SERVER[ 'HTTP_USER_AGENT' ] ) || $_SERVER[ 'HTTP_USER_AGENT' ] !== Litespeed_Crawler::FAST_USER_AGENT ) {
|
| 46 |
+
LiteSpeed_Cache_Log::debug( '[Router] user agent not match' ) ;
|
| 47 |
return ;
|
| 48 |
}
|
| 49 |
|
| 50 |
// Hash validation
|
| 51 |
$hash = get_option( LiteSpeed_Cache_Config::ITEM_CRAWLER_HASH ) ;
|
| 52 |
if ( ! $hash || $_COOKIE[ 'litespeed_hash' ] != $hash ) {
|
| 53 |
+
LiteSpeed_Cache_Log::debug( '[Router] crawler hash not match ' . $_COOKIE[ 'litespeed_hash' ] . ' != ' . $hash ) ;
|
| 54 |
return ;
|
| 55 |
}
|
| 56 |
|
| 57 |
$role_uid = $_COOKIE[ 'litespeed_role' ] ;
|
| 58 |
+
LiteSpeed_Cache_Log::debug( '[Router] role simulate litespeed_role uid ' . $role_uid ) ;
|
| 59 |
|
| 60 |
wp_set_current_user( $role_uid ) ;
|
| 61 |
}
|
| 74 |
$user = wp_get_current_user() ;
|
| 75 |
$user_id = $user->ID ;
|
| 76 |
|
| 77 |
+
LiteSpeed_Cache_Log::debug( '[Router] get_uid: ' . $user_id, 3 ) ;
|
| 78 |
|
| 79 |
define( 'LITESPEED_WP_UID', $user_id ) ;
|
| 80 |
|
| 104 |
$role = array_shift( $tmp ) ;
|
| 105 |
}
|
| 106 |
}
|
| 107 |
+
LiteSpeed_Cache_Log::debug( '[Router] get_role: ' . $role ) ;
|
| 108 |
|
| 109 |
if ( ! $role ) {
|
| 110 |
// Guest user
|
| 111 |
+
LiteSpeed_Cache_Log::debug( '[Router] role: guest' ) ;
|
| 112 |
}
|
| 113 |
|
| 114 |
define( 'LITESPEED_WP_ROLE', $role ) ;
|
| 190 |
self::$_action = false;
|
| 191 |
self::get_instance()->verify_action() ;
|
| 192 |
if ( self::$_action ) {
|
| 193 |
+
defined( 'LSCWP_LOG' ) && LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL verified: ' . var_export( self::$_action, true ) ) ;
|
| 194 |
}
|
| 195 |
|
| 196 |
}
|
| 264 |
public static function verify_type()
|
| 265 |
{
|
| 266 |
if ( empty( $_REQUEST[ 'type' ] ) ) {
|
| 267 |
+
LiteSpeed_Cache_Log::debug( '[Router] no type', 2 ) ;
|
| 268 |
return false ;
|
| 269 |
}
|
| 270 |
|
| 271 |
+
LiteSpeed_Cache_Log::debug( '[Router] parsed type: ' . $_REQUEST[ 'type' ], 2 ) ;
|
| 272 |
|
| 273 |
return $_REQUEST[ 'type' ] ;
|
| 274 |
}
|
| 282 |
private function verify_action()
|
| 283 |
{
|
| 284 |
if ( empty( $_REQUEST[ LiteSpeed_Cache::ACTION_KEY ] ) ) {
|
| 285 |
+
LiteSpeed_Cache_Log::debug2( '[Router] LSCWP_CTRL bypassed empty' ) ;
|
| 286 |
return ;
|
| 287 |
}
|
| 288 |
|
| 294 |
if ( ! $this->verify_nonce( $action ) && ! $this->_verify_sapi_passive( $action ) && ! $this->_verify_sapi_aggressive( $action ) ) {
|
| 295 |
// check if it is from admin ip
|
| 296 |
if ( ! $this->is_admin_ip() ) {
|
| 297 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL query string - did not match admin IP: ' . $action ) ;
|
| 298 |
return ;
|
| 299 |
}
|
| 300 |
|
| 307 |
LiteSpeed_Cache::ACTION_QS_PURGE_ALL,
|
| 308 |
LiteSpeed_Cache::ACTION_QS_PURGE_EMPTYCACHE,
|
| 309 |
) ) ) {
|
| 310 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL query string - did not match admin IP Actions: ' . $action ) ;
|
| 311 |
return ;
|
| 312 |
}
|
| 313 |
|
| 315 |
}
|
| 316 |
|
| 317 |
/* Now it is a valid action, lets log and check the permission */
|
| 318 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL: ' . $action ) ;
|
| 319 |
|
| 320 |
// OK, as we want to do something magic, lets check if its allowed
|
| 321 |
$_is_multisite = is_multisite() ;
|
| 381 |
case LiteSpeed_Cache::ACTION_BLACKLIST_SAVE:
|
| 382 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 383 |
case LiteSpeed_Cache::ACTION_MEDIA:
|
| 384 |
+
case LiteSpeed_Cache::ACTION_IMG_OPTM:
|
| 385 |
case LiteSpeed_Cache::ACTION_IAPI:
|
| 386 |
case LiteSpeed_Cache::ACTION_CDN:
|
| 387 |
case LiteSpeed_Cache::ACTION_IMPORT:
|
| 388 |
+
case LiteSpeed_Cache::ACTION_QUIC_CLOUD:
|
| 389 |
if ( defined( 'LITESPEED_ON' ) && $_can_option && ! $_is_network_admin ) {
|
| 390 |
self::$_action = $action ;
|
| 391 |
}
|
| 415 |
return ;
|
| 416 |
|
| 417 |
default:
|
| 418 |
+
LiteSpeed_Cache_Log::debug( '[Router] LSCWP_CTRL match falied: ' . $action ) ;
|
| 419 |
return ;
|
| 420 |
}
|
| 421 |
|
includes/litespeed-cache-task.class.php
CHANGED
|
@@ -38,10 +38,10 @@ class LiteSpeed_Cache_Task
|
|
| 38 |
}
|
| 39 |
|
| 40 |
// Register img optimization fetch ( always fetch immediately )
|
| 41 |
-
if ( ! LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_OPTM_CRON_OFF ) &&
|
| 42 |
self::schedule_filter_imgoptm() ;
|
| 43 |
|
| 44 |
-
add_action( self::CRON_ACTION_HOOK_IMGOPTM, '
|
| 45 |
}
|
| 46 |
else {
|
| 47 |
// wp_clear_scheduled_hook( self::CRON_ACTION_HOOK_IMGOPTM ) ;
|
| 38 |
}
|
| 39 |
|
| 40 |
// Register img optimization fetch ( always fetch immediately )
|
| 41 |
+
if ( ! LiteSpeed_Cache::config( LiteSpeed_Cache_Config::OPID_MEDIA_IMG_OPTM_CRON_OFF ) && LiteSpeed_Cache_Img_Optm::check_need_pull() ) {
|
| 42 |
self::schedule_filter_imgoptm() ;
|
| 43 |
|
| 44 |
+
add_action( self::CRON_ACTION_HOOK_IMGOPTM, 'LiteSpeed_Cache_Img_Optm::pull_optimized_img' ) ;
|
| 45 |
}
|
| 46 |
else {
|
| 47 |
// wp_clear_scheduled_hook( self::CRON_ACTION_HOOK_IMGOPTM ) ;
|
includes/litespeed-cache-vary.class.php
CHANGED
|
@@ -75,7 +75,7 @@ class LiteSpeed_Cache_Vary
|
|
| 75 |
* @since 1.6.7
|
| 76 |
*/
|
| 77 |
add_action( 'rest_api_init', function(){
|
| 78 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 79 |
add_filter( 'litespeed_can_change_vary', '__return_false' ) ;
|
| 80 |
} ) ;
|
| 81 |
|
|
@@ -197,7 +197,7 @@ class LiteSpeed_Cache_Vary
|
|
| 197 |
*/
|
| 198 |
public function add_logged_in( $logged_in_cookie = false, $expire = false, $expiration = false, $uid = false )
|
| 199 |
{
|
| 200 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 201 |
// If the cookie is lost somehow, set it
|
| 202 |
$this->_update_default_vary( $uid, $expire ) ;
|
| 203 |
}
|
|
@@ -211,7 +211,7 @@ class LiteSpeed_Cache_Vary
|
|
| 211 |
*/
|
| 212 |
public function remove_logged_in()
|
| 213 |
{
|
| 214 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 215 |
// Force update vary to remove login status
|
| 216 |
$this->_update_default_vary( -1 ) ;
|
| 217 |
}
|
|
@@ -230,7 +230,7 @@ class LiteSpeed_Cache_Vary
|
|
| 230 |
* @since 1.6.6
|
| 231 |
*/
|
| 232 |
if ( LiteSpeed_Cache_Router::is_ajax() && ! apply_filters( 'litespeed_ajax_vary', false ) ) {
|
| 233 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 234 |
return false ;
|
| 235 |
}
|
| 236 |
|
|
@@ -239,12 +239,12 @@ class LiteSpeed_Cache_Vary
|
|
| 239 |
* @since 1.6.5
|
| 240 |
*/
|
| 241 |
if ( $_SERVER["REQUEST_METHOD"] !== 'GET' && $_SERVER["REQUEST_METHOD"] !== 'POST' ) {
|
| 242 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 243 |
return false ;
|
| 244 |
}
|
| 245 |
|
| 246 |
if ( ! apply_filters( 'litespeed_can_change_vary', true ) ) {
|
| 247 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 248 |
return false ;
|
| 249 |
}
|
| 250 |
|
|
@@ -265,7 +265,7 @@ class LiteSpeed_Cache_Vary
|
|
| 265 |
define( 'LITESPEED_DID_' . __FUNCTION__, true ) ;
|
| 266 |
}
|
| 267 |
else {
|
| 268 |
-
LiteSpeed_Cache_Log::debug2( "Vary
|
| 269 |
return ;
|
| 270 |
}
|
| 271 |
|
|
@@ -280,7 +280,7 @@ class LiteSpeed_Cache_Vary
|
|
| 280 |
$expire = time() + 2 * DAY_IN_SECONDS ;
|
| 281 |
}
|
| 282 |
self::_cookie( $vary, $expire ) ;
|
| 283 |
-
LiteSpeed_Cache_Log::debug( "Vary
|
| 284 |
LiteSpeed_Cache_Control::set_nocache( 'changing default vary' . " $current_vary => $vary" ) ;
|
| 285 |
}
|
| 286 |
}
|
|
@@ -314,7 +314,7 @@ class LiteSpeed_Cache_Vary
|
|
| 314 |
$uid = LiteSpeed_Cache_Router::get_uid() ;
|
| 315 |
}
|
| 316 |
else {
|
| 317 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 318 |
}
|
| 319 |
|
| 320 |
// get user's group id
|
|
@@ -336,13 +336,13 @@ class LiteSpeed_Cache_Vary
|
|
| 336 |
|
| 337 |
if ( $admin_bar ) {
|
| 338 |
$vary[ 'admin_bar' ] = 1 ;
|
| 339 |
-
LiteSpeed_Cache_Log::debug2( 'Vary
|
| 340 |
}
|
| 341 |
|
| 342 |
}
|
| 343 |
else {
|
| 344 |
// Guest user
|
| 345 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 346 |
|
| 347 |
}
|
| 348 |
|
|
@@ -437,7 +437,7 @@ class LiteSpeed_Cache_Vary
|
|
| 437 |
if ( ! empty( $_SERVER[ $tag ] ) ) {
|
| 438 |
$path = parse_url( $_SERVER[ $tag ] ) ;
|
| 439 |
$path = ! empty( $path[ 'path' ] ) ? $path[ 'path' ] : false ;
|
| 440 |
-
LiteSpeed_Cache_Log::debug( 'Cookie Vary path: ' . $path ) ;
|
| 441 |
}
|
| 442 |
return $path ;
|
| 443 |
}
|
|
@@ -499,7 +499,7 @@ class LiteSpeed_Cache_Vary
|
|
| 499 |
global $post ;
|
| 500 |
if ( ! empty($post->post_password) ) {
|
| 501 |
if ( isset($_COOKIE['wp-postpass_' . COOKIEHASH]) ) {
|
| 502 |
-
LiteSpeed_Cache_Log::debug( 'Vary
|
| 503 |
// If user has password cookie, do not cache
|
| 504 |
LiteSpeed_Cache_Control::set_nocache('password protected vary') ;
|
| 505 |
return ;
|
| 75 |
* @since 1.6.7
|
| 76 |
*/
|
| 77 |
add_action( 'rest_api_init', function(){
|
| 78 |
+
LiteSpeed_Cache_Log::debug( '[Vary] Rest API init disabled vary change' ) ;
|
| 79 |
add_filter( 'litespeed_can_change_vary', '__return_false' ) ;
|
| 80 |
} ) ;
|
| 81 |
|
| 197 |
*/
|
| 198 |
public function add_logged_in( $logged_in_cookie = false, $expire = false, $expiration = false, $uid = false )
|
| 199 |
{
|
| 200 |
+
LiteSpeed_Cache_Log::debug( '[Vary] add_logged_in' ) ;
|
| 201 |
// If the cookie is lost somehow, set it
|
| 202 |
$this->_update_default_vary( $uid, $expire ) ;
|
| 203 |
}
|
| 211 |
*/
|
| 212 |
public function remove_logged_in()
|
| 213 |
{
|
| 214 |
+
LiteSpeed_Cache_Log::debug( '[Vary] remove_logged_in' ) ;
|
| 215 |
// Force update vary to remove login status
|
| 216 |
$this->_update_default_vary( -1 ) ;
|
| 217 |
}
|
| 230 |
* @since 1.6.6
|
| 231 |
*/
|
| 232 |
if ( LiteSpeed_Cache_Router::is_ajax() && ! apply_filters( 'litespeed_ajax_vary', false ) ) {
|
| 233 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to ajax call' ) ;
|
| 234 |
return false ;
|
| 235 |
}
|
| 236 |
|
| 239 |
* @since 1.6.5
|
| 240 |
*/
|
| 241 |
if ( $_SERVER["REQUEST_METHOD"] !== 'GET' && $_SERVER["REQUEST_METHOD"] !== 'POST' ) {
|
| 242 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to method not get/post' ) ;
|
| 243 |
return false ;
|
| 244 |
}
|
| 245 |
|
| 246 |
if ( ! apply_filters( 'litespeed_can_change_vary', true ) ) {
|
| 247 |
+
LiteSpeed_Cache_Log::debug( '[Vary] can_change_vary bypassed due to litespeed_can_change_vary hook' ) ;
|
| 248 |
return false ;
|
| 249 |
}
|
| 250 |
|
| 265 |
define( 'LITESPEED_DID_' . __FUNCTION__, true ) ;
|
| 266 |
}
|
| 267 |
else {
|
| 268 |
+
LiteSpeed_Cache_Log::debug2( "[Vary] _update_default_vary bypassed due to run already" ) ;
|
| 269 |
return ;
|
| 270 |
}
|
| 271 |
|
| 280 |
$expire = time() + 2 * DAY_IN_SECONDS ;
|
| 281 |
}
|
| 282 |
self::_cookie( $vary, $expire ) ;
|
| 283 |
+
LiteSpeed_Cache_Log::debug( "[Vary] set_cookie ---> $vary" ) ;
|
| 284 |
LiteSpeed_Cache_Control::set_nocache( 'changing default vary' . " $current_vary => $vary" ) ;
|
| 285 |
}
|
| 286 |
}
|
| 314 |
$uid = LiteSpeed_Cache_Router::get_uid() ;
|
| 315 |
}
|
| 316 |
else {
|
| 317 |
+
LiteSpeed_Cache_Log::debug( '[Vary] uid: ' . $uid ) ;
|
| 318 |
}
|
| 319 |
|
| 320 |
// get user's group id
|
| 336 |
|
| 337 |
if ( $admin_bar ) {
|
| 338 |
$vary[ 'admin_bar' ] = 1 ;
|
| 339 |
+
LiteSpeed_Cache_Log::debug2( '[Vary] admin bar : true' ) ;
|
| 340 |
}
|
| 341 |
|
| 342 |
}
|
| 343 |
else {
|
| 344 |
// Guest user
|
| 345 |
+
LiteSpeed_Cache_Log::debug( '[Vary] role id: failed, guest' ) ;
|
| 346 |
|
| 347 |
}
|
| 348 |
|
| 437 |
if ( ! empty( $_SERVER[ $tag ] ) ) {
|
| 438 |
$path = parse_url( $_SERVER[ $tag ] ) ;
|
| 439 |
$path = ! empty( $path[ 'path' ] ) ? $path[ 'path' ] : false ;
|
| 440 |
+
LiteSpeed_Cache_Log::debug( '[Vary] Cookie Vary path: ' . $path ) ;
|
| 441 |
}
|
| 442 |
return $path ;
|
| 443 |
}
|
| 499 |
global $post ;
|
| 500 |
if ( ! empty($post->post_password) ) {
|
| 501 |
if ( isset($_COOKIE['wp-postpass_' . COOKIEHASH]) ) {
|
| 502 |
+
LiteSpeed_Cache_Log::debug( '[Vary] finalize bypassed due to password protected vary ' ) ;
|
| 503 |
// If user has password cookie, do not cache
|
| 504 |
LiteSpeed_Cache_Control::set_nocache('password protected vary') ;
|
| 505 |
return ;
|
includes/litespeed-cache.class.php
CHANGED
|
@@ -19,7 +19,7 @@ class LiteSpeed_Cache
|
|
| 19 |
private static $_instance ;
|
| 20 |
|
| 21 |
const PLUGIN_NAME = 'litespeed-cache' ;
|
| 22 |
-
const PLUGIN_VERSION = '
|
| 23 |
|
| 24 |
const PAGE_EDIT_HTACCESS = 'lscache-edit-htaccess' ;
|
| 25 |
|
|
@@ -47,6 +47,7 @@ class LiteSpeed_Cache
|
|
| 47 |
const ACTION_CRAWLER_CRON_ENABLE = 'crawler-cron-enable' ;
|
| 48 |
const ACTION_DO_CRAWL = 'do-crawl' ;
|
| 49 |
const ACTION_BLACKLIST_SAVE = 'blacklist-save' ;
|
|
|
|
| 50 |
|
| 51 |
const ACTION_FRONT_PURGE = 'front-purge' ;
|
| 52 |
const ACTION_FRONT_EXCLUDE = 'front-exclude' ;
|
|
@@ -57,6 +58,7 @@ class LiteSpeed_Cache
|
|
| 57 |
const ACTION_IMPORT = 'import' ;
|
| 58 |
const ACTION_PURGE = 'purge' ;
|
| 59 |
const ACTION_MEDIA = 'media' ;
|
|
|
|
| 60 |
const ACTION_IAPI = 'iapi' ;
|
| 61 |
const ACTION_CDN = 'cdn' ;
|
| 62 |
const ACTION_REPORT = 'report' ;
|
|
@@ -328,6 +330,10 @@ class LiteSpeed_Cache
|
|
| 328 |
$msg = LiteSpeed_Cache_Media::handler() ;
|
| 329 |
break ;
|
| 330 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 331 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 332 |
$msg = LiteSpeed_Cache_Purge::handler() ;
|
| 333 |
break ;
|
|
@@ -352,6 +358,10 @@ class LiteSpeed_Cache
|
|
| 352 |
$msg = LiteSpeed_Cache_Import::handler() ;
|
| 353 |
break ;
|
| 354 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 355 |
default:
|
| 356 |
break ;
|
| 357 |
}
|
| 19 |
private static $_instance ;
|
| 20 |
|
| 21 |
const PLUGIN_NAME = 'litespeed-cache' ;
|
| 22 |
+
const PLUGIN_VERSION = '2.0' ;
|
| 23 |
|
| 24 |
const PAGE_EDIT_HTACCESS = 'lscache-edit-htaccess' ;
|
| 25 |
|
| 47 |
const ACTION_CRAWLER_CRON_ENABLE = 'crawler-cron-enable' ;
|
| 48 |
const ACTION_DO_CRAWL = 'do-crawl' ;
|
| 49 |
const ACTION_BLACKLIST_SAVE = 'blacklist-save' ;
|
| 50 |
+
const ACTION_QUIC_CLOUD = 'quic_cloud' ;
|
| 51 |
|
| 52 |
const ACTION_FRONT_PURGE = 'front-purge' ;
|
| 53 |
const ACTION_FRONT_EXCLUDE = 'front-exclude' ;
|
| 58 |
const ACTION_IMPORT = 'import' ;
|
| 59 |
const ACTION_PURGE = 'purge' ;
|
| 60 |
const ACTION_MEDIA = 'media' ;
|
| 61 |
+
const ACTION_IMG_OPTM = 'img_optm' ;
|
| 62 |
const ACTION_IAPI = 'iapi' ;
|
| 63 |
const ACTION_CDN = 'cdn' ;
|
| 64 |
const ACTION_REPORT = 'report' ;
|
| 330 |
$msg = LiteSpeed_Cache_Media::handler() ;
|
| 331 |
break ;
|
| 332 |
|
| 333 |
+
case LiteSpeed_Cache::ACTION_IMG_OPTM:
|
| 334 |
+
$msg = LiteSpeed_Cache_Img_Optm::handler() ;
|
| 335 |
+
break ;
|
| 336 |
+
|
| 337 |
case LiteSpeed_Cache::ACTION_PURGE:
|
| 338 |
$msg = LiteSpeed_Cache_Purge::handler() ;
|
| 339 |
break ;
|
| 358 |
$msg = LiteSpeed_Cache_Import::handler() ;
|
| 359 |
break ;
|
| 360 |
|
| 361 |
+
case LiteSpeed_Cache::ACTION_QUIC_CLOUD:
|
| 362 |
+
$msg = LiteSpeed_Cache_QUIC_CLOUD::handler() ;
|
| 363 |
+
break ;
|
| 364 |
+
|
| 365 |
default:
|
| 366 |
break ;
|
| 367 |
}
|
includes/litespeed.autoload.php
CHANGED
|
@@ -34,11 +34,13 @@ if ( !function_exists('_litespeed_autoload') ) {
|
|
| 34 |
'LiteSpeed_Cache_ESI' => 'inc/esi.class.php',
|
| 35 |
'LiteSpeed_Cache_GUI' => 'inc/gui.class.php',
|
| 36 |
'LiteSpeed_Cache_Import' => 'inc/import.class.php',
|
|
|
|
| 37 |
'LiteSpeed_Cache_Log' => 'inc/log.class.php',
|
| 38 |
'LiteSpeed_Cache_Media' => 'inc/media.class.php',
|
| 39 |
'LiteSpeed_Cache_Object' => 'inc/object.class.php',
|
| 40 |
'LiteSpeed_Cache_Optimize' => 'inc/optimize.class.php',
|
| 41 |
'LiteSpeed_Cache_Optimizer' => 'inc/optimizer.class.php',
|
|
|
|
| 42 |
'LiteSpeed_Cache_Purge' => 'inc/purge.class.php',
|
| 43 |
'LiteSpeed_Cache_Router' => 'inc/router.class.php',
|
| 44 |
'LiteSpeed_Cache_Tag' => 'inc/tag.class.php',
|
| 34 |
'LiteSpeed_Cache_ESI' => 'inc/esi.class.php',
|
| 35 |
'LiteSpeed_Cache_GUI' => 'inc/gui.class.php',
|
| 36 |
'LiteSpeed_Cache_Import' => 'inc/import.class.php',
|
| 37 |
+
'LiteSpeed_Cache_Img_Optm' => 'inc/img_optm.class.php',
|
| 38 |
'LiteSpeed_Cache_Log' => 'inc/log.class.php',
|
| 39 |
'LiteSpeed_Cache_Media' => 'inc/media.class.php',
|
| 40 |
'LiteSpeed_Cache_Object' => 'inc/object.class.php',
|
| 41 |
'LiteSpeed_Cache_Optimize' => 'inc/optimize.class.php',
|
| 42 |
'LiteSpeed_Cache_Optimizer' => 'inc/optimizer.class.php',
|
| 43 |
+
'LiteSpeed_Cache_QUIC_CLOUD' => 'inc/quic_cloud.class.php',
|
| 44 |
'LiteSpeed_Cache_Purge' => 'inc/purge.class.php',
|
| 45 |
'LiteSpeed_Cache_Router' => 'inc/router.class.php',
|
| 46 |
'LiteSpeed_Cache_Tag' => 'inc/tag.class.php',
|
js/iziModal.min.js
ADDED
|
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
/*
|
| 2 |
+
* iziModal | v1.6.0
|
| 3 |
+
* http://izimodal.marcelodolce.com
|
| 4 |
+
* by Marcelo Dolce.
|
| 5 |
+
*/
|
| 6 |
+
!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):"object"==typeof module&&module.exports?module.exports=function(e,i){return void 0===i&&(i="undefined"!=typeof window?require("jquery"):require("jquery")(e)),t(i),i}:t(jQuery)}(function(t){function e(){var t,e=document.createElement("fakeelement"),i={animation:"animationend",OAnimation:"oAnimationEnd",MozAnimation:"animationend",WebkitAnimation:"webkitAnimationEnd"};for(t in i)if(void 0!==e.style[t])return i[t]}function i(t){return 9===t?navigator.appVersion.indexOf("MSIE 9.")!==-1:(userAgent=navigator.userAgent,userAgent.indexOf("MSIE ")>-1||userAgent.indexOf("Trident/")>-1)}function n(t){var e=/%|px|em|cm|vh|vw/;return parseInt(String(t).split(e)[0])}function o(e){var i=e.replace(/^.*#/,""),n=t(e);n.attr("id",i+"-tmp"),window.location.hash=e,n.attr("id",i)}var s=t(window),a=t(document),r="iziModal",l={CLOSING:"closing",CLOSED:"closed",OPENING:"opening",OPENED:"opened",DESTROYED:"destroyed"},d=e(),h=!!/Mobi/.test(navigator.userAgent);window.$iziModal={},window.$iziModal.autoOpen=0,window.$iziModal.history=!1;var c=function(t,e){this.init(t,e)};return c.prototype={constructor:c,init:function(e,i){var n=this;this.$element=t(e),void 0!==this.$element[0].id&&""!==this.$element[0].id?this.id=this.$element[0].id:(this.id=r+Math.floor(1e7*Math.random()+1),this.$element.attr("id",this.id)),this.classes=void 0!==this.$element.attr("class")?this.$element.attr("class"):"",this.content=this.$element.html(),this.state=l.CLOSED,this.options=i,this.width=0,this.timer=null,this.timerTimeout=null,this.progressBar=null,this.isPaused=!1,this.isFullscreen=!1,this.headerHeight=0,this.modalHeight=0,this.$overlay=t('<div class="'+r+'-overlay" style="background-color:'+i.overlayColor+'"></div>'),this.$navigate=t('<div class="'+r+'-navigate"><div class="'+r+'-navigate-caption">Use</div><button class="'+r+'-navigate-prev"></button><button class="'+r+'-navigate-next"></button></div>'),this.group={name:this.$element.attr("data-"+r+"-group"),index:null,ids:[]},this.$element.attr("aria-hidden","true"),this.$element.attr("aria-labelledby",this.id),this.$element.attr("role","dialog"),this.$element.hasClass("iziModal")||this.$element.addClass("iziModal"),void 0===this.group.name&&""!==i.group&&(this.group.name=i.group,this.$element.attr("data-"+r+"-group",i.group)),this.options.loop===!0&&this.$element.attr("data-"+r+"-loop",!0),t.each(this.options,function(t,e){var o=n.$element.attr("data-"+r+"-"+t);try{"undefined"!=typeof o&&(""===o||"true"==o?i[t]=!0:"false"==o?i[t]=!1:"function"==typeof e?i[t]=new Function(o):i[t]=o)}catch(s){}}),i.appendTo!==!1&&this.$element.appendTo(i.appendTo),i.iframe===!0?(this.$element.html('<div class="'+r+'-wrap"><div class="'+r+'-content"><iframe class="'+r+'-iframe"></iframe>'+this.content+"</div></div>"),null!==i.iframeHeight&&this.$element.find("."+r+"-iframe").css("height",i.iframeHeight)):this.$element.html('<div class="'+r+'-wrap"><div class="'+r+'-content">'+this.content+"</div></div>"),null!==this.options.background&&this.$element.css("background",this.options.background),this.$wrap=this.$element.find("."+r+"-wrap"),null===i.zindex||isNaN(parseInt(i.zindex))||(this.$element.css("z-index",i.zindex),this.$navigate.css("z-index",i.zindex-1),this.$overlay.css("z-index",i.zindex-2)),""!==i.radius&&this.$element.css("border-radius",i.radius),""!==i.padding&&this.$element.find("."+r+"-content").css("padding",i.padding),""!==i.theme&&("light"===i.theme?this.$element.addClass(r+"-light"):this.$element.addClass(i.theme)),i.rtl===!0&&this.$element.addClass(r+"-rtl"),i.openFullscreen===!0&&(this.isFullscreen=!0,this.$element.addClass("isFullscreen")),this.createHeader(),this.recalcWidth(),this.recalcVerticalPos(),!n.options.afterRender||"function"!=typeof n.options.afterRender&&"object"!=typeof n.options.afterRender||n.options.afterRender(n)},createHeader:function(){this.$header=t('<div class="'+r+'-header"><h2 class="'+r+'-header-title">'+this.options.title+'</h2><p class="'+r+'-header-subtitle">'+this.options.subtitle+'</p><div class="'+r+'-header-buttons"></div></div>'),this.options.closeButton===!0&&this.$header.find("."+r+"-header-buttons").append('<a href="javascript:void(0)" class="'+r+"-button "+r+'-button-close" data-'+r+"-close></a>"),this.options.fullscreen===!0&&this.$header.find("."+r+"-header-buttons").append('<a href="javascript:void(0)" class="'+r+"-button "+r+'-button-fullscreen" data-'+r+"-fullscreen></a>"),this.options.timeoutProgressbar===!0&&this.$header.prepend('<div class="'+r+'-progressbar"><div style="background-color:'+this.options.timeoutProgressbarColor+'"></div></div>'),""===this.options.subtitle&&this.$header.addClass(r+"-noSubtitle"),""!==this.options.title&&(null!==this.options.headerColor&&(this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+this.options.headerColor),this.$header.css("background",this.options.headerColor)),null===this.options.icon&&null===this.options.iconText||(this.$header.prepend('<i class="'+r+'-header-icon"></i>'),null!==this.options.icon&&this.$header.find("."+r+"-header-icon").addClass(this.options.icon).css("color",this.options.iconColor),null!==this.options.iconText&&this.$header.find("."+r+"-header-icon").html(this.options.iconText)),this.$element.css("overflow","hidden").prepend(this.$header))},setGroup:function(e){var i=this,n=this.group.name||e;if(this.group.ids=[],void 0!==e&&e!==this.group.name&&(n=e,this.group.name=n,this.$element.attr("data-"+r+"-group",n)),void 0!==n&&""!==n){var o=0;t.each(t("."+r+"[data-"+r+"-group="+n+"]"),function(e,n){i.group.ids.push(t(this)[0].id),i.id==t(this)[0].id&&(i.group.index=o),o++})}},toggle:function(){this.state==l.OPENED&&this.close(),this.state==l.CLOSED&&this.open()},startProgress:function(t){var e=this;this.isPaused=!1,clearTimeout(this.timerTimeout),this.options.timeoutProgressbar===!0?(this.progressBar={hideEta:null,maxHideTime:null,currentTime:(new Date).getTime(),el:this.$element.find("."+r+"-progressbar > div"),updateProgress:function(){if(!e.isPaused){e.progressBar.currentTime=e.progressBar.currentTime+10;var t=(e.progressBar.hideEta-e.progressBar.currentTime)/e.progressBar.maxHideTime*100;e.progressBar.el.width(t+"%"),t<0&&e.close()}}},t>0&&(this.progressBar.maxHideTime=parseFloat(t),this.progressBar.hideEta=(new Date).getTime()+this.progressBar.maxHideTime,this.timerTimeout=setInterval(this.progressBar.updateProgress,10))):this.timerTimeout=setTimeout(function(){e.close()},e.options.timeout)},pauseProgress:function(){this.isPaused=!0},resumeProgress:function(){this.isPaused=!1},resetProgress:function(t){clearTimeout(this.timerTimeout),this.progressBar={},this.$element.find("."+r+"-progressbar > div").width("100%")},open:function(e){function i(){s.state=l.OPENED,s.$element.trigger(l.OPENED),!s.options.onOpened||"function"!=typeof s.options.onOpened&&"object"!=typeof s.options.onOpened||s.options.onOpened(s)}function n(){s.$element.off("click","[data-"+r+"-close]").on("click","[data-"+r+"-close]",function(e){e.preventDefault();var i=t(e.currentTarget).attr("data-"+r+"-transitionOut");void 0!==i?s.close({transition:i}):s.close()}),s.$element.off("click","[data-"+r+"-fullscreen]").on("click","[data-"+r+"-fullscreen]",function(t){t.preventDefault(),s.isFullscreen===!0?(s.isFullscreen=!1,s.$element.removeClass("isFullscreen")):(s.isFullscreen=!0,s.$element.addClass("isFullscreen")),s.options.onFullscreen&&"function"==typeof s.options.onFullscreen&&s.options.onFullscreen(s),s.$element.trigger("fullscreen",s)}),s.$navigate.off("click","."+r+"-navigate-next").on("click","."+r+"-navigate-next",function(t){s.next(t)}),s.$element.off("click","[data-"+r+"-next]").on("click","[data-"+r+"-next]",function(t){s.next(t)}),s.$navigate.off("click","."+r+"-navigate-prev").on("click","."+r+"-navigate-prev",function(t){s.prev(t)}),s.$element.off("click","[data-"+r+"-prev]").on("click","[data-"+r+"-prev]",function(t){s.prev(t)})}var s=this;try{void 0!==e&&e.preventClose===!1&&t.each(t("."+r),function(e,i){if(void 0!==t(i).data().iziModal){var n=t(i).iziModal("getState");"opened"!=n&&"opening"!=n||t(i).iziModal("close")}})}catch(c){}if(function(){if(s.options.history){var t=document.title;document.title=t+" - "+s.options.title,o("#"+s.id),document.title=t,window.$iziModal.history=!0}else window.$iziModal.history=!1}(),this.state==l.CLOSED){if(n(),this.setGroup(),this.state=l.OPENING,this.$element.trigger(l.OPENING),this.$element.attr("aria-hidden","false"),this.options.timeoutProgressbar===!0&&this.$element.find("."+r+"-progressbar > div").width("100%"),this.options.iframe===!0){this.$element.find("."+r+"-content").addClass(r+"-content-loader"),this.$element.find("."+r+"-iframe").on("load",function(){t(this).parent().removeClass(r+"-content-loader")});var u=null;try{u=""!==t(e.currentTarget).attr("href")?t(e.currentTarget).attr("href"):null}catch(c){}if(null===this.options.iframeURL||null!==u&&void 0!==u||(u=this.options.iframeURL),null===u||void 0===u)throw new Error("Failed to find iframe URL");this.$element.find("."+r+"-iframe").attr("src",u)}(this.options.bodyOverflow||h)&&(t("html").addClass(r+"-isOverflow"),h&&t("body").css("overflow","hidden")),this.options.onOpening&&"function"==typeof this.options.onOpening&&this.options.onOpening(this),function(){if(s.group.ids.length>1){s.$navigate.appendTo("body"),s.$navigate.addClass("fadeIn"),s.options.navigateCaption===!0&&s.$navigate.find("."+r+"-navigate-caption").show();var n=s.$element.outerWidth();s.options.navigateArrows!==!1?"closeScreenEdge"===s.options.navigateArrows?(s.$navigate.find("."+r+"-navigate-prev").css("left",0).show(),s.$navigate.find("."+r+"-navigate-next").css("right",0).show()):(s.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(n/2+84)).show(),s.$navigate.find("."+r+"-navigate-next").css("margin-right",-(n/2+84)).show()):(s.$navigate.find("."+r+"-navigate-prev").hide(),s.$navigate.find("."+r+"-navigate-next").hide());var o;0===s.group.index&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-prev").hide()),s.group.index+1===s.group.ids.length&&(o=t("."+r+"[data-"+r+'-group="'+s.group.name+'"][data-'+r+"-loop]").length,0===o&&s.options.loop===!1&&s.$navigate.find("."+r+"-navigate-next").hide())}s.options.overlay===!0&&(s.options.appendToOverlay===!1?s.$overlay.appendTo("body"):s.$overlay.appendTo(s.options.appendToOverlay)),s.options.transitionInOverlay&&s.$overlay.addClass(s.options.transitionInOverlay);var a=s.options.transitionIn;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionIn||(a=e.transition||e.transitionIn),void 0!==e.zindex&&s.setZindex(e.zindex)),""!==a&&void 0!==d?(s.$element.addClass("transitionIn "+a).show(),s.$wrap.one(d,function(){s.$element.removeClass(a+" transitionIn"),s.$overlay.removeClass(s.options.transitionInOverlay),s.$navigate.removeClass("fadeIn"),i()})):(s.$element.show(),i()),s.options.pauseOnHover!==!0||s.options.pauseOnHover!==!0||s.options.timeout===!1||isNaN(parseInt(s.options.timeout))||s.options.timeout===!1||0===s.options.timeout||(s.$element.off("mouseenter").on("mouseenter",function(t){t.preventDefault(),s.isPaused=!0}),s.$element.off("mouseleave").on("mouseleave",function(t){t.preventDefault(),s.isPaused=!1}))}(),this.options.timeout===!1||isNaN(parseInt(this.options.timeout))||this.options.timeout===!1||0===this.options.timeout||s.startProgress(this.options.timeout),this.options.overlayClose&&!this.$element.hasClass(this.options.transitionOut)&&this.$overlay.click(function(){s.close()}),this.options.focusInput&&this.$element.find(":input:not(button):enabled:visible:first").focus(),function p(){s.recalcLayout(),s.timer=setTimeout(p,300)}(),a.on("keydown."+r,function(t){s.options.closeOnEscape&&27===t.keyCode&&s.close()})}},close:function(e){function i(){n.state=l.CLOSED,n.$element.trigger(l.CLOSED),n.options.iframe===!0&&n.$element.find("."+r+"-iframe").attr("src",""),(n.options.bodyOverflow||h)&&(t("html").removeClass(r+"-isOverflow"),h&&t("body").css("overflow","auto")),n.options.onClosed&&"function"==typeof n.options.onClosed&&n.options.onClosed(n),n.options.restoreDefaultContent===!0&&n.$element.find("."+r+"-content").html(n.content),0===t("."+r+":visible").length&&t("html").removeClass(r+"-isAttached")}var n=this;if(this.state==l.OPENED||this.state==l.OPENING){a.off("keydown."+r),this.state=l.CLOSING,this.$element.trigger(l.CLOSING),this.$element.attr("aria-hidden","true"),clearTimeout(this.timer),clearTimeout(this.timerTimeout),n.options.onClosing&&"function"==typeof n.options.onClosing&&n.options.onClosing(this);var o=this.options.transitionOut;"object"==typeof e&&(void 0===e.transition&&void 0===e.transitionOut||(o=e.transition||e.transitionOut)),o===!1||""===o||void 0===d?(this.$element.hide(),this.$overlay.remove(),this.$navigate.remove(),i()):(this.$element.attr("class",[this.classes,r,o,"light"==this.options.theme?r+"-light":this.options.theme,this.isFullscreen===!0?"isFullscreen":"",this.options.rtl?r+"-rtl":""].join(" ")),this.$overlay.attr("class",r+"-overlay "+this.options.transitionOutOverlay),n.options.navigateArrows===!1||h||this.$navigate.attr("class",r+"-navigate fadeOut"),this.$element.one(d,function(){n.$element.hasClass(o)&&n.$element.removeClass(o+" transitionOut").hide(),n.$overlay.removeClass(n.options.transitionOutOverlay).remove(),n.$navigate.removeClass("fadeOut").remove(),i()}))}},next:function(e){var i=this,n="fadeInRight",o="fadeOutLeft",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index+1;o<=i.group.ids.length;o++){try{a["in"]=t("#"+i.group.ids[o]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o]).iziModal("open",{transition:n});break}if(o==i.group.ids.length&&e>0||i.options.loop===!0)for(var l=0;l<=i.group.ids.length;l++)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},prev:function(e){var i=this,n="fadeInLeft",o="fadeOutRight",s=t("."+r+":visible"),a={};a.out=this,void 0!==e&&"object"!=typeof e?(e.preventDefault(),s=t(e.currentTarget),n=s.attr("data-"+r+"-transitionIn"),o=s.attr("data-"+r+"-transitionOut")):void 0!==e&&(void 0!==e.transitionIn&&(n=e.transitionIn),void 0!==e.transitionOut&&(o=e.transitionOut)),this.close({transition:o}),setTimeout(function(){for(var e=t("."+r+"[data-"+r+'-group="'+i.group.name+'"][data-'+r+"-loop]").length,o=i.group.index;o>=0;o--){try{a["in"]=t("#"+i.group.ids[o-1]).data().iziModal}catch(s){}if("undefined"!=typeof a["in"]){t("#"+i.group.ids[o-1]).iziModal("open",{transition:n});break}if(0===o&&e>0||i.options.loop===!0)for(var l=i.group.ids.length-1;l>=0;l--)if(a["in"]=t("#"+i.group.ids[l]).data().iziModal,"undefined"!=typeof a["in"]){t("#"+i.group.ids[l]).iziModal("open",{transition:n});break}}},200),t(document).trigger(r+"-group-change",a)},destroy:function(){var e=t.Event("destroy");this.$element.trigger(e),a.off("keydown."+r),clearTimeout(this.timer),clearTimeout(this.timerTimeout),this.options.iframe===!0&&this.$element.find("."+r+"-iframe").remove(),this.$element.html(this.$element.find("."+r+"-content").html()),this.$element.off("click","[data-"+r+"-close]"),this.$element.off("click","[data-"+r+"-fullscreen]"),this.$element.off("."+r).removeData(r).attr("style",""),this.$overlay.remove(),this.$navigate.remove(),this.$element.trigger(l.DESTROYED),this.$element=null},getState:function(){return this.state},getGroup:function(){return this.group},setWidth:function(t){this.options.width=t,this.recalcWidth();var e=this.$element.outerWidth();this.options.navigateArrows!==!0&&"closeToModal"!=this.options.navigateArrows||(this.$navigate.find("."+r+"-navigate-prev").css("margin-left",-(e/2+84)).show(),this.$navigate.find("."+r+"-navigate-next").css("margin-right",-(e/2+84)).show())},setTop:function(t){this.options.top=t,this.recalcVerticalPos(!1)},setBottom:function(t){this.options.bottom=t,this.recalcVerticalPos(!1)},setHeader:function(t){t?this.$element.find("."+r+"-header").show():(this.headerHeight=0,this.$element.find("."+r+"-header").hide())},setTitle:function(t){this.options.title=t,0===this.headerHeight&&this.createHeader(),0===this.$header.find("."+r+"-header-title").length&&this.$header.append('<h2 class="'+r+'-header-title"></h2>'),this.$header.find("."+r+"-header-title").html(t)},setSubtitle:function(t){""===t?(this.$header.find("."+r+"-header-subtitle").remove(),this.$header.addClass(r+"-noSubtitle")):(0===this.$header.find("."+r+"-header-subtitle").length&&this.$header.append('<p class="'+r+'-header-subtitle"></p>'),this.$header.removeClass(r+"-noSubtitle")),this.$header.find("."+r+"-header-subtitle").html(t),this.options.subtitle=t},setIcon:function(t){0===this.$header.find("."+r+"-header-icon").length&&this.$header.prepend('<i class="'+r+'-header-icon"></i>'),this.$header.find("."+r+"-header-icon").attr("class",r+"-header-icon "+t),this.options.icon=t},setIconText:function(t){this.$header.find("."+r+"-header-icon").html(t),this.options.iconText=t},setHeaderColor:function(t){this.options.borderBottom===!0&&this.$element.css("border-bottom","3px solid "+t),this.$header.css("background",t),this.options.headerColor=t},setBackground:function(t){t===!1?(this.options.background=null,this.$element.css("background","")):(this.$element.css("background",t),this.options.background=t)},setZindex:function(t){isNaN(parseInt(this.options.zindex))||(this.options.zindex=t,this.$element.css("z-index",t),this.$navigate.css("z-index",t-1),this.$overlay.css("z-index",t-2))},setFullscreen:function(t){t?(this.isFullscreen=!0,this.$element.addClass("isFullscreen")):(this.isFullscreen=!1,this.$element.removeClass("isFullscreen"))},setContent:function(t){if("object"==typeof t){var e=t["default"]||!1;e===!0&&(this.content=t.content),t=t.content}this.options.iframe===!1&&this.$element.find("."+r+"-content").html(t)},setTransitionIn:function(t){this.options.transitionIn=t},setTransitionOut:function(t){this.options.transitionOut=t},setTimeout:function(t){this.options.timeout=t},resetContent:function(){this.$element.find("."+r+"-content").html(this.content)},startLoading:function(){this.$element.find("."+r+"-loader").length||this.$element.append('<div class="'+r+'-loader fadeIn"></div>'),this.$element.find("."+r+"-loader").css({top:this.headerHeight,borderRadius:this.options.radius})},stopLoading:function(){var t=this.$element.find("."+r+"-loader");t.length||(this.$element.prepend('<div class="'+r+'-loader fadeIn"></div>'),t=this.$element.find("."+r+"-loader").css("border-radius",this.options.radius)),t.removeClass("fadeIn").addClass("fadeOut"),setTimeout(function(){t.remove()},600)},recalcWidth:function(){var t=this;if(this.$element.css("max-width",this.options.width),i()){var e=t.options.width;e.toString().split("%").length>1&&(e=t.$element.outerWidth()),t.$element.css({left:"50%",marginLeft:-(e/2)})}},recalcVerticalPos:function(t){null!==this.options.top&&this.options.top!==!1?(this.$element.css("margin-top",this.options.top),0===this.options.top&&this.$element.css({borderTopRightRadius:0,borderTopLeftRadius:0})):t===!1&&this.$element.css({marginTop:"",borderRadius:this.options.radius}),null!==this.options.bottom&&this.options.bottom!==!1?(this.$element.css("margin-bottom",this.options.bottom),0===this.options.bottom&&this.$element.css({borderBottomRightRadius:0,borderBottomLeftRadius:0})):t===!1&&this.$element.css({marginBottom:"",borderRadius:this.options.radius})},recalcLayout:function(){var e=this,o=s.height(),a=this.$element.outerHeight(),d=this.$element.outerWidth(),h=this.$element.find("."+r+"-content")[0].scrollHeight,c=h+this.headerHeight,u=this.$element.innerHeight()-this.headerHeight,p=(parseInt(-((this.$element.innerHeight()+1)/2))+"px",this.$wrap.scrollTop()),f=0;i()&&(d>=s.width()||this.isFullscreen===!0?this.$element.css({left:"0",marginLeft:""}):this.$element.css({left:"50%",marginLeft:-(d/2)})),this.options.borderBottom===!0&&""!==this.options.title&&(f=3),this.$element.find("."+r+"-header").length&&this.$element.find("."+r+"-header").is(":visible")?(this.headerHeight=parseInt(this.$element.find("."+r+"-header").innerHeight()),this.$element.css("overflow","hidden")):(this.headerHeight=0,this.$element.css("overflow","")),this.$element.find("."+r+"-loader").length&&this.$element.find("."+r+"-loader").css("top",this.headerHeight),a!==this.modalHeight&&(this.modalHeight=a,this.options.onResize&&"function"==typeof this.options.onResize&&this.options.onResize(this)),this.state!=l.OPENED&&this.state!=l.OPENING||(this.options.iframe===!0&&(o<this.options.iframeHeight+this.headerHeight+f||this.isFullscreen===!0?this.$element.find("."+r+"-iframe").css("height",o-(this.headerHeight+f)):this.$element.find("."+r+"-iframe").css("height",this.options.iframeHeight)),a==o?this.$element.addClass("isAttached"):this.$element.removeClass("isAttached"),this.isFullscreen===!1&&this.$element.width()>=s.width()?this.$element.find("."+r+"-button-fullscreen").hide():this.$element.find("."+r+"-button-fullscreen").show(),this.recalcButtons(),this.isFullscreen===!1&&(o=o-(n(this.options.top)||0)-(n(this.options.bottom)||0)),c>o?(this.options.top>0&&null===this.options.bottom&&h<s.height()&&this.$element.addClass("isAttachedBottom"),this.options.bottom>0&&null===this.options.top&&h<s.height()&&this.$element.addClass("isAttachedTop"),1===t("."+r+":visible").length&&t("html").addClass(r+"-isAttached"),this.$element.css("height",o)):(this.$element.css("height",h+(this.headerHeight+f)),this.$element.removeClass("isAttachedTop isAttachedBottom"),1===t("."+r+":visible").length&&t("html").removeClass(r+"-isAttached")),function(){h>u&&c>o?(e.$element.addClass("hasScroll"),e.$wrap.css("height",a-(e.headerHeight+f))):(e.$element.removeClass("hasScroll"),e.$wrap.css("height","auto"))}(),function(){u+p<h-30?e.$element.addClass("hasShadow"):e.$element.removeClass("hasShadow")}())},recalcButtons:function(){var t=this.$header.find("."+r+"-header-buttons").innerWidth()+10;this.options.rtl===!0?this.$header.css("padding-left",t):this.$header.css("padding-right",t)}},s.off("load."+r).on("load."+r,function(e){var i=document.location.hash;if(0===window.$iziModal.autoOpen&&!t("."+r).is(":visible"))try{var n=t(i).data();"undefined"!=typeof n&&n.iziModal.options.autoOpen!==!1&&t(i).iziModal("open")}catch(o){}}),s.off("hashchange."+r).on("hashchange."+r,function(e){var i=document.location.hash;if(""!==i)try{var n=t(i).data();"undefined"!=typeof n&&"opening"!==t(i).iziModal("getState")&&setTimeout(function(){t(i).iziModal("open",{preventClose:!1})},200)}catch(o){}else window.$iziModal.history&&t.each(t("."+r),function(e,i){if(void 0!==t(i).data().iziModal){var n=t(i).iziModal("getState");"opened"!=n&&"opening"!=n||t(i).iziModal("close")}})}),a.off("click","[data-"+r+"-open]").on("click","[data-"+r+"-open]",function(e){e.preventDefault();var i=t("."+r+":visible"),n=t(e.currentTarget).attr("data-"+r+"-open"),o=t(e.currentTarget).attr("data-"+r+"-preventClose"),s=t(e.currentTarget).attr("data-"+r+"-transitionIn"),a=t(e.currentTarget).attr("data-"+r+"-transitionOut"),l=t(e.currentTarget).attr("data-"+r+"-zindex");void 0!==l&&t(n).iziModal("setZindex",l),void 0===o&&(void 0!==a?i.iziModal("close",{transition:a}):i.iziModal("close")),setTimeout(function(){void 0!==s?t(n).iziModal("open",{transition:s}):t(n).iziModal("open")},200)}),a.off("keyup."+r).on("keyup."+r,function(e){if(t("."+r+":visible").length){var i=t("."+r+":visible")[0].id,n=t("#"+i).data().iziModal.options.arrowKeys,o=t("#"+i).iziModal("getGroup"),s=e||window.event,a=s.target||s.srcElement;void 0===i||!n||void 0===o.name||s.ctrlKey||s.metaKey||s.altKey||"INPUT"===a.tagName.toUpperCase()||"TEXTAREA"==a.tagName.toUpperCase()||(37===s.keyCode?t("#"+i).iziModal("prev",s):39===s.keyCode&&t("#"+i).iziModal("next",s))}}),t.fn[r]=function(e,i){if(!t(this).length&&"object"==typeof e){var n={$el:document.createElement("div"),id:this.selector.split("#"),"class":this.selector.split(".")};if(n.id.length>1){try{n.$el=document.createElement(id[0])}catch(o){}n.$el.id=this.selector.split("#")[1].trim()}else if(n["class"].length>1){try{n.$el=document.createElement(n["class"][0])}catch(o){}for(var s=1;s<n["class"].length;s++)n.$el.classList.add(n["class"][s].trim())}document.body.appendChild(n.$el),this.push(t(this.selector))}for(var a=this,l=0;l<a.length;l++){var d=t(a[l]),h=d.data(r),u=t.extend({},t.fn[r].defaults,d.data(),"object"==typeof e&&e);if(h||e&&"object"!=typeof e){if("string"==typeof e&&"undefined"!=typeof h)return h[e].apply(h,[].concat(i))}else d.data(r,h=new c(d,u));u.autoOpen&&(isNaN(parseInt(u.autoOpen))?u.autoOpen===!0&&h.open():setTimeout(function(){h.open()},u.autoOpen),window.$iziModal.autoOpen++)}return this},t.fn[r].defaults={title:"",subtitle:"",headerColor:"#88A0B9",background:null,theme:"",icon:null,iconText:null,iconColor:"",rtl:!1,width:600,top:null,bottom:null,borderBottom:!0,padding:0,radius:3,zindex:999,iframe:!1,iframeHeight:400,iframeURL:null,focusInput:!0,group:"",loop:!1,arrowKeys:!0,navigateCaption:!0,navigateArrows:!0,history:!1,restoreDefaultContent:!1,autoOpen:0,bodyOverflow:!1,fullscreen:!1,openFullscreen:!1,closeOnEscape:!0,closeButton:!0,appendTo:"body",appendToOverlay:"body",overlay:!0,overlayClose:!0,overlayColor:"rgba(0, 0, 0, 0.4)",timeout:!1,timeoutProgressbar:!1,pauseOnHover:!1,timeoutProgressbarColor:"rgba(255,255,255,0.5)",transitionIn:"comingIn",transitionOut:"comingOut",transitionInOverlay:"fadeIn",transitionOutOverlay:"fadeOut",onFullscreen:function(){},onResize:function(){},onOpening:function(){},onOpened:function(){},onClosing:function(){},onClosed:function(){},afterRender:function(){}},t.fn[r].Constructor=c,t.fn.iziModal});
|
languages/litespeed-cache.pot
CHANGED
|
@@ -2,9 +2,9 @@
|
|
| 2 |
# This file is distributed under the same license as the LiteSpeed Cache package.
|
| 3 |
msgid ""
|
| 4 |
msgstr ""
|
| 5 |
-
"Project-Id-Version: LiteSpeed Cache
|
| 6 |
"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/litespeed-cache\n"
|
| 7 |
-
"POT-Creation-Date: 2018-
|
| 8 |
"MIME-Version: 1.0\n"
|
| 9 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
"Content-Transfer-Encoding: 8bit\n"
|
|
@@ -28,52 +28,52 @@ msgstr ""
|
|
| 28 |
msgid "Message from LiteSpeed image server"
|
| 29 |
msgstr ""
|
| 30 |
|
| 31 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 32 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 33 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 34 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 35 |
msgid "Manage"
|
| 36 |
msgstr ""
|
| 37 |
|
| 38 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 39 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 40 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 41 |
msgid "Settings"
|
| 42 |
msgstr ""
|
| 43 |
|
| 44 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 45 |
msgid "Edit .htaccess"
|
| 46 |
msgstr ""
|
| 47 |
|
| 48 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 49 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 50 |
msgid "Image Optimization"
|
| 51 |
msgstr ""
|
| 52 |
|
| 53 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 54 |
msgid "Crawler"
|
| 55 |
msgstr ""
|
| 56 |
|
| 57 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 58 |
msgid "Report"
|
| 59 |
msgstr ""
|
| 60 |
|
| 61 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 62 |
msgid "Import / Export"
|
| 63 |
msgstr ""
|
| 64 |
|
| 65 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 66 |
#: admin/tpl/setting/settings_debug.php:13
|
| 67 |
msgid "Debug Log"
|
| 68 |
msgstr ""
|
| 69 |
|
| 70 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 71 |
msgid ""
|
| 72 |
"It is recommended that LiteSpeed Cache be purged after updating a plugin."
|
| 73 |
msgstr ""
|
| 74 |
|
| 75 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 76 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 77 |
#: admin/tpl/setting/settings_inc.cache_mobile.php:67
|
| 78 |
#: admin/tpl/setting/settings_media.php:73
|
| 79 |
#: admin/tpl/setting/settings_optimize.php:160
|
|
@@ -82,28 +82,35 @@ msgstr ""
|
|
| 82 |
msgid "ON"
|
| 83 |
msgstr ""
|
| 84 |
|
| 85 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 86 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 87 |
#: admin/tpl/setting/settings_inc.cache_object.php:149
|
| 88 |
#: admin/tpl/setting/settings_tuning.php:18
|
| 89 |
#: admin/tpl/setting/settings_tuning.php:54
|
| 90 |
msgid "OFF"
|
| 91 |
msgstr ""
|
| 92 |
|
| 93 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 94 |
msgid "Recommended value: %s"
|
| 95 |
msgstr ""
|
| 96 |
|
| 97 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 98 |
msgid "API"
|
| 99 |
msgstr ""
|
| 100 |
|
| 101 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 102 |
msgid "Server variable(s) %s available to override this setting."
|
| 103 |
msgstr ""
|
| 104 |
|
| 105 |
-
#: admin/litespeed-cache-admin-display.class.php:
|
| 106 |
-
#: admin/tpl/image_optimization.php:
|
| 107 |
#: admin/tpl/manage/manage_cdn.php:60
|
| 108 |
#: admin/tpl/setting/settings_advanced.php:10
|
| 109 |
#: admin/tpl/setting/settings_advanced.php:36
|
|
@@ -126,6 +133,22 @@ msgstr ""
|
|
| 126 |
msgid "Learn More"
|
| 127 |
msgstr ""
|
| 128 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 129 |
#: admin/litespeed-cache-admin-error.class.php:87
|
| 130 |
msgid "The installed PHP version is too old for the LiteSpeed Cache Plugin."
|
| 131 |
msgstr ""
|
|
@@ -409,7 +432,7 @@ msgid "Site options saved."
|
|
| 409 |
msgstr ""
|
| 410 |
|
| 411 |
#: admin/litespeed-cache-admin-settings.class.php:342
|
| 412 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 413 |
msgid "Default Public Cache"
|
| 414 |
msgstr ""
|
| 415 |
|
|
@@ -425,65 +448,53 @@ msgstr ""
|
|
| 425 |
msgid "Feed"
|
| 426 |
msgstr ""
|
| 427 |
|
| 428 |
-
#: admin/litespeed-cache-admin-settings.class.php:346
|
| 429 |
-
msgid "404"
|
| 430 |
-
msgstr ""
|
| 431 |
-
|
| 432 |
-
#: admin/litespeed-cache-admin-settings.class.php:347
|
| 433 |
-
msgid "403"
|
| 434 |
-
msgstr ""
|
| 435 |
-
|
| 436 |
-
#: admin/litespeed-cache-admin-settings.class.php:348
|
| 437 |
-
msgid "500"
|
| 438 |
-
msgstr ""
|
| 439 |
-
|
| 440 |
#: admin/litespeed-cache-admin-settings.class.php:844
|
| 441 |
#: admin/tpl/setting/settings_debug.php:78
|
| 442 |
msgid "Log File Size Limit"
|
| 443 |
msgstr ""
|
| 444 |
|
| 445 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 446 |
#: admin/tpl/setting/settings_crawler.php:13
|
| 447 |
msgid "Delay"
|
| 448 |
msgstr ""
|
| 449 |
|
| 450 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 451 |
#: admin/tpl/setting/settings_crawler.php:37
|
| 452 |
msgid "Run Duration"
|
| 453 |
msgstr ""
|
| 454 |
|
| 455 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 456 |
msgid "Cron Interval"
|
| 457 |
msgstr ""
|
| 458 |
|
| 459 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 460 |
msgid "Whole Interval"
|
| 461 |
msgstr ""
|
| 462 |
|
| 463 |
-
#: admin/litespeed-cache-admin-settings.class.php:
|
| 464 |
#: admin/tpl/setting/settings_crawler.php:73
|
| 465 |
msgid "Threads"
|
| 466 |
msgstr ""
|
| 467 |
|
| 468 |
-
#: admin/litespeed-cache-admin.class.php:
|
| 469 |
msgid ""
|
| 470 |
"For this scenario only, the network admin may uncheck \"Check Advanced Cache"
|
| 471 |
"\" in LiteSpeed Cache settings."
|
| 472 |
msgstr ""
|
| 473 |
|
| 474 |
-
#: admin/litespeed-cache-admin.class.php:
|
| 475 |
msgid ""
|
| 476 |
"For this scenario only, please uncheck \"Check Advanced Cache\" in LiteSpeed "
|
| 477 |
"Cache settings."
|
| 478 |
msgstr ""
|
| 479 |
|
| 480 |
-
#: admin/litespeed-cache-admin.class.php:
|
| 481 |
msgid ""
|
| 482 |
"Please disable/deactivate any other Full Page Cache solutions that are "
|
| 483 |
"currently being used."
|
| 484 |
msgstr ""
|
| 485 |
|
| 486 |
-
#: admin/litespeed-cache-admin.class.php:
|
| 487 |
msgid ""
|
| 488 |
"LiteSpeed Cache does work with other cache solutions, but only their non-"
|
| 489 |
"page caching offerings—such as minifying css/js files."
|
|
@@ -540,7 +551,7 @@ msgid "Disable"
|
|
| 540 |
msgstr ""
|
| 541 |
|
| 542 |
#: admin/tpl/crawler.php:94 admin/tpl/manage/manage_cdn.php:15
|
| 543 |
-
#: admin/tpl/setting/settings_optimize.php:13 admin/tpl/settings.php:
|
| 544 |
msgid "WARNING"
|
| 545 |
msgstr ""
|
| 546 |
|
|
@@ -751,199 +762,228 @@ msgstr ""
|
|
| 751 |
msgid "A TTL of 0 indicates do not cache."
|
| 752 |
msgstr ""
|
| 753 |
|
| 754 |
-
#: admin/tpl/image_optimization.php:
|
| 755 |
msgid "Level"
|
| 756 |
msgstr ""
|
| 757 |
|
| 758 |
-
#: admin/tpl/image_optimization.php:
|
| 759 |
msgid "Credit"
|
| 760 |
msgstr ""
|
| 761 |
|
| 762 |
-
#: admin/tpl/image_optimization.php:
|
| 763 |
msgid "Credit recovers with each successful pull."
|
| 764 |
msgstr ""
|
| 765 |
|
| 766 |
-
#: admin/tpl/image_optimization.php:
|
| 767 |
msgid "Total Reduction"
|
| 768 |
msgstr ""
|
| 769 |
|
| 770 |
-
#: admin/tpl/image_optimization.php:
|
| 771 |
msgid "Images pulled"
|
| 772 |
msgstr ""
|
| 773 |
|
| 774 |
-
#: admin/tpl/image_optimization.php:
|
| 775 |
msgid "Images failed to fetch"
|
| 776 |
msgstr ""
|
| 777 |
|
| 778 |
-
#: admin/tpl/image_optimization.php:
|
| 779 |
msgid "Images failed to notify"
|
| 780 |
msgstr ""
|
| 781 |
|
| 782 |
-
#: admin/tpl/image_optimization.php:
|
| 783 |
msgid "Images failed to pull"
|
| 784 |
msgstr ""
|
| 785 |
|
| 786 |
-
#: admin/tpl/image_optimization.php:
|
| 787 |
msgid "Last Request"
|
| 788 |
msgstr ""
|
| 789 |
|
| 790 |
-
#: admin/tpl/image_optimization.php:
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 791 |
msgid "LiteSpeed Cache Image Optimization"
|
| 792 |
msgstr ""
|
| 793 |
|
| 794 |
-
#: admin/tpl/image_optimization.php:
|
| 795 |
-
msgid "
|
| 796 |
msgstr ""
|
| 797 |
|
| 798 |
-
#: admin/tpl/image_optimization.php:
|
| 799 |
-
msgid "
|
| 800 |
msgstr ""
|
| 801 |
|
| 802 |
-
#: admin/tpl/image_optimization.php:
|
| 803 |
msgid ""
|
| 804 |
"This will communicate with LiteSpeed's Image Optimization Server and "
|
| 805 |
"retrieve the most recent status."
|
| 806 |
msgstr ""
|
| 807 |
|
| 808 |
-
#: admin/tpl/image_optimization.php:
|
| 809 |
msgid "Image Information"
|
| 810 |
msgstr ""
|
| 811 |
|
| 812 |
-
#: admin/tpl/image_optimization.php:
|
| 813 |
msgid "Beta Version"
|
| 814 |
msgstr ""
|
| 815 |
|
| 816 |
-
#: admin/tpl/image_optimization.php:
|
| 817 |
-
msgid "
|
| 818 |
msgstr ""
|
| 819 |
|
| 820 |
-
#: admin/tpl/image_optimization.php:
|
| 821 |
-
msgid "
|
| 822 |
msgstr ""
|
| 823 |
|
| 824 |
-
#: admin/tpl/image_optimization.php:
|
| 825 |
-
msgid "
|
| 826 |
msgstr ""
|
| 827 |
|
| 828 |
-
#: admin/tpl/image_optimization.php:
|
| 829 |
msgid "Please press the %s button before sending a new request."
|
| 830 |
msgstr ""
|
| 831 |
|
| 832 |
-
#: admin/tpl/image_optimization.php:
|
| 833 |
msgid ""
|
| 834 |
"This will send the optimization request and the images to LiteSpeed's Image "
|
| 835 |
"Optimization Server."
|
| 836 |
msgstr ""
|
| 837 |
|
| 838 |
-
#: admin/tpl/image_optimization.php:
|
| 839 |
msgid "You can send at most %s images at once."
|
| 840 |
msgstr ""
|
| 841 |
|
| 842 |
-
#: admin/tpl/image_optimization.php:
|
| 843 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
| 844 |
msgstr ""
|
| 845 |
|
| 846 |
-
#: admin/tpl/image_optimization.php:
|
| 847 |
-
msgid "Image
|
| 848 |
msgstr ""
|
| 849 |
|
| 850 |
-
#: admin/tpl/image_optimization.php:
|
| 851 |
msgid ""
|
| 852 |
"After LiteSpeed's Image Optimization Server finishes optimization, it will "
|
| 853 |
"notify your site to pull the optimized images."
|
| 854 |
msgstr ""
|
| 855 |
|
| 856 |
-
#: admin/tpl/image_optimization.php:
|
| 857 |
msgid "This process is automatic."
|
| 858 |
msgstr ""
|
| 859 |
|
| 860 |
-
#: admin/tpl/image_optimization.php:
|
| 861 |
-
msgid "
|
| 862 |
msgstr ""
|
| 863 |
|
| 864 |
-
#: admin/tpl/image_optimization.php:
|
| 865 |
-
msgid "Pull Images"
|
| 866 |
-
msgstr ""
|
| 867 |
-
|
| 868 |
-
#: admin/tpl/image_optimization.php:142
|
| 869 |
msgid "Only press the button if the pull cron job is disabled."
|
| 870 |
msgstr ""
|
| 871 |
|
| 872 |
-
#: admin/tpl/image_optimization.php:
|
| 873 |
msgid "Images will be pulled automatically if the cron job is running."
|
| 874 |
msgstr ""
|
| 875 |
|
| 876 |
-
#: admin/tpl/image_optimization.php:
|
| 877 |
msgid "Last pull initiated by cron at %s."
|
| 878 |
msgstr ""
|
| 879 |
|
| 880 |
-
#: admin/tpl/image_optimization.php:
|
| 881 |
-
msgid "
|
| 882 |
msgstr ""
|
| 883 |
|
| 884 |
-
#: admin/tpl/image_optimization.php:
|
| 885 |
msgid "Revert Optimization"
|
| 886 |
msgstr ""
|
| 887 |
|
| 888 |
-
#: admin/tpl/image_optimization.php:
|
| 889 |
msgid ""
|
| 890 |
"Switch all images in the media library back to their original unoptimized "
|
| 891 |
"versions."
|
| 892 |
msgstr ""
|
| 893 |
|
| 894 |
-
#: admin/tpl/image_optimization.php:
|
| 895 |
msgid "Undo Optimization"
|
| 896 |
msgstr ""
|
| 897 |
|
| 898 |
-
#: admin/tpl/image_optimization.php:
|
| 899 |
msgid "Revert all optimized images back to their original versions."
|
| 900 |
msgstr ""
|
| 901 |
|
| 902 |
-
#: admin/tpl/image_optimization.php:
|
| 903 |
msgid "Re-do Optimization"
|
| 904 |
msgstr ""
|
| 905 |
|
| 906 |
-
#: admin/tpl/image_optimization.php:
|
| 907 |
msgid "Switch back to using optimized images."
|
| 908 |
msgstr ""
|
| 909 |
|
| 910 |
-
#: admin/tpl/image_optimization.php:
|
| 911 |
msgid "Results can be checked in <a %s>Media Library</a>."
|
| 912 |
msgstr ""
|
| 913 |
|
| 914 |
-
#: admin/tpl/image_optimization.php:
|
| 915 |
msgid "Send New Thumbnail Requests"
|
| 916 |
msgstr ""
|
| 917 |
|
| 918 |
-
#: admin/tpl/image_optimization.php:
|
| 919 |
msgid ""
|
| 920 |
"Scan for any new unoptimized image thumbnail sizes and resend necessary "
|
| 921 |
"image optimization requests."
|
| 922 |
msgstr ""
|
| 923 |
|
| 924 |
-
#: admin/tpl/image_optimization.php:
|
| 925 |
msgid "Reset IAPI Key"
|
| 926 |
msgstr ""
|
| 927 |
|
| 928 |
-
#: admin/tpl/image_optimization.php:
|
| 929 |
msgid ""
|
| 930 |
"The current IAPI key must be reset after changing home URL or domain before "
|
| 931 |
"making any further optimization requests."
|
| 932 |
msgstr ""
|
| 933 |
|
| 934 |
-
#: admin/tpl/image_optimization.php:
|
| 935 |
msgid "Destroy All Optimization Data!"
|
| 936 |
msgstr ""
|
| 937 |
|
| 938 |
-
#: admin/tpl/image_optimization.php:
|
| 939 |
msgid ""
|
| 940 |
"Remove all previous image optimization requests/results, revert completed "
|
| 941 |
"optimizations, and delete all optimization files."
|
| 942 |
msgstr ""
|
| 943 |
|
| 944 |
-
#: admin/tpl/image_optimization.php:
|
| 945 |
#: admin/tpl/setting/settings_advanced.php:50
|
| 946 |
#: admin/tpl/setting/settings_cdn.php:97
|
|
|
|
|
|
|
|
|
|
| 947 |
#: admin/tpl/setting/settings_excludes.php:63
|
| 948 |
#: admin/tpl/setting/settings_excludes.php:101
|
| 949 |
#: admin/tpl/setting/settings_inc.cache_browser.php:12
|
|
@@ -957,16 +997,16 @@ msgstr ""
|
|
| 957 |
#: admin/tpl/setting/settings_optimize.php:162
|
| 958 |
#: admin/tpl/setting/settings_tuning.php:20
|
| 959 |
#: admin/tpl/setting/settings_tuning.php:56
|
| 960 |
-
msgid "NOTE
|
| 961 |
msgstr ""
|
| 962 |
|
| 963 |
-
#: admin/tpl/image_optimization.php:
|
| 964 |
msgid ""
|
| 965 |
"If there are unfinished requests in progress, the requests' credits will NOT "
|
| 966 |
"be recovered."
|
| 967 |
msgstr ""
|
| 968 |
|
| 969 |
-
#: admin/tpl/image_optimization.php:
|
| 970 |
#: admin/tpl/setting/settings_optimize.php:87
|
| 971 |
#: admin/tpl/setting/settings_optimize.php:163
|
| 972 |
msgid "JS Combine"
|
|
@@ -1011,16 +1051,26 @@ msgid ""
|
|
| 1011 |
"Cache settings."
|
| 1012 |
msgstr ""
|
| 1013 |
|
| 1014 |
-
#: admin/tpl/inc/admin_footer.php:
|
| 1015 |
-
msgid ""
|
| 1016 |
-
"Rate <strong>LiteSpeed Cache</strong> with %s on WordPress.org if you like "
|
| 1017 |
-
"us!"
|
| 1018 |
msgstr ""
|
| 1019 |
|
| 1020 |
-
|
| 1021 |
-
|
| 1022 |
-
|
| 1023 |
-
"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1024 |
msgstr ""
|
| 1025 |
|
| 1026 |
#: admin/tpl/inc/api_key.php:11
|
|
@@ -1387,8 +1437,8 @@ msgstr ""
|
|
| 1387 |
msgid "Are you sure you want to purge all?"
|
| 1388 |
msgstr ""
|
| 1389 |
|
| 1390 |
-
#: admin/tpl/manage/manage_purge.php:61 inc/gui.class.php:
|
| 1391 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 1392 |
msgid "Object Cache Purge All"
|
| 1393 |
msgstr ""
|
| 1394 |
|
|
@@ -1396,8 +1446,8 @@ msgstr ""
|
|
| 1396 |
msgid "Purge all the object caches"
|
| 1397 |
msgstr ""
|
| 1398 |
|
| 1399 |
-
#: admin/tpl/manage/manage_purge.php:71 inc/gui.class.php:
|
| 1400 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 1401 |
msgid "Opcode Cache Purge All"
|
| 1402 |
msgstr ""
|
| 1403 |
|
|
@@ -1512,8 +1562,8 @@ msgstr ""
|
|
| 1512 |
msgid "DB Optimizer"
|
| 1513 |
msgstr ""
|
| 1514 |
|
| 1515 |
-
#: admin/tpl/manage.php:12 admin/tpl/setting/settings_cdn.php:
|
| 1516 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1517 |
msgid "CDN"
|
| 1518 |
msgstr ""
|
| 1519 |
|
|
@@ -1824,8 +1874,7 @@ msgstr ""
|
|
| 1824 |
|
| 1825 |
#: admin/tpl/setting/settings_cdn.php:98
|
| 1826 |
msgid ""
|
| 1827 |
-
"
|
| 1828 |
-
"will override the others."
|
| 1829 |
msgstr ""
|
| 1830 |
|
| 1831 |
#: admin/tpl/setting/settings_cdn.php:103
|
|
@@ -1891,14 +1940,6 @@ msgstr ""
|
|
| 1891 |
msgid "Off"
|
| 1892 |
msgstr ""
|
| 1893 |
|
| 1894 |
-
#: admin/tpl/setting/settings_cdn.php:160
|
| 1895 |
-
msgid "Google"
|
| 1896 |
-
msgstr ""
|
| 1897 |
-
|
| 1898 |
-
#: admin/tpl/setting/settings_cdn.php:166
|
| 1899 |
-
msgid "Cdnjs"
|
| 1900 |
-
msgstr ""
|
| 1901 |
-
|
| 1902 |
#: admin/tpl/setting/settings_cdn.php:170
|
| 1903 |
msgid ""
|
| 1904 |
"Improve page load time by loading jQuery from a remote CDN service instead "
|
|
@@ -1910,76 +1951,64 @@ msgid "Quic Cloud API"
|
|
| 1910 |
msgstr ""
|
| 1911 |
|
| 1912 |
#: admin/tpl/setting/settings_cdn.php:180
|
| 1913 |
-
|
|
|
|
| 1914 |
msgstr ""
|
| 1915 |
|
| 1916 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1917 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1918 |
msgid "This can be managed from <a %2$s>%1$s</a>."
|
| 1919 |
msgstr ""
|
| 1920 |
|
| 1921 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1922 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1923 |
msgid "Email Address"
|
| 1924 |
msgstr ""
|
| 1925 |
|
| 1926 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1927 |
-
|
|
|
|
| 1928 |
msgstr ""
|
| 1929 |
|
| 1930 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1931 |
msgid "User API Key"
|
| 1932 |
msgstr ""
|
| 1933 |
|
| 1934 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1935 |
-
|
|
|
|
| 1936 |
msgstr ""
|
| 1937 |
|
| 1938 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1939 |
-
|
|
|
|
| 1940 |
msgstr ""
|
| 1941 |
|
| 1942 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1943 |
msgid "Site Domain"
|
| 1944 |
msgstr ""
|
| 1945 |
|
| 1946 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1947 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1948 |
msgid "You can just type part of the domain."
|
| 1949 |
msgstr ""
|
| 1950 |
|
| 1951 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1952 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1953 |
msgid ""
|
| 1954 |
"Once saved, it will be matched with the current list and completed "
|
| 1955 |
"automatically."
|
| 1956 |
msgstr ""
|
| 1957 |
|
| 1958 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1959 |
msgid "Cloudflare API"
|
| 1960 |
msgstr ""
|
| 1961 |
|
| 1962 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1963 |
-
msgid "Use Cloudflare API functionality."
|
| 1964 |
-
msgstr ""
|
| 1965 |
-
|
| 1966 |
-
#: admin/tpl/setting/settings_cdn.php:232
|
| 1967 |
-
msgid "Your Email address on Cloudflare."
|
| 1968 |
-
msgstr ""
|
| 1969 |
-
|
| 1970 |
-
#: admin/tpl/setting/settings_cdn.php:237
|
| 1971 |
msgid "Global API Key"
|
| 1972 |
msgstr ""
|
| 1973 |
|
| 1974 |
-
#: admin/tpl/setting/settings_cdn.php:
|
| 1975 |
-
msgid "Your API key is used to access Cloudflare APIs."
|
| 1976 |
-
msgstr ""
|
| 1977 |
-
|
| 1978 |
-
#: admin/tpl/setting/settings_cdn.php:242
|
| 1979 |
-
msgid "Get it from <a %s>Cloudflare account</a>."
|
| 1980 |
-
msgstr ""
|
| 1981 |
-
|
| 1982 |
-
#: admin/tpl/setting/settings_cdn.php:247
|
| 1983 |
msgid "Domain"
|
| 1984 |
msgstr ""
|
| 1985 |
|
|
@@ -2030,12 +2059,6 @@ msgid ""
|
|
| 2030 |
"Specify time in microseconds for the delay between requests during a crawl."
|
| 2031 |
msgstr ""
|
| 2032 |
|
| 2033 |
-
#: admin/tpl/setting/settings_crawler.php:22
|
| 2034 |
-
#: admin/tpl/setting/settings_crawler.php:95
|
| 2035 |
-
#: admin/tpl/setting/settings_crawler.php:100
|
| 2036 |
-
msgid "NOTE"
|
| 2037 |
-
msgstr ""
|
| 2038 |
-
|
| 2039 |
#: admin/tpl/setting/settings_crawler.php:23
|
| 2040 |
msgid "Server allowed min value"
|
| 2041 |
msgstr ""
|
|
@@ -2108,69 +2131,91 @@ msgid ""
|
|
| 2108 |
msgstr ""
|
| 2109 |
|
| 2110 |
#: admin/tpl/setting/settings_crawler.php:139
|
| 2111 |
-
|
| 2112 |
-
|
|
|
|
|
|
|
|
|
|
| 2113 |
msgstr ""
|
| 2114 |
|
| 2115 |
#: admin/tpl/setting/settings_crawler.php:144
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2116 |
msgid ""
|
| 2117 |
"The crawler can use your Google XML Sitemap instead of its own. Enter the "
|
| 2118 |
"full URL to your sitemap here."
|
| 2119 |
msgstr ""
|
| 2120 |
|
| 2121 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2122 |
msgid "Sitemap Generation"
|
| 2123 |
msgstr ""
|
| 2124 |
|
| 2125 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2126 |
msgid "Include Posts"
|
| 2127 |
msgstr ""
|
| 2128 |
|
| 2129 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2130 |
msgid "Include Pages"
|
| 2131 |
msgstr ""
|
| 2132 |
|
| 2133 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2134 |
msgid "Include Categories"
|
| 2135 |
msgstr ""
|
| 2136 |
|
| 2137 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2138 |
msgid "Include Tags"
|
| 2139 |
msgstr ""
|
| 2140 |
|
| 2141 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2142 |
msgid "Exclude Custom Post Types"
|
| 2143 |
msgstr ""
|
| 2144 |
|
| 2145 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2146 |
msgid "Exclude certain Custom Post Types in sitemap."
|
| 2147 |
msgstr ""
|
| 2148 |
|
| 2149 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2150 |
msgid "Available Custom Post Type"
|
| 2151 |
msgstr ""
|
| 2152 |
|
| 2153 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2154 |
msgid "Order links by"
|
| 2155 |
msgstr ""
|
| 2156 |
|
| 2157 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2158 |
msgid "Date, descending (Default)"
|
| 2159 |
msgstr ""
|
| 2160 |
|
| 2161 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2162 |
msgid "Date, ascending"
|
| 2163 |
msgstr ""
|
| 2164 |
|
| 2165 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2166 |
msgid "Alphabetical, descending"
|
| 2167 |
msgstr ""
|
| 2168 |
|
| 2169 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2170 |
msgid "Alphabetical, ascending"
|
| 2171 |
msgstr ""
|
| 2172 |
|
| 2173 |
-
#: admin/tpl/setting/settings_crawler.php:
|
| 2174 |
msgid "These options will be invalid when using %s."
|
| 2175 |
msgstr ""
|
| 2176 |
|
|
@@ -2645,14 +2690,6 @@ msgstr ""
|
|
| 2645 |
msgid "If %1$s is %2$s, then %3$s must be populated!"
|
| 2646 |
msgstr ""
|
| 2647 |
|
| 2648 |
-
#: admin/tpl/setting/settings_inc.cache_object.php:4
|
| 2649 |
-
msgid "Enabled"
|
| 2650 |
-
msgstr ""
|
| 2651 |
-
|
| 2652 |
-
#: admin/tpl/setting/settings_inc.cache_object.php:5
|
| 2653 |
-
msgid "Disabled"
|
| 2654 |
-
msgstr ""
|
| 2655 |
-
|
| 2656 |
#: admin/tpl/setting/settings_inc.cache_object.php:12
|
| 2657 |
msgid "Not Available"
|
| 2658 |
msgstr ""
|
|
@@ -2966,16 +3003,6 @@ msgstr ""
|
|
| 2966 |
msgid "Both full URLs and partial strings can be used."
|
| 2967 |
msgstr ""
|
| 2968 |
|
| 2969 |
-
#: admin/tpl/setting/settings_media.php:36
|
| 2970 |
-
#: admin/tpl/setting/settings_optimize.php:137
|
| 2971 |
-
#: admin/tpl/setting/settings_tuning.php:24
|
| 2972 |
-
#: admin/tpl/setting/settings_tuning.php:40
|
| 2973 |
-
#: admin/tpl/setting/settings_tuning.php:60
|
| 2974 |
-
#: admin/tpl/setting/settings_tuning.php:76
|
| 2975 |
-
#: admin/tpl/setting/settings_tuning.php:148
|
| 2976 |
-
msgid "API:"
|
| 2977 |
-
msgstr ""
|
| 2978 |
-
|
| 2979 |
#: admin/tpl/setting/settings_media.php:37
|
| 2980 |
#: admin/tpl/setting/settings_tuning.php:41
|
| 2981 |
#: admin/tpl/setting/settings_tuning.php:77
|
|
@@ -3288,7 +3315,7 @@ msgstr ""
|
|
| 3288 |
|
| 3289 |
#: admin/tpl/setting/settings_purge.php:51
|
| 3290 |
#: thirdparty/lscwp-3rd-woocommerce.cls.php:858
|
| 3291 |
-
msgid "Note
|
| 3292 |
msgstr ""
|
| 3293 |
|
| 3294 |
#: admin/tpl/setting/settings_purge.php:53
|
|
@@ -3513,29 +3540,29 @@ msgstr ""
|
|
| 3513 |
msgid "Compatibilities"
|
| 3514 |
msgstr ""
|
| 3515 |
|
| 3516 |
-
#: admin/tpl/settings.php:
|
| 3517 |
msgid "LiteSpeed Cache Settings"
|
| 3518 |
msgstr ""
|
| 3519 |
|
| 3520 |
-
#: admin/tpl/settings.php:
|
| 3521 |
msgid "Basic View"
|
| 3522 |
msgstr ""
|
| 3523 |
|
| 3524 |
-
#: admin/tpl/settings.php:
|
| 3525 |
msgid "Advanced View"
|
| 3526 |
msgstr ""
|
| 3527 |
|
| 3528 |
-
#: admin/tpl/settings.php:
|
| 3529 |
msgid "The network admin selected use primary site configs for all subsites."
|
| 3530 |
msgstr ""
|
| 3531 |
|
| 3532 |
-
#: admin/tpl/settings.php:
|
| 3533 |
msgid ""
|
| 3534 |
"The following options are selected, but are not editable in this settings "
|
| 3535 |
"page."
|
| 3536 |
msgstr ""
|
| 3537 |
|
| 3538 |
-
#: admin/tpl/settings.php:
|
| 3539 |
msgid "Save Changes"
|
| 3540 |
msgstr ""
|
| 3541 |
|
|
@@ -3555,27 +3582,27 @@ msgstr ""
|
|
| 3555 |
msgid "Purged the tags!"
|
| 3556 |
msgstr ""
|
| 3557 |
|
| 3558 |
-
#: inc/cdn.class.php:
|
| 3559 |
msgid "Notified Cloudflare to set development mode to %s successfully."
|
| 3560 |
msgstr ""
|
| 3561 |
|
| 3562 |
-
#: inc/cdn.class.php:
|
| 3563 |
msgid "Cloudflare API is set to off."
|
| 3564 |
msgstr ""
|
| 3565 |
|
| 3566 |
-
#: inc/cdn.class.php:
|
| 3567 |
msgid "Notified Cloudflare to purge all successfully."
|
| 3568 |
msgstr ""
|
| 3569 |
|
| 3570 |
-
#: inc/cdn.class.php:
|
| 3571 |
msgid "No available Cloudflare zone"
|
| 3572 |
msgstr ""
|
| 3573 |
|
| 3574 |
-
#: inc/cdn.class.php:
|
| 3575 |
msgid "Communicated with Cloudflare successfully."
|
| 3576 |
msgstr ""
|
| 3577 |
|
| 3578 |
-
#: inc/cdn.class.php:
|
| 3579 |
msgid "Failed to communicate with Cloudflare"
|
| 3580 |
msgstr ""
|
| 3581 |
|
|
@@ -3599,167 +3626,172 @@ msgstr ""
|
|
| 3599 |
msgid "Position reset notification sent successfully"
|
| 3600 |
msgstr ""
|
| 3601 |
|
| 3602 |
-
#: inc/crawler.class.php:
|
| 3603 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3604 |
msgid "Crawler %s reached end of sitemap file."
|
| 3605 |
msgstr ""
|
| 3606 |
|
| 3607 |
-
#: inc/crawler.class.php:
|
| 3608 |
-
#: includes/litespeed-cache-crawler.class.php:
|
| 3609 |
-
#: includes/litespeed-cache-crawler.class.php:
|
| 3610 |
msgid "Guest"
|
| 3611 |
msgstr ""
|
| 3612 |
|
| 3613 |
-
#: inc/gui.class.php:
|
| 3614 |
msgid "Purge this page"
|
| 3615 |
msgstr ""
|
| 3616 |
|
| 3617 |
-
#: inc/gui.class.php:
|
| 3618 |
msgid "Mark this page as "
|
| 3619 |
msgstr ""
|
| 3620 |
|
| 3621 |
-
#: inc/gui.class.php:
|
| 3622 |
msgid "Non cacheable"
|
| 3623 |
msgstr ""
|
| 3624 |
|
| 3625 |
-
#: inc/gui.class.php:
|
| 3626 |
msgid "Private cache"
|
| 3627 |
msgstr ""
|
| 3628 |
|
| 3629 |
-
#: inc/gui.class.php:
|
| 3630 |
msgid "No optimization"
|
| 3631 |
msgstr ""
|
| 3632 |
|
| 3633 |
-
#: inc/gui.class.php:
|
| 3634 |
msgid "More settings"
|
| 3635 |
msgstr ""
|
| 3636 |
|
| 3637 |
-
#: inc/gui.class.php:
|
| 3638 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 3639 |
-
#: includes/litespeed-cache-gui.class.php:
|
| 3640 |
msgid "LiteSpeed Cache Purge All"
|
| 3641 |
msgstr ""
|
| 3642 |
|
| 3643 |
-
#: inc/gui.class.php:
|
| 3644 |
msgid "Cloudflare Purge All"
|
| 3645 |
msgstr ""
|
| 3646 |
|
| 3647 |
-
#: inc/
|
| 3648 |
-
msgid "
|
| 3649 |
msgstr ""
|
| 3650 |
|
| 3651 |
-
#: inc/
|
| 3652 |
-
msgid "
|
| 3653 |
msgstr ""
|
| 3654 |
|
| 3655 |
-
#: inc/
|
| 3656 |
-
|
|
|
|
| 3657 |
msgstr ""
|
| 3658 |
|
| 3659 |
-
#: inc/
|
| 3660 |
-
msgid "
|
| 3661 |
msgstr ""
|
| 3662 |
|
| 3663 |
-
#: inc/
|
| 3664 |
-
msgid "
|
| 3665 |
msgstr ""
|
| 3666 |
|
| 3667 |
-
#: inc/
|
| 3668 |
-
msgid "
|
| 3669 |
msgstr ""
|
| 3670 |
|
| 3671 |
-
#: inc/
|
| 3672 |
-
msgid "
|
| 3673 |
msgstr ""
|
| 3674 |
|
| 3675 |
-
#: inc/
|
| 3676 |
-
msgid "
|
| 3677 |
msgstr ""
|
| 3678 |
|
| 3679 |
-
#: inc/
|
| 3680 |
-
msgid "
|
|
|
|
|
|
|
| 3681 |
msgstr ""
|
| 3682 |
|
| 3683 |
-
#: inc/
|
| 3684 |
-
msgid "
|
| 3685 |
msgstr ""
|
| 3686 |
|
| 3687 |
-
#: inc/
|
| 3688 |
-
msgid "
|
| 3689 |
msgstr ""
|
| 3690 |
|
| 3691 |
-
#: inc/
|
| 3692 |
-
msgid "
|
| 3693 |
msgstr ""
|
| 3694 |
|
| 3695 |
-
#: inc/
|
| 3696 |
-
msgid "
|
| 3697 |
msgstr ""
|
| 3698 |
|
| 3699 |
-
#: inc/
|
| 3700 |
-
msgid "
|
| 3701 |
msgstr ""
|
| 3702 |
|
| 3703 |
-
#: inc/
|
| 3704 |
-
msgid "
|
| 3705 |
msgstr ""
|
| 3706 |
|
| 3707 |
-
#: inc/
|
| 3708 |
-
msgid "
|
| 3709 |
msgstr ""
|
| 3710 |
|
| 3711 |
-
#: inc/
|
| 3712 |
-
msgid "
|
| 3713 |
msgstr ""
|
| 3714 |
|
| 3715 |
-
#: inc/
|
| 3716 |
-
msgid "
|
| 3717 |
msgstr ""
|
| 3718 |
|
| 3719 |
-
#: inc/
|
| 3720 |
-
msgid "
|
| 3721 |
msgstr ""
|
| 3722 |
|
| 3723 |
-
#: inc/
|
| 3724 |
-
msgid "
|
| 3725 |
msgstr ""
|
| 3726 |
|
| 3727 |
-
#: inc/
|
| 3728 |
-
msgid "
|
| 3729 |
msgstr ""
|
| 3730 |
|
| 3731 |
-
#: inc/
|
| 3732 |
-
msgid "
|
| 3733 |
msgstr ""
|
| 3734 |
|
| 3735 |
-
#: inc/
|
| 3736 |
-
msgid "
|
| 3737 |
msgstr ""
|
| 3738 |
|
| 3739 |
-
#: inc/media.class.php:
|
| 3740 |
-
msgid "
|
| 3741 |
msgstr ""
|
| 3742 |
|
| 3743 |
-
#: inc/media.class.php:
|
| 3744 |
-
msgid "
|
| 3745 |
msgstr ""
|
| 3746 |
|
| 3747 |
-
#: inc/media.class.php:
|
| 3748 |
-
msgid "
|
| 3749 |
msgstr ""
|
| 3750 |
|
| 3751 |
-
#: inc/media.class.php:
|
| 3752 |
-
msgid ""
|
| 3753 |
-
"Pushed %1$s groups with %2$s images to LiteSpeed optimization server, "
|
| 3754 |
-
"accepted %3$s groups with %4$s images."
|
| 3755 |
msgstr ""
|
| 3756 |
|
| 3757 |
-
#: inc/media.class.php:
|
| 3758 |
-
msgid "
|
| 3759 |
msgstr ""
|
| 3760 |
|
| 3761 |
-
#: inc/media.class.php:
|
| 3762 |
-
msgid "
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3763 |
msgstr ""
|
| 3764 |
|
| 3765 |
#: inc/purge.class.php:64 includes/litespeed-cache-purge.class.php:64
|
|
@@ -3806,35 +3838,35 @@ msgstr ""
|
|
| 3806 |
msgid " %s ago"
|
| 3807 |
msgstr ""
|
| 3808 |
|
| 3809 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3810 |
msgid "Cannot read meta file: %s"
|
| 3811 |
msgstr ""
|
| 3812 |
|
| 3813 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3814 |
msgid "Oh look, there is already another LiteSpeed crawler running!"
|
| 3815 |
msgstr ""
|
| 3816 |
|
| 3817 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3818 |
msgid "Stopped due to load hit the maximum."
|
| 3819 |
msgstr ""
|
| 3820 |
|
| 3821 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3822 |
msgid "Stopped due to error when crawling urls %1$s : %2$s"
|
| 3823 |
msgstr ""
|
| 3824 |
|
| 3825 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3826 |
msgid "Stopped: crawler disabled by the server admin"
|
| 3827 |
msgstr ""
|
| 3828 |
|
| 3829 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3830 |
msgid "Stopped due to exceeding defined Maximum Run Time"
|
| 3831 |
msgstr ""
|
| 3832 |
|
| 3833 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3834 |
msgid "Stopped due to reset meta position"
|
| 3835 |
msgstr ""
|
| 3836 |
|
| 3837 |
-
#: lib/litespeed/litespeed-crawler.class.php:
|
| 3838 |
msgid "Stopped due to load over limit"
|
| 3839 |
msgstr ""
|
| 3840 |
|
|
@@ -3931,10 +3963,6 @@ msgstr ""
|
|
| 3931 |
msgid "To test the cart, visit the <a %s>FAQ</a>."
|
| 3932 |
msgstr ""
|
| 3933 |
|
| 3934 |
-
#. Plugin Name of the plugin/theme
|
| 3935 |
-
msgid "LiteSpeed Cache"
|
| 3936 |
-
msgstr ""
|
| 3937 |
-
|
| 3938 |
#. Plugin URI of the plugin/theme
|
| 3939 |
msgid ""
|
| 3940 |
"https://www.litespeedtech.com/products/cache-plugins/wordpress-acceleration"
|
| 2 |
# This file is distributed under the same license as the LiteSpeed Cache package.
|
| 3 |
msgid ""
|
| 4 |
msgstr ""
|
| 5 |
+
"Project-Id-Version: LiteSpeed Cache 2.0\n"
|
| 6 |
"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/litespeed-cache\n"
|
| 7 |
+
"POT-Creation-Date: 2018-03-07 18:04:04+00:00\n"
|
| 8 |
"MIME-Version: 1.0\n"
|
| 9 |
"Content-Type: text/plain; charset=UTF-8\n"
|
| 10 |
"Content-Transfer-Encoding: 8bit\n"
|
| 28 |
msgid "Message from LiteSpeed image server"
|
| 29 |
msgstr ""
|
| 30 |
|
| 31 |
+
#: admin/litespeed-cache-admin-display.class.php:152
|
| 32 |
+
#: admin/tpl/setting/settings_cdn.php:203
|
| 33 |
+
#: admin/tpl/setting/settings_cdn.php:246 inc/gui.class.php:273
|
| 34 |
+
#: includes/litespeed-cache-gui.class.php:273
|
| 35 |
msgid "Manage"
|
| 36 |
msgstr ""
|
| 37 |
|
| 38 |
+
#: admin/litespeed-cache-admin-display.class.php:154
|
| 39 |
+
#: admin/litespeed-cache-admin-display.class.php:243 inc/gui.class.php:281
|
| 40 |
+
#: includes/litespeed-cache-gui.class.php:281
|
| 41 |
msgid "Settings"
|
| 42 |
msgstr ""
|
| 43 |
|
| 44 |
+
#: admin/litespeed-cache-admin-display.class.php:157
|
| 45 |
msgid "Edit .htaccess"
|
| 46 |
msgstr ""
|
| 47 |
|
| 48 |
+
#: admin/litespeed-cache-admin-display.class.php:161 inc/gui.class.php:290
|
| 49 |
+
#: includes/litespeed-cache-gui.class.php:290
|
| 50 |
msgid "Image Optimization"
|
| 51 |
msgstr ""
|
| 52 |
|
| 53 |
+
#: admin/litespeed-cache-admin-display.class.php:162 admin/tpl/settings.php:24
|
| 54 |
msgid "Crawler"
|
| 55 |
msgstr ""
|
| 56 |
|
| 57 |
+
#: admin/litespeed-cache-admin-display.class.php:163
|
| 58 |
msgid "Report"
|
| 59 |
msgstr ""
|
| 60 |
|
| 61 |
+
#: admin/litespeed-cache-admin-display.class.php:164
|
| 62 |
msgid "Import / Export"
|
| 63 |
msgstr ""
|
| 64 |
|
| 65 |
+
#: admin/litespeed-cache-admin-display.class.php:167
|
| 66 |
#: admin/tpl/setting/settings_debug.php:13
|
| 67 |
msgid "Debug Log"
|
| 68 |
msgstr ""
|
| 69 |
|
| 70 |
+
#: admin/litespeed-cache-admin-display.class.php:263
|
| 71 |
msgid ""
|
| 72 |
"It is recommended that LiteSpeed Cache be purged after updating a plugin."
|
| 73 |
msgstr ""
|
| 74 |
|
| 75 |
+
#: admin/litespeed-cache-admin-display.class.php:805
|
| 76 |
+
#: admin/litespeed-cache-admin-display.class.php:890
|
| 77 |
#: admin/tpl/setting/settings_inc.cache_mobile.php:67
|
| 78 |
#: admin/tpl/setting/settings_media.php:73
|
| 79 |
#: admin/tpl/setting/settings_optimize.php:160
|
| 82 |
msgid "ON"
|
| 83 |
msgstr ""
|
| 84 |
|
| 85 |
+
#: admin/litespeed-cache-admin-display.class.php:806
|
| 86 |
+
#: admin/litespeed-cache-admin-display.class.php:894
|
| 87 |
#: admin/tpl/setting/settings_inc.cache_object.php:149
|
| 88 |
#: admin/tpl/setting/settings_tuning.php:18
|
| 89 |
#: admin/tpl/setting/settings_tuning.php:54
|
| 90 |
msgid "OFF"
|
| 91 |
msgstr ""
|
| 92 |
|
| 93 |
+
#: admin/litespeed-cache-admin-display.class.php:920
|
| 94 |
msgid "Recommended value: %s"
|
| 95 |
msgstr ""
|
| 96 |
|
| 97 |
+
#: admin/litespeed-cache-admin-display.class.php:936
|
| 98 |
+
#: admin/tpl/setting/settings_media.php:36
|
| 99 |
+
#: admin/tpl/setting/settings_optimize.php:137
|
| 100 |
+
#: admin/tpl/setting/settings_tuning.php:24
|
| 101 |
+
#: admin/tpl/setting/settings_tuning.php:40
|
| 102 |
+
#: admin/tpl/setting/settings_tuning.php:60
|
| 103 |
+
#: admin/tpl/setting/settings_tuning.php:76
|
| 104 |
+
#: admin/tpl/setting/settings_tuning.php:148
|
| 105 |
msgid "API"
|
| 106 |
msgstr ""
|
| 107 |
|
| 108 |
+
#: admin/litespeed-cache-admin-display.class.php:937
|
| 109 |
msgid "Server variable(s) %s available to override this setting."
|
| 110 |
msgstr ""
|
| 111 |
|
| 112 |
+
#: admin/litespeed-cache-admin-display.class.php:939
|
| 113 |
+
#: admin/tpl/image_optimization.php:154 admin/tpl/image_optimization.php:211
|
| 114 |
#: admin/tpl/manage/manage_cdn.php:60
|
| 115 |
#: admin/tpl/setting/settings_advanced.php:10
|
| 116 |
#: admin/tpl/setting/settings_advanced.php:36
|
| 133 |
msgid "Learn More"
|
| 134 |
msgstr ""
|
| 135 |
|
| 136 |
+
#: admin/litespeed-cache-admin-display.class.php:954
|
| 137 |
+
msgid "%s groups"
|
| 138 |
+
msgstr ""
|
| 139 |
+
|
| 140 |
+
#: admin/litespeed-cache-admin-display.class.php:957
|
| 141 |
+
msgid "%s images"
|
| 142 |
+
msgstr ""
|
| 143 |
+
|
| 144 |
+
#: admin/litespeed-cache-admin-display.class.php:967
|
| 145 |
+
msgid "%s group"
|
| 146 |
+
msgstr ""
|
| 147 |
+
|
| 148 |
+
#: admin/litespeed-cache-admin-display.class.php:970
|
| 149 |
+
msgid "%s image"
|
| 150 |
+
msgstr ""
|
| 151 |
+
|
| 152 |
#: admin/litespeed-cache-admin-error.class.php:87
|
| 153 |
msgid "The installed PHP version is too old for the LiteSpeed Cache Plugin."
|
| 154 |
msgstr ""
|
| 432 |
msgstr ""
|
| 433 |
|
| 434 |
#: admin/litespeed-cache-admin-settings.class.php:342
|
| 435 |
+
#: admin/litespeed-cache-admin-settings.class.php:994
|
| 436 |
msgid "Default Public Cache"
|
| 437 |
msgstr ""
|
| 438 |
|
| 448 |
msgid "Feed"
|
| 449 |
msgstr ""
|
| 450 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 451 |
#: admin/litespeed-cache-admin-settings.class.php:844
|
| 452 |
#: admin/tpl/setting/settings_debug.php:78
|
| 453 |
msgid "Log File Size Limit"
|
| 454 |
msgstr ""
|
| 455 |
|
| 456 |
+
#: admin/litespeed-cache-admin-settings.class.php:917
|
| 457 |
#: admin/tpl/setting/settings_crawler.php:13
|
| 458 |
msgid "Delay"
|
| 459 |
msgstr ""
|
| 460 |
|
| 461 |
+
#: admin/litespeed-cache-admin-settings.class.php:918
|
| 462 |
#: admin/tpl/setting/settings_crawler.php:37
|
| 463 |
msgid "Run Duration"
|
| 464 |
msgstr ""
|
| 465 |
|
| 466 |
+
#: admin/litespeed-cache-admin-settings.class.php:919
|
| 467 |
msgid "Cron Interval"
|
| 468 |
msgstr ""
|
| 469 |
|
| 470 |
+
#: admin/litespeed-cache-admin-settings.class.php:920
|
| 471 |
msgid "Whole Interval"
|
| 472 |
msgstr ""
|
| 473 |
|
| 474 |
+
#: admin/litespeed-cache-admin-settings.class.php:921
|
| 475 |
#: admin/tpl/setting/settings_crawler.php:73
|
| 476 |
msgid "Threads"
|
| 477 |
msgstr ""
|
| 478 |
|
| 479 |
+
#: admin/litespeed-cache-admin.class.php:206
|
| 480 |
msgid ""
|
| 481 |
"For this scenario only, the network admin may uncheck \"Check Advanced Cache"
|
| 482 |
"\" in LiteSpeed Cache settings."
|
| 483 |
msgstr ""
|
| 484 |
|
| 485 |
+
#: admin/litespeed-cache-admin.class.php:208
|
| 486 |
msgid ""
|
| 487 |
"For this scenario only, please uncheck \"Check Advanced Cache\" in LiteSpeed "
|
| 488 |
"Cache settings."
|
| 489 |
msgstr ""
|
| 490 |
|
| 491 |
+
#: admin/litespeed-cache-admin.class.php:210
|
| 492 |
msgid ""
|
| 493 |
"Please disable/deactivate any other Full Page Cache solutions that are "
|
| 494 |
"currently being used."
|
| 495 |
msgstr ""
|
| 496 |
|
| 497 |
+
#: admin/litespeed-cache-admin.class.php:211
|
| 498 |
msgid ""
|
| 499 |
"LiteSpeed Cache does work with other cache solutions, but only their non-"
|
| 500 |
"page caching offerings—such as minifying css/js files."
|
| 551 |
msgstr ""
|
| 552 |
|
| 553 |
#: admin/tpl/crawler.php:94 admin/tpl/manage/manage_cdn.php:15
|
| 554 |
+
#: admin/tpl/setting/settings_optimize.php:13 admin/tpl/settings.php:165
|
| 555 |
msgid "WARNING"
|
| 556 |
msgstr ""
|
| 557 |
|
| 762 |
msgid "A TTL of 0 indicates do not cache."
|
| 763 |
msgstr ""
|
| 764 |
|
| 765 |
+
#: admin/tpl/image_optimization.php:16
|
| 766 |
msgid "Level"
|
| 767 |
msgstr ""
|
| 768 |
|
| 769 |
+
#: admin/tpl/image_optimization.php:20
|
| 770 |
msgid "Credit"
|
| 771 |
msgstr ""
|
| 772 |
|
| 773 |
+
#: admin/tpl/image_optimization.php:21
|
| 774 |
msgid "Credit recovers with each successful pull."
|
| 775 |
msgstr ""
|
| 776 |
|
| 777 |
+
#: admin/tpl/image_optimization.php:25
|
| 778 |
msgid "Total Reduction"
|
| 779 |
msgstr ""
|
| 780 |
|
| 781 |
+
#: admin/tpl/image_optimization.php:29
|
| 782 |
msgid "Images pulled"
|
| 783 |
msgstr ""
|
| 784 |
|
| 785 |
+
#: admin/tpl/image_optimization.php:32
|
| 786 |
msgid "Images failed to fetch"
|
| 787 |
msgstr ""
|
| 788 |
|
| 789 |
+
#: admin/tpl/image_optimization.php:35
|
| 790 |
msgid "Images failed to notify"
|
| 791 |
msgstr ""
|
| 792 |
|
| 793 |
+
#: admin/tpl/image_optimization.php:38
|
| 794 |
msgid "Images failed to pull"
|
| 795 |
msgstr ""
|
| 796 |
|
| 797 |
+
#: admin/tpl/image_optimization.php:41
|
| 798 |
msgid "Last Request"
|
| 799 |
msgstr ""
|
| 800 |
|
| 801 |
+
#: admin/tpl/image_optimization.php:52 admin/tpl/image_optimization.php:53
|
| 802 |
+
msgid "Click the %s button."
|
| 803 |
+
msgstr ""
|
| 804 |
+
|
| 805 |
+
#: admin/tpl/image_optimization.php:52 admin/tpl/image_optimization.php:116
|
| 806 |
+
#: admin/tpl/image_optimization.php:152
|
| 807 |
+
msgid "Update Status"
|
| 808 |
+
msgstr ""
|
| 809 |
+
|
| 810 |
+
#: admin/tpl/image_optimization.php:53 admin/tpl/image_optimization.php:149
|
| 811 |
+
#: admin/tpl/image_optimization.php:157
|
| 812 |
+
msgid "Send Optimization Request"
|
| 813 |
+
msgstr ""
|
| 814 |
+
|
| 815 |
+
#: admin/tpl/image_optimization.php:54
|
| 816 |
+
msgid "Click the %s button or wait for the cron job to finish the pull action."
|
| 817 |
+
msgstr ""
|
| 818 |
+
|
| 819 |
+
#: admin/tpl/image_optimization.php:54 admin/tpl/image_optimization.php:194
|
| 820 |
+
msgid "Pull Images"
|
| 821 |
+
msgstr ""
|
| 822 |
+
|
| 823 |
+
#: admin/tpl/image_optimization.php:55
|
| 824 |
+
msgid "Repeat the above steps until you have leveled up."
|
| 825 |
+
msgstr ""
|
| 826 |
+
|
| 827 |
+
#: admin/tpl/image_optimization.php:70
|
| 828 |
msgid "LiteSpeed Cache Image Optimization"
|
| 829 |
msgstr ""
|
| 830 |
|
| 831 |
+
#: admin/tpl/image_optimization.php:83
|
| 832 |
+
msgid "How to Level Up"
|
| 833 |
msgstr ""
|
| 834 |
|
| 835 |
+
#: admin/tpl/image_optimization.php:86
|
| 836 |
+
msgid "Optimization Summary"
|
| 837 |
msgstr ""
|
| 838 |
|
| 839 |
+
#: admin/tpl/image_optimization.php:119
|
| 840 |
msgid ""
|
| 841 |
"This will communicate with LiteSpeed's Image Optimization Server and "
|
| 842 |
"retrieve the most recent status."
|
| 843 |
msgstr ""
|
| 844 |
|
| 845 |
+
#: admin/tpl/image_optimization.php:124
|
| 846 |
msgid "Image Information"
|
| 847 |
msgstr ""
|
| 848 |
|
| 849 |
+
#: admin/tpl/image_optimization.php:125
|
| 850 |
msgid "Beta Version"
|
| 851 |
msgstr ""
|
| 852 |
|
| 853 |
+
#: admin/tpl/image_optimization.php:135
|
| 854 |
+
msgid "Images total"
|
| 855 |
msgstr ""
|
| 856 |
|
| 857 |
+
#: admin/tpl/image_optimization.php:137
|
| 858 |
+
msgid "What is a group?"
|
| 859 |
msgstr ""
|
| 860 |
|
| 861 |
+
#: admin/tpl/image_optimization.php:140
|
| 862 |
+
msgid "Images not yet requested"
|
| 863 |
msgstr ""
|
| 864 |
|
| 865 |
+
#: admin/tpl/image_optimization.php:152
|
| 866 |
msgid "Please press the %s button before sending a new request."
|
| 867 |
msgstr ""
|
| 868 |
|
| 869 |
+
#: admin/tpl/image_optimization.php:160
|
| 870 |
msgid ""
|
| 871 |
"This will send the optimization request and the images to LiteSpeed's Image "
|
| 872 |
"Optimization Server."
|
| 873 |
msgstr ""
|
| 874 |
|
| 875 |
+
#: admin/tpl/image_optimization.php:161
|
| 876 |
msgid "You can send at most %s images at once."
|
| 877 |
msgstr ""
|
| 878 |
|
| 879 |
+
#: admin/tpl/image_optimization.php:169
|
| 880 |
+
msgid "Images requested"
|
| 881 |
+
msgstr ""
|
| 882 |
+
|
| 883 |
+
#: admin/tpl/image_optimization.php:174
|
| 884 |
+
msgid "Images failed to optimize"
|
| 885 |
msgstr ""
|
| 886 |
|
| 887 |
+
#: admin/tpl/image_optimization.php:179
|
| 888 |
+
msgid "Image files missing"
|
| 889 |
msgstr ""
|
| 890 |
|
| 891 |
+
#: admin/tpl/image_optimization.php:184
|
| 892 |
msgid ""
|
| 893 |
"After LiteSpeed's Image Optimization Server finishes optimization, it will "
|
| 894 |
"notify your site to pull the optimized images."
|
| 895 |
msgstr ""
|
| 896 |
|
| 897 |
+
#: admin/tpl/image_optimization.php:185
|
| 898 |
msgid "This process is automatic."
|
| 899 |
msgstr ""
|
| 900 |
|
| 901 |
+
#: admin/tpl/image_optimization.php:188
|
| 902 |
+
msgid "Images notified to pull"
|
| 903 |
msgstr ""
|
| 904 |
|
| 905 |
+
#: admin/tpl/image_optimization.php:197
|
|
|
|
|
|
|
|
|
|
|
|
|
| 906 |
msgid "Only press the button if the pull cron job is disabled."
|
| 907 |
msgstr ""
|
| 908 |
|
| 909 |
+
#: admin/tpl/image_optimization.php:198
|
| 910 |
msgid "Images will be pulled automatically if the cron job is running."
|
| 911 |
msgstr ""
|
| 912 |
|
| 913 |
+
#: admin/tpl/image_optimization.php:202
|
| 914 |
msgid "Last pull initiated by cron at %s."
|
| 915 |
msgstr ""
|
| 916 |
|
| 917 |
+
#: admin/tpl/image_optimization.php:207
|
| 918 |
+
msgid "Images optimized and pulled"
|
| 919 |
msgstr ""
|
| 920 |
|
| 921 |
+
#: admin/tpl/image_optimization.php:216
|
| 922 |
msgid "Revert Optimization"
|
| 923 |
msgstr ""
|
| 924 |
|
| 925 |
+
#: admin/tpl/image_optimization.php:219
|
| 926 |
msgid ""
|
| 927 |
"Switch all images in the media library back to their original unoptimized "
|
| 928 |
"versions."
|
| 929 |
msgstr ""
|
| 930 |
|
| 931 |
+
#: admin/tpl/image_optimization.php:225
|
| 932 |
msgid "Undo Optimization"
|
| 933 |
msgstr ""
|
| 934 |
|
| 935 |
+
#: admin/tpl/image_optimization.php:228
|
| 936 |
msgid "Revert all optimized images back to their original versions."
|
| 937 |
msgstr ""
|
| 938 |
|
| 939 |
+
#: admin/tpl/image_optimization.php:234
|
| 940 |
msgid "Re-do Optimization"
|
| 941 |
msgstr ""
|
| 942 |
|
| 943 |
+
#: admin/tpl/image_optimization.php:237
|
| 944 |
msgid "Switch back to using optimized images."
|
| 945 |
msgstr ""
|
| 946 |
|
| 947 |
+
#: admin/tpl/image_optimization.php:242
|
| 948 |
msgid "Results can be checked in <a %s>Media Library</a>."
|
| 949 |
msgstr ""
|
| 950 |
|
| 951 |
+
#: admin/tpl/image_optimization.php:246
|
| 952 |
msgid "Send New Thumbnail Requests"
|
| 953 |
msgstr ""
|
| 954 |
|
| 955 |
+
#: admin/tpl/image_optimization.php:249
|
| 956 |
msgid ""
|
| 957 |
"Scan for any new unoptimized image thumbnail sizes and resend necessary "
|
| 958 |
"image optimization requests."
|
| 959 |
msgstr ""
|
| 960 |
|
| 961 |
+
#: admin/tpl/image_optimization.php:254
|
| 962 |
msgid "Reset IAPI Key"
|
| 963 |
msgstr ""
|
| 964 |
|
| 965 |
+
#: admin/tpl/image_optimization.php:257
|
| 966 |
msgid ""
|
| 967 |
"The current IAPI key must be reset after changing home URL or domain before "
|
| 968 |
"making any further optimization requests."
|
| 969 |
msgstr ""
|
| 970 |
|
| 971 |
+
#: admin/tpl/image_optimization.php:262
|
| 972 |
msgid "Destroy All Optimization Data!"
|
| 973 |
msgstr ""
|
| 974 |
|
| 975 |
+
#: admin/tpl/image_optimization.php:265
|
| 976 |
msgid ""
|
| 977 |
"Remove all previous image optimization requests/results, revert completed "
|
| 978 |
"optimizations, and delete all optimization files."
|
| 979 |
msgstr ""
|
| 980 |
|
| 981 |
+
#: admin/tpl/image_optimization.php:267
|
| 982 |
#: admin/tpl/setting/settings_advanced.php:50
|
| 983 |
#: admin/tpl/setting/settings_cdn.php:97
|
| 984 |
+
#: admin/tpl/setting/settings_crawler.php:22
|
| 985 |
+
#: admin/tpl/setting/settings_crawler.php:95
|
| 986 |
+
#: admin/tpl/setting/settings_crawler.php:100
|
| 987 |
#: admin/tpl/setting/settings_excludes.php:63
|
| 988 |
#: admin/tpl/setting/settings_excludes.php:101
|
| 989 |
#: admin/tpl/setting/settings_inc.cache_browser.php:12
|
| 997 |
#: admin/tpl/setting/settings_optimize.php:162
|
| 998 |
#: admin/tpl/setting/settings_tuning.php:20
|
| 999 |
#: admin/tpl/setting/settings_tuning.php:56
|
| 1000 |
+
msgid "NOTE"
|
| 1001 |
msgstr ""
|
| 1002 |
|
| 1003 |
+
#: admin/tpl/image_optimization.php:268
|
| 1004 |
msgid ""
|
| 1005 |
"If there are unfinished requests in progress, the requests' credits will NOT "
|
| 1006 |
"be recovered."
|
| 1007 |
msgstr ""
|
| 1008 |
|
| 1009 |
+
#: admin/tpl/image_optimization.php:268
|
| 1010 |
#: admin/tpl/setting/settings_optimize.php:87
|
| 1011 |
#: admin/tpl/setting/settings_optimize.php:163
|
| 1012 |
msgid "JS Combine"
|
| 1051 |
"Cache settings."
|
| 1052 |
msgstr ""
|
| 1053 |
|
| 1054 |
+
#: admin/tpl/inc/admin_footer.php:6
|
| 1055 |
+
msgid "Rate %s on %s"
|
|
|
|
|
|
|
| 1056 |
msgstr ""
|
| 1057 |
|
| 1058 |
+
#. #-#-#-#-# litespeed-cache.pot (LiteSpeed Cache 2.0) #-#-#-#-#
|
| 1059 |
+
#. Plugin Name of the plugin/theme
|
| 1060 |
+
#: admin/tpl/inc/admin_footer.php:6
|
| 1061 |
+
msgid "LiteSpeed Cache"
|
| 1062 |
+
msgstr ""
|
| 1063 |
+
|
| 1064 |
+
#: admin/tpl/inc/admin_footer.php:9
|
| 1065 |
+
msgid "Read LiteSpeed Wiki"
|
| 1066 |
+
msgstr ""
|
| 1067 |
+
|
| 1068 |
+
#: admin/tpl/inc/admin_footer.php:11
|
| 1069 |
+
msgid "Visit LSCWP support forum"
|
| 1070 |
+
msgstr ""
|
| 1071 |
+
|
| 1072 |
+
#: admin/tpl/inc/admin_footer.php:13
|
| 1073 |
+
msgid "Join LiteSpeed Slack community"
|
| 1074 |
msgstr ""
|
| 1075 |
|
| 1076 |
#: admin/tpl/inc/api_key.php:11
|
| 1437 |
msgid "Are you sure you want to purge all?"
|
| 1438 |
msgstr ""
|
| 1439 |
|
| 1440 |
+
#: admin/tpl/manage/manage_purge.php:61 inc/gui.class.php:318
|
| 1441 |
+
#: includes/litespeed-cache-gui.class.php:318
|
| 1442 |
msgid "Object Cache Purge All"
|
| 1443 |
msgstr ""
|
| 1444 |
|
| 1446 |
msgid "Purge all the object caches"
|
| 1447 |
msgstr ""
|
| 1448 |
|
| 1449 |
+
#: admin/tpl/manage/manage_purge.php:71 inc/gui.class.php:328
|
| 1450 |
+
#: includes/litespeed-cache-gui.class.php:328
|
| 1451 |
msgid "Opcode Cache Purge All"
|
| 1452 |
msgstr ""
|
| 1453 |
|
| 1562 |
msgid "DB Optimizer"
|
| 1563 |
msgstr ""
|
| 1564 |
|
| 1565 |
+
#: admin/tpl/manage.php:12 admin/tpl/setting/settings_cdn.php:203
|
| 1566 |
+
#: admin/tpl/setting/settings_cdn.php:246 admin/tpl/settings.php:14
|
| 1567 |
msgid "CDN"
|
| 1568 |
msgstr ""
|
| 1569 |
|
| 1874 |
|
| 1875 |
#: admin/tpl/setting/settings_cdn.php:98
|
| 1876 |
msgid ""
|
| 1877 |
+
"To randomize CDN hostname, define multiple hostnames for the same resources."
|
|
|
|
| 1878 |
msgstr ""
|
| 1879 |
|
| 1880 |
#: admin/tpl/setting/settings_cdn.php:103
|
| 1940 |
msgid "Off"
|
| 1941 |
msgstr ""
|
| 1942 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1943 |
#: admin/tpl/setting/settings_cdn.php:170
|
| 1944 |
msgid ""
|
| 1945 |
"Improve page load time by loading jQuery from a remote CDN service instead "
|
| 1951 |
msgstr ""
|
| 1952 |
|
| 1953 |
#: admin/tpl/setting/settings_cdn.php:180
|
| 1954 |
+
#: admin/tpl/setting/settings_cdn.php:245
|
| 1955 |
+
msgid "Use %s API functionality."
|
| 1956 |
msgstr ""
|
| 1957 |
|
| 1958 |
+
#: admin/tpl/setting/settings_cdn.php:203
|
| 1959 |
+
#: admin/tpl/setting/settings_cdn.php:246
|
| 1960 |
msgid "This can be managed from <a %2$s>%1$s</a>."
|
| 1961 |
msgstr ""
|
| 1962 |
|
| 1963 |
+
#: admin/tpl/setting/settings_cdn.php:207
|
| 1964 |
+
#: admin/tpl/setting/settings_cdn.php:250
|
| 1965 |
msgid "Email Address"
|
| 1966 |
msgstr ""
|
| 1967 |
|
| 1968 |
+
#: admin/tpl/setting/settings_cdn.php:211
|
| 1969 |
+
#: admin/tpl/setting/settings_cdn.php:254
|
| 1970 |
+
msgid "Your Email address on %s."
|
| 1971 |
msgstr ""
|
| 1972 |
|
| 1973 |
+
#: admin/tpl/setting/settings_cdn.php:216
|
| 1974 |
msgid "User API Key"
|
| 1975 |
msgstr ""
|
| 1976 |
|
| 1977 |
+
#: admin/tpl/setting/settings_cdn.php:220
|
| 1978 |
+
#: admin/tpl/setting/settings_cdn.php:263
|
| 1979 |
+
msgid "Your API key is used to access %s APIs."
|
| 1980 |
msgstr ""
|
| 1981 |
|
| 1982 |
+
#: admin/tpl/setting/settings_cdn.php:221
|
| 1983 |
+
#: admin/tpl/setting/settings_cdn.php:264
|
| 1984 |
+
msgid "Get it from <a %1$s>%2$s</a>."
|
| 1985 |
msgstr ""
|
| 1986 |
|
| 1987 |
+
#: admin/tpl/setting/settings_cdn.php:226
|
| 1988 |
msgid "Site Domain"
|
| 1989 |
msgstr ""
|
| 1990 |
|
| 1991 |
+
#: admin/tpl/setting/settings_cdn.php:232
|
| 1992 |
+
#: admin/tpl/setting/settings_cdn.php:277
|
| 1993 |
msgid "You can just type part of the domain."
|
| 1994 |
msgstr ""
|
| 1995 |
|
| 1996 |
+
#: admin/tpl/setting/settings_cdn.php:233
|
| 1997 |
+
#: admin/tpl/setting/settings_cdn.php:278
|
| 1998 |
msgid ""
|
| 1999 |
"Once saved, it will be matched with the current list and completed "
|
| 2000 |
"automatically."
|
| 2001 |
msgstr ""
|
| 2002 |
|
| 2003 |
+
#: admin/tpl/setting/settings_cdn.php:241
|
| 2004 |
msgid "Cloudflare API"
|
| 2005 |
msgstr ""
|
| 2006 |
|
| 2007 |
+
#: admin/tpl/setting/settings_cdn.php:259
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2008 |
msgid "Global API Key"
|
| 2009 |
msgstr ""
|
| 2010 |
|
| 2011 |
+
#: admin/tpl/setting/settings_cdn.php:269
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2012 |
msgid "Domain"
|
| 2013 |
msgstr ""
|
| 2014 |
|
| 2059 |
"Specify time in microseconds for the delay between requests during a crawl."
|
| 2060 |
msgstr ""
|
| 2061 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2062 |
#: admin/tpl/setting/settings_crawler.php:23
|
| 2063 |
msgid "Server allowed min value"
|
| 2064 |
msgstr ""
|
| 2131 |
msgstr ""
|
| 2132 |
|
| 2133 |
#: admin/tpl/setting/settings_crawler.php:139
|
| 2134 |
+
msgid "HTTP/2 Crawl"
|
| 2135 |
+
msgstr ""
|
| 2136 |
+
|
| 2137 |
+
#: admin/tpl/setting/settings_crawler.php:143
|
| 2138 |
+
msgid "Crawl using the HTTP/2 protocal."
|
| 2139 |
msgstr ""
|
| 2140 |
|
| 2141 |
#: admin/tpl/setting/settings_crawler.php:144
|
| 2142 |
+
msgid "Current curl HTTP/2 extension status"
|
| 2143 |
+
msgstr ""
|
| 2144 |
+
|
| 2145 |
+
#: admin/tpl/setting/settings_crawler.php:146
|
| 2146 |
+
#: admin/tpl/setting/settings_inc.cache_object.php:4
|
| 2147 |
+
msgid "Enabled"
|
| 2148 |
+
msgstr ""
|
| 2149 |
+
|
| 2150 |
+
#: admin/tpl/setting/settings_crawler.php:148
|
| 2151 |
+
#: admin/tpl/setting/settings_inc.cache_object.php:5
|
| 2152 |
+
msgid "Disabled"
|
| 2153 |
+
msgstr ""
|
| 2154 |
+
|
| 2155 |
+
#: admin/tpl/setting/settings_crawler.php:155
|
| 2156 |
+
#: admin/tpl/setting/settings_crawler.php:248
|
| 2157 |
+
msgid "Custom Sitemap"
|
| 2158 |
+
msgstr ""
|
| 2159 |
+
|
| 2160 |
+
#: admin/tpl/setting/settings_crawler.php:160
|
| 2161 |
msgid ""
|
| 2162 |
"The crawler can use your Google XML Sitemap instead of its own. Enter the "
|
| 2163 |
"full URL to your sitemap here."
|
| 2164 |
msgstr ""
|
| 2165 |
|
| 2166 |
+
#: admin/tpl/setting/settings_crawler.php:166
|
| 2167 |
msgid "Sitemap Generation"
|
| 2168 |
msgstr ""
|
| 2169 |
|
| 2170 |
+
#: admin/tpl/setting/settings_crawler.php:171
|
| 2171 |
msgid "Include Posts"
|
| 2172 |
msgstr ""
|
| 2173 |
|
| 2174 |
+
#: admin/tpl/setting/settings_crawler.php:178
|
| 2175 |
msgid "Include Pages"
|
| 2176 |
msgstr ""
|
| 2177 |
|
| 2178 |
+
#: admin/tpl/setting/settings_crawler.php:185
|
| 2179 |
msgid "Include Categories"
|
| 2180 |
msgstr ""
|
| 2181 |
|
| 2182 |
+
#: admin/tpl/setting/settings_crawler.php:192
|
| 2183 |
msgid "Include Tags"
|
| 2184 |
msgstr ""
|
| 2185 |
|
| 2186 |
+
#: admin/tpl/setting/settings_crawler.php:201
|
| 2187 |
msgid "Exclude Custom Post Types"
|
| 2188 |
msgstr ""
|
| 2189 |
|
| 2190 |
+
#: admin/tpl/setting/settings_crawler.php:206
|
| 2191 |
msgid "Exclude certain Custom Post Types in sitemap."
|
| 2192 |
msgstr ""
|
| 2193 |
|
| 2194 |
+
#: admin/tpl/setting/settings_crawler.php:212
|
| 2195 |
msgid "Available Custom Post Type"
|
| 2196 |
msgstr ""
|
| 2197 |
|
| 2198 |
+
#: admin/tpl/setting/settings_crawler.php:220
|
| 2199 |
msgid "Order links by"
|
| 2200 |
msgstr ""
|
| 2201 |
|
| 2202 |
+
#: admin/tpl/setting/settings_crawler.php:226
|
| 2203 |
msgid "Date, descending (Default)"
|
| 2204 |
msgstr ""
|
| 2205 |
|
| 2206 |
+
#: admin/tpl/setting/settings_crawler.php:232
|
| 2207 |
msgid "Date, ascending"
|
| 2208 |
msgstr ""
|
| 2209 |
|
| 2210 |
+
#: admin/tpl/setting/settings_crawler.php:238
|
| 2211 |
msgid "Alphabetical, descending"
|
| 2212 |
msgstr ""
|
| 2213 |
|
| 2214 |
+
#: admin/tpl/setting/settings_crawler.php:244
|
| 2215 |
msgid "Alphabetical, ascending"
|
| 2216 |
msgstr ""
|
| 2217 |
|
| 2218 |
+
#: admin/tpl/setting/settings_crawler.php:248
|
| 2219 |
msgid "These options will be invalid when using %s."
|
| 2220 |
msgstr ""
|
| 2221 |
|
| 2690 |
msgid "If %1$s is %2$s, then %3$s must be populated!"
|
| 2691 |
msgstr ""
|
| 2692 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 2693 |
#: admin/tpl/setting/settings_inc.cache_object.php:12
|
| 2694 |
msgid "Not Available"
|
| 2695 |
msgstr ""
|
| 3003 |
msgid "Both full URLs and partial strings can be used."
|
| 3004 |
msgstr ""
|
| 3005 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3006 |
#: admin/tpl/setting/settings_media.php:37
|
| 3007 |
#: admin/tpl/setting/settings_tuning.php:41
|
| 3008 |
#: admin/tpl/setting/settings_tuning.php:77
|
| 3315 |
|
| 3316 |
#: admin/tpl/setting/settings_purge.php:51
|
| 3317 |
#: thirdparty/lscwp-3rd-woocommerce.cls.php:858
|
| 3318 |
+
msgid "Note"
|
| 3319 |
msgstr ""
|
| 3320 |
|
| 3321 |
#: admin/tpl/setting/settings_purge.php:53
|
| 3540 |
msgid "Compatibilities"
|
| 3541 |
msgstr ""
|
| 3542 |
|
| 3543 |
+
#: admin/tpl/settings.php:129
|
| 3544 |
msgid "LiteSpeed Cache Settings"
|
| 3545 |
msgstr ""
|
| 3546 |
|
| 3547 |
+
#: admin/tpl/settings.php:135
|
| 3548 |
msgid "Basic View"
|
| 3549 |
msgstr ""
|
| 3550 |
|
| 3551 |
+
#: admin/tpl/settings.php:136
|
| 3552 |
msgid "Advanced View"
|
| 3553 |
msgstr ""
|
| 3554 |
|
| 3555 |
+
#: admin/tpl/settings.php:167
|
| 3556 |
msgid "The network admin selected use primary site configs for all subsites."
|
| 3557 |
msgstr ""
|
| 3558 |
|
| 3559 |
+
#: admin/tpl/settings.php:168
|
| 3560 |
msgid ""
|
| 3561 |
"The following options are selected, but are not editable in this settings "
|
| 3562 |
"page."
|
| 3563 |
msgstr ""
|
| 3564 |
|
| 3565 |
+
#: admin/tpl/settings.php:190 admin/tpl/settings.php:193
|
| 3566 |
msgid "Save Changes"
|
| 3567 |
msgstr ""
|
| 3568 |
|
| 3582 |
msgid "Purged the tags!"
|
| 3583 |
msgstr ""
|
| 3584 |
|
| 3585 |
+
#: inc/cdn.class.php:650 includes/litespeed-cache-cdn.class.php:650
|
| 3586 |
msgid "Notified Cloudflare to set development mode to %s successfully."
|
| 3587 |
msgstr ""
|
| 3588 |
|
| 3589 |
+
#: inc/cdn.class.php:668 includes/litespeed-cache-cdn.class.php:668
|
| 3590 |
msgid "Cloudflare API is set to off."
|
| 3591 |
msgstr ""
|
| 3592 |
|
| 3593 |
+
#: inc/cdn.class.php:684 includes/litespeed-cache-cdn.class.php:684
|
| 3594 |
msgid "Notified Cloudflare to purge all successfully."
|
| 3595 |
msgstr ""
|
| 3596 |
|
| 3597 |
+
#: inc/cdn.class.php:699 includes/litespeed-cache-cdn.class.php:699
|
| 3598 |
msgid "No available Cloudflare zone"
|
| 3599 |
msgstr ""
|
| 3600 |
|
| 3601 |
+
#: inc/cdn.class.php:794 includes/litespeed-cache-cdn.class.php:794
|
| 3602 |
msgid "Communicated with Cloudflare successfully."
|
| 3603 |
msgstr ""
|
| 3604 |
|
| 3605 |
+
#: inc/cdn.class.php:803 includes/litespeed-cache-cdn.class.php:803
|
| 3606 |
msgid "Failed to communicate with Cloudflare"
|
| 3607 |
msgstr ""
|
| 3608 |
|
| 3626 |
msgid "Position reset notification sent successfully"
|
| 3627 |
msgstr ""
|
| 3628 |
|
| 3629 |
+
#: inc/crawler.class.php:466 includes/litespeed-cache-crawler.class.php:466
|
| 3630 |
+
#: lib/litespeed/litespeed-crawler.class.php:402
|
| 3631 |
msgid "Crawler %s reached end of sitemap file."
|
| 3632 |
msgstr ""
|
| 3633 |
|
| 3634 |
+
#: inc/crawler.class.php:496 inc/crawler.class.php:500
|
| 3635 |
+
#: includes/litespeed-cache-crawler.class.php:496
|
| 3636 |
+
#: includes/litespeed-cache-crawler.class.php:500
|
| 3637 |
msgid "Guest"
|
| 3638 |
msgstr ""
|
| 3639 |
|
| 3640 |
+
#: inc/gui.class.php:210 includes/litespeed-cache-gui.class.php:210
|
| 3641 |
msgid "Purge this page"
|
| 3642 |
msgstr ""
|
| 3643 |
|
| 3644 |
+
#: inc/gui.class.php:218 includes/litespeed-cache-gui.class.php:218
|
| 3645 |
msgid "Mark this page as "
|
| 3646 |
msgstr ""
|
| 3647 |
|
| 3648 |
+
#: inc/gui.class.php:225 includes/litespeed-cache-gui.class.php:225
|
| 3649 |
msgid "Non cacheable"
|
| 3650 |
msgstr ""
|
| 3651 |
|
| 3652 |
+
#: inc/gui.class.php:232 includes/litespeed-cache-gui.class.php:232
|
| 3653 |
msgid "Private cache"
|
| 3654 |
msgstr ""
|
| 3655 |
|
| 3656 |
+
#: inc/gui.class.php:239 includes/litespeed-cache-gui.class.php:239
|
| 3657 |
msgid "No optimization"
|
| 3658 |
msgstr ""
|
| 3659 |
|
| 3660 |
+
#: inc/gui.class.php:246 includes/litespeed-cache-gui.class.php:246
|
| 3661 |
msgid "More settings"
|
| 3662 |
msgstr ""
|
| 3663 |
|
| 3664 |
+
#: inc/gui.class.php:265 inc/gui.class.php:299
|
| 3665 |
+
#: includes/litespeed-cache-gui.class.php:265
|
| 3666 |
+
#: includes/litespeed-cache-gui.class.php:299
|
| 3667 |
msgid "LiteSpeed Cache Purge All"
|
| 3668 |
msgstr ""
|
| 3669 |
|
| 3670 |
+
#: inc/gui.class.php:308 includes/litespeed-cache-gui.class.php:308
|
| 3671 |
msgid "Cloudflare Purge All"
|
| 3672 |
msgstr ""
|
| 3673 |
|
| 3674 |
+
#: inc/img_optm.class.php:76
|
| 3675 |
+
msgid "Failed to communicate with LiteSpeed IAPI server"
|
| 3676 |
msgstr ""
|
| 3677 |
|
| 3678 |
+
#: inc/img_optm.class.php:85
|
| 3679 |
+
msgid "Communicated with LiteSpeed Image Optimization Server successfully."
|
| 3680 |
msgstr ""
|
| 3681 |
|
| 3682 |
+
#: inc/img_optm.class.php:134 inc/img_optm.class.php:189
|
| 3683 |
+
#: inc/img_optm.class.php:1154 inc/img_optm.class.php:1219
|
| 3684 |
+
msgid "No image found."
|
| 3685 |
msgstr ""
|
| 3686 |
|
| 3687 |
+
#: inc/img_optm.class.php:161
|
| 3688 |
+
msgid "Number of images in one image group (%s) exceeds the credit (%s)"
|
| 3689 |
msgstr ""
|
| 3690 |
|
| 3691 |
+
#: inc/img_optm.class.php:209
|
| 3692 |
+
msgid "Optimized successfully."
|
| 3693 |
msgstr ""
|
| 3694 |
|
| 3695 |
+
#: inc/img_optm.class.php:266
|
| 3696 |
+
msgid "Pushed %1$s to LiteSpeed optimization server, accepted %2$s."
|
| 3697 |
msgstr ""
|
| 3698 |
|
| 3699 |
+
#: inc/img_optm.class.php:602
|
| 3700 |
+
msgid "Failed to push to LiteSpeed IAPI server: %s"
|
| 3701 |
msgstr ""
|
| 3702 |
|
| 3703 |
+
#: inc/img_optm.class.php:610
|
| 3704 |
+
msgid "Failed to parse data from LiteSpeed IAPI server: %s"
|
| 3705 |
msgstr ""
|
| 3706 |
|
| 3707 |
+
#: inc/img_optm.class.php:1257
|
| 3708 |
+
msgid ""
|
| 3709 |
+
"Pushed %1$s groups with %2$s images to LiteSpeed optimization server, "
|
| 3710 |
+
"accepted %3$s groups with %4$s images."
|
| 3711 |
msgstr ""
|
| 3712 |
|
| 3713 |
+
#: inc/img_optm.class.php:1479
|
| 3714 |
+
msgid "Disabled WebP file successfully."
|
| 3715 |
msgstr ""
|
| 3716 |
|
| 3717 |
+
#: inc/img_optm.class.php:1485
|
| 3718 |
+
msgid "Enabled WebP file successfully."
|
| 3719 |
msgstr ""
|
| 3720 |
|
| 3721 |
+
#: inc/img_optm.class.php:1501
|
| 3722 |
+
msgid "Restored original file successfully."
|
| 3723 |
msgstr ""
|
| 3724 |
|
| 3725 |
+
#: inc/img_optm.class.php:1508
|
| 3726 |
+
msgid "Switched to optimized file successfully."
|
| 3727 |
msgstr ""
|
| 3728 |
|
| 3729 |
+
#: inc/import.class.php:128
|
| 3730 |
+
msgid "Import failed due to file error."
|
| 3731 |
msgstr ""
|
| 3732 |
|
| 3733 |
+
#: inc/import.class.php:160
|
| 3734 |
+
msgid "Imported setting file %s successfully."
|
| 3735 |
msgstr ""
|
| 3736 |
|
| 3737 |
+
#: inc/litespeed-cache.class.php:262 includes/litespeed-cache.class.php:262
|
| 3738 |
+
msgid "Crawler blacklist is saved."
|
| 3739 |
msgstr ""
|
| 3740 |
|
| 3741 |
+
#: inc/litespeed-cache.class.php:267 includes/litespeed-cache.class.php:267
|
| 3742 |
+
msgid "Notified LiteSpeed Web Server to purge the front page."
|
| 3743 |
msgstr ""
|
| 3744 |
|
| 3745 |
+
#: inc/litespeed-cache.class.php:272 includes/litespeed-cache.class.php:272
|
| 3746 |
+
msgid "Notified LiteSpeed Web Server to purge pages."
|
| 3747 |
msgstr ""
|
| 3748 |
|
| 3749 |
+
#: inc/litespeed-cache.class.php:277 includes/litespeed-cache.class.php:277
|
| 3750 |
+
msgid "Notified LiteSpeed Web Server to purge CSS/JS entries."
|
| 3751 |
msgstr ""
|
| 3752 |
|
| 3753 |
+
#: inc/litespeed-cache.class.php:282 includes/litespeed-cache.class.php:282
|
| 3754 |
+
msgid "Notified LiteSpeed Web Server to purge error pages."
|
| 3755 |
msgstr ""
|
| 3756 |
|
| 3757 |
+
#: inc/litespeed-cache.class.php:288 includes/litespeed-cache.class.php:288
|
| 3758 |
+
msgid "Notified LiteSpeed Web Server to purge all caches."
|
| 3759 |
msgstr ""
|
| 3760 |
|
| 3761 |
+
#: inc/litespeed-cache.class.php:295 includes/litespeed-cache.class.php:295
|
| 3762 |
+
msgid "Notified LiteSpeed Web Server to purge everything."
|
| 3763 |
msgstr ""
|
| 3764 |
|
| 3765 |
+
#: inc/litespeed-cache.class.php:310 includes/litespeed-cache.class.php:310
|
| 3766 |
+
msgid "Notified LiteSpeed Web Server to purge the list."
|
| 3767 |
msgstr ""
|
| 3768 |
|
| 3769 |
+
#: inc/media.class.php:103
|
| 3770 |
+
msgid "LiteSpeed Optimization"
|
| 3771 |
msgstr ""
|
| 3772 |
|
| 3773 |
+
#: inc/media.class.php:127
|
| 3774 |
+
msgid "Disable WebP"
|
| 3775 |
msgstr ""
|
| 3776 |
|
| 3777 |
+
#: inc/media.class.php:132
|
| 3778 |
+
msgid "Enable WebP"
|
| 3779 |
msgstr ""
|
| 3780 |
|
| 3781 |
+
#: inc/media.class.php:150
|
| 3782 |
+
msgid "Restore Original File"
|
|
|
|
|
|
|
| 3783 |
msgstr ""
|
| 3784 |
|
| 3785 |
+
#: inc/media.class.php:155
|
| 3786 |
+
msgid "Switch To Optimized File"
|
| 3787 |
msgstr ""
|
| 3788 |
|
| 3789 |
+
#: inc/media.class.php:169
|
| 3790 |
+
msgid "WebP saved %s"
|
| 3791 |
+
msgstr ""
|
| 3792 |
+
|
| 3793 |
+
#: inc/media.class.php:178
|
| 3794 |
+
msgid "Original saved %s"
|
| 3795 |
msgstr ""
|
| 3796 |
|
| 3797 |
#: inc/purge.class.php:64 includes/litespeed-cache-purge.class.php:64
|
| 3838 |
msgid " %s ago"
|
| 3839 |
msgstr ""
|
| 3840 |
|
| 3841 |
+
#: lib/litespeed/litespeed-crawler.class.php:208
|
| 3842 |
msgid "Cannot read meta file: %s"
|
| 3843 |
msgstr ""
|
| 3844 |
|
| 3845 |
+
#: lib/litespeed/litespeed-crawler.class.php:213
|
| 3846 |
msgid "Oh look, there is already another LiteSpeed crawler running!"
|
| 3847 |
msgstr ""
|
| 3848 |
|
| 3849 |
+
#: lib/litespeed/litespeed-crawler.class.php:219
|
| 3850 |
msgid "Stopped due to load hit the maximum."
|
| 3851 |
msgstr ""
|
| 3852 |
|
| 3853 |
+
#: lib/litespeed/litespeed-crawler.class.php:301
|
| 3854 |
msgid "Stopped due to error when crawling urls %1$s : %2$s"
|
| 3855 |
msgstr ""
|
| 3856 |
|
| 3857 |
+
#: lib/litespeed/litespeed-crawler.class.php:308
|
| 3858 |
msgid "Stopped: crawler disabled by the server admin"
|
| 3859 |
msgstr ""
|
| 3860 |
|
| 3861 |
+
#: lib/litespeed/litespeed-crawler.class.php:329
|
| 3862 |
msgid "Stopped due to exceeding defined Maximum Run Time"
|
| 3863 |
msgstr ""
|
| 3864 |
|
| 3865 |
+
#: lib/litespeed/litespeed-crawler.class.php:346
|
| 3866 |
msgid "Stopped due to reset meta position"
|
| 3867 |
msgstr ""
|
| 3868 |
|
| 3869 |
+
#: lib/litespeed/litespeed-crawler.class.php:354
|
| 3870 |
msgid "Stopped due to load over limit"
|
| 3871 |
msgstr ""
|
| 3872 |
|
| 3963 |
msgid "To test the cart, visit the <a %s>FAQ</a>."
|
| 3964 |
msgstr ""
|
| 3965 |
|
|
|
|
|
|
|
|
|
|
|
|
|
| 3966 |
#. Plugin URI of the plugin/theme
|
| 3967 |
msgid ""
|
| 3968 |
"https://www.litespeedtech.com/products/cache-plugins/wordpress-acceleration"
|
lib/litespeed/litespeed-crawler.class.php
CHANGED
|
@@ -11,6 +11,7 @@ class Litespeed_Crawler
|
|
| 11 |
private $_baseUrl ;
|
| 12 |
private $_sitemap_file ;
|
| 13 |
private $_meta_file ;
|
|
|
|
| 14 |
private $_run_delay = 500 ;//microseconds
|
| 15 |
private $_run_duration = 200 ;//seconds
|
| 16 |
private $_threads_limit = 3 ;
|
|
@@ -43,6 +44,17 @@ class Litespeed_Crawler
|
|
| 43 |
$this->_meta_file = $this->_sitemap_file . '.meta' ;
|
| 44 |
}
|
| 45 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 46 |
/**
|
| 47 |
* Set headers for curl request
|
| 48 |
*
|
|
@@ -239,6 +251,34 @@ class Litespeed_Crawler
|
|
| 239 |
return $this->_return($end_reason) ;
|
| 240 |
}
|
| 241 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 242 |
/**
|
| 243 |
* Run crawler
|
| 244 |
*
|
|
@@ -267,17 +307,13 @@ class Litespeed_Crawler
|
|
| 267 |
if ( stripos($rets[$i], "HTTP/1.1 428 Precondition Required") !== false ) {
|
| 268 |
return __('Stopped: crawler disabled by the server admin', 'litespeed-cache') ;
|
| 269 |
}
|
| 270 |
-
|
|
|
|
| 271 |
// Only default visitor crawler needs to add blacklist
|
| 272 |
if ( $this->_meta[ 'curr_crawler' ] == 0 ) {
|
| 273 |
$this->_blacklist[] = $url ;
|
| 274 |
}
|
| 275 |
}
|
| 276 |
-
elseif ( stripos($rets[$i], "HTTP/1.1 200 OK") === false && stripos($rets[$i], "HTTP/1.1 201 Created") === false ){
|
| 277 |
-
if ( $this->_meta[ 'curr_crawler' ] == 0 ) {
|
| 278 |
-
$this->_blacklist[] = $url ;
|
| 279 |
-
}
|
| 280 |
-
}
|
| 281 |
}
|
| 282 |
|
| 283 |
// update offset position
|
|
@@ -530,7 +566,8 @@ class Litespeed_Crawler
|
|
| 530 |
* Try to enable http2 connection (only available since PHP7+)
|
| 531 |
* @since 1.9.1
|
| 532 |
*/
|
| 533 |
-
if ( defined( 'CURL_HTTP_VERSION_2' ) ) {
|
|
|
|
| 534 |
$options[ CURL_HTTP_VERSION_2 ] = 1 ;
|
| 535 |
}
|
| 536 |
else {
|
| 11 |
private $_baseUrl ;
|
| 12 |
private $_sitemap_file ;
|
| 13 |
private $_meta_file ;
|
| 14 |
+
private $_http2 = true ;
|
| 15 |
private $_run_delay = 500 ;//microseconds
|
| 16 |
private $_run_duration = 200 ;//seconds
|
| 17 |
private $_threads_limit = 3 ;
|
| 44 |
$this->_meta_file = $this->_sitemap_file . '.meta' ;
|
| 45 |
}
|
| 46 |
|
| 47 |
+
/**
|
| 48 |
+
* Set http/2 option for curl request
|
| 49 |
+
*
|
| 50 |
+
* @since 2.0
|
| 51 |
+
* @access public
|
| 52 |
+
*/
|
| 53 |
+
public function set_http2( $is_enabled )
|
| 54 |
+
{
|
| 55 |
+
$this->_http2 = $is_enabled ;
|
| 56 |
+
}
|
| 57 |
+
|
| 58 |
/**
|
| 59 |
* Set headers for curl request
|
| 60 |
*
|
| 251 |
return $this->_return($end_reason) ;
|
| 252 |
}
|
| 253 |
|
| 254 |
+
/**
|
| 255 |
+
* Check returned curl header to find if the status is 200 ok or not
|
| 256 |
+
*
|
| 257 |
+
* @since 2.0
|
| 258 |
+
* @access private
|
| 259 |
+
*/
|
| 260 |
+
private function _status_ok_and_cached( $headers )
|
| 261 |
+
{
|
| 262 |
+
if ( stripos( $headers, 'X-Litespeed-Cache-Control: no-cache' ) !== false ) {
|
| 263 |
+
return false ;
|
| 264 |
+
}
|
| 265 |
+
|
| 266 |
+
$_http_status_ok_list = array(
|
| 267 |
+
'HTTP/1.1 200 OK',
|
| 268 |
+
'HTTP/1.1 201 Created',
|
| 269 |
+
'HTTP/2 200',
|
| 270 |
+
'HTTP/2 201',
|
| 271 |
+
) ;
|
| 272 |
+
|
| 273 |
+
foreach ( $_http_status_ok_list as $http_status ) {
|
| 274 |
+
if ( stripos( $headers, $http_status ) !== false ) {
|
| 275 |
+
return true ;
|
| 276 |
+
}
|
| 277 |
+
}
|
| 278 |
+
|
| 279 |
+
return false ;
|
| 280 |
+
}
|
| 281 |
+
|
| 282 |
/**
|
| 283 |
* Run crawler
|
| 284 |
*
|
| 307 |
if ( stripos($rets[$i], "HTTP/1.1 428 Precondition Required") !== false ) {
|
| 308 |
return __('Stopped: crawler disabled by the server admin', 'litespeed-cache') ;
|
| 309 |
}
|
| 310 |
+
|
| 311 |
+
if ( ! $this->_status_ok_and_cached( $rets[ $i ] ) ) {
|
| 312 |
// Only default visitor crawler needs to add blacklist
|
| 313 |
if ( $this->_meta[ 'curr_crawler' ] == 0 ) {
|
| 314 |
$this->_blacklist[] = $url ;
|
| 315 |
}
|
| 316 |
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 317 |
}
|
| 318 |
|
| 319 |
// update offset position
|
| 566 |
* Try to enable http2 connection (only available since PHP7+)
|
| 567 |
* @since 1.9.1
|
| 568 |
*/
|
| 569 |
+
if ( defined( 'CURL_HTTP_VERSION_2' ) && $this->_http2 ) {
|
| 570 |
+
defined( 'LSCWP_LOG' ) && LiteSpeed_Cache_Log::debug( 'Crawler Lib: Enabled HTTP2' ) ;
|
| 571 |
$options[ CURL_HTTP_VERSION_2 ] = 1 ;
|
| 572 |
}
|
| 573 |
else {
|
litespeed-cache.php
CHANGED
|
@@ -15,7 +15,7 @@
|
|
| 15 |
* Plugin Name: LiteSpeed Cache
|
| 16 |
* Plugin URI: https://www.litespeedtech.com/products/cache-plugins/wordpress-acceleration
|
| 17 |
* Description: WordPress plugin to connect to LSCache on LiteSpeed Web Server.
|
| 18 |
-
* Version:
|
| 19 |
* Author: LiteSpeed Technologies
|
| 20 |
* Author URI: https://www.litespeedtech.com
|
| 21 |
* License: GPLv3
|
| 15 |
* Plugin Name: LiteSpeed Cache
|
| 16 |
* Plugin URI: https://www.litespeedtech.com/products/cache-plugins/wordpress-acceleration
|
| 17 |
* Description: WordPress plugin to connect to LSCache on LiteSpeed Web Server.
|
| 18 |
+
* Version: 2.0
|
| 19 |
* Author: LiteSpeed Technologies
|
| 20 |
* Author URI: https://www.litespeedtech.com
|
| 21 |
* License: GPLv3
|
readme.txt
CHANGED
|
@@ -1,9 +1,9 @@
|
|
| 1 |
=== LiteSpeed Cache ===
|
| 2 |
Contributors: LiteSpeedTech
|
| 3 |
-
Tags: cache, wp-cache, litespeed, super cache, http2, total cache,
|
| 4 |
Requires at least: 4.0
|
| 5 |
Tested up to: 4.9.4
|
| 6 |
-
Stable tag:
|
| 7 |
License: GPLv3
|
| 8 |
License URI: http://www.gnu.org/licenses/gpl.html
|
| 9 |
|
|
@@ -25,6 +25,8 @@ LSCWP includes additional optimization features, such as Database Optimization,
|
|
| 25 |
|
| 26 |
Want to know more about caching in general, and LiteSpeed caching in particular? See [our Caching 101 blog series](https://blog.litespeedtech.com/tag/caching-101/).
|
| 27 |
|
|
|
|
|
|
|
| 28 |
== Installation ==
|
| 29 |
|
| 30 |
1. Install [LiteSpeed Web Server Enterprise](https://www.litespeedtech.com/products/litespeed-web-server) with LSCache Module, [LiteSpeed Web ADC](https://www.litespeedtech.com/products/litespeed-web-adc), or [OpenLiteSpeed](https://www.litespeedtech.com/open-source/openlitespeed) with cache module [Free].
|
|
@@ -244,13 +246,35 @@ Click on the `Advanced View` link at the top of the page, and several more tabs
|
|
| 244 |
11. Admin Settings - Thirdparty WooCommerce
|
| 245 |
12. Admin Management - Purge
|
| 246 |
13. Admin Management - DB Optimizer
|
| 247 |
-
14.
|
| 248 |
-
15.
|
| 249 |
-
16. Cache
|
| 250 |
-
17.
|
|
|
|
| 251 |
|
| 252 |
== Changelog ==
|
| 253 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 254 |
= 1.9.1.1 - February 20 2018 =
|
| 255 |
* [Hotfix] Removed empty crawler when no role simulation is set.
|
| 256 |
|
| 1 |
=== LiteSpeed Cache ===
|
| 2 |
Contributors: LiteSpeedTech
|
| 3 |
+
Tags: cache, wp-cache, litespeed, super cache, http2, total cache, optimize
|
| 4 |
Requires at least: 4.0
|
| 5 |
Tested up to: 4.9.4
|
| 6 |
+
Stable tag: 2.0
|
| 7 |
License: GPLv3
|
| 8 |
License URI: http://www.gnu.org/licenses/gpl.html
|
| 9 |
|
| 25 |
|
| 26 |
Want to know more about caching in general, and LiteSpeed caching in particular? See [our Caching 101 blog series](https://blog.litespeedtech.com/tag/caching-101/).
|
| 27 |
|
| 28 |
+
[Join our Slack community](https://goo.gl/FG9S4N).
|
| 29 |
+
|
| 30 |
== Installation ==
|
| 31 |
|
| 32 |
1. Install [LiteSpeed Web Server Enterprise](https://www.litespeedtech.com/products/litespeed-web-server) with LSCache Module, [LiteSpeed Web ADC](https://www.litespeedtech.com/products/litespeed-web-adc), or [OpenLiteSpeed](https://www.litespeedtech.com/open-source/openlitespeed) with cache module [Free].
|
| 246 |
11. Admin Settings - Thirdparty WooCommerce
|
| 247 |
12. Admin Management - Purge
|
| 248 |
13. Admin Management - DB Optimizer
|
| 249 |
+
14. Image Optimization
|
| 250 |
+
15. Admin Crawler Status Page
|
| 251 |
+
16. Cache Miss Example
|
| 252 |
+
17. Cache Hit Example
|
| 253 |
+
18. Frontend Adminbar Shortcut
|
| 254 |
|
| 255 |
== Changelog ==
|
| 256 |
|
| 257 |
+
= 2.0 - Mar 7 2018 =
|
| 258 |
+
* [NEW FEATURE] *Image Optimization* Added level up guidance.
|
| 259 |
+
* [REFACTOR] *Image Optimization* Refactored Image Optimization class.
|
| 260 |
+
* [IAPI] *Image Optimization* New European Image Optimization server (EU2).
|
| 261 |
+
* [IMPROVEMENT] *Image Optimization* Manual pull action continues pulling until complete.
|
| 262 |
+
* [IMPROVEMENT] *CDN* Multiple CDNs can now be randomized for a single resource.
|
| 263 |
+
* [IMPROVEMENT] *Image Optimization* Improved compatibility of long src images.
|
| 264 |
+
* [IMPROVEMENT] *Image Optimization* Reduced runtime load.
|
| 265 |
+
* [IMPROVEMENT] *Image Optimization* Avoid potential loss/reset of notified images status when pulling.
|
| 266 |
+
* [IMPROVEMENT] *Image Optimization* Avoid duplicated optimization for multiple records in Media that have the same image source.
|
| 267 |
+
* [IMPROVEMENT] *Image Optimization* Fixed issue where phantom images continued to show in not-yet-requested queue.
|
| 268 |
+
* [BUGFIX] *Core* Improved compatibility when upgrading outside of WP Admin. (@jikatal @TylorB)
|
| 269 |
+
* [BUGFIX] *Crawler* Improved HTTP/2 compatibility to avoid erroneous blacklisting.
|
| 270 |
+
* [BUGFIX] *Crawler* Changing Delay setting will use server variable for min value validation if set.
|
| 271 |
+
* [UPDATE] *Crawler* Added HTTP/2 protocol switch in the Crawler settings.
|
| 272 |
+
* [UPDATE] Removed unnecessary translation strings.
|
| 273 |
+
* [GUI] Display translated role group name string instead of English values. (@Richard Hordern)
|
| 274 |
+
* [GUI] Added Join LiteSpeed Slack link.
|
| 275 |
+
* [GUI] *Import / Export* Cosmetic changes to Import Settings file field.
|
| 276 |
+
* [INTEGRATION] Improved compatibility with WPML Media for Image Optimization. (@szmigieldesign)
|
| 277 |
+
|
| 278 |
= 1.9.1.1 - February 20 2018 =
|
| 279 |
* [Hotfix] Removed empty crawler when no role simulation is set.
|
| 280 |
|
thirdparty/lscwp-3rd-woocommerce.cls.php
CHANGED
|
@@ -855,7 +855,7 @@ class LiteSpeed_Cache_ThirdParty_WooCommerce
|
|
| 855 |
</tr>
|
| 856 |
</tbody></table>
|
| 857 |
<div class='litespeed-callout-warning'>
|
| 858 |
-
<h4>" . __('Note
|
| 859 |
<i>
|
| 860 |
" . __('After verifying that the cache works in general, please test the cart.', 'litespeed-cache') . "
|
| 861 |
" . sprintf(__('To test the cart, visit the <a %s>FAQ</a>.', 'litespeed-cache'), 'href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:information:configuration" target="_blank"' ) . "
|
| 855 |
</tr>
|
| 856 |
</tbody></table>
|
| 857 |
<div class='litespeed-callout-warning'>
|
| 858 |
+
<h4>" . __('Note', 'litespeed-cache') . ":</h4>
|
| 859 |
<i>
|
| 860 |
" . __('After verifying that the cache works in general, please test the cart.', 'litespeed-cache') . "
|
| 861 |
" . sprintf(__('To test the cart, visit the <a %s>FAQ</a>.', 'litespeed-cache'), 'href="https://www.litespeedtech.com/support/wiki/doku.php/litespeed_wiki:cache:lscwp:information:configuration" target="_blank"' ) . "
|
