Version Description
- Permanently removed legacy version 1.x
- Fixed bug where editor code view was not redrawn on resize
- Fixed bug where fuzzy flag caused format flag to be ignored
- Fixed bug where autoloader responded to very long class names
- Purging WP object cache when active plugin list changes
- Added experimental source word count into POT info tab
- Bumped WP compatibility to 4.8.1
Download this release
Release Info
| Developer | timwhitlock |
| Plugin |  Loco Translate |
| Version | 2.0.15 |
| Comparing to | |
| See all releases | |
Code changes from version 2.0.14 to 2.0.15
- languages/loco-translate.pot +27 -15
- lib/compiled/gettext.php +2 -3
- lib/compiled/plurals.php +1 -1
- loco.php +6 -15
- old/CHANGELOG.md +0 -146
- old/README.md +0 -5
- old/bin/build-lang.sh +0 -31
- old/languages/README.md +0 -26
- old/languages/loco-legacy-ckb.mo +0 -0
- old/languages/loco-legacy-ckb.po +0 -655
- old/languages/loco-legacy-cs_CZ.mo +0 -0
- old/languages/loco-legacy-cs_CZ.po +0 -646
- old/languages/loco-legacy-de_DE.mo +0 -0
- old/languages/loco-legacy-de_DE.po +0 -639
- old/languages/loco-legacy-el.mo +0 -0
- old/languages/loco-legacy-el.po +0 -651
- old/languages/loco-legacy-es_ES.mo +0 -0
- old/languages/loco-legacy-es_ES.po +0 -703
- old/languages/loco-legacy-fa_IR.mo +0 -0
- old/languages/loco-legacy-fa_IR.po +0 -637
- old/languages/loco-legacy-fr_FR.mo +0 -0
- old/languages/loco-legacy-fr_FR.po +0 -654
- old/languages/loco-legacy-id_ID.mo +0 -0
- old/languages/loco-legacy-id_ID.po +0 -639
- old/languages/loco-legacy-it_IT.mo +0 -0
- old/languages/loco-legacy-it_IT.po +0 -642
- old/languages/loco-legacy-ja.mo +0 -0
- old/languages/loco-legacy-ja.po +0 -635
- old/languages/loco-legacy-ko_KR.mo +0 -0
- old/languages/loco-legacy-ko_KR.po +0 -636
- old/languages/loco-legacy-nl_BE.mo +0 -0
- old/languages/loco-legacy-nl_BE.po +0 -633
- old/languages/loco-legacy-nl_NL.mo +0 -0
- old/languages/loco-legacy-nl_NL.po +0 -633
- old/languages/loco-legacy-pl_PL.mo +0 -0
- old/languages/loco-legacy-pl_PL.po +0 -649
- old/languages/loco-legacy-pt_BR.mo +0 -0
- old/languages/loco-legacy-pt_BR.po +0 -643
- old/languages/loco-legacy-pt_PT.mo +0 -0
- old/languages/loco-legacy-pt_PT.po +0 -643
- old/languages/loco-legacy-ru_RU.mo +0 -0
- old/languages/loco-legacy-ru_RU.po +0 -641
- old/languages/loco-legacy-sv_SE.mo +0 -0
- old/languages/loco-legacy-sv_SE.po +0 -641
- old/languages/loco-legacy-tr_TR.mo +0 -0
- old/languages/loco-legacy-tr_TR.po +0 -661
- old/languages/loco-legacy-uk.mo +0 -0
- old/languages/loco-legacy-uk.po +0 -646
- old/languages/loco-legacy.pot +0 -628
- old/lib/build/gettext-compiled.php +0 -6
- old/lib/build/locales-compiled.php +0 -6
- old/lib/build/shell-compiled.php +0 -6
- old/lib/compat/loco-iconv.php +0 -22
- old/lib/compat/loco-json.php +0 -20
- old/lib/compat/loco-mbstring.php +0 -26
- old/lib/compat/loco-php.php +0 -26
- old/lib/compat/loco-tokenizer.php +0 -19
- old/lib/loco-admin.php +0 -1186
- old/lib/loco-boot.php +0 -324
- old/lib/loco-locales.php +0 -240
- old/lib/loco-packages.php +0 -1040
- old/php/loco-ajax.php +0 -53
- old/php/loco-data.php +0 -21
- old/php/loco-download.php +0 -95
- old/php/loco-fail.php +0 -10
- old/php/loco-fatal.php +0 -34
- old/php/loco-posave.php +0 -145
- old/php/loco-posync.php +0 -75
- old/pub/css/loco-admin.css +0 -1
- old/pub/css/loco-legacy.css +0 -18
- old/pub/css/skins/blue.css +0 -1
- old/pub/css/skins/coffee.css +0 -1
- old/pub/css/skins/ectoplasm.css +0 -1
- old/pub/css/skins/light.css +0 -1
- old/pub/css/skins/midnight.css +0 -1
- old/pub/css/skins/ocean.css +0 -1
- old/pub/css/skins/sunrise.css +0 -1
- old/pub/font/loco.eot +0 -0
- old/pub/font/loco.svg +0 -77
- old/pub/font/loco.ttf +0 -0
- old/pub/font/loco.woff +0 -0
- old/pub/img/flags.png +0 -0
- old/pub/img/loco-sprite.png +0 -0
- old/pub/img/wg/splitx.png +0 -0
- old/pub/img/wg/splity.png +0 -0
- old/pub/img/wp/menu.png +0 -0
- old/pub/js/build/admin-common.js +0 -3
- old/pub/js/build/admin-poedit.js +0 -163
- old/pub/js/build/admin-poinit.js +0 -2
- old/pub/js/debug.js +0 -23
- old/pub/js/lang/dummy.js +0 -21
- old/pub/js/lang/dummy.php +0 -58
- old/pub/js/lang/loco-translate-ckb.js +0 -185
- old/pub/js/lang/loco-translate-cs_CZ.js +0 -190
- old/pub/js/lang/loco-translate-de_DE.js +0 -185
- old/pub/js/lang/loco-translate-el.js +0 -185
- old/pub/js/lang/loco-translate-es_ES.js +0 -185
- old/pub/js/lang/loco-translate-fa_IR.js +0 -172
- old/pub/js/lang/loco-translate-fr_FR.js +0 -185
- old/pub/js/lang/loco-translate-id_ID.js +0 -172
- old/pub/js/lang/loco-translate-it_IT.js +0 -185
- old/pub/js/lang/loco-translate-ja.js +0 -172
- old/pub/js/lang/loco-translate-ko_KR.js +0 -172
- old/pub/js/lang/loco-translate-nl_BE.js +0 -185
- old/pub/js/lang/loco-translate-nl_NL.js +0 -185
- old/pub/js/lang/loco-translate-pl_PL.js +0 -190
- old/pub/js/lang/loco-translate-pt_BR.js +0 -185
- old/pub/js/lang/loco-translate-pt_PT.js +0 -185
- old/pub/js/lang/loco-translate-ru_RU.js +0 -190
- old/pub/js/lang/loco-translate-sv_SE.js +0 -185
- old/pub/js/lang/loco-translate-tr_TR.js +0 -185
- old/pub/js/lang/loco-translate-uk.js +0 -190
- old/tpl/admin-fscheck.tpl.php +0 -64
- old/tpl/admin-list.tpl.php +0 -112
- old/tpl/admin-nav.tpl.php +0 -42
- old/tpl/admin-opts.tpl.php +0 -106
- old/tpl/admin-poedit.tpl.php +0 -119
languages/loco-translate.pot
CHANGED
|
@@ -3,7 +3,7 @@ msgid ""
|
|
| 3 |
msgstr ""
|
| 4 |
"Project-Id-Version: PACKAGE VERSION\n"
|
| 5 |
"Report-Msgid-Bugs-To: \n"
|
| 6 |
-
"POT-Creation-Date: 2017-
|
| 7 |
"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
|
| 8 |
"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
|
| 9 |
"Language-Team: \n"
|
|
@@ -14,7 +14,7 @@ msgstr ""
|
|
| 14 |
"Content-Transfer-Encoding: 8bit\n"
|
| 15 |
"X-Generator: Loco https://localise.biz/"
|
| 16 |
|
| 17 |
-
#: loco.php:
|
| 18 |
#, php-format
|
| 19 |
msgid ""
|
| 20 |
"Loco requires the \"%s\" PHP extension. Ask your hosting provider to install "
|
|
@@ -401,7 +401,7 @@ msgstr ""
|
|
| 401 |
|
| 402 |
#: src/mvc/AdminRouter.php:61 src/admin/config/PrefsController.php:48
|
| 403 |
#: src/admin/config/SettingsController.php:77
|
| 404 |
-
#: src/admin/config/VersionController.php:
|
| 405 |
msgid "Plugin settings"
|
| 406 |
msgstr ""
|
| 407 |
|
|
@@ -453,14 +453,14 @@ msgstr ""
|
|
| 453 |
msgid "WordPress Core"
|
| 454 |
msgstr ""
|
| 455 |
|
| 456 |
-
#: src/package/Debugger.php:
|
| 457 |
#, php-format
|
| 458 |
msgid "One string extracted from source code for \"%2$s\""
|
| 459 |
msgid_plural "%s strings extracted from source code for \"%s\""
|
| 460 |
msgstr[0] ""
|
| 461 |
msgstr[1] ""
|
| 462 |
|
| 463 |
-
#: src/package/Debugger.php:
|
| 464 |
#, php-format
|
| 465 |
msgid "Configured domain has no extractable strings"
|
| 466 |
msgid_plural "%u configured domains have no extractable strings"
|
|
@@ -475,49 +475,49 @@ msgstr ""
|
|
| 475 |
msgid "Visit official site"
|
| 476 |
msgstr ""
|
| 477 |
|
| 478 |
-
#: src/package/Plugin.php:
|
| 479 |
#, php-format
|
| 480 |
msgid "Plugin not found: %s"
|
| 481 |
msgstr ""
|
| 482 |
|
| 483 |
-
#: tpl/admin/root.php:
|
| 484 |
msgid "Welcome to Loco Translate"
|
| 485 |
msgstr ""
|
| 486 |
|
| 487 |
#. 1: help URL, 2: forum URL; Must be HTML encoded
|
| 488 |
-
#: tpl/admin/root.php:
|
| 489 |
#, php-format
|
| 490 |
msgid ""
|
| 491 |
"If you have any questions, please try our <a href=\"%1$s\">help pages</a> or "
|
| 492 |
"ask in the <a href=\"%2$s\">support forum</a>."
|
| 493 |
msgstr ""
|
| 494 |
|
| 495 |
-
#: tpl/admin/root.php:
|
| 496 |
msgid "Recently updated:"
|
| 497 |
msgstr ""
|
| 498 |
|
| 499 |
-
#: tpl/admin/root.php:
|
| 500 |
msgid "Translations have been recently modified in the following bundles"
|
| 501 |
msgstr ""
|
| 502 |
|
| 503 |
-
#: tpl/admin/root.php:
|
| 504 |
msgid "Active theme:"
|
| 505 |
msgstr ""
|
| 506 |
|
| 507 |
-
#: tpl/admin/root.php:
|
| 508 |
msgid "See all themes"
|
| 509 |
msgstr ""
|
| 510 |
|
| 511 |
-
#: tpl/admin/root.php:
|
| 512 |
msgid "Running plugins:"
|
| 513 |
msgstr ""
|
| 514 |
|
| 515 |
-
#: tpl/admin/root.php:
|
| 516 |
msgid ""
|
| 517 |
"These plugins have recently loaded translation files into the admin area"
|
| 518 |
msgstr ""
|
| 519 |
|
| 520 |
-
#: tpl/admin/root.php:
|
| 521 |
msgid "See all plugins"
|
| 522 |
msgstr ""
|
| 523 |
|
|
@@ -1082,6 +1082,7 @@ msgid "Allow full access to these roles"
|
|
| 1082 |
msgstr ""
|
| 1083 |
|
| 1084 |
#: tpl/admin/config/version.php:11 tpl/admin/config/version.php:25
|
|
|
|
| 1085 |
#, php-format
|
| 1086 |
msgid "Version %s"
|
| 1087 |
msgstr ""
|
|
@@ -1092,6 +1093,10 @@ msgid "Upgrade to %s"
|
|
| 1092 |
msgstr ""
|
| 1093 |
|
| 1094 |
#: tpl/admin/config/version.php:28
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1095 |
msgid "You're running the latest version of Loco Translate"
|
| 1096 |
msgstr ""
|
| 1097 |
|
|
@@ -1225,6 +1230,13 @@ msgstr ""
|
|
| 1225 |
msgid "Source text"
|
| 1226 |
msgstr ""
|
| 1227 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1228 |
#: tpl/admin/file/info.php:14
|
| 1229 |
msgid "File doesn't exist"
|
| 1230 |
msgstr ""
|
| 3 |
msgstr ""
|
| 4 |
"Project-Id-Version: PACKAGE VERSION\n"
|
| 5 |
"Report-Msgid-Bugs-To: \n"
|
| 6 |
+
"POT-Creation-Date: 2017-08-03 12:24+0000\n"
|
| 7 |
"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
|
| 8 |
"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
|
| 9 |
"Language-Team: \n"
|
| 14 |
"Content-Transfer-Encoding: 8bit\n"
|
| 15 |
"X-Generator: Loco https://localise.biz/"
|
| 16 |
|
| 17 |
+
#: loco.php:131
|
| 18 |
#, php-format
|
| 19 |
msgid ""
|
| 20 |
"Loco requires the \"%s\" PHP extension. Ask your hosting provider to install "
|
| 401 |
|
| 402 |
#: src/mvc/AdminRouter.php:61 src/admin/config/PrefsController.php:48
|
| 403 |
#: src/admin/config/SettingsController.php:77
|
| 404 |
+
#: src/admin/config/VersionController.php:22 tpl/admin/help/tab-settings.php:2
|
| 405 |
msgid "Plugin settings"
|
| 406 |
msgstr ""
|
| 407 |
|
| 453 |
msgid "WordPress Core"
|
| 454 |
msgstr ""
|
| 455 |
|
| 456 |
+
#: src/package/Debugger.php:186
|
| 457 |
#, php-format
|
| 458 |
msgid "One string extracted from source code for \"%2$s\""
|
| 459 |
msgid_plural "%s strings extracted from source code for \"%s\""
|
| 460 |
msgstr[0] ""
|
| 461 |
msgstr[1] ""
|
| 462 |
|
| 463 |
+
#: src/package/Debugger.php:204
|
| 464 |
#, php-format
|
| 465 |
msgid "Configured domain has no extractable strings"
|
| 466 |
msgid_plural "%u configured domains have no extractable strings"
|
| 475 |
msgid "Visit official site"
|
| 476 |
msgstr ""
|
| 477 |
|
| 478 |
+
#: src/package/Plugin.php:203
|
| 479 |
#, php-format
|
| 480 |
msgid "Plugin not found: %s"
|
| 481 |
msgstr ""
|
| 482 |
|
| 483 |
+
#: tpl/admin/root.php:10
|
| 484 |
msgid "Welcome to Loco Translate"
|
| 485 |
msgstr ""
|
| 486 |
|
| 487 |
#. 1: help URL, 2: forum URL; Must be HTML encoded
|
| 488 |
+
#: tpl/admin/root.php:14
|
| 489 |
#, php-format
|
| 490 |
msgid ""
|
| 491 |
"If you have any questions, please try our <a href=\"%1$s\">help pages</a> or "
|
| 492 |
"ask in the <a href=\"%2$s\">support forum</a>."
|
| 493 |
msgstr ""
|
| 494 |
|
| 495 |
+
#: tpl/admin/root.php:24
|
| 496 |
msgid "Recently updated:"
|
| 497 |
msgstr ""
|
| 498 |
|
| 499 |
+
#: tpl/admin/root.php:27
|
| 500 |
msgid "Translations have been recently modified in the following bundles"
|
| 501 |
msgstr ""
|
| 502 |
|
| 503 |
+
#: tpl/admin/root.php:36
|
| 504 |
msgid "Active theme:"
|
| 505 |
msgstr ""
|
| 506 |
|
| 507 |
+
#: tpl/admin/root.php:40
|
| 508 |
msgid "See all themes"
|
| 509 |
msgstr ""
|
| 510 |
|
| 511 |
+
#: tpl/admin/root.php:48
|
| 512 |
msgid "Running plugins:"
|
| 513 |
msgstr ""
|
| 514 |
|
| 515 |
+
#: tpl/admin/root.php:51
|
| 516 |
msgid ""
|
| 517 |
"These plugins have recently loaded translation files into the admin area"
|
| 518 |
msgstr ""
|
| 519 |
|
| 520 |
+
#: tpl/admin/root.php:55
|
| 521 |
msgid "See all plugins"
|
| 522 |
msgstr ""
|
| 523 |
|
| 1082 |
msgstr ""
|
| 1083 |
|
| 1084 |
#: tpl/admin/config/version.php:11 tpl/admin/config/version.php:25
|
| 1085 |
+
#: tpl/admin/config/version.php:35
|
| 1086 |
#, php-format
|
| 1087 |
msgid "Version %s"
|
| 1088 |
msgstr ""
|
| 1093 |
msgstr ""
|
| 1094 |
|
| 1095 |
#: tpl/admin/config/version.php:28
|
| 1096 |
+
msgid "You're running a development snapshot of Loco Translate"
|
| 1097 |
+
msgstr ""
|
| 1098 |
+
|
| 1099 |
+
#: tpl/admin/config/version.php:38
|
| 1100 |
msgid "You're running the latest version of Loco Translate"
|
| 1101 |
msgstr ""
|
| 1102 |
|
| 1230 |
msgid "Source text"
|
| 1231 |
msgstr ""
|
| 1232 |
|
| 1233 |
+
#: tpl/admin/file/info-pot.php:19
|
| 1234 |
+
#, php-format
|
| 1235 |
+
msgid "1 word"
|
| 1236 |
+
msgid_plural "%s words"
|
| 1237 |
+
msgstr[0] ""
|
| 1238 |
+
msgstr[1] ""
|
| 1239 |
+
|
| 1240 |
#: tpl/admin/file/info.php:14
|
| 1241 |
msgid "File doesn't exist"
|
| 1242 |
msgstr ""
|
lib/compiled/gettext.php
CHANGED
|
@@ -7,14 +7,13 @@ interface LocoArrayInterface extends ArrayAccess, Iterator, Countable, JsonSeria
|
|
| 7 |
class LocoHeaders extends ArrayIterator implements LocoArrayInterface { private $map = array(); public function __construct( array $raw = array() ){ if( $raw ){ $keys = array_keys( $raw ); $this->map = array_combine( array_map( 'strtolower', $keys ), $keys ); parent::__construct($raw); } } public function normalize( $key ){ $k = strtolower($key); return isset($this->map[$k]) ? $this->map[$k] : null; } public function add( $key, $val ){ $this->offsetSet( $key, $val ); return $this; } public function __toString(){ $pairs = array(); foreach( $this as $key => $val ){ $pairs[] = trim($key).': '.$val; } return implode("\n", $pairs ); } public function trimmed( $prop ){ return trim( $this->__get($prop) ); } public function has( $key ){ $k = strtolower($key); return isset($this->map[$k]); } public function __get( $key ){ return $this->offsetGet( $key ); } public function __set( $key, $val ){ $this->offsetSet( $key, $val ); } public function offsetExists( $k ){ return ! is_null( $this->normalize($k) ); } public function offsetGet( $k ){ $k = $this->normalize($k); if( is_null($k) ){ return ''; } return parent::offsetGet($k); } public function offsetSet( $key, $v ){ $k = strtolower($key); if( isset($this->map[$k]) && $key !== $this->map[$k] ){ parent::offsetUnset( $this->map[$k] ); } $this->map[$k] = $key; return parent::offsetSet( $key, $v ); } public function offsetUnset( $key ){ $k = strtolower($key); if( isset($this->map[$k]) ){ parent::offsetUnset( $this->map[$k] ); unset( $this->map[$k] ); } } public function export(){ return $this->getArrayCopy(); } public function jsonSerialize(){ return $this->getArrayCopy(); } public function toArray(){ return $this->getArrayCopy(); } public function keys(){ return array_values( $this->map ); } }
|
| 8 |
class LocoPoHeaders extends LocoHeaders { public static function fromMsgstr( $str ){ $headers = new LocoPoHeaders; foreach( explode("\n",$str) as $line ){ $i = strpos($line,':') and $key = trim( substr($line,0,$i) ) and $headers->add( $key, trim( substr($line,++$i) ) ); } return $headers; } public static function fromSource( $raw ){ $raw = loco_ensure_utf8($raw); while( preg_match('/^.*[\r\n]+/u', $raw, $r ) ){ $line = $r[0]; if( '#' === $line{0} ){ $raw = substr( $raw, strlen($line) ); continue; } if( preg_match('/^msgid\s+""\s+msgstr\s+/', $raw, $r ) ){ $raw = substr( $raw, strlen($r[0]) ); $str = array(); while( preg_match('/^"(.*)"\s*/', $raw, $r ) ){ $raw = substr( $raw, strlen($r[0]) ); $chunk = $r[1]; if( '' !== $chunk ){ $str[] = stripcslashes( $r[1] ); } } if( $str ){ return self::fromMsgstr( implode('',$str) ); } break; } else { break; } } throw new Loco_error_ParseException('Invalid PO header'); } }
|
| 9 |
function loco_parse_reference_id( $refs, &$_id ){ if( false === ( $n = strpos($refs,'loco:') ) ){ $_id = ''; return $refs; } $_id = substr($refs, $n+5, 24 ); $refs = substr_replace( $refs, '', $n, 29 ); return trim( $refs ); }
|
| 10 |
-
function loco_parse_po( $src ){ $src = loco_ensure_utf8( $src ); $i = -1; $key = ''; $entries = array(); $template = array( '#' => array(), 'id' => array(), 'str' => array(), 'ctxt' => array() ); foreach( preg_split('/[\r\n]+/', $src) as $_i => $line ){ while( $line = trim($line," \t") ){ $c = $line{0}; if( '"' === $c ){ if( $key && isset($entry) ){ if( '"' === substr($line,-1) ){ $line = substr( $line, 1, -1 ); $entry[$key][$idx][] = stripcslashes($line); } } } else if( '#' === $c ){ if( isset($entry['i']) ){ unset( $entry ); $entry = $template; } $f = empty($line{1}) ? ' ' : $line{1}; $entry['#'][$f][] = trim( substr( $line, 1+strlen($f) ), "/ \n\r\t" ); } else if( preg_match('/^msg(id|str|ctxt|id_plural)(?:\[(\d+)\])?[ \t]+/', $line, $r ) ){ $key = $r[1]; $idx = isset($r[2]) ? (int) $r[2] : 0; if( 'str' === $key ){ if( ! isset($entry['i']) ){ $entry['i'] = ++$i; $entries[$i] = &$entry; } } else if( ! isset($entry) || isset($entry['i']) ){ unset( $entry ); $entry = $template; } $line = substr( $line, strlen($r[0]) ); continue; } continue 2; } } unset( $entry ); $assets = array(); foreach( $entries as $i => $entry ){ if( empty($entry['id']) ){ continue; } if( empty($entry['str']) ){ $entry['str'] = array( array('') ); } $asset = array( 'id' => null, 'source' => implode('',$entry['id'][0]), 'target' => implode('',$entry['str'][0]), ); if( isset($entry['ctxt'][0]) ){ $asset['context'] = implode('',$entry['ctxt'][0]); } if( isset($entry['#'][' ']) ){ $asset['comment'] = implode("\n", $
|
| 11 |
-
function loco_po_parse_flag( $text ){ static $map; $flag = 0; foreach( explode(',',$text) as $needle ){ if( $needle = trim($needle) ){ if( ! isset($map) ){ $map = unserialize('a:1:{i:4;s:8:"#, fuzzy";}'); } foreach( $map as $loco_flag => $haystack ){ if( false !== stripos($haystack, $needle) ){ $flag = $loco_flag; break 2; } } } } return $flag; }
|
| 12 |
function loco_parse_po_headers( $str ){ return LocoPoHeaders::fromMsgstr($str); }
|
| 13 |
class LocoMoParser { private $bin; private $be; private $n; private $o; private $t; private $v; private $cs; public function __construct( $bin ){ $this->bin = $bin; } public function getAt( $idx ){ $offset = $this->targetOffset(); $offset += ( $idx * 8 ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false === strpos( $txt, "\0") ){ return $txt; } return explode( "\0", $txt ); } public function parse(){ $r = array(); $sourceOffset = $this->sourceOffset(); $targetOffset = $this->targetOffset(); $soffset = $sourceOffset; $toffset = $targetOffset; while( $soffset < $targetOffset ){ $len = $this->integerAt( $soffset ); $idx = $this->integerAt( $soffset + 4 ); $src = $this->bytes( $idx, $len ); $eot = strpos( $src, "\x04" ); if( false === $eot ){ $context = null; } else { $context = $this->decodeStr( substr($src, 0, $eot ) ); $src = substr( $src, $eot+1 ); } $sources = explode( "\0", $src, 2 ); $len = $this->integerAt( $toffset ); $idx = $this->integerAt( $toffset + 4 ); $targets = explode( "\0", $this->bytes( $idx, $len ) ); $r[] = array( 'id' => null, 'source' => $this->decodeStr( $sources[0] ), 'target' => $this->decodeStr( $targets[0] ), 'context' => $context, ); if( isset($sources[1]) ){ $p = count($r) - 1; $nforms = max( 2, count($targets) ); for( $i = 1; $i < $nforms; $i++ ){ $r[] = array( 'id' => null, 'source' => isset($sources[$i]) ? $this->decodeStr( $sources[$i] ) : sprintf('%s (plural %u)',$r[$p]['source'],$i), 'target' => isset($targets[$i]) ? $this->decodeStr( $targets[$i] ) : '', 'parent' => $p, 'plural' => $i, ); } } $soffset += 8; $toffset += 8; } return $r; } public function isBigendian(){ while( is_null($this->be) ){ $str = $this->words( 0, 1 ); if( "\xDE\x12\x04\x95" === $str ){ $this->be = false; break; } if( "\x95\x04\x12\xDE" === $str ){ $this->be = true; break; } throw new Loco_error_ParseException('Invalid MO format'); } return $this->be; } public function version(){ if( is_null($this->v) ){ $this->v = $this->integerWord(1); } return $this->v; } public function count(){ if( is_null($this->n) ){ $this->n = $this->integerWord(2); } return $this->n; } public function sourceOffset(){ if( is_null($this->o) ){ $this->o = $this->integerWord(3); } return $this->o; } public function targetOffset(){ if( is_null($this->t) ){ $this->t = $this->integerWord(4); } return $this->t; } public function getHashTable(){ $s = $this->integerWord(5); $h = $this->integerWord(6); return $this->bytes( $h, $s * 4 ); } private function bytes( $offset, $length ){ return substr( $this->bin, $offset, $length ); } private function words( $offset, $length ){ return $this->bytes( $offset * 4, $length * 4 ); } private function integerWord( $offset ){ return $this->integerAt( $offset * 4 ); } private function integerAt( $offset ){ $str = $this->bytes( $offset, 4 ); $fmt = $this->isBigendian() ? 'N' : 'V'; $arr = unpack( $fmt, $str ); if( ! isset($arr[1]) || ! is_int($arr[1]) ){ throw new Loco_error_ParseException('Failed to read integer at byte '.$offset); } return $arr[1]; } private function decodeStr( $str ){ if( $this->cs ){ $enc = $this->cs; } else { $enc = mb_detect_encoding( $str, array('ASCII','UTF-8','ISO-8859-1'), false ); if( 'ASCII' !== $enc ){ $this->cs = $enc; } } if( 'UTF-8' !== $enc ){ $str = mb_convert_encoding( $str, 'UTF-8', array($enc) ); } return $str; } }
|
| 14 |
function loco_parse_mo( $src ){ $mo = new LocoMoParser($src); return $mo->parse(); }
|
| 15 |
function loco_parse_comment($comment){ if( '*' === $comment{1} ){ $lines = array(); $junk = "\r\t/ *"; foreach( explode("\n", $comment) as $line ){ if( $line = trim($line,$junk) ){ $lines[] = trim($line,$junk); } } return implode("\n", $lines); } return trim( $comment,"/ \n\r\t" ); }
|
| 16 |
function loco_parse_wp_comment( $block ){ $header = array(); if( '*' === $block{1} ){ $junk = "\r\t/ *"; foreach( explode("\n", $block) as $line ){ if( false !== ( $i = strpos($line,':') ) ){ $key = substr($line,0,$i); $val = substr($line,++$i); $header[ trim($key,$junk) ] = trim($val,$junk); } } } return $header; }
|
| 17 |
-
abstract class LocoExtractor { private $rules; private $exp = array(); private $reg = array(); private $dom = array(); private $wp = array(); private $dflt = ''; abstract public function decapse( $raw ); abstract public function fsniff( $str ); public function __construct( array $rules ){ $this->rules = $rules; } public function getTotal(){ return count( $this->exp ); } public function getDomainCounts(){ return $this->dom; } public function setDomain( $default ){ $this->dflt = (string) $default; return $this; } public function headerize( array $tags, $domain = '' ){ if( isset($this->wp[$domain]) ){ $this->wp[$domain] += $tags; } else { $this->wp[$domain] = $tags; } return $this; } public function extract( LocoTokensInterface $tokens, $fileref ){ $n = 0; $comment = ''; foreach( $tokens as $tok ){ if( is_string($tok) ){ $s = $tok; $t = null; } else { $t = $tok[0]; $s = $tok[1]; if( T_WHITESPACE === $t ){ throw new RuntimeException( get_class($tokens).' should not allow whitespace through' ); } } if( isset($args) ){ if( ')' === $s ){ if( 0 === --$depth ){ if( isset($arg) ){ $args[] = $arg; } $this->push( $rule, $args, $comment, $ref ); unset($args,$arg); $comment = ''; $n++; } } else if( '(' === $s ){ $depth++; } else if( ',' === $s ){ if( isset($arg) ){ $args[] = $arg; unset($arg); } } else if( isset($arg) ){ $arg[] = $tok; } else { $arg = array( $tok ); } } else if( T_COMMENT === $t || T_DOC_COMMENT === $t ){ if( $this->wp && 0 === $n && ( $header = loco_parse_wp_comment($s) ) ){ foreach( $this->wp as $domain => $tags ){ foreach( array_intersect_key($header,$tags) as $tag => $source ){ $this->pushMeta( $source, $tags[$tag], $domain ); } } } else { $comment = $s; } } else if( T_STRING === $t && isset($this->rules[$s]) && '(' === $tokens->advance() ){ $rule = $this->rules[$s]; $args = array(); $ref = $fileref ? $fileref.':'.$tok[2]: ''; $depth = 1; } else if( $comment ){ if( false === stripos($comment, 'translators:') && false === strpos($comment, 'xgettext:') ){ $comment = ''; } } } return $this->exp; } public function pushMeta( $source, $notes = '', $domain = null ){ if( ! $domain ){ $domain = $this->dflt; } $entry = array( 'id' => '', 'source' => $source, 'target' => '', 'notes' => $notes, ); if( $domain ){ $entry['domain'] = $domain; $key = $source."\1".$domain; } else { $key = $source; } $this->pushMsgid( $key, $entry, $domain ); return $this; } private function pushMsgid( $key, array $entry, $domain ){ if( isset($this->reg[$key]) ){ $index = $this->reg[$key]; $a = array(); isset($this->exp[$index]['refs']) and $a[] = $this->exp[$index]['refs']; isset($entry['refs']) and $a[] = $entry['refs']; $a && $this->exp[$index]['refs'] = implode(" ", $a ); $a = array(); isset($this->exp[$index]['notes']) and $a[] = $this->exp[$index]['notes']; isset($entry['notes']) and $a[] = $entry['notes']; $a && $this->exp[$index]['notes'] = implode("\n", $a ); } else { $index = count($this->exp); $this->reg[$key] = $index; $this->exp[] = $entry; if( isset($this->dom[$domain]) ){ $this->dom[$domain]++; } else { $this->dom[$domain] = 1; } } return $index; } private function push( $rule, array $args, $comment = '', $ref = '' ){ $s = strpos( $rule, 's'); $p = strpos( $rule, 'p'); $c = strpos( $rule, 'c'); $d = strpos( $rule, 'd'); foreach( $args as $i => $tokens ){ if( 1 === count($tokens) && is_array($tokens[0]) && T_CONSTANT_ENCAPSED_STRING === $tokens[0][0] ){ $args[$i] = $this->decapse( $tokens[0][1] ); } else { $args[$i] = null; } } if( ! isset($args[$s]) ){ return null; } $key = $msgid = $args[$s]; if( ! is_string($msgid) ){ return null; } $entry = array( 'id' => '', 'source' => $msgid, 'target' => '', ); if( is_int($c) && isset($args[$c]) ){ $entry['context'] = $context = $args[$c]; $key .= "\0". $context; } else if( ! isset($msgid{0}) ){ return null; } else { $context = null; } if( $ref ){ $entry['refs'] = $ref; } if( is_int($d) && array_key_exists($d,$args) ){ $domain = $args[$d]; if( is_null($domain) ){ $domain = ''; } } else { $domain = $this->dflt; } if( $domain ){ $entry['domain'] = $domain; $key .= "\1".$domain; } $parse_printf = true; if( $comment ){ if( preg_match('/xgettext:\s*((?:no-)?\w+)-format/', $comment, $r ) ){ $entry['format'] = $r[1]; if( 'no-' === substr($r[1],0,3) ){ $parse_printf = false; } else { $parse_printf = null; } $comment = str_replace( $r[0], '', $comment ); } $comment = loco_parse_comment($comment); if( preg_match('/^translators:\s+/i', $comment, $r ) ){ $comment = substr( $comment, strlen($r[0]) ); } $entry['notes'] = $comment; } if( $parse_printf && ( $format = $this->fsniff($msgid) ) ){ $entry['format'] = $format; } $index = $this->pushMsgid( $key, $entry, $domain ); if( is_int($p) && isset($args[$p]) ){ $msgid_plural = $args[$p]; $entry = array( 'id' => '', 'source' => $msgid_plural, 'target' => '', 'plural' => 1, 'parent' => $index, ); if( false !== $parse_printf && ( $format = $this->fsniff($msgid_plural) ) ){ $entry['format'] = $format; } $pkey = $key."\2"; if( isset($this->reg[$pkey]) ){ $plural_index = $this->reg[$pkey]; $this->exp[$plural_index] = $entry; } else { $plural_index = count($this->exp); $this->reg[$pkey] = $plural_index; $this->exp[] = $entry; } } return $index; } public function filter( $domain ){ $map = array(); $newOffset = 1; $matchAll = '*' === $domain; $raw = array( array( 'id' => '', 'source' => '', 'target' => '', 'domain' => $matchAll ? '' : $domain, ) ); foreach( $this->exp as $oldOffset => $r ){ if( isset($r['parent']) ){ if( isset($map[$r['parent']]) ){ $r['parent'] = $map[ $r['parent'] ]; $raw[ $newOffset++ ] = $r; } } else { if( $matchAll ){ $match = true; } else if( isset($r['domain']) ){ $match = $domain === $r['domain']; } else { $match = $domain === ''; } if( $match ){ $map[ $oldOffset ] = $newOffset; $raw[ $newOffset++ ] = $r; } } } return $raw; } }
|
| 18 |
interface LocoTokensInterface extends Iterator { public function advance(); }
|
| 19 |
class LocoPHPTokens implements LocoTokensInterface { private $i; private $tokens; private $skip_tokens = array(); private $skip_strings = array(); private $literal_tokens = array(); public function __construct( array $tokens ){ $this->tokens = $tokens; $this->rewind(); } public function literal(){ foreach( func_get_args() as $t ){ $this->literal_tokens[ $t ] = 1; } return $this; } public function ignore(){ foreach( func_get_args() as $t ){ if( is_int($t) ){ $this->skip_tokens[$t] = true; } else { $this->skip_strings[$t] = true; } } return $this; } public function export(){ $arr = array(); foreach( $this as $tok ){ $arr[] = $tok; } return $arr; } public function advance(){ $this->next(); return $this->current(); } public function pop(){ $tok = array_pop( $this->tokens ); $this->rewind(); return $tok; } public function shift(){ $tok = array_shift( $this->tokens); $this->rewind(); return $tok; } public function rewind(){ $this->i = ( false === reset($this->tokens) ? null : key($this->tokens) ); } public function valid(){ while( isset($this->i) ){ $tok = $this->tokens[$this->i]; if( is_array($tok) ){ if( isset($this->skip_tokens[$tok[0]]) ){ $this->next(); } else { return true; } } else if( isset($this->skip_strings[$tok]) ){ $this->next(); } else { return true; } } return false; } public function key(){ return $this->i; } public function next(){ $this->i = ( false === next($this->tokens) ? null : key($this->tokens) ); } public function current(){ if( ! $this->valid() ){ return false; } $tok = $this->tokens[$this->i]; if( is_array($tok) && isset($this->literal_tokens[$tok[0]]) ){ return $tok[1]; } return $tok; } public function __toString(){ $s = ''; foreach( $this as $token ){ $s .= is_array($token) ? $token[1] : $token; } return $s; } }
|
| 20 |
function loco_sniff_printf( $s, $p, $limit = 0, $offset = 0 ){ $n = 0; while( $s && false !== ( $i = strpos($s,'%',$offset) ) ){ if( 0 !== $i ){ $s = substr( $s, $i ); } if( preg_match( $p, $s, $r ) ){ $match = $r[0]; if( 0 < $n && isset($r[1]) && '' === $r[1] && '%' !== substr($match,-1) ){ return 0; } if( ++$n === $limit ){ break; } $offset = strlen($match); } else { return 0; } } return $n; }
|
| 7 |
class LocoHeaders extends ArrayIterator implements LocoArrayInterface { private $map = array(); public function __construct( array $raw = array() ){ if( $raw ){ $keys = array_keys( $raw ); $this->map = array_combine( array_map( 'strtolower', $keys ), $keys ); parent::__construct($raw); } } public function normalize( $key ){ $k = strtolower($key); return isset($this->map[$k]) ? $this->map[$k] : null; } public function add( $key, $val ){ $this->offsetSet( $key, $val ); return $this; } public function __toString(){ $pairs = array(); foreach( $this as $key => $val ){ $pairs[] = trim($key).': '.$val; } return implode("\n", $pairs ); } public function trimmed( $prop ){ return trim( $this->__get($prop) ); } public function has( $key ){ $k = strtolower($key); return isset($this->map[$k]); } public function __get( $key ){ return $this->offsetGet( $key ); } public function __set( $key, $val ){ $this->offsetSet( $key, $val ); } public function offsetExists( $k ){ return ! is_null( $this->normalize($k) ); } public function offsetGet( $k ){ $k = $this->normalize($k); if( is_null($k) ){ return ''; } return parent::offsetGet($k); } public function offsetSet( $key, $v ){ $k = strtolower($key); if( isset($this->map[$k]) && $key !== $this->map[$k] ){ parent::offsetUnset( $this->map[$k] ); } $this->map[$k] = $key; return parent::offsetSet( $key, $v ); } public function offsetUnset( $key ){ $k = strtolower($key); if( isset($this->map[$k]) ){ parent::offsetUnset( $this->map[$k] ); unset( $this->map[$k] ); } } public function export(){ return $this->getArrayCopy(); } public function jsonSerialize(){ return $this->getArrayCopy(); } public function toArray(){ return $this->getArrayCopy(); } public function keys(){ return array_values( $this->map ); } }
|
| 8 |
class LocoPoHeaders extends LocoHeaders { public static function fromMsgstr( $str ){ $headers = new LocoPoHeaders; foreach( explode("\n",$str) as $line ){ $i = strpos($line,':') and $key = trim( substr($line,0,$i) ) and $headers->add( $key, trim( substr($line,++$i) ) ); } return $headers; } public static function fromSource( $raw ){ $raw = loco_ensure_utf8($raw); while( preg_match('/^.*[\r\n]+/u', $raw, $r ) ){ $line = $r[0]; if( '#' === $line{0} ){ $raw = substr( $raw, strlen($line) ); continue; } if( preg_match('/^msgid\s+""\s+msgstr\s+/', $raw, $r ) ){ $raw = substr( $raw, strlen($r[0]) ); $str = array(); while( preg_match('/^"(.*)"\s*/', $raw, $r ) ){ $raw = substr( $raw, strlen($r[0]) ); $chunk = $r[1]; if( '' !== $chunk ){ $str[] = stripcslashes( $r[1] ); } } if( $str ){ return self::fromMsgstr( implode('',$str) ); } break; } else { break; } } throw new Loco_error_ParseException('Invalid PO header'); } }
|
| 9 |
function loco_parse_reference_id( $refs, &$_id ){ if( false === ( $n = strpos($refs,'loco:') ) ){ $_id = ''; return $refs; } $_id = substr($refs, $n+5, 24 ); $refs = substr_replace( $refs, '', $n, 29 ); return trim( $refs ); }
|
| 10 |
+
function loco_parse_po( $src ){ $src = loco_ensure_utf8( $src ); $i = -1; $key = ''; $entries = array(); $template = array( '#' => array(), 'id' => array(), 'str' => array(), 'ctxt' => array() ); foreach( preg_split('/[\r\n]+/', $src) as $_i => $line ){ while( $line = trim($line," \t") ){ $c = $line{0}; if( '"' === $c ){ if( $key && isset($entry) ){ if( '"' === substr($line,-1) ){ $line = substr( $line, 1, -1 ); $entry[$key][$idx][] = stripcslashes($line); } } } else if( '#' === $c ){ if( isset($entry['i']) ){ unset( $entry ); $entry = $template; } $f = empty($line{1}) ? ' ' : $line{1}; $entry['#'][$f][] = trim( substr( $line, 1+strlen($f) ), "/ \n\r\t" ); } else if( preg_match('/^msg(id|str|ctxt|id_plural)(?:\[(\d+)\])?[ \t]+/', $line, $r ) ){ $key = $r[1]; $idx = isset($r[2]) ? (int) $r[2] : 0; if( 'str' === $key ){ if( ! isset($entry['i']) ){ $entry['i'] = ++$i; $entries[$i] = &$entry; } } else if( ! isset($entry) || isset($entry['i']) ){ unset( $entry ); $entry = $template; } $line = substr( $line, strlen($r[0]) ); continue; } continue 2; } } unset( $entry ); $assets = array(); foreach( $entries as $i => $entry ){ if( empty($entry['id']) ){ continue; } if( empty($entry['str']) ){ $entry['str'] = array( array('') ); } $asset = array( 'id' => null, 'source' => implode('',$entry['id'][0]), 'target' => implode('',$entry['str'][0]), ); if( isset($entry['ctxt'][0]) ){ $asset['context'] = implode('',$entry['ctxt'][0]); } if( isset($entry['#']) ){ $cmt = $entry['#']; if( isset($cmt[' ']) ){ $asset['comment'] = implode("\n", $cmt[' '] ); } if( isset($cmt['.']) ){ $asset['notes'] = implode("\n", $cmt['.'] ); } if( isset($cmt[':']) ){ if( $refs = implode( ' ', $cmt[':'] ) ) { if( $refs = loco_parse_reference_id( $refs, $_id ) ){ $asset['refs'] = $refs; } if( $_id ){ $asset['_id'] = $_id; } } } if( isset($cmt[',']) ){ foreach( $cmt[','] as $flags ){ foreach( explode(',',$flags) as $flag ){ if( $flag = trim($flag) ){ if( preg_match('/^((?:no-)?\w+)-format/', $flag, $r ) ){ $asset['format'] = $r[1]; } else if( 'fuzzy' === $flag ){ $asset['flag'] = 4; } } } } } } $pidx = count($assets); $assets[] = $asset; if( isset($entry['id_plural']) || isset($entry['str'][1]) ){ $idx = 0; $num = max( 2, count($entry['str']) ); while( ++$idx < $num ){ $plural = array( 'id' => null, 'source' => '', 'target' => isset($entry['str'][$idx]) ? implode('',$entry['str'][$idx]) : '', 'plural' => $idx, 'parent' => $pidx, ); if( 1 === $idx ){ $plural['source'] = isset($entry['id_plural'][0]) ? implode('',$entry['id_plural'][0]) : ''; } $assets[] = $plural; } } } if( isset($assets[0]) && '' === $assets[0]['source'] ){ $headers = loco_parse_po_headers( $assets[0]['target'] ); $indexed = $headers['X-Loco-Lookup']; if( $indexed && 'text' !== $indexed ){ foreach( $assets as $i => $asset ){ if( isset($asset['notes']) ){ $notes = $texts = array(); foreach( explode("\n",$asset['notes']) as $line ){ 0 === strpos($line,'Source text: ') ? $texts[] = substr($line,13) : $notes[] = $line; } $assets[$i]['notes'] = implode("\n",$notes); $assets[$i]['id'] = $asset['source']; $assets[$i]['source'] = implode("\n",$texts); } } } } return $assets; }
|
|
|
|
| 11 |
function loco_parse_po_headers( $str ){ return LocoPoHeaders::fromMsgstr($str); }
|
| 12 |
class LocoMoParser { private $bin; private $be; private $n; private $o; private $t; private $v; private $cs; public function __construct( $bin ){ $this->bin = $bin; } public function getAt( $idx ){ $offset = $this->targetOffset(); $offset += ( $idx * 8 ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false === strpos( $txt, "\0") ){ return $txt; } return explode( "\0", $txt ); } public function parse(){ $r = array(); $sourceOffset = $this->sourceOffset(); $targetOffset = $this->targetOffset(); $soffset = $sourceOffset; $toffset = $targetOffset; while( $soffset < $targetOffset ){ $len = $this->integerAt( $soffset ); $idx = $this->integerAt( $soffset + 4 ); $src = $this->bytes( $idx, $len ); $eot = strpos( $src, "\x04" ); if( false === $eot ){ $context = null; } else { $context = $this->decodeStr( substr($src, 0, $eot ) ); $src = substr( $src, $eot+1 ); } $sources = explode( "\0", $src, 2 ); $len = $this->integerAt( $toffset ); $idx = $this->integerAt( $toffset + 4 ); $targets = explode( "\0", $this->bytes( $idx, $len ) ); $r[] = array( 'id' => null, 'source' => $this->decodeStr( $sources[0] ), 'target' => $this->decodeStr( $targets[0] ), 'context' => $context, ); if( isset($sources[1]) ){ $p = count($r) - 1; $nforms = max( 2, count($targets) ); for( $i = 1; $i < $nforms; $i++ ){ $r[] = array( 'id' => null, 'source' => isset($sources[$i]) ? $this->decodeStr( $sources[$i] ) : sprintf('%s (plural %u)',$r[$p]['source'],$i), 'target' => isset($targets[$i]) ? $this->decodeStr( $targets[$i] ) : '', 'parent' => $p, 'plural' => $i, ); } } $soffset += 8; $toffset += 8; } return $r; } public function isBigendian(){ while( is_null($this->be) ){ $str = $this->words( 0, 1 ); if( "\xDE\x12\x04\x95" === $str ){ $this->be = false; break; } if( "\x95\x04\x12\xDE" === $str ){ $this->be = true; break; } throw new Loco_error_ParseException('Invalid MO format'); } return $this->be; } public function version(){ if( is_null($this->v) ){ $this->v = $this->integerWord(1); } return $this->v; } public function count(){ if( is_null($this->n) ){ $this->n = $this->integerWord(2); } return $this->n; } public function sourceOffset(){ if( is_null($this->o) ){ $this->o = $this->integerWord(3); } return $this->o; } public function targetOffset(){ if( is_null($this->t) ){ $this->t = $this->integerWord(4); } return $this->t; } public function getHashTable(){ $s = $this->integerWord(5); $h = $this->integerWord(6); return $this->bytes( $h, $s * 4 ); } private function bytes( $offset, $length ){ return substr( $this->bin, $offset, $length ); } private function words( $offset, $length ){ return $this->bytes( $offset * 4, $length * 4 ); } private function integerWord( $offset ){ return $this->integerAt( $offset * 4 ); } private function integerAt( $offset ){ $str = $this->bytes( $offset, 4 ); $fmt = $this->isBigendian() ? 'N' : 'V'; $arr = unpack( $fmt, $str ); if( ! isset($arr[1]) || ! is_int($arr[1]) ){ throw new Loco_error_ParseException('Failed to read integer at byte '.$offset); } return $arr[1]; } private function decodeStr( $str ){ if( $this->cs ){ $enc = $this->cs; } else { $enc = mb_detect_encoding( $str, array('ASCII','UTF-8','ISO-8859-1'), false ); if( 'ASCII' !== $enc ){ $this->cs = $enc; } } if( 'UTF-8' !== $enc ){ $str = mb_convert_encoding( $str, 'UTF-8', array($enc) ); } return $str; } }
|
| 13 |
function loco_parse_mo( $src ){ $mo = new LocoMoParser($src); return $mo->parse(); }
|
| 14 |
function loco_parse_comment($comment){ if( '*' === $comment{1} ){ $lines = array(); $junk = "\r\t/ *"; foreach( explode("\n", $comment) as $line ){ if( $line = trim($line,$junk) ){ $lines[] = trim($line,$junk); } } return implode("\n", $lines); } return trim( $comment,"/ \n\r\t" ); }
|
| 15 |
function loco_parse_wp_comment( $block ){ $header = array(); if( '*' === $block{1} ){ $junk = "\r\t/ *"; foreach( explode("\n", $block) as $line ){ if( false !== ( $i = strpos($line,':') ) ){ $key = substr($line,0,$i); $val = substr($line,++$i); $header[ trim($key,$junk) ] = trim($val,$junk); } } } return $header; }
|
| 16 |
+
abstract class LocoExtractor { private $rules; private $exp = array(); private $reg = array(); private $dom = array(); private $wp = array(); private $dflt = ''; abstract public function decapse( $raw ); abstract public function fsniff( $str ); public function __construct( array $rules ){ $this->rules = $rules; } public function getTotal(){ return count( $this->exp ); } public function getDomainCounts(){ return $this->dom; } public function setDomain( $default ){ $this->dflt = (string) $default; return $this; } public function headerize( array $tags, $domain = '' ){ if( isset($this->wp[$domain]) ){ $this->wp[$domain] += $tags; } else { $this->wp[$domain] = $tags; } return $this; } public function extract( LocoTokensInterface $tokens, $fileref ){ $n = 0; $comment = ''; foreach( $tokens as $tok ){ if( is_string($tok) ){ $s = $tok; $t = null; } else { $t = $tok[0]; $s = $tok[1]; if( T_WHITESPACE === $t ){ throw new RuntimeException( get_class($tokens).' should not allow whitespace through' ); } } if( isset($args) ){ if( ')' === $s ){ if( 0 === --$depth ){ if( isset($arg) ){ $args[] = $arg; } $this->push( $rule, $args, $comment, $ref ); unset($args,$arg); $comment = ''; $n++; } } else if( '(' === $s ){ $depth++; } else if( ',' === $s ){ if( isset($arg) ){ $args[] = $arg; unset($arg); } } else if( isset($arg) ){ $arg[] = $tok; } else { $arg = array( $tok ); } } else if( T_COMMENT === $t || T_DOC_COMMENT === $t ){ if( $this->wp && 0 === $n && ( $header = loco_parse_wp_comment($s) ) ){ foreach( $this->wp as $domain => $tags ){ foreach( array_intersect_key($header,$tags) as $tag => $source ){ $this->pushMeta( $source, $tags[$tag], $domain ); } } } else { $comment = $s; } } else if( T_STRING === $t && isset($this->rules[$s]) && '(' === $tokens->advance() ){ $rule = $this->rules[$s]; $args = array(); $ref = $fileref ? $fileref.':'.$tok[2]: ''; $depth = 1; } else if( $comment ){ if( false === stripos($comment, 'translators:') && false === strpos($comment, 'xgettext:') ){ $comment = ''; } } } return $this->exp; } public function pushMeta( $source, $notes = '', $domain = null ){ if( ! $domain || '*' === $domain ){ $domain = $this->dflt; } $entry = array( 'id' => '', 'source' => $source, 'target' => '', 'notes' => $notes, ); if( $domain ){ $entry['domain'] = $domain; $key = $source."\1".$domain; } else { $key = $source; } $this->pushMsgid( $key, $entry, $domain ); return $this; } private function pushMsgid( $key, array $entry, $domain ){ if( isset($this->reg[$key]) ){ $index = $this->reg[$key]; $a = array(); isset($this->exp[$index]['refs']) and $a[] = $this->exp[$index]['refs']; isset($entry['refs']) and $a[] = $entry['refs']; $a && $this->exp[$index]['refs'] = implode(" ", $a ); $a = array(); isset($this->exp[$index]['notes']) and $a[] = $this->exp[$index]['notes']; isset($entry['notes']) and $a[] = $entry['notes']; $a && $this->exp[$index]['notes'] = implode("\n", $a ); } else { $index = count($this->exp); $this->reg[$key] = $index; $this->exp[] = $entry; if( isset($this->dom[$domain]) ){ $this->dom[$domain]++; } else { $this->dom[$domain] = 1; } } return $index; } private function push( $rule, array $args, $comment = '', $ref = '' ){ $s = strpos( $rule, 's'); $p = strpos( $rule, 'p'); $c = strpos( $rule, 'c'); $d = strpos( $rule, 'd'); foreach( $args as $i => $tokens ){ if( 1 === count($tokens) && is_array($tokens[0]) && T_CONSTANT_ENCAPSED_STRING === $tokens[0][0] ){ $args[$i] = $this->decapse( $tokens[0][1] ); } else { $args[$i] = null; } } if( ! isset($args[$s]) ){ return null; } $key = $msgid = $args[$s]; if( ! is_string($msgid) ){ return null; } $entry = array( 'id' => '', 'source' => $msgid, 'target' => '', ); if( is_int($c) && isset($args[$c]) ){ $entry['context'] = $context = $args[$c]; $key .= "\0". $context; } else if( ! isset($msgid{0}) ){ return null; } else { $context = null; } if( $ref ){ $entry['refs'] = $ref; } if( is_int($d) && array_key_exists($d,$args) ){ $domain = $args[$d]; if( is_null($domain) ){ $domain = ''; } } else { $domain = $this->dflt; } if( $domain ){ $entry['domain'] = $domain; $key .= "\1".$domain; } $parse_printf = true; if( $comment ){ if( preg_match('/xgettext:\s*((?:no-)?\w+)-format/', $comment, $r ) ){ $entry['format'] = $r[1]; if( 'no-' === substr($r[1],0,3) ){ $parse_printf = false; } else { $parse_printf = null; } $comment = str_replace( $r[0], '', $comment ); } $comment = loco_parse_comment($comment); if( preg_match('/^translators:\s+/i', $comment, $r ) ){ $comment = substr( $comment, strlen($r[0]) ); } $entry['notes'] = $comment; } if( $parse_printf && ( $format = $this->fsniff($msgid) ) ){ $entry['format'] = $format; } $index = $this->pushMsgid( $key, $entry, $domain ); if( is_int($p) && isset($args[$p]) ){ $msgid_plural = $args[$p]; $entry = array( 'id' => '', 'source' => $msgid_plural, 'target' => '', 'plural' => 1, 'parent' => $index, ); if( false !== $parse_printf && ( $format = $this->fsniff($msgid_plural) ) ){ $entry['format'] = $format; } $pkey = $key."\2"; if( isset($this->reg[$pkey]) ){ $plural_index = $this->reg[$pkey]; $this->exp[$plural_index] = $entry; } else { $plural_index = count($this->exp); $this->reg[$pkey] = $plural_index; $this->exp[] = $entry; } } return $index; } public function filter( $domain ){ $map = array(); $newOffset = 1; $matchAll = '*' === $domain; $raw = array( array( 'id' => '', 'source' => '', 'target' => '', 'domain' => $matchAll ? '' : $domain, ) ); foreach( $this->exp as $oldOffset => $r ){ if( isset($r['parent']) ){ if( isset($map[$r['parent']]) ){ $r['parent'] = $map[ $r['parent'] ]; $raw[ $newOffset++ ] = $r; } } else { if( $matchAll ){ $match = true; } else if( isset($r['domain']) ){ $match = $domain === $r['domain']; } else { $match = $domain === ''; } if( $match ){ $map[ $oldOffset ] = $newOffset; $raw[ $newOffset++ ] = $r; } } } return $raw; } }
|
| 17 |
interface LocoTokensInterface extends Iterator { public function advance(); }
|
| 18 |
class LocoPHPTokens implements LocoTokensInterface { private $i; private $tokens; private $skip_tokens = array(); private $skip_strings = array(); private $literal_tokens = array(); public function __construct( array $tokens ){ $this->tokens = $tokens; $this->rewind(); } public function literal(){ foreach( func_get_args() as $t ){ $this->literal_tokens[ $t ] = 1; } return $this; } public function ignore(){ foreach( func_get_args() as $t ){ if( is_int($t) ){ $this->skip_tokens[$t] = true; } else { $this->skip_strings[$t] = true; } } return $this; } public function export(){ $arr = array(); foreach( $this as $tok ){ $arr[] = $tok; } return $arr; } public function advance(){ $this->next(); return $this->current(); } public function pop(){ $tok = array_pop( $this->tokens ); $this->rewind(); return $tok; } public function shift(){ $tok = array_shift( $this->tokens); $this->rewind(); return $tok; } public function rewind(){ $this->i = ( false === reset($this->tokens) ? null : key($this->tokens) ); } public function valid(){ while( isset($this->i) ){ $tok = $this->tokens[$this->i]; if( is_array($tok) ){ if( isset($this->skip_tokens[$tok[0]]) ){ $this->next(); } else { return true; } } else if( isset($this->skip_strings[$tok]) ){ $this->next(); } else { return true; } } return false; } public function key(){ return $this->i; } public function next(){ $this->i = ( false === next($this->tokens) ? null : key($this->tokens) ); } public function current(){ if( ! $this->valid() ){ return false; } $tok = $this->tokens[$this->i]; if( is_array($tok) && isset($this->literal_tokens[$tok[0]]) ){ return $tok[1]; } return $tok; } public function __toString(){ $s = ''; foreach( $this as $token ){ $s .= is_array($token) ? $token[1] : $token; } return $s; } }
|
| 19 |
function loco_sniff_printf( $s, $p, $limit = 0, $offset = 0 ){ $n = 0; while( $s && false !== ( $i = strpos($s,'%',$offset) ) ){ if( 0 !== $i ){ $s = substr( $s, $i ); } if( preg_match( $p, $s, $r ) ){ $match = $r[0]; if( 0 < $n && isset($r[1]) && '' === $r[1] && '%' !== substr($match,-1) ){ return 0; } if( ++$n === $limit ){ break; } $offset = strlen($match); } else { return 0; } } return $n; }
|
lib/compiled/plurals.php
CHANGED
|
@@ -2,4 +2,4 @@
|
|
| 2 |
/**
|
| 3 |
* Downgraded for PHP 5.2 compatibility. Do not edit.
|
| 4 |
*/
|
| 5 |
-
return unserialize('a:65:{s:2:"ak";i:1;s:2:"am";i:1;s:2:"ar";i:2;s:3:"ary";i:2;s:2:"
|
| 2 |
/**
|
| 3 |
* Downgraded for PHP 5.2 compatibility. Do not edit.
|
| 4 |
*/
|
| 5 |
+
return unserialize('a:65:{s:2:"ak";i:1;s:2:"am";i:1;s:2:"ar";i:2;s:3:"ary";i:2;s:2:"be";i:3;s:2:"bm";i:4;s:2:"bo";i:4;s:2:"br";i:1;s:2:"bs";i:3;s:2:"cs";i:5;s:2:"cy";i:6;s:2:"dz";i:4;s:2:"fa";i:4;s:2:"ff";i:1;s:2:"fr";i:1;s:2:"ga";i:7;s:2:"gd";i:8;s:2:"gv";i:9;s:2:"hr";i:10;s:2:"id";i:4;s:2:"ii";i:4;s:2:"iu";i:11;s:2:"ja";i:4;s:2:"ka";i:4;s:2:"kk";i:4;s:2:"km";i:4;s:2:"kn";i:4;s:2:"ko";i:4;s:2:"kw";i:11;s:2:"ky";i:4;s:2:"ln";i:1;s:2:"lo";i:4;s:2:"lt";i:12;s:2:"lv";i:13;s:2:"mg";i:1;s:2:"mi";i:1;s:2:"mk";i:14;s:2:"ms";i:4;s:2:"mt";i:15;s:2:"my";i:4;s:2:"nr";i:4;s:2:"oc";i:1;s:2:"pl";i:16;s:2:"ro";i:17;s:2:"ru";i:3;s:2:"sa";i:11;s:2:"sg";i:4;s:2:"sk";i:5;s:2:"sl";i:18;s:2:"sm";i:4;s:2:"sr";i:3;s:2:"su";i:4;s:2:"th";i:4;s:2:"ti";i:1;s:2:"tl";i:1;s:2:"to";i:4;s:2:"tt";i:4;s:2:"ug";i:4;s:2:"uk";i:3;s:2:"vi";i:4;s:2:"wa";i:1;s:2:"wo";i:4;s:2:"yo";i:4;s:2:"zh";i:4;s:0:"";a:19:{i:0;a:2:{i:0;s:6:"n != 1";i:1;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}i:1;a:2:{i:0;s:5:"n > 1";i:1;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}i:2;a:2:{i:0;s:95:"n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n%100 >= 3 && n%100<=10 ? 3 : n%100 >= 11 && n%100<=99 ? 4 : 5";i:1;a:6:{i:0;s:4:"zero";i:1;s:3:"one";i:2;s:3:"two";i:3;s:3:"few";i:4;s:4:"many";i:5;s:5:"other";}}i:3;a:2:{i:0;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:4;a:2:{i:0;s:1:"0";i:1;a:1:{i:0;s:5:"other";}}i:5;a:2:{i:0;s:45:"( n == 1 ) ? 0 : ( n >= 2 && n <= 4 ) ? 1 : 2";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:6;a:2:{i:0;s:56:"n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n==3 ? 3 : n==6 ? 4 : 5";i:1;a:6:{i:0;s:4:"zero";i:1;s:3:"one";i:2;s:3:"two";i:3;s:3:"few";i:4;s:4:"many";i:5;s:5:"other";}}i:7;a:2:{i:0;s:44:"n==1 ? 0 : n==2 ? 1 : n<7 ? 2 : n<11 ? 3 : 4";i:1;a:5:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:4:"many";i:4;s:5:"other";}}i:8;a:2:{i:0;s:26:"n < 2 ? 0 : n == 2 ? 1 : 2";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:5:"other";}}i:9;a:2:{i:0;s:43:"n%10==1 ? 0 : n%10==2 ? 1 : n%20==0 ? 2 : 3";i:1;a:4:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:5:"other";}}i:10;a:2:{i:0;s:80:"n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:11;a:2:{i:0;s:27:"n == 1 ? 0 : n == 2 ? 1 : 2";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:5:"other";}}i:12;a:2:{i:0;s:71:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:13;a:2:{i:0;s:49:"n % 10 == 1 && n % 100 != 11 ? 0 : n != 0 ? 1 : 2";i:1;a:3:{i:0;s:3:"one";i:1;s:5:"other";i:2;s:4:"zero";}}i:14;a:2:{i:0;s:40:"( n % 10 == 1 && n % 100 != 11 ) ? 0 : 1";i:1;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}i:15;a:2:{i:0;s:75:"(n==1 ? 0 : n==0||( n%100>1 && n%100<11)? 1 :(n%100>10 && n%100<20)? 2 : 3)";i:1;a:4:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:4:"many";i:3;s:5:"other";}}i:16;a:2:{i:0;s:66:"(n==1 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:17;a:2:{i:0;s:56:"(n==1 ? 0 :(((n%100>19)||(( n%100==0)&&(n!=0)))? 2 : 1))";i:1;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}i:18;a:2:{i:0;s:56:"n%100==1 ? 0 : n%100==2 ? 1 : n%100==3||n%100==4 ? 2 : 3";i:1;a:4:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:5:"other";}}}}');
|
loco.php
CHANGED
|
@@ -4,7 +4,7 @@ Plugin Name: Loco Translate
|
|
| 4 |
Plugin URI: https://wordpress.org/plugins/loco-translate/
|
| 5 |
Description: Translate themes and plugins directly in WordPress
|
| 6 |
Author: Tim Whitlock
|
| 7 |
-
Version: 2.0.
|
| 8 |
Author URI: https://localise.biz/wordpress/plugin
|
| 9 |
Text Domain: loco-translate
|
| 10 |
Domain Path: /languages/
|
|
@@ -22,15 +22,6 @@ if( function_exists('loco_require') ){
|
|
| 22 |
}
|
| 23 |
|
| 24 |
|
| 25 |
-
// run plugin in legacy mode if forced by setting
|
| 26 |
-
if( '1' === get_option('loco-branch',false) ){
|
| 27 |
-
if( is_admin() ){
|
| 28 |
-
require dirname(__FILE__).'/old/v1.php';
|
| 29 |
-
}
|
| 30 |
-
return;
|
| 31 |
-
}
|
| 32 |
-
|
| 33 |
-
|
| 34 |
/**
|
| 35 |
* Get absolute path to Loco primary plugin file
|
| 36 |
* @return string
|
|
@@ -45,7 +36,7 @@ function loco_plugin_file(){
|
|
| 45 |
* @return string
|
| 46 |
*/
|
| 47 |
function loco_plugin_version(){
|
| 48 |
-
return '2.0.
|
| 49 |
}
|
| 50 |
|
| 51 |
|
|
@@ -95,7 +86,7 @@ function loco_doing_ajax(){
|
|
| 95 |
*/
|
| 96 |
function loco_constant( $name ){
|
| 97 |
$value = defined($name) ? constant($name) : null;
|
| 98 |
-
//
|
| 99 |
if( defined('LOCO_TEST') && LOCO_TEST ){
|
| 100 |
$value = apply_filters('loco_constant', $value, $name );
|
| 101 |
$value = apply_filters('loco_constant_'.$name, $value );
|
|
@@ -105,7 +96,7 @@ function loco_constant( $name ){
|
|
| 105 |
|
| 106 |
|
| 107 |
/**
|
| 108 |
-
*
|
| 109 |
* @return mixed
|
| 110 |
*/
|
| 111 |
function loco_include( $relpath ){
|
|
@@ -149,14 +140,14 @@ function loco_check_extension( $name ){
|
|
| 149 |
/**
|
| 150 |
* Class autoloader for Loco classes under src directory.
|
| 151 |
* e.g. class "Loco_foo_FooBar" wil be found in "src/foo/FooBar.php"
|
| 152 |
-
* Also does autoload for polyfills under "src/compat"
|
| 153 |
* @return void
|
| 154 |
*/
|
| 155 |
function loco_autoload( $name ){
|
| 156 |
if( 'Loco_' === substr($name,0,5) ){
|
| 157 |
loco_include( 'src/'.strtr( substr($name,5), '_', '/' ).'.php' );
|
| 158 |
}
|
| 159 |
-
else if( file_exists( $path = loco_plugin_root().'/src/compat/'.$name.'.php') ){
|
| 160 |
require $path;
|
| 161 |
}
|
| 162 |
}
|
| 4 |
Plugin URI: https://wordpress.org/plugins/loco-translate/
|
| 5 |
Description: Translate themes and plugins directly in WordPress
|
| 6 |
Author: Tim Whitlock
|
| 7 |
+
Version: 2.0.15
|
| 8 |
Author URI: https://localise.biz/wordpress/plugin
|
| 9 |
Text Domain: loco-translate
|
| 10 |
Domain Path: /languages/
|
| 22 |
}
|
| 23 |
|
| 24 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 25 |
/**
|
| 26 |
* Get absolute path to Loco primary plugin file
|
| 27 |
* @return string
|
| 36 |
* @return string
|
| 37 |
*/
|
| 38 |
function loco_plugin_version(){
|
| 39 |
+
return '2.0.15';
|
| 40 |
}
|
| 41 |
|
| 42 |
|
| 86 |
*/
|
| 87 |
function loco_constant( $name ){
|
| 88 |
$value = defined($name) ? constant($name) : null;
|
| 89 |
+
// constant values will only be modified in tests
|
| 90 |
if( defined('LOCO_TEST') && LOCO_TEST ){
|
| 91 |
$value = apply_filters('loco_constant', $value, $name );
|
| 92 |
$value = apply_filters('loco_constant_'.$name, $value );
|
| 96 |
|
| 97 |
|
| 98 |
/**
|
| 99 |
+
* Runtime inclusion of any file under plugin root
|
| 100 |
* @return mixed
|
| 101 |
*/
|
| 102 |
function loco_include( $relpath ){
|
| 140 |
/**
|
| 141 |
* Class autoloader for Loco classes under src directory.
|
| 142 |
* e.g. class "Loco_foo_FooBar" wil be found in "src/foo/FooBar.php"
|
| 143 |
+
* Also does autoload for polyfills under "src/compat" if classname < 20 chars
|
| 144 |
* @return void
|
| 145 |
*/
|
| 146 |
function loco_autoload( $name ){
|
| 147 |
if( 'Loco_' === substr($name,0,5) ){
|
| 148 |
loco_include( 'src/'.strtr( substr($name,5), '_', '/' ).'.php' );
|
| 149 |
}
|
| 150 |
+
else if( ! isset($name{20}) && file_exists( $path = loco_plugin_root().'/src/compat/'.$name.'.php') ){
|
| 151 |
require $path;
|
| 152 |
}
|
| 153 |
}
|
old/CHANGELOG.md
DELETED
|
@@ -1,146 +0,0 @@
|
|
| 1 |
-
# Legacy version changelog
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
= 1.5.6 =
|
| 5 |
-
* Added Czech and Greek translations
|
| 6 |
-
* Updated Russian and Polish translations
|
| 7 |
-
* No longer using glob functions
|
| 8 |
-
|
| 9 |
-
= 1.5.5 =
|
| 10 |
-
* Added Korean and Ukrainian translations
|
| 11 |
-
* Fixed hard-coding of dirname in symlink workaround
|
| 12 |
-
* Changed help links to point to Loco site
|
| 13 |
-
* Added Solaris incompatibility warning
|
| 14 |
-
|
| 15 |
-
= 1.5.4 =
|
| 16 |
-
* Added theme/plugin metadata extraction to POT generation
|
| 17 |
-
* POT extractor fix for function calls in argument lists
|
| 18 |
-
* Fix for authors using unsuffixed PO files as templates
|
| 19 |
-
* Updated translations, added pt_PT and Kurdish and amended typos
|
| 20 |
-
* Added WordPress skin colours
|
| 21 |
-
* Workarounds for single-file plugins
|
| 22 |
-
* Fixed reordering bug after sync
|
| 23 |
-
|
| 24 |
-
= 1.5.3 =
|
| 25 |
-
* Critical PHP < 5.4 compatibility bug fix
|
| 26 |
-
* Added option to exclude Fuzzy strings from MO files
|
| 27 |
-
|
| 28 |
-
= 1.5.2 =
|
| 29 |
-
* Handle locale codes used wrongly in POT file names
|
| 30 |
-
* Added French, Brazilian Portuguese, Persian, Japanese and Spanish translations. Updated Turkish and German
|
| 31 |
-
* Note that this release is broken for PHP < 5.4
|
| 32 |
-
|
| 33 |
-
= 1.5.1 =
|
| 34 |
-
* Better handling of incorrectly named POT files
|
| 35 |
-
* Appended potential issue warnings on existing "file check" page
|
| 36 |
-
* Added loco_admin_capability filter for all plugin access
|
| 37 |
-
* Fixed editor shortcuts to avoid blocking alt-commands
|
| 38 |
-
|
| 39 |
-
= 1.5 =
|
| 40 |
-
* Added PO Editor keyboard shortcuts
|
| 41 |
-
* Added WPLANG warning for WP4 deprecation
|
| 42 |
-
* Added some FAQs
|
| 43 |
-
* Removed SORT_NATURAL for PHP 5.3 compat
|
| 44 |
-
* Fixed dummy msginit bug when default locale exists
|
| 45 |
-
* POT/domain matching fix
|
| 46 |
-
* Using WordPress language codes
|
| 47 |
-
* Added polyfills for mbstring and iconv
|
| 48 |
-
|
| 49 |
-
= 1.4.7 =
|
| 50 |
-
* Added Polish translations
|
| 51 |
-
* Tested in WP 4.0
|
| 52 |
-
* Add support for WordPress's regionless locales
|
| 53 |
-
|
| 54 |
-
= 1.4.6 =
|
| 55 |
-
* Updated Swedish and Turkish translations
|
| 56 |
-
* Added Indonesian translations
|
| 57 |
-
* Added Italian translations
|
| 58 |
-
* Template bug fix for child theme inheritance
|
| 59 |
-
* Form action bug fix - affected Firefox
|
| 60 |
-
|
| 61 |
-
= 1.4.5 =
|
| 62 |
-
* Support for Domain Path tag
|
| 63 |
-
* Added choice of location when language and package folders both writable
|
| 64 |
-
* Fixed bug extracting domain from file names
|
| 65 |
-
* Child themes always have their own text domain and don't duplicate parent files
|
| 66 |
-
* Better plural support in PO file editor
|
| 67 |
-
* Added experimental support for core packages
|
| 68 |
-
* Tested in WP 3.9.1
|
| 69 |
-
* Added Swedish translations
|
| 70 |
-
* Added Russian translations
|
| 71 |
-
* Added text filter clear button
|
| 72 |
-
|
| 73 |
-
= 1.4.4 =
|
| 74 |
-
* Fixed bug in prefixing new PO files with text domain based on existing files
|
| 75 |
-
* Language file updates
|
| 76 |
-
* Tested in WP 3.9
|
| 77 |
-
* Added loco_cache_enabled filter
|
| 78 |
-
|
| 79 |
-
= 1.4.3 =
|
| 80 |
-
* Child themes use parent text domains
|
| 81 |
-
* MO files parsed when PO files missing
|
| 82 |
-
* Handle incorrect usage of PO files as templates
|
| 83 |
-
* Nicer top-level menu with dashicons icon
|
| 84 |
-
* Added IE<=8 warning
|
| 85 |
-
|
| 86 |
-
= 1.4.2 =
|
| 87 |
-
* Added backup feature
|
| 88 |
-
* Removed utm domain
|
| 89 |
-
* Added Turkish translations
|
| 90 |
-
* Fixed file naming for new theme files
|
| 91 |
-
|
| 92 |
-
= 1.4.1 =
|
| 93 |
-
* Cache invalidation
|
| 94 |
-
* Magic quotes stripping from po save
|
| 95 |
-
|
| 96 |
-
= 1.4 =
|
| 97 |
-
* Added native MO compiler
|
| 98 |
-
* Added hash generation config option
|
| 99 |
-
* Added direct MO download from editor
|
| 100 |
-
* Fixed some translations and added German
|
| 101 |
-
|
| 102 |
-
= 1.3.1 =
|
| 103 |
-
* style tweak for wp 3.8
|
| 104 |
-
* suppressing exception when proc_open fails
|
| 105 |
-
|
| 106 |
-
= 1.3 =
|
| 107 |
-
* Support for files under WP_LANG_DIR
|
| 108 |
-
* Last-Translator header added to PO files from WordPress user
|
| 109 |
-
* Disabling cache when WP_DEBUG = true
|
| 110 |
-
* Better editor integration, including source headers and file refs
|
| 111 |
-
* Added editor dropdown for switching between files
|
| 112 |
-
* Guessing of msgfmt path when not in settings
|
| 113 |
-
|
| 114 |
-
= 1.2.2 =
|
| 115 |
-
* Fixed incorrect plural equation offset
|
| 116 |
-
* Compacted pre-compiled locale data
|
| 117 |
-
* Added settings link from plugin meta row
|
| 118 |
-
|
| 119 |
-
= 1.2.1 =
|
| 120 |
-
* Fixed incorrect version update message
|
| 121 |
-
* Added note about Windows support in readme.txt
|
| 122 |
-
|
| 123 |
-
= 1.2 =
|
| 124 |
-
* Added settings screen with gettext config
|
| 125 |
-
* Fixed msgfmt hanging bug
|
| 126 |
-
|
| 127 |
-
= 1.1.3 =
|
| 128 |
-
* Improved PHP strings extraction
|
| 129 |
-
* Fixed strict warning
|
| 130 |
-
|
| 131 |
-
= 1.1.2 =
|
| 132 |
-
* Added dutch translations
|
| 133 |
-
* Better persistence of PO headers
|
| 134 |
-
|
| 135 |
-
= 1.1.1 =
|
| 136 |
-
* Added country flag icons
|
| 137 |
-
* Fixed major IE8 bug in editor search
|
| 138 |
-
* Reduced size of icon font file
|
| 139 |
-
|
| 140 |
-
= 1.1.0 =
|
| 141 |
-
* Added translation search filter in editor
|
| 142 |
-
* Added percentage completion in list and edit views
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
= 1.0.0 =
|
| 146 |
-
* First version published
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/README.md
DELETED
|
@@ -1,5 +0,0 @@
|
|
| 1 |
-
# Legacy version
|
| 2 |
-
|
| 3 |
-
The final release of 1.x bundled into 2.x
|
| 4 |
-
|
| 5 |
-
You can switch between branches by setting the site option `loco-branch` to either `"1"` or `"2"`.
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/bin/build-lang.sh
DELETED
|
@@ -1,31 +0,0 @@
|
|
| 1 |
-
#!/bin/bash
|
| 2 |
-
# Convert translations to JS and sync PO/MO with current POT
|
| 3 |
-
# Requires: dos2unix, sed, msgmerge, msgfmt, curl
|
| 4 |
-
#
|
| 5 |
-
# Note: this script uses the Loco REST API at localise.biz, subject to its Terms of Service.
|
| 6 |
-
# This API may be removed, changed or usage blocked at any time without notice or reason.
|
| 7 |
-
#
|
| 8 |
-
|
| 9 |
-
ROOT="`dirname $0`/..";
|
| 10 |
-
LOCO="https://localise.biz/"
|
| 11 |
-
|
| 12 |
-
cd $ROOT/languages;
|
| 13 |
-
dos2unix loco-translate.pot;
|
| 14 |
-
|
| 15 |
-
for po in *.po; do
|
| 16 |
-
echo "Building `basename $po`"
|
| 17 |
-
dos2unix $po;
|
| 18 |
-
|
| 19 |
-
# Sync PO and compile MO (disable this step if POT is not up to date)
|
| 20 |
-
mo=`echo $po | sed s/\.po/\.mo/`
|
| 21 |
-
msgmerge $po loco-translate.pot --update --backup=off --silent --no-fuzzy-matching
|
| 22 |
-
msgfmt $po -o $mo --use-fuzzy --no-hash --statistics
|
| 23 |
-
|
| 24 |
-
# Javascript conversion (currently the whole PO)
|
| 25 |
-
# TODO replace with PHP script to remove dependency on the Loco API
|
| 26 |
-
js=`echo $po | sed s/\.po/\.js/`
|
| 27 |
-
curl -s --data-binary @$po "$LOCO/api/convert/po/loco.js?index=text&pretty" | sed 's/var t =/loco = window.loco||{}, loco.t =/' > ../pub/js/lang/$js
|
| 28 |
-
echo "Saved $js\n"
|
| 29 |
-
done
|
| 30 |
-
|
| 31 |
-
echo Done
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/README.md
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
# Legacy version translations
|
| 2 |
-
|
| 3 |
-
Many thanks to the translators of version 1.x
|
| 4 |
-
|
| 5 |
-
Please note that this branch of Loco Translate is deprecated.
|
| 6 |
-
Version 2.x is the active branch.
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
* Dutch translations by [Niels Geryl](http://hetwittepaard.be)
|
| 10 |
-
* German translations by [Sebastian König](http://aykutmania.de) and [Arno Welzel](https://wordpress.org/support/profile/awelzel)
|
| 11 |
-
* Turkish translations by [Abdullah Pazarbaşı](http://abdullahpazarbasi.com), Abdullah Manaz and [WordCommerce](http://www.wordcommerce.com/wordcommerce-iletisim/)
|
| 12 |
-
* Swedish translations by [Jimmy Malmqvist](http://jimmymalmqvist.com)
|
| 13 |
-
* Russian translations by [Alexey Tkachenko](http://atkachenko.ru) and Vyacheslav Stabrovsky
|
| 14 |
-
* Indonesian translations by [Ivan Lanin](https://twitter.com/ivanlanin)
|
| 15 |
-
* Italian translations by [ElectricFeet](http://wordpress.org/support/profile/electricfeet)
|
| 16 |
-
* Polish translations by [Jerry1333](http://www.jerry1333.net) and [Marek Sierociński](http://marek.sierocinscy.pl)
|
| 17 |
-
* Persian translations by [Araz Rad](http://fa.araz.id.ir)
|
| 18 |
-
* Japanese translations by [Agarthe LLC](https://agarthe.com)
|
| 19 |
-
* Spanish translations by [temesis1234](https://wordpress.org/support/profile/temesis1234)
|
| 20 |
-
* Brazilian Portuguese translations by [pamcabezas](https://github.com/pamcabezas) and [Marcelo Saldanha](http://www.associadosweb.com/)
|
| 21 |
-
* European Portuguese translations by [Pedro Mendonça](https://github.com/pedro-mendonca)
|
| 22 |
-
* French translations by [Borjan Tchakaloff](https://github.com/bibz)
|
| 23 |
-
* Korean translations by [Josh Kim](mailto:joshkkim@gmail.com)
|
| 24 |
-
* Ukrainian translations by [Dmitriy Malyuta](https://www.facebook.com/malyuta)
|
| 25 |
-
* Czech translations by [Martin Kokeš](https://twitter.com/zhr3k)
|
| 26 |
-
* Greek translations by [Stathis Mellios](mailto:mellios@live.com)
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-ckb.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-ckb.po
DELETED
|
@@ -1,655 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:16:46 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Central Kurdish\n"
|
| 9 |
-
"Language: ckb\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: ckb_GB\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "هەڵە"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "ئاگاداری"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "باشە"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "ڕێنەدراو"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "ڕێکخستنەکان پاشەکەوتکران"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "% زمانێکی فەڕمی وێردپرێس نیە"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "دۆسیەیەکی (PO)ی نوێ"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"دۆسیەی (PO) وەکو داڕێژەیەک بەکارهاتووە، ئەمەش لە یەکەمین پاشەکەوتدا ناوی "
|
| 61 |
-
"دەنێتەوە \n"
|
| 62 |
-
"%s"
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "دەبێ شوێنێکی ناوەکیی دروست دیاری بکەی بۆ دۆسیەی نوێی (PO)"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "هیچ زنجیرەوەرگێڕانێک نەدۆزرایەوە"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "ناتوانی دۆسیەی (PO) دروست بکەی."
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "دۆسیەی (PO) ئامادەیە لەگەڵ %sی ناوەکی"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"لەخۆوە ناتوانرێ دۆسیە دروست بکرێ، ڕێدانەکانی دۆسیەکە چارەسەر بکە، یان داگرتن "
|
| 86 |
-
"بەکار بێنە لەبری پاشەکەوتکردن"
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr ""
|
| 91 |
-
"دۆسیەی \n"
|
| 92 |
-
"%s بەتاڵە"
|
| 93 |
-
|
| 94 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 95 |
-
msgid "Run Sync to update from source code"
|
| 96 |
-
msgstr "هاوهەنگاوی بەکار بخە بۆ نوێکردنەوە لە کۆدی سەرچاوەوە"
|
| 97 |
-
|
| 98 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 99 |
-
msgid "No strings could be extracted from source code"
|
| 100 |
-
msgstr "هیچ زنجیرەدەقێک نەتوانرا لە کۆدی سەرچاوەوە دەربهێنرێ"
|
| 101 |
-
|
| 102 |
-
#: lib/loco-admin.php:417
|
| 103 |
-
msgid "Run Sync to update from %s"
|
| 104 |
-
msgstr ""
|
| 105 |
-
"هاوهەنگاوی بەکار بخە بۆ نوێکردنەوە لە \n"
|
| 106 |
-
"%s\n"
|
| 107 |
-
"ەوە"
|
| 108 |
-
|
| 109 |
-
#: lib/loco-admin.php:436
|
| 110 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 111 |
-
msgstr "کۆدی سەرچاوە دەستکاریکرا، هاوهەنگاوی بەکار بخە بۆ نوێکردنەوەی (POT)"
|
| 112 |
-
|
| 113 |
-
#: lib/loco-admin.php:440
|
| 114 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 115 |
-
msgstr ""
|
| 116 |
-
"(POT) دەستکاری کرا لەوەتەی دۆسیەی (PO) پاشەکەوتکراوە، هاوهەنگاوی بەکار بخە "
|
| 117 |
-
"بۆ نوێکردنەوە"
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:536
|
| 120 |
-
msgid "Bad file path"
|
| 121 |
-
msgstr "ڕێڕەوی دۆسیە خراپە"
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:783
|
| 124 |
-
msgid "Empty or invalid %s file"
|
| 125 |
-
msgstr ""
|
| 126 |
-
"بەتاڵە یان دۆسیەی \n"
|
| 127 |
-
"%s نادروستە"
|
| 128 |
-
|
| 129 |
-
#: lib/loco-admin.php:787
|
| 130 |
-
msgid "%s file has no header"
|
| 131 |
-
msgstr ""
|
| 132 |
-
"دۆسیەی \n"
|
| 133 |
-
"%s هیچ سەرپەڕێکی نیە"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:934
|
| 136 |
-
msgctxt "Add button"
|
| 137 |
-
msgid "New template"
|
| 138 |
-
msgstr "داڕێژەی نوێ"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:953
|
| 141 |
-
msgctxt "Add button"
|
| 142 |
-
msgid "New language"
|
| 143 |
-
msgstr "زمانی نوێ"
|
| 144 |
-
|
| 145 |
-
#: lib/loco-admin.php:992
|
| 146 |
-
msgid "%s%% translated"
|
| 147 |
-
msgstr "%s%% وەرگێڕدراوە"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:992
|
| 150 |
-
msgid "1 string"
|
| 151 |
-
msgid_plural "%s strings"
|
| 152 |
-
msgstr[0] "زنجیرەدەقێک"
|
| 153 |
-
msgstr[1] "%s زنجیرەدەق"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:995
|
| 156 |
-
msgid "%s fuzzy"
|
| 157 |
-
msgstr "%s ناڕوونە"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:998
|
| 160 |
-
msgid "%s untranslated"
|
| 161 |
-
msgstr "%s وەرنەگێڕدراوە"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1044
|
| 164 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 165 |
-
msgstr "تێکخستنی دۆسیەی (MO) شکستی هێنا بە تێکخەری ناوخۆیی"
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 168 |
-
msgid "Loco, Translation Management"
|
| 169 |
-
msgstr "لۆکۆ، بەڕێوەبەرایەتی وەرگێڕان"
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 172 |
-
msgid "Manage translations"
|
| 173 |
-
msgstr "بەڕێوەبردنی وەرگێڕانەکان"
|
| 174 |
-
|
| 175 |
-
#: lib/loco-admin.php:1094
|
| 176 |
-
msgid "Translation options"
|
| 177 |
-
msgstr "هەڵبژاردنەکانی وەرگێڕان"
|
| 178 |
-
|
| 179 |
-
#: lib/loco-admin.php:1101
|
| 180 |
-
msgid "Loco Translate"
|
| 181 |
-
msgstr "لۆکۆ وەرگێڕ"
|
| 182 |
-
|
| 183 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 184 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 185 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 186 |
-
msgid "Settings"
|
| 187 |
-
msgstr "ڕێکخستنەکان"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-admin.php:1149
|
| 190 |
-
msgid "File download failed"
|
| 191 |
-
msgstr "داگرتنی دۆسیە شکستی هێنا"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-admin.php:1159
|
| 194 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 195 |
-
msgstr ""
|
| 196 |
-
"WPLANG بەباش دانانرێ و دەبێ لە \n"
|
| 197 |
-
"wp-config.php ڕەش بکرێتەوە"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-locales.php:77
|
| 200 |
-
msgid "Unknown language"
|
| 201 |
-
msgstr "زمانێکی نەزانراوە"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 204 |
-
msgid "Some files not writable"
|
| 205 |
-
msgstr "هەندێ دۆسیە بۆ نووسینەوە نیە"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:484
|
| 208 |
-
msgid "Some files missing"
|
| 209 |
-
msgstr "هەندێ دۆسیە دیار نین"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 212 |
-
msgid "\"%s\" folder not writable"
|
| 213 |
-
msgstr "بوخچەی \"%s\" بۆ نووسینەوە نیە"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:515
|
| 216 |
-
msgid "POT file not writable"
|
| 217 |
-
msgstr "دۆسیەی (POT) بۆ نووسینەوە نیە"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:520
|
| 220 |
-
msgid "PO file not writable"
|
| 221 |
-
msgstr "دۆسیەی (PO) بۆ نووسینەوە نیە"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:522
|
| 224 |
-
msgid "MO file not writable"
|
| 225 |
-
msgstr "دۆسیەی (MO) بۆ نووسینەوە نیە"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:522
|
| 228 |
-
msgid "MO file not found"
|
| 229 |
-
msgstr "دۆسیەی (MO) نەدۆزرایەوە"
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:527
|
| 232 |
-
msgid "Folder not writable"
|
| 233 |
-
msgstr "بوخچە بۆ نووسینەوە نیە"
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:527
|
| 236 |
-
msgid "Folder not found"
|
| 237 |
-
msgstr "بوخچە نەدۆزرایەوە"
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:546
|
| 240 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 241 |
-
msgstr "%s هیچ دەقەپاوانێکی ڕانەگەیاندووە"
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 244 |
-
msgid "Loco has guessed \"%s\""
|
| 245 |
-
msgstr "لۆکۆ \"%s\"ی خەملاندووە."
|
| 246 |
-
|
| 247 |
-
#: lib/loco-packages.php:551
|
| 248 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 249 |
-
msgstr "%s هیچ ڕێڕەوێکی پاوانی ڕانەگەیاندووە"
|
| 250 |
-
|
| 251 |
-
#: lib/loco-packages.php:556
|
| 252 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 253 |
-
msgstr ""
|
| 254 |
-
"%s هیچ دۆسیەیەکی (POT)ی نیە، ئەگەر دەتەوێ دانەیەک لە \"%s/%s.pot\" دروست بکە"
|
| 255 |
-
|
| 256 |
-
#: lib/loco-packages.php:559
|
| 257 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 258 |
-
msgstr ""
|
| 259 |
-
"%s دۆسیەناوێکی (POT)ی نامۆی هەیە کە (%s) ناویەتی، \"%s.pot\" بە ناوێکی باش "
|
| 260 |
-
"دادەنرێ."
|
| 261 |
-
|
| 262 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 263 |
-
msgid "User does not have permission to manage translations"
|
| 264 |
-
msgstr "بەکارهێنەر ڕێپێدراو نیە بۆ بەڕێوەبردنی وەرگێڕانەکان"
|
| 265 |
-
|
| 266 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 267 |
-
msgid "Invalid data posted to server"
|
| 268 |
-
msgstr "دراوەی نادروست لە ڕاژەکە بڵاوکراوەتەوە"
|
| 269 |
-
|
| 270 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 271 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 272 |
-
msgstr "تێکخستنی دۆسیە (MO)کە لەگەڵ %s شکستی هێنا، بە ڕێکخستنەکاندا بچۆوە"
|
| 273 |
-
|
| 274 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 275 |
-
msgid "Package not found called %s"
|
| 276 |
-
msgstr "هیچ پاکەتێک بە ناوی %s نەدۆزرایەوە"
|
| 277 |
-
|
| 278 |
-
#: php/loco-posave.php:58
|
| 279 |
-
msgid ""
|
| 280 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 281 |
-
"backups in settings"
|
| 282 |
-
msgstr ""
|
| 283 |
-
"تۆڕەڕاژە ناتوانێ پاراستنەکان لە \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە "
|
| 284 |
-
"چارەسەر بکە یان ڕێکخستنەکانی پاراستنەکان ناکارا بکە"
|
| 285 |
-
|
| 286 |
-
#: php/loco-posave.php:66
|
| 287 |
-
msgid ""
|
| 288 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 289 |
-
"create it manually."
|
| 290 |
-
msgstr ""
|
| 291 |
-
"تۆڕەڕاژە ناتوانێ بوخچەی \"%s\" لە \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە "
|
| 292 |
-
"چارەسەر بکە یان دەستکردانە دروستی بکە."
|
| 293 |
-
|
| 294 |
-
#: php/loco-posave.php:69
|
| 295 |
-
msgid ""
|
| 296 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 297 |
-
"or use the download function."
|
| 298 |
-
msgstr ""
|
| 299 |
-
"تۆڕەڕاژە ناتوانێ دۆسیە لە بوخچەی \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە "
|
| 300 |
-
"چارەسەر بکە یان فەرمانی داگرتن بەکار بهێنە"
|
| 301 |
-
|
| 302 |
-
#: php/loco-posave.php:81
|
| 303 |
-
msgid ""
|
| 304 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 305 |
-
"and copy to \"%s/%s\"."
|
| 306 |
-
msgstr ""
|
| 307 |
-
"%s شیاوی دەستکاری نیە بەهۆی تۆڕەڕاژەوە، ڕێپێدانەکانی دۆسیە چارەسەر بکە یان "
|
| 308 |
-
"دای بگرە و لەبەری بگرەوە بۆ \n"
|
| 309 |
-
"\"%s/%s\"."
|
| 310 |
-
|
| 311 |
-
#: php/loco-posave.php:102
|
| 312 |
-
msgid "Cannot create MO file"
|
| 313 |
-
msgstr "ناتوانرێ دۆسیەی (MO) دروستکرێ"
|
| 314 |
-
|
| 315 |
-
#: php/loco-posave.php:105
|
| 316 |
-
msgid "Cannot overwrite MO file"
|
| 317 |
-
msgstr "ناتوانرێ دۆسیە (MO)کە لەسەری بنووسرێتەوە"
|
| 318 |
-
|
| 319 |
-
#: php/loco-posave.php:131
|
| 320 |
-
msgid "Failed to write MO file"
|
| 321 |
-
msgstr "نووسینی دۆسیە (MO)کە شکستی هێنا"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 324 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 325 |
-
#: tpl/admin-root.tpl.php:6
|
| 326 |
-
msgid "Packages"
|
| 327 |
-
msgstr "پاکەتەکان"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 330 |
-
msgid "File check"
|
| 331 |
-
msgstr "پشکنینی دۆسیە"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 334 |
-
msgid "File system permissions for %s"
|
| 335 |
-
msgstr "ڕێپێدانی سیستەم بۆ دۆسیەی %s"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 338 |
-
msgid "Other potential issues with %s"
|
| 339 |
-
msgstr "کێشە ناڕوونەکان لەگەڵ %s"
|
| 340 |
-
|
| 341 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 342 |
-
msgid "Back"
|
| 343 |
-
msgstr "گەڕانەوە"
|
| 344 |
-
|
| 345 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 346 |
-
msgid "Get help"
|
| 347 |
-
msgstr "داوای یارمەتی"
|
| 348 |
-
|
| 349 |
-
#: tpl/admin-list.tpl.php:11
|
| 350 |
-
msgctxt "Table header"
|
| 351 |
-
msgid "Package details"
|
| 352 |
-
msgstr "وردەکارییەکانی پاکەت"
|
| 353 |
-
|
| 354 |
-
#: tpl/admin-list.tpl.php:14
|
| 355 |
-
msgctxt "Table header"
|
| 356 |
-
msgid "Translations (PO)"
|
| 357 |
-
msgstr "وەرگێڕانەکان (PO)"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:17
|
| 360 |
-
msgctxt "Table header"
|
| 361 |
-
msgid "Template (POT)"
|
| 362 |
-
msgstr "داڕێژە (POT)"
|
| 363 |
-
|
| 364 |
-
#: tpl/admin-list.tpl.php:20
|
| 365 |
-
msgctxt "Table header"
|
| 366 |
-
msgid "File permissions"
|
| 367 |
-
msgstr "ڕێپێدراوی دۆسیە"
|
| 368 |
-
|
| 369 |
-
#: tpl/admin-list.tpl.php:40
|
| 370 |
-
msgid "Extends: %s"
|
| 371 |
-
msgstr "لقوپۆپەکان: %s"
|
| 372 |
-
|
| 373 |
-
#: tpl/admin-list.tpl.php:44
|
| 374 |
-
msgid "1 language"
|
| 375 |
-
msgid_plural "%u languages"
|
| 376 |
-
msgstr[0] "زمانێک"
|
| 377 |
-
msgstr[1] "%s زمان"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 380 |
-
msgctxt "Modified time"
|
| 381 |
-
msgid "Updated"
|
| 382 |
-
msgstr "نوێکراوەتەوە"
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-nav.tpl.php:26
|
| 385 |
-
msgid "Powered by"
|
| 386 |
-
msgstr "بە پشتگیریی"
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-nav.tpl.php:32
|
| 389 |
-
msgid "Loco may not work as expected"
|
| 390 |
-
msgstr "لۆکۆ ڕەنگە وەک ئەوەی چاوەڕێ دەکرێ کار نەکات"
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:18
|
| 393 |
-
msgid "Configure Loco Translate"
|
| 394 |
-
msgstr "سازدانی لۆکۆ وەرگێڕ"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 397 |
-
msgid "Compiling MO files"
|
| 398 |
-
msgstr "تێکخستنی دۆسیە (MO)کان"
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:36
|
| 401 |
-
msgid "Use built-in MO compiler."
|
| 402 |
-
msgstr "بەکارهێنانی (MO) تێکخەری ناوخۆیی."
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:42
|
| 405 |
-
msgid "Use external command:"
|
| 406 |
-
msgstr "بەکارهێنانی فرمانە دەرەکیەکان:"
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:47
|
| 409 |
-
msgid "Enter path to msgfmt on server"
|
| 410 |
-
msgstr "ڕێڕەوی (msgfmt)ی سەر ڕاژە لێبدە"
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:54
|
| 413 |
-
msgid "Generate hash tables"
|
| 414 |
-
msgstr "دروستکردنی خشتە هاشیەکان"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:60
|
| 417 |
-
msgid "Include Fuzzy strings"
|
| 418 |
-
msgstr "لەخۆگرتنی دێرە ناڕوونەکان"
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 421 |
-
msgid "Backing up PO files"
|
| 422 |
-
msgstr "پاراستنی دۆسیە (PO)کان"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-opts.tpl.php:75
|
| 425 |
-
msgid "Number of backups to keep of each file:"
|
| 426 |
-
msgstr "ژمارەی پاراستنەکان بۆ هێشتنەوەی هەر دۆسیەیەک:"
|
| 427 |
-
|
| 428 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 429 |
-
msgid "Experimental features"
|
| 430 |
-
msgstr "تایبەتمەندیە تاقیکاریەکان"
|
| 431 |
-
|
| 432 |
-
#: tpl/admin-opts.tpl.php:92
|
| 433 |
-
msgid "Enable WordPress core translations"
|
| 434 |
-
msgstr "کاراکردنی وەرگێڕانەکانی کاکڵی وێردپرێس"
|
| 435 |
-
|
| 436 |
-
#: tpl/admin-opts.tpl.php:101
|
| 437 |
-
msgid "Save settings"
|
| 438 |
-
msgstr "پاشەکەوتکردنی ڕێکخستنەکان"
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 441 |
-
msgid "Template file"
|
| 442 |
-
msgstr "دۆسیەی داڕێژە"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 445 |
-
msgctxt "Dropdown label"
|
| 446 |
-
msgid "Switch to..."
|
| 447 |
-
msgstr "گۆڕین بۆ..."
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 450 |
-
msgid "never"
|
| 451 |
-
msgstr "هەرگیز"
|
| 452 |
-
|
| 453 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 454 |
-
msgctxt "Editor button"
|
| 455 |
-
msgid "Save"
|
| 456 |
-
msgstr "پاشەکەوتکردن"
|
| 457 |
-
|
| 458 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 459 |
-
msgctxt "Editor button"
|
| 460 |
-
msgid "Download"
|
| 461 |
-
msgstr "داگرتن"
|
| 462 |
-
|
| 463 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 464 |
-
msgctxt "Editor button"
|
| 465 |
-
msgid "Sync"
|
| 466 |
-
msgstr "هاوهەنگاوی"
|
| 467 |
-
|
| 468 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 469 |
-
msgctxt "Editor button"
|
| 470 |
-
msgid "Revert"
|
| 471 |
-
msgstr "گەڕاندنەوە"
|
| 472 |
-
|
| 473 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 474 |
-
msgctxt "Editor button"
|
| 475 |
-
msgid "Add"
|
| 476 |
-
msgstr "زیادکردن"
|
| 477 |
-
|
| 478 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 479 |
-
msgctxt "Editor button"
|
| 480 |
-
msgid "Del"
|
| 481 |
-
msgstr "سڕینەوە"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 484 |
-
msgctxt "Editor button"
|
| 485 |
-
msgid "Fuzzy"
|
| 486 |
-
msgstr "ناڕوون"
|
| 487 |
-
|
| 488 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 489 |
-
msgid "Filter translations"
|
| 490 |
-
msgstr "پاڵاوتنی وەرگێڕانەکان"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 493 |
-
msgctxt "Editor button"
|
| 494 |
-
msgid "Help"
|
| 495 |
-
msgstr "یارمەتی"
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 498 |
-
msgid "Initialize new translations in %s"
|
| 499 |
-
msgstr "دەستپێکردنی وەرگێڕانی نوێ لە %s"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 502 |
-
msgid "Select from common languages"
|
| 503 |
-
msgstr "دیاریکردن لە زمانە باوەکانەوە"
|
| 504 |
-
|
| 505 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 506 |
-
msgctxt "Form label"
|
| 507 |
-
msgid "or enter any language code"
|
| 508 |
-
msgstr "یان کۆدی زمانێک لێبدە"
|
| 509 |
-
|
| 510 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 511 |
-
msgctxt "Form label"
|
| 512 |
-
msgid "create in <code>%s</code>"
|
| 513 |
-
msgstr "دروستکردن لە <code>%s</code>"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 516 |
-
msgctxt "Form label"
|
| 517 |
-
msgid "create in global languages directory"
|
| 518 |
-
msgstr "دروستکردن لە بوخچەی زمانە جیهانیەکان"
|
| 519 |
-
|
| 520 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 521 |
-
msgctxt "Submit button"
|
| 522 |
-
msgid "Start translating"
|
| 523 |
-
msgstr "دەستپێکردنی وەرگێڕان"
|
| 524 |
-
|
| 525 |
-
#: tpl/admin-root.tpl.php:18
|
| 526 |
-
msgid "New version available"
|
| 527 |
-
msgstr "وەشانی نوێ بەردەستە"
|
| 528 |
-
|
| 529 |
-
#: tpl/admin-root.tpl.php:21
|
| 530 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 531 |
-
msgstr "بەرزکردنەوە بۆ وەشانی %sی لۆکۆ وەرگێڕ"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:31
|
| 534 |
-
msgid "Select a plugin or theme to translate"
|
| 535 |
-
msgstr "پێوەکراوەیەک یان ڕووکارێک دیاری بکە بۆ وەرگێڕان."
|
| 536 |
-
|
| 537 |
-
#: tpl/admin-root.tpl.php:40
|
| 538 |
-
msgctxt "Package list header"
|
| 539 |
-
msgid "Themes"
|
| 540 |
-
msgstr "ڕووکارەکان"
|
| 541 |
-
|
| 542 |
-
#: tpl/admin-root.tpl.php:53
|
| 543 |
-
msgctxt "Package list header"
|
| 544 |
-
msgid "Plugins"
|
| 545 |
-
msgstr "پێوەکراوەکان"
|
| 546 |
-
|
| 547 |
-
#: tpl/admin-root.tpl.php:66
|
| 548 |
-
msgctxt "Package list header"
|
| 549 |
-
msgid "Core"
|
| 550 |
-
msgstr "کاکڵ"
|
| 551 |
-
|
| 552 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 553 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 554 |
-
msgid ""
|
| 555 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 556 |
-
"install it"
|
| 557 |
-
msgstr ""
|
| 558 |
-
"لقوپۆپەی پی ئێچ پی \"%s\" دانەمەزراوە، ئەگەر تووشی کێشە هاتی؛ دەبێ دای "
|
| 559 |
-
"بمەزرێنیت"
|
| 560 |
-
|
| 561 |
-
#: pub/js/lang/dummy.php:8
|
| 562 |
-
msgid "Unknown error"
|
| 563 |
-
msgstr "هەڵەی نەناسراو"
|
| 564 |
-
|
| 565 |
-
#: pub/js/lang/dummy.php:10
|
| 566 |
-
msgid "PO file saved"
|
| 567 |
-
msgstr "دۆسیەی (PO)کە پاشەکەوتکرا"
|
| 568 |
-
|
| 569 |
-
#: pub/js/lang/dummy.php:12
|
| 570 |
-
msgid "and MO file compiled"
|
| 571 |
-
msgstr "دۆسیە (MO)کەش تێکخرا"
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:15
|
| 574 |
-
msgid "Merged from %s"
|
| 575 |
-
msgstr "لەگەڵ %s یەکخراون"
|
| 576 |
-
|
| 577 |
-
#: pub/js/lang/dummy.php:17
|
| 578 |
-
msgid "Merged from source code"
|
| 579 |
-
msgstr "لەگەڵ کۆدی سەرچاوە یەکخراون"
|
| 580 |
-
|
| 581 |
-
#: pub/js/lang/dummy.php:19
|
| 582 |
-
msgid "Already up to date with %s"
|
| 583 |
-
msgstr "هەتا ئێستا وەک %s وایە"
|
| 584 |
-
|
| 585 |
-
#: pub/js/lang/dummy.php:21
|
| 586 |
-
msgid "Already up to date with source code"
|
| 587 |
-
msgstr "هەتا ئێستا وەک کۆدی سەرچاوەیە"
|
| 588 |
-
|
| 589 |
-
#: pub/js/lang/dummy.php:23
|
| 590 |
-
msgid "1 new string added"
|
| 591 |
-
msgid_plural "%s new strings added"
|
| 592 |
-
msgstr[0] "دێرێکی نوێ زیادکرا"
|
| 593 |
-
msgstr[1] "%s دێری نوێ زیادکرا"
|
| 594 |
-
|
| 595 |
-
#: pub/js/lang/dummy.php:25
|
| 596 |
-
msgid "1 obsolete string removed"
|
| 597 |
-
msgid_plural "%s obsolete strings removed"
|
| 598 |
-
msgstr[0] "دێرێکی بەسەرچوو سڕاوەتەوە"
|
| 599 |
-
msgstr[1] "%s دێری بەسەرچوو سڕاوەتەوە"
|
| 600 |
-
|
| 601 |
-
#: pub/js/lang/dummy.php:27
|
| 602 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 603 |
-
msgstr "گۆڕانکاریەکانت لەدەست دەدەیت؛ ئەگەر بەبێ پاشەکەوتکردن بەردەوام بیت!"
|
| 604 |
-
|
| 605 |
-
#. label for the window pane holding native translation
|
| 606 |
-
#: pub/js/lang/dummy.php:35
|
| 607 |
-
msgctxt "Editor pane"
|
| 608 |
-
msgid "Source text"
|
| 609 |
-
msgstr "دەقی سەرچاوە"
|
| 610 |
-
|
| 611 |
-
#. where %s is the language, e.g French translation
|
| 612 |
-
#: pub/js/lang/dummy.php:38
|
| 613 |
-
msgctxt "Editor pane"
|
| 614 |
-
msgid "%s translation"
|
| 615 |
-
msgstr "%s وەرگێڕان"
|
| 616 |
-
|
| 617 |
-
#. label for the window pane holding translator comments
|
| 618 |
-
#: pub/js/lang/dummy.php:41
|
| 619 |
-
msgctxt "Editor pane"
|
| 620 |
-
msgid "Comments"
|
| 621 |
-
msgstr "لێدوانەکان"
|
| 622 |
-
|
| 623 |
-
#. label for the window pane holding message context
|
| 624 |
-
#: pub/js/lang/dummy.php:44
|
| 625 |
-
msgctxt "Editor pane"
|
| 626 |
-
msgid "Context"
|
| 627 |
-
msgstr "پێکهاتە"
|
| 628 |
-
|
| 629 |
-
#: pub/js/lang/dummy.php:52
|
| 630 |
-
msgid "Translation"
|
| 631 |
-
msgstr "وەرگێڕان"
|
| 632 |
-
|
| 633 |
-
#: pub/js/lang/dummy.php:54
|
| 634 |
-
msgid "No source files in this package, nothing to sync"
|
| 635 |
-
msgstr "هیچ دۆسیەیەکی سەرچاوە لەم پاکەتەدا نیە، هیچ شتێکیش بۆ هاوهەنگاوی نیە"
|
| 636 |
-
|
| 637 |
-
#: pub/js/lang/dummy.php:56
|
| 638 |
-
msgid "No strings could be extracted from source files"
|
| 639 |
-
msgstr "ناتوانرێ هیچ دێرێک لە دۆسیە سەرچاوەکان دەربهێنرێ"
|
| 640 |
-
|
| 641 |
-
#. Description of the plugin
|
| 642 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 643 |
-
msgstr ""
|
| 644 |
-
|
| 645 |
-
#. URI of the plugin
|
| 646 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 647 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 648 |
-
|
| 649 |
-
#. Author of the plugin
|
| 650 |
-
msgid "Tim Whitlock"
|
| 651 |
-
msgstr "Tim Whitlock"
|
| 652 |
-
|
| 653 |
-
#. Author URI of the plugin
|
| 654 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 655 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-cs_CZ.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-cs_CZ.po
DELETED
|
@@ -1,646 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:17:00 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Czech\n"
|
| 9 |
-
"Language: cs-CZ\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=3; plural=( n == 1 ) ? 0 : ( n >= 2 && n <= 4 ) ? 1 : "
|
| 14 |
-
"2\n"
|
| 15 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
-
"X-Poedit-Basepath: .\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 19 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 20 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 21 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 22 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 23 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 24 |
-
"X-Loco-Target-Locale: cs_CZ\n"
|
| 25 |
-
"X-Loco-WordPress-Plugin: 2.0\n"
|
| 26 |
-
|
| 27 |
-
#. Translators: Bold text label in admin error messages
|
| 28 |
-
#: lib/loco-admin.php:31
|
| 29 |
-
#, fuzzy
|
| 30 |
-
msgctxt "Message label"
|
| 31 |
-
msgid "Error"
|
| 32 |
-
msgstr "Chyba"
|
| 33 |
-
|
| 34 |
-
#: lib/loco-admin.php:41
|
| 35 |
-
msgctxt "Message label"
|
| 36 |
-
msgid "Warning"
|
| 37 |
-
msgstr "Varování"
|
| 38 |
-
|
| 39 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 40 |
-
msgctxt "Message label"
|
| 41 |
-
msgid "OK"
|
| 42 |
-
msgstr "OK"
|
| 43 |
-
|
| 44 |
-
#: lib/loco-admin.php:63
|
| 45 |
-
msgid "Permission denied"
|
| 46 |
-
msgstr "Přístup odepřen"
|
| 47 |
-
|
| 48 |
-
#: lib/loco-admin.php:86
|
| 49 |
-
msgid "Settings saved"
|
| 50 |
-
msgstr "Nastavení uloženo"
|
| 51 |
-
|
| 52 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 53 |
-
msgid "%s is not an official WordPress language"
|
| 54 |
-
msgstr "%s není oficiálním jazykem WordPress"
|
| 55 |
-
|
| 56 |
-
#: lib/loco-admin.php:199
|
| 57 |
-
msgid "New PO file"
|
| 58 |
-
msgstr "Nový soubor PO"
|
| 59 |
-
|
| 60 |
-
#: lib/loco-admin.php:214
|
| 61 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 62 |
-
msgstr ""
|
| 63 |
-
"PO soubor používaný jako šablona. Toto bude přejmenováno na %s při prvním "
|
| 64 |
-
"uložení"
|
| 65 |
-
|
| 66 |
-
#: lib/loco-admin.php:312
|
| 67 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 68 |
-
msgstr "Musíte zadat platné národní prostředí pro nový PO soubor"
|
| 69 |
-
|
| 70 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 71 |
-
msgid "No translatable strings found"
|
| 72 |
-
msgstr "Nebyly nalezeny žádné řetězce pro překlad"
|
| 73 |
-
|
| 74 |
-
#: lib/loco-admin.php:337
|
| 75 |
-
msgid "Cannot create a PO file."
|
| 76 |
-
msgstr "Nelze vytvořit soubor PO."
|
| 77 |
-
|
| 78 |
-
#: lib/loco-admin.php:344
|
| 79 |
-
msgid "PO file already exists with locale %s"
|
| 80 |
-
msgstr "Soubor PO již existuje s národním prostředím %s"
|
| 81 |
-
|
| 82 |
-
#: lib/loco-admin.php:396
|
| 83 |
-
msgid ""
|
| 84 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 85 |
-
"Download instead of Save"
|
| 86 |
-
msgstr ""
|
| 87 |
-
"Soubor nemůže být automaticky vytvořen. Opravte oprávnění k souboru nebo "
|
| 88 |
-
"použijte Stáhnout namísto Uložit"
|
| 89 |
-
|
| 90 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 91 |
-
msgid "%s file is empty"
|
| 92 |
-
msgstr "%s soubor je prázdný"
|
| 93 |
-
|
| 94 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 95 |
-
msgid "Run Sync to update from source code"
|
| 96 |
-
msgstr "Spusťte Sync pro aktualizaci ze zdrojového kódu"
|
| 97 |
-
|
| 98 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 99 |
-
msgid "No strings could be extracted from source code"
|
| 100 |
-
msgstr "Žádné řetězce by mohly být extrahovány ze zdrojového kódu"
|
| 101 |
-
|
| 102 |
-
#: lib/loco-admin.php:417
|
| 103 |
-
msgid "Run Sync to update from %s"
|
| 104 |
-
msgstr "Spusťte Sync pro aktualizaci ze %s"
|
| 105 |
-
|
| 106 |
-
#: lib/loco-admin.php:436
|
| 107 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 108 |
-
msgstr "Zdrojový kód byl změněn, spusťte Sync pro aktualizaci POT"
|
| 109 |
-
|
| 110 |
-
#: lib/loco-admin.php:440
|
| 111 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 112 |
-
msgstr "POT byl změněn od uložení PO souboru, spusťte Sync pro aktualizaci"
|
| 113 |
-
|
| 114 |
-
#: lib/loco-admin.php:536
|
| 115 |
-
msgid "Bad file path"
|
| 116 |
-
msgstr "Špatná cesta k souboru"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:783
|
| 119 |
-
msgid "Empty or invalid %s file"
|
| 120 |
-
msgstr "Prázdný nebo neplatný soubor %s"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:787
|
| 123 |
-
msgid "%s file has no header"
|
| 124 |
-
msgstr "Soubor %s nemá hlavičku"
|
| 125 |
-
|
| 126 |
-
#: lib/loco-admin.php:934
|
| 127 |
-
msgctxt "Add button"
|
| 128 |
-
msgid "New template"
|
| 129 |
-
msgstr "Nová šablona"
|
| 130 |
-
|
| 131 |
-
#: lib/loco-admin.php:953
|
| 132 |
-
msgctxt "Add button"
|
| 133 |
-
msgid "New language"
|
| 134 |
-
msgstr "Nový jazyk"
|
| 135 |
-
|
| 136 |
-
#: lib/loco-admin.php:992
|
| 137 |
-
msgid "%s%% translated"
|
| 138 |
-
msgstr "%s%% přeloženo"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:992
|
| 141 |
-
msgid "1 string"
|
| 142 |
-
msgid_plural "%s strings"
|
| 143 |
-
msgstr[0] "1 řetězec"
|
| 144 |
-
msgstr[1] "%s řetězce"
|
| 145 |
-
msgstr[2] "%s řetězců"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:995
|
| 148 |
-
msgid "%s fuzzy"
|
| 149 |
-
msgstr "%s odhadnuto"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:998
|
| 152 |
-
msgid "%s untranslated"
|
| 153 |
-
msgstr "%s nepřeloženo"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1044
|
| 156 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 157 |
-
msgstr "Nepodařilo se zkompilovat soubor MO vestavěným kompilátorem"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 160 |
-
msgid "Loco, Translation Management"
|
| 161 |
-
msgstr "Loco, Správa překladů"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 164 |
-
msgid "Manage translations"
|
| 165 |
-
msgstr "Spravovat překlady"
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1094
|
| 168 |
-
msgid "Translation options"
|
| 169 |
-
msgstr "Možnosti překladu"
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1101
|
| 172 |
-
msgid "Loco Translate"
|
| 173 |
-
msgstr "Překladač Loco"
|
| 174 |
-
|
| 175 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 176 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 177 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 178 |
-
msgid "Settings"
|
| 179 |
-
msgstr "Nastavení"
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1149
|
| 182 |
-
msgid "File download failed"
|
| 183 |
-
msgstr "Stažení souboru selhalo"
|
| 184 |
-
|
| 185 |
-
#: lib/loco-admin.php:1159
|
| 186 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 187 |
-
msgstr "WPLANG je zastaralý a měl by být odstraněn z wp-config.php"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-locales.php:77
|
| 190 |
-
msgid "Unknown language"
|
| 191 |
-
msgstr "Neznámý jazyk"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 194 |
-
msgid "Some files not writable"
|
| 195 |
-
msgstr "Některé soubory nejsou zapisovatelné"
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:484
|
| 198 |
-
msgid "Some files missing"
|
| 199 |
-
msgstr "Některé soubory chybí"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 202 |
-
msgid "\"%s\" folder not writable"
|
| 203 |
-
msgstr "Složka \"%s\" není zapisovatelná"
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:515
|
| 206 |
-
msgid "POT file not writable"
|
| 207 |
-
msgstr "Soubor POT není zapisovatelný"
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:520
|
| 210 |
-
msgid "PO file not writable"
|
| 211 |
-
msgstr "Soubor PO není zapisovatelný"
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not writable"
|
| 215 |
-
msgstr "Soubor MO není zapisovatelný"
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:522
|
| 218 |
-
msgid "MO file not found"
|
| 219 |
-
msgstr "Soubor MO nenalezen"
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not writable"
|
| 223 |
-
msgstr "Složka není zapisovatelná"
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:527
|
| 226 |
-
msgid "Folder not found"
|
| 227 |
-
msgstr "Složka nenalezena"
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546
|
| 230 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 231 |
-
msgstr "%s nedeklaruje \"Text Domain\""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 234 |
-
msgid "Loco has guessed \"%s\""
|
| 235 |
-
msgstr "Loco odhadnul \"%s\""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:551
|
| 238 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 239 |
-
msgstr "%s nedeklaruje \"Domain Path\""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:556
|
| 242 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 243 |
-
msgstr ""
|
| 244 |
-
"%s nemá žádný soubor POT. Vytvořte jej jako \"%s/%s.pot\", pokud jej "
|
| 245 |
-
"potřebujete."
|
| 246 |
-
|
| 247 |
-
#: lib/loco-packages.php:559
|
| 248 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 249 |
-
msgstr "%s má podivný název souboru POT (%s). Lepší jméno bylo by \"%s.pot\""
|
| 250 |
-
|
| 251 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 252 |
-
msgid "User does not have permission to manage translations"
|
| 253 |
-
msgstr "Uživatel nemá oprávnění ke správě překladů"
|
| 254 |
-
|
| 255 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 256 |
-
msgid "Invalid data posted to server"
|
| 257 |
-
msgstr "Neplatná data zaslaná na server"
|
| 258 |
-
|
| 259 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 260 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 261 |
-
msgstr "Nepodařilo se zkompilovat soubor MO s %s, zkontrolujte vaše nastavení"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 264 |
-
msgid "Package not found called %s"
|
| 265 |
-
msgstr "Balíček s názvem %s nenalezen"
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:58
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 270 |
-
"backups in settings"
|
| 271 |
-
msgstr ""
|
| 272 |
-
"Webový server nemůže vytvářet zálohy v \"%s\". Opravte oprávnění souborů "
|
| 273 |
-
"nebo zakažte zálohy v nastavení"
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:66
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 278 |
-
"create it manually."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"Webový server nemůže vytvořit adresář \"%s\" v \"%s\". Opravte oprávnění "
|
| 281 |
-
"souborů nebo jej vytvořte ručně."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:69
|
| 284 |
-
msgid ""
|
| 285 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 286 |
-
"or use the download function."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"Webový server nemůže vytvářet soubory v adresáři \"%s\". Opravte oprávnění "
|
| 289 |
-
"souborů nebo použijte funkci stahování."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:81
|
| 292 |
-
msgid ""
|
| 293 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 294 |
-
"and copy to \"%s/%s\"."
|
| 295 |
-
msgstr ""
|
| 296 |
-
"Soubor %s není zapisovatelný webovým serverem. Opravte oprávnění souborů "
|
| 297 |
-
"nebo stáhněte a zkopírujte do \"%s/%s\"."
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:102
|
| 300 |
-
msgid "Cannot create MO file"
|
| 301 |
-
msgstr "Nelze vytvořit soubor MO"
|
| 302 |
-
|
| 303 |
-
#: php/loco-posave.php:105
|
| 304 |
-
msgid "Cannot overwrite MO file"
|
| 305 |
-
msgstr "Nelze přepsat soubor MO"
|
| 306 |
-
|
| 307 |
-
#: php/loco-posave.php:131
|
| 308 |
-
msgid "Failed to write MO file"
|
| 309 |
-
msgstr "Do souboru MO nelze zapisovat"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 312 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 313 |
-
#: tpl/admin-root.tpl.php:6
|
| 314 |
-
msgid "Packages"
|
| 315 |
-
msgstr "Balíčky"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 318 |
-
msgid "File check"
|
| 319 |
-
msgstr "Kontrola souborů"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 322 |
-
msgid "File system permissions for %s"
|
| 323 |
-
msgstr "Oprávnění souborového systému pro %s"
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 326 |
-
msgid "Other potential issues with %s"
|
| 327 |
-
msgstr "Další potenciální problémy s %s"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 330 |
-
msgid "Back"
|
| 331 |
-
msgstr "Zpět"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 334 |
-
msgid "Get help"
|
| 335 |
-
msgstr "Získat pomoc"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-list.tpl.php:11
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Package details"
|
| 340 |
-
msgstr "Podrobnosti o balíčku"
|
| 341 |
-
|
| 342 |
-
#: tpl/admin-list.tpl.php:14
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Translations (PO)"
|
| 345 |
-
msgstr "Překlady (PO)"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:17
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Template (POT)"
|
| 350 |
-
msgstr "Šablona (POT)"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:20
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "File permissions"
|
| 355 |
-
msgstr "Oprávnění k souborům"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:40
|
| 358 |
-
msgid "Extends: %s"
|
| 359 |
-
msgstr "Rozšiřuje: %s"
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:44
|
| 362 |
-
msgid "1 language"
|
| 363 |
-
msgid_plural "%u languages"
|
| 364 |
-
msgstr[0] "1 jazyk"
|
| 365 |
-
msgstr[1] "%u jazyky"
|
| 366 |
-
msgstr[2] "%u jazyků"
|
| 367 |
-
|
| 368 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 369 |
-
msgctxt "Modified time"
|
| 370 |
-
msgid "Updated"
|
| 371 |
-
msgstr "Aktualizováno"
|
| 372 |
-
|
| 373 |
-
#: tpl/admin-nav.tpl.php:26
|
| 374 |
-
msgid "Powered by"
|
| 375 |
-
msgstr "Běží na"
|
| 376 |
-
|
| 377 |
-
#: tpl/admin-nav.tpl.php:32
|
| 378 |
-
msgid "Loco may not work as expected"
|
| 379 |
-
msgstr "Loco nemusí fungovat podle očekávání"
|
| 380 |
-
|
| 381 |
-
#: tpl/admin-opts.tpl.php:18
|
| 382 |
-
msgid "Configure Loco Translate"
|
| 383 |
-
msgstr "Konfigurace Překladače Loco"
|
| 384 |
-
|
| 385 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 386 |
-
msgid "Compiling MO files"
|
| 387 |
-
msgstr "Kompilace MO souborů"
|
| 388 |
-
|
| 389 |
-
#: tpl/admin-opts.tpl.php:36
|
| 390 |
-
msgid "Use built-in MO compiler."
|
| 391 |
-
msgstr "Použít vestavěný MO kompilátor."
|
| 392 |
-
|
| 393 |
-
#: tpl/admin-opts.tpl.php:42
|
| 394 |
-
msgid "Use external command:"
|
| 395 |
-
msgstr "Použít externí příkaz:"
|
| 396 |
-
|
| 397 |
-
#: tpl/admin-opts.tpl.php:47
|
| 398 |
-
msgid "Enter path to msgfmt on server"
|
| 399 |
-
msgstr "Vložte cestu k msgfmt na serveru"
|
| 400 |
-
|
| 401 |
-
#: tpl/admin-opts.tpl.php:54
|
| 402 |
-
msgid "Generate hash tables"
|
| 403 |
-
msgstr "Generovat hash tabulky"
|
| 404 |
-
|
| 405 |
-
#: tpl/admin-opts.tpl.php:60
|
| 406 |
-
msgid "Include Fuzzy strings"
|
| 407 |
-
msgstr "Zahrnout odhadnuté řetězce"
|
| 408 |
-
|
| 409 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 410 |
-
msgid "Backing up PO files"
|
| 411 |
-
msgstr "Zálohování PO souborů"
|
| 412 |
-
|
| 413 |
-
#: tpl/admin-opts.tpl.php:75
|
| 414 |
-
msgid "Number of backups to keep of each file:"
|
| 415 |
-
msgstr "Počet záloh pro zachování každého souboru:"
|
| 416 |
-
|
| 417 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 418 |
-
msgid "Experimental features"
|
| 419 |
-
msgstr "Experimentální funkce"
|
| 420 |
-
|
| 421 |
-
#: tpl/admin-opts.tpl.php:92
|
| 422 |
-
msgid "Enable WordPress core translations"
|
| 423 |
-
msgstr "Povolit překlady jádra WordPressu"
|
| 424 |
-
|
| 425 |
-
#: tpl/admin-opts.tpl.php:101
|
| 426 |
-
msgid "Save settings"
|
| 427 |
-
msgstr "Uložit nastavení"
|
| 428 |
-
|
| 429 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 430 |
-
msgid "Template file"
|
| 431 |
-
msgstr "Soubor šablony"
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 434 |
-
msgctxt "Dropdown label"
|
| 435 |
-
msgid "Switch to..."
|
| 436 |
-
msgstr "Přepnout na..."
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 439 |
-
msgid "never"
|
| 440 |
-
msgstr "nikdy"
|
| 441 |
-
|
| 442 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 443 |
-
msgctxt "Editor button"
|
| 444 |
-
msgid "Save"
|
| 445 |
-
msgstr "Uložit"
|
| 446 |
-
|
| 447 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 448 |
-
msgctxt "Editor button"
|
| 449 |
-
msgid "Download"
|
| 450 |
-
msgstr "Stáhnout"
|
| 451 |
-
|
| 452 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 453 |
-
msgctxt "Editor button"
|
| 454 |
-
msgid "Sync"
|
| 455 |
-
msgstr "Sync"
|
| 456 |
-
|
| 457 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 458 |
-
msgctxt "Editor button"
|
| 459 |
-
msgid "Revert"
|
| 460 |
-
msgstr "Vrátit"
|
| 461 |
-
|
| 462 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 463 |
-
msgctxt "Editor button"
|
| 464 |
-
msgid "Add"
|
| 465 |
-
msgstr "Přidat"
|
| 466 |
-
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Del"
|
| 470 |
-
msgstr "Smaz"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Fuzzy"
|
| 475 |
-
msgstr "Odhad"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 478 |
-
msgid "Filter translations"
|
| 479 |
-
msgstr "Filtrovat překlady"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 482 |
-
msgctxt "Editor button"
|
| 483 |
-
msgid "Help"
|
| 484 |
-
msgstr "Nápověda"
|
| 485 |
-
|
| 486 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 487 |
-
msgid "Initialize new translations in %s"
|
| 488 |
-
msgstr "Inicializovat nové překlady v %s"
|
| 489 |
-
|
| 490 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 491 |
-
msgid "Select from common languages"
|
| 492 |
-
msgstr "Vyberte z běžných jazyků"
|
| 493 |
-
|
| 494 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 495 |
-
msgctxt "Form label"
|
| 496 |
-
msgid "or enter any language code"
|
| 497 |
-
msgstr "nebo vložte libovolný kód jazyka"
|
| 498 |
-
|
| 499 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 500 |
-
msgctxt "Form label"
|
| 501 |
-
msgid "create in <code>%s</code>"
|
| 502 |
-
msgstr "vytvořit v <code>%s</code>"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 505 |
-
msgctxt "Form label"
|
| 506 |
-
msgid "create in global languages directory"
|
| 507 |
-
msgstr "vytvořit v adresáři s globálními jazyky"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 510 |
-
msgctxt "Submit button"
|
| 511 |
-
msgid "Start translating"
|
| 512 |
-
msgstr "Začít překládat"
|
| 513 |
-
|
| 514 |
-
#: tpl/admin-root.tpl.php:18
|
| 515 |
-
msgid "New version available"
|
| 516 |
-
msgstr "Nová verze k dispozici"
|
| 517 |
-
|
| 518 |
-
#: tpl/admin-root.tpl.php:21
|
| 519 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 520 |
-
msgstr "Aktualizujte na verzi %s Překladače Loco"
|
| 521 |
-
|
| 522 |
-
#: tpl/admin-root.tpl.php:31
|
| 523 |
-
msgid "Select a plugin or theme to translate"
|
| 524 |
-
msgstr "Vyberte plugin nebo téma pro překlad"
|
| 525 |
-
|
| 526 |
-
#: tpl/admin-root.tpl.php:40
|
| 527 |
-
msgctxt "Package list header"
|
| 528 |
-
msgid "Themes"
|
| 529 |
-
msgstr "Šablony"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-root.tpl.php:53
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Plugins"
|
| 534 |
-
msgstr "Pluginy"
|
| 535 |
-
|
| 536 |
-
#: tpl/admin-root.tpl.php:66
|
| 537 |
-
msgctxt "Package list header"
|
| 538 |
-
msgid "Core"
|
| 539 |
-
msgstr "Jádro"
|
| 540 |
-
|
| 541 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 542 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 543 |
-
msgid ""
|
| 544 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 545 |
-
"install it"
|
| 546 |
-
msgstr ""
|
| 547 |
-
"PHP rozšíření \"%s\" není nainstalováno. Pokud dochází k problémům, měli "
|
| 548 |
-
"byste jej nainstalovat"
|
| 549 |
-
|
| 550 |
-
#: pub/js/lang/dummy.php:8
|
| 551 |
-
msgid "Unknown error"
|
| 552 |
-
msgstr "Neznámá chyba"
|
| 553 |
-
|
| 554 |
-
#: pub/js/lang/dummy.php:10
|
| 555 |
-
msgid "PO file saved"
|
| 556 |
-
msgstr "Soubor PO uložen"
|
| 557 |
-
|
| 558 |
-
#: pub/js/lang/dummy.php:12
|
| 559 |
-
msgid "and MO file compiled"
|
| 560 |
-
msgstr "a soubor MO zkompilován"
|
| 561 |
-
|
| 562 |
-
#: pub/js/lang/dummy.php:15
|
| 563 |
-
msgid "Merged from %s"
|
| 564 |
-
msgstr "Sloučeno z %s"
|
| 565 |
-
|
| 566 |
-
#: pub/js/lang/dummy.php:17
|
| 567 |
-
msgid "Merged from source code"
|
| 568 |
-
msgstr "Sloučeno ze zdrojového kódu"
|
| 569 |
-
|
| 570 |
-
#: pub/js/lang/dummy.php:19
|
| 571 |
-
msgid "Already up to date with %s"
|
| 572 |
-
msgstr "Již v aktuálním stavu s %s"
|
| 573 |
-
|
| 574 |
-
#: pub/js/lang/dummy.php:21
|
| 575 |
-
msgid "Already up to date with source code"
|
| 576 |
-
msgstr "Již v aktuálním stavu se zdrojovým kódem"
|
| 577 |
-
|
| 578 |
-
#: pub/js/lang/dummy.php:23
|
| 579 |
-
msgid "1 new string added"
|
| 580 |
-
msgid_plural "%s new strings added"
|
| 581 |
-
msgstr[0] "1 nový řetězec přidán"
|
| 582 |
-
msgstr[1] "%s nové řetězce přidány"
|
| 583 |
-
msgstr[2] "%s nových řetězců přidáno"
|
| 584 |
-
|
| 585 |
-
#: pub/js/lang/dummy.php:25
|
| 586 |
-
msgid "1 obsolete string removed"
|
| 587 |
-
msgid_plural "%s obsolete strings removed"
|
| 588 |
-
msgstr[0] "1 zastaralý řetězec odstraněn"
|
| 589 |
-
msgstr[1] "%s zastaralé řetězce odstraněny"
|
| 590 |
-
msgstr[2] "%s zastaralých řetězců odstraněno"
|
| 591 |
-
|
| 592 |
-
#: pub/js/lang/dummy.php:27
|
| 593 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 594 |
-
msgstr "Vaše změny budou ztraceny, pokud budete pokračovat bez uložení"
|
| 595 |
-
|
| 596 |
-
#. label for the window pane holding native translation
|
| 597 |
-
#: pub/js/lang/dummy.php:35
|
| 598 |
-
msgctxt "Editor pane"
|
| 599 |
-
msgid "Source text"
|
| 600 |
-
msgstr "Zdrojový text"
|
| 601 |
-
|
| 602 |
-
#. where %s is the language, e.g French translation
|
| 603 |
-
#: pub/js/lang/dummy.php:38
|
| 604 |
-
msgctxt "Editor pane"
|
| 605 |
-
msgid "%s translation"
|
| 606 |
-
msgstr "%s překlad"
|
| 607 |
-
|
| 608 |
-
#. label for the window pane holding translator comments
|
| 609 |
-
#: pub/js/lang/dummy.php:41
|
| 610 |
-
msgctxt "Editor pane"
|
| 611 |
-
msgid "Comments"
|
| 612 |
-
msgstr "Komentáře"
|
| 613 |
-
|
| 614 |
-
#. label for the window pane holding message context
|
| 615 |
-
#: pub/js/lang/dummy.php:44
|
| 616 |
-
msgctxt "Editor pane"
|
| 617 |
-
msgid "Context"
|
| 618 |
-
msgstr "Kontext"
|
| 619 |
-
|
| 620 |
-
#: pub/js/lang/dummy.php:52
|
| 621 |
-
msgid "Translation"
|
| 622 |
-
msgstr "Překlad"
|
| 623 |
-
|
| 624 |
-
#: pub/js/lang/dummy.php:54
|
| 625 |
-
msgid "No source files in this package, nothing to sync"
|
| 626 |
-
msgstr "Žádné zdrojové soubory v tomto balíčku, není nic k synchronizaci"
|
| 627 |
-
|
| 628 |
-
#: pub/js/lang/dummy.php:56
|
| 629 |
-
msgid "No strings could be extracted from source files"
|
| 630 |
-
msgstr "Žádné řetězce nemohly být extrahovány ze zdrojových souborů"
|
| 631 |
-
|
| 632 |
-
#. Description of the plugin
|
| 633 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 634 |
-
msgstr "Překládejte WordPress pluginy a témata přímo ve vašem prohlížeči"
|
| 635 |
-
|
| 636 |
-
#. URI of the plugin
|
| 637 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 638 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 639 |
-
|
| 640 |
-
#. Author of the plugin
|
| 641 |
-
msgid "Tim Whitlock"
|
| 642 |
-
msgstr "Tim Whitlock"
|
| 643 |
-
|
| 644 |
-
#. Author URI of the plugin
|
| 645 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 646 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-de_DE.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-de_DE.po
DELETED
|
@@ -1,639 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:17:19 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: German\n"
|
| 9 |
-
"Language: de-DE\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: de_DE\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Fehler"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Warnung"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Zugriff verweigert"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Einstellungen gespeichert"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Neue PO-Datei"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"PO-Datei wird als Template verwendet. Dies wird in %s beim ersten Speichern "
|
| 61 |
-
"umbenannt."
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Du musst einen gültigen Pfad für die PO-Datei angeben"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Keine übersetzbaren Zeichenketten gefunden"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Erstellen der PO-Datei fehlgeschlagen."
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "PO-Datei existiert schon unter %s"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"Datei kann nicht automatisch erstellt werden. Setze die Datei-Zugriffsrechte "
|
| 85 |
-
"oder benutze Download anstatt Speichern"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "Datei (%s) ist leer"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "Benutze Sync, um von der Quelle zu aktualisieren"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "Es konnten keine Zeichenketten vom Quellcode extrahiert werden"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "Benutze Sync, um aus %s zu aktualisieren"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr "Quellcode wurde geändert, benutze Sync um POT zu aktualisieren"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"POT wurde aktualisiert bevor die PO-Datei gespeichert wurde. Benutze Sync "
|
| 111 |
-
"zum Aktualisieren."
|
| 112 |
-
|
| 113 |
-
#: lib/loco-admin.php:536
|
| 114 |
-
msgid "Bad file path"
|
| 115 |
-
msgstr "Falscher Dateipfad"
|
| 116 |
-
|
| 117 |
-
#: lib/loco-admin.php:783
|
| 118 |
-
msgid "Empty or invalid %s file"
|
| 119 |
-
msgstr "Leere oder ungültige %s-Datei"
|
| 120 |
-
|
| 121 |
-
#: lib/loco-admin.php:787
|
| 122 |
-
msgid "%s file has no header"
|
| 123 |
-
msgstr "%s-Datei hat keinen Header"
|
| 124 |
-
|
| 125 |
-
#: lib/loco-admin.php:934
|
| 126 |
-
msgctxt "Add button"
|
| 127 |
-
msgid "New template"
|
| 128 |
-
msgstr "Neues Template"
|
| 129 |
-
|
| 130 |
-
#: lib/loco-admin.php:953
|
| 131 |
-
msgctxt "Add button"
|
| 132 |
-
msgid "New language"
|
| 133 |
-
msgstr "Neue Sprache"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:992
|
| 136 |
-
msgid "%s%% translated"
|
| 137 |
-
msgstr "%s%% übersetzt"
|
| 138 |
-
|
| 139 |
-
#: lib/loco-admin.php:992
|
| 140 |
-
msgid "1 string"
|
| 141 |
-
msgid_plural "%s strings"
|
| 142 |
-
msgstr[0] "1 Zeichenkette"
|
| 143 |
-
msgstr[1] "%s Zeichenketten"
|
| 144 |
-
|
| 145 |
-
#: lib/loco-admin.php:995
|
| 146 |
-
msgid "%s fuzzy"
|
| 147 |
-
msgstr "%s undeutlich"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:998
|
| 150 |
-
msgid "%s untranslated"
|
| 151 |
-
msgstr "%s nicht übersetzt"
|
| 152 |
-
|
| 153 |
-
#: lib/loco-admin.php:1044
|
| 154 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 155 |
-
msgstr "Kompilieren der MO-Datei mit dem internen Kompilierer fehlgeschlagen."
|
| 156 |
-
|
| 157 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 158 |
-
msgid "Loco, Translation Management"
|
| 159 |
-
msgstr "Loco, Translation Management"
|
| 160 |
-
|
| 161 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 162 |
-
msgid "Manage translations"
|
| 163 |
-
msgstr "Übersetzungen verwalten"
|
| 164 |
-
|
| 165 |
-
#: lib/loco-admin.php:1094
|
| 166 |
-
msgid "Translation options"
|
| 167 |
-
msgstr "Übersetzungsoptionen"
|
| 168 |
-
|
| 169 |
-
#: lib/loco-admin.php:1101
|
| 170 |
-
msgid "Loco Translate"
|
| 171 |
-
msgstr "Loco Translate"
|
| 172 |
-
|
| 173 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 174 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 175 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 176 |
-
msgid "Settings"
|
| 177 |
-
msgstr "Einstellungen"
|
| 178 |
-
|
| 179 |
-
#: lib/loco-admin.php:1149
|
| 180 |
-
msgid "File download failed"
|
| 181 |
-
msgstr "Dateidownload ist fehlgeschlagen"
|
| 182 |
-
|
| 183 |
-
#: lib/loco-admin.php:1159
|
| 184 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 185 |
-
msgstr ""
|
| 186 |
-
|
| 187 |
-
#: lib/loco-locales.php:77
|
| 188 |
-
msgid "Unknown language"
|
| 189 |
-
msgstr "Unbekannte Sprache"
|
| 190 |
-
|
| 191 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 192 |
-
msgid "Some files not writable"
|
| 193 |
-
msgstr "Einige Dateien nicht schreibbar"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-packages.php:484
|
| 196 |
-
msgid "Some files missing"
|
| 197 |
-
msgstr "Einige Dateien fehlen"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 200 |
-
msgid "\"%s\" folder not writable"
|
| 201 |
-
msgstr "Ordner \"%s\" nicht schreibbar"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:515
|
| 204 |
-
msgid "POT file not writable"
|
| 205 |
-
msgstr "POT-Datei nicht schreibbar"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:520
|
| 208 |
-
msgid "PO file not writable"
|
| 209 |
-
msgstr "PO-Datei nicht schreibbar"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:522
|
| 212 |
-
msgid "MO file not writable"
|
| 213 |
-
msgstr "MO-Datei nicht schreibbar"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:522
|
| 216 |
-
msgid "MO file not found"
|
| 217 |
-
msgstr "MO-Datei nicht gefunden"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:527
|
| 220 |
-
msgid "Folder not writable"
|
| 221 |
-
msgstr "Ordner nicht schreibbar"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:527
|
| 224 |
-
msgid "Folder not found"
|
| 225 |
-
msgstr "Ordner nicht gefunden"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:546
|
| 228 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 229 |
-
msgstr ""
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 232 |
-
msgid "Loco has guessed \"%s\""
|
| 233 |
-
msgstr ""
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:551
|
| 236 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 237 |
-
msgstr ""
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:556
|
| 240 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 241 |
-
msgstr ""
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:559
|
| 244 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 245 |
-
msgstr ""
|
| 246 |
-
|
| 247 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 248 |
-
msgid "User does not have permission to manage translations"
|
| 249 |
-
msgstr "Benutzer hat keine Rechte die Übersetzungen zu verwalten"
|
| 250 |
-
|
| 251 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 252 |
-
msgid "Invalid data posted to server"
|
| 253 |
-
msgstr "Ungültige Daten zum Server gesendet"
|
| 254 |
-
|
| 255 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 256 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 257 |
-
msgstr ""
|
| 258 |
-
"Kompilieren der MO-Datei fehlgeschlagen. Bitte prüfe Deine Einstellungen"
|
| 259 |
-
|
| 260 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 261 |
-
msgid "Package not found called %s"
|
| 262 |
-
msgstr "Paket %s nicht gefunden"
|
| 263 |
-
|
| 264 |
-
#: php/loco-posave.php:58
|
| 265 |
-
msgid ""
|
| 266 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 267 |
-
"backups in settings"
|
| 268 |
-
msgstr ""
|
| 269 |
-
"Webserver kann keine Sicherungen in \"%s\" anlegen. Setze die Datei-"
|
| 270 |
-
"Zugriffrechte oder deaktiviere die Sicherungen in den Einstellungen"
|
| 271 |
-
|
| 272 |
-
#: php/loco-posave.php:66
|
| 273 |
-
msgid ""
|
| 274 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 275 |
-
"create it manually."
|
| 276 |
-
msgstr ""
|
| 277 |
-
"Webserver kann Ordner \"%s\" nicht in \"%s\" erstellen. Setze die "
|
| 278 |
-
"Zugriffsrechte oder erstelle den Ordner selbst."
|
| 279 |
-
|
| 280 |
-
#: php/loco-posave.php:69
|
| 281 |
-
msgid ""
|
| 282 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 283 |
-
"or use the download function."
|
| 284 |
-
msgstr ""
|
| 285 |
-
"Webserver kann keine Dateien im Ordner \"%s\" erstellen. Setze die Datei-"
|
| 286 |
-
"Zugriffsrechte oder benutze Download anstatt Speichern."
|
| 287 |
-
|
| 288 |
-
#: php/loco-posave.php:81
|
| 289 |
-
msgid ""
|
| 290 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 291 |
-
"and copy to \"%s/%s\"."
|
| 292 |
-
msgstr ""
|
| 293 |
-
"Datei %s ist vom Webserver nicht schreibbar. Setze die Datei-Zugriffsrechte "
|
| 294 |
-
"oder benutze Download anstatt Speichern und speichere die Datei auf dem "
|
| 295 |
-
"Server unter \"%s/%s\" ab."
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:102
|
| 298 |
-
msgid "Cannot create MO file"
|
| 299 |
-
msgstr "Erstellen der MO-Datei fehlgeschlagen."
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:105
|
| 302 |
-
msgid "Cannot overwrite MO file"
|
| 303 |
-
msgstr "Überschreiben der MO-Datei fehlgeschlagen"
|
| 304 |
-
|
| 305 |
-
#: php/loco-posave.php:131
|
| 306 |
-
msgid "Failed to write MO file"
|
| 307 |
-
msgstr "Fehler beim Schreiben der MO-Datei"
|
| 308 |
-
|
| 309 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 310 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 311 |
-
#: tpl/admin-root.tpl.php:6
|
| 312 |
-
msgid "Packages"
|
| 313 |
-
msgstr "Pakete"
|
| 314 |
-
|
| 315 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 316 |
-
msgid "File check"
|
| 317 |
-
msgstr "Dateiprüfung"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 320 |
-
msgid "File system permissions for %s"
|
| 321 |
-
msgstr "Dateisystem-Rechte für %s"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 324 |
-
msgid "Other potential issues with %s"
|
| 325 |
-
msgstr ""
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 328 |
-
msgid "Back"
|
| 329 |
-
msgstr "Zurück"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 332 |
-
msgid "Get help"
|
| 333 |
-
msgstr "Hilfe erhalten"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-list.tpl.php:11
|
| 336 |
-
msgctxt "Table header"
|
| 337 |
-
msgid "Package details"
|
| 338 |
-
msgstr "Paketdetails"
|
| 339 |
-
|
| 340 |
-
#: tpl/admin-list.tpl.php:14
|
| 341 |
-
msgctxt "Table header"
|
| 342 |
-
msgid "Translations (PO)"
|
| 343 |
-
msgstr "Übersetzungen (PO)"
|
| 344 |
-
|
| 345 |
-
#: tpl/admin-list.tpl.php:17
|
| 346 |
-
msgctxt "Table header"
|
| 347 |
-
msgid "Template (POT)"
|
| 348 |
-
msgstr "Template (POT)"
|
| 349 |
-
|
| 350 |
-
#: tpl/admin-list.tpl.php:20
|
| 351 |
-
msgctxt "Table header"
|
| 352 |
-
msgid "File permissions"
|
| 353 |
-
msgstr "Dateizugriffsrechte"
|
| 354 |
-
|
| 355 |
-
#: tpl/admin-list.tpl.php:40
|
| 356 |
-
msgid "Extends: %s"
|
| 357 |
-
msgstr "Erweiterung: %s"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:44
|
| 360 |
-
msgid "1 language"
|
| 361 |
-
msgid_plural "%u languages"
|
| 362 |
-
msgstr[0] "1 Sprache"
|
| 363 |
-
msgstr[1] "%u Sprachen"
|
| 364 |
-
|
| 365 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 366 |
-
msgctxt "Modified time"
|
| 367 |
-
msgid "Updated"
|
| 368 |
-
msgstr "Aktualisiert"
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-nav.tpl.php:26
|
| 371 |
-
msgid "Powered by"
|
| 372 |
-
msgstr "Präsentiert von"
|
| 373 |
-
|
| 374 |
-
#: tpl/admin-nav.tpl.php:32
|
| 375 |
-
msgid "Loco may not work as expected"
|
| 376 |
-
msgstr "Loco scheint nicht, wie erwartet, zu arbeiten"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-opts.tpl.php:18
|
| 379 |
-
msgid "Configure Loco Translate"
|
| 380 |
-
msgstr "Konfiguriere Loco Translate"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 383 |
-
msgid "Compiling MO files"
|
| 384 |
-
msgstr "MO-Dateien kompilieren"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:36
|
| 387 |
-
msgid "Use built-in MO compiler."
|
| 388 |
-
msgstr "Benutze internen MO-Kompilierer"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:42
|
| 391 |
-
msgid "Use external command:"
|
| 392 |
-
msgstr "Benutze externes Befehlsprogramm:"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:47
|
| 395 |
-
msgid "Enter path to msgfmt on server"
|
| 396 |
-
msgstr "Pfad zum msgfmt-Programm"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:54
|
| 399 |
-
msgid "Generate hash tables"
|
| 400 |
-
msgstr "Erzeuge Hashtabellen"
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:60
|
| 403 |
-
msgid "Include Fuzzy strings"
|
| 404 |
-
msgstr ""
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 407 |
-
msgid "Backing up PO files"
|
| 408 |
-
msgstr "PO-Datei sichern"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:75
|
| 411 |
-
msgid "Number of backups to keep of each file:"
|
| 412 |
-
msgstr "Anzahl der Sicherungen pro Datei"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 415 |
-
msgid "Experimental features"
|
| 416 |
-
msgstr "Experimentelle Funktionen"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:92
|
| 419 |
-
msgid "Enable WordPress core translations"
|
| 420 |
-
msgstr "WordPress Core Übersetzung aktivieren"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-opts.tpl.php:101
|
| 423 |
-
msgid "Save settings"
|
| 424 |
-
msgstr "Einstellungen speichern"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 427 |
-
msgid "Template file"
|
| 428 |
-
msgstr "Templatedatei"
|
| 429 |
-
|
| 430 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 431 |
-
msgctxt "Dropdown label"
|
| 432 |
-
msgid "Switch to..."
|
| 433 |
-
msgstr "Wechsle zu..."
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 436 |
-
msgid "never"
|
| 437 |
-
msgstr "niemals"
|
| 438 |
-
|
| 439 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 440 |
-
msgctxt "Editor button"
|
| 441 |
-
msgid "Save"
|
| 442 |
-
msgstr "Speichern"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 445 |
-
msgctxt "Editor button"
|
| 446 |
-
msgid "Download"
|
| 447 |
-
msgstr "Download"
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 450 |
-
msgctxt "Editor button"
|
| 451 |
-
msgid "Sync"
|
| 452 |
-
msgstr "Sync"
|
| 453 |
-
|
| 454 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 455 |
-
msgctxt "Editor button"
|
| 456 |
-
msgid "Revert"
|
| 457 |
-
msgstr "zurücksetzen"
|
| 458 |
-
|
| 459 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 460 |
-
msgctxt "Editor button"
|
| 461 |
-
msgid "Add"
|
| 462 |
-
msgstr "Hinzufügen"
|
| 463 |
-
|
| 464 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 465 |
-
msgctxt "Editor button"
|
| 466 |
-
msgid "Del"
|
| 467 |
-
msgstr "Löschen"
|
| 468 |
-
|
| 469 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 470 |
-
msgctxt "Editor button"
|
| 471 |
-
msgid "Fuzzy"
|
| 472 |
-
msgstr "Undeutlich"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 475 |
-
msgid "Filter translations"
|
| 476 |
-
msgstr "Übersetzungen filtern"
|
| 477 |
-
|
| 478 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 479 |
-
msgctxt "Editor button"
|
| 480 |
-
msgid "Help"
|
| 481 |
-
msgstr "Hilfe"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 484 |
-
msgid "Initialize new translations in %s"
|
| 485 |
-
msgstr "Initialisiere neue Übersetzung in %s"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 488 |
-
msgid "Select from common languages"
|
| 489 |
-
msgstr "Wähle aus den Standardsprachen"
|
| 490 |
-
|
| 491 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 492 |
-
msgctxt "Form label"
|
| 493 |
-
msgid "or enter any language code"
|
| 494 |
-
msgstr "oder trage den Sprach-Code ein"
|
| 495 |
-
|
| 496 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 497 |
-
msgctxt "Form label"
|
| 498 |
-
msgid "create in <code>%s</code>"
|
| 499 |
-
msgstr "erstellen in <code>%s</code>"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 502 |
-
msgctxt "Form label"
|
| 503 |
-
msgid "create in global languages directory"
|
| 504 |
-
msgstr "in globalem Sprachverzeichnis erstellen"
|
| 505 |
-
|
| 506 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 507 |
-
msgctxt "Submit button"
|
| 508 |
-
msgid "Start translating"
|
| 509 |
-
msgstr "Starte Übersetzung"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-root.tpl.php:18
|
| 512 |
-
msgid "New version available"
|
| 513 |
-
msgstr "Neue Version verfügbar"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-root.tpl.php:21
|
| 516 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 517 |
-
msgstr "Bitte upgrade Loco Translate auf Version %s"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:31
|
| 520 |
-
msgid "Select a plugin or theme to translate"
|
| 521 |
-
msgstr "Wähle ein Plugin oder Theme zum Übersetzen"
|
| 522 |
-
|
| 523 |
-
#: tpl/admin-root.tpl.php:40
|
| 524 |
-
msgctxt "Package list header"
|
| 525 |
-
msgid "Themes"
|
| 526 |
-
msgstr "Themes"
|
| 527 |
-
|
| 528 |
-
#: tpl/admin-root.tpl.php:53
|
| 529 |
-
msgctxt "Package list header"
|
| 530 |
-
msgid "Plugins"
|
| 531 |
-
msgstr "Plugins"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:66
|
| 534 |
-
msgctxt "Package list header"
|
| 535 |
-
msgid "Core"
|
| 536 |
-
msgstr "Core"
|
| 537 |
-
|
| 538 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 539 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 540 |
-
msgid ""
|
| 541 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 542 |
-
"install it"
|
| 543 |
-
msgstr ""
|
| 544 |
-
|
| 545 |
-
#: pub/js/lang/dummy.php:8
|
| 546 |
-
msgid "Unknown error"
|
| 547 |
-
msgstr "Unbekannter Fehler"
|
| 548 |
-
|
| 549 |
-
#: pub/js/lang/dummy.php:10
|
| 550 |
-
msgid "PO file saved"
|
| 551 |
-
msgstr "PO-Datei gespeichert"
|
| 552 |
-
|
| 553 |
-
#: pub/js/lang/dummy.php:12
|
| 554 |
-
msgid "and MO file compiled"
|
| 555 |
-
msgstr "und MO-Datei kompiliert"
|
| 556 |
-
|
| 557 |
-
#: pub/js/lang/dummy.php:15
|
| 558 |
-
msgid "Merged from %s"
|
| 559 |
-
msgstr "Aus %s zusammengeführt"
|
| 560 |
-
|
| 561 |
-
#: pub/js/lang/dummy.php:17
|
| 562 |
-
msgid "Merged from source code"
|
| 563 |
-
msgstr "Aus Quelle zusammengeführt"
|
| 564 |
-
|
| 565 |
-
#: pub/js/lang/dummy.php:19
|
| 566 |
-
msgid "Already up to date with %s"
|
| 567 |
-
msgstr "Bereits auf dem aktuellen Stand mit %s"
|
| 568 |
-
|
| 569 |
-
#: pub/js/lang/dummy.php:21
|
| 570 |
-
msgid "Already up to date with source code"
|
| 571 |
-
msgstr "Bereits mit der Quelle auf dem aktuellen Stand"
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:23
|
| 574 |
-
msgid "1 new string added"
|
| 575 |
-
msgid_plural "%s new strings added"
|
| 576 |
-
msgstr[0] "1 neue Zeichenkette hinzugefügt"
|
| 577 |
-
msgstr[1] "%s neue Zeichenketten hinzugefügt"
|
| 578 |
-
|
| 579 |
-
#: pub/js/lang/dummy.php:25
|
| 580 |
-
msgid "1 obsolete string removed"
|
| 581 |
-
msgid_plural "%s obsolete strings removed"
|
| 582 |
-
msgstr[0] "1 veraltete Zeichenkette entfernt"
|
| 583 |
-
msgstr[1] "%s veraltete Zeichenketten entfernt"
|
| 584 |
-
|
| 585 |
-
#: pub/js/lang/dummy.php:27
|
| 586 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 587 |
-
msgstr "Deine Änderungen gehen verloren, wenn du fortsetzt ohne zu Speichern"
|
| 588 |
-
|
| 589 |
-
#. label for the window pane holding native translation
|
| 590 |
-
#: pub/js/lang/dummy.php:35
|
| 591 |
-
msgctxt "Editor pane"
|
| 592 |
-
msgid "Source text"
|
| 593 |
-
msgstr "Quelltext"
|
| 594 |
-
|
| 595 |
-
#. where %s is the language, e.g French translation
|
| 596 |
-
#: pub/js/lang/dummy.php:38
|
| 597 |
-
msgctxt "Editor pane"
|
| 598 |
-
msgid "%s translation"
|
| 599 |
-
msgstr "%s Übersetzung"
|
| 600 |
-
|
| 601 |
-
#. label for the window pane holding translator comments
|
| 602 |
-
#: pub/js/lang/dummy.php:41
|
| 603 |
-
msgctxt "Editor pane"
|
| 604 |
-
msgid "Comments"
|
| 605 |
-
msgstr "Kommentare"
|
| 606 |
-
|
| 607 |
-
#. label for the window pane holding message context
|
| 608 |
-
#: pub/js/lang/dummy.php:44
|
| 609 |
-
msgctxt "Editor pane"
|
| 610 |
-
msgid "Context"
|
| 611 |
-
msgstr "Kontext"
|
| 612 |
-
|
| 613 |
-
#: pub/js/lang/dummy.php:52
|
| 614 |
-
msgid "Translation"
|
| 615 |
-
msgstr "Übersetzung"
|
| 616 |
-
|
| 617 |
-
#: pub/js/lang/dummy.php:54
|
| 618 |
-
msgid "No source files in this package, nothing to sync"
|
| 619 |
-
msgstr "Keine Quelldateien in diesem Paket gefunden, nichts zu synchronisieren"
|
| 620 |
-
|
| 621 |
-
#: pub/js/lang/dummy.php:56
|
| 622 |
-
msgid "No strings could be extracted from source files"
|
| 623 |
-
msgstr "Es konnten keine Zeichenketten aus der Quelle extrahiert werden"
|
| 624 |
-
|
| 625 |
-
#. Description of the plugin
|
| 626 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 627 |
-
msgstr ""
|
| 628 |
-
|
| 629 |
-
#. URI of the plugin
|
| 630 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 631 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 632 |
-
|
| 633 |
-
#. Author of the plugin
|
| 634 |
-
msgid "Tim Whitlock"
|
| 635 |
-
msgstr "Tim Whitlock"
|
| 636 |
-
|
| 637 |
-
#. Author URI of the plugin
|
| 638 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 639 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-el.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-el.po
DELETED
|
@@ -1,651 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:17:34 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Greek\n"
|
| 9 |
-
"Language: el\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: el_GR\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Λάθος"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Προειδοποίηση"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "ΟΚ"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Απαγορεύθηκε η πρόσβαση"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Οι ρυθμίσεις αποθηκεύτηκαν"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "%s δεν είναι μια επίσημη γλώσσα του WordPress"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Νέο αρχείο PO"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"Το αρχείο PO χρησιμοποιήθηκε ως πρότυπο. Αυτό θα μετονομαστεί σε %s με την "
|
| 61 |
-
"πρώτη αποθήκευση"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Πρέπει να προσδιορίσετε μία έγκυρη τοποθεσία για το νέο αρχείο PO"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Δε βρέθηκαν μεταφράσιμες φράσεις"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Δε μπορεί να δημιουργηθεί ένα αρχείο PO."
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "Το αρχείο PO υπάρχει ήδη με την τοποθεσία %s"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"Το αρχείο δε μπορεί να δημιουργηθεί αυτόματα. Διορθώστε τα δικαιώματα του "
|
| 85 |
-
"αρχείου ή χρησιμοποιήστε τη Λήψη αντί για την Αποθήκευση"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "Το αρχείο %s είναι άδειο"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "Τρέξτε τον Συγχρονισμό για να γίνει ενημέρωση από τον πηγαίο κώδικα"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "Δεν μπορούν να εξαχθούν φράσεις από τον πηγαίο κώδικα"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "Τρέξτε τον Συγχρονισμό για να γίνει ενημέρωση από το %s"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr ""
|
| 106 |
-
"Ο πηγαίος κώδικας έχει τροποποιηθεί, τρέξτε τον Συγχρονισμό για να "
|
| 107 |
-
"ενημερώσετε το POT"
|
| 108 |
-
|
| 109 |
-
#: lib/loco-admin.php:440
|
| 110 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 111 |
-
msgstr ""
|
| 112 |
-
"Το POT έχει τροποποιηθεί μετά την αποθήκευση του αρχείου PO, τρέξτε τον "
|
| 113 |
-
"Συγχρονισμό για να γίνει ενημέρωση"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:536
|
| 116 |
-
msgid "Bad file path"
|
| 117 |
-
msgstr "Λάθος διεύθυνση αρχείου"
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:783
|
| 120 |
-
msgid "Empty or invalid %s file"
|
| 121 |
-
msgstr "Κενό ή μη έγκυρο αρχείο %s"
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:787
|
| 124 |
-
msgid "%s file has no header"
|
| 125 |
-
msgstr "Το αρχείο %s δεν έχει κεφαλίδα"
|
| 126 |
-
|
| 127 |
-
#: lib/loco-admin.php:934
|
| 128 |
-
msgctxt "Add button"
|
| 129 |
-
msgid "New template"
|
| 130 |
-
msgstr "Νέο πρότυπο"
|
| 131 |
-
|
| 132 |
-
#: lib/loco-admin.php:953
|
| 133 |
-
msgctxt "Add button"
|
| 134 |
-
msgid "New language"
|
| 135 |
-
msgstr "Νέα γλώσσα"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "%s%% translated"
|
| 139 |
-
msgstr "%s%% μεταφράστηκε"
|
| 140 |
-
|
| 141 |
-
#: lib/loco-admin.php:992
|
| 142 |
-
msgid "1 string"
|
| 143 |
-
msgid_plural "%s strings"
|
| 144 |
-
msgstr[0] "1 φράση"
|
| 145 |
-
msgstr[1] "%s φράσεις"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:995
|
| 148 |
-
msgid "%s fuzzy"
|
| 149 |
-
msgstr "%s ασαφές"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:998
|
| 152 |
-
msgid "%s untranslated"
|
| 153 |
-
msgstr "%s αμετάφραστο"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1044
|
| 156 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 157 |
-
msgstr ""
|
| 158 |
-
"Αποτυχία μεταγλώττισης του αρχείου MO με τον ενσωματωμένο μεταγλωττιστή"
|
| 159 |
-
|
| 160 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 161 |
-
msgid "Loco, Translation Management"
|
| 162 |
-
msgstr "Loco, Διαχείριση Μετάφρασης"
|
| 163 |
-
|
| 164 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 165 |
-
msgid "Manage translations"
|
| 166 |
-
msgstr "Διαχείριση μεταφράσεων"
|
| 167 |
-
|
| 168 |
-
#: lib/loco-admin.php:1094
|
| 169 |
-
msgid "Translation options"
|
| 170 |
-
msgstr "Επιλογές μετάφρασης"
|
| 171 |
-
|
| 172 |
-
#: lib/loco-admin.php:1101
|
| 173 |
-
msgid "Loco Translate"
|
| 174 |
-
msgstr "Loco Translate"
|
| 175 |
-
|
| 176 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 177 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 178 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 179 |
-
msgid "Settings"
|
| 180 |
-
msgstr "Ρυθμίσεις"
|
| 181 |
-
|
| 182 |
-
#: lib/loco-admin.php:1149
|
| 183 |
-
msgid "File download failed"
|
| 184 |
-
msgstr "Η λήψη του αρχείου απέτυχε"
|
| 185 |
-
|
| 186 |
-
#: lib/loco-admin.php:1159
|
| 187 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 188 |
-
msgstr ""
|
| 189 |
-
"Το WPLANG έχει καταργηθεί και θα πρέπει να αφαιρεθεί από το wp-config.php"
|
| 190 |
-
|
| 191 |
-
#: lib/loco-locales.php:77
|
| 192 |
-
msgid "Unknown language"
|
| 193 |
-
msgstr "Άγνωστη γλώσσα"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 196 |
-
msgid "Some files not writable"
|
| 197 |
-
msgstr "Κάποια αρχεία δεν είναι εγγράψιμα"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:484
|
| 200 |
-
msgid "Some files missing"
|
| 201 |
-
msgstr "Κάποια αρχεία λείπουν"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 204 |
-
msgid "\"%s\" folder not writable"
|
| 205 |
-
msgstr "Ο φάκελος \"%s\" δεν είναι εγγράψιμος"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:515
|
| 208 |
-
msgid "POT file not writable"
|
| 209 |
-
msgstr "Το αρχείο POT δεν είναι εγγράψιμο"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:520
|
| 212 |
-
msgid "PO file not writable"
|
| 213 |
-
msgstr "Το αρχείο PO δεν είναι εγγράψιμο"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:522
|
| 216 |
-
msgid "MO file not writable"
|
| 217 |
-
msgstr "Το αρχείο MO δεν είναι εγγράψιμο"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:522
|
| 220 |
-
msgid "MO file not found"
|
| 221 |
-
msgstr "Το αρχείο MO δε βρέθηκε"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:527
|
| 224 |
-
msgid "Folder not writable"
|
| 225 |
-
msgstr "Ο φάκελος δεν είναι εγγράψιμος"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:527
|
| 228 |
-
msgid "Folder not found"
|
| 229 |
-
msgstr "Ο φάκελος δε βρέθηκε"
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:546
|
| 232 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 233 |
-
msgstr "Το %s δε δηλώνει κάποιο \"Πεδίο Κειμένου\""
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 236 |
-
msgid "Loco has guessed \"%s\""
|
| 237 |
-
msgstr "Το Loco έχει μαντέξει \"%s\""
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:551
|
| 240 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 241 |
-
msgstr "Το %s δε δηλώνει κάποιο \"Πεδίο Διεύθυνσης\""
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:556
|
| 244 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 245 |
-
msgstr ""
|
| 246 |
-
"Το %s δεν έχει κάποιο αρχείο POT. Εάν χρειάζεστε ένα, δημιουργήστε το στο "
|
| 247 |
-
"\"%s/%s.pot\""
|
| 248 |
-
|
| 249 |
-
#: lib/loco-packages.php:559
|
| 250 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 251 |
-
msgstr ""
|
| 252 |
-
"Το %s έχει ένα περίεργο όνομα αρχείου (%s). Ένα καλύτερο όνομα θα ήταν το "
|
| 253 |
-
"\"%s.pot\""
|
| 254 |
-
|
| 255 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 256 |
-
msgid "User does not have permission to manage translations"
|
| 257 |
-
msgstr "Ο χρήστης δεν έχει δικαιώματα να διαχειριστεί μεταφράσεις"
|
| 258 |
-
|
| 259 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 260 |
-
msgid "Invalid data posted to server"
|
| 261 |
-
msgstr "Δημοσιεύθηκαν μη έγκυρα δεδομένα στο διακομιστή"
|
| 262 |
-
|
| 263 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 264 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 265 |
-
msgstr ""
|
| 266 |
-
"Αποτυχία μεταγλώττισης του αρχείου MO με το %s, ελέγξτε τις ρυθμίσεις σας"
|
| 267 |
-
|
| 268 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 269 |
-
msgid "Package not found called %s"
|
| 270 |
-
msgstr "Το πακέτο %s δε βρέθηκε"
|
| 271 |
-
|
| 272 |
-
#: php/loco-posave.php:58
|
| 273 |
-
msgid ""
|
| 274 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 275 |
-
"backups in settings"
|
| 276 |
-
msgstr ""
|
| 277 |
-
"Ο διακομιστής web δε μπορεί να δημιουργήσει αντίγραφα ασφαλείας στο \"%s\". "
|
| 278 |
-
"Διορθώστε τα δικαιώματα αρχείου ή απενεργοποιήστε τα αντίγραφα ασφαλείας "
|
| 279 |
-
"στις ρυθμίσεις"
|
| 280 |
-
|
| 281 |
-
#: php/loco-posave.php:66
|
| 282 |
-
msgid ""
|
| 283 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 284 |
-
"create it manually."
|
| 285 |
-
msgstr ""
|
| 286 |
-
"Ο διακομιστής web δε μπορεί να δημιουργήσει το φάκελο \"%s\" στο \"%s\". "
|
| 287 |
-
"Διορθώστε τα δικαιώματα αρχείου ή δημιουργήστε το χειροκίνητα."
|
| 288 |
-
|
| 289 |
-
#: php/loco-posave.php:69
|
| 290 |
-
msgid ""
|
| 291 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 292 |
-
"or use the download function."
|
| 293 |
-
msgstr ""
|
| 294 |
-
"Ο διακομιστής web δε μπορεί να δημιουργήσει αρχεία στο φάκελο \"%s\". "
|
| 295 |
-
"Διορθώστε τα δικαιώματα αρχείου ή χρησιμοποιήστε τη λειτουργία Λήψη."
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:81
|
| 298 |
-
msgid ""
|
| 299 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 300 |
-
"and copy to \"%s/%s\"."
|
| 301 |
-
msgstr ""
|
| 302 |
-
"Το αρχείο \"%s\" δεν είναι εγγράψιμο από το διακομιστή web. Διορθώστε τα "
|
| 303 |
-
"δικαιώματα αρχείου ή κάντε λήψη και αντιγράψτε το στο \"%s/%s\"."
|
| 304 |
-
|
| 305 |
-
#: php/loco-posave.php:102
|
| 306 |
-
msgid "Cannot create MO file"
|
| 307 |
-
msgstr "Δε μπόρεσε να δημιουργηθεί το αρχείο MO"
|
| 308 |
-
|
| 309 |
-
#: php/loco-posave.php:105
|
| 310 |
-
msgid "Cannot overwrite MO file"
|
| 311 |
-
msgstr "Δε μπόρεσε να αντικατασταθεί το αρχείο MO"
|
| 312 |
-
|
| 313 |
-
#: php/loco-posave.php:131
|
| 314 |
-
msgid "Failed to write MO file"
|
| 315 |
-
msgstr "Δε μπόρεσε να εγγραφεί να αρχείο MO"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 318 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 319 |
-
#: tpl/admin-root.tpl.php:6
|
| 320 |
-
msgid "Packages"
|
| 321 |
-
msgstr "Πακέτα"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 324 |
-
msgid "File check"
|
| 325 |
-
msgstr "Έλεγχος αρχείου"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 328 |
-
msgid "File system permissions for %s"
|
| 329 |
-
msgstr "Δικαιώματα συστήματος αρχείων για το %s"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 332 |
-
msgid "Other potential issues with %s"
|
| 333 |
-
msgstr "Άλλα πιθανά θέματα με το %s"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 336 |
-
msgid "Back"
|
| 337 |
-
msgstr "Πίσω"
|
| 338 |
-
|
| 339 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 340 |
-
msgid "Get help"
|
| 341 |
-
msgstr "Βοήθεια"
|
| 342 |
-
|
| 343 |
-
#: tpl/admin-list.tpl.php:11
|
| 344 |
-
msgctxt "Table header"
|
| 345 |
-
msgid "Package details"
|
| 346 |
-
msgstr "Λεπτομέρειες πακέτου"
|
| 347 |
-
|
| 348 |
-
#: tpl/admin-list.tpl.php:14
|
| 349 |
-
msgctxt "Table header"
|
| 350 |
-
msgid "Translations (PO)"
|
| 351 |
-
msgstr "Μεταφράσεις (PO)"
|
| 352 |
-
|
| 353 |
-
#: tpl/admin-list.tpl.php:17
|
| 354 |
-
msgctxt "Table header"
|
| 355 |
-
msgid "Template (POT)"
|
| 356 |
-
msgstr "Πρότυπο (POT)"
|
| 357 |
-
|
| 358 |
-
#: tpl/admin-list.tpl.php:20
|
| 359 |
-
msgctxt "Table header"
|
| 360 |
-
msgid "File permissions"
|
| 361 |
-
msgstr "Δικαιώματα αρχείου"
|
| 362 |
-
|
| 363 |
-
#: tpl/admin-list.tpl.php:40
|
| 364 |
-
msgid "Extends: %s"
|
| 365 |
-
msgstr "Επεκτείνεται σε: %s"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-list.tpl.php:44
|
| 368 |
-
msgid "1 language"
|
| 369 |
-
msgid_plural "%u languages"
|
| 370 |
-
msgstr[0] "1 γλώσσα"
|
| 371 |
-
msgstr[1] "%u γλώσσες"
|
| 372 |
-
|
| 373 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 374 |
-
msgctxt "Modified time"
|
| 375 |
-
msgid "Updated"
|
| 376 |
-
msgstr "Ενημερώθηκε"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-nav.tpl.php:26
|
| 379 |
-
msgid "Powered by"
|
| 380 |
-
msgstr "Παραγωγή"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-nav.tpl.php:32
|
| 383 |
-
msgid "Loco may not work as expected"
|
| 384 |
-
msgstr "Το Loco μπορεί να μη δουλέψει όπως αναμένεται"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:18
|
| 387 |
-
msgid "Configure Loco Translate"
|
| 388 |
-
msgstr "Διαμόρφωση του Loco Translate"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 391 |
-
msgid "Compiling MO files"
|
| 392 |
-
msgstr "Μεταγλώττιση των αρχείων MO"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:36
|
| 395 |
-
msgid "Use built-in MO compiler."
|
| 396 |
-
msgstr "Χρήση του ενσωματωμένου μεταγλωττιστή MO."
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:42
|
| 399 |
-
msgid "Use external command:"
|
| 400 |
-
msgstr "Χρήση εξωτερικής εντολής:"
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:47
|
| 403 |
-
msgid "Enter path to msgfmt on server"
|
| 404 |
-
msgstr "Εισάγετε τη διεύθυνση για το msgfmt στο διακομιστή"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:54
|
| 407 |
-
msgid "Generate hash tables"
|
| 408 |
-
msgstr "Δημιουργία των hash tables"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:60
|
| 411 |
-
msgid "Include Fuzzy strings"
|
| 412 |
-
msgstr "Συμπερίληψη ασαφών χαρακτήρων"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 415 |
-
msgid "Backing up PO files"
|
| 416 |
-
msgstr "Δημιουργία αντιγράφων ασφαλείας των αρχείων PO"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:75
|
| 419 |
-
msgid "Number of backups to keep of each file:"
|
| 420 |
-
msgstr "Ποσότητα αντιγράφων ασφαλείας που θα διατηρηθούν για κάθε αρχείο:"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 423 |
-
msgid "Experimental features"
|
| 424 |
-
msgstr "Πειραματικά χαρακτηριστικά"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-opts.tpl.php:92
|
| 427 |
-
msgid "Enable WordPress core translations"
|
| 428 |
-
msgstr "Ενεργοποίηση μεταφράσεων του πυρήνα του WordPress"
|
| 429 |
-
|
| 430 |
-
#: tpl/admin-opts.tpl.php:101
|
| 431 |
-
msgid "Save settings"
|
| 432 |
-
msgstr "Αποθήκευση ρυθμίσεων"
|
| 433 |
-
|
| 434 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 435 |
-
msgid "Template file"
|
| 436 |
-
msgstr "Πρότυπο αρχείο"
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 439 |
-
msgctxt "Dropdown label"
|
| 440 |
-
msgid "Switch to..."
|
| 441 |
-
msgstr "Μετάβαση σε..."
|
| 442 |
-
|
| 443 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 444 |
-
msgid "never"
|
| 445 |
-
msgstr "ποτέ"
|
| 446 |
-
|
| 447 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 448 |
-
msgctxt "Editor button"
|
| 449 |
-
msgid "Save"
|
| 450 |
-
msgstr "Αποθήκευση"
|
| 451 |
-
|
| 452 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 453 |
-
msgctxt "Editor button"
|
| 454 |
-
msgid "Download"
|
| 455 |
-
msgstr "Λήψη"
|
| 456 |
-
|
| 457 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 458 |
-
msgctxt "Editor button"
|
| 459 |
-
msgid "Sync"
|
| 460 |
-
msgstr "Συγχρονισμός"
|
| 461 |
-
|
| 462 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 463 |
-
msgctxt "Editor button"
|
| 464 |
-
msgid "Revert"
|
| 465 |
-
msgstr "Επαναφορά"
|
| 466 |
-
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Add"
|
| 470 |
-
msgstr "Προσθήκη"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Del"
|
| 475 |
-
msgstr "Διαγραφή"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 478 |
-
msgctxt "Editor button"
|
| 479 |
-
msgid "Fuzzy"
|
| 480 |
-
msgstr "Ασαφή"
|
| 481 |
-
|
| 482 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 483 |
-
msgid "Filter translations"
|
| 484 |
-
msgstr "Φιλτράρισμα μεταφράσεων"
|
| 485 |
-
|
| 486 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 487 |
-
msgctxt "Editor button"
|
| 488 |
-
msgid "Help"
|
| 489 |
-
msgstr "Βοήθεια"
|
| 490 |
-
|
| 491 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 492 |
-
msgid "Initialize new translations in %s"
|
| 493 |
-
msgstr "Προετοιμασία νέων μεταφράσεων στο %s"
|
| 494 |
-
|
| 495 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 496 |
-
msgid "Select from common languages"
|
| 497 |
-
msgstr "Επιλέξτε από τις κοινές γλώσσες"
|
| 498 |
-
|
| 499 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 500 |
-
msgctxt "Form label"
|
| 501 |
-
msgid "or enter any language code"
|
| 502 |
-
msgstr "ή εισάγετε έναν κωδικό γλώσσας"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 505 |
-
msgctxt "Form label"
|
| 506 |
-
msgid "create in <code>%s</code>"
|
| 507 |
-
msgstr "δημιουργία στο %s"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 510 |
-
msgctxt "Form label"
|
| 511 |
-
msgid "create in global languages directory"
|
| 512 |
-
msgstr "δημιουργία στο φάκελο γενικών γλωσσών"
|
| 513 |
-
|
| 514 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 515 |
-
msgctxt "Submit button"
|
| 516 |
-
msgid "Start translating"
|
| 517 |
-
msgstr "Έναρξη μετάφρασης"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:18
|
| 520 |
-
msgid "New version available"
|
| 521 |
-
msgstr "Διαθέσιμη νέα έκδοση"
|
| 522 |
-
|
| 523 |
-
#: tpl/admin-root.tpl.php:21
|
| 524 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 525 |
-
msgstr "Αναβάθμιση στην έκδοση %s του Loco Translate"
|
| 526 |
-
|
| 527 |
-
#: tpl/admin-root.tpl.php:31
|
| 528 |
-
msgid "Select a plugin or theme to translate"
|
| 529 |
-
msgstr "Επιλέξτε ένα πρόσθετο ή ένα θέμα για μετάφραση"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-root.tpl.php:40
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Themes"
|
| 534 |
-
msgstr "Θέματα"
|
| 535 |
-
|
| 536 |
-
#: tpl/admin-root.tpl.php:53
|
| 537 |
-
msgctxt "Package list header"
|
| 538 |
-
msgid "Plugins"
|
| 539 |
-
msgstr "Πρόσθετα"
|
| 540 |
-
|
| 541 |
-
#: tpl/admin-root.tpl.php:66
|
| 542 |
-
msgctxt "Package list header"
|
| 543 |
-
msgid "Core"
|
| 544 |
-
msgstr "Πυρήνας"
|
| 545 |
-
|
| 546 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 547 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 548 |
-
msgid ""
|
| 549 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 550 |
-
"install it"
|
| 551 |
-
msgstr ""
|
| 552 |
-
"Η επέκταση του PHP \"%s\" δεν είναι εγκατεστημένη. Εάν αντιμετωπίσετε "
|
| 553 |
-
"προβλήματα θα πρέπει να την εκαταστήσετε."
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:8
|
| 556 |
-
msgid "Unknown error"
|
| 557 |
-
msgstr "Άγνωστο λάθος"
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:10
|
| 560 |
-
msgid "PO file saved"
|
| 561 |
-
msgstr "Το αρχείο PO αποθηκεύτηκε"
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:12
|
| 564 |
-
msgid "and MO file compiled"
|
| 565 |
-
msgstr "και το αρχείο MO μεταγλωττίστηκε"
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:15
|
| 568 |
-
msgid "Merged from %s"
|
| 569 |
-
msgstr "Συγχώνευση από %s"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:17
|
| 572 |
-
msgid "Merged from source code"
|
| 573 |
-
msgstr "Συγχώνευση από τον πηγαίο κώδικα"
|
| 574 |
-
|
| 575 |
-
#: pub/js/lang/dummy.php:19
|
| 576 |
-
msgid "Already up to date with %s"
|
| 577 |
-
msgstr "Ήδη ενημερωμένο με το %s"
|
| 578 |
-
|
| 579 |
-
#: pub/js/lang/dummy.php:21
|
| 580 |
-
msgid "Already up to date with source code"
|
| 581 |
-
msgstr "Ήδη ενημερωμένο με τον πηγαίο κώδικα"
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:23
|
| 584 |
-
msgid "1 new string added"
|
| 585 |
-
msgid_plural "%s new strings added"
|
| 586 |
-
msgstr[0] "Προστέθηκε 1 καινούργια φράση"
|
| 587 |
-
msgstr[1] "Προστέθηκαν %s καινούργιες φράσεις"
|
| 588 |
-
|
| 589 |
-
#: pub/js/lang/dummy.php:25
|
| 590 |
-
msgid "1 obsolete string removed"
|
| 591 |
-
msgid_plural "%s obsolete strings removed"
|
| 592 |
-
msgstr[0] "Αφαιρέθηκε 1 απαρχαιωμένη φράση"
|
| 593 |
-
msgstr[1] "Αφαιρέθηκαν %s απαρχαιωμένες φράσεις"
|
| 594 |
-
|
| 595 |
-
#: pub/js/lang/dummy.php:27
|
| 596 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 597 |
-
msgstr ""
|
| 598 |
-
"Οι αλλαγές που κάνατε θα χαθούν εάν συνεχίσετε χωρίς να κάνετε αποθήκευση"
|
| 599 |
-
|
| 600 |
-
#. label for the window pane holding native translation
|
| 601 |
-
#: pub/js/lang/dummy.php:35
|
| 602 |
-
msgctxt "Editor pane"
|
| 603 |
-
msgid "Source text"
|
| 604 |
-
msgstr "Κείμενο πηγής"
|
| 605 |
-
|
| 606 |
-
#. where %s is the language, e.g French translation
|
| 607 |
-
#: pub/js/lang/dummy.php:38
|
| 608 |
-
msgctxt "Editor pane"
|
| 609 |
-
msgid "%s translation"
|
| 610 |
-
msgstr "%s μετάφραση"
|
| 611 |
-
|
| 612 |
-
#. label for the window pane holding translator comments
|
| 613 |
-
#: pub/js/lang/dummy.php:41
|
| 614 |
-
msgctxt "Editor pane"
|
| 615 |
-
msgid "Comments"
|
| 616 |
-
msgstr "Σχόλια"
|
| 617 |
-
|
| 618 |
-
#. label for the window pane holding message context
|
| 619 |
-
#: pub/js/lang/dummy.php:44
|
| 620 |
-
msgctxt "Editor pane"
|
| 621 |
-
msgid "Context"
|
| 622 |
-
msgstr "Πλαίσιο"
|
| 623 |
-
|
| 624 |
-
#: pub/js/lang/dummy.php:52
|
| 625 |
-
msgid "Translation"
|
| 626 |
-
msgstr "Μετάφραση"
|
| 627 |
-
|
| 628 |
-
#: pub/js/lang/dummy.php:54
|
| 629 |
-
msgid "No source files in this package, nothing to sync"
|
| 630 |
-
msgstr ""
|
| 631 |
-
"Δεν υπάρχουν αρχεία πηγής σε αυτό το πακέτο, δε μπορεί να συγχρονιστεί κάτι"
|
| 632 |
-
|
| 633 |
-
#: pub/js/lang/dummy.php:56
|
| 634 |
-
msgid "No strings could be extracted from source files"
|
| 635 |
-
msgstr "Δε μπόρεσαν να εξαχθούν φράσεις από τα αρχεία πηγής"
|
| 636 |
-
|
| 637 |
-
#. Description of the plugin
|
| 638 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 639 |
-
msgstr "Μεταφράστε πρόσθετα ή θέματα του WordPress απευθείας στον browser σας"
|
| 640 |
-
|
| 641 |
-
#. URI of the plugin
|
| 642 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 643 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 644 |
-
|
| 645 |
-
#. Author of the plugin
|
| 646 |
-
msgid "Tim Whitlock"
|
| 647 |
-
msgstr "Tim Whitlock"
|
| 648 |
-
|
| 649 |
-
#. Author URI of the plugin
|
| 650 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 651 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-es_ES.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-es_ES.po
DELETED
|
@@ -1,703 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:17:43 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Spanish (Spain)\n"
|
| 9 |
-
"Language: es-ES\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: es_ES\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Error"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Atención"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "Correcto"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Permiso denegado"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Configuración guardada"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "%s no es un nombre oficial de idioma de WordPress"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Nuevo fichero PO"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"Fichero PO utilizado como plantilla. Se renombrará a %s la primera vez que "
|
| 61 |
-
"lo guarde"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr ""
|
| 66 |
-
"Debe\n"
|
| 67 |
-
" \n"
|
| 68 |
-
"especificar\n"
|
| 69 |
-
" \n"
|
| 70 |
-
"una\n"
|
| 71 |
-
" \n"
|
| 72 |
-
"configuración regional\n"
|
| 73 |
-
" \n"
|
| 74 |
-
"válida\n"
|
| 75 |
-
" \n"
|
| 76 |
-
"para\n"
|
| 77 |
-
" \n"
|
| 78 |
-
"un\n"
|
| 79 |
-
" \n"
|
| 80 |
-
"nuevo\n"
|
| 81 |
-
" \n"
|
| 82 |
-
"archivo\n"
|
| 83 |
-
" \n"
|
| 84 |
-
"PO"
|
| 85 |
-
|
| 86 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 87 |
-
msgid "No translatable strings found"
|
| 88 |
-
msgstr ""
|
| 89 |
-
"Sin\n"
|
| 90 |
-
" \n"
|
| 91 |
-
"las cadenas\n"
|
| 92 |
-
" \n"
|
| 93 |
-
"traducibles\n"
|
| 94 |
-
" \n"
|
| 95 |
-
"encontradas"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:337
|
| 98 |
-
msgid "Cannot create a PO file."
|
| 99 |
-
msgstr "No se puede crear una archivo PO."
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:344
|
| 102 |
-
msgid "PO file already exists with locale %s"
|
| 103 |
-
msgstr "El archivo PO ya existe con la configuración regional %s"
|
| 104 |
-
|
| 105 |
-
#: lib/loco-admin.php:396
|
| 106 |
-
msgid ""
|
| 107 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 108 |
-
"Download instead of Save"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"El archivo no puede crearse automáticamente. \n"
|
| 111 |
-
"Fijar\n"
|
| 112 |
-
" \n"
|
| 113 |
-
"los\n"
|
| 114 |
-
" \n"
|
| 115 |
-
"permisos\n"
|
| 116 |
-
" de \n"
|
| 117 |
-
"archivo\n"
|
| 118 |
-
" \n"
|
| 119 |
-
"o\n"
|
| 120 |
-
" \n"
|
| 121 |
-
"utilice\n"
|
| 122 |
-
" D\n"
|
| 123 |
-
"escarga\n"
|
| 124 |
-
"r \n"
|
| 125 |
-
"en vez\n"
|
| 126 |
-
" \n"
|
| 127 |
-
"de\n"
|
| 128 |
-
" G\n"
|
| 129 |
-
"uardar"
|
| 130 |
-
|
| 131 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 132 |
-
msgid "%s file is empty"
|
| 133 |
-
msgstr "El fichero %s está vacío"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 136 |
-
msgid "Run Sync to update from source code"
|
| 137 |
-
msgstr "Ejecutar Sinc para actualizar desde el código fuente"
|
| 138 |
-
|
| 139 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 140 |
-
msgid "No strings could be extracted from source code"
|
| 141 |
-
msgstr "No se pueden extraer las cadenas del código fuente"
|
| 142 |
-
|
| 143 |
-
#: lib/loco-admin.php:417
|
| 144 |
-
msgid "Run Sync to update from %s"
|
| 145 |
-
msgstr "Ejecutar Sinc para actualizar desde %s"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:436
|
| 148 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 149 |
-
msgstr "El código fuente ha sido modificado, ejecute Sinc para actualizar POT"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:440
|
| 152 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 153 |
-
msgstr ""
|
| 154 |
-
"POT ha sido modificado desde que el archivo PO fué guardado, ejecute Sync "
|
| 155 |
-
"para actualizar"
|
| 156 |
-
|
| 157 |
-
#: lib/loco-admin.php:536
|
| 158 |
-
msgid "Bad file path"
|
| 159 |
-
msgstr ""
|
| 160 |
-
"Ruta\n"
|
| 161 |
-
" de \n"
|
| 162 |
-
"archivo\n"
|
| 163 |
-
" \n"
|
| 164 |
-
"incorrecta"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:783
|
| 167 |
-
msgid "Empty or invalid %s file"
|
| 168 |
-
msgstr "Archivo %s vacío o no válido"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:787
|
| 171 |
-
msgid "%s file has no header"
|
| 172 |
-
msgstr "El archivo %s no tiene cabecera"
|
| 173 |
-
|
| 174 |
-
#: lib/loco-admin.php:934
|
| 175 |
-
msgctxt "Add button"
|
| 176 |
-
msgid "New template"
|
| 177 |
-
msgstr "Nueva plantilla"
|
| 178 |
-
|
| 179 |
-
#: lib/loco-admin.php:953
|
| 180 |
-
msgctxt "Add button"
|
| 181 |
-
msgid "New language"
|
| 182 |
-
msgstr "Nuevo idioma"
|
| 183 |
-
|
| 184 |
-
#: lib/loco-admin.php:992
|
| 185 |
-
msgid "%s%% translated"
|
| 186 |
-
msgstr "%s%% traducido"
|
| 187 |
-
|
| 188 |
-
#: lib/loco-admin.php:992
|
| 189 |
-
msgid "1 string"
|
| 190 |
-
msgid_plural "%s strings"
|
| 191 |
-
msgstr[0] "1 cadena"
|
| 192 |
-
msgstr[1] "%s cadenas"
|
| 193 |
-
|
| 194 |
-
#: lib/loco-admin.php:995
|
| 195 |
-
msgid "%s fuzzy"
|
| 196 |
-
msgstr "%s fuzzy"
|
| 197 |
-
|
| 198 |
-
#: lib/loco-admin.php:998
|
| 199 |
-
msgid "%s untranslated"
|
| 200 |
-
msgstr "%s no traducido"
|
| 201 |
-
|
| 202 |
-
#: lib/loco-admin.php:1044
|
| 203 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 204 |
-
msgstr "Fallo al compilar el archivo PO con el compilador integrado"
|
| 205 |
-
|
| 206 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 207 |
-
msgid "Loco, Translation Management"
|
| 208 |
-
msgstr "Loco, Gestión de Traducción"
|
| 209 |
-
|
| 210 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 211 |
-
msgid "Manage translations"
|
| 212 |
-
msgstr "Gestionar traducciones"
|
| 213 |
-
|
| 214 |
-
#: lib/loco-admin.php:1094
|
| 215 |
-
msgid "Translation options"
|
| 216 |
-
msgstr "Opciones de traducción"
|
| 217 |
-
|
| 218 |
-
#: lib/loco-admin.php:1101
|
| 219 |
-
msgid "Loco Translate"
|
| 220 |
-
msgstr "Loco Translate"
|
| 221 |
-
|
| 222 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 223 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 224 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 225 |
-
msgid "Settings"
|
| 226 |
-
msgstr "Configuración"
|
| 227 |
-
|
| 228 |
-
#: lib/loco-admin.php:1149
|
| 229 |
-
msgid "File download failed"
|
| 230 |
-
msgstr "Descarga de archivo fallida"
|
| 231 |
-
|
| 232 |
-
#: lib/loco-admin.php:1159
|
| 233 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 234 |
-
msgstr "WPLANG está obsoleto y debería de quitarse de wp-config.php"
|
| 235 |
-
|
| 236 |
-
#: lib/loco-locales.php:77
|
| 237 |
-
msgid "Unknown language"
|
| 238 |
-
msgstr "Idioma desconocido"
|
| 239 |
-
|
| 240 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 241 |
-
msgid "Some files not writable"
|
| 242 |
-
msgstr "Algunos archivos no grabables"
|
| 243 |
-
|
| 244 |
-
#: lib/loco-packages.php:484
|
| 245 |
-
msgid "Some files missing"
|
| 246 |
-
msgstr "Faltan algunos archivos"
|
| 247 |
-
|
| 248 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 249 |
-
msgid "\"%s\" folder not writable"
|
| 250 |
-
msgstr "La carpeta \"%s\" no es grabable"
|
| 251 |
-
|
| 252 |
-
#: lib/loco-packages.php:515
|
| 253 |
-
msgid "POT file not writable"
|
| 254 |
-
msgstr "Archivo POT no es grabable"
|
| 255 |
-
|
| 256 |
-
#: lib/loco-packages.php:520
|
| 257 |
-
msgid "PO file not writable"
|
| 258 |
-
msgstr "Archivo PO no es grabable"
|
| 259 |
-
|
| 260 |
-
#: lib/loco-packages.php:522
|
| 261 |
-
msgid "MO file not writable"
|
| 262 |
-
msgstr "Archivo MO no es grabable"
|
| 263 |
-
|
| 264 |
-
#: lib/loco-packages.php:522
|
| 265 |
-
msgid "MO file not found"
|
| 266 |
-
msgstr "Archivo MO no encontrado"
|
| 267 |
-
|
| 268 |
-
#: lib/loco-packages.php:527
|
| 269 |
-
msgid "Folder not writable"
|
| 270 |
-
msgstr "No se puede escribir en la carpeta"
|
| 271 |
-
|
| 272 |
-
#: lib/loco-packages.php:527
|
| 273 |
-
msgid "Folder not found"
|
| 274 |
-
msgstr "Carpeta no encontrada"
|
| 275 |
-
|
| 276 |
-
#: lib/loco-packages.php:546
|
| 277 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 278 |
-
msgstr "%s no declara un \"Text Domain\""
|
| 279 |
-
|
| 280 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 281 |
-
msgid "Loco has guessed \"%s\""
|
| 282 |
-
msgstr "Loco ha adivinado \"%s\""
|
| 283 |
-
|
| 284 |
-
#: lib/loco-packages.php:551
|
| 285 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 286 |
-
msgstr "%s no declara una \"Ruta de Dominio\""
|
| 287 |
-
|
| 288 |
-
#: lib/loco-packages.php:556
|
| 289 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 290 |
-
msgstr "%s no tiene un fichero POT. Crear uno en \"%s/%s.pot\" si lo necesita."
|
| 291 |
-
|
| 292 |
-
#: lib/loco-packages.php:559
|
| 293 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 294 |
-
msgstr ""
|
| 295 |
-
"%s tiene un nombre de archivo POT extraño. Un mejor nombre sería \"%s.pot\""
|
| 296 |
-
|
| 297 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 298 |
-
msgid "User does not have permission to manage translations"
|
| 299 |
-
msgstr "El usuario no tiene permiso para gestionar traducciones"
|
| 300 |
-
|
| 301 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 302 |
-
msgid "Invalid data posted to server"
|
| 303 |
-
msgstr "Datos no válidos publicados en el servidor"
|
| 304 |
-
|
| 305 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 306 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 307 |
-
msgstr "Fallo al compilar el archivo MO con %s, compruebe su configuración"
|
| 308 |
-
|
| 309 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 310 |
-
msgid "Package not found called %s"
|
| 311 |
-
msgstr "Paquete llamado %s no encontrado"
|
| 312 |
-
|
| 313 |
-
#: php/loco-posave.php:58
|
| 314 |
-
msgid ""
|
| 315 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 316 |
-
"backups in settings"
|
| 317 |
-
msgstr ""
|
| 318 |
-
"El servidor web no puede hacer copias de seguridad en \"%s\". Establezca los "
|
| 319 |
-
"permisos de fichero o deshabilite las copias de seguridad en configuración"
|
| 320 |
-
|
| 321 |
-
#: php/loco-posave.php:66
|
| 322 |
-
msgid ""
|
| 323 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 324 |
-
"create it manually."
|
| 325 |
-
msgstr ""
|
| 326 |
-
"El servidor web no puede crear la carpeta \"%s\" en \"%s\". Establezca los "
|
| 327 |
-
"permisos de fichero o créelo manualmente."
|
| 328 |
-
|
| 329 |
-
#: php/loco-posave.php:69
|
| 330 |
-
msgid ""
|
| 331 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 332 |
-
"or use the download function."
|
| 333 |
-
msgstr ""
|
| 334 |
-
"El servidor web no puede crear archivos en la carpeta \"%s\". Establezca los "
|
| 335 |
-
"permisos de archivo o utilice la función de descarga."
|
| 336 |
-
|
| 337 |
-
#: php/loco-posave.php:81
|
| 338 |
-
msgid ""
|
| 339 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 340 |
-
"and copy to \"%s/%s\"."
|
| 341 |
-
msgstr ""
|
| 342 |
-
"El archivo %s no se puede escribir por el servidor web. Establezca los "
|
| 343 |
-
"permisos o descargue y cópielo a \"%s/%s\"."
|
| 344 |
-
|
| 345 |
-
#: php/loco-posave.php:102
|
| 346 |
-
msgid "Cannot create MO file"
|
| 347 |
-
msgstr "No se puede crear el archivo MO"
|
| 348 |
-
|
| 349 |
-
#: php/loco-posave.php:105
|
| 350 |
-
msgid "Cannot overwrite MO file"
|
| 351 |
-
msgstr "No se puede sobreescribir el archivo MO"
|
| 352 |
-
|
| 353 |
-
#: php/loco-posave.php:131
|
| 354 |
-
msgid "Failed to write MO file"
|
| 355 |
-
msgstr "Fallo al escribir el archivo MO"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 358 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 359 |
-
#: tpl/admin-root.tpl.php:6
|
| 360 |
-
msgid "Packages"
|
| 361 |
-
msgstr "Paquetes"
|
| 362 |
-
|
| 363 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 364 |
-
msgid "File check"
|
| 365 |
-
msgstr "Comprobar archivo"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 368 |
-
msgid "File system permissions for %s"
|
| 369 |
-
msgstr "Permisos del sistema de archivos para %s"
|
| 370 |
-
|
| 371 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 372 |
-
msgid "Other potential issues with %s"
|
| 373 |
-
msgstr "Otros posibles problemas con %s"
|
| 374 |
-
|
| 375 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 376 |
-
msgid "Back"
|
| 377 |
-
msgstr "Volver"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 380 |
-
msgid "Get help"
|
| 381 |
-
msgstr "Obtener ayuda"
|
| 382 |
-
|
| 383 |
-
#: tpl/admin-list.tpl.php:11
|
| 384 |
-
msgctxt "Table header"
|
| 385 |
-
msgid "Package details"
|
| 386 |
-
msgstr ""
|
| 387 |
-
"Detalles\n"
|
| 388 |
-
" del \n"
|
| 389 |
-
"paquete"
|
| 390 |
-
|
| 391 |
-
#: tpl/admin-list.tpl.php:14
|
| 392 |
-
msgctxt "Table header"
|
| 393 |
-
msgid "Translations (PO)"
|
| 394 |
-
msgstr "Traducciones (PO)"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-list.tpl.php:17
|
| 397 |
-
msgctxt "Table header"
|
| 398 |
-
msgid "Template (POT)"
|
| 399 |
-
msgstr "Plantilla (POT)"
|
| 400 |
-
|
| 401 |
-
#: tpl/admin-list.tpl.php:20
|
| 402 |
-
msgctxt "Table header"
|
| 403 |
-
msgid "File permissions"
|
| 404 |
-
msgstr "Permisos de archivo"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-list.tpl.php:40
|
| 407 |
-
msgid "Extends: %s"
|
| 408 |
-
msgstr "Extiende: %s"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-list.tpl.php:44
|
| 411 |
-
msgid "1 language"
|
| 412 |
-
msgid_plural "%u languages"
|
| 413 |
-
msgstr[0] "1 idioma"
|
| 414 |
-
msgstr[1] "%u idiomas"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 417 |
-
msgctxt "Modified time"
|
| 418 |
-
msgid "Updated"
|
| 419 |
-
msgstr "Actualizado"
|
| 420 |
-
|
| 421 |
-
#: tpl/admin-nav.tpl.php:26
|
| 422 |
-
msgid "Powered by"
|
| 423 |
-
msgstr "Funciona con"
|
| 424 |
-
|
| 425 |
-
#: tpl/admin-nav.tpl.php:32
|
| 426 |
-
msgid "Loco may not work as expected"
|
| 427 |
-
msgstr "Loco puede no funcionar como se esperaba"
|
| 428 |
-
|
| 429 |
-
#: tpl/admin-opts.tpl.php:18
|
| 430 |
-
msgid "Configure Loco Translate"
|
| 431 |
-
msgstr "Configurar Loco Translate"
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 434 |
-
msgid "Compiling MO files"
|
| 435 |
-
msgstr "Compilando archivo MO"
|
| 436 |
-
|
| 437 |
-
#: tpl/admin-opts.tpl.php:36
|
| 438 |
-
msgid "Use built-in MO compiler."
|
| 439 |
-
msgstr "Utilizar compilador MO integrado."
|
| 440 |
-
|
| 441 |
-
#: tpl/admin-opts.tpl.php:42
|
| 442 |
-
msgid "Use external command:"
|
| 443 |
-
msgstr ""
|
| 444 |
-
"Utilice\n"
|
| 445 |
-
" el \n"
|
| 446 |
-
"comando\n"
|
| 447 |
-
" \n"
|
| 448 |
-
"externo\n"
|
| 449 |
-
":"
|
| 450 |
-
|
| 451 |
-
#: tpl/admin-opts.tpl.php:47
|
| 452 |
-
msgid "Enter path to msgfmt on server"
|
| 453 |
-
msgstr "Introduzca la carpeta del servidor msgfmt"
|
| 454 |
-
|
| 455 |
-
#: tpl/admin-opts.tpl.php:54
|
| 456 |
-
msgid "Generate hash tables"
|
| 457 |
-
msgstr ""
|
| 458 |
-
"Generar\n"
|
| 459 |
-
" \n"
|
| 460 |
-
"tablas\n"
|
| 461 |
-
" \n"
|
| 462 |
-
"hash"
|
| 463 |
-
|
| 464 |
-
#: tpl/admin-opts.tpl.php:60
|
| 465 |
-
msgid "Include Fuzzy strings"
|
| 466 |
-
msgstr ""
|
| 467 |
-
|
| 468 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 469 |
-
msgid "Backing up PO files"
|
| 470 |
-
msgstr "Haciendo copia de seguridad de archivos PO"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-opts.tpl.php:75
|
| 473 |
-
msgid "Number of backups to keep of each file:"
|
| 474 |
-
msgstr "Número de copias de seguridad para mantener de cada archivo:"
|
| 475 |
-
|
| 476 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 477 |
-
msgid "Experimental features"
|
| 478 |
-
msgstr "Características experimentales"
|
| 479 |
-
|
| 480 |
-
#: tpl/admin-opts.tpl.php:92
|
| 481 |
-
msgid "Enable WordPress core translations"
|
| 482 |
-
msgstr "Habilitar traducciones del núcleo de WordPress"
|
| 483 |
-
|
| 484 |
-
#: tpl/admin-opts.tpl.php:101
|
| 485 |
-
msgid "Save settings"
|
| 486 |
-
msgstr "Guardar configuración"
|
| 487 |
-
|
| 488 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 489 |
-
msgid "Template file"
|
| 490 |
-
msgstr "Archivo de plantilla"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 493 |
-
msgctxt "Dropdown label"
|
| 494 |
-
msgid "Switch to..."
|
| 495 |
-
msgstr "Cambiar a..."
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 498 |
-
msgid "never"
|
| 499 |
-
msgstr "nunca"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 502 |
-
msgctxt "Editor button"
|
| 503 |
-
msgid "Save"
|
| 504 |
-
msgstr "Guardar"
|
| 505 |
-
|
| 506 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 507 |
-
msgctxt "Editor button"
|
| 508 |
-
msgid "Download"
|
| 509 |
-
msgstr "Descargar"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 512 |
-
msgctxt "Editor button"
|
| 513 |
-
msgid "Sync"
|
| 514 |
-
msgstr "Sinc"
|
| 515 |
-
|
| 516 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 517 |
-
msgctxt "Editor button"
|
| 518 |
-
msgid "Revert"
|
| 519 |
-
msgstr "Deshacer"
|
| 520 |
-
|
| 521 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 522 |
-
msgctxt "Editor button"
|
| 523 |
-
msgid "Add"
|
| 524 |
-
msgstr "Añadir"
|
| 525 |
-
|
| 526 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 527 |
-
msgctxt "Editor button"
|
| 528 |
-
msgid "Del"
|
| 529 |
-
msgstr "Eliminar"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 532 |
-
msgctxt "Editor button"
|
| 533 |
-
msgid "Fuzzy"
|
| 534 |
-
msgstr "Fuzzy"
|
| 535 |
-
|
| 536 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 537 |
-
msgid "Filter translations"
|
| 538 |
-
msgstr "Filtrar traducciones"
|
| 539 |
-
|
| 540 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 541 |
-
msgctxt "Editor button"
|
| 542 |
-
msgid "Help"
|
| 543 |
-
msgstr "Ayuda"
|
| 544 |
-
|
| 545 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 546 |
-
msgid "Initialize new translations in %s"
|
| 547 |
-
msgstr "Comenzar nuevas traducciones en %s"
|
| 548 |
-
|
| 549 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 550 |
-
msgid "Select from common languages"
|
| 551 |
-
msgstr "Seleccione de lenguajes comunes"
|
| 552 |
-
|
| 553 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 554 |
-
msgctxt "Form label"
|
| 555 |
-
msgid "or enter any language code"
|
| 556 |
-
msgstr "o introduzca cualquier código de idioma"
|
| 557 |
-
|
| 558 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 559 |
-
msgctxt "Form label"
|
| 560 |
-
msgid "create in <code>%s</code>"
|
| 561 |
-
msgstr "crear en <code>%s</code>"
|
| 562 |
-
|
| 563 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 564 |
-
msgctxt "Form label"
|
| 565 |
-
msgid "create in global languages directory"
|
| 566 |
-
msgstr "crear en la carpeta global de idiomas"
|
| 567 |
-
|
| 568 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 569 |
-
msgctxt "Submit button"
|
| 570 |
-
msgid "Start translating"
|
| 571 |
-
msgstr "Comenzar la traducicción"
|
| 572 |
-
|
| 573 |
-
#: tpl/admin-root.tpl.php:18
|
| 574 |
-
msgid "New version available"
|
| 575 |
-
msgstr "Disponible nueva versión"
|
| 576 |
-
|
| 577 |
-
#: tpl/admin-root.tpl.php:21
|
| 578 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 579 |
-
msgstr "Actualizar a la versión %s de Loco Translate"
|
| 580 |
-
|
| 581 |
-
#: tpl/admin-root.tpl.php:31
|
| 582 |
-
msgid "Select a plugin or theme to translate"
|
| 583 |
-
msgstr "Seleccione un plugin o tema para traducir"
|
| 584 |
-
|
| 585 |
-
#: tpl/admin-root.tpl.php:40
|
| 586 |
-
msgctxt "Package list header"
|
| 587 |
-
msgid "Themes"
|
| 588 |
-
msgstr "Temas"
|
| 589 |
-
|
| 590 |
-
#: tpl/admin-root.tpl.php:53
|
| 591 |
-
msgctxt "Package list header"
|
| 592 |
-
msgid "Plugins"
|
| 593 |
-
msgstr "Plugins"
|
| 594 |
-
|
| 595 |
-
#: tpl/admin-root.tpl.php:66
|
| 596 |
-
msgctxt "Package list header"
|
| 597 |
-
msgid "Core"
|
| 598 |
-
msgstr "Núcleo"
|
| 599 |
-
|
| 600 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 601 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 602 |
-
msgid ""
|
| 603 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 604 |
-
"install it"
|
| 605 |
-
msgstr ""
|
| 606 |
-
"La extensión PHP \"%s\" no está instalada. Si experimenta problemas debería "
|
| 607 |
-
"instalarlo"
|
| 608 |
-
|
| 609 |
-
#: pub/js/lang/dummy.php:8
|
| 610 |
-
msgid "Unknown error"
|
| 611 |
-
msgstr "Error desconocido"
|
| 612 |
-
|
| 613 |
-
#: pub/js/lang/dummy.php:10
|
| 614 |
-
msgid "PO file saved"
|
| 615 |
-
msgstr "Fichero PO guardado"
|
| 616 |
-
|
| 617 |
-
#: pub/js/lang/dummy.php:12
|
| 618 |
-
msgid "and MO file compiled"
|
| 619 |
-
msgstr "y compilado el fichero MO"
|
| 620 |
-
|
| 621 |
-
#: pub/js/lang/dummy.php:15
|
| 622 |
-
msgid "Merged from %s"
|
| 623 |
-
msgstr "Combinado desde %s"
|
| 624 |
-
|
| 625 |
-
#: pub/js/lang/dummy.php:17
|
| 626 |
-
msgid "Merged from source code"
|
| 627 |
-
msgstr "Combinado desde el código fuente"
|
| 628 |
-
|
| 629 |
-
#: pub/js/lang/dummy.php:19
|
| 630 |
-
msgid "Already up to date with %s"
|
| 631 |
-
msgstr "Ya actualizado con %s"
|
| 632 |
-
|
| 633 |
-
#: pub/js/lang/dummy.php:21
|
| 634 |
-
msgid "Already up to date with source code"
|
| 635 |
-
msgstr "Actualizado ya con el código fuente"
|
| 636 |
-
|
| 637 |
-
#: pub/js/lang/dummy.php:23
|
| 638 |
-
msgid "1 new string added"
|
| 639 |
-
msgid_plural "%s new strings added"
|
| 640 |
-
msgstr[0] "Añadido 1 nueva cadena"
|
| 641 |
-
msgstr[1] "Añadidas %s nuevas cadenas"
|
| 642 |
-
|
| 643 |
-
#: pub/js/lang/dummy.php:25
|
| 644 |
-
msgid "1 obsolete string removed"
|
| 645 |
-
msgid_plural "%s obsolete strings removed"
|
| 646 |
-
msgstr[0] "1 cadena obsoleta eliminada"
|
| 647 |
-
msgstr[1] "%s cadenas obsoletas eliminadas"
|
| 648 |
-
|
| 649 |
-
#: pub/js/lang/dummy.php:27
|
| 650 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 651 |
-
msgstr "Los cambios se perderán si continúa sin guardarlos"
|
| 652 |
-
|
| 653 |
-
#. label for the window pane holding native translation
|
| 654 |
-
#: pub/js/lang/dummy.php:35
|
| 655 |
-
msgctxt "Editor pane"
|
| 656 |
-
msgid "Source text"
|
| 657 |
-
msgstr "Texto origen"
|
| 658 |
-
|
| 659 |
-
#. where %s is the language, e.g French translation
|
| 660 |
-
#: pub/js/lang/dummy.php:38
|
| 661 |
-
msgctxt "Editor pane"
|
| 662 |
-
msgid "%s translation"
|
| 663 |
-
msgstr "%s traducción"
|
| 664 |
-
|
| 665 |
-
#. label for the window pane holding translator comments
|
| 666 |
-
#: pub/js/lang/dummy.php:41
|
| 667 |
-
msgctxt "Editor pane"
|
| 668 |
-
msgid "Comments"
|
| 669 |
-
msgstr "Comentarios"
|
| 670 |
-
|
| 671 |
-
#. label for the window pane holding message context
|
| 672 |
-
#: pub/js/lang/dummy.php:44
|
| 673 |
-
msgctxt "Editor pane"
|
| 674 |
-
msgid "Context"
|
| 675 |
-
msgstr "Contexto"
|
| 676 |
-
|
| 677 |
-
#: pub/js/lang/dummy.php:52
|
| 678 |
-
msgid "Translation"
|
| 679 |
-
msgstr "Traducción"
|
| 680 |
-
|
| 681 |
-
#: pub/js/lang/dummy.php:54
|
| 682 |
-
msgid "No source files in this package, nothing to sync"
|
| 683 |
-
msgstr ""
|
| 684 |
-
|
| 685 |
-
#: pub/js/lang/dummy.php:56
|
| 686 |
-
msgid "No strings could be extracted from source files"
|
| 687 |
-
msgstr "No se pueden extraer las cadenas de los archivos fuente"
|
| 688 |
-
|
| 689 |
-
#. Description of the plugin
|
| 690 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 691 |
-
msgstr ""
|
| 692 |
-
|
| 693 |
-
#. URI of the plugin
|
| 694 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 695 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 696 |
-
|
| 697 |
-
#. Author of the plugin
|
| 698 |
-
msgid "Tim Whitlock"
|
| 699 |
-
msgstr "Tim Whitlock"
|
| 700 |
-
|
| 701 |
-
#. Author URI of the plugin
|
| 702 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 703 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-fa_IR.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-fa_IR.po
DELETED
|
@@ -1,637 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:17:53 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Persian\n"
|
| 9 |
-
"Language: fa-IR\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=1; plural=0\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 17 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 18 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 19 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 20 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 21 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 22 |
-
"X-Loco-Target-Locale: fa_IR\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "خطا"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "اخطار"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "اوکی"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "دسترسی امکان پذیر نیست"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "تنظیمات ذخیره شد"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "فایل PO جدید"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"فایل PO به جای قالب استفاده شد. در ذخیره اول، فایل به نام %s تغییر نام خواهد "
|
| 61 |
-
"داد"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "شما باید یک مسیر قابل قبول برای فایل PO مشخص کنید"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "هیچ سطری برای ترجمه پیدا نشد"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "ساخت فایل PO امکان پذیر نیست"
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "فایل PO قبلا برای زبان %s وجیو دارد"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"فایل قایل دخیره شدن نیست. اجازه دسترسی فایل ها را درست کنید یا از دریافت به "
|
| 85 |
-
"جای دخیره استفاده کنید"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "فایل %s خالی است"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "اجرای هماهنگ سازی برای به روز رسانی سورس کد"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "هیچ سطری از سورس کد پیدا نشد"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "اجرای هماهنگ سازی برای به روز رسانی از %s"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr "سورس کد ویرایش شده است؛ برای به روز رسانی، هماهنگ سازی را اجرا کنید"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"از زمانی که فایل PO ذخیره شده بود، فایل POT ویرایش شده است. هماهنگ سازی را "
|
| 111 |
-
"اجرا کنید"
|
| 112 |
-
|
| 113 |
-
#: lib/loco-admin.php:536
|
| 114 |
-
msgid "Bad file path"
|
| 115 |
-
msgstr "مسیر قایل قبول نیست"
|
| 116 |
-
|
| 117 |
-
#: lib/loco-admin.php:783
|
| 118 |
-
msgid "Empty or invalid %s file"
|
| 119 |
-
msgstr "فایل %s خالی یا غیر قابل قبول می باشد"
|
| 120 |
-
|
| 121 |
-
#: lib/loco-admin.php:787
|
| 122 |
-
msgid "%s file has no header"
|
| 123 |
-
msgstr "فایل %s دارای سربرگ نمی باشد"
|
| 124 |
-
|
| 125 |
-
#: lib/loco-admin.php:934
|
| 126 |
-
msgctxt "Add button"
|
| 127 |
-
msgid "New template"
|
| 128 |
-
msgstr "فرم جدید"
|
| 129 |
-
|
| 130 |
-
#: lib/loco-admin.php:953
|
| 131 |
-
msgctxt "Add button"
|
| 132 |
-
msgid "New language"
|
| 133 |
-
msgstr "زبان جدید"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:992
|
| 136 |
-
msgid "%s%% translated"
|
| 137 |
-
msgstr "%s%% ترجمه شده"
|
| 138 |
-
|
| 139 |
-
#: lib/loco-admin.php:992
|
| 140 |
-
msgid "1 string"
|
| 141 |
-
msgid_plural "%s strings"
|
| 142 |
-
msgstr[0] "%s سطر"
|
| 143 |
-
msgstr[1] ""
|
| 144 |
-
|
| 145 |
-
#: lib/loco-admin.php:995
|
| 146 |
-
msgid "%s fuzzy"
|
| 147 |
-
msgstr "%s مبهم"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:998
|
| 150 |
-
msgid "%s untranslated"
|
| 151 |
-
msgstr "%s ترجمه نشده"
|
| 152 |
-
|
| 153 |
-
#: lib/loco-admin.php:1044
|
| 154 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 155 |
-
msgstr "فایل MO با کامپایلر توکار، کامپایل نشد"
|
| 156 |
-
|
| 157 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 158 |
-
msgid "Loco, Translation Management"
|
| 159 |
-
msgstr "لوکو، مدریت ترجمه"
|
| 160 |
-
|
| 161 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 162 |
-
msgid "Manage translations"
|
| 163 |
-
msgstr "مدریت ترجمه ها"
|
| 164 |
-
|
| 165 |
-
#: lib/loco-admin.php:1094
|
| 166 |
-
msgid "Translation options"
|
| 167 |
-
msgstr "تنظیمات ترجمه ها"
|
| 168 |
-
|
| 169 |
-
#: lib/loco-admin.php:1101
|
| 170 |
-
msgid "Loco Translate"
|
| 171 |
-
msgstr "مترجم لوکو"
|
| 172 |
-
|
| 173 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 174 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 175 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 176 |
-
msgid "Settings"
|
| 177 |
-
msgstr "تنظیمات"
|
| 178 |
-
|
| 179 |
-
#: lib/loco-admin.php:1149
|
| 180 |
-
msgid "File download failed"
|
| 181 |
-
msgstr "خطا در دریافت فایل"
|
| 182 |
-
|
| 183 |
-
#: lib/loco-admin.php:1159
|
| 184 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 185 |
-
msgstr "WPLANG منسوخ شده و باید از wp-config.php پاک شود"
|
| 186 |
-
|
| 187 |
-
#: lib/loco-locales.php:77
|
| 188 |
-
msgid "Unknown language"
|
| 189 |
-
msgstr "زبان نا آشنا"
|
| 190 |
-
|
| 191 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 192 |
-
msgid "Some files not writable"
|
| 193 |
-
msgstr "تعدادی از فایل قابل نوشتن نیستند"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-packages.php:484
|
| 196 |
-
msgid "Some files missing"
|
| 197 |
-
msgstr "تعدادی از فایل ها موجود نیستند"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 200 |
-
msgid "\"%s\" folder not writable"
|
| 201 |
-
msgstr "پوشه %s قابل نوشتن نیست"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:515
|
| 204 |
-
msgid "POT file not writable"
|
| 205 |
-
msgstr "فایل POT قایل نوشتن نیست"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:520
|
| 208 |
-
msgid "PO file not writable"
|
| 209 |
-
msgstr "فایل PO فابل نوشتن نیست"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:522
|
| 212 |
-
msgid "MO file not writable"
|
| 213 |
-
msgstr "فایل MO فابل نوشتن نیست"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:522
|
| 216 |
-
msgid "MO file not found"
|
| 217 |
-
msgstr "فایل MO پیدا نشد"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:527
|
| 220 |
-
msgid "Folder not writable"
|
| 221 |
-
msgstr "پوشه قایل نوشتن نیست"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:527
|
| 224 |
-
msgid "Folder not found"
|
| 225 |
-
msgstr "پوشه پیدا نشد"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:546
|
| 228 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 229 |
-
msgstr ""
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 232 |
-
msgid "Loco has guessed \"%s\""
|
| 233 |
-
msgstr ""
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:551
|
| 236 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 237 |
-
msgstr ""
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:556
|
| 240 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 241 |
-
msgstr ""
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:559
|
| 244 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 245 |
-
msgstr ""
|
| 246 |
-
|
| 247 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 248 |
-
msgid "User does not have permission to manage translations"
|
| 249 |
-
msgstr "کاربر دسترسی لازم برای مدریت ترجمه ها را ندارد"
|
| 250 |
-
|
| 251 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 252 |
-
msgid "Invalid data posted to server"
|
| 253 |
-
msgstr "داده نادرست به سرور ارسال شده"
|
| 254 |
-
|
| 255 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 256 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 257 |
-
msgstr "خطای کامپایل فایل MO با %s. تنظیمات خود را برسی کنید"
|
| 258 |
-
|
| 259 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 260 |
-
msgid "Package not found called %s"
|
| 261 |
-
msgstr "بسته ای با نام %s پیدا نشد"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:58
|
| 264 |
-
msgid ""
|
| 265 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 266 |
-
"backups in settings"
|
| 267 |
-
msgstr ""
|
| 268 |
-
"سرور نمی تواند در %s پشتیبان تهیه کند. اجازه دسترسی را درست کنید یا پشتیبان "
|
| 269 |
-
"گیری را غیر فعال کنید"
|
| 270 |
-
|
| 271 |
-
#: php/loco-posave.php:66
|
| 272 |
-
msgid ""
|
| 273 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 274 |
-
"create it manually."
|
| 275 |
-
msgstr ""
|
| 276 |
-
"سرور نمی تواند پوشه %s را در %s یسازد. اجازه دسترسی بدهید و یا پوشه را به "
|
| 277 |
-
"صورت دستی بسازید"
|
| 278 |
-
|
| 279 |
-
#: php/loco-posave.php:69
|
| 280 |
-
msgid ""
|
| 281 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 282 |
-
"or use the download function."
|
| 283 |
-
msgstr ""
|
| 284 |
-
"سرور نمی تواند فایلی در %s بسازد. اجازه دسترسی بدهید و یا از امکان دریافت "
|
| 285 |
-
"استفاده کنید"
|
| 286 |
-
|
| 287 |
-
#: php/loco-posave.php:81
|
| 288 |
-
msgid ""
|
| 289 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 290 |
-
"and copy to \"%s/%s\"."
|
| 291 |
-
msgstr ""
|
| 292 |
-
"فایل %s قابل نوشتن نیست. اجازه دسترسی بدهید و یا یک نسخه به %s/%s کپی کنید"
|
| 293 |
-
|
| 294 |
-
#: php/loco-posave.php:102
|
| 295 |
-
msgid "Cannot create MO file"
|
| 296 |
-
msgstr "فایل MO ساخته نشد"
|
| 297 |
-
|
| 298 |
-
#: php/loco-posave.php:105
|
| 299 |
-
msgid "Cannot overwrite MO file"
|
| 300 |
-
msgstr "فایل MO دوباره نویسی نشد"
|
| 301 |
-
|
| 302 |
-
#: php/loco-posave.php:131
|
| 303 |
-
msgid "Failed to write MO file"
|
| 304 |
-
msgstr "فایل MO نوشته نشد"
|
| 305 |
-
|
| 306 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 307 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 308 |
-
#: tpl/admin-root.tpl.php:6
|
| 309 |
-
msgid "Packages"
|
| 310 |
-
msgstr "بسته ها"
|
| 311 |
-
|
| 312 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 313 |
-
msgid "File check"
|
| 314 |
-
msgstr "چک فایل"
|
| 315 |
-
|
| 316 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 317 |
-
msgid "File system permissions for %s"
|
| 318 |
-
msgstr "اجازه دسترسی برای %s"
|
| 319 |
-
|
| 320 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 321 |
-
msgid "Other potential issues with %s"
|
| 322 |
-
msgstr ""
|
| 323 |
-
|
| 324 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 325 |
-
msgid "Back"
|
| 326 |
-
msgstr "فبلی"
|
| 327 |
-
|
| 328 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 329 |
-
msgid "Get help"
|
| 330 |
-
msgstr "کمک بگیرید"
|
| 331 |
-
|
| 332 |
-
#: tpl/admin-list.tpl.php:11
|
| 333 |
-
msgctxt "Table header"
|
| 334 |
-
msgid "Package details"
|
| 335 |
-
msgstr "جزئیات بسته"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-list.tpl.php:14
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Translations (PO)"
|
| 340 |
-
msgstr "ترجمه (PO)"
|
| 341 |
-
|
| 342 |
-
#: tpl/admin-list.tpl.php:17
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Template (POT)"
|
| 345 |
-
msgstr "قالب (POT)"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:20
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "File permissions"
|
| 350 |
-
msgstr "دسترسی فایل"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:40
|
| 353 |
-
msgid "Extends: %s"
|
| 354 |
-
msgstr "اضافه شد: %s"
|
| 355 |
-
|
| 356 |
-
#: tpl/admin-list.tpl.php:44
|
| 357 |
-
msgid "1 language"
|
| 358 |
-
msgid_plural "%u languages"
|
| 359 |
-
msgstr[0] "%u زبان"
|
| 360 |
-
msgstr[1] ""
|
| 361 |
-
|
| 362 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 363 |
-
msgctxt "Modified time"
|
| 364 |
-
msgid "Updated"
|
| 365 |
-
msgstr "به روز رسانی شد"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-nav.tpl.php:26
|
| 368 |
-
msgid "Powered by"
|
| 369 |
-
msgstr "قدرت گرفته توسط"
|
| 370 |
-
|
| 371 |
-
#: tpl/admin-nav.tpl.php:32
|
| 372 |
-
msgid "Loco may not work as expected"
|
| 373 |
-
msgstr "لوکو ممکن است درست کار نکند"
|
| 374 |
-
|
| 375 |
-
#: tpl/admin-opts.tpl.php:18
|
| 376 |
-
msgid "Configure Loco Translate"
|
| 377 |
-
msgstr "تنظیم مترجم لوکو"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 380 |
-
msgid "Compiling MO files"
|
| 381 |
-
msgstr "در حال کامپایل فایل MO"
|
| 382 |
-
|
| 383 |
-
#: tpl/admin-opts.tpl.php:36
|
| 384 |
-
msgid "Use built-in MO compiler."
|
| 385 |
-
msgstr "استفاده از کامپایر توکار MO."
|
| 386 |
-
|
| 387 |
-
#: tpl/admin-opts.tpl.php:42
|
| 388 |
-
msgid "Use external command:"
|
| 389 |
-
msgstr "استفاده از دستور خارجی:"
|
| 390 |
-
|
| 391 |
-
#: tpl/admin-opts.tpl.php:47
|
| 392 |
-
msgid "Enter path to msgfmt on server"
|
| 393 |
-
msgstr "وارد کردن مسیر msgfmt در سرور"
|
| 394 |
-
|
| 395 |
-
#: tpl/admin-opts.tpl.php:54
|
| 396 |
-
msgid "Generate hash tables"
|
| 397 |
-
msgstr "ساختن جدول hash"
|
| 398 |
-
|
| 399 |
-
#: tpl/admin-opts.tpl.php:60
|
| 400 |
-
msgid "Include Fuzzy strings"
|
| 401 |
-
msgstr ""
|
| 402 |
-
|
| 403 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 404 |
-
msgid "Backing up PO files"
|
| 405 |
-
msgstr "پشتیبان گیری از فایل های PO"
|
| 406 |
-
|
| 407 |
-
#: tpl/admin-opts.tpl.php:75
|
| 408 |
-
msgid "Number of backups to keep of each file:"
|
| 409 |
-
msgstr "تعداد پشتیبان های گرفته شده از هر فایل:"
|
| 410 |
-
|
| 411 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 412 |
-
msgid "Experimental features"
|
| 413 |
-
msgstr "قابلیت های آزمایشی"
|
| 414 |
-
|
| 415 |
-
#: tpl/admin-opts.tpl.php:92
|
| 416 |
-
msgid "Enable WordPress core translations"
|
| 417 |
-
msgstr "فعال سازی ترجمه هسته وردپرس"
|
| 418 |
-
|
| 419 |
-
#: tpl/admin-opts.tpl.php:101
|
| 420 |
-
msgid "Save settings"
|
| 421 |
-
msgstr "دخیره تنظیمات"
|
| 422 |
-
|
| 423 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 424 |
-
msgid "Template file"
|
| 425 |
-
msgstr "قالب فایل"
|
| 426 |
-
|
| 427 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 428 |
-
msgctxt "Dropdown label"
|
| 429 |
-
msgid "Switch to..."
|
| 430 |
-
msgstr "تعویض به"
|
| 431 |
-
|
| 432 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 433 |
-
msgid "never"
|
| 434 |
-
msgstr "هرگز"
|
| 435 |
-
|
| 436 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 437 |
-
msgctxt "Editor button"
|
| 438 |
-
msgid "Save"
|
| 439 |
-
msgstr "ذخیره"
|
| 440 |
-
|
| 441 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 442 |
-
msgctxt "Editor button"
|
| 443 |
-
msgid "Download"
|
| 444 |
-
msgstr "دریافت"
|
| 445 |
-
|
| 446 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 447 |
-
msgctxt "Editor button"
|
| 448 |
-
msgid "Sync"
|
| 449 |
-
msgstr "هماهنگ سازی"
|
| 450 |
-
|
| 451 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 452 |
-
msgctxt "Editor button"
|
| 453 |
-
msgid "Revert"
|
| 454 |
-
msgstr "برگرداندن"
|
| 455 |
-
|
| 456 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 457 |
-
msgctxt "Editor button"
|
| 458 |
-
msgid "Add"
|
| 459 |
-
msgstr "اضافه کردن"
|
| 460 |
-
|
| 461 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 462 |
-
msgctxt "Editor button"
|
| 463 |
-
msgid "Del"
|
| 464 |
-
msgstr "پاک کردن"
|
| 465 |
-
|
| 466 |
-
# cant find a proper word
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Fuzzy"
|
| 470 |
-
msgstr "مبهم"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 473 |
-
msgid "Filter translations"
|
| 474 |
-
msgstr "فیلتر ترجمه"
|
| 475 |
-
|
| 476 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 477 |
-
msgctxt "Editor button"
|
| 478 |
-
msgid "Help"
|
| 479 |
-
msgstr "کمک"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 482 |
-
msgid "Initialize new translations in %s"
|
| 483 |
-
msgstr "ایجاد فایل ترجمه برای %s"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 486 |
-
msgid "Select from common languages"
|
| 487 |
-
msgstr "یکی از زبان های متداول رو انتخاب کنید"
|
| 488 |
-
|
| 489 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 490 |
-
msgctxt "Form label"
|
| 491 |
-
msgid "or enter any language code"
|
| 492 |
-
msgstr "یا کد زبان را وارد کنید"
|
| 493 |
-
|
| 494 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 495 |
-
msgctxt "Form label"
|
| 496 |
-
msgid "create in <code>%s</code>"
|
| 497 |
-
msgstr "در <code>%s</code> ساخته شود"
|
| 498 |
-
|
| 499 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 500 |
-
msgctxt "Form label"
|
| 501 |
-
msgid "create in global languages directory"
|
| 502 |
-
msgstr "در پوشه ترجمه های سراسری ساخته شود"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 505 |
-
msgctxt "Submit button"
|
| 506 |
-
msgid "Start translating"
|
| 507 |
-
msgstr "شروع ترجمه"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-root.tpl.php:18
|
| 510 |
-
msgid "New version available"
|
| 511 |
-
msgstr "نسخه جدید آماده است"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:21
|
| 514 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 515 |
-
msgstr "به نسخه %s مترجم لوکو به روز رسانی شد"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:31
|
| 518 |
-
msgid "Select a plugin or theme to translate"
|
| 519 |
-
msgstr "یک افزونه یا پوسته را برای ترجمه انتخاب کنید"
|
| 520 |
-
|
| 521 |
-
#: tpl/admin-root.tpl.php:40
|
| 522 |
-
msgctxt "Package list header"
|
| 523 |
-
msgid "Themes"
|
| 524 |
-
msgstr "پوسته ها"
|
| 525 |
-
|
| 526 |
-
#: tpl/admin-root.tpl.php:53
|
| 527 |
-
msgctxt "Package list header"
|
| 528 |
-
msgid "Plugins"
|
| 529 |
-
msgstr "افزونه ها"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-root.tpl.php:66
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Core"
|
| 534 |
-
msgstr "هسته"
|
| 535 |
-
|
| 536 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 537 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 538 |
-
msgid ""
|
| 539 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 540 |
-
"install it"
|
| 541 |
-
msgstr ""
|
| 542 |
-
|
| 543 |
-
#: pub/js/lang/dummy.php:8
|
| 544 |
-
msgid "Unknown error"
|
| 545 |
-
msgstr "خطای نا آشنا"
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:10
|
| 548 |
-
msgid "PO file saved"
|
| 549 |
-
msgstr "فایل PO ذخیره شد"
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:12
|
| 552 |
-
msgid "and MO file compiled"
|
| 553 |
-
msgstr "و فایل MO کامپایل شد"
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:15
|
| 556 |
-
msgid "Merged from %s"
|
| 557 |
-
msgstr "از %s یکی سازی شد"
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:17
|
| 560 |
-
msgid "Merged from source code"
|
| 561 |
-
msgstr "یکی سازی از سورس کد"
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:19
|
| 564 |
-
msgid "Already up to date with %s"
|
| 565 |
-
msgstr "قبلا با %s به روز است"
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:21
|
| 568 |
-
msgid "Already up to date with source code"
|
| 569 |
-
msgstr "قبلا با سورس کد به روز است"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:23
|
| 572 |
-
msgid "1 new string added"
|
| 573 |
-
msgid_plural "%s new strings added"
|
| 574 |
-
msgstr[0] "%s سطر اضافه شد"
|
| 575 |
-
msgstr[1] ""
|
| 576 |
-
|
| 577 |
-
#: pub/js/lang/dummy.php:25
|
| 578 |
-
msgid "1 obsolete string removed"
|
| 579 |
-
msgid_plural "%s obsolete strings removed"
|
| 580 |
-
msgstr[0] "%s سطر قدیمی پاک شد"
|
| 581 |
-
msgstr[1] ""
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:27
|
| 584 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 585 |
-
msgstr "اگر بدون ذخیره کردن ادامه دهید، تنظیمات شما پاک خواهد شد"
|
| 586 |
-
|
| 587 |
-
#. label for the window pane holding native translation
|
| 588 |
-
#: pub/js/lang/dummy.php:35
|
| 589 |
-
msgctxt "Editor pane"
|
| 590 |
-
msgid "Source text"
|
| 591 |
-
msgstr "متن"
|
| 592 |
-
|
| 593 |
-
#. where %s is the language, e.g French translation
|
| 594 |
-
#: pub/js/lang/dummy.php:38
|
| 595 |
-
msgctxt "Editor pane"
|
| 596 |
-
msgid "%s translation"
|
| 597 |
-
msgstr "ترجمه %s"
|
| 598 |
-
|
| 599 |
-
#. label for the window pane holding translator comments
|
| 600 |
-
#: pub/js/lang/dummy.php:41
|
| 601 |
-
msgctxt "Editor pane"
|
| 602 |
-
msgid "Comments"
|
| 603 |
-
msgstr "یادداشت"
|
| 604 |
-
|
| 605 |
-
#. label for the window pane holding message context
|
| 606 |
-
#: pub/js/lang/dummy.php:44
|
| 607 |
-
msgctxt "Editor pane"
|
| 608 |
-
msgid "Context"
|
| 609 |
-
msgstr "متن"
|
| 610 |
-
|
| 611 |
-
#: pub/js/lang/dummy.php:52
|
| 612 |
-
msgid "Translation"
|
| 613 |
-
msgstr "ترجمه"
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:54
|
| 616 |
-
msgid "No source files in this package, nothing to sync"
|
| 617 |
-
msgstr "هیج فایل سورسی در این بسته پیدا نشد؛ چیزی برای هماهنگ سازی نیست"
|
| 618 |
-
|
| 619 |
-
#: pub/js/lang/dummy.php:56
|
| 620 |
-
msgid "No strings could be extracted from source files"
|
| 621 |
-
msgstr "هیچ سطری از سورس کد وارد نشد"
|
| 622 |
-
|
| 623 |
-
#. Description of the plugin
|
| 624 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 625 |
-
msgstr ""
|
| 626 |
-
|
| 627 |
-
#. URI of the plugin
|
| 628 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 629 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 630 |
-
|
| 631 |
-
#. Author of the plugin
|
| 632 |
-
msgid "Tim Whitlock"
|
| 633 |
-
msgstr "Tim Whitlock"
|
| 634 |
-
|
| 635 |
-
#. Author URI of the plugin
|
| 636 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 637 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-fr_FR.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-fr_FR.po
DELETED
|
@@ -1,654 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:18:03 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: French (France)\n"
|
| 9 |
-
"Language: fr-FR\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n > 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: fr_FR\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Erreur"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Avertissement"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "Succès"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Non autorisé"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Paramètres enregistrés"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Nouveau fichier de traduction (fichier PO)"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"Fichier de traduction (fichier PO) utilisé comme modèle. Ce fichier sera "
|
| 61 |
-
"renommé en %s au premier enregistrement"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr ""
|
| 66 |
-
"Vous devez indiquer une région valide pour le nouveau fichier de traduction "
|
| 67 |
-
"(fichier PO)"
|
| 68 |
-
|
| 69 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 70 |
-
msgid "No translatable strings found"
|
| 71 |
-
msgstr "Aucune chaîne de caractères à traduire"
|
| 72 |
-
|
| 73 |
-
#: lib/loco-admin.php:337
|
| 74 |
-
msgid "Cannot create a PO file."
|
| 75 |
-
msgstr "Impossible de créer le fichier de traduction (fichier PO)."
|
| 76 |
-
|
| 77 |
-
#: lib/loco-admin.php:344
|
| 78 |
-
msgid "PO file already exists with locale %s"
|
| 79 |
-
msgstr "Le fichier de traduction (fichier PO) existe déjà pour la région %s"
|
| 80 |
-
|
| 81 |
-
#: lib/loco-admin.php:396
|
| 82 |
-
msgid ""
|
| 83 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 84 |
-
"Download instead of Save"
|
| 85 |
-
msgstr ""
|
| 86 |
-
"Le fichier ne peut pas être créé automatiquement. Fixez les autorisations du "
|
| 87 |
-
"fichier ou utilisez la fonction Télécharger au lieu de Sauvegarder"
|
| 88 |
-
|
| 89 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 90 |
-
msgid "%s file is empty"
|
| 91 |
-
msgstr "Le fichier %s est vide"
|
| 92 |
-
|
| 93 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 94 |
-
msgid "Run Sync to update from source code"
|
| 95 |
-
msgstr "Exécutez Synchro pour mettre à jour depuis le code source"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 98 |
-
msgid "No strings could be extracted from source code"
|
| 99 |
-
msgstr "Aucune chaîne de caractères n'a pu être extraire du code source"
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:417
|
| 102 |
-
msgid "Run Sync to update from %s"
|
| 103 |
-
msgstr "Exécutez Synchro pour mettre à jour depuis %s"
|
| 104 |
-
|
| 105 |
-
#: lib/loco-admin.php:436
|
| 106 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 107 |
-
msgstr ""
|
| 108 |
-
"Le code source a été modifié, exécutez Synchro pour mettre à jour le modèle "
|
| 109 |
-
"(fichier POT)"
|
| 110 |
-
|
| 111 |
-
#: lib/loco-admin.php:440
|
| 112 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 113 |
-
msgstr ""
|
| 114 |
-
"Le modèle (fichier POT) a été mis à jour depuis la dernière modification du "
|
| 115 |
-
"fichier de traduction (fichier PO), exécutez Synchro pour mettre à jour ce "
|
| 116 |
-
"dernier"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:536
|
| 119 |
-
msgid "Bad file path"
|
| 120 |
-
msgstr "Mauvais chemin de fichier"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:783
|
| 123 |
-
msgid "Empty or invalid %s file"
|
| 124 |
-
msgstr "Le fichier %s est vide ou non-valide"
|
| 125 |
-
|
| 126 |
-
#: lib/loco-admin.php:787
|
| 127 |
-
msgid "%s file has no header"
|
| 128 |
-
msgstr "Le fichier %s n'a pas d'en-têtes"
|
| 129 |
-
|
| 130 |
-
#: lib/loco-admin.php:934
|
| 131 |
-
msgctxt "Add button"
|
| 132 |
-
msgid "New template"
|
| 133 |
-
msgstr "Nouveau modèle"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:953
|
| 136 |
-
msgctxt "Add button"
|
| 137 |
-
msgid "New language"
|
| 138 |
-
msgstr "Nouvelle langue"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:992
|
| 141 |
-
msgid "%s%% translated"
|
| 142 |
-
msgstr "%s%% traduit"
|
| 143 |
-
|
| 144 |
-
#: lib/loco-admin.php:992
|
| 145 |
-
msgid "1 string"
|
| 146 |
-
msgid_plural "%s strings"
|
| 147 |
-
msgstr[0] "1 chaîne de caractères"
|
| 148 |
-
msgstr[1] "%s chaînes de caractères"
|
| 149 |
-
|
| 150 |
-
#: lib/loco-admin.php:995
|
| 151 |
-
msgid "%s fuzzy"
|
| 152 |
-
msgstr "%s floues"
|
| 153 |
-
|
| 154 |
-
#: lib/loco-admin.php:998
|
| 155 |
-
msgid "%s untranslated"
|
| 156 |
-
msgstr "%s non traduites"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1044
|
| 159 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 160 |
-
msgstr ""
|
| 161 |
-
"Impossible de compiler le fichier binaire de traduction (fichier MO) avec le "
|
| 162 |
-
"compilateur intégré"
|
| 163 |
-
|
| 164 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 165 |
-
msgid "Loco, Translation Management"
|
| 166 |
-
msgstr "Loco, Gestionnaire de Traduction"
|
| 167 |
-
|
| 168 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 169 |
-
msgid "Manage translations"
|
| 170 |
-
msgstr "Traductions"
|
| 171 |
-
|
| 172 |
-
#: lib/loco-admin.php:1094
|
| 173 |
-
msgid "Translation options"
|
| 174 |
-
msgstr "Paramètres"
|
| 175 |
-
|
| 176 |
-
#: lib/loco-admin.php:1101
|
| 177 |
-
msgid "Loco Translate"
|
| 178 |
-
msgstr "Loco Translate"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 181 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 182 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 183 |
-
msgid "Settings"
|
| 184 |
-
msgstr "Paramètres"
|
| 185 |
-
|
| 186 |
-
#: lib/loco-admin.php:1149
|
| 187 |
-
msgid "File download failed"
|
| 188 |
-
msgstr "Le téléchargement du fichier a échoué"
|
| 189 |
-
|
| 190 |
-
#: lib/loco-admin.php:1159
|
| 191 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 192 |
-
msgstr ""
|
| 193 |
-
"La constante WPLANG est dépréciée et devrait être supprimée de wp-config.php"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-locales.php:77
|
| 196 |
-
msgid "Unknown language"
|
| 197 |
-
msgstr "Région inconnue"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 200 |
-
msgid "Some files not writable"
|
| 201 |
-
msgstr "Certains fichiers ne sont pas accessibles en écriture"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:484
|
| 204 |
-
msgid "Some files missing"
|
| 205 |
-
msgstr "Certains fichiers sont manquants"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 208 |
-
msgid "\"%s\" folder not writable"
|
| 209 |
-
msgstr "Le répertoire \"%s\" n'est pas accessible en écriture"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:515
|
| 212 |
-
msgid "POT file not writable"
|
| 213 |
-
msgstr "Le modèle (fichier POT) n'est pas accessible en écriture"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:520
|
| 216 |
-
msgid "PO file not writable"
|
| 217 |
-
msgstr "Le fichier de traduction (fichier PO) n'est pas accessible en écriture"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:522
|
| 220 |
-
msgid "MO file not writable"
|
| 221 |
-
msgstr ""
|
| 222 |
-
"Le fichier binaire de traduction (fichier MO) n'est pas accessible en "
|
| 223 |
-
"écriture"
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:522
|
| 226 |
-
msgid "MO file not found"
|
| 227 |
-
msgstr "Le fichier binaire de traduction (fichier MO) n'a pas été trouvé"
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:527
|
| 230 |
-
msgid "Folder not writable"
|
| 231 |
-
msgstr "Répertoire non accessible en écriture"
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:527
|
| 234 |
-
msgid "Folder not found"
|
| 235 |
-
msgstr "Répertoire non trouvé"
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:546
|
| 238 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 239 |
-
msgstr ""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 242 |
-
msgid "Loco has guessed \"%s\""
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: lib/loco-packages.php:551
|
| 246 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 247 |
-
msgstr ""
|
| 248 |
-
|
| 249 |
-
#: lib/loco-packages.php:556
|
| 250 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 251 |
-
msgstr ""
|
| 252 |
-
|
| 253 |
-
#: lib/loco-packages.php:559
|
| 254 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 255 |
-
msgstr ""
|
| 256 |
-
|
| 257 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 258 |
-
msgid "User does not have permission to manage translations"
|
| 259 |
-
msgstr ""
|
| 260 |
-
"L'utilisateur n'a pas les droits d'accès nécessaires pour gérer les "
|
| 261 |
-
"traductions"
|
| 262 |
-
|
| 263 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 264 |
-
msgid "Invalid data posted to server"
|
| 265 |
-
msgstr "Données non valides envoyées au serveur"
|
| 266 |
-
|
| 267 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 268 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 269 |
-
msgstr ""
|
| 270 |
-
"Impossible de compiler le fichier binaire de traduction (fichier MO) avec "
|
| 271 |
-
"%s, vérifiez vos paramètres"
|
| 272 |
-
|
| 273 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 274 |
-
msgid "Package not found called %s"
|
| 275 |
-
msgstr "Le paquetage %s n'a pas été trouvé"
|
| 276 |
-
|
| 277 |
-
#: php/loco-posave.php:58
|
| 278 |
-
msgid ""
|
| 279 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 280 |
-
"backups in settings"
|
| 281 |
-
msgstr ""
|
| 282 |
-
"Le serveur web ne peut pas créer de sauvegardes dans \"%s\". Résolvez les "
|
| 283 |
-
"droits d'accès au fichier ou désactivez les sauvegardes dans les paramètres"
|
| 284 |
-
|
| 285 |
-
#: php/loco-posave.php:66
|
| 286 |
-
msgid ""
|
| 287 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 288 |
-
"create it manually."
|
| 289 |
-
msgstr ""
|
| 290 |
-
"Le serveur web ne peut pas créer \"%s\" dans \"%s\". Résolvez les droits "
|
| 291 |
-
"d'accès au fichier ou créez le manuellement."
|
| 292 |
-
|
| 293 |
-
#: php/loco-posave.php:69
|
| 294 |
-
msgid ""
|
| 295 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 296 |
-
"or use the download function."
|
| 297 |
-
msgstr ""
|
| 298 |
-
"Le serveur web ne peut pas créer de fichiers dans \"%s\". Résolvez les "
|
| 299 |
-
"droits d'accès au fichier ou utilisez la fonction Télécharger"
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:81
|
| 302 |
-
msgid ""
|
| 303 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 304 |
-
"and copy to \"%s/%s\"."
|
| 305 |
-
msgstr ""
|
| 306 |
-
"Le fichier %s n'est pas accessible en écriture par le serveur web. Résolvez "
|
| 307 |
-
"les droits d'accès au fichier ou téléchargez puis copiez dans \"%s/%s\"."
|
| 308 |
-
|
| 309 |
-
#: php/loco-posave.php:102
|
| 310 |
-
msgid "Cannot create MO file"
|
| 311 |
-
msgstr "Impossible de créer le fichier binaire de traduction (fichier MO)"
|
| 312 |
-
|
| 313 |
-
#: php/loco-posave.php:105
|
| 314 |
-
msgid "Cannot overwrite MO file"
|
| 315 |
-
msgstr "Impossible de réécrire le fichier binaire de traduction (fichier MO)"
|
| 316 |
-
|
| 317 |
-
#: php/loco-posave.php:131
|
| 318 |
-
msgid "Failed to write MO file"
|
| 319 |
-
msgstr "Impossible d'écrire dans le fichier binaire de traduction (fichier MO)"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 322 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 323 |
-
#: tpl/admin-root.tpl.php:6
|
| 324 |
-
msgid "Packages"
|
| 325 |
-
msgstr "Paquetages"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 328 |
-
msgid "File check"
|
| 329 |
-
msgstr "Vérification de fichier"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 332 |
-
msgid "File system permissions for %s"
|
| 333 |
-
msgstr "Droits d'accès de %s"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 336 |
-
msgid "Other potential issues with %s"
|
| 337 |
-
msgstr ""
|
| 338 |
-
|
| 339 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 340 |
-
msgid "Back"
|
| 341 |
-
msgstr "Retour"
|
| 342 |
-
|
| 343 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 344 |
-
msgid "Get help"
|
| 345 |
-
msgstr "Demander de l'aide"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:11
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Package details"
|
| 350 |
-
msgstr "Détails du paquetage"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:14
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "Translations (PO)"
|
| 355 |
-
msgstr "Traductions (PO)"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:17
|
| 358 |
-
msgctxt "Table header"
|
| 359 |
-
msgid "Template (POT)"
|
| 360 |
-
msgstr "Modèles (POT)"
|
| 361 |
-
|
| 362 |
-
#: tpl/admin-list.tpl.php:20
|
| 363 |
-
msgctxt "Table header"
|
| 364 |
-
msgid "File permissions"
|
| 365 |
-
msgstr "Droits d'accès"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-list.tpl.php:40
|
| 368 |
-
msgid "Extends: %s"
|
| 369 |
-
msgstr "Étend : %s"
|
| 370 |
-
|
| 371 |
-
#: tpl/admin-list.tpl.php:44
|
| 372 |
-
msgid "1 language"
|
| 373 |
-
msgid_plural "%u languages"
|
| 374 |
-
msgstr[0] "1 langue"
|
| 375 |
-
msgstr[1] "%u langues"
|
| 376 |
-
|
| 377 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 378 |
-
msgctxt "Modified time"
|
| 379 |
-
msgid "Updated"
|
| 380 |
-
msgstr "Mise à jour"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-nav.tpl.php:26
|
| 383 |
-
msgid "Powered by"
|
| 384 |
-
msgstr "Propulsé par"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-nav.tpl.php:32
|
| 387 |
-
msgid "Loco may not work as expected"
|
| 388 |
-
msgstr "Loco peut ne pas fonctionner correctement"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:18
|
| 391 |
-
msgid "Configure Loco Translate"
|
| 392 |
-
msgstr "Paramétrez Loco Translate"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 395 |
-
msgid "Compiling MO files"
|
| 396 |
-
msgstr "Compilation des fichiers binaires de traduction (fichiers MO)"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:36
|
| 399 |
-
msgid "Use built-in MO compiler."
|
| 400 |
-
msgstr "Utiliser le compilateur intégré."
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:42
|
| 403 |
-
msgid "Use external command:"
|
| 404 |
-
msgstr "Utiliser une commande personnalisée :"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:47
|
| 407 |
-
msgid "Enter path to msgfmt on server"
|
| 408 |
-
msgstr "Entrez le chemin d'accès à msgfmt sur le serveur"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:54
|
| 411 |
-
msgid "Generate hash tables"
|
| 412 |
-
msgstr "Générer les tables de hachage"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:60
|
| 415 |
-
msgid "Include Fuzzy strings"
|
| 416 |
-
msgstr ""
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 419 |
-
msgid "Backing up PO files"
|
| 420 |
-
msgstr "Sauvegarde des fichiers de traduction (fichiers PO)"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-opts.tpl.php:75
|
| 423 |
-
msgid "Number of backups to keep of each file:"
|
| 424 |
-
msgstr "Nombre de sauvegardes à conserver pour chaque fichier :"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 427 |
-
msgid "Experimental features"
|
| 428 |
-
msgstr "Fonctionnalités expérimentales"
|
| 429 |
-
|
| 430 |
-
#: tpl/admin-opts.tpl.php:92
|
| 431 |
-
msgid "Enable WordPress core translations"
|
| 432 |
-
msgstr "Activer la traduction des fichiers principaux de WordPress"
|
| 433 |
-
|
| 434 |
-
#: tpl/admin-opts.tpl.php:101
|
| 435 |
-
msgid "Save settings"
|
| 436 |
-
msgstr "Enregistrer les paramètres"
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 439 |
-
msgid "Template file"
|
| 440 |
-
msgstr "Modèle"
|
| 441 |
-
|
| 442 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 443 |
-
msgctxt "Dropdown label"
|
| 444 |
-
msgid "Switch to..."
|
| 445 |
-
msgstr "Permuter avec…"
|
| 446 |
-
|
| 447 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 448 |
-
msgid "never"
|
| 449 |
-
msgstr "jamais"
|
| 450 |
-
|
| 451 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 452 |
-
msgctxt "Editor button"
|
| 453 |
-
msgid "Save"
|
| 454 |
-
msgstr "Sauvegarder"
|
| 455 |
-
|
| 456 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 457 |
-
msgctxt "Editor button"
|
| 458 |
-
msgid "Download"
|
| 459 |
-
msgstr "Télécharger"
|
| 460 |
-
|
| 461 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 462 |
-
msgctxt "Editor button"
|
| 463 |
-
msgid "Sync"
|
| 464 |
-
msgstr "Synchro"
|
| 465 |
-
|
| 466 |
-
# a
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Revert"
|
| 470 |
-
msgstr "Rétablir"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Add"
|
| 475 |
-
msgstr "Ajouter"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 478 |
-
msgctxt "Editor button"
|
| 479 |
-
msgid "Del"
|
| 480 |
-
msgstr "Supprimer"
|
| 481 |
-
|
| 482 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 483 |
-
msgctxt "Editor button"
|
| 484 |
-
msgid "Fuzzy"
|
| 485 |
-
msgstr "Flou"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 488 |
-
msgid "Filter translations"
|
| 489 |
-
msgstr "Filtrer les traductions"
|
| 490 |
-
|
| 491 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 492 |
-
msgctxt "Editor button"
|
| 493 |
-
msgid "Help"
|
| 494 |
-
msgstr "Aide"
|
| 495 |
-
|
| 496 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 497 |
-
msgid "Initialize new translations in %s"
|
| 498 |
-
msgstr "Créer une nouvelle traduction pour %s"
|
| 499 |
-
|
| 500 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 501 |
-
msgid "Select from common languages"
|
| 502 |
-
msgstr "Choisir parmi les langues courantes"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 505 |
-
msgctxt "Form label"
|
| 506 |
-
msgid "or enter any language code"
|
| 507 |
-
msgstr "ou choisir un code régional"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 510 |
-
msgctxt "Form label"
|
| 511 |
-
msgid "create in <code>%s</code>"
|
| 512 |
-
msgstr "créer dans <code>%s</code>"
|
| 513 |
-
|
| 514 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 515 |
-
msgctxt "Form label"
|
| 516 |
-
msgid "create in global languages directory"
|
| 517 |
-
msgstr "créer dans le répertoire global des langues"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 520 |
-
msgctxt "Submit button"
|
| 521 |
-
msgid "Start translating"
|
| 522 |
-
msgstr "Traduire"
|
| 523 |
-
|
| 524 |
-
#: tpl/admin-root.tpl.php:18
|
| 525 |
-
msgid "New version available"
|
| 526 |
-
msgstr "Nouvelle version disponible"
|
| 527 |
-
|
| 528 |
-
#: tpl/admin-root.tpl.php:21
|
| 529 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 530 |
-
msgstr "Passer à la version %s de Loco Translate"
|
| 531 |
-
|
| 532 |
-
#: tpl/admin-root.tpl.php:31
|
| 533 |
-
msgid "Select a plugin or theme to translate"
|
| 534 |
-
msgstr "Choisissez une extension ou un thème à traduire"
|
| 535 |
-
|
| 536 |
-
#: tpl/admin-root.tpl.php:40
|
| 537 |
-
msgctxt "Package list header"
|
| 538 |
-
msgid "Themes"
|
| 539 |
-
msgstr "Thèmes"
|
| 540 |
-
|
| 541 |
-
#: tpl/admin-root.tpl.php:53
|
| 542 |
-
msgctxt "Package list header"
|
| 543 |
-
msgid "Plugins"
|
| 544 |
-
msgstr "Extensions"
|
| 545 |
-
|
| 546 |
-
#: tpl/admin-root.tpl.php:66
|
| 547 |
-
msgctxt "Package list header"
|
| 548 |
-
msgid "Core"
|
| 549 |
-
msgstr "Fichiers principaux"
|
| 550 |
-
|
| 551 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 552 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 553 |
-
msgid ""
|
| 554 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 555 |
-
"install it"
|
| 556 |
-
msgstr ""
|
| 557 |
-
|
| 558 |
-
#: pub/js/lang/dummy.php:8
|
| 559 |
-
msgid "Unknown error"
|
| 560 |
-
msgstr "Erreur inconnue"
|
| 561 |
-
|
| 562 |
-
#: pub/js/lang/dummy.php:10
|
| 563 |
-
msgid "PO file saved"
|
| 564 |
-
msgstr "Fichier de traduction (fichier PO) sauvegardé"
|
| 565 |
-
|
| 566 |
-
#: pub/js/lang/dummy.php:12
|
| 567 |
-
msgid "and MO file compiled"
|
| 568 |
-
msgstr "et fichier binaire de traduction (fichier MO) compilé"
|
| 569 |
-
|
| 570 |
-
#: pub/js/lang/dummy.php:15
|
| 571 |
-
msgid "Merged from %s"
|
| 572 |
-
msgstr "Fusionné avec %s"
|
| 573 |
-
|
| 574 |
-
#: pub/js/lang/dummy.php:17
|
| 575 |
-
msgid "Merged from source code"
|
| 576 |
-
msgstr "Fusionné depuis le code source"
|
| 577 |
-
|
| 578 |
-
#: pub/js/lang/dummy.php:19
|
| 579 |
-
msgid "Already up to date with %s"
|
| 580 |
-
msgstr "Déjà à jour avec %s"
|
| 581 |
-
|
| 582 |
-
#: pub/js/lang/dummy.php:21
|
| 583 |
-
msgid "Already up to date with source code"
|
| 584 |
-
msgstr "Déjà à jour avec le code source"
|
| 585 |
-
|
| 586 |
-
#: pub/js/lang/dummy.php:23
|
| 587 |
-
msgid "1 new string added"
|
| 588 |
-
msgid_plural "%s new strings added"
|
| 589 |
-
msgstr[0] "1 nouvelle chaîne de caractères a été ajoutée"
|
| 590 |
-
msgstr[1] "%s nouvelles chaînes de caractères ont été ajoutées"
|
| 591 |
-
|
| 592 |
-
#: pub/js/lang/dummy.php:25
|
| 593 |
-
msgid "1 obsolete string removed"
|
| 594 |
-
msgid_plural "%s obsolete strings removed"
|
| 595 |
-
msgstr[0] "1 chaîne de caractères obsolète a été supprimée"
|
| 596 |
-
msgstr[1] "%s chaînes de caractères obsolètes ont été supprimées"
|
| 597 |
-
|
| 598 |
-
#: pub/js/lang/dummy.php:27
|
| 599 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 600 |
-
msgstr ""
|
| 601 |
-
"Vos modifications seront perdues si vous ne sauvegardez pas avant de "
|
| 602 |
-
"continuer"
|
| 603 |
-
|
| 604 |
-
#. label for the window pane holding native translation
|
| 605 |
-
#: pub/js/lang/dummy.php:35
|
| 606 |
-
msgctxt "Editor pane"
|
| 607 |
-
msgid "Source text"
|
| 608 |
-
msgstr "Source"
|
| 609 |
-
|
| 610 |
-
#. where %s is the language, e.g French translation
|
| 611 |
-
#: pub/js/lang/dummy.php:38
|
| 612 |
-
msgctxt "Editor pane"
|
| 613 |
-
msgid "%s translation"
|
| 614 |
-
msgstr "%s traduction"
|
| 615 |
-
|
| 616 |
-
#. label for the window pane holding translator comments
|
| 617 |
-
#: pub/js/lang/dummy.php:41
|
| 618 |
-
msgctxt "Editor pane"
|
| 619 |
-
msgid "Comments"
|
| 620 |
-
msgstr "Commentaires"
|
| 621 |
-
|
| 622 |
-
#. label for the window pane holding message context
|
| 623 |
-
#: pub/js/lang/dummy.php:44
|
| 624 |
-
msgctxt "Editor pane"
|
| 625 |
-
msgid "Context"
|
| 626 |
-
msgstr "Contexte"
|
| 627 |
-
|
| 628 |
-
#: pub/js/lang/dummy.php:52
|
| 629 |
-
msgid "Translation"
|
| 630 |
-
msgstr "Traduction"
|
| 631 |
-
|
| 632 |
-
#: pub/js/lang/dummy.php:54
|
| 633 |
-
msgid "No source files in this package, nothing to sync"
|
| 634 |
-
msgstr "Aucun fichier source dans ce paquetage, il n'y a rien à synchroniser"
|
| 635 |
-
|
| 636 |
-
#: pub/js/lang/dummy.php:56
|
| 637 |
-
msgid "No strings could be extracted from source files"
|
| 638 |
-
msgstr "Aucune chaîne de caractères n'a pu être extraite des fichiers sources"
|
| 639 |
-
|
| 640 |
-
#. Description of the plugin
|
| 641 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 642 |
-
msgstr ""
|
| 643 |
-
|
| 644 |
-
#. URI of the plugin
|
| 645 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 646 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 647 |
-
|
| 648 |
-
#. Author of the plugin
|
| 649 |
-
msgid "Tim Whitlock"
|
| 650 |
-
msgstr "Tim Whitlock"
|
| 651 |
-
|
| 652 |
-
#. Author URI of the plugin
|
| 653 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 654 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-id_ID.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-id_ID.po
DELETED
|
@@ -1,639 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:18:15 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Indonesian\n"
|
| 9 |
-
"Language: id-ID\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=1; plural=0\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: id_ID\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Kesalahan"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Peringatan"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "Oke"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Akses ditolak"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Setelan disimpan"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Berkas PO baru"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"Berkas PO digunakan sebagai template. Berkas ini akan diubah namanya menjadi "
|
| 61 |
-
"%s saat disimpan"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Anda harus menentukan locale valid untuk berkas PO baru"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Tidak ada string yang dapat diterjemahkan"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Berkas PO tidak dapat dibuat"
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "Berkas PO untuk locale %s sudah ada"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"Berkas tidak dapat dibuat otomatis. Perbaiki hak akses atau gunakan Unduh "
|
| 85 |
-
"alih-alih Simpan"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "Berkas %s kosong"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "Jalankan Sinkronisasi untuk memperbarui dari kode program"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "Tidak ada string yang dapat diambil dari kode program"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "Jalankan Sinkronisasi untuk mengambil dari %s"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr "Kode program telah diubah; jalankan Sinkronisasi untuk memperbarui POT"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"POT telah diubah sejak berkas PO terakhir disimpan; jalankan Sinkronisasi "
|
| 111 |
-
"untuk memperbarui POT"
|
| 112 |
-
|
| 113 |
-
#: lib/loco-admin.php:536
|
| 114 |
-
msgid "Bad file path"
|
| 115 |
-
msgstr "Folder berkas salah"
|
| 116 |
-
|
| 117 |
-
#: lib/loco-admin.php:783
|
| 118 |
-
msgid "Empty or invalid %s file"
|
| 119 |
-
msgstr "Berkas %s kosong atau tidak valid"
|
| 120 |
-
|
| 121 |
-
#: lib/loco-admin.php:787
|
| 122 |
-
msgid "%s file has no header"
|
| 123 |
-
msgstr "%s berkas tidak memiliki header"
|
| 124 |
-
|
| 125 |
-
#: lib/loco-admin.php:934
|
| 126 |
-
msgctxt "Add button"
|
| 127 |
-
msgid "New template"
|
| 128 |
-
msgstr "Template baru"
|
| 129 |
-
|
| 130 |
-
#: lib/loco-admin.php:953
|
| 131 |
-
msgctxt "Add button"
|
| 132 |
-
msgid "New language"
|
| 133 |
-
msgstr "Bahasa baru"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:992
|
| 136 |
-
msgid "%s%% translated"
|
| 137 |
-
msgstr "%s%% diterjemahkan"
|
| 138 |
-
|
| 139 |
-
#: lib/loco-admin.php:992
|
| 140 |
-
msgid "1 string"
|
| 141 |
-
msgid_plural "%s strings"
|
| 142 |
-
msgstr[0] "1 string"
|
| 143 |
-
msgstr[1] ""
|
| 144 |
-
|
| 145 |
-
#: lib/loco-admin.php:995
|
| 146 |
-
msgid "%s fuzzy"
|
| 147 |
-
msgstr "%s fuzzy"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:998
|
| 150 |
-
msgid "%s untranslated"
|
| 151 |
-
msgstr "%s%% belum diterjemahkan"
|
| 152 |
-
|
| 153 |
-
#: lib/loco-admin.php:1044
|
| 154 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 155 |
-
msgstr "Gagal mengompilasi berkas MO dengan kompilator bawaan"
|
| 156 |
-
|
| 157 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 158 |
-
msgid "Loco, Translation Management"
|
| 159 |
-
msgstr "Loco, Pengelola Terjemahan"
|
| 160 |
-
|
| 161 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 162 |
-
msgid "Manage translations"
|
| 163 |
-
msgstr "Kelola terjemahan"
|
| 164 |
-
|
| 165 |
-
#: lib/loco-admin.php:1094
|
| 166 |
-
msgid "Translation options"
|
| 167 |
-
msgstr "Opsi terjemahan"
|
| 168 |
-
|
| 169 |
-
#: lib/loco-admin.php:1101
|
| 170 |
-
msgid "Loco Translate"
|
| 171 |
-
msgstr "Loco Terjemahan"
|
| 172 |
-
|
| 173 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 174 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 175 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 176 |
-
msgid "Settings"
|
| 177 |
-
msgstr "Setelan"
|
| 178 |
-
|
| 179 |
-
#: lib/loco-admin.php:1149
|
| 180 |
-
msgid "File download failed"
|
| 181 |
-
msgstr "Gagal mengunduh berkas"
|
| 182 |
-
|
| 183 |
-
#: lib/loco-admin.php:1159
|
| 184 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 185 |
-
msgstr ""
|
| 186 |
-
|
| 187 |
-
#: lib/loco-locales.php:77
|
| 188 |
-
msgid "Unknown language"
|
| 189 |
-
msgstr "Bahasa tidak dikenal"
|
| 190 |
-
|
| 191 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 192 |
-
msgid "Some files not writable"
|
| 193 |
-
msgstr "Beberapa berkas tidak dapat ditulis"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-packages.php:484
|
| 196 |
-
msgid "Some files missing"
|
| 197 |
-
msgstr "Beberapa berkas hilang"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 200 |
-
msgid "\"%s\" folder not writable"
|
| 201 |
-
msgstr "Folder \"%s\" tidak dapat ditulisi"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:515
|
| 204 |
-
msgid "POT file not writable"
|
| 205 |
-
msgstr "Berkas POT tidak dapat ditulis"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:520
|
| 208 |
-
msgid "PO file not writable"
|
| 209 |
-
msgstr "Berkas PO tidak dapat ditulis"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:522
|
| 212 |
-
msgid "MO file not writable"
|
| 213 |
-
msgstr "Berkas MO tidak dapat ditulis"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:522
|
| 216 |
-
msgid "MO file not found"
|
| 217 |
-
msgstr "Berkas MO tidak ditemukan"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:527
|
| 220 |
-
msgid "Folder not writable"
|
| 221 |
-
msgstr "Folder tidak dapat ditulisi"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:527
|
| 224 |
-
msgid "Folder not found"
|
| 225 |
-
msgstr "Folder tidak ditemukan"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:546
|
| 228 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 229 |
-
msgstr ""
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 232 |
-
msgid "Loco has guessed \"%s\""
|
| 233 |
-
msgstr ""
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:551
|
| 236 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 237 |
-
msgstr ""
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:556
|
| 240 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 241 |
-
msgstr ""
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:559
|
| 244 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 245 |
-
msgstr ""
|
| 246 |
-
|
| 247 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 248 |
-
msgid "User does not have permission to manage translations"
|
| 249 |
-
msgstr "Pengguna tidak memiliki hak akses untuk mengelola terjemahan"
|
| 250 |
-
|
| 251 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 252 |
-
msgid "Invalid data posted to server"
|
| 253 |
-
msgstr "Data yang dikirim ke server tidak valid"
|
| 254 |
-
|
| 255 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 256 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 257 |
-
msgstr "Gagal mengompilasi berkas MO dengan %s; periksa setelan Anda"
|
| 258 |
-
|
| 259 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 260 |
-
msgid "Package not found called %s"
|
| 261 |
-
msgstr "Paket %s tidak ditemukan"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:58
|
| 264 |
-
msgid ""
|
| 265 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 266 |
-
"backups in settings"
|
| 267 |
-
msgstr ""
|
| 268 |
-
"Tidak dapat membuat cadangan di \"%s\". Perbaiki hak akses atau matikan "
|
| 269 |
-
"pencadangan di setelan."
|
| 270 |
-
|
| 271 |
-
#: php/loco-posave.php:66
|
| 272 |
-
msgid ""
|
| 273 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 274 |
-
"create it manually."
|
| 275 |
-
msgstr ""
|
| 276 |
-
"Tidak dapat membuat direktori \"%s\" di \"%s\". Perbaiki hak akses atau buat "
|
| 277 |
-
"secara manual."
|
| 278 |
-
|
| 279 |
-
#: php/loco-posave.php:69
|
| 280 |
-
msgid ""
|
| 281 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 282 |
-
"or use the download function."
|
| 283 |
-
msgstr ""
|
| 284 |
-
"Tidak dapat membuat berkas di direktori \"%s\". Perbaiki hak akses atau "
|
| 285 |
-
"gunakan fungsi unduh."
|
| 286 |
-
|
| 287 |
-
#: php/loco-posave.php:81
|
| 288 |
-
msgid ""
|
| 289 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 290 |
-
"and copy to \"%s/%s\"."
|
| 291 |
-
msgstr ""
|
| 292 |
-
"Berkas %s tidak dapat ditulis. Perbaiki hak akses atau unduh dan salin ke "
|
| 293 |
-
"\"%s/%s\"."
|
| 294 |
-
|
| 295 |
-
#: php/loco-posave.php:102
|
| 296 |
-
msgid "Cannot create MO file"
|
| 297 |
-
msgstr "Berkas MO tidak dapat dibuat"
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:105
|
| 300 |
-
msgid "Cannot overwrite MO file"
|
| 301 |
-
msgstr "Berkas MO tidak dapat ditimpa"
|
| 302 |
-
|
| 303 |
-
#: php/loco-posave.php:131
|
| 304 |
-
msgid "Failed to write MO file"
|
| 305 |
-
msgstr "Gagal menulis berkas MO"
|
| 306 |
-
|
| 307 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 308 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 309 |
-
#: tpl/admin-root.tpl.php:6
|
| 310 |
-
msgid "Packages"
|
| 311 |
-
msgstr "Paket"
|
| 312 |
-
|
| 313 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 314 |
-
msgid "File check"
|
| 315 |
-
msgstr "Pemeriksaan berkas"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 318 |
-
msgid "File system permissions for %s"
|
| 319 |
-
msgstr "Hak akses sistem berkas untuk %s"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 322 |
-
msgid "Other potential issues with %s"
|
| 323 |
-
msgstr ""
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 326 |
-
msgid "Back"
|
| 327 |
-
msgstr "Kembali"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 330 |
-
msgid "Get help"
|
| 331 |
-
msgstr "Dapatkan bantuan"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-list.tpl.php:11
|
| 334 |
-
msgctxt "Table header"
|
| 335 |
-
msgid "Package details"
|
| 336 |
-
msgstr "Detail paket"
|
| 337 |
-
|
| 338 |
-
#: tpl/admin-list.tpl.php:14
|
| 339 |
-
msgctxt "Table header"
|
| 340 |
-
msgid "Translations (PO)"
|
| 341 |
-
msgstr "Terjemahan (PO)"
|
| 342 |
-
|
| 343 |
-
#: tpl/admin-list.tpl.php:17
|
| 344 |
-
msgctxt "Table header"
|
| 345 |
-
msgid "Template (POT)"
|
| 346 |
-
msgstr "Template (POT)"
|
| 347 |
-
|
| 348 |
-
#: tpl/admin-list.tpl.php:20
|
| 349 |
-
msgctxt "Table header"
|
| 350 |
-
msgid "File permissions"
|
| 351 |
-
msgstr "Hak akses"
|
| 352 |
-
|
| 353 |
-
#: tpl/admin-list.tpl.php:40
|
| 354 |
-
msgid "Extends: %s"
|
| 355 |
-
msgstr ""
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:44
|
| 358 |
-
msgid "1 language"
|
| 359 |
-
msgid_plural "%u languages"
|
| 360 |
-
msgstr[0] "1 bahasa"
|
| 361 |
-
msgstr[1] "%u bahasa"
|
| 362 |
-
|
| 363 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 364 |
-
msgctxt "Modified time"
|
| 365 |
-
msgid "Updated"
|
| 366 |
-
msgstr "Diperbarui"
|
| 367 |
-
|
| 368 |
-
#: tpl/admin-nav.tpl.php:26
|
| 369 |
-
msgid "Powered by"
|
| 370 |
-
msgstr "Didukung oleh"
|
| 371 |
-
|
| 372 |
-
#: tpl/admin-nav.tpl.php:32
|
| 373 |
-
msgid "Loco may not work as expected"
|
| 374 |
-
msgstr "Loco mungkin tidak bekerja sesuai harapan"
|
| 375 |
-
|
| 376 |
-
#: tpl/admin-opts.tpl.php:18
|
| 377 |
-
msgid "Configure Loco Translate"
|
| 378 |
-
msgstr "Konfigurasikan Loco Translate"
|
| 379 |
-
|
| 380 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 381 |
-
msgid "Compiling MO files"
|
| 382 |
-
msgstr "Kompilasi berkas MO"
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-opts.tpl.php:36
|
| 385 |
-
msgid "Use built-in MO compiler."
|
| 386 |
-
msgstr "Gunakan kompiler bawaan"
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-opts.tpl.php:42
|
| 389 |
-
msgid "Use external command:"
|
| 390 |
-
msgstr "Gunakan perintah eksternal:"
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:47
|
| 393 |
-
msgid "Enter path to msgfmt on server"
|
| 394 |
-
msgstr "Masukkan folder msgfmt pada server"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:54
|
| 397 |
-
msgid "Generate hash tables"
|
| 398 |
-
msgstr "Buat tabel hash"
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:60
|
| 401 |
-
msgid "Include Fuzzy strings"
|
| 402 |
-
msgstr ""
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 405 |
-
msgid "Backing up PO files"
|
| 406 |
-
msgstr "Pencadangan berkas PO"
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:75
|
| 409 |
-
msgid "Number of backups to keep of each file:"
|
| 410 |
-
msgstr "Jumlah cadangan untuk tiap berkas:"
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 413 |
-
msgid "Experimental features"
|
| 414 |
-
msgstr "Fitur eksperimen"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:92
|
| 417 |
-
msgid "Enable WordPress core translations"
|
| 418 |
-
msgstr "Aktifkan penerjemahan inti WordPress"
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-opts.tpl.php:101
|
| 421 |
-
msgid "Save settings"
|
| 422 |
-
msgstr "Simpan setelan"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 425 |
-
msgid "Template file"
|
| 426 |
-
msgstr "Berkas template"
|
| 427 |
-
|
| 428 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 429 |
-
msgctxt "Dropdown label"
|
| 430 |
-
msgid "Switch to..."
|
| 431 |
-
msgstr "Beralih ke..."
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 434 |
-
msgid "never"
|
| 435 |
-
msgstr "tidak pernah"
|
| 436 |
-
|
| 437 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 438 |
-
msgctxt "Editor button"
|
| 439 |
-
msgid "Save"
|
| 440 |
-
msgstr "Simpan"
|
| 441 |
-
|
| 442 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 443 |
-
msgctxt "Editor button"
|
| 444 |
-
msgid "Download"
|
| 445 |
-
msgstr "Unduh"
|
| 446 |
-
|
| 447 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 448 |
-
msgctxt "Editor button"
|
| 449 |
-
msgid "Sync"
|
| 450 |
-
msgstr "Sinkronisasi"
|
| 451 |
-
|
| 452 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 453 |
-
msgctxt "Editor button"
|
| 454 |
-
msgid "Revert"
|
| 455 |
-
msgstr "Kembalikan"
|
| 456 |
-
|
| 457 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 458 |
-
msgctxt "Editor button"
|
| 459 |
-
msgid "Add"
|
| 460 |
-
msgstr "Tambah"
|
| 461 |
-
|
| 462 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 463 |
-
msgctxt "Editor button"
|
| 464 |
-
msgid "Del"
|
| 465 |
-
msgstr "Hapus"
|
| 466 |
-
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Fuzzy"
|
| 470 |
-
msgstr "Fuzzy"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 473 |
-
msgid "Filter translations"
|
| 474 |
-
msgstr "Saring terjemahan"
|
| 475 |
-
|
| 476 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 477 |
-
msgctxt "Editor button"
|
| 478 |
-
msgid "Help"
|
| 479 |
-
msgstr "Bantuan"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 482 |
-
msgid "Initialize new translations in %s"
|
| 483 |
-
msgstr "Buat terjemahan baru di %s"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 486 |
-
msgid "Select from common languages"
|
| 487 |
-
msgstr "Pilih dari bahasa yang umum"
|
| 488 |
-
|
| 489 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 490 |
-
msgctxt "Form label"
|
| 491 |
-
msgid "or enter any language code"
|
| 492 |
-
msgstr "atau masukkan suatu kode bahasa"
|
| 493 |
-
|
| 494 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 495 |
-
msgctxt "Form label"
|
| 496 |
-
msgid "create in <code>%s</code>"
|
| 497 |
-
msgstr "buat di <code>%s</code>"
|
| 498 |
-
|
| 499 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 500 |
-
msgctxt "Form label"
|
| 501 |
-
msgid "create in global languages directory"
|
| 502 |
-
msgstr "buat di direktori bahasa global"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 505 |
-
msgctxt "Submit button"
|
| 506 |
-
msgid "Start translating"
|
| 507 |
-
msgstr "Mulai penerjemahan"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-root.tpl.php:18
|
| 510 |
-
msgid "New version available"
|
| 511 |
-
msgstr "Ada versi baru"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:21
|
| 514 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 515 |
-
msgstr "Tingkatkan Loco Translate kepada versi %s"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:31
|
| 518 |
-
msgid "Select a plugin or theme to translate"
|
| 519 |
-
msgstr "Pilih plugin atau tema untuk diterjemahkan"
|
| 520 |
-
|
| 521 |
-
#: tpl/admin-root.tpl.php:40
|
| 522 |
-
msgctxt "Package list header"
|
| 523 |
-
msgid "Themes"
|
| 524 |
-
msgstr "Tema"
|
| 525 |
-
|
| 526 |
-
#: tpl/admin-root.tpl.php:53
|
| 527 |
-
msgctxt "Package list header"
|
| 528 |
-
msgid "Plugins"
|
| 529 |
-
msgstr "Plugin"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-root.tpl.php:66
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Core"
|
| 534 |
-
msgstr "Inti"
|
| 535 |
-
|
| 536 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 537 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 538 |
-
msgid ""
|
| 539 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 540 |
-
"install it"
|
| 541 |
-
msgstr ""
|
| 542 |
-
|
| 543 |
-
#: pub/js/lang/dummy.php:8
|
| 544 |
-
msgid "Unknown error"
|
| 545 |
-
msgstr "Kesalahan "
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:10
|
| 548 |
-
msgid "PO file saved"
|
| 549 |
-
msgstr "Berkas PO disimpan"
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:12
|
| 552 |
-
msgid "and MO file compiled"
|
| 553 |
-
msgstr "dan berkas MO dikompilasi"
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:15
|
| 556 |
-
msgid "Merged from %s"
|
| 557 |
-
msgstr "Digabungkan dari %s"
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:17
|
| 560 |
-
msgid "Merged from source code"
|
| 561 |
-
msgstr "Digabungkan dari kode program"
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:19
|
| 564 |
-
msgid "Already up to date with %s"
|
| 565 |
-
msgstr "Sudah selaras dengan %s"
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:21
|
| 568 |
-
msgid "Already up to date with source code"
|
| 569 |
-
msgstr "Sudah selaras dengan kode program"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:23
|
| 572 |
-
msgid "1 new string added"
|
| 573 |
-
msgid_plural "%s new strings added"
|
| 574 |
-
msgstr[0] "1 string baru ditambahkan"
|
| 575 |
-
msgstr[1] "%s string baru ditambahkan"
|
| 576 |
-
|
| 577 |
-
#: pub/js/lang/dummy.php:25
|
| 578 |
-
msgid "1 obsolete string removed"
|
| 579 |
-
msgid_plural "%s obsolete strings removed"
|
| 580 |
-
msgstr[0] "1 string usang dihapus"
|
| 581 |
-
msgstr[1] "%s string usang dihapus"
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:27
|
| 584 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 585 |
-
msgstr "Perubahan akan dibuang bila melanjutkan tanpa menyimpan"
|
| 586 |
-
|
| 587 |
-
#. label for the window pane holding native translation
|
| 588 |
-
#: pub/js/lang/dummy.php:35
|
| 589 |
-
msgctxt "Editor pane"
|
| 590 |
-
msgid "Source text"
|
| 591 |
-
msgstr "Teks sumber"
|
| 592 |
-
|
| 593 |
-
#. where %s is the language, e.g French translation
|
| 594 |
-
#: pub/js/lang/dummy.php:38
|
| 595 |
-
msgctxt "Editor pane"
|
| 596 |
-
msgid "%s translation"
|
| 597 |
-
msgstr "%s terjemahan"
|
| 598 |
-
|
| 599 |
-
#. label for the window pane holding translator comments
|
| 600 |
-
#: pub/js/lang/dummy.php:41
|
| 601 |
-
msgctxt "Editor pane"
|
| 602 |
-
msgid "Comments"
|
| 603 |
-
msgstr "Komentar"
|
| 604 |
-
|
| 605 |
-
#. label for the window pane holding message context
|
| 606 |
-
#: pub/js/lang/dummy.php:44
|
| 607 |
-
msgctxt "Editor pane"
|
| 608 |
-
msgid "Context"
|
| 609 |
-
msgstr "Konteks"
|
| 610 |
-
|
| 611 |
-
#: pub/js/lang/dummy.php:52
|
| 612 |
-
msgid "Translation"
|
| 613 |
-
msgstr "Terjemahan"
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:54
|
| 616 |
-
msgid "No source files in this package, nothing to sync"
|
| 617 |
-
msgstr ""
|
| 618 |
-
"Berkas sumber paket ini tidak ditemukan; tidak ada yang dapat "
|
| 619 |
-
"disinkronisasikan"
|
| 620 |
-
|
| 621 |
-
#: pub/js/lang/dummy.php:56
|
| 622 |
-
msgid "No strings could be extracted from source files"
|
| 623 |
-
msgstr "Tidak ada string yang dapat diekstrak dari berkas sumber"
|
| 624 |
-
|
| 625 |
-
#. Description of the plugin
|
| 626 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 627 |
-
msgstr ""
|
| 628 |
-
|
| 629 |
-
#. URI of the plugin
|
| 630 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 631 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 632 |
-
|
| 633 |
-
#. Author of the plugin
|
| 634 |
-
msgid "Tim Whitlock"
|
| 635 |
-
msgstr "Tim Whitlock"
|
| 636 |
-
|
| 637 |
-
#. Author URI of the plugin
|
| 638 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 639 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-it_IT.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-it_IT.po
DELETED
|
@@ -1,642 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:18:34 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Italian\n"
|
| 9 |
-
"Language: it-IT\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: it_IT\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Errore"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Attenzione"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Permesso negato"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Impostazioni salvate"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Nuovo file PO"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"File PO usato come modello. Verrà rinominato in %s la prima volta che è "
|
| 61 |
-
"salvato."
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Devi specificare un locale valido per un nuovo file PO "
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Nessuna stringa da tradurre trovata"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Il file PO non può essere creato."
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "Il file PO esiste già con un locale %s"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr "Il file non può essere creato"
|
| 84 |
-
|
| 85 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 86 |
-
msgid "%s file is empty"
|
| 87 |
-
msgstr "Il file %s è vuoto"
|
| 88 |
-
|
| 89 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 90 |
-
msgid "Run Sync to update from source code"
|
| 91 |
-
msgstr "Utilizza Sync per sincronizzare con il codice sorgente"
|
| 92 |
-
|
| 93 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 94 |
-
msgid "No strings could be extracted from source code"
|
| 95 |
-
msgstr "Impossibile estrarre le stringhe dal codice sorgente"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:417
|
| 98 |
-
msgid "Run Sync to update from %s"
|
| 99 |
-
msgstr "Utilizza Sync per aggiornare da %s"
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:436
|
| 102 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 103 |
-
msgstr ""
|
| 104 |
-
"Il codice sorgente è stato modificato, utilizza Sync per aggiornare il file "
|
| 105 |
-
"POT"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"Il file POT è stato modificato dopo che il file PO è stato salvato, utilizza "
|
| 111 |
-
"Sync per aggiornare"
|
| 112 |
-
|
| 113 |
-
#: lib/loco-admin.php:536
|
| 114 |
-
msgid "Bad file path"
|
| 115 |
-
msgstr "Percorso errato"
|
| 116 |
-
|
| 117 |
-
#: lib/loco-admin.php:783
|
| 118 |
-
msgid "Empty or invalid %s file"
|
| 119 |
-
msgstr "File %s vuoto o invalido"
|
| 120 |
-
|
| 121 |
-
#: lib/loco-admin.php:787
|
| 122 |
-
msgid "%s file has no header"
|
| 123 |
-
msgstr "File %s senza l'intestazione"
|
| 124 |
-
|
| 125 |
-
#: lib/loco-admin.php:934
|
| 126 |
-
msgctxt "Add button"
|
| 127 |
-
msgid "New template"
|
| 128 |
-
msgstr "Nuovo modello"
|
| 129 |
-
|
| 130 |
-
#: lib/loco-admin.php:953
|
| 131 |
-
msgctxt "Add button"
|
| 132 |
-
msgid "New language"
|
| 133 |
-
msgstr "Nuova lingua"
|
| 134 |
-
|
| 135 |
-
#: lib/loco-admin.php:992
|
| 136 |
-
msgid "%s%% translated"
|
| 137 |
-
msgstr "%s%% tradotto"
|
| 138 |
-
|
| 139 |
-
#: lib/loco-admin.php:992
|
| 140 |
-
msgid "1 string"
|
| 141 |
-
msgid_plural "%s strings"
|
| 142 |
-
msgstr[0] "1 stringa"
|
| 143 |
-
msgstr[1] "%s stringhe"
|
| 144 |
-
|
| 145 |
-
#: lib/loco-admin.php:995
|
| 146 |
-
msgid "%s fuzzy"
|
| 147 |
-
msgstr "%s non verificata"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:998
|
| 150 |
-
msgid "%s untranslated"
|
| 151 |
-
msgstr "%s non tradotto"
|
| 152 |
-
|
| 153 |
-
#: lib/loco-admin.php:1044
|
| 154 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 155 |
-
msgstr ""
|
| 156 |
-
"Non è stato possibile compilare il file MO con il compilatore incorporato"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 159 |
-
msgid "Loco, Translation Management"
|
| 160 |
-
msgstr "Loco, Gestione di Traduzione"
|
| 161 |
-
|
| 162 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 163 |
-
msgid "Manage translations"
|
| 164 |
-
msgstr "Gestire le traduzioni"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:1094
|
| 167 |
-
msgid "Translation options"
|
| 168 |
-
msgstr "Opzioni di traduzione"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:1101
|
| 171 |
-
msgid "Loco Translate"
|
| 172 |
-
msgstr "Tradurre con Loco"
|
| 173 |
-
|
| 174 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 175 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 176 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 177 |
-
msgid "Settings"
|
| 178 |
-
msgstr "Impostazioni"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1149
|
| 181 |
-
msgid "File download failed"
|
| 182 |
-
msgstr "Download del file non riuscito"
|
| 183 |
-
|
| 184 |
-
#: lib/loco-admin.php:1159
|
| 185 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 186 |
-
msgstr "WPLANG è deprecato e dovrebbe essere rimosso da wp-config.php"
|
| 187 |
-
|
| 188 |
-
#: lib/loco-locales.php:77
|
| 189 |
-
msgid "Unknown language"
|
| 190 |
-
msgstr "Lingua sconosciuta"
|
| 191 |
-
|
| 192 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 193 |
-
msgid "Some files not writable"
|
| 194 |
-
msgstr "Alcuni file non scrivibili"
|
| 195 |
-
|
| 196 |
-
#: lib/loco-packages.php:484
|
| 197 |
-
msgid "Some files missing"
|
| 198 |
-
msgstr "Alcuni file mancanti"
|
| 199 |
-
|
| 200 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 201 |
-
msgid "\"%s\" folder not writable"
|
| 202 |
-
msgstr "Cartella %s non scrivibile"
|
| 203 |
-
|
| 204 |
-
#: lib/loco-packages.php:515
|
| 205 |
-
msgid "POT file not writable"
|
| 206 |
-
msgstr "File POT non scrivibile"
|
| 207 |
-
|
| 208 |
-
#: lib/loco-packages.php:520
|
| 209 |
-
msgid "PO file not writable"
|
| 210 |
-
msgstr "File PO non scrivibile"
|
| 211 |
-
|
| 212 |
-
#: lib/loco-packages.php:522
|
| 213 |
-
msgid "MO file not writable"
|
| 214 |
-
msgstr "File MO non scrivibile"
|
| 215 |
-
|
| 216 |
-
#: lib/loco-packages.php:522
|
| 217 |
-
msgid "MO file not found"
|
| 218 |
-
msgstr "File MO non trovato"
|
| 219 |
-
|
| 220 |
-
#: lib/loco-packages.php:527
|
| 221 |
-
msgid "Folder not writable"
|
| 222 |
-
msgstr "Cartella non scrivibile"
|
| 223 |
-
|
| 224 |
-
#: lib/loco-packages.php:527
|
| 225 |
-
msgid "Folder not found"
|
| 226 |
-
msgstr "Cartella non trovata"
|
| 227 |
-
|
| 228 |
-
#: lib/loco-packages.php:546
|
| 229 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 230 |
-
msgstr "%s non dichiara un \"Text Domain\""
|
| 231 |
-
|
| 232 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 233 |
-
msgid "Loco has guessed \"%s\""
|
| 234 |
-
msgstr "Loco ha ipotizzato \"%s\""
|
| 235 |
-
|
| 236 |
-
#: lib/loco-packages.php:551
|
| 237 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 238 |
-
msgstr "%s non dichiara un \"Domain Path\""
|
| 239 |
-
|
| 240 |
-
#: lib/loco-packages.php:556
|
| 241 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 242 |
-
msgstr "%s non ha un file POT. Creane uno a \"%s/%s.pot\" se serve."
|
| 243 |
-
|
| 244 |
-
#: lib/loco-packages.php:559
|
| 245 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 246 |
-
msgstr ""
|
| 247 |
-
"%s ha uno strano nome del file POT (%s). Un nome migliore sarebbe \"%s.pot\""
|
| 248 |
-
|
| 249 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 250 |
-
msgid "User does not have permission to manage translations"
|
| 251 |
-
msgstr "L'utente non ha il permesso di gestire le traduzioni"
|
| 252 |
-
|
| 253 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 254 |
-
msgid "Invalid data posted to server"
|
| 255 |
-
msgstr "Dati invalidi mandati al server"
|
| 256 |
-
|
| 257 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 258 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 259 |
-
msgstr ""
|
| 260 |
-
"Non è stato possibile compilare il file MO con %s, controlla le impostazioni"
|
| 261 |
-
|
| 262 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 263 |
-
msgid "Package not found called %s"
|
| 264 |
-
msgstr "Nessun pacchetto trovato che si chiama %s"
|
| 265 |
-
|
| 266 |
-
#: php/loco-posave.php:58
|
| 267 |
-
msgid ""
|
| 268 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 269 |
-
"backups in settings"
|
| 270 |
-
msgstr ""
|
| 271 |
-
"Il server web non può effettuare un backup in \"%s\". Devi aggiustare i "
|
| 272 |
-
"permessi dei file or disattivare i backup nelle impostazioni"
|
| 273 |
-
|
| 274 |
-
#: php/loco-posave.php:66
|
| 275 |
-
msgid ""
|
| 276 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 277 |
-
"create it manually."
|
| 278 |
-
msgstr ""
|
| 279 |
-
"Il server web non può creare la cartella \"%s\" in \"%s\". Devi aggiustare i "
|
| 280 |
-
"permessi dei file or crearla manualmente."
|
| 281 |
-
|
| 282 |
-
#: php/loco-posave.php:69
|
| 283 |
-
msgid ""
|
| 284 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 285 |
-
"or use the download function."
|
| 286 |
-
msgstr ""
|
| 287 |
-
"Il server web non può creare i file nella cartella \"%s\". Devi aggiustare i "
|
| 288 |
-
"permessi dei file or utilizzare la funzione download."
|
| 289 |
-
|
| 290 |
-
#: php/loco-posave.php:81
|
| 291 |
-
msgid ""
|
| 292 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 293 |
-
"and copy to \"%s/%s\"."
|
| 294 |
-
msgstr ""
|
| 295 |
-
"File %s non è scrivibile dal server web. Devi aggiustare i permessi dei file "
|
| 296 |
-
"or utilizzare la funzione download e copiarlo nel \"%s/%s\"."
|
| 297 |
-
|
| 298 |
-
#: php/loco-posave.php:102
|
| 299 |
-
msgid "Cannot create MO file"
|
| 300 |
-
msgstr "Il file MO non può essere creato."
|
| 301 |
-
|
| 302 |
-
#: php/loco-posave.php:105
|
| 303 |
-
msgid "Cannot overwrite MO file"
|
| 304 |
-
msgstr "Il file MO non può essere sovrascritto."
|
| 305 |
-
|
| 306 |
-
#: php/loco-posave.php:131
|
| 307 |
-
msgid "Failed to write MO file"
|
| 308 |
-
msgstr "Impossibile scrivere il file MO"
|
| 309 |
-
|
| 310 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 311 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 312 |
-
#: tpl/admin-root.tpl.php:6
|
| 313 |
-
msgid "Packages"
|
| 314 |
-
msgstr "Pacchetti"
|
| 315 |
-
|
| 316 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 317 |
-
msgid "File check"
|
| 318 |
-
msgstr "Controllo file"
|
| 319 |
-
|
| 320 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 321 |
-
msgid "File system permissions for %s"
|
| 322 |
-
msgstr "Permessi del file system per %s"
|
| 323 |
-
|
| 324 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 325 |
-
msgid "Other potential issues with %s"
|
| 326 |
-
msgstr ""
|
| 327 |
-
|
| 328 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 329 |
-
msgid "Back"
|
| 330 |
-
msgstr "Indietro"
|
| 331 |
-
|
| 332 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 333 |
-
msgid "Get help"
|
| 334 |
-
msgstr "Ottenere aiuto"
|
| 335 |
-
|
| 336 |
-
#: tpl/admin-list.tpl.php:11
|
| 337 |
-
msgctxt "Table header"
|
| 338 |
-
msgid "Package details"
|
| 339 |
-
msgstr "Dettagli del pacchetto"
|
| 340 |
-
|
| 341 |
-
#: tpl/admin-list.tpl.php:14
|
| 342 |
-
msgctxt "Table header"
|
| 343 |
-
msgid "Translations (PO)"
|
| 344 |
-
msgstr "Traduzioni (PO)"
|
| 345 |
-
|
| 346 |
-
#: tpl/admin-list.tpl.php:17
|
| 347 |
-
msgctxt "Table header"
|
| 348 |
-
msgid "Template (POT)"
|
| 349 |
-
msgstr "Modello (POT)"
|
| 350 |
-
|
| 351 |
-
#: tpl/admin-list.tpl.php:20
|
| 352 |
-
msgctxt "Table header"
|
| 353 |
-
msgid "File permissions"
|
| 354 |
-
msgstr "Permessi dei file"
|
| 355 |
-
|
| 356 |
-
#: tpl/admin-list.tpl.php:40
|
| 357 |
-
msgid "Extends: %s"
|
| 358 |
-
msgstr "Estende: %s"
|
| 359 |
-
|
| 360 |
-
#: tpl/admin-list.tpl.php:44
|
| 361 |
-
msgid "1 language"
|
| 362 |
-
msgid_plural "%u languages"
|
| 363 |
-
msgstr[0] "1 lingua"
|
| 364 |
-
msgstr[1] "lingue"
|
| 365 |
-
|
| 366 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 367 |
-
msgctxt "Modified time"
|
| 368 |
-
msgid "Updated"
|
| 369 |
-
msgstr "Modificato"
|
| 370 |
-
|
| 371 |
-
#: tpl/admin-nav.tpl.php:26
|
| 372 |
-
msgid "Powered by"
|
| 373 |
-
msgstr "Powered by"
|
| 374 |
-
|
| 375 |
-
#: tpl/admin-nav.tpl.php:32
|
| 376 |
-
msgid "Loco may not work as expected"
|
| 377 |
-
msgstr "Loco potrebbe non funzionare come dovrebbe"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-opts.tpl.php:18
|
| 380 |
-
msgid "Configure Loco Translate"
|
| 381 |
-
msgstr "Configurare Loco Translate"
|
| 382 |
-
|
| 383 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 384 |
-
msgid "Compiling MO files"
|
| 385 |
-
msgstr "Compilando i file MO"
|
| 386 |
-
|
| 387 |
-
#: tpl/admin-opts.tpl.php:36
|
| 388 |
-
msgid "Use built-in MO compiler."
|
| 389 |
-
msgstr "Utilizza il compilatore di MO incorporato"
|
| 390 |
-
|
| 391 |
-
#: tpl/admin-opts.tpl.php:42
|
| 392 |
-
msgid "Use external command:"
|
| 393 |
-
msgstr "Utilizza il comando esterno:"
|
| 394 |
-
|
| 395 |
-
#: tpl/admin-opts.tpl.php:47
|
| 396 |
-
msgid "Enter path to msgfmt on server"
|
| 397 |
-
msgstr "Inserisci il percorso a msgfmt sul server"
|
| 398 |
-
|
| 399 |
-
#: tpl/admin-opts.tpl.php:54
|
| 400 |
-
msgid "Generate hash tables"
|
| 401 |
-
msgstr "Generare tabelle hash"
|
| 402 |
-
|
| 403 |
-
#: tpl/admin-opts.tpl.php:60
|
| 404 |
-
msgid "Include Fuzzy strings"
|
| 405 |
-
msgstr "Include stringhe ambigue"
|
| 406 |
-
|
| 407 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 408 |
-
msgid "Backing up PO files"
|
| 409 |
-
msgstr "Effettuando un backup dei file PO"
|
| 410 |
-
|
| 411 |
-
#: tpl/admin-opts.tpl.php:75
|
| 412 |
-
msgid "Number of backups to keep of each file:"
|
| 413 |
-
msgstr "Numero di backup da conservare per ogni file:"
|
| 414 |
-
|
| 415 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 416 |
-
msgid "Experimental features"
|
| 417 |
-
msgstr "Funzioni sperimentali"
|
| 418 |
-
|
| 419 |
-
#: tpl/admin-opts.tpl.php:92
|
| 420 |
-
msgid "Enable WordPress core translations"
|
| 421 |
-
msgstr "Abilita la traduzione del core di WordPress"
|
| 422 |
-
|
| 423 |
-
#: tpl/admin-opts.tpl.php:101
|
| 424 |
-
msgid "Save settings"
|
| 425 |
-
msgstr "Salva le impostazioni"
|
| 426 |
-
|
| 427 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 428 |
-
msgid "Template file"
|
| 429 |
-
msgstr "File modello"
|
| 430 |
-
|
| 431 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 432 |
-
msgctxt "Dropdown label"
|
| 433 |
-
msgid "Switch to..."
|
| 434 |
-
msgstr "Passare al..."
|
| 435 |
-
|
| 436 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 437 |
-
msgid "never"
|
| 438 |
-
msgstr "mai"
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 441 |
-
msgctxt "Editor button"
|
| 442 |
-
msgid "Save"
|
| 443 |
-
msgstr "Salva"
|
| 444 |
-
|
| 445 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 446 |
-
msgctxt "Editor button"
|
| 447 |
-
msgid "Download"
|
| 448 |
-
msgstr "Scarica"
|
| 449 |
-
|
| 450 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 451 |
-
msgctxt "Editor button"
|
| 452 |
-
msgid "Sync"
|
| 453 |
-
msgstr "Sync"
|
| 454 |
-
|
| 455 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 456 |
-
msgctxt "Editor button"
|
| 457 |
-
msgid "Revert"
|
| 458 |
-
msgstr "Ritornare"
|
| 459 |
-
|
| 460 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 461 |
-
msgctxt "Editor button"
|
| 462 |
-
msgid "Add"
|
| 463 |
-
msgstr "Aggiungi"
|
| 464 |
-
|
| 465 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 466 |
-
msgctxt "Editor button"
|
| 467 |
-
msgid "Del"
|
| 468 |
-
msgstr "Canc"
|
| 469 |
-
|
| 470 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 471 |
-
msgctxt "Editor button"
|
| 472 |
-
msgid "Fuzzy"
|
| 473 |
-
msgstr "Non verificato"
|
| 474 |
-
|
| 475 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 476 |
-
msgid "Filter translations"
|
| 477 |
-
msgstr "Filtra le traduzioni"
|
| 478 |
-
|
| 479 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 480 |
-
msgctxt "Editor button"
|
| 481 |
-
msgid "Help"
|
| 482 |
-
msgstr "Aiuto"
|
| 483 |
-
|
| 484 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 485 |
-
msgid "Initialize new translations in %s"
|
| 486 |
-
msgstr "Inizializza nuove traduzioni in %s "
|
| 487 |
-
|
| 488 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 489 |
-
msgid "Select from common languages"
|
| 490 |
-
msgstr "Seleziona una lingua predefinita"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 493 |
-
msgctxt "Form label"
|
| 494 |
-
msgid "or enter any language code"
|
| 495 |
-
msgstr "o inserisci qualsiasi codice lingua"
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 498 |
-
msgctxt "Form label"
|
| 499 |
-
msgid "create in <code>%s</code>"
|
| 500 |
-
msgstr "creare in <code>%s</code>"
|
| 501 |
-
|
| 502 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 503 |
-
msgctxt "Form label"
|
| 504 |
-
msgid "create in global languages directory"
|
| 505 |
-
msgstr "creare nella cartella globale di lingue"
|
| 506 |
-
|
| 507 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 508 |
-
msgctxt "Submit button"
|
| 509 |
-
msgid "Start translating"
|
| 510 |
-
msgstr "Inizia a tradurre"
|
| 511 |
-
|
| 512 |
-
#: tpl/admin-root.tpl.php:18
|
| 513 |
-
msgid "New version available"
|
| 514 |
-
msgstr "Nuova versione disponibile"
|
| 515 |
-
|
| 516 |
-
#: tpl/admin-root.tpl.php:21
|
| 517 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 518 |
-
msgstr "Aggiorna alla versione %s di Loco Translate"
|
| 519 |
-
|
| 520 |
-
#: tpl/admin-root.tpl.php:31
|
| 521 |
-
msgid "Select a plugin or theme to translate"
|
| 522 |
-
msgstr "Seleziona un plugin o un tema da tradurre"
|
| 523 |
-
|
| 524 |
-
#: tpl/admin-root.tpl.php:40
|
| 525 |
-
msgctxt "Package list header"
|
| 526 |
-
msgid "Themes"
|
| 527 |
-
msgstr "Temi"
|
| 528 |
-
|
| 529 |
-
#: tpl/admin-root.tpl.php:53
|
| 530 |
-
msgctxt "Package list header"
|
| 531 |
-
msgid "Plugins"
|
| 532 |
-
msgstr "Plugin"
|
| 533 |
-
|
| 534 |
-
#: tpl/admin-root.tpl.php:66
|
| 535 |
-
msgctxt "Package list header"
|
| 536 |
-
msgid "Core"
|
| 537 |
-
msgstr "Core"
|
| 538 |
-
|
| 539 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 540 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 541 |
-
msgid ""
|
| 542 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 543 |
-
"install it"
|
| 544 |
-
msgstr ""
|
| 545 |
-
"L'estensione PHP \"%s\" non è installata. Se riscontri dei problemi dovresti "
|
| 546 |
-
"installarla"
|
| 547 |
-
|
| 548 |
-
#: pub/js/lang/dummy.php:8
|
| 549 |
-
msgid "Unknown error"
|
| 550 |
-
msgstr "Errore sconosciuto"
|
| 551 |
-
|
| 552 |
-
#: pub/js/lang/dummy.php:10
|
| 553 |
-
msgid "PO file saved"
|
| 554 |
-
msgstr "File PO salvato"
|
| 555 |
-
|
| 556 |
-
#: pub/js/lang/dummy.php:12
|
| 557 |
-
msgid "and MO file compiled"
|
| 558 |
-
msgstr "e il file MO compilato"
|
| 559 |
-
|
| 560 |
-
#: pub/js/lang/dummy.php:15
|
| 561 |
-
msgid "Merged from %s"
|
| 562 |
-
msgstr "Uniti da %s"
|
| 563 |
-
|
| 564 |
-
#: pub/js/lang/dummy.php:17
|
| 565 |
-
msgid "Merged from source code"
|
| 566 |
-
msgstr "Uniti dal codice sorgente"
|
| 567 |
-
|
| 568 |
-
#: pub/js/lang/dummy.php:19
|
| 569 |
-
msgid "Already up to date with %s"
|
| 570 |
-
msgstr "Già aggiornato con %s"
|
| 571 |
-
|
| 572 |
-
#: pub/js/lang/dummy.php:21
|
| 573 |
-
msgid "Already up to date with source code"
|
| 574 |
-
msgstr "Già aggiornato con il codice sorgente"
|
| 575 |
-
|
| 576 |
-
#: pub/js/lang/dummy.php:23
|
| 577 |
-
msgid "1 new string added"
|
| 578 |
-
msgid_plural "%s new strings added"
|
| 579 |
-
msgstr[0] "1 nuova stringa aggiunta"
|
| 580 |
-
msgstr[1] "%s nuove stringhe aggiunte"
|
| 581 |
-
|
| 582 |
-
#: pub/js/lang/dummy.php:25
|
| 583 |
-
msgid "1 obsolete string removed"
|
| 584 |
-
msgid_plural "%s obsolete strings removed"
|
| 585 |
-
msgstr[0] "1 stringa obsoleta rimossa"
|
| 586 |
-
msgstr[1] "%s stringhe obsolete rimosse"
|
| 587 |
-
|
| 588 |
-
#: pub/js/lang/dummy.php:27
|
| 589 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 590 |
-
msgstr "Le modifiche saranno perse se continui senza salvarle"
|
| 591 |
-
|
| 592 |
-
#. label for the window pane holding native translation
|
| 593 |
-
#: pub/js/lang/dummy.php:35
|
| 594 |
-
msgctxt "Editor pane"
|
| 595 |
-
msgid "Source text"
|
| 596 |
-
msgstr "Testo sorgente"
|
| 597 |
-
|
| 598 |
-
#. where %s is the language, e.g French translation
|
| 599 |
-
#: pub/js/lang/dummy.php:38
|
| 600 |
-
msgctxt "Editor pane"
|
| 601 |
-
msgid "%s translation"
|
| 602 |
-
msgstr "Traduzione %s"
|
| 603 |
-
|
| 604 |
-
#. label for the window pane holding translator comments
|
| 605 |
-
#: pub/js/lang/dummy.php:41
|
| 606 |
-
msgctxt "Editor pane"
|
| 607 |
-
msgid "Comments"
|
| 608 |
-
msgstr "Note"
|
| 609 |
-
|
| 610 |
-
#. label for the window pane holding message context
|
| 611 |
-
#: pub/js/lang/dummy.php:44
|
| 612 |
-
msgctxt "Editor pane"
|
| 613 |
-
msgid "Context"
|
| 614 |
-
msgstr "Contesto"
|
| 615 |
-
|
| 616 |
-
#: pub/js/lang/dummy.php:52
|
| 617 |
-
msgid "Translation"
|
| 618 |
-
msgstr "Traduzione"
|
| 619 |
-
|
| 620 |
-
#: pub/js/lang/dummy.php:54
|
| 621 |
-
msgid "No source files in this package, nothing to sync"
|
| 622 |
-
msgstr "Nessun file sorgente in questo pacchetto, niente da sincronizzare"
|
| 623 |
-
|
| 624 |
-
#: pub/js/lang/dummy.php:56
|
| 625 |
-
msgid "No strings could be extracted from source files"
|
| 626 |
-
msgstr "Impossibile estrarre le stringhe dai file sorgenti"
|
| 627 |
-
|
| 628 |
-
#. Description of the plugin
|
| 629 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 630 |
-
msgstr "Traduci plugin e temi di Wordpress direttamente nel tuo browser"
|
| 631 |
-
|
| 632 |
-
#. URI of the plugin
|
| 633 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 634 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 635 |
-
|
| 636 |
-
#. Author of the plugin
|
| 637 |
-
msgid "Tim Whitlock"
|
| 638 |
-
msgstr "Tim Whitlock"
|
| 639 |
-
|
| 640 |
-
#. Author URI of the plugin
|
| 641 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 642 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-ja.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-ja.po
DELETED
|
@@ -1,635 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:18:48 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Japanese\n"
|
| 9 |
-
"Language: ja\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=1; plural=0\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 17 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 18 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 19 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 20 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 21 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 22 |
-
"X-Loco-Target-Locale: ja_JP\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "エラー"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "警告"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "アクセスが拒否されました"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "設定を保存しました"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "新しいPOファイル"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"POファイルをテンプレートとして使用しました。これは最初に%sとして保存されま"
|
| 61 |
-
"す。"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "新しいPOファイルのための有効なロケールを指定する必要があります"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "翻訳できる文字列が見つかりませんでした"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "POファイルを作成できません。"
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "ロケール%sのPOファイルはすでに存在します"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"ファイルを自動的に作成できません。ファイルのパーミッションを変更するか、ダウ"
|
| 85 |
-
"ンロードして保存したものを使用して下さい。"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "ファイル %s は空です"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "ソースコードの更新の同期を実行"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "ソースファイルから文字列が見つかりませんでした"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "%sの更新の同期を実行"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr "ソースコードを変更し、POTの同期と更新を行いました"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr "POファイルの保存後にPOTが変更されたため、同期と更新を行いました"
|
| 110 |
-
|
| 111 |
-
#: lib/loco-admin.php:536
|
| 112 |
-
msgid "Bad file path"
|
| 113 |
-
msgstr "間違ったファイルパス"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:783
|
| 116 |
-
msgid "Empty or invalid %s file"
|
| 117 |
-
msgstr "ファイル%sは空または壊れています"
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:787
|
| 120 |
-
msgid "%s file has no header"
|
| 121 |
-
msgstr "ファイル%sにヘッダがありません"
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:934
|
| 124 |
-
msgctxt "Add button"
|
| 125 |
-
msgid "New template"
|
| 126 |
-
msgstr "新しいテンプレート"
|
| 127 |
-
|
| 128 |
-
#: lib/loco-admin.php:953
|
| 129 |
-
msgctxt "Add button"
|
| 130 |
-
msgid "New language"
|
| 131 |
-
msgstr "新しい言語"
|
| 132 |
-
|
| 133 |
-
#: lib/loco-admin.php:992
|
| 134 |
-
msgid "%s%% translated"
|
| 135 |
-
msgstr "%s%%件翻訳済み"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "1 string"
|
| 139 |
-
msgid_plural "%s strings"
|
| 140 |
-
msgstr[0] "%s件の文字列"
|
| 141 |
-
msgstr[1] "1件の文字列"
|
| 142 |
-
|
| 143 |
-
#: lib/loco-admin.php:995
|
| 144 |
-
msgid "%s fuzzy"
|
| 145 |
-
msgstr "%s件のファジー"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:998
|
| 148 |
-
msgid "%s untranslated"
|
| 149 |
-
msgstr "%s件の未翻訳"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:1044
|
| 152 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 153 |
-
msgstr "内蔵コンパイラーでのMOファイルのコンパイルができませんでした"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 156 |
-
msgid "Loco, Translation Management"
|
| 157 |
-
msgstr "Loco - 翻訳管理"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 160 |
-
msgid "Manage translations"
|
| 161 |
-
msgstr "管理"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1094
|
| 164 |
-
msgid "Translation options"
|
| 165 |
-
msgstr "設定"
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1101
|
| 168 |
-
msgid "Loco Translate"
|
| 169 |
-
msgstr "Loco Translate"
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 172 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 173 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 174 |
-
msgid "Settings"
|
| 175 |
-
msgstr "設定"
|
| 176 |
-
|
| 177 |
-
#: lib/loco-admin.php:1149
|
| 178 |
-
msgid "File download failed"
|
| 179 |
-
msgstr "ファイルのダウンロードができませんでした"
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1159
|
| 182 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 183 |
-
msgstr "WPLANG は廃止されたため、wp-config.php から削除する必要があります。"
|
| 184 |
-
|
| 185 |
-
#: lib/loco-locales.php:77
|
| 186 |
-
msgid "Unknown language"
|
| 187 |
-
msgstr "不明な言語"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 190 |
-
msgid "Some files not writable"
|
| 191 |
-
msgstr "いくつかのファイルに書き込めません"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:484
|
| 194 |
-
msgid "Some files missing"
|
| 195 |
-
msgstr "いくつかのファイルが不明"
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 198 |
-
msgid "\"%s\" folder not writable"
|
| 199 |
-
msgstr "\"%s\" フォルダに書き込めません"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:515
|
| 202 |
-
msgid "POT file not writable"
|
| 203 |
-
msgstr "POTファイルに書き込めません"
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:520
|
| 206 |
-
msgid "PO file not writable"
|
| 207 |
-
msgstr "POファイルに書き込めません"
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:522
|
| 210 |
-
msgid "MO file not writable"
|
| 211 |
-
msgstr "MOファイルに書き込めません"
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not found"
|
| 215 |
-
msgstr "MOファイルが見つかりません"
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:527
|
| 218 |
-
msgid "Folder not writable"
|
| 219 |
-
msgstr "フォルダに書き込めません"
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not found"
|
| 223 |
-
msgstr "フォルダが見つかりません"
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:546
|
| 226 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 227 |
-
msgstr ""
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 230 |
-
msgid "Loco has guessed \"%s\""
|
| 231 |
-
msgstr ""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:551
|
| 234 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 235 |
-
msgstr ""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:556
|
| 238 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 239 |
-
msgstr ""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:559
|
| 242 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 246 |
-
msgid "User does not have permission to manage translations"
|
| 247 |
-
msgstr "ユーザーは翻訳管理を行う権限を持っていません"
|
| 248 |
-
|
| 249 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 250 |
-
msgid "Invalid data posted to server"
|
| 251 |
-
msgstr "サーバーへの無効なデータ送信"
|
| 252 |
-
|
| 253 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 254 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 255 |
-
msgstr "%sのMOファイルのコンパイルに失敗しました。設定を確認して下さい。"
|
| 256 |
-
|
| 257 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 258 |
-
msgid "Package not found called %s"
|
| 259 |
-
msgstr "パッケージが見つからず%sを呼び出せません"
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:58
|
| 262 |
-
msgid ""
|
| 263 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 264 |
-
"backups in settings"
|
| 265 |
-
msgstr ""
|
| 266 |
-
"ウェブサーバーで\"%s\"のバックアップを作成できません。ファイルのパーミッショ"
|
| 267 |
-
"ンを変更するか、設定のバックアップを無効にして下さい。"
|
| 268 |
-
|
| 269 |
-
#: php/loco-posave.php:66
|
| 270 |
-
msgid ""
|
| 271 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 272 |
-
"create it manually."
|
| 273 |
-
msgstr ""
|
| 274 |
-
"ウェブサーバーは\"%s\"を\"%s\"に作成できません。ファイルのパーミッションを変"
|
| 275 |
-
"更するか、手で作成して下さい。"
|
| 276 |
-
|
| 277 |
-
#: php/loco-posave.php:69
|
| 278 |
-
msgid ""
|
| 279 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 280 |
-
"or use the download function."
|
| 281 |
-
msgstr ""
|
| 282 |
-
"ウェブサーバーは\"%s\"ディレクトリにファイルを作成できません。ファイルのパー"
|
| 283 |
-
"ミッションを変更するか、ダウンロード機能を使用して下さい。"
|
| 284 |
-
|
| 285 |
-
#: php/loco-posave.php:81
|
| 286 |
-
msgid ""
|
| 287 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 288 |
-
"and copy to \"%s/%s\"."
|
| 289 |
-
msgstr ""
|
| 290 |
-
"%sファイルはウェブサーバーから書き込みできません。ファイルの権限を変更する"
|
| 291 |
-
"か、 ダウンロードして\"%s/%s\"へコピーして下さい。"
|
| 292 |
-
|
| 293 |
-
#: php/loco-posave.php:102
|
| 294 |
-
msgid "Cannot create MO file"
|
| 295 |
-
msgstr "MOファイルを作成できません"
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:105
|
| 298 |
-
msgid "Cannot overwrite MO file"
|
| 299 |
-
msgstr "MOファイルを上書きできません"
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:131
|
| 302 |
-
msgid "Failed to write MO file"
|
| 303 |
-
msgstr "MOファイルへ書き込みできません"
|
| 304 |
-
|
| 305 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 306 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 307 |
-
#: tpl/admin-root.tpl.php:6
|
| 308 |
-
msgid "Packages"
|
| 309 |
-
msgstr "パッケージ"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 312 |
-
msgid "File check"
|
| 313 |
-
msgstr "ファイルチェック"
|
| 314 |
-
|
| 315 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 316 |
-
msgid "File system permissions for %s"
|
| 317 |
-
msgstr "%sのファイルシステム権限"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 320 |
-
msgid "Other potential issues with %s"
|
| 321 |
-
msgstr ""
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 324 |
-
msgid "Back"
|
| 325 |
-
msgstr "戻る"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 328 |
-
msgid "Get help"
|
| 329 |
-
msgstr "ヘルプ"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-list.tpl.php:11
|
| 332 |
-
msgctxt "Table header"
|
| 333 |
-
msgid "Package details"
|
| 334 |
-
msgstr "パッケージ詳細"
|
| 335 |
-
|
| 336 |
-
#: tpl/admin-list.tpl.php:14
|
| 337 |
-
msgctxt "Table header"
|
| 338 |
-
msgid "Translations (PO)"
|
| 339 |
-
msgstr "翻訳 (PO)"
|
| 340 |
-
|
| 341 |
-
#: tpl/admin-list.tpl.php:17
|
| 342 |
-
msgctxt "Table header"
|
| 343 |
-
msgid "Template (POT)"
|
| 344 |
-
msgstr "テンプレート (POT) "
|
| 345 |
-
|
| 346 |
-
#: tpl/admin-list.tpl.php:20
|
| 347 |
-
msgctxt "Table header"
|
| 348 |
-
msgid "File permissions"
|
| 349 |
-
msgstr "ファイル権限"
|
| 350 |
-
|
| 351 |
-
#: tpl/admin-list.tpl.php:40
|
| 352 |
-
msgid "Extends: %s"
|
| 353 |
-
msgstr "拡張: %s"
|
| 354 |
-
|
| 355 |
-
#: tpl/admin-list.tpl.php:44
|
| 356 |
-
msgid "1 language"
|
| 357 |
-
msgid_plural "%u languages"
|
| 358 |
-
msgstr[0] "%u言語"
|
| 359 |
-
msgstr[1] "1言語"
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 362 |
-
msgctxt "Modified time"
|
| 363 |
-
msgid "Updated"
|
| 364 |
-
msgstr "更新日時"
|
| 365 |
-
|
| 366 |
-
#: tpl/admin-nav.tpl.php:26
|
| 367 |
-
msgid "Powered by"
|
| 368 |
-
msgstr " "
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-nav.tpl.php:32
|
| 371 |
-
msgid "Loco may not work as expected"
|
| 372 |
-
msgstr "Loco が期待通りに動作しない可能性があります"
|
| 373 |
-
|
| 374 |
-
#: tpl/admin-opts.tpl.php:18
|
| 375 |
-
msgid "Configure Loco Translate"
|
| 376 |
-
msgstr "Loco Translate の設定"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 379 |
-
msgid "Compiling MO files"
|
| 380 |
-
msgstr "MOファイルのコンパイル"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-opts.tpl.php:36
|
| 383 |
-
msgid "Use built-in MO compiler."
|
| 384 |
-
msgstr "内蔵のMOコンパイラーを使用する"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:42
|
| 387 |
-
msgid "Use external command:"
|
| 388 |
-
msgstr "外部コマンドを使用する:"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:47
|
| 391 |
-
msgid "Enter path to msgfmt on server"
|
| 392 |
-
msgstr "サーバのmsgfmtへのパスを入力"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:54
|
| 395 |
-
msgid "Generate hash tables"
|
| 396 |
-
msgstr "ハッシュテーブルを生成する"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:60
|
| 399 |
-
msgid "Include Fuzzy strings"
|
| 400 |
-
msgstr ""
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 403 |
-
msgid "Backing up PO files"
|
| 404 |
-
msgstr "POファイルのバックアップ"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:75
|
| 407 |
-
msgid "Number of backups to keep of each file:"
|
| 408 |
-
msgstr "ファイルごとに保存するバックアップ数:"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 411 |
-
msgid "Experimental features"
|
| 412 |
-
msgstr "実験的な機能"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:92
|
| 415 |
-
msgid "Enable WordPress core translations"
|
| 416 |
-
msgstr "WordPressコアの翻訳を行う"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:101
|
| 419 |
-
msgid "Save settings"
|
| 420 |
-
msgstr "設定を保存"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 423 |
-
msgid "Template file"
|
| 424 |
-
msgstr "テンプレートファイル"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 427 |
-
msgctxt "Dropdown label"
|
| 428 |
-
msgid "Switch to..."
|
| 429 |
-
msgstr "切り替え…"
|
| 430 |
-
|
| 431 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 432 |
-
msgid "never"
|
| 433 |
-
msgstr "常に"
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 436 |
-
msgctxt "Editor button"
|
| 437 |
-
msgid "Save"
|
| 438 |
-
msgstr "保存"
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 441 |
-
msgctxt "Editor button"
|
| 442 |
-
msgid "Download"
|
| 443 |
-
msgstr "ダウンロード"
|
| 444 |
-
|
| 445 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 446 |
-
msgctxt "Editor button"
|
| 447 |
-
msgid "Sync"
|
| 448 |
-
msgstr "同期"
|
| 449 |
-
|
| 450 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 451 |
-
msgctxt "Editor button"
|
| 452 |
-
msgid "Revert"
|
| 453 |
-
msgstr "元に戻す"
|
| 454 |
-
|
| 455 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 456 |
-
msgctxt "Editor button"
|
| 457 |
-
msgid "Add"
|
| 458 |
-
msgstr "追加"
|
| 459 |
-
|
| 460 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 461 |
-
msgctxt "Editor button"
|
| 462 |
-
msgid "Del"
|
| 463 |
-
msgstr "削除"
|
| 464 |
-
|
| 465 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 466 |
-
msgctxt "Editor button"
|
| 467 |
-
msgid "Fuzzy"
|
| 468 |
-
msgstr "ファジー"
|
| 469 |
-
|
| 470 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 471 |
-
msgid "Filter translations"
|
| 472 |
-
msgstr "翻訳を絞り込み"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 475 |
-
msgctxt "Editor button"
|
| 476 |
-
msgid "Help"
|
| 477 |
-
msgstr "ヘルプ"
|
| 478 |
-
|
| 479 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 480 |
-
msgid "Initialize new translations in %s"
|
| 481 |
-
msgstr "%sの新しい言語の初期化"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 484 |
-
msgid "Select from common languages"
|
| 485 |
-
msgstr "定義済みの言語から選択"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 488 |
-
msgctxt "Form label"
|
| 489 |
-
msgid "or enter any language code"
|
| 490 |
-
msgstr "または他の言語コードを入力"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 493 |
-
msgctxt "Form label"
|
| 494 |
-
msgid "create in <code>%s</code>"
|
| 495 |
-
msgstr "<code>%s</code>に作成する"
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 498 |
-
msgctxt "Form label"
|
| 499 |
-
msgid "create in global languages directory"
|
| 500 |
-
msgstr "全体の言語ディレクトリに作成する"
|
| 501 |
-
|
| 502 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 503 |
-
msgctxt "Submit button"
|
| 504 |
-
msgid "Start translating"
|
| 505 |
-
msgstr "翻訳を開始する"
|
| 506 |
-
|
| 507 |
-
#: tpl/admin-root.tpl.php:18
|
| 508 |
-
msgid "New version available"
|
| 509 |
-
msgstr "利用可能な新しいバージョン"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-root.tpl.php:21
|
| 512 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 513 |
-
msgstr "Loco Translate のバージョンを%sへ更新します"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-root.tpl.php:31
|
| 516 |
-
msgid "Select a plugin or theme to translate"
|
| 517 |
-
msgstr "翻訳するテーマまたはプラグインを選択して下さい"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:40
|
| 520 |
-
msgctxt "Package list header"
|
| 521 |
-
msgid "Themes"
|
| 522 |
-
msgstr "テーマ"
|
| 523 |
-
|
| 524 |
-
#: tpl/admin-root.tpl.php:53
|
| 525 |
-
msgctxt "Package list header"
|
| 526 |
-
msgid "Plugins"
|
| 527 |
-
msgstr "プラグイン"
|
| 528 |
-
|
| 529 |
-
#: tpl/admin-root.tpl.php:66
|
| 530 |
-
msgctxt "Package list header"
|
| 531 |
-
msgid "Core"
|
| 532 |
-
msgstr "コア"
|
| 533 |
-
|
| 534 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 535 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 536 |
-
msgid ""
|
| 537 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 538 |
-
"install it"
|
| 539 |
-
msgstr ""
|
| 540 |
-
|
| 541 |
-
#: pub/js/lang/dummy.php:8
|
| 542 |
-
msgid "Unknown error"
|
| 543 |
-
msgstr "不明なエラー"
|
| 544 |
-
|
| 545 |
-
#: pub/js/lang/dummy.php:10
|
| 546 |
-
msgid "PO file saved"
|
| 547 |
-
msgstr "POファイルを保存しました"
|
| 548 |
-
|
| 549 |
-
#: pub/js/lang/dummy.php:12
|
| 550 |
-
msgid "and MO file compiled"
|
| 551 |
-
msgstr "またMOファイルをコンパイルしました"
|
| 552 |
-
|
| 553 |
-
#: pub/js/lang/dummy.php:15
|
| 554 |
-
msgid "Merged from %s"
|
| 555 |
-
msgstr "%sから結合"
|
| 556 |
-
|
| 557 |
-
#: pub/js/lang/dummy.php:17
|
| 558 |
-
msgid "Merged from source code"
|
| 559 |
-
msgstr "ソースコードから結合"
|
| 560 |
-
|
| 561 |
-
#: pub/js/lang/dummy.php:19
|
| 562 |
-
msgid "Already up to date with %s"
|
| 563 |
-
msgstr "%sはすでに最新です"
|
| 564 |
-
|
| 565 |
-
#: pub/js/lang/dummy.php:21
|
| 566 |
-
msgid "Already up to date with source code"
|
| 567 |
-
msgstr "ソースコードはすでに最新です"
|
| 568 |
-
|
| 569 |
-
#: pub/js/lang/dummy.php:23
|
| 570 |
-
msgid "1 new string added"
|
| 571 |
-
msgid_plural "%s new strings added"
|
| 572 |
-
msgstr[0] "%s件の新しい文字列を追加しました"
|
| 573 |
-
msgstr[1] "1件の新しい文字列を追加しました"
|
| 574 |
-
|
| 575 |
-
#: pub/js/lang/dummy.php:25
|
| 576 |
-
msgid "1 obsolete string removed"
|
| 577 |
-
msgid_plural "%s obsolete strings removed"
|
| 578 |
-
msgstr[0] "%s件の文字列を削除しました"
|
| 579 |
-
msgstr[1] "1件の文字列を削除しました"
|
| 580 |
-
|
| 581 |
-
#: pub/js/lang/dummy.php:27
|
| 582 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 583 |
-
msgstr "保存せずに続けると変更内容は反映されません"
|
| 584 |
-
|
| 585 |
-
#. label for the window pane holding native translation
|
| 586 |
-
#: pub/js/lang/dummy.php:35
|
| 587 |
-
msgctxt "Editor pane"
|
| 588 |
-
msgid "Source text"
|
| 589 |
-
msgstr "原文"
|
| 590 |
-
|
| 591 |
-
#. where %s is the language, e.g French translation
|
| 592 |
-
#: pub/js/lang/dummy.php:38
|
| 593 |
-
msgctxt "Editor pane"
|
| 594 |
-
msgid "%s translation"
|
| 595 |
-
msgstr "%sの翻訳"
|
| 596 |
-
|
| 597 |
-
#. label for the window pane holding translator comments
|
| 598 |
-
#: pub/js/lang/dummy.php:41
|
| 599 |
-
msgctxt "Editor pane"
|
| 600 |
-
msgid "Comments"
|
| 601 |
-
msgstr "コメント"
|
| 602 |
-
|
| 603 |
-
#. label for the window pane holding message context
|
| 604 |
-
#: pub/js/lang/dummy.php:44
|
| 605 |
-
msgctxt "Editor pane"
|
| 606 |
-
msgid "Context"
|
| 607 |
-
msgstr "属性"
|
| 608 |
-
|
| 609 |
-
#: pub/js/lang/dummy.php:52
|
| 610 |
-
msgid "Translation"
|
| 611 |
-
msgstr "訳文"
|
| 612 |
-
|
| 613 |
-
#: pub/js/lang/dummy.php:54
|
| 614 |
-
msgid "No source files in this package, nothing to sync"
|
| 615 |
-
msgstr "このパッケージにはソースファイルがないため、同期していません"
|
| 616 |
-
|
| 617 |
-
#: pub/js/lang/dummy.php:56
|
| 618 |
-
msgid "No strings could be extracted from source files"
|
| 619 |
-
msgstr "ソースファイルから文字列が見つかりませんでした"
|
| 620 |
-
|
| 621 |
-
#. Description of the plugin
|
| 622 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 623 |
-
msgstr ""
|
| 624 |
-
|
| 625 |
-
#. URI of the plugin
|
| 626 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 627 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 628 |
-
|
| 629 |
-
#. Author of the plugin
|
| 630 |
-
msgid "Tim Whitlock"
|
| 631 |
-
msgstr "Tim Whitlock"
|
| 632 |
-
|
| 633 |
-
#. Author URI of the plugin
|
| 634 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 635 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-ko_KR.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-ko_KR.po
DELETED
|
@@ -1,636 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:19:02 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Korean\n"
|
| 9 |
-
"Language: ko-KR\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=1; plural=0\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 17 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 18 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 19 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 20 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 21 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 22 |
-
"X-Loco-Target-Locale: ko_KR\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "오류"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "경고"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "확인"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "권한이 거부됨"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "설정이 저장됨"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "%s은(는) 공식 워드프레스 언어가 아닙니다"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "새로운 PO 파일"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr "PO 파일이 양식으로 사용됨. 처음 저장 시 파일명이 %s(으)로 바뀝니다."
|
| 60 |
-
|
| 61 |
-
#: lib/loco-admin.php:312
|
| 62 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 63 |
-
msgstr "새로운 PO 파일에 대한 올바른 로케일을 지정해야 합니다"
|
| 64 |
-
|
| 65 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 66 |
-
msgid "No translatable strings found"
|
| 67 |
-
msgstr "번역 가능한 스트링을 발견하지 못함"
|
| 68 |
-
|
| 69 |
-
#: lib/loco-admin.php:337
|
| 70 |
-
msgid "Cannot create a PO file."
|
| 71 |
-
msgstr "PO 파일을 생성할 수 없음."
|
| 72 |
-
|
| 73 |
-
#: lib/loco-admin.php:344
|
| 74 |
-
msgid "PO file already exists with locale %s"
|
| 75 |
-
msgstr "이미 로케일 %s에 대한 PO 파일이 존재함"
|
| 76 |
-
|
| 77 |
-
#: lib/loco-admin.php:396
|
| 78 |
-
msgid ""
|
| 79 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 80 |
-
"Download instead of Save"
|
| 81 |
-
msgstr ""
|
| 82 |
-
"파일을 자동으로 생성하지 못했습니다. 파일 권한을 수정하거나 저장 대신 다운로"
|
| 83 |
-
"드를 사용하세요"
|
| 84 |
-
|
| 85 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 86 |
-
msgid "%s file is empty"
|
| 87 |
-
msgstr "%s 파일이 비어있음"
|
| 88 |
-
|
| 89 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 90 |
-
msgid "Run Sync to update from source code"
|
| 91 |
-
msgstr "소스 코드로부터 업데이트 하기 위해 동기화를 실행하세요"
|
| 92 |
-
|
| 93 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 94 |
-
msgid "No strings could be extracted from source code"
|
| 95 |
-
msgstr "소스 코드로부터 스트링을 추출하지 못했음"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:417
|
| 98 |
-
msgid "Run Sync to update from %s"
|
| 99 |
-
msgstr "%s(으)로부터 업데이트 하기 위해 동기화를 실행하세요"
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:436
|
| 102 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 103 |
-
msgstr "소스 코드가 변경되었음, POT를 업데이트 하기 위해 동기화를 실행하세요"
|
| 104 |
-
|
| 105 |
-
#: lib/loco-admin.php:440
|
| 106 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 107 |
-
msgstr ""
|
| 108 |
-
"PO 파일이 저장된 이후로 POT가 변경됨, 업데이트 하기 위해 동기화를 실행하세요"
|
| 109 |
-
|
| 110 |
-
#: lib/loco-admin.php:536
|
| 111 |
-
msgid "Bad file path"
|
| 112 |
-
msgstr "잘못된 파일 경로"
|
| 113 |
-
|
| 114 |
-
#: lib/loco-admin.php:783
|
| 115 |
-
msgid "Empty or invalid %s file"
|
| 116 |
-
msgstr "비어있거나 잘못된 %s 파일"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:787
|
| 119 |
-
msgid "%s file has no header"
|
| 120 |
-
msgstr "%s 파일에 머리글이 없음"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:934
|
| 123 |
-
msgctxt "Add button"
|
| 124 |
-
msgid "New template"
|
| 125 |
-
msgstr "새로운 양식"
|
| 126 |
-
|
| 127 |
-
#: lib/loco-admin.php:953
|
| 128 |
-
msgctxt "Add button"
|
| 129 |
-
msgid "New language"
|
| 130 |
-
msgstr "새로운 언어"
|
| 131 |
-
|
| 132 |
-
#: lib/loco-admin.php:992
|
| 133 |
-
msgid "%s%% translated"
|
| 134 |
-
msgstr "%s%% 번역됨"
|
| 135 |
-
|
| 136 |
-
#: lib/loco-admin.php:992
|
| 137 |
-
msgid "1 string"
|
| 138 |
-
msgid_plural "%s strings"
|
| 139 |
-
msgstr[0] "%u개의 스트링"
|
| 140 |
-
msgstr[1] ""
|
| 141 |
-
|
| 142 |
-
#: lib/loco-admin.php:995
|
| 143 |
-
msgid "%s fuzzy"
|
| 144 |
-
msgstr "%s개가 모호함"
|
| 145 |
-
|
| 146 |
-
#: lib/loco-admin.php:998
|
| 147 |
-
msgid "%s untranslated"
|
| 148 |
-
msgstr "%s개가 번역되지 않음"
|
| 149 |
-
|
| 150 |
-
#: lib/loco-admin.php:1044
|
| 151 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 152 |
-
msgstr "내장된 생성 도구로 MO 파일을 생성하는데 실패함"
|
| 153 |
-
|
| 154 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 155 |
-
msgid "Loco, Translation Management"
|
| 156 |
-
msgstr "Loco, 번역 관리"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 159 |
-
msgid "Manage translations"
|
| 160 |
-
msgstr "번역 관리"
|
| 161 |
-
|
| 162 |
-
#: lib/loco-admin.php:1094
|
| 163 |
-
msgid "Translation options"
|
| 164 |
-
msgstr "번역 옵션"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:1101
|
| 167 |
-
msgid "Loco Translate"
|
| 168 |
-
msgstr "Loco 번역"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 171 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 172 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 173 |
-
msgid "Settings"
|
| 174 |
-
msgstr "설정"
|
| 175 |
-
|
| 176 |
-
#: lib/loco-admin.php:1149
|
| 177 |
-
msgid "File download failed"
|
| 178 |
-
msgstr "파일 다운로드에 실패함"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1159
|
| 181 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 182 |
-
msgstr "WPLANG은 사용 중지되었으며 wp-config.php에서 제거되어야 합니다."
|
| 183 |
-
|
| 184 |
-
#: lib/loco-locales.php:77
|
| 185 |
-
msgid "Unknown language"
|
| 186 |
-
msgstr "알 수 없는 언어"
|
| 187 |
-
|
| 188 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 189 |
-
msgid "Some files not writable"
|
| 190 |
-
msgstr "일부 파일에 쓰기가 불가능함"
|
| 191 |
-
|
| 192 |
-
#: lib/loco-packages.php:484
|
| 193 |
-
msgid "Some files missing"
|
| 194 |
-
msgstr "일부 파일을 찾지 못함"
|
| 195 |
-
|
| 196 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 197 |
-
msgid "\"%s\" folder not writable"
|
| 198 |
-
msgstr "\"%s\" 폴더에 쓰기가 불가능함"
|
| 199 |
-
|
| 200 |
-
#: lib/loco-packages.php:515
|
| 201 |
-
msgid "POT file not writable"
|
| 202 |
-
msgstr "POT 파일에 쓰기가 불가능함"
|
| 203 |
-
|
| 204 |
-
#: lib/loco-packages.php:520
|
| 205 |
-
msgid "PO file not writable"
|
| 206 |
-
msgstr "PO 파일에 쓰기가 불가능함"
|
| 207 |
-
|
| 208 |
-
#: lib/loco-packages.php:522
|
| 209 |
-
msgid "MO file not writable"
|
| 210 |
-
msgstr "MO 파일에 쓰기가 불가능함"
|
| 211 |
-
|
| 212 |
-
#: lib/loco-packages.php:522
|
| 213 |
-
msgid "MO file not found"
|
| 214 |
-
msgstr "MO 파일을 찾지 못함"
|
| 215 |
-
|
| 216 |
-
#: lib/loco-packages.php:527
|
| 217 |
-
msgid "Folder not writable"
|
| 218 |
-
msgstr "폴더에 쓰기가 불가능함"
|
| 219 |
-
|
| 220 |
-
#: lib/loco-packages.php:527
|
| 221 |
-
msgid "Folder not found"
|
| 222 |
-
msgstr "폴더를 찾지 못함"
|
| 223 |
-
|
| 224 |
-
#: lib/loco-packages.php:546
|
| 225 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 226 |
-
msgstr "%s 이(가) \"텍스트 도메인\"을 알려주지 않습니다"
|
| 227 |
-
|
| 228 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 229 |
-
msgid "Loco has guessed \"%s\""
|
| 230 |
-
msgstr "Loco가 \"%s\"로 추측했습니다"
|
| 231 |
-
|
| 232 |
-
#: lib/loco-packages.php:551
|
| 233 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 234 |
-
msgstr "%s 이(가) \"도메인 경로\"를 알려주지 않습니다"
|
| 235 |
-
|
| 236 |
-
#: lib/loco-packages.php:556
|
| 237 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 238 |
-
msgstr ""
|
| 239 |
-
"%s 은(는) POT 파일이 없습니다. 필요할 경우 \"%s/%s.pot\" 에서 생성하세요."
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:559
|
| 242 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 243 |
-
msgstr "%s의 POT 파일명(%s)이 이상합니다. \"%s.pot\"가 더 나은 것 같습니다."
|
| 244 |
-
|
| 245 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 246 |
-
msgid "User does not have permission to manage translations"
|
| 247 |
-
msgstr "사용자가 번역을 관리할 권한이 없음"
|
| 248 |
-
|
| 249 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 250 |
-
msgid "Invalid data posted to server"
|
| 251 |
-
msgstr "서버에 잘못된 데이터가 게시됨"
|
| 252 |
-
|
| 253 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 254 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 255 |
-
msgstr "%s(으)로 MO 파일을 생성하는데 실패함, 설정을 확인하세요"
|
| 256 |
-
|
| 257 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 258 |
-
msgid "Package not found called %s"
|
| 259 |
-
msgstr "%s 이라 불리우는 패키지를 찾지 못함"
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:58
|
| 262 |
-
msgid ""
|
| 263 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 264 |
-
"backups in settings"
|
| 265 |
-
msgstr ""
|
| 266 |
-
"웹 서버가 \"%s\" 에 백업을 생성할 수 없음. 파일 권한을 수정하거나 설정에서 백"
|
| 267 |
-
"업을 비활성화하세요"
|
| 268 |
-
|
| 269 |
-
#: php/loco-posave.php:66
|
| 270 |
-
msgid ""
|
| 271 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 272 |
-
"create it manually."
|
| 273 |
-
msgstr ""
|
| 274 |
-
"웹 서버가 \"%s\" 디렉터리를 \"%s\" 에 생성하지 못했습니다. 파일 권한을 수정"
|
| 275 |
-
"하거나 수동으로 생성하세요."
|
| 276 |
-
|
| 277 |
-
#: php/loco-posave.php:69
|
| 278 |
-
msgid ""
|
| 279 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 280 |
-
"or use the download function."
|
| 281 |
-
msgstr ""
|
| 282 |
-
"웹 서버가 \"%s\" 디렉터리를 \"%s\" 에 생성하지 못했습니다. 파일 권한을 수정"
|
| 283 |
-
"하거나 다운로드 기능을 사용하세요."
|
| 284 |
-
|
| 285 |
-
#: php/loco-posave.php:81
|
| 286 |
-
msgid ""
|
| 287 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 288 |
-
"and copy to \"%s/%s\"."
|
| 289 |
-
msgstr ""
|
| 290 |
-
"웹 서버가 %s 파일을 기록할 수 없습니다. 파일 권한을 수정하거나 \"%s/%s\" 에 "
|
| 291 |
-
"다운로드 및 복사하세요."
|
| 292 |
-
|
| 293 |
-
#: php/loco-posave.php:102
|
| 294 |
-
msgid "Cannot create MO file"
|
| 295 |
-
msgstr "MO 파일을 생성할 수 없음"
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:105
|
| 298 |
-
msgid "Cannot overwrite MO file"
|
| 299 |
-
msgstr "MO 파일을 덮어쓸 수 없음"
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:131
|
| 302 |
-
msgid "Failed to write MO file"
|
| 303 |
-
msgstr "MO 파일에 기록하지 못함"
|
| 304 |
-
|
| 305 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 306 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 307 |
-
#: tpl/admin-root.tpl.php:6
|
| 308 |
-
msgid "Packages"
|
| 309 |
-
msgstr "패키지"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 312 |
-
msgid "File check"
|
| 313 |
-
msgstr "파일 확인"
|
| 314 |
-
|
| 315 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 316 |
-
msgid "File system permissions for %s"
|
| 317 |
-
msgstr "%s 에 대한 파일 시스템 권한"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 320 |
-
msgid "Other potential issues with %s"
|
| 321 |
-
msgstr "%s 에 대한 기타 잠재적 문제점"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 324 |
-
msgid "Back"
|
| 325 |
-
msgstr "뒤로"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 328 |
-
msgid "Get help"
|
| 329 |
-
msgstr "도움 얻기"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-list.tpl.php:11
|
| 332 |
-
msgctxt "Table header"
|
| 333 |
-
msgid "Package details"
|
| 334 |
-
msgstr "패키지 세부 사항"
|
| 335 |
-
|
| 336 |
-
#: tpl/admin-list.tpl.php:14
|
| 337 |
-
msgctxt "Table header"
|
| 338 |
-
msgid "Translations (PO)"
|
| 339 |
-
msgstr "번역 (PO)"
|
| 340 |
-
|
| 341 |
-
#: tpl/admin-list.tpl.php:17
|
| 342 |
-
msgctxt "Table header"
|
| 343 |
-
msgid "Template (POT)"
|
| 344 |
-
msgstr "양식 (POT)"
|
| 345 |
-
|
| 346 |
-
#: tpl/admin-list.tpl.php:20
|
| 347 |
-
msgctxt "Table header"
|
| 348 |
-
msgid "File permissions"
|
| 349 |
-
msgstr "파일 권한"
|
| 350 |
-
|
| 351 |
-
#: tpl/admin-list.tpl.php:40
|
| 352 |
-
msgid "Extends: %s"
|
| 353 |
-
msgstr "다음으로부터 확장: %s"
|
| 354 |
-
|
| 355 |
-
#: tpl/admin-list.tpl.php:44
|
| 356 |
-
msgid "1 language"
|
| 357 |
-
msgid_plural "%u languages"
|
| 358 |
-
msgstr[0] "%u개의 언어"
|
| 359 |
-
msgstr[1] ""
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 362 |
-
msgctxt "Modified time"
|
| 363 |
-
msgid "Updated"
|
| 364 |
-
msgstr "업데이트:"
|
| 365 |
-
|
| 366 |
-
#: tpl/admin-nav.tpl.php:26
|
| 367 |
-
msgid "Powered by"
|
| 368 |
-
msgstr "다음에 의해 작동 중:"
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-nav.tpl.php:32
|
| 371 |
-
msgid "Loco may not work as expected"
|
| 372 |
-
msgstr "Loco가 예상대로 작동하지 않을 수 있음"
|
| 373 |
-
|
| 374 |
-
#: tpl/admin-opts.tpl.php:18
|
| 375 |
-
msgid "Configure Loco Translate"
|
| 376 |
-
msgstr "Loco 번역 설정"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 379 |
-
msgid "Compiling MO files"
|
| 380 |
-
msgstr "MO 파일 생성 작업"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-opts.tpl.php:36
|
| 383 |
-
msgid "Use built-in MO compiler."
|
| 384 |
-
msgstr "내장된 MO 생성 도구 사용"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:42
|
| 387 |
-
msgid "Use external command:"
|
| 388 |
-
msgstr "외부 명령어 사용:"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:47
|
| 391 |
-
msgid "Enter path to msgfmt on server"
|
| 392 |
-
msgstr "서버의 msgfmt 에 대한 경로 입력"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:54
|
| 395 |
-
msgid "Generate hash tables"
|
| 396 |
-
msgstr "해시 테이블 생성"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:60
|
| 399 |
-
msgid "Include Fuzzy strings"
|
| 400 |
-
msgstr "모호한 스트링 포함"
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 403 |
-
msgid "Backing up PO files"
|
| 404 |
-
msgstr "PO 파일 백업 작업"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:75
|
| 407 |
-
msgid "Number of backups to keep of each file:"
|
| 408 |
-
msgstr "각 파일 별 유지할 백업 개수"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 411 |
-
msgid "Experimental features"
|
| 412 |
-
msgstr "실험적인 기능"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:92
|
| 415 |
-
msgid "Enable WordPress core translations"
|
| 416 |
-
msgstr "워드프레스 핵심 번역 활성화"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:101
|
| 419 |
-
msgid "Save settings"
|
| 420 |
-
msgstr "설정 저장"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 423 |
-
msgid "Template file"
|
| 424 |
-
msgstr "양식 파일"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 427 |
-
msgctxt "Dropdown label"
|
| 428 |
-
msgid "Switch to..."
|
| 429 |
-
msgstr "다음으로 전환..."
|
| 430 |
-
|
| 431 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 432 |
-
msgid "never"
|
| 433 |
-
msgstr "절대"
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 436 |
-
msgctxt "Editor button"
|
| 437 |
-
msgid "Save"
|
| 438 |
-
msgstr "저장"
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 441 |
-
msgctxt "Editor button"
|
| 442 |
-
msgid "Download"
|
| 443 |
-
msgstr "다운로드"
|
| 444 |
-
|
| 445 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 446 |
-
msgctxt "Editor button"
|
| 447 |
-
msgid "Sync"
|
| 448 |
-
msgstr "동기화"
|
| 449 |
-
|
| 450 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 451 |
-
msgctxt "Editor button"
|
| 452 |
-
msgid "Revert"
|
| 453 |
-
msgstr "되돌리기"
|
| 454 |
-
|
| 455 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 456 |
-
msgctxt "Editor button"
|
| 457 |
-
msgid "Add"
|
| 458 |
-
msgstr "추가"
|
| 459 |
-
|
| 460 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 461 |
-
msgctxt "Editor button"
|
| 462 |
-
msgid "Del"
|
| 463 |
-
msgstr "삭제"
|
| 464 |
-
|
| 465 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 466 |
-
msgctxt "Editor button"
|
| 467 |
-
msgid "Fuzzy"
|
| 468 |
-
msgstr "모호함"
|
| 469 |
-
|
| 470 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 471 |
-
msgid "Filter translations"
|
| 472 |
-
msgstr "필터 번역"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 475 |
-
msgctxt "Editor button"
|
| 476 |
-
msgid "Help"
|
| 477 |
-
msgstr "도움말"
|
| 478 |
-
|
| 479 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 480 |
-
msgid "Initialize new translations in %s"
|
| 481 |
-
msgstr "%s 에 새로운 번역을 시작"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 484 |
-
msgid "Select from common languages"
|
| 485 |
-
msgstr "공통 언어에서 선택"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 488 |
-
msgctxt "Form label"
|
| 489 |
-
msgid "or enter any language code"
|
| 490 |
-
msgstr "또는 원하는 언어 코드 입력"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 493 |
-
msgctxt "Form label"
|
| 494 |
-
msgid "create in <code>%s</code>"
|
| 495 |
-
msgstr "<code>%s</code> 에 생성"
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 498 |
-
msgctxt "Form label"
|
| 499 |
-
msgid "create in global languages directory"
|
| 500 |
-
msgstr "범용 언어 디렉터리에 생성"
|
| 501 |
-
|
| 502 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 503 |
-
msgctxt "Submit button"
|
| 504 |
-
msgid "Start translating"
|
| 505 |
-
msgstr "번역 시작"
|
| 506 |
-
|
| 507 |
-
#: tpl/admin-root.tpl.php:18
|
| 508 |
-
msgid "New version available"
|
| 509 |
-
msgstr "새로운 버전 사용 가능"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-root.tpl.php:21
|
| 512 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 513 |
-
msgstr "Loco 번역을 버전 %s(으)로 업그레이드"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-root.tpl.php:31
|
| 516 |
-
msgid "Select a plugin or theme to translate"
|
| 517 |
-
msgstr "번역할 플러그인 또는 테마를 선택하세요"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:40
|
| 520 |
-
msgctxt "Package list header"
|
| 521 |
-
msgid "Themes"
|
| 522 |
-
msgstr "테마"
|
| 523 |
-
|
| 524 |
-
#: tpl/admin-root.tpl.php:53
|
| 525 |
-
msgctxt "Package list header"
|
| 526 |
-
msgid "Plugins"
|
| 527 |
-
msgstr "플러그인"
|
| 528 |
-
|
| 529 |
-
#: tpl/admin-root.tpl.php:66
|
| 530 |
-
msgctxt "Package list header"
|
| 531 |
-
msgid "Core"
|
| 532 |
-
msgstr "핵심"
|
| 533 |
-
|
| 534 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 535 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 536 |
-
msgid ""
|
| 537 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 538 |
-
"install it"
|
| 539 |
-
msgstr ""
|
| 540 |
-
"php 확장 기능 \"%s\"이(가) 설치되지 않았습니다. 문제가 발생할 경우 설치하세요"
|
| 541 |
-
|
| 542 |
-
#: pub/js/lang/dummy.php:8
|
| 543 |
-
msgid "Unknown error"
|
| 544 |
-
msgstr "알 수없는 오류"
|
| 545 |
-
|
| 546 |
-
#: pub/js/lang/dummy.php:10
|
| 547 |
-
msgid "PO file saved"
|
| 548 |
-
msgstr "PO 파일이 저장됨"
|
| 549 |
-
|
| 550 |
-
#: pub/js/lang/dummy.php:12
|
| 551 |
-
msgid "and MO file compiled"
|
| 552 |
-
msgstr "그리고 MO 파일이 생성되었음"
|
| 553 |
-
|
| 554 |
-
#: pub/js/lang/dummy.php:15
|
| 555 |
-
msgid "Merged from %s"
|
| 556 |
-
msgstr "%s (으)로부터 병합됨"
|
| 557 |
-
|
| 558 |
-
#: pub/js/lang/dummy.php:17
|
| 559 |
-
msgid "Merged from source code"
|
| 560 |
-
msgstr "원본 코드에서 병합됨"
|
| 561 |
-
|
| 562 |
-
#: pub/js/lang/dummy.php:19
|
| 563 |
-
msgid "Already up to date with %s"
|
| 564 |
-
msgstr "%s 와(과) 비교하여 최신 상태임"
|
| 565 |
-
|
| 566 |
-
#: pub/js/lang/dummy.php:21
|
| 567 |
-
msgid "Already up to date with source code"
|
| 568 |
-
msgstr "원본 코드와 비교하여 최신 상태임"
|
| 569 |
-
|
| 570 |
-
#: pub/js/lang/dummy.php:23
|
| 571 |
-
msgid "1 new string added"
|
| 572 |
-
msgid_plural "%s new strings added"
|
| 573 |
-
msgstr[0] "%u개의 새로운 스트링이 추가됨"
|
| 574 |
-
msgstr[1] ""
|
| 575 |
-
|
| 576 |
-
#: pub/js/lang/dummy.php:25
|
| 577 |
-
msgid "1 obsolete string removed"
|
| 578 |
-
msgid_plural "%s obsolete strings removed"
|
| 579 |
-
msgstr[0] "%u개의 사용 중지된 스트링이 제거됨"
|
| 580 |
-
msgstr[1] ""
|
| 581 |
-
|
| 582 |
-
#: pub/js/lang/dummy.php:27
|
| 583 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 584 |
-
msgstr "저장하지 않고 계속할 경우 변경 사항을 잃게 됩니다."
|
| 585 |
-
|
| 586 |
-
#. label for the window pane holding native translation
|
| 587 |
-
#: pub/js/lang/dummy.php:35
|
| 588 |
-
msgctxt "Editor pane"
|
| 589 |
-
msgid "Source text"
|
| 590 |
-
msgstr "원본 텍스트"
|
| 591 |
-
|
| 592 |
-
#. where %s is the language, e.g French translation
|
| 593 |
-
#: pub/js/lang/dummy.php:38
|
| 594 |
-
msgctxt "Editor pane"
|
| 595 |
-
msgid "%s translation"
|
| 596 |
-
msgstr "%s 번역"
|
| 597 |
-
|
| 598 |
-
#. label for the window pane holding translator comments
|
| 599 |
-
#: pub/js/lang/dummy.php:41
|
| 600 |
-
msgctxt "Editor pane"
|
| 601 |
-
msgid "Comments"
|
| 602 |
-
msgstr "댓글"
|
| 603 |
-
|
| 604 |
-
#. label for the window pane holding message context
|
| 605 |
-
#: pub/js/lang/dummy.php:44
|
| 606 |
-
msgctxt "Editor pane"
|
| 607 |
-
msgid "Context"
|
| 608 |
-
msgstr "문맥"
|
| 609 |
-
|
| 610 |
-
#: pub/js/lang/dummy.php:52
|
| 611 |
-
msgid "Translation"
|
| 612 |
-
msgstr "번역"
|
| 613 |
-
|
| 614 |
-
#: pub/js/lang/dummy.php:54
|
| 615 |
-
msgid "No source files in this package, nothing to sync"
|
| 616 |
-
msgstr "이 패키지에 소스 파일이 없습니다, 동기화 할 것이 없음"
|
| 617 |
-
|
| 618 |
-
#: pub/js/lang/dummy.php:56
|
| 619 |
-
msgid "No strings could be extracted from source files"
|
| 620 |
-
msgstr "소스 파일로부터 스트링을 추출하지 못했음"
|
| 621 |
-
|
| 622 |
-
#. Description of the plugin
|
| 623 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 624 |
-
msgstr "브라우저에서 직접 워드프레스 플러그인 및 테마 번역"
|
| 625 |
-
|
| 626 |
-
#. URI of the plugin
|
| 627 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 628 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 629 |
-
|
| 630 |
-
#. Author of the plugin
|
| 631 |
-
msgid "Tim Whitlock"
|
| 632 |
-
msgstr "Tim Whitlock"
|
| 633 |
-
|
| 634 |
-
#. Author URI of the plugin
|
| 635 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 636 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-nl_BE.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-nl_BE.po
DELETED
|
@@ -1,633 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:19:21 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Dutch (Belgium)\n"
|
| 9 |
-
"Language: nl-BE\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Loco-Target-Locale: nl_BE\n"
|
| 16 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Poedit-Basepath: .\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Fout"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Waarschuwing"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr ""
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr ""
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Nieuw PO-bestand"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
|
| 61 |
-
#: lib/loco-admin.php:312
|
| 62 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 63 |
-
msgstr "Specifieer een geldige locale voor een nieuw PO-bestand"
|
| 64 |
-
|
| 65 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 66 |
-
msgid "No translatable strings found"
|
| 67 |
-
msgstr "Geen vertaalbare teksten gevonden"
|
| 68 |
-
|
| 69 |
-
#: lib/loco-admin.php:337
|
| 70 |
-
msgid "Cannot create a PO file."
|
| 71 |
-
msgstr "Kan geen PO-bestand aanmaken"
|
| 72 |
-
|
| 73 |
-
#: lib/loco-admin.php:344
|
| 74 |
-
msgid "PO file already exists with locale %s"
|
| 75 |
-
msgstr "PO-bestand bestaat al in locale %s"
|
| 76 |
-
|
| 77 |
-
#: lib/loco-admin.php:396
|
| 78 |
-
msgid ""
|
| 79 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 80 |
-
"Download instead of Save"
|
| 81 |
-
msgstr ""
|
| 82 |
-
"Bestand kan niet automatisch aangemaakt worden. Verander de rechten of "
|
| 83 |
-
"gebruik download en bewaar."
|
| 84 |
-
|
| 85 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 86 |
-
msgid "%s file is empty"
|
| 87 |
-
msgstr "Het bestand %s is leeg"
|
| 88 |
-
|
| 89 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 90 |
-
msgid "Run Sync to update from source code"
|
| 91 |
-
msgstr "Voer Sync uit om de broncode up te daten"
|
| 92 |
-
|
| 93 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 94 |
-
msgid "No strings could be extracted from source code"
|
| 95 |
-
msgstr "Er kon geen tekst uit de broncode gehaald worden"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:417
|
| 98 |
-
msgid "Run Sync to update from %s"
|
| 99 |
-
msgstr "Gebruik Sync om vanuit %s up te daten"
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:436
|
| 102 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 103 |
-
msgstr "Broncode is veranderd. Gebruik Sync om POT up te daten"
|
| 104 |
-
|
| 105 |
-
#: lib/loco-admin.php:440
|
| 106 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 107 |
-
msgstr ""
|
| 108 |
-
"POT is veranderd sedert bewaren van het PO-bestand. Gebruik Sync om up te "
|
| 109 |
-
"daten"
|
| 110 |
-
|
| 111 |
-
#: lib/loco-admin.php:536
|
| 112 |
-
msgid "Bad file path"
|
| 113 |
-
msgstr "Foute bestandslocatie"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:783
|
| 116 |
-
msgid "Empty or invalid %s file"
|
| 117 |
-
msgstr ""
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:787
|
| 120 |
-
msgid "%s file has no header"
|
| 121 |
-
msgstr ""
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:934
|
| 124 |
-
msgctxt "Add button"
|
| 125 |
-
msgid "New template"
|
| 126 |
-
msgstr "Nieuw sjabloon"
|
| 127 |
-
|
| 128 |
-
#: lib/loco-admin.php:953
|
| 129 |
-
msgctxt "Add button"
|
| 130 |
-
msgid "New language"
|
| 131 |
-
msgstr "Nieuwe taal"
|
| 132 |
-
|
| 133 |
-
#: lib/loco-admin.php:992
|
| 134 |
-
msgid "%s%% translated"
|
| 135 |
-
msgstr "%s%% vertaald"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "1 string"
|
| 139 |
-
msgid_plural "%s strings"
|
| 140 |
-
msgstr[0] "1 te vertalen tekst"
|
| 141 |
-
msgstr[1] "%s te vertalen teksten"
|
| 142 |
-
|
| 143 |
-
#: lib/loco-admin.php:995
|
| 144 |
-
msgid "%s fuzzy"
|
| 145 |
-
msgstr "%s onzeker"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:998
|
| 148 |
-
msgid "%s untranslated"
|
| 149 |
-
msgstr "%s onvertaald"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:1044
|
| 152 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 153 |
-
msgstr ""
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 156 |
-
msgid "Loco, Translation Management"
|
| 157 |
-
msgstr "Loco, vertalingsbeheer"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 160 |
-
msgid "Manage translations"
|
| 161 |
-
msgstr "Beheer vertalingen"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1094
|
| 164 |
-
msgid "Translation options"
|
| 165 |
-
msgstr ""
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1101
|
| 168 |
-
msgid "Loco Translate"
|
| 169 |
-
msgstr ""
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 172 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 173 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 174 |
-
msgid "Settings"
|
| 175 |
-
msgstr ""
|
| 176 |
-
|
| 177 |
-
#: lib/loco-admin.php:1149
|
| 178 |
-
msgid "File download failed"
|
| 179 |
-
msgstr ""
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1159
|
| 182 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 183 |
-
msgstr ""
|
| 184 |
-
|
| 185 |
-
#: lib/loco-locales.php:77
|
| 186 |
-
msgid "Unknown language"
|
| 187 |
-
msgstr "Onbekende taal"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 190 |
-
msgid "Some files not writable"
|
| 191 |
-
msgstr "Sommige bestanden hebben geen schrijfrechten"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:484
|
| 194 |
-
msgid "Some files missing"
|
| 195 |
-
msgstr ""
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 198 |
-
msgid "\"%s\" folder not writable"
|
| 199 |
-
msgstr "Map \"%s\" heeft geen schrijfrechten"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:515
|
| 202 |
-
msgid "POT file not writable"
|
| 203 |
-
msgstr ""
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:520
|
| 206 |
-
msgid "PO file not writable"
|
| 207 |
-
msgstr ""
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:522
|
| 210 |
-
msgid "MO file not writable"
|
| 211 |
-
msgstr ""
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not found"
|
| 215 |
-
msgstr ""
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:527
|
| 218 |
-
msgid "Folder not writable"
|
| 219 |
-
msgstr ""
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not found"
|
| 223 |
-
msgstr ""
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:546
|
| 226 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 227 |
-
msgstr ""
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 230 |
-
msgid "Loco has guessed \"%s\""
|
| 231 |
-
msgstr ""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:551
|
| 234 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 235 |
-
msgstr ""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:556
|
| 238 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 239 |
-
msgstr ""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:559
|
| 242 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 246 |
-
msgid "User does not have permission to manage translations"
|
| 247 |
-
msgstr "Gebruik heeft geen rechten om vertalingen te beheren"
|
| 248 |
-
|
| 249 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 250 |
-
msgid "Invalid data posted to server"
|
| 251 |
-
msgstr "Ongeldige gegevens op server"
|
| 252 |
-
|
| 253 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 254 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 255 |
-
msgstr ""
|
| 256 |
-
|
| 257 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 258 |
-
msgid "Package not found called %s"
|
| 259 |
-
msgstr ""
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:58
|
| 262 |
-
msgid ""
|
| 263 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 264 |
-
"backups in settings"
|
| 265 |
-
msgstr ""
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:66
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 270 |
-
"create it manually."
|
| 271 |
-
msgstr ""
|
| 272 |
-
"Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of "
|
| 273 |
-
"maak het zelf aan."
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:69
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 278 |
-
"or use the download function."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of "
|
| 281 |
-
"gebruik de downloadfunctie."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:81
|
| 284 |
-
msgid ""
|
| 285 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 286 |
-
"and copy to \"%s/%s\"."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"Bestand %s kan niet beschreven worden door de webserver. Bewerk de "
|
| 289 |
-
"schrijfrechten of download en kopieer naar \"%s/%s\"."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:102
|
| 292 |
-
msgid "Cannot create MO file"
|
| 293 |
-
msgstr ""
|
| 294 |
-
|
| 295 |
-
#: php/loco-posave.php:105
|
| 296 |
-
msgid "Cannot overwrite MO file"
|
| 297 |
-
msgstr ""
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:131
|
| 300 |
-
msgid "Failed to write MO file"
|
| 301 |
-
msgstr ""
|
| 302 |
-
|
| 303 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 304 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 305 |
-
#: tpl/admin-root.tpl.php:6
|
| 306 |
-
msgid "Packages"
|
| 307 |
-
msgstr "Pakketten"
|
| 308 |
-
|
| 309 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 310 |
-
msgid "File check"
|
| 311 |
-
msgstr ""
|
| 312 |
-
|
| 313 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 314 |
-
msgid "File system permissions for %s"
|
| 315 |
-
msgstr ""
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 318 |
-
msgid "Other potential issues with %s"
|
| 319 |
-
msgstr ""
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 322 |
-
msgid "Back"
|
| 323 |
-
msgstr ""
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 326 |
-
msgid "Get help"
|
| 327 |
-
msgstr ""
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-list.tpl.php:11
|
| 330 |
-
msgctxt "Table header"
|
| 331 |
-
msgid "Package details"
|
| 332 |
-
msgstr "Pakketdetails"
|
| 333 |
-
|
| 334 |
-
#: tpl/admin-list.tpl.php:14
|
| 335 |
-
msgctxt "Table header"
|
| 336 |
-
msgid "Translations (PO)"
|
| 337 |
-
msgstr "Vertalingen (PO)"
|
| 338 |
-
|
| 339 |
-
#: tpl/admin-list.tpl.php:17
|
| 340 |
-
msgctxt "Table header"
|
| 341 |
-
msgid "Template (POT)"
|
| 342 |
-
msgstr "Sjabloon (POT)"
|
| 343 |
-
|
| 344 |
-
#: tpl/admin-list.tpl.php:20
|
| 345 |
-
msgctxt "Table header"
|
| 346 |
-
msgid "File permissions"
|
| 347 |
-
msgstr "Bestandsrechten"
|
| 348 |
-
|
| 349 |
-
#: tpl/admin-list.tpl.php:40
|
| 350 |
-
msgid "Extends: %s"
|
| 351 |
-
msgstr ""
|
| 352 |
-
|
| 353 |
-
#: tpl/admin-list.tpl.php:44
|
| 354 |
-
msgid "1 language"
|
| 355 |
-
msgid_plural "%u languages"
|
| 356 |
-
msgstr[0] "1 taal"
|
| 357 |
-
msgstr[1] "%u talen"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 360 |
-
msgctxt "Modified time"
|
| 361 |
-
msgid "Updated"
|
| 362 |
-
msgstr "Geüpdated"
|
| 363 |
-
|
| 364 |
-
#: tpl/admin-nav.tpl.php:26
|
| 365 |
-
msgid "Powered by"
|
| 366 |
-
msgstr "Ondersteund door"
|
| 367 |
-
|
| 368 |
-
#: tpl/admin-nav.tpl.php:32
|
| 369 |
-
msgid "Loco may not work as expected"
|
| 370 |
-
msgstr ""
|
| 371 |
-
|
| 372 |
-
#: tpl/admin-opts.tpl.php:18
|
| 373 |
-
msgid "Configure Loco Translate"
|
| 374 |
-
msgstr ""
|
| 375 |
-
|
| 376 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 377 |
-
msgid "Compiling MO files"
|
| 378 |
-
msgstr ""
|
| 379 |
-
|
| 380 |
-
#: tpl/admin-opts.tpl.php:36
|
| 381 |
-
msgid "Use built-in MO compiler."
|
| 382 |
-
msgstr ""
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-opts.tpl.php:42
|
| 385 |
-
msgid "Use external command:"
|
| 386 |
-
msgstr ""
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-opts.tpl.php:47
|
| 389 |
-
msgid "Enter path to msgfmt on server"
|
| 390 |
-
msgstr ""
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:54
|
| 393 |
-
msgid "Generate hash tables"
|
| 394 |
-
msgstr ""
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:60
|
| 397 |
-
msgid "Include Fuzzy strings"
|
| 398 |
-
msgstr ""
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 401 |
-
msgid "Backing up PO files"
|
| 402 |
-
msgstr ""
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:75
|
| 405 |
-
msgid "Number of backups to keep of each file:"
|
| 406 |
-
msgstr ""
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 409 |
-
msgid "Experimental features"
|
| 410 |
-
msgstr ""
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:92
|
| 413 |
-
msgid "Enable WordPress core translations"
|
| 414 |
-
msgstr ""
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:101
|
| 417 |
-
msgid "Save settings"
|
| 418 |
-
msgstr ""
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 421 |
-
msgid "Template file"
|
| 422 |
-
msgstr "Sjabloonbestand"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 425 |
-
msgctxt "Dropdown label"
|
| 426 |
-
msgid "Switch to..."
|
| 427 |
-
msgstr ""
|
| 428 |
-
|
| 429 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 430 |
-
msgid "never"
|
| 431 |
-
msgstr "nooit"
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 434 |
-
msgctxt "Editor button"
|
| 435 |
-
msgid "Save"
|
| 436 |
-
msgstr "Opslaan"
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 439 |
-
msgctxt "Editor button"
|
| 440 |
-
msgid "Download"
|
| 441 |
-
msgstr "Downloaden"
|
| 442 |
-
|
| 443 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 444 |
-
msgctxt "Editor button"
|
| 445 |
-
msgid "Sync"
|
| 446 |
-
msgstr "Sync"
|
| 447 |
-
|
| 448 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 449 |
-
msgctxt "Editor button"
|
| 450 |
-
msgid "Revert"
|
| 451 |
-
msgstr "Ongedaan maken"
|
| 452 |
-
|
| 453 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 454 |
-
msgctxt "Editor button"
|
| 455 |
-
msgid "Add"
|
| 456 |
-
msgstr "Toevoegen"
|
| 457 |
-
|
| 458 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 459 |
-
msgctxt "Editor button"
|
| 460 |
-
msgid "Del"
|
| 461 |
-
msgstr "Verwijder"
|
| 462 |
-
|
| 463 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 464 |
-
msgctxt "Editor button"
|
| 465 |
-
msgid "Fuzzy"
|
| 466 |
-
msgstr "Onzeker"
|
| 467 |
-
|
| 468 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 469 |
-
msgid "Filter translations"
|
| 470 |
-
msgstr "Filter vertalingen"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Help"
|
| 475 |
-
msgstr "Help"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 478 |
-
msgid "Initialize new translations in %s"
|
| 479 |
-
msgstr "Start nieuwe vertalingen in %s"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 482 |
-
msgid "Select from common languages"
|
| 483 |
-
msgstr "Selecteer van gebruikelijke talen"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 486 |
-
msgctxt "Form label"
|
| 487 |
-
msgid "or enter any language code"
|
| 488 |
-
msgstr "of geef een taalcode op"
|
| 489 |
-
|
| 490 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 491 |
-
msgctxt "Form label"
|
| 492 |
-
msgid "create in <code>%s</code>"
|
| 493 |
-
msgstr ""
|
| 494 |
-
|
| 495 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 496 |
-
msgctxt "Form label"
|
| 497 |
-
msgid "create in global languages directory"
|
| 498 |
-
msgstr ""
|
| 499 |
-
|
| 500 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 501 |
-
msgctxt "Submit button"
|
| 502 |
-
msgid "Start translating"
|
| 503 |
-
msgstr "Start vertalen"
|
| 504 |
-
|
| 505 |
-
#: tpl/admin-root.tpl.php:18
|
| 506 |
-
msgid "New version available"
|
| 507 |
-
msgstr "Nieuwe versie beschikbaar"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-root.tpl.php:21
|
| 510 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 511 |
-
msgstr "Loco Translate upgraden naar versie %s"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:31
|
| 514 |
-
msgid "Select a plugin or theme to translate"
|
| 515 |
-
msgstr "Selecteer een plug-in of thema om te vertalen"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:40
|
| 518 |
-
msgctxt "Package list header"
|
| 519 |
-
msgid "Themes"
|
| 520 |
-
msgstr "Thema's"
|
| 521 |
-
|
| 522 |
-
#: tpl/admin-root.tpl.php:53
|
| 523 |
-
msgctxt "Package list header"
|
| 524 |
-
msgid "Plugins"
|
| 525 |
-
msgstr "Plug-ins"
|
| 526 |
-
|
| 527 |
-
#: tpl/admin-root.tpl.php:66
|
| 528 |
-
msgctxt "Package list header"
|
| 529 |
-
msgid "Core"
|
| 530 |
-
msgstr ""
|
| 531 |
-
|
| 532 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 533 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 534 |
-
msgid ""
|
| 535 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 536 |
-
"install it"
|
| 537 |
-
msgstr ""
|
| 538 |
-
|
| 539 |
-
#: pub/js/lang/dummy.php:8
|
| 540 |
-
msgid "Unknown error"
|
| 541 |
-
msgstr ""
|
| 542 |
-
|
| 543 |
-
#: pub/js/lang/dummy.php:10
|
| 544 |
-
msgid "PO file saved"
|
| 545 |
-
msgstr ""
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:12
|
| 548 |
-
msgid "and MO file compiled"
|
| 549 |
-
msgstr ""
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:15
|
| 552 |
-
msgid "Merged from %s"
|
| 553 |
-
msgstr ""
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:17
|
| 556 |
-
msgid "Merged from source code"
|
| 557 |
-
msgstr ""
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:19
|
| 560 |
-
msgid "Already up to date with %s"
|
| 561 |
-
msgstr ""
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:21
|
| 564 |
-
msgid "Already up to date with source code"
|
| 565 |
-
msgstr ""
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:23
|
| 568 |
-
msgid "1 new string added"
|
| 569 |
-
msgid_plural "%s new strings added"
|
| 570 |
-
msgstr[0] ""
|
| 571 |
-
msgstr[1] ""
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:25
|
| 574 |
-
msgid "1 obsolete string removed"
|
| 575 |
-
msgid_plural "%s obsolete strings removed"
|
| 576 |
-
msgstr[0] ""
|
| 577 |
-
msgstr[1] ""
|
| 578 |
-
|
| 579 |
-
#: pub/js/lang/dummy.php:27
|
| 580 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 581 |
-
msgstr ""
|
| 582 |
-
|
| 583 |
-
#. label for the window pane holding native translation
|
| 584 |
-
#: pub/js/lang/dummy.php:35
|
| 585 |
-
msgctxt "Editor pane"
|
| 586 |
-
msgid "Source text"
|
| 587 |
-
msgstr ""
|
| 588 |
-
|
| 589 |
-
#. where %s is the language, e.g French translation
|
| 590 |
-
#: pub/js/lang/dummy.php:38
|
| 591 |
-
msgctxt "Editor pane"
|
| 592 |
-
msgid "%s translation"
|
| 593 |
-
msgstr ""
|
| 594 |
-
|
| 595 |
-
#. label for the window pane holding translator comments
|
| 596 |
-
#: pub/js/lang/dummy.php:41
|
| 597 |
-
msgctxt "Editor pane"
|
| 598 |
-
msgid "Comments"
|
| 599 |
-
msgstr ""
|
| 600 |
-
|
| 601 |
-
#. label for the window pane holding message context
|
| 602 |
-
#: pub/js/lang/dummy.php:44
|
| 603 |
-
msgctxt "Editor pane"
|
| 604 |
-
msgid "Context"
|
| 605 |
-
msgstr ""
|
| 606 |
-
|
| 607 |
-
#: pub/js/lang/dummy.php:52
|
| 608 |
-
msgid "Translation"
|
| 609 |
-
msgstr ""
|
| 610 |
-
|
| 611 |
-
#: pub/js/lang/dummy.php:54
|
| 612 |
-
msgid "No source files in this package, nothing to sync"
|
| 613 |
-
msgstr ""
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:56
|
| 616 |
-
msgid "No strings could be extracted from source files"
|
| 617 |
-
msgstr "Er konden geen te vertalen teksten uit de bronbestanden gehaald worden"
|
| 618 |
-
|
| 619 |
-
#. Description of the plugin
|
| 620 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 621 |
-
msgstr ""
|
| 622 |
-
|
| 623 |
-
#. URI of the plugin
|
| 624 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 625 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 626 |
-
|
| 627 |
-
#. Author of the plugin
|
| 628 |
-
msgid "Tim Whitlock"
|
| 629 |
-
msgstr "Tim Whitlock"
|
| 630 |
-
|
| 631 |
-
#. Author URI of the plugin
|
| 632 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 633 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-nl_NL.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-nl_NL.po
DELETED
|
@@ -1,633 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:19:34 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Dutch\n"
|
| 9 |
-
"Language: nl-NL\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Loco-Target-Locale: nl_NL\n"
|
| 16 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Poedit-Basepath: .\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Fout"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Waarschuwing"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr ""
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr ""
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr ""
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Nieuw PO-bestand"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
|
| 61 |
-
#: lib/loco-admin.php:312
|
| 62 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 63 |
-
msgstr "Specifieer een geldige locale voor een nieuw PO-bestand"
|
| 64 |
-
|
| 65 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 66 |
-
msgid "No translatable strings found"
|
| 67 |
-
msgstr "Geen vertaalbare teksten gevonden"
|
| 68 |
-
|
| 69 |
-
#: lib/loco-admin.php:337
|
| 70 |
-
msgid "Cannot create a PO file."
|
| 71 |
-
msgstr "Kan geen PO-bestand aanmaken"
|
| 72 |
-
|
| 73 |
-
#: lib/loco-admin.php:344
|
| 74 |
-
msgid "PO file already exists with locale %s"
|
| 75 |
-
msgstr "PO-bestand bestaat al in locale %s"
|
| 76 |
-
|
| 77 |
-
#: lib/loco-admin.php:396
|
| 78 |
-
msgid ""
|
| 79 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 80 |
-
"Download instead of Save"
|
| 81 |
-
msgstr ""
|
| 82 |
-
"Bestand kan niet automatisch aangemaakt worden. Verander de rechten of "
|
| 83 |
-
"gebruik download en bewaar."
|
| 84 |
-
|
| 85 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 86 |
-
msgid "%s file is empty"
|
| 87 |
-
msgstr "Het bestand %s is leeg"
|
| 88 |
-
|
| 89 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 90 |
-
msgid "Run Sync to update from source code"
|
| 91 |
-
msgstr "Voer Sync uit om de broncode up te daten"
|
| 92 |
-
|
| 93 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 94 |
-
msgid "No strings could be extracted from source code"
|
| 95 |
-
msgstr "Er kon geen tekst uit de broncode gehaald worden"
|
| 96 |
-
|
| 97 |
-
#: lib/loco-admin.php:417
|
| 98 |
-
msgid "Run Sync to update from %s"
|
| 99 |
-
msgstr "Gebruik Sync om vanuit %s up te daten"
|
| 100 |
-
|
| 101 |
-
#: lib/loco-admin.php:436
|
| 102 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 103 |
-
msgstr "Broncode is veranderd. Gebruik Sync om POT up te daten"
|
| 104 |
-
|
| 105 |
-
#: lib/loco-admin.php:440
|
| 106 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 107 |
-
msgstr ""
|
| 108 |
-
"POT is veranderd sedert bewaren van het PO-bestand. Gebruik Sync om up te "
|
| 109 |
-
"daten"
|
| 110 |
-
|
| 111 |
-
#: lib/loco-admin.php:536
|
| 112 |
-
msgid "Bad file path"
|
| 113 |
-
msgstr "Foute bestandslocatie"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:783
|
| 116 |
-
msgid "Empty or invalid %s file"
|
| 117 |
-
msgstr ""
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:787
|
| 120 |
-
msgid "%s file has no header"
|
| 121 |
-
msgstr ""
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:934
|
| 124 |
-
msgctxt "Add button"
|
| 125 |
-
msgid "New template"
|
| 126 |
-
msgstr "Nieuw sjabloon"
|
| 127 |
-
|
| 128 |
-
#: lib/loco-admin.php:953
|
| 129 |
-
msgctxt "Add button"
|
| 130 |
-
msgid "New language"
|
| 131 |
-
msgstr "Nieuwe taal"
|
| 132 |
-
|
| 133 |
-
#: lib/loco-admin.php:992
|
| 134 |
-
msgid "%s%% translated"
|
| 135 |
-
msgstr "%s%% vertaald"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "1 string"
|
| 139 |
-
msgid_plural "%s strings"
|
| 140 |
-
msgstr[0] "1 te vertalen tekst"
|
| 141 |
-
msgstr[1] "%s te vertalen teksten"
|
| 142 |
-
|
| 143 |
-
#: lib/loco-admin.php:995
|
| 144 |
-
msgid "%s fuzzy"
|
| 145 |
-
msgstr "%s onzeker"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:998
|
| 148 |
-
msgid "%s untranslated"
|
| 149 |
-
msgstr "%s onvertaald"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:1044
|
| 152 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 153 |
-
msgstr ""
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 156 |
-
msgid "Loco, Translation Management"
|
| 157 |
-
msgstr "Loco, vertalingsbeheer"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 160 |
-
msgid "Manage translations"
|
| 161 |
-
msgstr "Beheer vertalingen"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1094
|
| 164 |
-
msgid "Translation options"
|
| 165 |
-
msgstr ""
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1101
|
| 168 |
-
msgid "Loco Translate"
|
| 169 |
-
msgstr ""
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 172 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 173 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 174 |
-
msgid "Settings"
|
| 175 |
-
msgstr ""
|
| 176 |
-
|
| 177 |
-
#: lib/loco-admin.php:1149
|
| 178 |
-
msgid "File download failed"
|
| 179 |
-
msgstr ""
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1159
|
| 182 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 183 |
-
msgstr ""
|
| 184 |
-
|
| 185 |
-
#: lib/loco-locales.php:77
|
| 186 |
-
msgid "Unknown language"
|
| 187 |
-
msgstr "Onbekende taal"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 190 |
-
msgid "Some files not writable"
|
| 191 |
-
msgstr "Sommige bestanden hebben geen schrijfrechten"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:484
|
| 194 |
-
msgid "Some files missing"
|
| 195 |
-
msgstr ""
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 198 |
-
msgid "\"%s\" folder not writable"
|
| 199 |
-
msgstr "Map \"%s\" heeft geen schrijfrechten"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:515
|
| 202 |
-
msgid "POT file not writable"
|
| 203 |
-
msgstr ""
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:520
|
| 206 |
-
msgid "PO file not writable"
|
| 207 |
-
msgstr ""
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:522
|
| 210 |
-
msgid "MO file not writable"
|
| 211 |
-
msgstr ""
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not found"
|
| 215 |
-
msgstr ""
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:527
|
| 218 |
-
msgid "Folder not writable"
|
| 219 |
-
msgstr ""
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not found"
|
| 223 |
-
msgstr ""
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:546
|
| 226 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 227 |
-
msgstr ""
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 230 |
-
msgid "Loco has guessed \"%s\""
|
| 231 |
-
msgstr ""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:551
|
| 234 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 235 |
-
msgstr ""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:556
|
| 238 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 239 |
-
msgstr ""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:559
|
| 242 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 246 |
-
msgid "User does not have permission to manage translations"
|
| 247 |
-
msgstr "Gebruik heeft geen rechten om vertalingen te beheren"
|
| 248 |
-
|
| 249 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 250 |
-
msgid "Invalid data posted to server"
|
| 251 |
-
msgstr "Ongeldige gegevens op server"
|
| 252 |
-
|
| 253 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 254 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 255 |
-
msgstr ""
|
| 256 |
-
|
| 257 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 258 |
-
msgid "Package not found called %s"
|
| 259 |
-
msgstr ""
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:58
|
| 262 |
-
msgid ""
|
| 263 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 264 |
-
"backups in settings"
|
| 265 |
-
msgstr ""
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:66
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 270 |
-
"create it manually."
|
| 271 |
-
msgstr ""
|
| 272 |
-
"Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of "
|
| 273 |
-
"maak het zelf aan."
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:69
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 278 |
-
"or use the download function."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of "
|
| 281 |
-
"gebruik de downloadfunctie."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:81
|
| 284 |
-
msgid ""
|
| 285 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 286 |
-
"and copy to \"%s/%s\"."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"Bestand %s kan niet beschreven worden door de webserver. Bewerk de "
|
| 289 |
-
"schrijfrechten of download en kopieer naar \"%s/%s\"."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:102
|
| 292 |
-
msgid "Cannot create MO file"
|
| 293 |
-
msgstr ""
|
| 294 |
-
|
| 295 |
-
#: php/loco-posave.php:105
|
| 296 |
-
msgid "Cannot overwrite MO file"
|
| 297 |
-
msgstr ""
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:131
|
| 300 |
-
msgid "Failed to write MO file"
|
| 301 |
-
msgstr ""
|
| 302 |
-
|
| 303 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 304 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 305 |
-
#: tpl/admin-root.tpl.php:6
|
| 306 |
-
msgid "Packages"
|
| 307 |
-
msgstr "Pakketten"
|
| 308 |
-
|
| 309 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 310 |
-
msgid "File check"
|
| 311 |
-
msgstr ""
|
| 312 |
-
|
| 313 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 314 |
-
msgid "File system permissions for %s"
|
| 315 |
-
msgstr ""
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 318 |
-
msgid "Other potential issues with %s"
|
| 319 |
-
msgstr ""
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 322 |
-
msgid "Back"
|
| 323 |
-
msgstr ""
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 326 |
-
msgid "Get help"
|
| 327 |
-
msgstr ""
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-list.tpl.php:11
|
| 330 |
-
msgctxt "Table header"
|
| 331 |
-
msgid "Package details"
|
| 332 |
-
msgstr "Pakketdetails"
|
| 333 |
-
|
| 334 |
-
#: tpl/admin-list.tpl.php:14
|
| 335 |
-
msgctxt "Table header"
|
| 336 |
-
msgid "Translations (PO)"
|
| 337 |
-
msgstr "Vertalingen (PO)"
|
| 338 |
-
|
| 339 |
-
#: tpl/admin-list.tpl.php:17
|
| 340 |
-
msgctxt "Table header"
|
| 341 |
-
msgid "Template (POT)"
|
| 342 |
-
msgstr "Sjabloon (POT)"
|
| 343 |
-
|
| 344 |
-
#: tpl/admin-list.tpl.php:20
|
| 345 |
-
msgctxt "Table header"
|
| 346 |
-
msgid "File permissions"
|
| 347 |
-
msgstr "Bestandsrechten"
|
| 348 |
-
|
| 349 |
-
#: tpl/admin-list.tpl.php:40
|
| 350 |
-
msgid "Extends: %s"
|
| 351 |
-
msgstr ""
|
| 352 |
-
|
| 353 |
-
#: tpl/admin-list.tpl.php:44
|
| 354 |
-
msgid "1 language"
|
| 355 |
-
msgid_plural "%u languages"
|
| 356 |
-
msgstr[0] "1 taal"
|
| 357 |
-
msgstr[1] "%u talen"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 360 |
-
msgctxt "Modified time"
|
| 361 |
-
msgid "Updated"
|
| 362 |
-
msgstr "Geüpdated"
|
| 363 |
-
|
| 364 |
-
#: tpl/admin-nav.tpl.php:26
|
| 365 |
-
msgid "Powered by"
|
| 366 |
-
msgstr "Ondersteund door"
|
| 367 |
-
|
| 368 |
-
#: tpl/admin-nav.tpl.php:32
|
| 369 |
-
msgid "Loco may not work as expected"
|
| 370 |
-
msgstr ""
|
| 371 |
-
|
| 372 |
-
#: tpl/admin-opts.tpl.php:18
|
| 373 |
-
msgid "Configure Loco Translate"
|
| 374 |
-
msgstr ""
|
| 375 |
-
|
| 376 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 377 |
-
msgid "Compiling MO files"
|
| 378 |
-
msgstr ""
|
| 379 |
-
|
| 380 |
-
#: tpl/admin-opts.tpl.php:36
|
| 381 |
-
msgid "Use built-in MO compiler."
|
| 382 |
-
msgstr ""
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-opts.tpl.php:42
|
| 385 |
-
msgid "Use external command:"
|
| 386 |
-
msgstr ""
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-opts.tpl.php:47
|
| 389 |
-
msgid "Enter path to msgfmt on server"
|
| 390 |
-
msgstr ""
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:54
|
| 393 |
-
msgid "Generate hash tables"
|
| 394 |
-
msgstr ""
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:60
|
| 397 |
-
msgid "Include Fuzzy strings"
|
| 398 |
-
msgstr ""
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 401 |
-
msgid "Backing up PO files"
|
| 402 |
-
msgstr ""
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:75
|
| 405 |
-
msgid "Number of backups to keep of each file:"
|
| 406 |
-
msgstr ""
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 409 |
-
msgid "Experimental features"
|
| 410 |
-
msgstr ""
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:92
|
| 413 |
-
msgid "Enable WordPress core translations"
|
| 414 |
-
msgstr ""
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:101
|
| 417 |
-
msgid "Save settings"
|
| 418 |
-
msgstr ""
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 421 |
-
msgid "Template file"
|
| 422 |
-
msgstr "Sjabloonbestand"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 425 |
-
msgctxt "Dropdown label"
|
| 426 |
-
msgid "Switch to..."
|
| 427 |
-
msgstr ""
|
| 428 |
-
|
| 429 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 430 |
-
msgid "never"
|
| 431 |
-
msgstr "nooit"
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 434 |
-
msgctxt "Editor button"
|
| 435 |
-
msgid "Save"
|
| 436 |
-
msgstr "Opslaan"
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 439 |
-
msgctxt "Editor button"
|
| 440 |
-
msgid "Download"
|
| 441 |
-
msgstr "Downloaden"
|
| 442 |
-
|
| 443 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 444 |
-
msgctxt "Editor button"
|
| 445 |
-
msgid "Sync"
|
| 446 |
-
msgstr "Sync"
|
| 447 |
-
|
| 448 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 449 |
-
msgctxt "Editor button"
|
| 450 |
-
msgid "Revert"
|
| 451 |
-
msgstr "Ongedaan maken"
|
| 452 |
-
|
| 453 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 454 |
-
msgctxt "Editor button"
|
| 455 |
-
msgid "Add"
|
| 456 |
-
msgstr "Toevoegen"
|
| 457 |
-
|
| 458 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 459 |
-
msgctxt "Editor button"
|
| 460 |
-
msgid "Del"
|
| 461 |
-
msgstr "Verwijder"
|
| 462 |
-
|
| 463 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 464 |
-
msgctxt "Editor button"
|
| 465 |
-
msgid "Fuzzy"
|
| 466 |
-
msgstr "Onzeker"
|
| 467 |
-
|
| 468 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 469 |
-
msgid "Filter translations"
|
| 470 |
-
msgstr "Filter vertalingen"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Help"
|
| 475 |
-
msgstr "Help"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 478 |
-
msgid "Initialize new translations in %s"
|
| 479 |
-
msgstr "Start nieuwe vertalingen in %s"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 482 |
-
msgid "Select from common languages"
|
| 483 |
-
msgstr "Selecteer van gebruikelijke talen"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 486 |
-
msgctxt "Form label"
|
| 487 |
-
msgid "or enter any language code"
|
| 488 |
-
msgstr "of geef een taalcode op"
|
| 489 |
-
|
| 490 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 491 |
-
msgctxt "Form label"
|
| 492 |
-
msgid "create in <code>%s</code>"
|
| 493 |
-
msgstr ""
|
| 494 |
-
|
| 495 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 496 |
-
msgctxt "Form label"
|
| 497 |
-
msgid "create in global languages directory"
|
| 498 |
-
msgstr ""
|
| 499 |
-
|
| 500 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 501 |
-
msgctxt "Submit button"
|
| 502 |
-
msgid "Start translating"
|
| 503 |
-
msgstr "Start vertalen"
|
| 504 |
-
|
| 505 |
-
#: tpl/admin-root.tpl.php:18
|
| 506 |
-
msgid "New version available"
|
| 507 |
-
msgstr "Nieuwe versie beschikbaar"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-root.tpl.php:21
|
| 510 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 511 |
-
msgstr "Loco Translate upgraden naar versie %s"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:31
|
| 514 |
-
msgid "Select a plugin or theme to translate"
|
| 515 |
-
msgstr "Selecteer een plug-in of thema om te vertalen"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:40
|
| 518 |
-
msgctxt "Package list header"
|
| 519 |
-
msgid "Themes"
|
| 520 |
-
msgstr "Thema's"
|
| 521 |
-
|
| 522 |
-
#: tpl/admin-root.tpl.php:53
|
| 523 |
-
msgctxt "Package list header"
|
| 524 |
-
msgid "Plugins"
|
| 525 |
-
msgstr "Plug-ins"
|
| 526 |
-
|
| 527 |
-
#: tpl/admin-root.tpl.php:66
|
| 528 |
-
msgctxt "Package list header"
|
| 529 |
-
msgid "Core"
|
| 530 |
-
msgstr ""
|
| 531 |
-
|
| 532 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 533 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 534 |
-
msgid ""
|
| 535 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 536 |
-
"install it"
|
| 537 |
-
msgstr ""
|
| 538 |
-
|
| 539 |
-
#: pub/js/lang/dummy.php:8
|
| 540 |
-
msgid "Unknown error"
|
| 541 |
-
msgstr ""
|
| 542 |
-
|
| 543 |
-
#: pub/js/lang/dummy.php:10
|
| 544 |
-
msgid "PO file saved"
|
| 545 |
-
msgstr ""
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:12
|
| 548 |
-
msgid "and MO file compiled"
|
| 549 |
-
msgstr ""
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:15
|
| 552 |
-
msgid "Merged from %s"
|
| 553 |
-
msgstr ""
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:17
|
| 556 |
-
msgid "Merged from source code"
|
| 557 |
-
msgstr ""
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:19
|
| 560 |
-
msgid "Already up to date with %s"
|
| 561 |
-
msgstr ""
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:21
|
| 564 |
-
msgid "Already up to date with source code"
|
| 565 |
-
msgstr ""
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:23
|
| 568 |
-
msgid "1 new string added"
|
| 569 |
-
msgid_plural "%s new strings added"
|
| 570 |
-
msgstr[0] ""
|
| 571 |
-
msgstr[1] ""
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:25
|
| 574 |
-
msgid "1 obsolete string removed"
|
| 575 |
-
msgid_plural "%s obsolete strings removed"
|
| 576 |
-
msgstr[0] ""
|
| 577 |
-
msgstr[1] ""
|
| 578 |
-
|
| 579 |
-
#: pub/js/lang/dummy.php:27
|
| 580 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 581 |
-
msgstr ""
|
| 582 |
-
|
| 583 |
-
#. label for the window pane holding native translation
|
| 584 |
-
#: pub/js/lang/dummy.php:35
|
| 585 |
-
msgctxt "Editor pane"
|
| 586 |
-
msgid "Source text"
|
| 587 |
-
msgstr ""
|
| 588 |
-
|
| 589 |
-
#. where %s is the language, e.g French translation
|
| 590 |
-
#: pub/js/lang/dummy.php:38
|
| 591 |
-
msgctxt "Editor pane"
|
| 592 |
-
msgid "%s translation"
|
| 593 |
-
msgstr ""
|
| 594 |
-
|
| 595 |
-
#. label for the window pane holding translator comments
|
| 596 |
-
#: pub/js/lang/dummy.php:41
|
| 597 |
-
msgctxt "Editor pane"
|
| 598 |
-
msgid "Comments"
|
| 599 |
-
msgstr ""
|
| 600 |
-
|
| 601 |
-
#. label for the window pane holding message context
|
| 602 |
-
#: pub/js/lang/dummy.php:44
|
| 603 |
-
msgctxt "Editor pane"
|
| 604 |
-
msgid "Context"
|
| 605 |
-
msgstr ""
|
| 606 |
-
|
| 607 |
-
#: pub/js/lang/dummy.php:52
|
| 608 |
-
msgid "Translation"
|
| 609 |
-
msgstr ""
|
| 610 |
-
|
| 611 |
-
#: pub/js/lang/dummy.php:54
|
| 612 |
-
msgid "No source files in this package, nothing to sync"
|
| 613 |
-
msgstr ""
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:56
|
| 616 |
-
msgid "No strings could be extracted from source files"
|
| 617 |
-
msgstr "Er konden geen te vertalen teksten uit de bronbestanden gehaald worden"
|
| 618 |
-
|
| 619 |
-
#. Description of the plugin
|
| 620 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 621 |
-
msgstr ""
|
| 622 |
-
|
| 623 |
-
#. URI of the plugin
|
| 624 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 625 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 626 |
-
|
| 627 |
-
#. Author of the plugin
|
| 628 |
-
msgid "Tim Whitlock"
|
| 629 |
-
msgstr "Tim Whitlock"
|
| 630 |
-
|
| 631 |
-
#. Author URI of the plugin
|
| 632 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 633 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-pl_PL.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-pl_PL.po
DELETED
|
@@ -1,649 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:19:51 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Polish\n"
|
| 9 |
-
"Language: pl-PL\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=3; plural=(n==1 ? 0 : n%10 >= 2 && n%10<=4 &&(n"
|
| 14 |
-
"%100<10||n%100 >= 20)? 1 : 2)\n"
|
| 15 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
-
"X-Poedit-Basepath: .\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 19 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 20 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 21 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 22 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 23 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 24 |
-
"X-Loco-Target-Locale: pl_PL\n"
|
| 25 |
-
|
| 26 |
-
#. Translators: Bold text label in admin error messages
|
| 27 |
-
#: lib/loco-admin.php:31
|
| 28 |
-
msgctxt "Message label"
|
| 29 |
-
msgid "Error"
|
| 30 |
-
msgstr "Błąd"
|
| 31 |
-
|
| 32 |
-
#: lib/loco-admin.php:41
|
| 33 |
-
msgctxt "Message label"
|
| 34 |
-
msgid "Warning"
|
| 35 |
-
msgstr "Ostrzeżenie"
|
| 36 |
-
|
| 37 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 38 |
-
msgctxt "Message label"
|
| 39 |
-
msgid "OK"
|
| 40 |
-
msgstr "OK"
|
| 41 |
-
|
| 42 |
-
#: lib/loco-admin.php:63
|
| 43 |
-
msgid "Permission denied"
|
| 44 |
-
msgstr "Odmowa dostępu"
|
| 45 |
-
|
| 46 |
-
#: lib/loco-admin.php:86
|
| 47 |
-
msgid "Settings saved"
|
| 48 |
-
msgstr "Ustawienia zapisane"
|
| 49 |
-
|
| 50 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 51 |
-
msgid "%s is not an official WordPress language"
|
| 52 |
-
msgstr "%s nie jest oficjalnym tłumaczeniem WordPress'a"
|
| 53 |
-
|
| 54 |
-
#: lib/loco-admin.php:199
|
| 55 |
-
msgid "New PO file"
|
| 56 |
-
msgstr "Nowy plik PO"
|
| 57 |
-
|
| 58 |
-
#: lib/loco-admin.php:214
|
| 59 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 60 |
-
msgstr ""
|
| 61 |
-
"Plik PO użyty jako szablon. Nazwa zostanie zmieniona na % przy pierwszym "
|
| 62 |
-
"zapisie"
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "Musisz określić właściwy region dla nowego pliku PO"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "Brak dostępnych lini do tłumaczenia"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "Nie można utworzyć pliku PO."
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "Plik PO już istnieje z regionu %s"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"Plik nie może być utworzony automatycznie. Napraw uprawnienia albo użyj "
|
| 86 |
-
"Pobierz zamiast Zapisz"
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr "Plik %s jest pusty"
|
| 91 |
-
|
| 92 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 93 |
-
msgid "Run Sync to update from source code"
|
| 94 |
-
msgstr "Uruchom synchronizację aby zaktualizować z kodu źródłowego"
|
| 95 |
-
|
| 96 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 97 |
-
msgid "No strings could be extracted from source code"
|
| 98 |
-
msgstr "Nie można wyciągnąć żadnych linii z kodu źródłowego"
|
| 99 |
-
|
| 100 |
-
#: lib/loco-admin.php:417
|
| 101 |
-
msgid "Run Sync to update from %s"
|
| 102 |
-
msgstr "Uruchom synchronizację aby zaktualizować z %s"
|
| 103 |
-
|
| 104 |
-
#: lib/loco-admin.php:436
|
| 105 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 106 |
-
msgstr ""
|
| 107 |
-
"Kod źródłowy został zaktualizowany, uruchom synchronizację aby zaktualizować "
|
| 108 |
-
"plik POT"
|
| 109 |
-
|
| 110 |
-
#: lib/loco-admin.php:440
|
| 111 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 112 |
-
msgstr ""
|
| 113 |
-
"Plik POT został zmieniony od czasu zapisu pliku PO, uruchom synchronizację "
|
| 114 |
-
"aby zaktualizować"
|
| 115 |
-
|
| 116 |
-
#: lib/loco-admin.php:536
|
| 117 |
-
msgid "Bad file path"
|
| 118 |
-
msgstr "Błędna ścieżka pliku"
|
| 119 |
-
|
| 120 |
-
#: lib/loco-admin.php:783
|
| 121 |
-
msgid "Empty or invalid %s file"
|
| 122 |
-
msgstr "Pusty lub błędny plik %s"
|
| 123 |
-
|
| 124 |
-
#: lib/loco-admin.php:787
|
| 125 |
-
msgid "%s file has no header"
|
| 126 |
-
msgstr "Plik %s nie ma nagłówka"
|
| 127 |
-
|
| 128 |
-
#: lib/loco-admin.php:934
|
| 129 |
-
msgctxt "Add button"
|
| 130 |
-
msgid "New template"
|
| 131 |
-
msgstr "Nowy szablon"
|
| 132 |
-
|
| 133 |
-
#: lib/loco-admin.php:953
|
| 134 |
-
msgctxt "Add button"
|
| 135 |
-
msgid "New language"
|
| 136 |
-
msgstr "Nowy język"
|
| 137 |
-
|
| 138 |
-
#: lib/loco-admin.php:992
|
| 139 |
-
msgid "%s%% translated"
|
| 140 |
-
msgstr "%s%% przetłumaczono"
|
| 141 |
-
|
| 142 |
-
#: lib/loco-admin.php:992
|
| 143 |
-
msgid "1 string"
|
| 144 |
-
msgid_plural "%s strings"
|
| 145 |
-
msgstr[0] "1 linia"
|
| 146 |
-
msgstr[1] "%s linie"
|
| 147 |
-
msgstr[2] "%s linii"
|
| 148 |
-
|
| 149 |
-
#: lib/loco-admin.php:995
|
| 150 |
-
msgid "%s fuzzy"
|
| 151 |
-
msgstr "%s niepewnych"
|
| 152 |
-
|
| 153 |
-
#: lib/loco-admin.php:998
|
| 154 |
-
msgid "%s untranslated"
|
| 155 |
-
msgstr "%s nie przetłumaczone"
|
| 156 |
-
|
| 157 |
-
#: lib/loco-admin.php:1044
|
| 158 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 159 |
-
msgstr "Niepowodzenie kompilacji pliku MO używając wbudowanego kompilatora"
|
| 160 |
-
|
| 161 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 162 |
-
msgid "Loco, Translation Management"
|
| 163 |
-
msgstr "Loco, Menadżer Tłumaczeń"
|
| 164 |
-
|
| 165 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 166 |
-
msgid "Manage translations"
|
| 167 |
-
msgstr "Zarządzaj tłumaczeniami"
|
| 168 |
-
|
| 169 |
-
#: lib/loco-admin.php:1094
|
| 170 |
-
msgid "Translation options"
|
| 171 |
-
msgstr "Opcje tłumaczeń"
|
| 172 |
-
|
| 173 |
-
#: lib/loco-admin.php:1101
|
| 174 |
-
msgid "Loco Translate"
|
| 175 |
-
msgstr "Loco Translate"
|
| 176 |
-
|
| 177 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 178 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 179 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 180 |
-
msgid "Settings"
|
| 181 |
-
msgstr "Ustawienia"
|
| 182 |
-
|
| 183 |
-
#: lib/loco-admin.php:1149
|
| 184 |
-
msgid "File download failed"
|
| 185 |
-
msgstr "Błąd pobierania pliku"
|
| 186 |
-
|
| 187 |
-
#: lib/loco-admin.php:1159
|
| 188 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 189 |
-
msgstr "WPLANG jest przestarzały i powinien zostać usunięty z wp-config.php"
|
| 190 |
-
|
| 191 |
-
#: lib/loco-locales.php:77
|
| 192 |
-
msgid "Unknown language"
|
| 193 |
-
msgstr "Nieznany język"
|
| 194 |
-
|
| 195 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 196 |
-
msgid "Some files not writable"
|
| 197 |
-
msgstr "Niektóre pliki są tylko do odczytu"
|
| 198 |
-
|
| 199 |
-
#: lib/loco-packages.php:484
|
| 200 |
-
msgid "Some files missing"
|
| 201 |
-
msgstr "Brakujące niektóre pliki"
|
| 202 |
-
|
| 203 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 204 |
-
msgid "\"%s\" folder not writable"
|
| 205 |
-
msgstr "\"%s\" katalog jest tylko do odczytu"
|
| 206 |
-
|
| 207 |
-
#: lib/loco-packages.php:515
|
| 208 |
-
msgid "POT file not writable"
|
| 209 |
-
msgstr "Plik POT jest tylko do odczytu"
|
| 210 |
-
|
| 211 |
-
#: lib/loco-packages.php:520
|
| 212 |
-
msgid "PO file not writable"
|
| 213 |
-
msgstr "Plik PO jest tylko do odczytu"
|
| 214 |
-
|
| 215 |
-
#: lib/loco-packages.php:522
|
| 216 |
-
msgid "MO file not writable"
|
| 217 |
-
msgstr "Plik MO jest tylko do odczytu"
|
| 218 |
-
|
| 219 |
-
#: lib/loco-packages.php:522
|
| 220 |
-
msgid "MO file not found"
|
| 221 |
-
msgstr "Nie znaleziono pliku MO"
|
| 222 |
-
|
| 223 |
-
#: lib/loco-packages.php:527
|
| 224 |
-
msgid "Folder not writable"
|
| 225 |
-
msgstr "Katalog jest tylko do odczytu"
|
| 226 |
-
|
| 227 |
-
#: lib/loco-packages.php:527
|
| 228 |
-
msgid "Folder not found"
|
| 229 |
-
msgstr "Nie znaleziono katalogu"
|
| 230 |
-
|
| 231 |
-
#: lib/loco-packages.php:546
|
| 232 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 233 |
-
msgstr "%s nie deklaruje \"Tekst Domeny\""
|
| 234 |
-
|
| 235 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 236 |
-
msgid "Loco has guessed \"%s\""
|
| 237 |
-
msgstr "Loco zgadł \"%s\""
|
| 238 |
-
|
| 239 |
-
#: lib/loco-packages.php:551
|
| 240 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 241 |
-
msgstr "%s nie deklaruje \"Ścieżka Domeny\""
|
| 242 |
-
|
| 243 |
-
#: lib/loco-packages.php:556
|
| 244 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 245 |
-
msgstr ""
|
| 246 |
-
"%s nie ma żadnego pliku POT. Stwórz go w \"%s/%s.pot\" jeżeli takowego "
|
| 247 |
-
"potrzebujesz."
|
| 248 |
-
|
| 249 |
-
#: lib/loco-packages.php:559
|
| 250 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 251 |
-
msgstr "%s ma dziwną nazwę pliku POT (%s). Lepszą nazwą byłoby \"%s.pot\""
|
| 252 |
-
|
| 253 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 254 |
-
msgid "User does not have permission to manage translations"
|
| 255 |
-
msgstr "Użytkownik nie ma uprawnień do zarządzania tłumaczeniami"
|
| 256 |
-
|
| 257 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 258 |
-
msgid "Invalid data posted to server"
|
| 259 |
-
msgstr "Błędne dane wysłane do serwera"
|
| 260 |
-
|
| 261 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 262 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 263 |
-
msgstr "Nie udało się skompilować pliku MO używając %s, sprawdź ustawienia"
|
| 264 |
-
|
| 265 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 266 |
-
msgid "Package not found called %s"
|
| 267 |
-
msgstr "Paczka o nazwie %s nie została znaleziona"
|
| 268 |
-
|
| 269 |
-
#: php/loco-posave.php:58
|
| 270 |
-
msgid ""
|
| 271 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 272 |
-
"backups in settings"
|
| 273 |
-
msgstr ""
|
| 274 |
-
"Serwer www nie może utworzyć kopii w \"%s\". Popraw uprawnienia lub wyłącz "
|
| 275 |
-
"kopie zapasowe w ustawieniach"
|
| 276 |
-
|
| 277 |
-
#: php/loco-posave.php:66
|
| 278 |
-
msgid ""
|
| 279 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 280 |
-
"create it manually."
|
| 281 |
-
msgstr ""
|
| 282 |
-
"Serwer www nie może utworzyć katalogu \"%s\". Popraw uprawnienia lub utwórz "
|
| 283 |
-
"go ręcznie."
|
| 284 |
-
|
| 285 |
-
#: php/loco-posave.php:69
|
| 286 |
-
msgid ""
|
| 287 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 288 |
-
"or use the download function."
|
| 289 |
-
msgstr ""
|
| 290 |
-
"Serwer www nie może utworzyć plików w katalogu \"%s\". Popraw uprawnienia "
|
| 291 |
-
"lub użyj funkcji pobierania."
|
| 292 |
-
|
| 293 |
-
#: php/loco-posave.php:81
|
| 294 |
-
msgid ""
|
| 295 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 296 |
-
"and copy to \"%s/%s\"."
|
| 297 |
-
msgstr ""
|
| 298 |
-
"%s jest tylko do odczytu dla serwera www. Popraw uprawnienia lub pobierz i "
|
| 299 |
-
"skopiuj do \"%s/%s\"."
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:102
|
| 302 |
-
msgid "Cannot create MO file"
|
| 303 |
-
msgstr "Nie można utworzyć pliku MO"
|
| 304 |
-
|
| 305 |
-
#: php/loco-posave.php:105
|
| 306 |
-
msgid "Cannot overwrite MO file"
|
| 307 |
-
msgstr "Nie można nadpisać pliku MO"
|
| 308 |
-
|
| 309 |
-
#: php/loco-posave.php:131
|
| 310 |
-
msgid "Failed to write MO file"
|
| 311 |
-
msgstr "Błąd zapisu pliku MO"
|
| 312 |
-
|
| 313 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 314 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 315 |
-
#: tpl/admin-root.tpl.php:6
|
| 316 |
-
msgid "Packages"
|
| 317 |
-
msgstr "Paczki"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 320 |
-
msgid "File check"
|
| 321 |
-
msgstr "Sprawdzenie plików"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 324 |
-
msgid "File system permissions for %s"
|
| 325 |
-
msgstr "Uprawnienia systemu plików dla %s"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 328 |
-
msgid "Other potential issues with %s"
|
| 329 |
-
msgstr "Inne potencjalne problemy z %s"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 332 |
-
msgid "Back"
|
| 333 |
-
msgstr "Wstecz"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 336 |
-
msgid "Get help"
|
| 337 |
-
msgstr "Pomoc"
|
| 338 |
-
|
| 339 |
-
#: tpl/admin-list.tpl.php:11
|
| 340 |
-
msgctxt "Table header"
|
| 341 |
-
msgid "Package details"
|
| 342 |
-
msgstr "Detale paczki"
|
| 343 |
-
|
| 344 |
-
#: tpl/admin-list.tpl.php:14
|
| 345 |
-
msgctxt "Table header"
|
| 346 |
-
msgid "Translations (PO)"
|
| 347 |
-
msgstr "Tłumaczenia (PO)"
|
| 348 |
-
|
| 349 |
-
#: tpl/admin-list.tpl.php:17
|
| 350 |
-
msgctxt "Table header"
|
| 351 |
-
msgid "Template (POT)"
|
| 352 |
-
msgstr "Schemat (POT)"
|
| 353 |
-
|
| 354 |
-
#: tpl/admin-list.tpl.php:20
|
| 355 |
-
msgctxt "Table header"
|
| 356 |
-
msgid "File permissions"
|
| 357 |
-
msgstr "Uprawnienia plików"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:40
|
| 360 |
-
msgid "Extends: %s"
|
| 361 |
-
msgstr "Rozszerza: %s"
|
| 362 |
-
|
| 363 |
-
#: tpl/admin-list.tpl.php:44
|
| 364 |
-
msgid "1 language"
|
| 365 |
-
msgid_plural "%u languages"
|
| 366 |
-
msgstr[0] "1 język"
|
| 367 |
-
msgstr[1] "%u języki"
|
| 368 |
-
msgstr[2] "%u języków"
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 371 |
-
msgctxt "Modified time"
|
| 372 |
-
msgid "Updated"
|
| 373 |
-
msgstr "Zaktualizowano"
|
| 374 |
-
|
| 375 |
-
#: tpl/admin-nav.tpl.php:26
|
| 376 |
-
msgid "Powered by"
|
| 377 |
-
msgstr "Napędzany przez"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-nav.tpl.php:32
|
| 380 |
-
msgid "Loco may not work as expected"
|
| 381 |
-
msgstr "Loco może nie działać tak jak oczekujesz"
|
| 382 |
-
|
| 383 |
-
#: tpl/admin-opts.tpl.php:18
|
| 384 |
-
msgid "Configure Loco Translate"
|
| 385 |
-
msgstr "Konfiguruj Loco Translate"
|
| 386 |
-
|
| 387 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 388 |
-
msgid "Compiling MO files"
|
| 389 |
-
msgstr "Kompilowanie plików MO"
|
| 390 |
-
|
| 391 |
-
#: tpl/admin-opts.tpl.php:36
|
| 392 |
-
msgid "Use built-in MO compiler."
|
| 393 |
-
msgstr "Użyj wbudowanego kompilatora MO."
|
| 394 |
-
|
| 395 |
-
#: tpl/admin-opts.tpl.php:42
|
| 396 |
-
msgid "Use external command:"
|
| 397 |
-
msgstr "Użyj zewnętrznej komendy:"
|
| 398 |
-
|
| 399 |
-
#: tpl/admin-opts.tpl.php:47
|
| 400 |
-
msgid "Enter path to msgfmt on server"
|
| 401 |
-
msgstr "Wpisz ścieżkę do msgfmt na serwerze"
|
| 402 |
-
|
| 403 |
-
#: tpl/admin-opts.tpl.php:54
|
| 404 |
-
msgid "Generate hash tables"
|
| 405 |
-
msgstr "Generuj tablice hash"
|
| 406 |
-
|
| 407 |
-
#: tpl/admin-opts.tpl.php:60
|
| 408 |
-
msgid "Include Fuzzy strings"
|
| 409 |
-
msgstr "Uwzględniaj niepewne ciągi znaków"
|
| 410 |
-
|
| 411 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 412 |
-
msgid "Backing up PO files"
|
| 413 |
-
msgstr "Zrób kopię zapasową plików PO"
|
| 414 |
-
|
| 415 |
-
#: tpl/admin-opts.tpl.php:75
|
| 416 |
-
msgid "Number of backups to keep of each file:"
|
| 417 |
-
msgstr "Liczba kopii zapasowych każdego pliku do przechowania:"
|
| 418 |
-
|
| 419 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 420 |
-
msgid "Experimental features"
|
| 421 |
-
msgstr "Funkcje eksperymentalne"
|
| 422 |
-
|
| 423 |
-
#: tpl/admin-opts.tpl.php:92
|
| 424 |
-
msgid "Enable WordPress core translations"
|
| 425 |
-
msgstr "Włącz tłumaczenie silnika WordPress"
|
| 426 |
-
|
| 427 |
-
#: tpl/admin-opts.tpl.php:101
|
| 428 |
-
msgid "Save settings"
|
| 429 |
-
msgstr "Zapisz ustawienia"
|
| 430 |
-
|
| 431 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 432 |
-
msgid "Template file"
|
| 433 |
-
msgstr "Plik schematu"
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 436 |
-
msgctxt "Dropdown label"
|
| 437 |
-
msgid "Switch to..."
|
| 438 |
-
msgstr "Zmień na..."
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 441 |
-
msgid "never"
|
| 442 |
-
msgstr "nigdy"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 445 |
-
msgctxt "Editor button"
|
| 446 |
-
msgid "Save"
|
| 447 |
-
msgstr "Zapisz"
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 450 |
-
msgctxt "Editor button"
|
| 451 |
-
msgid "Download"
|
| 452 |
-
msgstr "Pobierz"
|
| 453 |
-
|
| 454 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 455 |
-
msgctxt "Editor button"
|
| 456 |
-
msgid "Sync"
|
| 457 |
-
msgstr "Synchronizuj"
|
| 458 |
-
|
| 459 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 460 |
-
msgctxt "Editor button"
|
| 461 |
-
msgid "Revert"
|
| 462 |
-
msgstr "Przywróć"
|
| 463 |
-
|
| 464 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 465 |
-
msgctxt "Editor button"
|
| 466 |
-
msgid "Add"
|
| 467 |
-
msgstr "Dodaj"
|
| 468 |
-
|
| 469 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 470 |
-
msgctxt "Editor button"
|
| 471 |
-
msgid "Del"
|
| 472 |
-
msgstr "Usuń"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 475 |
-
msgctxt "Editor button"
|
| 476 |
-
msgid "Fuzzy"
|
| 477 |
-
msgstr "Niepewny"
|
| 478 |
-
|
| 479 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 480 |
-
msgid "Filter translations"
|
| 481 |
-
msgstr "Filtruj tłumaczenia"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 484 |
-
msgctxt "Editor button"
|
| 485 |
-
msgid "Help"
|
| 486 |
-
msgstr "Pomoc"
|
| 487 |
-
|
| 488 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 489 |
-
msgid "Initialize new translations in %s"
|
| 490 |
-
msgstr "Zainicjuj nowe tłumaczenie w %s"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 493 |
-
msgid "Select from common languages"
|
| 494 |
-
msgstr "Wybierz z częstych języków"
|
| 495 |
-
|
| 496 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 497 |
-
msgctxt "Form label"
|
| 498 |
-
msgid "or enter any language code"
|
| 499 |
-
msgstr "lub wpisz dowolny kod języka"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 502 |
-
msgctxt "Form label"
|
| 503 |
-
msgid "create in <code>%s</code>"
|
| 504 |
-
msgstr "stwórz w <code>%s</code>"
|
| 505 |
-
|
| 506 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 507 |
-
msgctxt "Form label"
|
| 508 |
-
msgid "create in global languages directory"
|
| 509 |
-
msgstr "stwórz w globalny, katalogu języków"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 512 |
-
msgctxt "Submit button"
|
| 513 |
-
msgid "Start translating"
|
| 514 |
-
msgstr "Zacznij tłumaczyć"
|
| 515 |
-
|
| 516 |
-
#: tpl/admin-root.tpl.php:18
|
| 517 |
-
msgid "New version available"
|
| 518 |
-
msgstr "Nowa wersja jest dostępna"
|
| 519 |
-
|
| 520 |
-
#: tpl/admin-root.tpl.php:21
|
| 521 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 522 |
-
msgstr "Zaktualizuj Loco Translate do wersji %s"
|
| 523 |
-
|
| 524 |
-
#: tpl/admin-root.tpl.php:31
|
| 525 |
-
msgid "Select a plugin or theme to translate"
|
| 526 |
-
msgstr "Wybierz wtyczkę lub motyw do tłumaczenia"
|
| 527 |
-
|
| 528 |
-
#: tpl/admin-root.tpl.php:40
|
| 529 |
-
msgctxt "Package list header"
|
| 530 |
-
msgid "Themes"
|
| 531 |
-
msgstr "Motywy"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:53
|
| 534 |
-
msgctxt "Package list header"
|
| 535 |
-
msgid "Plugins"
|
| 536 |
-
msgstr "Wtyczki"
|
| 537 |
-
|
| 538 |
-
#: tpl/admin-root.tpl.php:66
|
| 539 |
-
msgctxt "Package list header"
|
| 540 |
-
msgid "Core"
|
| 541 |
-
msgstr "Silnik"
|
| 542 |
-
|
| 543 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 544 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 545 |
-
msgid ""
|
| 546 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 547 |
-
"install it"
|
| 548 |
-
msgstr ""
|
| 549 |
-
"Rozszerzenie PHP \"%s\" nie jest zainstalowane. Jeżeli doświadczasz pewnych "
|
| 550 |
-
"problemów to powinieneś je spróbować zainstalować"
|
| 551 |
-
|
| 552 |
-
#: pub/js/lang/dummy.php:8
|
| 553 |
-
msgid "Unknown error"
|
| 554 |
-
msgstr "Nieznany błąd"
|
| 555 |
-
|
| 556 |
-
#: pub/js/lang/dummy.php:10
|
| 557 |
-
msgid "PO file saved"
|
| 558 |
-
msgstr "Plik PO zapisany"
|
| 559 |
-
|
| 560 |
-
#: pub/js/lang/dummy.php:12
|
| 561 |
-
msgid "and MO file compiled"
|
| 562 |
-
msgstr "oraz plik MO skompilowany"
|
| 563 |
-
|
| 564 |
-
#: pub/js/lang/dummy.php:15
|
| 565 |
-
msgid "Merged from %s"
|
| 566 |
-
msgstr "Połączono z %s"
|
| 567 |
-
|
| 568 |
-
#: pub/js/lang/dummy.php:17
|
| 569 |
-
msgid "Merged from source code"
|
| 570 |
-
msgstr "Połączono z kodu źródłowego"
|
| 571 |
-
|
| 572 |
-
#: pub/js/lang/dummy.php:19
|
| 573 |
-
msgid "Already up to date with %s"
|
| 574 |
-
msgstr "Już aktualne z %s"
|
| 575 |
-
|
| 576 |
-
#: pub/js/lang/dummy.php:21
|
| 577 |
-
msgid "Already up to date with source code"
|
| 578 |
-
msgstr "Już aktualne z kodu źródłowego"
|
| 579 |
-
|
| 580 |
-
#: pub/js/lang/dummy.php:23
|
| 581 |
-
msgid "1 new string added"
|
| 582 |
-
msgid_plural "%s new strings added"
|
| 583 |
-
msgstr[0] "1 nowa linia dodana"
|
| 584 |
-
msgstr[1] "%s nowe linie dodano"
|
| 585 |
-
msgstr[2] "%s nowych linii dodano"
|
| 586 |
-
|
| 587 |
-
#: pub/js/lang/dummy.php:25
|
| 588 |
-
msgid "1 obsolete string removed"
|
| 589 |
-
msgid_plural "%s obsolete strings removed"
|
| 590 |
-
msgstr[0] "1 zbędna linia usunięta"
|
| 591 |
-
msgstr[1] "%s zbędne linie usunięte"
|
| 592 |
-
msgstr[2] "%s zbędnych linii usunięto"
|
| 593 |
-
|
| 594 |
-
#: pub/js/lang/dummy.php:27
|
| 595 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 596 |
-
msgstr "Utracisz aktualne zmiany jeśli będziesz kontynuował bez zapisywania"
|
| 597 |
-
|
| 598 |
-
#. label for the window pane holding native translation
|
| 599 |
-
#: pub/js/lang/dummy.php:35
|
| 600 |
-
msgctxt "Editor pane"
|
| 601 |
-
msgid "Source text"
|
| 602 |
-
msgstr "Tekst źródłowy"
|
| 603 |
-
|
| 604 |
-
#. where %s is the language, e.g French translation
|
| 605 |
-
#: pub/js/lang/dummy.php:38
|
| 606 |
-
msgctxt "Editor pane"
|
| 607 |
-
msgid "%s translation"
|
| 608 |
-
msgstr "%s tłumaczenie"
|
| 609 |
-
|
| 610 |
-
#. label for the window pane holding translator comments
|
| 611 |
-
#: pub/js/lang/dummy.php:41
|
| 612 |
-
msgctxt "Editor pane"
|
| 613 |
-
msgid "Comments"
|
| 614 |
-
msgstr "Komentarze"
|
| 615 |
-
|
| 616 |
-
#. label for the window pane holding message context
|
| 617 |
-
#: pub/js/lang/dummy.php:44
|
| 618 |
-
msgctxt "Editor pane"
|
| 619 |
-
msgid "Context"
|
| 620 |
-
msgstr "Kontekst"
|
| 621 |
-
|
| 622 |
-
#: pub/js/lang/dummy.php:52
|
| 623 |
-
msgid "Translation"
|
| 624 |
-
msgstr "Tłumaczenie"
|
| 625 |
-
|
| 626 |
-
#: pub/js/lang/dummy.php:54
|
| 627 |
-
msgid "No source files in this package, nothing to sync"
|
| 628 |
-
msgstr "Brak plików źródłowych w tej paczce, nic do synchronizacji"
|
| 629 |
-
|
| 630 |
-
#: pub/js/lang/dummy.php:56
|
| 631 |
-
msgid "No strings could be extracted from source files"
|
| 632 |
-
msgstr "Żadne linie nie mogą być wyciągnięte z plików źródłowych"
|
| 633 |
-
|
| 634 |
-
#. Description of the plugin
|
| 635 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 636 |
-
msgstr ""
|
| 637 |
-
"Tłumacz wtyczki i skórki WordPress'a bezpośrednio z poziomu przeglądarki"
|
| 638 |
-
|
| 639 |
-
#. URI of the plugin
|
| 640 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 641 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 642 |
-
|
| 643 |
-
#. Author of the plugin
|
| 644 |
-
msgid "Tim Whitlock"
|
| 645 |
-
msgstr "Tim Whitlock"
|
| 646 |
-
|
| 647 |
-
#. Author URI of the plugin
|
| 648 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 649 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-pt_BR.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-pt_BR.po
DELETED
|
@@ -1,643 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:03 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Portuguese (Brazil)\n"
|
| 9 |
-
"Language: pt-BR\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: pt_BR\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Erro"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Alerta"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "Ok"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Permissão negada"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Configurações salvas"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "%s não é uma linguagem oficial do Wordpress"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Novo arquivo PO"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"Arquivo PO usado como template. Isto vai ser renomeado para %s no primeiro "
|
| 61 |
-
"salvamento"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Você tem que especificar um local válido para o novo arquivo PO"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Não foram encontrados termos traduzíveis"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Não pode ser criado o arquivo PO."
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "Arquivo PO já existe com a localização %s"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"Arquivo não pode ser criado automaticamente. Corrija as permissões do "
|
| 85 |
-
"arquivo ou use Baixar em vez de Salvar."
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "O arquivo %s está vazio"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "Clique em Sincronizar para atualizar a partir do código fonte"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "Nenhum termo pode ser extraído a partir do código fonte"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "Clique em Sincronizar para atualizar a partir de %s"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr ""
|
| 106 |
-
"O código fonte foi modificado, clique em Sincronizar para o POT atualizado"
|
| 107 |
-
|
| 108 |
-
#: lib/loco-admin.php:440
|
| 109 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 110 |
-
msgstr ""
|
| 111 |
-
"O arquivo POT não foi atualizado desde que o arquivo PO foi salvo, clique em "
|
| 112 |
-
"Sincronizar para atualizar"
|
| 113 |
-
|
| 114 |
-
#: lib/loco-admin.php:536
|
| 115 |
-
msgid "Bad file path"
|
| 116 |
-
msgstr "Endereço de arquivo ruim"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:783
|
| 119 |
-
msgid "Empty or invalid %s file"
|
| 120 |
-
msgstr "O arquivo %s está vazio ou é inválido"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:787
|
| 123 |
-
msgid "%s file has no header"
|
| 124 |
-
msgstr "O arquivo %s não tem cabeçalho"
|
| 125 |
-
|
| 126 |
-
#: lib/loco-admin.php:934
|
| 127 |
-
msgctxt "Add button"
|
| 128 |
-
msgid "New template"
|
| 129 |
-
msgstr "Novo modelo"
|
| 130 |
-
|
| 131 |
-
#: lib/loco-admin.php:953
|
| 132 |
-
msgctxt "Add button"
|
| 133 |
-
msgid "New language"
|
| 134 |
-
msgstr "Novo idioma"
|
| 135 |
-
|
| 136 |
-
#: lib/loco-admin.php:992
|
| 137 |
-
msgid "%s%% translated"
|
| 138 |
-
msgstr "%s%% traduzido"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:992
|
| 141 |
-
msgid "1 string"
|
| 142 |
-
msgid_plural "%s strings"
|
| 143 |
-
msgstr[0] "1 termo"
|
| 144 |
-
msgstr[1] "%s termos"
|
| 145 |
-
|
| 146 |
-
#: lib/loco-admin.php:995
|
| 147 |
-
msgid "%s fuzzy"
|
| 148 |
-
msgstr "%s incerto"
|
| 149 |
-
|
| 150 |
-
#: lib/loco-admin.php:998
|
| 151 |
-
msgid "%s untranslated"
|
| 152 |
-
msgstr "%s não traduzido"
|
| 153 |
-
|
| 154 |
-
#: lib/loco-admin.php:1044
|
| 155 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 156 |
-
msgstr "Falha ao compilar arquivo MO com compilador embutido"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 159 |
-
msgid "Loco, Translation Management"
|
| 160 |
-
msgstr "Loco, Gerenciador de Tradução"
|
| 161 |
-
|
| 162 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 163 |
-
msgid "Manage translations"
|
| 164 |
-
msgstr "Gerenciar traduções"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:1094
|
| 167 |
-
msgid "Translation options"
|
| 168 |
-
msgstr "Opções de traduções"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:1101
|
| 171 |
-
msgid "Loco Translate"
|
| 172 |
-
msgstr "Tradução (Loco)"
|
| 173 |
-
|
| 174 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 175 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 176 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 177 |
-
msgid "Settings"
|
| 178 |
-
msgstr "Configurações"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1149
|
| 181 |
-
msgid "File download failed"
|
| 182 |
-
msgstr "Download do arquivo falhou"
|
| 183 |
-
|
| 184 |
-
#: lib/loco-admin.php:1159
|
| 185 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 186 |
-
msgstr "WPLANG é obsoleto e deve ser removido do wp-config.php"
|
| 187 |
-
|
| 188 |
-
#: lib/loco-locales.php:77
|
| 189 |
-
msgid "Unknown language"
|
| 190 |
-
msgstr "Idioma desconhecido"
|
| 191 |
-
|
| 192 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 193 |
-
msgid "Some files not writable"
|
| 194 |
-
msgstr "Alguns arquivos não são editáveis"
|
| 195 |
-
|
| 196 |
-
#: lib/loco-packages.php:484
|
| 197 |
-
msgid "Some files missing"
|
| 198 |
-
msgstr "Alguns arquivos estão ausentes"
|
| 199 |
-
|
| 200 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 201 |
-
msgid "\"%s\" folder not writable"
|
| 202 |
-
msgstr "Pasta \"%s\" não editável"
|
| 203 |
-
|
| 204 |
-
#: lib/loco-packages.php:515
|
| 205 |
-
msgid "POT file not writable"
|
| 206 |
-
msgstr "Arquivo POT não editável"
|
| 207 |
-
|
| 208 |
-
#: lib/loco-packages.php:520
|
| 209 |
-
msgid "PO file not writable"
|
| 210 |
-
msgstr "Arquivo PO não editável"
|
| 211 |
-
|
| 212 |
-
#: lib/loco-packages.php:522
|
| 213 |
-
msgid "MO file not writable"
|
| 214 |
-
msgstr "Arquivo MO não editável"
|
| 215 |
-
|
| 216 |
-
#: lib/loco-packages.php:522
|
| 217 |
-
msgid "MO file not found"
|
| 218 |
-
msgstr "Arquivo MO ausente"
|
| 219 |
-
|
| 220 |
-
#: lib/loco-packages.php:527
|
| 221 |
-
msgid "Folder not writable"
|
| 222 |
-
msgstr "Pasta não editável"
|
| 223 |
-
|
| 224 |
-
#: lib/loco-packages.php:527
|
| 225 |
-
msgid "Folder not found"
|
| 226 |
-
msgstr "Pasta não encontrada"
|
| 227 |
-
|
| 228 |
-
#: lib/loco-packages.php:546
|
| 229 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 230 |
-
msgstr "%s não declara um \"Text Domain\""
|
| 231 |
-
|
| 232 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 233 |
-
msgid "Loco has guessed \"%s\""
|
| 234 |
-
msgstr "Loco adivinhou \"%s\""
|
| 235 |
-
|
| 236 |
-
#: lib/loco-packages.php:551
|
| 237 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 238 |
-
msgstr "%s não declara um \"Domain Path\""
|
| 239 |
-
|
| 240 |
-
#: lib/loco-packages.php:556
|
| 241 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 242 |
-
msgstr ""
|
| 243 |
-
"%s não possui um arquivo POT. Crie um em \"%s/%s.pot\" se você precisar."
|
| 244 |
-
|
| 245 |
-
#: lib/loco-packages.php:559
|
| 246 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 247 |
-
msgstr ""
|
| 248 |
-
"%s possui um nome estranho para o arquivo POT (%s). Um nome melhor seria "
|
| 249 |
-
"\"%s.pot\""
|
| 250 |
-
|
| 251 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 252 |
-
msgid "User does not have permission to manage translations"
|
| 253 |
-
msgstr "O usuário não tem permissões para gerenciar traduções"
|
| 254 |
-
|
| 255 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 256 |
-
msgid "Invalid data posted to server"
|
| 257 |
-
msgstr "Dados inválidos enviados para servidor"
|
| 258 |
-
|
| 259 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 260 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 261 |
-
msgstr "Falha ao compilar arquivo MO com %s, verifique suas configurações"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 264 |
-
msgid "Package not found called %s"
|
| 265 |
-
msgstr "Pacote chamado %s não encontrado"
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:58
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 270 |
-
"backups in settings"
|
| 271 |
-
msgstr ""
|
| 272 |
-
"Servidor Web não pode criar backups em \"%s\". Corrija as permissões do "
|
| 273 |
-
"arquivo ou desabilite backups nas configurações."
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:66
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 278 |
-
"create it manually."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"Servidor Web não pode criar o diretório \"%s\" em \"%s\". Corrija permissões "
|
| 281 |
-
"do arquivo ou crie manualmente."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:69
|
| 284 |
-
msgid ""
|
| 285 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 286 |
-
"or use the download function."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"O servidor web não pode criar arquivos no diretório \"%s\". Resolva as "
|
| 289 |
-
"permissões do arquivo ou use a função de download."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:81
|
| 292 |
-
msgid ""
|
| 293 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 294 |
-
"and copy to \"%s/%s\"."
|
| 295 |
-
msgstr ""
|
| 296 |
-
"Arquivo %s não é editável pelo servidor web. Corrija as permissões do "
|
| 297 |
-
"arquivo ou baixe e copie para \"%s/%s\"."
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:102
|
| 300 |
-
msgid "Cannot create MO file"
|
| 301 |
-
msgstr "Arquivo MO não pode ser criado"
|
| 302 |
-
|
| 303 |
-
#: php/loco-posave.php:105
|
| 304 |
-
msgid "Cannot overwrite MO file"
|
| 305 |
-
msgstr "Arquivo MO não pode ser sobrescrito"
|
| 306 |
-
|
| 307 |
-
#: php/loco-posave.php:131
|
| 308 |
-
msgid "Failed to write MO file"
|
| 309 |
-
msgstr "Arquivo MO falho em ser editado"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 312 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 313 |
-
#: tpl/admin-root.tpl.php:6
|
| 314 |
-
msgid "Packages"
|
| 315 |
-
msgstr "Pacotes"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 318 |
-
msgid "File check"
|
| 319 |
-
msgstr "Conferência"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 322 |
-
msgid "File system permissions for %s"
|
| 323 |
-
msgstr "Permissões do sistema de arquivo para %s"
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 326 |
-
msgid "Other potential issues with %s"
|
| 327 |
-
msgstr "Outros problemas em potencial com %s"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 330 |
-
msgid "Back"
|
| 331 |
-
msgstr "Voltar"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 334 |
-
msgid "Get help"
|
| 335 |
-
msgstr "Pedir ajudar"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-list.tpl.php:11
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Package details"
|
| 340 |
-
msgstr "Detalhes do pacote"
|
| 341 |
-
|
| 342 |
-
#: tpl/admin-list.tpl.php:14
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Translations (PO)"
|
| 345 |
-
msgstr "Traduções (PO)"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:17
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Template (POT)"
|
| 350 |
-
msgstr "Modelo (POT)"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:20
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "File permissions"
|
| 355 |
-
msgstr "Permissões do arquivo"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:40
|
| 358 |
-
msgid "Extends: %s"
|
| 359 |
-
msgstr "Extendido: %s"
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:44
|
| 362 |
-
msgid "1 language"
|
| 363 |
-
msgid_plural "%u languages"
|
| 364 |
-
msgstr[0] "1 idioma"
|
| 365 |
-
msgstr[1] "%u idiomas"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 368 |
-
msgctxt "Modified time"
|
| 369 |
-
msgid "Updated"
|
| 370 |
-
msgstr "Atualizado"
|
| 371 |
-
|
| 372 |
-
#: tpl/admin-nav.tpl.php:26
|
| 373 |
-
msgid "Powered by"
|
| 374 |
-
msgstr "Desenvolvido por"
|
| 375 |
-
|
| 376 |
-
#: tpl/admin-nav.tpl.php:32
|
| 377 |
-
msgid "Loco may not work as expected"
|
| 378 |
-
msgstr "Loco pode não funcionar como esperado"
|
| 379 |
-
|
| 380 |
-
#: tpl/admin-opts.tpl.php:18
|
| 381 |
-
msgid "Configure Loco Translate"
|
| 382 |
-
msgstr "Configure Tradução Loco"
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 385 |
-
msgid "Compiling MO files"
|
| 386 |
-
msgstr "Compilando arquivos MO"
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-opts.tpl.php:36
|
| 389 |
-
msgid "Use built-in MO compiler."
|
| 390 |
-
msgstr "Usar compilador MO interno."
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:42
|
| 393 |
-
msgid "Use external command:"
|
| 394 |
-
msgstr "Usar comando externo:"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:47
|
| 397 |
-
msgid "Enter path to msgfmt on server"
|
| 398 |
-
msgstr "Digite caminho para msgfmt no servidor"
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:54
|
| 401 |
-
msgid "Generate hash tables"
|
| 402 |
-
msgstr "Gerar tabela de dispersão"
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:60
|
| 405 |
-
msgid "Include Fuzzy strings"
|
| 406 |
-
msgstr "Incluir Fuzzy strings"
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 409 |
-
msgid "Backing up PO files"
|
| 410 |
-
msgstr "Criando cópia de segurança dos arquivos PO"
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:75
|
| 413 |
-
msgid "Number of backups to keep of each file:"
|
| 414 |
-
msgstr "Número de backups para manter de cada arquivo:"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 417 |
-
msgid "Experimental features"
|
| 418 |
-
msgstr "Funcionalidades experimentais"
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-opts.tpl.php:92
|
| 421 |
-
msgid "Enable WordPress core translations"
|
| 422 |
-
msgstr "Ativar traduções da core do WordPress"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-opts.tpl.php:101
|
| 425 |
-
msgid "Save settings"
|
| 426 |
-
msgstr "Configurações de salvamento"
|
| 427 |
-
|
| 428 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 429 |
-
msgid "Template file"
|
| 430 |
-
msgstr "Arquivo modelo"
|
| 431 |
-
|
| 432 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 433 |
-
msgctxt "Dropdown label"
|
| 434 |
-
msgid "Switch to..."
|
| 435 |
-
msgstr "Mudar para..."
|
| 436 |
-
|
| 437 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 438 |
-
msgid "never"
|
| 439 |
-
msgstr "nunca"
|
| 440 |
-
|
| 441 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 442 |
-
msgctxt "Editor button"
|
| 443 |
-
msgid "Save"
|
| 444 |
-
msgstr "Salvar"
|
| 445 |
-
|
| 446 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 447 |
-
msgctxt "Editor button"
|
| 448 |
-
msgid "Download"
|
| 449 |
-
msgstr "Baixar"
|
| 450 |
-
|
| 451 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 452 |
-
msgctxt "Editor button"
|
| 453 |
-
msgid "Sync"
|
| 454 |
-
msgstr "Sincronizar"
|
| 455 |
-
|
| 456 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 457 |
-
msgctxt "Editor button"
|
| 458 |
-
msgid "Revert"
|
| 459 |
-
msgstr "Reverter"
|
| 460 |
-
|
| 461 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 462 |
-
msgctxt "Editor button"
|
| 463 |
-
msgid "Add"
|
| 464 |
-
msgstr "Adicionar"
|
| 465 |
-
|
| 466 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 467 |
-
msgctxt "Editor button"
|
| 468 |
-
msgid "Del"
|
| 469 |
-
msgstr "Apagar"
|
| 470 |
-
|
| 471 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 472 |
-
msgctxt "Editor button"
|
| 473 |
-
msgid "Fuzzy"
|
| 474 |
-
msgstr "Incerto"
|
| 475 |
-
|
| 476 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 477 |
-
msgid "Filter translations"
|
| 478 |
-
msgstr "Filtrar traduções"
|
| 479 |
-
|
| 480 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 481 |
-
msgctxt "Editor button"
|
| 482 |
-
msgid "Help"
|
| 483 |
-
msgstr "Ajuda"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 486 |
-
msgid "Initialize new translations in %s"
|
| 487 |
-
msgstr "Iniciar novas traduções em %s"
|
| 488 |
-
|
| 489 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 490 |
-
msgid "Select from common languages"
|
| 491 |
-
msgstr "Selecionar a partir dos idiomas mais comuns"
|
| 492 |
-
|
| 493 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 494 |
-
msgctxt "Form label"
|
| 495 |
-
msgid "or enter any language code"
|
| 496 |
-
msgstr "ou adicione novo código de linguagem"
|
| 497 |
-
|
| 498 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 499 |
-
msgctxt "Form label"
|
| 500 |
-
msgid "create in <code>%s</code>"
|
| 501 |
-
msgstr "criar em <code>%s</code>"
|
| 502 |
-
|
| 503 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 504 |
-
msgctxt "Form label"
|
| 505 |
-
msgid "create in global languages directory"
|
| 506 |
-
msgstr "criar no diretório de idiomas global"
|
| 507 |
-
|
| 508 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 509 |
-
msgctxt "Submit button"
|
| 510 |
-
msgid "Start translating"
|
| 511 |
-
msgstr "Começar a traduzir"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:18
|
| 514 |
-
msgid "New version available"
|
| 515 |
-
msgstr "Novo atualização disponível"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:21
|
| 518 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 519 |
-
msgstr "Atualizar para a versão %s do Tradução (Loco)"
|
| 520 |
-
|
| 521 |
-
#: tpl/admin-root.tpl.php:31
|
| 522 |
-
msgid "Select a plugin or theme to translate"
|
| 523 |
-
msgstr "Selecione um plugin ou tema para traduzir"
|
| 524 |
-
|
| 525 |
-
#: tpl/admin-root.tpl.php:40
|
| 526 |
-
msgctxt "Package list header"
|
| 527 |
-
msgid "Themes"
|
| 528 |
-
msgstr "Temas"
|
| 529 |
-
|
| 530 |
-
#: tpl/admin-root.tpl.php:53
|
| 531 |
-
msgctxt "Package list header"
|
| 532 |
-
msgid "Plugins"
|
| 533 |
-
msgstr "Plugins"
|
| 534 |
-
|
| 535 |
-
#: tpl/admin-root.tpl.php:66
|
| 536 |
-
msgctxt "Package list header"
|
| 537 |
-
msgid "Core"
|
| 538 |
-
msgstr "Núcleo"
|
| 539 |
-
|
| 540 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 541 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 542 |
-
msgid ""
|
| 543 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 544 |
-
"install it"
|
| 545 |
-
msgstr ""
|
| 546 |
-
"A extensão PHP \"%s\" não está instalada. Se você encontrar problemas, tente "
|
| 547 |
-
"instalá-la."
|
| 548 |
-
|
| 549 |
-
#: pub/js/lang/dummy.php:8
|
| 550 |
-
msgid "Unknown error"
|
| 551 |
-
msgstr "Erro desconhecido"
|
| 552 |
-
|
| 553 |
-
#: pub/js/lang/dummy.php:10
|
| 554 |
-
msgid "PO file saved"
|
| 555 |
-
msgstr "Arquivo PO salvo"
|
| 556 |
-
|
| 557 |
-
#: pub/js/lang/dummy.php:12
|
| 558 |
-
msgid "and MO file compiled"
|
| 559 |
-
msgstr "e MO compilado"
|
| 560 |
-
|
| 561 |
-
#: pub/js/lang/dummy.php:15
|
| 562 |
-
msgid "Merged from %s"
|
| 563 |
-
msgstr "Combinado a partir de %s"
|
| 564 |
-
|
| 565 |
-
#: pub/js/lang/dummy.php:17
|
| 566 |
-
msgid "Merged from source code"
|
| 567 |
-
msgstr "Combinado a partir do código fonte"
|
| 568 |
-
|
| 569 |
-
#: pub/js/lang/dummy.php:19
|
| 570 |
-
msgid "Already up to date with %s"
|
| 571 |
-
msgstr "Atualizado desde %s"
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:21
|
| 574 |
-
msgid "Already up to date with source code"
|
| 575 |
-
msgstr "Já está atualizado a partir do código fonte"
|
| 576 |
-
|
| 577 |
-
#: pub/js/lang/dummy.php:23
|
| 578 |
-
msgid "1 new string added"
|
| 579 |
-
msgid_plural "%s new strings added"
|
| 580 |
-
msgstr[0] "1 novo termo adicionado"
|
| 581 |
-
msgstr[1] "%s novos termos adicionados"
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:25
|
| 584 |
-
msgid "1 obsolete string removed"
|
| 585 |
-
msgid_plural "%s obsolete strings removed"
|
| 586 |
-
msgstr[0] "1 um termo obsoleto removido"
|
| 587 |
-
msgstr[1] "%s termos obsoletos removidos"
|
| 588 |
-
|
| 589 |
-
#: pub/js/lang/dummy.php:27
|
| 590 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 591 |
-
msgstr "Suas alterações serão perdidas se você continuar sem salvar"
|
| 592 |
-
|
| 593 |
-
#. label for the window pane holding native translation
|
| 594 |
-
#: pub/js/lang/dummy.php:35
|
| 595 |
-
msgctxt "Editor pane"
|
| 596 |
-
msgid "Source text"
|
| 597 |
-
msgstr "Texto fonte"
|
| 598 |
-
|
| 599 |
-
#. where %s is the language, e.g French translation
|
| 600 |
-
#: pub/js/lang/dummy.php:38
|
| 601 |
-
msgctxt "Editor pane"
|
| 602 |
-
msgid "%s translation"
|
| 603 |
-
msgstr "tradução %s"
|
| 604 |
-
|
| 605 |
-
#. label for the window pane holding translator comments
|
| 606 |
-
#: pub/js/lang/dummy.php:41
|
| 607 |
-
msgctxt "Editor pane"
|
| 608 |
-
msgid "Comments"
|
| 609 |
-
msgstr "Comentários"
|
| 610 |
-
|
| 611 |
-
#. label for the window pane holding message context
|
| 612 |
-
#: pub/js/lang/dummy.php:44
|
| 613 |
-
msgctxt "Editor pane"
|
| 614 |
-
msgid "Context"
|
| 615 |
-
msgstr "Contexto"
|
| 616 |
-
|
| 617 |
-
#: pub/js/lang/dummy.php:52
|
| 618 |
-
msgid "Translation"
|
| 619 |
-
msgstr "Tradução"
|
| 620 |
-
|
| 621 |
-
#: pub/js/lang/dummy.php:54
|
| 622 |
-
msgid "No source files in this package, nothing to sync"
|
| 623 |
-
msgstr "Não há arquivos fontes neste pacote, nada a sincronizar"
|
| 624 |
-
|
| 625 |
-
#: pub/js/lang/dummy.php:56
|
| 626 |
-
msgid "No strings could be extracted from source files"
|
| 627 |
-
msgstr "Nenhum termo não pode ser extraído a partir dos arquivos de origem"
|
| 628 |
-
|
| 629 |
-
#. Description of the plugin
|
| 630 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 631 |
-
msgstr ""
|
| 632 |
-
|
| 633 |
-
#. URI of the plugin
|
| 634 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 635 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 636 |
-
|
| 637 |
-
#. Author of the plugin
|
| 638 |
-
msgid "Tim Whitlock"
|
| 639 |
-
msgstr "Tim Whitlock"
|
| 640 |
-
|
| 641 |
-
#. Author URI of the plugin
|
| 642 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 643 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-pt_PT.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-pt_PT.po
DELETED
|
@@ -1,643 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:12 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Portuguese (Portugal)\n"
|
| 9 |
-
"Language: pt-PT\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: ..\n"
|
| 16 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 17 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 18 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 19 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 20 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 21 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 22 |
-
"X-Poedit-SearchPath-0: .\n"
|
| 23 |
-
"X-Poedit-SearchPathExcluded-0: lib/loco-boot.php\n"
|
| 24 |
-
"X-Loco-Target-Locale: pt_PT\n"
|
| 25 |
-
|
| 26 |
-
#. Translators: Bold text label in admin error messages
|
| 27 |
-
#: lib/loco-admin.php:31
|
| 28 |
-
msgctxt "Message label"
|
| 29 |
-
msgid "Error"
|
| 30 |
-
msgstr "Erro"
|
| 31 |
-
|
| 32 |
-
#: lib/loco-admin.php:41
|
| 33 |
-
msgctxt "Message label"
|
| 34 |
-
msgid "Warning"
|
| 35 |
-
msgstr "Aviso"
|
| 36 |
-
|
| 37 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 38 |
-
msgctxt "Message label"
|
| 39 |
-
msgid "OK"
|
| 40 |
-
msgstr "Ok"
|
| 41 |
-
|
| 42 |
-
#: lib/loco-admin.php:63
|
| 43 |
-
msgid "Permission denied"
|
| 44 |
-
msgstr "Permissão negada"
|
| 45 |
-
|
| 46 |
-
#: lib/loco-admin.php:86
|
| 47 |
-
msgid "Settings saved"
|
| 48 |
-
msgstr "Definições guardadas"
|
| 49 |
-
|
| 50 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 51 |
-
msgid "%s is not an official WordPress language"
|
| 52 |
-
msgstr "%s não é um idioma oficial do WordPress"
|
| 53 |
-
|
| 54 |
-
#: lib/loco-admin.php:199
|
| 55 |
-
msgid "New PO file"
|
| 56 |
-
msgstr "Novo ficheiro PO"
|
| 57 |
-
|
| 58 |
-
#: lib/loco-admin.php:214
|
| 59 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 60 |
-
msgstr ""
|
| 61 |
-
"Ficheiro PO utilizado como modelo. Será renomeado para %s quando o guardar "
|
| 62 |
-
"pela primeira vez."
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "Tem que especificar um código locale válido para o novo ficheiro PO"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "Não foram encontrados termos para tradução"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "Não pode ser criado o ficheiro PO."
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "O ficheiro PO já existe com o código locale %s"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"Não foi possível criar o ficheiro automaticamente. Corrija as permissões do "
|
| 86 |
-
"ficheiro ou use Descarregar em vez de Guardar."
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr "O ficheiro %s está vazio"
|
| 91 |
-
|
| 92 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 93 |
-
msgid "Run Sync to update from source code"
|
| 94 |
-
msgstr "Clique em Sincronizar para actualizar a partir do código fonte"
|
| 95 |
-
|
| 96 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 97 |
-
msgid "No strings could be extracted from source code"
|
| 98 |
-
msgstr "Nenhum termo pôde ser extraído a partir do código fonte"
|
| 99 |
-
|
| 100 |
-
#: lib/loco-admin.php:417
|
| 101 |
-
msgid "Run Sync to update from %s"
|
| 102 |
-
msgstr "Clique em Sincronizar para actualizar a partir de %s"
|
| 103 |
-
|
| 104 |
-
#: lib/loco-admin.php:436
|
| 105 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 106 |
-
msgstr ""
|
| 107 |
-
"O código fonte foi modificado, clique em Sincronizar para actualizar o POT"
|
| 108 |
-
|
| 109 |
-
#: lib/loco-admin.php:440
|
| 110 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 111 |
-
msgstr ""
|
| 112 |
-
"O ficheiro POT foi modificado depois do ficheiro PO ter sido guardado, "
|
| 113 |
-
"clique em Sincronizar para actualizar"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:536
|
| 116 |
-
msgid "Bad file path"
|
| 117 |
-
msgstr "Caminho do ficheiro incorrecto"
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:783
|
| 120 |
-
msgid "Empty or invalid %s file"
|
| 121 |
-
msgstr "O ficheiro %s está vazio ou é inválido"
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:787
|
| 124 |
-
msgid "%s file has no header"
|
| 125 |
-
msgstr "O ficheiro %s não tem cabeçalho"
|
| 126 |
-
|
| 127 |
-
#: lib/loco-admin.php:934
|
| 128 |
-
msgctxt "Add button"
|
| 129 |
-
msgid "New template"
|
| 130 |
-
msgstr "Novo modelo"
|
| 131 |
-
|
| 132 |
-
#: lib/loco-admin.php:953
|
| 133 |
-
msgctxt "Add button"
|
| 134 |
-
msgid "New language"
|
| 135 |
-
msgstr "Novo idioma"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "%s%% translated"
|
| 139 |
-
msgstr "%s%% traduzido"
|
| 140 |
-
|
| 141 |
-
#: lib/loco-admin.php:992
|
| 142 |
-
msgid "1 string"
|
| 143 |
-
msgid_plural "%s strings"
|
| 144 |
-
msgstr[0] "1 termo"
|
| 145 |
-
msgstr[1] "%s termos"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:995
|
| 148 |
-
msgid "%s fuzzy"
|
| 149 |
-
msgstr "%s impreciso(s)"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:998
|
| 152 |
-
msgid "%s untranslated"
|
| 153 |
-
msgstr "%s não traduzido"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1044
|
| 156 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 157 |
-
msgstr "Falhou ao compilar o ficheiro MO com compilador incluído"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 160 |
-
msgid "Loco, Translation Management"
|
| 161 |
-
msgstr "Loco, Translation Management"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 164 |
-
msgid "Manage translations"
|
| 165 |
-
msgstr "Gerir traduções"
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1094
|
| 168 |
-
msgid "Translation options"
|
| 169 |
-
msgstr "Opções de tradução"
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1101
|
| 172 |
-
msgid "Loco Translate"
|
| 173 |
-
msgstr "Loco Translate"
|
| 174 |
-
|
| 175 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 176 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 177 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 178 |
-
msgid "Settings"
|
| 179 |
-
msgstr "Definições"
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1149
|
| 182 |
-
msgid "File download failed"
|
| 183 |
-
msgstr "Falhou ao descarregar o ficheiro"
|
| 184 |
-
|
| 185 |
-
#: lib/loco-admin.php:1159
|
| 186 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 187 |
-
msgstr "O WPLANG está obsoleto e deve ser removido do wp-config.php"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-locales.php:77
|
| 190 |
-
msgid "Unknown language"
|
| 191 |
-
msgstr "Idioma desconhecido"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 194 |
-
msgid "Some files not writable"
|
| 195 |
-
msgstr "Alguns ficheiros não são editáveis"
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:484
|
| 198 |
-
msgid "Some files missing"
|
| 199 |
-
msgstr "Alguns ficheiros em falta"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 202 |
-
msgid "\"%s\" folder not writable"
|
| 203 |
-
msgstr "Pasta \"%s\" não é editável"
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:515
|
| 206 |
-
msgid "POT file not writable"
|
| 207 |
-
msgstr "Ficheiro POT não editável"
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:520
|
| 210 |
-
msgid "PO file not writable"
|
| 211 |
-
msgstr "Ficheiro PO não editável"
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not writable"
|
| 215 |
-
msgstr "Ficheiro MO não editável"
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:522
|
| 218 |
-
msgid "MO file not found"
|
| 219 |
-
msgstr "Ficheiro MO não encontrado"
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not writable"
|
| 223 |
-
msgstr "Pasta não editável"
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:527
|
| 226 |
-
msgid "Folder not found"
|
| 227 |
-
msgstr "Pasta não encontrada"
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546
|
| 230 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 231 |
-
msgstr "O %s não declara um \"Text Domain\""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 234 |
-
msgid "Loco has guessed \"%s\""
|
| 235 |
-
msgstr "O Loco adivinhou \"%s\""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:551
|
| 238 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 239 |
-
msgstr "O %s não declara um \"Domain Path\""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:556
|
| 242 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 243 |
-
msgstr "O %s não tem ficheiro POT. Crie um em \"%s/%s.pot\" se precisar."
|
| 244 |
-
|
| 245 |
-
#: lib/loco-packages.php:559
|
| 246 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 247 |
-
msgstr ""
|
| 248 |
-
"O %s tem um ficheiro POT com um nome estranho (%s). Seria melhor um nome "
|
| 249 |
-
"como \"%s.pot\"."
|
| 250 |
-
|
| 251 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 252 |
-
msgid "User does not have permission to manage translations"
|
| 253 |
-
msgstr "O utilizador não tem permissões para gerir traduções"
|
| 254 |
-
|
| 255 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 256 |
-
msgid "Invalid data posted to server"
|
| 257 |
-
msgstr "Dados inválidos enviados para o servidor"
|
| 258 |
-
|
| 259 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 260 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 261 |
-
msgstr "Falhou ao compilar ficheiro MO com %s, verifique as suas definições"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 264 |
-
msgid "Package not found called %s"
|
| 265 |
-
msgstr "Pacote com nome %s não encontrado"
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:58
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 270 |
-
"backups in settings"
|
| 271 |
-
msgstr ""
|
| 272 |
-
"O servidor web não pode criar cópias de segurança em \"%s\". Corrija as "
|
| 273 |
-
"permissões do ficheiro ou desactive as cópias de segurança nas definições."
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:66
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 278 |
-
"create it manually."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"O servidor web não pode criar o directório \"%s\" em \"%s\". Corrija "
|
| 281 |
-
"permissões do ficheiro ou crie o directório manualmente."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:69
|
| 284 |
-
msgid ""
|
| 285 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 286 |
-
"or use the download function."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"O servidor web não pode criar ficheiros no directório \"%s\". Corrija as "
|
| 289 |
-
"permissões do ficheiro ou utilize a função Descarregar."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:81
|
| 292 |
-
msgid ""
|
| 293 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 294 |
-
"and copy to \"%s/%s\"."
|
| 295 |
-
msgstr ""
|
| 296 |
-
"O ficheiro %s não é editável pelo servidor web. Corrija as permissões do "
|
| 297 |
-
"ficheiro ou descarregue e copie para \"%s/%s\"."
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:102
|
| 300 |
-
msgid "Cannot create MO file"
|
| 301 |
-
msgstr "Não é possível criar ficheiro MO"
|
| 302 |
-
|
| 303 |
-
#: php/loco-posave.php:105
|
| 304 |
-
msgid "Cannot overwrite MO file"
|
| 305 |
-
msgstr "Não é possível substituir ficheiro MO"
|
| 306 |
-
|
| 307 |
-
#: php/loco-posave.php:131
|
| 308 |
-
msgid "Failed to write MO file"
|
| 309 |
-
msgstr "Falhou ao guardar ficheiro MO"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 312 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 313 |
-
#: tpl/admin-root.tpl.php:6
|
| 314 |
-
msgid "Packages"
|
| 315 |
-
msgstr "Pacotes"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 318 |
-
msgid "File check"
|
| 319 |
-
msgstr "Verificação do ficheiro"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 322 |
-
msgid "File system permissions for %s"
|
| 323 |
-
msgstr "Permissões do sistema de ficheiros para %s"
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 326 |
-
msgid "Other potential issues with %s"
|
| 327 |
-
msgstr "Outros problemas potenciais com %s"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 330 |
-
msgid "Back"
|
| 331 |
-
msgstr "Voltar"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 334 |
-
msgid "Get help"
|
| 335 |
-
msgstr "Obter ajuda"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-list.tpl.php:11
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Package details"
|
| 340 |
-
msgstr "Detalhes do pacote"
|
| 341 |
-
|
| 342 |
-
#: tpl/admin-list.tpl.php:14
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Translations (PO)"
|
| 345 |
-
msgstr "Traduções (PO)"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:17
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Template (POT)"
|
| 350 |
-
msgstr "Modelo (POT)"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:20
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "File permissions"
|
| 355 |
-
msgstr "Permissões do ficheiro"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:40
|
| 358 |
-
msgid "Extends: %s"
|
| 359 |
-
msgstr "Estendido: %s"
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:44
|
| 362 |
-
msgid "1 language"
|
| 363 |
-
msgid_plural "%u languages"
|
| 364 |
-
msgstr[0] "1 idioma"
|
| 365 |
-
msgstr[1] "%u idiomas"
|
| 366 |
-
|
| 367 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 368 |
-
msgctxt "Modified time"
|
| 369 |
-
msgid "Updated"
|
| 370 |
-
msgstr "Actualizado"
|
| 371 |
-
|
| 372 |
-
#: tpl/admin-nav.tpl.php:26
|
| 373 |
-
msgid "Powered by"
|
| 374 |
-
msgstr "Desenvolvido por"
|
| 375 |
-
|
| 376 |
-
#: tpl/admin-nav.tpl.php:32
|
| 377 |
-
msgid "Loco may not work as expected"
|
| 378 |
-
msgstr "O Loco pode não funcionar como esperado"
|
| 379 |
-
|
| 380 |
-
#: tpl/admin-opts.tpl.php:18
|
| 381 |
-
msgid "Configure Loco Translate"
|
| 382 |
-
msgstr "Configurar Loco Translate"
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 385 |
-
msgid "Compiling MO files"
|
| 386 |
-
msgstr "A compilar ficheiros MO"
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-opts.tpl.php:36
|
| 389 |
-
msgid "Use built-in MO compiler."
|
| 390 |
-
msgstr "Utilizar compilador MO incluído."
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:42
|
| 393 |
-
msgid "Use external command:"
|
| 394 |
-
msgstr "Utilizar comando externo:"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:47
|
| 397 |
-
msgid "Enter path to msgfmt on server"
|
| 398 |
-
msgstr "Introduza o caminho para o msgfmt no servidor"
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:54
|
| 401 |
-
msgid "Generate hash tables"
|
| 402 |
-
msgstr "Gerar tabela hash"
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:60
|
| 405 |
-
msgid "Include Fuzzy strings"
|
| 406 |
-
msgstr "Incluir termos imprecisos"
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 409 |
-
msgid "Backing up PO files"
|
| 410 |
-
msgstr "A criar cópia de segurança dos ficheiros PO"
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:75
|
| 413 |
-
msgid "Number of backups to keep of each file:"
|
| 414 |
-
msgstr "Número de cópias de segurança a manter de para cada ficheiro:"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 417 |
-
msgid "Experimental features"
|
| 418 |
-
msgstr "Recursos experimentais"
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-opts.tpl.php:92
|
| 421 |
-
msgid "Enable WordPress core translations"
|
| 422 |
-
msgstr "Activar traduções do core do WordPress"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-opts.tpl.php:101
|
| 425 |
-
msgid "Save settings"
|
| 426 |
-
msgstr "Guardar definições"
|
| 427 |
-
|
| 428 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 429 |
-
msgid "Template file"
|
| 430 |
-
msgstr "Ficheiro modelo"
|
| 431 |
-
|
| 432 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 433 |
-
msgctxt "Dropdown label"
|
| 434 |
-
msgid "Switch to..."
|
| 435 |
-
msgstr "Mudar para..."
|
| 436 |
-
|
| 437 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 438 |
-
msgid "never"
|
| 439 |
-
msgstr "nunca"
|
| 440 |
-
|
| 441 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 442 |
-
msgctxt "Editor button"
|
| 443 |
-
msgid "Save"
|
| 444 |
-
msgstr "Guardar"
|
| 445 |
-
|
| 446 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 447 |
-
msgctxt "Editor button"
|
| 448 |
-
msgid "Download"
|
| 449 |
-
msgstr "Descarregar"
|
| 450 |
-
|
| 451 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 452 |
-
msgctxt "Editor button"
|
| 453 |
-
msgid "Sync"
|
| 454 |
-
msgstr "Sincronizar"
|
| 455 |
-
|
| 456 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 457 |
-
msgctxt "Editor button"
|
| 458 |
-
msgid "Revert"
|
| 459 |
-
msgstr "Reverter"
|
| 460 |
-
|
| 461 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 462 |
-
msgctxt "Editor button"
|
| 463 |
-
msgid "Add"
|
| 464 |
-
msgstr "Adicionar"
|
| 465 |
-
|
| 466 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 467 |
-
msgctxt "Editor button"
|
| 468 |
-
msgid "Del"
|
| 469 |
-
msgstr "Apagar"
|
| 470 |
-
|
| 471 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 472 |
-
msgctxt "Editor button"
|
| 473 |
-
msgid "Fuzzy"
|
| 474 |
-
msgstr "Impreciso"
|
| 475 |
-
|
| 476 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 477 |
-
msgid "Filter translations"
|
| 478 |
-
msgstr "Filtrar traduções"
|
| 479 |
-
|
| 480 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 481 |
-
msgctxt "Editor button"
|
| 482 |
-
msgid "Help"
|
| 483 |
-
msgstr "Ajuda"
|
| 484 |
-
|
| 485 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 486 |
-
msgid "Initialize new translations in %s"
|
| 487 |
-
msgstr "Iniciar novas traduções em %s"
|
| 488 |
-
|
| 489 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 490 |
-
msgid "Select from common languages"
|
| 491 |
-
msgstr "Selecionar a partir dos idiomas mais comuns"
|
| 492 |
-
|
| 493 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 494 |
-
msgctxt "Form label"
|
| 495 |
-
msgid "or enter any language code"
|
| 496 |
-
msgstr "ou introduza um código de idioma"
|
| 497 |
-
|
| 498 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 499 |
-
msgctxt "Form label"
|
| 500 |
-
msgid "create in <code>%s</code>"
|
| 501 |
-
msgstr "criar em <code>%s</code>"
|
| 502 |
-
|
| 503 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 504 |
-
msgctxt "Form label"
|
| 505 |
-
msgid "create in global languages directory"
|
| 506 |
-
msgstr "criar no directório global de idiomas"
|
| 507 |
-
|
| 508 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 509 |
-
msgctxt "Submit button"
|
| 510 |
-
msgid "Start translating"
|
| 511 |
-
msgstr "Começar a traduzir"
|
| 512 |
-
|
| 513 |
-
#: tpl/admin-root.tpl.php:18
|
| 514 |
-
msgid "New version available"
|
| 515 |
-
msgstr "Novo atualização disponível"
|
| 516 |
-
|
| 517 |
-
#: tpl/admin-root.tpl.php:21
|
| 518 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 519 |
-
msgstr "Actualizar para a versão %s do Loco Translate"
|
| 520 |
-
|
| 521 |
-
#: tpl/admin-root.tpl.php:31
|
| 522 |
-
msgid "Select a plugin or theme to translate"
|
| 523 |
-
msgstr "Selecione um plugin ou tema para traduzir"
|
| 524 |
-
|
| 525 |
-
#: tpl/admin-root.tpl.php:40
|
| 526 |
-
msgctxt "Package list header"
|
| 527 |
-
msgid "Themes"
|
| 528 |
-
msgstr "Temas"
|
| 529 |
-
|
| 530 |
-
#: tpl/admin-root.tpl.php:53
|
| 531 |
-
msgctxt "Package list header"
|
| 532 |
-
msgid "Plugins"
|
| 533 |
-
msgstr "Plugins"
|
| 534 |
-
|
| 535 |
-
#: tpl/admin-root.tpl.php:66
|
| 536 |
-
msgctxt "Package list header"
|
| 537 |
-
msgid "Core"
|
| 538 |
-
msgstr "Core"
|
| 539 |
-
|
| 540 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 541 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 542 |
-
msgid ""
|
| 543 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 544 |
-
"install it"
|
| 545 |
-
msgstr ""
|
| 546 |
-
"A extensão \"%s\" do PHP não está instalada. Se tiver algum problema deverá "
|
| 547 |
-
"proceder à sua instalação."
|
| 548 |
-
|
| 549 |
-
#: pub/js/lang/dummy.php:8
|
| 550 |
-
msgid "Unknown error"
|
| 551 |
-
msgstr "Erro desconhecido"
|
| 552 |
-
|
| 553 |
-
#: pub/js/lang/dummy.php:10
|
| 554 |
-
msgid "PO file saved"
|
| 555 |
-
msgstr "Ficheiro PO guardado"
|
| 556 |
-
|
| 557 |
-
#: pub/js/lang/dummy.php:12
|
| 558 |
-
msgid "and MO file compiled"
|
| 559 |
-
msgstr "e ficheiro MO compilado"
|
| 560 |
-
|
| 561 |
-
#: pub/js/lang/dummy.php:15
|
| 562 |
-
msgid "Merged from %s"
|
| 563 |
-
msgstr "Misturado a partir de %s"
|
| 564 |
-
|
| 565 |
-
#: pub/js/lang/dummy.php:17
|
| 566 |
-
msgid "Merged from source code"
|
| 567 |
-
msgstr "Misturado a partir do código fonte"
|
| 568 |
-
|
| 569 |
-
#: pub/js/lang/dummy.php:19
|
| 570 |
-
msgid "Already up to date with %s"
|
| 571 |
-
msgstr "Actualizado desde %s"
|
| 572 |
-
|
| 573 |
-
#: pub/js/lang/dummy.php:21
|
| 574 |
-
msgid "Already up to date with source code"
|
| 575 |
-
msgstr "Já está actualizado a partir do código fonte"
|
| 576 |
-
|
| 577 |
-
#: pub/js/lang/dummy.php:23
|
| 578 |
-
msgid "1 new string added"
|
| 579 |
-
msgid_plural "%s new strings added"
|
| 580 |
-
msgstr[0] "1 novo termo adicionado"
|
| 581 |
-
msgstr[1] "%s novos termos adicionados"
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:25
|
| 584 |
-
msgid "1 obsolete string removed"
|
| 585 |
-
msgid_plural "%s obsolete strings removed"
|
| 586 |
-
msgstr[0] "1 um termo obsoleto removido"
|
| 587 |
-
msgstr[1] "%s termos obsoletos removidos"
|
| 588 |
-
|
| 589 |
-
#: pub/js/lang/dummy.php:27
|
| 590 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 591 |
-
msgstr "As suas alterações serão perdidas se continuar sem guardar"
|
| 592 |
-
|
| 593 |
-
#. label for the window pane holding native translation
|
| 594 |
-
#: pub/js/lang/dummy.php:35
|
| 595 |
-
msgctxt "Editor pane"
|
| 596 |
-
msgid "Source text"
|
| 597 |
-
msgstr "Texto fonte"
|
| 598 |
-
|
| 599 |
-
#. where %s is the language, e.g French translation
|
| 600 |
-
#: pub/js/lang/dummy.php:38
|
| 601 |
-
msgctxt "Editor pane"
|
| 602 |
-
msgid "%s translation"
|
| 603 |
-
msgstr "Tradução para %s"
|
| 604 |
-
|
| 605 |
-
#. label for the window pane holding translator comments
|
| 606 |
-
#: pub/js/lang/dummy.php:41
|
| 607 |
-
msgctxt "Editor pane"
|
| 608 |
-
msgid "Comments"
|
| 609 |
-
msgstr "Comentários"
|
| 610 |
-
|
| 611 |
-
#. label for the window pane holding message context
|
| 612 |
-
#: pub/js/lang/dummy.php:44
|
| 613 |
-
msgctxt "Editor pane"
|
| 614 |
-
msgid "Context"
|
| 615 |
-
msgstr "Contexto"
|
| 616 |
-
|
| 617 |
-
#: pub/js/lang/dummy.php:52
|
| 618 |
-
msgid "Translation"
|
| 619 |
-
msgstr "Tradução"
|
| 620 |
-
|
| 621 |
-
#: pub/js/lang/dummy.php:54
|
| 622 |
-
msgid "No source files in this package, nothing to sync"
|
| 623 |
-
msgstr "Não há ficheiros de origem neste pacote, não há nada para sincronizar."
|
| 624 |
-
|
| 625 |
-
#: pub/js/lang/dummy.php:56
|
| 626 |
-
msgid "No strings could be extracted from source files"
|
| 627 |
-
msgstr "Nenhum termo pôde ser extraído a partir dos ficheiros de origem"
|
| 628 |
-
|
| 629 |
-
#. Description of the plugin
|
| 630 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 631 |
-
msgstr "Traduza plugins e temas do WordPress directamente no seu browser"
|
| 632 |
-
|
| 633 |
-
#. URI of the plugin
|
| 634 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 635 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 636 |
-
|
| 637 |
-
#. Author of the plugin
|
| 638 |
-
msgid "Tim Whitlock"
|
| 639 |
-
msgstr "Tim Whitlock"
|
| 640 |
-
|
| 641 |
-
#. Author URI of the plugin
|
| 642 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 643 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-ru_RU.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-ru_RU.po
DELETED
|
@@ -1,641 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:21 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Russian\n"
|
| 9 |
-
"Language: ru-RU\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=3; plural=(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n"
|
| 14 |
-
"%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)\n"
|
| 15 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
-
"X-Poedit-Basepath: .\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 19 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 20 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 21 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 22 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 23 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 24 |
-
"X-Loco-Target-Locale: ru_RU\n"
|
| 25 |
-
|
| 26 |
-
#. Translators: Bold text label in admin error messages
|
| 27 |
-
#: lib/loco-admin.php:31
|
| 28 |
-
msgctxt "Message label"
|
| 29 |
-
msgid "Error"
|
| 30 |
-
msgstr "Ошибка"
|
| 31 |
-
|
| 32 |
-
#: lib/loco-admin.php:41
|
| 33 |
-
msgctxt "Message label"
|
| 34 |
-
msgid "Warning"
|
| 35 |
-
msgstr "Предупреждение"
|
| 36 |
-
|
| 37 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 38 |
-
msgctxt "Message label"
|
| 39 |
-
msgid "OK"
|
| 40 |
-
msgstr "ОК"
|
| 41 |
-
|
| 42 |
-
#: lib/loco-admin.php:63
|
| 43 |
-
msgid "Permission denied"
|
| 44 |
-
msgstr "Доступ невозможен"
|
| 45 |
-
|
| 46 |
-
#: lib/loco-admin.php:86
|
| 47 |
-
msgid "Settings saved"
|
| 48 |
-
msgstr "Установки сохранены"
|
| 49 |
-
|
| 50 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 51 |
-
msgid "%s is not an official WordPress language"
|
| 52 |
-
msgstr "%s не является официальным языком WordPress"
|
| 53 |
-
|
| 54 |
-
#: lib/loco-admin.php:199
|
| 55 |
-
msgid "New PO file"
|
| 56 |
-
msgstr "Новый РО-файл"
|
| 57 |
-
|
| 58 |
-
#: lib/loco-admin.php:214
|
| 59 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 60 |
-
msgstr ""
|
| 61 |
-
"PO-файл используется как шаблон. Он будет переименован в %s при первом "
|
| 62 |
-
"сохранении"
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "Укажите правильную локаль для нового РО-файла"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "Строк для перевода не обнаружено"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "Невозможно создать РО-файл"
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "PO-файл уже существует в локали %s"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"Файл не может быть создан автоматически. Исправьте права доступа, или "
|
| 86 |
-
"используйте Загрузить вместо Сохранить"
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr "файл %s пуст"
|
| 91 |
-
|
| 92 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 93 |
-
msgid "Run Sync to update from source code"
|
| 94 |
-
msgstr "Выполните Синхронизацию для обновления из исходного кода"
|
| 95 |
-
|
| 96 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 97 |
-
msgid "No strings could be extracted from source code"
|
| 98 |
-
msgstr "Нет строк для извлечения из исходного кода"
|
| 99 |
-
|
| 100 |
-
#: lib/loco-admin.php:417
|
| 101 |
-
msgid "Run Sync to update from %s"
|
| 102 |
-
msgstr "Выполните Синхронизацию для обновления из %s"
|
| 103 |
-
|
| 104 |
-
#: lib/loco-admin.php:436
|
| 105 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 106 |
-
msgstr "Исходный код был изменён. Выполните Синхронизацию для обновления РОТ"
|
| 107 |
-
|
| 108 |
-
#: lib/loco-admin.php:440
|
| 109 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 110 |
-
msgstr ""
|
| 111 |
-
"РОТ был изменён после сохранения РО-файла. Выполните Синхронизацию для "
|
| 112 |
-
"обновления"
|
| 113 |
-
|
| 114 |
-
#: lib/loco-admin.php:536
|
| 115 |
-
msgid "Bad file path"
|
| 116 |
-
msgstr "Неправильный путь к файлу"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:783
|
| 119 |
-
msgid "Empty or invalid %s file"
|
| 120 |
-
msgstr "Файл %s пустой или поврежденный"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:787
|
| 123 |
-
msgid "%s file has no header"
|
| 124 |
-
msgstr "Файл %s без заголовка"
|
| 125 |
-
|
| 126 |
-
#: lib/loco-admin.php:934
|
| 127 |
-
msgctxt "Add button"
|
| 128 |
-
msgid "New template"
|
| 129 |
-
msgstr "Новый шаблон"
|
| 130 |
-
|
| 131 |
-
#: lib/loco-admin.php:953
|
| 132 |
-
msgctxt "Add button"
|
| 133 |
-
msgid "New language"
|
| 134 |
-
msgstr "Новый язык"
|
| 135 |
-
|
| 136 |
-
#: lib/loco-admin.php:992
|
| 137 |
-
msgid "%s%% translated"
|
| 138 |
-
msgstr "%s%% переведено"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:992
|
| 141 |
-
msgid "1 string"
|
| 142 |
-
msgid_plural "%s strings"
|
| 143 |
-
msgstr[0] "1 строка"
|
| 144 |
-
msgstr[1] "%s строк(и)"
|
| 145 |
-
|
| 146 |
-
#: lib/loco-admin.php:995
|
| 147 |
-
msgid "%s fuzzy"
|
| 148 |
-
msgstr "%s неточный перевод"
|
| 149 |
-
|
| 150 |
-
#: lib/loco-admin.php:998
|
| 151 |
-
msgid "%s untranslated"
|
| 152 |
-
msgstr "%s не переведено"
|
| 153 |
-
|
| 154 |
-
#: lib/loco-admin.php:1044
|
| 155 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 156 |
-
msgstr "Ошибка компиляции МО-файла встроенным компилятором"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 159 |
-
msgid "Loco, Translation Management"
|
| 160 |
-
msgstr "Loco Translate, менеджер переводов"
|
| 161 |
-
|
| 162 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 163 |
-
msgid "Manage translations"
|
| 164 |
-
msgstr "Менеджер переводов"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:1094
|
| 167 |
-
msgid "Translation options"
|
| 168 |
-
msgstr "Опции перевода"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:1101
|
| 171 |
-
msgid "Loco Translate"
|
| 172 |
-
msgstr "Loco Translate"
|
| 173 |
-
|
| 174 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 175 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 176 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 177 |
-
msgid "Settings"
|
| 178 |
-
msgstr "Установки"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1149
|
| 181 |
-
msgid "File download failed"
|
| 182 |
-
msgstr "Ошибка загрузки файла"
|
| 183 |
-
|
| 184 |
-
#: lib/loco-admin.php:1159
|
| 185 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 186 |
-
msgstr "WPLANG устарела и должна быть удалена из wp-config.php"
|
| 187 |
-
|
| 188 |
-
#: lib/loco-locales.php:77
|
| 189 |
-
msgid "Unknown language"
|
| 190 |
-
msgstr "Неизвестный язык"
|
| 191 |
-
|
| 192 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 193 |
-
msgid "Some files not writable"
|
| 194 |
-
msgstr "Некоторые файлы недоступны для записи"
|
| 195 |
-
|
| 196 |
-
#: lib/loco-packages.php:484
|
| 197 |
-
msgid "Some files missing"
|
| 198 |
-
msgstr "Некоторые файлы с ошибками или отсутствуют"
|
| 199 |
-
|
| 200 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 201 |
-
msgid "\"%s\" folder not writable"
|
| 202 |
-
msgstr "Папка \"%s\" недоступна для записи"
|
| 203 |
-
|
| 204 |
-
#: lib/loco-packages.php:515
|
| 205 |
-
msgid "POT file not writable"
|
| 206 |
-
msgstr "РОТ-файл недоступен для записи"
|
| 207 |
-
|
| 208 |
-
#: lib/loco-packages.php:520
|
| 209 |
-
msgid "PO file not writable"
|
| 210 |
-
msgstr "РО-файл недоступен для записи"
|
| 211 |
-
|
| 212 |
-
#: lib/loco-packages.php:522
|
| 213 |
-
msgid "MO file not writable"
|
| 214 |
-
msgstr "МО-файл недоступен для записи"
|
| 215 |
-
|
| 216 |
-
#: lib/loco-packages.php:522
|
| 217 |
-
msgid "MO file not found"
|
| 218 |
-
msgstr "МО-файл не найден"
|
| 219 |
-
|
| 220 |
-
#: lib/loco-packages.php:527
|
| 221 |
-
msgid "Folder not writable"
|
| 222 |
-
msgstr "Папка недоступна для записи"
|
| 223 |
-
|
| 224 |
-
#: lib/loco-packages.php:527
|
| 225 |
-
msgid "Folder not found"
|
| 226 |
-
msgstr "Папка не найдена"
|
| 227 |
-
|
| 228 |
-
#: lib/loco-packages.php:546
|
| 229 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 230 |
-
msgstr "%s не объявлена \"Text Domain\""
|
| 231 |
-
|
| 232 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 233 |
-
msgid "Loco has guessed \"%s\""
|
| 234 |
-
msgstr "Loco распознал \"%s\""
|
| 235 |
-
|
| 236 |
-
#: lib/loco-packages.php:551
|
| 237 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 238 |
-
msgstr "%s не объявлена \"Domain Path\""
|
| 239 |
-
|
| 240 |
-
#: lib/loco-packages.php:556
|
| 241 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 242 |
-
msgstr ""
|
| 243 |
-
"%s не имеет POT-файла. Создайте файл из \"%s/%s.pot\" если он вам нужен."
|
| 244 |
-
|
| 245 |
-
#: lib/loco-packages.php:559
|
| 246 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 247 |
-
msgstr "%s неправильное имя POT-файла (%s). Правильное имя будет \"%s.pot\""
|
| 248 |
-
|
| 249 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 250 |
-
msgid "User does not have permission to manage translations"
|
| 251 |
-
msgstr "У пользователя недостаточно прав для управления переводами"
|
| 252 |
-
|
| 253 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 254 |
-
msgid "Invalid data posted to server"
|
| 255 |
-
msgstr "На сервер отправлены неверные данные"
|
| 256 |
-
|
| 257 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 258 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 259 |
-
msgstr "Ошибка компилирования МО-файла с %s . Проверьте настройки"
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 262 |
-
msgid "Package not found called %s"
|
| 263 |
-
msgstr "Не найден пакет с именем %s"
|
| 264 |
-
|
| 265 |
-
#: php/loco-posave.php:58
|
| 266 |
-
msgid ""
|
| 267 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 268 |
-
"backups in settings"
|
| 269 |
-
msgstr ""
|
| 270 |
-
"Web сервер не может создать резервную копию в \"%s\". Исправьте права "
|
| 271 |
-
"доступа, или отключите функцию резервирования в настройках"
|
| 272 |
-
|
| 273 |
-
#: php/loco-posave.php:66
|
| 274 |
-
msgid ""
|
| 275 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 276 |
-
"create it manually."
|
| 277 |
-
msgstr ""
|
| 278 |
-
"Web сервер не может создать \"%s\" в каталоге \"%s\". Исправьте права "
|
| 279 |
-
"доступа, или создайте вручную"
|
| 280 |
-
|
| 281 |
-
#: php/loco-posave.php:69
|
| 282 |
-
msgid ""
|
| 283 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 284 |
-
"or use the download function."
|
| 285 |
-
msgstr ""
|
| 286 |
-
"Web сервер не может создать файлы в каталоге \"%s\". Исправьте права "
|
| 287 |
-
"доступа, или используйте функцию загрузки."
|
| 288 |
-
|
| 289 |
-
#: php/loco-posave.php:81
|
| 290 |
-
msgid ""
|
| 291 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 292 |
-
"and copy to \"%s/%s\"."
|
| 293 |
-
msgstr ""
|
| 294 |
-
"%s файл не может быть записан на сервер. Исправьте права доступа или "
|
| 295 |
-
"загрузите и скопируйте \"%s/%s\"."
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:102
|
| 298 |
-
msgid "Cannot create MO file"
|
| 299 |
-
msgstr "Невозможно создать МО-файл"
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:105
|
| 302 |
-
msgid "Cannot overwrite MO file"
|
| 303 |
-
msgstr "Невозможно перезаписать МО-файл"
|
| 304 |
-
|
| 305 |
-
#: php/loco-posave.php:131
|
| 306 |
-
msgid "Failed to write MO file"
|
| 307 |
-
msgstr "Ошибка записи МО-файла"
|
| 308 |
-
|
| 309 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 310 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 311 |
-
#: tpl/admin-root.tpl.php:6
|
| 312 |
-
msgid "Packages"
|
| 313 |
-
msgstr "Пакеты переводов"
|
| 314 |
-
|
| 315 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 316 |
-
msgid "File check"
|
| 317 |
-
msgstr "Проверка файла"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 320 |
-
msgid "File system permissions for %s"
|
| 321 |
-
msgstr "Права доступа файловой системы для %s"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 324 |
-
msgid "Other potential issues with %s"
|
| 325 |
-
msgstr "Другие потенциальные проблемы с %s"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 328 |
-
msgid "Back"
|
| 329 |
-
msgstr "Назад"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 332 |
-
msgid "Get help"
|
| 333 |
-
msgstr "Помощь"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-list.tpl.php:11
|
| 336 |
-
msgctxt "Table header"
|
| 337 |
-
msgid "Package details"
|
| 338 |
-
msgstr "Детали пакета"
|
| 339 |
-
|
| 340 |
-
#: tpl/admin-list.tpl.php:14
|
| 341 |
-
msgctxt "Table header"
|
| 342 |
-
msgid "Translations (PO)"
|
| 343 |
-
msgstr "Переводы (РО)"
|
| 344 |
-
|
| 345 |
-
#: tpl/admin-list.tpl.php:17
|
| 346 |
-
msgctxt "Table header"
|
| 347 |
-
msgid "Template (POT)"
|
| 348 |
-
msgstr "Шаблоны (РОТ)"
|
| 349 |
-
|
| 350 |
-
#: tpl/admin-list.tpl.php:20
|
| 351 |
-
msgctxt "Table header"
|
| 352 |
-
msgid "File permissions"
|
| 353 |
-
msgstr "Права доступа к файлу"
|
| 354 |
-
|
| 355 |
-
#: tpl/admin-list.tpl.php:40
|
| 356 |
-
msgid "Extends: %s"
|
| 357 |
-
msgstr "Расширить: %s"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:44
|
| 360 |
-
msgid "1 language"
|
| 361 |
-
msgid_plural "%u languages"
|
| 362 |
-
msgstr[0] "1 язык"
|
| 363 |
-
msgstr[1] "%s языка(ов)"
|
| 364 |
-
|
| 365 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 366 |
-
msgctxt "Modified time"
|
| 367 |
-
msgid "Updated"
|
| 368 |
-
msgstr "Обновлённый"
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-nav.tpl.php:26
|
| 371 |
-
msgid "Powered by"
|
| 372 |
-
msgstr "Представляем"
|
| 373 |
-
|
| 374 |
-
#: tpl/admin-nav.tpl.php:32
|
| 375 |
-
msgid "Loco may not work as expected"
|
| 376 |
-
msgstr "Плагин Loco Translate может не работать, как ожидалось"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-opts.tpl.php:18
|
| 379 |
-
msgid "Configure Loco Translate"
|
| 380 |
-
msgstr "Настройка Loco Translate"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 383 |
-
msgid "Compiling MO files"
|
| 384 |
-
msgstr "Компиляция МО-файлов"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:36
|
| 387 |
-
msgid "Use built-in MO compiler."
|
| 388 |
-
msgstr "Использовать встроенный МО компилятор"
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:42
|
| 391 |
-
msgid "Use external command:"
|
| 392 |
-
msgstr "Использовать внешнюю команду:"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:47
|
| 395 |
-
msgid "Enter path to msgfmt on server"
|
| 396 |
-
msgstr "Путь к msgfmt на сервере"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:54
|
| 399 |
-
msgid "Generate hash tables"
|
| 400 |
-
msgstr "Генерировать hash таблицы"
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:60
|
| 403 |
-
msgid "Include Fuzzy strings"
|
| 404 |
-
msgstr "Включить нечеткие строки"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 407 |
-
msgid "Backing up PO files"
|
| 408 |
-
msgstr "Резервное копирование РО-файлов"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:75
|
| 411 |
-
msgid "Number of backups to keep of each file:"
|
| 412 |
-
msgstr "Количество копии для каждого файла:"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 415 |
-
msgid "Experimental features"
|
| 416 |
-
msgstr "Экспериментальные функции"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:92
|
| 419 |
-
msgid "Enable WordPress core translations"
|
| 420 |
-
msgstr "Включить переводы ядра WordPress"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-opts.tpl.php:101
|
| 423 |
-
msgid "Save settings"
|
| 424 |
-
msgstr "Сохранить установки"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 427 |
-
msgid "Template file"
|
| 428 |
-
msgstr "Файл шаблона"
|
| 429 |
-
|
| 430 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 431 |
-
msgctxt "Dropdown label"
|
| 432 |
-
msgid "Switch to..."
|
| 433 |
-
msgstr "Переключиться на..."
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 436 |
-
msgid "never"
|
| 437 |
-
msgstr "никогда"
|
| 438 |
-
|
| 439 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 440 |
-
msgctxt "Editor button"
|
| 441 |
-
msgid "Save"
|
| 442 |
-
msgstr "Сохранить"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 445 |
-
msgctxt "Editor button"
|
| 446 |
-
msgid "Download"
|
| 447 |
-
msgstr "Загрузить"
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 450 |
-
msgctxt "Editor button"
|
| 451 |
-
msgid "Sync"
|
| 452 |
-
msgstr "Синхронизация"
|
| 453 |
-
|
| 454 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 455 |
-
msgctxt "Editor button"
|
| 456 |
-
msgid "Revert"
|
| 457 |
-
msgstr "Вернуться"
|
| 458 |
-
|
| 459 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 460 |
-
msgctxt "Editor button"
|
| 461 |
-
msgid "Add"
|
| 462 |
-
msgstr "Добавить"
|
| 463 |
-
|
| 464 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 465 |
-
msgctxt "Editor button"
|
| 466 |
-
msgid "Del"
|
| 467 |
-
msgstr "Удалить"
|
| 468 |
-
|
| 469 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 470 |
-
msgctxt "Editor button"
|
| 471 |
-
msgid "Fuzzy"
|
| 472 |
-
msgstr "Неточный перевод"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 475 |
-
msgid "Filter translations"
|
| 476 |
-
msgstr "Поиск по фразе"
|
| 477 |
-
|
| 478 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 479 |
-
msgctxt "Editor button"
|
| 480 |
-
msgid "Help"
|
| 481 |
-
msgstr "Помощь"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 484 |
-
msgid "Initialize new translations in %s"
|
| 485 |
-
msgstr "Начать новый перевод в %s"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 488 |
-
msgid "Select from common languages"
|
| 489 |
-
msgstr "Выберите язык из списка"
|
| 490 |
-
|
| 491 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 492 |
-
msgctxt "Form label"
|
| 493 |
-
msgid "or enter any language code"
|
| 494 |
-
msgstr "или введите код языка"
|
| 495 |
-
|
| 496 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 497 |
-
msgctxt "Form label"
|
| 498 |
-
msgid "create in <code>%s</code>"
|
| 499 |
-
msgstr "создать в <code>%s</code>"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 502 |
-
msgctxt "Form label"
|
| 503 |
-
msgid "create in global languages directory"
|
| 504 |
-
msgstr "создать в каталоге глобальных языков"
|
| 505 |
-
|
| 506 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 507 |
-
msgctxt "Submit button"
|
| 508 |
-
msgid "Start translating"
|
| 509 |
-
msgstr "Начать перевод"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-root.tpl.php:18
|
| 512 |
-
msgid "New version available"
|
| 513 |
-
msgstr "Доступна новая версия"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-root.tpl.php:21
|
| 516 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 517 |
-
msgstr "Обновить Loco Translate до версии %s"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:31
|
| 520 |
-
msgid "Select a plugin or theme to translate"
|
| 521 |
-
msgstr "Выберите плагин или тему для перевода "
|
| 522 |
-
|
| 523 |
-
#: tpl/admin-root.tpl.php:40
|
| 524 |
-
msgctxt "Package list header"
|
| 525 |
-
msgid "Themes"
|
| 526 |
-
msgstr "Темы"
|
| 527 |
-
|
| 528 |
-
#: tpl/admin-root.tpl.php:53
|
| 529 |
-
msgctxt "Package list header"
|
| 530 |
-
msgid "Plugins"
|
| 531 |
-
msgstr "Плагины"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:66
|
| 534 |
-
msgctxt "Package list header"
|
| 535 |
-
msgid "Core"
|
| 536 |
-
msgstr "Ядро"
|
| 537 |
-
|
| 538 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 539 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 540 |
-
msgid ""
|
| 541 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 542 |
-
"install it"
|
| 543 |
-
msgstr ""
|
| 544 |
-
"Расширение PHP \"%s\" не установлено. Вы должны его установить, если у вас "
|
| 545 |
-
"возникли проблемы"
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:8
|
| 548 |
-
msgid "Unknown error"
|
| 549 |
-
msgstr "Неизвестная ошибка"
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:10
|
| 552 |
-
msgid "PO file saved"
|
| 553 |
-
msgstr "РО-файл сохранён"
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:12
|
| 556 |
-
msgid "and MO file compiled"
|
| 557 |
-
msgstr "и МО-файл скомпилирован"
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:15
|
| 560 |
-
msgid "Merged from %s"
|
| 561 |
-
msgstr "Объединено с %s"
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:17
|
| 564 |
-
msgid "Merged from source code"
|
| 565 |
-
msgstr "Объединено с исходным кодом"
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:19
|
| 568 |
-
msgid "Already up to date with %s"
|
| 569 |
-
msgstr "Уже обновлено с %s"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:21
|
| 572 |
-
msgid "Already up to date with source code"
|
| 573 |
-
msgstr "Уже обновлено с исходным кодом"
|
| 574 |
-
|
| 575 |
-
#: pub/js/lang/dummy.php:23
|
| 576 |
-
msgid "1 new string added"
|
| 577 |
-
msgid_plural "%s new strings added"
|
| 578 |
-
msgstr[0] "добавлена 1 новая строка"
|
| 579 |
-
msgstr[1] "добавлено %s новых строк(и)"
|
| 580 |
-
|
| 581 |
-
#: pub/js/lang/dummy.php:25
|
| 582 |
-
msgid "1 obsolete string removed"
|
| 583 |
-
msgid_plural "%s obsolete strings removed"
|
| 584 |
-
msgstr[0] "удалена 1 строка"
|
| 585 |
-
msgstr[1] "удалены %s строк(и)"
|
| 586 |
-
|
| 587 |
-
#: pub/js/lang/dummy.php:27
|
| 588 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 589 |
-
msgstr "Ваши изменения будут потеряны, если вы не сохранитесь"
|
| 590 |
-
|
| 591 |
-
#. label for the window pane holding native translation
|
| 592 |
-
#: pub/js/lang/dummy.php:35
|
| 593 |
-
msgctxt "Editor pane"
|
| 594 |
-
msgid "Source text"
|
| 595 |
-
msgstr "Исходный текст"
|
| 596 |
-
|
| 597 |
-
#. where %s is the language, e.g French translation
|
| 598 |
-
#: pub/js/lang/dummy.php:38
|
| 599 |
-
msgctxt "Editor pane"
|
| 600 |
-
msgid "%s translation"
|
| 601 |
-
msgstr "перевод %s"
|
| 602 |
-
|
| 603 |
-
#. label for the window pane holding translator comments
|
| 604 |
-
#: pub/js/lang/dummy.php:41
|
| 605 |
-
msgctxt "Editor pane"
|
| 606 |
-
msgid "Comments"
|
| 607 |
-
msgstr "Комментарии"
|
| 608 |
-
|
| 609 |
-
#. label for the window pane holding message context
|
| 610 |
-
#: pub/js/lang/dummy.php:44
|
| 611 |
-
msgctxt "Editor pane"
|
| 612 |
-
msgid "Context"
|
| 613 |
-
msgstr "Контекст"
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:52
|
| 616 |
-
msgid "Translation"
|
| 617 |
-
msgstr "Перевод"
|
| 618 |
-
|
| 619 |
-
#: pub/js/lang/dummy.php:54
|
| 620 |
-
msgid "No source files in this package, nothing to sync"
|
| 621 |
-
msgstr "В этом пакете исходные файлы для синхронизации отсутствуют "
|
| 622 |
-
|
| 623 |
-
#: pub/js/lang/dummy.php:56
|
| 624 |
-
msgid "No strings could be extracted from source files"
|
| 625 |
-
msgstr "Нет строк для обработки из исходного кода"
|
| 626 |
-
|
| 627 |
-
#. Description of the plugin
|
| 628 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 629 |
-
msgstr "Переводите WordPress плагины и темы прямо в вашем браузере"
|
| 630 |
-
|
| 631 |
-
#. URI of the plugin
|
| 632 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 633 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 634 |
-
|
| 635 |
-
#. Author of the plugin
|
| 636 |
-
msgid "Tim Whitlock"
|
| 637 |
-
msgstr "Tim Whitlock"
|
| 638 |
-
|
| 639 |
-
#. Author URI of the plugin
|
| 640 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 641 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-sv_SE.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-sv_SE.po
DELETED
|
@@ -1,641 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:35 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Swedish\n"
|
| 9 |
-
"Language: sv-SE\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 17 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 18 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 19 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 20 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 21 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 22 |
-
"X-Loco-Target-Locale: sv_SE\n"
|
| 23 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
msgctxt "Message label"
|
| 28 |
-
msgid "Error"
|
| 29 |
-
msgstr "Fel"
|
| 30 |
-
|
| 31 |
-
#: lib/loco-admin.php:41
|
| 32 |
-
msgctxt "Message label"
|
| 33 |
-
msgid "Warning"
|
| 34 |
-
msgstr "Varning"
|
| 35 |
-
|
| 36 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 37 |
-
msgctxt "Message label"
|
| 38 |
-
msgid "OK"
|
| 39 |
-
msgstr "OK"
|
| 40 |
-
|
| 41 |
-
#: lib/loco-admin.php:63
|
| 42 |
-
msgid "Permission denied"
|
| 43 |
-
msgstr "Behörighet saknas"
|
| 44 |
-
|
| 45 |
-
#: lib/loco-admin.php:86
|
| 46 |
-
msgid "Settings saved"
|
| 47 |
-
msgstr "Inställningar sparade"
|
| 48 |
-
|
| 49 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 50 |
-
msgid "%s is not an official WordPress language"
|
| 51 |
-
msgstr "%s är inte ett officiellt språk i WordPress"
|
| 52 |
-
|
| 53 |
-
#: lib/loco-admin.php:199
|
| 54 |
-
msgid "New PO file"
|
| 55 |
-
msgstr "Ny PO-fil"
|
| 56 |
-
|
| 57 |
-
#: lib/loco-admin.php:214
|
| 58 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 59 |
-
msgstr ""
|
| 60 |
-
"PO-fil används som mall. Den kommer att byta namn till %s när du väljer att "
|
| 61 |
-
"spara"
|
| 62 |
-
|
| 63 |
-
#: lib/loco-admin.php:312
|
| 64 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 65 |
-
msgstr "Du måste ange en giltig landskod för en ny PO-fil"
|
| 66 |
-
|
| 67 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 68 |
-
msgid "No translatable strings found"
|
| 69 |
-
msgstr "Inga översättbara strängar hittades"
|
| 70 |
-
|
| 71 |
-
#: lib/loco-admin.php:337
|
| 72 |
-
msgid "Cannot create a PO file."
|
| 73 |
-
msgstr "Kunde ej skapa en PO-fil."
|
| 74 |
-
|
| 75 |
-
#: lib/loco-admin.php:344
|
| 76 |
-
msgid "PO file already exists with locale %s"
|
| 77 |
-
msgstr "PO-fil finns redan med landskod %s"
|
| 78 |
-
|
| 79 |
-
#: lib/loco-admin.php:396
|
| 80 |
-
msgid ""
|
| 81 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 82 |
-
"Download instead of Save"
|
| 83 |
-
msgstr ""
|
| 84 |
-
"Fil kunde ej skapas automatiskt. Ändra filrättigheter eller använd Ladda ner "
|
| 85 |
-
"istället för Spara"
|
| 86 |
-
|
| 87 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 88 |
-
msgid "%s file is empty"
|
| 89 |
-
msgstr "%s-filen är tom"
|
| 90 |
-
|
| 91 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 92 |
-
msgid "Run Sync to update from source code"
|
| 93 |
-
msgstr "Använd Synka för att uppdatera från källkoden"
|
| 94 |
-
|
| 95 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 96 |
-
msgid "No strings could be extracted from source code"
|
| 97 |
-
msgstr "Inga strängar kunde hittas från källkoden"
|
| 98 |
-
|
| 99 |
-
#: lib/loco-admin.php:417
|
| 100 |
-
msgid "Run Sync to update from %s"
|
| 101 |
-
msgstr "Använd Synka för att uppdatera från %s"
|
| 102 |
-
|
| 103 |
-
#: lib/loco-admin.php:436
|
| 104 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 105 |
-
msgstr "Källkod har ändrats, använd Synka för att uppdatera POT"
|
| 106 |
-
|
| 107 |
-
#: lib/loco-admin.php:440
|
| 108 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 109 |
-
msgstr ""
|
| 110 |
-
"POT har ändrats sedan PO-filen sparades, använd Synka för att uppdatera"
|
| 111 |
-
|
| 112 |
-
#: lib/loco-admin.php:536
|
| 113 |
-
msgid "Bad file path"
|
| 114 |
-
msgstr "Ogiltig sökväg"
|
| 115 |
-
|
| 116 |
-
#: lib/loco-admin.php:783
|
| 117 |
-
msgid "Empty or invalid %s file"
|
| 118 |
-
msgstr "Tom eller ogiltigt %s-fil"
|
| 119 |
-
|
| 120 |
-
#: lib/loco-admin.php:787
|
| 121 |
-
msgid "%s file has no header"
|
| 122 |
-
msgstr "%s-filen saknar header"
|
| 123 |
-
|
| 124 |
-
#: lib/loco-admin.php:934
|
| 125 |
-
msgctxt "Add button"
|
| 126 |
-
msgid "New template"
|
| 127 |
-
msgstr "Ny mall"
|
| 128 |
-
|
| 129 |
-
#: lib/loco-admin.php:953
|
| 130 |
-
msgctxt "Add button"
|
| 131 |
-
msgid "New language"
|
| 132 |
-
msgstr "Nytt språk"
|
| 133 |
-
|
| 134 |
-
#: lib/loco-admin.php:992
|
| 135 |
-
msgid "%s%% translated"
|
| 136 |
-
msgstr "%s%% översatt"
|
| 137 |
-
|
| 138 |
-
#: lib/loco-admin.php:992
|
| 139 |
-
msgid "1 string"
|
| 140 |
-
msgid_plural "%s strings"
|
| 141 |
-
msgstr[0] "1 sträng"
|
| 142 |
-
msgstr[1] "%s strängar"
|
| 143 |
-
|
| 144 |
-
#: lib/loco-admin.php:995
|
| 145 |
-
msgid "%s fuzzy"
|
| 146 |
-
msgstr "%s oklar"
|
| 147 |
-
|
| 148 |
-
#: lib/loco-admin.php:998
|
| 149 |
-
msgid "%s untranslated"
|
| 150 |
-
msgstr "%s ej översatta"
|
| 151 |
-
|
| 152 |
-
#: lib/loco-admin.php:1044
|
| 153 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 154 |
-
msgstr "Det gick ej att sammanställa MO-fil med inbyggd kompilator"
|
| 155 |
-
|
| 156 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 157 |
-
msgid "Loco, Translation Management"
|
| 158 |
-
msgstr "Loco, Translation Management"
|
| 159 |
-
|
| 160 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 161 |
-
msgid "Manage translations"
|
| 162 |
-
msgstr "Språkfiler"
|
| 163 |
-
|
| 164 |
-
#: lib/loco-admin.php:1094
|
| 165 |
-
msgid "Translation options"
|
| 166 |
-
msgstr "Inställningar"
|
| 167 |
-
|
| 168 |
-
#: lib/loco-admin.php:1101
|
| 169 |
-
msgid "Loco Translate"
|
| 170 |
-
msgstr "Loco Translate"
|
| 171 |
-
|
| 172 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 173 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 174 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 175 |
-
msgid "Settings"
|
| 176 |
-
msgstr "Inställningar"
|
| 177 |
-
|
| 178 |
-
#: lib/loco-admin.php:1149
|
| 179 |
-
msgid "File download failed"
|
| 180 |
-
msgstr "Nedladdning misslyckades"
|
| 181 |
-
|
| 182 |
-
#: lib/loco-admin.php:1159
|
| 183 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 184 |
-
msgstr "WPLANG är inaktuell och bör tas bort från wp-config.php"
|
| 185 |
-
|
| 186 |
-
#: lib/loco-locales.php:77
|
| 187 |
-
msgid "Unknown language"
|
| 188 |
-
msgstr "Okänt språk"
|
| 189 |
-
|
| 190 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 191 |
-
msgid "Some files not writable"
|
| 192 |
-
msgstr "Vissa filer är ej skrivbara"
|
| 193 |
-
|
| 194 |
-
#: lib/loco-packages.php:484
|
| 195 |
-
msgid "Some files missing"
|
| 196 |
-
msgstr "Vissa filer saknas"
|
| 197 |
-
|
| 198 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 199 |
-
msgid "\"%s\" folder not writable"
|
| 200 |
-
msgstr "Mappen \"%s\" är ej skrivbar"
|
| 201 |
-
|
| 202 |
-
#: lib/loco-packages.php:515
|
| 203 |
-
msgid "POT file not writable"
|
| 204 |
-
msgstr "POT-filen är ej skrivbar"
|
| 205 |
-
|
| 206 |
-
#: lib/loco-packages.php:520
|
| 207 |
-
msgid "PO file not writable"
|
| 208 |
-
msgstr "PO-filen är ej skrivbar"
|
| 209 |
-
|
| 210 |
-
#: lib/loco-packages.php:522
|
| 211 |
-
msgid "MO file not writable"
|
| 212 |
-
msgstr "MO-filen är ej skrivbar"
|
| 213 |
-
|
| 214 |
-
#: lib/loco-packages.php:522
|
| 215 |
-
msgid "MO file not found"
|
| 216 |
-
msgstr "MO-fil hittades ej"
|
| 217 |
-
|
| 218 |
-
#: lib/loco-packages.php:527
|
| 219 |
-
msgid "Folder not writable"
|
| 220 |
-
msgstr "Mappen är ej skrivbar"
|
| 221 |
-
|
| 222 |
-
#: lib/loco-packages.php:527
|
| 223 |
-
msgid "Folder not found"
|
| 224 |
-
msgstr "Mappen hittades ej"
|
| 225 |
-
|
| 226 |
-
#: lib/loco-packages.php:546
|
| 227 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 228 |
-
msgstr "%s har inte angivit \"Text Domain\""
|
| 229 |
-
|
| 230 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 231 |
-
msgid "Loco has guessed \"%s\""
|
| 232 |
-
msgstr "Loco har gissat på \"%s\""
|
| 233 |
-
|
| 234 |
-
#: lib/loco-packages.php:551
|
| 235 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 236 |
-
msgstr "%s har inte angivit \"Domain Path\""
|
| 237 |
-
|
| 238 |
-
#: lib/loco-packages.php:556
|
| 239 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 240 |
-
msgstr "%s har ingen POT-fil. Skapa en i \"%s/%s.pot\" om du behöver en."
|
| 241 |
-
|
| 242 |
-
#: lib/loco-packages.php:559
|
| 243 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 244 |
-
msgstr ""
|
| 245 |
-
"%s har ett konstigt POT-filnamn (%s). Ett bättre filnamn hade varit \"%s.pot"
|
| 246 |
-
"\""
|
| 247 |
-
|
| 248 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 249 |
-
msgid "User does not have permission to manage translations"
|
| 250 |
-
msgstr "Användaren saknar behörighet att hantera översättningar"
|
| 251 |
-
|
| 252 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 253 |
-
msgid "Invalid data posted to server"
|
| 254 |
-
msgstr "Ogiltig data skickades till servern"
|
| 255 |
-
|
| 256 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 257 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 258 |
-
msgstr ""
|
| 259 |
-
"Det gick ej sammanställa MO-filen med %s , kontrollera dina inställningar"
|
| 260 |
-
|
| 261 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 262 |
-
msgid "Package not found called %s"
|
| 263 |
-
msgstr "Paket %s ej hittat"
|
| 264 |
-
|
| 265 |
-
#: php/loco-posave.php:58
|
| 266 |
-
msgid ""
|
| 267 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 268 |
-
"backups in settings"
|
| 269 |
-
msgstr ""
|
| 270 |
-
"Webbservern kunde ej skapa säkerhetskopior i \"%s\". Ändra filrättigheter "
|
| 271 |
-
"eller inaktivera säkerhetskopior i inställningarna"
|
| 272 |
-
|
| 273 |
-
#: php/loco-posave.php:66
|
| 274 |
-
msgid ""
|
| 275 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 276 |
-
"create it manually."
|
| 277 |
-
msgstr ""
|
| 278 |
-
"Webbservern kunde ej skapa mappen \"%s\" i \"%s\". Ändra filrättigheter "
|
| 279 |
-
"eller skapa den manuellt."
|
| 280 |
-
|
| 281 |
-
#: php/loco-posave.php:69
|
| 282 |
-
msgid ""
|
| 283 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 284 |
-
"or use the download function."
|
| 285 |
-
msgstr ""
|
| 286 |
-
"Webbservern kunde ej skapa filer i mappen \"%s\". Ändra filrättigheter eller "
|
| 287 |
-
"använd nedladdningsfunktionen."
|
| 288 |
-
|
| 289 |
-
#: php/loco-posave.php:81
|
| 290 |
-
msgid ""
|
| 291 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 292 |
-
"and copy to \"%s/%s\"."
|
| 293 |
-
msgstr ""
|
| 294 |
-
"%s-filen är ej skrivbar av webbservern. Ändra filrättigheter eller ladda ner "
|
| 295 |
-
"och kopiera till \"%s/%s\"."
|
| 296 |
-
|
| 297 |
-
#: php/loco-posave.php:102
|
| 298 |
-
msgid "Cannot create MO file"
|
| 299 |
-
msgstr "Kunde ej skapa MO-fil"
|
| 300 |
-
|
| 301 |
-
#: php/loco-posave.php:105
|
| 302 |
-
msgid "Cannot overwrite MO file"
|
| 303 |
-
msgstr "Kunde ej skriva över MO-fil"
|
| 304 |
-
|
| 305 |
-
#: php/loco-posave.php:131
|
| 306 |
-
msgid "Failed to write MO file"
|
| 307 |
-
msgstr "Kunde ej skapa MO-fil"
|
| 308 |
-
|
| 309 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 310 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 311 |
-
#: tpl/admin-root.tpl.php:6
|
| 312 |
-
msgid "Packages"
|
| 313 |
-
msgstr "Språkfiler"
|
| 314 |
-
|
| 315 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 316 |
-
msgid "File check"
|
| 317 |
-
msgstr "Filrättigheter"
|
| 318 |
-
|
| 319 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 320 |
-
msgid "File system permissions for %s"
|
| 321 |
-
msgstr "Filsystem rättigheter för %s"
|
| 322 |
-
|
| 323 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 324 |
-
msgid "Other potential issues with %s"
|
| 325 |
-
msgstr "Andra potentiella problem med %s"
|
| 326 |
-
|
| 327 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 328 |
-
msgid "Back"
|
| 329 |
-
msgstr "Tillbaka"
|
| 330 |
-
|
| 331 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 332 |
-
msgid "Get help"
|
| 333 |
-
msgstr "Hjälp"
|
| 334 |
-
|
| 335 |
-
#: tpl/admin-list.tpl.php:11
|
| 336 |
-
msgctxt "Table header"
|
| 337 |
-
msgid "Package details"
|
| 338 |
-
msgstr "Beskrivning"
|
| 339 |
-
|
| 340 |
-
#: tpl/admin-list.tpl.php:14
|
| 341 |
-
msgctxt "Table header"
|
| 342 |
-
msgid "Translations (PO)"
|
| 343 |
-
msgstr "Översättningar (PO)"
|
| 344 |
-
|
| 345 |
-
#: tpl/admin-list.tpl.php:17
|
| 346 |
-
msgctxt "Table header"
|
| 347 |
-
msgid "Template (POT)"
|
| 348 |
-
msgstr "Mall (POT)"
|
| 349 |
-
|
| 350 |
-
#: tpl/admin-list.tpl.php:20
|
| 351 |
-
msgctxt "Table header"
|
| 352 |
-
msgid "File permissions"
|
| 353 |
-
msgstr "Filrättigheter"
|
| 354 |
-
|
| 355 |
-
#: tpl/admin-list.tpl.php:40
|
| 356 |
-
msgid "Extends: %s"
|
| 357 |
-
msgstr "Utökar: %s"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:44
|
| 360 |
-
msgid "1 language"
|
| 361 |
-
msgid_plural "%u languages"
|
| 362 |
-
msgstr[0] "1 språk"
|
| 363 |
-
msgstr[1] "%u språk"
|
| 364 |
-
|
| 365 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 366 |
-
msgctxt "Modified time"
|
| 367 |
-
msgid "Updated"
|
| 368 |
-
msgstr "Senast sparad"
|
| 369 |
-
|
| 370 |
-
#: tpl/admin-nav.tpl.php:26
|
| 371 |
-
msgid "Powered by"
|
| 372 |
-
msgstr "Drivs av"
|
| 373 |
-
|
| 374 |
-
#: tpl/admin-nav.tpl.php:32
|
| 375 |
-
msgid "Loco may not work as expected"
|
| 376 |
-
msgstr "Loco kanske ej fungerar som väntat"
|
| 377 |
-
|
| 378 |
-
#: tpl/admin-opts.tpl.php:18
|
| 379 |
-
msgid "Configure Loco Translate"
|
| 380 |
-
msgstr "Konfigurera Loco Translate"
|
| 381 |
-
|
| 382 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 383 |
-
msgid "Compiling MO files"
|
| 384 |
-
msgstr "Sammanställa MO-filer"
|
| 385 |
-
|
| 386 |
-
#: tpl/admin-opts.tpl.php:36
|
| 387 |
-
msgid "Use built-in MO compiler."
|
| 388 |
-
msgstr "Använd inbyggd MO-kompilator."
|
| 389 |
-
|
| 390 |
-
#: tpl/admin-opts.tpl.php:42
|
| 391 |
-
msgid "Use external command:"
|
| 392 |
-
msgstr "Använd externt kommando:"
|
| 393 |
-
|
| 394 |
-
#: tpl/admin-opts.tpl.php:47
|
| 395 |
-
msgid "Enter path to msgfmt on server"
|
| 396 |
-
msgstr "Skriv in sökväg till msgfmt på servern"
|
| 397 |
-
|
| 398 |
-
#: tpl/admin-opts.tpl.php:54
|
| 399 |
-
msgid "Generate hash tables"
|
| 400 |
-
msgstr "Generera hashtabeller"
|
| 401 |
-
|
| 402 |
-
#: tpl/admin-opts.tpl.php:60
|
| 403 |
-
msgid "Include Fuzzy strings"
|
| 404 |
-
msgstr "Inkludera luddiga översättningar"
|
| 405 |
-
|
| 406 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 407 |
-
msgid "Backing up PO files"
|
| 408 |
-
msgstr "Säkerhetskopiera PO-filer"
|
| 409 |
-
|
| 410 |
-
#: tpl/admin-opts.tpl.php:75
|
| 411 |
-
msgid "Number of backups to keep of each file:"
|
| 412 |
-
msgstr "Antal säkerhetskopior att behålla för varje fil:"
|
| 413 |
-
|
| 414 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 415 |
-
msgid "Experimental features"
|
| 416 |
-
msgstr "Experimentella funktioner"
|
| 417 |
-
|
| 418 |
-
#: tpl/admin-opts.tpl.php:92
|
| 419 |
-
msgid "Enable WordPress core translations"
|
| 420 |
-
msgstr "Aktivera WordPress översättningar"
|
| 421 |
-
|
| 422 |
-
#: tpl/admin-opts.tpl.php:101
|
| 423 |
-
msgid "Save settings"
|
| 424 |
-
msgstr "Spara inställningar"
|
| 425 |
-
|
| 426 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 427 |
-
msgid "Template file"
|
| 428 |
-
msgstr "Mallfil"
|
| 429 |
-
|
| 430 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 431 |
-
msgctxt "Dropdown label"
|
| 432 |
-
msgid "Switch to..."
|
| 433 |
-
msgstr "Växla till..."
|
| 434 |
-
|
| 435 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 436 |
-
msgid "never"
|
| 437 |
-
msgstr "aldrig"
|
| 438 |
-
|
| 439 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 440 |
-
msgctxt "Editor button"
|
| 441 |
-
msgid "Save"
|
| 442 |
-
msgstr "Spara"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 445 |
-
msgctxt "Editor button"
|
| 446 |
-
msgid "Download"
|
| 447 |
-
msgstr "Ladda ner"
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 450 |
-
msgctxt "Editor button"
|
| 451 |
-
msgid "Sync"
|
| 452 |
-
msgstr "Synka"
|
| 453 |
-
|
| 454 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 455 |
-
msgctxt "Editor button"
|
| 456 |
-
msgid "Revert"
|
| 457 |
-
msgstr "Återgå"
|
| 458 |
-
|
| 459 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 460 |
-
msgctxt "Editor button"
|
| 461 |
-
msgid "Add"
|
| 462 |
-
msgstr "Lägg till"
|
| 463 |
-
|
| 464 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 465 |
-
msgctxt "Editor button"
|
| 466 |
-
msgid "Del"
|
| 467 |
-
msgstr "Radera"
|
| 468 |
-
|
| 469 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 470 |
-
msgctxt "Editor button"
|
| 471 |
-
msgid "Fuzzy"
|
| 472 |
-
msgstr "Oklar"
|
| 473 |
-
|
| 474 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 475 |
-
msgid "Filter translations"
|
| 476 |
-
msgstr "Sök översättningar"
|
| 477 |
-
|
| 478 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 479 |
-
msgctxt "Editor button"
|
| 480 |
-
msgid "Help"
|
| 481 |
-
msgstr "Hjälp"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 484 |
-
msgid "Initialize new translations in %s"
|
| 485 |
-
msgstr "Skapa nya översättningar i %s"
|
| 486 |
-
|
| 487 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 488 |
-
msgid "Select from common languages"
|
| 489 |
-
msgstr "Välj bland vanliga språk"
|
| 490 |
-
|
| 491 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 492 |
-
msgctxt "Form label"
|
| 493 |
-
msgid "or enter any language code"
|
| 494 |
-
msgstr "eller skriv valfri landskod"
|
| 495 |
-
|
| 496 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 497 |
-
msgctxt "Form label"
|
| 498 |
-
msgid "create in <code>%s</code>"
|
| 499 |
-
msgstr "skapa i <code>%s</code>"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 502 |
-
msgctxt "Form label"
|
| 503 |
-
msgid "create in global languages directory"
|
| 504 |
-
msgstr "skapa i den globala språk mappen"
|
| 505 |
-
|
| 506 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 507 |
-
msgctxt "Submit button"
|
| 508 |
-
msgid "Start translating"
|
| 509 |
-
msgstr "Börja översätta"
|
| 510 |
-
|
| 511 |
-
#: tpl/admin-root.tpl.php:18
|
| 512 |
-
msgid "New version available"
|
| 513 |
-
msgstr "Ny version tillgänglig"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-root.tpl.php:21
|
| 516 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 517 |
-
msgstr "Uppdatera till version %s av Loco Translate"
|
| 518 |
-
|
| 519 |
-
#: tpl/admin-root.tpl.php:31
|
| 520 |
-
msgid "Select a plugin or theme to translate"
|
| 521 |
-
msgstr "Välj ett tillägg eller tema att översätta"
|
| 522 |
-
|
| 523 |
-
#: tpl/admin-root.tpl.php:40
|
| 524 |
-
msgctxt "Package list header"
|
| 525 |
-
msgid "Themes"
|
| 526 |
-
msgstr "Teman"
|
| 527 |
-
|
| 528 |
-
#: tpl/admin-root.tpl.php:53
|
| 529 |
-
msgctxt "Package list header"
|
| 530 |
-
msgid "Plugins"
|
| 531 |
-
msgstr "Tillägg"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:66
|
| 534 |
-
msgctxt "Package list header"
|
| 535 |
-
msgid "Core"
|
| 536 |
-
msgstr "WordPress"
|
| 537 |
-
|
| 538 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 539 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 540 |
-
msgid ""
|
| 541 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 542 |
-
"install it"
|
| 543 |
-
msgstr ""
|
| 544 |
-
"PHP tillägg \"%s\" är inte installerat. Om du upplever problem bör du "
|
| 545 |
-
"installera det"
|
| 546 |
-
|
| 547 |
-
#: pub/js/lang/dummy.php:8
|
| 548 |
-
msgid "Unknown error"
|
| 549 |
-
msgstr "Okänt fel"
|
| 550 |
-
|
| 551 |
-
#: pub/js/lang/dummy.php:10
|
| 552 |
-
msgid "PO file saved"
|
| 553 |
-
msgstr "PO-fil sparad"
|
| 554 |
-
|
| 555 |
-
#: pub/js/lang/dummy.php:12
|
| 556 |
-
msgid "and MO file compiled"
|
| 557 |
-
msgstr "och MO-fil sammanställd"
|
| 558 |
-
|
| 559 |
-
#: pub/js/lang/dummy.php:15
|
| 560 |
-
msgid "Merged from %s"
|
| 561 |
-
msgstr "Sammanslagen från %s"
|
| 562 |
-
|
| 563 |
-
#: pub/js/lang/dummy.php:17
|
| 564 |
-
msgid "Merged from source code"
|
| 565 |
-
msgstr "Sammanslagen från källkod"
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:19
|
| 568 |
-
msgid "Already up to date with %s"
|
| 569 |
-
msgstr "Redan aktuell med %s"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:21
|
| 572 |
-
msgid "Already up to date with source code"
|
| 573 |
-
msgstr "Redan aktuell med källkod"
|
| 574 |
-
|
| 575 |
-
#: pub/js/lang/dummy.php:23
|
| 576 |
-
msgid "1 new string added"
|
| 577 |
-
msgid_plural "%s new strings added"
|
| 578 |
-
msgstr[0] "1 ny sträng tillagd"
|
| 579 |
-
msgstr[1] "%s nya strängar tillagda"
|
| 580 |
-
|
| 581 |
-
#: pub/js/lang/dummy.php:25
|
| 582 |
-
msgid "1 obsolete string removed"
|
| 583 |
-
msgid_plural "%s obsolete strings removed"
|
| 584 |
-
msgstr[0] "1 föråldrad sträng togs bort"
|
| 585 |
-
msgstr[1] "%s föråldrade strängar togs bort"
|
| 586 |
-
|
| 587 |
-
#: pub/js/lang/dummy.php:27
|
| 588 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 589 |
-
msgstr "Dina ändringar kommer att gå förlorade om du fortsätter utan att spara"
|
| 590 |
-
|
| 591 |
-
#. label for the window pane holding native translation
|
| 592 |
-
#: pub/js/lang/dummy.php:35
|
| 593 |
-
msgctxt "Editor pane"
|
| 594 |
-
msgid "Source text"
|
| 595 |
-
msgstr "Källtext"
|
| 596 |
-
|
| 597 |
-
#. where %s is the language, e.g French translation
|
| 598 |
-
#: pub/js/lang/dummy.php:38
|
| 599 |
-
msgctxt "Editor pane"
|
| 600 |
-
msgid "%s translation"
|
| 601 |
-
msgstr "%s översättning"
|
| 602 |
-
|
| 603 |
-
#. label for the window pane holding translator comments
|
| 604 |
-
#: pub/js/lang/dummy.php:41
|
| 605 |
-
msgctxt "Editor pane"
|
| 606 |
-
msgid "Comments"
|
| 607 |
-
msgstr "Kommentarer"
|
| 608 |
-
|
| 609 |
-
#. label for the window pane holding message context
|
| 610 |
-
#: pub/js/lang/dummy.php:44
|
| 611 |
-
msgctxt "Editor pane"
|
| 612 |
-
msgid "Context"
|
| 613 |
-
msgstr "Innehåll"
|
| 614 |
-
|
| 615 |
-
#: pub/js/lang/dummy.php:52
|
| 616 |
-
msgid "Translation"
|
| 617 |
-
msgstr "Översättning"
|
| 618 |
-
|
| 619 |
-
#: pub/js/lang/dummy.php:54
|
| 620 |
-
msgid "No source files in this package, nothing to sync"
|
| 621 |
-
msgstr "Inga källfiler finns i detta paket, inget att synka"
|
| 622 |
-
|
| 623 |
-
#: pub/js/lang/dummy.php:56
|
| 624 |
-
msgid "No strings could be extracted from source files"
|
| 625 |
-
msgstr "Inga strängar kunde hittas från källfiler"
|
| 626 |
-
|
| 627 |
-
#. Description of the plugin
|
| 628 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 629 |
-
msgstr ""
|
| 630 |
-
|
| 631 |
-
#. URI of the plugin
|
| 632 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 633 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 634 |
-
|
| 635 |
-
#. Author of the plugin
|
| 636 |
-
msgid "Tim Whitlock"
|
| 637 |
-
msgstr "Tim Whitlock"
|
| 638 |
-
|
| 639 |
-
#. Author URI of the plugin
|
| 640 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 641 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-tr_TR.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-tr_TR.po
DELETED
|
@@ -1,661 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:43 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Turkish\n"
|
| 9 |
-
"Language: tr-TR\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=2; plural=n != 1\n"
|
| 14 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 15 |
-
"X-Poedit-Basepath: .\n"
|
| 16 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 17 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 18 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 19 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 20 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 21 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 22 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 23 |
-
"X-Loco-Target-Locale: tr_TR\n"
|
| 24 |
-
|
| 25 |
-
#. Translators: Bold text label in admin error messages
|
| 26 |
-
#: lib/loco-admin.php:31
|
| 27 |
-
#, fuzzy
|
| 28 |
-
msgctxt "Message label"
|
| 29 |
-
msgid "Error"
|
| 30 |
-
msgstr "Hata"
|
| 31 |
-
|
| 32 |
-
#: lib/loco-admin.php:41
|
| 33 |
-
msgctxt "Message label"
|
| 34 |
-
msgid "Warning"
|
| 35 |
-
msgstr "Uyarı"
|
| 36 |
-
|
| 37 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 38 |
-
msgctxt "Message label"
|
| 39 |
-
msgid "OK"
|
| 40 |
-
msgstr "Tamam"
|
| 41 |
-
|
| 42 |
-
#: lib/loco-admin.php:63
|
| 43 |
-
msgid "Permission denied"
|
| 44 |
-
msgstr "İzin reddedildi"
|
| 45 |
-
|
| 46 |
-
#: lib/loco-admin.php:86
|
| 47 |
-
msgid "Settings saved"
|
| 48 |
-
msgstr "Ayarlar kaydedildi"
|
| 49 |
-
|
| 50 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 51 |
-
msgid "%s is not an official WordPress language"
|
| 52 |
-
msgstr "%s resmi WordPress dillerinden biri değil"
|
| 53 |
-
|
| 54 |
-
#: lib/loco-admin.php:199
|
| 55 |
-
msgid "New PO file"
|
| 56 |
-
msgstr "Yeni PO Dosyası"
|
| 57 |
-
|
| 58 |
-
#: lib/loco-admin.php:214
|
| 59 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 60 |
-
msgstr ""
|
| 61 |
-
"PO dosyası şablon olarak kullanıldı. İlk kaydetmenizde %s olarak "
|
| 62 |
-
"isimlendirilecek."
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "Yeni PO dosyası için geçerli bir yerel değer belirtmek zorundasınız"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "Çevrilebilecek satır bulunamadı"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "Bir PO dosyası oluşturulamaz."
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "PO dosyası %s yerel değeri ile zaten var"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"Dosya otomatik olarak oluşturulamıyor. Dosya izinlerini düzenleyin ya da "
|
| 86 |
-
"İndirilenler dizinine kaydedin."
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr "%s dosyası boş"
|
| 91 |
-
|
| 92 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 93 |
-
msgid "Run Sync to update from source code"
|
| 94 |
-
msgstr "Kaynak kodundan güncelleştirmek için eşleştirme yapın"
|
| 95 |
-
|
| 96 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 97 |
-
msgid "No strings could be extracted from source code"
|
| 98 |
-
msgstr "Kaynak kodundan herhangi satır çıkarılamadı"
|
| 99 |
-
|
| 100 |
-
#: lib/loco-admin.php:417
|
| 101 |
-
msgid "Run Sync to update from %s"
|
| 102 |
-
msgstr "%s kaynağından güncelleştirme için eşleştirme yapın"
|
| 103 |
-
|
| 104 |
-
#: lib/loco-admin.php:436
|
| 105 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 106 |
-
msgstr "Kaynak dosyası değiştirilmiş, POT güncellemesi için eşleştirme yapın"
|
| 107 |
-
|
| 108 |
-
#: lib/loco-admin.php:440
|
| 109 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 110 |
-
msgstr ""
|
| 111 |
-
"PO dosyası en son kaydedildiğinden beri POT değişikliğe uğramış, güncelleme "
|
| 112 |
-
"için eşleştirme yapın"
|
| 113 |
-
|
| 114 |
-
#: lib/loco-admin.php:536
|
| 115 |
-
msgid "Bad file path"
|
| 116 |
-
msgstr "Kötü dosya yolu"
|
| 117 |
-
|
| 118 |
-
#: lib/loco-admin.php:783
|
| 119 |
-
msgid "Empty or invalid %s file"
|
| 120 |
-
msgstr "%s dosyası boş veya geçersiz"
|
| 121 |
-
|
| 122 |
-
#: lib/loco-admin.php:787
|
| 123 |
-
msgid "%s file has no header"
|
| 124 |
-
msgstr "%s dosyasının başlığı yok"
|
| 125 |
-
|
| 126 |
-
#: lib/loco-admin.php:934
|
| 127 |
-
msgctxt "Add button"
|
| 128 |
-
msgid "New template"
|
| 129 |
-
msgstr "Yeni Şablon"
|
| 130 |
-
|
| 131 |
-
#: lib/loco-admin.php:953
|
| 132 |
-
msgctxt "Add button"
|
| 133 |
-
msgid "New language"
|
| 134 |
-
msgstr "Yeni Dil"
|
| 135 |
-
|
| 136 |
-
#: lib/loco-admin.php:992
|
| 137 |
-
msgid "%s%% translated"
|
| 138 |
-
msgstr "%s%% çevrildi"
|
| 139 |
-
|
| 140 |
-
#: lib/loco-admin.php:992
|
| 141 |
-
msgid "1 string"
|
| 142 |
-
msgid_plural "%s strings"
|
| 143 |
-
msgstr[0] "1 satır"
|
| 144 |
-
msgstr[1] "%s cümle"
|
| 145 |
-
|
| 146 |
-
#: lib/loco-admin.php:995
|
| 147 |
-
msgid "%s fuzzy"
|
| 148 |
-
msgstr "%s belirsiz"
|
| 149 |
-
|
| 150 |
-
#: lib/loco-admin.php:998
|
| 151 |
-
msgid "%s untranslated"
|
| 152 |
-
msgstr "%s çevrilmemiş"
|
| 153 |
-
|
| 154 |
-
#: lib/loco-admin.php:1044
|
| 155 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 156 |
-
msgstr "Dahili derleyici ile MO dosyası derleme işlemi başarısız oldu"
|
| 157 |
-
|
| 158 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 159 |
-
msgid "Loco, Translation Management"
|
| 160 |
-
msgstr "Loco, Çeviri Yönetimi"
|
| 161 |
-
|
| 162 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 163 |
-
msgid "Manage translations"
|
| 164 |
-
msgstr "Çevirileri Yönet"
|
| 165 |
-
|
| 166 |
-
#: lib/loco-admin.php:1094
|
| 167 |
-
msgid "Translation options"
|
| 168 |
-
msgstr "Çeviri Seçenekleri"
|
| 169 |
-
|
| 170 |
-
#: lib/loco-admin.php:1101
|
| 171 |
-
msgid "Loco Translate"
|
| 172 |
-
msgstr "Loco Çeviri"
|
| 173 |
-
|
| 174 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 175 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 176 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 177 |
-
msgid "Settings"
|
| 178 |
-
msgstr "Ayarlar"
|
| 179 |
-
|
| 180 |
-
#: lib/loco-admin.php:1149
|
| 181 |
-
msgid "File download failed"
|
| 182 |
-
msgstr "Dosya indirme işlemi başarısız oldu"
|
| 183 |
-
|
| 184 |
-
#: lib/loco-admin.php:1159
|
| 185 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 186 |
-
msgstr ""
|
| 187 |
-
"WPLANG artık kullanılmıyor, bu nedenle wp-config.php dosyasından "
|
| 188 |
-
"kaldırılması gerekmektedir"
|
| 189 |
-
|
| 190 |
-
#: lib/loco-locales.php:77
|
| 191 |
-
msgid "Unknown language"
|
| 192 |
-
msgstr "Bilinmeyen dil"
|
| 193 |
-
|
| 194 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 195 |
-
msgid "Some files not writable"
|
| 196 |
-
msgstr "Bazı dosyalar yazılabilir değil"
|
| 197 |
-
|
| 198 |
-
#: lib/loco-packages.php:484
|
| 199 |
-
msgid "Some files missing"
|
| 200 |
-
msgstr "Bazı dosyalar yok"
|
| 201 |
-
|
| 202 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 203 |
-
msgid "\"%s\" folder not writable"
|
| 204 |
-
msgstr "\"%s\" dizini yazılabilir değil"
|
| 205 |
-
|
| 206 |
-
#: lib/loco-packages.php:515
|
| 207 |
-
msgid "POT file not writable"
|
| 208 |
-
msgstr "POT dosyası yazılabilir değil"
|
| 209 |
-
|
| 210 |
-
#: lib/loco-packages.php:520
|
| 211 |
-
msgid "PO file not writable"
|
| 212 |
-
msgstr "PO dosyası yazılabilir değil"
|
| 213 |
-
|
| 214 |
-
#: lib/loco-packages.php:522
|
| 215 |
-
msgid "MO file not writable"
|
| 216 |
-
msgstr "MO dosyası yazılabilir değil"
|
| 217 |
-
|
| 218 |
-
#: lib/loco-packages.php:522
|
| 219 |
-
msgid "MO file not found"
|
| 220 |
-
msgstr "MO dosyası bulunamadı"
|
| 221 |
-
|
| 222 |
-
#: lib/loco-packages.php:527
|
| 223 |
-
msgid "Folder not writable"
|
| 224 |
-
msgstr "Dizin yazılabilir değil"
|
| 225 |
-
|
| 226 |
-
#: lib/loco-packages.php:527
|
| 227 |
-
msgid "Folder not found"
|
| 228 |
-
msgstr "Dizin bulunmadı"
|
| 229 |
-
|
| 230 |
-
#: lib/loco-packages.php:546
|
| 231 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 232 |
-
msgstr "%s bir \"Metin Etki Alanı\" beyan etmiyor"
|
| 233 |
-
|
| 234 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 235 |
-
msgid "Loco has guessed \"%s\""
|
| 236 |
-
msgstr "Loco tahmini: \"%s\""
|
| 237 |
-
|
| 238 |
-
#: lib/loco-packages.php:551
|
| 239 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 240 |
-
msgstr "%s bir \"Etki Alanı Yolu\" beyan etmiyor"
|
| 241 |
-
|
| 242 |
-
#: lib/loco-packages.php:556
|
| 243 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 244 |
-
msgstr ""
|
| 245 |
-
"%s POT dosyası içermiyor. Eğer ihtiyacınız varsa \"%s/%s.pot\" yolunda bir "
|
| 246 |
-
"tane oluşturabilirsiniz."
|
| 247 |
-
|
| 248 |
-
#: lib/loco-packages.php:559
|
| 249 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 250 |
-
msgstr ""
|
| 251 |
-
"%s alışılmadık bir POT dosya adına (%s) sahip. Daha iyi bir isim önerisi: "
|
| 252 |
-
"\"%s.pot\""
|
| 253 |
-
|
| 254 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 255 |
-
msgid "User does not have permission to manage translations"
|
| 256 |
-
msgstr "Kullanıcı çevirileri yönetmek için gerekli izinlere sahip değil"
|
| 257 |
-
|
| 258 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 259 |
-
msgid "Invalid data posted to server"
|
| 260 |
-
msgstr "Sunucuya gönderilen veri geçersiz"
|
| 261 |
-
|
| 262 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 263 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 264 |
-
msgstr ""
|
| 265 |
-
"%s ile MO dosyası derleme işlemi başarısız oldu, ayarlarınızı tekrar kontrol "
|
| 266 |
-
"edin"
|
| 267 |
-
|
| 268 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 269 |
-
msgid "Package not found called %s"
|
| 270 |
-
msgstr "%s isimli paket bulunamadı"
|
| 271 |
-
|
| 272 |
-
#: php/loco-posave.php:58
|
| 273 |
-
msgid ""
|
| 274 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 275 |
-
"backups in settings"
|
| 276 |
-
msgstr ""
|
| 277 |
-
"Web Sunucusu \"%s\" içinde yedek oluşturamıyor. Dosya izinlerini düzeltin "
|
| 278 |
-
"veya ayarlarda bulunan yedekleme işlemini devre dışı bırakın."
|
| 279 |
-
|
| 280 |
-
#: php/loco-posave.php:66
|
| 281 |
-
msgid ""
|
| 282 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 283 |
-
"create it manually."
|
| 284 |
-
msgstr ""
|
| 285 |
-
"Web sunucusu \"%s\" dizinini \"%s\" içinde oluşturamıyor . Dosya izinlerini "
|
| 286 |
-
"düzeltin veya elle oluşturun."
|
| 287 |
-
|
| 288 |
-
#: php/loco-posave.php:69
|
| 289 |
-
msgid ""
|
| 290 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 291 |
-
"or use the download function."
|
| 292 |
-
msgstr ""
|
| 293 |
-
"Web sunucusu \"%s\" dizini içinde dosyaları oluşturamıyor. Dosya izinlerini "
|
| 294 |
-
"düzeltin veya indirme fonksiyonunu kullanın."
|
| 295 |
-
|
| 296 |
-
#: php/loco-posave.php:81
|
| 297 |
-
msgid ""
|
| 298 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 299 |
-
"and copy to \"%s/%s\"."
|
| 300 |
-
msgstr ""
|
| 301 |
-
"%s dosyası web sunucu tarafından yazılamaz durumda. Dosya izinlerini "
|
| 302 |
-
"düzeltin veya dosyayı indirip \"%s/%s\" yoluna kopyalayın."
|
| 303 |
-
|
| 304 |
-
#: php/loco-posave.php:102
|
| 305 |
-
msgid "Cannot create MO file"
|
| 306 |
-
msgstr "MO dosyası oluşturulamıyor"
|
| 307 |
-
|
| 308 |
-
#: php/loco-posave.php:105
|
| 309 |
-
msgid "Cannot overwrite MO file"
|
| 310 |
-
msgstr "MO dosyası üzerine yazılamıyor"
|
| 311 |
-
|
| 312 |
-
#: php/loco-posave.php:131
|
| 313 |
-
msgid "Failed to write MO file"
|
| 314 |
-
msgstr "MO dosyasına yazma işlemi başarısız oldu"
|
| 315 |
-
|
| 316 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 317 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 318 |
-
#: tpl/admin-root.tpl.php:6
|
| 319 |
-
msgid "Packages"
|
| 320 |
-
msgstr "Paketler"
|
| 321 |
-
|
| 322 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 323 |
-
msgid "File check"
|
| 324 |
-
msgstr "Dosya denetimi"
|
| 325 |
-
|
| 326 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 327 |
-
msgid "File system permissions for %s"
|
| 328 |
-
msgstr "%s için dosya sistemi izinleri"
|
| 329 |
-
|
| 330 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 331 |
-
msgid "Other potential issues with %s"
|
| 332 |
-
msgstr ""
|
| 333 |
-
"%s ile\n"
|
| 334 |
-
" \n"
|
| 335 |
-
"diğer\n"
|
| 336 |
-
" \n"
|
| 337 |
-
"potansiyel\n"
|
| 338 |
-
" \n"
|
| 339 |
-
"sorunlar"
|
| 340 |
-
|
| 341 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 342 |
-
msgid "Back"
|
| 343 |
-
msgstr "Geri"
|
| 344 |
-
|
| 345 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 346 |
-
msgid "Get help"
|
| 347 |
-
msgstr "Yardım"
|
| 348 |
-
|
| 349 |
-
#: tpl/admin-list.tpl.php:11
|
| 350 |
-
msgctxt "Table header"
|
| 351 |
-
msgid "Package details"
|
| 352 |
-
msgstr "Paket Detayları"
|
| 353 |
-
|
| 354 |
-
#: tpl/admin-list.tpl.php:14
|
| 355 |
-
msgctxt "Table header"
|
| 356 |
-
msgid "Translations (PO)"
|
| 357 |
-
msgstr "Çeviriler (PO)"
|
| 358 |
-
|
| 359 |
-
#: tpl/admin-list.tpl.php:17
|
| 360 |
-
msgctxt "Table header"
|
| 361 |
-
msgid "Template (POT)"
|
| 362 |
-
msgstr "Şablon (POT)"
|
| 363 |
-
|
| 364 |
-
#: tpl/admin-list.tpl.php:20
|
| 365 |
-
msgctxt "Table header"
|
| 366 |
-
msgid "File permissions"
|
| 367 |
-
msgstr "Dosya İzinleri"
|
| 368 |
-
|
| 369 |
-
#: tpl/admin-list.tpl.php:40
|
| 370 |
-
msgid "Extends: %s"
|
| 371 |
-
msgstr "Genişletmeler: %s"
|
| 372 |
-
|
| 373 |
-
#: tpl/admin-list.tpl.php:44
|
| 374 |
-
msgid "1 language"
|
| 375 |
-
msgid_plural "%u languages"
|
| 376 |
-
msgstr[0] "1 Dil"
|
| 377 |
-
msgstr[1] "%u Lisan"
|
| 378 |
-
|
| 379 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 380 |
-
msgctxt "Modified time"
|
| 381 |
-
msgid "Updated"
|
| 382 |
-
msgstr "Güncellendi"
|
| 383 |
-
|
| 384 |
-
#: tpl/admin-nav.tpl.php:26
|
| 385 |
-
msgid "Powered by"
|
| 386 |
-
msgstr "Hazırlayan:"
|
| 387 |
-
|
| 388 |
-
#: tpl/admin-nav.tpl.php:32
|
| 389 |
-
msgid "Loco may not work as expected"
|
| 390 |
-
msgstr "Loco beklendiği gibi çalışmayabilir"
|
| 391 |
-
|
| 392 |
-
#: tpl/admin-opts.tpl.php:18
|
| 393 |
-
msgid "Configure Loco Translate"
|
| 394 |
-
msgstr "Loco Çeviri Yapılandırma"
|
| 395 |
-
|
| 396 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 397 |
-
msgid "Compiling MO files"
|
| 398 |
-
msgstr "MO Dosyaları Derleme"
|
| 399 |
-
|
| 400 |
-
#: tpl/admin-opts.tpl.php:36
|
| 401 |
-
msgid "Use built-in MO compiler."
|
| 402 |
-
msgstr "Dahili MO derleyici kullan"
|
| 403 |
-
|
| 404 |
-
#: tpl/admin-opts.tpl.php:42
|
| 405 |
-
msgid "Use external command:"
|
| 406 |
-
msgstr "Harici komut kullan:"
|
| 407 |
-
|
| 408 |
-
#: tpl/admin-opts.tpl.php:47
|
| 409 |
-
msgid "Enter path to msgfmt on server"
|
| 410 |
-
msgstr "Sunucudaki msgfmt yolunu girin"
|
| 411 |
-
|
| 412 |
-
#: tpl/admin-opts.tpl.php:54
|
| 413 |
-
msgid "Generate hash tables"
|
| 414 |
-
msgstr "Komut tabloları oluştur"
|
| 415 |
-
|
| 416 |
-
#: tpl/admin-opts.tpl.php:60
|
| 417 |
-
msgid "Include Fuzzy strings"
|
| 418 |
-
msgstr "Belirsiz satırları dahil et"
|
| 419 |
-
|
| 420 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 421 |
-
msgid "Backing up PO files"
|
| 422 |
-
msgstr "PO Dosyaları Yedekleme"
|
| 423 |
-
|
| 424 |
-
#: tpl/admin-opts.tpl.php:75
|
| 425 |
-
msgid "Number of backups to keep of each file:"
|
| 426 |
-
msgstr "Her bir dosyanın saklanacak yedek sayısı:"
|
| 427 |
-
|
| 428 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 429 |
-
msgid "Experimental features"
|
| 430 |
-
msgstr "Deneysel Özellikler"
|
| 431 |
-
|
| 432 |
-
#: tpl/admin-opts.tpl.php:92
|
| 433 |
-
msgid "Enable WordPress core translations"
|
| 434 |
-
msgstr "WordPress çekirdek çevirilerini etkinleştir"
|
| 435 |
-
|
| 436 |
-
#: tpl/admin-opts.tpl.php:101
|
| 437 |
-
msgid "Save settings"
|
| 438 |
-
msgstr "Ayarları Kaydet"
|
| 439 |
-
|
| 440 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 441 |
-
msgid "Template file"
|
| 442 |
-
msgstr "Şablon dosyası"
|
| 443 |
-
|
| 444 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 445 |
-
msgctxt "Dropdown label"
|
| 446 |
-
msgid "Switch to..."
|
| 447 |
-
msgstr "Geçiş Yap:"
|
| 448 |
-
|
| 449 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 450 |
-
msgid "never"
|
| 451 |
-
msgstr "asla"
|
| 452 |
-
|
| 453 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 454 |
-
msgctxt "Editor button"
|
| 455 |
-
msgid "Save"
|
| 456 |
-
msgstr "Kaydet"
|
| 457 |
-
|
| 458 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 459 |
-
msgctxt "Editor button"
|
| 460 |
-
msgid "Download"
|
| 461 |
-
msgstr "İndir"
|
| 462 |
-
|
| 463 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 464 |
-
msgctxt "Editor button"
|
| 465 |
-
msgid "Sync"
|
| 466 |
-
msgstr "Eşleştir"
|
| 467 |
-
|
| 468 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 469 |
-
msgctxt "Editor button"
|
| 470 |
-
msgid "Revert"
|
| 471 |
-
msgstr "Geri Al"
|
| 472 |
-
|
| 473 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 474 |
-
msgctxt "Editor button"
|
| 475 |
-
msgid "Add"
|
| 476 |
-
msgstr "Ekle"
|
| 477 |
-
|
| 478 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 479 |
-
msgctxt "Editor button"
|
| 480 |
-
msgid "Del"
|
| 481 |
-
msgstr "Sil"
|
| 482 |
-
|
| 483 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 484 |
-
msgctxt "Editor button"
|
| 485 |
-
msgid "Fuzzy"
|
| 486 |
-
msgstr "Belirsiz"
|
| 487 |
-
|
| 488 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 489 |
-
msgid "Filter translations"
|
| 490 |
-
msgstr "Çevirileri filtrele"
|
| 491 |
-
|
| 492 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 493 |
-
msgctxt "Editor button"
|
| 494 |
-
msgid "Help"
|
| 495 |
-
msgstr "Yardım"
|
| 496 |
-
|
| 497 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 498 |
-
msgid "Initialize new translations in %s"
|
| 499 |
-
msgstr "%s için yeni çeviri başlat"
|
| 500 |
-
|
| 501 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 502 |
-
msgid "Select from common languages"
|
| 503 |
-
msgstr "Yaygın diller arasından seçin"
|
| 504 |
-
|
| 505 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 506 |
-
msgctxt "Form label"
|
| 507 |
-
msgid "or enter any language code"
|
| 508 |
-
msgstr "veya herhangi bir dil kodu girin"
|
| 509 |
-
|
| 510 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 511 |
-
msgctxt "Form label"
|
| 512 |
-
msgid "create in <code>%s</code>"
|
| 513 |
-
msgstr "<code>%s</code> adresinde oluştur"
|
| 514 |
-
|
| 515 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 516 |
-
msgctxt "Form label"
|
| 517 |
-
msgid "create in global languages directory"
|
| 518 |
-
msgstr "Genel \"Language\" dizininde oluştur"
|
| 519 |
-
|
| 520 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 521 |
-
msgctxt "Submit button"
|
| 522 |
-
msgid "Start translating"
|
| 523 |
-
msgstr "Çeviriye Başla"
|
| 524 |
-
|
| 525 |
-
#: tpl/admin-root.tpl.php:18
|
| 526 |
-
msgid "New version available"
|
| 527 |
-
msgstr "Yeni sürüm mevcut"
|
| 528 |
-
|
| 529 |
-
#: tpl/admin-root.tpl.php:21
|
| 530 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 531 |
-
msgstr "Loco Çeviri eklentisini %s sürümüne yükselt"
|
| 532 |
-
|
| 533 |
-
#: tpl/admin-root.tpl.php:31
|
| 534 |
-
msgid "Select a plugin or theme to translate"
|
| 535 |
-
msgstr "Çevirmek için bir eklenti veya tema seçin"
|
| 536 |
-
|
| 537 |
-
#: tpl/admin-root.tpl.php:40
|
| 538 |
-
msgctxt "Package list header"
|
| 539 |
-
msgid "Themes"
|
| 540 |
-
msgstr "Temalar"
|
| 541 |
-
|
| 542 |
-
#: tpl/admin-root.tpl.php:53
|
| 543 |
-
msgctxt "Package list header"
|
| 544 |
-
msgid "Plugins"
|
| 545 |
-
msgstr "Eklentiler"
|
| 546 |
-
|
| 547 |
-
#: tpl/admin-root.tpl.php:66
|
| 548 |
-
msgctxt "Package list header"
|
| 549 |
-
msgid "Core"
|
| 550 |
-
msgstr "Çekirdek"
|
| 551 |
-
|
| 552 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 553 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 554 |
-
msgid ""
|
| 555 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 556 |
-
"install it"
|
| 557 |
-
msgstr ""
|
| 558 |
-
"\"%s\" PHP eklentisi yüklü değil. \n"
|
| 559 |
-
"Eğer\n"
|
| 560 |
-
" \n"
|
| 561 |
-
"sorun yaşarsanız\n"
|
| 562 |
-
" \n"
|
| 563 |
-
"bu eklentiyi\n"
|
| 564 |
-
" \n"
|
| 565 |
-
"yüklemeniz gerekir."
|
| 566 |
-
|
| 567 |
-
#: pub/js/lang/dummy.php:8
|
| 568 |
-
msgid "Unknown error"
|
| 569 |
-
msgstr "Bilinmeyen hata"
|
| 570 |
-
|
| 571 |
-
#: pub/js/lang/dummy.php:10
|
| 572 |
-
msgid "PO file saved"
|
| 573 |
-
msgstr "PO dosyası kaydedildi"
|
| 574 |
-
|
| 575 |
-
#: pub/js/lang/dummy.php:12
|
| 576 |
-
msgid "and MO file compiled"
|
| 577 |
-
msgstr "ve MO dosyası derlendi"
|
| 578 |
-
|
| 579 |
-
#: pub/js/lang/dummy.php:15
|
| 580 |
-
msgid "Merged from %s"
|
| 581 |
-
msgstr "%s üzerinden birleştirildi"
|
| 582 |
-
|
| 583 |
-
#: pub/js/lang/dummy.php:17
|
| 584 |
-
msgid "Merged from source code"
|
| 585 |
-
msgstr "Kaynak koddan birleştirildi"
|
| 586 |
-
|
| 587 |
-
#: pub/js/lang/dummy.php:19
|
| 588 |
-
msgid "Already up to date with %s"
|
| 589 |
-
msgstr "%s zaten güncel"
|
| 590 |
-
|
| 591 |
-
#: pub/js/lang/dummy.php:21
|
| 592 |
-
msgid "Already up to date with source code"
|
| 593 |
-
msgstr "Kaynak kod ile zaten güncel"
|
| 594 |
-
|
| 595 |
-
#: pub/js/lang/dummy.php:23
|
| 596 |
-
msgid "1 new string added"
|
| 597 |
-
msgid_plural "%s new strings added"
|
| 598 |
-
msgstr[0] "1 yeni satır eklendi"
|
| 599 |
-
msgstr[1] "%s yeni cümle eklendi"
|
| 600 |
-
|
| 601 |
-
#: pub/js/lang/dummy.php:25
|
| 602 |
-
msgid "1 obsolete string removed"
|
| 603 |
-
msgid_plural "%s obsolete strings removed"
|
| 604 |
-
msgstr[0] "1 adet kullanılmayan satır kaldırıldı"
|
| 605 |
-
msgstr[1] "%s kullanımdışı cümle kaldırıldı"
|
| 606 |
-
|
| 607 |
-
#: pub/js/lang/dummy.php:27
|
| 608 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 609 |
-
msgstr "Kaydetmeden devam ederseniz değişiklikleriniz kaybolacak"
|
| 610 |
-
|
| 611 |
-
#. label for the window pane holding native translation
|
| 612 |
-
#: pub/js/lang/dummy.php:35
|
| 613 |
-
msgctxt "Editor pane"
|
| 614 |
-
msgid "Source text"
|
| 615 |
-
msgstr "Kaynak Metin"
|
| 616 |
-
|
| 617 |
-
#. where %s is the language, e.g French translation
|
| 618 |
-
#: pub/js/lang/dummy.php:38
|
| 619 |
-
msgctxt "Editor pane"
|
| 620 |
-
msgid "%s translation"
|
| 621 |
-
msgstr "%s Çevirisi"
|
| 622 |
-
|
| 623 |
-
#. label for the window pane holding translator comments
|
| 624 |
-
#: pub/js/lang/dummy.php:41
|
| 625 |
-
msgctxt "Editor pane"
|
| 626 |
-
msgid "Comments"
|
| 627 |
-
msgstr "Yorumlar"
|
| 628 |
-
|
| 629 |
-
#. label for the window pane holding message context
|
| 630 |
-
#: pub/js/lang/dummy.php:44
|
| 631 |
-
msgctxt "Editor pane"
|
| 632 |
-
msgid "Context"
|
| 633 |
-
msgstr "Metin"
|
| 634 |
-
|
| 635 |
-
#: pub/js/lang/dummy.php:52
|
| 636 |
-
msgid "Translation"
|
| 637 |
-
msgstr "Çeviri"
|
| 638 |
-
|
| 639 |
-
#: pub/js/lang/dummy.php:54
|
| 640 |
-
msgid "No source files in this package, nothing to sync"
|
| 641 |
-
msgstr "Bu pakette eşleştirilecek kaynak dosyalar bulunmuyor"
|
| 642 |
-
|
| 643 |
-
#: pub/js/lang/dummy.php:56
|
| 644 |
-
msgid "No strings could be extracted from source files"
|
| 645 |
-
msgstr "Kaynak dosyalardan herhangi satır çıkartılamadı"
|
| 646 |
-
|
| 647 |
-
#. Description of the plugin
|
| 648 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 649 |
-
msgstr ""
|
| 650 |
-
|
| 651 |
-
#. URI of the plugin
|
| 652 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 653 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 654 |
-
|
| 655 |
-
#. Author of the plugin
|
| 656 |
-
msgid "Tim Whitlock"
|
| 657 |
-
msgstr "Tim Whitlock"
|
| 658 |
-
|
| 659 |
-
#. Author URI of the plugin
|
| 660 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 661 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy-uk.mo
DELETED
|
Binary file
|
old/languages/loco-legacy-uk.po
DELETED
|
@@ -1,646 +0,0 @@
|
|
| 1 |
-
msgid ""
|
| 2 |
-
msgstr ""
|
| 3 |
-
"Project-Id-Version: Loco Translate\n"
|
| 4 |
-
"Report-Msgid-Bugs-To: \n"
|
| 5 |
-
"POT-Creation-Date: Thu Jan 02 2014 17:30:57 GMT+0000 (GMT)\n"
|
| 6 |
-
"PO-Revision-Date: Wed Jul 06 2016 12:20:54 GMT+0100 (BST)\n"
|
| 7 |
-
"Last-Translator: admin <support@localise.biz>\n"
|
| 8 |
-
"Language-Team: Ukrainian\n"
|
| 9 |
-
"Language: uk\n"
|
| 10 |
-
"MIME-Version: 1.0\n"
|
| 11 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 12 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 13 |
-
"Plural-Forms: nplurals=3; plural=(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n"
|
| 14 |
-
"%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)\n"
|
| 15 |
-
"X-Poedit-SourceCharset: UTF-8\n"
|
| 16 |
-
"X-Poedit-Basepath: .\n"
|
| 17 |
-
"X-Poedit-SearchPath-0: ..\n"
|
| 18 |
-
"X-Poedit-KeywordsList: _:1;gettext:1;dgettext:2;ngettext:1,2;dngettext:2,3;"
|
| 19 |
-
"__:1;_e:1;_c:1;_n:1,2;_n_noop:1,2;_nc:1,2;__ngettext:1,2;__ngettext_noop:1,2;"
|
| 20 |
-
"_x:1,2c;_ex:1,2c;_nx:1,2,4c;_nx_noop:1,2,3c;_n_js:1,2;_nx_js:1,2,3c;"
|
| 21 |
-
"esc_attr__:1;esc_html__:1;esc_attr_e:1;esc_html_e:1;esc_attr_x:1,2c;"
|
| 22 |
-
"esc_html_x:1,2c;comments_number_link:2,3;t:1;st:1;trans:1;transChoice:1,2\n"
|
| 23 |
-
"X-Generator: Loco - https://localise.biz/\n"
|
| 24 |
-
"X-Loco-Target-Locale: uk_UA\n"
|
| 25 |
-
|
| 26 |
-
#. Translators: Bold text label in admin error messages
|
| 27 |
-
#: lib/loco-admin.php:31
|
| 28 |
-
msgctxt "Message label"
|
| 29 |
-
msgid "Error"
|
| 30 |
-
msgstr "Помилка"
|
| 31 |
-
|
| 32 |
-
#: lib/loco-admin.php:41
|
| 33 |
-
msgctxt "Message label"
|
| 34 |
-
msgid "Warning"
|
| 35 |
-
msgstr "Попередження"
|
| 36 |
-
|
| 37 |
-
#: lib/loco-admin.php:54 tpl/admin-list.tpl.php:98
|
| 38 |
-
msgctxt "Message label"
|
| 39 |
-
msgid "OK"
|
| 40 |
-
msgstr "ОК"
|
| 41 |
-
|
| 42 |
-
#: lib/loco-admin.php:63
|
| 43 |
-
msgid "Permission denied"
|
| 44 |
-
msgstr "Доступ заборонено"
|
| 45 |
-
|
| 46 |
-
#: lib/loco-admin.php:86
|
| 47 |
-
msgid "Settings saved"
|
| 48 |
-
msgstr "Налаштування збережено"
|
| 49 |
-
|
| 50 |
-
#: lib/loco-admin.php:126 lib/loco-packages.php:568
|
| 51 |
-
msgid "%s is not an official WordPress language"
|
| 52 |
-
msgstr "%s не є офіційною мовою WordPress"
|
| 53 |
-
|
| 54 |
-
#: lib/loco-admin.php:199
|
| 55 |
-
msgid "New PO file"
|
| 56 |
-
msgstr "Новий РО-файл"
|
| 57 |
-
|
| 58 |
-
#: lib/loco-admin.php:214
|
| 59 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 60 |
-
msgstr ""
|
| 61 |
-
"РО-файл використовується як шаблон. Його буде перейменовано до %s при "
|
| 62 |
-
"першому збереженні"
|
| 63 |
-
|
| 64 |
-
#: lib/loco-admin.php:312
|
| 65 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 66 |
-
msgstr "Ви маєте визначити правильну локаль для нового РО-файла"
|
| 67 |
-
|
| 68 |
-
#: lib/loco-admin.php:337 lib/loco-admin.php:426
|
| 69 |
-
msgid "No translatable strings found"
|
| 70 |
-
msgstr "Не знайдено строк, які можна було б перекласти"
|
| 71 |
-
|
| 72 |
-
#: lib/loco-admin.php:337
|
| 73 |
-
msgid "Cannot create a PO file."
|
| 74 |
-
msgstr "Не можу створити РО файл."
|
| 75 |
-
|
| 76 |
-
#: lib/loco-admin.php:344
|
| 77 |
-
msgid "PO file already exists with locale %s"
|
| 78 |
-
msgstr "РО-файл вже існує для локалі %s"
|
| 79 |
-
|
| 80 |
-
#: lib/loco-admin.php:396
|
| 81 |
-
msgid ""
|
| 82 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 83 |
-
"Download instead of Save"
|
| 84 |
-
msgstr ""
|
| 85 |
-
"Файл не може бути створений автоматично. Виправте права доступу або "
|
| 86 |
-
"використайте «Завантажити» замість «Зберегти»"
|
| 87 |
-
|
| 88 |
-
#: lib/loco-admin.php:405 lib/loco-admin.php:414
|
| 89 |
-
msgid "%s file is empty"
|
| 90 |
-
msgstr "%s файл пустий"
|
| 91 |
-
|
| 92 |
-
#: lib/loco-admin.php:406 lib/loco-admin.php:421
|
| 93 |
-
msgid "Run Sync to update from source code"
|
| 94 |
-
msgstr "Запустіть «Синхронізувати», щоб оновити з ісходного коду"
|
| 95 |
-
|
| 96 |
-
#: lib/loco-admin.php:410 php/loco-posync.php:52
|
| 97 |
-
msgid "No strings could be extracted from source code"
|
| 98 |
-
msgstr "Немає строк, які можуть бути витягнуті із ісходного коду"
|
| 99 |
-
|
| 100 |
-
#: lib/loco-admin.php:417
|
| 101 |
-
msgid "Run Sync to update from %s"
|
| 102 |
-
msgstr "Запустіть «Синхронізувати», щоб оновити з %s"
|
| 103 |
-
|
| 104 |
-
#: lib/loco-admin.php:436
|
| 105 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 106 |
-
msgstr ""
|
| 107 |
-
"Ісходний код було модифіковано, запустіть «Синхронізувати», щоб оновити РОТ"
|
| 108 |
-
|
| 109 |
-
#: lib/loco-admin.php:440
|
| 110 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 111 |
-
msgstr ""
|
| 112 |
-
"РОТ було модифіковано з моменту останнього збереження РО-файлу, запустіть "
|
| 113 |
-
"«Синхронізувати» для оновлення"
|
| 114 |
-
|
| 115 |
-
#: lib/loco-admin.php:536
|
| 116 |
-
msgid "Bad file path"
|
| 117 |
-
msgstr "Невірний шлях до файлу"
|
| 118 |
-
|
| 119 |
-
#: lib/loco-admin.php:783
|
| 120 |
-
msgid "Empty or invalid %s file"
|
| 121 |
-
msgstr "Пустий або ушкоджений %s файл "
|
| 122 |
-
|
| 123 |
-
#: lib/loco-admin.php:787
|
| 124 |
-
msgid "%s file has no header"
|
| 125 |
-
msgstr "%s файл не має заголовку"
|
| 126 |
-
|
| 127 |
-
#: lib/loco-admin.php:934
|
| 128 |
-
msgctxt "Add button"
|
| 129 |
-
msgid "New template"
|
| 130 |
-
msgstr "Новий шаблон"
|
| 131 |
-
|
| 132 |
-
#: lib/loco-admin.php:953
|
| 133 |
-
msgctxt "Add button"
|
| 134 |
-
msgid "New language"
|
| 135 |
-
msgstr "Нова мова"
|
| 136 |
-
|
| 137 |
-
#: lib/loco-admin.php:992
|
| 138 |
-
msgid "%s%% translated"
|
| 139 |
-
msgstr "%s%% перекладено"
|
| 140 |
-
|
| 141 |
-
#: lib/loco-admin.php:992
|
| 142 |
-
msgid "1 string"
|
| 143 |
-
msgid_plural "%s strings"
|
| 144 |
-
msgstr[0] "1 строка"
|
| 145 |
-
msgstr[1] "%s строк"
|
| 146 |
-
|
| 147 |
-
#: lib/loco-admin.php:995
|
| 148 |
-
msgid "%s fuzzy"
|
| 149 |
-
msgstr "%s неясний"
|
| 150 |
-
|
| 151 |
-
#: lib/loco-admin.php:998
|
| 152 |
-
msgid "%s untranslated"
|
| 153 |
-
msgstr "%s неперекладено"
|
| 154 |
-
|
| 155 |
-
#: lib/loco-admin.php:1044
|
| 156 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 157 |
-
msgstr "Не вдалося скомпілювати МО-файл за допомогою вбудованного компілятора"
|
| 158 |
-
|
| 159 |
-
#: lib/loco-admin.php:1092 tpl/admin-nav.tpl.php:27
|
| 160 |
-
msgid "Loco, Translation Management"
|
| 161 |
-
msgstr "Керування перекладами Loco"
|
| 162 |
-
|
| 163 |
-
#: lib/loco-admin.php:1093 lib/loco-admin.php:1124
|
| 164 |
-
msgid "Manage translations"
|
| 165 |
-
msgstr "Керувати перекладами"
|
| 166 |
-
|
| 167 |
-
#: lib/loco-admin.php:1094
|
| 168 |
-
msgid "Translation options"
|
| 169 |
-
msgstr "Налаштування перекладів"
|
| 170 |
-
|
| 171 |
-
#: lib/loco-admin.php:1101
|
| 172 |
-
msgid "Loco Translate"
|
| 173 |
-
msgstr "Перекладач Loco"
|
| 174 |
-
|
| 175 |
-
#: lib/loco-admin.php:1125 tpl/admin-fscheck.tpl.php:8
|
| 176 |
-
#: tpl/admin-opts.tpl.php:7 tpl/admin-poedit.tpl.php:7
|
| 177 |
-
#: tpl/admin-poinit.tpl.php:7 tpl/admin-root.tpl.php:7
|
| 178 |
-
msgid "Settings"
|
| 179 |
-
msgstr "Налаштування"
|
| 180 |
-
|
| 181 |
-
#: lib/loco-admin.php:1149
|
| 182 |
-
msgid "File download failed"
|
| 183 |
-
msgstr "Скачування файлу не вдалося"
|
| 184 |
-
|
| 185 |
-
#: lib/loco-admin.php:1159
|
| 186 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 187 |
-
msgstr "WPLANG застарів і його буде видалено з wp-config.php"
|
| 188 |
-
|
| 189 |
-
#: lib/loco-locales.php:77
|
| 190 |
-
msgid "Unknown language"
|
| 191 |
-
msgstr "Невідома мова"
|
| 192 |
-
|
| 193 |
-
#: lib/loco-packages.php:474 lib/loco-packages.php:481
|
| 194 |
-
msgid "Some files not writable"
|
| 195 |
-
msgstr "Деякі файли неможливо записувати"
|
| 196 |
-
|
| 197 |
-
#: lib/loco-packages.php:484
|
| 198 |
-
msgid "Some files missing"
|
| 199 |
-
msgstr "Деякі файли відсутні"
|
| 200 |
-
|
| 201 |
-
#: lib/loco-packages.php:490 lib/loco-packages.php:494
|
| 202 |
-
msgid "\"%s\" folder not writable"
|
| 203 |
-
msgstr "Папка \"%s\" не дозволяє записувати"
|
| 204 |
-
|
| 205 |
-
#: lib/loco-packages.php:515
|
| 206 |
-
msgid "POT file not writable"
|
| 207 |
-
msgstr "РОТ-файл не дозволяє записувати"
|
| 208 |
-
|
| 209 |
-
#: lib/loco-packages.php:520
|
| 210 |
-
msgid "PO file not writable"
|
| 211 |
-
msgstr "РО-файл не дозволяє записувати"
|
| 212 |
-
|
| 213 |
-
#: lib/loco-packages.php:522
|
| 214 |
-
msgid "MO file not writable"
|
| 215 |
-
msgstr "МО-файл не дозволяє записувати"
|
| 216 |
-
|
| 217 |
-
#: lib/loco-packages.php:522
|
| 218 |
-
msgid "MO file not found"
|
| 219 |
-
msgstr "МО-файл не знайдено"
|
| 220 |
-
|
| 221 |
-
#: lib/loco-packages.php:527
|
| 222 |
-
msgid "Folder not writable"
|
| 223 |
-
msgstr "Папка не дозволяє записувати"
|
| 224 |
-
|
| 225 |
-
#: lib/loco-packages.php:527
|
| 226 |
-
msgid "Folder not found"
|
| 227 |
-
msgstr "Папку не знайдено"
|
| 228 |
-
|
| 229 |
-
#: lib/loco-packages.php:546
|
| 230 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 231 |
-
msgstr "%s не декларує \"Text Domain\""
|
| 232 |
-
|
| 233 |
-
#: lib/loco-packages.php:546 lib/loco-packages.php:551
|
| 234 |
-
msgid "Loco has guessed \"%s\""
|
| 235 |
-
msgstr "Loco припускає \"%s\""
|
| 236 |
-
|
| 237 |
-
#: lib/loco-packages.php:551
|
| 238 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 239 |
-
msgstr "%s не декларує \"Domain Path\""
|
| 240 |
-
|
| 241 |
-
#: lib/loco-packages.php:556
|
| 242 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 243 |
-
msgstr ""
|
| 244 |
-
"%s не має РОТ-файлу. Створіть його як \"%s/%s.pot\", якщо ви потребуєте."
|
| 245 |
-
|
| 246 |
-
#: lib/loco-packages.php:559
|
| 247 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 248 |
-
msgstr "%s має дивну назву РОТ-файлу (%s). Кращою назвою була б \"%s.pot\""
|
| 249 |
-
|
| 250 |
-
#: php/loco-ajax.php:17 php/loco-download.php:21
|
| 251 |
-
msgid "User does not have permission to manage translations"
|
| 252 |
-
msgstr "Користувач немає доступу до керування перекладами"
|
| 253 |
-
|
| 254 |
-
#: php/loco-data.php:21 php/loco-posave.php:10 php/loco-posync.php:9
|
| 255 |
-
msgid "Invalid data posted to server"
|
| 256 |
-
msgstr "Невірна дата встановлена на сервері"
|
| 257 |
-
|
| 258 |
-
#: php/loco-download.php:75 php/loco-posave.php:121
|
| 259 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 260 |
-
msgstr ""
|
| 261 |
-
"Невдалося скомпілювати МО-файл за допомогою %s, перевірте ваші налаштування"
|
| 262 |
-
|
| 263 |
-
#: php/loco-posave.php:23 php/loco-posync.php:22
|
| 264 |
-
msgid "Package not found called %s"
|
| 265 |
-
msgstr "Пакунок %s не знайдено"
|
| 266 |
-
|
| 267 |
-
#: php/loco-posave.php:58
|
| 268 |
-
msgid ""
|
| 269 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 270 |
-
"backups in settings"
|
| 271 |
-
msgstr ""
|
| 272 |
-
"Сервер не може створити бекап у \"%s\". Виправте права доступу до файлів, "
|
| 273 |
-
"або вимкніть створення бекапів у налаштуваннях."
|
| 274 |
-
|
| 275 |
-
#: php/loco-posave.php:66
|
| 276 |
-
msgid ""
|
| 277 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 278 |
-
"create it manually."
|
| 279 |
-
msgstr ""
|
| 280 |
-
"Сервер не може створити папку \"%s\" у \"%s\". Виправте права доступу до "
|
| 281 |
-
"папки або створіть її вручну."
|
| 282 |
-
|
| 283 |
-
#: php/loco-posave.php:69
|
| 284 |
-
msgid ""
|
| 285 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 286 |
-
"or use the download function."
|
| 287 |
-
msgstr ""
|
| 288 |
-
"Сервер не може створити файл у папці \"%s\". Виправте права доступу або "
|
| 289 |
-
"використовуйте функції «Скачати РО» та «Скачати МО»."
|
| 290 |
-
|
| 291 |
-
#: php/loco-posave.php:81
|
| 292 |
-
msgid ""
|
| 293 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 294 |
-
"and copy to \"%s/%s\"."
|
| 295 |
-
msgstr ""
|
| 296 |
-
"Сервер не дозволяє записувати у файл %s. Виправте права доступу або скачайте "
|
| 297 |
-
"файл та скопіюйте його вручну до \"%s/%s\"."
|
| 298 |
-
|
| 299 |
-
#: php/loco-posave.php:102
|
| 300 |
-
msgid "Cannot create MO file"
|
| 301 |
-
msgstr "Не можу створити МО-файл"
|
| 302 |
-
|
| 303 |
-
#: php/loco-posave.php:105
|
| 304 |
-
msgid "Cannot overwrite MO file"
|
| 305 |
-
msgstr "Не можу переписати МО-файл"
|
| 306 |
-
|
| 307 |
-
#: php/loco-posave.php:131
|
| 308 |
-
msgid "Failed to write MO file"
|
| 309 |
-
msgstr "Не вдалося записати МО-файл"
|
| 310 |
-
|
| 311 |
-
#: tpl/admin-fscheck.tpl.php:7 tpl/admin-opts.tpl.php:6
|
| 312 |
-
#: tpl/admin-poedit.tpl.php:6 tpl/admin-poinit.tpl.php:6
|
| 313 |
-
#: tpl/admin-root.tpl.php:6
|
| 314 |
-
msgid "Packages"
|
| 315 |
-
msgstr "Пакунки"
|
| 316 |
-
|
| 317 |
-
#: tpl/admin-fscheck.tpl.php:10
|
| 318 |
-
msgid "File check"
|
| 319 |
-
msgstr "Перевірка файлу"
|
| 320 |
-
|
| 321 |
-
#: tpl/admin-fscheck.tpl.php:19
|
| 322 |
-
msgid "File system permissions for %s"
|
| 323 |
-
msgstr "Налаштування файлової системи для %s"
|
| 324 |
-
|
| 325 |
-
#: tpl/admin-fscheck.tpl.php:43
|
| 326 |
-
msgid "Other potential issues with %s"
|
| 327 |
-
msgstr "Інші потенційні проблеми з %s"
|
| 328 |
-
|
| 329 |
-
#: tpl/admin-fscheck.tpl.php:57
|
| 330 |
-
msgid "Back"
|
| 331 |
-
msgstr "Повернутись назад"
|
| 332 |
-
|
| 333 |
-
#: tpl/admin-fscheck.tpl.php:58 tpl/admin-opts.tpl.php:102
|
| 334 |
-
msgid "Get help"
|
| 335 |
-
msgstr "Отримати допомогу"
|
| 336 |
-
|
| 337 |
-
#: tpl/admin-list.tpl.php:11
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Package details"
|
| 340 |
-
msgstr "Деталі пакунку"
|
| 341 |
-
|
| 342 |
-
#: tpl/admin-list.tpl.php:14
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Translations (PO)"
|
| 345 |
-
msgstr "Переклади (РО)"
|
| 346 |
-
|
| 347 |
-
#: tpl/admin-list.tpl.php:17
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Template (POT)"
|
| 350 |
-
msgstr "Шаблони (РОТ)"
|
| 351 |
-
|
| 352 |
-
#: tpl/admin-list.tpl.php:20
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "File permissions"
|
| 355 |
-
msgstr "Доступ до файлів"
|
| 356 |
-
|
| 357 |
-
#: tpl/admin-list.tpl.php:40
|
| 358 |
-
msgid "Extends: %s"
|
| 359 |
-
msgstr "Розширення: %s"
|
| 360 |
-
|
| 361 |
-
#: tpl/admin-list.tpl.php:44
|
| 362 |
-
msgid "1 language"
|
| 363 |
-
msgid_plural "%u languages"
|
| 364 |
-
msgstr[0] "1 мова"
|
| 365 |
-
msgstr[1] "%u мов"
|
| 366 |
-
msgstr[2] "%u мов"
|
| 367 |
-
|
| 368 |
-
#: tpl/admin-list.tpl.php:49 tpl/admin-poedit.tpl.php:57
|
| 369 |
-
msgctxt "Modified time"
|
| 370 |
-
msgid "Updated"
|
| 371 |
-
msgstr "Оновлено"
|
| 372 |
-
|
| 373 |
-
#: tpl/admin-nav.tpl.php:26
|
| 374 |
-
msgid "Powered by"
|
| 375 |
-
msgstr "Запроваджено"
|
| 376 |
-
|
| 377 |
-
#: tpl/admin-nav.tpl.php:32
|
| 378 |
-
msgid "Loco may not work as expected"
|
| 379 |
-
msgstr "Можливо, Loco працює не так, як планувалося"
|
| 380 |
-
|
| 381 |
-
#: tpl/admin-opts.tpl.php:18
|
| 382 |
-
msgid "Configure Loco Translate"
|
| 383 |
-
msgstr "Налаштувати Перекладач Loco"
|
| 384 |
-
|
| 385 |
-
#: tpl/admin-opts.tpl.php:27 tpl/admin-opts.tpl.php:31
|
| 386 |
-
msgid "Compiling MO files"
|
| 387 |
-
msgstr "Компіляція МО-файлів"
|
| 388 |
-
|
| 389 |
-
#: tpl/admin-opts.tpl.php:36
|
| 390 |
-
msgid "Use built-in MO compiler."
|
| 391 |
-
msgstr "Використовувати вбудований МО-компілятор."
|
| 392 |
-
|
| 393 |
-
#: tpl/admin-opts.tpl.php:42
|
| 394 |
-
msgid "Use external command:"
|
| 395 |
-
msgstr "Використовувати зовнішні команди:"
|
| 396 |
-
|
| 397 |
-
#: tpl/admin-opts.tpl.php:47
|
| 398 |
-
msgid "Enter path to msgfmt on server"
|
| 399 |
-
msgstr "Введіть шлях до msgfmt на сервері"
|
| 400 |
-
|
| 401 |
-
#: tpl/admin-opts.tpl.php:54
|
| 402 |
-
msgid "Generate hash tables"
|
| 403 |
-
msgstr "Генерувати таблицю хешів"
|
| 404 |
-
|
| 405 |
-
#: tpl/admin-opts.tpl.php:60
|
| 406 |
-
msgid "Include Fuzzy strings"
|
| 407 |
-
msgstr "Включити нечітки строки"
|
| 408 |
-
|
| 409 |
-
#: tpl/admin-opts.tpl.php:67 tpl/admin-opts.tpl.php:71
|
| 410 |
-
msgid "Backing up PO files"
|
| 411 |
-
msgstr "Збереження(бекап) РО-файлів"
|
| 412 |
-
|
| 413 |
-
#: tpl/admin-opts.tpl.php:75
|
| 414 |
-
msgid "Number of backups to keep of each file:"
|
| 415 |
-
msgstr "Скільки бекапів зберегати для кожного файлу:"
|
| 416 |
-
|
| 417 |
-
#: tpl/admin-opts.tpl.php:83 tpl/admin-opts.tpl.php:87
|
| 418 |
-
msgid "Experimental features"
|
| 419 |
-
msgstr "Експериментальні можливості"
|
| 420 |
-
|
| 421 |
-
#: tpl/admin-opts.tpl.php:92
|
| 422 |
-
msgid "Enable WordPress core translations"
|
| 423 |
-
msgstr "Включити переклад ядра WordPress"
|
| 424 |
-
|
| 425 |
-
#: tpl/admin-opts.tpl.php:101
|
| 426 |
-
msgid "Save settings"
|
| 427 |
-
msgstr "Зберегти налаштування"
|
| 428 |
-
|
| 429 |
-
#: tpl/admin-poedit.tpl.php:32
|
| 430 |
-
msgid "Template file"
|
| 431 |
-
msgstr "Файл шаблону"
|
| 432 |
-
|
| 433 |
-
#: tpl/admin-poedit.tpl.php:40
|
| 434 |
-
msgctxt "Dropdown label"
|
| 435 |
-
msgid "Switch to..."
|
| 436 |
-
msgstr "Переключитись до..."
|
| 437 |
-
|
| 438 |
-
#: tpl/admin-poedit.tpl.php:62
|
| 439 |
-
msgid "never"
|
| 440 |
-
msgstr "ніколи"
|
| 441 |
-
|
| 442 |
-
#: tpl/admin-poedit.tpl.php:87
|
| 443 |
-
msgctxt "Editor button"
|
| 444 |
-
msgid "Save"
|
| 445 |
-
msgstr "Зберегти"
|
| 446 |
-
|
| 447 |
-
#: tpl/admin-poedit.tpl.php:94 tpl/admin-poedit.tpl.php:103
|
| 448 |
-
msgctxt "Editor button"
|
| 449 |
-
msgid "Download"
|
| 450 |
-
msgstr "Скачати"
|
| 451 |
-
|
| 452 |
-
#: tpl/admin-poedit.tpl.php:115
|
| 453 |
-
msgctxt "Editor button"
|
| 454 |
-
msgid "Sync"
|
| 455 |
-
msgstr "Синхронізувати"
|
| 456 |
-
|
| 457 |
-
#: tpl/admin-poedit.tpl.php:120
|
| 458 |
-
msgctxt "Editor button"
|
| 459 |
-
msgid "Revert"
|
| 460 |
-
msgstr "Повернути"
|
| 461 |
-
|
| 462 |
-
#: tpl/admin-poedit.tpl.php:125
|
| 463 |
-
msgctxt "Editor button"
|
| 464 |
-
msgid "Add"
|
| 465 |
-
msgstr "Додати"
|
| 466 |
-
|
| 467 |
-
#: tpl/admin-poedit.tpl.php:130
|
| 468 |
-
msgctxt "Editor button"
|
| 469 |
-
msgid "Del"
|
| 470 |
-
msgstr "Видалити"
|
| 471 |
-
|
| 472 |
-
#: tpl/admin-poedit.tpl.php:135
|
| 473 |
-
msgctxt "Editor button"
|
| 474 |
-
msgid "Fuzzy"
|
| 475 |
-
msgstr "Нечіткі"
|
| 476 |
-
|
| 477 |
-
#: tpl/admin-poedit.tpl.php:140
|
| 478 |
-
msgid "Filter translations"
|
| 479 |
-
msgstr "Фільтрувати переклади"
|
| 480 |
-
|
| 481 |
-
#: tpl/admin-poedit.tpl.php:145
|
| 482 |
-
msgctxt "Editor button"
|
| 483 |
-
msgid "Help"
|
| 484 |
-
msgstr "Справка"
|
| 485 |
-
|
| 486 |
-
#: tpl/admin-poinit.tpl.php:22
|
| 487 |
-
msgid "Initialize new translations in %s"
|
| 488 |
-
msgstr "Ініціалізувати нові переклади у %s"
|
| 489 |
-
|
| 490 |
-
#: tpl/admin-poinit.tpl.php:35
|
| 491 |
-
msgid "Select from common languages"
|
| 492 |
-
msgstr "Оберіть із доступних мов"
|
| 493 |
-
|
| 494 |
-
#: tpl/admin-poinit.tpl.php:47
|
| 495 |
-
msgctxt "Form label"
|
| 496 |
-
msgid "or enter any language code"
|
| 497 |
-
msgstr "або введіть код будь-якої мови"
|
| 498 |
-
|
| 499 |
-
#: tpl/admin-poinit.tpl.php:59 pub/js/lang/dummy.php:58
|
| 500 |
-
msgctxt "Form label"
|
| 501 |
-
msgid "create in <code>%s</code>"
|
| 502 |
-
msgstr "створено у <code>%s</code>"
|
| 503 |
-
|
| 504 |
-
#: tpl/admin-poinit.tpl.php:64
|
| 505 |
-
msgctxt "Form label"
|
| 506 |
-
msgid "create in global languages directory"
|
| 507 |
-
msgstr "створити у глобальній папці для мов"
|
| 508 |
-
|
| 509 |
-
#: tpl/admin-poinit.tpl.php:71
|
| 510 |
-
msgctxt "Submit button"
|
| 511 |
-
msgid "Start translating"
|
| 512 |
-
msgstr "Розпочати переклад"
|
| 513 |
-
|
| 514 |
-
#: tpl/admin-root.tpl.php:18
|
| 515 |
-
msgid "New version available"
|
| 516 |
-
msgstr "Нова версія доступна"
|
| 517 |
-
|
| 518 |
-
#: tpl/admin-root.tpl.php:21
|
| 519 |
-
msgid "Upgrade to version %s of Loco Translate"
|
| 520 |
-
msgstr "Оновіться до версії %s Перекладача Loco"
|
| 521 |
-
|
| 522 |
-
#: tpl/admin-root.tpl.php:31
|
| 523 |
-
msgid "Select a plugin or theme to translate"
|
| 524 |
-
msgstr "Оберіть плагін або тему для перекладу"
|
| 525 |
-
|
| 526 |
-
#: tpl/admin-root.tpl.php:40
|
| 527 |
-
msgctxt "Package list header"
|
| 528 |
-
msgid "Themes"
|
| 529 |
-
msgstr "Теми"
|
| 530 |
-
|
| 531 |
-
#: tpl/admin-root.tpl.php:53
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Plugins"
|
| 534 |
-
msgstr "Плагіни"
|
| 535 |
-
|
| 536 |
-
#: tpl/admin-root.tpl.php:66
|
| 537 |
-
msgctxt "Package list header"
|
| 538 |
-
msgid "Core"
|
| 539 |
-
msgstr "Ядро"
|
| 540 |
-
|
| 541 |
-
#: lib/compat/loco-iconv.php:13 lib/compat/loco-json.php:13
|
| 542 |
-
#: lib/compat/loco-mbstring.php:13 lib/compat/loco-tokenizer.php:12
|
| 543 |
-
msgid ""
|
| 544 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 545 |
-
"install it"
|
| 546 |
-
msgstr ""
|
| 547 |
-
"PHP-розширення \"%s\" не встановлене. Якщо ви досвічені у цих питаннях, "
|
| 548 |
-
"встановіть його"
|
| 549 |
-
|
| 550 |
-
#: pub/js/lang/dummy.php:8
|
| 551 |
-
msgid "Unknown error"
|
| 552 |
-
msgstr "Невідома помилка"
|
| 553 |
-
|
| 554 |
-
#: pub/js/lang/dummy.php:10
|
| 555 |
-
msgid "PO file saved"
|
| 556 |
-
msgstr "РО-файл збережено"
|
| 557 |
-
|
| 558 |
-
#: pub/js/lang/dummy.php:12
|
| 559 |
-
msgid "and MO file compiled"
|
| 560 |
-
msgstr "та МО-файл скомпільовано"
|
| 561 |
-
|
| 562 |
-
#: pub/js/lang/dummy.php:15
|
| 563 |
-
msgid "Merged from %s"
|
| 564 |
-
msgstr "Об'єднано з %s"
|
| 565 |
-
|
| 566 |
-
#: pub/js/lang/dummy.php:17
|
| 567 |
-
msgid "Merged from source code"
|
| 568 |
-
msgstr "Об'єднано з ісходним кодом"
|
| 569 |
-
|
| 570 |
-
#: pub/js/lang/dummy.php:19
|
| 571 |
-
msgid "Already up to date with %s"
|
| 572 |
-
msgstr "Вже оновлено з %s"
|
| 573 |
-
|
| 574 |
-
#: pub/js/lang/dummy.php:21
|
| 575 |
-
msgid "Already up to date with source code"
|
| 576 |
-
msgstr "Вже оновлено з ісходного коду"
|
| 577 |
-
|
| 578 |
-
#: pub/js/lang/dummy.php:23
|
| 579 |
-
msgid "1 new string added"
|
| 580 |
-
msgid_plural "%s new strings added"
|
| 581 |
-
msgstr[0] "1 нову строку додано"
|
| 582 |
-
msgstr[1] "%s нових строк додано"
|
| 583 |
-
msgstr[2] "%s нових строк додано"
|
| 584 |
-
|
| 585 |
-
#: pub/js/lang/dummy.php:25
|
| 586 |
-
msgid "1 obsolete string removed"
|
| 587 |
-
msgid_plural "%s obsolete strings removed"
|
| 588 |
-
msgstr[0] "1 застарілу строку видалено"
|
| 589 |
-
msgstr[1] "%s застарілих строк видалено"
|
| 590 |
-
msgstr[2] "%s застарілих строк видалено"
|
| 591 |
-
|
| 592 |
-
#: pub/js/lang/dummy.php:27
|
| 593 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 594 |
-
msgstr "Внесені зміни буде втрачено, якщо ви продовжите без збереження"
|
| 595 |
-
|
| 596 |
-
#. label for the window pane holding native translation
|
| 597 |
-
#: pub/js/lang/dummy.php:35
|
| 598 |
-
msgctxt "Editor pane"
|
| 599 |
-
msgid "Source text"
|
| 600 |
-
msgstr "Ісходний текст"
|
| 601 |
-
|
| 602 |
-
#. where %s is the language, e.g French translation
|
| 603 |
-
#: pub/js/lang/dummy.php:38
|
| 604 |
-
msgctxt "Editor pane"
|
| 605 |
-
msgid "%s translation"
|
| 606 |
-
msgstr "%s переклад"
|
| 607 |
-
|
| 608 |
-
#. label for the window pane holding translator comments
|
| 609 |
-
#: pub/js/lang/dummy.php:41
|
| 610 |
-
msgctxt "Editor pane"
|
| 611 |
-
msgid "Comments"
|
| 612 |
-
msgstr "Коментарі"
|
| 613 |
-
|
| 614 |
-
#. label for the window pane holding message context
|
| 615 |
-
#: pub/js/lang/dummy.php:44
|
| 616 |
-
msgctxt "Editor pane"
|
| 617 |
-
msgid "Context"
|
| 618 |
-
msgstr "Контекст"
|
| 619 |
-
|
| 620 |
-
#: pub/js/lang/dummy.php:52
|
| 621 |
-
msgid "Translation"
|
| 622 |
-
msgstr "Переклад"
|
| 623 |
-
|
| 624 |
-
#: pub/js/lang/dummy.php:54
|
| 625 |
-
msgid "No source files in this package, nothing to sync"
|
| 626 |
-
msgstr "Немає ісходних файлів у цьому пакунку, немає що синхронізувати"
|
| 627 |
-
|
| 628 |
-
#: pub/js/lang/dummy.php:56
|
| 629 |
-
msgid "No strings could be extracted from source files"
|
| 630 |
-
msgstr "Немає строк, які б можна було витягнути із ісходних файлі"
|
| 631 |
-
|
| 632 |
-
#. Description of the plugin
|
| 633 |
-
msgid "Translate WordPress plugins and themes directly in your browser"
|
| 634 |
-
msgstr "Переклад плагінів та тем WordPress прямо у вашому браузері"
|
| 635 |
-
|
| 636 |
-
#. URI of the plugin
|
| 637 |
-
msgid "http://wordpress.org/extend/plugins/loco-translate"
|
| 638 |
-
msgstr "http://wordpress.org/extend/plugins/loco-translate"
|
| 639 |
-
|
| 640 |
-
#. Author of the plugin
|
| 641 |
-
msgid "Tim Whitlock"
|
| 642 |
-
msgstr "Tim Whitlock"
|
| 643 |
-
|
| 644 |
-
#. Author URI of the plugin
|
| 645 |
-
msgid "https://localise.biz/help/wordpress/translate-plugin"
|
| 646 |
-
msgstr "https://localise.biz/help/wordpress/translate-plugin"
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/languages/loco-legacy.pot
DELETED
|
@@ -1,628 +0,0 @@
|
|
| 1 |
-
#, fuzzy
|
| 2 |
-
msgid ""
|
| 3 |
-
msgstr ""
|
| 4 |
-
"Project-Id-Version: PACKAGE VERSION\n"
|
| 5 |
-
"Report-Msgid-Bugs-To: \n"
|
| 6 |
-
"POT-Creation-Date: 2017-05-18 13:34+0000\n"
|
| 7 |
-
"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
|
| 8 |
-
"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
|
| 9 |
-
"Language-Team: \n"
|
| 10 |
-
"Language: \n"
|
| 11 |
-
"Plural-Forms: nplurals=INTEGER; plural=EXPRESSION;\n"
|
| 12 |
-
"MIME-Version: 1.0\n"
|
| 13 |
-
"Content-Type: text/plain; charset=UTF-8\n"
|
| 14 |
-
"Content-Transfer-Encoding: 8bit\n"
|
| 15 |
-
"X-Generator: Loco https://localise.biz/"
|
| 16 |
-
|
| 17 |
-
#. Bold text label in admin error messages
|
| 18 |
-
#: old/lib/loco-admin.php:31
|
| 19 |
-
msgctxt "Message label"
|
| 20 |
-
msgid "Error"
|
| 21 |
-
msgstr ""
|
| 22 |
-
|
| 23 |
-
#: old/lib/loco-admin.php:41
|
| 24 |
-
msgctxt "Message label"
|
| 25 |
-
msgid "Warning"
|
| 26 |
-
msgstr ""
|
| 27 |
-
|
| 28 |
-
#: old/lib/loco-admin.php:54 old/tpl/admin-list.tpl.php:98
|
| 29 |
-
msgctxt "Message label"
|
| 30 |
-
msgid "OK"
|
| 31 |
-
msgstr ""
|
| 32 |
-
|
| 33 |
-
#: old/lib/loco-admin.php:63
|
| 34 |
-
msgid "Permission denied"
|
| 35 |
-
msgstr ""
|
| 36 |
-
|
| 37 |
-
#: old/lib/loco-admin.php:86
|
| 38 |
-
msgid "Settings saved"
|
| 39 |
-
msgstr ""
|
| 40 |
-
|
| 41 |
-
#: old/lib/loco-admin.php:179
|
| 42 |
-
msgid "New PO file"
|
| 43 |
-
msgstr ""
|
| 44 |
-
|
| 45 |
-
#: old/lib/loco-admin.php:194
|
| 46 |
-
#, php-format
|
| 47 |
-
msgid "PO file used as template. This will be renamed to %s on first save"
|
| 48 |
-
msgstr ""
|
| 49 |
-
|
| 50 |
-
#: old/lib/loco-admin.php:292
|
| 51 |
-
msgid "You must specify a valid locale for a new PO file"
|
| 52 |
-
msgstr ""
|
| 53 |
-
|
| 54 |
-
#: old/lib/loco-admin.php:317 old/lib/loco-admin.php:406
|
| 55 |
-
msgid "No translatable strings found"
|
| 56 |
-
msgstr ""
|
| 57 |
-
|
| 58 |
-
#: old/lib/loco-admin.php:317
|
| 59 |
-
msgid "Cannot create a PO file."
|
| 60 |
-
msgstr ""
|
| 61 |
-
|
| 62 |
-
#: old/lib/loco-admin.php:324
|
| 63 |
-
#, php-format
|
| 64 |
-
msgid "PO file already exists with locale %s"
|
| 65 |
-
msgstr ""
|
| 66 |
-
|
| 67 |
-
#: old/lib/loco-admin.php:376
|
| 68 |
-
msgid ""
|
| 69 |
-
"File cannot be created automatically. Fix the file permissions or use "
|
| 70 |
-
"Download instead of Save"
|
| 71 |
-
msgstr ""
|
| 72 |
-
|
| 73 |
-
#: old/lib/loco-admin.php:385 old/lib/loco-admin.php:394
|
| 74 |
-
#, php-format
|
| 75 |
-
msgid "%s file is empty"
|
| 76 |
-
msgstr ""
|
| 77 |
-
|
| 78 |
-
#: old/lib/loco-admin.php:386 old/lib/loco-admin.php:401
|
| 79 |
-
msgid "Run Sync to update from source code"
|
| 80 |
-
msgstr ""
|
| 81 |
-
|
| 82 |
-
#: old/lib/loco-admin.php:390 old/php/loco-posync.php:52
|
| 83 |
-
msgid "No strings could be extracted from source code"
|
| 84 |
-
msgstr ""
|
| 85 |
-
|
| 86 |
-
#: old/lib/loco-admin.php:397
|
| 87 |
-
#, php-format
|
| 88 |
-
msgid "Run Sync to update from %s"
|
| 89 |
-
msgstr ""
|
| 90 |
-
|
| 91 |
-
#: old/lib/loco-admin.php:416
|
| 92 |
-
msgid "Source code has been modified, run Sync to update POT"
|
| 93 |
-
msgstr ""
|
| 94 |
-
|
| 95 |
-
#: old/lib/loco-admin.php:420
|
| 96 |
-
msgid "POT has been modified since PO file was saved, run Sync to update"
|
| 97 |
-
msgstr ""
|
| 98 |
-
|
| 99 |
-
#: old/lib/loco-admin.php:516
|
| 100 |
-
msgid "Bad file path"
|
| 101 |
-
msgstr ""
|
| 102 |
-
|
| 103 |
-
#: old/lib/loco-admin.php:768
|
| 104 |
-
#, php-format
|
| 105 |
-
msgid "Empty or invalid %s file"
|
| 106 |
-
msgstr ""
|
| 107 |
-
|
| 108 |
-
#: old/lib/loco-admin.php:772
|
| 109 |
-
#, php-format
|
| 110 |
-
msgid "%s file has no header"
|
| 111 |
-
msgstr ""
|
| 112 |
-
|
| 113 |
-
#: old/lib/loco-admin.php:919
|
| 114 |
-
msgctxt "Add button"
|
| 115 |
-
msgid "New template"
|
| 116 |
-
msgstr ""
|
| 117 |
-
|
| 118 |
-
#: old/lib/loco-admin.php:938
|
| 119 |
-
msgctxt "Add button"
|
| 120 |
-
msgid "New language"
|
| 121 |
-
msgstr ""
|
| 122 |
-
|
| 123 |
-
#: old/lib/loco-admin.php:977
|
| 124 |
-
#, php-format
|
| 125 |
-
msgid "%s%% translated"
|
| 126 |
-
msgstr ""
|
| 127 |
-
|
| 128 |
-
#: old/lib/loco-admin.php:977
|
| 129 |
-
#, php-format
|
| 130 |
-
msgid "1 string"
|
| 131 |
-
msgid_plural "%s strings"
|
| 132 |
-
msgstr[0] ""
|
| 133 |
-
msgstr[1] ""
|
| 134 |
-
|
| 135 |
-
#: old/lib/loco-admin.php:980
|
| 136 |
-
#, php-format
|
| 137 |
-
msgid "%s fuzzy"
|
| 138 |
-
msgstr ""
|
| 139 |
-
|
| 140 |
-
#: old/lib/loco-admin.php:983
|
| 141 |
-
#, php-format
|
| 142 |
-
msgid "%s untranslated"
|
| 143 |
-
msgstr ""
|
| 144 |
-
|
| 145 |
-
#: old/lib/loco-admin.php:1029
|
| 146 |
-
msgid "Failed to compile MO file with built-in compiler"
|
| 147 |
-
msgstr ""
|
| 148 |
-
|
| 149 |
-
#: old/lib/loco-admin.php:1083 old/tpl/admin-nav.tpl.php:36
|
| 150 |
-
msgid "Loco, Translation Management"
|
| 151 |
-
msgstr ""
|
| 152 |
-
|
| 153 |
-
#: old/lib/loco-admin.php:1084 old/lib/loco-admin.php:1122
|
| 154 |
-
msgid "Manage translations"
|
| 155 |
-
msgstr ""
|
| 156 |
-
|
| 157 |
-
#: old/lib/loco-admin.php:1085
|
| 158 |
-
msgid "Translation options"
|
| 159 |
-
msgstr ""
|
| 160 |
-
|
| 161 |
-
#: old/lib/loco-admin.php:1092
|
| 162 |
-
msgid "Loco Translate"
|
| 163 |
-
msgstr ""
|
| 164 |
-
|
| 165 |
-
#: old/lib/loco-admin.php:1123 old/tpl/admin-fscheck.tpl.php:8
|
| 166 |
-
#: old/tpl/admin-opts.tpl.php:7 old/tpl/admin-poedit.tpl.php:7
|
| 167 |
-
#: old/tpl/admin-poinit.tpl.php:7 old/tpl/admin-root.tpl.php:7
|
| 168 |
-
msgid "Settings"
|
| 169 |
-
msgstr ""
|
| 170 |
-
|
| 171 |
-
#: old/lib/loco-admin.php:1147
|
| 172 |
-
msgid "File download failed"
|
| 173 |
-
msgstr ""
|
| 174 |
-
|
| 175 |
-
#: old/lib/loco-admin.php:1157
|
| 176 |
-
msgid "WPLANG is deprecated and should be removed from wp-config.php"
|
| 177 |
-
msgstr ""
|
| 178 |
-
|
| 179 |
-
#: old/lib/loco-locales.php:77
|
| 180 |
-
msgid "Unknown language"
|
| 181 |
-
msgstr ""
|
| 182 |
-
|
| 183 |
-
#: old/lib/loco-packages.php:474 old/lib/loco-packages.php:481
|
| 184 |
-
msgid "Some files not writable"
|
| 185 |
-
msgstr ""
|
| 186 |
-
|
| 187 |
-
#: old/lib/loco-packages.php:484
|
| 188 |
-
msgid "Some files missing"
|
| 189 |
-
msgstr ""
|
| 190 |
-
|
| 191 |
-
#: old/lib/loco-packages.php:490 old/lib/loco-packages.php:494
|
| 192 |
-
#, php-format
|
| 193 |
-
msgid "\"%s\" folder not writable"
|
| 194 |
-
msgstr ""
|
| 195 |
-
|
| 196 |
-
#: old/lib/loco-packages.php:515
|
| 197 |
-
msgid "POT file not writable"
|
| 198 |
-
msgstr ""
|
| 199 |
-
|
| 200 |
-
#: old/lib/loco-packages.php:520
|
| 201 |
-
msgid "PO file not writable"
|
| 202 |
-
msgstr ""
|
| 203 |
-
|
| 204 |
-
#: old/lib/loco-packages.php:522
|
| 205 |
-
msgid "MO file not writable"
|
| 206 |
-
msgstr ""
|
| 207 |
-
|
| 208 |
-
#: old/lib/loco-packages.php:522
|
| 209 |
-
msgid "MO file not found"
|
| 210 |
-
msgstr ""
|
| 211 |
-
|
| 212 |
-
#: old/lib/loco-packages.php:527
|
| 213 |
-
msgid "Folder not writable"
|
| 214 |
-
msgstr ""
|
| 215 |
-
|
| 216 |
-
#: old/lib/loco-packages.php:527
|
| 217 |
-
msgid "Folder not found"
|
| 218 |
-
msgstr ""
|
| 219 |
-
|
| 220 |
-
#: old/lib/loco-packages.php:546
|
| 221 |
-
#, php-format
|
| 222 |
-
msgid "%s does not declare a \"Text Domain\""
|
| 223 |
-
msgstr ""
|
| 224 |
-
|
| 225 |
-
#: old/lib/loco-packages.php:546 old/lib/loco-packages.php:551
|
| 226 |
-
#, php-format
|
| 227 |
-
msgid "Loco has guessed \"%s\""
|
| 228 |
-
msgstr ""
|
| 229 |
-
|
| 230 |
-
#: old/lib/loco-packages.php:551
|
| 231 |
-
#, php-format
|
| 232 |
-
msgid "%s does not declare a \"Domain Path\""
|
| 233 |
-
msgstr ""
|
| 234 |
-
|
| 235 |
-
#: old/lib/loco-packages.php:556
|
| 236 |
-
#, php-format
|
| 237 |
-
msgid "%s has no POT file. Create one at \"%s/%s.pot\" if you need one."
|
| 238 |
-
msgstr ""
|
| 239 |
-
|
| 240 |
-
#: old/lib/loco-packages.php:559
|
| 241 |
-
#, php-format
|
| 242 |
-
msgid "%s has a strange POT file name (%s). A better name would be \"%s.pot\""
|
| 243 |
-
msgstr ""
|
| 244 |
-
|
| 245 |
-
#: old/lib/loco-packages.php:568
|
| 246 |
-
#, php-format
|
| 247 |
-
msgid "%s is not an official WordPress language"
|
| 248 |
-
msgstr ""
|
| 249 |
-
|
| 250 |
-
#: old/php/loco-ajax.php:17 old/php/loco-download.php:21
|
| 251 |
-
msgid "User does not have permission to manage translations"
|
| 252 |
-
msgstr ""
|
| 253 |
-
|
| 254 |
-
#: old/php/loco-data.php:21 old/php/loco-posave.php:10
|
| 255 |
-
#: old/php/loco-posync.php:9
|
| 256 |
-
msgid "Invalid data posted to server"
|
| 257 |
-
msgstr ""
|
| 258 |
-
|
| 259 |
-
#: old/php/loco-download.php:75 old/php/loco-posave.php:121
|
| 260 |
-
#, php-format
|
| 261 |
-
msgid "Failed to compile MO file with %s, check your settings"
|
| 262 |
-
msgstr ""
|
| 263 |
-
|
| 264 |
-
#: old/php/loco-posave.php:23 old/php/loco-posync.php:22
|
| 265 |
-
#, php-format
|
| 266 |
-
msgid "Package not found called %s"
|
| 267 |
-
msgstr ""
|
| 268 |
-
|
| 269 |
-
#: old/php/loco-posave.php:58
|
| 270 |
-
#, php-format
|
| 271 |
-
msgid ""
|
| 272 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable "
|
| 273 |
-
"backups in settings"
|
| 274 |
-
msgstr ""
|
| 275 |
-
|
| 276 |
-
#: old/php/loco-posave.php:66
|
| 277 |
-
#, php-format
|
| 278 |
-
msgid ""
|
| 279 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or "
|
| 280 |
-
"create it manually."
|
| 281 |
-
msgstr ""
|
| 282 |
-
|
| 283 |
-
#: old/php/loco-posave.php:69
|
| 284 |
-
#, php-format
|
| 285 |
-
msgid ""
|
| 286 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions "
|
| 287 |
-
"or use the download function."
|
| 288 |
-
msgstr ""
|
| 289 |
-
|
| 290 |
-
#: old/php/loco-posave.php:81
|
| 291 |
-
#, php-format
|
| 292 |
-
msgid ""
|
| 293 |
-
"%s file is not writable by the web server. Fix file permissions or download "
|
| 294 |
-
"and copy to \"%s/%s\"."
|
| 295 |
-
msgstr ""
|
| 296 |
-
|
| 297 |
-
#: old/php/loco-posave.php:102
|
| 298 |
-
msgid "Cannot create MO file"
|
| 299 |
-
msgstr ""
|
| 300 |
-
|
| 301 |
-
#: old/php/loco-posave.php:105
|
| 302 |
-
msgid "Cannot overwrite MO file"
|
| 303 |
-
msgstr ""
|
| 304 |
-
|
| 305 |
-
#: old/php/loco-posave.php:131
|
| 306 |
-
msgid "Failed to write MO file"
|
| 307 |
-
msgstr ""
|
| 308 |
-
|
| 309 |
-
#: old/tpl/admin-fscheck.tpl.php:7 old/tpl/admin-opts.tpl.php:6
|
| 310 |
-
#: old/tpl/admin-poedit.tpl.php:6 old/tpl/admin-poinit.tpl.php:6
|
| 311 |
-
#: old/tpl/admin-root.tpl.php:6
|
| 312 |
-
msgid "Packages"
|
| 313 |
-
msgstr ""
|
| 314 |
-
|
| 315 |
-
#: old/tpl/admin-fscheck.tpl.php:10
|
| 316 |
-
msgid "File check"
|
| 317 |
-
msgstr ""
|
| 318 |
-
|
| 319 |
-
#: old/tpl/admin-fscheck.tpl.php:19
|
| 320 |
-
#, php-format
|
| 321 |
-
msgid "File system permissions for %s"
|
| 322 |
-
msgstr ""
|
| 323 |
-
|
| 324 |
-
#: old/tpl/admin-fscheck.tpl.php:43
|
| 325 |
-
#, php-format
|
| 326 |
-
msgid "Other potential issues with %s"
|
| 327 |
-
msgstr ""
|
| 328 |
-
|
| 329 |
-
#: old/tpl/admin-fscheck.tpl.php:57
|
| 330 |
-
msgid "Back"
|
| 331 |
-
msgstr ""
|
| 332 |
-
|
| 333 |
-
#: old/tpl/admin-fscheck.tpl.php:58 old/tpl/admin-opts.tpl.php:102
|
| 334 |
-
msgid "Get help"
|
| 335 |
-
msgstr ""
|
| 336 |
-
|
| 337 |
-
#: old/tpl/admin-list.tpl.php:11
|
| 338 |
-
msgctxt "Table header"
|
| 339 |
-
msgid "Package details"
|
| 340 |
-
msgstr ""
|
| 341 |
-
|
| 342 |
-
#: old/tpl/admin-list.tpl.php:14
|
| 343 |
-
msgctxt "Table header"
|
| 344 |
-
msgid "Translations (PO)"
|
| 345 |
-
msgstr ""
|
| 346 |
-
|
| 347 |
-
#: old/tpl/admin-list.tpl.php:17
|
| 348 |
-
msgctxt "Table header"
|
| 349 |
-
msgid "Template (POT)"
|
| 350 |
-
msgstr ""
|
| 351 |
-
|
| 352 |
-
#: old/tpl/admin-list.tpl.php:20
|
| 353 |
-
msgctxt "Table header"
|
| 354 |
-
msgid "File permissions"
|
| 355 |
-
msgstr ""
|
| 356 |
-
|
| 357 |
-
#: old/tpl/admin-list.tpl.php:40
|
| 358 |
-
#, php-format
|
| 359 |
-
msgid "Extends: %s"
|
| 360 |
-
msgstr ""
|
| 361 |
-
|
| 362 |
-
#: old/tpl/admin-list.tpl.php:44
|
| 363 |
-
#, php-format
|
| 364 |
-
msgid "1 language"
|
| 365 |
-
msgid_plural "%u languages"
|
| 366 |
-
msgstr[0] ""
|
| 367 |
-
msgstr[1] ""
|
| 368 |
-
|
| 369 |
-
#: old/tpl/admin-list.tpl.php:49 old/tpl/admin-poedit.tpl.php:57
|
| 370 |
-
msgctxt "Modified time"
|
| 371 |
-
msgid "Updated"
|
| 372 |
-
msgstr ""
|
| 373 |
-
|
| 374 |
-
#: old/tpl/admin-nav.tpl.php:35
|
| 375 |
-
msgid "Powered by"
|
| 376 |
-
msgstr ""
|
| 377 |
-
|
| 378 |
-
#: old/tpl/admin-nav.tpl.php:41
|
| 379 |
-
msgid "Loco may not work as expected"
|
| 380 |
-
msgstr ""
|
| 381 |
-
|
| 382 |
-
#: old/tpl/admin-opts.tpl.php:18
|
| 383 |
-
msgid "Configure Loco Translate"
|
| 384 |
-
msgstr ""
|
| 385 |
-
|
| 386 |
-
#: old/tpl/admin-opts.tpl.php:27 old/tpl/admin-opts.tpl.php:31
|
| 387 |
-
msgid "Compiling MO files"
|
| 388 |
-
msgstr ""
|
| 389 |
-
|
| 390 |
-
#: old/tpl/admin-opts.tpl.php:36
|
| 391 |
-
msgid "Use built-in MO compiler."
|
| 392 |
-
msgstr ""
|
| 393 |
-
|
| 394 |
-
#: old/tpl/admin-opts.tpl.php:42
|
| 395 |
-
msgid "Use external command:"
|
| 396 |
-
msgstr ""
|
| 397 |
-
|
| 398 |
-
#: old/tpl/admin-opts.tpl.php:47
|
| 399 |
-
msgid "Enter path to msgfmt on server"
|
| 400 |
-
msgstr ""
|
| 401 |
-
|
| 402 |
-
#: old/tpl/admin-opts.tpl.php:54
|
| 403 |
-
msgid "Generate hash tables"
|
| 404 |
-
msgstr ""
|
| 405 |
-
|
| 406 |
-
#: old/tpl/admin-opts.tpl.php:60
|
| 407 |
-
msgid "Include Fuzzy strings"
|
| 408 |
-
msgstr ""
|
| 409 |
-
|
| 410 |
-
#: old/tpl/admin-opts.tpl.php:67 old/tpl/admin-opts.tpl.php:71
|
| 411 |
-
msgid "Backing up PO files"
|
| 412 |
-
msgstr ""
|
| 413 |
-
|
| 414 |
-
#: old/tpl/admin-opts.tpl.php:75
|
| 415 |
-
msgid "Number of backups to keep of each file:"
|
| 416 |
-
msgstr ""
|
| 417 |
-
|
| 418 |
-
#: old/tpl/admin-opts.tpl.php:83 old/tpl/admin-opts.tpl.php:87
|
| 419 |
-
msgid "Experimental features"
|
| 420 |
-
msgstr ""
|
| 421 |
-
|
| 422 |
-
#: old/tpl/admin-opts.tpl.php:92
|
| 423 |
-
msgid "Enable WordPress core translations"
|
| 424 |
-
msgstr ""
|
| 425 |
-
|
| 426 |
-
#: old/tpl/admin-opts.tpl.php:101
|
| 427 |
-
msgid "Save settings"
|
| 428 |
-
msgstr ""
|
| 429 |
-
|
| 430 |
-
#: old/tpl/admin-poedit.tpl.php:32
|
| 431 |
-
msgid "Template file"
|
| 432 |
-
msgstr ""
|
| 433 |
-
|
| 434 |
-
#: old/tpl/admin-poedit.tpl.php:40
|
| 435 |
-
msgctxt "Dropdown label"
|
| 436 |
-
msgid "Switch to..."
|
| 437 |
-
msgstr ""
|
| 438 |
-
|
| 439 |
-
#: old/tpl/admin-poedit.tpl.php:62
|
| 440 |
-
msgid "never"
|
| 441 |
-
msgstr ""
|
| 442 |
-
|
| 443 |
-
#: old/tpl/admin-poedit.tpl.php:87
|
| 444 |
-
msgctxt "Editor button"
|
| 445 |
-
msgid "Save"
|
| 446 |
-
msgstr ""
|
| 447 |
-
|
| 448 |
-
#: old/tpl/admin-poedit.tpl.php:94 old/tpl/admin-poedit.tpl.php:103
|
| 449 |
-
msgctxt "Editor button"
|
| 450 |
-
msgid "Download"
|
| 451 |
-
msgstr ""
|
| 452 |
-
|
| 453 |
-
#: old/tpl/admin-poedit.tpl.php:115
|
| 454 |
-
msgctxt "Editor button"
|
| 455 |
-
msgid "Sync"
|
| 456 |
-
msgstr ""
|
| 457 |
-
|
| 458 |
-
#: old/tpl/admin-poedit.tpl.php:120
|
| 459 |
-
msgctxt "Editor button"
|
| 460 |
-
msgid "Revert"
|
| 461 |
-
msgstr ""
|
| 462 |
-
|
| 463 |
-
#: old/tpl/admin-poedit.tpl.php:125
|
| 464 |
-
msgctxt "Editor button"
|
| 465 |
-
msgid "Add"
|
| 466 |
-
msgstr ""
|
| 467 |
-
|
| 468 |
-
#: old/tpl/admin-poedit.tpl.php:130
|
| 469 |
-
msgctxt "Editor button"
|
| 470 |
-
msgid "Del"
|
| 471 |
-
msgstr ""
|
| 472 |
-
|
| 473 |
-
#: old/tpl/admin-poedit.tpl.php:135
|
| 474 |
-
msgctxt "Editor button"
|
| 475 |
-
msgid "Fuzzy"
|
| 476 |
-
msgstr ""
|
| 477 |
-
|
| 478 |
-
#: old/tpl/admin-poedit.tpl.php:140
|
| 479 |
-
msgid "Filter translations"
|
| 480 |
-
msgstr ""
|
| 481 |
-
|
| 482 |
-
#: old/tpl/admin-poedit.tpl.php:145
|
| 483 |
-
msgctxt "Editor button"
|
| 484 |
-
msgid "Help"
|
| 485 |
-
msgstr ""
|
| 486 |
-
|
| 487 |
-
#: old/tpl/admin-poinit.tpl.php:22
|
| 488 |
-
#, php-format
|
| 489 |
-
msgid "Initialize new translations in %s"
|
| 490 |
-
msgstr ""
|
| 491 |
-
|
| 492 |
-
#: old/tpl/admin-poinit.tpl.php:35
|
| 493 |
-
msgid "Select from common languages"
|
| 494 |
-
msgstr ""
|
| 495 |
-
|
| 496 |
-
#: old/tpl/admin-poinit.tpl.php:47
|
| 497 |
-
msgctxt "Form label"
|
| 498 |
-
msgid "or enter any language code"
|
| 499 |
-
msgstr ""
|
| 500 |
-
|
| 501 |
-
#: old/tpl/admin-poinit.tpl.php:59 old/pub/js/lang/dummy.php:58
|
| 502 |
-
#, php-format
|
| 503 |
-
msgctxt "Form label"
|
| 504 |
-
msgid "create in <code>%s</code>"
|
| 505 |
-
msgstr ""
|
| 506 |
-
|
| 507 |
-
#: old/tpl/admin-poinit.tpl.php:64
|
| 508 |
-
msgctxt "Form label"
|
| 509 |
-
msgid "create in global languages directory"
|
| 510 |
-
msgstr ""
|
| 511 |
-
|
| 512 |
-
#: old/tpl/admin-poinit.tpl.php:71
|
| 513 |
-
msgctxt "Submit button"
|
| 514 |
-
msgid "Start translating"
|
| 515 |
-
msgstr ""
|
| 516 |
-
|
| 517 |
-
#: old/tpl/admin-root.tpl.php:17
|
| 518 |
-
msgid "Select a plugin or theme to translate"
|
| 519 |
-
msgstr ""
|
| 520 |
-
|
| 521 |
-
#: old/tpl/admin-root.tpl.php:26
|
| 522 |
-
msgctxt "Package list header"
|
| 523 |
-
msgid "Themes"
|
| 524 |
-
msgstr ""
|
| 525 |
-
|
| 526 |
-
#: old/tpl/admin-root.tpl.php:39
|
| 527 |
-
msgctxt "Package list header"
|
| 528 |
-
msgid "Plugins"
|
| 529 |
-
msgstr ""
|
| 530 |
-
|
| 531 |
-
#: old/tpl/admin-root.tpl.php:52
|
| 532 |
-
msgctxt "Package list header"
|
| 533 |
-
msgid "Core"
|
| 534 |
-
msgstr ""
|
| 535 |
-
|
| 536 |
-
#: old/lib/compat/loco-iconv.php:13 old/lib/compat/loco-json.php:13
|
| 537 |
-
#: old/lib/compat/loco-mbstring.php:13 old/lib/compat/loco-tokenizer.php:12
|
| 538 |
-
#, php-format
|
| 539 |
-
msgid ""
|
| 540 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should "
|
| 541 |
-
"install it"
|
| 542 |
-
msgstr ""
|
| 543 |
-
|
| 544 |
-
#: old/pub/js/lang/dummy.php:8
|
| 545 |
-
msgid "Unknown error"
|
| 546 |
-
msgstr ""
|
| 547 |
-
|
| 548 |
-
#: old/pub/js/lang/dummy.php:10
|
| 549 |
-
msgid "PO file saved"
|
| 550 |
-
msgstr ""
|
| 551 |
-
|
| 552 |
-
#: old/pub/js/lang/dummy.php:12
|
| 553 |
-
msgid "and MO file compiled"
|
| 554 |
-
msgstr ""
|
| 555 |
-
|
| 556 |
-
#. where %s is the path to a POT file
|
| 557 |
-
#: old/pub/js/lang/dummy.php:15
|
| 558 |
-
#, php-format
|
| 559 |
-
msgid "Merged from %s"
|
| 560 |
-
msgstr ""
|
| 561 |
-
|
| 562 |
-
#: old/pub/js/lang/dummy.php:17
|
| 563 |
-
msgid "Merged from source code"
|
| 564 |
-
msgstr ""
|
| 565 |
-
|
| 566 |
-
#: old/pub/js/lang/dummy.php:19
|
| 567 |
-
#, php-format
|
| 568 |
-
msgid "Already up to date with %s"
|
| 569 |
-
msgstr ""
|
| 570 |
-
|
| 571 |
-
#: old/pub/js/lang/dummy.php:21
|
| 572 |
-
msgid "Already up to date with source code"
|
| 573 |
-
msgstr ""
|
| 574 |
-
|
| 575 |
-
#: old/pub/js/lang/dummy.php:23
|
| 576 |
-
#, php-format
|
| 577 |
-
msgid "1 new string added"
|
| 578 |
-
msgid_plural "%s new strings added"
|
| 579 |
-
msgstr[0] ""
|
| 580 |
-
msgstr[1] ""
|
| 581 |
-
|
| 582 |
-
#: old/pub/js/lang/dummy.php:25
|
| 583 |
-
#, php-format
|
| 584 |
-
msgid "1 obsolete string removed"
|
| 585 |
-
msgid_plural "%s obsolete strings removed"
|
| 586 |
-
msgstr[0] ""
|
| 587 |
-
msgstr[1] ""
|
| 588 |
-
|
| 589 |
-
#: old/pub/js/lang/dummy.php:27
|
| 590 |
-
msgid "Your changes will be lost if you continue without saving"
|
| 591 |
-
msgstr ""
|
| 592 |
-
|
| 593 |
-
#. label for the window pane holding native translation
|
| 594 |
-
#: old/pub/js/lang/dummy.php:35
|
| 595 |
-
msgctxt "Editor pane"
|
| 596 |
-
msgid "Source text"
|
| 597 |
-
msgstr ""
|
| 598 |
-
|
| 599 |
-
#. where %s is the language, e.g French translation
|
| 600 |
-
#: old/pub/js/lang/dummy.php:38
|
| 601 |
-
#, php-format
|
| 602 |
-
msgctxt "Editor pane"
|
| 603 |
-
msgid "%s translation"
|
| 604 |
-
msgstr ""
|
| 605 |
-
|
| 606 |
-
#. label for the window pane holding translator comments
|
| 607 |
-
#: old/pub/js/lang/dummy.php:41
|
| 608 |
-
msgctxt "Editor pane"
|
| 609 |
-
msgid "Comments"
|
| 610 |
-
msgstr ""
|
| 611 |
-
|
| 612 |
-
#. label for the window pane holding message context
|
| 613 |
-
#: old/pub/js/lang/dummy.php:44
|
| 614 |
-
msgctxt "Editor pane"
|
| 615 |
-
msgid "Context"
|
| 616 |
-
msgstr ""
|
| 617 |
-
|
| 618 |
-
#: old/pub/js/lang/dummy.php:52
|
| 619 |
-
msgid "Translation"
|
| 620 |
-
msgstr ""
|
| 621 |
-
|
| 622 |
-
#: old/pub/js/lang/dummy.php:54
|
| 623 |
-
msgid "No source files in this package, nothing to sync"
|
| 624 |
-
msgstr ""
|
| 625 |
-
|
| 626 |
-
#: old/pub/js/lang/dummy.php:56
|
| 627 |
-
msgid "No strings could be extracted from source files"
|
| 628 |
-
msgstr ""
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/build/gettext-compiled.php
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Compiled source built from Loco core. Do not edit!
|
| 4 |
-
* Mon, 07 Sep 2015 11:46:08 +0100
|
| 5 |
-
*/
|
| 6 |
-
interface LocoArrayInterface extends ArrayAccess, Iterator, Countable, JsonSerializable { public function export(); public function keys(); } class LocoHeaders extends ArrayIterator implements LocoArrayInterface { private $map = array(); public function __construct( array $raw = array() ){ if( $raw ){ $keys = array_keys( $raw ); $this->map = array_combine( array_map( 'strtolower', $keys ), $keys ); parent::__construct($raw); } } private function normalize( $key ){ $k = strtolower($key); return isset($this->map[$k]) ? $this->map[$k] : null; } public function add( $key, $val ){ $this->offsetSet( $key, $val ); return $this; } public function __toString(){ $pairs = array(); foreach( $this as $key => $val ){ $pairs[] = trim($key).': '.$val; } return implode("\n", $pairs ); } public function trimmed( $prop ){ return trim( $this->__get($prop) ); } public function has( $key ){ return $this->offsetExists($key); } public function __get( $key ){ return $this->offsetGet( $key ); } public function offsetExists( $k ){ return ! is_null( $this->normalize($k) ); } public function offsetGet( $k ){ $k = $this->normalize($k); if( is_null($k) ){ return ''; } return parent::offsetGet($k); } public function offsetSet( $k, $v ){ $this->map[ strtolower($k) ] = $k; return parent::offsetSet( $k, $v ); } public function offsetUnset( $k ){ return parent::offsetUnset( $this->normalize($k) ); } public function export(){ return $this->getArrayCopy(); } public function jsonSerialize(){ return $this->getArrayCopy(); } public function keys(){ return array_values( $this->map ); } } function loco_sniff_printf( $str ){ return false !== strpos($str,'%') && preg_match('/%(?:(\d)\$)?([,\'\+\-#0 \(]*)(\d*)(\.\d+|\.\*)?([sScCuidoxXfFeEgGaAbBpn@])/', $str ); } function loco_parse_reference_id( $refs, &$_id ){ if( false === ( $n = strpos($refs,'loco:') ) ){ $_id = ''; return $refs; } $_id = substr($refs, $n+5, 24 ); $refs = substr_replace( $refs, '', $n, 29 ); return trim( $refs ); } function loco_ensure_utf8( $str, $enc = false, $prefix_bom = false ){ if( false === $enc ){ $m = substr( $str, 0, 3 ); if( "\xEF\xBB\xBF" === $m ){ $str = substr( $str, 3 ); } else if( "\xFF" === $m{0} && "\xFE" === $m{1} ){ $str = substr( $str, 2 ); $enc = 'UTF-16LE'; } else if( "\xFE" === $m{0} && "\xFF" === $m{1} ){ $str = substr( $str, 2 ); $enc = 'UTF-16BE'; } else { $enc = mb_detect_encoding( $str, array('ASCII','UTF-8','Windows-1252','ISO-8859-1'), false ); if( ! $enc ){ throw new Exception('Unknown character encoding'); } } } else if( ! strcasecmp('ISO-8859-1',$enc) || ! strcasecmp('CP-1252', $enc ) ){ $enc = 'Windows-1252'; } else if( ! strcasecmp('UTF8', $enc) ){ $enc = ''; } if( $enc && $enc !== 'ASCII' && $enc !== 'UTF-8' ){ $str = iconv( $enc, 'UTF-8//TRANSLIT', $str ); if( ! $str ){ throw new Exception('Failed to ensure UTF-8 from '.$enc); } } if( $prefix_bom ){ $str = "\xEF\xBB\xBF".$str; } return $str; } function loco_parse_po( $src ){ $src = loco_ensure_utf8( $src ); $i = -1; $key = ''; $entries = array(); $template = array( '#' => array(), 'id' => array(), 'str' => array(), 'ctxt' => array() ); foreach( preg_split('/[\r\n]+/', $src) as $line ){ while( $line = trim($line) ){ $c = $line{0}; if( '"' === $c ){ if( $key && isset($entry) ){ $entry[$key][$idx][] = loco_po_unquote( $line ); } } else if( '#' === $c ){ if( isset($entry['i']) ){ unset( $entry ); $entry = $template; } $f = empty($line{1}) ? ' ' : $line{1}; $entry['#'][$f][] = trim( substr( $line, 1+strlen($f) ), "/ \n\r\t" ); } else if( preg_match('/^msg(id|str|ctxt|id_plural)(?:\[(\d+)\])?[ \t]+/', $line, $r ) ){ $key = $r[1]; $idx = isset($r[2]) ? (int) $r[2] : 0; if( 'str' === $key ){ if( ! isset($entry['i']) ){ $entry['i'] = ++$i; $entries[$i] = &$entry; } } else if( ! isset($entry) || isset($entry['i']) ){ unset( $entry ); $entry = $template; } $line = substr( $line, strlen($r[0]) ); continue; } continue 2; } } unset( $entry ); $assets = array(); foreach( $entries as $i => $entry ){ if( empty($entry['id']) ){ continue; } if( empty($entry['str']) ){ $entry['str'] = array( array('') ); } $asset = array ( 'id' => '', 'source' => implode('',$entry['id'][0]), 'target' => implode('',$entry['str'][0]), ); $parse_printf = true; if( isset($entry['ctxt'][0]) ){ $asset['context'] = implode('',$entry['ctxt'][0]); } if( isset($entry['#'][' ']) ){ $asset['comment'] = implode("\n", $entry['#'][' '] ); } if( isset($entry['#']['.']) ){ $asset['notes'] = implode("\n", $entry['#']['.'] ); } if( isset($entry['#'][':']) ){ if( $refs = implode( "\n", $entry['#'][':'] ) ) { if( $refs = loco_parse_reference_id( $refs, $_id ) ){ $asset['refs'] = $refs; } if( $_id ){ $asset['_id'] = $_id; } } } if( isset($entry['#'][',']) ){ foreach( $entry['#'][','] as $flag ){ if( preg_match('/((?:no-)?\w+)-format/', $flag, $r ) ){ $parse_printf = false; if( 'no-' === substr($r[1],0,3) ){ $asset['format'] = false; } else { $asset['format'] = $r[1]; } } else if( $flag = loco_po_parse_flag($flag) ){ $asset['flag'] = $flag; break; } } } if( $parse_printf ){ if( $asset['source'] && loco_sniff_printf( $asset['source'] ) ){ $asset['format'] = 'c'; $parse_printf = false; } } $pidx = count($assets); $assets[] = $asset; if( isset($entry['id_plural']) || isset($entry['str'][1]) ){ $idx = 0; $num = max( 2, count($entry['str']) ); while( ++$idx < $num ){ $plural = array ( 'id' => '', 'source' => null, 'target' => isset($entry['str'][$idx]) ? implode('',$entry['str'][$idx]) : '', 'plural' => $idx, 'parent' => $pidx, ); if( 1 === $idx ){ $plural['source'] = isset($entry['id_plural'][0]) ? implode('',$entry['id_plural'][0]) : ''; } if( $parse_printf ){ if( $plural['source'] && loco_sniff_printf( $plural['source'] ) ){ $assets[$pidx]['format'] = 'c'; $parse_printf = false; } } $assets[] = $plural; } } } if( $assets && '' === $assets[0]['source'] ){ $headers = loco_parse_po_headers( $assets[0]['target'] ); $indexed = $headers->__get('X-Loco-Lookup'); if( 'id' === $indexed || 'name' === $indexed ){ foreach( $assets as $i => $asset ){ if( isset($asset['notes']) ){ $notes = $texts = array(); foreach( explode("\n",$asset['notes']) as $line ){ 0 === strpos($line,'Source text: ') ? $texts[] = substr($line,13) : $notes[] = $line; } $assets[$i]['notes'] = implode("\n",$notes); $assets[$i]['id'] = $asset['source']; $assets[$i]['source'] = implode("\n",$texts); } } } } return $assets; } function loco_po_parse_flag( $text, $flag = 0 ){ static $map; foreach( explode(',',$text) as $needle ){ if( $needle = trim($needle) ){ if( ! isset($map) ){ $map = unserialize('a:1:{i:4;s:8:"#, fuzzy";}'); } foreach( $map as $loco_flag => $haystack ){ if( false !== stripos($haystack, $needle) ){ $flag |= $loco_flag; break; } } } } return $flag; } function loco_po_unquote( $str ){ return substr( stripcslashes($str), 1, -1 ); } function loco_parse_po_headers( $str ){ $headers = new LocoHeaders; foreach( explode("\n",$str) as $line ){ $i = strpos($line,':') and $key = trim( substr($line,0,$i) ) and $headers->add( $key, trim( substr($line,++$i) ) ); } return $headers; } abstract class LocoException extends Exception { abstract public function getStatus(); } class LocoParseException extends LocoException { protected $column; private $context; public function getStatus(){ return 422; } public function setContext( $line, $column, $source ){ $this->line = $line; $this->column = $column; $lines = explode( "\n", $source ); $this->context = $lines[ $line - 1 ] ."\n". str_repeat(' ', max(0,$column-2) ).'^'; $this->message = sprintf("Error at line %u, column %u: %s", $this->line, $this->column, $this->message ); } public function getContext(){ return $this->context; } } class LocoMoParser { private $bin; private $be; private $n; private $o; private $t; private $v; public function __construct( $bin ){ $this->bin = $bin; } public function getAt( $idx ){ $offset = $this->targetOffset(); $offset += ( $idx * 8 ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false === strpos( $txt, "\0") ){ return $txt; } return explode( "\0", $txt ); } public function parse(){ $sourceOffset = $this->sourceOffset(); $targetOffset = $this->targetOffset(); $r = array(); $p = array(); $i = 0; $offset = $sourceOffset; while( $offset < $targetOffset ){ $r[$i] = array( 'id' => '', 'source' => '', 'target' => '' ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $src = $this->bytes( $idx, $len ); $eot = strpos( $src, "\x04" ); if( false !== $eot ){ $r[$i]['context'] = $this->decodeStr( substr($src, 0, $eot ) ); $src = substr( $src, $eot+1 ); } $nul = strpos( $src, "\0" ); if( false !== $nul ){ $p[$i][1] = array( 'id' => '', 'source' => substr($src, $nul+1 ), 'target' => '', 'parent' => $i, 'plural' => 1 ); $src = substr( $src, 0, $nul ); } $r[$i++]['source'] = $this->decodeStr($src); $offset += 8; } $t = $i; $offset = $targetOffset; for( $i = 0; $i < $t; $i++ ){ $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false !== strpos( $txt, "\0" ) ){ $arr = explode( "\0", $txt ); $txt = array_shift( $arr ); if( isset($p[$i][1]) ){ foreach( $arr as $_i => $plural_txt ){ $plural_idx = $_i + 1; $p[$i][$plural_idx]['target'] = $this->decodeStr($plural_txt); } } else if( '' === implode('',$arr) ){ } else { throw new LocoParseException('plural has no corresponding msgid_plural at '.$i); } } $r[$i]['target'] = $this->decodeStr($txt); $offset += 8; } foreach( $p as $parent_id => $plurals ){ foreach( $plurals as $plural_idx => $msg ){ if( 1 < $plural_idx ){ $msg['source'] = $plurals[1]['source'].' (plural '.$plural_idx.')'; } $msg['parent'] = $parent_id; $msg['plural'] = $plural_idx; $r[] = $msg; } } return $r; } public function isBigendian(){ while( is_null($this->be) ){ $str = $this->words( 0, 2 ); $arr = unpack('V', $str); if( 0x950412de === $arr[1] ){ $this->be = false; break; } if( 0xde120495 === $arr[1] ){ $this->be = true; break; } throw new LocoParseException('Invalid MO format'); } return $this->be; } public function version(){ if( is_null($this->v) ){ $this->v = $this->integerWord(1); } return $this->v; } public function count(){ if( is_null($this->n) ){ $this->n = $this->integerWord(2); } return $this->n; } public function sourceOffset(){ if( is_null($this->o) ){ $this->o = $this->integerWord(3); } return $this->o; } public function targetOffset(){ if( is_null($this->t) ){ $this->t = $this->integerWord(4); } return $this->t; } public function getHashTable(){ $s = $this->integerWord(5); $h = $this->integerWord(6); return $this->bytes( $h, $s * 4 ); } private function bytes( $offset, $length ){ return substr( $this->bin, $offset, $length ); } private function words( $offset, $length ){ return $this->bytes( $offset * 4, $length * 4 ); } private function integerWord( $offset ){ return $this->integerAt( $offset * 4 ); } private function integerAt( $offset ){ $str = $this->bytes( $offset, 4 ); $fmt = $this->isBigendian() ? 'N' : 'V'; $arr = unpack( $fmt, $str ); if( ! isset($arr[1]) || ! is_int($arr[1]) ){ throw new LocoParseException('Failed to read 32 bit integer at byte '.$offset); } return $arr[1]; } private function decodeStr( $str ){ $enc = mb_detect_encoding( $str, array('ASCII','UTF-8','ISO-8859-1'), false ); if( $enc && $enc !== 'ASCII' && $enc !== 'UTF-8' ){ $str = iconv( $enc, 'UTF-8', $str ); } return $str; } } function loco_parse_mo( $src ){ $mo = new LocoMoParser($src); return $mo->parse(); } class LocoPHPTokens implements Iterator { private $tokens; private $i; private $skip_tokens = array(); private $skip_strings = array(); private $literal_tokens = array(); public function __construct( array $tokens ){ $this->tokens = $tokens; $this->rewind(); } public function literal(){ foreach( func_get_args() as $t ){ $this->literal_tokens[ $t ] = 1; } return $this; } public function ignore(){ foreach( func_get_args() as $t ){ if( is_int($t) ){ $this->skip_tokens[$t] = true; } else { $this->skip_strings[$t] = true; } } return $this; } public function export(){ $arr = array(); foreach( $this as $tok ){ $arr[] = $tok; } return $arr; } public function advance(){ $this->next(); return $this->current(); } public function pop(){ $tok = array_pop( $this->tokens ); $this->rewind(); return $tok; } public function shift(){ $tok = array_shift( $this->tokens); $this->rewind(); return $tok; } public function rewind(){ $this->i = ( false === reset($this->tokens) ? null : key($this->tokens) ); } public function valid(){ while( isset($this->i) ){ $tok = $this->tokens[$this->i]; if( is_array($tok) ){ if( isset($this->skip_tokens[$tok[0]]) ){ $this->next(); } else { return true; } } else if( isset($this->skip_strings[$tok]) ){ $this->next(); } else { return true; } } return false; } public function key(){ return $this->i; } public function next(){ $this->i = ( false === next($this->tokens) ? null : key($this->tokens) ); } public function current(){ if( ! $this->valid() ){ return false; } $tok = $this->tokens[$this->i]; if( is_array($tok) && isset($this->literal_tokens[$tok[0]]) ){ return $tok[1]; } return $tok; } public function __toString(){ $s = ''; foreach( $this as $token ){ $s .= is_array($token) ? $token[1] : $token; } return $s; } } function loco_parse_comment($comment){ if( '*' === $comment{1} ){ $lines = array(); foreach( explode("\n", $comment) as $line ){ $line and $lines[] = trim($line,"/* \r\t"); } $comment = implode("\n", $lines); } return trim( $comment,"/ \n\r\t" ); } function loco_parse_wp_comment( $block ){ $header = array(); if( '*' === $block{1} ){ foreach( explode("\n", $block) as $line ){ if( false !== ( $i = strpos($line,':') ) ){ $key = substr($line,0,$i); $val = substr($line,++$i); $header[ trim($key,"/* \r\t") ] = trim($val,"/* \r\t"); } } } return $header; } function loco_decapse_php_string( $s ){ if( ! $s ){ return ''; } $q = $s{0}; if( "'" === $q ){ return str_replace( array( '\\'.$q, '\\\\' ), array( $q, '\\' ), substr( $s, 1, -1 ) ); } if( '"' !== $q ){ return $s; } $s = substr( $s, 1, -1 ); $a = ''; $e = false; $symbols = array ( 'n' => "\x0A", 'r' => "\x0D", 't' => "\x09", 'v' => "\x0B", 'f' => "\x0C", 'e' => "\x1B", '$' => '$', '\\' => '\\', '"' => '"', ); foreach( explode('\\', $s) as $i => $t ){ if( '' === $t ){ if( $e ){ $a .= '\\'; } $e = ! $e; continue; } if( $e ){ $c = $t{0}; while( true ){ if( 'x' === $c || 'X' === $c ){ if( preg_match('/^x([0-9a-f]{1,2})/i', $t, $n ) ){ $c = chr( intval( $n[1], 16 ) ); $n = strlen($n[0]); break; } } else if( isset($symbols[$c]) ){ $c = $symbols[$c]; $n = 1; break; } else if( is_numeric($c) && preg_match('/^[0-7]{1,3}/', $t, $n ) ){ $c = chr( intval( $n[0], 8 ) ); $n = strlen($n[0]); break; } $a .= '\\'.$t; continue 2; } $a .= substr_replace( $t, $c, 0, $n ); continue; } $a .= $t; $e = true; } return $a; } function loco_extract_php( array $tokens, $fileref = '' ){ $extractor = new LocoPHPExtractor; return $extractor ->set_wp_theme() ->set_wp_plugin() ->extract( $tokens, $fileref ); } final class LocoPHPExtractor { private static $rules = array ( '_' => 's', 'gettext' => 's', 'dgettext' => '_s', 'ngettext' => 'sp', 'dngettext' => '_sp', '__' => 's', '_e' => 's', '_c' => 's', '_n' => 'sp', '_n_noop' => 'sp', '_nc' => 'sp', '__ngettext' => 'sp', '__ngettext_noop' => 'sp', '_x' => 'sc', '_ex' => 'sc', '_nx' => 'sp_c', '_nx_noop' => 'spc', '_n_js' => 'sp', '_nx_js' => 'spc', 'esc_attr__' => 's', 'esc_html__' => 's', 'esc_attr_e' => 's', 'esc_html_e' => 's', 'esc_attr_x' => 'sc', 'esc_html_x' => 'sc', 'comments_number_link' => '_sp', 't' => 's', 'st' => 's', 'trans' => 's', 'transChoice' => 'sp', ); private $exp = array(); private $reg = array(); private $wp = array(); public function set_wp_theme(){ return $this->headerize( array( 'Template Name' => 'Name of the template', ) ); } public function set_wp_plugin(){ return $this->headerize( array( 'Plugin Name' => 'Name of the plugin', 'Description' => 'Description of the plugin', 'Plugin URI' => 'URI of the plugin', 'Author' => 'Author of the plugin', 'Author URI' => 'Author URI of the plugin', ) ); } public function headerize( array $tags ){ $this->wp += $tags; return $this; } public function extract( array $tokens, $fileref = '' ){ $tokens = new LocoPHPTokens( $tokens ); $tokens->ignore( T_WHITESPACE ); $n = 0; $comment = ''; foreach( $tokens as $tok ){ if( isset($args) ){ if( ')' === $tok ){ if( 0 === --$depth ){ isset($arg) and $arg and $args[] = $arg; $this->push( $rule, $args, $comment, $ref ); unset($args,$arg); $comment = ''; $n++; } } else if( '(' === $tok ){ $depth++; } else if( ',' === $tok ){ isset($arg) and $arg and $args[] = $arg; unset($arg); } else if( isset($arg) ){ $arg[] = $tok; } else { $arg = array( $tok ); } } else if( is_array($tok) ){ list($t,$s) = $tok; if( T_COMMENT === $t || T_DOC_COMMENT === $t ){ if( $this->wp && 0 === $n && ( $header = loco_parse_wp_comment($s) ) ){ $this->pushHeader( $header ); } else { $comment = $s; } } else if( T_STRING === $t && isset(self::$rules[$s]) && '(' === $tokens->advance() ){ $rule = self::$rules[$s]; $args = array(); $ref = $fileref ? $fileref.':'.$tok[2]: ''; $depth = 1; } else if( $comment ){ if( false === stripos($comment, 'translators') ){ $comment = ''; } } } } return $this->exp; } private function pushHeader( array $header ){ $id = $target = ''; foreach( array_intersect_key($header,$this->wp) as $tag => $source ){ $notes = $this->wp[$tag]; $this->exp[] = compact('id','source','target','notes'); } } private function push( $rule, array $args, $comment = '', $ref = '' ){ $s = strpos( $rule, 's'); $p = strpos( $rule, 'p'); $c = strpos( $rule, 'c'); foreach( $args as $i => $tokens ){ if( 1 === count($tokens) && is_array($tokens[0]) && T_CONSTANT_ENCAPSED_STRING === $tokens[0][0] ){ $args[$i] = loco_decapse_php_string( $tokens[0][1] ); } else { $args[$i] = null; } } $key = $msgid = $args[$s]; if( ! $msgid ){ return null; } $entry = array ( 'id' => '', 'source' => $msgid, 'target' => '', ); if( $c && isset($args[$c]) ){ $entry['context'] = $args[$c]; $key .= "\0". $args[$c]; } if( $ref ){ $entry['refs'] = $ref; } $parse_printf = true; if( $comment ){ if( preg_match('/xgettext:\s*((?:no-)?\w+)-format/', $comment, $r ) ){ if( 'no-' === substr($r[1],0,3) ){ $entry['format'] = false; } else { $entry['format'] = $r[1]; } $comment = str_replace( $r[0], '', $comment ); $parse_printf = false; } $entry['notes'] = loco_parse_comment($comment); } if( $parse_printf && loco_sniff_printf( $msgid ) ){ $entry['format'] = 'php'; $parse_printf = false; } if( isset($this->reg[$key]) ){ $index = $this->reg[$key]; $a = array(); isset($this->exp[$index]['refs']) and $a[] = $this->exp[$index]['refs']; isset($entry['refs']) and $a[] = $entry['refs']; $a && $this->exp[$index]['refs'] = implode(" ", $a ); $a = array(); isset($this->exp[$index]['notes']) and $a[] = $this->exp[$index]['notes']; isset($entry['notes']) and $a[] = $entry['notes']; $a && $this->exp[$index]['notes'] = implode("\n", $a ); } else { $index = count($this->exp); $this->reg[$key] = $index; $this->exp[] = $entry; } if( $p && isset($args[$p]) ){ $msgid_plural = $args[$p]; $entry = array ( 'id' => '', 'source' => $msgid_plural, 'target' => '', 'plural' => 1, 'parent' => $index, ); if( $parse_printf && loco_sniff_printf( $msgid_plural ) ){ $this->exp[$index]['format'] = 'php'; } $key = $msgid_plural."\0\0"; if( isset($this->reg[$key]) ){ $plural_index = $this->reg[$key]; $this->exp[$plural_index] = $entry; } else { $plural_index = count($this->exp); $this->reg[$key] = $plural_index; $this->exp[] = $entry; } } return $index; } public function get_xgettext( $input = '-' ){ $cmd = defined('WHICH_XGETTEXT') ? WHICH_XGETTEXT : 'xgettext'; $cmd.= ' -LPHP -c -o-'; if( $k = $this->get_xgettext_keywords() ){ $cmd.= ' -k'.implode(' -k', $k ); } return $cmd.' '.$input; } public function get_xgettext_keywords(){ $ks = array(); foreach( self::$rules as $word => $rule ){ $s = strpos( $rule, 's'); $k = $word.':'.++$s; if( false !== $p = strpos( $rule, 'p') ){ $k.= ','.++$p; } if( false !== $p = strpos( $rule, 'c') ){ $k.= ','.++$p.'c'; } $ks[] = $k; } return $ks; } } function loco_relative_path( $source_path, $target_path ){ $rel = ''; $common = false; $src = preg_split('!/+!', $source_path, -1, PREG_SPLIT_NO_EMPTY ); $dst = preg_split('!/+!', $target_path, -1, PREG_SPLIT_NO_EMPTY ); while( $src && $dst ){ if( current($src) !== current($dst) ){ break; } $common = true; array_shift($src); array_shift($dst); } if( ! $common ){ return $target_path; } if( $src ){ $up = array_fill( 0, count($src), '..' ); $rel = implode('/', $up ); } if( $dst ){ $rel && $rel .= '/'; $rel .= implode('/', $dst ); } return $rel; } define( 'LOCO_FLAG_ALL', -2 ); define( 'LOCO_FLAG_UNTRANSLATED', -1 ); define( 'LOCO_FLAG_TRANSLATED', 0 ); define( 'LOCO_FLAG_INCORRECT', 1 ); define( 'LOCO_FLAG_PROVISIONAL', 2 ); define( 'LOCO_FLAG_UNAPPROVED', 3 ); define( 'LOCO_FLAG_FUZZY', 4 ); define( 'LOCO_FLAG_INCOMPLETE', 5 ); function loco_flags(){ static $flags = array( LOCO_FLAG_TRANSLATED => 'Translated', LOCO_FLAG_INCORRECT => 'Incorrect', LOCO_FLAG_PROVISIONAL => 'Provisional', LOCO_FLAG_UNAPPROVED => 'Unapproved', LOCO_FLAG_FUZZY => 'Fuzzy', LOCO_FLAG_INCOMPLETE => 'Incomplete', ); return $flags; } function loco_status_flags(){ static $flags = array( LOCO_FLAG_UNTRANSLATED => 'Untranslated', LOCO_FLAG_ALL => 'All', ); return $flags; } function loco_flag( $f ){ if( 0 > $f ){ $flags = loco_status_flags(); } else { $flags = loco_flags(); } if( ! isset($flags[$f]) ){ throw new Exception('Invalid LOCO_FLAG_ constant '. json_encode($f) ); } return $flags[$f]; } function loco_flag_integer( $f ){ if( is_numeric($f) ){ $f = (int) $f; } else { $f = 'LOCO_FLAG_'.strtoupper($f); if( defined($f) ){ $f = constant($f); } else { $f = -3; } } if( $f > 5 || $f < -2 ){ throw new InvalidArgumentException('Unknown flag, '.json_encode(func_get_arg(0))); } return $f; } class LocoMo { private $bin; private $msgs; private $head; private $hash; private $use_fuzzy = false; public function __construct( Iterator $export, Iterator $head = null ){ if( $head ){ $this->head = $head; } else { $this->head = new LocoHeaders( array ( 'Project-Id-Version' => 'Loco', 'Language' => 'English', 'Plural-Forms' => 'nplurals=2; plural=(n!=1);', 'MIME-Version' => '1.0', 'Content-Type' => 'text/plain; charset=UTF-8', 'Content-Transfer-Encoding' => '8bit', 'X-Generator' => 'Loco '.PLUG_HTTP_ADDR, ) ); } $this->msgs = $export; $this->bin = ''; } public function enableHash(){ return $this->hash = new LocoMoTable; } public function useFuzzy(){ $this->use_fuzzy = true; } public function setHeader( $key, $val ){ $this->head->add($key, $val); return $this; } public function setProject( LocoProject $Proj ){ return $this ->setHeader( 'Project-Id-Version', $Proj->proj_name ) ->setHeader($key, $val) ; } public function setLocale( LocoProjectLocale $Loc ){ return $this ->setHeader( 'Language', $Loc->label ) ->setHeader( 'Plural-Forms', 'nplurals='.$Loc->nplurals.'; plural='.$Loc->pluraleq.';' ) ; } public function count(){ return count($this->msgs); } public function compile(){ $table = array(''); $sources = array(''); $targets = array( $this->head->__toString() ); foreach( $this->msgs as $r ){ if( isset($r['flag']) && LOCO_FLAG_FUZZY === $r['flag'] && ! $this->use_fuzzy ){ continue; } $msgid = $r['key']; if( isset($r['context']) && $r['context'] ){ $msgid or $msgid = "(".$r['context'].')'; $msgid = $r['context']."\x04".$msgid; } if( ! $msgid ){ continue; } $msgstr = $r['target']; if( ! $msgstr ){ continue; } $table[] = $msgid; if( isset($r['plurals']) ){ foreach( $r['plurals'] as $i => $p ){ if( $i === 0 ){ $msgid .= "\0".$p['key']; } $msgstr .= "\0".$p['target']; } } $sources[] = $msgid; $targets[] = $msgstr; } asort( $sources, SORT_STRING ); $this->bin = ''; $this->writeInteger( 0x950412de ); $this->writeInteger( 0 ); $n = count($sources); $this->writeInteger( $n ); $offset = 28; $this->writeInteger( $offset ); $offset += $n * 8; $this->writeInteger( $offset ); if( $this->hash ){ sort( $table, SORT_STRING ); $this->hash->compile( $table ); $s = $this->hash->count(); } else { $s = 0; } $this->writeInteger( $s ); $offset += $n * 8; $this->writeInteger( $offset ); if( $s ){ $offset += $s * 4; } $source = ''; foreach( $sources as $i => $str ){ $source .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } $target = ''; foreach( array_keys($sources) as $i ){ $str = $targets[$i]; $target .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } if( $this->hash ){ $this->bin .= $this->hash->__toString(); } $this->bin .= $source; $this->bin .= $target; return $this->bin; } private function writeInteger( $num ){ $this->bin .= pack( 'V', $num ); return $this; } } class LocoMoTable { private $size = 0; private $bin = ''; private $map; public function __construct( $data = null ){ if( is_array($data) ){ $this->compile( $data ); } else if( $data ){ $this->parse( $data ); } } public function count(){ if( ! isset($this->size) ){ if( $this->bin ){ $this->size = (int) ( strlen( $this->bin ) / 4 ); } else if( is_array($this->map) ){ $this->size = count($this->map); } else { return 0; } if( ! self::is_prime($this->size) || $this->size < 3 ){ throw new Exception('Size expected to be prime number above 2, got '.$this->size); } } return $this->size; } public function bytes(){ return $this->count() * 4; } public function __toString(){ return $this->bin; } public function export(){ if( ! is_array($this->map) ){ $this->parse( $this->bin ); } return $this->map; } private function reset( $length ){ $this->size = max( 3, self::next_prime ( $length * 4 / 3 ) ); $this->bin = null; $this->map = array(); return $this->size; } public function compile( array $msgids ){ $hash_tab_size = $this->reset( count($msgids) ); $packed = array_fill( 0, $hash_tab_size, "\0\0\0\0" ); $j = 0; foreach( $msgids as $msgid ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $hash_tab_size; if( array_key_exists($idx, $this->map) ){ $incr = 1 + ( $hash_val % ( $hash_tab_size - 2 ) ); do { $idx += $incr; if( $hash_val === $idx ){ throw new Exception('Unable to find empty slot in hash table'); } $idx %= $hash_tab_size; } while( array_key_exists($idx, $this->map ) ); } $this->map[$idx] = $j; $packed[$idx] = pack('V', ++$j ); } return $this->bin = implode('',$packed); } public function lookup( $msgid, array $msgids ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $this->size; $incr = 1 + ( $hash_val % ( $this->size - 2 ) ); while( true ){ if( ! array_key_exists($idx, $this->map) ){ break; } $j = $this->map[$idx]; if( isset($msgids[$j]) && $msgid === $msgids[$j] ){ return $j; } $idx += $incr; if( $idx === $hash_val ){ break; } $idx %= $this->size; } return -1; } public function parse( $bin ){ $this->bin = (string) $bin; $this->size = null; $hash_tab_size = $this->count(); $this->map = array(); $idx = -1; $byte = 0; while( ++$idx < $hash_tab_size ){ $word = substr( $this->bin, $byte, 4 ); if( "\0\0\0\0" !== $word ){ list(,$j) = unpack('V', $word ); $this->map[$idx] = $j - 1; } $byte += 4; } return $this->map; } public static function hashpjw( $str ){ $i = -1; $hval = 0; $len = strlen($str); while( ++$i < $len ){ $ord = ord( $str{$i} ); $hval = ( $hval << 4 ) + $ord; $g = $hval & 0xf0000000; if( $g !== 0 ){ $hval ^= $g >> 24; $hval ^= $g; } } return $hval; } private static function next_prime( $seed ){ $seed |= 1; while ( ! self::is_prime($seed) ){ $seed += 2; } return $seed; } private static function is_prime( $num ) { if ($num === 1 ){ return false; } if( $num === 2 ){ return true; } if( $num % 2 == 0 ) { return false; } for( $i = 3; $i <= ceil(sqrt($num)); $i = $i + 2) { if($num % $i == 0 ){ return false; } } return true; } } function loco_msgfmt( $po, $withhash = false, $usefuzzy = false ){ if( ! is_array($po) ){ $po = loco_parse_po( $po ); } $head = null; if( isset($po[0]) && '' === $po[0]['source'] ){ $head = loco_parse_po_headers( $po[0]['target'] ); $po[0] = null; } $export = new ArrayIterator; foreach( $po as $i => $r ){ if( ! $r ){ continue; } $msg = array ( 'key' => $r['source'], 'target' => $r['target'], 'flag' => isset($r['flag']) ? $r['flag'] : 0, ); if( isset($r['parent']) ){ unset( $parent ); $parent = &$export[ $r['parent'] ]; isset($parent['plurals']) or $parent['plurals'] = array(); $parent['plurals'][] = $msg; } else { isset($r['context']) and $msg['context'] = $r['context']; $export[$i] = $msg; } } $mo = new LocoMo( $export, $head ); if( $withhash ){ $mo->enableHash(); } if( $usefuzzy ){ $mo->useFuzzy(); } return $mo->compile(); } function loco_po_stats( array $po ){ $t = $n = $f = $u = 0; foreach( $po as $r ){ if( ! isset($r['source']) || '' === $r['source'] ){ continue; } if( isset($r['parent']) && is_int($r['parent']) ){ continue; } $t++; if( '' === $r['target'] ){ $u++; } else if( isset($r['flag']) && LOCO_FLAG_FUZZY === $r['flag'] ){ $f++; } else { $n++; } } $r = $t && $n ? $n / $t : 0; $p = (string) round( $r * 100 ); return compact('t','p','f','u'); }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/build/locales-compiled.php
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Compiled source built from Loco core. Do not edit!
|
| 4 |
-
* Mon, 07 Sep 2015 11:46:08 +0100
|
| 5 |
-
*/
|
| 6 |
-
function loco_language_country( $lang ){ static $a; if( ! isset($a) ){ $a = unserialize('a:80:{s:2:"af";s:2:"ZA";s:2:"ar";s:2:"AE";s:2:"az";s:2:"AZ";s:2:"bg";s:2:"BG";s:2:"bn";s:2:"BD";s:2:"bs";s:2:"BA";s:2:"ca";s:2:"ES";s:2:"cs";s:2:"CZ";s:2:"cy";s:2:"GB";s:2:"da";s:2:"DK";s:2:"de";s:2:"DE";s:2:"el";s:2:"GR";s:2:"en";s:2:"GB";s:2:"es";s:2:"ES";s:2:"et";s:2:"EE";s:2:"fa";s:2:"AF";s:2:"fi";s:2:"FI";s:2:"fo";s:2:"FO";s:2:"fr";s:2:"FR";s:2:"ga";s:2:"IE";s:2:"gl";s:2:"ES";s:2:"gn";s:2:"PY";s:2:"he";s:2:"IL";s:2:"hi";s:2:"IN";s:2:"hr";s:2:"HR";s:2:"ht";s:2:"HT";s:2:"hu";s:2:"HU";s:2:"hy";s:2:"AM";s:2:"id";s:2:"ID";s:2:"is";s:2:"IS";s:2:"it";s:2:"IT";s:2:"ja";s:2:"JP";s:2:"jv";s:2:"ID";s:2:"ka";s:2:"GE";s:2:"kk";s:2:"KZ";s:2:"kn";s:2:"IN";s:2:"ko";s:2:"KR";s:2:"lb";s:2:"LU";s:2:"li";s:2:"NL";s:2:"lo";s:2:"LA";s:2:"lt";s:2:"LT";s:2:"lv";s:2:"LV";s:2:"mg";s:2:"MG";s:2:"ms";s:2:"MY";s:2:"mt";s:2:"MT";s:2:"my";s:2:"MM";s:2:"nb";s:2:"NO";s:2:"ne";s:2:"NP";s:2:"nl";s:2:"NL";s:2:"nn";s:2:"NO";s:2:"no";s:2:"NO";s:2:"os";s:2:"RU";s:2:"pa";s:2:"IN";s:2:"pl";s:2:"PL";s:2:"pt";s:2:"PT";s:2:"ro";s:2:"RO";s:2:"ru";s:2:"RU";s:2:"sa";s:2:"IN";s:2:"sc";s:2:"IT";s:2:"sd";s:2:"PK";s:2:"si";s:2:"LK";s:2:"sk";s:2:"SK";s:2:"sl";s:2:"SI";s:2:"so";s:2:"SO";s:2:"sq";s:2:"AL";s:2:"sr";s:2:"RS";s:2:"su";s:2:"ID";s:2:"sv";s:2:"SE";s:2:"sw";s:2:"KE";s:2:"ta";s:2:"IN";s:2:"te";s:2:"IN";s:2:"tg";s:2:"TJ";s:2:"th";s:2:"TH";s:2:"tr";s:2:"TR";s:2:"ug";s:2:"CN";s:2:"uk";s:2:"UA";s:2:"ur";s:2:"IN";s:2:"uz";s:2:"UZ";s:2:"vi";s:2:"VN";s:2:"zh";s:2:"CN";}'); } if( isset($a[$lang]) ){ return $a[$lang]; } return ''; } return unserialize('a:3:{s:7:"locales";a:120:{s:2:"af";a:1:{s:0:"";s:9:"Afrikaans";}s:2:"ak";a:1:{s:0:"";s:4:"Akan";}s:2:"sq";a:1:{s:0:"";s:8:"Albanian";}s:2:"am";a:1:{s:0:"";s:7:"Amharic";}s:2:"ar";a:1:{s:0:"";s:6:"Arabic";}s:2:"hy";a:1:{s:0:"";s:8:"Armenian";}s:3:"rup";a:1:{s:2:"MK";s:9:"Aromanian";}s:2:"as";a:1:{s:0:"";s:8:"Assamese";}s:2:"az";a:2:{s:0:"";s:11:"Azerbaijani";s:2:"TR";s:20:"Azerbaijani (Turkey)";}s:2:"ba";a:1:{s:0:"";s:7:"Bashkir";}s:2:"eu";a:1:{s:0:"";s:6:"Basque";}s:3:"bel";a:1:{s:0:"";s:10:"Belarusian";}s:2:"bn";a:1:{s:2:"BD";s:7:"Bengali";}s:2:"bs";a:1:{s:2:"BA";s:7:"Bosnian";}s:2:"bg";a:1:{s:2:"BG";s:9:"Bulgarian";}s:2:"my";a:1:{s:2:"MM";s:7:"Burmese";}s:2:"ca";a:1:{s:0:"";s:7:"Catalan";}s:3:"bal";a:1:{s:0:"";s:16:"Catalan (Balear)";}s:2:"zh";a:3:{s:2:"CN";s:15:"Chinese (China)";s:2:"HK";s:19:"Chinese (Hong Kong)";s:2:"TW";s:16:"Chinese (Taiwan)";}s:2:"co";a:1:{s:0:"";s:8:"Corsican";}s:2:"hr";a:1:{s:0:"";s:8:"Croatian";}s:2:"cs";a:1:{s:2:"CZ";s:5:"Czech";}s:2:"da";a:1:{s:2:"DK";s:6:"Danish";}s:2:"dv";a:1:{s:0:"";s:7:"Dhivehi";}s:2:"nl";a:2:{s:2:"NL";s:5:"Dutch";s:2:"BE";s:15:"Dutch (Belgium)";}s:2:"en";a:4:{s:2:"US";s:7:"English";s:2:"AU";s:19:"English (Australia)";s:2:"CA";s:16:"English (Canada)";s:2:"GB";s:12:"English (UK)";}s:2:"eo";a:1:{s:0:"";s:9:"Esperanto";}s:2:"et";a:1:{s:0:"";s:8:"Estonian";}s:2:"fo";a:1:{s:0:"";s:7:"Faroese";}s:2:"fi";a:1:{s:0:"";s:7:"Finnish";}s:2:"fr";a:2:{s:2:"BE";s:16:"French (Belgium)";s:2:"FR";s:15:"French (France)";}s:2:"fy";a:1:{s:0:"";s:7:"Frisian";}s:3:"fuc";a:1:{s:0:"";s:5:"Fulah";}s:2:"gl";a:1:{s:2:"ES";s:8:"Galician";}s:2:"ka";a:1:{s:2:"GE";s:8:"Georgian";}s:2:"de";a:2:{s:2:"DE";s:6:"German";s:2:"CH";s:20:"German (Switzerland)";}s:2:"el";a:1:{s:0:"";s:5:"Greek";}s:2:"gn";a:1:{s:0:"";s:8:"Guaraní";}s:2:"gu";a:1:{s:2:"IN";s:8:"Gujarati";}s:3:"haw";a:1:{s:2:"US";s:8:"Hawaiian";}s:3:"haz";a:1:{s:0:"";s:8:"Hazaragi";}s:2:"he";a:1:{s:2:"IL";s:6:"Hebrew";}s:2:"hi";a:1:{s:2:"IN";s:5:"Hindi";}s:2:"hu";a:1:{s:2:"HU";s:9:"Hungarian";}s:2:"is";a:1:{s:2:"IS";s:9:"Icelandic";}s:3:"ido";a:1:{s:0:"";s:3:"Ido";}s:2:"id";a:1:{s:2:"ID";s:10:"Indonesian";}s:2:"ga";a:1:{s:0:"";s:5:"Irish";}s:2:"it";a:1:{s:2:"IT";s:7:"Italian";}s:2:"ja";a:1:{s:0:"";s:8:"Japanese";}s:2:"jv";a:1:{s:2:"ID";s:8:"Javanese";}s:2:"kn";a:1:{s:0:"";s:7:"Kannada";}s:2:"kk";a:1:{s:0:"";s:6:"Kazakh";}s:2:"km";a:1:{s:0:"";s:5:"Khmer";}s:3:"kin";a:1:{s:0:"";s:11:"Kinyarwanda";}s:2:"ky";a:1:{s:2:"KY";s:7:"Kirghiz";}s:2:"ko";a:1:{s:2:"KR";s:6:"Korean";}s:3:"ckb";a:1:{s:0:"";s:16:"Kurdish (Sorani)";}s:2:"lo";a:1:{s:0:"";s:3:"Lao";}s:2:"lv";a:1:{s:0:"";s:7:"Latvian";}s:2:"li";a:1:{s:0:"";s:10:"Limburgish";}s:3:"lin";a:1:{s:0:"";s:7:"Lingala";}s:2:"lt";a:1:{s:2:"LT";s:10:"Lithuanian";}s:2:"lb";a:1:{s:2:"LU";s:13:"Luxembourgish";}s:2:"mk";a:1:{s:2:"MK";s:10:"Macedonian";}s:2:"mg";a:1:{s:2:"MG";s:8:"Malagasy";}s:2:"ms";a:1:{s:2:"MY";s:5:"Malay";}s:2:"ml";a:1:{s:2:"IN";s:9:"Malayalam";}s:2:"mr";a:1:{s:0:"";s:7:"Marathi";}s:3:"xmf";a:1:{s:0:"";s:10:"Mingrelian";}s:2:"mn";a:1:{s:0:"";s:9:"Mongolian";}s:2:"me";a:1:{s:2:"ME";s:11:"Montenegrin";}s:2:"ne";a:1:{s:2:"NP";s:6:"Nepali";}s:2:"nb";a:1:{s:2:"NO";s:19:"Norwegian (Bokmål)";}s:2:"nn";a:1:{s:2:"NO";s:19:"Norwegian (Nynorsk)";}s:3:"ory";a:1:{s:0:"";s:5:"Oriya";}s:2:"os";a:1:{s:0:"";s:7:"Ossetic";}s:2:"ps";a:1:{s:0:"";s:6:"Pashto";}s:2:"fa";a:2:{s:2:"IR";s:7:"Persian";s:2:"AF";s:21:"Persian (Afghanistan)";}s:2:"pl";a:1:{s:2:"PL";s:6:"Polish";}s:2:"pt";a:2:{s:2:"BR";s:19:"Portuguese (Brazil)";s:2:"PT";s:21:"Portuguese (Portugal)";}s:2:"pa";a:1:{s:2:"IN";s:7:"Punjabi";}s:3:"rhg";a:1:{s:0:"";s:8:"Rohingya";}s:2:"ro";a:1:{s:2:"RO";s:8:"Romanian";}s:2:"ru";a:2:{s:2:"RU";s:7:"Russian";s:2:"UA";s:17:"Russian (Ukraine)";}s:3:"rue";a:1:{s:0:"";s:5:"Rusyn";}s:3:"sah";a:1:{s:0:"";s:5:"Sakha";}s:2:"sa";a:1:{s:2:"IN";s:8:"Sanskrit";}s:3:"srd";a:1:{s:0:"";s:9:"Sardinian";}s:2:"gd";a:1:{s:0:"";s:15:"Scottish Gaelic";}s:2:"sr";a:1:{s:2:"RS";s:7:"Serbian";}s:2:"sd";a:1:{s:2:"PK";s:6:"Sindhi";}s:2:"si";a:1:{s:2:"LK";s:7:"Sinhala";}s:2:"sk";a:1:{s:2:"SK";s:6:"Slovak";}s:2:"sl";a:1:{s:2:"SI";s:9:"Slovenian";}s:2:"so";a:1:{s:2:"SO";s:6:"Somali";}s:3:"azb";a:1:{s:0:"";s:17:"South Azerbaijani";}s:2:"es";a:8:{s:2:"AR";s:19:"Spanish (Argentina)";s:2:"CL";s:15:"Spanish (Chile)";s:2:"CO";s:18:"Spanish (Colombia)";s:2:"MX";s:16:"Spanish (Mexico)";s:2:"PE";s:14:"Spanish (Peru)";s:2:"PR";s:21:"Spanish (Puerto Rico)";s:2:"ES";s:15:"Spanish (Spain)";s:2:"VE";s:19:"Spanish (Venezuela)";}s:2:"su";a:1:{s:2:"ID";s:9:"Sundanese";}s:2:"sw";a:1:{s:0:"";s:7:"Swahili";}s:2:"sv";a:1:{s:2:"SE";s:7:"Swedish";}s:3:"gsw";a:1:{s:0:"";s:12:"Swiss German";}s:2:"tl";a:1:{s:0:"";s:7:"Tagalog";}s:2:"tg";a:1:{s:0:"";s:5:"Tajik";}s:3:"tzm";a:1:{s:0:"";s:25:"Tamazight (Central Atlas)";}s:2:"ta";a:2:{s:2:"IN";s:5:"Tamil";s:2:"LK";s:17:"Tamil (Sri Lanka)";}s:2:"tt";a:1:{s:2:"RU";s:5:"Tatar";}s:2:"te";a:1:{s:0:"";s:6:"Telugu";}s:2:"th";a:1:{s:0:"";s:4:"Thai";}s:2:"bo";a:1:{s:0:"";s:7:"Tibetan";}s:3:"tir";a:1:{s:0:"";s:8:"Tigrinya";}s:2:"tr";a:1:{s:2:"TR";s:7:"Turkish";}s:3:"tuk";a:1:{s:0:"";s:7:"Turkmen";}s:2:"ug";a:1:{s:2:"CN";s:6:"Uighur";}s:2:"uk";a:1:{s:0:"";s:9:"Ukrainian";}s:2:"ur";a:1:{s:0:"";s:4:"Urdu";}s:2:"uz";a:1:{s:2:"UZ";s:5:"Uzbek";}s:2:"vi";a:1:{s:0:"";s:10:"Vietnamese";}s:2:"wa";a:1:{s:0:"";s:7:"Walloon";}s:2:"cy";a:1:{s:0:"";s:5:"Welsh";}}s:5:"langs";a:190:{s:2:"ab";a:3:{i:0;s:9:"Abkhazian";i:1;s:0:"";i:2;a:0:{}}s:2:"aa";a:3:{i:0;s:4:"Afar";i:1;s:0:"";i:2;a:0:{}}s:2:"af";a:3:{i:0;s:9:"Afrikaans";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ak";a:3:{i:0;s:4:"Akan";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"sq";a:3:{i:0;s:8:"Albanian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:3:"gsw";a:3:{i:0;s:21:"Alemani; Swiss German";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"am";a:3:{i:0;s:7:"Amharic";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ar";a:3:{i:0;s:6:"Arabic";i:1;s:95:"n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n%100 >= 3 && n%100<=10 ? 3 : n%100 >= 11 && n%100<=99 ? 4 : 5";i:2;a:6:{i:0;s:4:"zero";i:1;s:3:"one";i:2;s:3:"two";i:3;s:3:"few";i:4;s:4:"many";i:5;s:5:"other";}}s:2:"an";a:3:{i:0;s:9:"Aragonese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"hy";a:3:{i:0;s:8:"Armenian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:3:"rup";a:3:{i:0;s:37:"Aromanian; Arumanian; Macedo-Romanian";i:1;s:0:"";i:2;a:0:{}}s:2:"as";a:3:{i:0;s:8:"Assamese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"av";a:3:{i:0;s:6:"Avaric";i:1;s:0:"";i:2;a:0:{}}s:2:"ae";a:3:{i:0;s:7:"Avestan";i:1;s:0:"";i:2;a:0:{}}s:2:"ay";a:3:{i:0;s:6:"Aymara";i:1;s:0:"";i:2;a:0:{}}s:2:"az";a:3:{i:0;s:11:"Azerbaijani";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:3:"bal";a:3:{i:0;s:7:"Baluchi";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"bm";a:3:{i:0;s:7:"Bambara";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ba";a:3:{i:0;s:7:"Bashkir";i:1;s:0:"";i:2;a:0:{}}s:2:"eu";a:3:{i:0;s:6:"Basque";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"be";a:3:{i:0;s:10:"Belarusian";i:1;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"bn";a:3:{i:0;s:7:"Bengali";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"bh";a:3:{i:0;s:6:"Bihari";i:1;s:28:"( n >= 0 && n <= 1 ) ? 0 : 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"bi";a:3:{i:0;s:7:"Bislama";i:1;s:0:"";i:2;a:0:{}}s:2:"bs";a:3:{i:0;s:7:"Bosnian";i:1;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"br";a:3:{i:0;s:6:"Breton";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"bg";a:3:{i:0;s:9:"Bulgarian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"my";a:3:{i:0;s:7:"Burmese";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ca";a:3:{i:0;s:18:"Catalan; Valencian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ch";a:3:{i:0;s:8:"Chamorro";i:1;s:0:"";i:2;a:0:{}}s:2:"ce";a:3:{i:0;s:7:"Chechen";i:1;s:0:"";i:2;a:0:{}}s:2:"ny";a:3:{i:0;s:23:"Chichewa; Chewa; Nyanja";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"zh";a:3:{i:0;s:7:"Chinese";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"cu";a:3:{i:0;s:64:"Church Slavic; Old Slavonic; Church Slavonic; Old Bulgarian; Old";i:1;s:0:"";i:2;a:0:{}}s:2:"cv";a:3:{i:0;s:7:"Chuvash";i:1;s:0:"";i:2;a:0:{}}s:2:"kw";a:3:{i:0;s:7:"Cornish";i:1;s:27:"n == 1 ? 0 : n == 2 ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:5:"other";}}s:2:"co";a:3:{i:0;s:8:"Corsican";i:1;s:0:"";i:2;a:0:{}}s:2:"cr";a:3:{i:0;s:4:"Cree";i:1;s:0:"";i:2;a:0:{}}s:2:"hr";a:3:{i:0;s:8:"Croatian";i:1;s:80:"n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"cs";a:3:{i:0;s:5:"Czech";i:1;s:45:"( n == 1 ) ? 0 : ( n >= 2 && n <= 4 ) ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"da";a:3:{i:0;s:6:"Danish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"dv";a:3:{i:0;s:26:"Divehi; Dhivehi; Maldivian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"nl";a:3:{i:0;s:14:"Dutch; Flemish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"dz";a:3:{i:0;s:8:"Dzongkha";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"en";a:3:{i:0;s:7:"English";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"eo";a:3:{i:0;s:9:"Esperanto";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"et";a:3:{i:0;s:8:"Estonian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ee";a:3:{i:0;s:3:"Ewe";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"fo";a:3:{i:0;s:7:"Faroese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"fj";a:3:{i:0;s:6:"Fijian";i:1;s:0:"";i:2;a:0:{}}s:2:"fi";a:3:{i:0;s:7:"Finnish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"fr";a:3:{i:0;s:6:"French";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ff";a:3:{i:0;s:5:"Fulah";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"gd";a:3:{i:0;s:23:"Gaelic; Scottish Gaelic";i:1;s:26:"n < 2 ? 0 : n == 2 ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:5:"other";}}s:2:"gl";a:3:{i:0;s:8:"Galician";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"lg";a:3:{i:0;s:5:"Ganda";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ka";a:3:{i:0;s:8:"Georgian";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"de";a:3:{i:0;s:6:"German";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"el";a:3:{i:0;s:5:"Greek";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"gn";a:3:{i:0;s:7:"Guarani";i:1;s:0:"";i:2;a:0:{}}s:2:"gu";a:3:{i:0;s:8:"Gujarati";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ht";a:3:{i:0;s:23:"Haitian; Haitian Creole";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ha";a:3:{i:0;s:5:"Hausa";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:3:"haw";a:3:{i:0;s:8:"Hawaiian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"he";a:3:{i:0;s:6:"Hebrew";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"hz";a:3:{i:0;s:6:"Herero";i:1;s:0:"";i:2;a:0:{}}s:2:"hi";a:3:{i:0;s:5:"Hindi";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ho";a:3:{i:0;s:9:"Hiri Motu";i:1;s:0:"";i:2;a:0:{}}s:2:"hu";a:3:{i:0;s:9:"Hungarian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"is";a:3:{i:0;s:9:"Icelandic";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"io";a:3:{i:0;s:3:"Ido";i:1;s:0:"";i:2;a:0:{}}s:2:"ig";a:3:{i:0;s:4:"Igbo";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"id";a:3:{i:0;s:10:"Indonesian";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ia";a:3:{i:0;s:58:"Interlingua (International Auxiliary Language Association)";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ie";a:3:{i:0;s:11:"Interlingue";i:1;s:0:"";i:2;a:0:{}}s:2:"iu";a:3:{i:0;s:9:"Inuktitut";i:1;s:27:"n == 1 ? 0 : n == 2 ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:5:"other";}}s:2:"ik";a:3:{i:0;s:7:"Inupiaq";i:1;s:0:"";i:2;a:0:{}}s:2:"ga";a:3:{i:0;s:5:"Irish";i:1;s:44:"n==1 ? 0 : n==2 ? 1 : n<7 ? 2 : n<11 ? 3 : 4";i:2;a:5:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:4:"many";i:4;s:5:"other";}}s:2:"it";a:3:{i:0;s:7:"Italian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ja";a:3:{i:0;s:8:"Japanese";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"jv";a:3:{i:0;s:8:"Javanese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"kl";a:3:{i:0;s:24:"Kalaallisut; Greenlandic";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"kn";a:3:{i:0;s:7:"Kannada";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"kr";a:3:{i:0;s:6:"Kanuri";i:1;s:0:"";i:2;a:0:{}}s:2:"ks";a:3:{i:0;s:8:"Kashmiri";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"kk";a:3:{i:0;s:6:"Kazakh";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"km";a:3:{i:0;s:5:"Khmer";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ki";a:3:{i:0;s:14:"Kikuyu; Gikuyu";i:1;s:0:"";i:2;a:0:{}}s:2:"rw";a:3:{i:0;s:11:"Kinyarwanda";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ky";a:3:{i:0;s:7:"Kirghiz";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"kv";a:3:{i:0;s:4:"Komi";i:1;s:0:"";i:2;a:0:{}}s:2:"kg";a:3:{i:0;s:5:"Kongo";i:1;s:0:"";i:2;a:0:{}}s:2:"ko";a:3:{i:0;s:6:"Korean";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"kj";a:3:{i:0;s:18:"Kuanyama; Kwanyama";i:1;s:0:"";i:2;a:0:{}}s:2:"ku";a:3:{i:0;s:7:"Kurdish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"lo";a:3:{i:0;s:3:"Lao";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"la";a:3:{i:0;s:5:"Latin";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"lv";a:3:{i:0;s:7:"Latvian";i:1;s:49:"n % 10 == 1 && n % 100 != 11 ? 0 : n != 0 ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:5:"other";i:2;s:4:"zero";}}s:2:"li";a:3:{i:0;s:32:"Limburgan; Limburger; Limburgish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ln";a:3:{i:0;s:7:"Lingala";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"lt";a:3:{i:0;s:10:"Lithuanian";i:1;s:71:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"lu";a:3:{i:0;s:12:"Luba-Katanga";i:1;s:0:"";i:2;a:0:{}}s:2:"lb";a:3:{i:0;s:28:"Luxembourgish; Letzeburgesch";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"mk";a:3:{i:0;s:10:"Macedonian";i:1;s:40:"( n % 10 == 1 && n % 100 != 11 ) ? 0 : 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"mg";a:3:{i:0;s:8:"Malagasy";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ms";a:3:{i:0;s:5:"Malay";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ml";a:3:{i:0;s:9:"Malayalam";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"mt";a:3:{i:0;s:7:"Maltese";i:1;s:75:"(n==1 ? 0 : n==0||( n%100>1 && n%100<11)? 1 :(n%100>10 && n%100<20)? 2 : 3)";i:2;a:4:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:4:"many";i:3;s:5:"other";}}s:2:"gv";a:3:{i:0;s:4:"Manx";i:1;s:43:"n%10==1 ? 0 : n%10==2 ? 1 : n%20==0 ? 2 : 3";i:2;a:4:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:5:"other";}}s:2:"mi";a:3:{i:0;s:5:"Maori";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"mr";a:3:{i:0;s:7:"Marathi";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"mh";a:3:{i:0;s:11:"Marshallese";i:1;s:0:"";i:2;a:0:{}}s:2:"mo";a:3:{i:0;s:9:"Moldavian";i:1;s:50:"n == 1 ? 0 : n % 100 >= 1 && n % 100 <= 19 ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"mn";a:3:{i:0;s:9:"Mongolian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"na";a:3:{i:0;s:5:"Nauru";i:1;s:0:"";i:2;a:0:{}}s:2:"nv";a:3:{i:0;s:14:"Navajo; Navaho";i:1;s:0:"";i:2;a:0:{}}s:2:"nd";a:3:{i:0;s:29:"Ndebele, North; North Ndebele";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"nr";a:3:{i:0;s:29:"Ndebele, South; South Ndebele";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ng";a:3:{i:0;s:6:"Ndonga";i:1;s:0:"";i:2;a:0:{}}s:2:"ne";a:3:{i:0;s:6:"Nepali";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"se";a:3:{i:0;s:13:"Northern Sami";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"no";a:3:{i:0;s:9:"Norwegian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"nb";a:3:{i:0;s:17:"Norwegian Bokmål";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"nn";a:3:{i:0;s:17:"Norwegian Nynorsk";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"oc";a:3:{i:0;s:31:"Occitan (post 1500); Provençal";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"oj";a:3:{i:0;s:6:"Ojibwa";i:1;s:0:"";i:2;a:0:{}}s:2:"or";a:3:{i:0;s:5:"Oriya";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"om";a:3:{i:0;s:5:"Oromo";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"os";a:3:{i:0;s:17:"Ossetian; Ossetic";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"pi";a:3:{i:0;s:4:"Pali";i:1;s:0:"";i:2;a:0:{}}s:2:"pa";a:3:{i:0;s:16:"Panjabi; Punjabi";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"fa";a:3:{i:0;s:7:"Persian";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"pl";a:3:{i:0;s:6:"Polish";i:1;s:66:"(n==1 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"pt";a:3:{i:0;s:10:"Portuguese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ps";a:3:{i:0;s:6:"Pushto";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"qu";a:3:{i:0;s:7:"Quechua";i:1;s:0:"";i:2;a:0:{}}s:2:"rm";a:3:{i:0;s:13:"Raeto-Romance";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ro";a:3:{i:0;s:8:"Romanian";i:1;s:56:"(n==1 ? 0 :(((n%100>19)||(( n%100==0)&&(n!=0)))? 2 : 1))";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"rn";a:3:{i:0;s:5:"Rundi";i:1;s:0:"";i:2;a:0:{}}s:2:"ru";a:3:{i:0;s:7:"Russian";i:1;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"sm";a:3:{i:0;s:6:"Samoan";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"sg";a:3:{i:0;s:5:"Sango";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"sa";a:3:{i:0;s:8:"Sanskrit";i:1;s:0:"";i:2;a:0:{}}s:2:"sc";a:3:{i:0;s:9:"Sardinian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"sr";a:3:{i:0;s:7:"Serbian";i:1;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"sn";a:3:{i:0;s:5:"Shona";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ii";a:3:{i:0;s:10:"Sichuan Yi";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"sd";a:3:{i:0;s:6:"Sindhi";i:1;s:0:"";i:2;a:0:{}}s:2:"si";a:3:{i:0;s:18:"Sinhala; Sinhalese";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"sk";a:3:{i:0;s:6:"Slovak";i:1;s:45:"( n == 1 ) ? 0 : ( n >= 2 && n <= 4 ) ? 1 : 2";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"sl";a:3:{i:0;s:9:"Slovenian";i:1;s:56:"n%100==1 ? 0 : n%100==2 ? 1 : n%100==3||n%100==4 ? 2 : 3";i:2;a:4:{i:0;s:3:"one";i:1;s:3:"two";i:2;s:3:"few";i:3;s:5:"other";}}s:2:"so";a:3:{i:0;s:6:"Somali";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"st";a:3:{i:0;s:15:"Sotho, Southern";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"es";a:3:{i:0;s:7:"Spanish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"su";a:3:{i:0;s:9:"Sundanese";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"sw";a:3:{i:0;s:7:"Swahili";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ss";a:3:{i:0;s:5:"Swati";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"sv";a:3:{i:0;s:7:"Swedish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"tl";a:3:{i:0;s:7:"Tagalog";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ty";a:3:{i:0;s:8:"Tahitian";i:1;s:0:"";i:2;a:0:{}}s:2:"tg";a:3:{i:0;s:5:"Tajik";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ta";a:3:{i:0;s:5:"Tamil";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"tt";a:3:{i:0;s:5:"Tatar";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"te";a:3:{i:0;s:6:"Telugu";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"th";a:3:{i:0;s:4:"Thai";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"bo";a:3:{i:0;s:7:"Tibetan";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ti";a:3:{i:0;s:8:"Tigrinya";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"to";a:3:{i:0;s:21:"Tonga (Tonga Islands)";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"ts";a:3:{i:0;s:6:"Tsonga";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"tn";a:3:{i:0;s:6:"Tswana";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"tr";a:3:{i:0;s:7:"Turkish";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"tk";a:3:{i:0;s:7:"Turkmen";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"tw";a:3:{i:0;s:3:"Twi";i:1;s:0:"";i:2;a:0:{}}s:2:"ug";a:3:{i:0;s:14:"Uighur; Uyghur";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"uk";a:3:{i:0;s:9:"Ukrainian";i:1;s:82:"(n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2)";i:2;a:3:{i:0;s:3:"one";i:1;s:3:"few";i:2;s:5:"other";}}s:2:"ur";a:3:{i:0;s:4:"Urdu";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"uz";a:3:{i:0;s:5:"Uzbek";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"ve";a:3:{i:0;s:5:"Venda";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"vi";a:3:{i:0;s:10:"Vietnamese";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"vo";a:3:{i:0;s:8:"Volapük";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"wa";a:3:{i:0;s:7:"Walloon";i:1;s:5:"n > 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"cy";a:3:{i:0;s:5:"Welsh";i:1;s:56:"n==0 ? 0 : n==1 ? 1 : n==2 ? 2 : n==3 ? 3 : n==6 ? 4 : 5";i:2;a:6:{i:0;s:4:"zero";i:1;s:3:"one";i:2;s:3:"two";i:3;s:3:"few";i:4;s:4:"many";i:5;s:5:"other";}}s:2:"fy";a:3:{i:0;s:15:"Western Frisian";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"wo";a:3:{i:0;s:5:"Wolof";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"xh";a:3:{i:0;s:5:"Xhosa";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:3:"sah";a:3:{i:0;s:5:"Yakut";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"yi";a:3:{i:0;s:7:"Yiddish";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}s:2:"yo";a:3:{i:0;s:6:"Yoruba";i:1;s:1:"0";i:2;a:1:{i:0;s:5:"other";}}s:2:"za";a:3:{i:0;s:14:"Zhuang; Chuang";i:1;s:0:"";i:2;a:0:{}}s:2:"zu";a:3:{i:0;s:4:"Zulu";i:1;s:6:"n != 1";i:2;a:2:{i:0;s:3:"one";i:1;s:5:"other";}}}s:7:"regions";a:249:{s:2:"AF";s:11:"Afghanistan";s:2:"AX";s:14:"Åland Islands";s:2:"AL";s:7:"Albania";s:2:"DZ";s:7:"Algeria";s:2:"AS";s:14:"American Samoa";s:2:"AD";s:7:"Andorra";s:2:"AO";s:6:"Angola";s:2:"AI";s:8:"Anguilla";s:2:"AQ";s:10:"Antarctica";s:2:"AG";s:19:"Antigua and Barbuda";s:2:"AR";s:9:"Argentina";s:2:"AM";s:7:"Armenia";s:2:"AW";s:5:"Aruba";s:2:"AU";s:9:"Australia";s:2:"AT";s:7:"Austria";s:2:"AZ";s:10:"Azerbaijan";s:2:"BS";s:7:"Bahamas";s:2:"BH";s:7:"Bahrain";s:2:"BD";s:10:"Bangladesh";s:2:"BB";s:8:"Barbados";s:2:"BY";s:7:"Belarus";s:2:"BE";s:7:"Belgium";s:2:"BZ";s:6:"Belize";s:2:"BJ";s:5:"Benin";s:2:"BM";s:7:"Bermuda";s:2:"BT";s:6:"Bhutan";s:2:"BO";s:31:"Bolivia, Plurinational State of";s:2:"BQ";s:32:"Bonaire, Sint Eustatius and Saba";s:2:"BA";s:22:"Bosnia and Herzegovina";s:2:"BW";s:8:"Botswana";s:2:"BV";s:13:"Bouvet Island";s:2:"BR";s:6:"Brazil";s:2:"IO";s:30:"British Indian Ocean Territory";s:2:"BN";s:17:"Brunei Darussalam";s:2:"BG";s:8:"Bulgaria";s:2:"BF";s:12:"Burkina Faso";s:2:"BI";s:7:"Burundi";s:2:"KH";s:8:"Cambodia";s:2:"CM";s:8:"Cameroon";s:2:"CA";s:6:"Canada";s:2:"CV";s:10:"Cape Verde";s:2:"KY";s:14:"Cayman Islands";s:2:"CF";s:24:"Central African Republic";s:2:"TD";s:4:"Chad";s:2:"CL";s:5:"Chile";s:2:"CN";s:5:"China";s:2:"CX";s:16:"Christmas Island";s:2:"CC";s:23:"Cocos (Keeling) Islands";s:2:"CO";s:8:"Colombia";s:2:"KM";s:7:"Comoros";s:2:"CG";s:5:"Congo";s:2:"CD";s:37:"Congo, The Democratic Republic of The";s:2:"CK";s:12:"Cook Islands";s:2:"CR";s:10:"Costa Rica";s:2:"CI";s:14:"Côte D\'Ivoire";s:2:"HR";s:7:"Croatia";s:2:"CU";s:4:"Cuba";s:2:"CW";s:8:"Curaçao";s:2:"CY";s:6:"Cyprus";s:2:"CZ";s:14:"Czech Republic";s:2:"DK";s:7:"Denmark";s:2:"DJ";s:8:"Djibouti";s:2:"DM";s:8:"Dominica";s:2:"DO";s:18:"Dominican Republic";s:2:"EC";s:7:"Ecuador";s:2:"EG";s:5:"Egypt";s:2:"SV";s:11:"El Salvador";s:2:"GQ";s:17:"Equatorial Guinea";s:2:"ER";s:7:"Eritrea";s:2:"EE";s:7:"Estonia";s:2:"ET";s:8:"Ethiopia";s:2:"FK";s:27:"Falkland Islands (Malvinas)";s:2:"FO";s:13:"Faroe Islands";s:2:"FJ";s:4:"Fiji";s:2:"FI";s:7:"Finland";s:2:"FR";s:6:"France";s:2:"GF";s:13:"French Guiana";s:2:"PF";s:16:"French Polynesia";s:2:"TF";s:27:"French Southern Territories";s:2:"GA";s:5:"Gabon";s:2:"GM";s:6:"Gambia";s:2:"GE";s:7:"Georgia";s:2:"DE";s:7:"Germany";s:2:"GH";s:5:"Ghana";s:2:"GI";s:9:"Gibraltar";s:2:"GR";s:6:"Greece";s:2:"GL";s:9:"Greenland";s:2:"GD";s:7:"Grenada";s:2:"GP";s:10:"Guadeloupe";s:2:"GU";s:4:"Guam";s:2:"GT";s:9:"Guatemala";s:2:"GG";s:8:"Guernsey";s:2:"GN";s:6:"Guinea";s:2:"GW";s:13:"Guinea-Bissau";s:2:"GY";s:6:"Guyana";s:2:"HT";s:5:"Haiti";s:2:"HM";s:33:"Heard Island and Mcdonald Islands";s:2:"VA";s:29:"Holy See (Vatican City State)";s:2:"HN";s:8:"Honduras";s:2:"HK";s:9:"Hong Kong";s:2:"HU";s:7:"Hungary";s:2:"IS";s:7:"Iceland";s:2:"IN";s:5:"India";s:2:"ID";s:9:"Indonesia";s:2:"IR";s:25:"Iran, Islamic Republic of";s:2:"IQ";s:4:"Iraq";s:2:"IE";s:7:"Ireland";s:2:"IM";s:11:"Isle of Man";s:2:"IL";s:6:"Israel";s:2:"IT";s:5:"Italy";s:2:"JM";s:7:"Jamaica";s:2:"JP";s:5:"Japan";s:2:"JE";s:6:"Jersey";s:2:"JO";s:6:"Jordan";s:2:"KZ";s:10:"Kazakhstan";s:2:"KE";s:5:"Kenya";s:2:"KI";s:8:"Kiribati";s:2:"KP";s:38:"Korea, Democratic People\'s Republic of";s:2:"KR";s:18:"Korea, Republic of";s:2:"KW";s:6:"Kuwait";s:2:"KG";s:10:"Kyrgyzstan";s:2:"LA";s:32:"Lao People\'s Democratic Republic";s:2:"LV";s:6:"Latvia";s:2:"LB";s:7:"Lebanon";s:2:"LS";s:7:"Lesotho";s:2:"LR";s:7:"Liberia";s:2:"LY";s:5:"Libya";s:2:"LI";s:13:"Liechtenstein";s:2:"LT";s:9:"Lithuania";s:2:"LU";s:10:"Luxembourg";s:2:"MO";s:5:"Macao";s:2:"MK";s:42:"Macedonia, The Former Yugoslav Republic of";s:2:"MG";s:10:"Madagascar";s:2:"MW";s:6:"Malawi";s:2:"MY";s:8:"Malaysia";s:2:"MV";s:8:"Maldives";s:2:"ML";s:4:"Mali";s:2:"MT";s:5:"Malta";s:2:"MH";s:16:"Marshall Islands";s:2:"MQ";s:10:"Martinique";s:2:"MR";s:10:"Mauritania";s:2:"MU";s:9:"Mauritius";s:2:"YT";s:7:"Mayotte";s:2:"MX";s:6:"Mexico";s:2:"FM";s:31:"Micronesia, Federated States of";s:2:"MD";s:20:"Moldova, Republic of";s:2:"MC";s:6:"Monaco";s:2:"MN";s:8:"Mongolia";s:2:"ME";s:10:"Montenegro";s:2:"MS";s:10:"Montserrat";s:2:"MA";s:7:"Morocco";s:2:"MZ";s:10:"Mozambique";s:2:"MM";s:7:"Myanmar";s:2:"NA";s:7:"Namibia";s:2:"NR";s:5:"Nauru";s:2:"NP";s:5:"Nepal";s:2:"NL";s:11:"Netherlands";s:2:"NC";s:13:"New Caledonia";s:2:"NZ";s:11:"New Zealand";s:2:"NI";s:9:"Nicaragua";s:2:"NE";s:5:"Niger";s:2:"NG";s:7:"Nigeria";s:2:"NU";s:4:"Niue";s:2:"NF";s:14:"Norfolk Island";s:2:"MP";s:24:"Northern Mariana Islands";s:2:"NO";s:6:"Norway";s:2:"OM";s:4:"Oman";s:2:"PK";s:8:"Pakistan";s:2:"PW";s:5:"Palau";s:2:"PS";s:31:"Palestinian Territory, Occupied";s:2:"PA";s:6:"Panama";s:2:"PG";s:16:"Papua New Guinea";s:2:"PY";s:8:"Paraguay";s:2:"PE";s:4:"Peru";s:2:"PH";s:11:"Philippines";s:2:"PN";s:8:"Pitcairn";s:2:"PL";s:6:"Poland";s:2:"PT";s:8:"Portugal";s:2:"PR";s:11:"Puerto Rico";s:2:"QA";s:5:"Qatar";s:2:"RE";s:8:"Réunion";s:2:"RO";s:7:"Romania";s:2:"RU";s:18:"Russian Federation";s:2:"RW";s:6:"Rwanda";s:2:"BL";s:17:"Saint Barthélemy";s:2:"SH";s:44:"Saint Helena, Ascension and Tristan Da Cunha";s:2:"KN";s:21:"Saint Kitts and Nevis";s:2:"LC";s:11:"Saint Lucia";s:2:"MF";s:26:"Saint Martin (French Part)";s:2:"PM";s:25:"Saint Pierre and Miquelon";s:2:"VC";s:32:"Saint Vincent and The Grenadines";s:2:"WS";s:5:"Samoa";s:2:"SM";s:10:"San Marino";s:2:"ST";s:21:"Sao Tome and Principe";s:2:"SA";s:12:"Saudi Arabia";s:2:"SN";s:7:"Senegal";s:2:"RS";s:6:"Serbia";s:2:"SC";s:10:"Seychelles";s:2:"SL";s:12:"Sierra Leone";s:2:"SG";s:9:"Singapore";s:2:"SX";s:25:"Sint Maarten (Dutch Part)";s:2:"SK";s:8:"Slovakia";s:2:"SI";s:8:"Slovenia";s:2:"SB";s:15:"Solomon Islands";s:2:"SO";s:7:"Somalia";s:2:"ZA";s:12:"South Africa";s:2:"GS";s:44:"South Georgia and The South Sandwich Islands";s:2:"SS";s:11:"South Sudan";s:2:"ES";s:5:"Spain";s:2:"LK";s:9:"Sri Lanka";s:2:"SD";s:5:"Sudan";s:2:"SR";s:8:"Suriname";s:2:"SJ";s:22:"Svalbard and Jan Mayen";s:2:"SZ";s:9:"Swaziland";s:2:"SE";s:6:"Sweden";s:2:"CH";s:11:"Switzerland";s:2:"SY";s:20:"Syrian Arab Republic";s:2:"TW";s:25:"Taiwan, Province of China";s:2:"TJ";s:10:"Tajikistan";s:2:"TZ";s:28:"Tanzania, United Republic of";s:2:"TH";s:8:"Thailand";s:2:"TL";s:11:"Timor-Leste";s:2:"TG";s:4:"Togo";s:2:"TK";s:7:"Tokelau";s:2:"TO";s:5:"Tonga";s:2:"TT";s:19:"Trinidad and Tobago";s:2:"TN";s:7:"Tunisia";s:2:"TR";s:6:"Turkey";s:2:"TM";s:12:"Turkmenistan";s:2:"TC";s:24:"Turks and Caicos Islands";s:2:"TV";s:6:"Tuvalu";s:2:"UG";s:6:"Uganda";s:2:"UA";s:7:"Ukraine";s:2:"AE";s:20:"United Arab Emirates";s:2:"GB";s:14:"United Kingdom";s:2:"US";s:13:"United States";s:2:"UM";s:36:"United States Minor Outlying Islands";s:2:"UY";s:7:"Uruguay";s:2:"UZ";s:10:"Uzbekistan";s:2:"VU";s:7:"Vanuatu";s:2:"VE";s:33:"Venezuela, Bolivarian Republic of";s:2:"VN";s:8:"Viet Nam";s:2:"VG";s:23:"Virgin Islands, British";s:2:"VI";s:20:"Virgin Islands, U.S.";s:2:"WF";s:17:"Wallis and Futuna";s:2:"EH";s:14:"Western Sahara";s:2:"YE";s:5:"Yemen";s:2:"ZM";s:6:"Zambia";s:2:"ZW";s:8:"Zimbabwe";}}');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/build/shell-compiled.php
DELETED
|
@@ -1,6 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Compiled source built from Loco core. Do not edit!
|
| 4 |
-
* Mon, 07 Sep 2015 11:46:08 +0100
|
| 5 |
-
*/
|
| 6 |
-
function loco_compile_mo( $po, $withhash = false, $usefuzzy = false ){ $descriptorspec = array( 0 => array('pipe', 'r'), 1 => array('pipe', 'w'), 2 => array('pipe', 'a'), ); $cmd = WHICH_MSGFMT; if( ! $withhash ){ $cmd .= ' --no-hash'; } if( $usefuzzy ){ $cmd .= ' --use-fuzzy'; } $process = proc_open($cmd.' -o - -', $descriptorspec, $pipes ); if( ! $process ){ throw new Exception('Failed to open process to '.$cmd); } fwrite($pipes[0], $po); fclose($pipes[0]); $err = stream_get_contents($pipes[2]); fclose($pipes[2]); $mo = stream_get_contents($pipes[1]); fclose($pipes[1]); $e = proc_close($process); if( 0 !== $e ){ $err and trigger_error( $err, E_USER_WARNING ); throw new Exception( WHICH_MSGFMT.' exited with code '.sprintf('%d',$e).'; Got '.strlen($mo).' bytes from '.strlen($po).' bytes'); } if( ! $mo ){ throw new Exception('Empty file from '.WHICH_MSGFMT); } return $mo; } function loco_compile_mo_file( $pofile, $mofile = '', $withhash = false, $usefuzzy = false ){ $descriptorspec = array ( 0 => array('pipe', 'r'), 1 => array('pipe', 'w'), 2 => array('pipe', 'a'), ); $cmd = WHICH_MSGFMT; if( ! $withhash ){ $cmd .= ' --no-hash'; } if( $usefuzzy ){ $cmd .= ' --use-fuzzy'; } if( ! $mofile ){ $mofile = $pofile.'.mo'; } $cmd .= ' -o '.escapeshellarg($mofile).' '.escapeshellarg($pofile); $process = proc_open( $cmd, $descriptorspec, $pipes ); if( ! $process ){ throw new Exception('Failed to open process to '.$cmd); } $err = stream_get_contents($pipes[0]); fclose($pipes[0]); $e = proc_close($process); if( 0 !== $e ){ $err and trigger_error( $err, E_USER_WARNING ); throw new Exception('Gettext msgfmt exited with code '.sprintf('%d',$e).';'); } if( ! file_exists($mofile) ){ throw new Exception('Gettext msgfmt failed to create '.$mofile); } return $mofile; } function loco_find_executable( $name ){ $paths = array ( '/usr/local/', '/usr/', '/', '~/' ); $descriptorspec = array ( 0 => array('pipe', 'r'), 1 => array('pipe', 'w'), 2 => array('pipe', 'w'), ); foreach( array('bin/','sbin/') as $dir ){ foreach( $paths as $path ){ $bin = $path.$dir.$name; $cmd = '[ -x '.escapeshellarg($bin).' ]'; $process = proc_open( $cmd, $descriptorspec, $pipes ); if( ! $process ){ return ''; } $e = proc_close($process); if( 0 === $e ){ return $bin; } } } return ''; }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/compat/loco-iconv.php
DELETED
|
@@ -1,22 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Polyfiller for missing PHP iconv extension.
|
| 4 |
-
* Simply avoids fatal errors. Doesn't attempt to really replace the functionality
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
function loco_compat_iconv( $in_charset, $out_charset, $str ){
|
| 9 |
-
return $str;
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
if( ! extension_loaded('iconv') && WP_DEBUG && ( ! defined('DOING_AJAX') || ! DOING_AJAX ) ){
|
| 13 |
-
LocoAdmin::warning( sprintf( __('PHP extension "%s" is not installed. If you experience problems you should install it','loco-legacy'), 'iconv' ) );
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
if( ! function_exists('iconv') ){
|
| 17 |
-
function iconv( $in_charset = '', $out_charset = '', $str = '' ){
|
| 18 |
-
return loco_compat_iconv( $in_charset, $out_charset, $str );
|
| 19 |
-
}
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/compat/loco-json.php
DELETED
|
@@ -1,20 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Polyfiller for missing PHP json extension.
|
| 4 |
-
* Simply avoids fatal errors. Doesn't attempt to really replace the functionality
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
function loco_compat_json_encode( $value ){
|
| 9 |
-
return '{"error":{"code":-1,"message":"json extension is not installed"}}';
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
if( ! extension_loaded('json_encode') && WP_DEBUG && ( ! defined('DOING_AJAX') || ! DOING_AJAX ) ){
|
| 13 |
-
LocoAdmin::warning( sprintf( __('PHP extension "%s" is not installed. If you experience problems you should install it','loco-legacy'), 'json_encode' ) );
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
if( ! function_exists('json_encode') ){
|
| 17 |
-
function json_encode( $value = '' ){
|
| 18 |
-
return loco_compat_json_encode( $value );
|
| 19 |
-
}
|
| 20 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/compat/loco-mbstring.php
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Polyfiller for missing PHP mbstring extension.
|
| 4 |
-
* Simply avoids fatal errors. Doesn't attempt to really replace the functionality
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
function loco_compat_mb_detect_encoding( $str, array $encoding_list, $strict ){
|
| 9 |
-
return 'UTF-8';
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
if( ! extension_loaded('mbstring') && WP_DEBUG && ( ! defined('DOING_AJAX') || ! DOING_AJAX ) ){
|
| 13 |
-
LocoAdmin::warning( sprintf( __('PHP extension "%s" is not installed. If you experience problems you should install it','loco-legacy'), 'mbstring' ) );
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
if( ! function_exists('mb_detect_encoding') ){
|
| 17 |
-
function mb_detect_encoding( $str = '', array $encoding_list = array(), $strict = false ){
|
| 18 |
-
return loco_compat_mb_detect_encoding( $str, $encoding_list, $strict );
|
| 19 |
-
}
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
if( ! function_exists('mb_list_encodings') ){
|
| 23 |
-
function mb_list_encodings(){
|
| 24 |
-
return array('none');
|
| 25 |
-
}
|
| 26 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/compat/loco-php.php
DELETED
|
@@ -1,26 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Polyfiller for versions of PHP below 5.4.
|
| 4 |
-
* Cannot fix use of [array,literals] but can fudge some built in classes and interfaces
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* < 5.4
|
| 10 |
-
*/
|
| 11 |
-
if( ! interface_exists('JsonSerializable') ){
|
| 12 |
-
interface JsonSerializable {
|
| 13 |
-
public function jsonSerialize();
|
| 14 |
-
}
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
/**
|
| 19 |
-
* <= 5.0.5
|
| 20 |
-
*/
|
| 21 |
-
if( ! interface_exists('Countable') ){
|
| 22 |
-
interface Countable {
|
| 23 |
-
public function count();
|
| 24 |
-
}
|
| 25 |
-
}
|
| 26 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/compat/loco-tokenizer.php
DELETED
|
@@ -1,19 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Polyfiller for missing PHP tokenizer extension.
|
| 4 |
-
* Simply avoids fatal errors. Doesn't attempt to really replace the functionality
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
function loco_compat_token_get_all(){
|
| 8 |
-
return array();
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
if( ! extension_loaded('tokenizer') && WP_DEBUG && ( ! defined('DOING_AJAX') || ! DOING_AJAX ) ){
|
| 12 |
-
LocoAdmin::warning( sprintf( __('PHP extension "%s" is not installed. If you experience problems you should install it','loco-legacy'), 'tokenizer' ) );
|
| 13 |
-
}
|
| 14 |
-
|
| 15 |
-
if( ! function_exists('token_get_all') ){
|
| 16 |
-
function token_get_all(){
|
| 17 |
-
return loco_compat_token_get_all();
|
| 18 |
-
}
|
| 19 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/loco-admin.php
DELETED
|
@@ -1,1186 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Loco admin
|
| 4 |
-
*/
|
| 5 |
-
abstract class LocoAdmin {
|
| 6 |
-
|
| 7 |
-
/**
|
| 8 |
-
* Admin notices buffer
|
| 9 |
-
*/
|
| 10 |
-
private static $notices = array();
|
| 11 |
-
|
| 12 |
-
/**
|
| 13 |
-
* Flush admin notices buffer
|
| 14 |
-
*/
|
| 15 |
-
public static function flush_notices(){
|
| 16 |
-
while( $buffered = array_shift(self::$notices) ){
|
| 17 |
-
list( $func, $args ) = $buffered;
|
| 18 |
-
call_user_func_array( array(__CLASS__,$func), $args );
|
| 19 |
-
}
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
/**
|
| 24 |
-
* Print error
|
| 25 |
-
*/
|
| 26 |
-
public static function error( $message, $label = '' ){
|
| 27 |
-
if( defined('DOING_AJAX') && DOING_AJAX ){
|
| 28 |
-
throw new Exception( $message );
|
| 29 |
-
}
|
| 30 |
-
// Translators: Bold text label in admin error messages
|
| 31 |
-
$label or $label = _x('Error','Message label','loco-legacy');
|
| 32 |
-
echo '<div class="loco-message error loco-error"><p><strong>',$label,':</strong> ',Loco::html($message),'</p></div>';
|
| 33 |
-
}
|
| 34 |
-
|
| 35 |
-
|
| 36 |
-
/**
|
| 37 |
-
* Print warning notice
|
| 38 |
-
*/
|
| 39 |
-
public static function warning( $message, $label = '' ){
|
| 40 |
-
if( did_action('admin_notices') ){
|
| 41 |
-
$label or $label = _x('Warning','Message label','loco-legacy');
|
| 42 |
-
echo '<div class="loco-message error loco-warning"><p><strong>',$label,':</strong> ',Loco::html($message),'</p></div>';
|
| 43 |
-
}
|
| 44 |
-
else {
|
| 45 |
-
self::$notices[] = array( __FUNCTION__, func_get_args() );
|
| 46 |
-
}
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Print success
|
| 52 |
-
*/
|
| 53 |
-
public static function success( $message, $label = '' ){
|
| 54 |
-
$label or $label = _x('OK','Message label','loco-legacy');
|
| 55 |
-
echo '<div class="loco-message updated loco-success"><p><strong>',$label,':</strong> ',Loco::html($message),'</p></div>';
|
| 56 |
-
}
|
| 57 |
-
|
| 58 |
-
|
| 59 |
-
/**
|
| 60 |
-
* Exit forbidden
|
| 61 |
-
*/
|
| 62 |
-
private static function forbid(){
|
| 63 |
-
wp_die( __('Permission denied','loco-legacy'), 'Forbidden', array('response' => 403 ) );
|
| 64 |
-
trigger_error('wp_die failure', E_USER_ERROR );
|
| 65 |
-
exit();
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
|
| 69 |
-
/**
|
| 70 |
-
* Check current user has permission to access Loco admin screens, or exit forbidden
|
| 71 |
-
*/
|
| 72 |
-
private static function check_capability(){
|
| 73 |
-
current_user_can( Loco::admin_capablity() ) or self::forbid();
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
|
| 77 |
-
/**
|
| 78 |
-
* Admin settings page render call
|
| 79 |
-
*/
|
| 80 |
-
public static function render_page_options(){
|
| 81 |
-
self::check_capability();
|
| 82 |
-
// update application settings if posted
|
| 83 |
-
if( isset($_POST['loco']) && is_array( $update = $_POST['loco'] ) ){
|
| 84 |
-
$update += array( 'gen_hash' => '0', 'use_fuzzy' => '0', 'enable_core' => '0' );
|
| 85 |
-
$args = Loco::config( $update );
|
| 86 |
-
$args['success'] = __('Settings saved','loco-legacy');
|
| 87 |
-
}
|
| 88 |
-
else {
|
| 89 |
-
$args = Loco::config();
|
| 90 |
-
}
|
| 91 |
-
// establish a default msgfmt if required and possible
|
| 92 |
-
if( $args['use_msgfmt'] && ! $args['which_msgfmt'] ){
|
| 93 |
-
function_exists('loco_find_executable') or loco_require('build/shell-compiled');
|
| 94 |
-
$args['which_msgfmt'] = loco_find_executable('msgfmt');// and Loco::config( $args );
|
| 95 |
-
}
|
| 96 |
-
Loco::enqueue_scripts('build/admin-common');
|
| 97 |
-
Loco::render('admin-opts', $args );
|
| 98 |
-
}
|
| 99 |
-
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
/**
|
| 103 |
-
* Admin soft upgrade page
|
| 104 |
-
*/
|
| 105 |
-
public static function render_soft_upgrade(){
|
| 106 |
-
$args = array (
|
| 107 |
-
'home' => self::uri(),
|
| 108 |
-
'nonce' => wp_create_nonce('upgrade-v2'),
|
| 109 |
-
);
|
| 110 |
-
Loco::render('admin-upgrade', $args );
|
| 111 |
-
}
|
| 112 |
-
|
| 113 |
-
|
| 114 |
-
|
| 115 |
-
/**
|
| 116 |
-
* Admin tools page render call
|
| 117 |
-
*/
|
| 118 |
-
public static function render_page_tools(){
|
| 119 |
-
self::check_capability();
|
| 120 |
-
do {
|
| 121 |
-
try {
|
| 122 |
-
|
| 123 |
-
// libs required for all manage translation pages
|
| 124 |
-
loco_require('loco-locales','loco-packages');
|
| 125 |
-
|
| 126 |
-
// most actions except root listing define a single package by name and type
|
| 127 |
-
$package = null;
|
| 128 |
-
if( isset($_GET['name']) && isset($_GET['type']) ){
|
| 129 |
-
$package = LocoPackage::get( $_GET['name'], $_GET['type'] );
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
// Extract messages if 'xgettext' is in query string
|
| 133 |
-
//
|
| 134 |
-
if( isset($_GET['xgettext']) ){
|
| 135 |
-
$domain = $_GET['xgettext'];
|
| 136 |
-
if( $pot_path = $package->get_pot($domain) ){
|
| 137 |
-
throw new Exception('POT already exists at '.$pot_path );
|
| 138 |
-
}
|
| 139 |
-
// Establish best/intended location for new POT file
|
| 140 |
-
$dir = $package->lang_dir( $domain );
|
| 141 |
-
$pot_path = $dir.'/'.$domain.'.pot';
|
| 142 |
-
$export = self::xgettext( $package, $dir );
|
| 143 |
-
self::render_poeditor( $package, $pot_path, $export );
|
| 144 |
-
break;
|
| 145 |
-
}
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
// Initialize a new PO file if 'msginit' is in query string
|
| 149 |
-
//
|
| 150 |
-
if( isset($_GET['msginit']) ){
|
| 151 |
-
$domain = $_GET['msginit'];
|
| 152 |
-
$force_global = isset($_GET['gforce']) ? (bool) $_GET['gforce'] : null;
|
| 153 |
-
// handle PO file creation if locale is set
|
| 154 |
-
if( isset($_GET['custom-locale']) ){
|
| 155 |
-
try {
|
| 156 |
-
$locale = $_GET['custom-locale'] or $locale = $_GET['common-locale'];
|
| 157 |
-
$po_path = self::msginit( $package, $domain, $locale, $export, $head, $force_global );
|
| 158 |
-
if( $po_path ){
|
| 159 |
-
self::render_poeditor( $package, $po_path, $export, $head );
|
| 160 |
-
break;
|
| 161 |
-
}
|
| 162 |
-
}
|
| 163 |
-
catch( Exception $Ex ){
|
| 164 |
-
// fall through to msginit screen with error
|
| 165 |
-
self::error( $Ex->getMessage() );
|
| 166 |
-
}
|
| 167 |
-
}
|
| 168 |
-
// else do a dry run to pre-empt failures and allow manual alteration of target path
|
| 169 |
-
$path = self::msginit( $package, $domain, 'zz_ZZ', $export, $head, $force_global );
|
| 170 |
-
// get alternative location options
|
| 171 |
-
$pdir = $package->lang_dir( $domain, true );
|
| 172 |
-
$gdir = $package->global_lang_dir();
|
| 173 |
-
$pdir_ok = is_writeable($pdir);
|
| 174 |
-
$gdir_ok = is_writeable($gdir);
|
| 175 |
-
$is_global = $package->is_global_path( $path );
|
| 176 |
-
// warn about unwriteable locations?
|
| 177 |
-
|
| 178 |
-
// render msginit start screen
|
| 179 |
-
$title = __('New PO file','loco-legacy');
|
| 180 |
-
$locales = LocoLocale::get_names();
|
| 181 |
-
Loco::enqueue_scripts( 'build/admin-common', 'build/admin-poinit');
|
| 182 |
-
Loco::render('admin-poinit', compact('package','domain','title','locales','path','pdir','gdir','pdir_ok','gdir_ok','is_global') );
|
| 183 |
-
break;
|
| 184 |
-
}
|
| 185 |
-
|
| 186 |
-
|
| 187 |
-
// Render existing file in editor if 'poedit' contains a valid file path relative to content directory
|
| 188 |
-
//
|
| 189 |
-
if( isset($_GET['poedit']) && $po_path = self::resolve_path( $_GET['poedit'] ) ){
|
| 190 |
-
$export = self::parse_po_with_headers( $po_path, $head );
|
| 191 |
-
// support incorrect usage of PO files as templates
|
| 192 |
-
if( isset($_GET['pot']) && ! self::is_pot($po_path) ){
|
| 193 |
-
$po_path = dirname($po_path).'/'.$_GET['pot'].'.pot';
|
| 194 |
-
self::warning( sprintf( __('PO file used as template. This will be renamed to %s on first save','loco-legacy'), basename($po_path) ) );
|
| 195 |
-
}
|
| 196 |
-
self::render_poeditor( $package, $po_path, $export, $head );
|
| 197 |
-
break;
|
| 198 |
-
}
|
| 199 |
-
|
| 200 |
-
|
| 201 |
-
// Show filesystem check if 'fscheck' in query
|
| 202 |
-
//
|
| 203 |
-
if( isset($_GET['fscheck']) ){
|
| 204 |
-
$args = $package->meta() + compact('package');
|
| 205 |
-
Loco::enqueue_scripts('build/admin-common');
|
| 206 |
-
Loco::render('admin-fscheck', $args );
|
| 207 |
-
break;
|
| 208 |
-
}
|
| 209 |
-
|
| 210 |
-
|
| 211 |
-
}
|
| 212 |
-
catch( Exception $Ex ){
|
| 213 |
-
self::error( $Ex->getMessage() );
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
// default screen renders root page with available themes and plugins to translate
|
| 217 |
-
|
| 218 |
-
// @var WP_Theme $theme
|
| 219 |
-
$themes = array();
|
| 220 |
-
foreach( wp_get_themes( array( 'allowed' => true ) ) as $name => $theme ){
|
| 221 |
-
$package = LocoPackage::get( $name, 'theme' ) and
|
| 222 |
-
$name = $package->get_name();
|
| 223 |
-
$themes[ $name ] = $package;
|
| 224 |
-
}
|
| 225 |
-
// @var array $plugin
|
| 226 |
-
$plugins = array();
|
| 227 |
-
foreach( get_plugins() as $plugin_file => $plugin ){
|
| 228 |
-
$package = LocoPackage::get( $plugin_file, 'plugin' ) and
|
| 229 |
-
$plugins[] = $package;
|
| 230 |
-
}
|
| 231 |
-
// @var array $core
|
| 232 |
-
$core = array();
|
| 233 |
-
$conf = Loco::config();
|
| 234 |
-
if( ! empty($conf['enable_core']) ){
|
| 235 |
-
foreach( LocoPackage::get_core_packages() as $package ){
|
| 236 |
-
// if package has no PO or POT we skip it because core packages have no source
|
| 237 |
-
if( $package->get_po() || $package->get_pot() ){
|
| 238 |
-
$core[] = $package;
|
| 239 |
-
}
|
| 240 |
-
}
|
| 241 |
-
}
|
| 242 |
-
// order most active packges first in each set
|
| 243 |
-
$args = array (
|
| 244 |
-
'themes' => LocoPackage::sort_modified( $themes ),
|
| 245 |
-
'plugins' => LocoPackage::sort_modified( $plugins ),
|
| 246 |
-
'core' => LocoPackage::sort_modified( $core ),
|
| 247 |
-
);
|
| 248 |
-
// upgrade notice
|
| 249 |
-
if( $updates = get_site_transient('update_plugins') ){
|
| 250 |
-
$key = Loco::NS.'/loco.php';
|
| 251 |
-
if( isset($updates->checked[$key]) && isset($updates->response[$key]) ){
|
| 252 |
-
$old = $updates->checked[$key];
|
| 253 |
-
$new = $updates->response[$key]->new_version;
|
| 254 |
-
if( 1 === version_compare( $new, $old ) ){
|
| 255 |
-
// current version is lower than latest
|
| 256 |
-
$args['update'] = $new;
|
| 257 |
-
}
|
| 258 |
-
}
|
| 259 |
-
}
|
| 260 |
-
Loco::enqueue_scripts('build/admin-common');
|
| 261 |
-
Loco::render('admin-root', $args );
|
| 262 |
-
}
|
| 263 |
-
while( false );
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
|
| 268 |
-
/**
|
| 269 |
-
* utility gets newest file modification from an array of files
|
| 270 |
-
*/
|
| 271 |
-
private static function newest_mtime_recursive( array $files ){
|
| 272 |
-
$mtime = 0;
|
| 273 |
-
foreach( func_get_args() as $files ){
|
| 274 |
-
foreach( $files as $path ){
|
| 275 |
-
$mtime = max( $mtime, filemtime($path) );
|
| 276 |
-
}
|
| 277 |
-
}
|
| 278 |
-
return $mtime;
|
| 279 |
-
}
|
| 280 |
-
|
| 281 |
-
|
| 282 |
-
|
| 283 |
-
/**
|
| 284 |
-
* Initialize a new PO file from a locale code
|
| 285 |
-
* @return string path where PO file will be saved to
|
| 286 |
-
*/
|
| 287 |
-
private static function msginit( LocoPackage $package, $domain = '', $code, &$export, &$head, $force_global = null ){
|
| 288 |
-
$head = null;
|
| 289 |
-
$export = array();
|
| 290 |
-
$locale = $code ? loco_locale_resolve($code) : null;
|
| 291 |
-
if( ! $locale ){
|
| 292 |
-
throw new Exception( __('You must specify a valid locale for a new PO file','loco-legacy') );
|
| 293 |
-
}
|
| 294 |
-
|
| 295 |
-
// default PO file location
|
| 296 |
-
$po_path = $package->create_po_path( $locale, $domain, $force_global );
|
| 297 |
-
$po_dir = dirname( $po_path );
|
| 298 |
-
$po_name = basename( $po_path );
|
| 299 |
-
|
| 300 |
-
// extract strings from POT if possible
|
| 301 |
-
if( $pot_path = $package->get_pot($domain) ){
|
| 302 |
-
$pot = self::parse_po_with_headers( $pot_path, $head );
|
| 303 |
-
if( $pot && ! ( 1 === count($pot) && '' === $pot[0]['source'] ) ){
|
| 304 |
-
$export = $pot;
|
| 305 |
-
$pot_dir = dirname( $pot_path );
|
| 306 |
-
// override default PO location if POT location is writable and getting best location
|
| 307 |
-
if( is_writable($pot_dir) && is_null($force_global) ){
|
| 308 |
-
$po_dir = $pot_dir;
|
| 309 |
-
}
|
| 310 |
-
}
|
| 311 |
-
}
|
| 312 |
-
|
| 313 |
-
// else extract strings from source code when no POT
|
| 314 |
-
if( ! $export ){
|
| 315 |
-
$export = self::xgettext( $package, $po_dir );
|
| 316 |
-
if( ! $export ){
|
| 317 |
-
throw new Exception( __('No translatable strings found','loco-legacy').'. '.__('Cannot create a PO file.','loco-legacy') );
|
| 318 |
-
}
|
| 319 |
-
}
|
| 320 |
-
|
| 321 |
-
// check for PO conflict as this is msginit, not a sync.
|
| 322 |
-
$po_path = $po_dir.'/'.$po_name;
|
| 323 |
-
if( file_exists($po_path) ){
|
| 324 |
-
throw new Exception( sprintf(__('PO file already exists with locale %s','loco-legacy'), $locale->get_code() ) );
|
| 325 |
-
}
|
| 326 |
-
|
| 327 |
-
// return path, export and head set as references
|
| 328 |
-
$head or $head = new LocoHeaders;
|
| 329 |
-
return $po_path;
|
| 330 |
-
}
|
| 331 |
-
|
| 332 |
-
|
| 333 |
-
|
| 334 |
-
|
| 335 |
-
|
| 336 |
-
/**
|
| 337 |
-
* Render poedit screen
|
| 338 |
-
* @param string optional package root directory
|
| 339 |
-
* @param string PO or PO file path
|
| 340 |
-
* @param array data to load into editor
|
| 341 |
-
*/
|
| 342 |
-
private static function render_poeditor( LocoPackage $package, $path, array $data, LocoHeaders $head = null ){
|
| 343 |
-
$pot = $po = $locale = null;
|
| 344 |
-
$warnings = array();
|
| 345 |
-
// remove header and check if empty
|
| 346 |
-
$minlength = 1;
|
| 347 |
-
if( isset($data[0]['source']) && $data[0]['source'] === '' ){
|
| 348 |
-
$data[0] = array();
|
| 349 |
-
$minlength = 2;
|
| 350 |
-
}
|
| 351 |
-
|
| 352 |
-
// path may not exist if we're creating a new one
|
| 353 |
-
if( file_exists($path) ){
|
| 354 |
-
$modified = self::format_datetime( filemtime($path) );
|
| 355 |
-
}
|
| 356 |
-
else {
|
| 357 |
-
$modified = 0;
|
| 358 |
-
}
|
| 359 |
-
|
| 360 |
-
if( $is_pot = self::is_pot($path) ){
|
| 361 |
-
$pot = $data;
|
| 362 |
-
$type = 'POT';
|
| 363 |
-
}
|
| 364 |
-
// else PO is locked and has a locale
|
| 365 |
-
else {
|
| 366 |
-
$po = $data;
|
| 367 |
-
$type = 'PO';
|
| 368 |
-
$locale = self::resolve_file_locale($path);
|
| 369 |
-
$domain = self::resolve_file_domain($path);
|
| 370 |
-
$haspot = $package->get_pot( $domain );
|
| 371 |
-
}
|
| 372 |
-
|
| 373 |
-
// warn if new file can't be written
|
| 374 |
-
$writable = self::is_writable( $path );
|
| 375 |
-
if( ! $writable && ! $modified ){
|
| 376 |
-
$warnings[] = __('File cannot be created automatically. Fix the file permissions or use Download instead of Save','loco-legacy');
|
| 377 |
-
}
|
| 378 |
-
|
| 379 |
-
// Warnings if file is empty
|
| 380 |
-
if( count($data) < $minlength ){
|
| 381 |
-
$lines = array();
|
| 382 |
-
if( $is_pot ){
|
| 383 |
-
if( $modified ){
|
| 384 |
-
// existing POT, may need sync
|
| 385 |
-
$lines[] = sprintf( __('%s file is empty','loco-legacy'), 'POT' );
|
| 386 |
-
$lines[] = __('Run Sync to update from source code','loco-legacy');
|
| 387 |
-
}
|
| 388 |
-
else {
|
| 389 |
-
// new POT, would have tried to extract from source. Fine you can add by hand
|
| 390 |
-
$lines[] = __('No strings could be extracted from source code','loco-legacy');
|
| 391 |
-
}
|
| 392 |
-
}
|
| 393 |
-
else if( $modified ){
|
| 394 |
-
$lines[] = sprintf( __('%s file is empty','loco-legacy'), 'PO' );
|
| 395 |
-
if( $haspot ){
|
| 396 |
-
// existing PO that might be updatable from POT
|
| 397 |
-
$lines[] = sprintf( __('Run Sync to update from %s','loco-legacy'), basename($haspot) );
|
| 398 |
-
}
|
| 399 |
-
else {
|
| 400 |
-
// existing PO that might be updatable from sources
|
| 401 |
-
$lines[] = __('Run Sync to update from source code','loco-legacy');
|
| 402 |
-
}
|
| 403 |
-
}
|
| 404 |
-
else {
|
| 405 |
-
// this shouldn't happen if we throw an error during msginit
|
| 406 |
-
throw new Exception( __('No translatable strings found','loco-legacy') );
|
| 407 |
-
}
|
| 408 |
-
$warnings[] = implode('. ', $lines );
|
| 409 |
-
}
|
| 410 |
-
|
| 411 |
-
// warning if file needs syncing
|
| 412 |
-
else if( $modified ){
|
| 413 |
-
if( $is_pot ){
|
| 414 |
-
$sources = $package->get_source_files();
|
| 415 |
-
if( $sources && filemtime($path) < self::newest_mtime_recursive($sources) ){
|
| 416 |
-
$warnings[] = __('Source code has been modified, run Sync to update POT','loco-legacy');
|
| 417 |
-
}
|
| 418 |
-
}
|
| 419 |
-
else if( $haspot && filemtime($haspot) > filemtime($path) ){
|
| 420 |
-
$warnings[] = __('POT has been modified since PO file was saved, run Sync to update','loco-legacy');
|
| 421 |
-
}
|
| 422 |
-
}
|
| 423 |
-
|
| 424 |
-
// extract some PO headers
|
| 425 |
-
if( $head instanceof LocoHeaders ){
|
| 426 |
-
$proj = $head->trimmed('Project-Id-Version');
|
| 427 |
-
if( $proj && 'PACKAGE VERSION' !== $proj ){
|
| 428 |
-
$name = $proj;
|
| 429 |
-
}
|
| 430 |
-
}
|
| 431 |
-
else {
|
| 432 |
-
$head = new LocoHeaders;
|
| 433 |
-
}
|
| 434 |
-
|
| 435 |
-
// set Last-Translator if PO file
|
| 436 |
-
if( ! $is_pot ){
|
| 437 |
-
/* @var WP_User $user */
|
| 438 |
-
$user = wp_get_current_user() and
|
| 439 |
-
$head->add( 'Last-Translator', $user->get('display_name').' <'.$user->get('user_email').'>' );
|
| 440 |
-
}
|
| 441 |
-
|
| 442 |
-
// overwrite source location headers
|
| 443 |
-
// create a relative path to target source directory from location of PO
|
| 444 |
-
if( ! $head->has('X-Poedit-Basepath') ){
|
| 445 |
-
$head->add('X-Poedit-Basepath', '.' );
|
| 446 |
-
foreach( $package->get_source_dirs($path) as $i => $dir ){
|
| 447 |
-
$dir or $dir = '.';
|
| 448 |
-
$head->add('X-Poedit-SearchPath-'.$i, $dir );
|
| 449 |
-
}
|
| 450 |
-
}
|
| 451 |
-
|
| 452 |
-
// compiled keywords for running source extraction in POEdit
|
| 453 |
-
// note that these aren't just wordpress keywords, but they're the same as we're using in self::xgettext
|
| 454 |
-
$ext = new LocoPHPExtractor;
|
| 455 |
-
$head->add('X-Poedit-KeywordsList', implode( ';', $ext->get_xgettext_keywords() ) );
|
| 456 |
-
|
| 457 |
-
// ensure nice name for project
|
| 458 |
-
if( ! isset($name) ){
|
| 459 |
-
$meta = $package->meta();
|
| 460 |
-
$name = $meta['name'];
|
| 461 |
-
}
|
| 462 |
-
$head->add( 'Project-Id-Version', $name );
|
| 463 |
-
$headers = $head->export();
|
| 464 |
-
|
| 465 |
-
// no longer need the full local paths
|
| 466 |
-
$path = self::trim_path( $path );
|
| 467 |
-
|
| 468 |
-
// If parsing MO file, from now on treat as PO
|
| 469 |
-
if( ! $is_pot && self::is_mo($path) ){
|
| 470 |
-
$path = str_replace( '.mo', '.po', $path );
|
| 471 |
-
}
|
| 472 |
-
|
| 473 |
-
Loco::enqueue_scripts('build/admin-common','build/admin-poedit');
|
| 474 |
-
Loco::render('admin-poedit', compact('package','path','po','pot','locale','headers','name','type','modified','writable','warnings') );
|
| 475 |
-
return true;
|
| 476 |
-
}
|
| 477 |
-
|
| 478 |
-
|
| 479 |
-
|
| 480 |
-
/**
|
| 481 |
-
* Test if a file path is a POT (template) file
|
| 482 |
-
*/
|
| 483 |
-
public static function is_pot( $path ){
|
| 484 |
-
return 'pot' === strtolower( pathinfo($path,PATHINFO_EXTENSION) );
|
| 485 |
-
}
|
| 486 |
-
|
| 487 |
-
|
| 488 |
-
|
| 489 |
-
/**
|
| 490 |
-
* Test if a file path is a MO (compiled) file
|
| 491 |
-
*/
|
| 492 |
-
public static function is_mo( $path ){
|
| 493 |
-
return 'mo' === strtolower( pathinfo($path,PATHINFO_EXTENSION) );
|
| 494 |
-
}
|
| 495 |
-
|
| 496 |
-
|
| 497 |
-
|
| 498 |
-
/**
|
| 499 |
-
* Test if a file path is a PO file
|
| 500 |
-
*/
|
| 501 |
-
public static function is_po( $path ){
|
| 502 |
-
return 'po' === strtolower( pathinfo($path,PATHINFO_EXTENSION) );
|
| 503 |
-
}
|
| 504 |
-
|
| 505 |
-
|
| 506 |
-
|
| 507 |
-
/**
|
| 508 |
-
* resolve file path that may be relative to wp-content
|
| 509 |
-
*/
|
| 510 |
-
public static function resolve_path( $path, $isdir = false ){
|
| 511 |
-
if( $path && '/' !== $path{0} ){
|
| 512 |
-
$path = WP_CONTENT_DIR.'/'.$path;
|
| 513 |
-
}
|
| 514 |
-
$realpath = realpath( $path );
|
| 515 |
-
if( ! $realpath || ! is_readable($realpath) || ( $isdir && ! is_dir($realpath) ) || ( ! $isdir && ! is_file($realpath) ) ){
|
| 516 |
-
self::error( __('Bad file path','loco-legacy').' '.var_export($path,1) );
|
| 517 |
-
return '';
|
| 518 |
-
}
|
| 519 |
-
// returning original path in case something was symlinked outside the web root
|
| 520 |
-
return $path;
|
| 521 |
-
}
|
| 522 |
-
|
| 523 |
-
|
| 524 |
-
|
| 525 |
-
/**
|
| 526 |
-
* remove wp-content from path for more compact display in urls and such
|
| 527 |
-
*/
|
| 528 |
-
public static function trim_path( $path ){
|
| 529 |
-
return str_replace( WP_CONTENT_DIR.'/', '', $path );
|
| 530 |
-
}
|
| 531 |
-
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
/**
|
| 535 |
-
* Test whether a file can be written to, whether it exists or not
|
| 536 |
-
*/
|
| 537 |
-
public static function is_writable( $path ){
|
| 538 |
-
// if file exists it must be writable itself:
|
| 539 |
-
if( file_exists($path) ){
|
| 540 |
-
return is_writable($path);
|
| 541 |
-
}
|
| 542 |
-
// else file must be created, which may mean recursive directory permissions
|
| 543 |
-
$dir = dirname( $path );
|
| 544 |
-
return is_dir($dir) && is_writable($dir);
|
| 545 |
-
}
|
| 546 |
-
|
| 547 |
-
|
| 548 |
-
|
| 549 |
-
/**
|
| 550 |
-
* Recursively find PO and POT files under WP_LANG_DIR (wp-content/languages)
|
| 551 |
-
* Then remove them so after all packages are processed we can pick up orphans.
|
| 552 |
-
*/
|
| 553 |
-
public static function pop_lang_dir( $domain = '', $filtered = array() ){
|
| 554 |
-
static $found;
|
| 555 |
-
if( ! isset($found) ){
|
| 556 |
-
$found = array();
|
| 557 |
-
if( is_dir(WP_LANG_DIR) ){
|
| 558 |
-
$found = self::find_po( WP_LANG_DIR );
|
| 559 |
-
}
|
| 560 |
-
}
|
| 561 |
-
if( ! $domain ){
|
| 562 |
-
return $found;
|
| 563 |
-
}
|
| 564 |
-
foreach( $found as $ext => $paths ){
|
| 565 |
-
isset($filtered[$ext]) or $filtered[$ext] = array();
|
| 566 |
-
foreach( $paths as $i => $path ){
|
| 567 |
-
if( 0 === strpos( basename($path), $domain.'-' ) ){
|
| 568 |
-
$filtered[$ext][] = $path;
|
| 569 |
-
unset( $found[$ext][$i] );
|
| 570 |
-
}
|
| 571 |
-
}
|
| 572 |
-
}
|
| 573 |
-
return $filtered;
|
| 574 |
-
}
|
| 575 |
-
|
| 576 |
-
|
| 577 |
-
|
| 578 |
-
/**
|
| 579 |
-
* Recursively find all PO and POT files anywhere under a directory
|
| 580 |
-
*/
|
| 581 |
-
public static function find_po( $dir ){
|
| 582 |
-
return self::find( $dir, array('po','pot') );
|
| 583 |
-
}
|
| 584 |
-
|
| 585 |
-
|
| 586 |
-
|
| 587 |
-
/**
|
| 588 |
-
* Recursively find all MO files anywhere under a directory
|
| 589 |
-
*/
|
| 590 |
-
public static function find_mo( $dir ){
|
| 591 |
-
$files = self::find( $dir, array('mo') );
|
| 592 |
-
return $files['mo'];
|
| 593 |
-
}
|
| 594 |
-
|
| 595 |
-
|
| 596 |
-
|
| 597 |
-
/**
|
| 598 |
-
* Recursively find all POT files anywhere under a directory
|
| 599 |
-
*/
|
| 600 |
-
public static function find_pot( $dir ){
|
| 601 |
-
$files = self::find( $dir, array('pot') );
|
| 602 |
-
return $files['pot'];
|
| 603 |
-
}
|
| 604 |
-
|
| 605 |
-
|
| 606 |
-
|
| 607 |
-
/**
|
| 608 |
-
* Recursively find all PHP source files anywhere under a directory
|
| 609 |
-
*/
|
| 610 |
-
public static function find_php( $dir ){
|
| 611 |
-
$files = self::find( $dir, array('php','phtml') );
|
| 612 |
-
return array_merge($files['php'], $files['phtml']);
|
| 613 |
-
}
|
| 614 |
-
|
| 615 |
-
|
| 616 |
-
|
| 617 |
-
/**
|
| 618 |
-
* Recursively find files of any given extensions
|
| 619 |
-
*/
|
| 620 |
-
private static function find( $dir, array $exts ){
|
| 621 |
-
$found = array_fill_keys( $exts, array() );
|
| 622 |
-
if( is_readable($dir) && is_dir($dir) ){
|
| 623 |
-
$match = '/\\.(?:'.implode('|',$exts).')$/';
|
| 624 |
-
$found = self::find_grouped( $dir, $match, $found, true );
|
| 625 |
-
}
|
| 626 |
-
return $found;
|
| 627 |
-
}
|
| 628 |
-
|
| 629 |
-
|
| 630 |
-
|
| 631 |
-
/**
|
| 632 |
-
* @internal
|
| 633 |
-
*/
|
| 634 |
-
public static function find_grouped( $dir, $match, array $found = array(), $recurse = false, $recursions = array() ){
|
| 635 |
-
if( is_readable($dir) && is_dir($dir) && ( $rs = opendir($dir) ) ){
|
| 636 |
-
while( $f = readdir($rs) ){
|
| 637 |
-
if( '.' === $f{0} ){
|
| 638 |
-
continue;
|
| 639 |
-
}
|
| 640 |
-
$path = $dir.'/'.$f;
|
| 641 |
-
if( ! file_exists($path) ){
|
| 642 |
-
// likely to be a symlink to outside PHP's open_basedir. file_exists call will have raised E_WARNING
|
| 643 |
-
continue;
|
| 644 |
-
}
|
| 645 |
-
if( is_link($path) ){
|
| 646 |
-
$path = realpath($path);
|
| 647 |
-
if( ! $path ){
|
| 648 |
-
continue;
|
| 649 |
-
}
|
| 650 |
-
}
|
| 651 |
-
if( is_dir($path) ){
|
| 652 |
-
if( $recurse && ! isset($recursions[$path]) ){
|
| 653 |
-
$recursions[$path] = true;
|
| 654 |
-
$found = self::find_grouped( $path, $match, $found, true, $recursions );
|
| 655 |
-
}
|
| 656 |
-
}
|
| 657 |
-
else if( ! $match || preg_match($match,$path) ){
|
| 658 |
-
$ext = strtolower( pathinfo($path,PATHINFO_EXTENSION ) );
|
| 659 |
-
$found[$ext][] = $path;
|
| 660 |
-
}
|
| 661 |
-
}
|
| 662 |
-
closedir($rs);
|
| 663 |
-
}
|
| 664 |
-
return $found;
|
| 665 |
-
}
|
| 666 |
-
|
| 667 |
-
|
| 668 |
-
|
| 669 |
-
|
| 670 |
-
/**
|
| 671 |
-
* Perform xgettext style extraction from PHP source files
|
| 672 |
-
* @todo JavaScript files too
|
| 673 |
-
* @todo filter on TextDomain?
|
| 674 |
-
* @return array Loco's internal array format
|
| 675 |
-
*/
|
| 676 |
-
public static function xgettext( LocoPackage $package, $relative_to = '' ){
|
| 677 |
-
class_exists('LocoPHPExtractor') or loco_require('build/gettext-compiled');
|
| 678 |
-
$extractor = new LocoPHPExtractor;
|
| 679 |
-
// parse out header tags in template files
|
| 680 |
-
if( $package instanceof LocoThemePackage ){
|
| 681 |
-
$extractor->set_wp_theme();
|
| 682 |
-
}
|
| 683 |
-
else if( $package instanceof LocoPluginPackage ){
|
| 684 |
-
$extractor->set_wp_plugin();
|
| 685 |
-
}
|
| 686 |
-
$export = array();
|
| 687 |
-
// extract from PHP sources, as long as source locations exist
|
| 688 |
-
if( $srcdirs = $package->get_source_dirs() ){
|
| 689 |
-
foreach( $srcdirs as $dir ){
|
| 690 |
-
$fileref = loco_relative_path( $relative_to, $dir );
|
| 691 |
-
foreach( self::find_php($dir) as $path ){
|
| 692 |
-
$source = file_get_contents($path) and
|
| 693 |
-
$tokens = token_get_all($source) and
|
| 694 |
-
$export = $extractor->extract( $tokens, str_replace( $dir, $fileref, $path ) );
|
| 695 |
-
}
|
| 696 |
-
}
|
| 697 |
-
}
|
| 698 |
-
// extract from single file plugin
|
| 699 |
-
else if( $path = $package->get_default_file() ){
|
| 700 |
-
$dir = dirname($path);
|
| 701 |
-
$fileref = loco_relative_path( $relative_to, $dir );
|
| 702 |
-
$source = file_get_contents($path) and
|
| 703 |
-
$tokens = token_get_all($source) and
|
| 704 |
-
$export = $extractor->extract( $tokens, str_replace( $dir, $fileref, $path ) );
|
| 705 |
-
}
|
| 706 |
-
// else use first existing PO file in place of POT
|
| 707 |
-
else if( $po = $package->get_po() ){
|
| 708 |
-
foreach( $po as $code => $path ){
|
| 709 |
-
$export = self::parse_po( $path );
|
| 710 |
-
// strip translations, as this is intended as a POT
|
| 711 |
-
foreach( $export as $i => $message ){
|
| 712 |
-
$export[$i]['target'] = '';
|
| 713 |
-
}
|
| 714 |
-
break;
|
| 715 |
-
}
|
| 716 |
-
}
|
| 717 |
-
// add translatable header tags that won't have been in PHP
|
| 718 |
-
if( $package instanceof LocoThemePackage ){
|
| 719 |
-
$id = $target = '';
|
| 720 |
-
foreach( $package->get_headers() as $tag => $source ){
|
| 721 |
-
if( $source ){
|
| 722 |
-
$notes = str_replace('URI',' URI',$tag).' of the theme';
|
| 723 |
-
$export[] = compact('id','source','target','notes');
|
| 724 |
-
}
|
| 725 |
-
}
|
| 726 |
-
}
|
| 727 |
-
return $export;
|
| 728 |
-
}
|
| 729 |
-
|
| 730 |
-
|
| 731 |
-
|
| 732 |
-
/**
|
| 733 |
-
* Establish if translations are all empty
|
| 734 |
-
*/
|
| 735 |
-
private static function none_translated( array $data ){
|
| 736 |
-
foreach( $data as $message ){
|
| 737 |
-
if( ! empty($message['target']) ){
|
| 738 |
-
return false;
|
| 739 |
-
}
|
| 740 |
-
}
|
| 741 |
-
return true;
|
| 742 |
-
}
|
| 743 |
-
|
| 744 |
-
|
| 745 |
-
|
| 746 |
-
/**
|
| 747 |
-
* Parse MO, PO or POT file
|
| 748 |
-
*/
|
| 749 |
-
public static function parse_po( $path ){
|
| 750 |
-
function_exists('loco_parse_po') or loco_require('build/gettext-compiled');
|
| 751 |
-
$source = trim( file_get_contents($path) );
|
| 752 |
-
if( ! $source ){
|
| 753 |
-
return array();
|
| 754 |
-
}
|
| 755 |
-
$parser = strpos($path,'.mo') ? 'loco_parse_mo' : 'loco_parse_po';
|
| 756 |
-
return call_user_func( $parser, $source );
|
| 757 |
-
}
|
| 758 |
-
|
| 759 |
-
|
| 760 |
-
|
| 761 |
-
/**
|
| 762 |
-
* Parse MO, PO or POT file, placing header object into argument
|
| 763 |
-
*/
|
| 764 |
-
public static function parse_po_with_headers( $path, &$headers ){
|
| 765 |
-
$export = self::parse_po( $path );
|
| 766 |
-
if( ! isset($export[0]) ){
|
| 767 |
-
$ext = strtoupper( pathinfo($path,PATHINFO_EXTENSION) );
|
| 768 |
-
throw new Exception( sprintf( __('Empty or invalid %s file','loco-legacy'), $ext ) );
|
| 769 |
-
}
|
| 770 |
-
if( $export[0]['source'] !== '' ){
|
| 771 |
-
$ext = strtoupper( pathinfo($path,PATHINFO_EXTENSION) );
|
| 772 |
-
throw new Exception( sprintf( __('%s file has no header','loco-legacy'), $ext ) );
|
| 773 |
-
}
|
| 774 |
-
$headers = loco_parse_po_headers( $export[0]['target'] );
|
| 775 |
-
$export[0] = array(); // <- avoid index errors as json
|
| 776 |
-
return $export;
|
| 777 |
-
}
|
| 778 |
-
|
| 779 |
-
|
| 780 |
-
|
| 781 |
-
/**
|
| 782 |
-
* Resolve a list of PO file paths to locale instances
|
| 783 |
-
*/
|
| 784 |
-
private static function resolve_file_locales( array $files ){
|
| 785 |
-
$locales = array();
|
| 786 |
-
foreach( $files as $key => $path ){
|
| 787 |
-
$locale = self::resolve_file_locale( $path );
|
| 788 |
-
$locales[$key] = $locale;
|
| 789 |
-
}
|
| 790 |
-
return $locales;
|
| 791 |
-
}
|
| 792 |
-
|
| 793 |
-
|
| 794 |
-
|
| 795 |
-
/**
|
| 796 |
-
* Resolve a PO file path or file name to a locale.
|
| 797 |
-
* Note that this does not read the file and the PO header, but perhaps it should. (performance!)
|
| 798 |
-
* @return LocoLocale
|
| 799 |
-
*/
|
| 800 |
-
public static function resolve_file_locale( $path ){
|
| 801 |
-
$stub = str_replace( array('.po','.mo'), array('',''), basename($path) );
|
| 802 |
-
$locale = loco_locale_resolve($stub);
|
| 803 |
-
return $locale;
|
| 804 |
-
}
|
| 805 |
-
|
| 806 |
-
|
| 807 |
-
/**
|
| 808 |
-
* Resolve a PO file path or file name to TextDomain.
|
| 809 |
-
* Note that this does not parse the file to read any data, it just extracts from filename
|
| 810 |
-
* @param string e.g. "path/to/foo-fr_FR.po" or "foo.pot"
|
| 811 |
-
* @return string e.g. "foo"
|
| 812 |
-
*/
|
| 813 |
-
public static function resolve_file_domain( $path ){
|
| 814 |
-
extract( pathinfo($path) );
|
| 815 |
-
if( ! isset($filename) ){
|
| 816 |
-
$filename = str_replace( '.'.$extension, '', $basename ); // PHP < 5.2.0
|
| 817 |
-
}
|
| 818 |
-
if( 'pot' === $extension ){
|
| 819 |
-
// POT shouldn't have a locale code, but people do things like 'en_EN.pot'
|
| 820 |
-
if( preg_match('/[a-z]{2,3}_[A-Z]{2}$/', $filename ) ){
|
| 821 |
-
return '';
|
| 822 |
-
}
|
| 823 |
-
return $filename;
|
| 824 |
-
}
|
| 825 |
-
if( $domain = preg_replace('/[a-z]{2,3}(_[A-Z]{2})?$/', '', $filename ) ){
|
| 826 |
-
return rtrim( $domain, '-' );
|
| 827 |
-
}
|
| 828 |
-
// empty domain means file name is probably just a locale
|
| 829 |
-
return '';
|
| 830 |
-
}
|
| 831 |
-
|
| 832 |
-
|
| 833 |
-
/**
|
| 834 |
-
* Resolve a PO file to a theme
|
| 835 |
-
* @return WP_Theme
|
| 836 |
-
*/
|
| 837 |
-
public static function resolve_file_theme( $path ){
|
| 838 |
-
if( false !== strpos($path,'/themes/') ){
|
| 839 |
-
$domain = self::resolve_file_domain($path);
|
| 840 |
-
return wp_get_theme( $domain );
|
| 841 |
-
}
|
| 842 |
-
}
|
| 843 |
-
|
| 844 |
-
|
| 845 |
-
/**
|
| 846 |
-
* Generate an admin page URI with custom args
|
| 847 |
-
*/
|
| 848 |
-
public static function uri( array $args = array(), $suffix = '' ){
|
| 849 |
-
$base_uri = admin_url('admin.php');
|
| 850 |
-
if( ! isset($args['page']) ){
|
| 851 |
-
$args['page'] = Loco::NS;
|
| 852 |
-
if( $suffix ){
|
| 853 |
-
$args['page'].= '-'.$suffix;
|
| 854 |
-
}
|
| 855 |
-
}
|
| 856 |
-
return add_query_arg($args,$base_uri);
|
| 857 |
-
}
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
|
| 861 |
-
/**
|
| 862 |
-
* Test if we're on our own admin page
|
| 863 |
-
* @param string optionally specify exact slug including Loco::NS
|
| 864 |
-
* @return string current slug
|
| 865 |
-
*/
|
| 866 |
-
public static function is_self( $page = null ){
|
| 867 |
-
static $active;
|
| 868 |
-
if( ! isset($active) ){
|
| 869 |
-
$screen = get_current_screen();
|
| 870 |
-
$splode = explode( Loco::NS, $screen->base, 2 );
|
| 871 |
-
$active = isset($splode[1]) ? Loco::NS.$splode[1] : false;
|
| 872 |
-
}
|
| 873 |
-
if( false !== $active && ( is_null($page) || $page === $active ) ){
|
| 874 |
-
return $active;
|
| 875 |
-
}
|
| 876 |
-
return '';
|
| 877 |
-
}
|
| 878 |
-
|
| 879 |
-
|
| 880 |
-
/**
|
| 881 |
-
* Generate a URL to edit a po/pot file
|
| 882 |
-
*/
|
| 883 |
-
public static function edit_uri( LocoPackage $package, $path ){
|
| 884 |
-
$args = $package->get_query() + array (
|
| 885 |
-
'poedit' => self::trim_path( $path ),
|
| 886 |
-
);
|
| 887 |
-
if( $domain = $package->is_pot($path) ){
|
| 888 |
-
$args['pot'] = $domain;
|
| 889 |
-
}
|
| 890 |
-
return self::uri( $args );
|
| 891 |
-
}
|
| 892 |
-
|
| 893 |
-
|
| 894 |
-
/**
|
| 895 |
-
* Generate a link to edit a po/pot file
|
| 896 |
-
*/
|
| 897 |
-
public static function edit_link( LocoPackage $package, $path, $label = '', $icon = '' ){
|
| 898 |
-
$url = self::edit_uri( $package, $path );
|
| 899 |
-
if( ! $label ){
|
| 900 |
-
$label = basename( $path );
|
| 901 |
-
}
|
| 902 |
-
$inner = Loco::html($label);
|
| 903 |
-
if( $icon ){
|
| 904 |
-
$inner = '<span class="'.$icon.'"></span>'.$inner;
|
| 905 |
-
}
|
| 906 |
-
return '<a href="'.Loco::html($url).'">'.$inner.'</a>';
|
| 907 |
-
}
|
| 908 |
-
|
| 909 |
-
|
| 910 |
-
|
| 911 |
-
/**
|
| 912 |
-
* Generate a link to generate a new POT file
|
| 913 |
-
*/
|
| 914 |
-
public static function xgettext_link( LocoPackage $package, $domain = '', $label = '' ){
|
| 915 |
-
$url = self::uri( $package->get_query() + array(
|
| 916 |
-
'xgettext' => $domain ? $domain : $package->get_domain(),
|
| 917 |
-
) );
|
| 918 |
-
if( ! $label ){
|
| 919 |
-
$label = _x('New template','Add button','loco-legacy') ;
|
| 920 |
-
}
|
| 921 |
-
return '<a href="'.Loco::html($url).'">'.Loco::html($label).'</a>';
|
| 922 |
-
|
| 923 |
-
}
|
| 924 |
-
|
| 925 |
-
|
| 926 |
-
|
| 927 |
-
/**
|
| 928 |
-
* Generate a link to create a new PO file for a not-yet-specified locale
|
| 929 |
-
*/
|
| 930 |
-
public static function msginit_link( LocoPackage $package, $domain = '', $label = '' ){
|
| 931 |
-
if( ! $domain ){
|
| 932 |
-
$domain = $package->get_domain();
|
| 933 |
-
}
|
| 934 |
-
$url = self::uri( $package->get_query() + array (
|
| 935 |
-
'msginit' => $domain ? $domain : $package->get_domain(),
|
| 936 |
-
) );
|
| 937 |
-
if( ! $label ){
|
| 938 |
-
$label = _x('New language','Add button','loco-legacy');
|
| 939 |
-
}
|
| 940 |
-
return '<a href="'.Loco::html($url).'">'.Loco::html($label).'</a>';
|
| 941 |
-
}
|
| 942 |
-
|
| 943 |
-
|
| 944 |
-
/**
|
| 945 |
-
* Generate a link to check file permissions on a packge
|
| 946 |
-
*/
|
| 947 |
-
public static function fscheck_link( LocoPackage $package, $domain = '', $label ){
|
| 948 |
-
if( ! $domain ){
|
| 949 |
-
$domain = $package->get_domain();
|
| 950 |
-
}
|
| 951 |
-
$url = self::uri( $package->get_query() + array (
|
| 952 |
-
'fscheck' => $domain ? $domain : $package->get_domain(),
|
| 953 |
-
) );
|
| 954 |
-
return '<a href="'.Loco::html($url).'">'.Loco::html($label).'</a>';
|
| 955 |
-
}
|
| 956 |
-
|
| 957 |
-
|
| 958 |
-
/**
|
| 959 |
-
* Date format util
|
| 960 |
-
*/
|
| 961 |
-
public static function format_datetime( $u ){
|
| 962 |
-
static $tf, $df;
|
| 963 |
-
if( ! $tf ){
|
| 964 |
-
$tf = get_option('time_format') or $tf = 'g:i A';
|
| 965 |
-
$df = get_option('date_format') or $df= 'M jS Y';
|
| 966 |
-
}
|
| 967 |
-
return date_i18n( $df.' '.$tf, $u );
|
| 968 |
-
}
|
| 969 |
-
|
| 970 |
-
|
| 971 |
-
|
| 972 |
-
/**
|
| 973 |
-
* PO translate progress summary
|
| 974 |
-
*/
|
| 975 |
-
public static function format_progress_summary( array $stats ){
|
| 976 |
-
extract( $stats );
|
| 977 |
-
$text = sprintf( __('%s%% translated','loco-legacy'), $p ).', '.sprintf( _n('1 string', '%s strings', $t,'loco-legacy' ), number_format($t) );
|
| 978 |
-
$extra = array();
|
| 979 |
-
if( $f ){
|
| 980 |
-
$extra[] = sprintf( __('%s fuzzy','loco-legacy'), number_format($f) );
|
| 981 |
-
}
|
| 982 |
-
if( $u ){
|
| 983 |
-
$extra[] = sprintf( __('%s untranslated','loco-legacy'), number_format($f) );
|
| 984 |
-
}
|
| 985 |
-
if( $extra ){
|
| 986 |
-
$text .= ' ('.implode(', ',$extra).')';
|
| 987 |
-
}
|
| 988 |
-
return $text;
|
| 989 |
-
}
|
| 990 |
-
|
| 991 |
-
|
| 992 |
-
/**
|
| 993 |
-
* get configured path to external msgfmt command, including --no-hash and --use-fuzzy arguments
|
| 994 |
-
* @return string
|
| 995 |
-
*/
|
| 996 |
-
public static function msgfmt_command(){
|
| 997 |
-
$conf = Loco::config();
|
| 998 |
-
if( ! $conf['use_msgfmt'] || ! $conf['which_msgfmt'] ){
|
| 999 |
-
return '';
|
| 1000 |
-
}
|
| 1001 |
-
$cmd = escapeshellarg( trim( $conf['which_msgfmt'] ) );
|
| 1002 |
-
if( ! $conf['gen_hash'] ){
|
| 1003 |
-
$cmd .= ' --no-hash';
|
| 1004 |
-
}
|
| 1005 |
-
if( $conf['use_fuzzy'] ){
|
| 1006 |
-
$cmd .= ' --use-fuzzy';
|
| 1007 |
-
}
|
| 1008 |
-
return $cmd;
|
| 1009 |
-
}
|
| 1010 |
-
|
| 1011 |
-
|
| 1012 |
-
/**
|
| 1013 |
-
* Execute native msgfmt command
|
| 1014 |
-
* @param string po source
|
| 1015 |
-
* @return string binary mo source
|
| 1016 |
-
*/
|
| 1017 |
-
public static function msgfmt_native( $po ){
|
| 1018 |
-
try {
|
| 1019 |
-
$conf = Loco::config();
|
| 1020 |
-
loco_require('build/gettext-compiled');
|
| 1021 |
-
$gen_hash = (bool) $conf['gen_hash'];
|
| 1022 |
-
$use_fuzzy = (bool) $conf['use_fuzzy'];
|
| 1023 |
-
$mo = loco_msgfmt( $po, $gen_hash, $use_fuzzy );
|
| 1024 |
-
}
|
| 1025 |
-
catch( Exception $Ex ){
|
| 1026 |
-
error_log( $Ex->getMessage(), 0 );
|
| 1027 |
-
}
|
| 1028 |
-
if( ! $mo ){
|
| 1029 |
-
throw new Exception( sprintf( __('Failed to compile MO file with built-in compiler','loco-legacy') ) );
|
| 1030 |
-
}
|
| 1031 |
-
return $mo;
|
| 1032 |
-
}
|
| 1033 |
-
|
| 1034 |
-
|
| 1035 |
-
}
|
| 1036 |
-
|
| 1037 |
-
|
| 1038 |
-
|
| 1039 |
-
|
| 1040 |
-
// admin filter and action callbacks
|
| 1041 |
-
|
| 1042 |
-
|
| 1043 |
-
/**
|
| 1044 |
-
* Enqueue only admin styles we need
|
| 1045 |
-
*/
|
| 1046 |
-
function _loco_hook__current_screen(){
|
| 1047 |
-
if( $slug = LocoAdmin::is_self() ){
|
| 1048 |
-
// redirect legacy links
|
| 1049 |
-
if( $i = strpos( $slug,'-legacy') ){
|
| 1050 |
-
$args = $_GET;
|
| 1051 |
-
$args['page'] = substr_replace( $slug, '', $i );
|
| 1052 |
-
$uri = LocoAdmin::uri( $args, $slug );
|
| 1053 |
-
wp_redirect( $uri );
|
| 1054 |
-
}
|
| 1055 |
-
// handle upgrade post
|
| 1056 |
-
if( isset($_POST['loco-nonce']) && wp_verify_nonce($_POST['loco-nonce'],'upgrade-v2') ){
|
| 1057 |
-
update_option( 'loco-branch', '2', true );
|
| 1058 |
-
$uri = LocoAdmin::uri( array('page' => 'loco' ) );
|
| 1059 |
-
wp_redirect( $uri );
|
| 1060 |
-
}
|
| 1061 |
-
// add common resources for all Loco admin pages
|
| 1062 |
-
Loco::enqueue_styles('loco-admin');
|
| 1063 |
-
// load colour scheme is user has non-default
|
| 1064 |
-
$skin = get_user_option('admin_color');
|
| 1065 |
-
if( $skin && 'fresh' !== $skin ){
|
| 1066 |
-
Loco::enqueue_styles( 'skins/'.$skin );
|
| 1067 |
-
}
|
| 1068 |
-
}
|
| 1069 |
-
}
|
| 1070 |
-
|
| 1071 |
-
|
| 1072 |
-
|
| 1073 |
-
/**
|
| 1074 |
-
* Admin menu registration callback
|
| 1075 |
-
*/
|
| 1076 |
-
function _loco_hook__admin_menu() {
|
| 1077 |
-
$cap = Loco::admin_capablity();
|
| 1078 |
-
if( current_user_can($cap) ){
|
| 1079 |
-
// hook in legacy wordpress styles as menu will display
|
| 1080 |
-
$wp_38 = version_compare( $GLOBALS['wp_version'], '3.8', '>=' ) or
|
| 1081 |
-
Loco::enqueue_styles('loco-legacy');
|
| 1082 |
-
|
| 1083 |
-
$page_title = __('Loco, Translation Management','loco-legacy');
|
| 1084 |
-
$tool_title = __('Manage translations','loco-legacy');
|
| 1085 |
-
$opts_title = __('Translation options','loco-legacy');
|
| 1086 |
-
// Loco main menu item
|
| 1087 |
-
$slug = Loco::NS;
|
| 1088 |
-
$title = $page_title.' - '.$tool_title;
|
| 1089 |
-
$page = array( 'LocoAdmin', 'render_page_tools' );
|
| 1090 |
-
// Dashicons were introduced in WP 3.8
|
| 1091 |
-
$icon = $wp_38 ? 'dashicons-translation' : 'none';
|
| 1092 |
-
add_menu_page( $title, __('Loco Translate','loco-legacy'), $cap, $slug, $page, $icon );
|
| 1093 |
-
// add main link under self with different name
|
| 1094 |
-
add_submenu_page( $slug, $title, $tool_title, $cap, $slug, $page );
|
| 1095 |
-
// also add under Tools menu (legacy)
|
| 1096 |
-
add_management_page( $title, $tool_title, $cap, $slug.'-legacy', $page );
|
| 1097 |
-
|
| 1098 |
-
// Settings page
|
| 1099 |
-
$slug = Loco::NS.'-settings';
|
| 1100 |
-
$title = $page_title.' - '.$opts_title;
|
| 1101 |
-
$page = array( 'LocoAdmin', 'render_page_options' );
|
| 1102 |
-
add_submenu_page( Loco::NS, $title, $opts_title, $cap, $slug, $page );
|
| 1103 |
-
// also add under Settings menu (legacy)
|
| 1104 |
-
add_options_page( $title, $opts_title, $cap, $slug.'-legacy', $page );
|
| 1105 |
-
|
| 1106 |
-
// Version 2.0 soft upgrade page
|
| 1107 |
-
$slug = Loco::NS.'-upgrade';
|
| 1108 |
-
$page = array( 'LocoAdmin', 'render_soft_upgrade' );
|
| 1109 |
-
add_submenu_page( Loco::NS, 'Enable version 2', 'Enable version 2', $cap, $slug, $page );
|
| 1110 |
-
|
| 1111 |
-
// Hook in page stuff as soon as screen is avaiable
|
| 1112 |
-
add_action('current_screen', '_loco_hook__current_screen' );
|
| 1113 |
-
}
|
| 1114 |
-
}
|
| 1115 |
-
|
| 1116 |
-
|
| 1117 |
-
/**
|
| 1118 |
-
* extra visibility of settings link
|
| 1119 |
-
*/
|
| 1120 |
-
function _loco_hook__plugin_row_meta( $links, $file = '' ){
|
| 1121 |
-
if( false !== strpos($file,'/loco.php') ){
|
| 1122 |
-
$links[] = '<a href="'.Loco::html( LocoAdmin::uri( array(), '' ) ).'"><strong>'.__('Manage translations','loco-legacy').'</strong></a>';
|
| 1123 |
-
$links[] = '<a href="'.Loco::html( LocoAdmin::uri( array(), 'settings') ).'"><strong>'.__('Settings','loco-legacy').'</strong></a>';
|
| 1124 |
-
}
|
| 1125 |
-
return $links;
|
| 1126 |
-
}
|
| 1127 |
-
|
| 1128 |
-
|
| 1129 |
-
/**
|
| 1130 |
-
* execute ajax actions
|
| 1131 |
-
*/
|
| 1132 |
-
function _loco_hook__wp_ajax(){
|
| 1133 |
-
extract( Loco::postdata() );
|
| 1134 |
-
if( isset($action) ){
|
| 1135 |
-
require Loco::basedir().'/php/loco-ajax.php';
|
| 1136 |
-
}
|
| 1137 |
-
}
|
| 1138 |
-
|
| 1139 |
-
|
| 1140 |
-
/**
|
| 1141 |
-
* execute file download actions
|
| 1142 |
-
*/
|
| 1143 |
-
function _loco_hook__wp_ajax_download(){
|
| 1144 |
-
extract( Loco::postdata() );
|
| 1145 |
-
if( isset($action) ){
|
| 1146 |
-
require Loco::basedir().'/php/loco-download.php';
|
| 1147 |
-
die( __('File download failed','loco-legacy') );
|
| 1148 |
-
}
|
| 1149 |
-
}
|
| 1150 |
-
|
| 1151 |
-
|
| 1152 |
-
/**
|
| 1153 |
-
* callback when admin notices are being printed
|
| 1154 |
-
*/
|
| 1155 |
-
function _loco_hook_admin_notices(){
|
| 1156 |
-
if( defined('WPLANG') && LocoAdmin::is_self() && WPLANG && 3 < (int) $GLOBALS['wp_version'] ){
|
| 1157 |
-
LocoAdmin::warning( __('WPLANG is deprecated and should be removed from wp-config.php','loco-legacy') );
|
| 1158 |
-
}
|
| 1159 |
-
LocoAdmin::flush_notices();
|
| 1160 |
-
}
|
| 1161 |
-
|
| 1162 |
-
|
| 1163 |
-
|
| 1164 |
-
add_action('admin_menu', '_loco_hook__admin_menu' );
|
| 1165 |
-
add_action('admin_notices', '_loco_hook_admin_notices');
|
| 1166 |
-
add_action('plugin_row_meta', '_loco_hook__plugin_row_meta', 10, 2 );
|
| 1167 |
-
|
| 1168 |
-
// ajax hooks all going through one central function
|
| 1169 |
-
add_action('wp_ajax_loco-data', '_loco_hook__wp_ajax' );
|
| 1170 |
-
add_action('wp_ajax_loco-posave', '_loco_hook__wp_ajax' );
|
| 1171 |
-
add_action('wp_ajax_loco-posync', '_loco_hook__wp_ajax' );
|
| 1172 |
-
add_action('wp_ajax_loco-download', '_loco_hook__wp_ajax_download' );
|
| 1173 |
-
|
| 1174 |
-
// WP_LANG_DIR was introduced in WordPress 2.1.0.
|
| 1175 |
-
if( ! defined('WP_LANG_DIR') ){
|
| 1176 |
-
define('WP_LANG_DIR', WP_CONTENT_DIR.'/languages' );
|
| 1177 |
-
}
|
| 1178 |
-
|
| 1179 |
-
// Load polyfills and raise warnings in debug mode
|
| 1180 |
-
extension_loaded('mbstring') or loco_require('compat/loco-mbstring');
|
| 1181 |
-
extension_loaded('tokenizer') or loco_require('compat/loco-tokenizer');
|
| 1182 |
-
extension_loaded('iconv') or loco_require('compat/loco-iconv');
|
| 1183 |
-
extension_loaded('json') or loco_require('compat/loco-json');
|
| 1184 |
-
|
| 1185 |
-
// emergency polyfills for php<5.4
|
| 1186 |
-
version_compare( phpversion(), '5.4', '>=' ) or loco_require('compat/loco-php');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/loco-boot.php
DELETED
|
@@ -1,324 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Loco | bootstraps plugin when it's needed.
|
| 4 |
-
* Top-level Loco class holds some basic utilities
|
| 5 |
-
*/
|
| 6 |
-
abstract class Loco {
|
| 7 |
-
|
| 8 |
-
/** plugin namespace */
|
| 9 |
-
const NS = 'loco-translate';
|
| 10 |
-
|
| 11 |
-
/** plugin version */
|
| 12 |
-
const VERSION = '1.5.6-legacy';
|
| 13 |
-
|
| 14 |
-
/* current plugin locale */
|
| 15 |
-
private static $locale;
|
| 16 |
-
|
| 17 |
-
/* whether to enable APC cache */
|
| 18 |
-
public static $apc_enabled;
|
| 19 |
-
|
| 20 |
-
/* whether to enable the cache at all */
|
| 21 |
-
public static $cache_enabled;
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
/**
|
| 25 |
-
* Bootstrap localisation of self
|
| 26 |
-
*/
|
| 27 |
-
public static function load_textdomain( $locale = null ){
|
| 28 |
-
if( is_null($locale) ){
|
| 29 |
-
$locale = get_locale();
|
| 30 |
-
}
|
| 31 |
-
if( ! $locale || 0 === strpos($locale,'en') ){
|
| 32 |
-
self::$locale and unload_textdomain( Loco::NS );
|
| 33 |
-
$locale = 'en_US';
|
| 34 |
-
}
|
| 35 |
-
else if( self::$locale !== $locale ){
|
| 36 |
-
$plugin_rel_path = basename( self::basedir() );
|
| 37 |
-
load_plugin_textdomain( Loco::NS, false, $plugin_rel_path.'/languages' );
|
| 38 |
-
}
|
| 39 |
-
// detect changes in plugin locale, binding once only
|
| 40 |
-
isset(self::$locale) or add_filter( 'plugin_locale', array(__CLASS__,'filter_plugin_locale'), 10 , 2 );
|
| 41 |
-
self::$locale = $locale;
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
|
| 45 |
-
|
| 46 |
-
/**
|
| 47 |
-
* Listen for change in plugin locale
|
| 48 |
-
*/
|
| 49 |
-
public static function filter_plugin_locale( $locale, $domain ){
|
| 50 |
-
if( self::NS !== $domain && $locale !== self::$locale ){
|
| 51 |
-
self::load_textdomain( $locale );
|
| 52 |
-
}
|
| 53 |
-
return $locale;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
|
| 57 |
-
|
| 58 |
-
/**
|
| 59 |
-
* Get path to this file, accounting for symlink problem
|
| 60 |
-
*/
|
| 61 |
-
private static function _this_file(){
|
| 62 |
-
$here = __FILE__;
|
| 63 |
-
// handle symlinking so path to this file is always under WP_PLUGIN_DIR
|
| 64 |
-
$root = trailingslashit(WP_PLUGIN_DIR);
|
| 65 |
-
if( 0 !== strpos( $here, $root ) ){
|
| 66 |
-
$base = dirname(dirname(dirname(dirname($here)))).'/';
|
| 67 |
-
$here = str_replace( $base, $root, $here );
|
| 68 |
-
}
|
| 69 |
-
return $here;
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Get plugin local base directory in case __DIR__ isn't available (php<5.3)
|
| 75 |
-
*/
|
| 76 |
-
public static function basedir(){
|
| 77 |
-
static $dir;
|
| 78 |
-
isset($dir) or $dir = dirname( dirname( self::_this_file() ) );
|
| 79 |
-
return $dir;
|
| 80 |
-
}
|
| 81 |
-
|
| 82 |
-
|
| 83 |
-
/**
|
| 84 |
-
* Get plugin base URL path.
|
| 85 |
-
*/
|
| 86 |
-
public static function baseurl(){
|
| 87 |
-
static $url;
|
| 88 |
-
isset($url) or $url = plugins_url( '', self::basedir().'/loco.php' );
|
| 89 |
-
return $url;
|
| 90 |
-
}
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
/**
|
| 94 |
-
* Simple template renderer
|
| 95 |
-
*/
|
| 96 |
-
public static function render( $tpl, array $arguments = array() ){
|
| 97 |
-
extract( $arguments );
|
| 98 |
-
include Loco::basedir().'/tpl/'.$tpl.'.tpl.php';
|
| 99 |
-
}
|
| 100 |
-
|
| 101 |
-
|
| 102 |
-
/**
|
| 103 |
-
* replacement for bloated esc_html function
|
| 104 |
-
*/
|
| 105 |
-
public static function html( $text ){
|
| 106 |
-
return htmlspecialchars( $text, ENT_COMPAT, 'UTF-8' );
|
| 107 |
-
}
|
| 108 |
-
|
| 109 |
-
|
| 110 |
-
/**
|
| 111 |
-
* html output printer with printf built-in
|
| 112 |
-
*/
|
| 113 |
-
public static function h( $text, $_ = null ){
|
| 114 |
-
if( isset($_) ){
|
| 115 |
-
$args = func_get_args();
|
| 116 |
-
$text = call_user_func_array('sprintf', $args );
|
| 117 |
-
}
|
| 118 |
-
echo self::html( $text );
|
| 119 |
-
return '';
|
| 120 |
-
}
|
| 121 |
-
|
| 122 |
-
|
| 123 |
-
/**
|
| 124 |
-
* Abstract enquement of JavaScript
|
| 125 |
-
*/
|
| 126 |
-
public static function enqueue_scripts(){
|
| 127 |
-
static $v, $i = 0;
|
| 128 |
-
$stubs = func_get_args();
|
| 129 |
-
if( ! isset($v) ){
|
| 130 |
-
$v = WP_DEBUG ? time() : Loco::VERSION;
|
| 131 |
-
// enqueue JavaScript translations once
|
| 132 |
-
$trans = 'lang/dummy';
|
| 133 |
-
$locale = get_locale() and
|
| 134 |
-
0 !== strpos( $locale, 'en' ) and
|
| 135 |
-
file_exists( Loco::basedir().'/pub/js/lang/'.Loco::NS.'-'.$locale.'.js' ) and
|
| 136 |
-
$trans = 'lang/'.Loco::NS.'-'.$locale;
|
| 137 |
-
array_unshift( $stubs, $trans );
|
| 138 |
-
}
|
| 139 |
-
foreach( $stubs as $stub ){
|
| 140 |
-
$js = Loco::baseurl().'/pub/js/'.$stub.'.js';
|
| 141 |
-
$id = self::NS.'-js-'.( ++$i );
|
| 142 |
-
wp_enqueue_script( $id, $js, array('jquery'), $v, true );
|
| 143 |
-
}
|
| 144 |
-
}
|
| 145 |
-
|
| 146 |
-
|
| 147 |
-
|
| 148 |
-
/**
|
| 149 |
-
* Abstract enquement of Stylesheets
|
| 150 |
-
*/
|
| 151 |
-
public static function enqueue_styles(){
|
| 152 |
-
static $v, $i = 0;
|
| 153 |
-
isset($v) or $v = WP_DEBUG ? time() : Loco::VERSION;
|
| 154 |
-
foreach( func_get_args() as $stub ){
|
| 155 |
-
$css = Loco::baseurl().'/pub/css/'.$stub.'.css';
|
| 156 |
-
wp_enqueue_style( self::NS.'-css-'.(++$i), $css, array(), $v );
|
| 157 |
-
}
|
| 158 |
-
}
|
| 159 |
-
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
*
|
| 164 |
-
*/
|
| 165 |
-
public static function utm_query( $utm_medium ){
|
| 166 |
-
$utm_campaign = 'wp';
|
| 167 |
-
$utm_source = 'wp-admin';
|
| 168 |
-
$utm_content = Loco::VERSION;
|
| 169 |
-
return http_build_query( compact('utm_campaign','utm_medium','utm_content','utm_source') );
|
| 170 |
-
}
|
| 171 |
-
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
/**
|
| 175 |
-
* Get actual postdata, not hacked postdata WordPress ruined with wp_magic_quotes
|
| 176 |
-
* @return array
|
| 177 |
-
*/
|
| 178 |
-
public static function postdata(){
|
| 179 |
-
static $post;
|
| 180 |
-
if( ! is_array($post) ){
|
| 181 |
-
// Not using WordPress's hacked POST collection.
|
| 182 |
-
$str = file_get_contents('php://input') or
|
| 183 |
-
// preferred way is to parse original data
|
| 184 |
-
$str = isset($_SERVER['HTTP_RAW_POST_DATA']) ? $_SERVER['HTTP_RAW_POST_DATA'] : '';
|
| 185 |
-
if( $str ){
|
| 186 |
-
parse_str( $str, $post );
|
| 187 |
-
}
|
| 188 |
-
// fall back to undoing WordPress 'magic'
|
| 189 |
-
else {
|
| 190 |
-
$post = stripslashes_deep( $_POST );
|
| 191 |
-
}
|
| 192 |
-
}
|
| 193 |
-
return $post;
|
| 194 |
-
}
|
| 195 |
-
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
/**
|
| 199 |
-
* Abstraction of cache retrieval, using apc where possible
|
| 200 |
-
* @return mixed
|
| 201 |
-
*/
|
| 202 |
-
public static function cached( $key ){
|
| 203 |
-
if( ! self::$cache_enabled ){
|
| 204 |
-
return null;
|
| 205 |
-
}
|
| 206 |
-
$key = self::cache_key($key);
|
| 207 |
-
if( self::$apc_enabled ){
|
| 208 |
-
return apc_fetch( $key );
|
| 209 |
-
}
|
| 210 |
-
return get_transient( $key );
|
| 211 |
-
}
|
| 212 |
-
|
| 213 |
-
|
| 214 |
-
|
| 215 |
-
/**
|
| 216 |
-
* Abstraction of cache storage, using apc where possible
|
| 217 |
-
* @return void
|
| 218 |
-
*/
|
| 219 |
-
public static function cache( $key, $value, $ttl = 0 ){
|
| 220 |
-
if( ! self::$cache_enabled ){
|
| 221 |
-
return;
|
| 222 |
-
}
|
| 223 |
-
$key = self::cache_key($key);
|
| 224 |
-
if( self::$apc_enabled ){
|
| 225 |
-
apc_store( $key, $value, $ttl );
|
| 226 |
-
return;
|
| 227 |
-
}
|
| 228 |
-
if( ! $ttl ){
|
| 229 |
-
// WP would expire immediately as opposed to never
|
| 230 |
-
$ttl = 31536000;
|
| 231 |
-
}
|
| 232 |
-
set_transient( $key, $value, $ttl );
|
| 233 |
-
}
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
/**
|
| 237 |
-
* Abstraction of cache removal
|
| 238 |
-
* @return void
|
| 239 |
-
*/
|
| 240 |
-
public static function uncache( $key ){
|
| 241 |
-
$key = self::cache_key($key);
|
| 242 |
-
if( self::$apc_enabled ){
|
| 243 |
-
apc_delete( $key );
|
| 244 |
-
return;
|
| 245 |
-
}
|
| 246 |
-
delete_transient( $key );
|
| 247 |
-
}
|
| 248 |
-
|
| 249 |
-
|
| 250 |
-
|
| 251 |
-
/**
|
| 252 |
-
* Sanitize a cache key
|
| 253 |
-
*/
|
| 254 |
-
private static function cache_key( $key ){
|
| 255 |
-
static $prefix;
|
| 256 |
-
if( ! isset($prefix) ){
|
| 257 |
-
$prefix = 'loco_'.str_replace('.','_',Loco::VERSION).'_';
|
| 258 |
-
}
|
| 259 |
-
$key = $prefix.preg_replace('/[^a-z]+/','_', strtolower($key) );
|
| 260 |
-
if( isset($key{45}) ){
|
| 261 |
-
$key = 'loco_'.md5($key);
|
| 262 |
-
}
|
| 263 |
-
return $key;
|
| 264 |
-
}
|
| 265 |
-
|
| 266 |
-
|
| 267 |
-
/**
|
| 268 |
-
* Plugin option getter/setter
|
| 269 |
-
*/
|
| 270 |
-
public static function config( array $update = array() ){
|
| 271 |
-
static $conf;
|
| 272 |
-
if( ! isset($conf) ){
|
| 273 |
-
$conf = array (
|
| 274 |
-
// whether to use external msgfmt command (1), or internal (default)
|
| 275 |
-
'use_msgfmt' => false,
|
| 276 |
-
// which external msgfmt command to use
|
| 277 |
-
'which_msgfmt' => '',
|
| 278 |
-
// whether to compile hash table into MO files
|
| 279 |
-
'gen_hash' => '0',
|
| 280 |
-
// whether to include Fuzzy strings in MO files
|
| 281 |
-
'use_fuzzy' => '1',
|
| 282 |
-
// number of backups to keep of PO and MO files
|
| 283 |
-
'num_backups' => '1',
|
| 284 |
-
// whether to enable core package translation
|
| 285 |
-
'enable_core' => '0',
|
| 286 |
-
);
|
| 287 |
-
foreach( $conf as $key => $val ){
|
| 288 |
-
$conf[$key] = get_option( Loco::NS.'-'.$key);
|
| 289 |
-
if( ! is_string($conf[$key]) ){
|
| 290 |
-
$conf[$key] = $val;
|
| 291 |
-
}
|
| 292 |
-
}
|
| 293 |
-
}
|
| 294 |
-
foreach( $update as $key => $val ){
|
| 295 |
-
if( isset($conf[$key]) ){
|
| 296 |
-
update_option( Loco::NS.'-'.$key, $val );
|
| 297 |
-
$conf[$key] = $val;
|
| 298 |
-
}
|
| 299 |
-
}
|
| 300 |
-
// force msgfmt usage if path is set (legacy installs/upgrades)
|
| 301 |
-
if( false === $conf['use_msgfmt'] ){
|
| 302 |
-
$conf['use_msgfmt'] = $conf['which_msgfmt'] ? '1' : '0';
|
| 303 |
-
}
|
| 304 |
-
return $conf;
|
| 305 |
-
}
|
| 306 |
-
|
| 307 |
-
|
| 308 |
-
/**
|
| 309 |
-
* Get WordPress capability for all Loco Admin functionality
|
| 310 |
-
*/
|
| 311 |
-
public static function admin_capablity(){
|
| 312 |
-
return apply_filters( 'loco_admin_capability', 'manage_options' );
|
| 313 |
-
}
|
| 314 |
-
|
| 315 |
-
}
|
| 316 |
-
|
| 317 |
-
|
| 318 |
-
|
| 319 |
-
|
| 320 |
-
// minimum config
|
| 321 |
-
Loco::$cache_enabled = apply_filters( 'loco_cache_enabled', ! WP_DEBUG ) and
|
| 322 |
-
Loco::$apc_enabled = function_exists('apc_fetch') && ini_get('apc.enabled');
|
| 323 |
-
Loco::load_textdomain();
|
| 324 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/loco-locales.php
DELETED
|
@@ -1,240 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Loco locale utilities
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Match locale to code at end of string.
|
| 10 |
-
* @param string e.g. "something-fr_FR"
|
| 11 |
-
* @return LocoLocale
|
| 12 |
-
*/
|
| 13 |
-
function loco_locale_resolve( $s ){
|
| 14 |
-
$lc = '';
|
| 15 |
-
$cc = '';
|
| 16 |
-
if( preg_match('/(?:^|\W)([a-z]{2,3})(?:(?:-|_)([a-z]{2}))?$/i', $s, $r ) ){
|
| 17 |
-
$lc = strtolower($r[1]);
|
| 18 |
-
if( isset($r[2]) ){
|
| 19 |
-
$cc = strtoupper($r[2]);
|
| 20 |
-
// handle situation when short domain part looks like language
|
| 21 |
-
if( ! LocoLocale::is_known_language($lc) && LocoLocale::is_known_language($cc) ){
|
| 22 |
-
$lc = strtolower($cc);
|
| 23 |
-
$cc = '';
|
| 24 |
-
}
|
| 25 |
-
}
|
| 26 |
-
}
|
| 27 |
-
return LocoLocale::init( $lc, $cc );
|
| 28 |
-
}
|
| 29 |
-
|
| 30 |
-
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Locale object
|
| 34 |
-
*/
|
| 35 |
-
final class LocoLocale {
|
| 36 |
-
|
| 37 |
-
private $lang;
|
| 38 |
-
private $region;
|
| 39 |
-
private $label;
|
| 40 |
-
private $plurals = array('one','other');
|
| 41 |
-
private $nplurals = 2;
|
| 42 |
-
private $pluraleq = 'n != 1';
|
| 43 |
-
|
| 44 |
-
private function __construct( $lc, $cc ){
|
| 45 |
-
$lc and $this->lang = strtolower($lc);
|
| 46 |
-
$cc and $this->region = strtoupper($cc);
|
| 47 |
-
}
|
| 48 |
-
|
| 49 |
-
public function export(){
|
| 50 |
-
$data = get_object_vars($this);
|
| 51 |
-
$this->region or $data['region'] = self::default_region($this->lang);
|
| 52 |
-
$data['icon'] = $this->icon_class();
|
| 53 |
-
return $data;
|
| 54 |
-
}
|
| 55 |
-
|
| 56 |
-
public function __toString(){
|
| 57 |
-
$str = $this->get_name();
|
| 58 |
-
if( $code = $this->get_code() ){
|
| 59 |
-
$str = $code.', '.$str;
|
| 60 |
-
}
|
| 61 |
-
return $str;
|
| 62 |
-
}
|
| 63 |
-
|
| 64 |
-
public function get_code(){
|
| 65 |
-
return $this->lang && $this->region ? $this->lang.'_'.$this->region : ( $this->lang ? $this->lang : '' ) ;
|
| 66 |
-
}
|
| 67 |
-
|
| 68 |
-
public function icon_class(){
|
| 69 |
-
$cc = $this->region or $cc = self::default_region($this->lang);
|
| 70 |
-
if( $cc ){
|
| 71 |
-
return 'flag flag-'.strtolower($cc).' lang-'.$this->lang;
|
| 72 |
-
}
|
| 73 |
-
return 'lang lang-'.$this->lang;
|
| 74 |
-
}
|
| 75 |
-
|
| 76 |
-
public function get_name(){
|
| 77 |
-
return empty($this->label) ? __('Unknown language','loco-legacy') : $this->label;
|
| 78 |
-
}
|
| 79 |
-
|
| 80 |
-
public function equal_to( LocoLocale $locale ){
|
| 81 |
-
return $this->get_code() === $locale->get_code();
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
public function preg( $delimiter = '/' ){
|
| 85 |
-
$lc = preg_quote( $this->lang, $delimiter );
|
| 86 |
-
$cc = preg_quote( $this->region, $delimiter );
|
| 87 |
-
return $lc.'(?:[\-_]'.$cc.')?';
|
| 88 |
-
}
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
/**
|
| 93 |
-
* @return LocoLocale
|
| 94 |
-
*/
|
| 95 |
-
public static function init( $lc, $cc ){
|
| 96 |
-
extract( self::data() );
|
| 97 |
-
if( ! $cc ){
|
| 98 |
-
if( self::is_regionless($lc) ){
|
| 99 |
-
// WordPress expects this locale to be regionless
|
| 100 |
-
$cc = '';
|
| 101 |
-
}
|
| 102 |
-
else {
|
| 103 |
-
$cc = self::default_region($lc);
|
| 104 |
-
}
|
| 105 |
-
}
|
| 106 |
-
$label = '';
|
| 107 |
-
$locale = new LocoLocale( $lc, $cc );
|
| 108 |
-
// get locale name from official WordPress list
|
| 109 |
-
if( isset($locales[$lc][$cc]) ){
|
| 110 |
-
$locale->label = $locales[$lc][$cc];
|
| 111 |
-
}
|
| 112 |
-
// get plural rules from iso 639 language and set label if common locale wasn't known
|
| 113 |
-
if( isset($langs[$lc]) ){
|
| 114 |
-
list( $label, $pluraleq, $plurals ) = $langs[$lc];
|
| 115 |
-
$locale->pluraleq = $pluraleq;
|
| 116 |
-
$locale->plurals = $plurals;
|
| 117 |
-
$locale->nplurals = count( $plurals );
|
| 118 |
-
}
|
| 119 |
-
// get country just for label if not already applied from common locale combo
|
| 120 |
-
if( ! $locale->label ){
|
| 121 |
-
if( $cc ){
|
| 122 |
-
if( isset($regions[$cc]) ){
|
| 123 |
-
$label = $label ? $label.' ('.$regions[$cc].')' : $regions[$cc];
|
| 124 |
-
}
|
| 125 |
-
else {
|
| 126 |
-
$label = $label ? $label.' ('.$cc.')' : '';
|
| 127 |
-
}
|
| 128 |
-
}
|
| 129 |
-
$locale->label = $label;
|
| 130 |
-
}
|
| 131 |
-
return $locale;
|
| 132 |
-
}
|
| 133 |
-
|
| 134 |
-
|
| 135 |
-
|
| 136 |
-
/**
|
| 137 |
-
* @return array
|
| 138 |
-
*/
|
| 139 |
-
private static function data(){
|
| 140 |
-
static $data;
|
| 141 |
-
if( ! isset($data) ){
|
| 142 |
-
// this must be the first include of this file to ensure it returns
|
| 143 |
-
$data = loco_require('build/locales-compiled');
|
| 144 |
-
}
|
| 145 |
-
return $data;
|
| 146 |
-
}
|
| 147 |
-
|
| 148 |
-
|
| 149 |
-
|
| 150 |
-
/**
|
| 151 |
-
* Get names of all common locales indexed by xx_YY code
|
| 152 |
-
* @return array
|
| 153 |
-
*/
|
| 154 |
-
public static function get_names(){
|
| 155 |
-
static $names = array();
|
| 156 |
-
if( ! $names ){
|
| 157 |
-
$data = self::data();
|
| 158 |
-
foreach( $data['locales'] as $lc => $regions ){
|
| 159 |
-
foreach( $regions as $cc => $label ){
|
| 160 |
-
if( '' === $cc ){
|
| 161 |
-
$names[$lc] = $label;
|
| 162 |
-
}
|
| 163 |
-
else {
|
| 164 |
-
$names[$lc.'_'.$cc] = $label;
|
| 165 |
-
}
|
| 166 |
-
}
|
| 167 |
-
}
|
| 168 |
-
asort($names,SORT_ASC|SORT_STRING);
|
| 169 |
-
}
|
| 170 |
-
return $names;
|
| 171 |
-
}
|
| 172 |
-
|
| 173 |
-
|
| 174 |
-
|
| 175 |
-
/**
|
| 176 |
-
* Test whether a language code is considered regionless by WordPress core.
|
| 177 |
-
* example: Thai is not "th_TH" but only "th"
|
| 178 |
-
*/
|
| 179 |
-
public static function is_regionless( $lc ){
|
| 180 |
-
$data = self::data();
|
| 181 |
-
return isset($data['locales'][$lc]['']);
|
| 182 |
-
}
|
| 183 |
-
|
| 184 |
-
|
| 185 |
-
|
| 186 |
-
/**
|
| 187 |
-
* Alias to loco_language_country
|
| 188 |
-
*/
|
| 189 |
-
public static function default_region( $lang ){
|
| 190 |
-
self::data();
|
| 191 |
-
if( 'en' === $lang ){
|
| 192 |
-
return 'US';
|
| 193 |
-
}
|
| 194 |
-
return loco_language_country( $lang );
|
| 195 |
-
}
|
| 196 |
-
|
| 197 |
-
|
| 198 |
-
/**
|
| 199 |
-
* Test if locale code is strictly a valid WordPress locale
|
| 200 |
-
*/
|
| 201 |
-
public static function is_valid_wordpress( $code ){
|
| 202 |
-
if( ! preg_match('/^[a-z]{2,3}(?:_[A-Z]{2})?$/', $code, $r ) ){
|
| 203 |
-
return false;
|
| 204 |
-
}
|
| 205 |
-
$names = self::get_names();
|
| 206 |
-
return isset( $names[$r[0]] );
|
| 207 |
-
}
|
| 208 |
-
|
| 209 |
-
|
| 210 |
-
/**
|
| 211 |
-
* Test if code is a valid language code
|
| 212 |
-
* This includes all two character languages in ISO-639, plus any three character codes used by WordPress
|
| 213 |
-
*/
|
| 214 |
-
public static function is_known_language( $code ){
|
| 215 |
-
$data = self::data();
|
| 216 |
-
$code = strtolower($code);
|
| 217 |
-
return isset($data['langs'][$code]);
|
| 218 |
-
}
|
| 219 |
-
|
| 220 |
-
|
| 221 |
-
/**
|
| 222 |
-
* Test if code is a known region
|
| 223 |
-
* This includes all two character languages in ISO-3166
|
| 224 |
-
*/
|
| 225 |
-
public static function is_known_region( $code ){
|
| 226 |
-
$data = self::data();
|
| 227 |
-
$code = strtoupper($code);
|
| 228 |
-
return isset($data['regions'][$code]);
|
| 229 |
-
}
|
| 230 |
-
|
| 231 |
-
}
|
| 232 |
-
|
| 233 |
-
|
| 234 |
-
|
| 235 |
-
|
| 236 |
-
|
| 237 |
-
|
| 238 |
-
|
| 239 |
-
|
| 240 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/lib/loco-packages.php
DELETED
|
@@ -1,1040 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Object representing a theme, plugin or domain within core code.
|
| 4 |
-
* Packages are identified uniquely by a type (e.g. "theme") and internal wordpress name, e.g. "loco-translate".
|
| 5 |
-
*/
|
| 6 |
-
abstract class LocoPackage {
|
| 7 |
-
|
| 8 |
-
/**
|
| 9 |
-
* Internal identifier, could be name, or path, or anything in future
|
| 10 |
-
* @var string
|
| 11 |
-
*/
|
| 12 |
-
private $handle;
|
| 13 |
-
|
| 14 |
-
/**
|
| 15 |
-
* Default text domain, e.g. "loco"
|
| 16 |
-
* @var string
|
| 17 |
-
*/
|
| 18 |
-
private $domain;
|
| 19 |
-
|
| 20 |
-
/**
|
| 21 |
-
* Default domain path relative to package root, e.g. "/languages"
|
| 22 |
-
* @var string
|
| 23 |
-
*/
|
| 24 |
-
protected $domainpath = '/languages';
|
| 25 |
-
|
| 26 |
-
/**
|
| 27 |
-
* Nice descriptive name, e.g. "Loco Translate"
|
| 28 |
-
* @var string
|
| 29 |
-
*/
|
| 30 |
-
private $name;
|
| 31 |
-
|
| 32 |
-
/**
|
| 33 |
-
* Locales with available translations
|
| 34 |
-
* @var array
|
| 35 |
-
*/
|
| 36 |
-
private $locales = array();
|
| 37 |
-
|
| 38 |
-
/**
|
| 39 |
-
* POT files, per domain
|
| 40 |
-
* @var array
|
| 41 |
-
*/
|
| 42 |
-
private $pot = array();
|
| 43 |
-
|
| 44 |
-
/**
|
| 45 |
-
* PO files, per domain, per locale
|
| 46 |
-
* @var array
|
| 47 |
-
*/
|
| 48 |
-
private $po = array();
|
| 49 |
-
|
| 50 |
-
/**
|
| 51 |
-
* Paths under which there may be source code in any of our domains
|
| 52 |
-
* @var array
|
| 53 |
-
*/
|
| 54 |
-
private $src = array();
|
| 55 |
-
|
| 56 |
-
/**
|
| 57 |
-
* Directories last modification times, used for cache invalidation
|
| 58 |
-
* @var array
|
| 59 |
-
*/
|
| 60 |
-
private $dirs = array();
|
| 61 |
-
|
| 62 |
-
/**
|
| 63 |
-
* @var int
|
| 64 |
-
*/
|
| 65 |
-
private $mtime = 0;
|
| 66 |
-
|
| 67 |
-
/**
|
| 68 |
-
* number of PO or POT files present
|
| 69 |
-
* @var int
|
| 70 |
-
*/
|
| 71 |
-
private $nfiles = 0;
|
| 72 |
-
|
| 73 |
-
/**
|
| 74 |
-
* Cached meta data
|
| 75 |
-
* @var array
|
| 76 |
-
*/
|
| 77 |
-
private $_meta;
|
| 78 |
-
|
| 79 |
-
/**
|
| 80 |
-
* Get package subclass type
|
| 81 |
-
* @return string theme, plugin or core
|
| 82 |
-
*/
|
| 83 |
-
abstract public function get_type();
|
| 84 |
-
|
| 85 |
-
/**
|
| 86 |
-
* Get original data about package stored in WordPress
|
| 87 |
-
*/
|
| 88 |
-
abstract public function get_original( $header );
|
| 89 |
-
|
| 90 |
-
/**
|
| 91 |
-
* Get primary file containing package headers
|
| 92 |
-
*/
|
| 93 |
-
abstract public function get_default_file();
|
| 94 |
-
|
| 95 |
-
|
| 96 |
-
/**
|
| 97 |
-
* Construct package from name, root and domain
|
| 98 |
-
*/
|
| 99 |
-
protected function __construct( $name_or_path, $domain, $name, $dpath = '' ){
|
| 100 |
-
$this->handle = $name_or_path;
|
| 101 |
-
$this->domain = $domain;
|
| 102 |
-
$this->name = $name or $this->name = $domain;
|
| 103 |
-
if( $dpath ){
|
| 104 |
-
$this->domainpath = '/'.trim($dpath,'/');
|
| 105 |
-
}
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
|
| 109 |
-
/**
|
| 110 |
-
* Get translatable header tags
|
| 111 |
-
*/
|
| 112 |
-
public function get_headers(){
|
| 113 |
-
return array();
|
| 114 |
-
}
|
| 115 |
-
|
| 116 |
-
|
| 117 |
-
/**
|
| 118 |
-
* Get default system languages directory
|
| 119 |
-
*/
|
| 120 |
-
public function global_lang_dir(){
|
| 121 |
-
return WP_LANG_DIR;
|
| 122 |
-
}
|
| 123 |
-
|
| 124 |
-
|
| 125 |
-
/**
|
| 126 |
-
* Test if provided path is under global lang dir
|
| 127 |
-
*/
|
| 128 |
-
public function is_global_path($path){
|
| 129 |
-
return 0 === strpos( $path, $this->global_lang_dir() );
|
| 130 |
-
}
|
| 131 |
-
|
| 132 |
-
|
| 133 |
-
/**
|
| 134 |
-
* Test if package has a writable global lang dir
|
| 135 |
-
*/
|
| 136 |
-
public function is_global_writable(){
|
| 137 |
-
$dir = $this->global_lang_dir();
|
| 138 |
-
return $dir && is_dir($dir) && is_writable( $dir );
|
| 139 |
-
}
|
| 140 |
-
|
| 141 |
-
|
| 142 |
-
/**
|
| 143 |
-
* Get identifying pair of arguments for fetching this object
|
| 144 |
-
* @return array
|
| 145 |
-
*/
|
| 146 |
-
public function get_query(){
|
| 147 |
-
return array (
|
| 148 |
-
'name' => $this->handle,
|
| 149 |
-
'type' => $this->get_type(),
|
| 150 |
-
);
|
| 151 |
-
}
|
| 152 |
-
|
| 153 |
-
|
| 154 |
-
/**
|
| 155 |
-
* Get package handle used for retreiving theme or plugin via wordpress functions
|
| 156 |
-
*/
|
| 157 |
-
public function get_handle(){
|
| 158 |
-
return $this->handle;
|
| 159 |
-
}
|
| 160 |
-
|
| 161 |
-
|
| 162 |
-
/**
|
| 163 |
-
* Get descriptive package name
|
| 164 |
-
*/
|
| 165 |
-
public function get_name(){
|
| 166 |
-
return $this->name;
|
| 167 |
-
}
|
| 168 |
-
|
| 169 |
-
|
| 170 |
-
/**
|
| 171 |
-
* Get all text domains with PO or POT files.
|
| 172 |
-
*/
|
| 173 |
-
private function get_domains(){
|
| 174 |
-
return array_unique( array_merge( array_keys($this->pot), array_keys($this->po) ) );
|
| 175 |
-
}
|
| 176 |
-
|
| 177 |
-
|
| 178 |
-
/**
|
| 179 |
-
* Get default text domain
|
| 180 |
-
*/
|
| 181 |
-
public function get_domain(){
|
| 182 |
-
if( ! $this->domain ){
|
| 183 |
-
$this->domain = $this->handle;
|
| 184 |
-
}
|
| 185 |
-
if( $this->domain === $this->handle ){
|
| 186 |
-
// if text domain defaulted and existing files disagree, try to correct primary domain
|
| 187 |
-
$candidates = $this->get_domains();
|
| 188 |
-
if( $candidates && ! in_array( $this->domain, $candidates, true ) ){
|
| 189 |
-
$this->domain = $candidates[0];
|
| 190 |
-
}
|
| 191 |
-
}
|
| 192 |
-
return $this->domain;
|
| 193 |
-
}
|
| 194 |
-
|
| 195 |
-
|
| 196 |
-
/**
|
| 197 |
-
* Get time most recent PO/POT file was updated
|
| 198 |
-
*/
|
| 199 |
-
public function get_modified(){
|
| 200 |
-
return $this->mtime;
|
| 201 |
-
}
|
| 202 |
-
|
| 203 |
-
|
| 204 |
-
/**
|
| 205 |
-
* Add PO or POT file and set modified state
|
| 206 |
-
*/
|
| 207 |
-
private function add_file( $path ){
|
| 208 |
-
if( filesize($path) ){
|
| 209 |
-
$this->mtime = max( $this->mtime, filemtime($path) );
|
| 210 |
-
$this->nfiles++;
|
| 211 |
-
$this->add_dir( dirname($path) );
|
| 212 |
-
return true;
|
| 213 |
-
}
|
| 214 |
-
}
|
| 215 |
-
|
| 216 |
-
|
| 217 |
-
/**
|
| 218 |
-
* Add directory and remember last modification time
|
| 219 |
-
*/
|
| 220 |
-
private function add_dir( $path ){
|
| 221 |
-
if( ! isset($this->dirs[$path]) ){
|
| 222 |
-
$this->dirs[$path] = filemtime($path);
|
| 223 |
-
}
|
| 224 |
-
}
|
| 225 |
-
|
| 226 |
-
|
| 227 |
-
/**
|
| 228 |
-
* find additional plugin PO under WP_LANG_DIR
|
| 229 |
-
*/
|
| 230 |
-
private function add_lang_dir( $langdir, $domain ){
|
| 231 |
-
$nfiles = $this->nfiles;
|
| 232 |
-
$files = LocoAdmin::find_grouped( $langdir, '/(?:-[^\.]+\.po|\.pot)$/' ) and
|
| 233 |
-
$this->add_po( $files, $domain );
|
| 234 |
-
// add $langdir if files added
|
| 235 |
-
if( $nfiles !== $this->nfiles ){
|
| 236 |
-
$this->add_dir( $langdir );
|
| 237 |
-
}
|
| 238 |
-
}
|
| 239 |
-
|
| 240 |
-
|
| 241 |
-
|
| 242 |
-
/**
|
| 243 |
-
* Add multiple locations from found PO and POT files
|
| 244 |
-
* @param array file paths collected with LocoAdmin::find_po
|
| 245 |
-
* @param string specific text domain to add
|
| 246 |
-
* @return LocoPackage
|
| 247 |
-
*/
|
| 248 |
-
private function add_po( array $files, $domain ){
|
| 249 |
-
if( isset($files['pot']) && is_array($files['pot']) ){
|
| 250 |
-
foreach( $files['pot'] as $path ){
|
| 251 |
-
$key = LocoAdmin::resolve_file_domain($path) or $key = $this->get_domain();
|
| 252 |
-
if( ( ! $domain || $key === $domain ) && $this->add_file($path) ){
|
| 253 |
-
$this->pot[$key] = $path;
|
| 254 |
-
}
|
| 255 |
-
}
|
| 256 |
-
}
|
| 257 |
-
if( isset($files['po']) && is_array($files['po']) ){
|
| 258 |
-
foreach( $files['po'] as $path ){
|
| 259 |
-
// catch namings like "default.po", "en.po" etc..
|
| 260 |
-
$name = basename($path);
|
| 261 |
-
if( false === strpos($name,'-') ){
|
| 262 |
-
// PO file has no locale suffix, we might need to use this as a POT if there is none
|
| 263 |
-
if( 'default' === $domain ){
|
| 264 |
-
$key = 'default'; // <- core
|
| 265 |
-
}
|
| 266 |
-
else {
|
| 267 |
-
$key = $this->get_domain();
|
| 268 |
-
if( ! isset($this->pot[$key]) ){
|
| 269 |
-
$this->pot[$key] = $path;
|
| 270 |
-
continue;
|
| 271 |
-
}
|
| 272 |
-
}
|
| 273 |
-
}
|
| 274 |
-
else {
|
| 275 |
-
$key = LocoAdmin::resolve_file_domain($path) or $key = $this->get_domain();
|
| 276 |
-
}
|
| 277 |
-
if( ! $domain || $key !== $domain ){
|
| 278 |
-
continue;
|
| 279 |
-
}
|
| 280 |
-
$locale = LocoAdmin::resolve_file_locale($path);
|
| 281 |
-
$code = $locale->get_code() or $code = 'xx_XX';
|
| 282 |
-
if( $this->add_file($path) ){
|
| 283 |
-
$this->po[ $key ][ $code ] = $path;
|
| 284 |
-
}
|
| 285 |
-
}
|
| 286 |
-
}
|
| 287 |
-
return $this;
|
| 288 |
-
}
|
| 289 |
-
|
| 290 |
-
|
| 291 |
-
|
| 292 |
-
/**
|
| 293 |
-
* Add any MO files for which PO files are missing
|
| 294 |
-
*/
|
| 295 |
-
private function add_mo( array $files, $domain = '' ){
|
| 296 |
-
foreach( $files as $mo_path ){
|
| 297 |
-
$domain or $domain = LocoAdmin::resolve_file_domain($mo_path) or $domain = $this->get_domain();
|
| 298 |
-
$locale = LocoAdmin::resolve_file_locale($mo_path);
|
| 299 |
-
$code = $locale->get_code() or $code = 'xx_XX';
|
| 300 |
-
if( isset($this->po[$domain][$code]) ){
|
| 301 |
-
// PO matched, ignore this MO
|
| 302 |
-
// @todo better matching as PO may not be in same location as MO
|
| 303 |
-
continue;
|
| 304 |
-
}
|
| 305 |
-
// add MO in place of PO, but only if locale code is valid
|
| 306 |
-
if( 'xx_XX' !== $code ){
|
| 307 |
-
$this->add_file($mo_path) and $this->po[$domain][$code] = $mo_path;
|
| 308 |
-
}
|
| 309 |
-
}
|
| 310 |
-
}
|
| 311 |
-
|
| 312 |
-
|
| 313 |
-
|
| 314 |
-
/**
|
| 315 |
-
* Add a location under which there may be PHP source files for one or more of our domains
|
| 316 |
-
* @return LocoPackage
|
| 317 |
-
*/
|
| 318 |
-
private function add_source( $path ){
|
| 319 |
-
$this->src[] = $path;
|
| 320 |
-
return $this;
|
| 321 |
-
}
|
| 322 |
-
|
| 323 |
-
|
| 324 |
-
/**
|
| 325 |
-
* Get most likely intended language folder
|
| 326 |
-
*/
|
| 327 |
-
public function lang_dir( $domain = '', $skip_global = false ){
|
| 328 |
-
$dirs = array();
|
| 329 |
-
// check location of POT in domain
|
| 330 |
-
foreach( $this->pot as $d => $path ){
|
| 331 |
-
if( ! $domain || $d === $domain ){
|
| 332 |
-
if( $skip_global && $this->is_global_path($path) ){
|
| 333 |
-
continue;
|
| 334 |
-
}
|
| 335 |
-
$path = dirname($path);
|
| 336 |
-
if( is_writable($path) ){
|
| 337 |
-
return $path;
|
| 338 |
-
}
|
| 339 |
-
$dirs[] = $path;
|
| 340 |
-
}
|
| 341 |
-
}
|
| 342 |
-
// check location of all PO files in domain
|
| 343 |
-
foreach( $this->po as $d => $paths ){
|
| 344 |
-
if( ! $domain || $d === $domain ){
|
| 345 |
-
foreach( $paths as $path ){
|
| 346 |
-
if( $skip_global && $this->is_global_path($path) ){
|
| 347 |
-
continue;
|
| 348 |
-
}
|
| 349 |
-
$path = dirname($path);
|
| 350 |
-
if( is_writable($path) ){
|
| 351 |
-
return $path;
|
| 352 |
-
}
|
| 353 |
-
$dirs[] = $path;
|
| 354 |
-
}
|
| 355 |
-
}
|
| 356 |
-
}
|
| 357 |
-
// check languages subfolder of all source file locations
|
| 358 |
-
foreach( $this->src as $path ){
|
| 359 |
-
if( $skip_global && $this->is_global_path($path) ){
|
| 360 |
-
continue;
|
| 361 |
-
}
|
| 362 |
-
$pref = $path.$this->domainpath;
|
| 363 |
-
if( is_writable($pref) ){
|
| 364 |
-
return $pref;
|
| 365 |
-
}
|
| 366 |
-
if( is_writable($path) ){
|
| 367 |
-
return $path;
|
| 368 |
-
}
|
| 369 |
-
if( is_dir($pref) ){
|
| 370 |
-
$dirs[] = $pref;
|
| 371 |
-
}
|
| 372 |
-
else {
|
| 373 |
-
$dirs[] = $path;
|
| 374 |
-
}
|
| 375 |
-
}
|
| 376 |
-
// check global languages location
|
| 377 |
-
if( ! $skip_global ){
|
| 378 |
-
$path = $this->global_lang_dir();
|
| 379 |
-
if( is_writable($path) ){
|
| 380 |
-
return $path;
|
| 381 |
-
}
|
| 382 |
-
$dirs[] = $path;
|
| 383 |
-
}
|
| 384 |
-
// failed to get writable directory, so we'll just return the highest priority
|
| 385 |
-
return array_shift( $dirs );
|
| 386 |
-
}
|
| 387 |
-
|
| 388 |
-
|
| 389 |
-
/**
|
| 390 |
-
* Build name of PO file for given or default domain
|
| 391 |
-
*/
|
| 392 |
-
public function create_po_path( LocoLocale $locale, $domain = '', $force_global = null ){
|
| 393 |
-
if( ! $domain ){
|
| 394 |
-
$domain = $this->get_domain();
|
| 395 |
-
}
|
| 396 |
-
// get best directory
|
| 397 |
-
if( is_null($force_global) ){
|
| 398 |
-
$dir = $this->lang_dir( $domain );
|
| 399 |
-
$force_global = $this->is_global_path( $dir );
|
| 400 |
-
}
|
| 401 |
-
// else use global directory by force
|
| 402 |
-
else if( $force_global ){
|
| 403 |
-
$dir = $this->global_lang_dir();
|
| 404 |
-
}
|
| 405 |
-
// else use best, but skipping global directory
|
| 406 |
-
else {
|
| 407 |
-
$dir = $this->lang_dir( $domain, true );
|
| 408 |
-
}
|
| 409 |
-
$name = $locale->get_code().'.po';
|
| 410 |
-
// core default package has no file prefix
|
| 411 |
-
$type = $this->get_type();
|
| 412 |
-
if( 'core' === $type && 'default' === $domain ){
|
| 413 |
-
$prefix = '';
|
| 414 |
-
}
|
| 415 |
-
// only prefix with text domain for plugins and files in global lang directory
|
| 416 |
-
else if( 'plugin' === $type || $force_global ){
|
| 417 |
-
$prefix = $domain.'-';
|
| 418 |
-
}
|
| 419 |
-
else {
|
| 420 |
-
$prefix = '';
|
| 421 |
-
}
|
| 422 |
-
// if PO files exist, copy their naming format and use location if writable
|
| 423 |
-
if( is_null($force_global) && ! empty($this->po[$domain]) ){
|
| 424 |
-
foreach( $this->po[$domain] as $code => $path ){
|
| 425 |
-
$info = pathinfo( $path );
|
| 426 |
-
$prefix = str_replace( $code.'.'.$info['extension'], '', $info['basename'] );
|
| 427 |
-
if( is_writable($info['dirname']) ){
|
| 428 |
-
$dir = $info['dirname'];
|
| 429 |
-
break;
|
| 430 |
-
}
|
| 431 |
-
}
|
| 432 |
-
}
|
| 433 |
-
return $dir.'/'.$prefix.$name;
|
| 434 |
-
}
|
| 435 |
-
|
| 436 |
-
|
| 437 |
-
/**
|
| 438 |
-
* Get root of package
|
| 439 |
-
*/
|
| 440 |
-
public function get_root(){
|
| 441 |
-
foreach( $this->src as $path ){
|
| 442 |
-
return $path;
|
| 443 |
-
}
|
| 444 |
-
return WP_LANG_DIR;
|
| 445 |
-
}
|
| 446 |
-
|
| 447 |
-
|
| 448 |
-
/**
|
| 449 |
-
* Get all PO an POT files
|
| 450 |
-
*/
|
| 451 |
-
public function get_gettext_files(){
|
| 452 |
-
$files = array();
|
| 453 |
-
foreach( $this->pot as $domain => $path ){
|
| 454 |
-
$files[] = $path;
|
| 455 |
-
}
|
| 456 |
-
foreach( $this->po as $domain => $paths ){
|
| 457 |
-
foreach( $paths as $path ){
|
| 458 |
-
$files[] = $path;
|
| 459 |
-
}
|
| 460 |
-
}
|
| 461 |
-
return $files;
|
| 462 |
-
}
|
| 463 |
-
|
| 464 |
-
|
| 465 |
-
/**
|
| 466 |
-
* Check PO/POT paths are writable.
|
| 467 |
-
* Called when generating root list view for simple error indicators.
|
| 468 |
-
*/
|
| 469 |
-
public function check_permissions(){
|
| 470 |
-
$dirs = array();
|
| 471 |
-
foreach( $this->pot as $path ){
|
| 472 |
-
$dirs[ dirname($path) ] = 1;
|
| 473 |
-
if( ! is_writable($path) ){
|
| 474 |
-
throw new Exception( __('Some files not writable','loco-legacy') );
|
| 475 |
-
}
|
| 476 |
-
}
|
| 477 |
-
foreach( $this->po as $paths ){
|
| 478 |
-
foreach( $paths as $path ){
|
| 479 |
-
$dirs[ dirname($path) ] = 1;
|
| 480 |
-
if( ! is_writable($path) ){
|
| 481 |
-
throw new Exception( __('Some files not writable','loco-legacy') );
|
| 482 |
-
}
|
| 483 |
-
if( ! file_exists( preg_replace('/\.po$/', '.mo', $path) ) ){
|
| 484 |
-
throw new Exception( __('Some files missing','loco-legacy') );
|
| 485 |
-
}
|
| 486 |
-
}
|
| 487 |
-
}
|
| 488 |
-
$dir = $this->lang_dir();
|
| 489 |
-
if( ! is_writable($dir) ){
|
| 490 |
-
throw new Exception( sprintf( __('"%s" folder not writable','loco-legacy'), basename($dir) ) );
|
| 491 |
-
}
|
| 492 |
-
foreach( array_keys($dirs) as $path ){
|
| 493 |
-
if( ! is_writable($path) ){
|
| 494 |
-
throw new Exception( sprintf( __('"%s" folder not writable','loco-legacy'), basename($dir) ) );
|
| 495 |
-
}
|
| 496 |
-
}
|
| 497 |
-
}
|
| 498 |
-
|
| 499 |
-
|
| 500 |
-
/**
|
| 501 |
-
* Get file permission for every important file path in package
|
| 502 |
-
*/
|
| 503 |
-
public function get_permission_errors(){
|
| 504 |
-
$dirs = array();
|
| 505 |
-
// add common directories
|
| 506 |
-
$base = $this->get_root();
|
| 507 |
-
$dirs[ $base ] = 1;
|
| 508 |
-
$dirs[ $base.$this->domainpath ] = 1;
|
| 509 |
-
$dirs[ $this->lang_dir() ] = 1;
|
| 510 |
-
$dirs[ $this->global_lang_dir() ] = 1;
|
| 511 |
-
// add and check files, collecting additional directories along the way
|
| 512 |
-
$paths = array();
|
| 513 |
-
foreach( $this->pot as $path ){
|
| 514 |
-
$dirs[ dirname($path) ] = 1;
|
| 515 |
-
$paths[$path] = is_writable($path) ? '' : __('POT file not writable','loco-legacy');
|
| 516 |
-
}
|
| 517 |
-
foreach( $this->po as $pos ){
|
| 518 |
-
foreach( $pos as $path ){
|
| 519 |
-
$dirs[ dirname($path) ] = 1;
|
| 520 |
-
$paths[$path] = is_writable($path) ? '' : __('PO file not writable','loco-legacy');
|
| 521 |
-
$path = preg_replace('/\.po$/', '.mo', $path );
|
| 522 |
-
$paths[$path] = file_exists($path) ? ( is_writeable($path) ? '' : __('MO file not writable','loco-legacy') ) : __('MO file not found','loco-legacy');
|
| 523 |
-
}
|
| 524 |
-
}
|
| 525 |
-
// run directory checks and sort final list alphabetically
|
| 526 |
-
foreach( array_keys($dirs) as $dir ){
|
| 527 |
-
$paths[$dir] = is_writable($dir) ? '' : ( is_dir($dir) ? __('Folder not writable','loco-legacy') : __('Folder not found','loco-legacy') );
|
| 528 |
-
}
|
| 529 |
-
ksort( $paths );
|
| 530 |
-
return $paths;
|
| 531 |
-
}
|
| 532 |
-
|
| 533 |
-
|
| 534 |
-
/**
|
| 535 |
-
* Get package errors, or things that may cause problems displaying translations
|
| 536 |
-
*/
|
| 537 |
-
public function get_author_warnings(){
|
| 538 |
-
$warn = array();
|
| 539 |
-
$type = $this->get_type();
|
| 540 |
-
if( 'core' !== $type ){
|
| 541 |
-
$camelType = strtoupper($type{0}).substr($type,1);
|
| 542 |
-
// check package declares Text Domain
|
| 543 |
-
$domain = $this->get_original('TextDomain');
|
| 544 |
-
if( ! $domain ){
|
| 545 |
-
$domain = $this->get_domain();
|
| 546 |
-
$warn[] = sprintf(__('%s does not declare a "Text Domain"','loco-legacy'),$camelType).' .. '.sprintf(__('Loco has guessed "%s"','loco-legacy'), $domain );
|
| 547 |
-
}
|
| 548 |
-
// check package declares "Domain Path"
|
| 549 |
-
$path = $this->get_original('Domain Path');
|
| 550 |
-
if( ! $domain ){
|
| 551 |
-
$warn[] = sprintf(__('%s does not declare a "Domain Path"','loco-legacy'),$camelType).' .. '.sprintf(__('Loco has guessed "%s"','loco-legacy'), $this->domainpath );
|
| 552 |
-
}
|
| 553 |
-
// check POT exists and looks correct
|
| 554 |
-
$path = $this->get_pot($domain);
|
| 555 |
-
if( ! $path ){
|
| 556 |
-
$warn[] = sprintf( __('%s has no POT file. Create one at "%s/%s.pot" if you need one.','loco-legacy'), $camelType, $this->domainpath, $domain );
|
| 557 |
-
}
|
| 558 |
-
else if( $domain.'.pot' !== basename($path) ){
|
| 559 |
-
$warn[] = sprintf( __('%s has a strange POT file name (%s). A better name would be "%s.pot"','loco-legacy'), $camelType, basename($path), $domain );
|
| 560 |
-
}
|
| 561 |
-
// TODO check references to other domains in xgettext
|
| 562 |
-
}
|
| 563 |
-
// Check if any locale codes are not an official WordPress languages
|
| 564 |
-
$meta = $this->meta();
|
| 565 |
-
foreach( $meta['po'] as $po_data ){
|
| 566 |
-
$wplang = $po_data['locale']->get_code() or $wplang = $po_data['locale']->get_name();
|
| 567 |
-
if( ! LocoLocale::is_valid_wordpress($wplang) ){
|
| 568 |
-
$warn[] = sprintf( __('%s is not an official WordPress language','loco-legacy'), $wplang );
|
| 569 |
-
}
|
| 570 |
-
}
|
| 571 |
-
return $warn;
|
| 572 |
-
}
|
| 573 |
-
|
| 574 |
-
|
| 575 |
-
/**
|
| 576 |
-
* Fetch POT file for given, or default domain
|
| 577 |
-
* @return string
|
| 578 |
-
*/
|
| 579 |
-
public function get_pot( $domain = '' ){
|
| 580 |
-
if( ! $domain ){
|
| 581 |
-
$domain = $this->get_domain();
|
| 582 |
-
}
|
| 583 |
-
if( ! empty($this->pot[$domain]) ){
|
| 584 |
-
return $this->pot[$domain];
|
| 585 |
-
}
|
| 586 |
-
// no POT, but some authors may use PO files incorrectly as a template
|
| 587 |
-
if( isset($this->po[$domain]) ){
|
| 588 |
-
foreach( array('','xx_XX','en_US','en_GB','en_EN') as $try ){
|
| 589 |
-
if( isset($this->po[$domain][$try]) ){
|
| 590 |
-
$pot = $this->po[$domain][$try];
|
| 591 |
-
unset( $this->po[$domain][$try] );
|
| 592 |
-
return $this->pot[$domain] = $pot;
|
| 593 |
-
}
|
| 594 |
-
}
|
| 595 |
-
}
|
| 596 |
-
// no template candidate
|
| 597 |
-
return '';
|
| 598 |
-
}
|
| 599 |
-
|
| 600 |
-
|
| 601 |
-
/**
|
| 602 |
-
* Check if given path is one of the package's POT files
|
| 603 |
-
* @return string related text domain if valid POT, else false
|
| 604 |
-
*/
|
| 605 |
-
public function is_pot( $path ){
|
| 606 |
-
return array_search( $path, $this->pot, true );
|
| 607 |
-
}
|
| 608 |
-
|
| 609 |
-
|
| 610 |
-
|
| 611 |
-
/**
|
| 612 |
-
* Fetch PO paths indexed by locale for given, or default domain
|
| 613 |
-
* @return array
|
| 614 |
-
*/
|
| 615 |
-
public function get_po( $domain = '' ){
|
| 616 |
-
if( ! $domain ){
|
| 617 |
-
$domain = $this->get_domain();
|
| 618 |
-
}
|
| 619 |
-
return isset($this->po[$domain]) ? $this->po[$domain] : array();
|
| 620 |
-
}
|
| 621 |
-
|
| 622 |
-
|
| 623 |
-
|
| 624 |
-
/**
|
| 625 |
-
* Find all source files, currently only PHP
|
| 626 |
-
*/
|
| 627 |
-
public function get_source_files(){
|
| 628 |
-
$found = array();
|
| 629 |
-
foreach( $this->src as $dir ){
|
| 630 |
-
foreach( LocoAdmin::find_php($dir) as $path ){
|
| 631 |
-
$found[] = $path;
|
| 632 |
-
}
|
| 633 |
-
}
|
| 634 |
-
return $found;
|
| 635 |
-
}
|
| 636 |
-
|
| 637 |
-
|
| 638 |
-
/**
|
| 639 |
-
* Get all source root directories
|
| 640 |
-
*/
|
| 641 |
-
public function get_source_dirs( $relative_to = '' ){
|
| 642 |
-
if( ! $relative_to ){
|
| 643 |
-
return $this->src;
|
| 644 |
-
}
|
| 645 |
-
// calculate path from location of given file (which may not exist)
|
| 646 |
-
if( pathinfo($relative_to,PATHINFO_EXTENSION) ){
|
| 647 |
-
$relative_to = dirname($relative_to);
|
| 648 |
-
}
|
| 649 |
-
$dirs = array();
|
| 650 |
-
foreach( $this->src as $target_dir ){
|
| 651 |
-
$dirs[] = loco_relative_path( $relative_to, $target_dir );
|
| 652 |
-
}
|
| 653 |
-
return $dirs;
|
| 654 |
-
}
|
| 655 |
-
|
| 656 |
-
|
| 657 |
-
/**
|
| 658 |
-
* Test if package has any source directories
|
| 659 |
-
*/
|
| 660 |
-
public function has_source_dirs(){
|
| 661 |
-
return ! empty( $this->src );
|
| 662 |
-
}
|
| 663 |
-
|
| 664 |
-
|
| 665 |
-
/**
|
| 666 |
-
* Export meta data used by templates.
|
| 667 |
-
* @return array
|
| 668 |
-
*/
|
| 669 |
-
public function meta(){
|
| 670 |
-
if( ! is_array($this->_meta) ){
|
| 671 |
-
$pot = $po = array();
|
| 672 |
-
// get POT files for all domains, fixing incorrect PO usage
|
| 673 |
-
foreach( $this->get_domains() as $domain ){
|
| 674 |
-
$path = $this->get_pot( $domain ) and
|
| 675 |
-
$pot[] = compact('domain','path');
|
| 676 |
-
}
|
| 677 |
-
// get progress and locale for each PO file
|
| 678 |
-
foreach( $this->po as $domain => $locales ){
|
| 679 |
-
foreach( $locales as $code => $path ){
|
| 680 |
-
try {
|
| 681 |
-
unset($headers);
|
| 682 |
-
$export = LocoAdmin::parse_po_with_headers( $path, $headers );
|
| 683 |
-
$po[] = array (
|
| 684 |
-
'path' => $path,
|
| 685 |
-
'domain' => $domain,
|
| 686 |
-
'name' => trim( str_replace( array('.po','.mo',$domain), array('','',''), basename($path) ), '-_'),
|
| 687 |
-
'stats' => loco_po_stats( $export ),
|
| 688 |
-
'length' => count( $export ),
|
| 689 |
-
'locale' => loco_locale_resolve($code),
|
| 690 |
-
'projid' => trim( $headers->{'project-id-version'} ),
|
| 691 |
-
);
|
| 692 |
-
}
|
| 693 |
-
catch( Exception $Ex ){
|
| 694 |
-
continue;
|
| 695 |
-
}
|
| 696 |
-
}
|
| 697 |
-
}
|
| 698 |
-
$this->_meta = compact('po','pot') + array(
|
| 699 |
-
'name' => $this->get_name(),
|
| 700 |
-
'root' => $this->get_root(),
|
| 701 |
-
'domain' => $this->get_domain(),
|
| 702 |
-
);
|
| 703 |
-
}
|
| 704 |
-
return $this->_meta;
|
| 705 |
-
}
|
| 706 |
-
|
| 707 |
-
|
| 708 |
-
|
| 709 |
-
/**
|
| 710 |
-
* Clear this package from the cache. Called to invalidate when something updates
|
| 711 |
-
* @return LocoPackage
|
| 712 |
-
*/
|
| 713 |
-
public function uncache(){
|
| 714 |
-
$key = $this->get_type().'_'.$this->handle;
|
| 715 |
-
Loco::uncache( $key );
|
| 716 |
-
$this->_meta = null;
|
| 717 |
-
return $this;
|
| 718 |
-
}
|
| 719 |
-
|
| 720 |
-
|
| 721 |
-
/**
|
| 722 |
-
* Invalidate cache based on last modification of directories
|
| 723 |
-
* @return bool whether cache should be invalidated
|
| 724 |
-
*/
|
| 725 |
-
private function invalidate(){
|
| 726 |
-
foreach( $this->dirs as $path => $mtime ){
|
| 727 |
-
if( ! is_dir($path) || filemtime($path) !== $mtime ){
|
| 728 |
-
return true;
|
| 729 |
-
}
|
| 730 |
-
}
|
| 731 |
-
}
|
| 732 |
-
|
| 733 |
-
|
| 734 |
-
/**
|
| 735 |
-
* Construct package object from theme data
|
| 736 |
-
* @return LocoPackage
|
| 737 |
-
*/
|
| 738 |
-
private static function get_theme( $handle ){
|
| 739 |
-
$theme = wp_get_theme( $handle );
|
| 740 |
-
if( $theme && $theme->exists() ){
|
| 741 |
-
$name = $theme->get('Name');
|
| 742 |
-
$domain = $theme->get('TextDomain') or $domain = $handle;
|
| 743 |
-
// create theme package with text domain defaulting to template name
|
| 744 |
-
$package = new LocoThemePackage( $handle, $domain, $name, $theme->get('DomainPath') );
|
| 745 |
-
$root = $theme->get_theme_root().'/'.$handle;
|
| 746 |
-
$package->add_source( $root );
|
| 747 |
-
// add PO and POT under theme root
|
| 748 |
-
if( $pofiles = LocoAdmin::find_po($root) ){
|
| 749 |
-
$package->add_po( $pofiles, $domain );
|
| 750 |
-
}
|
| 751 |
-
// pick up any MO files that have missing PO
|
| 752 |
-
if( $mofiles = LocoAdmin::find_mo($root) ){
|
| 753 |
-
$package->add_mo( $mofiles, $domain );
|
| 754 |
-
}
|
| 755 |
-
// find additional theme PO under WP_LANG_DIR/themes unless a child theme
|
| 756 |
-
$package->add_lang_dir( WP_LANG_DIR.'/themes', $domain );
|
| 757 |
-
// child theme inherits parent, but keeps its own domain
|
| 758 |
-
if( $parent = $theme->get_template() ){
|
| 759 |
-
if( $parent !== $handle ){
|
| 760 |
-
$package->inherit( $parent );
|
| 761 |
-
}
|
| 762 |
-
}
|
| 763 |
-
// fall back to all POT matches if no exact domain match
|
| 764 |
-
if( ! $package->pot ){
|
| 765 |
-
unset( $pofiles['po'] );
|
| 766 |
-
$package->add_po( $pofiles, null );
|
| 767 |
-
}
|
| 768 |
-
return $package;
|
| 769 |
-
}
|
| 770 |
-
}
|
| 771 |
-
|
| 772 |
-
|
| 773 |
-
/**
|
| 774 |
-
* Construct package object from plugin array
|
| 775 |
-
* note that handle is file path for plugins in WordPress
|
| 776 |
-
*/
|
| 777 |
-
private static function get_plugin( $handle ){
|
| 778 |
-
$plugins = get_plugins();
|
| 779 |
-
if( isset($plugins[$handle]) && is_array($plugins[$handle]) ){
|
| 780 |
-
$plugin = $plugins[$handle];
|
| 781 |
-
$domain = $plugin['TextDomain'] or $domain = str_replace('/','-',dirname($handle));
|
| 782 |
-
if( '.' === $domain ){
|
| 783 |
-
// single-file plugin has no directory to take a domain from
|
| 784 |
-
$domain = substr( basename($handle),0,-4);
|
| 785 |
-
}
|
| 786 |
-
$package = new LocoPluginPackage( $handle, $domain, $plugin['Name'], $plugin['DomainPath'] );
|
| 787 |
-
// single-file plugins have no root, or anywhere to save POT file.
|
| 788 |
-
if( false !== strpos($handle,'/') ){
|
| 789 |
-
$root = WP_PLUGIN_DIR.'/'.dirname($handle);
|
| 790 |
-
$package->add_source( $root );
|
| 791 |
-
// add PO and POT under plugin root
|
| 792 |
-
if( $pofiles = LocoAdmin::find_po($root) ){
|
| 793 |
-
$package->add_po( $pofiles, $domain );
|
| 794 |
-
}
|
| 795 |
-
// pick up any MO files that have missing PO
|
| 796 |
-
if( $mofiles = LocoAdmin::find_mo($root) ){
|
| 797 |
-
$package->add_mo( $mofiles, $domain );
|
| 798 |
-
}
|
| 799 |
-
}
|
| 800 |
-
// find additional plugin PO under WP_LANG_DIR/plugin
|
| 801 |
-
$package->add_lang_dir( WP_LANG_DIR.'/plugins', $domain );
|
| 802 |
-
// fall back to all POT matches if no exact domain match
|
| 803 |
-
if( ! $package->pot && isset($pofiles) ){
|
| 804 |
-
unset( $pofiles['po'] );
|
| 805 |
-
$package->add_po( $pofiles, null );
|
| 806 |
-
}
|
| 807 |
-
return $package;
|
| 808 |
-
}
|
| 809 |
-
}
|
| 810 |
-
|
| 811 |
-
|
| 812 |
-
/**
|
| 813 |
-
* construct a core package object from name
|
| 814 |
-
* @return LocoPackage
|
| 815 |
-
*/
|
| 816 |
-
private static function get_core( $handle ){
|
| 817 |
-
static $grouped;
|
| 818 |
-
if( ! isset($grouped) ){
|
| 819 |
-
$grouped = array();
|
| 820 |
-
foreach( LocoAdmin::find_grouped( WP_LANG_DIR, '/\.pot?$/' ) as $ext => $files ){
|
| 821 |
-
foreach( $files as $path ){
|
| 822 |
-
$domain = LocoAdmin::resolve_file_domain( $path );
|
| 823 |
-
$grouped[ $domain ][ $ext ][] = $path;
|
| 824 |
-
}
|
| 825 |
-
}
|
| 826 |
-
}
|
| 827 |
-
$domain = $handle or $domain = 'default';
|
| 828 |
-
$package = new LocoCorePackage( $handle, $domain, '' );
|
| 829 |
-
if( isset($grouped[$handle]) ){
|
| 830 |
-
// add PO file and POT files for this component
|
| 831 |
-
$package->add_po( $grouped[$handle], $domain );
|
| 832 |
-
// get name from po file
|
| 833 |
-
$meta = $package->meta();
|
| 834 |
-
foreach( $meta['po'] as $pmeta ){
|
| 835 |
-
if( $pmeta['projid'] ){
|
| 836 |
-
$package->name = $pmeta['projid'];
|
| 837 |
-
}
|
| 838 |
-
}
|
| 839 |
-
// disable source directories as Core packages cannot be synced
|
| 840 |
-
$package->src = array();
|
| 841 |
-
}
|
| 842 |
-
return $package;
|
| 843 |
-
}
|
| 844 |
-
|
| 845 |
-
|
| 846 |
-
|
| 847 |
-
/**
|
| 848 |
-
* Get all core pseudo packages
|
| 849 |
-
*/
|
| 850 |
-
public static function get_core_packages(){
|
| 851 |
-
static $names = array( '', 'admin', 'admin-network', 'continents-cities', 'ms' );
|
| 852 |
-
$packages = array();
|
| 853 |
-
foreach( $names as $handle ){
|
| 854 |
-
$packages[$handle] = self::get( $handle, 'core' );
|
| 855 |
-
}
|
| 856 |
-
return $packages;
|
| 857 |
-
}
|
| 858 |
-
|
| 859 |
-
|
| 860 |
-
|
| 861 |
-
/**
|
| 862 |
-
* Get a package - from cache if possible
|
| 863 |
-
* @param string unique name or identifier known to WordPress
|
| 864 |
-
* @param string "core", "theme" or "plugin"
|
| 865 |
-
* @return LocoPackage
|
| 866 |
-
*/
|
| 867 |
-
public static function get( $handle, $type ){
|
| 868 |
-
$key = $type.'_'.$handle;
|
| 869 |
-
$package = Loco::cached($key);
|
| 870 |
-
if( $package instanceof LocoPackage ){
|
| 871 |
-
if( $package->invalidate() ){
|
| 872 |
-
$package = null;
|
| 873 |
-
}
|
| 874 |
-
}
|
| 875 |
-
if( ! $package instanceof LocoPackage ){
|
| 876 |
-
$getter = array( __CLASS__, 'get_'.$type );
|
| 877 |
-
$package = call_user_func( $getter, $handle );
|
| 878 |
-
if( $package ){
|
| 879 |
-
$package->meta();
|
| 880 |
-
Loco::cache( $key, $package );
|
| 881 |
-
}
|
| 882 |
-
}
|
| 883 |
-
return $package;
|
| 884 |
-
}
|
| 885 |
-
|
| 886 |
-
|
| 887 |
-
|
| 888 |
-
/**
|
| 889 |
-
* @internal
|
| 890 |
-
*/
|
| 891 |
-
private static function _sort_modified( LocoPackage $a, LocoPackage $b ){
|
| 892 |
-
$a = $a->get_modified();
|
| 893 |
-
$b = $b->get_modified();
|
| 894 |
-
if( $a > $b ){
|
| 895 |
-
return -1;
|
| 896 |
-
}
|
| 897 |
-
if( $b > $a ){
|
| 898 |
-
return 1;
|
| 899 |
-
}
|
| 900 |
-
return 0;
|
| 901 |
-
}
|
| 902 |
-
|
| 903 |
-
|
| 904 |
-
/**
|
| 905 |
-
* Sort packages according to most recently updated language files
|
| 906 |
-
*/
|
| 907 |
-
public static function sort_modified( array $packages ){
|
| 908 |
-
static $sorter = array( __CLASS__, '_sort_modified' );
|
| 909 |
-
usort( $packages, $sorter );
|
| 910 |
-
return $packages;
|
| 911 |
-
}
|
| 912 |
-
|
| 913 |
-
|
| 914 |
-
|
| 915 |
-
}
|
| 916 |
-
|
| 917 |
-
|
| 918 |
-
/**
|
| 919 |
-
* Extended package class for themes
|
| 920 |
-
*/
|
| 921 |
-
class LocoThemePackage extends LocoPackage {
|
| 922 |
-
private $parent;
|
| 923 |
-
public function global_lang_dir(){
|
| 924 |
-
return WP_LANG_DIR.'/themes';
|
| 925 |
-
}
|
| 926 |
-
protected function inherit( $template ){
|
| 927 |
-
$parent = wp_get_theme( $template );
|
| 928 |
-
if( $parent && $parent->exists() ){
|
| 929 |
-
$this->parent = $template;
|
| 930 |
-
}
|
| 931 |
-
}
|
| 932 |
-
protected function is_child(){
|
| 933 |
-
return ! empty($this->parent);
|
| 934 |
-
}
|
| 935 |
-
protected function get_parent(){
|
| 936 |
-
return $this->parent ? LocoPackage::get( $this->parent, 'theme' ) : null;
|
| 937 |
-
}
|
| 938 |
-
public function meta(){
|
| 939 |
-
$meta = parent::meta();
|
| 940 |
-
if( $parent = $this->get_parent() ){
|
| 941 |
-
$pmeta = $parent->meta();
|
| 942 |
-
$meta['parent'] = $parent->get_name();
|
| 943 |
-
// merge parent resources unless child has its own domain
|
| 944 |
-
if( $meta['domain'] === $pmeta['domain'] ){
|
| 945 |
-
$meta['po'] = array_merge( $meta['po'], $pmeta['po'] );
|
| 946 |
-
$meta['pot'] = array_merge( $meta['pot'], $pmeta['pot'] );
|
| 947 |
-
}
|
| 948 |
-
}
|
| 949 |
-
return $meta;
|
| 950 |
-
}
|
| 951 |
-
public function check_permissions(){
|
| 952 |
-
parent::check_permissions();
|
| 953 |
-
if( $parent = $this->get_parent() ){
|
| 954 |
-
$parent->check_permissions();
|
| 955 |
-
}
|
| 956 |
-
}
|
| 957 |
-
public function get_permission_errors(){
|
| 958 |
-
$paths = parent::get_permission_errors();
|
| 959 |
-
// check parent theme if exists
|
| 960 |
-
if( $parent = $this->get_parent() ){
|
| 961 |
-
// recurse if child theme uses same domain as parent
|
| 962 |
-
if( $this->get_domain() === $parent->get_domain() ){
|
| 963 |
-
$paths += $parent->get_permission_errors( true );
|
| 964 |
-
}
|
| 965 |
-
}
|
| 966 |
-
return $paths;
|
| 967 |
-
}
|
| 968 |
-
public function get_pot( $domain = '' ){
|
| 969 |
-
if( ( $parent = $this->get_parent() ) && ( $pot = $parent->get_pot($domain) ) ){
|
| 970 |
-
return $pot;
|
| 971 |
-
}
|
| 972 |
-
return parent::get_pot( $domain );
|
| 973 |
-
}
|
| 974 |
-
public function get_type(){
|
| 975 |
-
return 'theme';
|
| 976 |
-
}
|
| 977 |
-
public function get_original( $tag ){
|
| 978 |
-
$theme = wp_get_theme( $this->get_handle() );
|
| 979 |
-
return $theme->get( $tag );
|
| 980 |
-
}
|
| 981 |
-
public function get_headers(){
|
| 982 |
-
$headers = array();
|
| 983 |
-
$theme = wp_get_theme( $this->get_handle() );
|
| 984 |
-
foreach( array('Name','ThemeURI','Description','Author','AuthorURI') as $tag ){
|
| 985 |
-
$headers[$tag] = $theme->get($tag) or $headers[$tag] = '';
|
| 986 |
-
}
|
| 987 |
-
return $headers;
|
| 988 |
-
}
|
| 989 |
-
public function get_default_file(){
|
| 990 |
-
return $this->get_root().'/style.css';
|
| 991 |
-
}
|
| 992 |
-
}
|
| 993 |
-
|
| 994 |
-
|
| 995 |
-
/**
|
| 996 |
-
* Extended package class for plugins
|
| 997 |
-
*/
|
| 998 |
-
class LocoPluginPackage extends LocoPackage {
|
| 999 |
-
public function global_lang_dir(){
|
| 1000 |
-
return WP_LANG_DIR.'/plugins';
|
| 1001 |
-
}
|
| 1002 |
-
public function get_type(){
|
| 1003 |
-
return 'plugin';
|
| 1004 |
-
}
|
| 1005 |
-
public function get_original( $tag ){
|
| 1006 |
-
$plugins = get_plugins();
|
| 1007 |
-
$plugin = $plugins[ $this->get_handle() ];
|
| 1008 |
-
return isset($plugin[$tag]) ? $plugin[$tag] : '';
|
| 1009 |
-
}
|
| 1010 |
-
public function get_headers(){
|
| 1011 |
-
$headers = array();
|
| 1012 |
-
$plugins = get_plugins();
|
| 1013 |
-
$plugin = $plugins[ $this->get_handle() ];
|
| 1014 |
-
foreach( array('Name','PluginURI','Description','Author','AuthorURI') as $tag ){
|
| 1015 |
-
$headers[$tag] = isset($plugin[$tag]) ? $plugin[$tag] : '';
|
| 1016 |
-
}
|
| 1017 |
-
return $headers;
|
| 1018 |
-
}
|
| 1019 |
-
public function get_default_file(){
|
| 1020 |
-
return WP_PLUGIN_DIR.'/'.$this->get_handle();
|
| 1021 |
-
}
|
| 1022 |
-
}
|
| 1023 |
-
|
| 1024 |
-
|
| 1025 |
-
/**
|
| 1026 |
-
* Extended package class for core pseudo packages
|
| 1027 |
-
*/
|
| 1028 |
-
class LocoCorePackage extends LocoPackage {
|
| 1029 |
-
protected $domainpath = '';
|
| 1030 |
-
public function get_type(){
|
| 1031 |
-
return 'core';
|
| 1032 |
-
}
|
| 1033 |
-
public function get_original( $header ){
|
| 1034 |
-
return null;
|
| 1035 |
-
}
|
| 1036 |
-
public function get_default_file(){
|
| 1037 |
-
return null;
|
| 1038 |
-
}
|
| 1039 |
-
}
|
| 1040 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-ajax.php
DELETED
|
@@ -1,53 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin ajax action wrapper
|
| 4 |
-
*/
|
| 5 |
-
try {
|
| 6 |
-
|
| 7 |
-
// no errors ruining json response please
|
| 8 |
-
if( false === ini_set( 'display_errors', 0 ) ){
|
| 9 |
-
error_reporting(0);
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
if( ! function_exists('current_user_can') || ! class_exists('LocoAdmin') ){
|
| 13 |
-
throw new Exception('Ajax action only');
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
if( ! current_user_can(Loco::admin_capablity()) ){
|
| 17 |
-
throw new Exception( __('User does not have permission to manage translations','loco-legacy'), 403 );
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
$incphp = isset($action) ? dirname(__FILE__).'/'.$action.'.php' : '';
|
| 21 |
-
if( ! $incphp || ! file_exists($incphp) ){
|
| 22 |
-
throw new Exception('Bad Ajax action');
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
// Ajax action can only exit 200
|
| 27 |
-
try {
|
| 28 |
-
$response = include $incphp;
|
| 29 |
-
}
|
| 30 |
-
catch( Exception $Ex ){
|
| 31 |
-
$response = array( 'error' => array (
|
| 32 |
-
'code' => $Ex->getCode(),
|
| 33 |
-
'message' => $Ex->getMessage(),
|
| 34 |
-
) );
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
if( ! is_array($response) ){
|
| 39 |
-
throw new Exception('Ajax action did not return a response');
|
| 40 |
-
}
|
| 41 |
-
|
| 42 |
-
// json ok
|
| 43 |
-
$body = json_encode( $response );
|
| 44 |
-
header('Content-Type: application/json; charset=UTF-8', true );
|
| 45 |
-
header('Content-Length: '.strlen($body), true );
|
| 46 |
-
echo $body;
|
| 47 |
-
exit(0);
|
| 48 |
-
|
| 49 |
-
|
| 50 |
-
}
|
| 51 |
-
catch( Exception $Ex ){
|
| 52 |
-
require dirname(__FILE__).'/loco-fatal.php';
|
| 53 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-data.php
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin ajax include that returns compiled-in data
|
| 4 |
-
* Included by loco-ajax.php during Ajax action
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
DOING_AJAX or die();
|
| 8 |
-
|
| 9 |
-
// default is single locale response
|
| 10 |
-
if( isset($locale) ){
|
| 11 |
-
loco_require('loco-locales');
|
| 12 |
-
$data = loco_locale_resolve($locale);
|
| 13 |
-
return array (
|
| 14 |
-
'locales' => array (
|
| 15 |
-
$locale => $data->export(),
|
| 16 |
-
),
|
| 17 |
-
);
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
throw new Exception( __('Invalid data posted to server','loco-legacy'), 422 );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-download.php
DELETED
|
@@ -1,95 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* PO/MO download script
|
| 4 |
-
*/
|
| 5 |
-
try {
|
| 6 |
-
|
| 7 |
-
if( 'POST' !== $_SERVER['REQUEST_METHOD'] ){
|
| 8 |
-
throw new Exception( 'Method not permitted', 405 );
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
// no errors ruining response please
|
| 12 |
-
if( false === ini_set( 'display_errors', 0 ) ){
|
| 13 |
-
error_reporting(0);
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
if( ! function_exists('current_user_can') || ! class_exists('LocoAdmin') ){
|
| 17 |
-
throw new Exception('WordPress not bootstrapped');
|
| 18 |
-
}
|
| 19 |
-
|
| 20 |
-
if( ! current_user_can(Loco::admin_capablity()) ){
|
| 21 |
-
throw new Exception( __('User does not have permission to manage translations','loco-legacy'), 403 );
|
| 22 |
-
}
|
| 23 |
-
|
| 24 |
-
if( empty($po) ){
|
| 25 |
-
throw new Exception( 'Empty source data', 422 );
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
if( empty($path) ){
|
| 29 |
-
$name = 'messages.po';
|
| 30 |
-
$ext = 'po';
|
| 31 |
-
}
|
| 32 |
-
else {
|
| 33 |
-
$name = basename($path);
|
| 34 |
-
$ext = strtolower( pathinfo( $name, PATHINFO_EXTENSION ) );
|
| 35 |
-
}
|
| 36 |
-
|
| 37 |
-
|
| 38 |
-
// Undo magic quotes if enabled
|
| 39 |
-
if( get_magic_quotes_gpc() ){
|
| 40 |
-
$po = stripslashes( $po );
|
| 41 |
-
}
|
| 42 |
-
|
| 43 |
-
|
| 44 |
-
// Simple post-through for PO and POT
|
| 45 |
-
if( 'mo' !== $ext ){
|
| 46 |
-
header('Content-Type: application/x-gettext; charset=UTF-8', true );
|
| 47 |
-
header('Content-Length: '.strlen($po), true );
|
| 48 |
-
header('Content-Disposition: attachment; filename='.$name, true );
|
| 49 |
-
echo $po;
|
| 50 |
-
exit(0);
|
| 51 |
-
}
|
| 52 |
-
|
| 53 |
-
|
| 54 |
-
// Attempt to compile MO direct to file via shell
|
| 55 |
-
if( $msgfmt = LocoAdmin::msgfmt_command() ){
|
| 56 |
-
try {
|
| 57 |
-
loco_require('build/shell-compiled');
|
| 58 |
-
define( 'WHICH_MSGFMT', $msgfmt );
|
| 59 |
-
// use temp file if possible, due to stdin size restrictions
|
| 60 |
-
if( $popath = tempnam( sys_get_temp_dir(), 'loco-' ) ){
|
| 61 |
-
register_shutdown_function( 'unlink', $popath );
|
| 62 |
-
file_put_contents( $popath, $po );
|
| 63 |
-
$mopath = loco_compile_mo_file( $popath, $mopath );
|
| 64 |
-
register_shutdown_function( 'unlink', $mopath );
|
| 65 |
-
$mo = file_get_contents( $mopath );
|
| 66 |
-
}
|
| 67 |
-
else {
|
| 68 |
-
$mo = loco_compile_mo( $po );
|
| 69 |
-
}
|
| 70 |
-
}
|
| 71 |
-
catch( Exception $Ex ){
|
| 72 |
-
error_log( $Ex->getMessage(), 0 );
|
| 73 |
-
}
|
| 74 |
-
if( ! $mo ){
|
| 75 |
-
throw new Exception( sprintf( __('Failed to compile MO file with %s, check your settings','loco-legacy'), WHICH_MSGFMT ) );
|
| 76 |
-
}
|
| 77 |
-
}
|
| 78 |
-
|
| 79 |
-
// Fall back to in-built MO compiler - requires PO is parsed too
|
| 80 |
-
else {
|
| 81 |
-
$mo = LocoAdmin::msgfmt_native($po);
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
// exit with binary MO
|
| 85 |
-
header('Content-Type: application/x-gettext-translation; charset=UTF-8', true );
|
| 86 |
-
header('Content-Length: '.strlen($mo), true );
|
| 87 |
-
header('Content-Disposition: attachment; filename='.$name, true );
|
| 88 |
-
echo $mo;
|
| 89 |
-
exit(0);
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
}
|
| 93 |
-
catch( Exception $Ex ){
|
| 94 |
-
require dirname(__FILE__).'/loco-fatal.php';
|
| 95 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-fail.php
DELETED
|
@@ -1,10 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Script that deliberately fails
|
| 4 |
-
*/
|
| 5 |
-
try {
|
| 6 |
-
throw new Exception('Unknown error');
|
| 7 |
-
}
|
| 8 |
-
catch( Exception $Ex ){
|
| 9 |
-
require dirname(__FILE__).'/loco-fatal.php';
|
| 10 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-fatal.php
DELETED
|
@@ -1,34 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Handle exception with fatal exit
|
| 4 |
-
*/
|
| 5 |
-
$status = $Ex->getCode() or $status = 500;
|
| 6 |
-
$message = $Ex->getMessage();
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
if( ( isset($_SERVER['HTTP_X_REQUESTED_WITH']) && 'XMLHttpRequest' === $_SERVER['HTTP_X_REQUESTED_WITH'] ) ){
|
| 10 |
-
$type = 'application/json; charset=UTF-8';
|
| 11 |
-
$body = json_encode( compact('status','message') );
|
| 12 |
-
}
|
| 13 |
-
else {
|
| 14 |
-
$type = 'text/html; charset=UTF-8';
|
| 15 |
-
$body = '<!DOCTYPE html>
|
| 16 |
-
<html>
|
| 17 |
-
<head>
|
| 18 |
-
<meta charset="utf-8" />
|
| 19 |
-
<title>Error '.$status.'</title>
|
| 20 |
-
</head>
|
| 21 |
-
<body>
|
| 22 |
-
<h1>'.htmlspecialchars($message, ENT_COMPAT, 'UTF-8').'</h1>
|
| 23 |
-
</body>
|
| 24 |
-
</html>
|
| 25 |
-
';
|
| 26 |
-
}
|
| 27 |
-
|
| 28 |
-
|
| 29 |
-
header( sprintf('HTTP/1.0 %u %s', $status, $message ), true, $status );
|
| 30 |
-
header('Content-Type: '.$type, true, $status );
|
| 31 |
-
header('Content-Length: '.strlen($body), true, $status );
|
| 32 |
-
|
| 33 |
-
echo $body;
|
| 34 |
-
exit(0);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-posave.php
DELETED
|
@@ -1,145 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin ajax include that saves PO file from editor to disk
|
| 4 |
-
* Included by loco-ajax.php during Ajax action
|
| 5 |
-
*/
|
| 6 |
-
|
| 7 |
-
DOING_AJAX or die();
|
| 8 |
-
|
| 9 |
-
if( empty($path) || empty($po) || ! isset($name) || empty($type) ){
|
| 10 |
-
throw new Exception( __('Invalid data posted to server','loco-legacy'), 422 );
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
// path is allowed to not exist yet
|
| 14 |
-
if( '/' !== $path{0} ){
|
| 15 |
-
$path = WP_CONTENT_DIR.'/'.$path;
|
| 16 |
-
}
|
| 17 |
-
|
| 18 |
-
// but package must exist so we can get POT or source
|
| 19 |
-
/* @var $package LocoPackage */
|
| 20 |
-
loco_require('loco-packages','loco-locales');
|
| 21 |
-
$package = LocoPackage::get( $name, $type );
|
| 22 |
-
if( ! $package ){
|
| 23 |
-
throw new Exception( sprintf( __('Package not found called %s','loco-legacy'), $name ), 404 );
|
| 24 |
-
}
|
| 25 |
-
|
| 26 |
-
$fname = basename($path);
|
| 27 |
-
$podir = dirname( $path );
|
| 28 |
-
$dname = basename( $podir );
|
| 29 |
-
$ispot = LocoAdmin::is_pot( $fname );
|
| 30 |
-
$ftype = $ispot ? 'POT' : 'PO';
|
| 31 |
-
|
| 32 |
-
|
| 33 |
-
// handle file backups if file exists and enabled
|
| 34 |
-
if( file_exists($path) ){
|
| 35 |
-
$conf = Loco::config();
|
| 36 |
-
$num = (int) $conf['num_backups'];
|
| 37 |
-
if( is_writable($podir) ){
|
| 38 |
-
$dest = preg_replace('/\.(pot?)$/i', '-backup-', $path );
|
| 39 |
-
// delete oldest backups until we have $num-1 remaining
|
| 40 |
-
if( $prev = glob( $dest.'*' ) ){
|
| 41 |
-
function _loco_sort_backups( $f1, $f2 ){
|
| 42 |
-
$t1 = filemtime($f1);
|
| 43 |
-
$t2 = filemtime($f2);
|
| 44 |
-
return $t1 < $t2 ? -1 : ( $t2 < $t1 ? 1 : 0 );
|
| 45 |
-
}
|
| 46 |
-
usort( $prev, '_loco_sort_backups' );
|
| 47 |
-
foreach( array_slice( $prev, max(0,$num-1) ) as $oldpath ){
|
| 48 |
-
register_shutdown_function( 'unlink', $oldpath );
|
| 49 |
-
}
|
| 50 |
-
}
|
| 51 |
-
// write new backup
|
| 52 |
-
if( $num ){
|
| 53 |
-
$dest .= date('YmdHis').'.'.strtolower($ftype).'~';
|
| 54 |
-
copy( $path, $dest );
|
| 55 |
-
}
|
| 56 |
-
}
|
| 57 |
-
else if( $num ){
|
| 58 |
-
throw new Exception( sprintf( __('Web server cannot create backups in "%s". Fix file permissions or disable backups in settings','loco-legacy'), basename($podir) ) );
|
| 59 |
-
}
|
| 60 |
-
}
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
// else construct directory tree if file does not exist
|
| 64 |
-
else if( ! file_exists($podir) && ! mkdir( $path, 0775, true ) ){
|
| 65 |
-
$pname = basename( dirname($podir) );
|
| 66 |
-
throw new Exception( sprintf( __('Web server cannot create "%s" directory in "%s". Fix file permissions or create it manually.','loco-legacy'), $dname, $pname ) );
|
| 67 |
-
}
|
| 68 |
-
else if( ! is_dir($podir) || ! is_writable($podir) ){
|
| 69 |
-
throw new Exception( sprintf(__('Web server cannot create files in the "%s" directory. Fix file permissions or use the download function.','loco-legacy'), basename($podir) ) );
|
| 70 |
-
}
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
// Undo magic quotes if enabled
|
| 74 |
-
if( get_magic_quotes_gpc() ){
|
| 75 |
-
$po = stripslashes( $po );
|
| 76 |
-
}
|
| 77 |
-
|
| 78 |
-
// attempt to write PO file
|
| 79 |
-
$bytes = file_put_contents( $path, $po );
|
| 80 |
-
if( false === $bytes ){
|
| 81 |
-
throw new Exception( sprintf(__('%s file is not writable by the web server. Fix file permissions or download and copy to "%s/%s".','loco-legacy'), $ftype, $dname, $fname ) );
|
| 82 |
-
}
|
| 83 |
-
|
| 84 |
-
// primary action ok
|
| 85 |
-
$response = array (
|
| 86 |
-
'bytes' => $bytes,
|
| 87 |
-
'filename' => basename($path),
|
| 88 |
-
'modified' => LocoAdmin::format_datetime( filemtime($path) ),
|
| 89 |
-
);
|
| 90 |
-
|
| 91 |
-
// flush package from cache, so it's regenerated next list view with new stats
|
| 92 |
-
$package->uncache();
|
| 93 |
-
|
| 94 |
-
|
| 95 |
-
// attempt to write MO file also, but may fail for numerous reasons.
|
| 96 |
-
while( ! $ispot ){
|
| 97 |
-
try {
|
| 98 |
-
|
| 99 |
-
// check target MO path before compiling
|
| 100 |
-
$mopath = preg_replace( '/\.po$/', '.mo', $path );
|
| 101 |
-
if( ! file_exists($mopath) && ! is_writable( dirname($mopath) ) ){
|
| 102 |
-
throw new Exception( __('Cannot create MO file','loco-legacy') );
|
| 103 |
-
}
|
| 104 |
-
else if( file_exists($mopath) && ! is_writable($mopath) ){
|
| 105 |
-
throw new Exception( __('Cannot overwrite MO file','loco-legacy') );
|
| 106 |
-
}
|
| 107 |
-
|
| 108 |
-
// attempt to compile MO direct to file via shell
|
| 109 |
-
if( $msgfmt = LocoAdmin::msgfmt_command() ){
|
| 110 |
-
try {
|
| 111 |
-
$bytes = 0;
|
| 112 |
-
loco_require('build/shell-compiled');
|
| 113 |
-
define( 'WHICH_MSGFMT', $msgfmt );
|
| 114 |
-
$mopath = loco_compile_mo_file( $path, $mopath );
|
| 115 |
-
$bytes = $mopath && file_exists($mopath) ? filesize($mopath) : 0;
|
| 116 |
-
}
|
| 117 |
-
catch( Exception $Ex ){
|
| 118 |
-
error_log( $Ex->getMessage(), 0 );
|
| 119 |
-
}
|
| 120 |
-
if( ! $bytes ){
|
| 121 |
-
throw new Exception( sprintf( __('Failed to compile MO file with %s, check your settings','loco-legacy'), WHICH_MSGFMT ) );
|
| 122 |
-
}
|
| 123 |
-
$response['compiled'] = $bytes;
|
| 124 |
-
break;
|
| 125 |
-
}
|
| 126 |
-
|
| 127 |
-
// Fall back to in-built MO compiler - requires PO is parsed too
|
| 128 |
-
$mo = LocoAdmin::msgfmt_native($po);
|
| 129 |
-
$bytes = file_put_contents( $mopath, $mo );
|
| 130 |
-
if( ! $bytes ){
|
| 131 |
-
throw new Exception( __('Failed to write MO file','loco-legacy') );
|
| 132 |
-
}
|
| 133 |
-
$response['compiled'] = $bytes;
|
| 134 |
-
break;
|
| 135 |
-
|
| 136 |
-
}
|
| 137 |
-
catch( Exception $e ){
|
| 138 |
-
$response['compiled'] = $e->getMessage();
|
| 139 |
-
break;
|
| 140 |
-
}
|
| 141 |
-
}
|
| 142 |
-
|
| 143 |
-
|
| 144 |
-
|
| 145 |
-
return $response;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/php/loco-posync.php
DELETED
|
@@ -1,75 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin ajax include that syncs PO or POT file with sources
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
DOING_AJAX or die();
|
| 7 |
-
|
| 8 |
-
if( empty($path) || ! isset($name) || empty($type) ){
|
| 9 |
-
throw new Exception( __('Invalid data posted to server','loco-legacy'), 422 );
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
// path is allowed to not exist yet
|
| 13 |
-
if( '/' !== $path{0} ){
|
| 14 |
-
$path = WP_CONTENT_DIR.'/'.$path;
|
| 15 |
-
}
|
| 16 |
-
|
| 17 |
-
// but package must exist so we can get POT or source
|
| 18 |
-
/* @var $package LocoPackage */
|
| 19 |
-
loco_require('loco-packages','loco-locales');
|
| 20 |
-
$package = LocoPackage::get( $name, $type );
|
| 21 |
-
if( ! $package ){
|
| 22 |
-
throw new Exception( sprintf( __('Package not found called %s','loco-legacy'), $name ), 404 );
|
| 23 |
-
}
|
| 24 |
-
|
| 25 |
-
|
| 26 |
-
while( true ){
|
| 27 |
-
|
| 28 |
-
// If file we're syncing is POT, we can only sync from sources
|
| 29 |
-
if( ! LocoAdmin::is_pot($path) ){
|
| 30 |
-
|
| 31 |
-
// if a POT file exists, sync from that
|
| 32 |
-
$domain = LocoAdmin::resolve_file_domain($path) or $domain = $package->get_domain();
|
| 33 |
-
if( $pot_path = $package->get_pot($domain) ){
|
| 34 |
-
$exp = LocoAdmin::parse_po( $pot_path );
|
| 35 |
-
if( ! $exp || ( 1 === count($exp) && '' === $exp[0]['source'] ) ){
|
| 36 |
-
// fall through to try source code
|
| 37 |
-
}
|
| 38 |
-
else {
|
| 39 |
-
$pot = basename($pot_path);
|
| 40 |
-
break;
|
| 41 |
-
}
|
| 42 |
-
}
|
| 43 |
-
|
| 44 |
-
}
|
| 45 |
-
|
| 46 |
-
// Extract from sources
|
| 47 |
-
if( $exp = LocoAdmin::xgettext( $package, dirname($path) ) ){
|
| 48 |
-
$pot = '';
|
| 49 |
-
break;
|
| 50 |
-
}
|
| 51 |
-
|
| 52 |
-
throw new Exception( __('No strings could be extracted from source code','loco-legacy') );
|
| 53 |
-
}
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
// sync selected headers
|
| 57 |
-
$headers = array();
|
| 58 |
-
if( '' === $exp[0]['source'] ){
|
| 59 |
-
$keep = array('Project-Id-Version','Language-Team','POT-Creation-Date','POT-Revision-Date');
|
| 60 |
-
$head = loco_parse_po_headers( $exp[0]['target'] );
|
| 61 |
-
$headers = array_intersect_key( $head->export(), array_flip($keep) );
|
| 62 |
-
/*/ add prefixed header keys that can't be included above
|
| 63 |
-
foreach( $head as $key => $value ){
|
| 64 |
-
if( 0 === strpos($key, 'X-Poedit-' ) ){
|
| 65 |
-
$headers[$key] = $value;
|
| 66 |
-
}
|
| 67 |
-
}*/
|
| 68 |
-
$exp[0] = array();
|
| 69 |
-
}
|
| 70 |
-
|
| 71 |
-
|
| 72 |
-
// sync ok.
|
| 73 |
-
return compact( 'pot', 'exp', 'headers' );
|
| 74 |
-
|
| 75 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/css/loco-admin.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap a.nav-tab-active{cursor:text}.wrap #loco-poedit ._ajax_loader_f2{background:transparent url(../img/ajax-loader-f2.gif) 0 0 no-repeat;min-height:16px}.wrap #loco-poedit ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif) 0 0 no-repeat;min-height:75px}@media only screen and (-webkit-min-device-pixel-ratio: 2), only screen and (min--moz-device-pixel-ratio: 2), only screen and (-o-min-device-pixel-ratio: 2 / 1), only screen and (min-device-pixel-ratio: 2), only screen and (min-resolution: 192dpi), only screen and (min-resolution: 2dppx){.wrap #loco-poedit ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif);background-size:16px}}.wrap #loco-poedit ._green_glow_inner,.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{-webkit-box-shadow:inset 0 0 0.6em 0 #3db63d;-moz-box-shadow:inset 0 0 0.6em 0 #3db63d;box-shadow:inset 0 0 0.6em 0 #3db63d}.wrap #loco-poedit ._green_glow_outer{-webkit-box-shadow:0 0 0.5em 0 #3db63d;-moz-box-shadow:0 0 0.5em 0 #3db63d;box-shadow:0 0 0.5em 0 #3db63d}.wrap #loco-poedit .wg-cell,.wrap #loco-poedit .wg-cell div{position:relative;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.wrap #loco-poedit .wg-cell{left:0;top:0;padding:0;margin:0;overflow:hidden}.wrap #loco-poedit .wg-split{background:#eee}.wrap #loco-poedit .wg-body:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}.wrap #loco-poedit .wg-split-x>div>.not-first>*{margin-left:6px}.wrap #loco-poedit .wg-split-y>div>.not-first>*{margin-top:6px}.wrap #loco-poedit .wg-split>div>.has-title .wg-content{margin-top:0}.wrap #loco-poedit .wg-split-x>div>.wg-cell{float:left;clear:none;height:100%}.wrap #loco-poedit .wg-split-x>div{cursor:move;cursor:ew-resize;cursor:col-resize}.wrap #loco-poedit .wg-split>div>.not-first:before{display:block;position:absolute;overflow:hidden;content:" "}.wrap #loco-poedit .wg-split-x>div>.not-first:before{width:6px;height:100%;background:transparent url(../img/wg/splitx.png) center center no-repeat}.wrap #loco-poedit .wg-split-y>div{cursor:move;cursor:ns-resize;cursor:row-resize}.wrap #loco-poedit .wg-split-y>div>.not-first:before{height:6px;width:100%;background:transparent url(../img/wg/splity.png) center center no-repeat}.wrap #loco-poedit .wg-split>div.locked{cursor:default}.wrap #loco-poedit .wg-split-x>div.locked>.not-first>*{margin-left:1px}.wrap #loco-poedit .wg-split-y>div.locked>.not-first>*{margin-top:1px}.wrap #loco-poedit .wg-split>div.locked>.not-first:before{display:none}.wrap #loco-poedit .wg-title{background:#ddd;cursor:default !important;margin:0;padding:4px 6px;font-size:1em;white-space:nowrap}.wrap #loco-poedit .wg-content{background:#fff;cursor:default;padding:4px 6px;overflow:hidden;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}.wrap #loco-poedit .wg-content,.wrap #loco-poedit .wg-tbody>div{overflow-x:hidden;overflow-y:auto}.wrap #loco-poedit .is-table{background-color:#fff}.wrap #loco-poedit .is-table .wg-title{padding:3px 10px;margin:0 !important;font-weight:normal}.wrap #loco-poedit .is-table .wg-thead>div>.not-first:before{background-position:center center}.wrap #loco-poedit .is-table .wg-thead{background:#ddd;border-bottom:solid 1px #ccc}.wrap #loco-poedit .is-table .wg-cols{outline:none}.wrap #loco-poedit .is-table .wg-cols>div{float:left;clear:none}.wrap #loco-poedit .is-table .wg-cols>div>div{white-space:nowrap;line-height:1.7em;padding-left:10px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;-o-text-overflow:ellipsis;-ms-text-overflow:ellipsis}.wrap #loco-poedit .is-table .wg-cols>div>div:nth-child(even){background-color:#f7f7f7}.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#3db63d;color:#fff}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div{padding-left:4px}.wrap #loco-poedit .is-field>.wg-content{cursor:text;outline:none;word-wrap:break-word;white-space:pre-wrap;white-space:-moz-pre-wrap;white-space:-pre-wrap;white-space:-o-pre-wrap}.wrap #loco-poedit .is-readonly>.wg-content{cursor:default;background:#f8f8f8;text-shadow:0 1px #fff;padding:0.6em 0.8em}.wrap #loco-poedit .is-editable>.wg-content{padding:0}.wrap #loco-poedit .is-editable>.wg-content .wg-field{width:100%;height:100%;padding:0.6em 0.8em;-webkit-border-radius:0;-moz-border-radius:0;-ms-border-radius:0;-o-border-radius:0;border-radius:0}.wrap #loco-poedit .is-editable>.wg-content textarea{resize:none;overflow:auto}.wrap #loco-poedit .wg-split-x>nav.wg-tabs{white-space:nowrap;text-align:center}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a{display:inline-block;padding:0.5em 1em;color:#000;text-decoration:none;-webkit-border-radius:0.2em 0.2em 0 0;-moz-border-radius:0.2em 0.2em 0 0;-ms-border-radius:0.2em 0.2em 0 0;-o-border-radius:0.2em 0.2em 0 0;border-radius:0.2em 0.2em 0 0;background-color:#f3f7fd}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a:hover{background-color:#fff}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active{background-color:#3db63d;color:#fff}.wrap #loco-poedit .wg-split>div>.has-nav>.wg-body{margin-top:0px}@media all and (max-width: 768px){.wrap #loco-poedit .wg-split-x>div>.not-first>*{margin-left:20px}.wrap #loco-poedit .wg-split-y>div>.not-first>*{margin-top:20px}.wrap #loco-poedit .wg-split-x>div>.not-first:before{width:20px}.wrap #loco-poedit .wg-split-y>div>.not-first:before{height:20px}.wrap #loco-poedit .is-table .wg-title{padding-left:20px}}.wrap #loco-poedit .is-table .po-fuzzy{color:#b59829;font-weight:bold}.wrap #loco-poedit .is-table .po-empty{color:#1f507a;font-weight:bold}.wrap #loco-poedit .is-table .po-flagged{color:#CC0000}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div:before{font-family:loco;vertical-align:middle;display:inline-block;content:" ";width:1.3em;line-height:1}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div.po-flagged:before{content:"\e62e"}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div.po-comment:before{content:"\e613";color:#999}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div.po-unsaved:before{content:"\e612";color:#f1d040}.wrap #loco-poedit .is-table .wg-cols>div:first-child>div.selected:before{color:#fff !important}.wrap #loco-poedit #po-list .wg-content{padding:0}.wrap #loco-poedit #po-source>.wg-body>.has-title>h2{background:transparent;font-weight:normal;float:left;clear:none;min-width:3.4em}.wrap #loco-poedit #po-source>.wg-body>.has-title>.wg-content{clear:none}.wrap #loco-poedit #po-source p.notes{font-style:italic;color:#999;margin:0 0 0.5em 0;font-size:0.85em;line-height:1.2em}.wrap #loco-poedit #po-source>p.notes{margin:0;padding:4px 6px;cursor:default !important}.wrap #loco-poedit .wg-title .flag,.wrap #loco-poedit .wg-title .lang.lang-ca,.wrap #loco-poedit .wg-title .lang.lang-cy,.wrap #loco-poedit .wg-title .lang.lang-eo,.wrap #loco-poedit .wg-title .lang.lang-eu,.wrap #loco-poedit .wg-title .lang.lang-gd,.wrap #loco-poedit .wg-title .lang.lang-bel{margin-right:6px}.wrap #loco-poedit #po-source>.wg-body>.has-title>h2{min-width:4.5em}.wrap #loco-poedit .is-table .wg-td{font-size:13px}.wrap .flag,.wrap .lang.lang-ca,.wrap .lang.lang-cy,.wrap .lang.lang-eo,.wrap .lang.lang-eu,.wrap .lang.lang-gd,.wrap .lang.lang-bel{width:16px;height:11px;display:inline-block;background-image:url(../img/flags.png);background-repeat:no-repeat}.wrap .flag:before,.wrap .lang.lang-ca:before,.wrap .lang.lang-cy:before,.wrap .lang.lang-eo:before,.wrap .lang.lang-eu:before,.wrap .lang.lang-gd:before,.wrap .lang.lang-bel:before{display:none}.wrap .flag-ad{background-position:0 -12px}.wrap .flag-ae{background-position:0 -24px}.wrap .flag-af{background-position:0 -36px}.wrap .flag-ag{background-position:0 -48px}.wrap .flag-ai{background-position:0 -60px}.wrap .flag-al{background-position:0 -72px}.wrap .flag-am{background-position:0 -84px}.wrap .flag-an{background-position:0 -96px}.wrap .flag-ao{background-position:0 -108px}.wrap .flag-aq{background-position:0 -120px}.wrap .flag-ar{background-position:0 -137px}.wrap .flag-as{background-position:0 -149px}.wrap .flag-at{background-position:0 -161px}.wrap .flag-au{background-position:0 -173px}.wrap .flag-aw{background-position:0 -185px}.wrap .flag-ax{background-position:0 -197px}.wrap .flag-az{background-position:0 -209px}.wrap .flag-ba{background-position:0 -221px}.wrap .flag-bb{background-position:0 -233px}.wrap .flag-bd{background-position:0 -245px}.wrap .flag-be{background-position:0 -257px}.wrap .flag-bf{background-position:0 -269px}.wrap .flag-bg{background-position:0 -281px}.wrap .flag-bh{background-position:0 -293px}.wrap .flag-bi{background-position:0 -305px}.wrap .flag-bj{background-position:0 -317px}.wrap .flag-bl{background-position:0 -329px}.wrap .flag-bm{background-position:0 -346px}.wrap .flag-bn{background-position:0 -358px}.wrap .flag-bo{background-position:0 -370px}.wrap .flag-bq{background-position:0 -382px}.wrap .flag-br{background-position:0 -394px}.wrap .flag-bs{background-position:0 -406px}.wrap .flag-bt{background-position:0 -418px}.wrap .flag-bv{background-position:0 -430px}.wrap .flag-bw{background-position:0 -442px}.wrap .flag-by,.wrap .lang.lang-bel{background-position:0 -454px}.wrap .flag-bz{background-position:0 -466px}.wrap .flag-ca{background-position:0 -478px}.wrap .flag-cc{background-position:0 -490px}.wrap .flag-cd{background-position:0 -502px}.wrap .flag-cf{background-position:0 -514px}.wrap .flag-cg{background-position:0 -526px}.wrap .flag-ch{background-position:0 -538px}.wrap .flag-ci{background-position:0 -550px}.wrap .flag-ck{background-position:0 -562px}.wrap .flag-cl{background-position:0 -574px}.wrap .flag-cm{background-position:0 -586px}.wrap .flag-cn{background-position:0 -598px}.wrap .flag-co{background-position:0 -610px}.wrap .flag-cr{background-position:0 -622px}.wrap .flag-cs{background-position:0 -634px}.wrap .flag-cu{background-position:0 -646px}.wrap .flag-cv{background-position:0 -658px}.wrap .flag-cw{background-position:0 -670px}.wrap .flag-cx{background-position:0 -687px}.wrap .flag-cy{background-position:0 -699px}.wrap .flag-cz{background-position:0 -711px}.wrap .flag-de{background-position:0 -723px}.wrap .flag-dj{background-position:0 -735px}.wrap .flag-dk{background-position:0 -747px}.wrap .flag-dm{background-position:0 -759px}.wrap .flag-do{background-position:0 -771px}.wrap .flag-dz{background-position:0 -783px}.wrap .flag-ec{background-position:0 -795px}.wrap .flag-ee{background-position:0 -807px}.wrap .flag-eg{background-position:0 -819px}.wrap .flag-eh{background-position:0 -831px}.wrap .flag-er{background-position:0 -843px}.wrap .flag-es{background-position:0 -855px}.wrap .flag-et{background-position:0 -867px}.wrap .flag-eu{background-position:0 -879px}.wrap .flag-fi{background-position:0 -891px}.wrap .flag-fj{background-position:0 -903px}.wrap .flag-fk{background-position:0 -915px}.wrap .flag-fm{background-position:0 -927px}.wrap .flag-fo{background-position:0 -939px}.wrap .flag-fr{background-position:0 -951px}.wrap .flag-ga{background-position:0 -963px}.wrap .flag-gb{background-position:0 -975px}.wrap .flag-gd{background-position:0 -987px}.wrap .flag-ge{background-position:0 -999px}.wrap .flag-gf{background-position:0 -1011px}.wrap .flag-gg{background-position:0 -1023px}.wrap .flag-gh{background-position:0 -1040px}.wrap .flag-gi{background-position:0 -1052px}.wrap .flag-gl{background-position:0 -1064px}.wrap .flag-gm{background-position:0 -1076px}.wrap .flag-gn{background-position:0 -1088px}.wrap .flag-gp{background-position:0 -1100px}.wrap .flag-gq{background-position:0 -1112px}.wrap .flag-gr{background-position:0 -1124px}.wrap .flag-gs{background-position:0 -1136px}.wrap .flag-gt{background-position:0 -1148px}.wrap .flag-gu{background-position:0 -1160px}.wrap .flag-gw{background-position:0 -1172px}.wrap .flag-gy{background-position:0 -1184px}.wrap .flag-hk{background-position:0 -1196px}.wrap .flag-hm{background-position:0 -1208px}.wrap .flag-hn{background-position:0 -1220px}.wrap .flag-hr{background-position:0 -1232px}.wrap .flag-ht{background-position:0 -1244px}.wrap .flag-hu{background-position:0 -1256px}.wrap .flag-id{background-position:0 -1268px}.wrap .flag-ie{background-position:0 -1280px}.wrap .flag-il{background-position:0 -1292px}.wrap .flag-im{background-position:0 -1304px}.wrap .flag-in{background-position:0 -1321px}.wrap .flag-io{background-position:0 -1333px}.wrap .flag-iq{background-position:0 -1345px}.wrap .flag-ir{background-position:0 -1357px}.wrap .flag-is{background-position:0 -1369px}.wrap .flag-it{background-position:0 -1381px}.wrap .flag-je{background-position:0 -1393px}.wrap .flag-jm{background-position:0 -1410px}.wrap .flag-jo{background-position:0 -1422px}.wrap .flag-jp{background-position:0 -1434px}.wrap .flag-ke{background-position:0 -1446px}.wrap .flag-kg{background-position:0 -1458px}.wrap .flag-kh{background-position:0 -1470px}.wrap .flag-ki{background-position:0 -1482px}.wrap .flag-km{background-position:0 -1494px}.wrap .flag-kn{background-position:0 -1506px}.wrap .flag-kp{background-position:0 -1518px}.wrap .flag-kr{background-position:0 -1530px}.wrap .flag-kw{background-position:0 -1542px}.wrap .flag-ky{background-position:0 -1554px}.wrap .flag-kz{background-position:0 -1566px}.wrap .flag-la{background-position:0 -1578px}.wrap .flag-lang-ca,.wrap .lang.lang-ca{background-position:0 -1590px}.wrap .flag-lang-cy,.wrap .lang.lang-cy{background-position:0 -1602px}.wrap .flag-lang-eo,.wrap .lang.lang-eo{background-position:0 -1614px}.wrap .flag-lang-eu,.wrap .lang.lang-eu{background-position:0 -1626px}.wrap .flag-lang-gd,.wrap .lang.lang-gd{background-position:0 -1638px}.wrap .flag-lb{background-position:0 -1650px}.wrap .flag-lc{background-position:0 -1662px}.wrap .flag-li{background-position:0 -1674px}.wrap .flag-lk{background-position:0 -1686px}.wrap .flag-lr{background-position:0 -1698px}.wrap .flag-ls{background-position:0 -1710px}.wrap .flag-lt{background-position:0 -1722px}.wrap .flag-lu{background-position:0 -1734px}.wrap .flag-lv{background-position:0 -1746px}.wrap .flag-ly{background-position:0 -1758px}.wrap .flag-ma{background-position:0 -1770px}.wrap .flag-mc{background-position:0 -1782px}.wrap .flag-md{background-position:0 -1794px}.wrap .flag-me{background-position:0 -1806px}.wrap .flag-mf{background-position:0 -1819px}.wrap .flag-mg{background-position:0 -1836px}.wrap .flag-mh{background-position:0 -1848px}.wrap .flag-mk{background-position:0 -1860px}.wrap .flag-ml{background-position:0 -1872px}.wrap .flag-mm{background-position:0 -1884px}.wrap .flag-mn{background-position:0 -1896px}.wrap .flag-mo{background-position:0 -1908px}.wrap .flag-mp{background-position:0 -1920px}.wrap .flag-mq{background-position:0 -1932px}.wrap .flag-mr{background-position:0 -1944px}.wrap .flag-ms{background-position:0 -1956px}.wrap .flag-mt{background-position:0 -1968px}.wrap .flag-mu{background-position:0 -1980px}.wrap .flag-mv{background-position:0 -1992px}.wrap .flag-mw{background-position:0 -2004px}.wrap .flag-mx{background-position:0 -2016px}.wrap .flag-my{background-position:0 -2028px}.wrap .flag-mz{background-position:0 -2040px}.wrap .flag-na{background-position:0 -2052px}.wrap .flag-nc{background-position:0 -2064px}.wrap .flag-ne{background-position:0 -2076px}.wrap .flag-nf{background-position:0 -2088px}.wrap .flag-ng{background-position:0 -2100px}.wrap .flag-ni{background-position:0 -2112px}.wrap .flag-nl{background-position:0 -2124px}.wrap .flag-no{background-position:0 -2136px}.wrap .flag-np{background-position:0 -2148px}.wrap .flag-nr{background-position:0 -2160px}.wrap .flag-nu{background-position:0 -2172px}.wrap .flag-nz{background-position:0 -2184px}.wrap .flag-om{background-position:0 -2196px}.wrap .flag-pa{background-position:0 -2208px}.wrap .flag-pe{background-position:0 -2220px}.wrap .flag-pf{background-position:0 -2232px}.wrap .flag-pg{background-position:0 -2244px}.wrap .flag-ph{background-position:0 -2256px}.wrap .flag-pk{background-position:0 -2268px}.wrap .flag-pl{background-position:0 -2280px}.wrap .flag-pm{background-position:0 -2292px}.wrap .flag-pn{background-position:0 -2304px}.wrap .flag-pr{background-position:0 -2316px}.wrap .flag-ps{background-position:0 -2328px}.wrap .flag-pt{background-position:0 -2340px}.wrap .flag-pw{background-position:0 -2352px}.wrap .flag-py{background-position:0 -2364px}.wrap .flag-qa{background-position:0 -2376px}.wrap .flag-re{background-position:0 -2388px}.wrap .flag-ro{background-position:0 -2400px}.wrap .flag-rs{background-position:0 -2412px}.wrap .flag-ru{background-position:0 -2424px}.wrap .flag-rw{background-position:0 -2436px}.wrap .flag-sa{background-position:0 -2448px}.wrap .flag-sb{background-position:0 -2460px}.wrap .flag-sc{background-position:0 -2472px}.wrap .flag-sd{background-position:0 -2484px}.wrap .flag-se{background-position:0 -2496px}.wrap .flag-sg{background-position:0 -2508px}.wrap .flag-sh{background-position:0 -2520px}.wrap .flag-si{background-position:0 -2532px}.wrap .flag-sj{background-position:0 -2544px}.wrap .flag-sk{background-position:0 -2556px}.wrap .flag-sl{background-position:0 -2568px}.wrap .flag-sm{background-position:0 -2580px}.wrap .flag-sn{background-position:0 -2592px}.wrap .flag-so{background-position:0 -2604px}.wrap .flag-sr{background-position:0 -2616px}.wrap .flag-ss{background-position:0 -2628px}.wrap .flag-st{background-position:0 -2645px}.wrap .flag-sv{background-position:0 -2657px}.wrap .flag-sx{background-position:0 -2669px}.wrap .flag-sy{background-position:0 -2686px}.wrap .flag-sz{background-position:0 -2698px}.wrap .flag-tc{background-position:0 -2710px}.wrap .flag-td{background-position:0 -2722px}.wrap .flag-tf{background-position:0 -2734px}.wrap .flag-tg{background-position:0 -2746px}.wrap .flag-th{background-position:0 -2758px}.wrap .flag-tj{background-position:0 -2770px}.wrap .flag-tk{background-position:0 -2782px}.wrap .flag-tl{background-position:0 -2794px}.wrap .flag-tm{background-position:0 -2806px}.wrap .flag-tn{background-position:0 -2818px}.wrap .flag-to{background-position:0 -2830px}.wrap .flag-tr{background-position:0 -2842px}.wrap .flag-tt{background-position:0 -2854px}.wrap .flag-tv{background-position:0 -2866px}.wrap .flag-tw{background-position:0 -2878px}.wrap .flag-tz{background-position:0 -2890px}.wrap .flag-ua{background-position:0 -2902px}.wrap .flag-ug{background-position:0 -2914px}.wrap .flag-um{background-position:0 -2926px}.wrap .flag-us{background-position:0 -2938px}.wrap .flag-uy{background-position:0 -2950px}.wrap .flag-uz{background-position:0 -2962px}.wrap .flag-va{background-position:0 -2974px}.wrap .flag-vc{background-position:0 -2986px}.wrap .flag-ve{background-position:0 -2998px}.wrap .flag-vg{background-position:0 -3010px}.wrap .flag-vi{background-position:0 -3022px}.wrap .flag-vn{background-position:0 -3034px}.wrap .flag-vu{background-position:0 -3046px}.wrap .flag-wf{background-position:0 -3058px}.wrap .flag-ws{background-position:0 -3070px}.wrap .flag-ye{background-position:0 -3082px}.wrap .flag-yt{background-position:0 -3094px}.wrap .flag-za{background-position:0 -3106px}.wrap .flag-zm{background-position:0 -3118px}.wrap .flag-zw{background-position:0 -3130px}.wrap .lang{width:16px;color:#fff;background-color:#aaa;display:inline-block;text-transform:uppercase;overflow:hidden;font-size:9px;line-height:12px;text-align:center}.wrap .lang:before{vertical-align:middle}.wrap .lang-aa:before{content:"aa"}.wrap .lang-ab:before{content:"ab"}.wrap .lang-af:before{content:"af"}.wrap .lang-ak:before{content:"ak"}.wrap .lang-sq:before{content:"sq"}.wrap .lang-am:before{content:"am"}.wrap .lang-ar:before{content:"ar"}.wrap .lang-an:before{content:"an"}.wrap .lang-hy:before{content:"hy"}.wrap .lang-as:before{content:"as"}.wrap .lang-av:before{content:"av"}.wrap .lang-ae:before{content:"ae"}.wrap .lang-ay:before{content:"ay"}.wrap .lang-az:before{content:"az"}.wrap .lang-ba:before{content:"ba"}.wrap .lang-bm:before{content:"bm"}.wrap .lang-eu:before{content:"eu"}.wrap .lang-be:before{content:"be"}.wrap .lang-bn:before{content:"bn"}.wrap .lang-bh:before{content:"bh"}.wrap .lang-bi:before{content:"bi"}.wrap .lang-bs:before{content:"bs"}.wrap .lang-br:before{content:"br"}.wrap .lang-bg:before{content:"bg"}.wrap .lang-my:before{content:"my"}.wrap .lang-ca:before{content:"ca"}.wrap .lang-ch:before{content:"ch"}.wrap .lang-ce:before{content:"ce"}.wrap .lang-zh:before{content:"zh"}.wrap .lang-cu:before{content:"cu"}.wrap .lang-cv:before{content:"cv"}.wrap .lang-kw:before{content:"kw"}.wrap .lang-co:before{content:"co"}.wrap .lang-cr:before{content:"cr"}.wrap .lang-cs:before{content:"cs"}.wrap .lang-da:before{content:"da"}.wrap .lang-dv:before{content:"dv"}.wrap .lang-nl:before{content:"nl"}.wrap .lang-dz:before{content:"dz"}.wrap .lang-en:before{content:"en"}.wrap .lang-eo:before{content:"eo"}.wrap .lang-et:before{content:"et"}.wrap .lang-ee:before{content:"ee"}.wrap .lang-fo:before{content:"fo"}.wrap .lang-fj:before{content:"fj"}.wrap .lang-fi:before{content:"fi"}.wrap .lang-fr:before{content:"fr"}.wrap .lang-fy:before{content:"fy"}.wrap .lang-ff:before{content:"ff"}.wrap .lang-ka:before{content:"ka"}.wrap .lang-de:before{content:"de"}.wrap .lang-gd:before{content:"gd"}.wrap .lang-ga:before{content:"ga"}.wrap .lang-gl:before{content:"gl"}.wrap .lang-gv:before{content:"gv"}.wrap .lang-el:before{content:"el"}.wrap .lang-gn:before{content:"gn"}.wrap .lang-gu:before{content:"gu"}.wrap .lang-ht:before{content:"ht"}.wrap .lang-ha:before{content:"ha"}.wrap .lang-he:before{content:"he"}.wrap .lang-hz:before{content:"hz"}.wrap .lang-hi:before{content:"hi"}.wrap .lang-ho:before{content:"ho"}.wrap .lang-hu:before{content:"hu"}.wrap .lang-ig:before{content:"ig"}.wrap .lang-is:before{content:"is"}.wrap .lang-io:before{content:"io"}.wrap .lang-ii:before{content:"ii"}.wrap .lang-iu:before{content:"iu"}.wrap .lang-ie:before{content:"ie"}.wrap .lang-ia:before{content:"ia"}.wrap .lang-id:before{content:"id"}.wrap .lang-ik:before{content:"ik"}.wrap .lang-it:before{content:"it"}.wrap .lang-jv:before{content:"jv"}.wrap .lang-ja:before{content:"ja"}.wrap .lang-kl:before{content:"kl"}.wrap .lang-kn:before{content:"kn"}.wrap .lang-ks:before{content:"ks"}.wrap .lang-kr:before{content:"kr"}.wrap .lang-kk:before{content:"kk"}.wrap .lang-km:before{content:"km"}.wrap .lang-ki:before{content:"ki"}.wrap .lang-rw:before{content:"rw"}.wrap .lang-ky:before{content:"ky"}.wrap .lang-kv:before{content:"kv"}.wrap .lang-kg:before{content:"kg"}.wrap .lang-ko:before{content:"ko"}.wrap .lang-kj:before{content:"kj"}.wrap .lang-ku:before{content:"ku"}.wrap .lang-lo:before{content:"lo"}.wrap .lang-la:before{content:"la"}.wrap .lang-lv:before{content:"lv"}.wrap .lang-li:before{content:"li"}.wrap .lang-ln:before{content:"ln"}.wrap .lang-lt:before{content:"lt"}.wrap .lang-lb:before{content:"lb"}.wrap .lang-lu:before{content:"lu"}.wrap .lang-lg:before{content:"lg"}.wrap .lang-mk:before{content:"mk"}.wrap .lang-mh:before{content:"mh"}.wrap .lang-ml:before{content:"ml"}.wrap .lang-mi:before{content:"mi"}.wrap .lang-mr:before{content:"mr"}.wrap .lang-ms:before{content:"ms"}.wrap .lang-mg:before{content:"mg"}.wrap .lang-mt:before{content:"mt"}.wrap .lang-mo:before{content:"mo"}.wrap .lang-mn:before{content:"mn"}.wrap .lang-na:before{content:"na"}.wrap .lang-nv:before{content:"nv"}.wrap .lang-nr:before{content:"nr"}.wrap .lang-nd:before{content:"nd"}.wrap .lang-ng:before{content:"ng"}.wrap .lang-ne:before{content:"ne"}.wrap .lang-nn:before{content:"nn"}.wrap .lang-nb:before{content:"nb"}.wrap .lang-no:before{content:"no"}.wrap .lang-ny:before{content:"ny"}.wrap .lang-oc:before{content:"oc"}.wrap .lang-oj:before{content:"oj"}.wrap .lang-or:before{content:"or"}.wrap .lang-om:before{content:"om"}.wrap .lang-os:before{content:"os"}.wrap .lang-pa:before{content:"pa"}.wrap .lang-fa:before{content:"fa"}.wrap .lang-pi:before{content:"pi"}.wrap .lang-pl:before{content:"pl"}.wrap .lang-pt:before{content:"pt"}.wrap .lang-ps:before{content:"ps"}.wrap .lang-qu:before{content:"qu"}.wrap .lang-rm:before{content:"rm"}.wrap .lang-ro:before{content:"ro"}.wrap .lang-rn:before{content:"rn"}.wrap .lang-ru:before{content:"ru"}.wrap .lang-sg:before{content:"sg"}.wrap .lang-sa:before{content:"sa"}.wrap .lang-sr:before{content:"sr"}.wrap .lang-hr:before{content:"hr"}.wrap .lang-si:before{content:"si"}.wrap .lang-sk:before{content:"sk"}.wrap .lang-sl:before{content:"sl"}.wrap .lang-se:before{content:"se"}.wrap .lang-sm:before{content:"sm"}.wrap .lang-sn:before{content:"sn"}.wrap .lang-sd:before{content:"sd"}.wrap .lang-so:before{content:"so"}.wrap .lang-st:before{content:"st"}.wrap .lang-es:before{content:"es"}.wrap .lang-sc:before{content:"sc"}.wrap .lang-ss:before{content:"ss"}.wrap .lang-su:before{content:"su"}.wrap .lang-sw:before{content:"sw"}.wrap .lang-sv:before{content:"sv"}.wrap .lang-ty:before{content:"ty"}.wrap .lang-ta:before{content:"ta"}.wrap .lang-tt:before{content:"tt"}.wrap .lang-te:before{content:"te"}.wrap .lang-tg:before{content:"tg"}.wrap .lang-tl:before{content:"tl"}.wrap .lang-th:before{content:"th"}.wrap .lang-bo:before{content:"bo"}.wrap .lang-ti:before{content:"ti"}.wrap .lang-to:before{content:"to"}.wrap .lang-tn:before{content:"tn"}.wrap .lang-ts:before{content:"ts"}.wrap .lang-tk:before{content:"tk"}.wrap .lang-tr:before{content:"tr"}.wrap .lang-tw:before{content:"tw"}.wrap .lang-ug:before{content:"ug"}.wrap .lang-uk:before{content:"uk"}.wrap .lang-ur:before{content:"ur"}.wrap .lang-uz:before{content:"uz"}.wrap .lang-ve:before{content:"ve"}.wrap .lang-vi:before{content:"vi"}.wrap .lang-vo:before{content:"vo"}.wrap .lang-cy:before{content:"cy"}.wrap .lang-wa:before{content:"wa"}.wrap .lang-wo:before{content:"wo"}.wrap .lang-xh:before{content:"xh"}.wrap .lang-yi:before{content:"yi"}.wrap .lang-yo:before{content:"yo"}.wrap .lang-za:before{content:"za"}.wrap .lang-zu:before{content:"zu"}.wrap .loco-add>*:before{content:"\e60c"}.wrap .loco-del>*:before{content:"\e60d"}.wrap .loco-save>*:before{content:"\e610"}.wrap .loco-sync>*:before{content:"\e633"}.wrap .loco-help>*:before{content:"\3f"}.wrap .loco-revert>*:before{content:"\e634"}.wrap .loco-fuzzy>*:before{content:"\e607"}.wrap .loco-download>*:before{content:"\e608"}.wrap .loco-ok>*:before{content:"\e618"}.wrap .loco-error>*:before,.wrap .loco-warning>*:before{content:"\e62e"}.wrap .loco-edit-pot>*:before{content:"\e61e"}.wrap .loco-clearable>a:before{content:"\e615"}@font-face{font-family:'loco';src:url("../font/loco.eot");src:url("../font/loco.eot?#iefix") format("embedded-opentype"),url("../font/loco.woff") format("woff"),url("../font/loco.ttf") format("truetype"),url("../font/loco.svg#loco") format("svg");font-weight:normal;font-style:normal}.wrap div{position:relative}h2 .nav-tab.nav-tab-loco{float:right;border-color:transparent;font-size:16px;color:#2e892e;background:transparent}h2 .nav-tab.nav-tab-loco:hover{color:#3db63d}.widefat thead tr th{width:25%}.wrap.loco-lists>h2:before{display:inline-block;font-family:dashicons;opacity:0.5}.wrap .loco-list{margin:10px 0}.wrap .loco-message p:before,.wrap .loco-list li>a:before,.wrap .loco-list li>span:before{padding-right:0.5em;font-family:loco;color:inherit}.wrap .loco-list li.loco-add a{color:#666666}.wrap .loco-list li.loco-add a:hover{color:#000}.wrap .loco-list li.loco-edit-po .flag,.wrap .loco-list li.loco-edit-po .lang.lang-ca,.wrap .loco-list li.loco-edit-po .lang.lang-cy,.wrap .loco-list li.loco-edit-po .lang.lang-eo,.wrap .loco-list li.loco-edit-po .lang.lang-eu,.wrap .loco-list li.loco-edit-po .lang.lang-gd,.wrap .loco-list li.loco-edit-po .lang.lang-bel{margin-right:6px}.wrap .loco-list li.loco-warning>*:before{color:#cc0000}.wrap .loco-list li.loco-ok>*:before{color:#006600}.wrap .loco-list .loco-details li{margin-bottom:0}.wrap .loco-list .loco-mtime{color:#999}.wrap .loco-list .loco-progress{color:#999}.error a.dismiss,.updated a.dismiss{text-decoration:none;font-size:20px;line-height:1;display:block;position:absolute;right:10px;top:5px}.error a.dismiss:before,.updated a.dismiss:before{display:none}.wrap div.loco-message{margin-top:10px}.wrap div.loco-success{border-color:#00CC00;background-color:#ccffcc}.wrap div.loco-warning{border-color:#FFA500}.wrap div.loco-message:hover{border-color:#000}form.loco-switcher{display:inline;display:inline-block;padding:0 5px}form.loco-switcher select{font-weight:normal;height:auto;display:inline}h3.title .loco-meta{font-weight:normal;font-size:14px}.wrap #loco-poedit{border:solid 1px #ccc}.wrap #loco-poedit-inner{min-height:600px;font-size:14px;clear:both}.wrap #loco-poedit-inner h2{color:#000;line-height:1}#loco-nav{font-size:14px;height:50px}#loco-nav form{display:block;float:left;clear:none;padding:0;margin:0}#loco-search,#loco-nav button{display:block;position:relative;float:left;clear:none;box-sizing:border-box;margin:5px 0 0 5px;height:40px;text-align:left}#loco-nav form.loco-right{float:right;margin-right:5px}#loco-nav button span:before{padding-right:0.5em;font-family:loco}.wp-core-ui button.loco-inverted,.wp-core-ui button.loco-inverted:hover{background-image:-webkit-gradient(linear, left top, left bottom, from(#e0e0e0), to(#fefefe));background-image:-webkit-linear-gradient(top, #e0e0e0, #fefefe);background-image:-moz-linear-gradient(top, #e0e0e0, #fefefe);background-image:-o-linear-gradient(top, #e0e0e0, #fefefe);background-image:linear-gradient(to bottom, #e0e0e0, #fefefe)}#loco-filter input[type="text"]{padding-left:10px;margin-left:20px;font-size:14px;line-height:normal}#loco-filter .invalid input[type="text"]:focus{border-color:#cc0000;-webkit-box-shadow:0 0 2px rgba(153,0,0,0.5);-moz-box-shadow:0 0 2px rgba(153,0,0,0.5);box-shadow:0 0 2px rgba(153,0,0,0.5)}.loco-clearable{display:inline-block;vertical-align:middle;position:relative}.loco-clearable a.clear{top:0;right:0;outline:none;padding:1em 0.5em;position:absolute;font-size:1em;line-height:normal;text-decoration:none}.loco-clearable a.clear:before{font-family:loco;vertical-align:middle;padding:0;color:#999}.loco-clearable a.clear:hover:before{color:#333}.loco-clearable a.clear span{display:none}.loco-clearable ::-ms-clear{display:none}.loco-fscheck .loco-list{margin-bottom:20px}.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(0,115,170,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#0073aa}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/loco-legacy.css
DELETED
|
@@ -1,18 +0,0 @@
|
|
| 1 |
-
/* styles for versions of wordpress below 3.8 */
|
| 2 |
-
|
| 3 |
-
#adminmenu .toplevel_page_loco-translate .wp-menu-image {
|
| 4 |
-
background-image: url(../img/wp/menu.png);
|
| 5 |
-
background-position: 2px 0;
|
| 6 |
-
-webkit-background-size: 28px 56px; /* Safari 3.0 */
|
| 7 |
-
-moz-background-size: 28px 56px; /* Gecko 1.9.2 (Firefox 3.6) */
|
| 8 |
-
-o-background-size: 28px 56px; /* Opera 9.5 */
|
| 9 |
-
background-size: 28px 56px; /* Gecko 2.0 (Firefox 4.0) and other CSS3-compliant browsers */
|
| 10 |
-
}
|
| 11 |
-
|
| 12 |
-
#adminmenu .toplevel_page_loco-translate.wp-has-current-submenu .wp-menu-image {
|
| 13 |
-
background-position: 2px -28px;
|
| 14 |
-
}
|
| 15 |
-
|
| 16 |
-
.wrap.loco-lists > h2:before {
|
| 17 |
-
display: none !important;
|
| 18 |
-
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/css/skins/blue.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(9,100,132,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#096484}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/coffee.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(199,165,137,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#c7a589}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/ectoplasm.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(163,183,69,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#a3b745}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/light.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(136,136,136,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#888}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/midnight.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(225,77,67,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#e14d43}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/ocean.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(158,186,160,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#9ebaa0}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/css/skins/sunrise.css
DELETED
|
@@ -1 +0,0 @@
|
|
| 1 |
-
.wrap #loco-poedit .is-table .wg-tr:nth-child(even){background-color:rgba(221,130,59,0.05)}.wrap #loco-poedit .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-poedit .is-table .wg-cols>div>div.selected{background-color:#dd823b}.wrap #loco-poedit .is-editable>.wg-content .wg-field:focus{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);-moz-box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8);box-shadow:inset 0 0 0.6em rgba(30,140,190,0.8)}
|
|
|
old/pub/font/loco.eot
DELETED
|
Binary file
|
old/pub/font/loco.svg
DELETED
|
@@ -1,77 +0,0 @@
|
|
| 1 |
-
<?xml version="1.0" standalone="no"?>
|
| 2 |
-
<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
|
| 3 |
-
<svg xmlns="http://www.w3.org/2000/svg">
|
| 4 |
-
<metadata>Generated by IcoMoon</metadata>
|
| 5 |
-
<defs>
|
| 6 |
-
<font id="loco" horiz-adv-x="1024">
|
| 7 |
-
<font-face units-per-em="1024" ascent="960" descent="-64" />
|
| 8 |
-
<missing-glyph horiz-adv-x="1024" />
|
| 9 |
-
<glyph unicode=" " d="" horiz-adv-x="512" />
|
| 10 |
-
<glyph unicode="?" d="M512 164.571v109.714q0 8-5.143 13.143t-13.143 5.143h-109.714q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h109.714q8 0 13.143 5.143t5.143 13.143zM658.286 548.571q0 50.286-31.714 93.143t-79.143 66.286-97.143 23.429q-138.857 0-212-121.714-8.571-13.714 4.571-24l75.429-57.143q4-3.429 10.857-3.429 9.143 0 14.286 6.857 30.286 38.857 49.143 52.571 19.429 13.714 49.143 13.714 27.429 0 48.857-14.857t21.429-33.714q0-21.714-11.429-34.857t-38.857-25.714q-36-16-66-49.429t-30-71.714v-20.571q0-8 5.143-13.143t13.143-5.143h109.714q8 0 13.143 5.143t5.143 13.143q0 10.857 12.286 28.286t31.143 28.286q18.286 10.286 28 16.286t26.286 20 25.429 27.429 16 34.571 7.143 46.286zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 11 |
-
<glyph unicode="×" d="M741.714 195.428q0-22.857-16-38.857l-77.714-77.714q-16-16-38.857-16t-38.857 16l-168 168-168-168q-16-16-38.857-16t-38.857 16l-77.714 77.714q-16 16-16 38.857t16 38.857l168 168-168 168q-16 16-16 38.857t16 38.857l77.714 77.714q16 16 38.857 16t38.857-16l168-168 168 168q16 16 38.857 16t38.857-16l77.714-77.714q16-16 16-38.857t-16-38.857l-168-168 168-168q16-16 16-38.857z" horiz-adv-x="805" />
|
| 12 |
-
<glyph unicode="ℹ" d="M585.143 164.571v91.429q0 8-5.143 13.143t-13.143 5.143h-54.857v292.571q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-91.429q0-8 5.143-13.143t13.143-5.143h54.857v-182.857h-54.857q-8 0-13.143-5.143t-5.143-13.143v-91.429q0-8 5.143-13.143t13.143-5.143h256q8 0 13.143 5.143t5.143 13.143zM512 676.571v91.429q0 8-5.143 13.143t-13.143 5.143h-109.714q-8 0-13.143-5.143t-5.143-13.143v-91.429q0-8 5.143-13.143t13.143-5.143h109.714q8 0 13.143 5.143t5.143 13.143zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 13 |
-
<glyph unicode="⚪" d="M438.857 749.714q-84.571 0-156-41.714t-113.143-113.143-41.714-156 41.714-156 113.143-113.143 156-41.714 156 41.714 113.143 113.143 41.714 156-41.714 156-113.143 113.143-156 41.714zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 14 |
-
<glyph unicode="⚫" d="M877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 15 |
-
<glyph unicode="" d="M877.714 182.857v-73.143q0-14.857-10.857-25.714t-25.714-10.857h-804.571q-14.857 0-25.714 10.857t-10.857 25.714v73.143q0 14.857 10.857 25.714t25.714 10.857h804.571q14.857 0 25.714-10.857t10.857-25.714zM877.714 475.428v-73.143q0-14.857-10.857-25.714t-25.714-10.857h-804.571q-14.857 0-25.714 10.857t-10.857 25.714v73.143q0 14.857 10.857 25.714t25.714 10.857h804.571q14.857 0 25.714-10.857t10.857-25.714zM877.714 768v-73.143q0-14.857-10.857-25.714t-25.714-10.857h-804.571q-14.857 0-25.714 10.857t-10.857 25.714v73.143q0 14.857 10.857 25.714t25.714 10.857h804.571q14.857 0 25.714-10.857t10.857-25.714z" horiz-adv-x="878" />
|
| 16 |
-
<glyph unicode="" d="M585.143 256q0-14.857-10.857-25.714t-25.714-10.857h-512q-14.857 0-25.714 10.857t-10.857 25.714 10.857 25.714l256 256q10.857 10.857 25.714 10.857t25.714-10.857l256-256q10.857-10.857 10.857-25.714z" horiz-adv-x="585" />
|
| 17 |
-
<glyph unicode="" d="M585.143 548.571q0-14.857-10.857-25.714l-256-256q-10.857-10.857-25.714-10.857t-25.714 10.857l-256 256q-10.857 10.857-10.857 25.714t10.857 25.714 25.714 10.857h512q14.857 0 25.714-10.857t10.857-25.714z" horiz-adv-x="585" />
|
| 18 |
-
<glyph unicode="" d="M1024 545.143v-453.714q0-37.714-26.857-64.571t-64.571-26.857h-841.143q-37.714 0-64.571 26.857t-26.857 64.571v453.714q25.143-28 57.714-49.714 206.857-140.571 284-197.143 32.571-24 52.857-37.429t54-27.429 62.857-14h1.143q29.143 0 62.857 14t54 27.429 52.857 37.429q97.143 70.286 284.571 197.143 32.571 22.286 57.143 49.714zM1024 713.143q0-45.143-28-86.286t-69.714-70.286q-214.857-149.143-267.429-185.714-5.714-4-24.286-17.429t-30.857-21.714-29.714-18.571-32.857-15.429-28.571-5.143h-1.143q-13.143 0-28.571 5.143t-32.857 15.429-29.714 18.571-30.857 21.714-24.286 17.429q-52 36.571-149.714 104.286t-117.143 81.429q-35.429 24-66.857 66t-31.429 78q0 44.571 23.714 74.286t67.714 29.714h841.143q37.143 0 64.286-26.857t27.143-64.571z" />
|
| 19 |
-
<glyph unicode="" d="M182.857 512h292.571v109.714q0 60.571-42.857 103.429t-103.429 42.857-103.429-42.857-42.857-103.429v-109.714zM658.286 457.143v-329.143q0-22.857-16-38.857t-38.857-16h-548.571q-22.857 0-38.857 16t-16 38.857v329.143q0 22.857 16 38.857t38.857 16h18.286v109.714q0 105.143 75.429 180.571t180.571 75.429 180.571-75.429 75.429-180.571v-109.714h18.286q22.857 0 38.857-16t16-38.857z" horiz-adv-x="658" />
|
| 20 |
-
<glyph unicode="" d="M749.714 440.571q0 92-49.714 168.571l-430.857-430.286q78.286-50.857 169.714-50.857 63.429 0 120.857 24.857t99.143 66.571 66.286 99.714 24.571 121.429zM178.857 269.714l431.429 430.857q-77.143 52-171.429 52-84.571 0-156-41.714t-113.143-113.714-41.714-156.571q0-92.571 50.857-170.857zM877.714 440.571q0-89.714-34.857-171.429t-93.429-140.571-140-93.714-170.571-34.857-170.571 34.857-140 93.714-93.429 140.571-34.857 171.429 34.857 171.143 93.429 140.286 140 93.714 170.571 34.857 170.571-34.857 140-93.714 93.429-140.286 34.857-171.143z" horiz-adv-x="878" />
|
| 21 |
-
<glyph unicode="" d="M475.429 658.286q0 45.714-32 77.714t-77.714 32-77.714-32-32-77.714q0-24 10.857-47.429-23.429 10.857-47.429 10.857-45.714 0-77.714-32t-32-77.714 32-77.714 77.714-32 77.714 32 32 77.714q0 24-10.857 47.429 23.429-10.857 47.429-10.857 45.714 0 77.714 32t32 77.714zM961.714 256q0-9.714-28-37.714t-37.714-28q-5.143 0-16.286 9.143t-20.857 18.857-22 22.857-14 14.857l-54.857-54.857 125.714-125.714q16-16 16-38.857 0-24-22.286-46.286t-46.286-22.286q-22.857 0-38.857 16l-383.429 383.429q-100.571-74.857-208.571-74.857-93.143 0-151.714 58.571t-58.571 151.714q0 91.429 54.286 178.857t141.714 141.714 178.857 54.286q93.143 0 151.714-58.571t58.571-151.714q0-108-74.857-208.571l202.857-202.857 54.857 54.857q-1.714 1.714-14.857 14t-22.857 22-18.857 20.857-9.143 16.286q0 9.714 28 37.714t37.714 28q7.429 0 13.143-5.714 3.429-3.429 26.286-25.429t46.857-45.429 49.429-49.143 41.714-44.571 16.286-23.429z" />
|
| 22 |
-
<glyph unicode="" d="M1097.143 292.571q0-90.857-64.286-155.143t-155.143-64.286h-621.714q-105.714 0-180.857 75.143t-75.143 180.857q0 75.429 40.571 138t106.857 93.429q-1.143 16-1.143 24.571 0 121.143 85.714 206.857t206.857 85.714q90.286 0 163.714-50.286t107.143-131.429q40 35.429 94.857 35.429 60.571 0 103.429-42.857t42.857-103.429q0-42.857-23.429-78.857 73.714-17.143 121.714-76.857t48-136.857z" horiz-adv-x="1097" />
|
| 23 |
-
<glyph unicode="" d="M731.429 182.857q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM877.714 182.857q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM950.857 310.857v-182.857q0-22.857-16-38.857t-38.857-16h-841.143q-22.857 0-38.857 16t-16 38.857v182.857q0 22.857 16 38.857t38.857 16h265.714l77.143-77.714q33.143-32 77.714-32t77.714 32l77.714 77.714h265.143q22.857 0 38.857-16t16-38.857zM765.143 636q9.714-23.429-8-40l-256-256q-10.286-10.857-25.714-10.857t-25.714 10.857l-256 256q-17.714 16.571-8 40 9.714 22.286 33.714 22.286h146.286v256q0 14.857 10.857 25.714t25.714 10.857h146.286q14.857 0 25.714-10.857t10.857-25.714v-256h146.286q24 0 33.714-22.286z" horiz-adv-x="951" />
|
| 24 |
-
<glyph unicode="" d="M731.429 109.714q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM877.714 109.714q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM950.857 237.714v-182.857q0-22.857-16-38.857t-38.857-16h-841.143q-22.857 0-38.857 16t-16 38.857v182.857q0 22.857 16 38.857t38.857 16h244q12-32 40.286-52.571t63.143-20.571h146.286q34.857 0 63.143 20.571t40.286 52.571h244q22.857 0 38.857-16t16-38.857zM765.143 608q-9.714-22.857-33.714-22.857h-146.286v-256q0-14.857-10.857-25.714t-25.714-10.857h-146.286q-14.857 0-25.714 10.857t-10.857 25.714v256h-146.286q-24 0-33.714 22.857-9.714 22.286 8 39.429l256 256q10.286 10.857 25.714 10.857t25.714-10.857l256-256q17.714-17.143 8-39.429z" horiz-adv-x="951" />
|
| 25 |
-
<glyph unicode="" d="M281.714 674.857q9.143 0 15.714 6.571t6.571 15.714-6.571 15.714-15.714 6.571-15.429-6.571-6.286-15.714 6.286-15.714 15.429-6.571zM522.857 674.857q9.143 0 15.429 6.571t6.286 15.714-6.286 15.714-15.429 6.571-15.714-6.571-6.571-15.714 6.571-15.714 15.714-6.571zM58.857 569.714q24 0 41.143-17.143t17.143-41.143v-245.714q0-24.571-16.857-41.714t-41.429-17.143-41.714 17.143-17.143 41.714v245.714q0 24 17.143 41.143t41.714 17.143zM664.571 558.857v-380.571q0-26.286-18.286-44.571t-44-18.286h-42.857v-129.714q0-24.571-17.143-41.714t-41.714-17.143-41.714 17.143-17.143 41.714v129.714h-78.857v-129.714q0-24.571-17.143-41.714t-41.714-17.143q-24 0-41.143 17.143t-17.143 41.714l-0.571 129.714h-42.286q-26.286 0-44.571 18.286t-18.286 44.571v380.571h524.571zM532 790.286q61.143-31.429 97.714-87.714t36.571-123.143h-528.571q0 66.857 36.571 123.143t98.286 87.714l-40.571 74.857q-4 7.429 2.857 11.429 7.429 3.429 11.429-3.429l41.143-75.429q54.286 24 114.857 24t114.857-24l41.143 75.429q4 6.857 11.429 3.429 6.857-4 2.857-11.429zM804.571 511.428v-245.714q0-24.571-17.143-41.714t-41.714-17.143q-24 0-41.143 17.143t-17.143 41.714v245.714q0 24.571 17.143 41.429t41.143 16.857q24.571 0 41.714-16.857t17.143-41.429z" horiz-adv-x="805" />
|
| 26 |
-
<glyph unicode="" d="M796 256.571q-22.286-71.429-70.286-142.857-73.714-112-146.857-112-28 0-80 18.286-49.143 18.286-86.286 18.286-34.857 0-81.143-18.857-46.286-19.429-75.429-19.429-86.857 0-172 148-84 149.143-84 287.429 0 130.286 64.571 213.714 64 82.286 162.286 82.286 41.143 0 101.143-17.143 59.429-17.143 78.857-17.143 25.714 0 81.714 19.429 58.286 19.429 98.857 19.429 68 0 121.714-37.143 29.714-20.571 59.429-57.143-45.143-38.286-65.143-67.429-37.143-53.714-37.143-118.286 0-70.857 39.429-127.429t90.286-72zM581.143 926.857q0-34.857-16.571-77.714-17.143-42.857-53.143-78.857-30.857-30.857-61.714-41.143-21.143-6.286-59.429-9.714 1.714 85.143 44.571 146.857 42.286 61.143 142.857 84.571 0.571-1.714 1.429-6.286t1.429-6.286q0-2.286 0.286-5.714t0.286-5.714z" horiz-adv-x="805" />
|
| 27 |
-
<glyph unicode="" d="M694.857 402.286v73.143q0 14.857-10.857 25.714t-25.714 10.857h-146.286v146.286q0 14.857-10.857 25.714t-25.714 10.857h-73.143q-14.857 0-25.714-10.857t-10.857-25.714v-146.286h-146.286q-14.857 0-25.714-10.857t-10.857-25.714v-73.143q0-14.857 10.857-25.714t25.714-10.857h146.286v-146.286q0-14.857 10.857-25.714t25.714-10.857h73.143q14.857 0 25.714 10.857t10.857 25.714v146.286h146.286q14.857 0 25.714 10.857t10.857 25.714zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 28 |
-
<glyph unicode="" d="M694.857 402.286v73.143q0 14.857-10.857 25.714t-25.714 10.857h-438.857q-14.857 0-25.714-10.857t-10.857-25.714v-73.143q0-14.857 10.857-25.714t25.714-10.857h438.857q14.857 0 25.714 10.857t10.857 25.714zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 29 |
-
<glyph unicode="" d="M182.857 804.571q0-41.143-36.571-62.857v-723.429q0-7.429-5.429-12.857t-12.857-5.429h-36.571q-7.429 0-12.857 5.429t-5.429 12.857v723.429q-36.571 21.714-36.571 62.857 0 30.286 21.429 51.714t51.714 21.429 51.714-21.429 21.429-51.714zM1024 768v-436q0-14.286-7.143-22t-22.571-15.714q-122.857-66.286-210.857-66.286-34.857 0-70.571 12.571t-62 27.429-66 27.429-81.429 12.571q-109.714 0-265.143-83.429-9.714-5.143-18.857-5.143-14.857 0-25.714 10.857t-10.857 25.714v424q0 18.286 17.714 31.429 12 8 45.143 24.571 134.857 68.571 240.571 68.571 61.143 0 114.286-16.571t125.143-50.286q21.714-10.857 50.286-10.857 30.857 0 67.143 12t62.857 26.857 50.286 26.857 31.143 12q14.857 0 25.714-10.857t10.857-25.714z" />
|
| 30 |
-
<glyph unicode="" d="M292.571 530.286v-329.143q0-8-5.143-13.143t-13.143-5.143h-36.571q-8 0-13.143 5.143t-5.143 13.143v329.143q0 8 5.143 13.143t13.143 5.143h36.571q8 0 13.143-5.143t5.143-13.143zM438.857 530.286v-329.143q0-8-5.143-13.143t-13.143-5.143h-36.571q-8 0-13.143 5.143t-5.143 13.143v329.143q0 8 5.143 13.143t13.143 5.143h36.571q8 0 13.143-5.143t5.143-13.143zM585.143 530.286v-329.143q0-8-5.143-13.143t-13.143-5.143h-36.571q-8 0-13.143 5.143t-5.143 13.143v329.143q0 8 5.143 13.143t13.143 5.143h36.571q8 0 13.143-5.143t5.143-13.143zM658.286 116.571v541.714h-512v-541.714q0-12.571 4-23.143t8.286-15.429 6-4.857h475.429q1.714 0 6 4.857t8.286 15.429 4 23.143zM274.286 731.428h256l-27.429 66.857q-4 5.143-9.714 6.286h-181.143q-5.714-1.143-9.714-6.286zM804.571 713.143v-36.571q0-8-5.143-13.143t-13.143-5.143h-54.857v-541.714q0-47.429-26.857-82t-64.571-34.571h-475.429q-37.714 0-64.571 33.429t-26.857 80.857v544h-54.857q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h176.571l40 95.429q8.571 21.143 30.857 36t45.143 14.857h182.857q22.857 0 45.143-14.857t30.857-36l40-95.429h176.571q8 0 13.143-5.143t5.143-13.143z" horiz-adv-x="805" />
|
| 31 |
-
<glyph unicode="" d="M219.429 73.143h438.857v219.429h-438.857v-219.429zM731.429 73.143h73.143v512q0 8-5.714 22t-11.429 19.714l-160.571 160.571q-5.714 5.714-19.429 11.429t-22.286 5.714v-237.714q0-22.857-16-38.857t-38.857-16h-329.143q-22.857 0-38.857 16t-16 38.857v237.714h-73.143v-731.429h73.143v237.714q0 22.857 16 38.857t38.857 16h475.429q22.857 0 38.857-16t16-38.857v-237.714zM512 603.428v182.857q0 7.429-5.429 12.857t-12.857 5.429h-109.714q-7.429 0-12.857-5.429t-5.429-12.857v-182.857q0-7.429 5.429-12.857t12.857-5.429h109.714q7.429 0 12.857 5.429t5.429 12.857zM877.714 585.143v-530.286q0-22.857-16-38.857t-38.857-16h-768q-22.857 0-38.857 16t-16 38.857v768q0 22.857 16 38.857t38.857 16h530.286q22.857 0 50.286-11.429t43.429-27.429l160-160q16-16 27.429-43.429t11.429-50.286z" horiz-adv-x="878" />
|
| 32 |
-
<glyph unicode="" d="M585.143 274.286v-36.571q0-8-5.143-13.143t-13.143-5.143h-402.286q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h402.286q8 0 13.143-5.143t5.143-13.143zM585.143 420.571v-36.571q0-8-5.143-13.143t-13.143-5.143h-402.286q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h402.286q8 0 13.143-5.143t5.143-13.143zM73.143 73.143h585.143v438.857h-237.714q-22.857 0-38.857 16t-16 38.857v237.714h-292.571v-731.429zM438.857 585.143h214.857q-5.714 16.571-12.571 23.429l-178.857 178.857q-6.857 6.857-23.429 12.571v-214.857zM731.429 566.857v-512q0-22.857-16-38.857t-38.857-16h-621.714q-22.857 0-38.857 16t-16 38.857v768q0 22.857 16 38.857t38.857 16h365.714q22.857 0 50.286-11.429t43.429-27.429l178.286-178.286q16-16 27.429-43.429t11.429-50.286z" horiz-adv-x="731" />
|
| 33 |
-
<glyph unicode="" d="M950.857 581.143q0-12.571-14.857-27.429l-207.429-202.286 49.143-285.714q0.571-4 0.571-11.429 0-12-6-20.286t-17.429-8.286q-10.857 0-22.857 6.857l-256.571 134.857-256.571-134.857q-12.571-6.857-22.857-6.857-12 0-18 8.286t-6 20.286q0 3.429 1.143 11.429l49.143 285.714-208 202.286q-14.286 15.429-14.286 27.429 0 21.143 32 26.286l286.857 41.714 128.571 260q10.857 23.429 28 23.429t28-23.429l128.571-260 286.857-41.714q32-5.143 32-26.286z" horiz-adv-x="951" />
|
| 34 |
-
<glyph unicode="" d="M1024 438.857q0-99.429-68.571-183.714t-186.286-133.143-257.143-48.857q-40 0-82.857 4.571-113.143-100-262.857-138.286-28-8-65.143-12.571-9.714-1.143-17.429 5.143t-10 16.571v0.571q-1.714 2.286-0.286 6.857t1.143 5.714 2.571 5.429l3.429 5.143t4 4.857 4.571 5.143q4 4.571 17.714 19.714t19.714 21.714 17.714 22.571 18.571 29.143 15.429 33.714 14.857 43.429q-89.714 50.857-141.429 125.714t-51.714 160.571q0 74.286 40.571 142t109.143 116.857 163.429 78 198.857 28.857q139.429 0 257.143-48.857t186.286-133.143 68.571-183.714z" />
|
| 35 |
-
<glyph unicode="" d="M804.571 512q0-79.429-53.714-146.857t-146.571-106.571-202-39.143q-49.143 0-100.571 9.143-70.857-50.286-158.857-73.143-20.571-5.143-49.143-9.143h-1.714q-6.286 0-11.714 4.571t-6.571 12q-0.571 1.714-0.571 3.714t0.286 3.714 1.143 3.429l1.429 2.857t2 3.143 2.286 2.857 2.571 2.857 2.286 2.571q2.857 3.429 13.143 14.286t14.857 16.857 12.857 16.571 14.286 22 11.714 25.143q-70.857 41.143-111.429 101.143t-40.571 128q0 79.429 53.714 146.857t146.571 106.571 202 39.143 202-39.143 146.571-106.571 53.714-146.857zM1024 365.714q0-68.571-40.571-128.286t-111.429-100.857q5.714-13.714 11.714-25.143t14.286-22 12.857-16.571 14.857-16.857 13.143-14.286q0.571-0.571 2.286-2.571t2.571-2.857 2.286-2.857 2-3.143l1.429-2.857t1.143-3.429 0.286-3.714-0.571-3.714q-1.714-8-7.429-12.571t-12.571-4q-28.571 4-49.143 9.143-88 22.857-158.857 73.143-51.429-9.143-100.571-9.143-154.857 0-269.714 75.429 33.143-2.286 50.286-2.286 92 0 176.571 25.714t150.857 73.714q71.429 52.571 109.714 121.143t38.286 145.143q0 44-13.143 86.857 73.714-40.571 116.571-101.714t42.857-131.429z" />
|
| 36 |
-
<glyph unicode="" d="M656.571 309.714q0 14.857-10.857 25.714l-103.429 103.429 103.429 103.429q10.857 10.857 10.857 25.714 0 15.429-10.857 26.286l-51.429 51.429q-10.857 10.857-26.286 10.857-14.857 0-25.714-10.857l-103.429-103.429-103.429 103.429q-10.857 10.857-25.714 10.857-15.429 0-26.286-10.857l-51.429-51.429q-10.857-10.857-10.857-26.286 0-14.857 10.857-25.714l103.429-103.429-103.429-103.429q-10.857-10.857-10.857-25.714 0-15.429 10.857-26.286l51.429-51.429q10.857-10.857 26.286-10.857 14.857 0 25.714 10.857l103.429 103.429 103.429-103.429q10.857-10.857 25.714-10.857 15.429 0 26.286 10.857l51.429 51.429q10.857 10.857 10.857 26.286zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 37 |
-
<glyph unicode="" d="M603.429 512q22.857 0 38.857-16t16-38.857v-329.143q0-22.857-16-38.857t-38.857-16h-548.571q-22.857 0-38.857 16t-16 38.857v329.143q0 22.857 16 38.857t38.857 16h18.286v182.857q0 105.714 75.143 180.857t180.857 75.143 180.857-75.143 75.143-180.857q0-14.857-10.857-25.714t-25.714-10.857h-36.571q-14.857 0-25.714 10.857t-10.857 25.714q0 60.571-42.857 103.429t-103.429 42.857-103.429-42.857-42.857-103.429v-182.857h420.571z" horiz-adv-x="658" />
|
| 38 |
-
<glyph unicode="" d="M731.429 457.143q0 8-5.143 13.143l-201.143 201.143q-5.143 5.143-13.143 5.143t-13.143-5.143l-200.571-200.571q-5.714-6.857-5.714-13.714 0-8 5.143-13.143t13.143-5.143h128v-201.143q0-7.429 5.429-12.857t12.857-5.429h109.714q7.429 0 12.857 5.429t5.429 12.857v201.143h128q7.429 0 12.857 5.429t5.429 12.857zM1097.143 292.571q0-90.857-64.286-155.143t-155.143-64.286h-621.714q-105.714 0-180.857 75.143t-75.143 180.857q0 74.286 40 137.143t107.429 94.286q-1.143 17.143-1.143 24.571 0 121.143 85.714 206.857t206.857 85.714q89.143 0 163.143-49.714t107.714-132q40.571 35.429 94.857 35.429 60.571 0 103.429-42.857t42.857-103.429q0-43.429-23.429-78.857 74.286-17.714 122-77.429t47.714-136.286z" horiz-adv-x="1097" />
|
| 39 |
-
<glyph unicode="" d="M954.857 627.428q0-22.857-16-38.857l-491.429-491.429q-16-16-38.857-16t-38.857 16l-284.571 284.571q-16 16-16 38.857t16 38.857l77.714 77.714q16 16 38.857 16t38.857-16l168-168.571 374.857 375.429q16 16 38.857 16t38.857-16l77.714-77.714q16-16 16-38.857z" />
|
| 40 |
-
<glyph unicode="" d="M676.571 438.857q0-14.857-10.857-25.714l-310.857-310.857q-10.857-10.857-25.714-10.857t-25.714 10.857-10.857 25.714v164.571h-256q-14.857 0-25.714 10.857t-10.857 25.714v219.429q0 14.857 10.857 25.714t25.714 10.857h256v164.571q0 14.857 10.857 25.714t25.714 10.857 25.714-10.857l310.857-310.857q10.857-10.857 10.857-25.714zM877.714 640v-402.286q0-68-48.286-116.286t-116.286-48.286h-182.857q-7.429 0-12.857 5.429t-5.429 12.857q0 2.286-0.571 11.429t-0.286 15.143 1.714 13.429 5.714 11.143 11.714 3.714h182.857q37.714 0 64.571 26.857t26.857 64.571v402.286q0 37.714-26.857 64.571t-64.571 26.857h-178.285t-6.571 0.571-6.571 1.714-4.571 3.143-4 5.143-1.143 7.714q0 2.286-0.571 11.429t-0.286 15.143 1.714 13.429 5.714 11.143 11.714 3.714h182.857q68 0 116.286-48.286t48.286-116.286z" horiz-adv-x="878" />
|
| 41 |
-
<glyph unicode="" d="M365.714 128q0-2.286 0.571-11.429t0.286-15.143-1.714-13.429-5.714-11.143-11.714-3.714h-182.857q-68 0-116.286 48.286t-48.286 116.286v402.286q0 68 48.286 116.286t116.286 48.286h182.857q7.429 0 12.857-5.429t5.429-12.857q0-2.286 0.571-11.429t0.286-15.143-1.714-13.429-5.714-11.143-11.714-3.714h-182.857q-37.714 0-64.571-26.857t-26.857-64.571v-402.286q0-37.714 26.857-64.571t64.571-26.857h178.285t6.571-0.571 6.571-1.714 4.571-3.143 4-5.143 1.143-7.714zM896 438.857q0-14.857-10.857-25.714l-310.857-310.857q-10.857-10.857-25.714-10.857t-25.714 10.857-10.857 25.714v164.571h-256q-14.857 0-25.714 10.857t-10.857 25.714v219.429q0 14.857 10.857 25.714t25.714 10.857h256v164.571q0 14.857 10.857 25.714t25.714 10.857 25.714-10.857l310.857-310.857q10.857-10.857 10.857-25.714z" horiz-adv-x="951" />
|
| 42 |
-
<glyph unicode="" d="M585.143 438.857q0 60.571-42.857 103.429t-103.429 42.857-103.429-42.857-42.857-103.429 42.857-103.429 103.429-42.857 103.429 42.857 42.857 103.429zM877.714 501.143v-126.857q0-6.857-4.571-13.143t-11.429-7.429l-105.714-16q-10.857-30.857-22.286-52 20-28.571 61.143-78.857 5.714-6.857 5.714-14.286t-5.143-13.143q-15.429-21.143-56.571-61.714t-53.714-40.571q-6.857 0-14.857 5.143l-78.857 61.714q-25.143-13.143-52-21.714-9.143-77.714-16.571-106.286-4-16-20.571-16h-126.857q-8 0-14 4.857t-6.571 12.286l-16 105.143q-28 9.143-51.429 21.143l-80.571-61.143q-5.714-5.143-14.286-5.143-8 0-14.286 6.286-72 65.143-94.286 96-4 5.714-4 13.143 0 6.857 4.571 13.143 8.571 12 29.143 38t30.857 40.286q-15.429 28.571-23.429 56.571l-104.571 15.429q-7.429 1.143-12 7.143t-4.571 13.429v126.857q0 6.857 4.571 13.143t10.857 7.429l106.286 16q8 26.286 22.286 52.571-22.857 32.571-61.143 78.857-5.714 6.857-5.714 13.714 0 5.714 5.143 13.143 14.857 20.571 56.286 61.429t54 40.857q7.429 0 14.857-5.714l78.857-61.143q25.143 13.143 52 21.714 9.143 77.714 16.571 106.286 4 16 20.571 16h126.857q8 0 14-4.857t6.571-12.286l16-105.143q28-9.143 51.429-21.143l81.143 61.143q5.143 5.143 13.714 5.143 7.429 0 14.286-5.714 73.714-68 94.286-97.143 4-4.571 4-12.571 0-6.857-4.571-13.143-8.571-12-29.143-38t-30.857-40.286q14.857-28.571 23.429-56l104.571-16q7.429-1.143 12-7.143t4.571-13.429z" horiz-adv-x="878" />
|
| 43 |
-
<glyph unicode="" d="M512 438.857q0 60.571-42.857 103.429t-103.429 42.857-103.429-42.857-42.857-103.429 42.857-103.429 103.429-42.857 103.429 42.857 42.857 103.429zM950.857 146.286q0 29.714-21.714 51.429t-51.429 21.714-51.429-21.714-21.714-51.429q0-30.286 21.429-51.714t51.714-21.429 51.714 21.429 21.429 51.714zM950.857 731.428q0 29.714-21.714 51.429t-51.429 21.714-51.429-21.714-21.714-51.429q0-30.286 21.429-51.714t51.714-21.429 51.714 21.429 21.429 51.714zM731.429 490.857v-105.714q0-5.714-4-11.143t-9.143-6l-88.571-13.714q-6.286-20-18.286-43.429 19.429-27.429 51.429-65.714 4-5.714 4-11.429 0-6.857-4-10.857-13.143-17.143-47.143-51.143t-44.857-34q-6.286 0-12 4l-65.714 51.429q-21.143-10.857-44-17.714-6.286-61.714-13.143-88.571-4-13.714-17.143-13.714h-106.286q-6.286 0-11.429 4.286t-5.714 10l-13.143 87.429q-19.429 5.714-42.857 17.714l-67.429-50.857q-4-4-11.429-4-6.286 0-12 4.571-82.286 76-82.286 91.429 0 5.143 4 10.857 5.714 8 23.429 30.286t26.857 34.857q-13.143 25.143-20 46.857l-86.857 13.714q-5.714 0.571-9.714 5.429t-4 11.143v105.714q0 5.714 4 11.143t9.143 6l88.571 13.714q6.286 20 18.286 43.429-19.429 27.429-51.429 65.714-4 6.286-4 11.429 0 6.857 4 11.429 12.571 17.143 46.857 50.857t45.143 33.714q6.286 0 12-4l65.714-51.429q19.429 10.286 44 18.286 6.286 61.714 13.143 88 4 13.714 17.143 13.714h106.286q6.286 0 11.429-4.286t5.714-10l13.143-87.429q19.429-5.714 42.857-17.714l67.429 50.857q4.571 4 11.429 4 6.286 0 12-4.571 82.286-76 82.286-91.429 0-5.143-4-10.857-6.857-9.143-24-30.857t-25.714-34.286q13.143-27.429 19.429-46.857l86.857-13.143q5.714-1.143 9.714-6t4-11.143zM1097.143 186.286v-80q0-9.143-85.143-17.714-6.857-15.429-17.143-29.714 29.143-64.571 29.143-78.857 0-2.286-2.286-4-69.714-40.571-70.857-40.571-4.571 0-26.286 26.857t-29.714 38.857q-11.429-1.143-17.143-1.143t-17.143 1.143q-8-12-29.714-38.857t-26.286-26.857q-1.143 0-70.857 40.571-2.286 1.714-2.286 4 0 14.286 29.143 78.857-10.286 14.286-17.143 29.714-85.143 8.571-85.143 17.714v80q0 9.143 85.143 17.714 7.429 16.571 17.143 29.714-29.143 64.571-29.143 78.857 0 2.286 2.286 4 2.286 1.143 20 11.429t33.714 19.429 17.143 9.143q4.571 0 26.286-26.571t29.714-38.571q11.429 1.143 17.143 1.143t17.143-1.143q29.143 40.571 52.571 64l3.429 1.143q2.286 0 70.857-40 2.286-1.714 2.286-4 0-14.286-29.143-78.857 9.714-13.143 17.143-29.714 85.143-8.571 85.143-17.714zM1097.143 771.428v-80q0-9.143-85.143-17.714-6.857-15.429-17.143-29.714 29.143-64.571 29.143-78.857 0-2.286-2.286-4-69.714-40.571-70.857-40.571-4.571 0-26.286 26.857t-29.714 38.857q-11.429-1.143-17.143-1.143t-17.143 1.143q-8-12-29.714-38.857t-26.286-26.857q-1.143 0-70.857 40.571-2.286 1.714-2.286 4 0 14.286 29.143 78.857-10.286 14.286-17.143 29.714-85.143 8.571-85.143 17.714v80q0 9.143 85.143 17.714 7.429 16.571 17.143 29.714-29.143 64.571-29.143 78.857 0 2.286 2.286 4 2.286 1.143 20 11.429t33.714 19.429 17.143 9.143q4.571 0 26.286-26.571t29.714-38.571q11.429 1.143 17.143 1.143t17.143-1.143q29.143 40.571 52.571 64l3.429 1.143q2.286 0 70.857-40 2.286-1.714 2.286-4 0-14.286-29.143-78.857 9.714-13.143 17.143-29.714 85.143-8.571 85.143-17.714z" horiz-adv-x="1097" />
|
| 44 |
-
<glyph unicode="" d="M438.857 877.714q119.429 0 220.286-58.857t159.714-159.714 58.857-220.286-58.857-220.286-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857zM595.429 580q-1.143-0.571-5.429-5.429t-7.714-5.429q1.143 0 2.571 2.857t2.857 6.286 2 4q3.429 4 12.571 8.571 8 3.429 29.714 6.857 19.429 4.571 29.143-6.286-1.143 1.143 5.429 7.429t8.286 6.857q1.714 1.143 8.571 2.571t8.571 4.286l1.143 12.571q-6.857-0.571-10 4t-3.714 12q0-1.143-3.429-4.571 0 4-2.571 4.571t-6.571-0.571-5.143-0.571q-5.714 1.714-8.571 4.286t-4.571 9.429-2.286 8.571q-1.143 2.857-5.429 6t-5.429 6q-0.571 1.143-1.429 3.143t-1.714 3.714-2.286 3.143-3.143 1.429-4-2.857-4.286-5.714-2.571-2.857q-1.714 1.143-3.429 0.857t-2.571-0.571-2.571-1.714-2.857-2q-1.714-1.143-4.857-1.714t-4.857-1.143q8.571 2.857-0.571 6.286-5.714 2.286-9.143 1.714 5.143 2.286 4.286 6.857t-4.857 8h2.857q-0.571 2.286-4.857 4.857t-10 4.857-7.429 3.429q-4.571 2.857-19.429 5.429t-18.857 0.286q-2.857-3.429-2.571-6t2.286-8 2-7.143q0.571-3.429-3.143-7.429t-3.714-6.857q0-4 8-8.857t5.714-12.286q-1.714-4.571-9.143-9.143t-9.143-6.857q-2.857-4.571-0.857-10.571t6-9.429q1.143-1.143 0.857-2.286t-2-2.571-3.143-2.286-3.714-2l-1.714-1.143q-6.286-2.857-11.714 3.429t-7.714 14.857q-4 14.286-9.143 17.143-13.143 4.571-16.571-0.571-2.857 7.429-23.429 14.857-14.286 5.143-33.143 2.286 3.429 0.571 0 8.571-4 8.571-10.857 6.857 1.714 3.429 2.286 10t0.571 7.714q1.714 7.429 6.857 13.143 0.571 0.571 4 4.857t5.429 7.714 0.286 3.429q20-2.286 28.571 6.286 2.857 2.857 6.571 9.714t6 9.714q5.143 3.429 8 3.143t8.286-3.143 8.286-2.857q8-0.571 8.857 6.286t-4.286 11.429q6.857-0.571 1.714 9.714-2.857 4-4.571 5.143-6.857 2.286-15.429-2.857-4.571-2.286 1.143-4.571-0.571 0.571-5.429-6t-9.429-10-9.143 2.857q-0.571 0.571-3.143 7.714t-5.429 7.714q-4.571 0-9.143-8.571 1.714 4.571-6.286 8.571t-13.714 4.571q10.857 6.857-4.571 15.429-4 2.286-11.714 2.857t-11.143-2.286q-2.857-4-3.143-6.571t2.857-4.571 6-3.143 6.571-2.286 4.857-1.714q8-5.714 4.571-8-1.143-0.571-4.857-2t-6.571-2.571-3.429-2.286q-1.714-2.286 0-8t-1.143-8q-2.857 2.857-5.143 10t-4 9.429q4-5.143-14.286-3.429l-5.714 0.571q-2.286 0-9.143-1.143t-11.714-0.571-7.714 4.571q-2.286 4.571 0 11.429 0.571 2.286 2.286 1.143-2.286 1.714-6.286 5.429t-5.714 4.857q-26.286-8.571-53.714-23.429 3.429-0.571 6.857 0.571 2.857 1.143 7.429 3.714t5.714 3.143q19.429 8 24 4l2.857 2.857q8-9.143 11.429-14.286-4 2.286-17.143 0.571-11.429-3.429-12.571-6.857 4-6.857 2.857-10.286-2.286 1.714-6.571 5.714t-8.286 6.286-8.571 2.857q-9.143 0-12.571-0.571-83.429-45.714-134.286-126.857 4-4 6.857-4.571 2.286-0.571 2.857-5.143t1.429-6.286 6.571 1.714q5.143-4.571 1.714-10.857 0.571 0.571 25.143-15.429 10.857-9.714 12-12 1.714-6.286-5.714-10.286-0.571 1.143-5.143 5.143t-5.143 2.286q-1.714-2.857 0.286-10.571t6-7.143q-4 0-5.429-9.143t-1.429-20.286-0.571-13.429l1.143-0.571q-1.714-6.857 3.143-19.714t12.286-11.143q-7.429-1.714 11.429-24.571 3.429-4.571 4.571-5.143 1.714-1.143 6.857-4.286t8.571-5.714 5.714-6q2.286-2.857 5.714-12.857t8-13.429q-1.143-3.429 5.429-11.429t6-13.143q-0.571 0-1.429-0.571t-1.429-0.571q1.714-4 8.857-8t8.857-7.429q0.571-1.714 1.143-5.714t1.714-6.286 4.571-1.143q1.143 11.429-13.714 35.429-8.571 14.286-9.714 16.571-1.714 2.857-3.143 8.857t-2.571 8.286q1.143 0 3.429-0.857t4.857-2 4.286-2.286 1.143-1.714q-1.714-4 1.143-10t6.857-10.571 9.714-10.857 6.857-7.429q3.429-3.429 8-11.143t0-7.714q5.143 0 11.429-5.714t9.714-11.429q2.857-4.571 4.571-14.857t2.857-13.714q1.143-4 4.857-7.714t7.143-5.429l9.143-4.571t7.429-4q2.857-1.143 10.571-6t12.286-6.571q5.714-2.286 9.143-2.286t8.286 1.429 7.714 2q8.571 1.143 16.571-8.571t12-12q20.571-10.857 31.429-6.286-1.143-0.571 0.286-4.286t4.571-8.857 5.143-8.286 3.143-4.857q2.857-3.429 10.286-8.571t10.286-8.571q3.429 2.286 4 5.143-1.714-4.571 4-11.429t10.286-5.714q8 1.714 8 18.286-17.714-8.571-28 10.286 0 0.571-1.429 3.143t-2.286 4.857-1.429 4.857 0 4.286 2.857 1.714q5.143 0 5.714 2t-1.143 7.143-2.286 7.429q-0.571 4.571-6.286 11.429t-6.857 8.571q-2.857-5.143-9.143-4.571t-9.143 5.143q0-0.571-0.857-3.143t-0.857-3.714q-7.429 0-8.571 0.571 0.571 1.714 1.429 10t2 12.857q0.571 2.286 3.143 6.857t4.286 8.286 2.286 7.143-2.571 5.429-10 1.429q-10.857-0.571-14.857-11.429-0.571-1.714-1.714-6t-2.857-6.571-5.143-4q-4-1.714-13.714-1.143t-13.714 2.857q-7.429 4.571-12.857 16.571t-5.429 21.143q0 5.714 1.429 15.143t1.714 14.286-3.143 14q1.714 1.143 5.143 5.429t5.714 6q1.143 0.571 2.571 0.857t2.571 0 2.286 0.857 1.714 3.429q-0.571 0.571-2.286 1.714-1.714 1.714-2.286 1.714 4-1.714 16.286 0.857t15.714-0.857q8.571-6.286 12.571 1.143 0 0.571-1.429 5.429t-0.286 7.714q2.857-15.429 16.571-5.143 1.714-1.714 8.857-2.857t10-2.857q1.714-1.143 4-3.143t3.143-2.571 2.857 0.286 4.857 3.714q5.714-8 6.857-13.714 6.286-22.857 10.857-25.143 4-1.714 6.286-1.143t2.571 5.429 0 8-0.857 7.143l-0.571 4.571v10.286l-0.571 4.571q-8.571 1.714-10.571 6.857t0.857 10.571 8.571 10.571q0.571 0.571 4.571 2t8.857 3.714 7.143 4.571q12 10.857 8.571 20 4 0 6.286 5.143-0.571 0-2.857 1.714t-4.286 2.857-2.571 1.143q5.143 2.857 1.143 9.143 2.857 1.714 4.286 6.286t4.286 5.714q5.143-6.857 12-1.143 4 4.571 0.571 9.143 2.857 4 11.714 6t10.571 5.429q4-1.143 4.571 1.143t0.571 6.857 1.714 6.857q2.286 2.857 8.571 5.143t7.429 2.857l9.714 6.286q1.714 2.286 0 2.286 10.286-1.143 17.714 6.286 5.714 6.286-3.429 11.429 1.714 3.429-1.714 5.429t-8.571 3.143q1.714 0.571 6.571 0.286t6 0.857q8.571 5.714-4 9.143-9.714 2.857-24.571-6.857zM502.286 78.857q117.714 20.571 200.571 108-1.714 1.714-7.143 2.571t-7.143 2q-10.286 4-13.714 4.571 0.571 4-1.429 7.429t-4.571 5.143-7.143 4.571-6.286 4q-1.143 1.143-4 3.429t-4 3.143-4.286 2.571-4.857 1.143-5.714-0.571l-1.714-0.571q-1.714-0.571-3.143-1.429t-3.143-1.714-2.286-1.714 0-1.429q-12 9.714-20.571 12.571-2.857 0.571-6.286 3.143t-6 4-5.714 0.857-6.571-4q-2.857-2.857-3.429-8.571t-1.143-7.429q-4 2.857 0 10t1.143 10.571q-1.714 3.429-6 2.571t-6.857-2.571-6.571-4.857-5.143-3.714-4.857-3.143-4.857-4.286q-1.714-2.286-3.429-6.857t-2.857-6.286q-1.143 2.286-6.571 3.714t-5.429 3.143q1.143-5.714 2.286-20t2.857-21.714q4-17.714-6.857-27.429-15.429-14.286-16.571-22.857-2.286-12.571 6.857-14.857 0-4-4.571-11.714t-4-12.286q0-3.429 1.143-9.143z" horiz-adv-x="878" />
|
| 45 |
-
<glyph unicode="" d="M207.429 73.143l52 52-134.286 134.286-52-52v-61.143h73.143v-73.143h61.143zM506.286 603.428q0 12.571-12.571 12.571-5.714 0-9.714-4l-309.714-309.714q-4-4-4-9.714 0-12.571 12.571-12.571 5.714 0 9.714 4l309.714 309.714q4 4 4 9.714zM475.429 713.143l237.714-237.714-475.429-475.429h-237.714v237.714zM865.714 658.286q0-30.286-21.143-51.429l-94.857-94.857-237.714 237.714 94.857 94.286q20.571 21.714 51.429 21.714 30.286 0 52-21.714l134.286-133.714q21.143-22.286 21.143-52z" horiz-adv-x="878" />
|
| 46 |
-
<glyph unicode="" d="M338.857 438.857q-92.571-2.857-151.429-73.143h-76.571q-46.857 0-78.857 23.143t-32 67.714q0 201.714 70.857 201.714 3.429 0 24.857-12t55.714-24.286 68-12.286q38.286 0 76 13.143-2.857-21.143-2.857-37.714 0-79.429 46.286-146.286zM950.857 74.857q0-68.571-41.714-108.286t-110.857-39.714h-499.429q-69.143 0-110.857 39.714t-41.714 108.286q0 30.286 2 59.143t8 62.286 15.143 62 24.571 55.714 35.429 46.286 48.857 30.571 63.714 11.429q5.714 0 24.571-12.286t41.714-27.429 61.143-27.429 77.143-12.286 77.143 12.286 61.143 27.429 41.714 27.429 24.571 12.286q34.857 0 63.714-11.429t48.857-30.571 35.429-46.286 24.571-55.714 15.143-62 8-62.286 2-59.143zM365.714 804.571q0-60.571-42.857-103.429t-103.429-42.857-103.429 42.857-42.857 103.429 42.857 103.429 103.429 42.857 103.429-42.857 42.857-103.429zM768 585.143q0-90.857-64.286-155.143t-155.143-64.286-155.143 64.286-64.286 155.143 64.286 155.143 155.143 64.286 155.143-64.286 64.286-155.143zM1097.143 456.571q0-44.571-32-67.714t-78.857-23.143h-76.571q-58.857 70.286-151.429 73.143 46.286 66.857 46.286 146.286 0 16.571-2.857 37.714 37.714-13.143 76-13.143 33.714 0 68 12.286t55.714 24.286 24.857 12q70.857 0 70.857-201.714zM1024 804.571q0-60.571-42.857-103.429t-103.429-42.857-103.429 42.857-42.857 103.429 42.857 103.429 103.429 42.857 103.429-42.857 42.857-103.429z" horiz-adv-x="1097" />
|
| 47 |
-
<glyph unicode="" d="M804.571 148q0-68.571-41.714-108.286t-110.857-39.714h-499.429q-69.143 0-110.857 39.714t-41.714 108.286q0 30.286 2 59.143t8 62.286 15.143 62 24.571 55.714 35.429 46.286 48.857 30.571 63.714 11.429q5.143 0 24-12.286t42.571-27.429 61.714-27.429 76.286-12.286 76.286 12.286 61.714 27.429 42.571 27.429 24 12.286q34.857 0 63.714-11.429t48.857-30.571 35.429-46.286 24.571-55.714 15.143-62 8-62.286 2-59.143zM621.714 658.286q0-90.857-64.286-155.143t-155.143-64.286-155.143 64.286-64.286 155.143 64.286 155.143 155.143 64.286 155.143-64.286 64.286-155.143z" horiz-adv-x="805" />
|
| 48 |
-
<glyph unicode="" d="M192 896v-768h768v768h-768zM896 192h-640v640h640v-640zM128 64v640l-64 64v-768h768l-64 64zM429.254 274.746l192 192 146.746-146.746v384h-384l146.746-146.746-192-192z" />
|
| 49 |
-
<glyph unicode="" d="M256 694.857q0 30.286-21.429 51.714t-51.714 21.429-51.714-21.429-21.429-51.714 21.429-51.714 51.714-21.429 51.714 21.429 21.429 51.714zM865.714 365.714q0-30.286-21.143-51.429l-280.571-281.143q-22.286-21.143-52-21.143-30.286 0-51.429 21.143l-408.571 409.143q-21.714 21.143-36.857 57.714t-15.143 66.857v237.714q0 29.714 21.714 51.429t51.429 21.714h237.714q30.286 0 66.857-15.143t58.286-36.857l408.571-408q21.143-22.286 21.143-52z" horiz-adv-x="878" />
|
| 50 |
-
<glyph unicode="" d="M256 694.857q0 30.286-21.429 51.714t-51.714 21.429-51.714-21.429-21.429-51.714 21.429-51.714 51.714-21.429 51.714 21.429 21.429 51.714zM865.714 365.714q0-30.286-21.143-51.429l-280.571-281.143q-22.286-21.143-52-21.143-30.286 0-51.429 21.143l-408.571 409.143q-21.714 21.143-36.857 57.714t-15.143 66.857v237.714q0 29.714 21.714 51.429t51.429 21.714h237.714q30.286 0 66.857-15.143t58.286-36.857l408.571-408q21.143-22.286 21.143-52zM1085.143 365.714q0-30.286-21.143-51.429l-280.571-281.143q-22.286-21.143-52-21.143-20.571 0-33.714 8t-30.286 25.714l268.571 268.571q21.143 21.143 21.143 51.429 0 29.714-21.143 52l-408.571 408q-21.714 21.714-58.286 36.857t-66.857 15.143h128q30.286 0 66.857-15.143t58.286-36.857l408.571-408q21.143-22.286 21.143-52z" horiz-adv-x="1097" />
|
| 51 |
-
<glyph unicode="" d="M292.571 365.714v-219.429h-146.286v219.429h146.286zM512 658.286v-512h-146.286v512h146.286zM731.429 512v-365.714h-146.286v365.714h146.286zM950.857 731.428v-585.143h-146.286v585.143h146.286zM1024 91.428v694.857q0 7.429-5.429 12.857t-12.857 5.429h-914.286q-7.429 0-12.857-5.429t-5.429-12.857v-694.857q0-7.429 5.429-12.857t12.857-5.429h914.286q7.429 0 12.857 5.429t5.429 12.857zM1097.143 786.286v-694.857q0-37.714-26.857-64.571t-64.571-26.857h-914.286q-37.714 0-64.571 26.857t-26.857 64.571v694.857q0 37.714 26.857 64.571t64.571 26.857h914.286q37.714 0 64.571-26.857t26.857-64.571z" horiz-adv-x="1097" />
|
| 52 |
-
<glyph unicode="" d="M512 420.571v-36.571q0-8-5.143-13.143t-13.143-5.143h-128v-128q0-8-5.143-13.143t-13.143-5.143h-36.571q-8 0-13.143 5.143t-5.143 13.143v128h-128q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h128v128q0 8 5.143 13.143t13.143 5.143h36.571q8 0 13.143-5.143t5.143-13.143v-128h128q8 0 13.143-5.143t5.143-13.143zM585.143 201.143v402.286q0 22.857-16 38.857t-38.857 16h-402.286q-22.857 0-38.857-16t-16-38.857v-402.286q0-22.857 16-38.857t38.857-16h402.286q22.857 0 38.857 16t16 38.857zM658.286 603.428v-402.286q0-52.571-37.429-90.286t-90.571-37.714h-402.286q-53.143 0-90.571 37.714t-37.429 90.286v402.286q0 53.143 37.429 90.571t90.571 37.429h402.286q53.143 0 90.571-37.429t37.429-90.571z" horiz-adv-x="658" />
|
| 53 |
-
<glyph unicode="" d="M219.429 109.714q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM587.429 349.714l-389.714-389.714q-21.143-21.143-51.429-21.143-29.714 0-52 21.143l-60.571 61.714q-21.714 20.571-21.714 51.429 0 30.286 21.714 52l389.143 389.143q22.286-56 65.429-99.143t99.143-65.429zM949.714 598.286q0-22.286-13.143-60.571-26.857-76.571-94-124.286t-147.714-47.714q-105.714 0-180.857 75.143t-75.143 180.857 75.143 180.857 180.857 75.143q33.143 0 69.429-9.429t61.429-26.571q9.143-6.286 9.143-16t-9.143-16l-167.429-96.571v-128l110.286-61.143q2.857 1.714 45.143 27.714t77.429 46.286 40.286 20.286q8.571 0 13.429-5.714t4.857-14.286z" horiz-adv-x="951" />
|
| 54 |
-
<glyph unicode="" d="M292.571 164.571v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM292.571 384v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM585.143 164.571v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM292.571 603.428v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM585.143 384v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM877.714 164.571v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM585.143 603.428v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM877.714 384v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM877.714 603.428v109.714q0 8-5.143 13.143t-13.143 5.143h-182.857q-8 0-13.143-5.143t-5.143-13.143v-109.714q0-8 5.143-13.143t13.143-5.143h182.857q8 0 13.143 5.143t5.143 13.143zM950.857 786.286v-621.714q0-37.714-26.857-64.571t-64.571-26.857h-768q-37.714 0-64.571 26.857t-26.857 64.571v621.714q0 37.714 26.857 64.571t64.571 26.857h768q37.714 0 64.571-26.857t26.857-64.571z" horiz-adv-x="951" />
|
| 55 |
-
<glyph unicode="" d="M219.429 182.857q0-45.714-32-77.714t-77.714-32-77.714 32-32 77.714 32 77.714 77.714 32 77.714-32 32-77.714zM512 112.571q1.143-16-9.714-27.429-10.286-12-26.857-12h-77.143q-14.286 0-24.571 9.429t-11.429 23.714q-12.571 130.857-105.429 223.714t-223.714 105.429q-14.286 1.143-23.714 11.429t-9.429 24.571v77.143q0 16.571 12 26.857 9.714 9.714 24.571 9.714h2.857q91.429-7.429 174.857-46t148-103.714q65.143-64.571 103.714-148t46-174.857zM804.571 111.428q1.143-15.429-10.286-26.857-10.286-11.429-26.286-11.429h-81.714q-14.857 0-25.429 10t-11.143 24.286q-6.857 122.857-57.714 233.429t-132.286 192-192 132.286-233.429 58.286q-14.286 0.571-24.286 11.143t-10 24.857v81.714q0 16 11.429 26.286 10.286 10.286 25.143 10.286h1.714q149.714-7.429 286.571-68.571t243.143-168q106.857-106.286 168-243.143t68.571-286.571z" horiz-adv-x="805" />
|
| 56 |
-
<glyph unicode="" d="M548.571 566.857q68 0 116.286-48.286t48.286-116.286-48.286-116.286-116.286-48.286-116.286 48.286-48.286 116.286 48.286 116.286 116.286 48.286zM950.857 804.571q60.571 0 103.429-42.857t42.857-103.429v-512q0-60.571-42.857-103.429t-103.429-42.857h-804.571q-60.571 0-103.429 42.857t-42.857 103.429v512q0 60.571 42.857 103.429t103.429 42.857h128l29.143 77.714q10.857 28 39.714 48.286t59.143 20.286h292.571q30.286 0 59.143-20.286t39.714-48.286l29.143-77.714h128zM548.571 146.286q105.714 0 180.857 75.143t75.143 180.857-75.143 180.857-180.857 75.143-180.857-75.143-75.143-180.857 75.143-180.857 180.857-75.143z" horiz-adv-x="1097" />
|
| 57 |
-
<glyph unicode="" d="M219.429 73.143h512v146.286h-512v-146.286zM219.429 438.857h512v219.429h-91.429q-22.857 0-38.857 16t-16 38.857v91.429h-365.714v-365.714zM877.714 402.286q0 14.857-10.857 25.714t-25.714 10.857-25.714-10.857-10.857-25.714 10.857-25.714 25.714-10.857 25.714 10.857 10.857 25.714zM950.857 402.286v-237.714q0-7.429-5.429-12.857t-12.857-5.429h-128v-91.429q0-22.857-16-38.857t-38.857-16h-548.571q-22.857 0-38.857 16t-16 38.857v91.429h-128q-7.429 0-12.857 5.429t-5.429 12.857v237.714q0 45.143 32.286 77.429t77.429 32.286h36.571v310.857q0 22.857 16 38.857t38.857 16h384q22.857 0 50.286-11.429t43.429-27.429l86.857-86.857q16-16 27.429-43.429t11.429-50.286v-146.286h36.571q45.143 0 77.429-32.286t32.286-77.429z" horiz-adv-x="951" />
|
| 58 |
-
<glyph unicode="" d="M969.143 731.428q22.857 0 38.857-16t16-38.857v-694.857q0-22.857-16-38.857t-38.857-16h-548.571q-22.857 0-38.857 16t-16 38.857v164.571h-310.857q-22.857 0-38.857 16t-16 38.857v384q0 22.857 11.429 50.286t27.429 43.429l233.143 233.143q16 16 43.429 27.429t50.286 11.429h237.714q22.857 0 38.857-16t16-38.857v-187.429q38.857 22.857 73.143 22.857h237.714zM658.286 609.714l-170.857-170.857h170.857v170.857zM292.571 829.143l-170.857-170.857h170.857v170.857zM404.571 459.428l180.571 180.571v237.714h-219.429v-237.714q0-22.857-16-38.857t-38.857-16h-237.714v-365.714h292.571v146.286q0 22.857 11.429 50.286t27.429 43.429zM950.857 0v658.286h-219.429v-237.714q0-22.857-16-38.857t-38.857-16h-237.714v-365.714h512z" />
|
| 59 |
-
<glyph unicode="" d="M329.143 438.857q0-14.857-10.857-25.714l-256-256q-10.857-10.857-25.714-10.857t-25.714 10.857-10.857 25.714v512q0 14.857 10.857 25.714t25.714 10.857 25.714-10.857l256-256q10.857-10.857 10.857-25.714z" horiz-adv-x="366" />
|
| 60 |
-
<glyph unicode="" d="M512 640v-256q0-8-5.143-13.143t-13.143-5.143h-182.857q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h128v201.143q0 8 5.143 13.143t13.143 5.143h36.571q8 0 13.143-5.143t5.143-13.143zM749.714 438.857q0 84.571-41.714 156t-113.143 113.143-156 41.714-156-41.714-113.143-113.143-41.714-156 41.714-156 113.143-113.143 156-41.714 156 41.714 113.143 113.143 41.714 156zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 61 |
-
<glyph unicode="" d="M585.143 165.143v108.571q0 8-5.429 13.429t-12.857 5.429h-109.714q-7.429 0-12.857-5.429t-5.429-13.429v-108.571q0-8 5.429-13.429t12.857-5.429h109.714q7.429 0 12.857 5.429t5.429 13.429zM584 378.857l10.286 262.286q0 6.857-5.714 10.857-7.429 6.286-13.714 6.286h-125.714q-6.286 0-13.714-6.286-5.714-4-5.714-12l9.714-261.143q0-5.714 5.714-9.429t13.714-3.714h105.714q8 0 13.429 3.714t6 9.429zM576 912.571l438.857-804.571q20-36-1.143-72-9.714-16.571-26.571-26.286t-36.286-9.714h-877.714q-19.429 0-36.286 9.714t-26.571 26.286q-21.143 36-1.143 72l438.857 804.571q9.714 17.714 26.857 28t37.143 10.286 37.143-10.286 26.857-28z" />
|
| 62 |
-
<glyph unicode="" d="M530.286 731.428q53.143 0 90.571-37.429t37.429-90.571v-402.286q0-52.571-37.429-90.286t-90.571-37.714h-402.286q-53.143 0-90.571 37.714t-37.429 90.286v402.286q0 53.143 37.429 90.571t90.571 37.429h402.286zM585.143 201.143v402.286q0 22.857-16 38.857t-38.857 16h-402.286q-22.857 0-38.857-16t-16-38.857v-402.286q0-22.857 16-38.857t38.857-16h402.286q22.857 0 38.857 16t16 38.857zM493.714 438.857q8 0 13.143-5.143t5.143-13.143v-36.571q0-8-5.143-13.143t-13.143-5.143h-329.143q-8 0-13.143 5.143t-5.143 13.143v36.571q0 8 5.143 13.143t13.143 5.143h329.143z" horiz-adv-x="658" />
|
| 63 |
-
<glyph unicode="" d="M292 633.143h146.857l-17.143-162.286h-129.714v-470.857h-194.857v470.857h-97.143v162.286h97.143v97.714q0 104 49.143 157.429t161.714 53.429h129.714v-162.286h-81.143q-22.286 0-35.714-3.714t-19.429-13.429-7.714-19.714-1.714-28.286v-81.143z" horiz-adv-x="439" />
|
| 64 |
-
<glyph unicode="" d="M1024 640l-512 256-512-256 512-256 512 256zM512 811.030l342.058-171.030-342.058-171.030-342.058 171.030 342.058 171.030zM921.444 499.278l102.556-51.278-512-256-512 256 102.556 51.278 409.444-204.722zM921.444 307.278l102.556-51.278-512-256-512 256 102.556 51.278 409.444-204.722z" />
|
| 65 |
-
<glyph unicode="" d="M877.714 438.857q0-143.429-83.714-258t-216.286-158.571q-15.429-2.857-22.571 4t-7.143 17.143v120.571q0 55.429-29.714 81.143 32.571 3.429 58.571 10.286t53.714 22.286 46.286 38 30.286 60 11.714 86q0 69.143-45.143 117.714 21.143 52-4.571 116.571-16 5.143-46.286-6.286t-52.571-25.143l-21.714-13.714q-53.143 14.857-109.714 14.857t-109.714-14.857q-9.143 6.286-24.286 15.429t-47.714 22-49.143 7.714q-25.143-64.571-4-116.571-45.143-48.571-45.143-117.714 0-48.571 11.714-85.714t30-60 46-38.286 53.714-22.286 58.571-10.286q-22.857-20.571-28-58.857-12-5.714-25.714-8.571t-32.571-2.857-37.429 12.286-31.714 35.714q-10.857 18.286-27.714 29.714t-28.286 13.714l-11.429 1.714q-12 0-16.571-2.571t-2.857-6.571 5.143-8 7.429-6.857l4-2.857q12.571-5.714 24.857-21.714t18-29.143l5.714-13.143q7.429-21.714 25.143-35.143t38.286-17.143 39.714-4 31.714 2l13.143 2.286q0-21.714 0.286-50.857t0.286-30.857q0-10.286-7.429-17.143t-22.857-4q-132.571 44-216.286 158.571t-83.714 258q0 119.429 58.857 220.286t159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 66 |
-
<glyph unicode="" d="M863.429 347.428q0-2.857-0.571-4-36.571-153.143-153.143-248.286t-273.143-95.143q-83.429 0-161.429 31.429t-139.143 89.714l-73.714-73.714q-10.857-10.857-25.714-10.857t-25.714 10.857-10.857 25.714v256q0 14.857 10.857 25.714t25.714 10.857h256q14.857 0 25.714-10.857t10.857-25.714-10.857-25.714l-78.286-78.286q40.571-37.714 92-58.286t106.857-20.571q76.571 0 142.857 37.143t106.286 102.286q6.286 9.714 30.286 66.857 4.571 13.143 17.143 13.143h109.714q7.429 0 12.857-5.429t5.429-12.857zM877.714 804.571v-256q0-14.857-10.857-25.714t-25.714-10.857h-256q-14.857 0-25.714 10.857t-10.857 25.714 10.857 25.714l78.857 78.857q-84.571 78.286-199.429 78.286-76.571 0-142.857-37.143t-106.286-102.286q-6.286-9.714-30.286-66.857-4.571-13.143-17.143-13.143h-113.714q-7.429 0-12.857 5.429t-5.429 12.857v4q37.143 153.143 154.286 248.286t274.286 95.143q83.429 0 162.286-31.714t140-89.429l74.286 73.714q10.857 10.857 25.714 10.857t25.714-10.857 10.857-25.714z" horiz-adv-x="878" />
|
| 67 |
-
<glyph unicode="" d="M877.714 804.571v-256q0-14.857-10.857-25.714t-25.714-10.857h-256q-24 0-33.714 22.857-9.714 22.286 8 39.429l78.857 78.857q-84.571 78.286-199.429 78.286-59.429 0-113.429-23.143t-93.429-62.571-62.571-93.429-23.143-113.429 23.143-113.429 62.571-93.429 93.429-62.571 113.429-23.143q68 0 128.571 29.714t102.286 84q4 5.714 13.143 6.857 8 0 14.286-5.143l78.286-78.857q5.143-4.571 5.429-11.714t-4.286-12.857q-62.286-75.429-150.857-116.857t-186.857-41.429q-89.143 0-170.286 34.857t-140 93.714-93.714 140-34.857 170.286 34.857 170.286 93.714 140 140 93.714 170.286 34.857q84 0 162.571-31.714t139.714-89.429l74.286 73.714q16.571 17.714 40 8 22.286-9.714 22.286-33.714z" horiz-adv-x="878" />
|
| 68 |
-
<glyph unicode="" d="M733.714 531.428q0 16-10.286 26.286l-52 51.429q-10.857 10.857-25.714 10.857t-25.714-10.857l-233.143-232.571-129.143 129.143q-10.857 10.857-25.714 10.857t-25.714-10.857l-52-51.429q-10.286-10.286-10.286-26.286 0-15.429 10.286-25.714l206.857-206.857q10.857-10.857 25.714-10.857 15.429 0 26.286 10.857l310.286 310.286q10.286 10.286 10.286 25.714zM877.714 438.857q0-119.429-58.857-220.286t-159.714-159.714-220.286-58.857-220.286 58.857-159.714 159.714-58.857 220.286 58.857 220.286 159.714 159.714 220.286 58.857 220.286-58.857 159.714-159.714 58.857-220.286z" horiz-adv-x="878" />
|
| 69 |
-
<glyph unicode="" d="M512 146.286l192 219.429h-438.857l-192-219.429h438.857zM1090.857 761.714q8.571-19.429 5.429-40.857t-17.429-37.429l-512-585.143q-21.714-25.143-54.857-25.143h-438.857q-21.714 0-39.714 11.714t-27.143 31.143q-8.571 19.429-5.429 40.857t17.429 37.429l512 585.143q21.714 25.143 54.857 25.143h438.857q21.714 0 39.714-11.714t27.143-31.143z" horiz-adv-x="1097" />
|
| 70 |
-
<glyph unicode="" d="M512 960c-282.77 0-512-229.23-512-512s229.23-512 512-512 512 229.23 512 512-229.23 512-512 512zM512 64c-212.078 0-384 171.922-384 384s171.922 384 384 384c212.078 0 384-171.922 384-384s-171.922-384-384-384z" />
|
| 71 |
-
<glyph unicode="" d="M512 960c-282.77 0-512-229.23-512-512s229.23-512 512-512 512 229.23 512 512-229.23 512-512 512zM512 64c-212.078 0-384 171.922-384 384s171.922 384 384 384c212.078 0 384-171.922 384-384s-171.922-384-384-384zM320 448c0 106.039 85.961 192 192 192s192-85.961 192-192c0-106.039-85.961-192-192-192s-192 85.961-192 192z" />
|
| 72 |
-
<glyph unicode="" d="M2.857 782.286q9.714 22.286 33.714 22.286h731.429q24 0 33.714-22.286 9.714-23.429-8-40l-281.714-281.714v-424q0-24-22.286-33.714-7.429-2.857-14.286-2.857-15.429 0-25.714 10.857l-146.286 146.286q-10.857 10.857-10.857 25.714v277.714l-281.714 281.714q-17.714 16.571-8 40z" horiz-adv-x="805" />
|
| 73 |
-
<glyph unicode="" d="M0.571 388l114.857 471.429q2.286 8 9.143 13.143t16 5.143h187.429q10.857 0 18.286-7.143t7.429-16.857q0-4.571-2.857-10.286l-97.714-264.571 226.286 56q4.571 1.143 6.857 1.143 10.857 0 19.429-8.571 10.286-11.429 4-25.143l-308.571-661.143q-7.429-14.286-24-14.286-2.286 0-8 1.143-9.714 2.857-14.571 10.857t-2.571 17.143l112.571 461.714-232-57.714q-2.286-0.571-6.857-0.571-10.286 0-17.714 6.286-10.286 8.571-7.429 22.286z" horiz-adv-x="512" />
|
| 74 |
-
<glyph unicode="" d="M0 64v616q1.714 5.143 2.286 5.714 2.857 3.429 11.429 6.286 60.571 20 85.143 28.571v219.429l318.857-113.143q1.143 0 91.714 31.429t180.571 62 92.286 30.571q11.429 0 11.429-12v-238.857l84-26.857v-616.571l-442.286 140.571q-8-3.429-214.286-72.857t-210.286-69.429q-7.429 0-10.286 7.429 0 0.571-0.571 1.714zM22.286 81.714l396.571 132.571v589.714l-396.571-133.143v-589.143zM84 240.571q3.429 2.286 46.857 52.571 12 13.714 48.857 65.714t44.857 67.429q9.714 17.143 29.143 56.286t20.571 44.286q-4.571 0.571-62.857-18.857-4.571-1.143-15.714-4.286t-19.714-5.429-9.714-2.857q-1.143-1.143-1.143-6t-0.571-5.429q-2.857-5.714-17.714-8.571-13.143-4-26.857 0-10.286 2.286-16 12-2.286 3.429-2.857 13.143 3.429 1.143 14 2.857t16.857 3.429q33.143 9.143 60 18.286 57.143 20 58.286 20 5.714 1.143 24.571 11.143t25.143 12.286q5.143 1.714 12.286 4.571t8.286 3.143 3.429-0.286q1.143-6.857-0.571-18.857 0-1.143-7.143-15.429t-15.143-30.571-9.714-19.143q-14.286-28.571-44-74.857l36.571-16q6.857-3.429 42.571-18.286t38.571-16q2.286-0.571 6-14.571t2.571-17.429q-0.571-1.714-7.143 0.286t-18 6.571l-11.429 5.143q-25.143 11.429-49.714 28-4 2.857-23.429 18t-21.714 16.286q-38.286-58.857-76.571-103.429-46.286-54.286-60-62.857-2.286-1.143-11.143-2.286t-10.571 0zM153.143 606.286l0.571 1.714q1.714-1.714 11.143-2.857t15.143 0 33.143 9.143q20.571 6.857 31.429 8 9.714 0 12-9.714 1.714-8.571-2.286-16-6.857-13.143-28.571-21.714-17.143-6.857-34.286-6.857-14.857 1.714-28 14.857-8 8.571-10.286 23.429zM177.143 6.857q0 4.571 2.857 7.714t7.429 3.143q2.286 0 10.286-4.286t17.429-9.429 11.714-6.286q41.714-21.143 91.143-35.143t90-14q54.286 0 95.429 8.286t89.714 28.857q8.571 4 17.429 8.857t19.429 10.857 16.286 9.429l-24.571 41.714 90.286-7.429-30.857-91.429-22.857 37.714q-74.286-47.429-157.714-61.714-33.143-6.857-52-6.857h-48q-45.143 0-114 22.286t-104.857 48.571q-4.571 4-4.571 9.143zM444 812.571l327.429-105.143v217.143zM505.714 332l58.286-17.714 25.714 62.857 120.571-37.143 21.143-77.143 58.286-17.714-103.429 375.429-57.143 17.714zM612 433.143l43.429 105.714 36-129.714z" />
|
| 75 |
-
<glyph unicode="" d="M0 73.143v97.143q68-48 185.714-72.571t253.143-24.571 253.143 24.571 185.714 72.571v-97.143q0-39.429-58.857-73.143t-160-53.429-220-19.714-220 19.714-160 53.429-58.857 73.143zM0 292.571v97.143q68-48 185.714-72.571t253.143-24.571 253.143 24.571 185.714 72.571v-97.143q0-39.429-58.857-73.143t-160-53.429-220-19.714-220 19.714-160 53.429-58.857 73.143zM0 512v97.143q68-48 185.714-72.571t253.143-24.571 253.143 24.571 185.714 72.571v-97.143q0-39.429-58.857-73.143t-160-53.429-220-19.714-220 19.714-160 53.429-58.857 73.143zM0 731.428v73.143q0 39.429 58.857 73.143t160 53.429 220 19.714 220-19.714 160-53.429 58.857-73.143v-73.143q0-39.429-58.857-73.143t-160-53.429-220-19.714-220 19.714-160 53.429-58.857 73.143z" />
|
| 76 |
-
<glyph unicode="🐦" d="M925.714 717.714q-38.286-56-92.571-95.429 0.571-8 0.571-24 0-74.286-21.714-148.286t-66-142-105.429-120.286-147.429-83.429-184.571-31.143q-154.857 0-283.429 82.857 20-2.286 44.571-2.286 128.571 0 229.143 78.857-60 1.143-107.429 36.857t-65.143 91.143q18.857-2.857 34.857-2.857 24.571 0 48.571 6.286-64 13.143-106 63.714t-42 117.429v2.286q38.857-21.714 83.429-23.429-37.714 25.143-60 65.714t-22.286 88q0 50.286 25.143 93.143 69.143-85.143 168.286-136.286t212.286-56.857q-4.571 21.714-4.571 42.286 0 76.571 54 130.571t130.571 54q80 0 134.857-58.286 62.286 12 117.143 44.571-21.143-65.714-81.143-101.714 53.143 5.714 106.286 28.571z" horiz-adv-x="951" />
|
| 77 |
-
</font></defs></svg>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/font/loco.ttf
DELETED
|
Binary file
|
old/pub/font/loco.woff
DELETED
|
Binary file
|
old/pub/img/flags.png
DELETED
|
Binary file
|
old/pub/img/loco-sprite.png
DELETED
|
Binary file
|
old/pub/img/wg/splitx.png
DELETED
|
Binary file
|
old/pub/img/wg/splity.png
DELETED
|
Binary file
|
old/pub/img/wp/menu.png
DELETED
|
Binary file
|
old/pub/js/build/admin-common.js
DELETED
|
@@ -1,3 +0,0 @@
|
|
| 1 |
-
!function(e,h,c){function m(b){b.stopPropagation();b.preventDefault();return!1}function n(b,a){function d(){g();f=setTimeout(function(){c(b).fadeOut(1E3,a)},e)}function g(){f&&clearTimeout(f);f=null}var f,e=5E3;d();c(b).mouseenter(g).mouseleave(d)}function k(b,a){function d(a){c(b).remove();c(e).triggerHandler("resize");return a&&m(a)}c('<a class="dismiss" href="#">×</a>').appendTo(b).click(d);a||n(b,d)}c("#wpbody-content").find("div.loco-message").each(function(b,a){k(a,!0)});var a=e.loco||
|
| 2 |
-
(e.loco={});a.killEvent=m;a.initMessage=k;a.showMessage=function(b,a,d,g){var f="loco-js-"+d;d=h.getElementById(f)||c('<div id="'+f+'" class="loco-message '+(g||d)+'"></div>').insertBefore(c("#loco-poedit"));b=c(h.createElement("p")).text(b);a=c(h.createElement("strong")).text(a+": ");b.prepend(a).appendTo(c(d).html(""));c(e).triggerHandler("resize");k(d);c("div.loco-warning").remove()};a.showError=function(b){return a.showMessage(b,l("Error"),"error")};a.showWarning=function(b){return a.showMessage(b,
|
| 3 |
-
l("Warning"),"updated loco-warning")};a.showSuccess=function(b){return a.showMessage(b,l("OK"),"updated loco-success")};a.debugError=function(a,c){e.console&&console.error&&(console.error("Loco Error: "+a),c&&console.debug(c))};var l=a.t||(a.t=function(a){return a})}(window,document,window.jQuery);
|
|
|
|
|
|
|
|
|
old/pub/js/build/admin-poedit.js
DELETED
|
@@ -1,163 +0,0 @@
|
|
| 1 |
-
(function(z,A,e,M){function U(){var d=B.stats(),c=d.t,n=d.f,h=d.u,c=K(D("1 string","%s strings",c),c),a=[];Q&&(c=K(D("%s%% translated"),d.p.replace("%",""))+", "+c,n&&a.push(K(D("%s fuzzy"),n)),h&&a.push(K(D("%s untranslated"),h)),a.length&&(c+=" ("+a.join(", ")+")"));e("#loco-po-status").text(c)}function X(d,c,n){function h(a,c,b){b=b||D("Unknown error");Y(b);n&&n(a,c,b);var k=e(d).find('input[name="action"]').val();I.debugError("Ajax failure for "+k+" action.",{status:a.status,error:c,message:b,
|
| 2 |
-
response:a.responseText})}return e.ajax({url:Z,type:d.method,data:e(d).serialize(),dataType:"json",error:h,success:function(a,f,b){!a||a.error?h(b,f,a&&a.error&&a.error.message):c&&c(a,f,b)}})}var p=function(){var d={};return{register:function(c,e){d[c]=e},require:function(c,e){var h=d[c];if(!h)throw Error('CommonJS error: failed to require("'+e+'")');return h}}}();p.register("$1",function(d,c,e){Array.prototype.indexOf||(Array.prototype.indexOf=function(c){if(null==this)throw new TypeError;var a,
|
| 3 |
-
f=Object(this),b=f.length>>>0;if(0===b)return-1;a=0;1<arguments.length&&(a=Number(arguments[1]),a!=a?a=0:0!=a&&Infinity!=a&&-Infinity!=a&&(a=(0<a||-1)*Math.floor(Math.abs(a))));if(a>=b)return-1;for(a=0<=a?a:Math.max(b-Math.abs(a),0);a<b;a++)if(a in f&&f[a]===c)return a;return-1});return d}({},z,A));p.register("$22",function(d,c,e){function h(k){b||c._gat&&(b=_gat._createTracker(a,"loco"));if(b){var m=k.shift();b[m].apply(b,k)}else f&&f.push(k);return d}var a,f,b;d._init=function(b){if(a=b.code){f=
|
| 4 |
-
c._gaq||(c._gaq=[]);f.push(["_setAccount",a]);f.push(["_trackPageview"]);f.push(["_setDomainName",b.host]);b=e.createElement("script");b.type="text/javascript";b.async=!0;b.src=("https:"==e.location.protocol?"https://ssl":"http://www")+".google-analytics.com/ga.js";var m=e.getElementsByTagName("script")[0];m.parentNode.insertBefore(b,m)}return d};d.event=function(b,a,c,f){return h(["_trackEvent",b||"",a||"",c||"",f||0])};d.page=function(b,a){return h(["_trackPageview",{page:b||location.pathname+location.hash,
|
| 5 |
-
title:a||e.title}])};return d}({},z,A));p.register("$23",function(d,c,e){function h(b,k){if(a)a[b](k);else c.ga&&ga(b,k);return d}var a,f;d._init=function(b){b.code&&(function(b,a,c,f,g,u,d){b.GoogleAnalyticsObject=g;b[g]=b[g]||function(){(b[g].q=b[g].q||[]).push(arguments)};b[g].l=1*new Date;u=a.createElement(c);d=a.getElementsByTagName(c)[0];u.async=1;u.src=f;d.parentNode.insertBefore(u,d)}(c,e,"script","//www.google-analytics.com/analytics.js","ga"),ga("create",b.code,{alwaysSendReferrer:!0,userId:b.user}),
|
| 6 |
-
b.custom&&h("set",b.custom),d.page(),ga(function(b){a=b}));return d};d.event=function(b,a,c,f){return h("send",{hitType:"event",eventCategory:b||"",eventAction:a||"",eventLabel:c||"",eventValue:Number(f||0)})};d.page=function(b,a){var c={hitType:"pageview",page:b||location.pathname+location.hash,title:a||e.title};c.location=location.protocol+"//"+location.hostname+c.page;f&&h("set",{referrer:f});f=c.location;return h("send",c)};d.reset=function(){f=location.href;h("set",{page:location.pathname+location.hash,
|
| 7 |
-
title:e.title,location:f});return d};return d}({},z,A));p.register("$10",function(d,c,n){function h(b,k){e(b).click(function(b){a&&a.event(k,"click",this.getAttribute("href")||"");return!0});b=null;return d}var a,f=location.hostname;d.init=function(b){!a&&b&&(f=b.host||(b.host=f),a=b.legacy?p.require("$22","legacy.js"):p.require("$23","universal.js"),a._init(b));return d};d.link=function(b){for(var a=b.getAttribute("href");a&&"#"!==a;){if(0===a.indexOf("#"))return h(b,"anchor");if(0===a.indexOf("http")||
|
| 8 |
-
0===a.indexOf("//")){if(-1!==a.indexOf(f)&&/^(https?:)*\/\/([^\/]+)/.exec(a)&&f===RegExp.$2)break;b.setAttribute("target","_blank");h(b,"external")}break}return d};d.page=function(){a&&a.page.apply(a,arguments);return d};d.event=function(){a&&a.event.apply(a,arguments);return d};d.reset=function(){a&&a.reset&&a.reset();return d};return d}({},z,A));p.register("$29",function(d,c,n){function h(b,a,c,l,d){function g(){w&&clearTimeout(w);v&&v.fadeOut(400,function(){e(this).remove();v=null});return!1}function u(){y();
|
| 9 |
-
-1!==l&&(w=setTimeout(g,l||2E3));v.off("mouseleave").on("mouseenter",y)}function y(){w&&clearTimeout(w);w=null;v.off("mouseenter").on("mouseleave",u)}var w;f||(f=n.createElement("div"),f.id="growls",n.body.appendChild(f));var v=e('<div class="growl growl-'+c+'"><div><a class="close" href="#"><span>X</span></a><span class="badge"></span><p class="message"></p><small class="caption"></small></div></div>');v.find("p").text(b||"Empty message");a?v.find("small").text(a):v.find("small").remove();if(d.length){d.push({label:"Cancel",
|
| 10 |
-
callback:g,css:"cancel"});var r,F=e('<form action="#" class="dialog"></form>');a=function(b,a){r=e('<input type="button" value="'+a.label+'" class="butt '+(a.css||"")+'" />');r.click(function(b){"function"===typeof a.callback&&a.callback(b,{close:g})});F.append(r);return r};for(b=0;b<d.length;b++)a(b,d[b]);v.append(F)}e(f).prepend(v.hide().fadeIn(400));v.find("a").click(g);u()}var a,f;d.init=function(){if(!a)return a=c.alert,c.alert=function(b){b=String(b).split("\n");var a=b[1]&&b.slice(1).join("\n");
|
| 11 |
-
d.alert(b[0],a)},d};d.debug=function(b){a(b);return d};d.alert=function(b,k,f,l,d){try{return h(b,k||"",f||"alert",l||4E3,d||[]),!0}catch(g){return b+="\n\n--\n"+(g.message||g),a.call(c,b),!1}};d.success=function(b,a,c){return d.alert(b,a,"success",c||2E3)};d.dialog=function(b,a,c,f){return d.alert(b,a,f||"alert",-1,c)};d.login=function(b,a,c,f){d.dialog(a||"You're not logged in",c||"Please log in to continue",[{label:f||"Log in",callback:function(a,k){location.assign(b||"/session/auth/login?r="+
|
| 12 |
-
encodeURIComponent(location.href))}}])};return d}({},z,A));p.register("$25",function(d,c,n){function h(b){return 27===b.keyCode&&u&&y?(C(),b.preventDefault(),!1):!0}function a(a){if(u){var g=Math.max(b.height(),k.outerHeight(!0));g&&l.css("height",g+"px");a&&(E=e(c).innerWidth(),G(s))}return!0}function f(b){b?(t.show(),m.addClass("has-title")):(t.hide(),m.removeClass("has-title"))}var b,k,m,l,t,g,u=!1,y=!1,w=!1,v,r,F,E,s,q=d.init=function(){if(!b){b=e('<div id="overlay"></div>');k=e('<div class="overlay-frame"></div>');
|
| 13 |
-
m=e('<div class="overlay-container"></div>');t=e('<div class="overlay-title"><span class="title">Untitled</span></div>');g=e('<a class="overlay-close" href="#"><span>x</span></a>');l=e('<div class="overlay-bg"></div>');b.append(k.append(m)).append(l).prependTo(n.body);e(n).on("keydown",h);e(c).resize(a);F=m.outerWidth(!0)-m.width()+(k.innerWidth()-k.width());m.outerHeight(!0);m.outerHeight(!1);k.innerHeight();k.height();E=e(c).innerWidth();v=parseInt(m.css("width"));if(!v||isNaN(v))v=m.width();r=
|
| 14 |
-
parseInt(m.css("height"));if(!r||isNaN(r))r=m.height();t.append(g.hide()).hide().prependTo(k);b.hide()}return b},G=d.width=function(a){q();if(null===a)k.css("width",""),m.css("width","");else{a=a||v||640;x=a+F;s=a;var g=E;x>g?(x=g,a=x-F,b.addClass("spill")):b.removeClass("spill");k.css("width",x+"px");m.css("width",a+"px")}return d};d.autoSize=function(){q();a();var b=v||0;m.children().each(function(a,g){b=Math.max(b,e(g).outerWidth(!0))});G(b);return d};d.css=function(b){q().attr("class",b);return d};
|
| 15 |
-
d.html=function(b){q();c.innerShiv&&(b=innerShiv(b,!1));return m.html(b)};d.append=function(b){q();b instanceof jQuery||(b=e(b));m.append(b);return d};var C=d.close=function(a){if(u){var g=function(){q().hide();e(n.body).removeClass("has-overlay");u=!1;m.html("");u=null;b.trigger("overlayClosed",[d])};null==a&&(a=300);b.trigger("overlayClosing",[d]);a?b.fadeOut(a,g):g()}return d};d.title=function(b){q();w=b||"";t.find("span.title").text(w);null!=b?f(!0):y||f(!1);return d};d.enableClose=function(){q();
|
| 16 |
-
y=!0;g.off("click").on("click",function(b){C();return!1});f(!0);g.show();return d};d.disableClose=function(){q();y=!1;g.hide();u&&w||f(!1);return d};d.open=function(){q();m.html("");G(v);b.attr("class","");e(n.body).addClass("has-overlay");q().show();u=!0;a();d.title(null);y&&f(!0);b.trigger("overlayOpened",[d]);return d};d.listen=function(b){q().on("overlayClosed",b);return d};d.unlisten=function(b){q().off("overlayClosed",b);return d};return d}({},z,A));p.register("$24",function(d,c,n){var h={401:"You've been logged out",
|
| 17 |
-
422:"Invalid data sent to server",404:"Not Found",500:"Server Error",502:"Bad Gateway",503:"Service unavailable",504:"Gateway timeout"};d.getErrors=function(){return h};d.jsonLink=function(a){if(!a)return"";a=a.split("?");a[0]=a[0].replace(/(\.[a-z0-9]{1,4})?$/i,".json");return a.join("?")};d.errorData=function(a,c,b){var k,m;b=a.responseText;c=a.status;if(!b&&0===c)return null;try{k=e.parseJSON(b)||{}}catch(l){k={},m=h[a.status]||l.message||l}m||(m=k.statusText||a.statusText||h[c]||"Unknown Error");
|
| 18 |
-
k.error=m;return k};d.ajax=function(a,f,b,k){function m(){b&&b()}function l(b){b.alert&&alert(b.alert);var a=b.success;a&&p.require("$29","growl.js").success.apply(this,a.push?a:[a]);a=k||e(n.body);a.trigger("locoAjaxSuccess",[b]);var f=b.events;if(f&&f.length)for(var l,v=p.require("$10","ga.js");l=f.shift();)a.trigger(l,[b]),v.event("ajax",l);if(a=b.download)c.location.assign(a);else if(a=b.redirect)if(0===a.indexOf("/modal/"))b.modal={url:a};else return c.location.assign(a),!1;else if(b.reload)return c.location.reload(),
|
| 19 |
-
!1;(a=b.modal)&&p.require("$12","modal.js").replace(a);m();return!0}function t(b,a,k){if("abort"!==a){var e=b.status,v;if(401===e)p.require("$29","growl.js").login(),f&&!1===f(null,h[e],e,b)&&m();else{if("parsererror"===a)c.console&&console.error&&console.error(e,b.responseText),v=404===e?"Ajax service not found":/^\s+Fatal error/.test(b.responseText)?"Fatal server error from Ajax request":"Bad Ajax response";else{var r=d.errorData(b,a,k);r&&r.error&&(v=r.error)}"function"===typeof f&&!1===f(null,
|
| 20 |
-
v,e,b)?m():r&&r.data&&!l(r.data)||(alert(v||"Unknown Ajax error"),m())}}}a.error=t;a.success=function(b,a,k){if(!b||"object"!==typeof b)return t(k,"unknown");b.status&&alert(b.statusText||"Unknown error");"function"===typeof f&&!1===f(b&&b.data?b.data:b,null,a,k)?m():b&&b.data?l(b.data):m()};-1!==a.url.indexOf(".json")&&(a.dataType="json");return e.ajax(a)};return d}({},z,A));p.register("$12",function(d,c,n){function h(b){b.stopPropagation();b.preventDefault();return!1}function a(){m||(m=p.require("$25",
|
| 21 |
-
"overlay.js"),m.listen(b));return m}function f(b,k){a().autoSize();var c=m.init();p.require("$2","html.js").init(c);c.find("[data-script]").each(function(b,a){a=e(a);for(var c=-1,g,f=a.attr("data-script").split(" ");++c<f.length;)g=f[c],t[g]?t[g](a,k||{}):alert("Unknown script "+g)});c.trigger("locoModalLoaded",[m,b||"",k||{}]);var g,f=c.find("form")[0],q;if(f)a:for(c=0;c<f.elements.length;c++)switch(g=f.elements[c],g.type){case "text":case "email":case "textarea":q=Number(g.getAttribute("tabindex"));
|
| 22 |
-
if(isNaN(q)||100>q)continue a;e(g).focus();break a}}function b(){u=null;g=[];return!0}function k(b){var a=e(b.currentTarget),k;k=a.attr("data-modal");if("back"===k){if(k=g.pop())return u=null,y.apply(this,k),h(b);k="close"}if("close"===k){w();var c=a.attr("href");if(c&&-1!==c.indexOf("#!"))return!0}else{var f="submit"===b.type,q=a.attr("title")||a.attr("data-title"),c=a.attr("href")||a.attr("action"),m=f?a.serialize():"",a=f?a.attr("method"):"get";k||(k=c.split("/").slice(1,4).join("-"));y(c,q,a,
|
| 23 |
-
m,"modal "+k)}return h(b)}var m,l=p.require("$10","ga.js"),t={},g=[],u,y=d.load=function(b,k,c,t,w){var q=u;u=arguments;g.length&&b===g[g.length-1][0]&&(g.pop(),q=g[g.length-1]);q&&(g.push(q),b+=-1===b.indexOf("?")?"?":"&",b+="r="+encodeURIComponent(q[0]));a().open().title("Loading ..").disableClose().css("modal").html('<div class="loading"></div>');w&&m.width(null).css(w).autoSize();var q=p.require("$24","http.js"),h={type:c||"get",data:t||"",url:q.jsonLink(b)};q.ajax(h,function(a,g,q){var d=a&&
|
| 24 |
-
a.html;if(!d)return a&&a.redirect?y(a.redirect,k,c,t,w):(a=e('<h3 class="error"></h3>').text(g||"Unknown error"),m.enableClose().title("Error "+q||"?").html("").append(a)),!1;k=a.title||k||"Untitled";m.enableClose().title(k).html(d);f(b,a.js);l.page(b,k);m.init().one("overlayClosed",function(){l.reset()});return!0});return d},w=d.close=function(){a().close();return d};d.initLink=function(b){b.click(k)};d.initForm=function(b){e(b).submit(k)};d.replace=function(b){a();var k=b&&b.html,c=b&&b.url,g=b&&
|
| 25 |
-
b.title,l=b&&b.action;c?(y(c,g),b=b&&b.css||c.split("/").slice(1,4).join("-"),m.width(null).css(" modal "+b).autoSize()):k?(m.open().html(k),g&&m.enableClose().title(g),f("",b&&b.js)):"close"===l&&w()};d.find=function(b){return a().init().find(b)};d.script=function(b,a){if(a){if("function"!==typeof a.run)throw Error(b+" macro has no run function");t[b]=a.run;return d}return t[b]};return d}({},z,A));p.register("$7",function(d,c,n){d.listen=function(d,a){function f(){w[l?"show":"hide"]()}function b(b){y&&
|
| 26 |
-
d.setAttribute("size",b.length||1);l=b;f();return b}function k(){t=null;a(l)}function m(){var a=d.value;u&&a===u&&(a="");a!==l&&(t&&clearTimeout(t),b(a),g?t=setTimeout(k,g):k())}var l,t;d=d instanceof jQuery?d[0]:d;var g=150,u=c.attachEvent&&d.getAttribute("placeholder"),y=1===Number(d.size),w=e('<a href="#clear" tabindex="-1" class="icon clear"><span>clear</span></a>').click(function(b){d.value="";m();return!1});b(d.value);e(d).on("input paste blur focus",function(){m();return!0}).after(w);f();return{delay:function(b){g=
|
| 27 |
-
b},ping:function(a){a?(t&&clearTimeout(t),a=d.value,u&&a===u&&(a=""),b(a),k(),a=void 0):a=m();return a},val:function(a){if(null==a)return l;t&&clearTimeout(t);d.value=b(a);f()},el:function(){return d},blur:function(b){return e(d).on("blur",b)}}};return d}({},z,A));p.register("$5",function(d,c,e){function h(){var a,c;this.clear=function(){this.length=0;a={};c=[]};this.getTree=function(){return a};this.getData=function(){return c};this.clear()}d.create=function(){return new h};c=h.prototype;c.depth=
|
| 28 |
-
0;c.matchall=!0;c.ignorecase=!0;c.boundary=/[\s.?!;:,*^+=~`"(){}<>[\]\/\\\u00a0\u1680\u180e\u2000-\u206f\u2e00-\u2e7f\u3000-\u303f]+/;c.nonword=/[\-'_]+/g;c.translit=function(a,c){function b(b){return a[b]||b}c=c||/[^a-z0-9]/g;this.trans=function(a){return a.replace(c,b)}};c.stoppers=function(a){this.stopped=function(c){return Boolean(a[c])}};c.add=function(a,c){var b=this.getData(),k=b.length;b.push(a);this.length++;for(var b=0,d=arguments.length;++b<d;){c=arguments[b];for(var l=-1,e,g,u,y,w,v=this.normalize(c),
|
| 29 |
-
r=v.length;++l<r;)if(e=v[l],!this.stopped(e)){g=this.getTree();u=Math.min(e.length,this.depth)||e.length;for(y=0;y<u;y++)w=e.charAt(y),g=g[w]||(g[w]={});e=g[" "]||(g[" "]=[]);e.push(k)}}return this};c.find=function(a,c){function b(a,c){var k,g,d;for(u in a)if(d=a[u]," "===u)for(k in d)y=d[k],g=w[y]||(w[y]={length:0,words:{}}),g.length+=g.words[c]?0:1,g.words[c]=1+(g.words[c]||0);else b(d,c)}var k=-1,d,l,e,g,u,y,w={},v=[],r=this.normalize(a),F=r.length,h=this.getData();a:for(;++k<F;){d=r[k];l=this.getTree();
|
| 30 |
-
e=Math.min(d.length,this.depth)||d.length;for(g=0;g<e;g++){u=d.charAt(g);if(!l[u])continue a;l=l[u]}b(l,d)}for(y in w)this.matchall&&w[y].length<F||v.push(h[y]);c&&(c.query=a,c.words=r);return v};c.normalize=function(a){for(var c=-1,b={},k=[],d=this.trans,l=this.split(a),e=l.length;++c<e;)if(a=l[c])if(this.ignorecase&&(a=a.toLowerCase()),a=this.strip(a))d&&(a=d(a)),b[a]||(k.push(a),b[a]=!0);return k};c.stopped=function(a){return 1===a.length};c.split=function(a){return a&&a.split(this.boundary)||
|
| 31 |
-
[]};c.strip=function(a){return a&&a.replace(this.nonword,"")||""};c.dump=function(){function a(a){for(var c=-1,d=[];++c<a.length;)d.push(b[a[c]]);return d}function c(b,d){var l,e;for(l in b)e=b[l]," "===l?console.log(d+": [ "+a(e).join(", ")+" ]"):c(e,d+l)}var b=this.getData();c(this.getTree(),"")};c=null;return d}({},z,A));p.register("$13",function(d,c,n){function h(a){-1===a.indexOf("?")&&(a="/auto/"+a+".json?q=");this.url=a;this.dead={}}function a(){this.dict=p.require("$5","dict.js").create()}
|
| 32 |
-
d.init=function(c){function b(){if("hint"!==S){var b=C.val()&&!(P&&P.val())&&null==q&&!F;V[b?"addClass":"removeClass"]("error")}}function k(b){P&&P.val(b)}function d(){R.show();var b=C.outerWidth(!1),a=C.outerHeight(!1),c=C.css("margin-top");c&&(c=parseInt(c),isNaN(c)||(a+=c));b-=2;R.css("top",a+"px").css("width",b+"px");F=!0}function l(){R.hide();F=!1}function t(){R.html("");l();r=0;G=q=null}function g(a){t();var c;for(c=0;c<a.length;c++){var k=c,g=a[c],q=e('<span class="label"></span>').text(g.label),
|
| 33 |
-
l=e('<div class="auto-comp-result"></div>'),f=void 0;for(f in g)l.data(f,g[f]);g.icon&&l.append(e("<span></span>").attr("class",g.icon));l.append(q);u(k,l)}(r=a.length)?(E&&d(),y(0)):(y(null),b(),V.trigger("locoAutonone",[]))}function u(b,a){R.append(a);a.click(function(c){c.stopPropagation();y(b,a);v();return!1});return a}function y(b,a){G&&(G.removeClass("selected"),G=null);q=null;null==b?k(""):(a||(a=R.find("div.auto-comp-result").eq(b)),a.length&&(a.addClass("selected"),q=b,G=a))}function w(b){if(r){var a=
|
| 34 |
-
r-1;null==q?b=0<b?0:a:(b=q+b,0>b?b=a:b>a&&(b=0));return y(b)}}function v(){if(null==q)z.val(""),k("");else{var a=R.find("div.auto-comp-result").eq(q),c=a.data()||{label:"Error"},g=c.value,d=c.label;k(g);z.val(d);l();a=a.clone();a.data(c);t();u(0,a);r=1;y(0,a);b();a.trigger("locoAutocomp",[g,d,a])}}var r=0,F=!1,E=!1,s=c.form,q=null,G=null,C=e(c),n=C.attr("name"),S=C.attr("data-mode"),O=C.attr("data-provider"),P="hint"!==S&&e('<input type="hidden" value="" name="'+n+'" />').appendTo(s),V=e('<div class="auto-comp-wrap"></div>').replaceAll(C),
|
| 35 |
-
R=e('<div class="auto-comp-drop"></div>');O&&(O=new h(O));P&&C.attr("name","_"+n);C.attr("autocomplete")||C.attr("autocomplete","off");V.append(C).append(R);l();C.focus(function(b){E=!0;1<r&&d()}).blur(function(a){E=!1;b()}).keydown(function(b){function a(){b.preventDefault();b.stopPropagation();return!1}switch(b.keyCode){case 27:F&&(b.stopPropagation(),l(),C.blur());break;case 40:r&&(F?w(1):d());break;case 38:F&&w(-1);break;case 13:if(F)return v(),a();if(!q&&"hint"!==S)return a()}return!0});var z=
|
| 36 |
-
p.require("$7","LocoTextListener.js").listen(C,function(b){O&&O.fetch(b,g)});(s=C.attr("data-pre"))&&(s=e.parseJSON(s))&&s.value&&s.label?(g([s]),v()):!c.value||P&&P.val()||!O||O.fetch(c.value,function(b){g(b);v()});return{$:C,val:function(){return P&&P.val()},clear:t,reset:function(){t();C.val("");k("");z.ping()},force:function(b,a){t();k(a||"");z.val(b)},preload:function(b){r&&t();O=new a;var c,k;for(c in b)k=b[c],O.add(k)},mode:function(b){S=b}}};h.prototype.fetch=function(a,b){if(!a)return b&&
|
| 37 |
-
b([]),this;var c,d=this.dead;for(c in d)if(0===a.indexOf(c))return b&&b([]),this;c={dataType:"json",url:this.url+encodeURIComponent(a)};p.require("$24","http.js").ajax(c,function(c){var k=c&&c.results;k&&(b&&c.query&&c.query===a&&b(c.results),k.length||(d[a]=0));return!0});return this};a.prototype.add=function(a){var b=a.fulltext||a.label||a.value;b&&this.dict.add(a,b)};a.prototype.fetch=function(a,b){if(!a)return b&&b([]),this;var c=this.dict.find(a);b(c)};return d}({},z,A));p.register("$14",function(d,
|
| 38 |
-
c,n){function h(b){b.stopPropagation();b.preventDefault();return!1}function a(b,a,c){if(c=c||b.getElement(a))c.off().mouseup(function(c){c.stopPropagation();b.selectIndex(a,!0);return!1}).mouseover(function(){e(this).addClass("over");b.hover=a;return!0}).mouseout(function(){e(this).removeClass("over");b.hover=-1;return!0}),c=null;return b}function f(b){if(b){var a=this,c=b[0];a.id=c.id||"";a.name=c.name||"";a.prefix=c.getAttribute("data-prefix");a.defaultIcon=c.getAttribute("data-icon")||"jshide";
|
| 39 |
-
var d=c.selectedIndex,f=[],g,u,y;for(u=0;u<c.options.length;u++)g=c.options[u],y=g.disabled,g=e(g),f.push([g.val(),g.text(),g.attr("data-icon")||"",y]);a.hidden=e('<input type="hidden" name="'+a.name+'" value="" />').appendTo(c.form);a.list=e('<ul class="clearfix"></ul>');a.icon=e('<span class="icon"> </span>');a.selection=e('<span class="label"></span>');a.handle=e('<a class="handle" href="#"></a>').attr("tabindex",b.attr("tabindex")||"").append(a.icon).append(a.selection);a.wrapper=e("<div></div>").addClass(c.className).addClass("selector").append(a.handle).append(a.list).replaceAll(c);
|
| 40 |
-
this.id&&a.wrapper.attr("id",this.id);for(a.clearOptions();g=f.shift();)a.addOption.apply(a,g);a.handle.click(function(b){b.preventDefault();return!1}).mouseover(function(b){return a.onRollover(b)}).mouseout(function(b){return a.onRollout(b)}).mousedown(function(b){return a.onPress(b)}).keydown(function(b){return a.onKeydown(b)});e(n.body).mouseup(function(b){return a.onRelease(b)}).keydown(function(b){return a.onGlobalKeydown(b)});a.close();a.selectIndex(d)}}d.create=function(b){return new f(b)};
|
| 41 |
-
d.extend=function(b){b.prototype=new f};c=f.prototype;c.onRollover=function(b){return this.over=!0};c.onRollout=function(b){this.over=!1;return!0};c.onPress=function(b){return this.active?this.over?(this.close(),b.stopPropagation(),b.preventDefault(),!1):!0:(this.open(),b.stopPropagation(),b.preventDefault(),this.handle.focus(),!1)};c.onRelease=function(b){this.active&&!this.over&&this.close();return!0};c.onGlobalKeydown=function(b){if(this.active)switch(b.keyCode){case 27:return this.close(),h(b);
|
| 42 |
-
case 40:return this.hoverNext(1),h(b);case 38:return this.hoverNext(-1),h(b);case 13:if(-1!=this.hover)return this.selectIndex(this.hover,!0),this.hoverItem(-1),this.close(),h(b)}return!0};c.onKeydown=function(b){return this.active||40!==b.keyCode?!0:(this.open(),h(b))};c.open=function(){this.active=!0;this.hover=-1;this.wrapper.addClass("active");var b=this.handle.outerHeight()||0;this.list.show().css("top",b+"px");var b=this.handle.outerWidth()||0,a=this.list.outerWidth()||0;b>a&&(a-=this.list.width(),
|
| 43 |
-
this.list.css("min-width",String(b-a)+"px"))};c.close=function(){this.list.hide();this.active=!1;-1!==this.hover&&(this.getElement(this.hover).removeClass("over"),this.hover=-1);this.wrapper.removeClass("active")};c.hoverItem=function(b,a){-1!==this.hover&&this.getElement(this.hover).removeClass("over");this.hover=b;-1!==b&&(a=a||this.getElement(b),a.addClass("over"))};c.hoverNext=function(b){var a=this.options.length;if(a){a-=1;if(-1==this.hover)b=0<b?0:a;else{b=this.hover+b;if(0>b){this.close();
|
| 44 |
-
return}b>a&&(b=0)}this.hoverItem(b)}};c.enableChange=function(b){this.eventName=b;this.eventData=[].slice.call(arguments,1);return this};c.enableConfirm=function(b){this.confirm=b;return this};c.clearOptions=function(){this.index={};this.length=0;this.options=[];this.list.html("");this.hidden.val("");this.idx=this.hover=-1;return this};c.addOption=function(b,c,d,l){var f=this.options.length,g=e("<span></span>").addClass(d||"jshide"),u=e('<span class="label"></span>').text(c||b),g=e("<li></li>").append(g).append(u).appendTo(this.list);
|
| 45 |
-
g.attr("data-option",f);this.options[f]={value:b,text:c,icon:d};this.index[b]=f;this.length=f+1;l?this.disableIndex(f):a(this,f,g);return f};c.disableOption=function(b){return this.disableIndex(this.index[b])};c.disableIndex=function(b){(b=this.getElement(b))&&b.addClass("disabled").off();return this};c.enableOption=function(b){return this.enableIndex(this.index[b])};c.enableIndex=function(b){return a(this,b)};c.reIndex=function(){this.index={};this.length=0;for(var b=this.options.length;-1<--b;)this.index[this.options[b].value]=
|
| 46 |
-
b,this.length++};c.selectValue=function(b,a){return this.selectIndex(this.index[b],a)};c.selectIndex=function(b,a){var c=this.options[b];if(c){var d=this,f=c.value,g=c.icon||d.defaultIcon,u=function(){d.hidden.val(f);d.idx=b;d.setLabel(c.text);d.icon.attr("class",g);a&&d.change()};d.idx===b?d.hidden.val(f):a?"function"===typeof d.confirm?d.confirm.call(null,c,function(b){b&&u()}):d.beforeChange(f)&&u():u();d.active&&d.close()}return this};c.setLabel=function(b){this.selection.text(b);this.prefix&&
|
| 47 |
-
this.selection.prepend(e('<span class="prefix"></span>').text(this.prefix))};c.val=function(){var b=this.options[this.idx];return b&&b.value};c.change=function(){var b=this.eventName||"change",a=[this.val()].concat(this.eventData||[]);this.wrapper.trigger(b,a);return this};c.beforeChange=function(b){var a=e.Event("locoBeforeSelect");this.wrapper.trigger(a,[b]);return!a.isDefaultPrevented()};c.renameOption=function(b,a){var c=this.index[b],d=this.options[c];d&&(d.text=a,this.getElement(c).find("span.label").text(a),
|
| 48 |
-
c===this.idx&&this.setLabel(a));return this};c.removeOption=function(b){var a=this.index[b],c=this.options[a];c&&(b=this.val(),this.getElement(a).remove(),this.options.splice(a,1),this.reIndex(),b===c.value?this.selectIndex(0,!0):this.selectValue(b,!1))};c.getElement=function(b){return this.list.find("li").eq(b)};c=null;return d}({},z,A));p.register("$15",function(d,c,n){function h(b,a){this.$element=e(b);this.options=a;this.enabled=!0;this.fixTitle()}d.init=function(b){var c=b.attr("data-gravity")||
|
| 49 |
-
"s";b.tipsy[c]&&(c=b.tipsy[c]);b.tipsy({fade:!0,gravity:c,offset:5,delayIn:a,delayOut:f,anchor:b.attr("data-anchor")})};d.delays=function(b,c){a=b||150;f=c||100};d.kill=function(){e("div.tipsy").remove()};d.text=function(b,a){a.data("tipsy").setTitle(b)};var a,f;d.delays();e(n.body).on("overlayOpened overlayClosing",function(b){d.kill();return!0});h.prototype={show:function(){var b=this.getTitle();if(b&&this.enabled){var a=this.tip();a.find(".tipsy-inner")[this.options.html?"html":"text"](b);a[0].className=
|
| 50 |
-
"tipsy";a.remove().css({top:0,left:0}).prependTo(n.body);var b=(b=this.options.anchor)?this.$element.find(b):this.$element,b=e.extend({},b.offset(),{width:b[0].offsetWidth,height:b[0].offsetHeight}),c=a[0].offsetWidth,d=a[0].offsetHeight,f="function"==typeof this.options.gravity?this.options.gravity.call(this.$element[0]):this.options.gravity,g;switch(f.charAt(0)){case "n":g={top:b.top+b.height+this.options.offset,left:b.left+b.width/2-c/2};break;case "s":g={top:b.top-d-this.options.offset,left:b.left+
|
| 51 |
-
b.width/2-c/2};break;case "e":g={top:b.top+b.height/2-d/2,left:b.left-c-this.options.offset};break;case "w":g={top:b.top+b.height/2-d/2,left:b.left+b.width+this.options.offset}}2==f.length&&("w"==f.charAt(1)?g.left=b.left+b.width/2-15:g.left=b.left+b.width/2-c+15);a.css(g).addClass("tipsy-"+f);a.find(".tipsy-arrow")[0].className="tipsy-arrow tipsy-arrow-"+f.charAt(0);this.options.className&&a.addClass("function"==typeof this.options.className?this.options.className.call(this.$element[0]):this.options.className);
|
| 52 |
-
a.addClass("in")}},hide:function(){this.tip().remove()},fixTitle:function(){var b=this.$element;(b.attr("title")||"string"!=typeof b.attr("original-title"))&&b.attr("original-title",b.attr("title")||"").removeAttr("title")},getTitle:function(){var b,a=this.$element,c=this.options;this.fixTitle();c=this.options;"string"==typeof c.title?b=a.attr("title"==c.title?"original-title":c.title):"function"==typeof c.title&&(b=c.title.call(a[0]));return(b=(""+b).replace(/(^\s*|\s*$)/,""))||c.fallback},setTitle:function(b){var a=
|
| 53 |
-
this.$element;a.attr("default-title")||a.attr("default-title",this.getTitle());null==b&&(b=a.attr("default-title")||this.getTitle());a.attr("original-title",b);if(this.$tip)this.$tip.find(".tipsy-inner")[this.options.html?"html":"text"](b)},tip:function(){this.$tip||(this.$tip=e('<div class="tipsy"></div>').html('<div class="tipsy-arrow"></div><div class="tipsy-inner"></div>'),this.$tip.data("tipsy-pointee",this.$element[0]));return this.$tip},validate:function(){this.$element[0].parentNode||(this.hide(),
|
| 54 |
-
this.options=this.$element=null)},enable:function(){this.enabled=!0},disable:function(){this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled}};e.fn.tipsy=function(b){function a(c){var g=e.data(c,"tipsy");g||(g=new h(c,e.fn.tipsy.elementOptions(c,b)),e.data(c,"tipsy",g));return g}function c(){var g=a(this);g.hoverState="in";0==b.delayIn?g.show():(g.fixTitle(),setTimeout(function(){"in"==g.hoverState&&g.show()},b.delayIn))}function d(){var c=a(this);c.hoverState="out";0==b.delayOut?
|
| 55 |
-
c.hide():(c.tip().removeClass("in"),setTimeout(function(){"out"==c.hoverState&&c.hide()},b.delayOut))}if(!0===b)return this.data("tipsy");if("string"==typeof b){var f=this.data("tipsy");if(f)f[b]();return this}b=e.extend({},e.fn.tipsy.defaults,b);b.live||this.each(function(){a(this)});if("manual"!=b.trigger){var f=b.live?"live":"bind",g="hover"==b.trigger?"mouseleave":"blur";this[f]("hover"==b.trigger?"mouseenter":"focus",c)[f](g,d)}return this};e.fn.tipsy.defaults={className:null,delayIn:0,delayOut:0,
|
| 56 |
-
fade:!1,fallback:"",gravity:"n",html:!1,live:!1,offset:0,opacity:0.8,title:"title",trigger:"hover",anchor:null};e.fn.tipsy.revalidate=function(){e(".tipsy").each(function(){var b=e.data(this,"tipsy-pointee"),a;if(!(a=!b)){a:{for(;b=b.parentNode;)if(b==n){b=!0;break a}b=!1}a=!b}a&&e(this).remove()})};e.fn.tipsy.elementOptions=function(b,a){return e.metadata?e.extend({},a,e(b).metadata()):a};e.fn.tipsy.autoNS=function(){return e(this).offset().top>e(n).scrollTop()+e(c).height()/2?"s":"n"};e.fn.tipsy.autoWE=
|
| 57 |
-
function(){return e(this).offset().left>e(n).scrollLeft()+e(c).width()/2?"e":"w"};e.fn.tipsy.autoBounds=function(b,a){return function(){var d=a[0],f=1<a.length?a[1]:!1,t=e(n).scrollTop()+b,g=e(n).scrollLeft()+b,u=e(this);u.offset().top<t&&(d="n");u.offset().left<g&&(f="w");e(c).width()+e(n).scrollLeft()-u.offset().left<b&&(f="e");e(c).height()+e(n).scrollTop()-u.offset().top<b&&(d="s");return d+(f?f:"")}};return d}({},z,A));p.register("$2",function(d,c,n){var h=c.ieVersion;d.ie=function(a){return a?
|
| 58 |
-
h<=a:h};var a=d.init=function(c){c?c instanceof jQuery||(c=e(c)):c=e(n.body);var b=p.require("$10","ga.js"),k=p.require("$11","forms.js"),m=p.require("$12","modal.js"),l=p.require("$13","LocoAutoComplete.js"),t=p.require("$14","LocoSelector.js"),g=p.require("$15","tooltip.js");c.find("form").each(function(b,a){var c=e(a);h&&10>h&&k.placeholders(c);a.getAttribute("data-modal")?m.initForm(a):a.action&&0!==c.attr("action").indexOf("#")&&!a.target&&k.jsonify(a);c.hasClass("hasreveal")&&k.revealify(c);
|
| 59 |
-
c.find("input.button").each(function(b,a){k.linkify(a)});c.find("input.auto-comp").each(function(b,a){l.init(a)});c.find("select.selector").each(function(b,a){t.create(e(a))})});c.find("a").each(function(c,f){-1!==f.className.indexOf("hastip")&&g.init(e(f));if(-1!==f.href.indexOf("/modal/")||f.getAttribute("data-modal"))m.initLink(e(f));else{b.link(f);var k=f.getAttribute("data-ajax-target");k&&(k=e("#"+k),e(f).click(function(b){b.preventDefault();k.addClass("loading");e.get(f.href,function(b){b=
|
| 60 |
-
d.$(b).replaceAll(k);a(b);b.trigger("locoAhah")});return!1}))}});k=m=l=c=null;return d};d.$=function(a){return e(c.innerShiv?innerShiv(a,!1):a)};e.fn._html=function(d){return null!=d?(d=this.html(c.innerShiv?innerShiv(d,!1):d),a(this),d):j.html()};e.fn.macro=function(a,b){if("function"!==typeof a.run)throw Error("macro has no run function");a.run(this,b||{});return this};d.el=function(a,b){var c=n.createElement(a||"div");b&&(c.className=b);return c};d.txt=function(a){return n.createTextNode(a||"")};
|
| 61 |
-
d.noop=function(a){a.preventDefault();a.stopPropagation();return!1};return d}({},z,A));p.register("$11",function(d,c,n){function h(b){function a(){b.value===f&&(b.value="",d.removeClass("placeheld"));return!0}function c(){""===b.value&&(b.value=f,d.addClass("placeheld"));return!0}var d=e(b);if(!d.hasClass("auto-comp")){var f=d.attr("placeholder");if(f)return d.focus(a).blur(c),c(),{kill:function(){a();d.off("focus",a).off("blur",c)}}}}var a=d.enable=function(b){function a(b,c){c.getAttribute("data-was-disabled")||
|
| 62 |
-
(c.disabled=!1)}b.find(".button").removeClass("loading");b.find("input").each(a);b.find("select").each(a);b.find("textarea").each(a);c.attachEvent&&b.hasClass("has-placeholders")&&d.placeholders(b);delete b._disabled},f=d.disable=function(b){function a(b,c){c.disabled?c.setAttribute("data-was-disabled","true"):c.disabled=!0}b._disabled||(b.find(".button").addClass("loading"),b.find("input").each(a),b.find("select").each(a),b.find("textarea").each(a),b._disabled=!0)};d.jsonify=function(b,d,m){b instanceof
|
| 63 |
-
jQuery||(b=e(b));b.disable||(e.fn.disable=function(){f(this);return this},e.fn.enable=function(){a(this);this.placehold&&this.placehold();return this});var l="";b.find('[type="submit"]').click(function(b){b&&b.target&&b.target.name&&(l=encodeURIComponent(b.target.name)+"="+encodeURIComponent(b.target.value));return!0});b.submit(function(a){if(a&&a.isDefaultPrevented&&a.isDefaultPrevented()||m&&!1===m(a))return!1;var g=c.tinyMCE;g&&b.find("textarea.editor").each(function(b,a){var c=g.get(a.id);c&&
|
| 64 |
-
c.save()});var f=b.serialize(),f=f.replace(/%0D%0A/g,"%0A");l&&(f&&(f+="&"),f+=l,l="");b.disable();var e=p.require("$24","http.js"),f={url:e.jsonLink(b.attr("action")),type:b.attr("method"),data:f};e.ajax(f,d,function(){b.enable()},b);a.preventDefault();a.stopPropagation();return!1});if(b.hasClass("autopost")){var t,g=Number(b.attr("data-autopost-delay")||500);b.find('input[type="checkbox"]').change(function(){t&&clearTimeout(t);t=setTimeout(function(){b.submit()},g);return!0})}};d.revealify=function(b){b.find("div[data-reveal-if]").each(function(a,
|
| 65 |
-
c){function d(b){var a;r=r||b.target;if("."===h)a=Boolean(r&&r[v]);else if("="===h){var c,g;a=e(r.form).serializeArray();for(g in a)a[g].name===y&&(c=a[g].value);a=v===c}if(a!==u)if(u=a,b)f[u?"slideDown":"slideUp"](200);else f[u?"show":"hide"]();return!0}var f=e(c),g=/^([_\w\-\[\]]+)(\.|=)(.+)$/.exec(f.attr("data-reveal-if"));if(g){var u,y=g[1],h=g[2],v=g[3],g=b[0][y];g.length||(g=[g]);var r;for(a=0;a<g.length;a++)r=g[a],d(),e(r).change(d).removeClass("jshide");g=g=r=null}});b=null};d.linkify=function(a){var c=
|
| 66 |
-
a.getAttribute("data-icon");if(c){var d=e(a),f=e("<a> </a>");f.attr("href",a.form.action);f.attr("class",d.attr("class"));f.attr("tabindex",d.attr("tabindex"));d.attr("tabindex","-1");f.text(d.val());c&&e("<span></span>").prependTo(f).addClass(c);d.hide().after(f);f.click(function(a){d.click();return!1})}};d.placeholders=function(a){var c,d=[];a.find("input[placeholder]").each(function(a,b){"password"!==b.type&&(c=h(b))&&d.push(c)});d.length&&(a.submit(function(){for(var a in d)d[a].kill()}),a.addClass("has-placeholders"),
|
| 67 |
-
c=i=null)};return d}({},z,A));p.register("$16",function(d,c,e){function h(a){this.reIndex([]);if(a)for(var c in a)this.add(c,a[c])}d.init=function(a){return new h(a)};c=h.prototype;c.reIndex=function(a){var c=-1;for(this.ords={};++c<a.length;)this.ords[a[c]]=c;this.keys=a;this.length=c};c.key=function(a,c){if(null==c)return this.keys[a];var b=this.keys[a],d=this.ords[c];if(c!==b){if(null!=d)throw Error("Clash with item at ["+d+"]");this.keys[a]=c;delete this.ords[b];this.ords[c]=a}return a};c.indexOf=
|
| 68 |
-
function(a){a=this.ords[a];return null==a?-1:a};c.add=function(a,c){var b=this.ords[a];null==b&&(this.keys[this.length]=a,b=this.ords[a]=this.length++);this[b]=c;return b};c.get=function(a){return this[this.ords[a]]};c.cut=function(a,c){var b=[].splice.call(this,a,c);this.keys.splice(a,c);this.reIndex(this.keys);return b};c.each=function(a){for(var c=-1;++c<this.length;)a(this.keys[c],this[c],c);return this};c=null;return d}({},z,A));p.register("$20",function(d,c,e){function h(a){c.console&&console.error&&
|
| 69 |
-
console.error(a)}function a(){h("Method not implemented")}function f(){}function b(a){}f.prototype.toString=function(){return"[Undefined]"};b.prototype._validate=function(b){var c,d,e=!0;for(c in this)d=this[c],d===a?(h(b+"."+c+"() must be implemented"),e=!1):d instanceof f&&(h(b+"."+c+" must be defined"),e=!1);return e};d.init=function(c,d){var e,h=new b;if(c)for(e=c.length;0!==e--;)h[c[e]]=a;if(d)for(e=d.length;0!==e--;)h[d[e]]=new f;return h};d.validate=function(a){var b=/function (\w+)\(/.exec(a.toString())?
|
| 70 |
-
RegExp.$1:"";a.prototype._validate(b||"Object")};return d}({},z,A));p.register("$17",function(d,c,e){function h(){}d.extend=function(a){return a.prototype=new h};c=h.prototype=p.require("$20","abstract.js").init(["add","load"]);c.row=function(a){return this.rows[a]};c.lock=function(a){this.locale(a||{lang:"zz",region:"ZZ",label:"Unknown",nplurals:1,pluraleq:"n!=1"});return this.loc};c.unlock=function(){var a=this.loc;this.loc=null;return a};c.locale=function(a){if(null==a)return this.loc;if(this.loc=
|
| 71 |
-
a)this.loc.toString=function(){return this.lang+"_"+this.region};return this};c.each=function(a){this.rows.each(a);return this};c.indexOf=function(a){"object"!==typeof a&&(a=this.get(a));if(!a)return-1;null==a.idx&&(a.idx=this.rows.indexOf(a.hash()));return a.idx};c.get=function(a){return this.rows&&this.rows.get(a)};c.del=function(a){a=this.indexOf(a);if(-1!==a){var c=this.rows.cut(a,1);if(c&&c.length)return this.length=this.rows.length,this.rows.each(function(a,c,d){c.idx=d}),a}};c.reIndex=function(a,
|
| 72 |
-
c){var b=this.indexOf(a),d=a.hash(),e=this.rows.indexOf(d);return e===b?b:-1!==e?(c=(c||0)+1,a.source("Error, duplicate "+String(c)+": "+a.source()),this.reIndex(a,c)):this.rows.key(b,d)};c=null;return d}({},z,A));p.register("$18",function(d,c,e){function h(){this.id=this._id=this.ref=this.cmt=this.xcmt=""}d.extend=function(a){return a.prototype=new h};c=h.prototype;c.flag=function(a,c){var b=this.flg||(this.flg=[]);if(null!=c)b[c]=a;else for(var d=Math.max(b.length,this.src.length,this.msg.length);0!==
|
| 73 |
-
d--;)b[d]=a;return this};c.flagged=function(a){var c=this.flg||[];if(null!=a)return c[a]||0;for(a=c.length;0!==a--;)if(c[a])return!0;return!1};c.flaggedAs=function(a,c){var b=this.flg||[];if(null!=c)return a===b[c]||0;for(var d=b.length;0!==d--;)if(b[d]===a)return!0;return!1};c.fuzzy=function(a,c){var b=this.flaggedAs(4,a);null!=c&&this.flag(c?4:0,a);return b};c.source=function(a,c){if(null==a)return this.src[c||0]||"";this.src[c||0]=a;return this};c.plural=function(a,c){if(null==a)return this.src[c||
|
| 74 |
-
1]||"";this.src[c||1]=a||"";return this};c.each=function(a){for(var c=-1,b=this.src,d=this.msg,e=Math.max(b.length,d.length);++c<e;)a(c,b[c],d[c]);return this};c.pluralized=function(){return 1<this.src.length||1<this.msg.length};c.translate=function(a,c){this.msg[c||0]=a||"";return this};c.untranslate=function(a){null!=a&&(this.msg[a]="");for(a=0;a<this.msg.length;a++)this.msg[a]="";return this};c.translation=function(a){return this.msg[a||0]||""};c.translated=function(a){if(arguments.length)return!!this.translation(a);
|
| 75 |
-
for(a=0;a<this.msg.length;a++)if(!this.msg[a])return!1;return!0};c.comment=function(a){if(null==a)return this.cmt;this.cmt=a||"";return this};c.notes=function(a){if(null==a)return this.xcmt;this.xcmt=a||"";return this};c.refs=function(a){if(null==a)return this.ref;this.ref=a||"";return this};c.format=function(a){if(null==a)return this.fmt;this.fmt=a;return this};c.context=function(a){if(null==a)return this.ctx||"";this.ctx=a||"";return this};c.toString=c.toText=function(){return this.src.concat(this.msg,
|
| 76 |
-
[this.id,this.ctx]).join(" ")};c.weight=function(){var a=0;this.translation()||(a+=2);this.fuzzy()&&(a+=1);return a};c.equals=function(a){return this===a||this.hash()===a.hash()};c.hash=function(){return this.id};c.normalize=function(){for(var a=this.msg.length;0!==a--;)this.msg[a]=this.src[a]||""};c.disabled=function(a){return!!(this.lck||[])[a||0]};c.disable=function(a){(this.lck||(this.lck=[]))[a||0]=!0;return this};c.saved=function(a){var c=this.drt;if(!c)return!0;if(null!=a)return!c[a];for(a=
|
| 77 |
-
c.length;0!==a--;)if(c[a])return!1;return!0};c.unsave=function(a){(this.drt||(this.drt=[]))[a||0]=!0;return this};c.save=function(a){var c=this.drt;null==a?this.drt=null:c[a]=!1;return this};c=null;return d}({},z,A));p.register("$3",function(d,c,e){function h(a){return{"Project-Id-Version":"PACKAGE VERSION","Report-Msgid-Bugs-To":"","POT-Creation-Date":a||"","POT-Revision-Date":a||"","PO-Revision-Date":a||"","Last-Translator":"","Language-Team":"",Language:"","Plural-Forms":"","MIME-Version":"1.0",
|
| 78 |
-
"Content-Type":"text/plain; charset=UTF-8","Content-Transfer-Encoding":"8bit","X-Poedit-SourceCharset":"UTF-8"}}function a(a,b){var c=a||"";b&&(c+="\x00"+b);return c}function f(){return p.require("$16","collection.js").init()}function b(a){return a.replace(/(["\\])/g,"\\$1").replace(/\n/g,"\\n")}function k(a){this.head={};this.headers(h(this.now()));this.locale(a);this.length=0;this.rows=f()}function m(a,b){this.src=[a||""];this.msg=[b||""]}d.create=function(a){return new k(a)};var l=d.quote=function(a){if(!a)return'""';
|
| 79 |
-
for(var c=a.split(/(?:\r\n|\n|\r)/g),d=c.length-1,e=[],f=-1,r;++f<c.length;){a=c[f];for(d&&d!==f&&(a+="\n");a&&a.charAt(77);){for(r=77;--r;)if(-1!==" \n\r.?!,;:-".indexOf(a.charAt(r))){r++;break}r||(r=77);e.push(b(a.substr(0,r)));a=a.substr(r)}a&&e.push(b(a))}e[1]&&e.unshift("");return'"'+e.join('"\n"')+'"'},t=d.wrap=function(a,b,c){if(0!==c){null==c&&(c=79);for(var d=c+1,e=a.split(/(?:\r\n|\n|\r)/g),f=[],l=-1,k;++l<e.length;){for(a=e[l];a&&a.charAt(d);){for(k=c;--k;)if(-1!==" \n\r.?!,;:-".indexOf(a.charAt(k))){k++;
|
| 80 |
-
break}k||(k=d);f.push(a.substr(0,k));a=a.substr(k)}a&&f.push(a)}a=f}else a=a.split(/(?:\r\n|\n|\r)/g);return b+a.join("\n"+b)};c=p.require("$17","messages.js").extend(k);c.now=function(){return(new Date).toString()};c.header=function(a,b){if(null==b)return this.headers()[a]||"";this.head[a]=b||"";return this};c.headers=function(a){var b;if(null!=a){for(b in a)this.head[b]=a[b];return this}var c=this.locale(),d=this.now();a={};for(b in this.head)a[b]=String(this.head[b]);c?(a.Language=c.label||"Unknown locale",
|
| 81 |
-
a["Plural-Forms"]="nplurals="+(c.nplurals||"2")+"; plural="+(c.pluraleq||"n!=1"),a["X-Loco-Target-Locale"]=(c.lang||"en")+"_"+(c.region||"GB"),a["PO-Revision-Date"]=d,delete a["POT-Revision-Date"]):(a.Language="",a["Plural-Forms"]="nplurals=INTEGER; plural=EXPRESSION",a["POT-Revision-Date"]=d,a["PO-Revision-Date"]="YEAR-MO-DA HO:MI+ZONE");a["X-Generator"]="Loco - https://localise.biz/";return a};c.locale=function(a){if(null==a)return this.loc;this.loc=a||{lang:"en",region:"GB",plurals:["one","other"],
|
| 82 |
-
pluraleg:[1,0],nplurals:2,pluraleq:"n!=1",label:"English"};this.loc.toString=function(){return this.lang+"_"+this.region};return this};c.get=function(b,c){var d=a(b,c);return this.rows.get(d)};c.add=function(a,b){a instanceof m||(a=new m(a));b&&a.context(b);var c=a.hash();if(this.rows.get(c))throw Error("Duplicate message at index "+this.indexOf(a));a.idx=this.rows.add(c,a);this.length=this.rows.length;return a};c.load=function(a){for(var b=-1,c,d,e,f,l,k=[],h=[],q=[],t=[];++b<a.length;)if(c=a[b],
|
| 83 |
-
null==c.parent){if(d=c.source||c.id,e=c.context,d||e)f=new m(d,c.target||""),f._id=c._id,e&&f.context(e),c.flag&&f.flag(c.flag,0),c.comment&&f.comment(c.comment),c.notes&&f.notes(c.notes),c.refs&&f.refs(c.refs),null!==c.format&&f.format(c.format),c.message=f,f.translation()?f.fuzzy()?q.push(f):h.push(f):t.push(f)}else k.push(c);for(b=-1;++b<k.length;)try{c=k[b];d=c.source||c.id;f=a[c.parent]&&a[c.parent].message;if(!f)throw Error("parent missing for plural "+d);l=c.plural;1===l&&f.plural(d);c.flag&&
|
| 84 |
-
f.flag(c.flag,l);f.translate(c.target||"",l)}catch(C){}return this._add(t,q,h)};c._add=function(a,b,c){c=[a,b,c];for(i=0;3>i;i++)for(b=c[i],a=-1;++a<b.length;)try{this.add(b[a])}catch(d){}return this};c.merge=function(a){var b,c=this.rows,d=[],e=[],l=[],k={add:[],del:[]};a=a.rows;this.rows.each(function(b,c){a.get(b)||k.del.push(c)});a.each(function(a,g){try{(b=c.get(a))?(b.ref=g.ref,b.fmt=g.fmt):(b=g,k.add.push(b)),b.translation()?b.fuzzy()?e.push(b):l.push(b):d.push(b)}catch(q){}});this.rows=f();
|
| 85 |
-
this._add(d,e,l);return k};c.toString=function(){var a,b=[],c=[],d=this.headers(),e=!this.loc;for(a in d)c.push(a+": "+d[a]);c=new m("",c.join("\n"));e&&(c.comment("Loco Gettext template"),c.fuzzy(0,!0));b.push(c.toString());b.push("");this.rows.each(function(a,c){a&&(b.push(c.toString(e)),b.push(""))});return b.join("\n")};c=p.require("$18","message.js").extend(m);c.hash=function(){return a(this.source(),this.context())};c.source=function(a,b){if(null==a)return this.src[0];this.src[0]=a;null!=b&&
|
| 86 |
-
this.plural(b);return this};c.toString=function(a){var b,c=[],d;(d=this.cmt)&&c.push(t(d,"# ",0));(d=this.xcmt)&&c.push(t(d,"#. ",0));b=this.ref;if(d=this._id)b+=(b?" ":"")+"loco:"+d;b&&/\S/.test(b)&&c.push(t(b,"#: ",79));!a&&this.fuzzy()&&c.push("#, fuzzy");(d=this.fmt)?c.push("#, "+d+"-format"):null!=d&&c.push("#, no-c-format");(d=this.ctx)&&c.push("msgctxt "+l(d));c.push("msgid "+l(this.src[0]));if(null==this.src[1])c.push("msgstr "+l(a?"":this.msg[0]));else for(b=-1,c.push("msgid_plural "+l(this.src[1]));++b<
|
| 87 |
-
this.msg.length;)c.push("msgstr["+b+"] "+l(a?"":this.msg[b]));return c.join("\n")};c.compare=function(a,b){var c=this.weight(),d=a.weight();if(c>d)return 1;if(c<d)return-1;if(b){c=this.hash().toLowerCase();d=a.hash().toLowerCase();if(c<d)return 1;if(c>d)return-1}return 0};c=c=null;return d}({},z,A));p.register("$19",function(d,c,e){function h(a){return Number(1!=a)}function a(a){var b=0,c,d=[].slice.call(arguments,1);return a.replace(/%(s|u|%)/g,function(a,e){if("%"===e)return"%";c=d[b++];return String(c)||
|
| 88 |
-
""})}d.create=function(c,b){function d(a){return c[a]||a||""}b||(b=h);return{s:a,_:d,_n:function(a,d,e){var g=c[a];g instanceof Object&&(g=g[pluralForms[b(e)]||"one"]);return g||(1===e?a:d)||a||""},_s:function(b){arguments[0]=d(b);return a.apply(null,arguments)}}};return d}({},z,A));p.register("$30",function(d,c,e){var h=c.requestAnimationFrame,a=c.cancelAnimationFrame,f=0;if(!h||!a)for(var b in{ms:1,moz:1,webkit:1,o:1})if(h=c[b+"RequestAnimationFrame"])if(a=c[b+"CancelAnimationFrame"]||c[b+"CancelRequestAnimationFrame"])break;
|
| 89 |
-
h&&a||(h=function(a){var b=k();timeToCall=Math.max(0,16-(b-f));nextTime=b+timeToCall;timerId=c.setTimeout(function(){a(nextTime)},timeToCall);f=nextTime;return timerId},a=function(a){clearTimeout(a)});var k=Date.now||function(){return(new Date).getTime()};d.loop=function(b,c){function d(){f=h(d,c);b(e++)}var e=0,f;d();return{stop:function(){f&&a(f);f=null}}};return d}({},z,A));p.register("$26",function(d,c,e){function h(a,c,d,e){if(b){var f=d;d=function(a){if((a.MSPOINTER_TYPE_TOUCH||"touch")===a.pointerType)return f(a)}}a.addEventListener(c,
|
| 90 |
-
d,e);return{unbind:function(){a.removeEventListener(c,d,e)}}}function a(a){a.preventDefault();a.stopPropagation();return!1}var f,b=!!c.navigator.msPointerEnabled,k=b?"MSPointerDown":"touchstart",m=b?"MSPointerMove":"touchmove",l=b?"MSPointerUp":"touchend";d.ok=function(a){null==f&&(f="function"===typeof e.body.addEventListener);f&&a&&a(d);return f};d.ms=function(){return b};d.dragger=function(b,c){function d(a){b.addEventListener(a,f[a],!1)}function e(a){b.removeEventListener(a,f[a],!1)}var f={};
|
| 91 |
-
f[k]=function(a){t(a,function(b,d){d.type=k;c(a,d,g)});d(m);d(l);return!0};f[l]=function(a){e(m);e(l);t(a,function(b,d){d.type=l;c(a,d,g)});return!0};f[m]=function(b){t(b,function(a,d){d.type=m;c(b,d,g)});return a(b)};d(k);var g={kill:function(){e(k);e(m);e(l);b=g=c=null}};return g};d.swiper=function(c,d,e){function f(a){c.addEventListener(a,G[a],!1)}function r(a){c.removeEventListener(a,G[a],!1)}function h(){E&&E.stop();E=null}var E,s,q,G={},C=[],n=[],S=[];G[k]=function(a){s=!1;h();var b=g();t(a,
|
| 92 |
-
function(a,c){C[a]=b;n[a]=c.clientX;S[a]=c.clientY});q=c.scrollLeft;return!0};G[l]=function(a){t(a,function(a,b){var c=g()-C[a],e=n[a]-b.clientX,c=Math.abs(e)/c;d(c,e?0>e?-1:1:0)});q=null;return!0};G[m]=function(b){var d,e;null==q||t(b,function(a,b){d=n[a]-b.clientX;e=S[a]-b.clientY});if(e&&Math.abs(e)>Math.abs(d))return s=!0;d&&(s=!0,c.scrollLeft=Math.max(0,q+d));return a(b)};if(!b||e)f(k),f(m),f(l),b&&(c.className+=" mstouch");return{kill:function(){r(k);r(m);r(l);h()},swiped:function(){return s},
|
| 93 |
-
ms:function(){return b},snap:function(a){b&&!e&&(c.style["-ms-scroll-snap-points-x"]="snapInterval(0px,"+a+"px)",c.style["-ms-scroll-snap-type"]="mandatory",c.style["-ms-scroll-chaining"]="none")},scroll:function(a,b,d){h();var e=c.scrollLeft,f=a>e?1:-1,q=Math[1===f?"min":"max"],g=Math.round(16*b*f);return E=p.require("$30","fps.js").loop(function(b){b&&(e=Math.max(0,q(a,e+g)),c.scrollLeft=e,a===e&&(h(),d&&d(e)))},c)}}};d.start=function(a,b){return h(a,k,b,!1)};d.move=function(a,b){return h(a,m,b,
|
| 94 |
-
!1)};d.end=function(a,b){return h(a,l,b,!1)};var t=d.each=function(a,c){if(b)(a.MSPOINTER_TYPE_TOUCH||"touch")===a.pointerType&&c(0,a);else for(var d=-1,e=(a.originalEvent||a).changedTouches||[];++d<e.length;)c(d,e[d])},g=Date.now||function(){return(new Date).getTime()};return d}({},z,A));p.register("$31",function(d,c,n){d.init=function(c,a){function d(c){if(b!==c){u.text(String(c));var e=a===c,f=e||c<a;changedState=e?2:f?1:3;if(changedState!==k){var g=n;e&&(g+=" maxed");f||(g+=" invalid");l.attr("class",
|
| 95 |
-
g);k=changedState}b=c}}var b,k,m=p.require("$2","html.js"),l=e(c.parent()).on("changing",function(a,b){d(b.length)}),t=e(m.el("span","total")).text(String(a)),g=e(m.el("span","separ")).text("/"),u=e(m.el("span","count")),n=l.attr("class")||"";e(m.el("div","counter")).append(u).append(g).append(t).appendTo(l);d(c.val().length);m=t=g=null};return d}({},z,A));p.register("$27",function(d,c,n){function h(a){function c(){var e=a.value;e!==l&&(l=e,d.trigger("changing",[e]))}var d=e(a),l=a.value,h;d.blur(function(){d.off("input paste");
|
| 96 |
-
c();f=null;h!==l&&d.trigger("changed",[l]);d.trigger("editBlur");return!0}).focus(function(e){f=a;h=l;d.on("input paste",c);d.trigger("editFocus");return!0});return{kill:function(){d.off("input paste blur focus")},fire:function(){l=null;c()}}}function a(a){this.e=a}var f;d.init=function(b){var c=new a(b);b.disabled?c.disable():c.enable();(b=c.attr("lang"))&&c.locale(b);(b=c.attr("maxlength"))&&c.max(Number(b));return c};d.create=function(b,c){var d=n.createElement("textarea"),d=new a(d);c?d.enable():
|
| 97 |
-
d.disable();return d.attr("wrap","virtual")};TextAreaPrototype=a.prototype;TextAreaPrototype.val=function(a){if(null==a)return this.e.value;this.e.value=a;return this};TextAreaPrototype.fire=function(){this.l&&this.l.fire();return this};TextAreaPrototype.focus=function(){return e(this.e).focus()};TextAreaPrototype.focused=function(){return f&&f===this.el};TextAreaPrototype.parent=function(){return this.e.parentNode};TextAreaPrototype.attr=function(a,c){var d=this.e;if(1===arguments.length)return d.getAttribute(a);
|
| 98 |
-
null==c?d.removeAttribute(a):d.setAttribute(a,c);return this};TextAreaPrototype.editable=function(){return!!this.l};TextAreaPrototype.enable=function(){var a=this.e;a.removeAttribute("readonly");a.removeAttribute("disabled");this.listen();return this};TextAreaPrototype.disable=function(){this.e.setAttribute("disabled",!0);this.unlisten();return this};TextAreaPrototype.listen=function(){var a=this.l;a&&a.kill();this.l=h(this.e);return this};TextAreaPrototype.unlisten=function(){this.l&&this.l.kill();
|
| 99 |
-
this.l=null;return this};TextAreaPrototype.locale=function(a){if(null==a)return this.loc;this.loc=a=String(a);this.attr("lang",a);return this.rtl(-1!=="ar,ps,he,ur,ckb".indexOf(a.substr(0,2)))};TextAreaPrototype.rtl=function(a){this.attr("dir",a?"RTL":"LTR");return this};TextAreaPrototype.max=function(a){if(0===arguments.length)return this.n||0;this.n=a;p.require("$31","counter.js").init(this,a);return this};TextAreaPrototype=null;return d}({},z,A));p.register("$28",function(d,c,n){function h(a){return function(){a.redraw();
|
| 100 |
-
return this}}function a(a){return function(b){var c=b.target.$r;if(null==c)return!0;a.select(c);b.stopPropagation();b.preventDefault();return!1}}function f(a){var b=a.p.style;a=null;return function(){b.backfaceVisibility="hidden";return!0}}function b(a){var b=a.p.style;a=null;return function(){b.backfaceVisibility="";return!0}}function k(a){return function(b){var c;c=b.keyCode;if(40===c)c=1;else if(38===c)c=-1;else return!0;if(b.shiftKey||b.ctrlKey||b.metaKey||b.altKey)return!0;a.selectNext(c);b.stopPropagation();
|
| 101 |
-
b.preventDefault();return!1}}function m(a){this.w=a}d.create=function(a){return new m(a)};c=m.prototype;c.init=function(c){function d(a){var b=n.createElement("div");a&&b.setAttribute("class",a);return b}var g=this.w,m=g.id,p=g.splity(m+"-thead",m+"-tbody"),w=p[0],p=p[1],v=[],r=[],F=[];w.css.push("wg-thead");p.css.push("wg-tbody");c.eachCol(function(a,b){v.push(m+"-col"+a);F.push(b)});for(var E=-1,s=v.length,q=d("wg-cols"),G=w.splitx.apply(w,v);++E<s;)G[E].header(F[E]),q.appendChild(r[E]=d());var C=
|
| 102 |
-
[],aa=n.createElement("div");c.eachRow(function(a,b,c){for(var d,e=[],f=-1,q=b.length;++f<q;)d=aa.cloneNode(!1),d.textContent=b[f]||"\u00a0",c&&d.setAttribute("class",c),e[f]=d,d.$r=a;C[a]=e});this.d=c;this.c=r;this.t=C;this._=q;this.p=p.body;w.redraw=h(this);c=p.fixed=G[0].bodyY()||20;g.lock().resize(c,p);g.css.push("is-table");g.restyle();this.render();e(q).attr("tabindex","-1").on("keydown",k(this)).on("mousedown",a(this)).on("mouseenter",f(this)).on("mouseleave",b(this));return this};c.redraw=
|
| 103 |
-
function(){var a=-1,b=this.c,c=b.length,d=this.w,e=d.cells[0],f=e.body.childNodes;for(d.redraw.call(e);++a<c;)b[a].style.width=f[a].style.width};c.visible=function(a){if(this.f){var b;a=this.t[a];return(a&&(b=a[0])&&b.parentNode)===this.c[0]}return!0};c.selected=function(){return this.r};c.tr=function(a){return this.t[a]};c.td=function(a,b){return(this.t[a]||[])[b]};c.scroll=function(a){var b=this._;if(0==arguments.length)return b&&b.scrollTop||0;b.scrollTop=a||0;return this};c.focus=function(){e(this._).focus();
|
| 104 |
-
return this};c.next=function(a,b,c){null==c&&(c=this.r);for(var d=c,e=this.t.length;c!==(d+=a);)if(0<=d&&e>d){if(this.visible(d))break}else if(b&&e)d=1===a?-1:e,b=!1;else{d=null;break}return d};c.selectNext=function(a,b,c){a=this.next(a,b);null!=a&&this.r!==a&&this.select(a,c);return this};c.deselect=function(a){var b=this.r;null!=b&&(e(this.t[b]).removeClass("selected"),this.r=null,this.w.fire("wgRowDeselect",[b,a]));return this};c.select=function(a,b){var c=this.visible(a);this.deselect(c);if(!c)return!1;
|
| 105 |
-
var c=this.t[a],d=this.w.cells[1],f=this.d.getRow(a);if(!c)return!1;e(c).addClass("selected");this.r=a;b||this.focus();d.scrollTo(c[0],!0);this.w.fire("wgRowSelect",[a,f]);return this};c.clear=function(){var a=this._,b=this.c,c,d=b.length;a.parentNode.removeChild(a);for(c=0;c<d;c++)b[c]=a.appendChild(a.removeChild(b[c]).cloneNode(!1));return this};c.render=function(){var a=this.f,b=this._,c=this.r,d=this._r,e=this.t,f,k=this.c,r,h,m=e.length,s,q=m&&e[0].length||0;if(a)for(m=a.length,h=0;h<m;h++)for(r=
|
| 106 |
-
a[h],f=e[r],s=0;s<q;s++)k[s].appendChild(f[s]);else for(r=0;r<m;r++)for(f=e[r],s=0;s<q;s++)k[s].appendChild(f[s]);this.p.appendChild(b);null==c?null!=d&&this.visible(d)&&(delete this._r,this.select(d,!0)):a&&!this.visible(c)?(this.deselect(),this._r=c):this.w.cells[1].scrollTo(e[c][0],!0);return this};c.promote=function(){this.p.style.backfaceVisibility="hidden";return this};c.demote=function(){this.p.style.backfaceVisibility="";return this};c.unfilter=function(){this.f&&(this.f=null,this.clear().render());
|
| 107 |
-
return this};c.filter=function(a){this.f=a;return this.clear().render()};c=null;return d}({},z,A));p.register("$21",function(d,c,n){function h(a,b){var c=a.id,d=c&&y[c],e=d&&d.parent();if(!d||!e)return null;var f=e.dir===u,c=f?"X":"Y",g="page"+c,f=f?k:m,h=f(e.el),c=b["offset"+c],l=e.el,n=l.className;null==c&&(c=b[g]-f(a));c&&(h+=c);l.className=n+" is-resizing";return{done:function(){l.className=n},move:function(a){e.resize(a[g]-h,d);return!0}}}function a(a,c){function d(){e(n).off("mousemove",f);
|
| 108 |
-
w&&(w.done(),w=null);return!0}function f(a){w?w.move(a):d();return!0}if(w)return!0;w=h(a.target,a);if(!w)return!0;e(n).one("mouseup",d).on("mousemove",f);return b(a)}function f(a,b){var c=b.type;"touchmove"===c?w&&w.move(b):"touchstart"===c?w=h(a.target,b):"touchend"===c&&w&&(w.done(),w=null)}function b(a){a.stopPropagation();a.preventDefault();return!1}function k(a,b){b||(b=n.body);for(var c=a.offsetLeft||0;(a=a.offsetParent)&&a!==b;)c+=a.offsetLeft||0;return c}function m(a,b){b||(b=n.body);for(var c=
|
| 109 |
-
a.offsetTop||0;(a=a.offsetParent)&&a!==b;)c+=a.offsetTop||0;return c}function l(a,b){var c=e(b).on("editFocus",function(b){c.trigger("wgFocus",[a])}).on("editBlur",function(a){c.trigger("wgBlur")})}function t(a){var b=this.id=a.id;this.el=a;this.pos=this.index=0;this.css=["wg-cell"];y[b]=this;this.clear()}var g=p.require("$2","html.js"),u=1,y={},w=!1;d.init=function(b){var c=new t(b);c.css.push("wg-root");c.redraw();p.require("$26","touch.js").ok(function(a){a.dragger(b,f)});e(b).mousedown(a);return c};
|
| 110 |
-
c=t.prototype;c.fire=function(a,b){var c=e.Event(a);c.cell=this;e(this.el).trigger(c,b);return this};c.each=function(a){for(var b=-1,c=this.cells,d=this.length;++b<d;)a(b,c[b]);return this};c.on=function(){return this.$("on",arguments)};c.off=function(){return this.$("off",arguments)};c.find=function(a){return e(this.el).find(a)};c.$=function(a,b){e.fn[a].apply(e(this.el),b);return this};c.parent=function(){return this.pid&&y[this.pid]};c.splitx=function(){return this._split(u,arguments)};c.splity=
|
| 111 |
-
function(){return this._split(2,arguments)};c._split=function(a,b){this.length&&this.clear();for(var c=-1,d,e=b.length,f=1/e,k=0;++c<e;){d=g.el();this.body.appendChild(d);for(var h=d,l=b[c],m=l,n=1;y[l];)l=m+"-"+ ++n;h.id=l;d=new t(d);d.index=c;d.pid=this.id;d.pos=k;k+=f;this.cells.push(d);this.length++}this.dir=a;this.redraw();return this.cells};c.destroy=function(){this.clear();delete y[this.id];var a=this.el;a.innerHTML="";e(a).off();return this};c.exists=function(){return this===y[this.id]};c.clear=
|
| 112 |
-
function(){for(var a=this.el,b=this.lang,c=this.cells,d=this.field,f=this.body,q=this.nav,k=this.length||0;0!==k--;)delete y[c[k].destroy().id];this.cells=[];this.length=0;q&&(a.removeChild(q),this.nav=null);f&&(d&&(g.ie()&&e(f).triggerHandler("blur"),d.unlisten(),this.field=null),this.table&&(this.table=null),a.removeChild(f));this.body=a.appendChild(g.el("","wg-body"));b&&this.locale(b);return this};c.resize=function(a,b){if(!b&&(b=this.cells[1],!b))return;var c=b.index,d=this.cells;this.parent();
|
| 113 |
-
var f=e(this.el)[this.dir===u?"width":"height"](),q=d[c+1],c=d[c-1];pad=(b.body||b.el.firstChild).offsetTop||0;max=(q?q.pos*f:f)-pad;min=c?c.pos*f:0;b.pos=Math.min(max,Math.max(min,a))/f;this.redraw();return this};c.distribute=function(){for(var a,b=0,c=this.cells,d=arguments.length;b<d;)a=arguments[b],c[++b].pos=Math.max(0,Math.min(1,a));this.redraw();return this};c.distribution=function(){for(var a=[],b=0,c=this.cells,d=c.length-1;b<d;)a[b]=c[++b].pos;return a};c.restyle=function(){var a=this.css.concat();
|
| 114 |
-
0===this.index?a.push("first"):a.push("not-first");this.dir&&(a.push("wg-split"),2===this.dir?a.push("wg-split-y"):a.push("wg-split-x"));this.t&&a.push("has-title");this.nav&&a.push("has-nav");null!=this.field&&(a.push("is-field"),this.field?a.push("is-editable"):a.push("is-readonly"));a=a.join(" ");a!==this._css&&(this._css=this.el.className=a);return this};c.redraw=function(){this.restyle();var a=this.el,b=this.body;if(b){var c=a.clientHeight||0,d=b.offsetTop||0;d<c&&(c-=d);b.style.height=String(c)+
|
| 115 |
-
"px"}for(var b=this.length,f=1,q=this.nav,g=2===this.dir?"height":"width";0!==b--;)c=this.cells[b],q?d=1:(c.fixed&&(c.pos=c.fixed/e(a)[g]()),d=f-c.pos,f=c.pos),c.el.style[g]=String(100*d)+"%",c.redraw();return this};c.contents=function(a){var b=this.el,c=this.lang,d=this.body;if(null==a)return d.innerHTML;this.length?this.clear():d&&(b.removeChild(d),d=null);d||(d=this.body=b.appendChild(g.el("","wg-content")),c&&this.locale(c));"string"===typeof a?e(d)._html(a):a&&this.append(a);this.redraw();return this};
|
| 116 |
-
c.textarea=function(a,b){var c=this.field;b?c?a!==c.val()&&this.field.val(a):(c=g.el("textarea","wg-field"),c.value=a,c.name=this.id,this.contents(c),this.field=p.require("$27","basic.js").init(c).attr("wrap","virtual"),this.restyle(),l(this,c)):(this.contents(g.txt(a)),c&&c.unlisten(),this.field=!1,this.restyle());return this};c.locale=function(a){a=String(a);var b=a.split("_"),c=b[0],d=this.body;b[1]||(a=c);d&&(d.setAttribute("lang",a.replace("_","-")),d.setAttribute("dir",-1!=="ar,ps,he,ur,ckb".indexOf(c)?
|
| 117 |
-
"RTL":"LTR"));this.lang=a;return this};c.editable=function(){var a=this.field;if(!a||!a.editable())for(var b=-1,c=this.length;++b<c&&!(a=this.cells[b].editable()););return a};c.append=function(a){a&&(a.nodeType?g.init(this.body.appendChild(a)):g.init(e(a).appendTo(this.body)));return this};c.prepend=function(a){var b=this.body;if(a.nodeType){var c=b.firstChild;g.init(c?b.insertBefore(a,c):b.appendChild(a))}else g.init(e(a).prependTo(b));return this};c.header=function(a,b){if(0===arguments.length)return this.el.getElementsByTagName("h2")[0];
|
| 118 |
-
var c=["wg-title"];b&&c.push(b);this.t=g.txt(a||"");this.el.insertBefore(g.el("h2",c.join(" ")),this.body).appendChild(this.t);this.redraw();return this};c.title=function(a){var b=this.t;if(b)return b.nodeValue=a||"",b;this.header(a);return this.t};c.titled=function(){var a=this.t;return a&&a.nodeValue};c.bodyY=function(){return m(this.body,this.el)};c.tabulate=function(a){return this.table=p.require("$28","wgtable.js").create(this).init(a)};c.lock=function(){this.body.className+=" locked";return this};
|
| 119 |
-
c.scrollTo=function(a,b){var c,d=this.body;c=d.scrollTop;var f=m(a,d);if(c>f)c=f;else{var q=d.clientHeight,f=f+e(a).outerHeight();if(q+c<f)c=f-q;else return}b?d.scrollTop=c:e(d).stop(!0).animate({scrollTop:c},250)};c.navigize=function(a,c){function d(a){var b=k[a],c=l[a],f=e(b.el).show();c.addClass("active");h=a;m.data("idx",a);b.fire("wgTabSelect",[a]);return f}var f=this,k=f.cells,q=f.nav,h,l=[];q&&f.el.removeChild(q);var q=f.nav=f.el.insertBefore(g.el("nav","wg-tabs"),f.body),m=e(q).on("click",
|
| 120 |
-
function(a){var c=e(a.target).data("idx");if(null==c)return!0;if(null!=h){var q=l[h];e(k[h].el).hide();q.removeClass("active")}d(c);f.redraw();return b(a)});null==c&&(c=m.data("idx")||0);f.each(function(b,c){l[b]=e('<a href="#'+c.id+'"></a>').data("idx",b).text(a[b]).appendTo(m);c.pos=0;e(c.el).hide()});d(k[c]?c:0);f.lock();f.redraw();return f};c.navigated=function(){var a=this.nav;if(a)return e(a).data("idx")};c=null;return d}({},z,A));p.register("$4",function(d,c,n){function h(a){var b=[];a&&(a.saved()||
|
| 121 |
-
b.push("po-unsaved"),a.fuzzy()?b.push("po-fuzzy"):a.flagged()&&b.push("po-flagged"),a.translation()||b.push("po-empty"),a.comment()&&b.push("po-comment"));return b.join(" ")}function a(a,b,c){b=e(a.title(b).parentNode);var d=b.find("span").hide();c&&(a.locale(c),a=c.icon,c=c.region,a||c&&"ZZ"!==c)&&(d.length||(d=e("<span></span>").prependTo(b)),d.attr("class",a||"flag flag-"+c.toLowerCase()).show())}function f(){}var b="poUpdate",k="changing",m="changed",l=0,t=1,g=2,u=3,y=4,w=5,v=/^[ \t\n\r]/,r,z;
|
| 122 |
-
d.extend=function(a){return a.prototype=new f};d.localise=function(a,b){return r=p.require("$19","t.js").create(a||{},b)};var A=function(){var a=n.createElement("p");return function(b){a.innerHTML=b;return a.textContent}}(),s=f.prototype=p.require("$20","abstract.js").init(["getListColumns","getListHeadings","getListEntry"],["editable","t"]);s.init=function(){this.localise();this.editable={source:!0,target:!0};return this};s.localise=function(a){this.t=a||(a=r||d.localise());var b=a._,c=this.labels=
|
| 123 |
-
[];c[l]=b("Source text")+":";c[u]=b("Translation")+":";c[y]=b("%s translation")+":";c[t]=b("Single")+":";c[g]=b("Plural")+":";c[w]=b("Context")+":";return a};s.setRootCell=function(a){function b(){d.redraw(!0);return!0}var d=p.require("$21","wingrid.js").init(a);e(c).on("resize",b);e(a).on("wgFocus wgBlur",function(a,b){z=b});this.destroy=function(){d.destroy();e(c).off("resize",b)};this.rootDiv=a;return d};s.on=function(a,b){return e(this.rootDiv).on(a,b)};s.setListCell=function(a){var b=this;b.listCell=
|
| 124 |
-
a;a.on("wgRowSelect",function(a,c){b.loadMessage(b.po.row(c));return!0}).on("wgRowDeselect",function(a,c,d){d||b.loadNothing();return!0})};s.setSourceCell=function(a){this.sourceCell=a;var b=a.find("p.notes");b.length||(b=e('<p class="notes"></p>').insertAfter(a.header()).hide());this.notesPara=b};s.next=function(a,b,c){for(var d=this.listTable,e=d.selected(),f=e,g,k=this.po;null!=(e=d.next(a,c,e));){if(f===e){e=null;break}if(b&&(g=k.row(e),g.translated(0)))continue;break}null!=e&&d.select(e,!0);
|
| 125 |
-
return e};s.current=function(a){if(null==a)return this.active;a?this.loadMessage(a):this.unloadActive();return this};s.getTargetEditable=function(){return this.editable.target&&this.targetCell&&this.targetCell.editable()};s.getSourceEditable=function(){return this.editable.source&&this.sourceCell&&this.sourceCell.editable()};s.getContextEditable=function(){return this.editable.context&&this.contextCell&&this.contextCell.editable()};s.getFirstEditable=function(){return this.getTargetEditable()||this.getSourceEditable()||
|
| 126 |
-
this.getContextEditable()};s.searchable=function(a){a&&(this.dict=a,this.po&&this.rebuildSearch());return this.dict&&!0};s.rebuildSearch=function(){var a=this.dict;a.clear();this.po.each(function(b,c,d){a.add(d,c.toText())});this.lastSearch="";this.lastFound=this.po.length};s.filtered=function(){return this.lastSearch||""};s.filter=function(a,b){var c,d={},e=this.listTable,f=this.lastFound,g=this.lastSearch;if(a){if(g===a)return f||0;if(g&&!f&&0===a.indexOf(g))return 0;c=this.dict.find(a,d);d.words.length||
|
| 127 |
-
(a="")}g=this.lastSearch=a;f=this.lastFound=c?c.length:this.po.length;c?e.filter(c):e.unfilter();b||this.fire("poFilter",[g,f]);return f};s.unsave=function(a,b){var c=!1;if(a=a||self.active){if(c=a.saved(b))this.dirty=!0,a.unsave(b),this.fire("poUnsaved",[a,b]);this.markUnsaved(a)}return c};s.markUnsaved=function(a){var b=this.po.indexOf(a),b=this.listTable.tr(b),c=b[0].className;changedStyle=c.replace(/(?:^| +)po-[a-z]+/g,"")+" "+h(a);changedStyle!==c&&e(b).attr("class",changedStyle)};s.save=function(a){var b=
|
| 128 |
-
this.po;if(this.dirty||a)b.each(function(a,b){b.save()}),this.listCell.find("div.po-unsaved").removeClass("po-unsaved"),this.dirty=!1,this.fire("poSave");return b};s.fire=function(a,b){var c=this.on;if(c&&c[a]&&(c=c[a].apply(this,b||[]),!1===c))return!1;c=e.Event(a);e(this.rootDiv).trigger(c,b);return!c.isDefaultPrevented()};s.reload=function(){var a=this,b=a.listCell,c=a.listTable,d=a.po,e=d&&d.length||0;if(d&&d.row){a.lastSearch&&(a.lastSearch="",a.lastFound=e,a.fire("poFilter",[a.lastSearch,a.lastFound]));
|
| 129 |
-
var f=c&&c.scroll(),c=a.listTable=b.tabulate({length:e,getRow:function(b){return a.getListEntry(d.row(b))},getCss:function(b){return a.getListEntry(d.row(b))},eachCol:function(b){for(var c=-1,d=a.getListHeadings(),e=d.length;++c<e;)b(c,d[c])},eachRow:function(b){var c=0;d.each(function(d,e){b(c++,a.getListEntry(e),h(e))})}});f&&c.scroll(f);a.targetLocale=a.po.locale();a.fire("poLoad");return!!a.po.length}b&&b.clear().header("Error").contents("Invalid messages list")};s.load=function(a,b){this.po=
|
| 130 |
-
a;this.dict&&this.rebuildSearch();this.reload()&&-1!==b&&this.listTable.select(b||0)};s.loadMessage=function(c){function d(){var e,f=s,n=s.id,f=T[l];E&&(N?E.text(N).show():E.text("").hide());s.titled()!==f&&a(s,f,h.sourceLocale);J?(e=s.splity(n+"-singular",n+"-plural"),f=e[0],e=e[1],f.header(T[t]).textarea(K,H),e.header(T[g]).textarea(J,H),s.lock()):s.textarea(K,H);H&&s.on(k,function(a,b){J&&a.target.name===n+"-plural"?c.plural(b):(c.source(b),h.updateListCell(c,"source"));h.unsave(c,r)}).on(m,function(a){J&&
|
| 131 |
-
a.target.name===n+"-plural"||h.po.reIndex(c);h.dict&&h.rebuildSearch();h.fire(b,[c])})}function e(d,f){var g=d.label,g=g&&-1===g.indexOf("Unknown")?U(T[y],g):T[u];v.titled()!==g&&a(v,g,d);if(c.pluralized()){var l=[],n=d.plurals||["One","Other"],t=p.require("$16","collection.js").init();for(c.each(function(a,b,c){if(c||n[a])l.push(n[a]||"Form "+a),t.add("plural-"+a,c)});(g=l.length)<d.nplurals;)l.push(n[g]||"Form "+t.length),t.add("plural-"+g,c.translation(g));children=v.splitx.apply(v,t.keys);v.each(function(a,
|
| 132 |
-
b){var d=D&&!c.disabled(a);b.textarea(t[a],d)});v.navigize(l,f||null).on("wgTabSelect",function(a,b){var c=D&&a.cell.editable();c&&c.focus();f=b;h.fire("poTab",[b])})}else D=D&&!c.disabled(0),v.textarea(c.translation(),D);D&&v.on(k,function(a,b){c.translate(b,f);0===f&&h.updateListCell(c,"target");c.fuzzy(f)?h.fuzzy(!1,c,f):h.unsave(c,f)}).on(m,function(a){h.dict&&h.rebuildSearch();h.fire(b,[c])})}function f(){a(A,T[w]);A.textarea(c.context(),!0);L&&A.on(k,function(a,b){c.context(b);h.updateListCell(c,
|
| 133 |
-
"source");h.unsave(c,r)}).on(m,function(){h.po.reIndex(c);h.dict&&h.rebuildSearch();h.fire(b,[c])})}var h=this,n=c===h.active,r=0,s=h.sourceCell,v=h.targetCell,A=h.contextCell,B=h.commentCell,E=h.notesPara,D=h.editable.target,H=h.editable.source,L=h.editable.context,K=c.source()||"",J=c.plural()||"",N=c.notes(),I=z,M=n&&I,Q=h.targetLocale,U=h.t.s,T=h.labels;n||(h.active=c);s&&s!==M&&(s.off().clear(),d());A&&A!==M&&(A.off().clear(),f());v&&Q&&v!==M&&(r=v.navigated()||0,v.off().clear(),e(Q,r));if(B&&
|
| 134 |
-
B!==M)B.off().clear().textarea(c.comment(),!0).on(k,function(a,b){c.comment(b);h.fire("poComment",[c,b]);h.unsave(c,r)});I&&(I.exists()||(I=I.parent()),(B=I.editable())&&B.focus());n||h.fire("poSelected",[c])};s.unloadActive=function(){var a;(a=this.notesPara)&&a.text("").hide();(a=this.sourceCell)&&a.off().clear();(a=this.contextCell)&&a.off().clear();(a=this.targetCell)&&a.off().clear();(a=this.commentCell)&&a.off();this.active&&(this.fire("poDeselected",[this.active]),this.active=null);return this};
|
| 135 |
-
s.loadNothing=function(){var a,b=this.t._;this.unloadActive();(a=this.commentCell)&&a.textarea("",!1);(a=this.sourceCell)&&a.textarea("",!1).title(b("Source text not loaded")+":");(a=this.contextCell)&&a.textarea("",!1).title(b("Context not loaded")+":");(a=this.targetCell)&&a.textarea("",!1).title(b("Translation not loaded")+":");this.fire("poSelected",[null])};s.updateListCell=function(a,b){var c=this.getListColumns()[b],d=this.getListEntry(a)[c||0],e=this.po.indexOf(a);this.listTable.td(e,c).textContent=
|
| 136 |
-
d};s.cellText=function(a){if(-1!==a.indexOf("<")||-1!==a.indexOf("&"))a=A(a);""===a?a="\u00a0":v.test(a)&&(a="\u00a0"+a);return a};s.fuzzy=function(a,c,d){if(!c){c=this.active;if(!c)return null;null==d&&(d=this.targetCell&&this.targetCell.navigated()||0)}var e=c.fuzzy(d);null!=a&&e!=a&&this.fire("poFuzzy",[c,a,d])&&(c.fuzzy(d,a),this.fire(b,[c])&&this.unsave(c,d));return e};s.add=function(a,c){var d,e=this.po.get(a,c);e?d=this.po.indexOf(e):(d=this.po.length,e=this.po.add(a,c),this.load(this.po),
|
| 137 |
-
this.fire("poAdd",[e]),this.fire(b,[e]));this.lastSearch&&this.filter("");this.listTable.select(d);return e};s.del=function(a){if(a=a||this.active){var c=this.lastSearch,d=this.po.del(a);null!=d&&(this.unsave(a),this.fire("poDel",[a]),this.fire(b,[a]),this.reload(),this.dict&&this.rebuildSearch(),this.active&&this.active.equals(a)&&this.unloadActive(),this.po.length&&(c&&this.filter(c),this.active||(d=Math.min(d,this.po.length-1),this.listTable.select(d))))}};s=null;return d}({},z,A));p.register("$6",
|
| 138 |
-
{"\u00e1":"a","\u00e0":"a","\u0103":"a","\u1eaf":"a","\u1eb1":"a","\u1eb5":"a","\u1eb3":"a","\u00e2":"a","\u1ea5":"a","\u1ea7":"a","\u1eab":"a","\u1ea9":"a","\u01ce":"a","\u00e5":"a","\u01fb":"a","\u00e4":"a","\u01df":"a","\u00e3":"a","\u0227":"a","\u01e1":"a","\u0105":"a","\u0101":"a","\u1ea3":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1eb7":"a","\u1ead":"a","\u1e01":"a","\u01fd":"\u00e6","\u01e3":"\u00e6","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0107":"c","\u0109":"c","\u010d":"c","\u010b":"c",
|
| 139 |
-
"\u00e7":"c","\u1e09":"c","\u010f":"d","\u1e0b":"d","\u1e11":"d","\u0111":"d","\u1e0d":"d","\u1e13":"d","\u1e0f":"d","\u00f0":"d","\ua77a":"d","\u01c6":"\u01f3","\u00e9":"e","\u00e8":"e","\u0115":"e","\u00ea":"e","\u1ebf":"e","\u1ec1":"e","\u1ec5":"e","\u1ec3":"e","\u011b":"e","\u00eb":"e","\u1ebd":"e","\u0117":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u0113":"e","\u1e17":"e","\u1e15":"e","\u1ebb":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u1e19":"e","\u1e1b":"e","\u1e1f":"f","\ua77c":"f",
|
| 140 |
-
"\u01f5":"g","\u011f":"g","\u011d":"g","\u01e7":"g","\u0121":"g","\u0123":"g","\u1e21":"g","\ua7a1":"g","\u1d79":"g","\u0125":"h","\u021f":"h","\u1e27":"h","\u1e23":"h","\u1e29":"h","\u0127":"h","\u210f":"h","\u1e25":"h","\u1e2b":"h","\u1e96":"h","\u00ed":"i","\u00ec":"i","\u012d":"i","\u00ee":"i","\u01d0":"i","\u00ef":"i","\u1e2f":"i","\u0129":"i","\u012f":"i","\u012b":"i","\u1ec9":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u1e2d":"i","\u0135":"j","\u01f0":"j","\u1e31":"k","\u01e9":"k","\u0137":"k",
|
| 141 |
-
"\ua7a3":"k","\u1e33":"k","\u1e35":"k","\u013a":"l","\u013e":"l","\u013c":"l","\u0142":"l","\u1e37":"l","\u1e39":"l","\u1e3d":"l","\u1e3b":"l","\u0140":"l","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0144":"n","\u01f9":"n","\u0148":"n","\u00f1":"n","\u1e45":"n","\u0146":"n","\ua7a5":"n","\u1e47":"n","\u1e4b":"n","\u1e49":"n","\u00f3":"o","\u00f2":"o","\u014f":"o","\u00f4":"o","\u1ed1":"o","\u1ed3":"o","\u1ed7":"o","\u1ed5":"o","\u01d2":"o","\u00f6":"o","\u022b":"o","\u0151":"o","\u00f5":"o","\u1e4d":"o",
|
| 142 |
-
"\u1e4f":"o","\u022d":"o","\u022f":"o","\u0231":"o","\u00f8":"o","\u01ff":"o","\u01eb":"o","\u01ed":"o","\u014d":"o","\u1e53":"o","\u1e51":"o","\u1ecf":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edb":"o","\u1edd":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u1e55":"p","\u1e57":"p","\u0155":"r","\u0159":"r","\u1e59":"r","\u0157":"r","\ua7a7":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u1e5f":"r","\ua783":"r","\u015b":"s","\u1e65":"s","\u015d":"s","\u0161":"s",
|
| 143 |
-
"\u1e67":"s","\u1e61":"s","\u015f":"s","\ua7a9":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u017f":"s","\ua785":"s","\u1e9b":"s","\u0165":"t","\u1e97":"t","\u1e6b":"t","\u0163":"t","\u1e6d":"t","\u021b":"t","\u1e71":"t","\u1e6f":"t","\ua787":"t","\u00fa":"u","\u00f9":"u","\u016d":"u","\u00fb":"u","\u01d4":"u","\u016f":"u","\u00fc":"u","\u01d8":"u","\u01dc":"u","\u01da":"u","\u01d6":"u","\u0171":"u","\u0169":"u","\u1e79":"u","\u0173":"u","\u016b":"u","\u1e7b":"u","\u1ee7":"u","\u0215":"u","\u0217":"u",
|
| 144 |
-
"\u01b0":"u","\u1ee9":"u","\u1eeb":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u1e77":"u","\u1e75":"u","\u1e7d":"v","\u1e7f":"v","\u1e83":"w","\u1e81":"w","\u0175":"w","\u1e98":"w","\u1e85":"w","\u1e87":"w","\u1e89":"w","\u1e8d":"x","\u1e8b":"x","\u00fd":"y","\u1ef3":"y","\u0177":"y","\u1e99":"y","\u00ff":"y","\u1ef9":"y","\u1e8f":"y","\u0233":"y","\u1ef7":"y","\u1ef5":"y","\u017a":"z","\u1e91":"z","\u017e":"z","\u017c":"z","\u1e93":"z","\u1e95":"z","\u01ef":"\u0292","\u1f00":"\u03b1",
|
| 145 |
-
"\u1f04":"\u03b1","\u1f84":"\u03b1","\u1f02":"\u03b1","\u1f82":"\u03b1","\u1f06":"\u03b1","\u1f86":"\u03b1","\u1f80":"\u03b1","\u1f01":"\u03b1","\u1f05":"\u03b1","\u1f85":"\u03b1","\u1f03":"\u03b1","\u1f83":"\u03b1","\u1f07":"\u03b1","\u1f87":"\u03b1","\u1f81":"\u03b1","\u03ac":"\u03b1","\u1f71":"\u03b1","\u1fb4":"\u03b1","\u1f70":"\u03b1","\u1fb2":"\u03b1","\u1fb0":"\u03b1","\u1fb6":"\u03b1","\u1fb7":"\u03b1","\u1fb1":"\u03b1","\u1fb3":"\u03b1","\u1f10":"\u03b5","\u1f14":"\u03b5","\u1f12":"\u03b5",
|
| 146 |
-
"\u1f11":"\u03b5","\u1f15":"\u03b5","\u1f13":"\u03b5","\u03ad":"\u03b5","\u1f73":"\u03b5","\u1f72":"\u03b5","\u1f20":"\u03b7","\u1f24":"\u03b7","\u1f94":"\u03b7","\u1f22":"\u03b7","\u1f92":"\u03b7","\u1f26":"\u03b7","\u1f96":"\u03b7","\u1f90":"\u03b7","\u1f21":"\u03b7","\u1f25":"\u03b7","\u1f95":"\u03b7","\u1f23":"\u03b7","\u1f93":"\u03b7","\u1f27":"\u03b7","\u1f97":"\u03b7","\u1f91":"\u03b7","\u03ae":"\u03b7","\u1f75":"\u03b7","\u1fc4":"\u03b7","\u1f74":"\u03b7","\u1fc2":"\u03b7","\u1fc6":"\u03b7",
|
| 147 |
-
"\u1fc7":"\u03b7","\u1fc3":"\u03b7","\u1f30":"\u03b9","\u1f34":"\u03b9","\u1f32":"\u03b9","\u1f36":"\u03b9","\u1f31":"\u03b9","\u1f35":"\u03b9","\u1f33":"\u03b9","\u1f37":"\u03b9","\u03af":"\u03b9","\u1f77":"\u03b9","\u1f76":"\u03b9","\u1fd0":"\u03b9","\u1fd6":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u1fd3":"\u03b9","\u1fd2":"\u03b9","\u1fd7":"\u03b9","\u1fd1":"\u03b9","\u1f40":"\u03bf","\u1f44":"\u03bf","\u1f42":"\u03bf","\u1f41":"\u03bf","\u1f45":"\u03bf","\u1f43":"\u03bf","\u03cc":"\u03bf",
|
| 148 |
-
"\u1f79":"\u03bf","\u1f78":"\u03bf","\u1fe4":"\u03c1","\u1fe5":"\u03c1","\u1f50":"\u03c5","\u1f54":"\u03c5","\u1f52":"\u03c5","\u1f56":"\u03c5","\u1f51":"\u03c5","\u1f55":"\u03c5","\u1f53":"\u03c5","\u1f57":"\u03c5","\u03cd":"\u03c5","\u1f7b":"\u03c5","\u1f7a":"\u03c5","\u1fe0":"\u03c5","\u1fe6":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u1fe3":"\u03c5","\u1fe2":"\u03c5","\u1fe7":"\u03c5","\u1fe1":"\u03c5","\u1f60":"\u03c9","\u1f64":"\u03c9","\u1fa4":"\u03c9","\u1f62":"\u03c9","\u1fa2":"\u03c9",
|
| 149 |
-
"\u1f66":"\u03c9","\u1fa6":"\u03c9","\u1fa0":"\u03c9","\u1f61":"\u03c9","\u1f65":"\u03c9","\u1fa5":"\u03c9","\u1f63":"\u03c9","\u1fa3":"\u03c9","\u1f67":"\u03c9","\u1fa7":"\u03c9","\u1fa1":"\u03c9","\u03ce":"\u03c9","\u1f7d":"\u03c9","\u1ff4":"\u03c9","\u1f7c":"\u03c9","\u1ff2":"\u03c9","\u1ff6":"\u03c9","\u1ff7":"\u03c9","\u1ff3":"\u03c9","\u0491":"\u0433","\u0450":"\u0435","\u0451":"\u0435","\u04c2":"\u0436","\u045d":"\u0438","\u04e3":"\u0438","\u04ef":"\u0443"});p.register("$8",function(d,c,e){function h(){this.init()._validate();
|
| 150 |
-
var a=this.t._;this.sourceLocale={lang:"en",label:"English",plurals:[a("Single"),a("Plural")]}}d.init=function(a){var c=new h,b=c.t._;a=c.setRootCell(a);var d=a.splity("po-list","po-edit"),e=d[0],l=d[1],d=l.splitx("po-trans","po-comment"),n=d[0],g=d[1].header(b("Comments")+":"),d=n.splity("po-source","po-target"),n=d[0].header(b("Source text")+":"),b=d[1].header(b("Translation")+":");a.distribute(0.34);l.distribute(0.8);c.setListCell(e);c.setSourceCell(n);c.targetCell=b;c.commentCell=g;c.editable.source=
|
| 151 |
-
!1;return c};c=h.prototype=p.require("$4","base.js").extend(h);c.getListHeadings=function(){return[this.t._("Source text"),this.t._("Translation")]};c.getListColumns=function(){return{source:0,target:1}};c.getListEntry=function(a){if(!a)return["",""];var c=this.cellText,b=[c(a.id||a.source()||""),c(a.translation()||"")];if(a=a.context())b[0]+=" [ "+c(a)+" ]";return b};c.stats=function(){var a=this.po.length,c=0,b=0,d=0;this.po.each(function(a,e){e.translation()?e.fuzzy()?d++:c++:b++});return{t:a,
|
| 152 |
-
p:String(c?Math.round(100*(c/a)):0)+"%",f:d,u:b}};c.unlock=function(){this._unlocked||(this._unlocked=this.targetLocale,delete this.targetLocale,this.po&&this.po.unlock(),this.editable={source:!0,context:!0,target:!1},this.contextCell=this.targetCell,delete this.targetCell,this.fire("poLock",[!1]),this.active&&this.loadMessage(this.active))};c.lock=function(){var a;this._unlocked&&(a=this.targetLocale=this._unlocked,delete this._unlocked,this.po&&this.po.lock(a),this.editable={source:!1,context:!1,
|
| 153 |
-
target:!0},this.targetCell=this.contextCell,delete this.contextCell,this.fire("poLock",[!0,a]),this.active&&this.loadMessage(this.active))};c.locked=function(){return!this._unlocked};return d}({},z,A));p.register("$9",function(d,c,n){function h(a){(a||(a=B.getFirstEditable()))&&a.fire();return a}var a={copy:66,clear:75,save:83,fuzzy:85,next:40,prev:38,enter:13},f={38:!0,40:!0},b={66:function(a,b){var c=b.current(),d;c&&(c.normalize(),b.current(!1).current(c),(d=b.getTargetEditable())&&h(d))},75:function(a,
|
| 154 |
-
b){var c=b.current(),d;c&&(c.untranslate(),b.current(!1).current(c),(d=b.getTargetEditable())&&h(d))},85:function(a,b){b.fuzzy(!b.fuzzy())},13:function(a,b){b.getFirstEditable()&&b.next(1,!0,!0)},40:function(a,b){var c=a.shiftKey;b.next(1,c,c)},38:function(a,b){var c=a.shiftKey;b.next(-1,c,c)}};d.init=function(d,h){function l(a){if(a.isPropagationStopped()||!a.metaKey&&!a.ctrlKey)return!0;var c=a.which;if(!n[c])return!0;var e=b[c];if(!e)throw Error("No such command");if(a.altKey||a.shiftKey&&!f[c])return!0;
|
| 155 |
-
e(a,d);a.preventDefault();return!1}var n={};e(h||c).on("keydown",l);return{add:function(c,d){b[a[c]]=d;return this},enable:function(){var b,c;for(c in arguments)b=a[arguments[c]],n[b]=!0;return this},disable:function(){e(h||c).off("keydown",l);d=h=n=null}}};return d}({},z,A));p.require("$1","array.js");p.require("$2","html.js");var I=z.loco,D=I.t,N=I.killEvent,Y=I.showError,$=I.showSuccess,Z=z.ajaxurl||"/wp-admin/admin-ajax.php";M=I.conf||{};var Q=M.locale,L=p.require("$3","po.js").create(Q),H={},
|
| 156 |
-
J=A.getElementById("loco-poedit-inner"),W=p.require("$4","base.js").localise({}),K=W.s;W._=W._n=D;e(z).resize(function(){function d(){var d;d=J;for(var a=d.offsetTop||0;(d=d.offsetParent)&&void 0!==d;)a+=d.offsetTop||0;d=a;a=e(z).innerHeight();d=Math.max(n,a-d-c);J.style.height=String(d)+"px";return!0}var c=20,n=parseInt(e(J).css("min-height")||0);d();return d}());H.save=function(d){function c(){d.disabled=!1}c();B.on("poUnsaved",function(){e(d).addClass("button-primary loco-flagged")}).on("poSave",
|
| 157 |
-
function(){e(d).removeClass("button-primary loco-flagged")});e(d.form).submit(function(n){var h=n.target;n.target.po.value=L.toString();d.disabled=!0;X(h,function(a){c();e("#loco-po-modified").text(a.modified);B.save(!0);var d=D("PO file saved"),b=a.filename;a=a.compiled;null!=a&&(/\D/.test(a)?Y(a):(d+=" "+D("and MO file compiled"),b=b.replace(/\.po$/i,".mo")));$(d+" - "+b)},c);return N(n)});return!0};H.download_po=H.download_mo=function(d){d.disabled=!1;d.form.setAttribute("action",Z);e(d).click(function(c){d.form.po.value=
|
| 158 |
-
L.toString();e(J).trigger("poSave");return!0});return!0};H.add=!Q&&function(d){d.disabled=!1;e(d).click(function(c){var d=1,e;for(e="New message";L.get(e);)d=/(\d+)/.exec(e)?Math.max(d,RegExp.$1):d,e="New message "+ ++d;B.add(e);return N(c)});return!0};H.del=!Q&&function(d){d.disabled=!1;e(d).click(function(c){B.del();return N(c)});return!0};H.fuzzy=Q&&function(d){function c(c){d.disabled=null==c;e(d)[c?"addClass":"removeClass"]("loco-inverted")}B.on("poSelected",function(d,e){c(e&&B.locked()?e.fuzzy():
|
| 159 |
-
null)}).on("poFuzzy",function(d,e,a){c(B.locked()?a:null)});e(d).click(function(c){var d=!B.fuzzy();B.fuzzy(d);return N(c)});return!0};H.sync=function(d){function c(){d.disabled=!1}c();B.on("poUnsaved",function(){d.disabled=!0}).on("poSave",function(){c()});e(d.form).submit(function(n){d.disabled=!0;X(n.target,function(d){c();var a=p.require("$3","po.js").create(void 0);a.load(d.exp);var f=[],a=L.merge(a),b=a.add.length,k=a.del.length;B.load(L);if(b||k){f.push(d.pot?K(D("Merged from %s"),d.pot):D("Merged from source code"));
|
| 160 |
-
b&&f.push(K(D("1 new string added","%s new strings added",b),b));k&&f.push(K(D("1 obsolete string removed","%s obsolete strings removed",k),k));e(J).trigger("poUnsaved",[]);if(z.console&&console.log){for(b=-1;++b<a.add.length;)console.log(" + "+a.add[b].source());for(b=-1;++b<a.del.length;)console.log(" - "+a.del[b].source())}U()}else f.push(d.pot?K(D("Already up to date with %s"),d.pot):D("Already up to date with source code"));L.headers(d.headers||{});$(f.join(". "));e(J).trigger("poMerge",[d])},
|
| 161 |
-
c);return N(n)});return!0};H.revert=function(d){B.on("poUnsaved",function(){d.disabled=!1}).on("poSave",function(){d.disabled=!0});e(d).click(function(c){location.reload();return N(c)});return!0};H.help=function(){return!0};J.innerHTML="";var B=p.require("$8","poedit.js").init(J);B._validate("POEdit");p.require("$9","hotkeys.js").init(B).add("save",function(d,c){e("#loco-poedit-save").submit()}).enable("copy","clear","enter","next","prev","fuzzy","save");e("#loco-nav").find("button").each(function(d,
|
| 162 |
-
c){var n=c.getAttribute("data-loco");H[n]&&H[n](c)||e(c).hide()});H=null;(function(d){function c(a){e(d.parentNode)[a||null==a?"removeClass":"addClass"]("invalid")}e(d.form).submit(function(a){return N(a)});var n=p.require("$5","dict.js").create();n.depth=10;n.translit(p.require("$6","flatten.json"));B.searchable(n);d.disabled=!1;d.value="";var h=p.require("$7","LocoTextListener.js").listen(d,function(a){a=B.filter(a,!0);c(a)});B.on("poFilter",function(a,d,b){h.val(d||"");c(b)}).on("poMerge",function(a,
|
| 163 |
-
c){var b=h.val();b&&B.filter(b)});n=null})(A.getElementById("loco-search"));B.on("poUnsaved",function(){z.onbeforeunload=function(){return D("Your changes will be lost if you continue without saving")}}).on("poSave",function(){z.onbeforeunload=null}).on("poUpdate",U);L.load(M.po||M.pot||{});L.headers(M.headers);B.load(L);B.targetLocale||B.unlock();U()})(window,document,window.jQuery);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/build/admin-poinit.js
DELETED
|
@@ -1,2 +0,0 @@
|
|
| 1 |
-
!function(f,m,b){function e(a){var c=b(d).find('input[type="submit"]')[0];if(/^([a-z]{2,3})(?:[ _\-]([A-Z]{2}))?$/i.exec(a))return a=RegExp.$1.toLowerCase(),RegExp.$2&&(a+="_"+RegExp.$2.toUpperCase()),c.disabled=!1,a;c.disabled=!0}function h(a){function c(a,c,b){console.error(b||"FAIL");n(b||p("Unknown error"))}g("");return b.ajax({url:q,type:"POST",data:{action:"loco-data",locale:a},dataType:"json",error:c,success:function(b,d,f){var e=b&&b.locales&&b.locales[a];if(!e)return c(f,d,b&&b.error&&b.error.message);
|
| 2 |
-
g(e.icon)}})}function g(a){var c=b(d).find("span.icon");c[a?"show":"hide"]();a="icon "+a;c.each(function(b,c){c.className=a})}var k=f.loco,p=k.t,n=k.showError,q=f.ajaxurl||"/wp-admin/admin-ajax.php",d=m.getElementById("loco-msginit"),l=d["custom-locale"];b(d["common-locale"]).change(function(){var a=e(l.value=b(this).val());a&&h(a);return!0});b(l).on("input",function(a){(a=e(a.target.value))&&h(a);return!0});g("")}(window,document,window.jQuery);
|
|
|
|
|
|
old/pub/js/debug.js
DELETED
|
@@ -1,23 +0,0 @@
|
|
| 1 |
-
!function( window, document, navigator, $ ){
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
var form = document.getElementById('loco-debug');
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
function setFieldValue( name, value ){
|
| 9 |
-
name = 'loco['+name+']';
|
| 10 |
-
form[name].value = value;
|
| 11 |
-
}
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
setFieldValue( 'ua', navigator.userAgent || navigator.appVersion );
|
| 16 |
-
|
| 17 |
-
|
| 18 |
-
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
}( window, document, navigator, window.jQuery );
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/dummy.js
DELETED
|
@@ -1,21 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Dummy translations, simply echos back as if translations all missing
|
| 3 |
-
*/
|
| 4 |
-
loco = window.loco||{}, loco.t = function(){
|
| 5 |
-
|
| 6 |
-
// calc numeric index of a plural form (0-1)
|
| 7 |
-
function pluralIndex( n ){
|
| 8 |
-
return Number( n != 1 );
|
| 9 |
-
}
|
| 10 |
-
|
| 11 |
-
// expose public t() function
|
| 12 |
-
return function( msgid1, msgid2, n ){
|
| 13 |
-
if( null == n ){
|
| 14 |
-
return msgid1||'';
|
| 15 |
-
}
|
| 16 |
-
// plural operation
|
| 17 |
-
n = pluralIndex( n );
|
| 18 |
-
return n ? msgid2 || msgid1 : msgid1 || '';
|
| 19 |
-
};
|
| 20 |
-
|
| 21 |
-
}();
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/dummy.php
DELETED
|
@@ -1,58 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Here for source code extraction until xgettext is applied to js files too
|
| 4 |
-
*/
|
| 5 |
-
|
| 6 |
-
// immediately preceeding comment block is extracted. this won't be.
|
| 7 |
-
//
|
| 8 |
-
__('Unknown error','loco-legacy');
|
| 9 |
-
|
| 10 |
-
__('PO file saved','loco-legacy');
|
| 11 |
-
|
| 12 |
-
__('and MO file compiled','loco-legacy');
|
| 13 |
-
|
| 14 |
-
/* Translators: where %s is the path to a POT file */
|
| 15 |
-
__('Merged from %s','loco-legacy');
|
| 16 |
-
|
| 17 |
-
__('Merged from source code','loco-legacy');
|
| 18 |
-
|
| 19 |
-
__('Already up to date with %s','loco-legacy');
|
| 20 |
-
|
| 21 |
-
__('Already up to date with source code','loco-legacy');
|
| 22 |
-
|
| 23 |
-
_n('1 new string added','%s new strings added', 2 ,'loco-legacy');
|
| 24 |
-
|
| 25 |
-
_n('1 obsolete string removed','%s obsolete strings removed', 2 ,'loco-legacy');
|
| 26 |
-
|
| 27 |
-
__('Your changes will be lost if you continue without saving','loco-legacy');
|
| 28 |
-
|
| 29 |
-
|
| 30 |
-
/**
|
| 31 |
-
* These items aren't ready for translation in source code yet because they come from Loco core, but they will be eventually
|
| 32 |
-
*/
|
| 33 |
-
|
| 34 |
-
// label for the window pane holding native translation
|
| 35 |
-
_x('Source text','Editor pane','loco-legacy');
|
| 36 |
-
|
| 37 |
-
// where %s is the language, e.g French translation
|
| 38 |
-
_x('%s translation','Editor pane','loco-legacy');
|
| 39 |
-
|
| 40 |
-
// label for the window pane holding translator comments
|
| 41 |
-
_x('Comments','Editor pane','loco-legacy');
|
| 42 |
-
|
| 43 |
-
// label for the window pane holding message context
|
| 44 |
-
_x('Context','Editor pane','loco-legacy');
|
| 45 |
-
|
| 46 |
-
|
| 47 |
-
/**
|
| 48 |
-
* Legacy translations, removed from front end but don't want to lose in case reinstated
|
| 49 |
-
*/
|
| 50 |
-
|
| 51 |
-
//
|
| 52 |
-
__('Translation','loco-legacy');
|
| 53 |
-
|
| 54 |
-
__('No source files in this package, nothing to sync','loco-legacy');
|
| 55 |
-
|
| 56 |
-
__('No strings could be extracted from source files','loco-legacy');
|
| 57 |
-
|
| 58 |
-
_x('create in <code>%s</code>','Form label','loco-legacy');
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-ckb.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: ckb-GB, Central Kurdish
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:05 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "هەڵە",
|
| 38 |
-
"Warning": "ئاگاداری",
|
| 39 |
-
"OK": "باشە",
|
| 40 |
-
"Permission denied": "ڕێنەدراو",
|
| 41 |
-
"Settings saved": "ڕێکخستنەکان پاشەکەوتکران",
|
| 42 |
-
"%s is not an official WordPress language": "% زمانێکی فەڕمی وێردپرێس نیە",
|
| 43 |
-
"New PO file": "دۆسیەیەکی (PO)ی نوێ",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "دۆسیەی (PO) وەکو داڕێژەیەک بەکارهاتووە، ئەمەش لە یەکەمین پاشەکەوتدا ناوی دەنێتەوە \n%s",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "دەبێ شوێنێکی ناوەکیی دروست دیاری بکەی بۆ دۆسیەی نوێی (PO)",
|
| 46 |
-
"No translatable strings found": "هیچ زنجیرەوەرگێڕانێک نەدۆزرایەوە",
|
| 47 |
-
"Cannot create a PO file.": "ناتوانی دۆسیەی (PO) دروست بکەی.",
|
| 48 |
-
"PO file already exists with locale %s": "دۆسیەی (PO) ئامادەیە لەگەڵ %sی ناوەکی",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "لەخۆوە ناتوانرێ دۆسیە دروست بکرێ، ڕێدانەکانی دۆسیەکە چارەسەر بکە، یان داگرتن بەکار بێنە لەبری پاشەکەوتکردن",
|
| 50 |
-
"%s file is empty": "دۆسیەی \n%s بەتاڵە",
|
| 51 |
-
"Run Sync to update from source code": "هاوهەنگاوی بەکار بخە بۆ نوێکردنەوە لە کۆدی سەرچاوەوە",
|
| 52 |
-
"No strings could be extracted from source code": "هیچ زنجیرەدەقێک نەتوانرا لە کۆدی سەرچاوەوە دەربهێنرێ",
|
| 53 |
-
"Run Sync to update from %s": "هاوهەنگاوی بەکار بخە بۆ نوێکردنەوە لە \n%s\nەوە",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "کۆدی سەرچاوە دەستکاریکرا، هاوهەنگاوی بەکار بخە بۆ نوێکردنەوەی (POT)",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "(POT) دەستکاری کرا لەوەتەی دۆسیەی (PO) پاشەکەوتکراوە، هاوهەنگاوی بەکار بخە بۆ نوێکردنەوە",
|
| 56 |
-
"Bad file path": "ڕێڕەوی دۆسیە خراپە",
|
| 57 |
-
"Empty or invalid %s file": "بەتاڵە یان دۆسیەی \n%s نادروستە",
|
| 58 |
-
"%s file has no header": "دۆسیەی \n%s هیچ سەرپەڕێکی نیە",
|
| 59 |
-
"New template": "داڕێژەی نوێ",
|
| 60 |
-
"New language": "زمانی نوێ",
|
| 61 |
-
"%s%% translated": "%s%% وەرگێڕدراوە",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "زنجیرەدەقێک",
|
| 64 |
-
"other": "%s زنجیرەدەق"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s ناڕوونە",
|
| 67 |
-
"%s untranslated": "%s وەرنەگێڕدراوە",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "تێکخستنی دۆسیەی (MO) شکستی هێنا بە تێکخەری ناوخۆیی",
|
| 69 |
-
"Loco, Translation Management": "لۆکۆ، بەڕێوەبەرایەتی وەرگێڕان",
|
| 70 |
-
"Manage translations": "بەڕێوەبردنی وەرگێڕانەکان",
|
| 71 |
-
"Translation options": "هەڵبژاردنەکانی وەرگێڕان",
|
| 72 |
-
"Loco Translate": "لۆکۆ وەرگێڕ",
|
| 73 |
-
"Settings": "ڕێکخستنەکان",
|
| 74 |
-
"File download failed": "داگرتنی دۆسیە شکستی هێنا",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG بەباش دانانرێ و دەبێ لە \nwp-config.php ڕەش بکرێتەوە",
|
| 76 |
-
"Unknown language": "زمانێکی نەزانراوە",
|
| 77 |
-
"Some files not writable": "هەندێ دۆسیە بۆ نووسینەوە نیە",
|
| 78 |
-
"Some files missing": "هەندێ دۆسیە دیار نین",
|
| 79 |
-
"\"%s\" folder not writable": "بوخچەی \"%s\" بۆ نووسینەوە نیە",
|
| 80 |
-
"POT file not writable": "دۆسیەی (POT) بۆ نووسینەوە نیە",
|
| 81 |
-
"PO file not writable": "دۆسیەی (PO) بۆ نووسینەوە نیە",
|
| 82 |
-
"MO file not writable": "دۆسیەی (MO) بۆ نووسینەوە نیە",
|
| 83 |
-
"MO file not found": "دۆسیەی (MO) نەدۆزرایەوە",
|
| 84 |
-
"Folder not writable": "بوخچە بۆ نووسینەوە نیە",
|
| 85 |
-
"Folder not found": "بوخچە نەدۆزرایەوە",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s هیچ دەقەپاوانێکی ڕانەگەیاندووە",
|
| 87 |
-
"Loco has guessed \"%s\"": "لۆکۆ \"%s\"ی خەملاندووە.",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s هیچ ڕێڕەوێکی پاوانی ڕانەگەیاندووە",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s هیچ دۆسیەیەکی (POT)ی نیە، ئەگەر دەتەوێ دانەیەک لە \"%s/%s.pot\" دروست بکە",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s دۆسیەناوێکی (POT)ی نامۆی هەیە کە (%s) ناویەتی، \"%s.pot\" بە ناوێکی باش دادەنرێ.",
|
| 91 |
-
"User does not have permission to manage translations": "بەکارهێنەر ڕێپێدراو نیە بۆ بەڕێوەبردنی وەرگێڕانەکان",
|
| 92 |
-
"Invalid data posted to server": "دراوەی نادروست لە ڕاژەکە بڵاوکراوەتەوە",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "تێکخستنی دۆسیە (MO)کە لەگەڵ %s شکستی هێنا، بە ڕێکخستنەکاندا بچۆوە",
|
| 94 |
-
"Package not found called %s": "هیچ پاکەتێک بە ناوی %s نەدۆزرایەوە",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "تۆڕەڕاژە ناتوانێ پاراستنەکان لە \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە چارەسەر بکە یان ڕێکخستنەکانی پاراستنەکان ناکارا بکە",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "تۆڕەڕاژە ناتوانێ بوخچەی \"%s\" لە \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە چارەسەر بکە یان دەستکردانە دروستی بکە.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "تۆڕەڕاژە ناتوانێ دۆسیە لە بوخچەی \"%s\" دروست بکات، ڕێپێدانەکانی دۆسیە چارەسەر بکە یان فەرمانی داگرتن بەکار بهێنە",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%s شیاوی دەستکاری نیە بەهۆی تۆڕەڕاژەوە، ڕێپێدانەکانی دۆسیە چارەسەر بکە یان دای بگرە و لەبەری بگرەوە بۆ \n\"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "ناتوانرێ دۆسیەی (MO) دروستکرێ",
|
| 100 |
-
"Cannot overwrite MO file": "ناتوانرێ دۆسیە (MO)کە لەسەری بنووسرێتەوە",
|
| 101 |
-
"Failed to write MO file": "نووسینی دۆسیە (MO)کە شکستی هێنا",
|
| 102 |
-
"Packages": "پاکەتەکان",
|
| 103 |
-
"File check": "پشکنینی دۆسیە",
|
| 104 |
-
"File system permissions for %s": "ڕێپێدانی سیستەم بۆ دۆسیەی %s",
|
| 105 |
-
"Other potential issues with %s": "کێشە ناڕوونەکان لەگەڵ %s",
|
| 106 |
-
"Back": "گەڕانەوە",
|
| 107 |
-
"Get help": "داوای یارمەتی",
|
| 108 |
-
"Package details": "وردەکارییەکانی پاکەت",
|
| 109 |
-
"Translations (PO)": "وەرگێڕانەکان (PO)",
|
| 110 |
-
"Template (POT)": "داڕێژە (POT)",
|
| 111 |
-
"File permissions": "ڕێپێدراوی دۆسیە",
|
| 112 |
-
"Extends: %s": "لقوپۆپەکان: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "زمانێک",
|
| 115 |
-
"other": "%s زمان"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "نوێکراوەتەوە",
|
| 118 |
-
"Powered by": "بە پشتگیریی",
|
| 119 |
-
"Loco may not work as expected": "لۆکۆ ڕەنگە وەک ئەوەی چاوەڕێ دەکرێ کار نەکات",
|
| 120 |
-
"Configure Loco Translate": "سازدانی لۆکۆ وەرگێڕ",
|
| 121 |
-
"Compiling MO files": "تێکخستنی دۆسیە (MO)کان",
|
| 122 |
-
"Use built-in MO compiler.": "بەکارهێنانی (MO) تێکخەری ناوخۆیی.",
|
| 123 |
-
"Use external command:": "بەکارهێنانی فرمانە دەرەکیەکان:",
|
| 124 |
-
"Enter path to msgfmt on server": "ڕێڕەوی (msgfmt)ی سەر ڕاژە لێبدە",
|
| 125 |
-
"Generate hash tables": "دروستکردنی خشتە هاشیەکان",
|
| 126 |
-
"Include Fuzzy strings": "لەخۆگرتنی دێرە ناڕوونەکان",
|
| 127 |
-
"Backing up PO files": "پاراستنی دۆسیە (PO)کان",
|
| 128 |
-
"Number of backups to keep of each file:": "ژمارەی پاراستنەکان بۆ هێشتنەوەی هەر دۆسیەیەک:",
|
| 129 |
-
"Experimental features": "تایبەتمەندیە تاقیکاریەکان",
|
| 130 |
-
"Enable WordPress core translations": "کاراکردنی وەرگێڕانەکانی کاکڵی وێردپرێس",
|
| 131 |
-
"Save settings": "پاشەکەوتکردنی ڕێکخستنەکان",
|
| 132 |
-
"Template file": "دۆسیەی داڕێژە",
|
| 133 |
-
"Switch to...": "گۆڕین بۆ...",
|
| 134 |
-
"never": "هەرگیز",
|
| 135 |
-
"Save": "پاشەکەوتکردن",
|
| 136 |
-
"Download": "داگرتن",
|
| 137 |
-
"Sync": "هاوهەنگاوی",
|
| 138 |
-
"Revert": "گەڕاندنەوە",
|
| 139 |
-
"Add": "زیادکردن",
|
| 140 |
-
"Del": "سڕینەوە",
|
| 141 |
-
"Fuzzy": "ناڕوون",
|
| 142 |
-
"Filter translations": "پاڵاوتنی وەرگێڕانەکان",
|
| 143 |
-
"Help": "یارمەتی",
|
| 144 |
-
"Initialize new translations in %s": "دەستپێکردنی وەرگێڕانی نوێ لە %s",
|
| 145 |
-
"Select from common languages": "دیاریکردن لە زمانە باوەکانەوە",
|
| 146 |
-
"or enter any language code": "یان کۆدی زمانێک لێبدە",
|
| 147 |
-
"create in <code>%s</code>": "دروستکردن لە <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "دروستکردن لە بوخچەی زمانە جیهانیەکان",
|
| 149 |
-
"Start translating": "دەستپێکردنی وەرگێڕان",
|
| 150 |
-
"New version available": "وەشانی نوێ بەردەستە",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "بەرزکردنەوە بۆ وەشانی %sی لۆکۆ وەرگێڕ",
|
| 152 |
-
"Select a plugin or theme to translate": "پێوەکراوەیەک یان ڕووکارێک دیاری بکە بۆ وەرگێڕان.",
|
| 153 |
-
"Themes": "ڕووکارەکان",
|
| 154 |
-
"Plugins": "پێوەکراوەکان",
|
| 155 |
-
"Core": "کاکڵ",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "لقوپۆپەی پی ئێچ پی \"%s\" دانەمەزراوە، ئەگەر تووشی کێشە هاتی؛ دەبێ دای بمەزرێنیت",
|
| 157 |
-
"Unknown error": "هەڵەی نەناسراو",
|
| 158 |
-
"PO file saved": "دۆسیەی (PO)کە پاشەکەوتکرا",
|
| 159 |
-
"and MO file compiled": "دۆسیە (MO)کەش تێکخرا",
|
| 160 |
-
"Merged from %s": "لەگەڵ %s یەکخراون",
|
| 161 |
-
"Merged from source code": "لەگەڵ کۆدی سەرچاوە یەکخراون",
|
| 162 |
-
"Already up to date with %s": "هەتا ئێستا وەک %s وایە",
|
| 163 |
-
"Already up to date with source code": "هەتا ئێستا وەک کۆدی سەرچاوەیە",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "دێرێکی نوێ زیادکرا",
|
| 166 |
-
"other": "%s دێری نوێ زیادکرا"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "دێرێکی بەسەرچوو سڕاوەتەوە",
|
| 170 |
-
"other": "%s دێری بەسەرچوو سڕاوەتەوە"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "گۆڕانکاریەکانت لەدەست دەدەیت؛ ئەگەر بەبێ پاشەکەوتکردن بەردەوام بیت!",
|
| 173 |
-
"Source text": "دەقی سەرچاوە",
|
| 174 |
-
"%s translation": "%s وەرگێڕان",
|
| 175 |
-
"Comments": "لێدوانەکان",
|
| 176 |
-
"Context": "پێکهاتە",
|
| 177 |
-
"Translation": "وەرگێڕان",
|
| 178 |
-
"No source files in this package, nothing to sync": "هیچ دۆسیەیەکی سەرچاوە لەم پاکەتەدا نیە، هیچ شتێکیش بۆ هاوهەنگاوی نیە",
|
| 179 |
-
"No strings could be extracted from source files": "ناتوانرێ هیچ دێرێک لە دۆسیە سەرچاوەکان دەربهێنرێ",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-cs_CZ.js
DELETED
|
@@ -1,190 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: cs-CZ, Czech
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:05 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"few",
|
| 15 |
-
"other"
|
| 16 |
-
];
|
| 17 |
-
|
| 18 |
-
// calc numeric index of a plural form (0-2)
|
| 19 |
-
function pluralIndex( n ){
|
| 20 |
-
return Number( ( n == 1 ) ? 0 : ( n >= 2 && n <= 4 ) ? 1 : 2 );
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
// expose public t() function
|
| 24 |
-
return function( msgid1, msgid2, n ){
|
| 25 |
-
var value = pairs[msgid1];
|
| 26 |
-
// singular if no multiplier
|
| 27 |
-
if( null == n ){
|
| 28 |
-
n = 1;
|
| 29 |
-
}
|
| 30 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 31 |
-
if( value instanceof Object ){
|
| 32 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 33 |
-
}
|
| 34 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 35 |
-
};
|
| 36 |
-
}(
|
| 37 |
-
{
|
| 38 |
-
"Error": "Chyba",
|
| 39 |
-
"Warning": "Varování",
|
| 40 |
-
"OK": "OK",
|
| 41 |
-
"Permission denied": "Přístup odepřen",
|
| 42 |
-
"Settings saved": "Nastavení uloženo",
|
| 43 |
-
"%s is not an official WordPress language": "%s není oficiálním jazykem WordPress",
|
| 44 |
-
"New PO file": "Nový soubor PO",
|
| 45 |
-
"PO file used as template. This will be renamed to %s on first save": "PO soubor používaný jako šablona. Toto bude přejmenováno na %s při prvním uložení",
|
| 46 |
-
"You must specify a valid locale for a new PO file": "Musíte zadat platné národní prostředí pro nový PO soubor",
|
| 47 |
-
"No translatable strings found": "Nebyly nalezeny žádné řetězce pro překlad",
|
| 48 |
-
"Cannot create a PO file.": "Nelze vytvořit soubor PO.",
|
| 49 |
-
"PO file already exists with locale %s": "Soubor PO již existuje s národním prostředím %s",
|
| 50 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Soubor nemůže být automaticky vytvořen. Opravte oprávnění k souboru nebo použijte Stáhnout namísto Uložit",
|
| 51 |
-
"%s file is empty": "%s soubor je prázdný",
|
| 52 |
-
"Run Sync to update from source code": "Spusťte Sync pro aktualizaci ze zdrojového kódu",
|
| 53 |
-
"No strings could be extracted from source code": "Žádné řetězce by mohly být extrahovány ze zdrojového kódu",
|
| 54 |
-
"Run Sync to update from %s": "Spusťte Sync pro aktualizaci ze %s",
|
| 55 |
-
"Source code has been modified, run Sync to update POT": "Zdrojový kód byl změněn, spusťte Sync pro aktualizaci POT",
|
| 56 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT byl změněn od uložení PO souboru, spusťte Sync pro aktualizaci",
|
| 57 |
-
"Bad file path": "Špatná cesta k souboru",
|
| 58 |
-
"Empty or invalid %s file": "Prázdný nebo neplatný soubor %s",
|
| 59 |
-
"%s file has no header": "Soubor %s nemá hlavičku",
|
| 60 |
-
"New template": "Nová šablona",
|
| 61 |
-
"New language": "Nový jazyk",
|
| 62 |
-
"%s%% translated": "%s%% přeloženo",
|
| 63 |
-
"1 string": {
|
| 64 |
-
"one": "1 řetězec",
|
| 65 |
-
"few": "%s řetězce",
|
| 66 |
-
"other": "%s řetězců"
|
| 67 |
-
},
|
| 68 |
-
"%s fuzzy": "%s odhadnuto",
|
| 69 |
-
"%s untranslated": "%s nepřeloženo",
|
| 70 |
-
"Failed to compile MO file with built-in compiler": "Nepodařilo se zkompilovat soubor MO vestavěným kompilátorem",
|
| 71 |
-
"Loco, Translation Management": "Loco, Správa překladů",
|
| 72 |
-
"Manage translations": "Spravovat překlady",
|
| 73 |
-
"Translation options": "Možnosti překladu",
|
| 74 |
-
"Loco Translate": "Překladač Loco",
|
| 75 |
-
"Settings": "Nastavení",
|
| 76 |
-
"File download failed": "Stažení souboru selhalo",
|
| 77 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG je zastaralý a měl by být odstraněn z wp-config.php",
|
| 78 |
-
"Unknown language": "Neznámý jazyk",
|
| 79 |
-
"Some files not writable": "Některé soubory nejsou zapisovatelné",
|
| 80 |
-
"Some files missing": "Některé soubory chybí",
|
| 81 |
-
"\"%s\" folder not writable": "Složka \"%s\" není zapisovatelná",
|
| 82 |
-
"POT file not writable": "Soubor POT není zapisovatelný",
|
| 83 |
-
"PO file not writable": "Soubor PO není zapisovatelný",
|
| 84 |
-
"MO file not writable": "Soubor MO není zapisovatelný",
|
| 85 |
-
"MO file not found": "Soubor MO nenalezen",
|
| 86 |
-
"Folder not writable": "Složka není zapisovatelná",
|
| 87 |
-
"Folder not found": "Složka nenalezena",
|
| 88 |
-
"%s does not declare a \"Text Domain\"": "%s nedeklaruje \"Text Domain\"",
|
| 89 |
-
"Loco has guessed \"%s\"": "Loco odhadnul \"%s\"",
|
| 90 |
-
"%s does not declare a \"Domain Path\"": "%s nedeklaruje \"Domain Path\"",
|
| 91 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s nemá žádný soubor POT. Vytvořte jej jako \"%s/%s.pot\", pokud jej potřebujete.",
|
| 92 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s má podivný název souboru POT (%s). Lepší jméno bylo by \"%s.pot\"",
|
| 93 |
-
"User does not have permission to manage translations": "Uživatel nemá oprávnění ke správě překladů",
|
| 94 |
-
"Invalid data posted to server": "Neplatná data zaslaná na server",
|
| 95 |
-
"Failed to compile MO file with %s, check your settings": "Nepodařilo se zkompilovat soubor MO s %s, zkontrolujte vaše nastavení",
|
| 96 |
-
"Package not found called %s": "Balíček s názvem %s nenalezen",
|
| 97 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Webový server nemůže vytvářet zálohy v \"%s\". Opravte oprávnění souborů nebo zakažte zálohy v nastavení",
|
| 98 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Webový server nemůže vytvořit adresář \"%s\" v \"%s\". Opravte oprávnění souborů nebo jej vytvořte ručně.",
|
| 99 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Webový server nemůže vytvářet soubory v adresáři \"%s\". Opravte oprávnění souborů nebo použijte funkci stahování.",
|
| 100 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Soubor %s není zapisovatelný webovým serverem. Opravte oprávnění souborů nebo stáhněte a zkopírujte do \"%s/%s\".",
|
| 101 |
-
"Cannot create MO file": "Nelze vytvořit soubor MO",
|
| 102 |
-
"Cannot overwrite MO file": "Nelze přepsat soubor MO",
|
| 103 |
-
"Failed to write MO file": "Do souboru MO nelze zapisovat",
|
| 104 |
-
"Packages": "Balíčky",
|
| 105 |
-
"File check": "Kontrola souborů",
|
| 106 |
-
"File system permissions for %s": "Oprávnění souborového systému pro %s",
|
| 107 |
-
"Other potential issues with %s": "Další potenciální problémy s %s",
|
| 108 |
-
"Back": "Zpět",
|
| 109 |
-
"Get help": "Získat pomoc",
|
| 110 |
-
"Package details": "Podrobnosti o balíčku",
|
| 111 |
-
"Translations (PO)": "Překlady (PO)",
|
| 112 |
-
"Template (POT)": "Šablona (POT)",
|
| 113 |
-
"File permissions": "Oprávnění k souborům",
|
| 114 |
-
"Extends: %s": "Rozšiřuje: %s",
|
| 115 |
-
"1 language": {
|
| 116 |
-
"one": "1 jazyk",
|
| 117 |
-
"few": "%u jazyky",
|
| 118 |
-
"other": "%u jazyků"
|
| 119 |
-
},
|
| 120 |
-
"Updated": "Aktualizováno",
|
| 121 |
-
"Powered by": "Běží na",
|
| 122 |
-
"Loco may not work as expected": "Loco nemusí fungovat podle očekávání",
|
| 123 |
-
"Configure Loco Translate": "Konfigurace Překladače Loco",
|
| 124 |
-
"Compiling MO files": "Kompilace MO souborů",
|
| 125 |
-
"Use built-in MO compiler.": "Použít vestavěný MO kompilátor.",
|
| 126 |
-
"Use external command:": "Použít externí příkaz:",
|
| 127 |
-
"Enter path to msgfmt on server": "Vložte cestu k msgfmt na serveru",
|
| 128 |
-
"Generate hash tables": "Generovat hash tabulky",
|
| 129 |
-
"Include Fuzzy strings": "Zahrnout odhadnuté řetězce",
|
| 130 |
-
"Backing up PO files": "Zálohování PO souborů",
|
| 131 |
-
"Number of backups to keep of each file:": "Počet záloh pro zachování každého souboru:",
|
| 132 |
-
"Experimental features": "Experimentální funkce",
|
| 133 |
-
"Enable WordPress core translations": "Povolit překlady jádra WordPressu",
|
| 134 |
-
"Save settings": "Uložit nastavení",
|
| 135 |
-
"Template file": "Soubor šablony",
|
| 136 |
-
"Switch to...": "Přepnout na...",
|
| 137 |
-
"never": "nikdy",
|
| 138 |
-
"Save": "Uložit",
|
| 139 |
-
"Download": "Stáhnout",
|
| 140 |
-
"Sync": "Sync",
|
| 141 |
-
"Revert": "Vrátit",
|
| 142 |
-
"Add": "Přidat",
|
| 143 |
-
"Del": "Smaz",
|
| 144 |
-
"Fuzzy": "Odhad",
|
| 145 |
-
"Filter translations": "Filtrovat překlady",
|
| 146 |
-
"Help": "Nápověda",
|
| 147 |
-
"Initialize new translations in %s": "Inicializovat nové překlady v %s",
|
| 148 |
-
"Select from common languages": "Vyberte z běžných jazyků",
|
| 149 |
-
"or enter any language code": "nebo vložte libovolný kód jazyka",
|
| 150 |
-
"create in <code>%s</code>": "vytvořit v <code>%s</code>",
|
| 151 |
-
"create in global languages directory": "vytvořit v adresáři s globálními jazyky",
|
| 152 |
-
"Start translating": "Začít překládat",
|
| 153 |
-
"New version available": "Nová verze k dispozici",
|
| 154 |
-
"Upgrade to version %s of Loco Translate": "Aktualizujte na verzi %s Překladače Loco",
|
| 155 |
-
"Select a plugin or theme to translate": "Vyberte plugin nebo téma pro překlad",
|
| 156 |
-
"Themes": "Šablony",
|
| 157 |
-
"Plugins": "Pluginy",
|
| 158 |
-
"Core": "Jádro",
|
| 159 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "PHP rozšíření \"%s\" není nainstalováno. Pokud dochází k problémům, měli byste jej nainstalovat",
|
| 160 |
-
"Unknown error": "Neznámá chyba",
|
| 161 |
-
"PO file saved": "Soubor PO uložen",
|
| 162 |
-
"and MO file compiled": "a soubor MO zkompilován",
|
| 163 |
-
"Merged from %s": "Sloučeno z %s",
|
| 164 |
-
"Merged from source code": "Sloučeno ze zdrojového kódu",
|
| 165 |
-
"Already up to date with %s": "Již v aktuálním stavu s %s",
|
| 166 |
-
"Already up to date with source code": "Již v aktuálním stavu se zdrojovým kódem",
|
| 167 |
-
"1 new string added": {
|
| 168 |
-
"one": "1 nový řetězec přidán",
|
| 169 |
-
"few": "%s nové řetězce přidány",
|
| 170 |
-
"other": "%s nových řetězců přidáno"
|
| 171 |
-
},
|
| 172 |
-
"1 obsolete string removed": {
|
| 173 |
-
"one": "1 zastaralý řetězec odstraněn",
|
| 174 |
-
"few": "%s zastaralé řetězce odstraněny",
|
| 175 |
-
"other": "%s zastaralých řetězců odstraněno"
|
| 176 |
-
},
|
| 177 |
-
"Your changes will be lost if you continue without saving": "Vaše změny budou ztraceny, pokud budete pokračovat bez uložení",
|
| 178 |
-
"Source text": "Zdrojový text",
|
| 179 |
-
"%s translation": "%s překlad",
|
| 180 |
-
"Comments": "Komentáře",
|
| 181 |
-
"Context": "Kontext",
|
| 182 |
-
"Translation": "Překlad",
|
| 183 |
-
"No source files in this package, nothing to sync": "Žádné zdrojové soubory v tomto balíčku, není nic k synchronizaci",
|
| 184 |
-
"No strings could be extracted from source files": "Žádné řetězce nemohly být extrahovány ze zdrojových souborů",
|
| 185 |
-
"Translate WordPress plugins and themes directly in your browser": "Překládejte WordPress pluginy a témata přímo ve vašem prohlížeči",
|
| 186 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 187 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 188 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 189 |
-
}
|
| 190 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-de_DE.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: de-DE, German
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:06 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Fehler",
|
| 38 |
-
"Warning": "Warnung",
|
| 39 |
-
"OK": "OK",
|
| 40 |
-
"Permission denied": "Zugriff verweigert",
|
| 41 |
-
"Settings saved": "Einstellungen gespeichert",
|
| 42 |
-
"%s is not an official WordPress language": "",
|
| 43 |
-
"New PO file": "Neue PO-Datei",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "PO-Datei wird als Template verwendet. Dies wird in %s beim ersten Speichern umbenannt.",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Du musst einen gültigen Pfad für die PO-Datei angeben",
|
| 46 |
-
"No translatable strings found": "Keine übersetzbaren Zeichenketten gefunden",
|
| 47 |
-
"Cannot create a PO file.": "Erstellen der PO-Datei fehlgeschlagen.",
|
| 48 |
-
"PO file already exists with locale %s": "PO-Datei existiert schon unter %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Datei kann nicht automatisch erstellt werden. Setze die Datei-Zugriffsrechte oder benutze Download anstatt Speichern",
|
| 50 |
-
"%s file is empty": "Datei (%s) ist leer",
|
| 51 |
-
"Run Sync to update from source code": "Benutze Sync, um von der Quelle zu aktualisieren",
|
| 52 |
-
"No strings could be extracted from source code": "Es konnten keine Zeichenketten vom Quellcode extrahiert werden",
|
| 53 |
-
"Run Sync to update from %s": "Benutze Sync, um aus %s zu aktualisieren",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Quellcode wurde geändert, benutze Sync um POT zu aktualisieren",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT wurde aktualisiert bevor die PO-Datei gespeichert wurde. Benutze Sync zum Aktualisieren.",
|
| 56 |
-
"Bad file path": "Falscher Dateipfad",
|
| 57 |
-
"Empty or invalid %s file": "Leere oder ungültige %s-Datei",
|
| 58 |
-
"%s file has no header": "%s-Datei hat keinen Header",
|
| 59 |
-
"New template": "Neues Template",
|
| 60 |
-
"New language": "Neue Sprache",
|
| 61 |
-
"%s%% translated": "%s%% übersetzt",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 Zeichenkette",
|
| 64 |
-
"other": "%s Zeichenketten"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s undeutlich",
|
| 67 |
-
"%s untranslated": "%s nicht übersetzt",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Kompilieren der MO-Datei mit dem internen Kompilierer fehlgeschlagen.",
|
| 69 |
-
"Loco, Translation Management": "Loco, Translation Management",
|
| 70 |
-
"Manage translations": "Übersetzungen verwalten",
|
| 71 |
-
"Translation options": "Übersetzungsoptionen",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Einstellungen",
|
| 74 |
-
"File download failed": "Dateidownload ist fehlgeschlagen",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "",
|
| 76 |
-
"Unknown language": "Unbekannte Sprache",
|
| 77 |
-
"Some files not writable": "Einige Dateien nicht schreibbar",
|
| 78 |
-
"Some files missing": "Einige Dateien fehlen",
|
| 79 |
-
"\"%s\" folder not writable": "Ordner \"%s\" nicht schreibbar",
|
| 80 |
-
"POT file not writable": "POT-Datei nicht schreibbar",
|
| 81 |
-
"PO file not writable": "PO-Datei nicht schreibbar",
|
| 82 |
-
"MO file not writable": "MO-Datei nicht schreibbar",
|
| 83 |
-
"MO file not found": "MO-Datei nicht gefunden",
|
| 84 |
-
"Folder not writable": "Ordner nicht schreibbar",
|
| 85 |
-
"Folder not found": "Ordner nicht gefunden",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 87 |
-
"Loco has guessed \"%s\"": "",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 91 |
-
"User does not have permission to manage translations": "Benutzer hat keine Rechte die Übersetzungen zu verwalten",
|
| 92 |
-
"Invalid data posted to server": "Ungültige Daten zum Server gesendet",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Kompilieren der MO-Datei fehlgeschlagen. Bitte prüfe Deine Einstellungen",
|
| 94 |
-
"Package not found called %s": "Paket %s nicht gefunden",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Webserver kann keine Sicherungen in \"%s\" anlegen. Setze die Datei-Zugriffrechte oder deaktiviere die Sicherungen in den Einstellungen",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Webserver kann Ordner \"%s\" nicht in \"%s\" erstellen. Setze die Zugriffsrechte oder erstelle den Ordner selbst.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Webserver kann keine Dateien im Ordner \"%s\" erstellen. Setze die Datei-Zugriffsrechte oder benutze Download anstatt Speichern.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Datei %s ist vom Webserver nicht schreibbar. Setze die Datei-Zugriffsrechte oder benutze Download anstatt Speichern und speichere die Datei auf dem Server unter \"%s/%s\" ab.",
|
| 99 |
-
"Cannot create MO file": "Erstellen der MO-Datei fehlgeschlagen.",
|
| 100 |
-
"Cannot overwrite MO file": "Überschreiben der MO-Datei fehlgeschlagen",
|
| 101 |
-
"Failed to write MO file": "Fehler beim Schreiben der MO-Datei",
|
| 102 |
-
"Packages": "Pakete",
|
| 103 |
-
"File check": "Dateiprüfung",
|
| 104 |
-
"File system permissions for %s": "Dateisystem-Rechte für %s",
|
| 105 |
-
"Other potential issues with %s": "",
|
| 106 |
-
"Back": "Zurück",
|
| 107 |
-
"Get help": "Hilfe erhalten",
|
| 108 |
-
"Package details": "Paketdetails",
|
| 109 |
-
"Translations (PO)": "Übersetzungen (PO)",
|
| 110 |
-
"Template (POT)": "Template (POT)",
|
| 111 |
-
"File permissions": "Dateizugriffsrechte",
|
| 112 |
-
"Extends: %s": "Erweiterung: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 Sprache",
|
| 115 |
-
"other": "%u Sprachen"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Aktualisiert",
|
| 118 |
-
"Powered by": "Präsentiert von",
|
| 119 |
-
"Loco may not work as expected": "Loco scheint nicht, wie erwartet, zu arbeiten",
|
| 120 |
-
"Configure Loco Translate": "Konfiguriere Loco Translate",
|
| 121 |
-
"Compiling MO files": "MO-Dateien kompilieren",
|
| 122 |
-
"Use built-in MO compiler.": "Benutze internen MO-Kompilierer",
|
| 123 |
-
"Use external command:": "Benutze externes Befehlsprogramm:",
|
| 124 |
-
"Enter path to msgfmt on server": "Pfad zum msgfmt-Programm",
|
| 125 |
-
"Generate hash tables": "Erzeuge Hashtabellen",
|
| 126 |
-
"Include Fuzzy strings": "",
|
| 127 |
-
"Backing up PO files": "PO-Datei sichern",
|
| 128 |
-
"Number of backups to keep of each file:": "Anzahl der Sicherungen pro Datei",
|
| 129 |
-
"Experimental features": "Experimentelle Funktionen",
|
| 130 |
-
"Enable WordPress core translations": "WordPress Core Übersetzung aktivieren",
|
| 131 |
-
"Save settings": "Einstellungen speichern",
|
| 132 |
-
"Template file": "Templatedatei",
|
| 133 |
-
"Switch to...": "Wechsle zu...",
|
| 134 |
-
"never": "niemals",
|
| 135 |
-
"Save": "Speichern",
|
| 136 |
-
"Download": "Download",
|
| 137 |
-
"Sync": "Sync",
|
| 138 |
-
"Revert": "zurücksetzen",
|
| 139 |
-
"Add": "Hinzufügen",
|
| 140 |
-
"Del": "Löschen",
|
| 141 |
-
"Fuzzy": "Undeutlich",
|
| 142 |
-
"Filter translations": "Übersetzungen filtern",
|
| 143 |
-
"Help": "Hilfe",
|
| 144 |
-
"Initialize new translations in %s": "Initialisiere neue Übersetzung in %s",
|
| 145 |
-
"Select from common languages": "Wähle aus den Standardsprachen",
|
| 146 |
-
"or enter any language code": "oder trage den Sprach-Code ein",
|
| 147 |
-
"create in <code>%s</code>": "erstellen in <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "in globalem Sprachverzeichnis erstellen",
|
| 149 |
-
"Start translating": "Starte Übersetzung",
|
| 150 |
-
"New version available": "Neue Version verfügbar",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Bitte upgrade Loco Translate auf Version %s",
|
| 152 |
-
"Select a plugin or theme to translate": "Wähle ein Plugin oder Theme zum Übersetzen",
|
| 153 |
-
"Themes": "Themes",
|
| 154 |
-
"Plugins": "Plugins",
|
| 155 |
-
"Core": "Core",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 157 |
-
"Unknown error": "Unbekannter Fehler",
|
| 158 |
-
"PO file saved": "PO-Datei gespeichert",
|
| 159 |
-
"and MO file compiled": "und MO-Datei kompiliert",
|
| 160 |
-
"Merged from %s": "Aus %s zusammengeführt",
|
| 161 |
-
"Merged from source code": "Aus Quelle zusammengeführt",
|
| 162 |
-
"Already up to date with %s": "Bereits auf dem aktuellen Stand mit %s",
|
| 163 |
-
"Already up to date with source code": "Bereits mit der Quelle auf dem aktuellen Stand",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 neue Zeichenkette hinzugefügt",
|
| 166 |
-
"other": "%s neue Zeichenketten hinzugefügt"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 veraltete Zeichenkette entfernt",
|
| 170 |
-
"other": "%s veraltete Zeichenketten entfernt"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Deine Änderungen gehen verloren, wenn du fortsetzt ohne zu Speichern",
|
| 173 |
-
"Source text": "Quelltext",
|
| 174 |
-
"%s translation": "%s Übersetzung",
|
| 175 |
-
"Comments": "Kommentare",
|
| 176 |
-
"Context": "Kontext",
|
| 177 |
-
"Translation": "Übersetzung",
|
| 178 |
-
"No source files in this package, nothing to sync": "Keine Quelldateien in diesem Paket gefunden, nichts zu synchronisieren",
|
| 179 |
-
"No strings could be extracted from source files": "Es konnten keine Zeichenketten aus der Quelle extrahiert werden",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-el.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: el-GR, Greek
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:06 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Λάθος",
|
| 38 |
-
"Warning": "Προειδοποίηση",
|
| 39 |
-
"OK": "ΟΚ",
|
| 40 |
-
"Permission denied": "Απαγορεύθηκε η πρόσβαση",
|
| 41 |
-
"Settings saved": "Οι ρυθμίσεις αποθηκεύτηκαν",
|
| 42 |
-
"%s is not an official WordPress language": "%s δεν είναι μια επίσημη γλώσσα του WordPress",
|
| 43 |
-
"New PO file": "Νέο αρχείο PO",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "Το αρχείο PO χρησιμοποιήθηκε ως πρότυπο. Αυτό θα μετονομαστεί σε %s με την πρώτη αποθήκευση",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Πρέπει να προσδιορίσετε μία έγκυρη τοποθεσία για το νέο αρχείο PO",
|
| 46 |
-
"No translatable strings found": "Δε βρέθηκαν μεταφράσιμες φράσεις",
|
| 47 |
-
"Cannot create a PO file.": "Δε μπορεί να δημιουργηθεί ένα αρχείο PO.",
|
| 48 |
-
"PO file already exists with locale %s": "Το αρχείο PO υπάρχει ήδη με την τοποθεσία %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Το αρχείο δε μπορεί να δημιουργηθεί αυτόματα. Διορθώστε τα δικαιώματα του αρχείου ή χρησιμοποιήστε τη Λήψη αντί για την Αποθήκευση",
|
| 50 |
-
"%s file is empty": "Το αρχείο %s είναι άδειο",
|
| 51 |
-
"Run Sync to update from source code": "Τρέξτε τον Συγχρονισμό για να γίνει ενημέρωση από τον πηγαίο κώδικα",
|
| 52 |
-
"No strings could be extracted from source code": "Δεν μπορούν να εξαχθούν φράσεις από τον πηγαίο κώδικα",
|
| 53 |
-
"Run Sync to update from %s": "Τρέξτε τον Συγχρονισμό για να γίνει ενημέρωση από το %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Ο πηγαίος κώδικας έχει τροποποιηθεί, τρέξτε τον Συγχρονισμό για να ενημερώσετε το POT",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "Το POT έχει τροποποιηθεί μετά την αποθήκευση του αρχείου PO, τρέξτε τον Συγχρονισμό για να γίνει ενημέρωση",
|
| 56 |
-
"Bad file path": "Λάθος διεύθυνση αρχείου",
|
| 57 |
-
"Empty or invalid %s file": "Κενό ή μη έγκυρο αρχείο %s",
|
| 58 |
-
"%s file has no header": "Το αρχείο %s δεν έχει κεφαλίδα",
|
| 59 |
-
"New template": "Νέο πρότυπο",
|
| 60 |
-
"New language": "Νέα γλώσσα",
|
| 61 |
-
"%s%% translated": "%s%% μεταφράστηκε",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 φράση",
|
| 64 |
-
"other": "%s φράσεις"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s ασαφές",
|
| 67 |
-
"%s untranslated": "%s αμετάφραστο",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Αποτυχία μεταγλώττισης του αρχείου MO με τον ενσωματωμένο μεταγλωττιστή",
|
| 69 |
-
"Loco, Translation Management": "Loco, Διαχείριση Μετάφρασης",
|
| 70 |
-
"Manage translations": "Διαχείριση μεταφράσεων",
|
| 71 |
-
"Translation options": "Επιλογές μετάφρασης",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Ρυθμίσεις",
|
| 74 |
-
"File download failed": "Η λήψη του αρχείου απέτυχε",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "Το WPLANG έχει καταργηθεί και θα πρέπει να αφαιρεθεί από το wp-config.php",
|
| 76 |
-
"Unknown language": "Άγνωστη γλώσσα",
|
| 77 |
-
"Some files not writable": "Κάποια αρχεία δεν είναι εγγράψιμα",
|
| 78 |
-
"Some files missing": "Κάποια αρχεία λείπουν",
|
| 79 |
-
"\"%s\" folder not writable": "Ο φάκελος \"%s\" δεν είναι εγγράψιμος",
|
| 80 |
-
"POT file not writable": "Το αρχείο POT δεν είναι εγγράψιμο",
|
| 81 |
-
"PO file not writable": "Το αρχείο PO δεν είναι εγγράψιμο",
|
| 82 |
-
"MO file not writable": "Το αρχείο MO δεν είναι εγγράψιμο",
|
| 83 |
-
"MO file not found": "Το αρχείο MO δε βρέθηκε",
|
| 84 |
-
"Folder not writable": "Ο φάκελος δεν είναι εγγράψιμος",
|
| 85 |
-
"Folder not found": "Ο φάκελος δε βρέθηκε",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "Το %s δε δηλώνει κάποιο \"Πεδίο Κειμένου\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "Το Loco έχει μαντέξει \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "Το %s δε δηλώνει κάποιο \"Πεδίο Διεύθυνσης\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "Το %s δεν έχει κάποιο αρχείο POT. Εάν χρειάζεστε ένα, δημιουργήστε το στο \"%s/%s.pot\"",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "Το %s έχει ένα περίεργο όνομα αρχείου (%s). Ένα καλύτερο όνομα θα ήταν το \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "Ο χρήστης δεν έχει δικαιώματα να διαχειριστεί μεταφράσεις",
|
| 92 |
-
"Invalid data posted to server": "Δημοσιεύθηκαν μη έγκυρα δεδομένα στο διακομιστή",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Αποτυχία μεταγλώττισης του αρχείου MO με το %s, ελέγξτε τις ρυθμίσεις σας",
|
| 94 |
-
"Package not found called %s": "Το πακέτο %s δε βρέθηκε",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Ο διακομιστής web δε μπορεί να δημιουργήσει αντίγραφα ασφαλείας στο \"%s\". Διορθώστε τα δικαιώματα αρχείου ή απενεργοποιήστε τα αντίγραφα ασφαλείας στις ρυθμίσεις",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Ο διακομιστής web δε μπορεί να δημιουργήσει το φάκελο \"%s\" στο \"%s\". Διορθώστε τα δικαιώματα αρχείου ή δημιουργήστε το χειροκίνητα.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Ο διακομιστής web δε μπορεί να δημιουργήσει αρχεία στο φάκελο \"%s\". Διορθώστε τα δικαιώματα αρχείου ή χρησιμοποιήστε τη λειτουργία Λήψη.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Το αρχείο \"%s\" δεν είναι εγγράψιμο από το διακομιστή web. Διορθώστε τα δικαιώματα αρχείου ή κάντε λήψη και αντιγράψτε το στο \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Δε μπόρεσε να δημιουργηθεί το αρχείο MO",
|
| 100 |
-
"Cannot overwrite MO file": "Δε μπόρεσε να αντικατασταθεί το αρχείο MO",
|
| 101 |
-
"Failed to write MO file": "Δε μπόρεσε να εγγραφεί να αρχείο MO",
|
| 102 |
-
"Packages": "Πακέτα",
|
| 103 |
-
"File check": "Έλεγχος αρχείου",
|
| 104 |
-
"File system permissions for %s": "Δικαιώματα συστήματος αρχείων για το %s",
|
| 105 |
-
"Other potential issues with %s": "Άλλα πιθανά θέματα με το %s",
|
| 106 |
-
"Back": "Πίσω",
|
| 107 |
-
"Get help": "Βοήθεια",
|
| 108 |
-
"Package details": "Λεπτομέρειες πακέτου",
|
| 109 |
-
"Translations (PO)": "Μεταφράσεις (PO)",
|
| 110 |
-
"Template (POT)": "Πρότυπο (POT)",
|
| 111 |
-
"File permissions": "Δικαιώματα αρχείου",
|
| 112 |
-
"Extends: %s": "Επεκτείνεται σε: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 γλώσσα",
|
| 115 |
-
"other": "%u γλώσσες"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Ενημερώθηκε",
|
| 118 |
-
"Powered by": "Παραγωγή",
|
| 119 |
-
"Loco may not work as expected": "Το Loco μπορεί να μη δουλέψει όπως αναμένεται",
|
| 120 |
-
"Configure Loco Translate": "Διαμόρφωση του Loco Translate",
|
| 121 |
-
"Compiling MO files": "Μεταγλώττιση των αρχείων MO",
|
| 122 |
-
"Use built-in MO compiler.": "Χρήση του ενσωματωμένου μεταγλωττιστή MO.",
|
| 123 |
-
"Use external command:": "Χρήση εξωτερικής εντολής:",
|
| 124 |
-
"Enter path to msgfmt on server": "Εισάγετε τη διεύθυνση για το msgfmt στο διακομιστή",
|
| 125 |
-
"Generate hash tables": "Δημιουργία των hash tables",
|
| 126 |
-
"Include Fuzzy strings": "Συμπερίληψη ασαφών χαρακτήρων",
|
| 127 |
-
"Backing up PO files": "Δημιουργία αντιγράφων ασφαλείας των αρχείων PO",
|
| 128 |
-
"Number of backups to keep of each file:": "Ποσότητα αντιγράφων ασφαλείας που θα διατηρηθούν για κάθε αρχείο:",
|
| 129 |
-
"Experimental features": "Πειραματικά χαρακτηριστικά",
|
| 130 |
-
"Enable WordPress core translations": "Ενεργοποίηση μεταφράσεων του πυρήνα του WordPress",
|
| 131 |
-
"Save settings": "Αποθήκευση ρυθμίσεων",
|
| 132 |
-
"Template file": "Πρότυπο αρχείο",
|
| 133 |
-
"Switch to...": "Μετάβαση σε...",
|
| 134 |
-
"never": "ποτέ",
|
| 135 |
-
"Save": "Αποθήκευση",
|
| 136 |
-
"Download": "Λήψη",
|
| 137 |
-
"Sync": "Συγχρονισμός",
|
| 138 |
-
"Revert": "Επαναφορά",
|
| 139 |
-
"Add": "Προσθήκη",
|
| 140 |
-
"Del": "Διαγραφή",
|
| 141 |
-
"Fuzzy": "Ασαφή",
|
| 142 |
-
"Filter translations": "Φιλτράρισμα μεταφράσεων",
|
| 143 |
-
"Help": "Βοήθεια",
|
| 144 |
-
"Initialize new translations in %s": "Προετοιμασία νέων μεταφράσεων στο %s",
|
| 145 |
-
"Select from common languages": "Επιλέξτε από τις κοινές γλώσσες",
|
| 146 |
-
"or enter any language code": "ή εισάγετε έναν κωδικό γλώσσας",
|
| 147 |
-
"create in <code>%s</code>": "δημιουργία στο %s",
|
| 148 |
-
"create in global languages directory": "δημιουργία στο φάκελο γενικών γλωσσών",
|
| 149 |
-
"Start translating": "Έναρξη μετάφρασης",
|
| 150 |
-
"New version available": "Διαθέσιμη νέα έκδοση",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Αναβάθμιση στην έκδοση %s του Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Επιλέξτε ένα πρόσθετο ή ένα θέμα για μετάφραση",
|
| 153 |
-
"Themes": "Θέματα",
|
| 154 |
-
"Plugins": "Πρόσθετα",
|
| 155 |
-
"Core": "Πυρήνας",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "Η επέκταση του PHP \"%s\" δεν είναι εγκατεστημένη. Εάν αντιμετωπίσετε προβλήματα θα πρέπει να την εκαταστήσετε.",
|
| 157 |
-
"Unknown error": "Άγνωστο λάθος",
|
| 158 |
-
"PO file saved": "Το αρχείο PO αποθηκεύτηκε",
|
| 159 |
-
"and MO file compiled": "και το αρχείο MO μεταγλωττίστηκε",
|
| 160 |
-
"Merged from %s": "Συγχώνευση από %s",
|
| 161 |
-
"Merged from source code": "Συγχώνευση από τον πηγαίο κώδικα",
|
| 162 |
-
"Already up to date with %s": "Ήδη ενημερωμένο με το %s",
|
| 163 |
-
"Already up to date with source code": "Ήδη ενημερωμένο με τον πηγαίο κώδικα",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "Προστέθηκε 1 καινούργια φράση",
|
| 166 |
-
"other": "Προστέθηκαν %s καινούργιες φράσεις"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "Αφαιρέθηκε 1 απαρχαιωμένη φράση",
|
| 170 |
-
"other": "Αφαιρέθηκαν %s απαρχαιωμένες φράσεις"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Οι αλλαγές που κάνατε θα χαθούν εάν συνεχίσετε χωρίς να κάνετε αποθήκευση",
|
| 173 |
-
"Source text": "Κείμενο πηγής",
|
| 174 |
-
"%s translation": "%s μετάφραση",
|
| 175 |
-
"Comments": "Σχόλια",
|
| 176 |
-
"Context": "Πλαίσιο",
|
| 177 |
-
"Translation": "Μετάφραση",
|
| 178 |
-
"No source files in this package, nothing to sync": "Δεν υπάρχουν αρχεία πηγής σε αυτό το πακέτο, δε μπορεί να συγχρονιστεί κάτι",
|
| 179 |
-
"No strings could be extracted from source files": "Δε μπόρεσαν να εξαχθούν φράσεις από τα αρχεία πηγής",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "Μεταφράστε πρόσθετα ή θέματα του WordPress απευθείας στον browser σας",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-es_ES.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: es-ES, Spanish (Spain)
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:07 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Error",
|
| 38 |
-
"Warning": "Atención",
|
| 39 |
-
"OK": "Correcto",
|
| 40 |
-
"Permission denied": "Permiso denegado",
|
| 41 |
-
"Settings saved": "Configuración guardada",
|
| 42 |
-
"%s is not an official WordPress language": "%s no es un nombre oficial de idioma de WordPress",
|
| 43 |
-
"New PO file": "Nuevo fichero PO",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "Fichero PO utilizado como plantilla. Se renombrará a %s la primera vez que lo guarde",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Debe\n \nespecificar\n \nuna\n \nconfiguración regional\n \nválida\n \npara\n \nun\n \nnuevo\n \narchivo\n \nPO",
|
| 46 |
-
"No translatable strings found": "Sin\n \nlas cadenas\n \ntraducibles\n \nencontradas",
|
| 47 |
-
"Cannot create a PO file.": "No se puede crear una archivo PO.",
|
| 48 |
-
"PO file already exists with locale %s": "El archivo PO ya existe con la configuración regional %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "El archivo no puede crearse automáticamente. \nFijar\n \nlos\n \npermisos\n de \narchivo\n \no\n \nutilice\n D\nescarga\nr \nen vez\n \nde\n G\nuardar",
|
| 50 |
-
"%s file is empty": "El fichero %s está vacío",
|
| 51 |
-
"Run Sync to update from source code": "Ejecutar Sinc para actualizar desde el código fuente",
|
| 52 |
-
"No strings could be extracted from source code": "No se pueden extraer las cadenas del código fuente",
|
| 53 |
-
"Run Sync to update from %s": "Ejecutar Sinc para actualizar desde %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "El código fuente ha sido modificado, ejecute Sinc para actualizar POT",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT ha sido modificado desde que el archivo PO fué guardado, ejecute Sync para actualizar",
|
| 56 |
-
"Bad file path": "Ruta\n de \narchivo\n \nincorrecta",
|
| 57 |
-
"Empty or invalid %s file": "Archivo %s vacío o no válido",
|
| 58 |
-
"%s file has no header": "El archivo %s no tiene cabecera",
|
| 59 |
-
"New template": "Nueva plantilla",
|
| 60 |
-
"New language": "Nuevo idioma",
|
| 61 |
-
"%s%% translated": "%s%% traducido",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 cadena",
|
| 64 |
-
"other": "%s cadenas"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s fuzzy",
|
| 67 |
-
"%s untranslated": "%s no traducido",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Fallo al compilar el archivo PO con el compilador integrado",
|
| 69 |
-
"Loco, Translation Management": "Loco, Gestión de Traducción",
|
| 70 |
-
"Manage translations": "Gestionar traducciones",
|
| 71 |
-
"Translation options": "Opciones de traducción",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Configuración",
|
| 74 |
-
"File download failed": "Descarga de archivo fallida",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG está obsoleto y debería de quitarse de wp-config.php",
|
| 76 |
-
"Unknown language": "Idioma desconocido",
|
| 77 |
-
"Some files not writable": "Algunos archivos no grabables",
|
| 78 |
-
"Some files missing": "Faltan algunos archivos",
|
| 79 |
-
"\"%s\" folder not writable": "La carpeta \"%s\" no es grabable",
|
| 80 |
-
"POT file not writable": "Archivo POT no es grabable",
|
| 81 |
-
"PO file not writable": "Archivo PO no es grabable",
|
| 82 |
-
"MO file not writable": "Archivo MO no es grabable",
|
| 83 |
-
"MO file not found": "Archivo MO no encontrado",
|
| 84 |
-
"Folder not writable": "No se puede escribir en la carpeta",
|
| 85 |
-
"Folder not found": "Carpeta no encontrada",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s no declara un \"Text Domain\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "Loco ha adivinado \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s no declara una \"Ruta de Dominio\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s no tiene un fichero POT. Crear uno en \"%s/%s.pot\" si lo necesita.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s tiene un nombre de archivo POT extraño. Un mejor nombre sería \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "El usuario no tiene permiso para gestionar traducciones",
|
| 92 |
-
"Invalid data posted to server": "Datos no válidos publicados en el servidor",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Fallo al compilar el archivo MO con %s, compruebe su configuración",
|
| 94 |
-
"Package not found called %s": "Paquete llamado %s no encontrado",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "El servidor web no puede hacer copias de seguridad en \"%s\". Establezca los permisos de fichero o deshabilite las copias de seguridad en configuración",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "El servidor web no puede crear la carpeta \"%s\" en \"%s\". Establezca los permisos de fichero o créelo manualmente.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "El servidor web no puede crear archivos en la carpeta \"%s\". Establezca los permisos de archivo o utilice la función de descarga.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "El archivo %s no se puede escribir por el servidor web. Establezca los permisos o descargue y cópielo a \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "No se puede crear el archivo MO",
|
| 100 |
-
"Cannot overwrite MO file": "No se puede sobreescribir el archivo MO",
|
| 101 |
-
"Failed to write MO file": "Fallo al escribir el archivo MO",
|
| 102 |
-
"Packages": "Paquetes",
|
| 103 |
-
"File check": "Comprobar archivo",
|
| 104 |
-
"File system permissions for %s": "Permisos del sistema de archivos para %s",
|
| 105 |
-
"Other potential issues with %s": "Otros posibles problemas con %s",
|
| 106 |
-
"Back": "Volver",
|
| 107 |
-
"Get help": "Obtener ayuda",
|
| 108 |
-
"Package details": "Detalles\n del \npaquete",
|
| 109 |
-
"Translations (PO)": "Traducciones (PO)",
|
| 110 |
-
"Template (POT)": "Plantilla (POT)",
|
| 111 |
-
"File permissions": "Permisos de archivo",
|
| 112 |
-
"Extends: %s": "Extiende: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 idioma",
|
| 115 |
-
"other": "%u idiomas"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Actualizado",
|
| 118 |
-
"Powered by": "Funciona con",
|
| 119 |
-
"Loco may not work as expected": "Loco puede no funcionar como se esperaba",
|
| 120 |
-
"Configure Loco Translate": "Configurar Loco Translate",
|
| 121 |
-
"Compiling MO files": "Compilando archivo MO",
|
| 122 |
-
"Use built-in MO compiler.": "Utilizar compilador MO integrado.",
|
| 123 |
-
"Use external command:": "Utilice\n el \ncomando\n \nexterno\n:",
|
| 124 |
-
"Enter path to msgfmt on server": "Introduzca la carpeta del servidor msgfmt",
|
| 125 |
-
"Generate hash tables": "Generar\n \ntablas\n \nhash",
|
| 126 |
-
"Include Fuzzy strings": "",
|
| 127 |
-
"Backing up PO files": "Haciendo copia de seguridad de archivos PO",
|
| 128 |
-
"Number of backups to keep of each file:": "Número de copias de seguridad para mantener de cada archivo:",
|
| 129 |
-
"Experimental features": "Características experimentales",
|
| 130 |
-
"Enable WordPress core translations": "Habilitar traducciones del núcleo de WordPress",
|
| 131 |
-
"Save settings": "Guardar configuración",
|
| 132 |
-
"Template file": "Archivo de plantilla",
|
| 133 |
-
"Switch to...": "Cambiar a...",
|
| 134 |
-
"never": "nunca",
|
| 135 |
-
"Save": "Guardar",
|
| 136 |
-
"Download": "Descargar",
|
| 137 |
-
"Sync": "Sinc",
|
| 138 |
-
"Revert": "Deshacer",
|
| 139 |
-
"Add": "Añadir",
|
| 140 |
-
"Del": "Eliminar",
|
| 141 |
-
"Fuzzy": "Fuzzy",
|
| 142 |
-
"Filter translations": "Filtrar traducciones",
|
| 143 |
-
"Help": "Ayuda",
|
| 144 |
-
"Initialize new translations in %s": "Comenzar nuevas traducciones en %s",
|
| 145 |
-
"Select from common languages": "Seleccione de lenguajes comunes",
|
| 146 |
-
"or enter any language code": "o introduzca cualquier código de idioma",
|
| 147 |
-
"create in <code>%s</code>": "crear en <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "crear en la carpeta global de idiomas",
|
| 149 |
-
"Start translating": "Comenzar la traducicción",
|
| 150 |
-
"New version available": "Disponible nueva versión",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Actualizar a la versión %s de Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Seleccione un plugin o tema para traducir",
|
| 153 |
-
"Themes": "Temas",
|
| 154 |
-
"Plugins": "Plugins",
|
| 155 |
-
"Core": "Núcleo",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "La extensión PHP \"%s\" no está instalada. Si experimenta problemas debería instalarlo",
|
| 157 |
-
"Unknown error": "Error desconocido",
|
| 158 |
-
"PO file saved": "Fichero PO guardado",
|
| 159 |
-
"and MO file compiled": "y compilado el fichero MO",
|
| 160 |
-
"Merged from %s": "Combinado desde %s",
|
| 161 |
-
"Merged from source code": "Combinado desde el código fuente",
|
| 162 |
-
"Already up to date with %s": "Ya actualizado con %s",
|
| 163 |
-
"Already up to date with source code": "Actualizado ya con el código fuente",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "Añadido 1 nueva cadena",
|
| 166 |
-
"other": "Añadidas %s nuevas cadenas"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 cadena obsoleta eliminada",
|
| 170 |
-
"other": "%s cadenas obsoletas eliminadas"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Los cambios se perderán si continúa sin guardarlos",
|
| 173 |
-
"Source text": "Texto origen",
|
| 174 |
-
"%s translation": "%s traducción",
|
| 175 |
-
"Comments": "Comentarios",
|
| 176 |
-
"Context": "Contexto",
|
| 177 |
-
"Translation": "Traducción",
|
| 178 |
-
"No source files in this package, nothing to sync": "",
|
| 179 |
-
"No strings could be extracted from source files": "No se pueden extraer las cadenas de los archivos fuente",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-fa_IR.js
DELETED
|
@@ -1,172 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: fa-IR, Persian
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:07 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"other"
|
| 14 |
-
];
|
| 15 |
-
|
| 16 |
-
// calc numeric index of a plural form (0-0)
|
| 17 |
-
function pluralIndex( n ){
|
| 18 |
-
return Number( 0 );
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
// expose public t() function
|
| 22 |
-
return function( msgid1, msgid2, n ){
|
| 23 |
-
var value = pairs[msgid1];
|
| 24 |
-
// singular if no multiplier
|
| 25 |
-
if( null == n ){
|
| 26 |
-
n = 1;
|
| 27 |
-
}
|
| 28 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 29 |
-
if( value instanceof Object ){
|
| 30 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 31 |
-
}
|
| 32 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 33 |
-
};
|
| 34 |
-
}(
|
| 35 |
-
{
|
| 36 |
-
"Error": "خطا",
|
| 37 |
-
"Warning": "اخطار",
|
| 38 |
-
"OK": "اوکی",
|
| 39 |
-
"Permission denied": "دسترسی امکان پذیر نیست",
|
| 40 |
-
"Settings saved": "تنظیمات ذخیره شد",
|
| 41 |
-
"%s is not an official WordPress language": "",
|
| 42 |
-
"New PO file": "فایل PO جدید",
|
| 43 |
-
"PO file used as template. This will be renamed to %s on first save": "فایل PO به جای قالب استفاده شد. در ذخیره اول، فایل به نام %s تغییر نام خواهد داد",
|
| 44 |
-
"You must specify a valid locale for a new PO file": "شما باید یک مسیر قابل قبول برای فایل PO مشخص کنید",
|
| 45 |
-
"No translatable strings found": "هیچ سطری برای ترجمه پیدا نشد",
|
| 46 |
-
"Cannot create a PO file.": "ساخت فایل PO امکان پذیر نیست",
|
| 47 |
-
"PO file already exists with locale %s": "فایل PO قبلا برای زبان %s وجیو دارد",
|
| 48 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "فایل قایل دخیره شدن نیست. اجازه دسترسی فایل ها را درست کنید یا از دریافت به جای دخیره استفاده کنید",
|
| 49 |
-
"%s file is empty": "فایل %s خالی است",
|
| 50 |
-
"Run Sync to update from source code": "اجرای هماهنگ سازی برای به روز رسانی سورس کد",
|
| 51 |
-
"No strings could be extracted from source code": "هیچ سطری از سورس کد پیدا نشد",
|
| 52 |
-
"Run Sync to update from %s": "اجرای هماهنگ سازی برای به روز رسانی از %s",
|
| 53 |
-
"Source code has been modified, run Sync to update POT": "سورس کد ویرایش شده است؛ برای به روز رسانی، هماهنگ سازی را اجرا کنید",
|
| 54 |
-
"POT has been modified since PO file was saved, run Sync to update": "از زمانی که فایل PO ذخیره شده بود، فایل POT ویرایش شده است. هماهنگ سازی را اجرا کنید",
|
| 55 |
-
"Bad file path": "مسیر قایل قبول نیست",
|
| 56 |
-
"Empty or invalid %s file": "فایل %s خالی یا غیر قابل قبول می باشد",
|
| 57 |
-
"%s file has no header": "فایل %s دارای سربرگ نمی باشد",
|
| 58 |
-
"New template": "فرم جدید",
|
| 59 |
-
"New language": "زبان جدید",
|
| 60 |
-
"%s%% translated": "%s%% ترجمه شده",
|
| 61 |
-
"1 string": "%s سطر",
|
| 62 |
-
"%s fuzzy": "%s مبهم",
|
| 63 |
-
"%s untranslated": "%s ترجمه نشده",
|
| 64 |
-
"Failed to compile MO file with built-in compiler": "فایل MO با کامپایلر توکار، کامپایل نشد",
|
| 65 |
-
"Loco, Translation Management": "لوکو، مدریت ترجمه",
|
| 66 |
-
"Manage translations": "مدریت ترجمه ها",
|
| 67 |
-
"Translation options": "تنظیمات ترجمه ها",
|
| 68 |
-
"Loco Translate": "مترجم لوکو",
|
| 69 |
-
"Settings": "تنظیمات",
|
| 70 |
-
"File download failed": "خطا در دریافت فایل",
|
| 71 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG منسوخ شده و باید از wp-config.php پاک شود",
|
| 72 |
-
"Unknown language": "زبان نا آشنا",
|
| 73 |
-
"Some files not writable": "تعدادی از فایل قابل نوشتن نیستند",
|
| 74 |
-
"Some files missing": "تعدادی از فایل ها موجود نیستند",
|
| 75 |
-
"\"%s\" folder not writable": "پوشه %s قابل نوشتن نیست",
|
| 76 |
-
"POT file not writable": "فایل POT قایل نوشتن نیست",
|
| 77 |
-
"PO file not writable": "فایل PO فابل نوشتن نیست",
|
| 78 |
-
"MO file not writable": "فایل MO فابل نوشتن نیست",
|
| 79 |
-
"MO file not found": "فایل MO پیدا نشد",
|
| 80 |
-
"Folder not writable": "پوشه قایل نوشتن نیست",
|
| 81 |
-
"Folder not found": "پوشه پیدا نشد",
|
| 82 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 83 |
-
"Loco has guessed \"%s\"": "",
|
| 84 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 85 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 86 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 87 |
-
"User does not have permission to manage translations": "کاربر دسترسی لازم برای مدریت ترجمه ها را ندارد",
|
| 88 |
-
"Invalid data posted to server": "داده نادرست به سرور ارسال شده",
|
| 89 |
-
"Failed to compile MO file with %s, check your settings": "خطای کامپایل فایل MO با %s. تنظیمات خود را برسی کنید",
|
| 90 |
-
"Package not found called %s": "بسته ای با نام %s پیدا نشد",
|
| 91 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "سرور نمی تواند در %s پشتیبان تهیه کند. اجازه دسترسی را درست کنید یا پشتیبان گیری را غیر فعال کنید",
|
| 92 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "سرور نمی تواند پوشه %s را در %s یسازد. اجازه دسترسی بدهید و یا پوشه را به صورت دستی بسازید",
|
| 93 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "سرور نمی تواند فایلی در %s بسازد. اجازه دسترسی بدهید و یا از امکان دریافت استفاده کنید",
|
| 94 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "فایل %s قابل نوشتن نیست. اجازه دسترسی بدهید و یا یک نسخه به %s/%s کپی کنید",
|
| 95 |
-
"Cannot create MO file": "فایل MO ساخته نشد",
|
| 96 |
-
"Cannot overwrite MO file": "فایل MO دوباره نویسی نشد",
|
| 97 |
-
"Failed to write MO file": "فایل MO نوشته نشد",
|
| 98 |
-
"Packages": "بسته ها",
|
| 99 |
-
"File check": "چک فایل",
|
| 100 |
-
"File system permissions for %s": "اجازه دسترسی برای %s",
|
| 101 |
-
"Other potential issues with %s": "",
|
| 102 |
-
"Back": "فبلی",
|
| 103 |
-
"Get help": "کمک بگیرید",
|
| 104 |
-
"Package details": "جزئیات بسته",
|
| 105 |
-
"Translations (PO)": "ترجمه (PO)",
|
| 106 |
-
"Template (POT)": "قالب (POT)",
|
| 107 |
-
"File permissions": "دسترسی فایل",
|
| 108 |
-
"Extends: %s": "اضافه شد: %s",
|
| 109 |
-
"1 language": "%u زبان",
|
| 110 |
-
"Updated": "به روز رسانی شد",
|
| 111 |
-
"Powered by": "قدرت گرفته توسط",
|
| 112 |
-
"Loco may not work as expected": "لوکو ممکن است درست کار نکند",
|
| 113 |
-
"Configure Loco Translate": "تنظیم مترجم لوکو",
|
| 114 |
-
"Compiling MO files": "در حال کامپایل فایل MO",
|
| 115 |
-
"Use built-in MO compiler.": "استفاده از کامپایر توکار MO.",
|
| 116 |
-
"Use external command:": "استفاده از دستور خارجی:",
|
| 117 |
-
"Enter path to msgfmt on server": "وارد کردن مسیر msgfmt در سرور",
|
| 118 |
-
"Generate hash tables": "ساختن جدول hash",
|
| 119 |
-
"Include Fuzzy strings": "",
|
| 120 |
-
"Backing up PO files": "پشتیبان گیری از فایل های PO",
|
| 121 |
-
"Number of backups to keep of each file:": "تعداد پشتیبان های گرفته شده از هر فایل:",
|
| 122 |
-
"Experimental features": "قابلیت های آزمایشی",
|
| 123 |
-
"Enable WordPress core translations": "فعال سازی ترجمه هسته وردپرس",
|
| 124 |
-
"Save settings": "دخیره تنظیمات",
|
| 125 |
-
"Template file": "قالب فایل",
|
| 126 |
-
"Switch to...": "تعویض به",
|
| 127 |
-
"never": "هرگز",
|
| 128 |
-
"Save": "ذخیره",
|
| 129 |
-
"Download": "دریافت",
|
| 130 |
-
"Sync": "هماهنگ سازی",
|
| 131 |
-
"Revert": "برگرداندن",
|
| 132 |
-
"Add": "اضافه کردن",
|
| 133 |
-
"Del": "پاک کردن",
|
| 134 |
-
"Fuzzy": "مبهم",
|
| 135 |
-
"Filter translations": "فیلتر ترجمه",
|
| 136 |
-
"Help": "کمک",
|
| 137 |
-
"Initialize new translations in %s": "ایجاد فایل ترجمه برای %s",
|
| 138 |
-
"Select from common languages": "یکی از زبان های متداول رو انتخاب کنید",
|
| 139 |
-
"or enter any language code": "یا کد زبان را وارد کنید",
|
| 140 |
-
"create in <code>%s</code>": "در <code>%s</code> ساخته شود",
|
| 141 |
-
"create in global languages directory": "در پوشه ترجمه های سراسری ساخته شود",
|
| 142 |
-
"Start translating": "شروع ترجمه",
|
| 143 |
-
"New version available": "نسخه جدید آماده است",
|
| 144 |
-
"Upgrade to version %s of Loco Translate": "به نسخه %s مترجم لوکو به روز رسانی شد",
|
| 145 |
-
"Select a plugin or theme to translate": "یک افزونه یا پوسته را برای ترجمه انتخاب کنید",
|
| 146 |
-
"Themes": "پوسته ها",
|
| 147 |
-
"Plugins": "افزونه ها",
|
| 148 |
-
"Core": "هسته",
|
| 149 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 150 |
-
"Unknown error": "خطای نا آشنا",
|
| 151 |
-
"PO file saved": "فایل PO ذخیره شد",
|
| 152 |
-
"and MO file compiled": "و فایل MO کامپایل شد",
|
| 153 |
-
"Merged from %s": "از %s یکی سازی شد",
|
| 154 |
-
"Merged from source code": "یکی سازی از سورس کد",
|
| 155 |
-
"Already up to date with %s": "قبلا با %s به روز است",
|
| 156 |
-
"Already up to date with source code": "قبلا با سورس کد به روز است",
|
| 157 |
-
"1 new string added": "%s سطر اضافه شد",
|
| 158 |
-
"1 obsolete string removed": "%s سطر قدیمی پاک شد",
|
| 159 |
-
"Your changes will be lost if you continue without saving": "اگر بدون ذخیره کردن ادامه دهید، تنظیمات شما پاک خواهد شد",
|
| 160 |
-
"Source text": "متن",
|
| 161 |
-
"%s translation": "ترجمه %s",
|
| 162 |
-
"Comments": "یادداشت",
|
| 163 |
-
"Context": "متن",
|
| 164 |
-
"Translation": "ترجمه",
|
| 165 |
-
"No source files in this package, nothing to sync": "هیج فایل سورسی در این بسته پیدا نشد؛ چیزی برای هماهنگ سازی نیست",
|
| 166 |
-
"No strings could be extracted from source files": "هیچ سطری از سورس کد وارد نشد",
|
| 167 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 168 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 169 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 170 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 171 |
-
}
|
| 172 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-fr_FR.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: fr-FR, French (France)
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:08 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n > 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Erreur",
|
| 38 |
-
"Warning": "Avertissement",
|
| 39 |
-
"OK": "Succès",
|
| 40 |
-
"Permission denied": "Non autorisé",
|
| 41 |
-
"Settings saved": "Paramètres enregistrés",
|
| 42 |
-
"%s is not an official WordPress language": "",
|
| 43 |
-
"New PO file": "Nouveau fichier de traduction (fichier PO)",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "Fichier de traduction (fichier PO) utilisé comme modèle. Ce fichier sera renommé en %s au premier enregistrement",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Vous devez indiquer une région valide pour le nouveau fichier de traduction (fichier PO)",
|
| 46 |
-
"No translatable strings found": "Aucune chaîne de caractères à traduire",
|
| 47 |
-
"Cannot create a PO file.": "Impossible de créer le fichier de traduction (fichier PO).",
|
| 48 |
-
"PO file already exists with locale %s": "Le fichier de traduction (fichier PO) existe déjà pour la région %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Le fichier ne peut pas être créé automatiquement. Fixez les autorisations du fichier ou utilisez la fonction Télécharger au lieu de Sauvegarder",
|
| 50 |
-
"%s file is empty": "Le fichier %s est vide",
|
| 51 |
-
"Run Sync to update from source code": "Exécutez Synchro pour mettre à jour depuis le code source",
|
| 52 |
-
"No strings could be extracted from source code": "Aucune chaîne de caractères n'a pu être extraire du code source",
|
| 53 |
-
"Run Sync to update from %s": "Exécutez Synchro pour mettre à jour depuis %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Le code source a été modifié, exécutez Synchro pour mettre à jour le modèle (fichier POT)",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "Le modèle (fichier POT) a été mis à jour depuis la dernière modification du fichier de traduction (fichier PO), exécutez Synchro pour mettre à jour ce dernier",
|
| 56 |
-
"Bad file path": "Mauvais chemin de fichier",
|
| 57 |
-
"Empty or invalid %s file": "Le fichier %s est vide ou non-valide",
|
| 58 |
-
"%s file has no header": "Le fichier %s n'a pas d'en-têtes",
|
| 59 |
-
"New template": "Nouveau modèle",
|
| 60 |
-
"New language": "Nouvelle langue",
|
| 61 |
-
"%s%% translated": "%s%% traduit",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 chaîne de caractères",
|
| 64 |
-
"other": "%s chaînes de caractères"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s floues",
|
| 67 |
-
"%s untranslated": "%s non traduites",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Impossible de compiler le fichier binaire de traduction (fichier MO) avec le compilateur intégré",
|
| 69 |
-
"Loco, Translation Management": "Loco, Gestionnaire de Traduction",
|
| 70 |
-
"Manage translations": "Traductions",
|
| 71 |
-
"Translation options": "Paramètres",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Paramètres",
|
| 74 |
-
"File download failed": "Le téléchargement du fichier a échoué",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "La constante WPLANG est dépréciée et devrait être supprimée de wp-config.php",
|
| 76 |
-
"Unknown language": "Région inconnue",
|
| 77 |
-
"Some files not writable": "Certains fichiers ne sont pas accessibles en écriture",
|
| 78 |
-
"Some files missing": "Certains fichiers sont manquants",
|
| 79 |
-
"\"%s\" folder not writable": "Le répertoire \"%s\" n'est pas accessible en écriture",
|
| 80 |
-
"POT file not writable": "Le modèle (fichier POT) n'est pas accessible en écriture",
|
| 81 |
-
"PO file not writable": "Le fichier de traduction (fichier PO) n'est pas accessible en écriture",
|
| 82 |
-
"MO file not writable": "Le fichier binaire de traduction (fichier MO) n'est pas accessible en écriture",
|
| 83 |
-
"MO file not found": "Le fichier binaire de traduction (fichier MO) n'a pas été trouvé",
|
| 84 |
-
"Folder not writable": "Répertoire non accessible en écriture",
|
| 85 |
-
"Folder not found": "Répertoire non trouvé",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 87 |
-
"Loco has guessed \"%s\"": "",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 91 |
-
"User does not have permission to manage translations": "L'utilisateur n'a pas les droits d'accès nécessaires pour gérer les traductions",
|
| 92 |
-
"Invalid data posted to server": "Données non valides envoyées au serveur",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Impossible de compiler le fichier binaire de traduction (fichier MO) avec %s, vérifiez vos paramètres",
|
| 94 |
-
"Package not found called %s": "Le paquetage %s n'a pas été trouvé",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Le serveur web ne peut pas créer de sauvegardes dans \"%s\". Résolvez les droits d'accès au fichier ou désactivez les sauvegardes dans les paramètres",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Le serveur web ne peut pas créer \"%s\" dans \"%s\". Résolvez les droits d'accès au fichier ou créez le manuellement.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Le serveur web ne peut pas créer de fichiers dans \"%s\". Résolvez les droits d'accès au fichier ou utilisez la fonction Télécharger",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Le fichier %s n'est pas accessible en écriture par le serveur web. Résolvez les droits d'accès au fichier ou téléchargez puis copiez dans \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Impossible de créer le fichier binaire de traduction (fichier MO)",
|
| 100 |
-
"Cannot overwrite MO file": "Impossible de réécrire le fichier binaire de traduction (fichier MO)",
|
| 101 |
-
"Failed to write MO file": "Impossible d'écrire dans le fichier binaire de traduction (fichier MO)",
|
| 102 |
-
"Packages": "Paquetages",
|
| 103 |
-
"File check": "Vérification de fichier",
|
| 104 |
-
"File system permissions for %s": "Droits d'accès de %s",
|
| 105 |
-
"Other potential issues with %s": "",
|
| 106 |
-
"Back": "Retour",
|
| 107 |
-
"Get help": "Demander de l'aide",
|
| 108 |
-
"Package details": "Détails du paquetage",
|
| 109 |
-
"Translations (PO)": "Traductions (PO)",
|
| 110 |
-
"Template (POT)": "Modèles (POT)",
|
| 111 |
-
"File permissions": "Droits d'accès",
|
| 112 |
-
"Extends: %s": "Étend : %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 langue",
|
| 115 |
-
"other": "%u langues"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Mise à jour",
|
| 118 |
-
"Powered by": "Propulsé par",
|
| 119 |
-
"Loco may not work as expected": "Loco peut ne pas fonctionner correctement",
|
| 120 |
-
"Configure Loco Translate": "Paramétrez Loco Translate",
|
| 121 |
-
"Compiling MO files": "Compilation des fichiers binaires de traduction (fichiers MO)",
|
| 122 |
-
"Use built-in MO compiler.": "Utiliser le compilateur intégré.",
|
| 123 |
-
"Use external command:": "Utiliser une commande personnalisée :",
|
| 124 |
-
"Enter path to msgfmt on server": "Entrez le chemin d'accès à msgfmt sur le serveur",
|
| 125 |
-
"Generate hash tables": "Générer les tables de hachage",
|
| 126 |
-
"Include Fuzzy strings": "",
|
| 127 |
-
"Backing up PO files": "Sauvegarde des fichiers de traduction (fichiers PO)",
|
| 128 |
-
"Number of backups to keep of each file:": "Nombre de sauvegardes à conserver pour chaque fichier :",
|
| 129 |
-
"Experimental features": "Fonctionnalités expérimentales",
|
| 130 |
-
"Enable WordPress core translations": "Activer la traduction des fichiers principaux de WordPress",
|
| 131 |
-
"Save settings": "Enregistrer les paramètres",
|
| 132 |
-
"Template file": "Modèle",
|
| 133 |
-
"Switch to...": "Permuter avec…",
|
| 134 |
-
"never": "jamais",
|
| 135 |
-
"Save": "Sauvegarder",
|
| 136 |
-
"Download": "Télécharger",
|
| 137 |
-
"Sync": "Synchro",
|
| 138 |
-
"Revert": "Rétablir",
|
| 139 |
-
"Add": "Ajouter",
|
| 140 |
-
"Del": "Supprimer",
|
| 141 |
-
"Fuzzy": "Flou",
|
| 142 |
-
"Filter translations": "Filtrer les traductions",
|
| 143 |
-
"Help": "Aide",
|
| 144 |
-
"Initialize new translations in %s": "Créer une nouvelle traduction pour %s",
|
| 145 |
-
"Select from common languages": "Choisir parmi les langues courantes",
|
| 146 |
-
"or enter any language code": "ou choisir un code régional",
|
| 147 |
-
"create in <code>%s</code>": "créer dans <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "créer dans le répertoire global des langues",
|
| 149 |
-
"Start translating": "Traduire",
|
| 150 |
-
"New version available": "Nouvelle version disponible",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Passer à la version %s de Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Choisissez une extension ou un thème à traduire",
|
| 153 |
-
"Themes": "Thèmes",
|
| 154 |
-
"Plugins": "Extensions",
|
| 155 |
-
"Core": "Fichiers principaux",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 157 |
-
"Unknown error": "Erreur inconnue",
|
| 158 |
-
"PO file saved": "Fichier de traduction (fichier PO) sauvegardé",
|
| 159 |
-
"and MO file compiled": "et fichier binaire de traduction (fichier MO) compilé",
|
| 160 |
-
"Merged from %s": "Fusionné avec %s",
|
| 161 |
-
"Merged from source code": "Fusionné depuis le code source",
|
| 162 |
-
"Already up to date with %s": "Déjà à jour avec %s",
|
| 163 |
-
"Already up to date with source code": "Déjà à jour avec le code source",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 nouvelle chaîne de caractères a été ajoutée",
|
| 166 |
-
"other": "%s nouvelles chaînes de caractères ont été ajoutées"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 chaîne de caractères obsolète a été supprimée",
|
| 170 |
-
"other": "%s chaînes de caractères obsolètes ont été supprimées"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Vos modifications seront perdues si vous ne sauvegardez pas avant de continuer",
|
| 173 |
-
"Source text": "Source",
|
| 174 |
-
"%s translation": "%s traduction",
|
| 175 |
-
"Comments": "Commentaires",
|
| 176 |
-
"Context": "Contexte",
|
| 177 |
-
"Translation": "Traduction",
|
| 178 |
-
"No source files in this package, nothing to sync": "Aucun fichier source dans ce paquetage, il n'y a rien à synchroniser",
|
| 179 |
-
"No strings could be extracted from source files": "Aucune chaîne de caractères n'a pu être extraite des fichiers sources",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-id_ID.js
DELETED
|
@@ -1,172 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: id-ID, Indonesian
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:08 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"other"
|
| 14 |
-
];
|
| 15 |
-
|
| 16 |
-
// calc numeric index of a plural form (0-0)
|
| 17 |
-
function pluralIndex( n ){
|
| 18 |
-
return Number( 0 );
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
// expose public t() function
|
| 22 |
-
return function( msgid1, msgid2, n ){
|
| 23 |
-
var value = pairs[msgid1];
|
| 24 |
-
// singular if no multiplier
|
| 25 |
-
if( null == n ){
|
| 26 |
-
n = 1;
|
| 27 |
-
}
|
| 28 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 29 |
-
if( value instanceof Object ){
|
| 30 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 31 |
-
}
|
| 32 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 33 |
-
};
|
| 34 |
-
}(
|
| 35 |
-
{
|
| 36 |
-
"Error": "Kesalahan",
|
| 37 |
-
"Warning": "Peringatan",
|
| 38 |
-
"OK": "Oke",
|
| 39 |
-
"Permission denied": "Akses ditolak",
|
| 40 |
-
"Settings saved": "Setelan disimpan",
|
| 41 |
-
"%s is not an official WordPress language": "",
|
| 42 |
-
"New PO file": "Berkas PO baru",
|
| 43 |
-
"PO file used as template. This will be renamed to %s on first save": "Berkas PO digunakan sebagai template. Berkas ini akan diubah namanya menjadi %s saat disimpan",
|
| 44 |
-
"You must specify a valid locale for a new PO file": "Anda harus menentukan locale valid untuk berkas PO baru",
|
| 45 |
-
"No translatable strings found": "Tidak ada string yang dapat diterjemahkan",
|
| 46 |
-
"Cannot create a PO file.": "Berkas PO tidak dapat dibuat",
|
| 47 |
-
"PO file already exists with locale %s": "Berkas PO untuk locale %s sudah ada",
|
| 48 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Berkas tidak dapat dibuat otomatis. Perbaiki hak akses atau gunakan Unduh alih-alih Simpan",
|
| 49 |
-
"%s file is empty": "Berkas %s kosong",
|
| 50 |
-
"Run Sync to update from source code": "Jalankan Sinkronisasi untuk memperbarui dari kode program",
|
| 51 |
-
"No strings could be extracted from source code": "Tidak ada string yang dapat diambil dari kode program",
|
| 52 |
-
"Run Sync to update from %s": "Jalankan Sinkronisasi untuk mengambil dari %s",
|
| 53 |
-
"Source code has been modified, run Sync to update POT": "Kode program telah diubah; jalankan Sinkronisasi untuk memperbarui POT",
|
| 54 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT telah diubah sejak berkas PO terakhir disimpan; jalankan Sinkronisasi untuk memperbarui POT",
|
| 55 |
-
"Bad file path": "Folder berkas salah",
|
| 56 |
-
"Empty or invalid %s file": "Berkas %s kosong atau tidak valid",
|
| 57 |
-
"%s file has no header": "%s berkas tidak memiliki header",
|
| 58 |
-
"New template": "Template baru",
|
| 59 |
-
"New language": "Bahasa baru",
|
| 60 |
-
"%s%% translated": "%s%% diterjemahkan",
|
| 61 |
-
"1 string": "1 string",
|
| 62 |
-
"%s fuzzy": "%s fuzzy",
|
| 63 |
-
"%s untranslated": "%s%% belum diterjemahkan",
|
| 64 |
-
"Failed to compile MO file with built-in compiler": "Gagal mengompilasi berkas MO dengan kompilator bawaan",
|
| 65 |
-
"Loco, Translation Management": "Loco, Pengelola Terjemahan",
|
| 66 |
-
"Manage translations": "Kelola terjemahan",
|
| 67 |
-
"Translation options": "Opsi terjemahan",
|
| 68 |
-
"Loco Translate": "Loco Terjemahan",
|
| 69 |
-
"Settings": "Setelan",
|
| 70 |
-
"File download failed": "Gagal mengunduh berkas",
|
| 71 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "",
|
| 72 |
-
"Unknown language": "Bahasa tidak dikenal",
|
| 73 |
-
"Some files not writable": "Beberapa berkas tidak dapat ditulis",
|
| 74 |
-
"Some files missing": "Beberapa berkas hilang",
|
| 75 |
-
"\"%s\" folder not writable": "Folder \"%s\" tidak dapat ditulisi",
|
| 76 |
-
"POT file not writable": "Berkas POT tidak dapat ditulis",
|
| 77 |
-
"PO file not writable": "Berkas PO tidak dapat ditulis",
|
| 78 |
-
"MO file not writable": "Berkas MO tidak dapat ditulis",
|
| 79 |
-
"MO file not found": "Berkas MO tidak ditemukan",
|
| 80 |
-
"Folder not writable": "Folder tidak dapat ditulisi",
|
| 81 |
-
"Folder not found": "Folder tidak ditemukan",
|
| 82 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 83 |
-
"Loco has guessed \"%s\"": "",
|
| 84 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 85 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 86 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 87 |
-
"User does not have permission to manage translations": "Pengguna tidak memiliki hak akses untuk mengelola terjemahan",
|
| 88 |
-
"Invalid data posted to server": "Data yang dikirim ke server tidak valid",
|
| 89 |
-
"Failed to compile MO file with %s, check your settings": "Gagal mengompilasi berkas MO dengan %s; periksa setelan Anda",
|
| 90 |
-
"Package not found called %s": "Paket %s tidak ditemukan",
|
| 91 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Tidak dapat membuat cadangan di \"%s\". Perbaiki hak akses atau matikan pencadangan di setelan.",
|
| 92 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Tidak dapat membuat direktori \"%s\" di \"%s\". Perbaiki hak akses atau buat secara manual.",
|
| 93 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Tidak dapat membuat berkas di direktori \"%s\". Perbaiki hak akses atau gunakan fungsi unduh.",
|
| 94 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Berkas %s tidak dapat ditulis. Perbaiki hak akses atau unduh dan salin ke \"%s/%s\".",
|
| 95 |
-
"Cannot create MO file": "Berkas MO tidak dapat dibuat",
|
| 96 |
-
"Cannot overwrite MO file": "Berkas MO tidak dapat ditimpa",
|
| 97 |
-
"Failed to write MO file": "Gagal menulis berkas MO",
|
| 98 |
-
"Packages": "Paket",
|
| 99 |
-
"File check": "Pemeriksaan berkas",
|
| 100 |
-
"File system permissions for %s": "Hak akses sistem berkas untuk %s",
|
| 101 |
-
"Other potential issues with %s": "",
|
| 102 |
-
"Back": "Kembali",
|
| 103 |
-
"Get help": "Dapatkan bantuan",
|
| 104 |
-
"Package details": "Detail paket",
|
| 105 |
-
"Translations (PO)": "Terjemahan (PO)",
|
| 106 |
-
"Template (POT)": "Template (POT)",
|
| 107 |
-
"File permissions": "Hak akses",
|
| 108 |
-
"Extends: %s": "",
|
| 109 |
-
"1 language": "1 bahasa",
|
| 110 |
-
"Updated": "Diperbarui",
|
| 111 |
-
"Powered by": "Didukung oleh",
|
| 112 |
-
"Loco may not work as expected": "Loco mungkin tidak bekerja sesuai harapan",
|
| 113 |
-
"Configure Loco Translate": "Konfigurasikan Loco Translate",
|
| 114 |
-
"Compiling MO files": "Kompilasi berkas MO",
|
| 115 |
-
"Use built-in MO compiler.": "Gunakan kompiler bawaan",
|
| 116 |
-
"Use external command:": "Gunakan perintah eksternal:",
|
| 117 |
-
"Enter path to msgfmt on server": "Masukkan folder msgfmt pada server",
|
| 118 |
-
"Generate hash tables": "Buat tabel hash",
|
| 119 |
-
"Include Fuzzy strings": "",
|
| 120 |
-
"Backing up PO files": "Pencadangan berkas PO",
|
| 121 |
-
"Number of backups to keep of each file:": "Jumlah cadangan untuk tiap berkas:",
|
| 122 |
-
"Experimental features": "Fitur eksperimen",
|
| 123 |
-
"Enable WordPress core translations": "Aktifkan penerjemahan inti WordPress",
|
| 124 |
-
"Save settings": "Simpan setelan",
|
| 125 |
-
"Template file": "Berkas template",
|
| 126 |
-
"Switch to...": "Beralih ke...",
|
| 127 |
-
"never": "tidak pernah",
|
| 128 |
-
"Save": "Simpan",
|
| 129 |
-
"Download": "Unduh",
|
| 130 |
-
"Sync": "Sinkronisasi",
|
| 131 |
-
"Revert": "Kembalikan",
|
| 132 |
-
"Add": "Tambah",
|
| 133 |
-
"Del": "Hapus",
|
| 134 |
-
"Fuzzy": "Fuzzy",
|
| 135 |
-
"Filter translations": "Saring terjemahan",
|
| 136 |
-
"Help": "Bantuan",
|
| 137 |
-
"Initialize new translations in %s": "Buat terjemahan baru di %s",
|
| 138 |
-
"Select from common languages": "Pilih dari bahasa yang umum",
|
| 139 |
-
"or enter any language code": "atau masukkan suatu kode bahasa",
|
| 140 |
-
"create in <code>%s</code>": "buat di <code>%s</code>",
|
| 141 |
-
"create in global languages directory": "buat di direktori bahasa global",
|
| 142 |
-
"Start translating": "Mulai penerjemahan",
|
| 143 |
-
"New version available": "Ada versi baru",
|
| 144 |
-
"Upgrade to version %s of Loco Translate": "Tingkatkan Loco Translate kepada versi %s",
|
| 145 |
-
"Select a plugin or theme to translate": "Pilih plugin atau tema untuk diterjemahkan",
|
| 146 |
-
"Themes": "Tema",
|
| 147 |
-
"Plugins": "Plugin",
|
| 148 |
-
"Core": "Inti",
|
| 149 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 150 |
-
"Unknown error": "Kesalahan ",
|
| 151 |
-
"PO file saved": "Berkas PO disimpan",
|
| 152 |
-
"and MO file compiled": "dan berkas MO dikompilasi",
|
| 153 |
-
"Merged from %s": "Digabungkan dari %s",
|
| 154 |
-
"Merged from source code": "Digabungkan dari kode program",
|
| 155 |
-
"Already up to date with %s": "Sudah selaras dengan %s",
|
| 156 |
-
"Already up to date with source code": "Sudah selaras dengan kode program",
|
| 157 |
-
"1 new string added": "1 string baru ditambahkan",
|
| 158 |
-
"1 obsolete string removed": "1 string usang dihapus",
|
| 159 |
-
"Your changes will be lost if you continue without saving": "Perubahan akan dibuang bila melanjutkan tanpa menyimpan",
|
| 160 |
-
"Source text": "Teks sumber",
|
| 161 |
-
"%s translation": "%s terjemahan",
|
| 162 |
-
"Comments": "Komentar",
|
| 163 |
-
"Context": "Konteks",
|
| 164 |
-
"Translation": "Terjemahan",
|
| 165 |
-
"No source files in this package, nothing to sync": "Berkas sumber paket ini tidak ditemukan; tidak ada yang dapat disinkronisasikan",
|
| 166 |
-
"No strings could be extracted from source files": "Tidak ada string yang dapat diekstrak dari berkas sumber",
|
| 167 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 168 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 169 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 170 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 171 |
-
}
|
| 172 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-it_IT.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: it-IT, Italian
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:09 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Errore",
|
| 38 |
-
"Warning": "Attenzione",
|
| 39 |
-
"OK": "OK",
|
| 40 |
-
"Permission denied": "Permesso negato",
|
| 41 |
-
"Settings saved": "Impostazioni salvate",
|
| 42 |
-
"%s is not an official WordPress language": "",
|
| 43 |
-
"New PO file": "Nuovo file PO",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "File PO usato come modello. Verrà rinominato in %s la prima volta che è salvato.",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Devi specificare un locale valido per un nuovo file PO ",
|
| 46 |
-
"No translatable strings found": "Nessuna stringa da tradurre trovata",
|
| 47 |
-
"Cannot create a PO file.": "Il file PO non può essere creato.",
|
| 48 |
-
"PO file already exists with locale %s": "Il file PO esiste già con un locale %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Il file non può essere creato",
|
| 50 |
-
"%s file is empty": "Il file %s è vuoto",
|
| 51 |
-
"Run Sync to update from source code": "Utilizza Sync per sincronizzare con il codice sorgente",
|
| 52 |
-
"No strings could be extracted from source code": "Impossibile estrarre le stringhe dal codice sorgente",
|
| 53 |
-
"Run Sync to update from %s": "Utilizza Sync per aggiornare da %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Il codice sorgente è stato modificato, utilizza Sync per aggiornare il file POT",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "Il file POT è stato modificato dopo che il file PO è stato salvato, utilizza Sync per aggiornare",
|
| 56 |
-
"Bad file path": "Percorso errato",
|
| 57 |
-
"Empty or invalid %s file": "File %s vuoto o invalido",
|
| 58 |
-
"%s file has no header": "File %s senza l'intestazione",
|
| 59 |
-
"New template": "Nuovo modello",
|
| 60 |
-
"New language": "Nuova lingua",
|
| 61 |
-
"%s%% translated": "%s%% tradotto",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 stringa",
|
| 64 |
-
"other": "%s stringhe"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s non verificata",
|
| 67 |
-
"%s untranslated": "%s non tradotto",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Non è stato possibile compilare il file MO con il compilatore incorporato",
|
| 69 |
-
"Loco, Translation Management": "Loco, Gestione di Traduzione",
|
| 70 |
-
"Manage translations": "Gestire le traduzioni",
|
| 71 |
-
"Translation options": "Opzioni di traduzione",
|
| 72 |
-
"Loco Translate": "Tradurre con Loco",
|
| 73 |
-
"Settings": "Impostazioni",
|
| 74 |
-
"File download failed": "Download del file non riuscito",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG è deprecato e dovrebbe essere rimosso da wp-config.php",
|
| 76 |
-
"Unknown language": "Lingua sconosciuta",
|
| 77 |
-
"Some files not writable": "Alcuni file non scrivibili",
|
| 78 |
-
"Some files missing": "Alcuni file mancanti",
|
| 79 |
-
"\"%s\" folder not writable": "Cartella %s non scrivibile",
|
| 80 |
-
"POT file not writable": "File POT non scrivibile",
|
| 81 |
-
"PO file not writable": "File PO non scrivibile",
|
| 82 |
-
"MO file not writable": "File MO non scrivibile",
|
| 83 |
-
"MO file not found": "File MO non trovato",
|
| 84 |
-
"Folder not writable": "Cartella non scrivibile",
|
| 85 |
-
"Folder not found": "Cartella non trovata",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s non dichiara un \"Text Domain\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "Loco ha ipotizzato \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s non dichiara un \"Domain Path\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s non ha un file POT. Creane uno a \"%s/%s.pot\" se serve.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s ha uno strano nome del file POT (%s). Un nome migliore sarebbe \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "L'utente non ha il permesso di gestire le traduzioni",
|
| 92 |
-
"Invalid data posted to server": "Dati invalidi mandati al server",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Non è stato possibile compilare il file MO con %s, controlla le impostazioni",
|
| 94 |
-
"Package not found called %s": "Nessun pacchetto trovato che si chiama %s",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Il server web non può effettuare un backup in \"%s\". Devi aggiustare i permessi dei file or disattivare i backup nelle impostazioni",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Il server web non può creare la cartella \"%s\" in \"%s\". Devi aggiustare i permessi dei file or crearla manualmente.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Il server web non può creare i file nella cartella \"%s\". Devi aggiustare i permessi dei file or utilizzare la funzione download.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "File %s non è scrivibile dal server web. Devi aggiustare i permessi dei file or utilizzare la funzione download e copiarlo nel \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Il file MO non può essere creato.",
|
| 100 |
-
"Cannot overwrite MO file": "Il file MO non può essere sovrascritto.",
|
| 101 |
-
"Failed to write MO file": "Impossibile scrivere il file MO",
|
| 102 |
-
"Packages": "Pacchetti",
|
| 103 |
-
"File check": "Controllo file",
|
| 104 |
-
"File system permissions for %s": "Permessi del file system per %s",
|
| 105 |
-
"Other potential issues with %s": "",
|
| 106 |
-
"Back": "Indietro",
|
| 107 |
-
"Get help": "Ottenere aiuto",
|
| 108 |
-
"Package details": "Dettagli del pacchetto",
|
| 109 |
-
"Translations (PO)": "Traduzioni (PO)",
|
| 110 |
-
"Template (POT)": "Modello (POT)",
|
| 111 |
-
"File permissions": "Permessi dei file",
|
| 112 |
-
"Extends: %s": "Estende: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 lingua",
|
| 115 |
-
"other": "lingue"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Modificato",
|
| 118 |
-
"Powered by": "Powered by",
|
| 119 |
-
"Loco may not work as expected": "Loco potrebbe non funzionare come dovrebbe",
|
| 120 |
-
"Configure Loco Translate": "Configurare Loco Translate",
|
| 121 |
-
"Compiling MO files": "Compilando i file MO",
|
| 122 |
-
"Use built-in MO compiler.": "Utilizza il compilatore di MO incorporato",
|
| 123 |
-
"Use external command:": "Utilizza il comando esterno:",
|
| 124 |
-
"Enter path to msgfmt on server": "Inserisci il percorso a msgfmt sul server",
|
| 125 |
-
"Generate hash tables": "Generare tabelle hash",
|
| 126 |
-
"Include Fuzzy strings": "Include stringhe ambigue",
|
| 127 |
-
"Backing up PO files": "Effettuando un backup dei file PO",
|
| 128 |
-
"Number of backups to keep of each file:": "Numero di backup da conservare per ogni file:",
|
| 129 |
-
"Experimental features": "Funzioni sperimentali",
|
| 130 |
-
"Enable WordPress core translations": "Abilita la traduzione del core di WordPress",
|
| 131 |
-
"Save settings": "Salva le impostazioni",
|
| 132 |
-
"Template file": "File modello",
|
| 133 |
-
"Switch to...": "Passare al...",
|
| 134 |
-
"never": "mai",
|
| 135 |
-
"Save": "Salva",
|
| 136 |
-
"Download": "Scarica",
|
| 137 |
-
"Sync": "Sync",
|
| 138 |
-
"Revert": "Ritornare",
|
| 139 |
-
"Add": "Aggiungi",
|
| 140 |
-
"Del": "Canc",
|
| 141 |
-
"Fuzzy": "Non verificato",
|
| 142 |
-
"Filter translations": "Filtra le traduzioni",
|
| 143 |
-
"Help": "Aiuto",
|
| 144 |
-
"Initialize new translations in %s": "Inizializza nuove traduzioni in %s ",
|
| 145 |
-
"Select from common languages": "Seleziona una lingua predefinita",
|
| 146 |
-
"or enter any language code": "o inserisci qualsiasi codice lingua",
|
| 147 |
-
"create in <code>%s</code>": "creare in <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "creare nella cartella globale di lingue",
|
| 149 |
-
"Start translating": "Inizia a tradurre",
|
| 150 |
-
"New version available": "Nuova versione disponibile",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Aggiorna alla versione %s di Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Seleziona un plugin o un tema da tradurre",
|
| 153 |
-
"Themes": "Temi",
|
| 154 |
-
"Plugins": "Plugin",
|
| 155 |
-
"Core": "Core",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "L'estensione PHP \"%s\" non è installata. Se riscontri dei problemi dovresti installarla",
|
| 157 |
-
"Unknown error": "Errore sconosciuto",
|
| 158 |
-
"PO file saved": "File PO salvato",
|
| 159 |
-
"and MO file compiled": "e il file MO compilato",
|
| 160 |
-
"Merged from %s": "Uniti da %s",
|
| 161 |
-
"Merged from source code": "Uniti dal codice sorgente",
|
| 162 |
-
"Already up to date with %s": "Già aggiornato con %s",
|
| 163 |
-
"Already up to date with source code": "Già aggiornato con il codice sorgente",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 nuova stringa aggiunta",
|
| 166 |
-
"other": "%s nuove stringhe aggiunte"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 stringa obsoleta rimossa",
|
| 170 |
-
"other": "%s stringhe obsolete rimosse"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Le modifiche saranno perse se continui senza salvarle",
|
| 173 |
-
"Source text": "Testo sorgente",
|
| 174 |
-
"%s translation": "Traduzione %s",
|
| 175 |
-
"Comments": "Note",
|
| 176 |
-
"Context": "Contesto",
|
| 177 |
-
"Translation": "Traduzione",
|
| 178 |
-
"No source files in this package, nothing to sync": "Nessun file sorgente in questo pacchetto, niente da sincronizzare",
|
| 179 |
-
"No strings could be extracted from source files": "Impossibile estrarre le stringhe dai file sorgenti",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "Traduci plugin e temi di Wordpress direttamente nel tuo browser",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-ja.js
DELETED
|
@@ -1,172 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: ja-JP, Japanese
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:09 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"other"
|
| 14 |
-
];
|
| 15 |
-
|
| 16 |
-
// calc numeric index of a plural form (0-0)
|
| 17 |
-
function pluralIndex( n ){
|
| 18 |
-
return Number( 0 );
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
// expose public t() function
|
| 22 |
-
return function( msgid1, msgid2, n ){
|
| 23 |
-
var value = pairs[msgid1];
|
| 24 |
-
// singular if no multiplier
|
| 25 |
-
if( null == n ){
|
| 26 |
-
n = 1;
|
| 27 |
-
}
|
| 28 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 29 |
-
if( value instanceof Object ){
|
| 30 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 31 |
-
}
|
| 32 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 33 |
-
};
|
| 34 |
-
}(
|
| 35 |
-
{
|
| 36 |
-
"Error": "エラー",
|
| 37 |
-
"Warning": "警告",
|
| 38 |
-
"OK": "OK",
|
| 39 |
-
"Permission denied": "アクセスが拒否されました",
|
| 40 |
-
"Settings saved": "設定を保存しました",
|
| 41 |
-
"%s is not an official WordPress language": "",
|
| 42 |
-
"New PO file": "新しいPOファイル",
|
| 43 |
-
"PO file used as template. This will be renamed to %s on first save": "POファイルをテンプレートとして使用しました。これは最初に%sとして保存されます。",
|
| 44 |
-
"You must specify a valid locale for a new PO file": "新しいPOファイルのための有効なロケールを指定する必要があります",
|
| 45 |
-
"No translatable strings found": "翻訳できる文字列が見つかりませんでした",
|
| 46 |
-
"Cannot create a PO file.": "POファイルを作成できません。",
|
| 47 |
-
"PO file already exists with locale %s": "ロケール%sのPOファイルはすでに存在します",
|
| 48 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "ファイルを自動的に作成できません。ファイルのパーミッションを変更するか、ダウンロードして保存したものを使用して下さい。",
|
| 49 |
-
"%s file is empty": "ファイル %s は空です",
|
| 50 |
-
"Run Sync to update from source code": "ソースコードの更新の同期を実行",
|
| 51 |
-
"No strings could be extracted from source code": "ソースファイルから文字列が見つかりませんでした",
|
| 52 |
-
"Run Sync to update from %s": "%sの更新の同期を実行",
|
| 53 |
-
"Source code has been modified, run Sync to update POT": "ソースコードを変更し、POTの同期と更新を行いました",
|
| 54 |
-
"POT has been modified since PO file was saved, run Sync to update": "POファイルの保存後にPOTが変更されたため、同期と更新を行いました",
|
| 55 |
-
"Bad file path": "間違ったファイルパス",
|
| 56 |
-
"Empty or invalid %s file": "ファイル%sは空または壊れています",
|
| 57 |
-
"%s file has no header": "ファイル%sにヘッダがありません",
|
| 58 |
-
"New template": "新しいテンプレート",
|
| 59 |
-
"New language": "新しい言語",
|
| 60 |
-
"%s%% translated": "%s%%件翻訳済み",
|
| 61 |
-
"1 string": "%s件の文字列",
|
| 62 |
-
"%s fuzzy": "%s件のファジー",
|
| 63 |
-
"%s untranslated": "%s件の未翻訳",
|
| 64 |
-
"Failed to compile MO file with built-in compiler": "内蔵コンパイラーでのMOファイルのコンパイルができませんでした",
|
| 65 |
-
"Loco, Translation Management": "Loco - 翻訳管理",
|
| 66 |
-
"Manage translations": "管理",
|
| 67 |
-
"Translation options": "設定",
|
| 68 |
-
"Loco Translate": "Loco Translate",
|
| 69 |
-
"Settings": "設定",
|
| 70 |
-
"File download failed": "ファイルのダウンロードができませんでした",
|
| 71 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG は廃止されたため、wp-config.php から削除する必要があります。",
|
| 72 |
-
"Unknown language": "不明な言語",
|
| 73 |
-
"Some files not writable": "いくつかのファイルに書き込めません",
|
| 74 |
-
"Some files missing": "いくつかのファイルが不明",
|
| 75 |
-
"\"%s\" folder not writable": "\"%s\" フォルダに書き込めません",
|
| 76 |
-
"POT file not writable": "POTファイルに書き込めません",
|
| 77 |
-
"PO file not writable": "POファイルに書き込めません",
|
| 78 |
-
"MO file not writable": "MOファイルに書き込めません",
|
| 79 |
-
"MO file not found": "MOファイルが見つかりません",
|
| 80 |
-
"Folder not writable": "フォルダに書き込めません",
|
| 81 |
-
"Folder not found": "フォルダが見つかりません",
|
| 82 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 83 |
-
"Loco has guessed \"%s\"": "",
|
| 84 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 85 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 86 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 87 |
-
"User does not have permission to manage translations": "ユーザーは翻訳管理を行う権限を持っていません",
|
| 88 |
-
"Invalid data posted to server": "サーバーへの無効なデータ送信",
|
| 89 |
-
"Failed to compile MO file with %s, check your settings": "%sのMOファイルのコンパイルに失敗しました。設定を確認して下さい。",
|
| 90 |
-
"Package not found called %s": "パッケージが見つからず%sを呼び出せません",
|
| 91 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "ウェブサーバーで\"%s\"のバックアップを作成できません。ファイルのパーミッションを変更するか、設定のバックアップを無効にして下さい。",
|
| 92 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "ウェブサーバーは\"%s\"を\"%s\"に作成できません。ファイルのパーミッションを変更するか、手で作成して下さい。",
|
| 93 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "ウェブサーバーは\"%s\"ディレクトリにファイルを作成できません。ファイルのパーミッションを変更するか、ダウンロード機能を使用して下さい。",
|
| 94 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%sファイルはウェブサーバーから書き込みできません。ファイルの権限を変更するか、 ダウンロードして\"%s/%s\"へコピーして下さい。",
|
| 95 |
-
"Cannot create MO file": "MOファイルを作成できません",
|
| 96 |
-
"Cannot overwrite MO file": "MOファイルを上書きできません",
|
| 97 |
-
"Failed to write MO file": "MOファイルへ書き込みできません",
|
| 98 |
-
"Packages": "パッケージ",
|
| 99 |
-
"File check": "ファイルチェック",
|
| 100 |
-
"File system permissions for %s": "%sのファイルシステム権限",
|
| 101 |
-
"Other potential issues with %s": "",
|
| 102 |
-
"Back": "戻る",
|
| 103 |
-
"Get help": "ヘルプ",
|
| 104 |
-
"Package details": "パッケージ詳細",
|
| 105 |
-
"Translations (PO)": "翻訳 (PO)",
|
| 106 |
-
"Template (POT)": "テンプレート (POT) ",
|
| 107 |
-
"File permissions": "ファイル権限",
|
| 108 |
-
"Extends: %s": "拡張: %s",
|
| 109 |
-
"1 language": "%u言語",
|
| 110 |
-
"Updated": "更新日時",
|
| 111 |
-
"Powered by": " ",
|
| 112 |
-
"Loco may not work as expected": "Loco が期待通りに動作しない可能性があります",
|
| 113 |
-
"Configure Loco Translate": "Loco Translate の設定",
|
| 114 |
-
"Compiling MO files": "MOファイルのコンパイル",
|
| 115 |
-
"Use built-in MO compiler.": "内蔵のMOコンパイラーを使用する",
|
| 116 |
-
"Use external command:": "外部コマンドを使用する:",
|
| 117 |
-
"Enter path to msgfmt on server": "サーバのmsgfmtへのパスを入力",
|
| 118 |
-
"Generate hash tables": "ハッシュテーブルを生成する",
|
| 119 |
-
"Include Fuzzy strings": "",
|
| 120 |
-
"Backing up PO files": "POファイルのバックアップ",
|
| 121 |
-
"Number of backups to keep of each file:": "ファイルごとに保存するバックアップ数:",
|
| 122 |
-
"Experimental features": "実験的な機能",
|
| 123 |
-
"Enable WordPress core translations": "WordPressコアの翻訳を行う",
|
| 124 |
-
"Save settings": "設定を保存",
|
| 125 |
-
"Template file": "テンプレートファイル",
|
| 126 |
-
"Switch to...": "切り替え…",
|
| 127 |
-
"never": "常に",
|
| 128 |
-
"Save": "保存",
|
| 129 |
-
"Download": "ダウンロード",
|
| 130 |
-
"Sync": "同期",
|
| 131 |
-
"Revert": "元に戻す",
|
| 132 |
-
"Add": "追加",
|
| 133 |
-
"Del": "削除",
|
| 134 |
-
"Fuzzy": "ファジー",
|
| 135 |
-
"Filter translations": "翻訳を絞り込み",
|
| 136 |
-
"Help": "ヘルプ",
|
| 137 |
-
"Initialize new translations in %s": "%sの新しい言語の初期化",
|
| 138 |
-
"Select from common languages": "定義済みの言語から選択",
|
| 139 |
-
"or enter any language code": "または他の言語コードを入力",
|
| 140 |
-
"create in <code>%s</code>": "<code>%s</code>に作成する",
|
| 141 |
-
"create in global languages directory": "全体の言語ディレクトリに作成する",
|
| 142 |
-
"Start translating": "翻訳を開始する",
|
| 143 |
-
"New version available": "利用可能な新しいバージョン",
|
| 144 |
-
"Upgrade to version %s of Loco Translate": "Loco Translate のバージョンを%sへ更新します",
|
| 145 |
-
"Select a plugin or theme to translate": "翻訳するテーマまたはプラグインを選択して下さい",
|
| 146 |
-
"Themes": "テーマ",
|
| 147 |
-
"Plugins": "プラグイン",
|
| 148 |
-
"Core": "コア",
|
| 149 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 150 |
-
"Unknown error": "不明なエラー",
|
| 151 |
-
"PO file saved": "POファイルを保存しました",
|
| 152 |
-
"and MO file compiled": "またMOファイルをコンパイルしました",
|
| 153 |
-
"Merged from %s": "%sから結合",
|
| 154 |
-
"Merged from source code": "ソースコードから結合",
|
| 155 |
-
"Already up to date with %s": "%sはすでに最新です",
|
| 156 |
-
"Already up to date with source code": "ソースコードはすでに最新です",
|
| 157 |
-
"1 new string added": "%s件の新しい文字列を追加しました",
|
| 158 |
-
"1 obsolete string removed": "%s件の文字列を削除しました",
|
| 159 |
-
"Your changes will be lost if you continue without saving": "保存せずに続けると変更内容は反映されません",
|
| 160 |
-
"Source text": "原文",
|
| 161 |
-
"%s translation": "%sの翻訳",
|
| 162 |
-
"Comments": "コメント",
|
| 163 |
-
"Context": "属性",
|
| 164 |
-
"Translation": "訳文",
|
| 165 |
-
"No source files in this package, nothing to sync": "このパッケージにはソースファイルがないため、同期していません",
|
| 166 |
-
"No strings could be extracted from source files": "ソースファイルから文字列が見つかりませんでした",
|
| 167 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 168 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 169 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 170 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 171 |
-
}
|
| 172 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-ko_KR.js
DELETED
|
@@ -1,172 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: ko-KR, Korean
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:10 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"other"
|
| 14 |
-
];
|
| 15 |
-
|
| 16 |
-
// calc numeric index of a plural form (0-0)
|
| 17 |
-
function pluralIndex( n ){
|
| 18 |
-
return Number( 0 );
|
| 19 |
-
}
|
| 20 |
-
|
| 21 |
-
// expose public t() function
|
| 22 |
-
return function( msgid1, msgid2, n ){
|
| 23 |
-
var value = pairs[msgid1];
|
| 24 |
-
// singular if no multiplier
|
| 25 |
-
if( null == n ){
|
| 26 |
-
n = 1;
|
| 27 |
-
}
|
| 28 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 29 |
-
if( value instanceof Object ){
|
| 30 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 31 |
-
}
|
| 32 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 33 |
-
};
|
| 34 |
-
}(
|
| 35 |
-
{
|
| 36 |
-
"Error": "오류",
|
| 37 |
-
"Warning": "경고",
|
| 38 |
-
"OK": "확인",
|
| 39 |
-
"Permission denied": "권한이 거부됨",
|
| 40 |
-
"Settings saved": "설정이 저장됨",
|
| 41 |
-
"%s is not an official WordPress language": "%s은(는) 공식 워드프레스 언어가 아닙니다",
|
| 42 |
-
"New PO file": "새로운 PO 파일",
|
| 43 |
-
"PO file used as template. This will be renamed to %s on first save": "PO 파일이 양식으로 사용됨. 처음 저장 시 파일명이 %s(으)로 바뀝니다.",
|
| 44 |
-
"You must specify a valid locale for a new PO file": "새로운 PO 파일에 대한 올바른 로케일을 지정해야 합니다",
|
| 45 |
-
"No translatable strings found": "번역 가능한 스트링을 발견하지 못함",
|
| 46 |
-
"Cannot create a PO file.": "PO 파일을 생성할 수 없음.",
|
| 47 |
-
"PO file already exists with locale %s": "이미 로케일 %s에 대한 PO 파일이 존재함",
|
| 48 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "파일을 자동으로 생성하지 못했습니다. 파일 권한을 수정하거나 저장 대신 다운로드를 사용하세요",
|
| 49 |
-
"%s file is empty": "%s 파일이 비어있음",
|
| 50 |
-
"Run Sync to update from source code": "소스 코드로부터 업데이트 하기 위해 동기화를 실행하세요",
|
| 51 |
-
"No strings could be extracted from source code": "소스 코드로부터 스트링을 추출하지 못했음",
|
| 52 |
-
"Run Sync to update from %s": "%s(으)로부터 업데이트 하기 위해 동기화를 실행하세요",
|
| 53 |
-
"Source code has been modified, run Sync to update POT": "소스 코드가 변경되었음, POT를 업데이트 하기 위해 동기화를 실행하세요",
|
| 54 |
-
"POT has been modified since PO file was saved, run Sync to update": "PO 파일이 저장된 이후로 POT가 변경됨, 업데이트 하기 위해 동기화를 실행하세요",
|
| 55 |
-
"Bad file path": "잘못된 파일 경로",
|
| 56 |
-
"Empty or invalid %s file": "비어있거나 잘못된 %s 파일",
|
| 57 |
-
"%s file has no header": "%s 파일에 머리글이 없음",
|
| 58 |
-
"New template": "새로운 양식",
|
| 59 |
-
"New language": "새로운 언어",
|
| 60 |
-
"%s%% translated": "%s%% 번역됨",
|
| 61 |
-
"1 string": "%u개의 스트링",
|
| 62 |
-
"%s fuzzy": "%s개가 모호함",
|
| 63 |
-
"%s untranslated": "%s개가 번역되지 않음",
|
| 64 |
-
"Failed to compile MO file with built-in compiler": "내장된 생성 도구로 MO 파일을 생성하는데 실패함",
|
| 65 |
-
"Loco, Translation Management": "Loco, 번역 관리",
|
| 66 |
-
"Manage translations": "번역 관리",
|
| 67 |
-
"Translation options": "번역 옵션",
|
| 68 |
-
"Loco Translate": "Loco 번역",
|
| 69 |
-
"Settings": "설정",
|
| 70 |
-
"File download failed": "파일 다운로드에 실패함",
|
| 71 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG은 사용 중지되었으며 wp-config.php에서 제거되어야 합니다.",
|
| 72 |
-
"Unknown language": "알 수 없는 언어",
|
| 73 |
-
"Some files not writable": "일부 파일에 쓰기가 불가능함",
|
| 74 |
-
"Some files missing": "일부 파일을 찾지 못함",
|
| 75 |
-
"\"%s\" folder not writable": "\"%s\" 폴더에 쓰기가 불가능함",
|
| 76 |
-
"POT file not writable": "POT 파일에 쓰기가 불가능함",
|
| 77 |
-
"PO file not writable": "PO 파일에 쓰기가 불가능함",
|
| 78 |
-
"MO file not writable": "MO 파일에 쓰기가 불가능함",
|
| 79 |
-
"MO file not found": "MO 파일을 찾지 못함",
|
| 80 |
-
"Folder not writable": "폴더에 쓰기가 불가능함",
|
| 81 |
-
"Folder not found": "폴더를 찾지 못함",
|
| 82 |
-
"%s does not declare a \"Text Domain\"": "%s 이(가) \"텍스트 도메인\"을 알려주지 않습니다",
|
| 83 |
-
"Loco has guessed \"%s\"": "Loco가 \"%s\"로 추측했습니다",
|
| 84 |
-
"%s does not declare a \"Domain Path\"": "%s 이(가) \"도메인 경로\"를 알려주지 않습니다",
|
| 85 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s 은(는) POT 파일이 없습니다. 필요할 경우 \"%s/%s.pot\" 에서 생성하세요.",
|
| 86 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s의 POT 파일명(%s)이 이상합니다. \"%s.pot\"가 더 나은 것 같습니다.",
|
| 87 |
-
"User does not have permission to manage translations": "사용자가 번역을 관리할 권한이 없음",
|
| 88 |
-
"Invalid data posted to server": "서버에 잘못된 데이터가 게시됨",
|
| 89 |
-
"Failed to compile MO file with %s, check your settings": "%s(으)로 MO 파일을 생성하는데 실패함, 설정을 확인하세요",
|
| 90 |
-
"Package not found called %s": "%s 이라 불리우는 패키지를 찾지 못함",
|
| 91 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "웹 서버가 \"%s\" 에 백업을 생성할 수 없음. 파일 권한을 수정하거나 설정에서 백업을 비활성화하세요",
|
| 92 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "웹 서버가 \"%s\" 디렉터리를 \"%s\" 에 생성하지 못했습니다. 파일 권한을 수정하거나 수동으로 생성하세요.",
|
| 93 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "웹 서버가 \"%s\" 디렉터리를 \"%s\" 에 생성하지 못했습니다. 파일 권한을 수정하거나 다운로드 기능을 사용하세요.",
|
| 94 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "웹 서버가 %s 파일을 기록할 수 없습니다. 파일 권한을 수정하거나 \"%s/%s\" 에 다운로드 및 복사하세요.",
|
| 95 |
-
"Cannot create MO file": "MO 파일을 생성할 수 없음",
|
| 96 |
-
"Cannot overwrite MO file": "MO 파일을 덮어쓸 수 없음",
|
| 97 |
-
"Failed to write MO file": "MO 파일에 기록하지 못함",
|
| 98 |
-
"Packages": "패키지",
|
| 99 |
-
"File check": "파일 확인",
|
| 100 |
-
"File system permissions for %s": "%s 에 대한 파일 시스템 권한",
|
| 101 |
-
"Other potential issues with %s": "%s 에 대한 기타 잠재적 문제점",
|
| 102 |
-
"Back": "뒤로",
|
| 103 |
-
"Get help": "도움 얻기",
|
| 104 |
-
"Package details": "패키지 세부 사항",
|
| 105 |
-
"Translations (PO)": "번역 (PO)",
|
| 106 |
-
"Template (POT)": "양식 (POT)",
|
| 107 |
-
"File permissions": "파일 권한",
|
| 108 |
-
"Extends: %s": "다음으로부터 확장: %s",
|
| 109 |
-
"1 language": "%u개의 언어",
|
| 110 |
-
"Updated": "업데이트:",
|
| 111 |
-
"Powered by": "다음에 의해 작동 중:",
|
| 112 |
-
"Loco may not work as expected": "Loco가 예상대로 작동하지 않을 수 있음",
|
| 113 |
-
"Configure Loco Translate": "Loco 번역 설정",
|
| 114 |
-
"Compiling MO files": "MO 파일 생성 작업",
|
| 115 |
-
"Use built-in MO compiler.": "내장된 MO 생성 도구 사용",
|
| 116 |
-
"Use external command:": "외부 명령어 사용:",
|
| 117 |
-
"Enter path to msgfmt on server": "서버의 msgfmt 에 대한 경로 입력",
|
| 118 |
-
"Generate hash tables": "해시 테이블 생성",
|
| 119 |
-
"Include Fuzzy strings": "모호한 스트링 포함",
|
| 120 |
-
"Backing up PO files": "PO 파일 백업 작업",
|
| 121 |
-
"Number of backups to keep of each file:": "각 파일 별 유지할 백업 개수",
|
| 122 |
-
"Experimental features": "실험적인 기능",
|
| 123 |
-
"Enable WordPress core translations": "워드프레스 핵심 번역 활성화",
|
| 124 |
-
"Save settings": "설정 저장",
|
| 125 |
-
"Template file": "양식 파일",
|
| 126 |
-
"Switch to...": "다음으로 전환...",
|
| 127 |
-
"never": "절대",
|
| 128 |
-
"Save": "저장",
|
| 129 |
-
"Download": "다운로드",
|
| 130 |
-
"Sync": "동기화",
|
| 131 |
-
"Revert": "되돌리기",
|
| 132 |
-
"Add": "추가",
|
| 133 |
-
"Del": "삭제",
|
| 134 |
-
"Fuzzy": "모호함",
|
| 135 |
-
"Filter translations": "필터 번역",
|
| 136 |
-
"Help": "도움말",
|
| 137 |
-
"Initialize new translations in %s": "%s 에 새로운 번역을 시작",
|
| 138 |
-
"Select from common languages": "공통 언어에서 선택",
|
| 139 |
-
"or enter any language code": "또는 원하는 언어 코드 입력",
|
| 140 |
-
"create in <code>%s</code>": "<code>%s</code> 에 생성",
|
| 141 |
-
"create in global languages directory": "범용 언어 디렉터리에 생성",
|
| 142 |
-
"Start translating": "번역 시작",
|
| 143 |
-
"New version available": "새로운 버전 사용 가능",
|
| 144 |
-
"Upgrade to version %s of Loco Translate": "Loco 번역을 버전 %s(으)로 업그레이드",
|
| 145 |
-
"Select a plugin or theme to translate": "번역할 플러그인 또는 테마를 선택하세요",
|
| 146 |
-
"Themes": "테마",
|
| 147 |
-
"Plugins": "플러그인",
|
| 148 |
-
"Core": "핵심",
|
| 149 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "php 확장 기능 \"%s\"이(가) 설치되지 않았습니다. 문제가 발생할 경우 설치하세요",
|
| 150 |
-
"Unknown error": "알 수없는 오류",
|
| 151 |
-
"PO file saved": "PO 파일이 저장됨",
|
| 152 |
-
"and MO file compiled": "그리고 MO 파일이 생성되었음",
|
| 153 |
-
"Merged from %s": "%s (으)로부터 병합됨",
|
| 154 |
-
"Merged from source code": "원본 코드에서 병합됨",
|
| 155 |
-
"Already up to date with %s": "%s 와(과) 비교하여 최신 상태임",
|
| 156 |
-
"Already up to date with source code": "원본 코드와 비교하여 최신 상태임",
|
| 157 |
-
"1 new string added": "%u개의 새로운 스트링이 추가됨",
|
| 158 |
-
"1 obsolete string removed": "%u개의 사용 중지된 스트링이 제거됨",
|
| 159 |
-
"Your changes will be lost if you continue without saving": "저장하지 않고 계속할 경우 변경 사항을 잃게 됩니다.",
|
| 160 |
-
"Source text": "원본 텍스트",
|
| 161 |
-
"%s translation": "%s 번역",
|
| 162 |
-
"Comments": "댓글",
|
| 163 |
-
"Context": "문맥",
|
| 164 |
-
"Translation": "번역",
|
| 165 |
-
"No source files in this package, nothing to sync": "이 패키지에 소스 파일이 없습니다, 동기화 할 것이 없음",
|
| 166 |
-
"No strings could be extracted from source files": "소스 파일로부터 스트링을 추출하지 못했음",
|
| 167 |
-
"Translate WordPress plugins and themes directly in your browser": "브라우저에서 직접 워드프레스 플러그인 및 테마 번역",
|
| 168 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 169 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 170 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 171 |
-
}
|
| 172 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-nl_BE.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: nl-BE, Dutch (Belgium)
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:10 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Fout",
|
| 38 |
-
"Warning": "Waarschuwing",
|
| 39 |
-
"OK": "OK",
|
| 40 |
-
"Permission denied": "",
|
| 41 |
-
"Settings saved": "",
|
| 42 |
-
"%s is not an official WordPress language": "",
|
| 43 |
-
"New PO file": "Nieuw PO-bestand",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Specifieer een geldige locale voor een nieuw PO-bestand",
|
| 46 |
-
"No translatable strings found": "Geen vertaalbare teksten gevonden",
|
| 47 |
-
"Cannot create a PO file.": "Kan geen PO-bestand aanmaken",
|
| 48 |
-
"PO file already exists with locale %s": "PO-bestand bestaat al in locale %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Bestand kan niet automatisch aangemaakt worden. Verander de rechten of gebruik download en bewaar.",
|
| 50 |
-
"%s file is empty": "Het bestand %s is leeg",
|
| 51 |
-
"Run Sync to update from source code": "Voer Sync uit om de broncode up te daten",
|
| 52 |
-
"No strings could be extracted from source code": "Er kon geen tekst uit de broncode gehaald worden",
|
| 53 |
-
"Run Sync to update from %s": "Gebruik Sync om vanuit %s up te daten",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Broncode is veranderd. Gebruik Sync om POT up te daten",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT is veranderd sedert bewaren van het PO-bestand. Gebruik Sync om up te daten",
|
| 56 |
-
"Bad file path": "Foute bestandslocatie",
|
| 57 |
-
"Empty or invalid %s file": "",
|
| 58 |
-
"%s file has no header": "",
|
| 59 |
-
"New template": "Nieuw sjabloon",
|
| 60 |
-
"New language": "Nieuwe taal",
|
| 61 |
-
"%s%% translated": "%s%% vertaald",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 te vertalen tekst",
|
| 64 |
-
"other": "%s te vertalen teksten"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s onzeker",
|
| 67 |
-
"%s untranslated": "%s onvertaald",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "",
|
| 69 |
-
"Loco, Translation Management": "Loco, vertalingsbeheer",
|
| 70 |
-
"Manage translations": "Beheer vertalingen",
|
| 71 |
-
"Translation options": "",
|
| 72 |
-
"Loco Translate": "",
|
| 73 |
-
"Settings": "",
|
| 74 |
-
"File download failed": "",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "",
|
| 76 |
-
"Unknown language": "Onbekende taal",
|
| 77 |
-
"Some files not writable": "Sommige bestanden hebben geen schrijfrechten",
|
| 78 |
-
"Some files missing": "",
|
| 79 |
-
"\"%s\" folder not writable": "Map \"%s\" heeft geen schrijfrechten",
|
| 80 |
-
"POT file not writable": "",
|
| 81 |
-
"PO file not writable": "",
|
| 82 |
-
"MO file not writable": "",
|
| 83 |
-
"MO file not found": "",
|
| 84 |
-
"Folder not writable": "",
|
| 85 |
-
"Folder not found": "",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 87 |
-
"Loco has guessed \"%s\"": "",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 91 |
-
"User does not have permission to manage translations": "Gebruik heeft geen rechten om vertalingen te beheren",
|
| 92 |
-
"Invalid data posted to server": "Ongeldige gegevens op server",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "",
|
| 94 |
-
"Package not found called %s": "",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of maak het zelf aan.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of gebruik de downloadfunctie.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Bestand %s kan niet beschreven worden door de webserver. Bewerk de schrijfrechten of download en kopieer naar \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "",
|
| 100 |
-
"Cannot overwrite MO file": "",
|
| 101 |
-
"Failed to write MO file": "",
|
| 102 |
-
"Packages": "Pakketten",
|
| 103 |
-
"File check": "",
|
| 104 |
-
"File system permissions for %s": "",
|
| 105 |
-
"Other potential issues with %s": "",
|
| 106 |
-
"Back": "",
|
| 107 |
-
"Get help": "",
|
| 108 |
-
"Package details": "Pakketdetails",
|
| 109 |
-
"Translations (PO)": "Vertalingen (PO)",
|
| 110 |
-
"Template (POT)": "Sjabloon (POT)",
|
| 111 |
-
"File permissions": "Bestandsrechten",
|
| 112 |
-
"Extends: %s": "",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 taal",
|
| 115 |
-
"other": "%u talen"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Geüpdated",
|
| 118 |
-
"Powered by": "Ondersteund door",
|
| 119 |
-
"Loco may not work as expected": "",
|
| 120 |
-
"Configure Loco Translate": "",
|
| 121 |
-
"Compiling MO files": "",
|
| 122 |
-
"Use built-in MO compiler.": "",
|
| 123 |
-
"Use external command:": "",
|
| 124 |
-
"Enter path to msgfmt on server": "",
|
| 125 |
-
"Generate hash tables": "",
|
| 126 |
-
"Include Fuzzy strings": "",
|
| 127 |
-
"Backing up PO files": "",
|
| 128 |
-
"Number of backups to keep of each file:": "",
|
| 129 |
-
"Experimental features": "",
|
| 130 |
-
"Enable WordPress core translations": "",
|
| 131 |
-
"Save settings": "",
|
| 132 |
-
"Template file": "Sjabloonbestand",
|
| 133 |
-
"Switch to...": "",
|
| 134 |
-
"never": "nooit",
|
| 135 |
-
"Save": "Opslaan",
|
| 136 |
-
"Download": "Downloaden",
|
| 137 |
-
"Sync": "Sync",
|
| 138 |
-
"Revert": "Ongedaan maken",
|
| 139 |
-
"Add": "Toevoegen",
|
| 140 |
-
"Del": "Verwijder",
|
| 141 |
-
"Fuzzy": "Onzeker",
|
| 142 |
-
"Filter translations": "Filter vertalingen",
|
| 143 |
-
"Help": "Help",
|
| 144 |
-
"Initialize new translations in %s": "Start nieuwe vertalingen in %s",
|
| 145 |
-
"Select from common languages": "Selecteer van gebruikelijke talen",
|
| 146 |
-
"or enter any language code": "of geef een taalcode op",
|
| 147 |
-
"create in <code>%s</code>": "",
|
| 148 |
-
"create in global languages directory": "",
|
| 149 |
-
"Start translating": "Start vertalen",
|
| 150 |
-
"New version available": "Nieuwe versie beschikbaar",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Loco Translate upgraden naar versie %s",
|
| 152 |
-
"Select a plugin or theme to translate": "Selecteer een plug-in of thema om te vertalen",
|
| 153 |
-
"Themes": "Thema's",
|
| 154 |
-
"Plugins": "Plug-ins",
|
| 155 |
-
"Core": "",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 157 |
-
"Unknown error": "",
|
| 158 |
-
"PO file saved": "",
|
| 159 |
-
"and MO file compiled": "",
|
| 160 |
-
"Merged from %s": "",
|
| 161 |
-
"Merged from source code": "",
|
| 162 |
-
"Already up to date with %s": "",
|
| 163 |
-
"Already up to date with source code": "",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "",
|
| 166 |
-
"other": ""
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "",
|
| 170 |
-
"other": ""
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "",
|
| 173 |
-
"Source text": "",
|
| 174 |
-
"%s translation": "",
|
| 175 |
-
"Comments": "",
|
| 176 |
-
"Context": "",
|
| 177 |
-
"Translation": "",
|
| 178 |
-
"No source files in this package, nothing to sync": "",
|
| 179 |
-
"No strings could be extracted from source files": "Er konden geen te vertalen teksten uit de bronbestanden gehaald worden",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-nl_NL.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: nl-NL, Dutch
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:11 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Fout",
|
| 38 |
-
"Warning": "Waarschuwing",
|
| 39 |
-
"OK": "OK",
|
| 40 |
-
"Permission denied": "",
|
| 41 |
-
"Settings saved": "",
|
| 42 |
-
"%s is not an official WordPress language": "",
|
| 43 |
-
"New PO file": "Nieuw PO-bestand",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Specifieer een geldige locale voor een nieuw PO-bestand",
|
| 46 |
-
"No translatable strings found": "Geen vertaalbare teksten gevonden",
|
| 47 |
-
"Cannot create a PO file.": "Kan geen PO-bestand aanmaken",
|
| 48 |
-
"PO file already exists with locale %s": "PO-bestand bestaat al in locale %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Bestand kan niet automatisch aangemaakt worden. Verander de rechten of gebruik download en bewaar.",
|
| 50 |
-
"%s file is empty": "Het bestand %s is leeg",
|
| 51 |
-
"Run Sync to update from source code": "Voer Sync uit om de broncode up te daten",
|
| 52 |
-
"No strings could be extracted from source code": "Er kon geen tekst uit de broncode gehaald worden",
|
| 53 |
-
"Run Sync to update from %s": "Gebruik Sync om vanuit %s up te daten",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Broncode is veranderd. Gebruik Sync om POT up te daten",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT is veranderd sedert bewaren van het PO-bestand. Gebruik Sync om up te daten",
|
| 56 |
-
"Bad file path": "Foute bestandslocatie",
|
| 57 |
-
"Empty or invalid %s file": "",
|
| 58 |
-
"%s file has no header": "",
|
| 59 |
-
"New template": "Nieuw sjabloon",
|
| 60 |
-
"New language": "Nieuwe taal",
|
| 61 |
-
"%s%% translated": "%s%% vertaald",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 te vertalen tekst",
|
| 64 |
-
"other": "%s te vertalen teksten"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s onzeker",
|
| 67 |
-
"%s untranslated": "%s onvertaald",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "",
|
| 69 |
-
"Loco, Translation Management": "Loco, vertalingsbeheer",
|
| 70 |
-
"Manage translations": "Beheer vertalingen",
|
| 71 |
-
"Translation options": "",
|
| 72 |
-
"Loco Translate": "",
|
| 73 |
-
"Settings": "",
|
| 74 |
-
"File download failed": "",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "",
|
| 76 |
-
"Unknown language": "Onbekende taal",
|
| 77 |
-
"Some files not writable": "Sommige bestanden hebben geen schrijfrechten",
|
| 78 |
-
"Some files missing": "",
|
| 79 |
-
"\"%s\" folder not writable": "Map \"%s\" heeft geen schrijfrechten",
|
| 80 |
-
"POT file not writable": "",
|
| 81 |
-
"PO file not writable": "",
|
| 82 |
-
"MO file not writable": "",
|
| 83 |
-
"MO file not found": "",
|
| 84 |
-
"Folder not writable": "",
|
| 85 |
-
"Folder not found": "",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "",
|
| 87 |
-
"Loco has guessed \"%s\"": "",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "",
|
| 91 |
-
"User does not have permission to manage translations": "Gebruik heeft geen rechten om vertalingen te beheren",
|
| 92 |
-
"Invalid data posted to server": "Ongeldige gegevens op server",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "",
|
| 94 |
-
"Package not found called %s": "",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of maak het zelf aan.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Webserver kan map \"%s\" in \"%s\" niet aanmaken. Bewerk bestandsrechten of gebruik de downloadfunctie.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Bestand %s kan niet beschreven worden door de webserver. Bewerk de schrijfrechten of download en kopieer naar \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "",
|
| 100 |
-
"Cannot overwrite MO file": "",
|
| 101 |
-
"Failed to write MO file": "",
|
| 102 |
-
"Packages": "Pakketten",
|
| 103 |
-
"File check": "",
|
| 104 |
-
"File system permissions for %s": "",
|
| 105 |
-
"Other potential issues with %s": "",
|
| 106 |
-
"Back": "",
|
| 107 |
-
"Get help": "",
|
| 108 |
-
"Package details": "Pakketdetails",
|
| 109 |
-
"Translations (PO)": "Vertalingen (PO)",
|
| 110 |
-
"Template (POT)": "Sjabloon (POT)",
|
| 111 |
-
"File permissions": "Bestandsrechten",
|
| 112 |
-
"Extends: %s": "",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 taal",
|
| 115 |
-
"other": "%u talen"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Geüpdated",
|
| 118 |
-
"Powered by": "Ondersteund door",
|
| 119 |
-
"Loco may not work as expected": "",
|
| 120 |
-
"Configure Loco Translate": "",
|
| 121 |
-
"Compiling MO files": "",
|
| 122 |
-
"Use built-in MO compiler.": "",
|
| 123 |
-
"Use external command:": "",
|
| 124 |
-
"Enter path to msgfmt on server": "",
|
| 125 |
-
"Generate hash tables": "",
|
| 126 |
-
"Include Fuzzy strings": "",
|
| 127 |
-
"Backing up PO files": "",
|
| 128 |
-
"Number of backups to keep of each file:": "",
|
| 129 |
-
"Experimental features": "",
|
| 130 |
-
"Enable WordPress core translations": "",
|
| 131 |
-
"Save settings": "",
|
| 132 |
-
"Template file": "Sjabloonbestand",
|
| 133 |
-
"Switch to...": "",
|
| 134 |
-
"never": "nooit",
|
| 135 |
-
"Save": "Opslaan",
|
| 136 |
-
"Download": "Downloaden",
|
| 137 |
-
"Sync": "Sync",
|
| 138 |
-
"Revert": "Ongedaan maken",
|
| 139 |
-
"Add": "Toevoegen",
|
| 140 |
-
"Del": "Verwijder",
|
| 141 |
-
"Fuzzy": "Onzeker",
|
| 142 |
-
"Filter translations": "Filter vertalingen",
|
| 143 |
-
"Help": "Help",
|
| 144 |
-
"Initialize new translations in %s": "Start nieuwe vertalingen in %s",
|
| 145 |
-
"Select from common languages": "Selecteer van gebruikelijke talen",
|
| 146 |
-
"or enter any language code": "of geef een taalcode op",
|
| 147 |
-
"create in <code>%s</code>": "",
|
| 148 |
-
"create in global languages directory": "",
|
| 149 |
-
"Start translating": "Start vertalen",
|
| 150 |
-
"New version available": "Nieuwe versie beschikbaar",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Loco Translate upgraden naar versie %s",
|
| 152 |
-
"Select a plugin or theme to translate": "Selecteer een plug-in of thema om te vertalen",
|
| 153 |
-
"Themes": "Thema's",
|
| 154 |
-
"Plugins": "Plug-ins",
|
| 155 |
-
"Core": "",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "",
|
| 157 |
-
"Unknown error": "",
|
| 158 |
-
"PO file saved": "",
|
| 159 |
-
"and MO file compiled": "",
|
| 160 |
-
"Merged from %s": "",
|
| 161 |
-
"Merged from source code": "",
|
| 162 |
-
"Already up to date with %s": "",
|
| 163 |
-
"Already up to date with source code": "",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "",
|
| 166 |
-
"other": ""
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "",
|
| 170 |
-
"other": ""
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "",
|
| 173 |
-
"Source text": "",
|
| 174 |
-
"%s translation": "",
|
| 175 |
-
"Comments": "",
|
| 176 |
-
"Context": "",
|
| 177 |
-
"Translation": "",
|
| 178 |
-
"No source files in this package, nothing to sync": "",
|
| 179 |
-
"No strings could be extracted from source files": "Er konden geen te vertalen teksten uit de bronbestanden gehaald worden",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-pl_PL.js
DELETED
|
@@ -1,190 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: pl-PL, Polish
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:11 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"few",
|
| 15 |
-
"other"
|
| 16 |
-
];
|
| 17 |
-
|
| 18 |
-
// calc numeric index of a plural form (0-2)
|
| 19 |
-
function pluralIndex( n ){
|
| 20 |
-
return Number( (n==1 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2) );
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
// expose public t() function
|
| 24 |
-
return function( msgid1, msgid2, n ){
|
| 25 |
-
var value = pairs[msgid1];
|
| 26 |
-
// singular if no multiplier
|
| 27 |
-
if( null == n ){
|
| 28 |
-
n = 1;
|
| 29 |
-
}
|
| 30 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 31 |
-
if( value instanceof Object ){
|
| 32 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 33 |
-
}
|
| 34 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 35 |
-
};
|
| 36 |
-
}(
|
| 37 |
-
{
|
| 38 |
-
"Error": "Błąd",
|
| 39 |
-
"Warning": "Ostrzeżenie",
|
| 40 |
-
"OK": "OK",
|
| 41 |
-
"Permission denied": "Odmowa dostępu",
|
| 42 |
-
"Settings saved": "Ustawienia zapisane",
|
| 43 |
-
"%s is not an official WordPress language": "%s nie jest oficjalnym tłumaczeniem WordPress'a",
|
| 44 |
-
"New PO file": "Nowy plik PO",
|
| 45 |
-
"PO file used as template. This will be renamed to %s on first save": "Plik PO użyty jako szablon. Nazwa zostanie zmieniona na % przy pierwszym zapisie",
|
| 46 |
-
"You must specify a valid locale for a new PO file": "Musisz określić właściwy region dla nowego pliku PO",
|
| 47 |
-
"No translatable strings found": "Brak dostępnych lini do tłumaczenia",
|
| 48 |
-
"Cannot create a PO file.": "Nie można utworzyć pliku PO.",
|
| 49 |
-
"PO file already exists with locale %s": "Plik PO już istnieje z regionu %s",
|
| 50 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Plik nie może być utworzony automatycznie. Napraw uprawnienia albo użyj Pobierz zamiast Zapisz",
|
| 51 |
-
"%s file is empty": "Plik %s jest pusty",
|
| 52 |
-
"Run Sync to update from source code": "Uruchom synchronizację aby zaktualizować z kodu źródłowego",
|
| 53 |
-
"No strings could be extracted from source code": "Nie można wyciągnąć żadnych linii z kodu źródłowego",
|
| 54 |
-
"Run Sync to update from %s": "Uruchom synchronizację aby zaktualizować z %s",
|
| 55 |
-
"Source code has been modified, run Sync to update POT": "Kod źródłowy został zaktualizowany, uruchom synchronizację aby zaktualizować plik POT",
|
| 56 |
-
"POT has been modified since PO file was saved, run Sync to update": "Plik POT został zmieniony od czasu zapisu pliku PO, uruchom synchronizację aby zaktualizować",
|
| 57 |
-
"Bad file path": "Błędna ścieżka pliku",
|
| 58 |
-
"Empty or invalid %s file": "Pusty lub błędny plik %s",
|
| 59 |
-
"%s file has no header": "Plik %s nie ma nagłówka",
|
| 60 |
-
"New template": "Nowy szablon",
|
| 61 |
-
"New language": "Nowy język",
|
| 62 |
-
"%s%% translated": "%s%% przetłumaczono",
|
| 63 |
-
"1 string": {
|
| 64 |
-
"one": "1 linia",
|
| 65 |
-
"few": "%s linie",
|
| 66 |
-
"other": "%s linii"
|
| 67 |
-
},
|
| 68 |
-
"%s fuzzy": "%s niepewnych",
|
| 69 |
-
"%s untranslated": "%s nie przetłumaczone",
|
| 70 |
-
"Failed to compile MO file with built-in compiler": "Niepowodzenie kompilacji pliku MO używając wbudowanego kompilatora",
|
| 71 |
-
"Loco, Translation Management": "Loco, Menadżer Tłumaczeń",
|
| 72 |
-
"Manage translations": "Zarządzaj tłumaczeniami",
|
| 73 |
-
"Translation options": "Opcje tłumaczeń",
|
| 74 |
-
"Loco Translate": "Loco Translate",
|
| 75 |
-
"Settings": "Ustawienia",
|
| 76 |
-
"File download failed": "Błąd pobierania pliku",
|
| 77 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG jest przestarzały i powinien zostać usunięty z wp-config.php",
|
| 78 |
-
"Unknown language": "Nieznany język",
|
| 79 |
-
"Some files not writable": "Niektóre pliki są tylko do odczytu",
|
| 80 |
-
"Some files missing": "Brakujące niektóre pliki",
|
| 81 |
-
"\"%s\" folder not writable": "\"%s\" katalog jest tylko do odczytu",
|
| 82 |
-
"POT file not writable": "Plik POT jest tylko do odczytu",
|
| 83 |
-
"PO file not writable": "Plik PO jest tylko do odczytu",
|
| 84 |
-
"MO file not writable": "Plik MO jest tylko do odczytu",
|
| 85 |
-
"MO file not found": "Nie znaleziono pliku MO",
|
| 86 |
-
"Folder not writable": "Katalog jest tylko do odczytu",
|
| 87 |
-
"Folder not found": "Nie znaleziono katalogu",
|
| 88 |
-
"%s does not declare a \"Text Domain\"": "%s nie deklaruje \"Tekst Domeny\"",
|
| 89 |
-
"Loco has guessed \"%s\"": "Loco zgadł \"%s\"",
|
| 90 |
-
"%s does not declare a \"Domain Path\"": "%s nie deklaruje \"Ścieżka Domeny\"",
|
| 91 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s nie ma żadnego pliku POT. Stwórz go w \"%s/%s.pot\" jeżeli takowego potrzebujesz.",
|
| 92 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s ma dziwną nazwę pliku POT (%s). Lepszą nazwą byłoby \"%s.pot\"",
|
| 93 |
-
"User does not have permission to manage translations": "Użytkownik nie ma uprawnień do zarządzania tłumaczeniami",
|
| 94 |
-
"Invalid data posted to server": "Błędne dane wysłane do serwera",
|
| 95 |
-
"Failed to compile MO file with %s, check your settings": "Nie udało się skompilować pliku MO używając %s, sprawdź ustawienia",
|
| 96 |
-
"Package not found called %s": "Paczka o nazwie %s nie została znaleziona",
|
| 97 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Serwer www nie może utworzyć kopii w \"%s\". Popraw uprawnienia lub wyłącz kopie zapasowe w ustawieniach",
|
| 98 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Serwer www nie może utworzyć katalogu \"%s\". Popraw uprawnienia lub utwórz go ręcznie.",
|
| 99 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Serwer www nie może utworzyć plików w katalogu \"%s\". Popraw uprawnienia lub użyj funkcji pobierania.",
|
| 100 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%s jest tylko do odczytu dla serwera www. Popraw uprawnienia lub pobierz i skopiuj do \"%s/%s\".",
|
| 101 |
-
"Cannot create MO file": "Nie można utworzyć pliku MO",
|
| 102 |
-
"Cannot overwrite MO file": "Nie można nadpisać pliku MO",
|
| 103 |
-
"Failed to write MO file": "Błąd zapisu pliku MO",
|
| 104 |
-
"Packages": "Paczki",
|
| 105 |
-
"File check": "Sprawdzenie plików",
|
| 106 |
-
"File system permissions for %s": "Uprawnienia systemu plików dla %s",
|
| 107 |
-
"Other potential issues with %s": "Inne potencjalne problemy z %s",
|
| 108 |
-
"Back": "Wstecz",
|
| 109 |
-
"Get help": "Pomoc",
|
| 110 |
-
"Package details": "Detale paczki",
|
| 111 |
-
"Translations (PO)": "Tłumaczenia (PO)",
|
| 112 |
-
"Template (POT)": "Schemat (POT)",
|
| 113 |
-
"File permissions": "Uprawnienia plików",
|
| 114 |
-
"Extends: %s": "Rozszerza: %s",
|
| 115 |
-
"1 language": {
|
| 116 |
-
"one": "1 język",
|
| 117 |
-
"few": "%u języki",
|
| 118 |
-
"other": "%u języków"
|
| 119 |
-
},
|
| 120 |
-
"Updated": "Zaktualizowano",
|
| 121 |
-
"Powered by": "Napędzany przez",
|
| 122 |
-
"Loco may not work as expected": "Loco może nie działać tak jak oczekujesz",
|
| 123 |
-
"Configure Loco Translate": "Konfiguruj Loco Translate",
|
| 124 |
-
"Compiling MO files": "Kompilowanie plików MO",
|
| 125 |
-
"Use built-in MO compiler.": "Użyj wbudowanego kompilatora MO.",
|
| 126 |
-
"Use external command:": "Użyj zewnętrznej komendy:",
|
| 127 |
-
"Enter path to msgfmt on server": "Wpisz ścieżkę do msgfmt na serwerze",
|
| 128 |
-
"Generate hash tables": "Generuj tablice hash",
|
| 129 |
-
"Include Fuzzy strings": "Uwzględniaj niepewne ciągi znaków",
|
| 130 |
-
"Backing up PO files": "Zrób kopię zapasową plików PO",
|
| 131 |
-
"Number of backups to keep of each file:": "Liczba kopii zapasowych każdego pliku do przechowania:",
|
| 132 |
-
"Experimental features": "Funkcje eksperymentalne",
|
| 133 |
-
"Enable WordPress core translations": "Włącz tłumaczenie silnika WordPress",
|
| 134 |
-
"Save settings": "Zapisz ustawienia",
|
| 135 |
-
"Template file": "Plik schematu",
|
| 136 |
-
"Switch to...": "Zmień na...",
|
| 137 |
-
"never": "nigdy",
|
| 138 |
-
"Save": "Zapisz",
|
| 139 |
-
"Download": "Pobierz",
|
| 140 |
-
"Sync": "Synchronizuj",
|
| 141 |
-
"Revert": "Przywróć",
|
| 142 |
-
"Add": "Dodaj",
|
| 143 |
-
"Del": "Usuń",
|
| 144 |
-
"Fuzzy": "Niepewny",
|
| 145 |
-
"Filter translations": "Filtruj tłumaczenia",
|
| 146 |
-
"Help": "Pomoc",
|
| 147 |
-
"Initialize new translations in %s": "Zainicjuj nowe tłumaczenie w %s",
|
| 148 |
-
"Select from common languages": "Wybierz z częstych języków",
|
| 149 |
-
"or enter any language code": "lub wpisz dowolny kod języka",
|
| 150 |
-
"create in <code>%s</code>": "stwórz w <code>%s</code>",
|
| 151 |
-
"create in global languages directory": "stwórz w globalny, katalogu języków",
|
| 152 |
-
"Start translating": "Zacznij tłumaczyć",
|
| 153 |
-
"New version available": "Nowa wersja jest dostępna",
|
| 154 |
-
"Upgrade to version %s of Loco Translate": "Zaktualizuj Loco Translate do wersji %s",
|
| 155 |
-
"Select a plugin or theme to translate": "Wybierz wtyczkę lub motyw do tłumaczenia",
|
| 156 |
-
"Themes": "Motywy",
|
| 157 |
-
"Plugins": "Wtyczki",
|
| 158 |
-
"Core": "Silnik",
|
| 159 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "Rozszerzenie PHP \"%s\" nie jest zainstalowane. Jeżeli doświadczasz pewnych problemów to powinieneś je spróbować zainstalować",
|
| 160 |
-
"Unknown error": "Nieznany błąd",
|
| 161 |
-
"PO file saved": "Plik PO zapisany",
|
| 162 |
-
"and MO file compiled": "oraz plik MO skompilowany",
|
| 163 |
-
"Merged from %s": "Połączono z %s",
|
| 164 |
-
"Merged from source code": "Połączono z kodu źródłowego",
|
| 165 |
-
"Already up to date with %s": "Już aktualne z %s",
|
| 166 |
-
"Already up to date with source code": "Już aktualne z kodu źródłowego",
|
| 167 |
-
"1 new string added": {
|
| 168 |
-
"one": "1 nowa linia dodana",
|
| 169 |
-
"few": "%s nowe linie dodano",
|
| 170 |
-
"other": "%s nowych linii dodano"
|
| 171 |
-
},
|
| 172 |
-
"1 obsolete string removed": {
|
| 173 |
-
"one": "1 zbędna linia usunięta",
|
| 174 |
-
"few": "%s zbędne linie usunięte",
|
| 175 |
-
"other": "%s zbędnych linii usunięto"
|
| 176 |
-
},
|
| 177 |
-
"Your changes will be lost if you continue without saving": "Utracisz aktualne zmiany jeśli będziesz kontynuował bez zapisywania",
|
| 178 |
-
"Source text": "Tekst źródłowy",
|
| 179 |
-
"%s translation": "%s tłumaczenie",
|
| 180 |
-
"Comments": "Komentarze",
|
| 181 |
-
"Context": "Kontekst",
|
| 182 |
-
"Translation": "Tłumaczenie",
|
| 183 |
-
"No source files in this package, nothing to sync": "Brak plików źródłowych w tej paczce, nic do synchronizacji",
|
| 184 |
-
"No strings could be extracted from source files": "Żadne linie nie mogą być wyciągnięte z plików źródłowych",
|
| 185 |
-
"Translate WordPress plugins and themes directly in your browser": "Tłumacz wtyczki i skórki WordPress'a bezpośrednio z poziomu przeglądarki",
|
| 186 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 187 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 188 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 189 |
-
}
|
| 190 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-pt_BR.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: pt-BR, Portuguese (Brazil)
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:12 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Erro",
|
| 38 |
-
"Warning": "Alerta",
|
| 39 |
-
"OK": "Ok",
|
| 40 |
-
"Permission denied": "Permissão negada",
|
| 41 |
-
"Settings saved": "Configurações salvas",
|
| 42 |
-
"%s is not an official WordPress language": "%s não é uma linguagem oficial do Wordpress",
|
| 43 |
-
"New PO file": "Novo arquivo PO",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "Arquivo PO usado como template. Isto vai ser renomeado para %s no primeiro salvamento",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Você tem que especificar um local válido para o novo arquivo PO",
|
| 46 |
-
"No translatable strings found": "Não foram encontrados termos traduzíveis",
|
| 47 |
-
"Cannot create a PO file.": "Não pode ser criado o arquivo PO.",
|
| 48 |
-
"PO file already exists with locale %s": "Arquivo PO já existe com a localização %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Arquivo não pode ser criado automaticamente. Corrija as permissões do arquivo ou use Baixar em vez de Salvar.",
|
| 50 |
-
"%s file is empty": "O arquivo %s está vazio",
|
| 51 |
-
"Run Sync to update from source code": "Clique em Sincronizar para atualizar a partir do código fonte",
|
| 52 |
-
"No strings could be extracted from source code": "Nenhum termo pode ser extraído a partir do código fonte",
|
| 53 |
-
"Run Sync to update from %s": "Clique em Sincronizar para atualizar a partir de %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "O código fonte foi modificado, clique em Sincronizar para o POT atualizado",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "O arquivo POT não foi atualizado desde que o arquivo PO foi salvo, clique em Sincronizar para atualizar",
|
| 56 |
-
"Bad file path": "Endereço de arquivo ruim",
|
| 57 |
-
"Empty or invalid %s file": "O arquivo %s está vazio ou é inválido",
|
| 58 |
-
"%s file has no header": "O arquivo %s não tem cabeçalho",
|
| 59 |
-
"New template": "Novo modelo",
|
| 60 |
-
"New language": "Novo idioma",
|
| 61 |
-
"%s%% translated": "%s%% traduzido",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 termo",
|
| 64 |
-
"other": "%s termos"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s incerto",
|
| 67 |
-
"%s untranslated": "%s não traduzido",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Falha ao compilar arquivo MO com compilador embutido",
|
| 69 |
-
"Loco, Translation Management": "Loco, Gerenciador de Tradução",
|
| 70 |
-
"Manage translations": "Gerenciar traduções",
|
| 71 |
-
"Translation options": "Opções de traduções",
|
| 72 |
-
"Loco Translate": "Tradução (Loco)",
|
| 73 |
-
"Settings": "Configurações",
|
| 74 |
-
"File download failed": "Download do arquivo falhou",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG é obsoleto e deve ser removido do wp-config.php",
|
| 76 |
-
"Unknown language": "Idioma desconhecido",
|
| 77 |
-
"Some files not writable": "Alguns arquivos não são editáveis",
|
| 78 |
-
"Some files missing": "Alguns arquivos estão ausentes",
|
| 79 |
-
"\"%s\" folder not writable": "Pasta \"%s\" não editável",
|
| 80 |
-
"POT file not writable": "Arquivo POT não editável",
|
| 81 |
-
"PO file not writable": "Arquivo PO não editável",
|
| 82 |
-
"MO file not writable": "Arquivo MO não editável",
|
| 83 |
-
"MO file not found": "Arquivo MO ausente",
|
| 84 |
-
"Folder not writable": "Pasta não editável",
|
| 85 |
-
"Folder not found": "Pasta não encontrada",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s não declara um \"Text Domain\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "Loco adivinhou \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s não declara um \"Domain Path\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s não possui um arquivo POT. Crie um em \"%s/%s.pot\" se você precisar.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s possui um nome estranho para o arquivo POT (%s). Um nome melhor seria \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "O usuário não tem permissões para gerenciar traduções",
|
| 92 |
-
"Invalid data posted to server": "Dados inválidos enviados para servidor",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Falha ao compilar arquivo MO com %s, verifique suas configurações",
|
| 94 |
-
"Package not found called %s": "Pacote chamado %s não encontrado",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Servidor Web não pode criar backups em \"%s\". Corrija as permissões do arquivo ou desabilite backups nas configurações.",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Servidor Web não pode criar o diretório \"%s\" em \"%s\". Corrija permissões do arquivo ou crie manualmente.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "O servidor web não pode criar arquivos no diretório \"%s\". Resolva as permissões do arquivo ou use a função de download.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Arquivo %s não é editável pelo servidor web. Corrija as permissões do arquivo ou baixe e copie para \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Arquivo MO não pode ser criado",
|
| 100 |
-
"Cannot overwrite MO file": "Arquivo MO não pode ser sobrescrito",
|
| 101 |
-
"Failed to write MO file": "Arquivo MO falho em ser editado",
|
| 102 |
-
"Packages": "Pacotes",
|
| 103 |
-
"File check": "Conferência",
|
| 104 |
-
"File system permissions for %s": "Permissões do sistema de arquivo para %s",
|
| 105 |
-
"Other potential issues with %s": "Outros problemas em potencial com %s",
|
| 106 |
-
"Back": "Voltar",
|
| 107 |
-
"Get help": "Pedir ajudar",
|
| 108 |
-
"Package details": "Detalhes do pacote",
|
| 109 |
-
"Translations (PO)": "Traduções (PO)",
|
| 110 |
-
"Template (POT)": "Modelo (POT)",
|
| 111 |
-
"File permissions": "Permissões do arquivo",
|
| 112 |
-
"Extends: %s": "Extendido: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 idioma",
|
| 115 |
-
"other": "%u idiomas"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Atualizado",
|
| 118 |
-
"Powered by": "Desenvolvido por",
|
| 119 |
-
"Loco may not work as expected": "Loco pode não funcionar como esperado",
|
| 120 |
-
"Configure Loco Translate": "Configure Tradução Loco",
|
| 121 |
-
"Compiling MO files": "Compilando arquivos MO",
|
| 122 |
-
"Use built-in MO compiler.": "Usar compilador MO interno.",
|
| 123 |
-
"Use external command:": "Usar comando externo:",
|
| 124 |
-
"Enter path to msgfmt on server": "Digite caminho para msgfmt no servidor",
|
| 125 |
-
"Generate hash tables": "Gerar tabela de dispersão",
|
| 126 |
-
"Include Fuzzy strings": "Incluir Fuzzy strings",
|
| 127 |
-
"Backing up PO files": "Criando cópia de segurança dos arquivos PO",
|
| 128 |
-
"Number of backups to keep of each file:": "Número de backups para manter de cada arquivo:",
|
| 129 |
-
"Experimental features": "Funcionalidades experimentais",
|
| 130 |
-
"Enable WordPress core translations": "Ativar traduções da core do WordPress",
|
| 131 |
-
"Save settings": "Configurações de salvamento",
|
| 132 |
-
"Template file": "Arquivo modelo",
|
| 133 |
-
"Switch to...": "Mudar para...",
|
| 134 |
-
"never": "nunca",
|
| 135 |
-
"Save": "Salvar",
|
| 136 |
-
"Download": "Baixar",
|
| 137 |
-
"Sync": "Sincronizar",
|
| 138 |
-
"Revert": "Reverter",
|
| 139 |
-
"Add": "Adicionar",
|
| 140 |
-
"Del": "Apagar",
|
| 141 |
-
"Fuzzy": "Incerto",
|
| 142 |
-
"Filter translations": "Filtrar traduções",
|
| 143 |
-
"Help": "Ajuda",
|
| 144 |
-
"Initialize new translations in %s": "Iniciar novas traduções em %s",
|
| 145 |
-
"Select from common languages": "Selecionar a partir dos idiomas mais comuns",
|
| 146 |
-
"or enter any language code": "ou adicione novo código de linguagem",
|
| 147 |
-
"create in <code>%s</code>": "criar em <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "criar no diretório de idiomas global",
|
| 149 |
-
"Start translating": "Começar a traduzir",
|
| 150 |
-
"New version available": "Novo atualização disponível",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Atualizar para a versão %s do Tradução (Loco)",
|
| 152 |
-
"Select a plugin or theme to translate": "Selecione um plugin ou tema para traduzir",
|
| 153 |
-
"Themes": "Temas",
|
| 154 |
-
"Plugins": "Plugins",
|
| 155 |
-
"Core": "Núcleo",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "A extensão PHP \"%s\" não está instalada. Se você encontrar problemas, tente instalá-la.",
|
| 157 |
-
"Unknown error": "Erro desconhecido",
|
| 158 |
-
"PO file saved": "Arquivo PO salvo",
|
| 159 |
-
"and MO file compiled": "e MO compilado",
|
| 160 |
-
"Merged from %s": "Combinado a partir de %s",
|
| 161 |
-
"Merged from source code": "Combinado a partir do código fonte",
|
| 162 |
-
"Already up to date with %s": "Atualizado desde %s",
|
| 163 |
-
"Already up to date with source code": "Já está atualizado a partir do código fonte",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 novo termo adicionado",
|
| 166 |
-
"other": "%s novos termos adicionados"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 um termo obsoleto removido",
|
| 170 |
-
"other": "%s termos obsoletos removidos"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Suas alterações serão perdidas se você continuar sem salvar",
|
| 173 |
-
"Source text": "Texto fonte",
|
| 174 |
-
"%s translation": "tradução %s",
|
| 175 |
-
"Comments": "Comentários",
|
| 176 |
-
"Context": "Contexto",
|
| 177 |
-
"Translation": "Tradução",
|
| 178 |
-
"No source files in this package, nothing to sync": "Não há arquivos fontes neste pacote, nada a sincronizar",
|
| 179 |
-
"No strings could be extracted from source files": "Nenhum termo não pode ser extraído a partir dos arquivos de origem",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-pt_PT.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: pt-PT, Portuguese (Portugal)
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:12 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Erro",
|
| 38 |
-
"Warning": "Aviso",
|
| 39 |
-
"OK": "Ok",
|
| 40 |
-
"Permission denied": "Permissão negada",
|
| 41 |
-
"Settings saved": "Definições guardadas",
|
| 42 |
-
"%s is not an official WordPress language": "%s não é um idioma oficial do WordPress",
|
| 43 |
-
"New PO file": "Novo ficheiro PO",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "Ficheiro PO utilizado como modelo. Será renomeado para %s quando o guardar pela primeira vez.",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Tem que especificar um código locale válido para o novo ficheiro PO",
|
| 46 |
-
"No translatable strings found": "Não foram encontrados termos para tradução",
|
| 47 |
-
"Cannot create a PO file.": "Não pode ser criado o ficheiro PO.",
|
| 48 |
-
"PO file already exists with locale %s": "O ficheiro PO já existe com o código locale %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Não foi possível criar o ficheiro automaticamente. Corrija as permissões do ficheiro ou use Descarregar em vez de Guardar.",
|
| 50 |
-
"%s file is empty": "O ficheiro %s está vazio",
|
| 51 |
-
"Run Sync to update from source code": "Clique em Sincronizar para actualizar a partir do código fonte",
|
| 52 |
-
"No strings could be extracted from source code": "Nenhum termo pôde ser extraído a partir do código fonte",
|
| 53 |
-
"Run Sync to update from %s": "Clique em Sincronizar para actualizar a partir de %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "O código fonte foi modificado, clique em Sincronizar para actualizar o POT",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "O ficheiro POT foi modificado depois do ficheiro PO ter sido guardado, clique em Sincronizar para actualizar",
|
| 56 |
-
"Bad file path": "Caminho do ficheiro incorrecto",
|
| 57 |
-
"Empty or invalid %s file": "O ficheiro %s está vazio ou é inválido",
|
| 58 |
-
"%s file has no header": "O ficheiro %s não tem cabeçalho",
|
| 59 |
-
"New template": "Novo modelo",
|
| 60 |
-
"New language": "Novo idioma",
|
| 61 |
-
"%s%% translated": "%s%% traduzido",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 termo",
|
| 64 |
-
"other": "%s termos"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s impreciso(s)",
|
| 67 |
-
"%s untranslated": "%s não traduzido",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Falhou ao compilar o ficheiro MO com compilador incluído",
|
| 69 |
-
"Loco, Translation Management": "Loco, Translation Management",
|
| 70 |
-
"Manage translations": "Gerir traduções",
|
| 71 |
-
"Translation options": "Opções de tradução",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Definições",
|
| 74 |
-
"File download failed": "Falhou ao descarregar o ficheiro",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "O WPLANG está obsoleto e deve ser removido do wp-config.php",
|
| 76 |
-
"Unknown language": "Idioma desconhecido",
|
| 77 |
-
"Some files not writable": "Alguns ficheiros não são editáveis",
|
| 78 |
-
"Some files missing": "Alguns ficheiros em falta",
|
| 79 |
-
"\"%s\" folder not writable": "Pasta \"%s\" não é editável",
|
| 80 |
-
"POT file not writable": "Ficheiro POT não editável",
|
| 81 |
-
"PO file not writable": "Ficheiro PO não editável",
|
| 82 |
-
"MO file not writable": "Ficheiro MO não editável",
|
| 83 |
-
"MO file not found": "Ficheiro MO não encontrado",
|
| 84 |
-
"Folder not writable": "Pasta não editável",
|
| 85 |
-
"Folder not found": "Pasta não encontrada",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "O %s não declara um \"Text Domain\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "O Loco adivinhou \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "O %s não declara um \"Domain Path\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "O %s não tem ficheiro POT. Crie um em \"%s/%s.pot\" se precisar.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "O %s tem um ficheiro POT com um nome estranho (%s). Seria melhor um nome como \"%s.pot\".",
|
| 91 |
-
"User does not have permission to manage translations": "O utilizador não tem permissões para gerir traduções",
|
| 92 |
-
"Invalid data posted to server": "Dados inválidos enviados para o servidor",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Falhou ao compilar ficheiro MO com %s, verifique as suas definições",
|
| 94 |
-
"Package not found called %s": "Pacote com nome %s não encontrado",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "O servidor web não pode criar cópias de segurança em \"%s\". Corrija as permissões do ficheiro ou desactive as cópias de segurança nas definições.",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "O servidor web não pode criar o directório \"%s\" em \"%s\". Corrija permissões do ficheiro ou crie o directório manualmente.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "O servidor web não pode criar ficheiros no directório \"%s\". Corrija as permissões do ficheiro ou utilize a função Descarregar.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "O ficheiro %s não é editável pelo servidor web. Corrija as permissões do ficheiro ou descarregue e copie para \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Não é possível criar ficheiro MO",
|
| 100 |
-
"Cannot overwrite MO file": "Não é possível substituir ficheiro MO",
|
| 101 |
-
"Failed to write MO file": "Falhou ao guardar ficheiro MO",
|
| 102 |
-
"Packages": "Pacotes",
|
| 103 |
-
"File check": "Verificação do ficheiro",
|
| 104 |
-
"File system permissions for %s": "Permissões do sistema de ficheiros para %s",
|
| 105 |
-
"Other potential issues with %s": "Outros problemas potenciais com %s",
|
| 106 |
-
"Back": "Voltar",
|
| 107 |
-
"Get help": "Obter ajuda",
|
| 108 |
-
"Package details": "Detalhes do pacote",
|
| 109 |
-
"Translations (PO)": "Traduções (PO)",
|
| 110 |
-
"Template (POT)": "Modelo (POT)",
|
| 111 |
-
"File permissions": "Permissões do ficheiro",
|
| 112 |
-
"Extends: %s": "Estendido: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 idioma",
|
| 115 |
-
"other": "%u idiomas"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Actualizado",
|
| 118 |
-
"Powered by": "Desenvolvido por",
|
| 119 |
-
"Loco may not work as expected": "O Loco pode não funcionar como esperado",
|
| 120 |
-
"Configure Loco Translate": "Configurar Loco Translate",
|
| 121 |
-
"Compiling MO files": "A compilar ficheiros MO",
|
| 122 |
-
"Use built-in MO compiler.": "Utilizar compilador MO incluído.",
|
| 123 |
-
"Use external command:": "Utilizar comando externo:",
|
| 124 |
-
"Enter path to msgfmt on server": "Introduza o caminho para o msgfmt no servidor",
|
| 125 |
-
"Generate hash tables": "Gerar tabela hash",
|
| 126 |
-
"Include Fuzzy strings": "Incluir termos imprecisos",
|
| 127 |
-
"Backing up PO files": "A criar cópia de segurança dos ficheiros PO",
|
| 128 |
-
"Number of backups to keep of each file:": "Número de cópias de segurança a manter de para cada ficheiro:",
|
| 129 |
-
"Experimental features": "Recursos experimentais",
|
| 130 |
-
"Enable WordPress core translations": "Activar traduções do core do WordPress",
|
| 131 |
-
"Save settings": "Guardar definições",
|
| 132 |
-
"Template file": "Ficheiro modelo",
|
| 133 |
-
"Switch to...": "Mudar para...",
|
| 134 |
-
"never": "nunca",
|
| 135 |
-
"Save": "Guardar",
|
| 136 |
-
"Download": "Descarregar",
|
| 137 |
-
"Sync": "Sincronizar",
|
| 138 |
-
"Revert": "Reverter",
|
| 139 |
-
"Add": "Adicionar",
|
| 140 |
-
"Del": "Apagar",
|
| 141 |
-
"Fuzzy": "Impreciso",
|
| 142 |
-
"Filter translations": "Filtrar traduções",
|
| 143 |
-
"Help": "Ajuda",
|
| 144 |
-
"Initialize new translations in %s": "Iniciar novas traduções em %s",
|
| 145 |
-
"Select from common languages": "Selecionar a partir dos idiomas mais comuns",
|
| 146 |
-
"or enter any language code": "ou introduza um código de idioma",
|
| 147 |
-
"create in <code>%s</code>": "criar em <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "criar no directório global de idiomas",
|
| 149 |
-
"Start translating": "Começar a traduzir",
|
| 150 |
-
"New version available": "Novo atualização disponível",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Actualizar para a versão %s do Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Selecione um plugin ou tema para traduzir",
|
| 153 |
-
"Themes": "Temas",
|
| 154 |
-
"Plugins": "Plugins",
|
| 155 |
-
"Core": "Core",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "A extensão \"%s\" do PHP não está instalada. Se tiver algum problema deverá proceder à sua instalação.",
|
| 157 |
-
"Unknown error": "Erro desconhecido",
|
| 158 |
-
"PO file saved": "Ficheiro PO guardado",
|
| 159 |
-
"and MO file compiled": "e ficheiro MO compilado",
|
| 160 |
-
"Merged from %s": "Misturado a partir de %s",
|
| 161 |
-
"Merged from source code": "Misturado a partir do código fonte",
|
| 162 |
-
"Already up to date with %s": "Actualizado desde %s",
|
| 163 |
-
"Already up to date with source code": "Já está actualizado a partir do código fonte",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 novo termo adicionado",
|
| 166 |
-
"other": "%s novos termos adicionados"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 um termo obsoleto removido",
|
| 170 |
-
"other": "%s termos obsoletos removidos"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "As suas alterações serão perdidas se continuar sem guardar",
|
| 173 |
-
"Source text": "Texto fonte",
|
| 174 |
-
"%s translation": "Tradução para %s",
|
| 175 |
-
"Comments": "Comentários",
|
| 176 |
-
"Context": "Contexto",
|
| 177 |
-
"Translation": "Tradução",
|
| 178 |
-
"No source files in this package, nothing to sync": "Não há ficheiros de origem neste pacote, não há nada para sincronizar.",
|
| 179 |
-
"No strings could be extracted from source files": "Nenhum termo pôde ser extraído a partir dos ficheiros de origem",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "Traduza plugins e temas do WordPress directamente no seu browser",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-ru_RU.js
DELETED
|
@@ -1,190 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: ru-RU, Russian
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:12 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"few",
|
| 15 |
-
"other"
|
| 16 |
-
];
|
| 17 |
-
|
| 18 |
-
// calc numeric index of a plural form (0-2)
|
| 19 |
-
function pluralIndex( n ){
|
| 20 |
-
return Number( (n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2) );
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
// expose public t() function
|
| 24 |
-
return function( msgid1, msgid2, n ){
|
| 25 |
-
var value = pairs[msgid1];
|
| 26 |
-
// singular if no multiplier
|
| 27 |
-
if( null == n ){
|
| 28 |
-
n = 1;
|
| 29 |
-
}
|
| 30 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 31 |
-
if( value instanceof Object ){
|
| 32 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 33 |
-
}
|
| 34 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 35 |
-
};
|
| 36 |
-
}(
|
| 37 |
-
{
|
| 38 |
-
"Error": "Ошибка",
|
| 39 |
-
"Warning": "Предупреждение",
|
| 40 |
-
"OK": "ОК",
|
| 41 |
-
"Permission denied": "Доступ невозможен",
|
| 42 |
-
"Settings saved": "Установки сохранены",
|
| 43 |
-
"%s is not an official WordPress language": "%s не является официальным языком WordPress",
|
| 44 |
-
"New PO file": "Новый РО-файл",
|
| 45 |
-
"PO file used as template. This will be renamed to %s on first save": "PO-файл используется как шаблон. Он будет переименован в %s при первом сохранении",
|
| 46 |
-
"You must specify a valid locale for a new PO file": "Укажите правильную локаль для нового РО-файла",
|
| 47 |
-
"No translatable strings found": "Строк для перевода не обнаружено",
|
| 48 |
-
"Cannot create a PO file.": "Невозможно создать РО-файл",
|
| 49 |
-
"PO file already exists with locale %s": "PO-файл уже существует в локали %s",
|
| 50 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Файл не может быть создан автоматически. Исправьте права доступа, или используйте Загрузить вместо Сохранить",
|
| 51 |
-
"%s file is empty": "файл %s пуст",
|
| 52 |
-
"Run Sync to update from source code": "Выполните Синхронизацию для обновления из исходного кода",
|
| 53 |
-
"No strings could be extracted from source code": "Нет строк для извлечения из исходного кода",
|
| 54 |
-
"Run Sync to update from %s": "Выполните Синхронизацию для обновления из %s",
|
| 55 |
-
"Source code has been modified, run Sync to update POT": "Исходный код был изменён. Выполните Синхронизацию для обновления РОТ",
|
| 56 |
-
"POT has been modified since PO file was saved, run Sync to update": "РОТ был изменён после сохранения РО-файла. Выполните Синхронизацию для обновления",
|
| 57 |
-
"Bad file path": "Неправильный путь к файлу",
|
| 58 |
-
"Empty or invalid %s file": "Файл %s пустой или поврежденный",
|
| 59 |
-
"%s file has no header": "Файл %s без заголовка",
|
| 60 |
-
"New template": "Новый шаблон",
|
| 61 |
-
"New language": "Новый язык",
|
| 62 |
-
"%s%% translated": "%s%% переведено",
|
| 63 |
-
"1 string": {
|
| 64 |
-
"one": "1 строка",
|
| 65 |
-
"few": "%s строк(и)",
|
| 66 |
-
"other": ""
|
| 67 |
-
},
|
| 68 |
-
"%s fuzzy": "%s неточный перевод",
|
| 69 |
-
"%s untranslated": "%s не переведено",
|
| 70 |
-
"Failed to compile MO file with built-in compiler": "Ошибка компиляции МО-файла встроенным компилятором",
|
| 71 |
-
"Loco, Translation Management": "Loco Translate, менеджер переводов",
|
| 72 |
-
"Manage translations": "Менеджер переводов",
|
| 73 |
-
"Translation options": "Опции перевода",
|
| 74 |
-
"Loco Translate": "Loco Translate",
|
| 75 |
-
"Settings": "Установки",
|
| 76 |
-
"File download failed": "Ошибка загрузки файла",
|
| 77 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG устарела и должна быть удалена из wp-config.php",
|
| 78 |
-
"Unknown language": "Неизвестный язык",
|
| 79 |
-
"Some files not writable": "Некоторые файлы недоступны для записи",
|
| 80 |
-
"Some files missing": "Некоторые файлы с ошибками или отсутствуют",
|
| 81 |
-
"\"%s\" folder not writable": "Папка \"%s\" недоступна для записи",
|
| 82 |
-
"POT file not writable": "РОТ-файл недоступен для записи",
|
| 83 |
-
"PO file not writable": "РО-файл недоступен для записи",
|
| 84 |
-
"MO file not writable": "МО-файл недоступен для записи",
|
| 85 |
-
"MO file not found": "МО-файл не найден",
|
| 86 |
-
"Folder not writable": "Папка недоступна для записи",
|
| 87 |
-
"Folder not found": "Папка не найдена",
|
| 88 |
-
"%s does not declare a \"Text Domain\"": "%s не объявлена \"Text Domain\"",
|
| 89 |
-
"Loco has guessed \"%s\"": "Loco распознал \"%s\"",
|
| 90 |
-
"%s does not declare a \"Domain Path\"": "%s не объявлена \"Domain Path\"",
|
| 91 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s не имеет POT-файла. Создайте файл из \"%s/%s.pot\" если он вам нужен.",
|
| 92 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s неправильное имя POT-файла (%s). Правильное имя будет \"%s.pot\"",
|
| 93 |
-
"User does not have permission to manage translations": "У пользователя недостаточно прав для управления переводами",
|
| 94 |
-
"Invalid data posted to server": "На сервер отправлены неверные данные",
|
| 95 |
-
"Failed to compile MO file with %s, check your settings": "Ошибка компилирования МО-файла с %s . Проверьте настройки",
|
| 96 |
-
"Package not found called %s": "Не найден пакет с именем %s",
|
| 97 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Web сервер не может создать резервную копию в \"%s\". Исправьте права доступа, или отключите функцию резервирования в настройках",
|
| 98 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Web сервер не может создать \"%s\" в каталоге \"%s\". Исправьте права доступа, или создайте вручную",
|
| 99 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Web сервер не может создать файлы в каталоге \"%s\". Исправьте права доступа, или используйте функцию загрузки.",
|
| 100 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%s файл не может быть записан на сервер. Исправьте права доступа или загрузите и скопируйте \"%s/%s\".",
|
| 101 |
-
"Cannot create MO file": "Невозможно создать МО-файл",
|
| 102 |
-
"Cannot overwrite MO file": "Невозможно перезаписать МО-файл",
|
| 103 |
-
"Failed to write MO file": "Ошибка записи МО-файла",
|
| 104 |
-
"Packages": "Пакеты переводов",
|
| 105 |
-
"File check": "Проверка файла",
|
| 106 |
-
"File system permissions for %s": "Права доступа файловой системы для %s",
|
| 107 |
-
"Other potential issues with %s": "Другие потенциальные проблемы с %s",
|
| 108 |
-
"Back": "Назад",
|
| 109 |
-
"Get help": "Помощь",
|
| 110 |
-
"Package details": "Детали пакета",
|
| 111 |
-
"Translations (PO)": "Переводы (РО)",
|
| 112 |
-
"Template (POT)": "Шаблоны (РОТ)",
|
| 113 |
-
"File permissions": "Права доступа к файлу",
|
| 114 |
-
"Extends: %s": "Расширить: %s",
|
| 115 |
-
"1 language": {
|
| 116 |
-
"one": "1 язык",
|
| 117 |
-
"few": "%s языка(ов)",
|
| 118 |
-
"other": ""
|
| 119 |
-
},
|
| 120 |
-
"Updated": "Обновлённый",
|
| 121 |
-
"Powered by": "Представляем",
|
| 122 |
-
"Loco may not work as expected": "Плагин Loco Translate может не работать, как ожидалось",
|
| 123 |
-
"Configure Loco Translate": "Настройка Loco Translate",
|
| 124 |
-
"Compiling MO files": "Компиляция МО-файлов",
|
| 125 |
-
"Use built-in MO compiler.": "Использовать встроенный МО компилятор",
|
| 126 |
-
"Use external command:": "Использовать внешнюю команду:",
|
| 127 |
-
"Enter path to msgfmt on server": "Путь к msgfmt на сервере",
|
| 128 |
-
"Generate hash tables": "Генерировать hash таблицы",
|
| 129 |
-
"Include Fuzzy strings": "Включить нечеткие строки",
|
| 130 |
-
"Backing up PO files": "Резервное копирование РО-файлов",
|
| 131 |
-
"Number of backups to keep of each file:": "Количество копии для каждого файла:",
|
| 132 |
-
"Experimental features": "Экспериментальные функции",
|
| 133 |
-
"Enable WordPress core translations": "Включить переводы ядра WordPress",
|
| 134 |
-
"Save settings": "Сохранить установки",
|
| 135 |
-
"Template file": "Файл шаблона",
|
| 136 |
-
"Switch to...": "Переключиться на...",
|
| 137 |
-
"never": "никогда",
|
| 138 |
-
"Save": "Сохранить",
|
| 139 |
-
"Download": "Загрузить",
|
| 140 |
-
"Sync": "Синхронизация",
|
| 141 |
-
"Revert": "Вернуться",
|
| 142 |
-
"Add": "Добавить",
|
| 143 |
-
"Del": "Удалить",
|
| 144 |
-
"Fuzzy": "Неточный перевод",
|
| 145 |
-
"Filter translations": "Поиск по фразе",
|
| 146 |
-
"Help": "Помощь",
|
| 147 |
-
"Initialize new translations in %s": "Начать новый перевод в %s",
|
| 148 |
-
"Select from common languages": "Выберите язык из списка",
|
| 149 |
-
"or enter any language code": "или введите код языка",
|
| 150 |
-
"create in <code>%s</code>": "создать в <code>%s</code>",
|
| 151 |
-
"create in global languages directory": "создать в каталоге глобальных языков",
|
| 152 |
-
"Start translating": "Начать перевод",
|
| 153 |
-
"New version available": "Доступна новая версия",
|
| 154 |
-
"Upgrade to version %s of Loco Translate": "Обновить Loco Translate до версии %s",
|
| 155 |
-
"Select a plugin or theme to translate": "Выберите плагин или тему для перевода ",
|
| 156 |
-
"Themes": "Темы",
|
| 157 |
-
"Plugins": "Плагины",
|
| 158 |
-
"Core": "Ядро",
|
| 159 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "Расширение PHP \"%s\" не установлено. Вы должны его установить, если у вас возникли проблемы",
|
| 160 |
-
"Unknown error": "Неизвестная ошибка",
|
| 161 |
-
"PO file saved": "РО-файл сохранён",
|
| 162 |
-
"and MO file compiled": "и МО-файл скомпилирован",
|
| 163 |
-
"Merged from %s": "Объединено с %s",
|
| 164 |
-
"Merged from source code": "Объединено с исходным кодом",
|
| 165 |
-
"Already up to date with %s": "Уже обновлено с %s",
|
| 166 |
-
"Already up to date with source code": "Уже обновлено с исходным кодом",
|
| 167 |
-
"1 new string added": {
|
| 168 |
-
"one": "добавлена 1 новая строка",
|
| 169 |
-
"few": "добавлено %s новых строк(и)",
|
| 170 |
-
"other": ""
|
| 171 |
-
},
|
| 172 |
-
"1 obsolete string removed": {
|
| 173 |
-
"one": "удалена 1 строка",
|
| 174 |
-
"few": "удалены %s строк(и)",
|
| 175 |
-
"other": ""
|
| 176 |
-
},
|
| 177 |
-
"Your changes will be lost if you continue without saving": "Ваши изменения будут потеряны, если вы не сохранитесь",
|
| 178 |
-
"Source text": "Исходный текст",
|
| 179 |
-
"%s translation": "перевод %s",
|
| 180 |
-
"Comments": "Комментарии",
|
| 181 |
-
"Context": "Контекст",
|
| 182 |
-
"Translation": "Перевод",
|
| 183 |
-
"No source files in this package, nothing to sync": "В этом пакете исходные файлы для синхронизации отсутствуют ",
|
| 184 |
-
"No strings could be extracted from source files": "Нет строк для обработки из исходного кода",
|
| 185 |
-
"Translate WordPress plugins and themes directly in your browser": "Переводите WordPress плагины и темы прямо в вашем браузере",
|
| 186 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 187 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 188 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 189 |
-
}
|
| 190 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-sv_SE.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: sv-SE, Swedish
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:13 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Fel",
|
| 38 |
-
"Warning": "Varning",
|
| 39 |
-
"OK": "OK",
|
| 40 |
-
"Permission denied": "Behörighet saknas",
|
| 41 |
-
"Settings saved": "Inställningar sparade",
|
| 42 |
-
"%s is not an official WordPress language": "%s är inte ett officiellt språk i WordPress",
|
| 43 |
-
"New PO file": "Ny PO-fil",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "PO-fil används som mall. Den kommer att byta namn till %s när du väljer att spara",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Du måste ange en giltig landskod för en ny PO-fil",
|
| 46 |
-
"No translatable strings found": "Inga översättbara strängar hittades",
|
| 47 |
-
"Cannot create a PO file.": "Kunde ej skapa en PO-fil.",
|
| 48 |
-
"PO file already exists with locale %s": "PO-fil finns redan med landskod %s",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Fil kunde ej skapas automatiskt. Ändra filrättigheter eller använd Ladda ner istället för Spara",
|
| 50 |
-
"%s file is empty": "%s-filen är tom",
|
| 51 |
-
"Run Sync to update from source code": "Använd Synka för att uppdatera från källkoden",
|
| 52 |
-
"No strings could be extracted from source code": "Inga strängar kunde hittas från källkoden",
|
| 53 |
-
"Run Sync to update from %s": "Använd Synka för att uppdatera från %s",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Källkod har ändrats, använd Synka för att uppdatera POT",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "POT har ändrats sedan PO-filen sparades, använd Synka för att uppdatera",
|
| 56 |
-
"Bad file path": "Ogiltig sökväg",
|
| 57 |
-
"Empty or invalid %s file": "Tom eller ogiltigt %s-fil",
|
| 58 |
-
"%s file has no header": "%s-filen saknar header",
|
| 59 |
-
"New template": "Ny mall",
|
| 60 |
-
"New language": "Nytt språk",
|
| 61 |
-
"%s%% translated": "%s%% översatt",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 sträng",
|
| 64 |
-
"other": "%s strängar"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s oklar",
|
| 67 |
-
"%s untranslated": "%s ej översatta",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Det gick ej att sammanställa MO-fil med inbyggd kompilator",
|
| 69 |
-
"Loco, Translation Management": "Loco, Translation Management",
|
| 70 |
-
"Manage translations": "Språkfiler",
|
| 71 |
-
"Translation options": "Inställningar",
|
| 72 |
-
"Loco Translate": "Loco Translate",
|
| 73 |
-
"Settings": "Inställningar",
|
| 74 |
-
"File download failed": "Nedladdning misslyckades",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG är inaktuell och bör tas bort från wp-config.php",
|
| 76 |
-
"Unknown language": "Okänt språk",
|
| 77 |
-
"Some files not writable": "Vissa filer är ej skrivbara",
|
| 78 |
-
"Some files missing": "Vissa filer saknas",
|
| 79 |
-
"\"%s\" folder not writable": "Mappen \"%s\" är ej skrivbar",
|
| 80 |
-
"POT file not writable": "POT-filen är ej skrivbar",
|
| 81 |
-
"PO file not writable": "PO-filen är ej skrivbar",
|
| 82 |
-
"MO file not writable": "MO-filen är ej skrivbar",
|
| 83 |
-
"MO file not found": "MO-fil hittades ej",
|
| 84 |
-
"Folder not writable": "Mappen är ej skrivbar",
|
| 85 |
-
"Folder not found": "Mappen hittades ej",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s har inte angivit \"Text Domain\"",
|
| 87 |
-
"Loco has guessed \"%s\"": "Loco har gissat på \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s har inte angivit \"Domain Path\"",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s har ingen POT-fil. Skapa en i \"%s/%s.pot\" om du behöver en.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s har ett konstigt POT-filnamn (%s). Ett bättre filnamn hade varit \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "Användaren saknar behörighet att hantera översättningar",
|
| 92 |
-
"Invalid data posted to server": "Ogiltig data skickades till servern",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "Det gick ej sammanställa MO-filen med %s , kontrollera dina inställningar",
|
| 94 |
-
"Package not found called %s": "Paket %s ej hittat",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Webbservern kunde ej skapa säkerhetskopior i \"%s\". Ändra filrättigheter eller inaktivera säkerhetskopior i inställningarna",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Webbservern kunde ej skapa mappen \"%s\" i \"%s\". Ändra filrättigheter eller skapa den manuellt.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Webbservern kunde ej skapa filer i mappen \"%s\". Ändra filrättigheter eller använd nedladdningsfunktionen.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%s-filen är ej skrivbar av webbservern. Ändra filrättigheter eller ladda ner och kopiera till \"%s/%s\".",
|
| 99 |
-
"Cannot create MO file": "Kunde ej skapa MO-fil",
|
| 100 |
-
"Cannot overwrite MO file": "Kunde ej skriva över MO-fil",
|
| 101 |
-
"Failed to write MO file": "Kunde ej skapa MO-fil",
|
| 102 |
-
"Packages": "Språkfiler",
|
| 103 |
-
"File check": "Filrättigheter",
|
| 104 |
-
"File system permissions for %s": "Filsystem rättigheter för %s",
|
| 105 |
-
"Other potential issues with %s": "Andra potentiella problem med %s",
|
| 106 |
-
"Back": "Tillbaka",
|
| 107 |
-
"Get help": "Hjälp",
|
| 108 |
-
"Package details": "Beskrivning",
|
| 109 |
-
"Translations (PO)": "Översättningar (PO)",
|
| 110 |
-
"Template (POT)": "Mall (POT)",
|
| 111 |
-
"File permissions": "Filrättigheter",
|
| 112 |
-
"Extends: %s": "Utökar: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 språk",
|
| 115 |
-
"other": "%u språk"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Senast sparad",
|
| 118 |
-
"Powered by": "Drivs av",
|
| 119 |
-
"Loco may not work as expected": "Loco kanske ej fungerar som väntat",
|
| 120 |
-
"Configure Loco Translate": "Konfigurera Loco Translate",
|
| 121 |
-
"Compiling MO files": "Sammanställa MO-filer",
|
| 122 |
-
"Use built-in MO compiler.": "Använd inbyggd MO-kompilator.",
|
| 123 |
-
"Use external command:": "Använd externt kommando:",
|
| 124 |
-
"Enter path to msgfmt on server": "Skriv in sökväg till msgfmt på servern",
|
| 125 |
-
"Generate hash tables": "Generera hashtabeller",
|
| 126 |
-
"Include Fuzzy strings": "Inkludera luddiga översättningar",
|
| 127 |
-
"Backing up PO files": "Säkerhetskopiera PO-filer",
|
| 128 |
-
"Number of backups to keep of each file:": "Antal säkerhetskopior att behålla för varje fil:",
|
| 129 |
-
"Experimental features": "Experimentella funktioner",
|
| 130 |
-
"Enable WordPress core translations": "Aktivera WordPress översättningar",
|
| 131 |
-
"Save settings": "Spara inställningar",
|
| 132 |
-
"Template file": "Mallfil",
|
| 133 |
-
"Switch to...": "Växla till...",
|
| 134 |
-
"never": "aldrig",
|
| 135 |
-
"Save": "Spara",
|
| 136 |
-
"Download": "Ladda ner",
|
| 137 |
-
"Sync": "Synka",
|
| 138 |
-
"Revert": "Återgå",
|
| 139 |
-
"Add": "Lägg till",
|
| 140 |
-
"Del": "Radera",
|
| 141 |
-
"Fuzzy": "Oklar",
|
| 142 |
-
"Filter translations": "Sök översättningar",
|
| 143 |
-
"Help": "Hjälp",
|
| 144 |
-
"Initialize new translations in %s": "Skapa nya översättningar i %s",
|
| 145 |
-
"Select from common languages": "Välj bland vanliga språk",
|
| 146 |
-
"or enter any language code": "eller skriv valfri landskod",
|
| 147 |
-
"create in <code>%s</code>": "skapa i <code>%s</code>",
|
| 148 |
-
"create in global languages directory": "skapa i den globala språk mappen",
|
| 149 |
-
"Start translating": "Börja översätta",
|
| 150 |
-
"New version available": "Ny version tillgänglig",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Uppdatera till version %s av Loco Translate",
|
| 152 |
-
"Select a plugin or theme to translate": "Välj ett tillägg eller tema att översätta",
|
| 153 |
-
"Themes": "Teman",
|
| 154 |
-
"Plugins": "Tillägg",
|
| 155 |
-
"Core": "WordPress",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "PHP tillägg \"%s\" är inte installerat. Om du upplever problem bör du installera det",
|
| 157 |
-
"Unknown error": "Okänt fel",
|
| 158 |
-
"PO file saved": "PO-fil sparad",
|
| 159 |
-
"and MO file compiled": "och MO-fil sammanställd",
|
| 160 |
-
"Merged from %s": "Sammanslagen från %s",
|
| 161 |
-
"Merged from source code": "Sammanslagen från källkod",
|
| 162 |
-
"Already up to date with %s": "Redan aktuell med %s",
|
| 163 |
-
"Already up to date with source code": "Redan aktuell med källkod",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 ny sträng tillagd",
|
| 166 |
-
"other": "%s nya strängar tillagda"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 föråldrad sträng togs bort",
|
| 170 |
-
"other": "%s föråldrade strängar togs bort"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Dina ändringar kommer att gå förlorade om du fortsätter utan att spara",
|
| 173 |
-
"Source text": "Källtext",
|
| 174 |
-
"%s translation": "%s översättning",
|
| 175 |
-
"Comments": "Kommentarer",
|
| 176 |
-
"Context": "Innehåll",
|
| 177 |
-
"Translation": "Översättning",
|
| 178 |
-
"No source files in this package, nothing to sync": "Inga källfiler finns i detta paket, inget att synka",
|
| 179 |
-
"No strings could be extracted from source files": "Inga strängar kunde hittas från källfiler",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-tr_TR.js
DELETED
|
@@ -1,185 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: tr-TR, Turkish
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:13 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"other"
|
| 15 |
-
];
|
| 16 |
-
|
| 17 |
-
// calc numeric index of a plural form (0-1)
|
| 18 |
-
function pluralIndex( n ){
|
| 19 |
-
return Number( n != 1 );
|
| 20 |
-
}
|
| 21 |
-
|
| 22 |
-
// expose public t() function
|
| 23 |
-
return function( msgid1, msgid2, n ){
|
| 24 |
-
var value = pairs[msgid1];
|
| 25 |
-
// singular if no multiplier
|
| 26 |
-
if( null == n ){
|
| 27 |
-
n = 1;
|
| 28 |
-
}
|
| 29 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 30 |
-
if( value instanceof Object ){
|
| 31 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 32 |
-
}
|
| 33 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 34 |
-
};
|
| 35 |
-
}(
|
| 36 |
-
{
|
| 37 |
-
"Error": "Hata",
|
| 38 |
-
"Warning": "Uyarı",
|
| 39 |
-
"OK": "Tamam",
|
| 40 |
-
"Permission denied": "İzin reddedildi",
|
| 41 |
-
"Settings saved": "Ayarlar kaydedildi",
|
| 42 |
-
"%s is not an official WordPress language": "%s resmi WordPress dillerinden biri değil",
|
| 43 |
-
"New PO file": "Yeni PO Dosyası",
|
| 44 |
-
"PO file used as template. This will be renamed to %s on first save": "PO dosyası şablon olarak kullanıldı. İlk kaydetmenizde %s olarak isimlendirilecek.",
|
| 45 |
-
"You must specify a valid locale for a new PO file": "Yeni PO dosyası için geçerli bir yerel değer belirtmek zorundasınız",
|
| 46 |
-
"No translatable strings found": "Çevrilebilecek satır bulunamadı",
|
| 47 |
-
"Cannot create a PO file.": "Bir PO dosyası oluşturulamaz.",
|
| 48 |
-
"PO file already exists with locale %s": "PO dosyası %s yerel değeri ile zaten var",
|
| 49 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Dosya otomatik olarak oluşturulamıyor. Dosya izinlerini düzenleyin ya da İndirilenler dizinine kaydedin.",
|
| 50 |
-
"%s file is empty": "%s dosyası boş",
|
| 51 |
-
"Run Sync to update from source code": "Kaynak kodundan güncelleştirmek için eşleştirme yapın",
|
| 52 |
-
"No strings could be extracted from source code": "Kaynak kodundan herhangi satır çıkarılamadı",
|
| 53 |
-
"Run Sync to update from %s": "%s kaynağından güncelleştirme için eşleştirme yapın",
|
| 54 |
-
"Source code has been modified, run Sync to update POT": "Kaynak dosyası değiştirilmiş, POT güncellemesi için eşleştirme yapın",
|
| 55 |
-
"POT has been modified since PO file was saved, run Sync to update": "PO dosyası en son kaydedildiğinden beri POT değişikliğe uğramış, güncelleme için eşleştirme yapın",
|
| 56 |
-
"Bad file path": "Kötü dosya yolu",
|
| 57 |
-
"Empty or invalid %s file": "%s dosyası boş veya geçersiz",
|
| 58 |
-
"%s file has no header": "%s dosyasının başlığı yok",
|
| 59 |
-
"New template": "Yeni Şablon",
|
| 60 |
-
"New language": "Yeni Dil",
|
| 61 |
-
"%s%% translated": "%s%% çevrildi",
|
| 62 |
-
"1 string": {
|
| 63 |
-
"one": "1 satır",
|
| 64 |
-
"other": "%s cümle"
|
| 65 |
-
},
|
| 66 |
-
"%s fuzzy": "%s belirsiz",
|
| 67 |
-
"%s untranslated": "%s çevrilmemiş",
|
| 68 |
-
"Failed to compile MO file with built-in compiler": "Dahili derleyici ile MO dosyası derleme işlemi başarısız oldu",
|
| 69 |
-
"Loco, Translation Management": "Loco, Çeviri Yönetimi",
|
| 70 |
-
"Manage translations": "Çevirileri Yönet",
|
| 71 |
-
"Translation options": "Çeviri Seçenekleri",
|
| 72 |
-
"Loco Translate": "Loco Çeviri",
|
| 73 |
-
"Settings": "Ayarlar",
|
| 74 |
-
"File download failed": "Dosya indirme işlemi başarısız oldu",
|
| 75 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG artık kullanılmıyor, bu nedenle wp-config.php dosyasından kaldırılması gerekmektedir",
|
| 76 |
-
"Unknown language": "Bilinmeyen dil",
|
| 77 |
-
"Some files not writable": "Bazı dosyalar yazılabilir değil",
|
| 78 |
-
"Some files missing": "Bazı dosyalar yok",
|
| 79 |
-
"\"%s\" folder not writable": "\"%s\" dizini yazılabilir değil",
|
| 80 |
-
"POT file not writable": "POT dosyası yazılabilir değil",
|
| 81 |
-
"PO file not writable": "PO dosyası yazılabilir değil",
|
| 82 |
-
"MO file not writable": "MO dosyası yazılabilir değil",
|
| 83 |
-
"MO file not found": "MO dosyası bulunamadı",
|
| 84 |
-
"Folder not writable": "Dizin yazılabilir değil",
|
| 85 |
-
"Folder not found": "Dizin bulunmadı",
|
| 86 |
-
"%s does not declare a \"Text Domain\"": "%s bir \"Metin Etki Alanı\" beyan etmiyor",
|
| 87 |
-
"Loco has guessed \"%s\"": "Loco tahmini: \"%s\"",
|
| 88 |
-
"%s does not declare a \"Domain Path\"": "%s bir \"Etki Alanı Yolu\" beyan etmiyor",
|
| 89 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s POT dosyası içermiyor. Eğer ihtiyacınız varsa \"%s/%s.pot\" yolunda bir tane oluşturabilirsiniz.",
|
| 90 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s alışılmadık bir POT dosya adına (%s) sahip. Daha iyi bir isim önerisi: \"%s.pot\"",
|
| 91 |
-
"User does not have permission to manage translations": "Kullanıcı çevirileri yönetmek için gerekli izinlere sahip değil",
|
| 92 |
-
"Invalid data posted to server": "Sunucuya gönderilen veri geçersiz",
|
| 93 |
-
"Failed to compile MO file with %s, check your settings": "%s ile MO dosyası derleme işlemi başarısız oldu, ayarlarınızı tekrar kontrol edin",
|
| 94 |
-
"Package not found called %s": "%s isimli paket bulunamadı",
|
| 95 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Web Sunucusu \"%s\" içinde yedek oluşturamıyor. Dosya izinlerini düzeltin veya ayarlarda bulunan yedekleme işlemini devre dışı bırakın.",
|
| 96 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Web sunucusu \"%s\" dizinini \"%s\" içinde oluşturamıyor . Dosya izinlerini düzeltin veya elle oluşturun.",
|
| 97 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Web sunucusu \"%s\" dizini içinde dosyaları oluşturamıyor. Dosya izinlerini düzeltin veya indirme fonksiyonunu kullanın.",
|
| 98 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "%s dosyası web sunucu tarafından yazılamaz durumda. Dosya izinlerini düzeltin veya dosyayı indirip \"%s/%s\" yoluna kopyalayın.",
|
| 99 |
-
"Cannot create MO file": "MO dosyası oluşturulamıyor",
|
| 100 |
-
"Cannot overwrite MO file": "MO dosyası üzerine yazılamıyor",
|
| 101 |
-
"Failed to write MO file": "MO dosyasına yazma işlemi başarısız oldu",
|
| 102 |
-
"Packages": "Paketler",
|
| 103 |
-
"File check": "Dosya denetimi",
|
| 104 |
-
"File system permissions for %s": "%s için dosya sistemi izinleri",
|
| 105 |
-
"Other potential issues with %s": "%s ile\n \ndiğer\n \npotansiyel\n \nsorunlar",
|
| 106 |
-
"Back": "Geri",
|
| 107 |
-
"Get help": "Yardım",
|
| 108 |
-
"Package details": "Paket Detayları",
|
| 109 |
-
"Translations (PO)": "Çeviriler (PO)",
|
| 110 |
-
"Template (POT)": "Şablon (POT)",
|
| 111 |
-
"File permissions": "Dosya İzinleri",
|
| 112 |
-
"Extends: %s": "Genişletmeler: %s",
|
| 113 |
-
"1 language": {
|
| 114 |
-
"one": "1 Dil",
|
| 115 |
-
"other": "%u Lisan"
|
| 116 |
-
},
|
| 117 |
-
"Updated": "Güncellendi",
|
| 118 |
-
"Powered by": "Hazırlayan:",
|
| 119 |
-
"Loco may not work as expected": "Loco beklendiği gibi çalışmayabilir",
|
| 120 |
-
"Configure Loco Translate": "Loco Çeviri Yapılandırma",
|
| 121 |
-
"Compiling MO files": "MO Dosyaları Derleme",
|
| 122 |
-
"Use built-in MO compiler.": "Dahili MO derleyici kullan",
|
| 123 |
-
"Use external command:": "Harici komut kullan:",
|
| 124 |
-
"Enter path to msgfmt on server": "Sunucudaki msgfmt yolunu girin",
|
| 125 |
-
"Generate hash tables": "Komut tabloları oluştur",
|
| 126 |
-
"Include Fuzzy strings": "Belirsiz satırları dahil et",
|
| 127 |
-
"Backing up PO files": "PO Dosyaları Yedekleme",
|
| 128 |
-
"Number of backups to keep of each file:": "Her bir dosyanın saklanacak yedek sayısı:",
|
| 129 |
-
"Experimental features": "Deneysel Özellikler",
|
| 130 |
-
"Enable WordPress core translations": "WordPress çekirdek çevirilerini etkinleştir",
|
| 131 |
-
"Save settings": "Ayarları Kaydet",
|
| 132 |
-
"Template file": "Şablon dosyası",
|
| 133 |
-
"Switch to...": "Geçiş Yap:",
|
| 134 |
-
"never": "asla",
|
| 135 |
-
"Save": "Kaydet",
|
| 136 |
-
"Download": "İndir",
|
| 137 |
-
"Sync": "Eşleştir",
|
| 138 |
-
"Revert": "Geri Al",
|
| 139 |
-
"Add": "Ekle",
|
| 140 |
-
"Del": "Sil",
|
| 141 |
-
"Fuzzy": "Belirsiz",
|
| 142 |
-
"Filter translations": "Çevirileri filtrele",
|
| 143 |
-
"Help": "Yardım",
|
| 144 |
-
"Initialize new translations in %s": "%s için yeni çeviri başlat",
|
| 145 |
-
"Select from common languages": "Yaygın diller arasından seçin",
|
| 146 |
-
"or enter any language code": "veya herhangi bir dil kodu girin",
|
| 147 |
-
"create in <code>%s</code>": "<code>%s</code> adresinde oluştur",
|
| 148 |
-
"create in global languages directory": "Genel \"Language\" dizininde oluştur",
|
| 149 |
-
"Start translating": "Çeviriye Başla",
|
| 150 |
-
"New version available": "Yeni sürüm mevcut",
|
| 151 |
-
"Upgrade to version %s of Loco Translate": "Loco Çeviri eklentisini %s sürümüne yükselt",
|
| 152 |
-
"Select a plugin or theme to translate": "Çevirmek için bir eklenti veya tema seçin",
|
| 153 |
-
"Themes": "Temalar",
|
| 154 |
-
"Plugins": "Eklentiler",
|
| 155 |
-
"Core": "Çekirdek",
|
| 156 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "\"%s\" PHP eklentisi yüklü değil. \nEğer\n \nsorun yaşarsanız\n \nbu eklentiyi\n \nyüklemeniz gerekir.",
|
| 157 |
-
"Unknown error": "Bilinmeyen hata",
|
| 158 |
-
"PO file saved": "PO dosyası kaydedildi",
|
| 159 |
-
"and MO file compiled": "ve MO dosyası derlendi",
|
| 160 |
-
"Merged from %s": "%s üzerinden birleştirildi",
|
| 161 |
-
"Merged from source code": "Kaynak koddan birleştirildi",
|
| 162 |
-
"Already up to date with %s": "%s zaten güncel",
|
| 163 |
-
"Already up to date with source code": "Kaynak kod ile zaten güncel",
|
| 164 |
-
"1 new string added": {
|
| 165 |
-
"one": "1 yeni satır eklendi",
|
| 166 |
-
"other": "%s yeni cümle eklendi"
|
| 167 |
-
},
|
| 168 |
-
"1 obsolete string removed": {
|
| 169 |
-
"one": "1 adet kullanılmayan satır kaldırıldı",
|
| 170 |
-
"other": "%s kullanımdışı cümle kaldırıldı"
|
| 171 |
-
},
|
| 172 |
-
"Your changes will be lost if you continue without saving": "Kaydetmeden devam ederseniz değişiklikleriniz kaybolacak",
|
| 173 |
-
"Source text": "Kaynak Metin",
|
| 174 |
-
"%s translation": "%s Çevirisi",
|
| 175 |
-
"Comments": "Yorumlar",
|
| 176 |
-
"Context": "Metin",
|
| 177 |
-
"Translation": "Çeviri",
|
| 178 |
-
"No source files in this package, nothing to sync": "Bu pakette eşleştirilecek kaynak dosyalar bulunmuyor",
|
| 179 |
-
"No strings could be extracted from source files": "Kaynak dosyalardan herhangi satır çıkartılamadı",
|
| 180 |
-
"Translate WordPress plugins and themes directly in your browser": "",
|
| 181 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 182 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 183 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 184 |
-
}
|
| 185 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/pub/js/lang/loco-translate-uk.js
DELETED
|
@@ -1,190 +0,0 @@
|
|
| 1 |
-
/**
|
| 2 |
-
* Loco js export: JavaScript function
|
| 3 |
-
* Project: loco.po conversion
|
| 4 |
-
* Release: Working copy
|
| 5 |
-
* Locale: uk-UA, Ukrainian
|
| 6 |
-
* Exported by: Unregistered user
|
| 7 |
-
* Exported at: Wed, 06 Jul 2016 12:21:14 +0100
|
| 8 |
-
*/
|
| 9 |
-
loco = window.loco||{}, loco.t = function( pairs ){
|
| 10 |
-
|
| 11 |
-
// named plural forms
|
| 12 |
-
var pluralForms = [
|
| 13 |
-
"one",
|
| 14 |
-
"few",
|
| 15 |
-
"other"
|
| 16 |
-
];
|
| 17 |
-
|
| 18 |
-
// calc numeric index of a plural form (0-2)
|
| 19 |
-
function pluralIndex( n ){
|
| 20 |
-
return Number( (n%10==1 && n%100!=11 ? 0 : n%10 >= 2 && n%10<=4 &&(n%100<10||n%100 >= 20)? 1 : 2) );
|
| 21 |
-
}
|
| 22 |
-
|
| 23 |
-
// expose public t() function
|
| 24 |
-
return function( msgid1, msgid2, n ){
|
| 25 |
-
var value = pairs[msgid1];
|
| 26 |
-
// singular if no multiplier
|
| 27 |
-
if( null == n ){
|
| 28 |
-
n = 1;
|
| 29 |
-
}
|
| 30 |
-
// plurals stored as objects, e.g. { one: "" }
|
| 31 |
-
if( value instanceof Object ){
|
| 32 |
-
value = value[ pluralForms[ pluralIndex(n) ] || 'one' ];
|
| 33 |
-
}
|
| 34 |
-
return value || ( 1 === n ? msgid1 : msgid2 ) || msgid1 || '';
|
| 35 |
-
};
|
| 36 |
-
}(
|
| 37 |
-
{
|
| 38 |
-
"Error": "Помилка",
|
| 39 |
-
"Warning": "Попередження",
|
| 40 |
-
"OK": "ОК",
|
| 41 |
-
"Permission denied": "Доступ заборонено",
|
| 42 |
-
"Settings saved": "Налаштування збережено",
|
| 43 |
-
"%s is not an official WordPress language": "%s не є офіційною мовою WordPress",
|
| 44 |
-
"New PO file": "Новий РО-файл",
|
| 45 |
-
"PO file used as template. This will be renamed to %s on first save": "РО-файл використовується як шаблон. Його буде перейменовано до %s при першому збереженні",
|
| 46 |
-
"You must specify a valid locale for a new PO file": "Ви маєте визначити правильну локаль для нового РО-файла",
|
| 47 |
-
"No translatable strings found": "Не знайдено строк, які можна було б перекласти",
|
| 48 |
-
"Cannot create a PO file.": "Не можу створити РО файл.",
|
| 49 |
-
"PO file already exists with locale %s": "РО-файл вже існує для локалі %s",
|
| 50 |
-
"File cannot be created automatically. Fix the file permissions or use Download instead of Save": "Файл не може бути створений автоматично. Виправте права доступу або використайте «Завантажити» замість «Зберегти»",
|
| 51 |
-
"%s file is empty": "%s файл пустий",
|
| 52 |
-
"Run Sync to update from source code": "Запустіть «Синхронізувати», щоб оновити з ісходного коду",
|
| 53 |
-
"No strings could be extracted from source code": "Немає строк, які можуть бути витягнуті із ісходного коду",
|
| 54 |
-
"Run Sync to update from %s": "Запустіть «Синхронізувати», щоб оновити з %s",
|
| 55 |
-
"Source code has been modified, run Sync to update POT": "Ісходний код було модифіковано, запустіть «Синхронізувати», щоб оновити РОТ",
|
| 56 |
-
"POT has been modified since PO file was saved, run Sync to update": "РОТ було модифіковано з моменту останнього збереження РО-файлу, запустіть «Синхронізувати» для оновлення",
|
| 57 |
-
"Bad file path": "Невірний шлях до файлу",
|
| 58 |
-
"Empty or invalid %s file": "Пустий або ушкоджений %s файл ",
|
| 59 |
-
"%s file has no header": "%s файл не має заголовку",
|
| 60 |
-
"New template": "Новий шаблон",
|
| 61 |
-
"New language": "Нова мова",
|
| 62 |
-
"%s%% translated": "%s%% перекладено",
|
| 63 |
-
"1 string": {
|
| 64 |
-
"one": "1 строка",
|
| 65 |
-
"few": "%s строк",
|
| 66 |
-
"other": ""
|
| 67 |
-
},
|
| 68 |
-
"%s fuzzy": "%s неясний",
|
| 69 |
-
"%s untranslated": "%s неперекладено",
|
| 70 |
-
"Failed to compile MO file with built-in compiler": "Не вдалося скомпілювати МО-файл за допомогою вбудованного компілятора",
|
| 71 |
-
"Loco, Translation Management": "Керування перекладами Loco",
|
| 72 |
-
"Manage translations": "Керувати перекладами",
|
| 73 |
-
"Translation options": "Налаштування перекладів",
|
| 74 |
-
"Loco Translate": "Перекладач Loco",
|
| 75 |
-
"Settings": "Налаштування",
|
| 76 |
-
"File download failed": "Скачування файлу не вдалося",
|
| 77 |
-
"WPLANG is deprecated and should be removed from wp-config.php": "WPLANG застарів і його буде видалено з wp-config.php",
|
| 78 |
-
"Unknown language": "Невідома мова",
|
| 79 |
-
"Some files not writable": "Деякі файли неможливо записувати",
|
| 80 |
-
"Some files missing": "Деякі файли відсутні",
|
| 81 |
-
"\"%s\" folder not writable": "Папка \"%s\" не дозволяє записувати",
|
| 82 |
-
"POT file not writable": "РОТ-файл не дозволяє записувати",
|
| 83 |
-
"PO file not writable": "РО-файл не дозволяє записувати",
|
| 84 |
-
"MO file not writable": "МО-файл не дозволяє записувати",
|
| 85 |
-
"MO file not found": "МО-файл не знайдено",
|
| 86 |
-
"Folder not writable": "Папка не дозволяє записувати",
|
| 87 |
-
"Folder not found": "Папку не знайдено",
|
| 88 |
-
"%s does not declare a \"Text Domain\"": "%s не декларує \"Text Domain\"",
|
| 89 |
-
"Loco has guessed \"%s\"": "Loco припускає \"%s\"",
|
| 90 |
-
"%s does not declare a \"Domain Path\"": "%s не декларує \"Domain Path\"",
|
| 91 |
-
"%s has no POT file. Create one at \"%s/%s.pot\" if you need one.": "%s не має РОТ-файлу. Створіть його як \"%s/%s.pot\", якщо ви потребуєте.",
|
| 92 |
-
"%s has a strange POT file name (%s). A better name would be \"%s.pot\"": "%s має дивну назву РОТ-файлу (%s). Кращою назвою була б \"%s.pot\"",
|
| 93 |
-
"User does not have permission to manage translations": "Користувач немає доступу до керування перекладами",
|
| 94 |
-
"Invalid data posted to server": "Невірна дата встановлена на сервері",
|
| 95 |
-
"Failed to compile MO file with %s, check your settings": "Невдалося скомпілювати МО-файл за допомогою %s, перевірте ваші налаштування",
|
| 96 |
-
"Package not found called %s": "Пакунок %s не знайдено",
|
| 97 |
-
"Web server cannot create backups in \"%s\". Fix file permissions or disable backups in settings": "Сервер не може створити бекап у \"%s\". Виправте права доступу до файлів, або вимкніть створення бекапів у налаштуваннях.",
|
| 98 |
-
"Web server cannot create \"%s\" directory in \"%s\". Fix file permissions or create it manually.": "Сервер не може створити папку \"%s\" у \"%s\". Виправте права доступу до папки або створіть її вручну.",
|
| 99 |
-
"Web server cannot create files in the \"%s\" directory. Fix file permissions or use the download function.": "Сервер не може створити файл у папці \"%s\". Виправте права доступу або використовуйте функції «Скачати РО» та «Скачати МО».",
|
| 100 |
-
"%s file is not writable by the web server. Fix file permissions or download and copy to \"%s/%s\".": "Сервер не дозволяє записувати у файл %s. Виправте права доступу або скачайте файл та скопіюйте його вручну до \"%s/%s\".",
|
| 101 |
-
"Cannot create MO file": "Не можу створити МО-файл",
|
| 102 |
-
"Cannot overwrite MO file": "Не можу переписати МО-файл",
|
| 103 |
-
"Failed to write MO file": "Не вдалося записати МО-файл",
|
| 104 |
-
"Packages": "Пакунки",
|
| 105 |
-
"File check": "Перевірка файлу",
|
| 106 |
-
"File system permissions for %s": "Налаштування файлової системи для %s",
|
| 107 |
-
"Other potential issues with %s": "Інші потенційні проблеми з %s",
|
| 108 |
-
"Back": "Повернутись назад",
|
| 109 |
-
"Get help": "Отримати допомогу",
|
| 110 |
-
"Package details": "Деталі пакунку",
|
| 111 |
-
"Translations (PO)": "Переклади (РО)",
|
| 112 |
-
"Template (POT)": "Шаблони (РОТ)",
|
| 113 |
-
"File permissions": "Доступ до файлів",
|
| 114 |
-
"Extends: %s": "Розширення: %s",
|
| 115 |
-
"1 language": {
|
| 116 |
-
"one": "1 мова",
|
| 117 |
-
"few": "%u мов",
|
| 118 |
-
"other": "%u мов"
|
| 119 |
-
},
|
| 120 |
-
"Updated": "Оновлено",
|
| 121 |
-
"Powered by": "Запроваджено",
|
| 122 |
-
"Loco may not work as expected": "Можливо, Loco працює не так, як планувалося",
|
| 123 |
-
"Configure Loco Translate": "Налаштувати Перекладач Loco",
|
| 124 |
-
"Compiling MO files": "Компіляція МО-файлів",
|
| 125 |
-
"Use built-in MO compiler.": "Використовувати вбудований МО-компілятор.",
|
| 126 |
-
"Use external command:": "Використовувати зовнішні команди:",
|
| 127 |
-
"Enter path to msgfmt on server": "Введіть шлях до msgfmt на сервері",
|
| 128 |
-
"Generate hash tables": "Генерувати таблицю хешів",
|
| 129 |
-
"Include Fuzzy strings": "Включити нечітки строки",
|
| 130 |
-
"Backing up PO files": "Збереження(бекап) РО-файлів",
|
| 131 |
-
"Number of backups to keep of each file:": "Скільки бекапів зберегати для кожного файлу:",
|
| 132 |
-
"Experimental features": "Експериментальні можливості",
|
| 133 |
-
"Enable WordPress core translations": "Включити переклад ядра WordPress",
|
| 134 |
-
"Save settings": "Зберегти налаштування",
|
| 135 |
-
"Template file": "Файл шаблону",
|
| 136 |
-
"Switch to...": "Переключитись до...",
|
| 137 |
-
"never": "ніколи",
|
| 138 |
-
"Save": "Зберегти",
|
| 139 |
-
"Download": "Скачати",
|
| 140 |
-
"Sync": "Синхронізувати",
|
| 141 |
-
"Revert": "Повернути",
|
| 142 |
-
"Add": "Додати",
|
| 143 |
-
"Del": "Видалити",
|
| 144 |
-
"Fuzzy": "Нечіткі",
|
| 145 |
-
"Filter translations": "Фільтрувати переклади",
|
| 146 |
-
"Help": "Справка",
|
| 147 |
-
"Initialize new translations in %s": "Ініціалізувати нові переклади у %s",
|
| 148 |
-
"Select from common languages": "Оберіть із доступних мов",
|
| 149 |
-
"or enter any language code": "або введіть код будь-якої мови",
|
| 150 |
-
"create in <code>%s</code>": "створено у <code>%s</code>",
|
| 151 |
-
"create in global languages directory": "створити у глобальній папці для мов",
|
| 152 |
-
"Start translating": "Розпочати переклад",
|
| 153 |
-
"New version available": "Нова версія доступна",
|
| 154 |
-
"Upgrade to version %s of Loco Translate": "Оновіться до версії %s Перекладача Loco",
|
| 155 |
-
"Select a plugin or theme to translate": "Оберіть плагін або тему для перекладу",
|
| 156 |
-
"Themes": "Теми",
|
| 157 |
-
"Plugins": "Плагіни",
|
| 158 |
-
"Core": "Ядро",
|
| 159 |
-
"PHP extension \"%s\" is not installed. If you experience problems you should install it": "PHP-розширення \"%s\" не встановлене. Якщо ви досвічені у цих питаннях, встановіть його",
|
| 160 |
-
"Unknown error": "Невідома помилка",
|
| 161 |
-
"PO file saved": "РО-файл збережено",
|
| 162 |
-
"and MO file compiled": "та МО-файл скомпільовано",
|
| 163 |
-
"Merged from %s": "Об'єднано з %s",
|
| 164 |
-
"Merged from source code": "Об'єднано з ісходним кодом",
|
| 165 |
-
"Already up to date with %s": "Вже оновлено з %s",
|
| 166 |
-
"Already up to date with source code": "Вже оновлено з ісходного коду",
|
| 167 |
-
"1 new string added": {
|
| 168 |
-
"one": "1 нову строку додано",
|
| 169 |
-
"few": "%s нових строк додано",
|
| 170 |
-
"other": "%s нових строк додано"
|
| 171 |
-
},
|
| 172 |
-
"1 obsolete string removed": {
|
| 173 |
-
"one": "1 застарілу строку видалено",
|
| 174 |
-
"few": "%s застарілих строк видалено",
|
| 175 |
-
"other": "%s застарілих строк видалено"
|
| 176 |
-
},
|
| 177 |
-
"Your changes will be lost if you continue without saving": "Внесені зміни буде втрачено, якщо ви продовжите без збереження",
|
| 178 |
-
"Source text": "Ісходний текст",
|
| 179 |
-
"%s translation": "%s переклад",
|
| 180 |
-
"Comments": "Коментарі",
|
| 181 |
-
"Context": "Контекст",
|
| 182 |
-
"Translation": "Переклад",
|
| 183 |
-
"No source files in this package, nothing to sync": "Немає ісходних файлів у цьому пакунку, немає що синхронізувати",
|
| 184 |
-
"No strings could be extracted from source files": "Немає строк, які б можна було витягнути із ісходних файлі",
|
| 185 |
-
"Translate WordPress plugins and themes directly in your browser": "Переклад плагінів та тем WordPress прямо у вашому браузері",
|
| 186 |
-
"http://wordpress.org/extend/plugins/loco-translate": "http://wordpress.org/extend/plugins/loco-translate",
|
| 187 |
-
"Tim Whitlock": "Tim Whitlock",
|
| 188 |
-
"https://localise.biz/help/wordpress/translate-plugin": "https://localise.biz/help/wordpress/translate-plugin"
|
| 189 |
-
}
|
| 190 |
-
);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/tpl/admin-fscheck.tpl.php
DELETED
|
@@ -1,64 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* File system check screen - shows permission problems and gives advice on fixing
|
| 4 |
-
* @var LocoPackage $package
|
| 5 |
-
*/
|
| 6 |
-
$nav = array (
|
| 7 |
-
__('Packages','loco-legacy') => array( 'href' => LocoAdmin::uri() ),
|
| 8 |
-
__('Settings','loco-legacy') => array( 'href' => LocoAdmin::uri( array(), 'settings' ), 'icon' => 'admin-settings' ),
|
| 9 |
-
//
|
| 10 |
-
__('File check','loco-legacy') => array( 'icon' => 'admin-tools' ),
|
| 11 |
-
);
|
| 12 |
-
?>
|
| 13 |
-
|
| 14 |
-
<div class="wrap loco-admin loco-fscheck">
|
| 15 |
-
|
| 16 |
-
<?php Loco::render('admin-nav', compact('nav') );?>
|
| 17 |
-
|
| 18 |
-
<h2>
|
| 19 |
-
<?php Loco::h( sprintf( __('File system permissions for %s','loco-legacy'), $name ) )?>
|
| 20 |
-
</h2><?php
|
| 21 |
-
|
| 22 |
-
/* @var $package LocoPackage */
|
| 23 |
-
foreach( $package->get_permission_errors() as $path => $error ):?>
|
| 24 |
-
<ul class="loco-list">
|
| 25 |
-
<li>
|
| 26 |
-
<code><?php Loco::h( LocoAdmin::trim_path($path) )?></code>
|
| 27 |
-
</li><?php
|
| 28 |
-
if( $error ):?>
|
| 29 |
-
<li class="loco-warning">
|
| 30 |
-
<span><?php Loco::h($error)?></span>
|
| 31 |
-
</li><?php
|
| 32 |
-
else:?>
|
| 33 |
-
<li class="loco-ok">
|
| 34 |
-
<span>OK</span>
|
| 35 |
-
</li><?php
|
| 36 |
-
endif?>
|
| 37 |
-
</ul><?php
|
| 38 |
-
endforeach;
|
| 39 |
-
|
| 40 |
-
|
| 41 |
-
if( $warnings = $package->get_author_warnings() ):?>
|
| 42 |
-
<h2>
|
| 43 |
-
<?php Loco::h( sprintf( __('Other potential issues with %s','loco-legacy'), $name ) ) ?>
|
| 44 |
-
</h2>
|
| 45 |
-
|
| 46 |
-
<ul class="loco-list"><?php
|
| 47 |
-
foreach( $warnings as $error ):?>
|
| 48 |
-
<li class="loco-warning">
|
| 49 |
-
<span><?php Loco::h($error)?></span>
|
| 50 |
-
</li><?php
|
| 51 |
-
endforeach;?>
|
| 52 |
-
</ul><?php
|
| 53 |
-
endif?>
|
| 54 |
-
|
| 55 |
-
|
| 56 |
-
<p class="submit">
|
| 57 |
-
<a class="button-primary" href="<?php Loco::h( LocoAdmin::uri() )?>"><?php Loco::h( __('Back','loco-legacy') )?></a>
|
| 58 |
-
<a class="button" href="https://localise.biz/help/wordpress/translate-plugin/support" target="_blank"><?php Loco::h( __('Get help','loco-legacy') )?></a>
|
| 59 |
-
</p>
|
| 60 |
-
|
| 61 |
-
|
| 62 |
-
|
| 63 |
-
|
| 64 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/tpl/admin-list.tpl.php
DELETED
|
@@ -1,112 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* List of either plugins or themes that are translatable
|
| 4 |
-
*/
|
| 5 |
-
?>
|
| 6 |
-
|
| 7 |
-
<table class="wp-list-table widefat" cellspacing="0">
|
| 8 |
-
<thead>
|
| 9 |
-
<tr>
|
| 10 |
-
<th scope="col">
|
| 11 |
-
<?php Loco::h( _x('Package details','Table header','loco-legacy') )?>
|
| 12 |
-
</th>
|
| 13 |
-
<th scope="col">
|
| 14 |
-
<?php Loco::h( _x('Translations (PO)','Table header','loco-legacy') )?>
|
| 15 |
-
</th>
|
| 16 |
-
<th scope="col">
|
| 17 |
-
<?php Loco::h( _x('Template (POT)','Table header','loco-legacy') )?>
|
| 18 |
-
</th>
|
| 19 |
-
<th scope="col">
|
| 20 |
-
<?php Loco::h( _x('File permissions','Table header','loco-legacy') )?>
|
| 21 |
-
</th>
|
| 22 |
-
</tr>
|
| 23 |
-
</thead>
|
| 24 |
-
<tbody><?php
|
| 25 |
-
/* @var $package LocoPackage */
|
| 26 |
-
foreach( $items as $package ):
|
| 27 |
-
unset($parent);
|
| 28 |
-
extract( $package->meta() );
|
| 29 |
-
$mtime = $package->get_modified();
|
| 30 |
-
$n = count( $po );
|
| 31 |
-
?>
|
| 32 |
-
<tr class="inactive">
|
| 33 |
-
<td>
|
| 34 |
-
<ul class="loco-details">
|
| 35 |
-
<li title="<?php Loco::h($domain)?>">
|
| 36 |
-
<strong><?php Loco::h($package->get_name())?></strong>
|
| 37 |
-
</li><?php
|
| 38 |
-
if( isset($parent) ):?>
|
| 39 |
-
<li>
|
| 40 |
-
<?php Loco::h( __('Extends: %s','loco-legacy'), $parent ) ?>
|
| 41 |
-
</li><?php
|
| 42 |
-
endif?>
|
| 43 |
-
<li><?php
|
| 44 |
-
Loco::h( _n( '1 language', '%u languages', $n, 'loco-legacy' ), $n )?>
|
| 45 |
-
</li><?php
|
| 46 |
-
if( $mtime ):?>
|
| 47 |
-
<li class="loco-mtime">
|
| 48 |
-
<small>
|
| 49 |
-
<?php Loco::h( _x('Updated','Modified time','loco-legacy') )?>
|
| 50 |
-
<?php Loco::h( LocoAdmin::format_datetime($mtime) )?>
|
| 51 |
-
</small>
|
| 52 |
-
</li><?php
|
| 53 |
-
endif?>
|
| 54 |
-
</ul>
|
| 55 |
-
</td>
|
| 56 |
-
<td>
|
| 57 |
-
<ul>
|
| 58 |
-
<li class="loco-add">
|
| 59 |
-
<?php echo LocoAdmin::msginit_link( $package, $domain )?>
|
| 60 |
-
</li><?php
|
| 61 |
-
/* @var $po_locale LocoLocale */
|
| 62 |
-
foreach( $po as $po_data ):
|
| 63 |
-
extract( $po_data, EXTR_PREFIX_ALL, 'po' );
|
| 64 |
-
$code = $po_locale->get_code();
|
| 65 |
-
$label = $code ? $code.' : '.$po_locale->get_name() : $po_name;
|
| 66 |
-
?>
|
| 67 |
-
<li class="loco-edit-po">
|
| 68 |
-
<?php echo LocoAdmin::edit_link( $package, $po_path, $label, $po_locale->icon_class() )?>
|
| 69 |
-
<small class="loco-progress" title="<?php echo $po_stats['p']?>">
|
| 70 |
-
<?php echo $po_stats['p']?>%
|
| 71 |
-
</small>
|
| 72 |
-
</li><?php
|
| 73 |
-
endforeach;?>
|
| 74 |
-
</ul>
|
| 75 |
-
</td>
|
| 76 |
-
<td>
|
| 77 |
-
<ul><?php // show POT files (should be no more than one)
|
| 78 |
-
if( $pot ):
|
| 79 |
-
foreach( $pot as $pot_data ):
|
| 80 |
-
extract( $pot_data, EXTR_PREFIX_ALL, 'pot' );
|
| 81 |
-
?>
|
| 82 |
-
<li class="loco-edit-pot">
|
| 83 |
-
<?php echo LocoAdmin::edit_link( $package, $pot_path )?>
|
| 84 |
-
</li><?php
|
| 85 |
-
endforeach;
|
| 86 |
-
else:?>
|
| 87 |
-
<li class="loco-add">
|
| 88 |
-
<?php echo LocoAdmin::xgettext_link( $package )?>
|
| 89 |
-
</li><?php
|
| 90 |
-
endif?>
|
| 91 |
-
</ul>
|
| 92 |
-
</td>
|
| 93 |
-
<td>
|
| 94 |
-
<ul><?php
|
| 95 |
-
try {
|
| 96 |
-
$package->check_permissions();?>
|
| 97 |
-
<li class="loco-ok">
|
| 98 |
-
<?php echo LocoAdmin::fscheck_link( $package, $domain, _x('OK','Message label','loco-legacy') )?>
|
| 99 |
-
</li><?php
|
| 100 |
-
}
|
| 101 |
-
catch( Exception $Ex ){?>
|
| 102 |
-
<li class="loco-warning">
|
| 103 |
-
<?php echo LocoAdmin::fscheck_link( $package, $domain, $Ex->getMessage() )?>
|
| 104 |
-
</li><?php
|
| 105 |
-
}?>
|
| 106 |
-
</ul>
|
| 107 |
-
</td>
|
| 108 |
-
</tr><?php
|
| 109 |
-
endforeach?>
|
| 110 |
-
</tbody>
|
| 111 |
-
</table>
|
| 112 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/tpl/admin-nav.tpl.php
DELETED
|
@@ -1,42 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* main nav on tabbed admin pages
|
| 4 |
-
*/
|
| 5 |
-
?>
|
| 6 |
-
|
| 7 |
-
<div class="notice inline notice-warning">
|
| 8 |
-
<p>
|
| 9 |
-
<strong>Deprecation notice</strong><br />
|
| 10 |
-
You're running the old version of Loco Translate.
|
| 11 |
-
The next major release of Loco Translate will no longer include the legacy plugin.
|
| 12 |
-
<a href="<?php echo esc_url(LocoAdmin::uri(array(),'upgrade'))?>">Switch to version 2 now.</a>
|
| 13 |
-
</p>
|
| 14 |
-
</div>
|
| 15 |
-
|
| 16 |
-
<h2 class="nav-tab-wrapper"><?php
|
| 17 |
-
foreach( $nav as $label => $attrs ):
|
| 18 |
-
$href = $icon = '';
|
| 19 |
-
extract( $attrs );
|
| 20 |
-
if( $icon ){
|
| 21 |
-
$icon = ' dashicons-before dashicons-'.$icon;
|
| 22 |
-
}
|
| 23 |
-
if( $href ):?>
|
| 24 |
-
<a href="<?php echo Loco::html($href)?>" class="nav-tab<?php echo $icon?>">
|
| 25 |
-
<?php echo Loco::html($label)?>
|
| 26 |
-
</a><?php
|
| 27 |
-
else:?>
|
| 28 |
-
<a href="#" class="nav-tab nav-tab-active<?php echo $icon?>">
|
| 29 |
-
<?php Loco::h($label)?>
|
| 30 |
-
</a><?php
|
| 31 |
-
endif;
|
| 32 |
-
endforeach?>
|
| 33 |
-
|
| 34 |
-
<a href="https://localise.biz/about/gettext?<?php Loco::h( Loco::utm_query('nav') )?>" class="nav-tab nav-tab-loco" target="_blank">
|
| 35 |
-
<?php Loco::h(__('Powered by','loco-legacy'))?>
|
| 36 |
-
<?php Loco::h(__('Loco, Translation Management','loco-legacy'))?>
|
| 37 |
-
</a>
|
| 38 |
-
</h2>
|
| 39 |
-
|
| 40 |
-
<!--[if lt IE 9]><?php
|
| 41 |
-
LocoAdmin::warning( __( $ignore = 'Your browser is out of date!').' '.Loco::html( __('Loco may not work as expected','loco-legacy') ) );
|
| 42 |
-
?><![endif]-->
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/tpl/admin-opts.tpl.php
DELETED
|
@@ -1,106 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* Admin options screen - changes loco plugin settings
|
| 4 |
-
*/
|
| 5 |
-
$nav = array (
|
| 6 |
-
__('Packages','loco-legacy') => array( 'href' => LocoAdmin::uri() ),
|
| 7 |
-
__('Settings','loco-legacy') => array( 'icon' => 'admin-settings' ),
|
| 8 |
-
);
|
| 9 |
-
?>
|
| 10 |
-
|
| 11 |
-
<div class="wrap loco-admin loco-settings">
|
| 12 |
-
|
| 13 |
-
<?php Loco::render('admin-nav', compact('nav') )?>
|
| 14 |
-
|
| 15 |
-
<div> </div>
|
| 16 |
-
<div class="icon32 icon-settings"><br /></div>
|
| 17 |
-
<h2>
|
| 18 |
-
<?php Loco::h( __('Configure Loco Translate','loco-legacy') )?>
|
| 19 |
-
</h2>
|
| 20 |
-
|
| 21 |
-
<?php isset($success) and LocoAdmin::success( $success )?>
|
| 22 |
-
|
| 23 |
-
<form action="" method="post">
|
| 24 |
-
<table class="form-table">
|
| 25 |
-
<tbody>
|
| 26 |
-
<tr valign="top">
|
| 27 |
-
<th scope="row"><?php Loco::h( __('Compiling MO files','loco-legacy') )?></th>
|
| 28 |
-
<td>
|
| 29 |
-
<fieldset>
|
| 30 |
-
<legend class="screen-reader-text">
|
| 31 |
-
<span><?php Loco::h( __('Compiling MO files','loco-legacy') )?></span>
|
| 32 |
-
</legend>
|
| 33 |
-
<p>
|
| 34 |
-
<label for="loco--use-msgfmt-0">
|
| 35 |
-
<input type="radio" name="loco[use_msgfmt]" value="0" id="loco--use-msgfmt-0"<?php echo $use_msgfmt ? '' : ' checked';?> />
|
| 36 |
-
<?php Loco::h( __('Use built-in MO compiler.','loco-legacy') )?>
|
| 37 |
-
</label>
|
| 38 |
-
</p>
|
| 39 |
-
<p>
|
| 40 |
-
<label for="loco--use-msgfmt-1">
|
| 41 |
-
<input type="radio" name="loco[use_msgfmt]" value="1" id="loco--use-msgfmt-1"<?php echo $use_msgfmt ? ' checked' : '';?> />
|
| 42 |
-
<?php Loco::h( __('Use external command:','loco-legacy') )?>
|
| 43 |
-
</label>
|
| 44 |
-
<ul>
|
| 45 |
-
<li>
|
| 46 |
-
<input type="text" size="32" name="loco[which_msgfmt]" id="loco--which_msgfmt" value="<?php Loco::h($which_msgfmt)?>"
|
| 47 |
-
placeholder="<?php Loco::h( __('Enter path to msgfmt on server','loco-legacy') ) ?>" />
|
| 48 |
-
</li>
|
| 49 |
-
</ul>
|
| 50 |
-
</p>
|
| 51 |
-
<p>
|
| 52 |
-
<label for="loco--gen-hash">
|
| 53 |
-
<input type="checkbox" name="loco[gen_hash]" value="1" id="loco--gen-hash"<?php echo $gen_hash ? ' checked' : '';?> />
|
| 54 |
-
<?php Loco::h( __('Generate hash tables','loco-legacy') )?>
|
| 55 |
-
</label>
|
| 56 |
-
</p>
|
| 57 |
-
<p>
|
| 58 |
-
<label for="loco--use-fuzzy">
|
| 59 |
-
<input type="checkbox" name="loco[use_fuzzy]" value="1" id="loco--use-fuzzy"<?php echo $use_fuzzy ? ' checked' : '';?> />
|
| 60 |
-
<?php Loco::h( __('Include Fuzzy strings','loco-legacy') )?>
|
| 61 |
-
</label>
|
| 62 |
-
</p>
|
| 63 |
-
</fieldset>
|
| 64 |
-
</td>
|
| 65 |
-
</tr>
|
| 66 |
-
<tr valign="top">
|
| 67 |
-
<th scope="row"><?php Loco::h( __('Backing up PO files','loco-legacy') )?></th>
|
| 68 |
-
<td>
|
| 69 |
-
<fieldset>
|
| 70 |
-
<legend class="screen-reader-text">
|
| 71 |
-
<span><?php Loco::h( __('Backing up PO files','loco-legacy') )?></span>
|
| 72 |
-
</legend>
|
| 73 |
-
<p>
|
| 74 |
-
<label for="loco--num-backups">
|
| 75 |
-
<?php Loco::h( __('Number of backups to keep of each file:','loco-legacy') )?>
|
| 76 |
-
</label>
|
| 77 |
-
<input type="number" min="0" max="99" size="2" name="loco[num_backups]" id="loco--num_backups" value="<?php printf('%u',$num_backups)?>" />
|
| 78 |
-
</p>
|
| 79 |
-
</fieldset>
|
| 80 |
-
</td>
|
| 81 |
-
</tr>
|
| 82 |
-
<tr valign="top">
|
| 83 |
-
<th scope="row"><?php Loco::h( __('Experimental features','loco-legacy') )?></th>
|
| 84 |
-
<td>
|
| 85 |
-
<fieldset>
|
| 86 |
-
<legend class="screen-reader-text">
|
| 87 |
-
<span><?php Loco::h( __('Experimental features','loco-legacy') )?></span>
|
| 88 |
-
</legend>
|
| 89 |
-
<p>
|
| 90 |
-
<label for="loco--enable-core">
|
| 91 |
-
<input type="checkbox" name="loco[enable_core]" value="1" id="loco--enable-core"<?php echo $enable_core ? ' checked' : '';?> />
|
| 92 |
-
<?php Loco::h( __('Enable WordPress core translations','loco-legacy') )?>
|
| 93 |
-
</label>
|
| 94 |
-
</p>
|
| 95 |
-
</fieldset>
|
| 96 |
-
</td>
|
| 97 |
-
</tr>
|
| 98 |
-
</tbody>
|
| 99 |
-
</table>
|
| 100 |
-
<p class="submit">
|
| 101 |
-
<input type="submit" class="button-primary" value="<?php Loco::h( __('Save settings','loco-legacy') )?>" />
|
| 102 |
-
<a class="button" href="https://localise.biz/help/wordpress/translate-plugin/support" target="_blank"><?php Loco::h( __('Get help','loco-legacy') )?></a>
|
| 103 |
-
</p>
|
| 104 |
-
</form>
|
| 105 |
-
|
| 106 |
-
</div>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
old/tpl/admin-poedit.tpl.php
DELETED
|
@@ -1,164 +0,0 @@
|
|
| 1 |
-
<?php
|
| 2 |
-
/**
|
| 3 |
-
* PO file editor screen
|
| 4 |
-
*/
|
| 5 |
-
$nav = array (
|
| 6 |
-
__('Packages','loco-legacy') => array( 'href' => LocoAdmin::uri() ),
|
| 7 |
-
__('Settings','loco-legacy') => array( 'href' => LocoAdmin::uri( array(), 'settings' ), 'icon' => 'admin-settings' ),
|
| 8 |
-
//
|
| 9 |
-
$name => array( 'icon' => 'POT' === $type ? 'edit' : 'translation' ),
|
| 10 |
-
);
|
| 11 |
-
|
| 12 |
-
$phpbase = Loco::html( Loco::baseurl() ).'/php';
|
| 13 |
-
$argpair = $package->get_query();
|
| 14 |
-
|
| 15 |
-
// whether to show file switcher
|
| 16 |
-
$pofiles = $package->get_gettext_files();
|
| 17 |
-
$modified or $pofiles[] = $path;
|
| 18 |
-
|
| 19 |
-
?>
|
| 20 |
-
<div class="wrap loco-admin loco-edit"><?php
|
| 21 |
-
|
| 22 |
-
// Main navigation
|
| 23 |
-
Loco::render('admin-nav', compact('nav') )?>
|
| 24 |
-
|
| 25 |
-
<h3 class="title"><?php
|
| 26 |
-
|
| 27 |
-
// print flag or template indicator
|
| 28 |
-
if( $locale ):?>
|
| 29 |
-
<span class="<?php echo $locale->icon_class()?>"></span> <?php
|
| 30 |
-
Loco::h( $locale->get_name() )?>:<?php
|
| 31 |
-
else:
|
| 32 |
-
Loco::h( __('Template file','loco-legacy') )?>: <?php
|
| 33 |
-
endif;
|
| 34 |
-
|
| 35 |
-
// print switcher if more than one file available
|
| 36 |
-
if( 1 < count($pofiles) ):?>
|
| 37 |
-
<form action="#" class="loco-switcher">
|
| 38 |
-
<select onchange="void function(u){ u && location.assign(u) }( this.options[this.options.selectedIndex].value);">
|
| 39 |
-
<option value="">
|
| 40 |
-
<?php Loco::h(_x('Switch to...','Dropdown label','loco-legacy'))?>
|
| 41 |
-
</option><?php
|
| 42 |
-
// drop down of files in package
|
| 43 |
-
$poname = str_replace( '.mo', '.po', basename( $path ) );
|
| 44 |
-
foreach( $pofiles as $_path ):
|
| 45 |
-
$label = str_replace( '.mo', '.po', basename($_path) );
|
| 46 |
-
$url = LocoAdmin::edit_uri( $package, $_path );
|
| 47 |
-
?>
|
| 48 |
-
<option value="<?php Loco::h($url)?>" <?php $poname === $label and print('selected')?>>
|
| 49 |
-
<?php Loco::h($label)?>
|
| 50 |
-
</option><?php
|
| 51 |
-
endforeach?>
|
| 52 |
-
</select>
|
| 53 |
-
</form><?php
|
| 54 |
-
endif?>
|
| 55 |
-
|
| 56 |
-
<span class="loco-meta">
|
| 57 |
-
<?php Loco::h( _x('Updated','Modified time','loco-legacy') )?>:
|
| 58 |
-
<span id="loco-po-modified">
|
| 59 |
-
<?php if( $modified ):?>
|
| 60 |
-
<?php Loco::h($modified)?>
|
| 61 |
-
<?php else:?>
|
| 62 |
-
<em><?php Loco::h( __('never','loco-legacy') )?></em>
|
| 63 |
-
<?php endif?>
|
| 64 |
-
</span>
|
| 65 |
-
—
|
| 66 |
-
<span id="loco-po-status">
|
| 67 |
-
<!-- js will load status -->
|
| 68 |
-
</span>
|
| 69 |
-
</span>
|
| 70 |
-
</h3>
|
| 71 |
-
|
| 72 |
-
|
| 73 |
-
<?php foreach( $warnings as $text ): LocoAdmin::warning($text); endforeach?>
|
| 74 |
-
|
| 75 |
-
|
| 76 |
-
<div id="loco-poedit">
|
| 77 |
-
|
| 78 |
-
<nav id="loco-nav" class="wp-core-ui">
|
| 79 |
-
<form action="<?php echo $phpbase?>/loco-fail.php" method="post" id="loco-poedit-save">
|
| 80 |
-
<input type="hidden" name="po" value="" />
|
| 81 |
-
<input type="hidden" name="path" value="<?php Loco::h($path)?>" />
|
| 82 |
-
<input type="hidden" name="action" value="loco-posave" /><?php
|
| 83 |
-
foreach( $argpair as $k => $v ):?>
|
| 84 |
-
<input type="hidden" name="<?php Loco::h($k)?>" value="<?php Loco::h($v)?>" /><?php
|
| 85 |
-
endforeach?>
|
| 86 |
-
<button class="button loco-save" data-loco="save" type="submit" disabled>
|
| 87 |
-
<span><?php Loco::h( _x('Save','Editor button','loco-legacy') )?></span>
|
| 88 |
-
</button>
|
| 89 |
-
</form>
|
| 90 |
-
<form action="<?php echo $phpbase?>/loco-fail.php" method="post">
|
| 91 |
-
<input type="hidden" name="po" value="" />
|
| 92 |
-
<input type="hidden" name="action" value="loco-download" />
|
| 93 |
-
<input type="hidden" name="path" value="<?php Loco::h($path)?>" />
|
| 94 |
-
<button class="button loco-download" data-loco="download_po" type="submit" disabled title="<?php Loco::h( _x('Download','Editor button','loco-legacy') )?> PO">
|
| 95 |
-
<span><?php echo $locale ? 'PO' : 'POT' ?></span>
|
| 96 |
-
</button>
|
| 97 |
-
</form><?php
|
| 98 |
-
if( $locale ):?>
|
| 99 |
-
<form action="<?php echo $phpbase?>/loco-fail.php" method="post">
|
| 100 |
-
<input type="hidden" name="po" value="" />
|
| 101 |
-
<input type="hidden" name="action" value="loco-download" />
|
| 102 |
-
<input type="hidden" name="path" value="<?php Loco::h( preg_replace('/\.po$/','.mo',$path) )?>" />
|
| 103 |
-
<button class="button loco-download" data-loco="download_mo" type="submit" disabled title="<?php Loco::h( _x('Download','Editor button','loco-legacy') )?> MO">
|
| 104 |
-
<span>MO</span>
|
| 105 |
-
</button>
|
| 106 |
-
</form><?php
|
| 107 |
-
endif?>
|
| 108 |
-
<form action="<?php echo $phpbase?>/loco-fail.php" method="post">
|
| 109 |
-
<input type="hidden" name="path" value="<?php Loco::h($path)?>" />
|
| 110 |
-
<input type="hidden" name="action" value="loco-posync" /><?php
|
| 111 |
-
foreach( $argpair as $k => $v ):?>
|
| 112 |
-
<input type="hidden" name="<?php Loco::h($k)?>" value="<?php Loco::h($v)?>" /><?php
|
| 113 |
-
endforeach?>
|
| 114 |
-
<button class="button loco-sync" data-loco="sync" disabled>
|
| 115 |
-
<span><?php Loco::h( _x('Sync','Editor button','loco-legacy') )?></span>
|
| 116 |
-
</button>
|
| 117 |
-
</form>
|
| 118 |
-
<form action="<?php echo $phpbase?>/loco-fail.php" method="get">
|
| 119 |
-
<button class="button loco-revert" data-loco="rever
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
