Loco Translate - Version 2.5.3

Version Description

Adds option to merge JSON translations when syncing from PO
Adds screen for editing file headers and sync options
Fix for missing responseText in failed Ajax responses
Fix for HTML entities returned from number_format_i18n
Localized number formatting in JavaScript
Replaced usage of date_i18n with wp_date
Added configurable API endpoint for DeepL
Bumped WordPress version to 5.7.2

Release Info

Developer	timwhitlock
Plugin	Loco Translate
Version	2.5.3
Comparing to
See all releases

Code changes from version 2.5.2 to 2.5.3

Files changed (65) hide show

languages/loco-translate.pot +112 -91
lib/compiled/gettext.php +7 -7
lib/data/locales.php +1 -1
loco.php +2 -2
pub/css/admin.css +1 -1
pub/css/editor.css +1 -1
pub/css/fileinfo.css +1 -1
pub/css/podiff.css +1 -1
pub/css/poview.css +1 -1
pub/css/skins/blue.css +1 -1
pub/css/skins/coffee.css +1 -1
pub/css/skins/ectoplasm.css +1 -1
pub/css/skins/light.css +1 -1
pub/css/skins/midnight.css +1 -1
pub/css/skins/modern.css +1 -1
pub/css/skins/ocean.css +1 -1
pub/css/skins/sunrise.css +1 -1
pub/js/min/admin.js +4914 -196
pub/js/min/config.js +32 -1
pub/js/min/debug.js +31 -1
pub/js/min/delete.js +4 -1
pub/js/min/editor.js +354 -1
pub/js/min/head.js +4 -0
pub/js/min/move.js +17 -1
pub/js/min/podiff.js +44 -1
pub/js/min/poinit.js +85 -1
pub/js/min/potinit.js +10 -1
pub/js/min/poview.js +37 -1
pub/js/min/setup.js +51 -1
pub/js/min/upload.js +47 -1
readme.txt +13 -3
src/admin/config/ApisController.php +1 -0
src/admin/file/DiffController.php +3 -2
src/admin/file/EditController.php +7 -9
src/admin/file/HeadController.php +169 -0
src/admin/file/InfoController.php +14 -10
src/ajax/MsginitController.php +39 -24
src/ajax/SyncController.php +16 -3
src/api/Providers.php +1 -0
src/cli/FetchCommand.php +1 -1
src/cli/SyncCommand.php +12 -7
src/compat/PosixExtension.php +7 -5
src/data/Settings.php +2 -0
src/error/AdminNotices.php +4 -6
src/error/Exception.php +34 -2
src/fs/Directory.php +1 -3
src/fs/File.php +4 -5
src/fs/Siblings.php +5 -5
src/gettext/Compiler.php +1 -1
src/gettext/Data.php +4 -3
src/gettext/Matcher.php +136 -1
src/gettext/SyncOptions.php +100 -0
src/hooks/LoadHelper.php +2 -1
src/js/Strings.php +4 -0
src/mvc/AdminController.php +6 -1
src/mvc/AdminRouter.php +1 -0
src/mvc/Controller.php +9 -0
src/mvc/FileParams.php +1 -1
src/mvc/ViewParams.php +19 -14
src/test/WordPressTestCase.php +1 -1
tpl/admin/config/apis.php +6 -0
tpl/admin/file/conf.php +63 -0
tpl/admin/file/head.php +39 -0
tpl/admin/file/info-po.php +1 -0
tpl/admin/init/init-po.php +13 -3

languages/loco-translate.pot CHANGED Viewed

	@@ -1,9 +1,9 @@
1	#, fuzzy
2	msgid ""
3	msgstr ""
4	- "Project-Id-Version: Loco Translate 2.5.2\n"
5	"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/loco-translate/\n"
6	- "POT-Creation-Date: 2021-03-11 09:51+0000\n"
7	"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
8	"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
9	"Language-Team: \n"
	@@ -13,7 +13,7 @@ msgstr ""
13	"Content-Type: text/plain; charset=UTF-8\n"
14	"Content-Transfer-Encoding: 8bit\n"
15	"X-Generator: Loco https://localise.biz/\n"
16	- "X-Loco-Version: 2.5.2; wp-5.7\n"
17	"X-Domain: loco-translate"
18
19	#: src/fs/FileWriter.php:214
	@@ -26,7 +26,7 @@ msgid "\"Hello Dolly\" is part of the WordPress core"
26	msgstr ""
27
28	#. (1) Number of files (2) Maximum size of file that will be included (3) Size of the largest encountered
29	- #: src/ajax/SyncController.php:86
30	#, php-format
31	msgid ""
32	"%1$s file has been skipped because it's %3$s. (Max is %2$s). Check all "
	@@ -54,7 +54,7 @@ msgstr[0] ""
54	msgstr[1] ""
55
56	#. 1: Number of strings; 2: Service provider; e.g. "50 strings translated via Google Translate"
57	- #: src/js/Strings.php:58
58	#, javascript-format
59	msgid "%1$s string translated via %2$s"
60	msgid_plural "%1$s strings translated via %2$s"
	@@ -67,7 +67,7 @@ msgid "%s already exists in this folder"
67	msgstr ""
68
69	#. characters meaning individual unicode characters of source text
70	- #: src/js/Strings.php:47
71	#, javascript-format
72	msgid "%s characters will be sent for translation."
73	msgstr ""
	@@ -107,13 +107,13 @@ msgstr[0] ""
107	msgstr[1] ""
108
109	#. Where %s is either PO or POT
110	- #: src/gettext/Compiler.php:239
111	#, php-format
112	msgid "%s file saved"
113	msgstr ""
114
115	#. Shows number of fuzzy strings at top of editor
116	- #: src/js/Strings.php:91 src/gettext/Metadata.php:206
117	#, javascript-format
118	msgid "%s fuzzy"
119	msgstr ""
	@@ -156,7 +156,7 @@ msgstr[1] ""
156
157	#. Shows total string count at top of editor
158	#. Where %s is any number of strings
159	- #: src/js/Strings.php:83 src/gettext/Metadata.php:194
160	#, javascript-format
161	msgid "%s string"
162	msgid_plural "%s strings"
	@@ -171,20 +171,28 @@ msgid_plural "%s strings marked Fuzzy"
171	msgstr[0] ""
172	msgstr[1] ""
173
174	- #: src/js/Strings.php:61
175	#, javascript-format
176	msgid "%s string updated"
177	msgid_plural "%s strings updated"
178	msgstr[0] ""
179	msgstr[1] ""
180
181	- #: ~~src/js/Strings.php:43~~








182	#, javascript-format
183	msgid "%s unique source strings."
184	msgstr ""
185
186	#. Shows number of untranslated strings at top of editor
187	- #: src/js/Strings.php:95 src/gettext/Metadata.php:209
188	#, javascript-format
189	msgid "%s untranslated"
190	msgstr ""
	@@ -197,7 +205,7 @@ msgstr[0] ""
197	msgstr[1] ""
198
199	#. Shows percentage translated at top of editor
200	- #: src/js/Strings.php:87 src/gettext/Metadata.php:204
201	#, javascript-format
202	msgid "%s%% translated"
203	msgstr ""
	@@ -245,7 +253,8 @@ msgid ""
245	"privacy notice</a>."
246	msgstr ""
247
248	- #: src/admin/bundle/BaseController.php:110 tpl/admin/file/~~move~~.php:26

249	msgid "Advanced"
250	msgstr ""
251
	@@ -289,10 +298,14 @@ msgstr ""
289	msgid "API keys"
290	msgstr ""
291
292	- #: src/admin/config/ApisController.php:66
293	msgid "API region"
294	msgstr ""
295




296	#: tpl/admin/file/delete.php:16
297	msgid ""
298	"Are you sure you want to <strong>permanently</strong> delete the following "
	@@ -321,7 +334,7 @@ msgid ""
321	"editor"
322	msgstr ""
323
324	- #: tpl/admin/file/info-po.php:46
325	msgid "Binary file missing"
326	msgstr ""
327
	@@ -368,7 +381,7 @@ msgstr ""
368	msgid "Check config repository"
369	msgstr ""
370
371	- #: src/js/Strings.php:~~113~~
372	msgid "Check console output for debugging information"
373	msgstr ""
374
	@@ -456,7 +469,7 @@ msgstr ""
456	msgid "Copy"
457	msgstr ""
458
459	- #: tpl/admin/init/init-po.php:147
460	#, php-format
461	msgid "Copy target translations from \"%s\""
462	msgstr ""
	@@ -525,9 +538,9 @@ msgstr ""
525	msgid "Disallow"
526	msgstr ""
527
528	- #: src/data/Settings.php:~~176~~ src/admin/file/EditController.php:~~164~~
529	#: src/admin/bundle/LocaleController.php:130 tpl/admin/config/settings.php:234
530	- #: tpl/admin/config/apis.php:~~122~~ tpl/admin/config/prefs.php:45
531	#: tpl/admin/common/inc-fsconn.php:16 tpl/admin/common/inc-fsconn.php:41
532	#: tpl/admin/errors/no-backups.php:22
533	msgid "Documentation"
	@@ -572,137 +585,137 @@ msgid "Editor"
572	msgstr ""
573
574	#. Where %s is the name of the language, e.g. "French translation"
575	- #: src/js/Strings.php:~~127~~
576	#, javascript-format
577	msgctxt "Editor"
578	msgid "%s translation"
579	msgstr ""
580
581	#. button for adding a new string when manually editing a POT file
582	- #: src/admin/file/EditController.php:~~189~~
583	msgctxt "Editor"
584	msgid "Add"
585	msgstr ""
586
587	#. Button that opens window for auto-translating
588	- #: src/admin/file/EditController.php:~~200~~
589	msgctxt "Editor"
590	msgid "Auto"
591	msgstr ""
592
593	#. Label for the window pane for entering translator comments
594	- #: src/js/Strings.php:~~133~~
595	msgctxt "Editor"
596	msgid "Comments"
597	msgstr ""
598
599	#. Label for the window pane holding message context
600	- #: src/js/Strings.php:~~130~~
601	msgctxt "Editor"
602	msgid "Context"
603	msgstr ""
604
605	#. Label for the context window when no translation selected
606	- #: src/js/Strings.php:~~157~~
607	msgctxt "Editor"
608	msgid "Context not loaded"
609	msgstr ""
610
611	#. Button for downloading a PO, MO or POT file
612	- #: src/admin/file/EditController.php:~~202~~
613	msgctxt "Editor"
614	msgid "Download"
615	msgstr ""
616
617	#. Label for the plural form of the original English text
618	- #: src/js/Strings.php:~~139~~
619	msgctxt "Editor"
620	msgid "Plural"
621	msgstr ""
622
623	#. button for removing a string when manually editing a POT file
624	- #: src/admin/file/EditController.php:~~191~~
625	msgctxt "Editor"
626	msgid "Remove"
627	msgstr ""
628
629	#. Button that reloads current screen
630	- #: src/admin/file/EditController.php:~~198~~
631	msgctxt "Editor"
632	msgid "Revert"
633	msgstr ""
634
635	#. Button that saves translations to disk
636	- #: src/admin/file/EditController.php:~~194~~
637	msgctxt "Editor"
638	msgid "Save"
639	msgstr ""
640
641	#. Label for the singular form of the original English text
642	- #: src/js/Strings.php:~~136~~
643	msgctxt "Editor"
644	msgid "Single"
645	msgstr ""
646
647	#. Label for the window pane holding the original English text
648	#. List heading showing preview of English text for each item
649	- #: src/js/Strings.php:~~123~~ tpl/admin/file/info-pot.php:30
650	msgctxt "Editor"
651	msgid "Source text"
652	msgstr ""
653
654	#. Label for the source text window when no translation selected
655	- #: src/js/Strings.php:~~154~~
656	msgctxt "Editor"
657	msgid "Source text not loaded"
658	msgstr ""
659
660	- #: src/js/Strings.php:~~151~~
661	msgctxt "Editor"
662	msgid "Suggest translation"
663	msgstr ""
664
665	#. Button that runs in-editor sync/operation
666	- #: src/admin/file/EditController.php:~~196~~
667	msgctxt "Editor"
668	msgid "Sync"
669	msgstr ""
670
671	#. Button that toggles between "code" and regular text editing modes
672	- #: src/admin/file/EditController.php:~~208~~
673	msgctxt "Editor"
674	msgid "Toggle code view"
675	msgstr ""
676
677	- #: src/js/Strings.php:~~148~~
678	msgctxt "Editor"
679	msgid "Toggle Fuzzy"
680	msgstr ""
681
682	#. Button that toggles invisible characters
683	- #: src/admin/file/EditController.php:~~206~~
684	msgctxt "Editor"
685	msgid "Toggle invisibles"
686	msgstr ""
687
688	- #: src/js/Strings.php:~~145~~
689	msgctxt "Editor"
690	msgid "Translated"
691	msgstr ""
692
693	#. List heading showing preview of translated text for each item
694	- #: src/js/Strings.php:~~163~~
695	msgctxt "Editor"
696	msgid "Translation"
697	msgstr ""
698
699	#. Label for the translation editing window when no translation selected
700	- #: src/js/Strings.php:~~160~~
701	msgctxt "Editor"
702	msgid "Translation not loaded"
703	msgstr ""
704
705	- #: src/js/Strings.php:~~142~~
706	msgctxt "Editor"
707	msgid "Untranslated"
708	msgstr ""
	@@ -721,7 +734,7 @@ msgstr ""
721	msgid "Enter a new location for this file"
722	msgstr ""
723
724	- #: src/js/Strings.php:98 src/error/Exception.php:~~158~~
725	msgid "Error"
726	msgstr ""
727
	@@ -800,7 +813,7 @@ msgid_plural "%u files deleted"
800	msgstr[0] ""
801	msgstr[1] ""
802
803	- #: src/admin/file/InfoController.php:~~167~~
804	msgid "File does not have a valid header"
805	msgstr ""
806
	@@ -854,7 +867,7 @@ msgid "File modification is disallowed by your WordPress config"
854	msgstr ""
855
856	#: tpl/admin/file/info-mo.php:21 tpl/admin/file/info-pot.php:24
857	- #: tpl/admin/file/info-po.php:26
858	msgid "File modified"
859	msgstr ""
860
	@@ -871,7 +884,7 @@ msgid "File restored"
871	msgstr ""
872
873	#: tpl/admin/file/info-mo.php:18 tpl/admin/file/info-pot.php:21
874	- #: tpl/admin/file/info-po.php:23
875	msgid "File size"
876	msgstr ""
877
	@@ -895,7 +908,7 @@ msgid ""
895	msgstr ""
896
897	#. Placeholder text for text filter above editor
898	- #: src/admin/file/EditController.php:~~204~~
899	msgid "Filter translations"
900	msgstr ""
901
	@@ -950,7 +963,7 @@ msgstr ""
950	msgid "Grant access to roles"
951	msgstr ""
952
953	- #: src/ajax/ApisController.php:26 src/admin/file/EditController.php:~~192~~
954	msgid "Help"
955	msgstr ""
956
	@@ -986,11 +999,11 @@ msgstr ""
986	msgid "Import config from XML"
987	msgstr ""
988
989	- #: tpl/admin/config/apis.php:~~112~~
990	msgid "Important"
991	msgstr ""
992
993	- #: tpl/admin/file/info-po.php:59
994	msgid "In sync with template"
995	msgstr ""
996
	@@ -1041,7 +1054,7 @@ msgstr ""
1041	msgid "JSON compilation failed for %s"
1042	msgstr ""
1043
1044	- #: tpl/admin/init/init-po.php:153
1045	msgid "Just copy English source strings"
1046	msgstr ""
1047
	@@ -1050,7 +1063,7 @@ msgstr ""
1050	msgid "Just now"
1051	msgstr ""
1052
1053	- #: src/js/Strings.php:76
1054	msgid "Keep this translation"
1055	msgstr ""
1056
	@@ -1058,7 +1071,7 @@ msgstr ""
1058	msgid "Language"
1059	msgstr ""
1060
1061	- #: src/admin/file/InfoController.php:~~174~~
1062	#, php-format
1063	msgid "Language header is \"%s\" but file name contains \"%s\""
1064	msgstr ""
	@@ -1087,7 +1100,7 @@ msgstr ""
1087	msgid "Last modified"
1088	msgstr ""
1089
1090	- #: tpl/admin/file/info-mo.php:24 tpl/admin/file/info-po.php:29
1091	msgid "Last translation"
1092	msgstr ""
1093
	@@ -1095,7 +1108,7 @@ msgstr ""
1095	msgid "Load config"
1096	msgstr ""
1097
1098	- #: src/js/Strings.php:73
1099	msgid "Loading suggestions"
1100	msgstr ""
1101
	@@ -1135,7 +1148,7 @@ msgstr ""
1135	msgid "Loco Translate %s"
1136	msgstr ""
1137
1138	- #: src/data/Settings.php:~~175~~
1139	msgid "Loco Translate 2.5 adds supports for JSON language pack generation."
1140	msgstr ""
1141
	@@ -1163,6 +1176,10 @@ msgstr ""
1163	msgid "Maximum line length (zero disables wrapping)"
1164	msgstr ""
1165




1166	#. Where %s is the name of the POT template file. Message appears after sync
1167	#: src/js/Strings.php:18
1168	#, javascript-format
	@@ -1174,7 +1191,7 @@ msgstr ""
1174	msgid "Merged from source code"
1175	msgstr ""
1176
1177	- #: tpl/admin/file/info-po.php:83
1178	msgid "Missing template"
1179	msgstr ""
1180
	@@ -1282,11 +1299,11 @@ msgstr ""
1282	msgid "Nothing matches the text filter"
1283	msgstr ""
1284
1285	- #: src/js/Strings.php:64
1286	msgid "Nothing needed updating"
1287	msgstr ""
1288
1289	- #: src/js/Strings.php:~~104~~ src/error/Notice.php:20
1290	#: tpl/admin/common/inc-fsconn.php:37
1291	msgid "Notice"
1292	msgstr ""
	@@ -1303,7 +1320,7 @@ msgstr ""
1303	msgid "Official plugin page"
1304	msgstr ""
1305
1306	- #: src/js/Strings.php:~~107~~ src/error/Success.php:19
1307	msgid "OK"
1308	msgstr ""
1309
	@@ -1311,7 +1328,7 @@ msgstr ""
1311	msgid "OK, Load this config"
1312	msgstr ""
1313
1314	- #: tpl/admin/file/info-po.php:70
1315	msgid "Out of sync with template"
1316	msgstr ""
1317
	@@ -1323,7 +1340,7 @@ msgstr ""
1323	msgid "Overwrite existing translations"
1324	msgstr ""
1325
1326	- #: src/mvc/AdminRouter.php:~~240~~
1327	msgid "Page not found"
1328	msgstr ""
1329
	@@ -1422,7 +1439,7 @@ msgid "Zero"
1422	msgstr ""
1423
1424	#. Where %s is the name of a template file
1425	- #: tpl/admin/file/info-po.php:74
1426	#, php-format
1427	msgid ""
1428	"PO file has different source strings to \"%s\". Try running Sync before "
	@@ -1430,7 +1447,7 @@ msgid ""
1430	msgstr ""
1431
1432	#. Where %s is the name of a template file
1433	- #: tpl/admin/file/info-po.php:63
1434	#, php-format
1435	msgid "PO file has the same source strings as \"%s\""
1436	msgstr ""
	@@ -1459,7 +1476,7 @@ msgstr ""
1459	msgid "Project name"
1460	msgstr ""
1461
1462	- #: src/js/Strings.php:~~116~~
1463	msgid "Provide the following text when reporting a problem"
1464	msgstr ""
1465
	@@ -1515,6 +1532,10 @@ msgstr ""
1515	msgid "Running plugins:"
1516	msgstr ""
1517




1518	#: tpl/admin/bundle/conf.php:141
1519	msgid "Save config"
1520	msgstr ""
	@@ -1523,7 +1544,7 @@ msgstr ""
1523	msgid "Save credentials in session"
1524	msgstr ""
1525
1526	- #: tpl/admin/config/settings.php:233 tpl/admin/config/apis.php:~~121~~
1527	#: tpl/admin/config/prefs.php:44
1528	msgid "Save settings"
1529	msgstr ""
	@@ -1560,12 +1581,12 @@ msgstr ""
1560	msgid "See FAQ"
1561	msgstr ""
1562
1563	- #: tpl/admin/config/apis.php:~~115~~
1564	msgid "See full disclaimer"
1565	msgstr ""
1566
1567	#. Generic error when external process broke an Ajax request
1568	- #: src/js/Strings.php:~~110~~
1569	msgid "Server returned invalid data"
1570	msgstr ""
1571
	@@ -1580,7 +1601,7 @@ msgid "Sets"
1580	msgstr ""
1581
1582	#: src/mvc/AdminRouter.php:67 src/mvc/AdminRouter.php:72
1583	- #: tpl/ajax/modal-apis-empty.php:15 src/admin/file/EditController.php:~~163~~
1584	#: tpl/admin/common/inc-fsconn.php:18 tpl/admin/common/inc-fsconn.php:43
1585	#: tpl/admin/errors/no-backups.php:24
1586	msgid "Settings"
	@@ -1633,18 +1654,18 @@ msgstr ""
1633	msgid "Source files to scan:"
1634	msgstr ""
1635
1636	- #: tpl/admin/init/init-po.php:~~173~~
1637	msgid "Start translating"
1638	msgstr ""
1639
1640	#. Message appears after sync operation, where %s refers to a POT file.
1641	- #: src/js/Strings.php:37
1642	#, javascript-format
1643	msgid "Strings up to date with %s"
1644	msgstr ""
1645
1646	#. Message appears after sync operation.
1647	- #: src/js/Strings.php:40
1648	msgid "Strings up to date with source code"
1649	msgstr ""
1650
	@@ -1652,7 +1673,7 @@ msgstr ""
1652	msgid "Strings will be extracted to:"
1653	msgstr ""
1654
1655	- #: src/js/Strings.php:70
1656	msgid "Suggested translations"
1657	msgstr ""
1658
	@@ -1695,7 +1716,7 @@ msgstr ""
1695	msgid "Template missing"
1696	msgstr ""
1697
1698	- #: tpl/admin/init/init-po.php:136
1699	msgid "Template options"
1700	msgstr ""
1701
	@@ -1737,7 +1758,7 @@ msgid "The namespace into which WordPress will load translated strings"
1737	msgstr ""
1738
1739	#. used when user name of web server process is unknown
1740	- #: src/compat/PosixExtension.php:~~109~~
1741	msgid "the web server"
1742	msgstr ""
1743
	@@ -1756,13 +1777,13 @@ msgid ""
1756	"These plugins have recently loaded translation files into the admin area"
1757	msgstr ""
1758
1759	- #: tpl/admin/file/info-po.php:87
1760	msgid ""
1761	"These translations are not linked to a POT file. Sync operations will "
1762	"extract strings directly from source code."
1763	msgstr ""
1764
1765	- #: tpl/admin/config/apis.php:~~114~~
1766	msgid ""
1767	"Third party services are subject to their own terms of use and may incur "
1768	"costs from the provider"
	@@ -1845,7 +1866,7 @@ msgid "This information is for developers to find problems in the bundle setup"
1845	msgstr ""
1846
1847	#. Warning when POT file is opened in the file editor. It can be disabled in settings.
1848	- #: src/admin/file/EditController.php:~~162~~
1849	msgid ""
1850	"This is NOT a translation file. Manual editing of source strings is not "
1851	"recommended."
	@@ -1905,31 +1926,31 @@ msgstr ""
1905	msgid "Translate themes and plugins directly in WordPress"
1906	msgstr ""
1907
1908	- #: src/js/Strings.php:54
1909	#, javascript-format
1910	msgid "Translation job aborted with %s string remaining"
1911	msgid_plural "Translation job aborted with %s strings remaining"
1912	msgstr[0] ""
1913	msgstr[1] ""
1914
1915	- #: tpl/admin/file/info-po.php:32 tpl/admin/bundle/inc-po-table.php:16
1916	#: tpl/admin/bundle/locale.php:36
1917	msgid "Translation progress"
1918	msgstr ""
1919
1920	#. %s%% is a percentage, e.g. 50%
1921	- #: src/js/Strings.php:51
1922	#, javascript-format
1923	msgid "Translation progress %s%%"
1924	msgstr ""
1925
1926	#. Where %s is the name of the invalid POT file
1927	- #: src/ajax/SyncController.php:68 src/admin/file/EditController.php:~~124~~
1928	#, php-format
1929	msgid "Translation template is invalid (%s)"
1930	msgstr ""
1931
1932	- #: src/admin/file/EditController.php:~~119~~
1933	#, php-format
1934	msgid "Translations don't match template. Run sync to update from %s"
1935	msgstr ""
	@@ -1954,11 +1975,11 @@ msgstr ""
1954	msgid "Unexpected file type"
1955	msgstr ""
1956
1957	- #: src/package/Header.php:86 src/admin/file/InfoController.php:~~136~~
1958	msgid "Unknown author"
1959	msgstr ""
1960
1961	- #: src/js/Strings.php:~~119~~
1962	msgid "Unknown error"
1963	msgstr ""
1964
	@@ -1983,11 +2004,11 @@ msgstr ""
1983	msgid "Upload PO file"
1984	msgstr ""
1985
1986	- #: tpl/admin/init/init-po.php:~~163~~
1987	msgid "Use this file as template when running Sync"
1988	msgstr ""
1989
1990	- #: src/js/Strings.php:67
1991	msgid "Use this translation"
1992	msgstr ""
1993
	@@ -2034,11 +2055,11 @@ msgstr ""
2034	msgid "Visit official site"
2035	msgstr ""
2036
2037	- #: src/js/Strings.php:~~101~~ src/error/Warning.php:19
2038	msgid "Warning"
2039	msgstr ""
2040
2041	- #: tpl/admin/file/info-po.php:49
2042	msgid "We can't find the binary MO file that belongs with these translations"
2043	msgstr ""
2044
	@@ -2150,7 +2171,7 @@ msgid "Your admin language is %s."
2150	msgstr ""
2151
2152	#. Warning appears when user tries to refresh or navigate away when editor work is unsaved
2153	- #: src/js/Strings.php:79
2154	msgid "Your changes will be lost if you continue without saving"
2155	msgstr ""
2156


1	#, fuzzy
2	msgid ""
3	msgstr ""
4	+ "Project-Id-Version: Loco Translate 2.5.3\n"
5	"Report-Msgid-Bugs-To: https://wordpress.org/support/plugin/loco-translate/\n"
6	+ "POT-Creation-Date: 2021-06-22 10:49+0000\n"
7	"PO-Revision-Date: YEAR-MO-DA HO:MI+ZONE\n"
8	"Last-Translator: FULL NAME <EMAIL@ADDRESS>\n"
9	"Language-Team: \n"

13	"Content-Type: text/plain; charset=UTF-8\n"
14	"Content-Transfer-Encoding: 8bit\n"
15	"X-Generator: Loco https://localise.biz/\n"
16	+ "X-Loco-Version: 2.5.3; wp-5.7.2\n"
17	"X-Domain: loco-translate"
18
19	#: src/fs/FileWriter.php:214

26	msgstr ""
27
28	#. (1) Number of files (2) Maximum size of file that will be included (3) Size of the largest encountered
29	+ #: src/ajax/SyncController.php:98
30	#, php-format
31	msgid ""
32	"%1$s file has been skipped because it's %3$s. (Max is %2$s). Check all "

54	msgstr[1] ""
55
56	#. 1: Number of strings; 2: Service provider; e.g. "50 strings translated via Google Translate"
57	+ #: src/js/Strings.php:62
58	#, javascript-format
59	msgid "%1$s string translated via %2$s"
60	msgid_plural "%1$s strings translated via %2$s"

67	msgstr ""
68
69	#. characters meaning individual unicode characters of source text
70	+ #: src/js/Strings.php:51
71	#, javascript-format
72	msgid "%s characters will be sent for translation."
73	msgstr ""

107	msgstr[1] ""
108
109	#. Where %s is either PO or POT
110	+ #: src/gettext/Compiler.php:239 src/admin/file/HeadController.php:80
111	#, php-format
112	msgid "%s file saved"
113	msgstr ""
114
115	#. Shows number of fuzzy strings at top of editor
116	+ #: src/js/Strings.php:95 src/gettext/Metadata.php:206
117	#, javascript-format
118	msgid "%s fuzzy"
119	msgstr ""

156
157	#. Shows total string count at top of editor
158	#. Where %s is any number of strings
159	+ #: src/js/Strings.php:87 src/gettext/Metadata.php:194
160	#, javascript-format
161	msgid "%s string"
162	msgid_plural "%s strings"

171	msgstr[0] ""
172	msgstr[1] ""
173
174	+ #: src/js/Strings.php:65
175	#, javascript-format
176	msgid "%s string updated"
177	msgid_plural "%s strings updated"
178	msgstr[0] ""
179	msgstr[1] ""
180
181	+ #. Summary of translations copied from a PO file during Sync
182	+ #: src/js/Strings.php:37
183	+ #, javascript-format
184	+ msgid "%s translation copied"
185	+ msgid_plural "%s translations copied"
186	+ msgstr[0] ""
187	+ msgstr[1] ""
188	+
189	+ #: src/js/Strings.php:47
190	#, javascript-format
191	msgid "%s unique source strings."
192	msgstr ""
193
194	#. Shows number of untranslated strings at top of editor
195	+ #: src/js/Strings.php:99 src/gettext/Metadata.php:209
196	#, javascript-format
197	msgid "%s untranslated"
198	msgstr ""

205	msgstr[1] ""
206
207	#. Shows percentage translated at top of editor
208	+ #: src/js/Strings.php:91 src/gettext/Metadata.php:204
209	#, javascript-format
210	msgid "%s%% translated"
211	msgstr ""

253	"privacy notice</a>."
254	msgstr ""
255
256	+ #: src/admin/bundle/BaseController.php:110 tpl/admin/file/conf.php:58
257	+ #: tpl/admin/file/move.php:26
258	msgid "Advanced"
259	msgstr ""
260

298	msgid "API keys"
299	msgstr ""
300
301	+ #: src/admin/config/ApisController.php:67
302	msgid "API region"
303	msgstr ""
304
305	+ #: src/admin/config/ApisController.php:66
306	+ msgid "API URL"
307	+ msgstr ""
308	+
309	#: tpl/admin/file/delete.php:16
310	msgid ""
311	"Are you sure you want to <strong>permanently</strong> delete the following "

334	"editor"
335	msgstr ""
336
337	+ #: tpl/admin/file/info-po.php:47
338	msgid "Binary file missing"
339	msgstr ""
340

381	msgid "Check config repository"
382	msgstr ""
383
384	+ #: src/js/Strings.php:117
385	msgid "Check console output for debugging information"
386	msgstr ""
387

469	msgid "Copy"
470	msgstr ""
471
472	+ #: tpl/admin/init/init-po.php:147 tpl/admin/file/conf.php:32
473	#, php-format
474	msgid "Copy target translations from \"%s\""
475	msgstr ""

538	msgid "Disallow"
539	msgstr ""
540
541	+ #: src/data/Settings.php:178 src/admin/file/EditController.php:161
542	#: src/admin/bundle/LocaleController.php:130 tpl/admin/config/settings.php:234
543	+ #: tpl/admin/config/apis.php:128 tpl/admin/config/prefs.php:45
544	#: tpl/admin/common/inc-fsconn.php:16 tpl/admin/common/inc-fsconn.php:41
545	#: tpl/admin/errors/no-backups.php:22
546	msgid "Documentation"

585	msgstr ""
586
587	#. Where %s is the name of the language, e.g. "French translation"
588	+ #: src/js/Strings.php:131
589	#, javascript-format
590	msgctxt "Editor"
591	msgid "%s translation"
592	msgstr ""
593
594	#. button for adding a new string when manually editing a POT file
595	+ #: src/admin/file/EditController.php:187
596	msgctxt "Editor"
597	msgid "Add"
598	msgstr ""
599
600	#. Button that opens window for auto-translating
601	+ #: src/admin/file/EditController.php:198
602	msgctxt "Editor"
603	msgid "Auto"
604	msgstr ""
605
606	#. Label for the window pane for entering translator comments
607	+ #: src/js/Strings.php:137
608	msgctxt "Editor"
609	msgid "Comments"
610	msgstr ""
611
612	#. Label for the window pane holding message context
613	+ #: src/js/Strings.php:134
614	msgctxt "Editor"
615	msgid "Context"
616	msgstr ""
617
618	#. Label for the context window when no translation selected
619	+ #: src/js/Strings.php:161
620	msgctxt "Editor"
621	msgid "Context not loaded"
622	msgstr ""
623
624	#. Button for downloading a PO, MO or POT file
625	+ #: src/admin/file/EditController.php:200
626	msgctxt "Editor"
627	msgid "Download"
628	msgstr ""
629
630	#. Label for the plural form of the original English text
631	+ #: src/js/Strings.php:143
632	msgctxt "Editor"
633	msgid "Plural"
634	msgstr ""
635
636	#. button for removing a string when manually editing a POT file
637	+ #: src/admin/file/EditController.php:189
638	msgctxt "Editor"
639	msgid "Remove"
640	msgstr ""
641
642	#. Button that reloads current screen
643	+ #: src/admin/file/EditController.php:196
644	msgctxt "Editor"
645	msgid "Revert"
646	msgstr ""
647
648	#. Button that saves translations to disk
649	+ #: src/admin/file/EditController.php:192
650	msgctxt "Editor"
651	msgid "Save"
652	msgstr ""
653
654	#. Label for the singular form of the original English text
655	+ #: src/js/Strings.php:140
656	msgctxt "Editor"
657	msgid "Single"
658	msgstr ""
659
660	#. Label for the window pane holding the original English text
661	#. List heading showing preview of English text for each item
662	+ #: src/js/Strings.php:127 tpl/admin/file/info-pot.php:30
663	msgctxt "Editor"
664	msgid "Source text"
665	msgstr ""
666
667	#. Label for the source text window when no translation selected
668	+ #: src/js/Strings.php:158
669	msgctxt "Editor"
670	msgid "Source text not loaded"
671	msgstr ""
672
673	+ #: src/js/Strings.php:155
674	msgctxt "Editor"
675	msgid "Suggest translation"
676	msgstr ""
677
678	#. Button that runs in-editor sync/operation
679	+ #: src/admin/file/EditController.php:194
680	msgctxt "Editor"
681	msgid "Sync"
682	msgstr ""
683
684	#. Button that toggles between "code" and regular text editing modes
685	+ #: src/admin/file/EditController.php:206
686	msgctxt "Editor"
687	msgid "Toggle code view"
688	msgstr ""
689
690	+ #: src/js/Strings.php:152
691	msgctxt "Editor"
692	msgid "Toggle Fuzzy"
693	msgstr ""
694
695	#. Button that toggles invisible characters
696	+ #: src/admin/file/EditController.php:204
697	msgctxt "Editor"
698	msgid "Toggle invisibles"
699	msgstr ""
700
701	+ #: src/js/Strings.php:149
702	msgctxt "Editor"
703	msgid "Translated"
704	msgstr ""
705
706	#. List heading showing preview of translated text for each item
707	+ #: src/js/Strings.php:167
708	msgctxt "Editor"
709	msgid "Translation"
710	msgstr ""
711
712	#. Label for the translation editing window when no translation selected
713	+ #: src/js/Strings.php:164
714	msgctxt "Editor"
715	msgid "Translation not loaded"
716	msgstr ""
717
718	+ #: src/js/Strings.php:146
719	msgctxt "Editor"
720	msgid "Untranslated"
721	msgstr ""

734	msgid "Enter a new location for this file"
735	msgstr ""
736
737	+ #: src/js/Strings.php:102 src/error/Exception.php:164
738	msgid "Error"
739	msgstr ""
740

813	msgstr[0] ""
814	msgstr[1] ""
815
816	+ #: src/admin/file/InfoController.php:170
817	msgid "File does not have a valid header"
818	msgstr ""
819

867	msgstr ""
868
869	#: tpl/admin/file/info-mo.php:21 tpl/admin/file/info-pot.php:24
870	+ #: tpl/admin/file/info-po.php:27
871	msgid "File modified"
872	msgstr ""
873

884	msgstr ""
885
886	#: tpl/admin/file/info-mo.php:18 tpl/admin/file/info-pot.php:21
887	+ #: tpl/admin/file/info-po.php:24
888	msgid "File size"
889	msgstr ""
890

908	msgstr ""
909
910	#. Placeholder text for text filter above editor
911	+ #: src/admin/file/EditController.php:202
912	msgid "Filter translations"
913	msgstr ""
914

963	msgid "Grant access to roles"
964	msgstr ""
965
966	+ #: src/ajax/ApisController.php:26 src/admin/file/EditController.php:190
967	msgid "Help"
968	msgstr ""
969

999	msgid "Import config from XML"
1000	msgstr ""
1001
1002	+ #: tpl/admin/config/apis.php:118
1003	msgid "Important"
1004	msgstr ""
1005
1006	+ #: tpl/admin/file/info-po.php:60
1007	msgid "In sync with template"
1008	msgstr ""
1009

1054	msgid "JSON compilation failed for %s"
1055	msgstr ""
1056
1057	+ #: tpl/admin/init/init-po.php:153 tpl/admin/file/conf.php:38
1058	msgid "Just copy English source strings"
1059	msgstr ""
1060

1063	msgid "Just now"
1064	msgstr ""
1065
1066	+ #: src/js/Strings.php:80
1067	msgid "Keep this translation"
1068	msgstr ""
1069

1071	msgid "Language"
1072	msgstr ""
1073
1074	+ #: src/admin/file/InfoController.php:177
1075	#, php-format
1076	msgid "Language header is \"%s\" but file name contains \"%s\""
1077	msgstr ""

1100	msgid "Last modified"
1101	msgstr ""
1102
1103	+ #: tpl/admin/file/info-mo.php:24 tpl/admin/file/info-po.php:30
1104	msgid "Last translation"
1105	msgstr ""
1106

1108	msgid "Load config"
1109	msgstr ""
1110
1111	+ #: src/js/Strings.php:77
1112	msgid "Loading suggestions"
1113	msgstr ""
1114

1148	msgid "Loco Translate %s"
1149	msgstr ""
1150
1151	+ #: src/data/Settings.php:177
1152	msgid "Loco Translate 2.5 adds supports for JSON language pack generation."
1153	msgstr ""
1154

1176	msgid "Maximum line length (zero disables wrapping)"
1177	msgstr ""
1178
1179	+ #: tpl/admin/init/init-po.php:163 tpl/admin/file/conf.php:48
1180	+ msgid "Merge strings from related JSON files"
1181	+ msgstr ""
1182	+
1183	#. Where %s is the name of the POT template file. Message appears after sync
1184	#: src/js/Strings.php:18
1185	#, javascript-format

1191	msgid "Merged from source code"
1192	msgstr ""
1193
1194	+ #: tpl/admin/file/info-po.php:84
1195	msgid "Missing template"
1196	msgstr ""
1197

1299	msgid "Nothing matches the text filter"
1300	msgstr ""
1301
1302	+ #: src/js/Strings.php:68
1303	msgid "Nothing needed updating"
1304	msgstr ""
1305
1306	+ #: src/js/Strings.php:108 src/error/Notice.php:20
1307	#: tpl/admin/common/inc-fsconn.php:37
1308	msgid "Notice"
1309	msgstr ""

1320	msgid "Official plugin page"
1321	msgstr ""
1322
1323	+ #: src/js/Strings.php:111 src/error/Success.php:19
1324	msgid "OK"
1325	msgstr ""
1326

1328	msgid "OK, Load this config"
1329	msgstr ""
1330
1331	+ #: tpl/admin/file/info-po.php:71
1332	msgid "Out of sync with template"
1333	msgstr ""
1334

1340	msgid "Overwrite existing translations"
1341	msgstr ""
1342
1343	+ #: src/mvc/AdminRouter.php:241
1344	msgid "Page not found"
1345	msgstr ""
1346

1439	msgstr ""
1440
1441	#. Where %s is the name of a template file
1442	+ #: tpl/admin/file/info-po.php:75
1443	#, php-format
1444	msgid ""
1445	"PO file has different source strings to \"%s\". Try running Sync before "

1447	msgstr ""
1448
1449	#. Where %s is the name of a template file
1450	+ #: tpl/admin/file/info-po.php:64
1451	#, php-format
1452	msgid "PO file has the same source strings as \"%s\""
1453	msgstr ""

1476	msgid "Project name"
1477	msgstr ""
1478
1479	+ #: src/js/Strings.php:120
1480	msgid "Provide the following text when reporting a problem"
1481	msgstr ""
1482

1532	msgid "Running plugins:"
1533	msgstr ""
1534
1535	+ #: tpl/admin/file/conf.php:57 tpl/admin/file/head.php:34
1536	+ msgid "Save"
1537	+ msgstr ""
1538	+
1539	#: tpl/admin/bundle/conf.php:141
1540	msgid "Save config"
1541	msgstr ""

1544	msgid "Save credentials in session"
1545	msgstr ""
1546
1547	+ #: tpl/admin/config/settings.php:233 tpl/admin/config/apis.php:127
1548	#: tpl/admin/config/prefs.php:44
1549	msgid "Save settings"
1550	msgstr ""

1581	msgid "See FAQ"
1582	msgstr ""
1583
1584	+ #: tpl/admin/config/apis.php:121
1585	msgid "See full disclaimer"
1586	msgstr ""
1587
1588	#. Generic error when external process broke an Ajax request
1589	+ #: src/js/Strings.php:114
1590	msgid "Server returned invalid data"
1591	msgstr ""
1592

1601	msgstr ""
1602
1603	#: src/mvc/AdminRouter.php:67 src/mvc/AdminRouter.php:72
1604	+ #: tpl/ajax/modal-apis-empty.php:15 src/admin/file/EditController.php:160
1605	#: tpl/admin/common/inc-fsconn.php:18 tpl/admin/common/inc-fsconn.php:43
1606	#: tpl/admin/errors/no-backups.php:24
1607	msgid "Settings"

1654	msgid "Source files to scan:"
1655	msgstr ""
1656
1657	+ #: tpl/admin/init/init-po.php:183
1658	msgid "Start translating"
1659	msgstr ""
1660
1661	#. Message appears after sync operation, where %s refers to a POT file.
1662	+ #: src/js/Strings.php:41
1663	#, javascript-format
1664	msgid "Strings up to date with %s"
1665	msgstr ""
1666
1667	#. Message appears after sync operation.
1668	+ #: src/js/Strings.php:44
1669	msgid "Strings up to date with source code"
1670	msgstr ""
1671

1673	msgid "Strings will be extracted to:"
1674	msgstr ""
1675
1676	+ #: src/js/Strings.php:74
1677	msgid "Suggested translations"
1678	msgstr ""
1679

1716	msgid "Template missing"
1717	msgstr ""
1718
1719	+ #: tpl/admin/init/init-po.php:136 tpl/admin/file/conf.php:12
1720	msgid "Template options"
1721	msgstr ""
1722

1758	msgstr ""
1759
1760	#. used when user name of web server process is unknown
1761	+ #: src/compat/PosixExtension.php:111
1762	msgid "the web server"
1763	msgstr ""
1764

1777	"These plugins have recently loaded translation files into the admin area"
1778	msgstr ""
1779
1780	+ #: tpl/admin/file/info-po.php:88
1781	msgid ""
1782	"These translations are not linked to a POT file. Sync operations will "
1783	"extract strings directly from source code."
1784	msgstr ""
1785
1786	+ #: tpl/admin/config/apis.php:120
1787	msgid ""
1788	"Third party services are subject to their own terms of use and may incur "
1789	"costs from the provider"

1866	msgstr ""
1867
1868	#. Warning when POT file is opened in the file editor. It can be disabled in settings.
1869	+ #: src/admin/file/EditController.php:159
1870	msgid ""
1871	"This is NOT a translation file. Manual editing of source strings is not "
1872	"recommended."

1926	msgid "Translate themes and plugins directly in WordPress"
1927	msgstr ""
1928
1929	+ #: src/js/Strings.php:58
1930	#, javascript-format
1931	msgid "Translation job aborted with %s string remaining"
1932	msgid_plural "Translation job aborted with %s strings remaining"
1933	msgstr[0] ""
1934	msgstr[1] ""
1935
1936	+ #: tpl/admin/file/info-po.php:33 tpl/admin/bundle/inc-po-table.php:16
1937	#: tpl/admin/bundle/locale.php:36
1938	msgid "Translation progress"
1939	msgstr ""
1940
1941	#. %s%% is a percentage, e.g. 50%
1942	+ #: src/js/Strings.php:55
1943	#, javascript-format
1944	msgid "Translation progress %s%%"
1945	msgstr ""
1946
1947	#. Where %s is the name of the invalid POT file
1948	+ #: src/ajax/SyncController.php:72 src/admin/file/EditController.php:121
1949	#, php-format
1950	msgid "Translation template is invalid (%s)"
1951	msgstr ""
1952
1953	+ #: src/admin/file/EditController.php:116
1954	#, php-format
1955	msgid "Translations don't match template. Run sync to update from %s"
1956	msgstr ""

1975	msgid "Unexpected file type"
1976	msgstr ""
1977
1978	+ #: src/package/Header.php:86 src/admin/file/InfoController.php:138
1979	msgid "Unknown author"
1980	msgstr ""
1981
1982	+ #: src/js/Strings.php:123
1983	msgid "Unknown error"
1984	msgstr ""
1985

2004	msgid "Upload PO file"
2005	msgstr ""
2006
2007	+ #: tpl/admin/init/init-po.php:173
2008	msgid "Use this file as template when running Sync"
2009	msgstr ""
2010
2011	+ #: src/js/Strings.php:71
2012	msgid "Use this translation"
2013	msgstr ""
2014

2055	msgid "Visit official site"
2056	msgstr ""
2057
2058	+ #: src/js/Strings.php:105 src/error/Warning.php:19
2059	msgid "Warning"
2060	msgstr ""
2061
2062	+ #: tpl/admin/file/info-po.php:50
2063	msgid "We can't find the binary MO file that belongs with these translations"
2064	msgstr ""
2065

2171	msgstr ""
2172
2173	#. Warning appears when user tries to refresh or navigate away when editor work is unsaved
2174	+ #: src/js/Strings.php:83
2175	msgid "Your changes will be lost if you continue without saving"
2176	msgstr ""
2177

lib/compiled/gettext.php CHANGED Viewed

	@@ -11,12 +11,12 @@ function loco_fix_utf8( $str ){ $fix = ''; while( is_string($str) && '' !== $st
11	abstract class LocoGettextParser { private $head = null; private $cs = ''; abstract public function parse( $limit = -1 ); protected function setHeader( LocoPoHeaders $head ){ $this->head = $head; $cs = $head->getCharset(); if( is_string($cs) && '' !== $cs ){ if( '' === $this->cs ){ $this->setCharset($cs); } } return $head; } public function getHeader(){ return $this->head; } protected function setCharset( $cs ){ $this->cs = $cs; } protected function getCharset(){ return $this->cs; } protected function str( $str ){ if( '' !== $str ){ $str = loco_convert_utf8($str,$this->cs,false); } return $str; } }
12	function loco_remove_bom( $s, &$c ){ $bom = substr($s,0,2); if( "\xFF\xFE" === $bom ){ $c = 'UTF-16LE'; return substr($s,2); } if( "\xFE\xFF" === $bom ){ $c = 'UTF-16BE'; return substr($s,2); } if( "\xEF\xBB" === $bom && "\xBF" === $s[2] ){ $c = 'UTF-8'; return substr($s,3); } $c = ''; return $s; }
13	function loco_parse_reference_id( $refs, &$_id ){ if( false === ( $n = strpos($refs,'loco:') ) ){ $_id = ''; return $refs; } $_id = substr($refs, $n+5, 24 ); $refs = substr_replace( $refs, '', $n, 29 ); return trim( $refs ); }
14	- class LocoPoParser extends LocoGettextParser implements Iterator { private $lines = array(); private $i; private $k; private $m; public function __construct( $src ){ if( '' !== $src ){ $src = loco_remove_bom($src,$cs); if( $cs && 'UTF-8' !== $cs ){ $src = mb_convert_encoding( $src, 'UTF-8', $cs ); $cs = 'UTF-8'; } if( 'UTF-8' === $cs ){ $this->setCharset('UTF-8'); } $this->lines = preg_split('/(\\r\\n?\|\\n)/', $src ); } } public function rewind(){ $this->i = -1; $this->k = -1; $this->next(); } public function valid(){ return is_int($this->i); } public function key(){ return $this->k; } public function current(){ return $this->m; } public function next(){ $valid = false; $entry = array( '#' => array(), 'id' => array(null), 'str' => array(null) ); $i = $this->i; while( array_key_exists(++$i,$this->lines) ){ $line = $this->lines[$i]; try { if( '' === $line ){ if( $valid ){ break; } continue; } $c = $line[0]; if( '#' === $c ){ if( $valid ){ $i--; break; } if( '#' === $line ){ continue; } $f = $line[1]; $entry['#'][$f][] = trim( substr( $line, 1+strlen($f) ), "/ \n\r\t" ); } else if( preg_match('/^msg(id(?:_plural)?\|ctxt\|str(?:\\[(\\d+)])?)[ \\t]*/', $line, $r ) ){ if( isset($r[2]) ){ $key = 'str'; $idx = (int) $r[2]; } else { $key = $r[1]; $idx = 0; } if( $valid && 'str' !== $key && null !== $entry['str'][0] ){ $i--; break; } $snip = strlen($r[0]); if( '"' !== substr($line,$snip,1) ){ throw new Exception('Expected " to follow msg'.$key); } $val = ''; $line = substr($line,$snip); while( true ){ if( '"' === $line \|\| '"' !== substr($line,-1) ){ throw new Exception('Unterminated msg'.$key ); } $val .= substr( $line, 1, -1 ); $j = $i + 1; if( array_key_exists($j,$this->lines) && ( $line = $this->lines[$j] ) && '"' === $line[0] ){ $i = $j; } else { break; } } if( ! $valid ){ $valid = true; } if( 'id_plural' === $key ){ $key = 'id'; $idx = 1; } $entry[$key][$idx] = stripcslashes($val); } else if( preg_match('/^[ \\t]+$/',$line) ){ if( $valid ) { break; } } else if( '"' === $c ){ throw new Exception('String encountered without keyword'); } else { throw new Exception('Junk'); } } catch( Exception $e ){ } } if( $valid ){ ++$this->k; $this->i = $i; $this->m = $entry; } else { $this->i = null; $this->k = null; $this->m = null; } } public function parse( $limit = -1 ){ $this->rewind(); if( ! $this->valid() ){ throw new Loco_error_ParseException('Invalid PO file'); } $~~i = -1; $assets = array(); $~~entry = $this->current(); if( '' !== $entry['id'][0] \|\| isset($entry['ctxt']) \|\| is_null($entry['str'][0]) ){ $head = $this->setHeader( new LocoPoHeaders ); } else { $head = $this->setHeader( LocoPoHeaders::fromMsgstr($entry['str'][0]) ); } $lk = $head['X-Loco-Lookup']; while( $this->valid() ){ $entry = $this->current(); $~~this->next(); $~~msgid = $entry['id'][0]; if( is_null($msgid) ){ continue; } if( ++$i === $limit ){ return $assets; } $asset = array( 'source' => $this->str( $msgid ), 'target' => $this->str( (string) $entry['str'][0] ), 'context' => null, ); $prev_entry = null; if( isset($entry['ctxt']) ){ $asset['context'] = $this->str( $entry['ctxt'][0] ); } $cmt = $entry['#']; if( isset($cmt[' ']) ){ $asset['comment'] = $this->str( implode("\n", $cmt[' '] ) ); } if( isset($cmt['.']) ){ $asset['notes'] = $this->str( implode("\n", $cmt['.'] ) ); } if( isset($cmt[':']) ){ if( $refs = implode( ' ', $cmt[':'] ) ) { $refs = $this->str($refs); if( $refs = loco_parse_reference_id( $refs, $_id ) ){ $asset['refs'] = $refs; } if( $_id ){ $asset['_id'] = $_id; } } } if( isset($cmt[',']) ){ foreach( $cmt[','] as $flags ){ foreach( explode(',',$flags) as $flag ){ if( $flag = trim($flag," \t") ){ if( preg_match('/^((?:no-)?\w+)-format/', $flag, $r ) ){ $asset['format'] = $r[1]; } else if( 'fuzzy' === $flag ){ $asset['flag'] = 4; } } } } } if( isset($cmt['\|']) ){ $p = new LocoPoParser(''); $p->lines = $cmt['\|']; $p->setCharset( $this->getCharset() ); try { $prev_entry = $p->parse(); } catch( Loco_error_ParseException $e ){ } if( $prev_entry ){ $msgid = $prev_entry[0]['source']; if( $lk && 'text' !== $lk ){ $asset[$lk] = $asset['source']; $asset['source'] = $msgid; } else if( 'loco:' === substr($msgid,0,5) ){ $asset['_id'] = substr($msgid,5); } else { $asset['prev'] = $prev_entry; $prev_entry = null; } } } $assets[] = $asset; if( isset($entry['id'][1]) ){ $idx = 0; $pidx = count($assets) - 1; $num = max( 2, count($entry['str']) ); while( ++$idx < $num ){ $plural = array( 'source' => '', 'target' => isset($entry['str'][$idx]) ? $this->str($entry['str'][$idx]) : '', 'plural' => $idx, 'parent' => $pidx, ); if( 1 === $idx ){ $plural['source'] = $this->str($entry['id'][1]); if( is_array($prev_entry) && isset($prev_entry[1]) ){ if( $lk && 'text' !== $lk ){ $plural[$lk] = $plural['source']; $plural['source'] = $prev_entry[1]['source']; } } } if( isset($asset['flag']) ){ $plural['flag'] = $asset['flag']; } $assets[] = $plural; } } } if( -1 === $i ){ throw new Loco_error_ParseException('Invalid PO file'); } else if( 0 === $i && '' === $assets[0]['source'] && '' === $assets[0]['target'] ){ throw new Loco_error_ParseException('Invalid PO file' ); } return $assets; } }
15	class LocoMoParser extends LocoGettextParser { private $bin; private $be; private $n; private $o; private $t; private $v; public function __construct( $bin ){ $this->bin = $bin; } public function getAt( $idx ){ $offset = $this->targetOffset(); $offset += ( $idx * 8 ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false === strpos( $txt, "\0") ){ return $txt; } return explode( "\0", $txt ); } public function parse( $limit = -1 ){ $i = -1; $r = array(); $sourceOffset = $this->sourceOffset(); $targetOffset = $this->targetOffset(); $soffset = $sourceOffset; $toffset = $targetOffset; while( $soffset < $targetOffset ){ $len = $this->integerAt( $soffset ); $idx = $this->integerAt( $soffset + 4 ); $src = $this->bytes( $idx, $len ); $eot = strpos( $src, "\x04" ); if( false === $eot ){ $context = null; } else { $context = $this->str( substr($src, 0, $eot ) ); $src = substr( $src, $eot+1 ); } $sources = explode( "\0", $src, 2 ); $len = $this->integerAt( $toffset ); $idx = $this->integerAt( $toffset + 4 ); $targets = explode( "\0", $this->bytes( $idx, $len ) ); if( -1 === $i && '' === $sources[0] && is_null($context) ){ $this->setHeader( LocoPoHeaders::fromMsgstr($targets[0]) ); } if( ++$i === $limit ){ break; } $r[$i] = array( 'source' => $this->str( $sources[0] ), 'target' => $this->str( $targets[0] ), 'context' => $context, ); if( isset($sources[1]) ){ $p = count($r) - 1; $nforms = max( 2, count($targets) ); for( $i = 1; $i < $nforms; $i++ ){ $r[] = array( 'source' => isset($sources[$i]) ? $this->str( $sources[$i] ) : sprintf('%s (plural %u)',$r[$p]['source'],$i), 'target' => isset($targets[$i]) ? $this->str( $targets[$i] ) : '', 'parent' => $p, 'plural' => $i, ); } } $soffset += 8; $toffset += 8; } return $r; } public function isBigendian(){ if( is_null($this->be) ){ $str = $this->words( 0, 1 ); if( "\xDE\x12\x04\x95" === $str ){ $this->be = false; } else if( "\x95\x04\x12\xDE" === $str ){ $this->be = true; } else { throw new Loco_error_ParseException('Invalid MO format'); } } return $this->be; } public function version(){ if( is_null($this->v) ){ $this->v = $this->integerWord(1); } return $this->v; } public function count(){ if( is_null($this->n) ){ $this->n = $this->integerWord(2); } return $this->n; } public function sourceOffset(){ if( is_null($this->o) ){ $this->o = $this->integerWord(3); } return $this->o; } public function targetOffset(){ if( is_null($this->t) ){ $this->t = $this->integerWord(4); } return $this->t; } public function getHashTable(){ $s = $this->integerWord(5); $h = $this->integerWord(6); return $this->bytes( $h, $s * 4 ); } private function bytes( $offset, $length ){ $s = substr( $this->bin, $offset, $length ); if( strlen($s) !== $length ){ throw new Loco_error_ParseException('Failed to read '.$length.' bytes at ['.$offset.']' ); } return $s; } private function words( $offset, $length ){ return $this->bytes( $offset * 4, $length * 4 ); } private function integerWord( $offset ){ return $this->integerAt( $offset * 4 ); } private function integerAt( $offset ){ $str = $this->bytes( $offset, 4 ); $fmt = $this->isBigendian() ? 'N' : 'V'; $arr = unpack( $fmt, $str ); if( ! isset($arr[1]) \|\| ! is_int($arr[1]) ){ throw new Loco_error_ParseException('Failed to read integer at byte '.$offset); } return $arr[1]; } }
16	abstract class LocoPo { public static function pair( $key, $text, $width = 79, $eol = "\n", $esc = '\\n' ){ if( '' === $text ){ return $key.' ""'; } $text = addcslashes( $text, "\t\x0B\x0C\x07\x08\\\"" ); if( $esc ) { $text = preg_replace('/(?:\\r\\n?\|\\n)/', $esc.$eol, $text, -1, $nbr ); } else { $eol = "\n"; $text = preg_replace_callback('/(?:\\r\\n?\|\\n)/',array(__CLASS__,'replace_br'), $text, -1, $nbr ); } if( $nbr ){ } else if( $width && $width < mb_strlen($text,'UTF-8') + strlen($key) + 3 ){ } else { return $key.' "'.$text.'"'; } $lines = array( $key.' "' ); if( $width ){ $width -= 2; $a = '/^.{0,'.($width-1).'}[-– \\.,:;\\?!\\)\\]\\}\\>]/u'; $b = '/^[^-– \\.,:;\\?!\\)\\]\\}\\>]+/u'; foreach( explode($eol,$text) as $unwrapped ){ $length = mb_strlen( $unwrapped, 'UTF-8' ); while( $length > $width ){ if( preg_match( $a, $unwrapped, $r ) ){ $line = $r[0]; } else if( preg_match( $b, $unwrapped, $r ) ){ $line = $r[0]; } else { throw new Exception('Wrapping error'); } $lines[] = $line; $trunc = mb_strlen($line,'UTF-8'); $length -= $trunc; $unwrapped = (string) substr( $unwrapped, strlen($line) ); if( ( '' === $unwrapped && 0 !== $length ) \|\| ( 0 === $length && '' !== $unwrapped ) ){ throw new Exception('Truncation error'); } } if( 0 !== $length ){ $lines[] = $unwrapped; } } } else { foreach( explode($eol,$text) as $unwrapped ){ $lines[] = $unwrapped; } } return implode('"'.$eol.'"',$lines).'"'; } private static function replace_br( array $r ){ return addcslashes($r[0],"\r\n")."\n"; } public static function refs( $text, $width = 76, $eol = "\n" ){ $text = preg_replace('/\\s+/u', ' ', $text ); if( $width ){ $text = wordwrap( $text, $width, $eol.'#: ', false ); } return '#: '.$text; } public static function prefix( $text, $prefix, $eol = "\n" ){ return $prefix . implode($eol.$prefix, self::split($text) ); } public static function split( $text ){ $lines = preg_split('/\\R/u', $text ); if( false === $lines ){ if( false === preg_match('//u',$text) ){ $text = mb_convert_encoding( $text, 'UTF-8', 'cp1252' ); } $lines = preg_split('/\\r?\\n+/', $text ); } return $lines; } public static function trim( $text ){ $lines = array(); $deferred = null; foreach( explode("\n",$text) as $line ){ if( '' === $line ){ continue; } if( preg_match('/^msg[a-z]+(?:\\[\\d+])? ""/',$line) ){ $deferred = $line; continue; } if( $deferred && '"' === $line[0] ){ $lines[] = $deferred; $deferred = null; } $lines[] = $line; } return implode("\n",$lines); } }
17	class LocoPoIndex extends ArrayIterator { public function compare( LocoPoMessage $a, LocoPoMessage $b ){ $h = $a->getHash(); if( ! isset($this[$h]) ){ return 1; } $j = $b->getHash(); if( ! isset($this[$j]) ){ return -1; } return $this[$h] > $this[$j] ? 1 : -1; } }
18	- class LocoPoMessage extends ArrayObject { public function __construct( array $r ){ $r['key'] = $r['source']; parent::__construct($r); } public function __get( $prop ){ return $this->offsetExists($prop) ? $this->offsetGet($prop) : null; } private function _getFlags(){ $flags = array(); $plurals = $this->__get('plurals'); if( 4 === $this->__get('flag') ){ $flags[] = 'fuzzy'; } else if( $plurals ){ foreach( $plurals as $child ){ if( 4 === $child->__get('flag') ){ $flags[] = 'fuzzy'; break; } } } if( $f = $this->__get('format') ){ $flags[] = $f.'-format'; } else if( isset($plurals[0]) && ( $f = $plurals[0]->format ) ){ $flags[] = $f.'-format'; } return $flags; } public function getHash(){ $hash = $this->getKey(); if( $this->offsetExists('plurals') ){ foreach( $this['plurals'] as $p ){ $hash .= "\0".$p->getHash(); break; } } return $hash; } public function getKey(){ $msgid = (string) $this['source']; $msgctxt = (string) $this->__get('context'); if( '' !== $msgctxt ){ if( '' === $msgid ){ $msgid = '('.$msgctxt.')'; } $msgid = $msgctxt."\4".$msgid; } return $msgid; } public function exportSerial(){ $a = array( $this['target'] ); if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); if( is_array($plurals) ){ foreach( $plurals as $i => $p ){ $a[] = $p['target']; } } } return $a; } public function __toString(){ return $this->render( 79, 76 ); } public function render( $width, $ref_width ){ $s = array(); try { if( $text = $this->__get('comment') ) { $s[] = LocoPo::prefix( $text, '# '); } if( $text = $this->__get('notes') ) { $s[] = LocoPo::prefix( $text, '#. '); } if( $text = $this->__get('refs') ){ $s[] = LocoPo::refs( $text, $ref_width ); } if( $texts = $this->_getFlags() ){ $s[] = '#, '.implode(', ',$texts); } $prev = $this->__get('prev'); if( is_array($prev) && $prev ){ foreach( new LocoPoIterator($prev) as $p ){ $text = $p->render( max(0,$width-3), 0 ); $s[] = LocoPo::prefix( LocoPo::trim($text),'#\| '); break; } } $text = $this->__get('context'); if( is_string($text) && '' !== $text ){ $s[] = LocoPo::pair('msgctxt', $text, $width ); } $s[] = LocoPo::pair( 'msgid', $this['source'], $width ); $target = $this['target']; $plurals = $this->__get('plurals'); if( is_array($plurals) ){ if( $plurals ){ foreach( $plurals as $i => $p ){ if( 0 === $i ){ $s[] = LocoPo::pair('msgid_plural', $p['source'], $width ); $s[] = LocoPo::pair('msgstr[0]', $target, $width ); } $s[] = LocoPo::pair('msgstr['.(++$i).']', $p['target'], $width ); } } else if( isset($this['plural_key']) ){ $s[] = LocoPo::pair('msgid_plural', $this['plural_key'], $width ); $s[] = LocoPo::pair('msgstr[0]', $target, $width ); } else { trigger_error('Missing plural_key in zero plural export'); $s[] = LocoPo::pair('msgstr', $target, $width ); } } else { $s[] = LocoPo::pair('msgstr', $target, $width ); } } catch( Exception $e ){ trigger_error( $e->getMessage(), E_USER_WARNING ); } return implode("\n",$s)."\n"; } public function merge( LocoPoMessage $def, $translate = false ){ if( $def->getHash() !== $this->getHash() ){ $prev = array( 'source' => '', 'target' => '' ); $prev = $this->diff('source',$def,$prev); $prev = $this->diff('context',$def,$prev); $this['flag'] = 4; $this['prev'] = array( $prev ); $defPlural = $def->getPlural(0); $ourPlural = $this->getPlural(0); if( $defPlural && $ourPlural ) { $ourPlural->merge($defPlural); if( $ourPlural->offsetExists('prev') ) { $this['prev'][] = $ourPlural->prev[0]+array('parent'=>0,'plural'=>1); $ourPlural->offsetUnset('prev'); } } else if( $defPlural ){ $this['plurals'] = array( clone $defPlural ); } else if( $ourPlural ){ $this['prev'][] = $ourPlural->exportBasic() + array('parent'=>0,'plural'=>1); $this->offsetUnset('plurals'); } } foreach( array('notes','refs') as $f ){ if( $def->offsetExists($f) ){ $this->offsetSet($f,$def->offsetGet($f)); } else if( $this->offsetExists($f) ){ $this->offsetUnset($f); } } if( $translate && '' === $this['target'] && '' !== $def['target'] ){ $this['target'] = $def['target']; if( $def->offsetExists('comment') ) { $this['comment'] = $def['comment']; } if( $this->offsetExists('plurals') ){ foreach( $this['plurals'] as $i => $ourPlural ){ if( '' === $ourPlural['target'] ){ $defPlural = $def->getPlural($i); if( $defPlural ){ $ourPlural['target'] = $defPlural['target']; } } } } } } private function diff( $key, LocoPoMessage $def, array $prev ){ $old = $this->__get($key); $new = $def->__get($key); if( $new !== $old ){ $this->offsetSet($key,$new); if( is_string($old) && '' !== $old ){ $prev[$key] = $old; } } return $prev; } private function getPlural( $i ){ if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); if( is_array($plurals) && array_key_exists($i,$plurals) ){ return $plurals[$i]; } } return null; } private function exportBasic(){ return array( 'source' => $this['source'], 'context' => $this->context, 'target' => '', ); } public function export(){ $a = $this->getArrayCopy(); unset($a['key']); return $a; } public function countForms(){ $len = 1; if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); $len += count($plurals); } return $len; } public function strip(){ $this['target'] = ''; $plurals = $this->plurals; if( is_array($plurals) ){ foreach( $plurals as $p ){ $p->strip(); } } return $this; } public function translated(){ ~~return~~ '' !== (string) $this['target']; } }
19	- class LocoPoIterator implements Iterator, Countable { private $po; private $headers = null; private $i; private $t; private $j; private $z = 0; private $w = 79; public function __construct( $po ){ if( is_array($po) ){ $this->po = $po; } else if( $po instanceof Traversable ){ $this->po = iterator_to_array($po,false); } else { throw new InvalidArgumentException('PO data must be array or iterator'); } $this->t = count($po); if( 0 === $this->t ){ throw new InvalidArgumentException('Empty PO data'); } $h = $po[0]; if( '' !== $h['source'] \|\| ( isset($h['context']) && '' !== $h['context'] ) \|\| ( isset($po[1]['parent']) && 0 === $po[1]['parent'] ) ){ $this->z = -1; } } public function push( LocoPoMessage $p ){ $raw = $p->export(); $plurals = $p->plurals; unset($raw['plurals']); $i = count($this->po); $this->po[$i] = $raw; $this->t++; if( is_array($plurals) ) { $j = 0; foreach( $plurals as $p ) { $raw = $p->export(); $raw['parent'] = $i; $raw['plural'] = ++$j; $this->po[] = $raw; $this->t++; } } } public function concat( LocoPoIterator $more ){ foreach( $more as $message ){ $this->push($message); } return $this; } public function __clone(){ if( $this->headers ){ $this->headers = new LocoPoHeaders( $this->headers->getArrayCopy() ); } } public function count(){ return $this->t - ( $this->z + 1 ); } public function wrap( $width ){ $width = (int) $width; if( $width > 0 ){ $this->w = max( 15, $width ); } else { $this->w = 0; } return $this; } public function rewind(){ $this->i = $this->z; $this->j = -1; $this->next(); } public function key(){ return $this->j; } public function valid(){ return is_int($this->i); } public function next(){ $i = $this->i; while( ++$i < $this->t ){ if( array_key_exists('parent',$this->po[$i]) ){ continue; } $this->j++; $this->i = $i; return; } $this->i = null; $this->j = null; } public function current(){ $i = $this->i; $po = $this->po; $parent = new LocoPoMessage( $po[$i] ); $plurals = array(); $nonseq = $parent->offsetExists('child'); $j = $nonseq ? $parent['child'] : $i+1; while( isset($po[$j]['parent']) && $i === $po[$j]['parent'] ){ $plurals[] = new LocoPoMessage($po[$j++]); } if( $plurals ){ $parent['plurals'] = $plurals; } return $parent; } public function getArrayCopy(){ $po = $this->po; if( 0 === $this->z ){ $po[0]['target'] = (string) $this->getHeaders(); } return $po; } public function clear(){ if( 0 === $this->z ){ $this->po = array( $this->po[0] ); $this->t = 1; } else { $this->po = array(); $this->t = 0; } } public function getHeaders(){ if( is_null($this->headers) ){ $header = $this->po[0]; if( 0 === $this->z ){ $this->headers = LocoPoHeaders::fromMsgstr( $header['target'] ); } else { $this->headers = new LocoPoHeaders; } } return $this->headers; } public function initPo(){ if( 0 === $this->z ){ unset( $this->po[0]['flag'] ); } return $this; } public function initPot(){ if( 0 === $this->z ){ $this->po[0]['flag'] = 4; } return $this; } public function strip(){ $po = $this->po; $i = count($po); $z = $this->z; while( --$i > $z ){ $po[$i]['target'] = ''; } $this->po = $po; return $this; } public function __toString(){ try { return $this->render(); } catch( Exception $e ){ trigger_error( $e->getMessage(), E_USER_WARNING ); return ''; } } public function render( $sorter = null ){ $width = $this->w; $ref_width = max( 0, $width - 3 ); $h = $this->exportHeader(); $msg = new LocoPoMessage( $h ); $s = $msg->render( $width, $ref_width ); if( $sorter ){ if( ! is_callable($sorter) ){ throw new InvalidArgumentException('Bad callback'); } $msgs = array(); foreach( $this as $msg ){ $msgs[] = $msg; } usort( $msgs, $sorter ); } else { $msgs = $this; } foreach( $msgs as $msg ){ $s .= "\n".$msg->render( $width, $ref_width ); } return $s; } public function exportJed(){ $head = $this->getHeaders(); $a = array( '' => array( 'domain' => $head['domain'], 'lang' => $head['language'], 'plural-forms' => $head['plural-forms'], ) ); foreach( $this as $message ){ if( $message->translated() ){ $a[ $message->getKey() ] = $message->exportSerial(); } } return $a; } private function exportHeader(){ if( 0 === $this->z ){ $h = $this->po[0]; } else { $h = array( 'source' => '', 'target' => '' ); } if( $this->headers ){ $h['target'] = (string) $this->headers; } return $h; } public function exportRefs( $grep = '' ){ $a = array(); if( '' === $grep ) { $grep = '/(\\S+):\\d+/'; } else { $grep = '/(\\S*'.$grep.'):\\d+/'; } $self = get_class($this); $base = array( $this->exportHeader() ); foreach( $this as $message ){ if( preg_match_all( $grep, (string) $message->refs, $r ) ){ foreach( $r[1] as $ref ) { if( array_key_exists($ref,$a) ){ $po = $a[$ref]; } else { $po = new $self($base); $a[$ref] = $po; } $po->push($message); } } } return $a; } public function splitRefs( array $map = null ){ $a = array(); $self = get_class($this); $base = array( $this->exportHeader() ); if( is_array($map) ){ $grep = implode('\|',array_keys($map)); } else { $grep = '[a-z]+'; } foreach( $this as $message ){ $refs = ltrim( (string) $message->refs ); if( '' !== $refs ){ if( preg_match_all('/\\S+\\.('.$grep.'):\\d+/', $refs, $r, PREG_SET_ORDER ) ){ $tmp = array(); foreach( $r as $rr ) { list( $ref, $ext ) = $rr; $tmp[$ext][$ref] = true; } foreach( $tmp as $ext => $refs ){ if( is_array($map) ){ $ext = $map[$ext]; } if( array_key_exists($ext,$a) ){ $po = $a[$ext]; } else { $po = new $self($base); $a[$ext] = $po; } $message = clone $message; $message['refs'] = implode(' ',array_keys($refs) ); $po->push($message); } } } } return $a; } public function getHashes(){ $a = array(); foreach( $this as $msg ){ $a[] = $msg->getHash(); } sort( $a, SORT_STRING ); return $a; } public function equalSource( LocoPoIterator $that ){ $a = $this->getHashes(); $b = $that->getHashes(); if( count($a) !== count($b) ){ return false; } foreach( $a as $i => $hash ){ if( $hash !== $b[$i] ){ return false; } } return true; } public function equal( LocoPoIterator $that ){ if( $this->t !== $that->t ){ return false; } $i = $this->z; $fields = array( 'source', 'context', 'notes', 'refs', 'target', 'comment', 'flag', 'parent', 'plural' ); while( ++$i < $this->t ){ $a = $this->po[$i]; $b = $that->po[$i]; foreach( $fields as $f ){ $af = isset($a[$f]) ? $a[$f] : ''; $bf = isset($b[$f]) ? $b[$f] : ''; if( $af !== $bf ){ return false; } } } return true; } public function sort( $func = null ){ $order = array(); foreach( $this as $msg ){ $order[] = $msg; } if( is_null($func) ){ $func = array( __CLASS__, 'compare' ); } else if( ! is_callable($func) ){ throw new InvalidArgumentException('Bad callback'); } usort( $order, $func ); $this->clear(); foreach( $order as $p ){ $this->push($p); } return $this; } public static function compare( LocoPoMessage $a, LocoPoMessage $b ){ $h = $a->getHash(); $j = $b->getHash(); $n = strcasecmp( $h, $j ); if( 0 === $n ){ $n = strcmp( $h, $j ); if( 0 === $n ){ return 0; } } return $n > 0 ? 1 : -1; } public function createSorter(){ $index = array(); foreach( $this as $i => $msg ){ $index[ $msg->getHash() ] = $i; } $obj = new LocoPoIndex( $index ); return array( $obj, 'compare' ); } }
20	class LocoMoTable { private $size = 0; private $bin = ''; private $map; public function __construct( $data = null ){ if( is_array($data) ){ $this->compile( $data ); } else if( $data ){ $this->parse( $data ); } } public function count(){ if( ! isset($this->size) ){ if( $this->bin ){ $this->size = (int) ( strlen( $this->bin ) / 4 ); } else if( is_array($this->map) ){ $this->size = count($this->map); } else { return 0; } if( ! self::is_prime($this->size) \|\| $this->size < 3 ){ throw new Exception('Size expected to be prime number above 2, got '.$this->size); } } return $this->size; } public function bytes(){ return $this->count() * 4; } public function __toString(){ return $this->bin; } public function export(){ if( ! is_array($this->map) ){ $this->parse( $this->bin ); } return $this->map; } private function reset( $length ){ $this->size = max( 3, self::next_prime ( $length * 4 / 3 ) ); $this->bin = null; $this->map = array(); return $this->size; } public function compile( array $msgids ){ $hash_tab_size = $this->reset( count($msgids) ); $packed = array_fill( 0, $hash_tab_size, "\0\0\0\0" ); $j = 0; foreach( $msgids as $msgid ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $hash_tab_size; if( array_key_exists($idx, $this->map) ){ $incr = 1 + ( $hash_val % ( $hash_tab_size - 2 ) ); do { $idx += $incr; if( $hash_val === $idx ){ throw new Exception('Unable to find empty slot in hash table'); } $idx %= $hash_tab_size; } while( array_key_exists($idx, $this->map ) ); } $this->map[$idx] = $j; $packed[$idx] = pack('V', ++$j ); } return $this->bin = implode('',$packed); } public function lookup( $msgid, array $msgids ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $this->size; $incr = 1 + ( $hash_val % ( $this->size - 2 ) ); while( true ){ if( ! array_key_exists($idx, $this->map) ){ break; } $j = $this->map[$idx]; if( isset($msgids[$j]) && $msgid === $msgids[$j] ){ return $j; } $idx += $incr; if( $idx === $hash_val ){ break; } $idx %= $this->size; } return -1; } public function parse( $bin ){ $this->bin = (string) $bin; $this->size = null; $hash_tab_size = $this->count(); $this->map = array(); $idx = -1; $byte = 0; while( ++$idx < $hash_tab_size ){ $word = substr( $this->bin, $byte, 4 ); if( "\0\0\0\0" !== $word ){ list(,$j) = unpack('V', $word ); $this->map[$idx] = $j - 1; } $byte += 4; } return $this->map; } public static function hashpjw( $str ){ $i = -1; $hval = 0; $len = strlen($str); while( ++$i < $len ){ $ord = ord( substr($str,$i,1) ); $hval = ( $hval << 4 ) + $ord; $g = $hval & 0xf0000000; if( $g !== 0 ){ $hval ^= $g >> 24; $hval ^= $g; } } return $hval; } private static function next_prime( $seed ){ $seed \|= 1; while ( ! self::is_prime($seed) ){ $seed += 2; } return $seed; } private static function is_prime( $num ) { if ($num === 1 ){ return false; } if( $num === 2 ){ return true; } if( $num % 2 == 0 ) { return false; } for( $i = 3; $i <= ceil(sqrt($num)); $i = $i + 2) { if($num % $i == 0 ){ return false; } } return true; } }
21	class LocoMo { private $bin; private $msgs; private $head; private $hash; private $use_fuzzy = false; private $cs; public function __construct( Iterator $export, LocoPoHeaders $head = null ){ if( $head ){ $this->head = $head; } else { $this->head = new LocoPoHeaders; $this->setHeader('Project-Id-Version','Loco'); } $this->msgs = $export; $this->bin = ''; } public function setCharset( $cs ){ $cs = $this->head->setCharset($cs); $this->cs = 'UTF-8' === $cs ? null : $cs; } public function enableHash(){ return $this->hash = new LocoMoTable; } public function useFuzzy(){ $this->use_fuzzy = true; } public function setHeader( $key, $val ){ $this->head->add($key, $val); return $this; } private function str( $s ){ $s = (string) $s; if( $cs = $this->cs ){ $s = mb_convert_encoding($s,$cs,array('UTF-8')); } return $s; } public function compile(){ $table = array(''); $sources = array(''); $targets = array( (string) $this->head ); $fuzzy_flag = 4; $skip_fuzzy = ! $this->use_fuzzy; foreach( $this->msgs as $r ){ if( $skip_fuzzy && isset($r['flag']) && $fuzzy_flag === $r['flag'] ){ continue; } $msgid = $this->str( $r['key'] ); if( isset($r['context']) ){ $msgctxt = $this->str( $r['context'] ); if( '' !== $msgctxt ){ if( '' === $msgid ){ $msgid = '('.$msgctxt.')'; } $msgid = $msgctxt."\x04".$msgid; } } if( '' === $msgid ){ continue; } $msgstr = $this->str( $r['target'] ); if( '' === $msgstr ){ continue; } $table[] = $msgid; if( isset($r['plurals']) ){ foreach( $r['plurals'] as $i => $p ){ if( $i === 0 ){ $msgid .= "\0".$p['key']; } $msgstr .= "\0".$p['target']; } } $sources[] = $msgid; $targets[] = $msgstr; } asort( $sources, SORT_STRING ); $this->bin = "\xDE\x12\x04\x95\x00\x00\x00\x00"; $n = count($sources); $this->writeInteger( $n ); $offset = 28; $this->writeInteger( $offset ); $offset += $n * 8; $this->writeInteger( $offset ); if( $this->hash ){ sort( $table, SORT_STRING ); $this->hash->compile( $table ); $s = $this->hash->count(); } else { $s = 0; } $this->writeInteger( $s ); $offset += $n * 8; $this->writeInteger( $offset ); if( $s ){ $offset += $s * 4; } $source = ''; foreach( $sources as $i => $str ){ $source .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } $target = ''; foreach( array_keys($sources) as $i ){ $str = $targets[$i]; $target .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } if( $this->hash ){ $this->bin .= $this->hash->__toString(); } $this->bin .= $source; $this->bin .= $target; return $this->bin; } private function writeInteger( $num ){ $this->bin .= pack( 'V', $num ); return $this; } }
22	interface LocoTokensInterface extends Iterator { public function advance(); public function ignore( array $a ); }
	@@ -24,16 +24,16 @@ class LocoTokenizer implements LocoTokensInterface { const T_LITERAL = 0; const
24	function loco_utf8_chr( $u ){ if( $u < 0x80 ){ if( $u < 0 ){ throw new RangeException( sprintf('%d is out of Unicode range', $u ) ); } return chr($u); } if( $u < 0x800 ) { return chr( ($u>>6) & 0x1F \| 0xC0 ).chr( $u & 0x3F \| 0x80 ); } if( $u < 0x10000 ) { return chr( $u>>12 & 15 \| 0xE0 ).chr( $u>>6 & 0x3F \| 0x80 ).chr( $u & 0x3F \| 0x80 ); } if( $u < 0x110000 ) { return chr( $u>>18 & 7 \| 0xF0 ).chr( $u>>12 & 0x3F \| 0x80 ).chr( $u>>6 & 0x3F \| 0x80 ).chr( $u & 0x3F \| 0x80 ); } throw new RangeException( sprintf('\\x%X is out of Unicode range', $u ) ); }
25	function loco_resolve_surrogates( $s ){ return preg_replace_callback('/\\xED([\\xA0-\\xAF])([\\x80-\\xBF])\\xED([\\xB0-\\xBF])([\\x80-\\xBF])/', '_loco_resolve_surrogates', $s ); }
26	function _loco_resolve_surrogates( array $r ){ return loco_utf8_chr ( ( ( ( ( 832 \| ( ord($r[1]) & 0x3F ) ) << 6 ) \| ( ord($r[2]) & 0x3F ) ) - 0xD800 ) * 0x400 + ( ( ( ( 832 \| ( ord($r[3]) & 0x3F ) ) << 6 ) \| ( ord($r[4]) & 0x3F ) ) - 0xDC00 ) + 0x10000 ); }
27	- class LocoEscapeParser { private $map; private $grep; public function __construct( array $map = array() ){ $this->map = $map; $rules = array('\\\\'); if( $map ){ $rules[] = '['.implode(array_keys($map)).']'; } if( ! isset($map['U']) ) { $rules[] = 'U[0-9A-Fa-f]{5,8}'; } if( ! isset($map['u']) ) { $rules[] = 'u(?:\\{[0-9A-Fa-f]+\\}\|[0-9A-Fa-f]{1,4})(?:\\\\u(?:\\{[0-9A-Fa-f]+\\}\|[0-9A-Fa-f]{1,4}))*'; } $this->grep = '/\\\\('.implode('\|',$rules).')/'; } public function unescape( $s ){ if( '' !== $s ) { return $this->stripSlashes( preg_replace_callback($this->grep, array($this, 'unescapeMatch'), $s) ); } return ''; } public function unescapeMatch( array $r ){ $s = $r[0]; $c = $s[1]; if( isset($this->map[$c]) ){ return $this->map[$c]; } if( 'u' === $c ){ $str = ''; $surrogates = false; foreach( explode('\\u',$s) as $i => $h ){ if( '' !== $h ){ $h = ltrim( trim($h,'{}'),'0'); $u = intval($h,16); $str.= loco_utf8_chr($u); if( ! $surrogates ){ $surrogates = $u >= 0xD800 && $u <= 0xDBFF; } } } if( $surrogates ){ $str = loco_resolve_surrogates($str); } return $str; } if( 'U' === $c ){ return loco_utf8_chr( intval(substr($s,2),16) ); } if( 'x' === $c ){ return chr( intval(substr($s,2),16) ); } if( ctype_digit($c) ){ return chr( intval(substr($s,1),8) ); } return $s; } protected function stripSlashes( $s ){ return stripcslashes($s); } }
28	class LocoJsTokens extends LocoTokenizer { const T_KWORD = 1; const T_REGEX = 2; private static $lex; protected static $words = array( 'true' => 1, 'false' => 1, 'null' => 1, 'break' => T_BREAK, 'else' => T_ELSE, 'new' => T_NEW, 'var' => 1, 'case' => T_CASE, 'finally' => T_FINALLY, 'return' => T_RETURN, 'void' => 1, 'catch' => T_CATCH, 'for' => T_FOR, 'switch' => T_SWITCH, 'while' => T_WHILE, 'continue' => T_CONTINUE, 'function' => T_FUNCTION, 'this' => T_STRING, 'with' => 1, 'default' => T_DEFAULT, 'if' => T_IF, 'throw' => T_THROW, 'delete' => 1, 'in' => 1, 'try' => T_TRY, 'do' => T_DO, 'instanceof' => 1, 'typeof' => 1, ); public static function decapse( $encapsed ){ $s = substr($encapsed,1,-1); $l = self::$lex; if( is_null($l) ){ $l = new LocoEscapeParser( array( 'U' => 'U', 'a' => 'a', ) ); self::$lex = $l; } return $l->unescape($s); } public function __construct( $src = '' ){ $this->define('/^(?:\\\\u[0-9A-F]{4,4}\|[$_\\pL\\p{Nl}])(?:\\\\u[0-9A-F]{4}\|[$_\\pL\\pN\\p{Mn}\\p{Mc}\\p{Pc}])/ui', array($this,'matchWord') ); $this->define('/^\\s+/u', T_WHITESPACE ); $this->define('!^//.!', T_COMMENT ); $this->define('!^/\\.\\/!Us', array($this,'matchComment') ); $this->define('/^"(?:\\\\.\|[^\\r\\n\\p{Zl}\\p{Zp}"\\\\])"/u', T_CONSTANT_ENCAPSED_STRING ); $this->define('/^\'(?:\\\\.\|[^\\r\\n\\p{Zl}\\p{Zp}\'\\\\])\'/u', T_CONSTANT_ENCAPSED_STRING ); $this->define('/^[-+;,<>.=:\|&^!?%~(){}[\\]]/'); parent::__construct($src); } public function matchWord( $s ){ if( array_key_exists($s,self::$words) ){ return self::$words[$s]; } return T_STRING; } public function matchComment( $s ){ if( '/**' === substr($s,0,3) ){ return T_DOC_COMMENT; } return T_COMMENT; } }
29	class LocoExtracted implements Countable { private $exp = array(); private $reg = array(); private $dom = array(); private $dflt = ''; public function extractSource( LocoExtractor $ext, $src, $fileref = '' ){ $ext->extract( $this, $ext->tokenize($src), $fileref ); return $this; } public function export(){ return $this->exp; } public function count(){ return count( $this->exp ); } public function getDomainCounts(){ return $this->dom; } public function setDomain( $default ){ $this->dflt = (string) $default; return $this; } public function getDomain(){ return $this->dflt; } private function key( array $entry ){ $key = (string) $entry['source']; foreach( array('context','domain') as $i => $prop ){ if( array_key_exists($prop,$entry) ) { $add = (string) $entry[$prop]; if( '' !== $add ){ $key .= ord($i).$add; } } } return $key; } public function pushMeta( $source, $notes, $domain = '' ){ if( '' === $domain \|\| '' === $domain ){ $domain = $this->dflt; } return $this->pushEntry( array( 'source' => $source, 'notes' => $notes, ), $domain ); } public function pushEntry( array $entry, $domain = '' ){ $entry['id'] = ''; $entry['target'] = ''; $entry['domain'] = $domain; $key = $this->key($entry); if( isset($this->reg[$key]) ){ $index = $this->reg[$key]; $clash = $this->exp[$index]; if( $value = $this->mergeField( $clash, $entry, 'refs', ' ') ){ $this->exp[$index]['refs'] = $value; } if( $value = $this->mergeField( $clash, $entry, 'notes', "\n") ){ $this->exp[$index]['notes'] = $value; } } else { $index = count($this->exp); $this->reg[$key] = $index; $this->exp[$index] = $entry; if( isset($this->dom[$domain]) ){ $this->dom[$domain]++; } else { $this->dom[$domain] = 1; } } return $index; } public function pushPlural( array $entry, $sindex ){ $parent = $this->exp[$sindex]; $domain = $parent['domain']; $pkey = $this->key($parent)."\2"; if( ! array_key_exists($pkey,$this->reg) ){ $pindex = count($this->exp); $this->reg[$pkey] = $pindex; $entry += array( 'id' => '', 'target' => '', 'plural' => 1, 'parent' => $sindex, 'domain' => $domain, ); $this->exp[$pindex] = $entry; if( isset($entry['format']) && ! isset( $parent['format']) ) { $this->exp[$sindex]['format'] = $entry['format']; } if( $pindex !== $sindex + $entry['plural']) { $this->exp[$sindex]['child'] = $pindex; } } } public function mergeField( array $old, array $new, $field, $glue ){ $prev = isset($old[$field]) ? $old[$field] : ''; if( isset($new[$field]) ){ $text = $new[$field]; if( '' !== $prev && $prev !== $text ){ if( 'notes' === $field && preg_match( '/^'.preg_quote( rtrim($text,'. '),'/').'[. ]$/mu', $prev ) ) { $text = $prev; } else { $text = $prev.$glue.$text; } } return $text; } return $prev; } public function filter( $domain ){ $map = array(); $newOffset = 1; $matchAll = '*' === $domain; $raw = array( array( 'id' => '', 'source' => '', 'target' => '', 'domain' => $matchAll ? '' : $domain, ) ); foreach( $this->exp as $oldOffset => $r ){ if( isset($r['parent']) ){ if( isset($map[$r['parent']]) ){ $r['parent'] = $map[ $r['parent'] ]; $raw[ $newOffset++ ] = $r; } } else { if( $matchAll ){ $match = true; } else if( isset($r['domain']) ){ $match = $domain === $r['domain']; } else { $match = $domain === ''; } if( $match ){ $map[ $oldOffset ] = $newOffset; $raw[ $newOffset++ ] = $r; } } } return $raw; } }
30	abstract class LocoExtractor { private $rules; private $wp = array(); private $domain = ''; abstract public function tokenize( $src ); abstract public function extract( LocoExtracted $strings, LocoTokensInterface $tokens, $fileref = '' ); abstract protected function fsniff( $str ); abstract protected function decapse( $raw ); abstract protected function comment( $comment ); public function __construct( array $rules ){ $this->rules = $rules; } public function setDomain( $default ){ $this->domain = $default; return $this; } public function headerize( array $tags, $domain = '' ){ if( isset($this->wp[$domain]) ){ $this->wp[$domain] += $tags; } else { $this->wp[$domain] = $tags; } return $this; } protected function getHeaders(){ return $this->wp; } final public function extractSource( $src, $fileref ){ $strings = new LocoExtracted; $this->extract( $strings, $this->tokenize($src), $fileref ); return $strings; } public function rule( $s ){ return isset($this->rules[$s]) ? $this->rules[$s] : ''; } protected function push( LocoExtracted $strings, $rule, array $args, $comment = '', $ref = '' ){ $s = strpos( $rule, 's'); $p = strpos( $rule, 'p'); $c = strpos( $rule, 'c'); $d = strpos( $rule, 'd'); if( false === $s \|\| ! isset($args[$s]) ){ return null; } $msgid = $args[$s]; if( ! is_string($msgid) ){ return null; } $entry = array( 'source' => $msgid, ); if( is_int($c) && isset($args[$c]) ){ $entry['context'] = $args[$c]; } else if( '' === $msgid ){ return null; } if( $ref ){ $entry['refs'] = $ref; } if( is_int($d) && array_key_exists($d,$args) ){ $domain = $args[$d]; if( is_null($domain) ){ $domain = ''; } } else if( '' === $this->domain ) { $domain = $strings->getDomain(); } else { $domain = $this->domain; } $parse_printf = true; if( $comment = $this->comment($comment) ){ if( preg_match('/^xgettext:\\s([-a-z]+)-format\\s/mi', $comment, $r, PREG_OFFSET_CAPTURE ) ){ $entry['format'] = $r[1][0]; $comment = trim( substr_replace( $comment,'', $r[0][1], strlen($r[0][0]) ) ); $parse_printf = ( 'no-' === substr($entry['format'],0,3) ) ? false : null; } if( preg_match('/^references?:( .+:\\d+)\\s*/mi', $comment, $r, PREG_OFFSET_CAPTURE ) ){ $entry['refs'] = trim($r[1][0],' '); $comment = trim( substr_replace( $comment, '', $r[0][1], strlen($r[0][0]) ) ); } $entry['notes'] = $comment; } if( $parse_printf && ( $format = $this->fsniff($msgid) ) ){ $entry['format'] = $format; } $index = $strings->pushEntry($entry,$domain); if( is_int($p) && isset($args[$p]) ){ $msgid_plural = $args[$p]; $entry = array( 'source' => $msgid_plural, ); if( false !== $parse_printf && ( $format = $this->fsniff($msgid_plural) ) ){ $entry['format'] = $format; } $strings->pushPlural($entry,$index); } return $index; } protected function utf8( $str ){ if( false === preg_match('//u',$str) ){ $str = mb_convert_encoding( $str, 'UTF-8', 'cp1252' ); } return $str; } }
31	class LocoPHPTokens implements LocoTokensInterface, Countable { private $i; private $tokens; private $skip_tokens = array(); private $literal_tokens = array(); public function __construct( array $tokens ){ $this->tokens = $tokens; $this->rewind(); } public function literal( array $a ){ foreach( $a as $t ){ $this->literal_tokens[ $t ] = 1; } return $this; } public function ignore( array $a ){ foreach( $a as $t ){ $this->skip_tokens[$t] = true; } return $this; } public function export(){ $arr = array(); $this->rewind(); while( $tok = $this->advance() ){ $arr[] = $tok; } return $arr; } public function advance(){ $tok = $this->current(); $this->next(); return $tok; } public function rewind(){ $this->i = ( false === reset($this->tokens) ? null : key($this->tokens) ); } public function valid(){ while( isset($this->i) ){ $tok = $this->tokens[$this->i]; if( array_key_exists( is_array($tok) ? $tok[0] : $tok, $this->skip_tokens ) ){ $this->next(); } else { return true; } } return false; } public function key(){ return $this->i; } public function next(){ $this->i = ( false === next($this->tokens) ? null : key($this->tokens) ); } public function current(){ if( ! $this->valid() ){ return false; } $tok = $this->tokens[$this->i]; if( is_array($tok) && isset($this->literal_tokens[$tok[0]]) ){ return $tok[1]; } return $tok; } public function __toString(){ $s = array(); foreach( $this as $token ){ $s[] = is_array($token) ? $token[1] : $token; } return implode('',$s); } public function count(){ return count($this->tokens); } }
32	- class LocoPHPEscapeParser extends LocoEscapeParser { public function __construct(){ parent::__construct( array( 'n' => "\n", 'r' => "\r", 't' => "\t", 'v' => "\x0B", 'f' => "\x0C", 'e' => "\x1B", '$' => '$', '\\' => '\\', '"' => '"', ) ); } protected function stripSlashes( $s ){ return preg_replace_callback('/\\\\(x[0-9A-Fa-f]{1,2}\|[0-3]?[0-7]{1,2})/', array($this,'unescapeMatch'), $s, -1, $n ); } }
33	function loco_unescape_php_string( $s ){ static $l; if( is_null($l) ) { $l = new LocoPHPEscapeParser; } return $l->unescape($s); }
34	function loco_decapse_php_string( $s ){ if( ! $s ){ return (string) $s; } $q = $s[0]; if( "'" === $q ){ return str_replace( array('\\'.$q, '\\\\'), array($q, '\\'), substr( $s, 1, -1 ) ); } if( '"' !== $q ){ return $s; } return loco_unescape_php_string( substr($s,1,-1) ); }
35	function loco_parse_php_comment($comment){ $comment = trim( $comment,"/ \n\r\t" ); if( '' !== $comment && '' === $comment[0] ){ $lines = array(); $junk = "\r\t/ "; foreach( explode("\n",$comment) as $line ){ $line = trim($line,$junk); if( '' !== $line ){ $lines[] = $line; } } $comment = implode("\n", $lines); } return $comment; }
36	- function loco_parse_wp_comment( $block ){ $header = array(); if( '' === $block~~[1]~~ ){ $junk = "\r\t/ "; foreach( explode("\n", $block) as $line ){ if( false !== ( $i = strpos($line,':') ) ){ $key = substr($line,0,$i); $val = substr($line,++$i); $header[ trim($key,$junk) ] = trim($val,$junk); } } } return $header; }
37	function loco_sniff_printf( $s, $p, $limit = 0, $offset = 0 ){ $n = 0; while( is_string($s) && '' !== $s && false !== ( $i = strpos($s,'%',$offset) ) ){ if( 0 !== $i ){ $s = substr( $s, $i ); } if( preg_match( $p, $s, $r ) ){ $match = $r[0]; if( 0 < $n && isset($r[1]) && '' === $r[1] && '%' !== substr($match,-1) ){ return 0; } if( ++$n === $limit ){ break; } $offset = strlen($match); } else { return 0; } } return $n; }
38	function loco_sniff_php_printf( $s, $limit = 0 ){ return loco_sniff_printf( $s, '/^%(?:[1-9]\\d\\$)?(?:\'.\|[-+0 ])\\d*(?:\\.\\d+)?[suxXbcdeEfFgGo%]/', $limit ); }
39	class LocoPHPExtractor extends LocoExtractor { private $defs = array(); public function tokenize( $src ){ return new LocoPHPTokens( token_get_all($src) ); } public function decapse( $raw ){ return loco_decapse_php_string( $raw ); } public function fsniff( $str ){ return loco_sniff_php_printf($str) ? 'php' : ''; } protected function comment( $comment ){ $comment = loco_parse_php_comment($comment); $comment = preg_replace('/^translators:\\s+/mi', '', $comment ); return $comment; } public function define( $name, $value ){ if( is_string($value) ){ $this->defs[$name] = $value; } return $this; } public function extract( LocoExtracted $strings, LocoTokensInterface $tokens, $fileref = '' ){ $tokens->ignore( array(T_WHITESPACE) ); $n = 0; $depth = 0; $comment = ''; $narg = 0; $args = array(); $ref = ''; $rule = ''; $wp = $this->getHeaders(); $tokens->rewind(); while( $tok = $tokens->advance() ){ if( is_string($tok) ){ $s = $tok; $t = null; } else { $t = $tok[0]; $s = $tok[1]; } if( $depth ){ if( ')' === $s \|\| ']' === $s ){ if( 0 === --$depth ){ if( $this->push( $strings, $rule, $args, $comment, $ref ) ){ $n++; } $comment = ''; } } else if( '(' === $s \|\| '[' === $s ){ $depth++; $args[$narg] = null; } else if( 1 === $depth ){ if( ',' === $s ){ $narg++; } else if( T_CONSTANT_ENCAPSED_STRING === $t ){ $s = self::utf8($s); $args[$narg] = $this->decapse($s); } else if( T_STRING === $t && array_key_exists($s,$this->defs) ){ $args[$narg] = $this->defs[$s]; } else { $args[$narg] = null; } } } else if( T_COMMENT === $t \|\| T_DOC_COMMENT === $t ){ $was_header = false; $s = self::utf8($s); if( 0 === $n ){ if( false !== strpos($s,'* @package') ){ $was_header = true; } if( $wp && ( $header = loco_parse_wp_comment($s) ) ){ foreach( $wp as $domain => $tags ){ foreach( array_intersect_key($header,$tags) as $tag => $source ){ $strings->pushMeta( $source, $tags[$tag], (string) $domain ); $was_header = true; } } } } if( ! $was_header ) { $comment = $s; } } else if( T_STRING === $t && '(' === $tokens->advance() && ( $rule = $this->rule($s) ) ){ $ref = $fileref ? $fileref.':'.$tok[2]: ''; $depth = 1; $args = array(); $narg = 0; } else if( $comment ){ if( false === stripos($comment, 'translators:') && false === strpos($comment, 'xgettext:') ){ $comment = ''; } } } return $this; } }
	@@ -44,5 +44,5 @@ function loco_wp_extractor( $type = 'php' ){ static $rules = array( '__' => 'sd
44	function loco_print_percent( $n, $t ){ $s = loco_string_percent( (int) $n, (int) $t ); echo $s,'%'; return ''; }
45	function loco_print_progress( $translated, $untranslated, $flagged ){ $total = $translated + $untranslated; $complete = loco_string_percent( $translated - $flagged, $total ); $class = 'progress'; if( ! $translated && ! $flagged ){ $class .= ' empty'; } else if( '100' === $complete ){ $class .= ' done'; } echo '<div class="',$class,'"><div class="t">'; if( $flagged ){ $s = loco_string_percent( $flagged, $total ); echo '<div class="bar f" style="width:',$s,'%"> </div>'; } if( '0' === $complete ){ echo ' '; } else { $class = 'bar p'; $p = (int) $complete; $class .= sprintf(' p-%u', 10*floor($p/10) ); $style = 'width:'.$complete.'%'; if( $flagged ){ $remain = 100.0 - (float) $s; $style .= '; max-width: '.sprintf('%s',$remain).'%'; } echo '<div class="',$class,'" style="'.$style.'"> </div>'; } echo '</div><div class="l">',$complete,'%</div></div>'; return ''; }
46	function loco_string_percent( $n, $t ){ if( ! $t \|\| ! $n ){ $s = '0'; } else if( $t === $n ){ $s = '100'; } else { $dp = 0; $n = 100 * $n / $t; if( $n > 99 ){ $s = number_format( min( $n, 99.9 ), ++$dp ); } else if( $n < 0.5 ){ $n = max( $n, 0.0001 ); do { $s = number_format( $n, ++$dp ); } while( preg_match('/^0\\.0+$/',$s) && $dp < 4 ); $s = substr($s,1); } else { $s = number_format( $n, $dp ); } } return $s; }
47	- class LocoFuzzyMatcher implements Countable { private $pot = array(); private $po = array(); private $diff = array(); private $dmax = .20; public function count(){ return count($this->pot); } public function unmatched(){ return array_values($this->pot); } public function redundant(){ return array_values($this->po); } public function setFuzziness( $s ){ if( $this->po ){ throw new LogicException('Cannot setFuzziness() after calling match()'); } $this->dmax = (float) max( 0, min( (int) $s, 100 ) ) / 100; } public function add( $a ){ $source = isset($a['source']) ? (string) $a['source'] : ''; $context = isset($a['context']) ? (string) $a['context'] : ''; $~~this->pot[~~$source."\4".$context] = $a; } ~~public~~ function ~~match~~( $a ) { $source = isset($a['source']) ? (string) $a['source'] : ''; $context = isset($a['context']) ? (string) $a['context'] : ''; ~~$old~~ = $source."\4".$context; if( isset($this->pot[$old]) ){ $new = $this->pot[$old]; unset($this->pot[$old]); return $new; } $this->po[$old] = $a; $target = isset($a['target']) ? (string) $a['target'] : ''; $comment = isset($a['comment']) ? (string) $a['comment'] : ''; if( '' === $target && '' === $comment ){ return null; } if( 0 < $this->dmax ){ foreach( $this->pot as $new => $_ ){ $dist = $this->distance($old,$new); if( -1 !== $dist ){ $this->diff[] = array( $old, $new, $dist ); } } } return null; } private function distance( $a, $b ){ $a = strtolower($a); $b = strtolower($b); if( $a === $b ){ return 0; } $lenA = strlen($a); $lenB = strlen($b); $lenDiff = abs($lenA-$lenB); $max = min($lenA,$lenB) + $lenDiff; $max = (int) ceil( $this->dmax * $max ); if( $max < $lenDiff ) { return -1; } $len = max($lenA,$lenB); if( $len < 256 ){ $d = levenshtein($a,$b); return $d > $max ? -1 : $d; } $d = 0; for( $i = 0; $i < $len; $i+=$max ){ $aa = substr($a,$i,$max); $bb = substr($b,$i,$max); $d += levenshtein($aa,$bb); if( $d > $max ){ return -1; } } return $d; } public function getFuzzyMatches(){ $pairs = array(); usort( $this->diff, array(__CLASS__,'compareDistance') ); foreach( $this->diff as $pair ){ list($old,$new) = $pair; if( ! array_key_exists($new,$this->pot) \|\| ! array_key_exists($old,$this->po) ){ continue; } $pairs[] = array( $this->po[$old], $this->pot[$new], ); unset($this->po[$old]); unset($this->pot[$new]); if( ! $this->po \|\| ! $this->pot ){ break; } } $this->diff = array(); return $pairs; } private static function compareDistance( array $a, array $b ){ return $a[2] - $b[2]; } }
48	defined('T_FINALLY') \|\| define('T_FINALLY',500); loco_check_extension('mbstring');


11	abstract class LocoGettextParser { private $head = null; private $cs = ''; abstract public function parse( $limit = -1 ); protected function setHeader( LocoPoHeaders $head ){ $this->head = $head; $cs = $head->getCharset(); if( is_string($cs) && '' !== $cs ){ if( '' === $this->cs ){ $this->setCharset($cs); } } return $head; } public function getHeader(){ return $this->head; } protected function setCharset( $cs ){ $this->cs = $cs; } protected function getCharset(){ return $this->cs; } protected function str( $str ){ if( '' !== $str ){ $str = loco_convert_utf8($str,$this->cs,false); } return $str; } }
12	function loco_remove_bom( $s, &$c ){ $bom = substr($s,0,2); if( "\xFF\xFE" === $bom ){ $c = 'UTF-16LE'; return substr($s,2); } if( "\xFE\xFF" === $bom ){ $c = 'UTF-16BE'; return substr($s,2); } if( "\xEF\xBB" === $bom && "\xBF" === $s[2] ){ $c = 'UTF-8'; return substr($s,3); } $c = ''; return $s; }
13	function loco_parse_reference_id( $refs, &$_id ){ if( false === ( $n = strpos($refs,'loco:') ) ){ $_id = ''; return $refs; } $_id = substr($refs, $n+5, 24 ); $refs = substr_replace( $refs, '', $n, 29 ); return trim( $refs ); }
14	+ class LocoPoParser extends LocoGettextParser implements Iterator { private $lines = array(); private $i; private $k; private $m; public function __construct( $src ){ if( '' !== $src ){ $src = loco_remove_bom($src,$cs); if( $cs && 'UTF-8' !== $cs ){ $src = mb_convert_encoding( $src, 'UTF-8', $cs ); $cs = 'UTF-8'; } if( 'UTF-8' === $cs ){ $this->setCharset('UTF-8'); } $this->lines = preg_split('/(\\r\\n?\|\\n)/', $src ); } } public function rewind(){ $this->i = -1; $this->k = -1; $this->next(); } public function valid(){ return is_int($this->i); } public function key(){ return $this->k; } public function current(){ return $this->m; } public function next(){ $valid = false; $entry = array( '#' => array(), 'id' => array(null), 'str' => array(null) ); $i = $this->i; while( array_key_exists(++$i,$this->lines) ){ $line = $this->lines[$i]; try { if( '' === $line ){ if( $valid ){ break; } continue; } $c = $line[0]; if( '#' === $c ){ if( $valid ){ $i--; break; } if( '#' === $line ){ continue; } $f = $line[1]; $entry['#'][$f][] = trim( substr( $line, 1+strlen($f) ), "/ \n\r\t" ); } else if( preg_match('/^msg(id(?:_plural)?\|ctxt\|str(?:\\[(\\d+)])?)[ \\t]*/', $line, $r ) ){ if( isset($r[2]) ){ $key = 'str'; $idx = (int) $r[2]; } else { $key = $r[1]; $idx = 0; } if( $valid && 'str' !== $key && null !== $entry['str'][0] ){ $i--; break; } $snip = strlen($r[0]); if( '"' !== substr($line,$snip,1) ){ throw new Exception('Expected " to follow msg'.$key); } $val = ''; $line = substr($line,$snip); while( true ){ if( '"' === $line \|\| '"' !== substr($line,-1) ){ throw new Exception('Unterminated msg'.$key ); } $val .= substr( $line, 1, -1 ); $j = $i + 1; if( array_key_exists($j,$this->lines) && ( $line = $this->lines[$j] ) && '"' === $line[0] ){ $i = $j; } else { break; } } if( ! $valid ){ $valid = true; } if( 'id_plural' === $key ){ $key = 'id'; $idx = 1; } $entry[$key][$idx] = stripcslashes($val); } else if( preg_match('/^[ \\t]+$/',$line) ){ if( $valid ) { break; } } else if( '"' === $c ){ throw new Exception('String encountered without keyword'); } else { throw new Exception('Junk'); } } catch( Exception $e ){ } } if( $valid ){ ++$this->k; $this->i = $i; $this->m = $entry; } else { $this->i = null; $this->k = null; $this->m = null; } } public function parse( $limit = -1 ){ $this->rewind(); if( ! $this->valid() ){ throw new Loco_error_ParseException('Invalid PO file'); } $entry = $this->current(); if( '' !== $entry['id'][0] \|\| isset($entry['ctxt']) \|\| is_null($entry['str'][0]) ){ $head = $this->setHeader( new LocoPoHeaders ); } else { $head = $this->setHeader( LocoPoHeaders::fromMsgstr($entry['str'][0]) ); } if( 0 === $limit ){ return array(); } $i = -1; $assets = array(); $lk = $head['X-Loco-Lookup']; while( $this->valid() ){ $entry = $this->current(); $msgid = $entry['id'][0]; if( is_null($msgid) ){ $this->next(); continue; } if( ++$i === $limit ){ return $assets; } $asset = array( 'source' => $this->str( $msgid ), 'target' => $this->str( (string) $entry['str'][0] ), 'context' => null, ); $prev_entry = null; if( isset($entry['ctxt']) ){ $asset['context'] = $this->str( $entry['ctxt'][0] ); } $cmt = $entry['#']; if( isset($cmt[' ']) ){ $asset['comment'] = $this->str( implode("\n", $cmt[' '] ) ); } if( isset($cmt['.']) ){ $asset['notes'] = $this->str( implode("\n", $cmt['.'] ) ); } if( isset($cmt[':']) ){ if( $refs = implode( ' ', $cmt[':'] ) ) { $refs = $this->str($refs); if( $refs = loco_parse_reference_id( $refs, $_id ) ){ $asset['refs'] = $refs; } if( $_id ){ $asset['_id'] = $_id; } } } if( isset($cmt[',']) ){ foreach( $cmt[','] as $flags ){ foreach( explode(',',$flags) as $flag ){ if( $flag = trim($flag," \t") ){ if( preg_match('/^((?:no-)?\w+)-format/', $flag, $r ) ){ $asset['format'] = $r[1]; } else if( 'fuzzy' === $flag ){ $asset['flag'] = 4; } } } } } if( isset($cmt['\|']) ){ $p = new LocoPoParser(''); $p->lines = $cmt['\|']; $p->setCharset( $this->getCharset() ); try { $prev_entry = $p->parse(); } catch( Loco_error_ParseException $e ){ } if( $prev_entry ){ $msgid = $prev_entry[0]['source']; if( $lk && 'text' !== $lk ){ $asset[$lk] = $asset['source']; $asset['source'] = $msgid; } else if( 'loco:' === substr($msgid,0,5) ){ $asset['_id'] = substr($msgid,5); } else { $asset['prev'] = $prev_entry; $prev_entry = null; } } } $assets[] = $asset; if( isset($entry['id'][1]) ){ $idx = 0; $pidx = count($assets) - 1; $num = max( 2, count($entry['str']) ); while( ++$idx < $num ){ $plural = array( 'source' => '', 'target' => isset($entry['str'][$idx]) ? $this->str($entry['str'][$idx]) : '', 'plural' => $idx, 'parent' => $pidx, ); if( 1 === $idx ){ $plural['source'] = $this->str($entry['id'][1]); if( is_array($prev_entry) && isset($prev_entry[1]) ){ if( $lk && 'text' !== $lk ){ $plural[$lk] = $plural['source']; $plural['source'] = $prev_entry[1]['source']; } } } if( isset($asset['flag']) ){ $plural['flag'] = $asset['flag']; } $assets[] = $plural; } } $this->next(); } if( -1 === $i ){ throw new Loco_error_ParseException('Invalid PO file'); } else if( 0 === $i && '' === $assets[0]['source'] && '' === $assets[0]['target'] ){ throw new Loco_error_ParseException('Invalid PO file' ); } return $assets; } }
15	class LocoMoParser extends LocoGettextParser { private $bin; private $be; private $n; private $o; private $t; private $v; public function __construct( $bin ){ $this->bin = $bin; } public function getAt( $idx ){ $offset = $this->targetOffset(); $offset += ( $idx * 8 ); $len = $this->integerAt( $offset ); $idx = $this->integerAt( $offset + 4 ); $txt = $this->bytes( $idx, $len ); if( false === strpos( $txt, "\0") ){ return $txt; } return explode( "\0", $txt ); } public function parse( $limit = -1 ){ $i = -1; $r = array(); $sourceOffset = $this->sourceOffset(); $targetOffset = $this->targetOffset(); $soffset = $sourceOffset; $toffset = $targetOffset; while( $soffset < $targetOffset ){ $len = $this->integerAt( $soffset ); $idx = $this->integerAt( $soffset + 4 ); $src = $this->bytes( $idx, $len ); $eot = strpos( $src, "\x04" ); if( false === $eot ){ $context = null; } else { $context = $this->str( substr($src, 0, $eot ) ); $src = substr( $src, $eot+1 ); } $sources = explode( "\0", $src, 2 ); $len = $this->integerAt( $toffset ); $idx = $this->integerAt( $toffset + 4 ); $targets = explode( "\0", $this->bytes( $idx, $len ) ); if( -1 === $i && '' === $sources[0] && is_null($context) ){ $this->setHeader( LocoPoHeaders::fromMsgstr($targets[0]) ); } if( ++$i === $limit ){ break; } $r[$i] = array( 'source' => $this->str( $sources[0] ), 'target' => $this->str( $targets[0] ), 'context' => $context, ); if( isset($sources[1]) ){ $p = count($r) - 1; $nforms = max( 2, count($targets) ); for( $i = 1; $i < $nforms; $i++ ){ $r[] = array( 'source' => isset($sources[$i]) ? $this->str( $sources[$i] ) : sprintf('%s (plural %u)',$r[$p]['source'],$i), 'target' => isset($targets[$i]) ? $this->str( $targets[$i] ) : '', 'parent' => $p, 'plural' => $i, ); } } $soffset += 8; $toffset += 8; } return $r; } public function isBigendian(){ if( is_null($this->be) ){ $str = $this->words( 0, 1 ); if( "\xDE\x12\x04\x95" === $str ){ $this->be = false; } else if( "\x95\x04\x12\xDE" === $str ){ $this->be = true; } else { throw new Loco_error_ParseException('Invalid MO format'); } } return $this->be; } public function version(){ if( is_null($this->v) ){ $this->v = $this->integerWord(1); } return $this->v; } public function count(){ if( is_null($this->n) ){ $this->n = $this->integerWord(2); } return $this->n; } public function sourceOffset(){ if( is_null($this->o) ){ $this->o = $this->integerWord(3); } return $this->o; } public function targetOffset(){ if( is_null($this->t) ){ $this->t = $this->integerWord(4); } return $this->t; } public function getHashTable(){ $s = $this->integerWord(5); $h = $this->integerWord(6); return $this->bytes( $h, $s * 4 ); } private function bytes( $offset, $length ){ $s = substr( $this->bin, $offset, $length ); if( strlen($s) !== $length ){ throw new Loco_error_ParseException('Failed to read '.$length.' bytes at ['.$offset.']' ); } return $s; } private function words( $offset, $length ){ return $this->bytes( $offset * 4, $length * 4 ); } private function integerWord( $offset ){ return $this->integerAt( $offset * 4 ); } private function integerAt( $offset ){ $str = $this->bytes( $offset, 4 ); $fmt = $this->isBigendian() ? 'N' : 'V'; $arr = unpack( $fmt, $str ); if( ! isset($arr[1]) \|\| ! is_int($arr[1]) ){ throw new Loco_error_ParseException('Failed to read integer at byte '.$offset); } return $arr[1]; } }
16	abstract class LocoPo { public static function pair( $key, $text, $width = 79, $eol = "\n", $esc = '\\n' ){ if( '' === $text ){ return $key.' ""'; } $text = addcslashes( $text, "\t\x0B\x0C\x07\x08\\\"" ); if( $esc ) { $text = preg_replace('/(?:\\r\\n?\|\\n)/', $esc.$eol, $text, -1, $nbr ); } else { $eol = "\n"; $text = preg_replace_callback('/(?:\\r\\n?\|\\n)/',array(__CLASS__,'replace_br'), $text, -1, $nbr ); } if( $nbr ){ } else if( $width && $width < mb_strlen($text,'UTF-8') + strlen($key) + 3 ){ } else { return $key.' "'.$text.'"'; } $lines = array( $key.' "' ); if( $width ){ $width -= 2; $a = '/^.{0,'.($width-1).'}[-– \\.,:;\\?!\\)\\]\\}\\>]/u'; $b = '/^[^-– \\.,:;\\?!\\)\\]\\}\\>]+/u'; foreach( explode($eol,$text) as $unwrapped ){ $length = mb_strlen( $unwrapped, 'UTF-8' ); while( $length > $width ){ if( preg_match( $a, $unwrapped, $r ) ){ $line = $r[0]; } else if( preg_match( $b, $unwrapped, $r ) ){ $line = $r[0]; } else { throw new Exception('Wrapping error'); } $lines[] = $line; $trunc = mb_strlen($line,'UTF-8'); $length -= $trunc; $unwrapped = (string) substr( $unwrapped, strlen($line) ); if( ( '' === $unwrapped && 0 !== $length ) \|\| ( 0 === $length && '' !== $unwrapped ) ){ throw new Exception('Truncation error'); } } if( 0 !== $length ){ $lines[] = $unwrapped; } } } else { foreach( explode($eol,$text) as $unwrapped ){ $lines[] = $unwrapped; } } return implode('"'.$eol.'"',$lines).'"'; } private static function replace_br( array $r ){ return addcslashes($r[0],"\r\n")."\n"; } public static function refs( $text, $width = 76, $eol = "\n" ){ $text = preg_replace('/\\s+/u', ' ', $text ); if( $width ){ $text = wordwrap( $text, $width, $eol.'#: ', false ); } return '#: '.$text; } public static function prefix( $text, $prefix, $eol = "\n" ){ return $prefix . implode($eol.$prefix, self::split($text) ); } public static function split( $text ){ $lines = preg_split('/\\R/u', $text ); if( false === $lines ){ if( false === preg_match('//u',$text) ){ $text = mb_convert_encoding( $text, 'UTF-8', 'cp1252' ); } $lines = preg_split('/\\r?\\n+/', $text ); } return $lines; } public static function trim( $text ){ $lines = array(); $deferred = null; foreach( explode("\n",$text) as $line ){ if( '' === $line ){ continue; } if( preg_match('/^msg[a-z]+(?:\\[\\d+])? ""/',$line) ){ $deferred = $line; continue; } if( $deferred && '"' === $line[0] ){ $lines[] = $deferred; $deferred = null; } $lines[] = $line; } return implode("\n",$lines); } }
17	class LocoPoIndex extends ArrayIterator { public function compare( LocoPoMessage $a, LocoPoMessage $b ){ $h = $a->getHash(); if( ! isset($this[$h]) ){ return 1; } $j = $b->getHash(); if( ! isset($this[$j]) ){ return -1; } return $this[$h] > $this[$j] ? 1 : -1; } }
18	+ class LocoPoMessage extends ArrayObject { public function __construct( array $r ){ $r['key'] = $r['source']; parent::__construct($r); } public function __get( $prop ){ return $this->offsetExists($prop) ? $this->offsetGet($prop) : null; } private function _getFlags(){ $flags = array(); $plurals = $this->__get('plurals'); if( 4 === $this->__get('flag') ){ $flags[] = 'fuzzy'; } else if( $plurals ){ foreach( $plurals as $child ){ if( 4 === $child->__get('flag') ){ $flags[] = 'fuzzy'; break; } } } if( $f = $this->__get('format') ){ $flags[] = $f.'-format'; } else if( isset($plurals[0]) && ( $f = $plurals[0]->format ) ){ $flags[] = $f.'-format'; } return $flags; } public function getHash(){ $hash = $this->getKey(); if( $this->offsetExists('plurals') ){ foreach( $this->offsetGet('plurals') as $p ){ $hash .= "\0".$p->getHash(); break; } } return $hash; } public function getKey(){ $msgid = (string) $this['source']; $msgctxt = (string) $this->__get('context'); if( '' !== $msgctxt ){ if( '' === $msgid ){ $msgid = '('.$msgctxt.')'; } $msgid = $msgctxt."\4".$msgid; } return $msgid; } public function exportSerial(){ $a = array( $this['target'] ); if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); if( is_array($plurals) ){ foreach( $plurals as $i => $p ){ $a[] = $p['target']; } } } return $a; } public function __toString(){ return $this->render( 79, 76 ); } public function render( $width, $ref_width ){ $s = array(); try { if( $text = $this->__get('comment') ) { $s[] = LocoPo::prefix( $text, '# '); } if( $text = $this->__get('notes') ) { $s[] = LocoPo::prefix( $text, '#. '); } if( $text = $this->__get('refs') ){ $s[] = LocoPo::refs( $text, $ref_width ); } if( $texts = $this->_getFlags() ){ $s[] = '#, '.implode(', ',$texts); } $prev = $this->__get('prev'); if( is_array($prev) && $prev ){ foreach( new LocoPoIterator($prev) as $p ){ $text = $p->render( max(0,$width-3), 0 ); $s[] = LocoPo::prefix( LocoPo::trim($text),'#\| '); break; } } $text = $this->__get('context'); if( is_string($text) && '' !== $text ){ $s[] = LocoPo::pair('msgctxt', $text, $width ); } $s[] = LocoPo::pair( 'msgid', $this['source'], $width ); $target = $this['target']; $plurals = $this->__get('plurals'); if( is_array($plurals) ){ if( $plurals ){ foreach( $plurals as $i => $p ){ if( 0 === $i ){ $s[] = LocoPo::pair('msgid_plural', $p['source'], $width ); $s[] = LocoPo::pair('msgstr[0]', $target, $width ); } $s[] = LocoPo::pair('msgstr['.(++$i).']', $p['target'], $width ); } } else if( isset($this['plural_key']) ){ $s[] = LocoPo::pair('msgid_plural', $this['plural_key'], $width ); $s[] = LocoPo::pair('msgstr[0]', $target, $width ); } else { trigger_error('Missing plural_key in zero plural export'); $s[] = LocoPo::pair('msgstr', $target, $width ); } } else { $s[] = LocoPo::pair('msgstr', $target, $width ); } } catch( Exception $e ){ trigger_error( $e->getMessage(), E_USER_WARNING ); } return implode("\n",$s)."\n"; } public function merge( LocoPoMessage $def, $translate = false ){ if( $def->getHash() !== $this->getHash() ){ $prev = array( 'source' => '', 'target' => '' ); $prev = $this->diff('source',$def,$prev); $prev = $this->diff('context',$def,$prev); $this['flag'] = 4; $this['prev'] = array( $prev ); $defPlural = $def->getPlural(0); $ourPlural = $this->getPlural(0); if( $defPlural && $ourPlural ) { $ourPlural->merge($defPlural); if( $ourPlural->offsetExists('prev') ) { $this['prev'][] = $ourPlural->prev[0]+array('parent'=>0,'plural'=>1); $ourPlural->offsetUnset('prev'); } } else if( $defPlural ){ $this['plurals'] = array( clone $defPlural ); } else if( $ourPlural ){ $this['prev'][] = $ourPlural->exportBasic() + array('parent'=>0,'plural'=>1); $this->offsetUnset('plurals'); } } foreach( array('notes','refs') as $f ){ if( $def->offsetExists($f) ){ $this->offsetSet($f,$def->offsetGet($f)); } else if( $this->offsetExists($f) ){ $this->offsetUnset($f); } } if( $translate && '' === $this['target'] && '' !== $def['target'] ){ $this['target'] = $def['target']; if( $def->offsetExists('comment') ) { $this['comment'] = $def['comment']; } if( $this->offsetExists('plurals') ){ foreach( $this['plurals'] as $i => $ourPlural ){ if( '' === $ourPlural['target'] ){ $defPlural = $def->getPlural($i); if( $defPlural ){ $ourPlural['target'] = $defPlural['target']; } } } } } } private function diff( $key, LocoPoMessage $def, array $prev ){ $old = $this->__get($key); $new = $def->__get($key); if( $new !== $old ){ $this->offsetSet($key,$new); if( is_string($old) && '' !== $old ){ $prev[$key] = $old; } } return $prev; } private function getPlural( $i ){ if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); if( is_array($plurals) && array_key_exists($i,$plurals) ){ return $plurals[$i]; } } return null; } private function exportBasic(){ return array( 'source' => $this['source'], 'context' => $this->context, 'target' => '', ); } public function export(){ $a = $this->getArrayCopy(); unset($a['key']); if( array_key_exists('plurals',$a) ){ foreach( $a['plurals'] as $i => $p ){ if( $p instanceof ArrayObject ){ $a['plurals'][$i] = $p->getArrayCopy(); } } } return $a; } public function countForms(){ $len = 1; if( $this->offsetExists('plurals') ){ $plurals = $this->offsetGet('plurals'); $len += count($plurals); } return $len; } public function strip(){ $this['target'] = ''; $plurals = $this->plurals; if( is_array($plurals) ){ foreach( $plurals as $p ){ $p->strip(); } } return $this; } public function translated(){ $n = 0; if( '' !== (string) $this['target'] ){ $n++; } if( $this->offsetExists('plurals') ){ foreach( $this->offsetGet('plurals') as $plural ) { if( '' !== (string) $plural['target']) { $n++; } } } return $n; } }
19	+ class LocoPoIterator implements Iterator, Countable { private $po; private $headers = null; private $i; private $t; private $j; private $z = 0; private $w = 79; public function __construct( $po ){ if( is_array($po) ){ $this->po = $po; } else if( $po instanceof Traversable ){ $this->po = iterator_to_array($po,false); } else { throw new InvalidArgumentException('PO data must be array or iterator'); } $this->t = count($po); if( 0 === $this->t ){ throw new InvalidArgumentException('Empty PO data'); } $h = $po[0]; if( '' !== $h['source'] \|\| ( isset($h['context']) && '' !== $h['context'] ) \|\| ( isset($po[1]['parent']) && 0 === $po[1]['parent'] ) ){ $this->z = -1; } } public function push( LocoPoMessage $p ){ $raw = $p->export(); $plurals = $p->plurals; unset($raw['plurals']); $i = count($this->po); $this->po[$i] = $raw; $this->t++; if( is_array($plurals) ) { $j = 0; foreach( $plurals as $p ) { $raw = $p->export(); $raw['parent'] = $i; $raw['plural'] = ++$j; $this->po[] = $raw; $this->t++; } } } public function concat( LocoPoIterator $more ){ foreach( $more as $message ){ $this->push($message); } return $this; } public function __clone(){ if( $this->headers ){ $this->headers = new LocoPoHeaders( $this->headers->getArrayCopy() ); } } public function count(){ return $this->t - ( $this->z + 1 ); } public function wrap( $width ){ $width = (int) $width; if( $width > 0 ){ $this->w = max( 15, $width ); } else { $this->w = 0; } return $this; } public function rewind(){ $this->i = $this->z; $this->j = -1; $this->next(); } public function key(){ return $this->j; } public function valid(){ return is_int($this->i); } public function next(){ $i = $this->i; while( ++$i < $this->t ){ if( array_key_exists('parent',$this->po[$i]) ){ continue; } $this->j++; $this->i = $i; return; } $this->i = null; $this->j = null; } public function current(){ $i = $this->i; $po = $this->po; $parent = new LocoPoMessage( $po[$i] ); $plurals = array(); $nonseq = $parent->offsetExists('child'); $j = $nonseq ? $parent['child'] : $i+1; while( isset($po[$j]['parent']) && $i === $po[$j]['parent'] ){ $plurals[] = new LocoPoMessage($po[$j++]); } if( $plurals ){ $parent['plurals'] = $plurals; } return $parent; } public function getArrayCopy(){ $po = $this->po; if( 0 === $this->z ){ $po[0]['target'] = (string) $this->getHeaders(); } return $po; } public function clear(){ if( 0 === $this->z ){ $this->po = array( $this->po[0] ); $this->t = 1; } else { $this->po = array(); $this->t = 0; } } public function getHeaders(){ if( is_null($this->headers) ){ $header = $this->po[0]; if( 0 === $this->z ){ $this->headers = LocoPoHeaders::fromMsgstr( $header['target'] ); } else { $this->headers = new LocoPoHeaders; } } return $this->headers; } public function setHeaders( LocoPoHeaders $head ){ $this->headers = $head; if( 0 === $this->z ){ $this->po[0]['target'] = null; } return $this; } public function initPo(){ if( 0 === $this->z ){ unset( $this->po[0]['flag'] ); } return $this; } public function initPot(){ if( 0 === $this->z ){ $this->po[0]['flag'] = 4; } return $this; } public function strip(){ $po = $this->po; $i = count($po); $z = $this->z; while( --$i > $z ){ $po[$i]['target'] = ''; } $this->po = $po; return $this; } public function __toString(){ try { return $this->render(); } catch( Exception $e ){ trigger_error( $e->getMessage(), E_USER_WARNING ); return ''; } } public function render( $sorter = null ){ $width = $this->w; $ref_width = max( 0, $width - 3 ); $h = $this->exportHeader(); $msg = new LocoPoMessage( $h ); $s = $msg->render( $width, $ref_width ); if( $sorter ){ if( ! is_callable($sorter) ){ throw new InvalidArgumentException('Bad callback'); } $msgs = array(); foreach( $this as $msg ){ $msgs[] = $msg; } usort( $msgs, $sorter ); } else { $msgs = $this; } foreach( $msgs as $msg ){ $s .= "\n".$msg->render( $width, $ref_width ); } return $s; } public function exportJed(){ $head = $this->getHeaders(); $a = array( '' => array( 'domain' => $head['domain'], 'lang' => $head['language'], 'plural-forms' => $head['plural-forms'], ) ); foreach( $this as $message ){ if( $message->translated() ){ $a[ $message->getKey() ] = $message->exportSerial(); } } return $a; } private function exportHeader(){ if( 0 === $this->z ){ $h = $this->po[0]; } else { $h = array( 'source' => '', 'target' => '' ); } if( $this->headers ){ $h['target'] = (string) $this->headers; } return $h; } public function exportRefs( $grep = '' ){ $a = array(); if( '' === $grep ) { $grep = '/(\\S+):\\d+/'; } else { $grep = '/(\\S*'.$grep.'):\\d+/'; } $self = get_class($this); $base = array( $this->exportHeader() ); foreach( $this as $message ){ if( preg_match_all( $grep, (string) $message->refs, $r ) ){ foreach( $r[1] as $ref ) { if( array_key_exists($ref,$a) ){ $po = $a[$ref]; } else { $po = new $self($base); $a[$ref] = $po; } $po->push($message); } } } return $a; } public function splitRefs( array $map = null ){ $a = array(); $self = get_class($this); $base = array( $this->exportHeader() ); if( is_array($map) ){ $grep = implode('\|',array_keys($map)); } else { $grep = '[a-z]+'; } foreach( $this as $message ){ $refs = ltrim( (string) $message->refs ); if( '' !== $refs ){ if( preg_match_all('/\\S+\\.('.$grep.'):\\d+/', $refs, $r, PREG_SET_ORDER ) ){ $tmp = array(); foreach( $r as $rr ) { list( $ref, $ext ) = $rr; $tmp[$ext][$ref] = true; } foreach( $tmp as $ext => $refs ){ if( is_array($map) ){ $ext = $map[$ext]; } if( array_key_exists($ext,$a) ){ $po = $a[$ext]; } else { $po = new $self($base); $a[$ext] = $po; } $message = clone $message; $message['refs'] = implode(' ',array_keys($refs) ); $po->push($message); } } } } return $a; } public function getHashes(){ $a = array(); foreach( $this as $msg ){ $a[] = $msg->getHash(); } sort( $a, SORT_STRING ); return $a; } public function equalSource( LocoPoIterator $that ){ $a = $this->getHashes(); $b = $that->getHashes(); if( count($a) !== count($b) ){ return false; } foreach( $a as $i => $hash ){ if( $hash !== $b[$i] ){ return false; } } return true; } public function equal( LocoPoIterator $that ){ if( $this->t !== $that->t ){ return false; } $i = $this->z; $fields = array( 'source', 'context', 'notes', 'refs', 'target', 'comment', 'flag', 'parent', 'plural' ); while( ++$i < $this->t ){ $a = $this->po[$i]; $b = $that->po[$i]; foreach( $fields as $f ){ $af = isset($a[$f]) ? $a[$f] : ''; $bf = isset($b[$f]) ? $b[$f] : ''; if( $af !== $bf ){ return false; } } } return true; } public function sort( $func = null ){ $order = array(); foreach( $this as $msg ){ $order[] = $msg; } if( is_null($func) ){ $func = array( __CLASS__, 'compare' ); } else if( ! is_callable($func) ){ throw new InvalidArgumentException('Bad callback'); } usort( $order, $func ); $this->clear(); foreach( $order as $p ){ $this->push($p); } return $this; } public static function compare( LocoPoMessage $a, LocoPoMessage $b ){ $h = $a->getHash(); $j = $b->getHash(); $n = strcasecmp( $h, $j ); if( 0 === $n ){ $n = strcmp( $h, $j ); if( 0 === $n ){ return 0; } } return $n > 0 ? 1 : -1; } public function createSorter(){ $index = array(); foreach( $this as $i => $msg ){ $index[ $msg->getHash() ] = $i; } $obj = new LocoPoIndex( $index ); return array( $obj, 'compare' ); } }
20	class LocoMoTable { private $size = 0; private $bin = ''; private $map; public function __construct( $data = null ){ if( is_array($data) ){ $this->compile( $data ); } else if( $data ){ $this->parse( $data ); } } public function count(){ if( ! isset($this->size) ){ if( $this->bin ){ $this->size = (int) ( strlen( $this->bin ) / 4 ); } else if( is_array($this->map) ){ $this->size = count($this->map); } else { return 0; } if( ! self::is_prime($this->size) \|\| $this->size < 3 ){ throw new Exception('Size expected to be prime number above 2, got '.$this->size); } } return $this->size; } public function bytes(){ return $this->count() * 4; } public function __toString(){ return $this->bin; } public function export(){ if( ! is_array($this->map) ){ $this->parse( $this->bin ); } return $this->map; } private function reset( $length ){ $this->size = max( 3, self::next_prime ( $length * 4 / 3 ) ); $this->bin = null; $this->map = array(); return $this->size; } public function compile( array $msgids ){ $hash_tab_size = $this->reset( count($msgids) ); $packed = array_fill( 0, $hash_tab_size, "\0\0\0\0" ); $j = 0; foreach( $msgids as $msgid ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $hash_tab_size; if( array_key_exists($idx, $this->map) ){ $incr = 1 + ( $hash_val % ( $hash_tab_size - 2 ) ); do { $idx += $incr; if( $hash_val === $idx ){ throw new Exception('Unable to find empty slot in hash table'); } $idx %= $hash_tab_size; } while( array_key_exists($idx, $this->map ) ); } $this->map[$idx] = $j; $packed[$idx] = pack('V', ++$j ); } return $this->bin = implode('',$packed); } public function lookup( $msgid, array $msgids ){ $hash_val = self::hashpjw( $msgid ); $idx = $hash_val % $this->size; $incr = 1 + ( $hash_val % ( $this->size - 2 ) ); while( true ){ if( ! array_key_exists($idx, $this->map) ){ break; } $j = $this->map[$idx]; if( isset($msgids[$j]) && $msgid === $msgids[$j] ){ return $j; } $idx += $incr; if( $idx === $hash_val ){ break; } $idx %= $this->size; } return -1; } public function parse( $bin ){ $this->bin = (string) $bin; $this->size = null; $hash_tab_size = $this->count(); $this->map = array(); $idx = -1; $byte = 0; while( ++$idx < $hash_tab_size ){ $word = substr( $this->bin, $byte, 4 ); if( "\0\0\0\0" !== $word ){ list(,$j) = unpack('V', $word ); $this->map[$idx] = $j - 1; } $byte += 4; } return $this->map; } public static function hashpjw( $str ){ $i = -1; $hval = 0; $len = strlen($str); while( ++$i < $len ){ $ord = ord( substr($str,$i,1) ); $hval = ( $hval << 4 ) + $ord; $g = $hval & 0xf0000000; if( $g !== 0 ){ $hval ^= $g >> 24; $hval ^= $g; } } return $hval; } private static function next_prime( $seed ){ $seed \|= 1; while ( ! self::is_prime($seed) ){ $seed += 2; } return $seed; } private static function is_prime( $num ) { if ($num === 1 ){ return false; } if( $num === 2 ){ return true; } if( $num % 2 == 0 ) { return false; } for( $i = 3; $i <= ceil(sqrt($num)); $i = $i + 2) { if($num % $i == 0 ){ return false; } } return true; } }
21	class LocoMo { private $bin; private $msgs; private $head; private $hash; private $use_fuzzy = false; private $cs; public function __construct( Iterator $export, LocoPoHeaders $head = null ){ if( $head ){ $this->head = $head; } else { $this->head = new LocoPoHeaders; $this->setHeader('Project-Id-Version','Loco'); } $this->msgs = $export; $this->bin = ''; } public function setCharset( $cs ){ $cs = $this->head->setCharset($cs); $this->cs = 'UTF-8' === $cs ? null : $cs; } public function enableHash(){ return $this->hash = new LocoMoTable; } public function useFuzzy(){ $this->use_fuzzy = true; } public function setHeader( $key, $val ){ $this->head->add($key, $val); return $this; } private function str( $s ){ $s = (string) $s; if( $cs = $this->cs ){ $s = mb_convert_encoding($s,$cs,array('UTF-8')); } return $s; } public function compile(){ $table = array(''); $sources = array(''); $targets = array( (string) $this->head ); $fuzzy_flag = 4; $skip_fuzzy = ! $this->use_fuzzy; foreach( $this->msgs as $r ){ if( $skip_fuzzy && isset($r['flag']) && $fuzzy_flag === $r['flag'] ){ continue; } $msgid = $this->str( $r['key'] ); if( isset($r['context']) ){ $msgctxt = $this->str( $r['context'] ); if( '' !== $msgctxt ){ if( '' === $msgid ){ $msgid = '('.$msgctxt.')'; } $msgid = $msgctxt."\x04".$msgid; } } if( '' === $msgid ){ continue; } $msgstr = $this->str( $r['target'] ); if( '' === $msgstr ){ continue; } $table[] = $msgid; if( isset($r['plurals']) ){ foreach( $r['plurals'] as $i => $p ){ if( $i === 0 ){ $msgid .= "\0".$p['key']; } $msgstr .= "\0".$p['target']; } } $sources[] = $msgid; $targets[] = $msgstr; } asort( $sources, SORT_STRING ); $this->bin = "\xDE\x12\x04\x95\x00\x00\x00\x00"; $n = count($sources); $this->writeInteger( $n ); $offset = 28; $this->writeInteger( $offset ); $offset += $n * 8; $this->writeInteger( $offset ); if( $this->hash ){ sort( $table, SORT_STRING ); $this->hash->compile( $table ); $s = $this->hash->count(); } else { $s = 0; } $this->writeInteger( $s ); $offset += $n * 8; $this->writeInteger( $offset ); if( $s ){ $offset += $s * 4; } $source = ''; foreach( $sources as $i => $str ){ $source .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } $target = ''; foreach( array_keys($sources) as $i ){ $str = $targets[$i]; $target .= $str."\0"; $this->writeInteger( $strlen = strlen($str) ); $this->writeInteger( $offset ); $offset += $strlen + 1; } if( $this->hash ){ $this->bin .= $this->hash->__toString(); } $this->bin .= $source; $this->bin .= $target; return $this->bin; } private function writeInteger( $num ){ $this->bin .= pack( 'V', $num ); return $this; } }
22	interface LocoTokensInterface extends Iterator { public function advance(); public function ignore( array $a ); }

24	function loco_utf8_chr( $u ){ if( $u < 0x80 ){ if( $u < 0 ){ throw new RangeException( sprintf('%d is out of Unicode range', $u ) ); } return chr($u); } if( $u < 0x800 ) { return chr( ($u>>6) & 0x1F \| 0xC0 ).chr( $u & 0x3F \| 0x80 ); } if( $u < 0x10000 ) { return chr( $u>>12 & 15 \| 0xE0 ).chr( $u>>6 & 0x3F \| 0x80 ).chr( $u & 0x3F \| 0x80 ); } if( $u < 0x110000 ) { return chr( $u>>18 & 7 \| 0xF0 ).chr( $u>>12 & 0x3F \| 0x80 ).chr( $u>>6 & 0x3F \| 0x80 ).chr( $u & 0x3F \| 0x80 ); } throw new RangeException( sprintf('\\x%X is out of Unicode range', $u ) ); }
25	function loco_resolve_surrogates( $s ){ return preg_replace_callback('/\\xED([\\xA0-\\xAF])([\\x80-\\xBF])\\xED([\\xB0-\\xBF])([\\x80-\\xBF])/', '_loco_resolve_surrogates', $s ); }
26	function _loco_resolve_surrogates( array $r ){ return loco_utf8_chr ( ( ( ( ( 832 \| ( ord($r[1]) & 0x3F ) ) << 6 ) \| ( ord($r[2]) & 0x3F ) ) - 0xD800 ) * 0x400 + ( ( ( ( 832 \| ( ord($r[3]) & 0x3F ) ) << 6 ) \| ( ord($r[4]) & 0x3F ) ) - 0xDC00 ) + 0x10000 ); }
27	+ class LocoEscapeParser { private $map; private $grep; public function __construct( array $map = array() ){ $this->map = $map; $rules = array('\\\\'); if( $map ){ $rules[] = '['.implode(array_keys($map)).']'; } if( ! isset($map['U']) ) { $rules[] = 'U[0-9A-Fa-f]{5,8}'; } if( ! isset($map['u']) ) { $rules[] = 'u(?:\\{[0-9A-Fa-f]+\\}\|[0-9A-Fa-f]{1,4})(?:\\\\u(?:\\{[0-9A-Fa-f]+\\}\|[0-9A-Fa-f]{1,4}))*'; } $this->grep = '/\\\\('.implode('\|',$rules).')/'; } final public function unescape( $s ) { if( '' !== $s ) { return $this->stripSlashes( preg_replace_callback($this->grep, array($this, 'unescapeMatch'), $s) ); } return ''; } final public function unescapeMatch( array $r ) { $s = $r[0]; $c = $s[1]; if( isset($this->map[$c]) ){ return $this->map[$c]; } if( 'u' === $c ){ $str = ''; $surrogates = false; foreach( explode('\\u',$s) as $i => $h ){ if( '' !== $h ){ $h = ltrim( trim($h,'{}'),'0'); $u = intval($h,16); $str.= loco_utf8_chr($u); if( ! $surrogates ){ $surrogates = $u >= 0xD800 && $u <= 0xDBFF; } } } if( $surrogates ){ $str = loco_resolve_surrogates($str); } return $str; } if( 'U' === $c ){ return loco_utf8_chr( intval(substr($s,2),16) ); } if( 'x' === $c ){ return chr( intval(substr($s,2),16) ); } if( ctype_digit($c) ){ return chr( intval(substr($s,1),8) ); } return $s; } protected function stripSlashes( $s ) { return stripcslashes($s); } }
28	class LocoJsTokens extends LocoTokenizer { const T_KWORD = 1; const T_REGEX = 2; private static $lex; protected static $words = array( 'true' => 1, 'false' => 1, 'null' => 1, 'break' => T_BREAK, 'else' => T_ELSE, 'new' => T_NEW, 'var' => 1, 'case' => T_CASE, 'finally' => T_FINALLY, 'return' => T_RETURN, 'void' => 1, 'catch' => T_CATCH, 'for' => T_FOR, 'switch' => T_SWITCH, 'while' => T_WHILE, 'continue' => T_CONTINUE, 'function' => T_FUNCTION, 'this' => T_STRING, 'with' => 1, 'default' => T_DEFAULT, 'if' => T_IF, 'throw' => T_THROW, 'delete' => 1, 'in' => 1, 'try' => T_TRY, 'do' => T_DO, 'instanceof' => 1, 'typeof' => 1, ); public static function decapse( $encapsed ){ $s = substr($encapsed,1,-1); $l = self::$lex; if( is_null($l) ){ $l = new LocoEscapeParser( array( 'U' => 'U', 'a' => 'a', ) ); self::$lex = $l; } return $l->unescape($s); } public function __construct( $src = '' ){ $this->define('/^(?:\\\\u[0-9A-F]{4,4}\|[$_\\pL\\p{Nl}])(?:\\\\u[0-9A-F]{4}\|[$_\\pL\\pN\\p{Mn}\\p{Mc}\\p{Pc}])/ui', array($this,'matchWord') ); $this->define('/^\\s+/u', T_WHITESPACE ); $this->define('!^//.!', T_COMMENT ); $this->define('!^/\\.\\/!Us', array($this,'matchComment') ); $this->define('/^"(?:\\\\.\|[^\\r\\n\\p{Zl}\\p{Zp}"\\\\])"/u', T_CONSTANT_ENCAPSED_STRING ); $this->define('/^\'(?:\\\\.\|[^\\r\\n\\p{Zl}\\p{Zp}\'\\\\])\'/u', T_CONSTANT_ENCAPSED_STRING ); $this->define('/^[-+;,<>.=:\|&^!?%~(){}[\\]]/'); parent::__construct($src); } public function matchWord( $s ){ if( array_key_exists($s,self::$words) ){ return self::$words[$s]; } return T_STRING; } public function matchComment( $s ){ if( '/**' === substr($s,0,3) ){ return T_DOC_COMMENT; } return T_COMMENT; } }
29	class LocoExtracted implements Countable { private $exp = array(); private $reg = array(); private $dom = array(); private $dflt = ''; public function extractSource( LocoExtractor $ext, $src, $fileref = '' ){ $ext->extract( $this, $ext->tokenize($src), $fileref ); return $this; } public function export(){ return $this->exp; } public function count(){ return count( $this->exp ); } public function getDomainCounts(){ return $this->dom; } public function setDomain( $default ){ $this->dflt = (string) $default; return $this; } public function getDomain(){ return $this->dflt; } private function key( array $entry ){ $key = (string) $entry['source']; foreach( array('context','domain') as $i => $prop ){ if( array_key_exists($prop,$entry) ) { $add = (string) $entry[$prop]; if( '' !== $add ){ $key .= ord($i).$add; } } } return $key; } public function pushMeta( $source, $notes, $domain = '' ){ if( '' === $domain \|\| '' === $domain ){ $domain = $this->dflt; } return $this->pushEntry( array( 'source' => $source, 'notes' => $notes, ), $domain ); } public function pushEntry( array $entry, $domain = '' ){ $entry['id'] = ''; $entry['target'] = ''; $entry['domain'] = $domain; $key = $this->key($entry); if( isset($this->reg[$key]) ){ $index = $this->reg[$key]; $clash = $this->exp[$index]; if( $value = $this->mergeField( $clash, $entry, 'refs', ' ') ){ $this->exp[$index]['refs'] = $value; } if( $value = $this->mergeField( $clash, $entry, 'notes', "\n") ){ $this->exp[$index]['notes'] = $value; } } else { $index = count($this->exp); $this->reg[$key] = $index; $this->exp[$index] = $entry; if( isset($this->dom[$domain]) ){ $this->dom[$domain]++; } else { $this->dom[$domain] = 1; } } return $index; } public function pushPlural( array $entry, $sindex ){ $parent = $this->exp[$sindex]; $domain = $parent['domain']; $pkey = $this->key($parent)."\2"; if( ! array_key_exists($pkey,$this->reg) ){ $pindex = count($this->exp); $this->reg[$pkey] = $pindex; $entry += array( 'id' => '', 'target' => '', 'plural' => 1, 'parent' => $sindex, 'domain' => $domain, ); $this->exp[$pindex] = $entry; if( isset($entry['format']) && ! isset( $parent['format']) ) { $this->exp[$sindex]['format'] = $entry['format']; } if( $pindex !== $sindex + $entry['plural']) { $this->exp[$sindex]['child'] = $pindex; } } } public function mergeField( array $old, array $new, $field, $glue ){ $prev = isset($old[$field]) ? $old[$field] : ''; if( isset($new[$field]) ){ $text = $new[$field]; if( '' !== $prev && $prev !== $text ){ if( 'notes' === $field && preg_match( '/^'.preg_quote( rtrim($text,'. '),'/').'[. ]$/mu', $prev ) ) { $text = $prev; } else { $text = $prev.$glue.$text; } } return $text; } return $prev; } public function filter( $domain ){ $map = array(); $newOffset = 1; $matchAll = '*' === $domain; $raw = array( array( 'id' => '', 'source' => '', 'target' => '', 'domain' => $matchAll ? '' : $domain, ) ); foreach( $this->exp as $oldOffset => $r ){ if( isset($r['parent']) ){ if( isset($map[$r['parent']]) ){ $r['parent'] = $map[ $r['parent'] ]; $raw[ $newOffset++ ] = $r; } } else { if( $matchAll ){ $match = true; } else if( isset($r['domain']) ){ $match = $domain === $r['domain']; } else { $match = $domain === ''; } if( $match ){ $map[ $oldOffset ] = $newOffset; $raw[ $newOffset++ ] = $r; } } } return $raw; } }
30	abstract class LocoExtractor { private $rules; private $wp = array(); private $domain = ''; abstract public function tokenize( $src ); abstract public function extract( LocoExtracted $strings, LocoTokensInterface $tokens, $fileref = '' ); abstract protected function fsniff( $str ); abstract protected function decapse( $raw ); abstract protected function comment( $comment ); public function __construct( array $rules ){ $this->rules = $rules; } public function setDomain( $default ){ $this->domain = $default; return $this; } public function headerize( array $tags, $domain = '' ){ if( isset($this->wp[$domain]) ){ $this->wp[$domain] += $tags; } else { $this->wp[$domain] = $tags; } return $this; } protected function getHeaders(){ return $this->wp; } final public function extractSource( $src, $fileref ){ $strings = new LocoExtracted; $this->extract( $strings, $this->tokenize($src), $fileref ); return $strings; } public function rule( $s ){ return isset($this->rules[$s]) ? $this->rules[$s] : ''; } protected function push( LocoExtracted $strings, $rule, array $args, $comment = '', $ref = '' ){ $s = strpos( $rule, 's'); $p = strpos( $rule, 'p'); $c = strpos( $rule, 'c'); $d = strpos( $rule, 'd'); if( false === $s \|\| ! isset($args[$s]) ){ return null; } $msgid = $args[$s]; if( ! is_string($msgid) ){ return null; } $entry = array( 'source' => $msgid, ); if( is_int($c) && isset($args[$c]) ){ $entry['context'] = $args[$c]; } else if( '' === $msgid ){ return null; } if( $ref ){ $entry['refs'] = $ref; } if( is_int($d) && array_key_exists($d,$args) ){ $domain = $args[$d]; if( is_null($domain) ){ $domain = ''; } } else if( '' === $this->domain ) { $domain = $strings->getDomain(); } else { $domain = $this->domain; } $parse_printf = true; if( $comment = $this->comment($comment) ){ if( preg_match('/^xgettext:\\s([-a-z]+)-format\\s/mi', $comment, $r, PREG_OFFSET_CAPTURE ) ){ $entry['format'] = $r[1][0]; $comment = trim( substr_replace( $comment,'', $r[0][1], strlen($r[0][0]) ) ); $parse_printf = ( 'no-' === substr($entry['format'],0,3) ) ? false : null; } if( preg_match('/^references?:( .+:\\d+)\\s*/mi', $comment, $r, PREG_OFFSET_CAPTURE ) ){ $entry['refs'] = trim($r[1][0],' '); $comment = trim( substr_replace( $comment, '', $r[0][1], strlen($r[0][0]) ) ); } $entry['notes'] = $comment; } if( $parse_printf && ( $format = $this->fsniff($msgid) ) ){ $entry['format'] = $format; } $index = $strings->pushEntry($entry,$domain); if( is_int($p) && isset($args[$p]) ){ $msgid_plural = $args[$p]; $entry = array( 'source' => $msgid_plural, ); if( false !== $parse_printf && ( $format = $this->fsniff($msgid_plural) ) ){ $entry['format'] = $format; } $strings->pushPlural($entry,$index); } return $index; } protected function utf8( $str ){ if( false === preg_match('//u',$str) ){ $str = mb_convert_encoding( $str, 'UTF-8', 'cp1252' ); } return $str; } }
31	class LocoPHPTokens implements LocoTokensInterface, Countable { private $i; private $tokens; private $skip_tokens = array(); private $literal_tokens = array(); public function __construct( array $tokens ){ $this->tokens = $tokens; $this->rewind(); } public function literal( array $a ){ foreach( $a as $t ){ $this->literal_tokens[ $t ] = 1; } return $this; } public function ignore( array $a ){ foreach( $a as $t ){ $this->skip_tokens[$t] = true; } return $this; } public function export(){ $arr = array(); $this->rewind(); while( $tok = $this->advance() ){ $arr[] = $tok; } return $arr; } public function advance(){ $tok = $this->current(); $this->next(); return $tok; } public function rewind(){ $this->i = ( false === reset($this->tokens) ? null : key($this->tokens) ); } public function valid(){ while( isset($this->i) ){ $tok = $this->tokens[$this->i]; if( array_key_exists( is_array($tok) ? $tok[0] : $tok, $this->skip_tokens ) ){ $this->next(); } else { return true; } } return false; } public function key(){ return $this->i; } public function next(){ $this->i = ( false === next($this->tokens) ? null : key($this->tokens) ); } public function current(){ if( ! $this->valid() ){ return false; } $tok = $this->tokens[$this->i]; if( is_array($tok) && isset($this->literal_tokens[$tok[0]]) ){ return $tok[1]; } return $tok; } public function __toString(){ $s = array(); foreach( $this as $token ){ $s[] = is_array($token) ? $token[1] : $token; } return implode('',$s); } public function count(){ return count($this->tokens); } }
32	+ class LocoPHPEscapeParser extends LocoEscapeParser { public function __construct(){ parent::__construct( array( 'n' => "\n", 'r' => "\r", 't' => "\t", 'v' => "\x0B", 'f' => "\x0C", 'e' => "\x1B", '$' => '$', '\\' => '\\', '"' => '"', ) ); } protected function stripSlashes( $s ) { return preg_replace_callback('/\\\\(x[0-9A-Fa-f]{1,2}\|[0-3]?[0-7]{1,2})/', array($this,'unescapeMatch'), $s, -1, $n ); } }
33	function loco_unescape_php_string( $s ){ static $l; if( is_null($l) ) { $l = new LocoPHPEscapeParser; } return $l->unescape($s); }
34	function loco_decapse_php_string( $s ){ if( ! $s ){ return (string) $s; } $q = $s[0]; if( "'" === $q ){ return str_replace( array('\\'.$q, '\\\\'), array($q, '\\'), substr( $s, 1, -1 ) ); } if( '"' !== $q ){ return $s; } return loco_unescape_php_string( substr($s,1,-1) ); }
35	function loco_parse_php_comment($comment){ $comment = trim( $comment,"/ \n\r\t" ); if( '' !== $comment && '' === $comment[0] ){ $lines = array(); $junk = "\r\t/ "; foreach( explode("\n",$comment) as $line ){ $line = trim($line,$junk); if( '' !== $line ){ $lines[] = $line; } } $comment = implode("\n", $lines); } return $comment; }
36	+ function loco_parse_wp_comment( $block ){ $header = array(); if( '/' === substr($block,0,2) ){ $junk = "\r\t/ "; foreach( explode("\n", $block) as $line ){ if( false !== ( $i = strpos($line,':') ) ){ $key = substr($line,0,$i); $val = substr($line,++$i); $header[ trim($key,$junk) ] = trim($val,$junk); } } } return $header; }
37	function loco_sniff_printf( $s, $p, $limit = 0, $offset = 0 ){ $n = 0; while( is_string($s) && '' !== $s && false !== ( $i = strpos($s,'%',$offset) ) ){ if( 0 !== $i ){ $s = substr( $s, $i ); } if( preg_match( $p, $s, $r ) ){ $match = $r[0]; if( 0 < $n && isset($r[1]) && '' === $r[1] && '%' !== substr($match,-1) ){ return 0; } if( ++$n === $limit ){ break; } $offset = strlen($match); } else { return 0; } } return $n; }
38	function loco_sniff_php_printf( $s, $limit = 0 ){ return loco_sniff_printf( $s, '/^%(?:[1-9]\\d\\$)?(?:\'.\|[-+0 ])\\d*(?:\\.\\d+)?[suxXbcdeEfFgGo%]/', $limit ); }
39	class LocoPHPExtractor extends LocoExtractor { private $defs = array(); public function tokenize( $src ){ return new LocoPHPTokens( token_get_all($src) ); } public function decapse( $raw ){ return loco_decapse_php_string( $raw ); } public function fsniff( $str ){ return loco_sniff_php_printf($str) ? 'php' : ''; } protected function comment( $comment ){ $comment = loco_parse_php_comment($comment); $comment = preg_replace('/^translators:\\s+/mi', '', $comment ); return $comment; } public function define( $name, $value ){ if( is_string($value) ){ $this->defs[$name] = $value; } return $this; } public function extract( LocoExtracted $strings, LocoTokensInterface $tokens, $fileref = '' ){ $tokens->ignore( array(T_WHITESPACE) ); $n = 0; $depth = 0; $comment = ''; $narg = 0; $args = array(); $ref = ''; $rule = ''; $wp = $this->getHeaders(); $tokens->rewind(); while( $tok = $tokens->advance() ){ if( is_string($tok) ){ $s = $tok; $t = null; } else { $t = $tok[0]; $s = $tok[1]; } if( $depth ){ if( ')' === $s \|\| ']' === $s ){ if( 0 === --$depth ){ if( $this->push( $strings, $rule, $args, $comment, $ref ) ){ $n++; } $comment = ''; } } else if( '(' === $s \|\| '[' === $s ){ $depth++; $args[$narg] = null; } else if( 1 === $depth ){ if( ',' === $s ){ $narg++; } else if( T_CONSTANT_ENCAPSED_STRING === $t ){ $s = self::utf8($s); $args[$narg] = $this->decapse($s); } else if( T_STRING === $t && array_key_exists($s,$this->defs) ){ $args[$narg] = $this->defs[$s]; } else { $args[$narg] = null; } } } else if( T_COMMENT === $t \|\| T_DOC_COMMENT === $t ){ $was_header = false; $s = self::utf8($s); if( 0 === $n ){ if( false !== strpos($s,'* @package') ){ $was_header = true; } if( $wp && ( $header = loco_parse_wp_comment($s) ) ){ foreach( $wp as $domain => $tags ){ foreach( array_intersect_key($header,$tags) as $tag => $source ){ $strings->pushMeta( $source, $tags[$tag], (string) $domain ); $was_header = true; } } } } if( ! $was_header ) { $comment = $s; } } else if( T_STRING === $t && '(' === $tokens->advance() && ( $rule = $this->rule($s) ) ){ $ref = $fileref ? $fileref.':'.$tok[2]: ''; $depth = 1; $args = array(); $narg = 0; } else if( $comment ){ if( false === stripos($comment, 'translators:') && false === strpos($comment, 'xgettext:') ){ $comment = ''; } } } return $this; } }

44	function loco_print_percent( $n, $t ){ $s = loco_string_percent( (int) $n, (int) $t ); echo $s,'%'; return ''; }
45	function loco_print_progress( $translated, $untranslated, $flagged ){ $total = $translated + $untranslated; $complete = loco_string_percent( $translated - $flagged, $total ); $class = 'progress'; if( ! $translated && ! $flagged ){ $class .= ' empty'; } else if( '100' === $complete ){ $class .= ' done'; } echo '<div class="',$class,'"><div class="t">'; if( $flagged ){ $s = loco_string_percent( $flagged, $total ); echo '<div class="bar f" style="width:',$s,'%"> </div>'; } if( '0' === $complete ){ echo ' '; } else { $class = 'bar p'; $p = (int) $complete; $class .= sprintf(' p-%u', 10*floor($p/10) ); $style = 'width:'.$complete.'%'; if( $flagged ){ $remain = 100.0 - (float) $s; $style .= '; max-width: '.sprintf('%s',$remain).'%'; } echo '<div class="',$class,'" style="'.$style.'"> </div>'; } echo '</div><div class="l">',$complete,'%</div></div>'; return ''; }
46	function loco_string_percent( $n, $t ){ if( ! $t \|\| ! $n ){ $s = '0'; } else if( $t === $n ){ $s = '100'; } else { $dp = 0; $n = 100 * $n / $t; if( $n > 99 ){ $s = number_format( min( $n, 99.9 ), ++$dp ); } else if( $n < 0.5 ){ $n = max( $n, 0.0001 ); do { $s = number_format( $n, ++$dp ); } while( preg_match('/^0\\.0+$/',$s) && $dp < 4 ); $s = substr($s,1); } else { $s = number_format( $n, $dp ); } } return $s; }
47	+ class LocoFuzzyMatcher implements Countable { private $pot = array(); private $po = array(); private $diff = array(); private $dmax = .20; public function count(){ return count($this->pot); } public function unmatched(){ return array_values($this->pot); } public function redundant(){ return array_values($this->po); } public function setFuzziness( $s ){ if( $this->po ){ throw new LogicException('Cannot setFuzziness() after calling match()'); } $this->dmax = (float) max( 0, min( (int) $s, 100 ) ) / 100; } public function add( $a ){ $source = isset($a['source']) ? (string) $a['source'] : ''; $context = isset($a['context']) ? (string) $a['context'] : ''; $key = $source."\4".$context; $this->pot[$key] = $a; } private function key( $a ){ $source = isset($a['source']) ? (string) $a['source'] : ''; $context = isset($a['context']) ? (string) $a['context'] : ''; return $source."\4".$context; } protected function getRef( $a ){ $key = $this->key($a); return array_key_exists($key,$this->pot) ? $this->pot[$key] : null; } public function match( $a ) { $old = $this->key($a); if( isset($this->pot[$old]) ){ $new = $this->pot[$old]; unset($this->pot[$old]); return $new; } $this->po[$old] = $a; $target = isset($a['target']) ? (string) $a['target'] : ''; $comment = isset($a['comment']) ? (string) $a['comment'] : ''; if( '' === $target && '' === $comment ){ return null; } if( 0 < $this->dmax ){ foreach( $this->pot as $new => $_ ){ $dist = $this->distance($old,$new); if( -1 !== $dist ){ $this->diff[] = array( $old, $new, $dist ); } } } return null; } private function distance( $a, $b ){ $a = strtolower($a); $b = strtolower($b); if( $a === $b ){ return 0; } $lenA = strlen($a); $lenB = strlen($b); $lenDiff = abs($lenA-$lenB); $max = min($lenA,$lenB) + $lenDiff; $max = (int) ceil( $this->dmax * $max ); if( $max < $lenDiff ) { return -1; } $len = max($lenA,$lenB); if( $len < 256 ){ $d = levenshtein($a,$b); return $d > $max ? -1 : $d; } $d = 0; for( $i = 0; $i < $len; $i+=$max ){ $aa = substr($a,$i,$max); $bb = substr($b,$i,$max); $d += levenshtein($aa,$bb); if( $d > $max ){ return -1; } } return $d; } public function getFuzzyMatches(){ $pairs = array(); usort( $this->diff, array(__CLASS__,'compareDistance') ); foreach( $this->diff as $pair ){ list($old,$new) = $pair; if( ! array_key_exists($new,$this->pot) \|\| ! array_key_exists($old,$this->po) ){ continue; } $pairs[] = array( $this->po[$old], $this->pot[$new], ); unset($this->po[$old]); unset($this->pot[$new]); if( ! $this->po \|\| ! $this->pot ){ break; } } $this->diff = array(); return $pairs; } private static function compareDistance( array $a, array $b ){ return $a[2] - $b[2]; } }
48	defined('T_FINALLY') \|\| define('T_FINALLY',500); loco_check_extension('mbstring');

lib/data/locales.php CHANGED Viewed

	@@ -2,4 +2,4 @@
2	/**
3	* Compiled data. Do not edit.
4	*/
5	- return array('af'=>array(0=>'Afrikaans',1=>'Afrikaans'),'ar'=>array(0=>'Arabic',1=>'العربية'),'ary'=>array(0=>'Moroccan Arabic',1=>'العربية المغربية'),'as'=>array(0=>'Assamese',1=>'অসমীয়া'),'az'=>array(0=>'Azerbaijani',1=>'Azərbaycan dili'),'azb'=>array(0=>'South Azerbaijani',1=>'گؤنئی آذربایجان'),'bel'=>array(0=>'Belarusian',1=>'Беларуская мова'),'bg_BG'=>array(0=>'Bulgarian',1=>'Български'),'bn_BD'=>array(0=>'Bengali (Bangladesh)',1=>'বাংলা'),'bo'=>array(0=>'Tibetan',1=>'བོད་ཡིག'),'bs_BA'=>array(0=>'Bosnian',1=>'Bosanski'),'ca'=>array(0=>'Catalan',1=>'Català'),'ceb'=>array(0=>'Cebuano',1=>'Cebuano'),'cs_CZ'=>array(0=>'Czech',1=>'Čeština'),'cy'=>array(0=>'Welsh',1=>'Cymraeg'),'da_DK'=>array(0=>'Danish',1=>'Dansk'),'~~de_CH_informal~~'=>array(0=>'German (Switzerland~~, Informal~~)',1=>'Deutsch (Schweiz~~, Du~~)'),'~~de_CH~~'=>array(0=>'German (Switzerland)',1=>'Deutsch (Schweiz)'),'~~de_DE_formal~~'=>array(0=>'German (~~Formal~~)',1=>'Deutsch (~~Sie~~)'),'~~de_DE~~'=>array(0=>'German',1=>'Deutsch'),'~~de_AT~~'=>array(0=>'German ~~(Austria)~~',1=>'Deutsch ~~(Österreich)~~'),'dsb'=>array(0=>'Lower Sorbian',1=>'Dolnoserbšćina'),'dzo'=>array(0=>'Dzongkha',1=>'རྫོང་ཁ'),'el'=>array(0=>'Greek',1=>'Ελληνικά'),'~~en_NZ~~'=>array(0=>'English (~~New~~ ~~Zealand~~)',1=>'English (~~New~~ ~~Zealand~~)'),'~~en_ZA~~'=>array(0=>'English (~~South Africa~~)',1=>'English (~~South Africa~~)'),'~~en_GB~~'=>array(0=>'English (UK)',1=>'English (UK)'),'~~en_AU~~'=>array(0=>'English (~~Australia~~)',1=>'English (~~Australia~~)'),'en_CA'=>array(0=>'English (Canada)',1=>'English (Canada)'),'eo'=>array(0=>'Esperanto',1=>'Esperanto'),'~~es_CO~~'=>array(0=>'Spanish (~~Colombia~~)',1=>'Español de ~~Colombia~~'),'es_CR'=>array(0=>'Spanish (Costa Rica)',1=>'Español de Costa Rica'),'~~es_VE~~'=>array(0=>'Spanish (~~Venezuela~~)',1=>'Español ~~de Venezuela~~'),'~~es_ES~~'=>array(0=>'Spanish (~~Spain~~)',1=>'Español'),'~~es_MX~~'=>array(0=>'Spanish (~~Mexico~~)',1=>'Español de ~~México~~'),'~~es_EC~~'=>array(0=>'Spanish (~~Ecuador~~)',1=>'Español de ~~Ecuador~~'),'~~es_AR~~'=>array(0=>'Spanish (~~Argentina~~)',1=>'Español de ~~Argentina~~'),'~~es_CL~~'=>array(0=>'Spanish (~~Chile~~)',1=>'Español de ~~Chile~~'),'~~es_PE~~'=>array(0=>'Spanish (~~Peru~~)',1=>'Español de ~~Perú~~'),'~~es_PR~~'=>array(0=>'Spanish (~~Puerto Rico~~)',1=>'Español de ~~Puerto Rico~~'),'~~es_UY~~'=>array(0=>'Spanish (~~Uruguay~~)',1=>'Español de ~~Uruguay~~'),'~~es_GT~~'=>array(0=>'Spanish (~~Guatemala~~)',1=>'Español de ~~Guatemala~~'),'et'=>array(0=>'Estonian',1=>'Eesti'),'eu'=>array(0=>'Basque',1=>'Euskara'),'~~fa_AF~~'=>array(0=>'Persian ~~(Afghanistan)~~',1=>'(فارسی ~~(افغانستان~~'),'~~fa_IR~~'=>array(0=>'Persian',1=>'فارسی'),'fi'=>array(0=>'Finnish',1=>'Suomi'),'~~fr_BE~~'=>array(0=>'French (~~Belgium~~)',1=>'Français de ~~Belgique~~'),'~~fr_FR~~'=>array(0=>'French (~~France~~)',1=>'Français'),'~~fr_CA~~'=>array(0=>'French (~~Canada~~)',1=>'Français ~~du Canada~~'),'fur'=>array(0=>'Friulian',1=>'Friulian'),'gd'=>array(0=>'Scottish Gaelic',1=>'Gàidhlig'),'gl_ES'=>array(0=>'Galician',1=>'Galego'),'gu'=>array(0=>'Gujarati',1=>'ગુજરાતી'),'haz'=>array(0=>'Hazaragi',1=>'هزاره گی'),'he_IL'=>array(0=>'Hebrew',1=>'עִבְרִית'),'hi_IN'=>array(0=>'Hindi',1=>'हिन्दी'),'hr'=>array(0=>'Croatian',1=>'Hrvatski'),'hsb'=>array(0=>'Upper Sorbian',1=>'Hornjoserbšćina'),'hu_HU'=>array(0=>'Hungarian',1=>'Magyar'),'hy'=>array(0=>'Armenian',1=>'Հայերեն'),'id_ID'=>array(0=>'Indonesian',1=>'Bahasa Indonesia'),'is_IS'=>array(0=>'Icelandic',1=>'Íslenska'),'it_IT'=>array(0=>'Italian',1=>'Italiano'),'ja'=>array(0=>'Japanese',1=>'日本語'),'jv_ID'=>array(0=>'Javanese',1=>'Basa Jawa'),'ka_GE'=>array(0=>'Georgian',1=>'ქართული'),'kab'=>array(0=>'Kabyle',1=>'Taqbaylit'),'kk'=>array(0=>'Kazakh',1=>'Қазақ тілі'),'km'=>array(0=>'Khmer',1=>'ភាសាខ្មែរ'),'kn'=>array(0=>'Kannada',1=>'ಕನ್ನಡ'),'ko_KR'=>array(0=>'Korean',1=>'한국어'),'ckb'=>array(0=>'Kurdish (Sorani)',1=>'كوردی‎'),'lo'=>array(0=>'Lao',1=>'ພາສາລາວ'),'lt_LT'=>array(0=>'Lithuanian',1=>'Lietuvių kalba'),'lv'=>array(0=>'Latvian',1=>'Latviešu valoda'),'mk_MK'=>array(0=>'Macedonian',1=>'Македонски јазик'),'ml_IN'=>array(0=>'Malayalam',1=>'മലയാളം'),'mn'=>array(0=>'Mongolian',1=>'Монгол'),'mr'=>array(0=>'Marathi',1=>'मराठी'),'ms_MY'=>array(0=>'Malay',1=>'Bahasa Melayu'),'my_MM'=>array(0=>'Myanmar (Burmese)',1=>'ဗမာစာ'),'nb_NO'=>array(0=>'Norwegian (Bokmål)',1=>'Norsk bokmål'),'ne_NP'=>array(0=>'Nepali',1=>'नेपाली'),'~~nl_BE~~'=>array(0=>'Dutch (~~Belgium~~)',1=>'Nederlands (~~België~~)'),'~~nl_NL~~'=>array(0=>'Dutch',1=>'Nederlands'),'~~nl_NL_formal~~'=>array(0=>'Dutch ~~(Formal)~~',1=>'Nederlands ~~(Formeel)~~'),'nn_NO'=>array(0=>'Norwegian (Nynorsk)',1=>'Norsk nynorsk'),'oci'=>array(0=>'Occitan',1=>'Occitan'),'pa_IN'=>array(0=>'Punjabi',1=>'ਪੰਜਾਬੀ'),'pl_PL'=>array(0=>'Polish',1=>'Polski'),'ps'=>array(0=>'Pashto',1=>'پښتو'),'~~pt_PT~~'=>array(0=>'Portuguese (~~Portugal~~)',1=>'Português'),'~~pt_BR~~'=>array(0=>'Portuguese (~~Brazil~~)',1=>'Português ~~do Brasil~~'),'~~pt_PT_ao90~~'=>array(0=>'Portuguese (~~Portugal, AO90~~)',1=>'Português ~~(AO90)~~'),'~~pt_AO~~'=>array(0=>'Portuguese (~~Angola~~)',1=>'Português ~~de Angola~~'),'rhg'=>array(0=>'Rohingya',1=>'Ruáinga'),'ro_RO'=>array(0=>'Romanian',1=>'Română'),'ru_RU'=>array(0=>'Russian',1=>'Русский'),'sah'=>array(0=>'Sakha',1=>'Сахалыы'),'snd'=>array(0=>'Sindhi',1=>'سنڌي'),'si_LK'=>array(0=>'Sinhala',1=>'සිංහල'),'sk_SK'=>array(0=>'Slovak',1=>'Slovenčina'),'skr'=>array(0=>'Saraiki',1=>'سرائیکی'),'sl_SI'=>array(0=>'Slovenian',1=>'Slovenščina'),'sq'=>array(0=>'Albanian',1=>'Shqip'),'sr_RS'=>array(0=>'Serbian',1=>'Српски језик'),'sv_SE'=>array(0=>'Swedish',1=>'Svenska'),'sw'=>array(0=>'Swahili',1=>'Kiswahili'),'szl'=>array(0=>'Silesian',1=>'Ślōnskŏ gŏdka'),'ta_IN'=>array(0=>'Tamil',1=>'தமிழ்'),'ta_LK'=>array(0=>'Tamil (Sri Lanka)',1=>'தமிழ்'),'te'=>array(0=>'Telugu',1=>'తెలుగు'),'th'=>array(0=>'Thai',1=>'ไทย'),'tl'=>array(0=>'Tagalog',1=>'Tagalog'),'tr_TR'=>array(0=>'Turkish',1=>'Türkçe'),'tt_RU'=>array(0=>'Tatar',1=>'Татар теле'),'tah'=>array(0=>'Tahitian',1=>'Reo Tahiti'),'ug_CN'=>array(0=>'Uighur',1=>'ئۇيغۇرچە'),'uk'=>array(0=>'Ukrainian',1=>'Українська'),'ur'=>array(0=>'Urdu',1=>'اردو'),'uz_UZ'=>array(0=>'Uzbek',1=>'O‘zbekcha'),'vi'=>array(0=>'Vietnamese',1=>'Tiếng Việt'),'zh_HK'=>array(0=>'Chinese (Hong Kong)',1=>'香港中文版 '),'~~zh_TW~~'=>array(0=>'Chinese (~~Taiwan~~)',1=>'~~繁體中文~~'),'~~zh_CN~~'=>array(0=>'Chinese (~~China~~)',1=>'~~简体中文~~'));


2	/**
3	* Compiled data. Do not edit.
4	*/
5	+ return array('af'=>array(0=>'Afrikaans',1=>'Afrikaans'),'ar'=>array(0=>'Arabic',1=>'العربية'),'ary'=>array(0=>'Moroccan Arabic',1=>'العربية المغربية'),'as'=>array(0=>'Assamese',1=>'অসমীয়া'),'az'=>array(0=>'Azerbaijani',1=>'Azərbaycan dili'),'azb'=>array(0=>'South Azerbaijani',1=>'گؤنئی آذربایجان'),'bel'=>array(0=>'Belarusian',1=>'Беларуская мова'),'bg_BG'=>array(0=>'Bulgarian',1=>'Български'),'bn_BD'=>array(0=>'Bengali (Bangladesh)',1=>'বাংলা'),'bo'=>array(0=>'Tibetan',1=>'བོད་ཡིག'),'bs_BA'=>array(0=>'Bosnian',1=>'Bosanski'),'ca'=>array(0=>'Catalan',1=>'Català'),'ceb'=>array(0=>'Cebuano',1=>'Cebuano'),'cs_CZ'=>array(0=>'Czech',1=>'Čeština'),'cy'=>array(0=>'Welsh',1=>'Cymraeg'),'da_DK'=>array(0=>'Danish',1=>'Dansk'),'de_CH'=>array(0=>'German (Switzerland)',1=>'Deutsch (Schweiz)'),'de_CH_informal'=>array(0=>'German (Switzerland, Informal)',1=>'Deutsch (Schweiz, Du)'),'de_AT'=>array(0=>'German (Austria)',1=>'Deutsch (Österreich)'),'de_DE_formal'=>array(0=>'German (Formal)',1=>'Deutsch (Sie)'),'de_DE'=>array(0=>'German',1=>'Deutsch'),'dsb'=>array(0=>'Lower Sorbian',1=>'Dolnoserbšćina'),'dzo'=>array(0=>'Dzongkha',1=>'རྫོང་ཁ'),'el'=>array(0=>'Greek',1=>'Ελληνικά'),'en_ZA'=>array(0=>'English (South Africa)',1=>'English (South Africa)'),'en_AU'=>array(0=>'English (Australia)',1=>'English (Australia)'),'en_NZ'=>array(0=>'English (New Zealand)',1=>'English (New Zealand)'),'en_GB'=>array(0=>'English (UK)',1=>'English (UK)'),'en_CA'=>array(0=>'English (Canada)',1=>'English (Canada)'),'eo'=>array(0=>'Esperanto',1=>'Esperanto'),'es_UY'=>array(0=>'Spanish (Uruguay)',1=>'Español de Uruguay'),'es_CR'=>array(0=>'Spanish (Costa Rica)',1=>'Español de Costa Rica'),'es_ES'=>array(0=>'Spanish (Spain)',1=>'Español'),'es_VE'=>array(0=>'Spanish (Venezuela)',1=>'Español de Venezuela'),'es_CL'=>array(0=>'Spanish (Chile)',1=>'Español de Chile'),'es_PE'=>array(0=>'Spanish (Peru)',1=>'Español de Perú'),'es_PR'=>array(0=>'Spanish (Puerto Rico)',1=>'Español de Puerto Rico'),'es_GT'=>array(0=>'Spanish (Guatemala)',1=>'Español de Guatemala'),'es_AR'=>array(0=>'Spanish (Argentina)',1=>'Español de Argentina'),'es_EC'=>array(0=>'Spanish (Ecuador)',1=>'Español de Ecuador'),'es_MX'=>array(0=>'Spanish (Mexico)',1=>'Español de México'),'es_CO'=>array(0=>'Spanish (Colombia)',1=>'Español de Colombia'),'et'=>array(0=>'Estonian',1=>'Eesti'),'eu'=>array(0=>'Basque',1=>'Euskara'),'fa_IR'=>array(0=>'Persian',1=>'فارسی'),'fa_AF'=>array(0=>'Persian (Afghanistan)',1=>'(فارسی (افغانستان'),'fi'=>array(0=>'Finnish',1=>'Suomi'),'fr_CA'=>array(0=>'French (Canada)',1=>'Français du Canada'),'fr_BE'=>array(0=>'French (Belgium)',1=>'Français de Belgique'),'fr_FR'=>array(0=>'French (France)',1=>'Français'),'fur'=>array(0=>'Friulian',1=>'Friulian'),'gd'=>array(0=>'Scottish Gaelic',1=>'Gàidhlig'),'gl_ES'=>array(0=>'Galician',1=>'Galego'),'gu'=>array(0=>'Gujarati',1=>'ગુજરાતી'),'haz'=>array(0=>'Hazaragi',1=>'هزاره گی'),'he_IL'=>array(0=>'Hebrew',1=>'עִבְרִית'),'hi_IN'=>array(0=>'Hindi',1=>'हिन्दी'),'hr'=>array(0=>'Croatian',1=>'Hrvatski'),'hsb'=>array(0=>'Upper Sorbian',1=>'Hornjoserbšćina'),'hu_HU'=>array(0=>'Hungarian',1=>'Magyar'),'hy'=>array(0=>'Armenian',1=>'Հայերեն'),'id_ID'=>array(0=>'Indonesian',1=>'Bahasa Indonesia'),'is_IS'=>array(0=>'Icelandic',1=>'Íslenska'),'it_IT'=>array(0=>'Italian',1=>'Italiano'),'ja'=>array(0=>'Japanese',1=>'日本語'),'jv_ID'=>array(0=>'Javanese',1=>'Basa Jawa'),'ka_GE'=>array(0=>'Georgian',1=>'ქართული'),'kab'=>array(0=>'Kabyle',1=>'Taqbaylit'),'kk'=>array(0=>'Kazakh',1=>'Қазақ тілі'),'km'=>array(0=>'Khmer',1=>'ភាសាខ្មែរ'),'kn'=>array(0=>'Kannada',1=>'ಕನ್ನಡ'),'ko_KR'=>array(0=>'Korean',1=>'한국어'),'ckb'=>array(0=>'Kurdish (Sorani)',1=>'كوردی‎'),'lo'=>array(0=>'Lao',1=>'ພາສາລາວ'),'lt_LT'=>array(0=>'Lithuanian',1=>'Lietuvių kalba'),'lv'=>array(0=>'Latvian',1=>'Latviešu valoda'),'mk_MK'=>array(0=>'Macedonian',1=>'Македонски јазик'),'ml_IN'=>array(0=>'Malayalam',1=>'മലയാളം'),'mn'=>array(0=>'Mongolian',1=>'Монгол'),'mr'=>array(0=>'Marathi',1=>'मराठी'),'ms_MY'=>array(0=>'Malay',1=>'Bahasa Melayu'),'my_MM'=>array(0=>'Myanmar (Burmese)',1=>'ဗမာစာ'),'nb_NO'=>array(0=>'Norwegian (Bokmål)',1=>'Norsk bokmål'),'ne_NP'=>array(0=>'Nepali',1=>'नेपाली'),'nl_NL_formal'=>array(0=>'Dutch (Formal)',1=>'Nederlands (Formeel)'),'nl_BE'=>array(0=>'Dutch (Belgium)',1=>'Nederlands (België)'),'nl_NL'=>array(0=>'Dutch',1=>'Nederlands'),'nn_NO'=>array(0=>'Norwegian (Nynorsk)',1=>'Norsk nynorsk'),'oci'=>array(0=>'Occitan',1=>'Occitan'),'pa_IN'=>array(0=>'Punjabi',1=>'ਪੰਜਾਬੀ'),'pl_PL'=>array(0=>'Polish',1=>'Polski'),'ps'=>array(0=>'Pashto',1=>'پښتو'),'pt_BR'=>array(0=>'Portuguese (Brazil)',1=>'Português do Brasil'),'pt_PT_ao90'=>array(0=>'Portuguese (Portugal, AO90)',1=>'Português (AO90)'),'pt_AO'=>array(0=>'Portuguese (Angola)',1=>'Português de Angola'),'pt_PT'=>array(0=>'Portuguese (Portugal)',1=>'Português'),'rhg'=>array(0=>'Rohingya',1=>'Ruáinga'),'ro_RO'=>array(0=>'Romanian',1=>'Română'),'ru_RU'=>array(0=>'Russian',1=>'Русский'),'sah'=>array(0=>'Sakha',1=>'Сахалыы'),'snd'=>array(0=>'Sindhi',1=>'سنڌي'),'si_LK'=>array(0=>'Sinhala',1=>'සිංහල'),'sk_SK'=>array(0=>'Slovak',1=>'Slovenčina'),'skr'=>array(0=>'Saraiki',1=>'سرائیکی'),'sl_SI'=>array(0=>'Slovenian',1=>'Slovenščina'),'sq'=>array(0=>'Albanian',1=>'Shqip'),'sr_RS'=>array(0=>'Serbian',1=>'Српски језик'),'sv_SE'=>array(0=>'Swedish',1=>'Svenska'),'sw'=>array(0=>'Swahili',1=>'Kiswahili'),'szl'=>array(0=>'Silesian',1=>'Ślōnskŏ gŏdka'),'ta_IN'=>array(0=>'Tamil',1=>'தமிழ்'),'ta_LK'=>array(0=>'Tamil (Sri Lanka)',1=>'தமிழ்'),'te'=>array(0=>'Telugu',1=>'తెలుగు'),'th'=>array(0=>'Thai',1=>'ไทย'),'tl'=>array(0=>'Tagalog',1=>'Tagalog'),'tr_TR'=>array(0=>'Turkish',1=>'Türkçe'),'tt_RU'=>array(0=>'Tatar',1=>'Татар теле'),'tah'=>array(0=>'Tahitian',1=>'Reo Tahiti'),'ug_CN'=>array(0=>'Uighur',1=>'ئۇيغۇرچە'),'uk'=>array(0=>'Ukrainian',1=>'Українська'),'ur'=>array(0=>'Urdu',1=>'اردو'),'uz_UZ'=>array(0=>'Uzbek',1=>'O‘zbekcha'),'vi'=>array(0=>'Vietnamese',1=>'Tiếng Việt'),'zh_HK'=>array(0=>'Chinese (Hong Kong)',1=>'香港中文版 '),'zh_CN'=>array(0=>'Chinese (China)',1=>'简体中文'),'zh_TW'=>array(0=>'Chinese (Taiwan)',1=>'繁體中文'));

loco.php CHANGED Viewed

	@@ -4,7 +4,7 @@ Plugin Name: Loco Translate
4	Plugin URI: https://wordpress.org/plugins/loco-translate/
5	Description: Translate themes and plugins directly in WordPress
6	Author: Tim Whitlock
7	- Version: 2.5.2
8	Requires at least: 4.1
9	Tested up to: 5.7
10	Requires PHP: 5.2.4
	@@ -33,7 +33,7 @@ function loco_plugin_file(){
33	* @return string
34	*/
35	function loco_plugin_version(){
36	- return '2.5.2';
37	}
38
39


4	Plugin URI: https://wordpress.org/plugins/loco-translate/
5	Description: Translate themes and plugins directly in WordPress
6	Author: Tim Whitlock
7	+ Version: 2.5.3
8	Requires at least: 4.1
9	Tested up to: 5.7
10	Requires PHP: 5.2.4

33	* @return string
34	*/
35	function loco_plugin_version(){
36	+ return '2.5.3';
37	}
38
39

pub/css/admin.css CHANGED Viewed

@@ -1 +1 @@

- ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.2) 0 0 no-repeat;min-height:75px}._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.2);background-size:16px}._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.2);background-size:16px}}._green_glow_inner{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}.loco-font,#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after,#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}@font-face{font-family:"loco";src:url("../font/loco.eot?v=2.5.2");src:url("../font/loco.eot?v=2.5.2?#iefix") format("embedded-opentype"),url("../font/loco.woff?v=2.5.2") format("woff"),url("../font/loco.ttf?v=2.5.2") format("truetype"),url("../font/loco.svg?v=2.5.2#loco") format("svg");font-weight:normal;font-style:normal}.tipsy{font-size:11px;position:absolute;padding:5px;z-index:500001;opacity:0;-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.tipsy.in{opacity:1}.tipsy-inner{background-color:#000;color:#fff;white-space:nowrap;padding:6px 8px;line-height:1.3em;text-align:center;-webkit-border-radius:3px;-moz-border-radius:3px;-ms-border-radius:3px;-o-border-radius:3px;border-radius:3px;-webkit-font-smoothing:subpixel-antialiased}.tipsy-arrow{position:absolute;width:0;height:0;line-height:0;border:5px dashed #000}.tipsy-n .tipsy-arrow{top:0px;left:50%;margin-left:-5px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-nw .tipsy-arrow{top:0;left:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-ne .tipsy-arrow{top:0;right:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-s .tipsy-arrow{bottom:0;left:50%;margin-left:-5px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-sw .tipsy-arrow{bottom:0;left:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-se .tipsy-arrow{bottom:0;right:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-e .tipsy-arrow{right:0;top:50%;margin-top:-5px;border-left-style:solid;border-right:none;border-top-color:transparent;border-bottom-color:transparent}.tipsy-w .tipsy-arrow{left:0;top:50%;margin-top:-5px;border-right-style:solid;border-left:none;border-top-color:transparent;border-bottom-color:transparent}#loco-admin.wrap .selector li,#loco-admin.wrap .selector .handle,#loco-admin.wrap .selectoradd a,#loco-admin.wrap .selectorsep:before,#loco-admin.wrap .selectorsep span{padding:.3em .75em}#loco-admin.wrap .selector{text-align:left;display:inline-block;white-space:nowrap}#loco-admin.wrap .selectoradd a,#loco-admin.wrap .selector .handle{cursor:default;display:block;position:relative;border-top:solid 1px #fff;border-right:solid 1px #ddd;border-bottom:solid 1px #ddd;border-left:solid 1px #fff;color:#666;height:1.3em;overflow:hidden;white-space:normal}#loco-admin.wrap .selectorsep{display:inline-block;border:solid 1px transparent}#loco-admin.wrap .selectorsep:before{display:block;position:relative;color:#999;height:1.3em;overflow:hidden}#loco-admin.wrap .selectorsep>*{display:block;line-height:1em;color:#666;height:1.3em;overflow:hidden}#loco-admin.wrap .selector .handle{outline:none;white-space:nowrap;padding-right:2.3em;max-width:250px;text-overflow:ellipsis}#loco-admin.wrap .selector .handle .prefix{padding-right:.6ex}#loco-admin.wrap .selector .handle:after{font-family:loco;font-size:1.3em;color:#ccc;display:block;position:absolute;top:.25em;right:.6em;content:"▼"}#loco-admin.wrap .selector .handle:focus:after,#loco-admin.wrap .selector .handle:hover:after{color:#666}#loco-admin.wrap .selector.no-caret .handle{padding-right:.75em}#loco-admin.wrap .selector.no-caret .handle:after{display:none}#loco-admin.wrap .selector.no-title .handle{padding-left:.5em;padding-right:.5em}#loco-admin.wrap .selector.no-title .handle .label{display:none}#loco-admin.wrap .selector.no-title .handle .icon{margin-right:0px}#loco-admin.wrap .selector.dummy .handle{border-color:transparent}#loco-admin.wrap .selector.dummy .handle:after{display:none}#loco-admin.wrap .selectoradd{position:relative}#loco-admin.wrap .selectoradd>*{display:block;float:left;clear:none}#loco-admin.wrap .selectoradd>a.has-icon{width:1.3em}#loco-admin.wrap .selectoradd>a.has-icon:before{color:#999;display:inline;padding-left:0;padding-right:0;line-height:1.4em}#loco-admin.wrap .selectoradd>a.has-icon:hover:after{color:#2e892e}#loco-admin.wrap .selectorsep{display:inline-block}#loco-admin.wrap .selectorsep span{color:#666;height:1.3em}#loco-admin.wrap .selector ul{padding:0}#loco-admin.wrap .selector ul,#loco-admin.wrap .selector li{display:block;position:relative;cursor:default;margin:0}#loco-admin.wrap .selector ul{z-index:5;position:absolute;left:0;top:0;background:#f5f5f5;box-shadow:0 10px 5px rgba(0,0,0,.2);border:solid 1px #ccc;overflow:auto}#loco-admin.wrap .selector.up ul{margin-top:0}#loco-admin.wrap .selector.multi li input{display:none}#loco-admin.wrap .selector.multi li.checked{background:#e5e5e5}#loco-admin.wrap .selector li.active{background:#e5e5e5 !important}#loco-admin.wrap .selector li.over{background:#ccc !important;color:#fff;text-shadow:1px 1px #aaa}#loco-admin.wrap .selector li.over .label{color:#fff}#loco-admin.wrap .selector .label{font:inherit;color:inherit}#loco-admin.wrap .selector .icon{display:inline-block;min-width:1.2em;text-align:center;font-size:14px}#loco-admin.wrap .selector .icon.no-icon{display:none}#loco-admin.wrap .selector .icon:before{color:#666}#loco-admin.wrap .selector .avtr{width:18px;height:18px;background-size:18px;background-repeat:no-repeat}#loco-admin.wrap .selector .label{line-height:1}#loco-admin.wrap .selector .icon,#loco-admin.wrap .selector .icon-16{vertical-align:bottom}#loco-admin.wrap .selector .icon,#loco-admin.wrap .selector .lang,#loco-admin.wrap .selector .icon-16{margin-right:5px}#loco-admin.wrap .selector .region,#loco-admin.wrap .selector .variant-wales,#loco-admin.wrap .selector .region-gb.lang-cy,#loco-admin.wrap .selector .variant-scotland,#loco-admin.wrap .selector .region-gb.lang-gd,#loco-admin.wrap .selector .variant-valencia,#loco-admin.wrap .selector .region-es.variant-valencia,#loco-admin.wrap .selector .lang-ca,#loco-admin.wrap .selector .region-es.lang-ca,#loco-admin.wrap .selector .lang-eo,#loco-admin.wrap .selector .lang-eu{margin-left:2px;margin-right:7px}#loco-admin.wrap .selector.ticked .icon.no-icon{font-size:12px;display:inline-block}#loco-admin.wrap .selector.ticked .active .icon.no-icon:before{content:"✓"}#loco-admin.wrap .selectoradd a:hover,#loco-admin.wrap .selector a.handle:focus,#loco-admin.wrap .selector a.handle:hover{color:#000;border-color:#999}#loco-admin.wrap .selector.active .handle{border-color:#999;background-color:#eee;color:#999}#loco-admin.wrap .selector.active .handle:after{color:#999;content:"▲"}#loco-admin.wrap .selector.disabled{cursor:default;cursor:no-drop;cursor:not-allowed}#loco-admin.wrap .selector.disabled .handle{pointer-events:none;border-top:solid 1px #fff;border-right:solid 1px #ddd;border-bottom:solid 1px #ddd;border-left:solid 1px #fff;color:#999;padding-right:1em}#loco-admin.wrap .selector.disabled .handle:after{display:none}#loco-admin.wrap .selector.disabled .handle span.icon{color:#999 !important}#loco-admin.wrap .selector li.disabled,#loco-admin.wrap .selector li.disabled.over{color:#aaa;text-shadow:1px 1px #fff;pointer-events:none}#loco-admin.wrap .selector li.disabled *{cursor:text}#loco-admin.wrap .selector li.disabled .icon:before{color:#aaa}#loco-admin.wrap .selector li.disabled .flag,#loco-admin.wrap .selector li.disabled .icon-16{opacity:.4}#loco-admin.wrap .selector.lefty ul{left:auto;right:0}#loco-admin.wrap .selector.lefty ul .icon,#loco-admin.wrap .selector.lefty ul .icon-32{display:block;float:right;clear:none}#loco-admin.wrap .selector.lefty ul .label{padding-right:32px;padding-left:0}#loco-admin.wrap .selector ul>form{margin:0;display:block}#loco-admin.wrap .selector ul>form input{margin:0;-webkit-border-radius:0;-moz-border-radius:0;-ms-border-radius:0;-o-border-radius:0;border-radius:0}#loco-admin.wrap .selector ul>form input:focus{-webkit-box-shadow:inset 0 0 5px 0 #3db63d;-moz-box-shadow:inset 0 0 5px 0 #3db63d;box-shadow:inset 0 0 5px 0 #3db63d}#loco-admin.wrap .selector ul>form input.error{border-color:#c00;-webkit-box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5);-moz-box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5);box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5)}#loco-admin.wrap .selector ul>form a.clear{margin:0;border:none}#loco-admin.wrap .selector ul>form ::placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form ::-webkit-input-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form :-moz-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block;opacity:1}#loco-admin.wrap .selector ul>form ::-moz-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block;opacity:1}#loco-admin.wrap .selector ul>form :-ms-input-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form .ielt10 .placeheld{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap div.auto-comp-wrap{width:100%}#loco-admin.wrap div.auto-comp-wrap input{display:inline-block}#loco-admin.wrap div.auto-comp-wrap.loading input{background:transparent url(../img/ajax-loader.gif?v=2.5.2) right 2px no-repeat}#loco-admin.wrap div.auto-comp-drop{color:#333;background:#fff;border-top:none;position:absolute;width:auto;top:0;left:0;z-index:99;-webkit-box-shadow:0 5px 5px rgba(0,0,0,.4);-moz-box-shadow:0 5px 5px rgba(0,0,0,.4);box-shadow:0 5px 5px rgba(0,0,0,.4)}#loco-admin.wrap div.auto-comp-result{padding:5px 10px;cursor:pointer;background:#f0f0f0;border-top:solid 1px #fff;border-bottom:solid 1px #ddd;white-space:nowrap}#loco-admin.wrap div.auto-comp-result:first-child{border-top:solid 1px #ddd}#loco-admin.wrap div.auto-comp-result>*{display:inline-block;vertical-align:middle;line-height:normal}#loco-admin.wrap div.auto-comp-result .icon:before{padding-right:5px}#loco-admin.wrap div.auto-comp-result:hover{background:#a8a8a8;color:#fff;border-top-color:#a8a8a8;border-bottom-color:#999}#loco-admin.wrap div.auto-comp-result.selected{background:#666 !important;color:#fff;border-top-color:#666;border-bottom-color:#666}#loco-admin.wrap div.auto-comp-result .lang,#loco-admin.wrap div.auto-comp-result .region,#loco-admin.wrap div.auto-comp-result .variant-wales,#loco-admin.wrap div.auto-comp-result .region-gb.lang-cy,#loco-admin.wrap div.auto-comp-result .variant-scotland,#loco-admin.wrap div.auto-comp-result .region-gb.lang-gd,#loco-admin.wrap div.auto-comp-result .variant-valencia,#loco-admin.wrap div.auto-comp-result .region-es.variant-valencia,#loco-admin.wrap div.auto-comp-result .lang-ca,#loco-admin.wrap div.auto-comp-result .region-es.lang-ca,#loco-admin.wrap div.auto-comp-result .lang-eo,#loco-admin.wrap div.auto-comp-result .lang-eu,#loco-admin.wrap div.auto-comp-result .avtr{margin-right:5px}#loco-admin.wrap div.auto-comp-wrap.error a.icon.clear:before{color:#c00;opacity:1}#loco-admin.wrap div.auto-comp-wrap.error input[type=text]{border-color:#c00;color:#c00}#loco-admin.wrap div.auto-comp-wrap.error input[type=text]:focus{-webkit-box-shadow:0 0 .5em 0 rgba(153,0,0,.5);-moz-box-shadow:0 0 .5em 0 rgba(153,0,0,.5);box-shadow:0 0 .5em 0 rgba(153,0,0,.5)}#loco-admin.wrap ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}#loco-admin.wrap ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.2) 0 0 no-repeat;min-height:75px}#loco-admin.wrap ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-admin.wrap ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.2);background-size:16px}#loco-admin.wrap ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.2);background-size:16px}}#loco-admin.wrap ._green_glow_inner{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-admin.wrap ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-admin.wrap .loco-font,#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after,#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-admin.wrap .has-icon:before{display:inline-block;padding-right:.3em}#loco-admin.wrap a.icon-help{cursor:help}#loco-admin.wrap a.icon-help span{display:none}#loco-admin.wrap .icon-notag:before{content:""}#loco-admin.wrap .icon-magnify:before{content:"🔍"}#loco-admin.wrap .icon-python:before{content:"🐍"}#loco-admin.wrap .icon-unicode:before{content:"u"}#loco-admin.wrap .icon-json:before{content:"{"}#loco-admin.wrap .icon-bullist:before{content:""}#loco-admin.wrap .icon-numlist:before{content:""}#loco-admin.wrap .icon-indent:before{content:""}#loco-admin.wrap .icon-outdent:before{content:""}#loco-admin.wrap .icon-link:before{content:""}#loco-admin.wrap .icon-unlink:before{content:""}#loco-admin.wrap .icon-bold:before{content:"B"}#loco-admin.wrap .icon-italic:before{content:"I"}#loco-admin.wrap .icon-translate:before{content:""}#loco-admin.wrap .icon-proj:before{content:""}#loco-admin.wrap .icon-plural:before{content:"᛬"}#loco-admin.wrap .icon-max:before,#loco-admin.wrap .icon-full-screen:before{content:""}#loco-admin.wrap .icon-min:before{content:""}#loco-admin.wrap .icon-sort:before{content:""}#loco-admin.wrap .icon-ok:before,#loco-admin.wrap .notice-success>.has-icon:before,#loco-admin.wrap .notice-success p>strong.has-icon:before{content:"✓"}#loco-admin.wrap .icon-ok-empty:before{content:"🗌"}#loco-admin.wrap .icon-checkbox-checked:before,#loco-admin.wrap .selector.multi li.checked .icon-checkbox:before{content:"☑"}#loco-admin.wrap .icon-checkbox-unchecked:before{content:"☐"}#loco-admin.wrap .icon-checkbox-partial:before{content:"☉"}#loco-admin.wrap .icon-radio-checked:before{content:"⚫"}#loco-admin.wrap .icon-radio-unchecked:before{content:"⚪"}#loco-admin.wrap .icon-ext:before{content:"⬈"}#loco-admin.wrap .icon-share:before{content:""}#loco-admin.wrap .icon-star:before{content:""}#loco-admin.wrap .icon-user:before{content:""}#loco-admin.wrap .icon-remove:before,#loco-admin.wrap a.icon.close:before{content:"×"}#loco-admin.wrap .icon-cog:before{content:""}#loco-admin.wrap .icon-trash:before{content:""}#loco-admin.wrap .icon-time:before,#loco-admin.wrap .icon-history:before{content:""}#loco-admin.wrap .icon-download:before{content:""}#loco-admin.wrap .icon-revert:before{content:""}#loco-admin.wrap .icon-sync:before{content:""}#loco-admin.wrap .icon-lock:before,#loco-admin.wrap .notice-locked>.has-icon:before,#loco-admin.wrap .notice-locked p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-flag:before{content:""}#loco-admin.wrap .icon-tag:before{content:""}#loco-admin.wrap .icon-tags:before{content:""}#loco-admin.wrap .icon-print:before{content:""}#loco-admin.wrap .icon-camera:before{content:""}#loco-admin.wrap .icon-pencil:before{content:""}#loco-admin.wrap .icon-add:before{content:""}#loco-admin.wrap .icon-del:before{content:""}#loco-admin.wrap .icon-clear:before,#loco-admin.wrap a.icon.clear:before{content:""}#loco-admin.wrap .icon-ok-sign:before{content:"✔"}#loco-admin.wrap .icon-help:before{content:"?"}#loco-admin.wrap .icon-info:before,#loco-admin.wrap .notice-info>.has-icon:before,#loco-admin.wrap .notice-info p>strong.has-icon:before{content:"ℹ"}#loco-admin.wrap .icon-cancel:before{content:""}#loco-admin.wrap .icon-warn:before,#loco-admin.wrap .notice-error>.has-icon:before,#loco-admin.wrap .notice-error p>strong.has-icon:before,#loco-admin.wrap .notice-warning>.has-icon:before,#loco-admin.wrap .notice-warning p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-comment:before{content:""}#loco-admin.wrap .icon-bar-chart:before{content:""}#loco-admin.wrap .icon-key:before{content:""}#loco-admin.wrap .icon-cogs:before{content:""}#loco-admin.wrap .icon-comments:before{content:""}#loco-admin.wrap .icon-signout:before{content:""}#loco-admin.wrap .icon-signin:before{content:""}#loco-admin.wrap .icon-upload:before{content:""}#loco-admin.wrap .icon-twitter:before{content:"🐦"}#loco-admin.wrap .icon-facebook:before{content:""}#loco-admin.wrap .icon-github:before{content:""}#loco-admin.wrap .icon-feed:before{content:""}#loco-admin.wrap .icon-globe:before{content:""}#loco-admin.wrap .icon-wrench:before,#loco-admin.wrap .notice-debug>.has-icon:before,#loco-admin.wrap .notice-debug p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-group:before{content:""}#loco-admin.wrap .icon-cloud:before{content:""}#loco-admin.wrap .icon-copy:before{content:""}#loco-admin.wrap .icon-save:before{content:""}#loco-admin.wrap .icon-menu:before{content:""}#loco-admin.wrap .icon-table:before{content:""}#loco-admin.wrap .icon-caret-down:before{content:"▼"}#loco-admin.wrap .icon-caret-up:before{content:"▲"}#loco-admin.wrap .icon-caret-right:before{content:"▶"}#loco-admin.wrap .icon-mail:before{content:""}#loco-admin.wrap .icon-cloud-upload:before{content:""}#loco-admin.wrap .icon-file:before{content:""}#loco-admin.wrap .icon-circle-white:before{content:"⚬"}#loco-admin.wrap .icon-circle-black:before{content:"●"}#loco-admin.wrap .icon-eraser:before{content:""}#loco-admin.wrap .icon-unlock:before{content:""}#loco-admin.wrap .icon-apple:before{content:""}#loco-admin.wrap .icon-android:before{content:""}#loco-admin.wrap .icon-robot:before{content:"🤖"}#loco-admin.wrap .icon-back:before{content:"⬅"}#loco-admin.wrap .icon-next:before{content:"➔"}#loco-admin.wrap .icon-arrow-up:before{content:""}#loco-admin.wrap .icon-ccard:before{content:""}#loco-admin.wrap .icon-caret-left:before{content:"◀"}#loco-admin.wrap .icon-pro:before{content:"⚡"}#loco-admin.wrap .icon-bell:before{content:""}#loco-admin.wrap .icon-code:before{content:""}#loco-admin.wrap .icon-privacy:before{content:"🛡"}#loco-admin.wrap .icon-hellip:before{content:"…"}#loco-admin.wrap .icon-vellip:before{content:"⁞"}#loco-admin.wrap .icon-collapse:before{content:""}#loco-admin.wrap .icon-expand:before{content:""}#loco-admin.wrap .icon-wordpress:before{content:""}#loco-admin.wrap .icon-database:before{content:""}#loco-admin.wrap .icon-restore:before{content:""}#loco-admin.wrap .icon-pilcrow:before{content:"¶"}#loco-admin.wrap .icon-status.is-translated:before,#loco-admin.wrap .is-translated>header>.icon-status:before{color:#2e892e;content:"✓";text-align:center}#loco-admin.wrap .icon-status.is-untranslated:before,#loco-admin.wrap .is-untranslated>header>.icon-status:before{color:#aaa;content:"×";text-align:center;font-size:1.1em}#loco-admin.wrap .icon-status.is-flagged:before,#loco-admin.wrap .is-flagged>header>.icon-status:before{color:#bd2c00;content:"";text-align:center}#loco-admin.wrap .icon-status.is-translated.is-blank:before,#loco-admin.wrap .icon-status.is-translated.is-inherit:before,#loco-admin.wrap .is-translated.is-blank>header>.icon-status:before,#loco-admin.wrap .is-translated.is-inherit>header>.icon-status:before{content:"🗌"}#loco-admin.wrap .icon-status.is-fuzzy:before,#loco-admin.wrap .is-fuzzy>header>.icon-status:before{color:#666;content:""}#loco-admin.wrap .lang,#loco-admin.wrap .region,#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy,#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd,#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia,#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca,#loco-admin.wrap .lang-eo,#loco-admin.wrap .lang-eu{color:#fff;background:#2e892e;display:inline-block;text-transform:uppercase;overflow:hidden;font-family:Verdana,Arial,sans-serif;font-size:9px;font-weight:normal;font-style:normal;line-height:12px;text-align:center;white-space:normal;text-shadow:none}#loco-admin.wrap .lang{width:20px;height:12px;line-height:12px;vertical-align:middle}#loco-admin.wrap .lang:before{content:attr(lang);vertical-align:baseline}#loco-admin.wrap .no-lang{width:18px;height:10px;border:solid 1px #2e892e;background:transparent}#loco-admin.wrap .lang-el{background-color:#1d48a3}#loco-admin.wrap .lang-el:before{content:"Ελ"}#loco-admin.wrap .region,#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy,#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd,#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia,#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca,#loco-admin.wrap .lang-eo,#loco-admin.wrap .lang-eu{width:16px;height:12px;margin:0 2px;background-image:url(../img/flags.png?v=2.5.2);background-repeat:no-repeat;background-color:transparent}#loco-admin.wrap .region:before,#loco-admin.wrap .variant-wales:before,#loco-admin.wrap .region-gb.lang-cy:before,#loco-admin.wrap .variant-scotland:before,#loco-admin.wrap .region-gb.lang-gd:before,#loco-admin.wrap .variant-valencia:before,#loco-admin.wrap .region-es.variant-valencia:before,#loco-admin.wrap .lang-ca:before,#loco-admin.wrap .region-es.lang-ca:before,#loco-admin.wrap .lang-eo:before,#loco-admin.wrap .lang-eu:before{visibility:hidden}#loco-admin.wrap .lang-zh{background-color:#b90000}#loco-admin.wrap .lang-zh.script-hans:before{content:"中国"}#loco-admin.wrap .lang-zh.script-hant:before{content:"中國"}#loco-admin.wrap .__{background-position:0 0}#loco-admin.wrap .lang-eo{background-position:0 -12px}#loco-admin.wrap .lang-eu{background-position:0 -24px}#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca{background-position:0 -36px}#loco-admin.wrap .region-tg{background-position:0 -48px}#loco-admin.wrap .region-me{background-position:0 -60px}#loco-admin.wrap .region-la{background-position:0 -73px}#loco-admin.wrap .region-mr{background-position:0 -85px}#loco-admin.wrap .region-ni{background-position:0 -97px}#loco-admin.wrap .region-lv{background-position:0 -109px}#loco-admin.wrap .region-om{background-position:0 -121px}#loco-admin.wrap .region-af{background-position:0 -133px}#loco-admin.wrap .region-cy{background-position:0 -145px}#loco-admin.wrap .region-bj{background-position:0 -157px}#loco-admin.wrap .region-aq{background-position:0 -169px}#loco-admin.wrap .region-cn{background-position:0 -186px}#loco-admin.wrap .region-co{background-position:0 -198px}#loco-admin.wrap .region-cx{background-position:0 -210px}#loco-admin.wrap .region-ag{background-position:0 -222px}#loco-admin.wrap .region-ms{background-position:0 -234px}#loco-admin.wrap .region-md{background-position:0 -246px}#loco-admin.wrap .region-zm{background-position:0 -258px}#loco-admin.wrap .region-vn{background-position:0 -270px}#loco-admin.wrap .region-tf{background-position:0 -282px}#loco-admin.wrap .region-td{background-position:0 -294px}#loco-admin.wrap .region-yt{background-position:0 -306px}#loco-admin.wrap .region-lb{background-position:0 -318px}#loco-admin.wrap .region-mf{background-position:0 -330px}#loco-admin.wrap .region-lu{background-position:0 -347px}#loco-admin.wrap .region-mq{background-position:0 -359px}#loco-admin.wrap .region-cz{background-position:0 -371px}#loco-admin.wrap .region-ae{background-position:0 -383px}#loco-admin.wrap .region-cm{background-position:0 -395px}#loco-admin.wrap .region-bi{background-position:0 -407px}#loco-admin.wrap .region-ar{background-position:0 -419px}#loco-admin.wrap .region-as{background-position:0 -431px}#loco-admin.wrap .region-bh{background-position:0 -443px}#loco-admin.wrap .region-cl{background-position:0 -455px}#loco-admin.wrap .region-ad{background-position:0 -467px}#loco-admin.wrap .region-mp{background-position:0 -479px}#loco-admin.wrap .region-lt{background-position:0 -491px}#loco-admin.wrap .region-mg{background-position:0 -503px}#loco-admin.wrap .region-lc{background-position:0 -515px}#loco-admin.wrap .region-tr{background-position:0 -527px}#loco-admin.wrap .region-ua{background-position:0 -539px}#loco-admin.wrap .region-tv{background-position:0 -551px}#loco-admin.wrap .region-vi{background-position:0 -563px}#loco-admin.wrap .region-mt{background-position:0 -575px}#loco-admin.wrap .region-no{background-position:0 -587px}#loco-admin.wrap .region-mc{background-position:0 -599px}#loco-admin.wrap .region-ch{background-position:0 -611px}#loco-admin.wrap .region-bl{background-position:0 -623px}#loco-admin.wrap .region-aw{background-position:0 -640px}#loco-admin.wrap .region-bz{background-position:0 -652px}#loco-admin.wrap .region-bm{background-position:0 -664px}#loco-admin.wrap .region-ci{background-position:0 -676px}#loco-admin.wrap .region-mu{background-position:0 -688px}#loco-admin.wrap .region-us{background-position:0 -700px}#loco-admin.wrap .region-tw{background-position:0 -712px}#loco-admin.wrap .region-ye{background-position:0 -724px}#loco-admin.wrap .region-mw{background-position:0 -736px}#loco-admin.wrap .region-nl{background-position:0 -748px}#loco-admin.wrap .region-ls{background-position:0 -760px}#loco-admin.wrap .region-bo{background-position:0 -772px}#loco-admin.wrap .region-at{background-position:0 -784px}#loco-admin.wrap .region-ck{background-position:0 -796px}#loco-admin.wrap .region-by{background-position:0 -808px}#loco-admin.wrap .region-au{background-position:0 -820px}#loco-admin.wrap .region-bn{background-position:0 -832px}#loco-admin.wrap .region-ma{background-position:0 -844px}#loco-admin.wrap .region-nz{background-position:0 -856px}#loco-admin.wrap .region-lr{background-position:0 -868px}#loco-admin.wrap .region-mv{background-position:0 -880px}#loco-admin.wrap .region-tc{background-position:0 -892px}#loco-admin.wrap .region-ug{background-position:0 -904px}#loco-admin.wrap .region-tt{background-position:0 -916px}#loco-admin.wrap .region-pl{background-position:0 -928px}#loco-admin.wrap .region-rs{background-position:0 -940px}#loco-admin.wrap .region-in{background-position:0 -952px}#loco-admin.wrap .region-ge{background-position:0 -964px}#loco-admin.wrap .region-gr{background-position:0 -976px}#loco-admin.wrap .region-gs{background-position:0 -988px}#loco-admin.wrap .region-gd{background-position:0 -1000px}#loco-admin.wrap .region-io{background-position:0 -1012px}#loco-admin.wrap .region-hk{background-position:0 -1024px}#loco-admin.wrap .region-kp{background-position:0 -1036px}#loco-admin.wrap .region-kg{background-position:0 -1048px}#loco-admin.wrap .region-pm{background-position:0 -1060px}#loco-admin.wrap .region-sv{background-position:0 -1072px}#loco-admin.wrap .region-re{background-position:0 -1084px}#loco-admin.wrap .region-sa{background-position:0 -1096px}#loco-admin.wrap .region-sc{background-position:0 -1108px}#loco-admin.wrap .region-st{background-position:0 -1120px}#loco-admin.wrap .region-ke{background-position:0 -1132px}#loco-admin.wrap .region-im{background-position:0 -1144px}#loco-admin.wrap .region-kr{background-position:0 -1161px}#loco-admin.wrap .region-gf{background-position:0 -1173px}#loco-admin.wrap .region-dj{background-position:0 -1185px}#loco-admin.wrap .region-gq{background-position:0 -1197px}#loco-admin.wrap .region-gp{background-position:0 -1209px}#loco-admin.wrap .region-dk{background-position:0 -1221px}#loco-admin.wrap .region-gg{background-position:0 -1233px}#loco-admin.wrap .region-il{background-position:0 -1250px}#loco-admin.wrap .region-pn{background-position:0 -1262px}#loco-admin.wrap .region-sb{background-position:0 -1274px}#loco-admin.wrap .region-py{background-position:0 -1286px}#loco-admin.wrap .region-ru{background-position:0 -1298px}#loco-admin.wrap .region-kw{background-position:0 -1310px}#loco-admin.wrap .region-do{background-position:0 -1322px}#loco-admin.wrap .region-gt{background-position:0 -1334px}#loco-admin.wrap .region-gb{background-position:0 -1346px}#loco-admin.wrap .region-gu{background-position:0 -1358px}#loco-admin.wrap .region-je{background-position:0 -1370px}#loco-admin.wrap .region-hm{background-position:0 -1387px}#loco-admin.wrap .region-sg{background-position:0 -1399px}#loco-admin.wrap .region-pk{background-position:0 -1411px}#loco-admin.wrap .region-sr{background-position:0 -1423px}#loco-admin.wrap .region-se{background-position:0 -1435px}#loco-admin.wrap .region-jp{background-position:0 -1447px}#loco-admin.wrap .region-gw{background-position:0 -1459px}#loco-admin.wrap .region-eh{background-position:0 -1471px}#loco-admin.wrap .region-dz{background-position:0 -1483px}#loco-admin.wrap .region-ga{background-position:0 -1495px}#loco-admin.wrap .region-fr{background-position:0 -1507px}#loco-admin.wrap .region-dm{background-position:0 -1519px}#loco-admin.wrap .region-hn{background-position:0 -1531px}#loco-admin.wrap .region-sd{background-position:0 -1543px}#loco-admin.wrap .region-rw{background-position:0 -1555px}#loco-admin.wrap .region-ph{background-position:0 -1567px}#loco-admin.wrap .region-ss{background-position:0 -1579px}#loco-admin.wrap .region-qa{background-position:0 -1596px}#loco-admin.wrap .region-pe{background-position:0 -1608px}#loco-admin.wrap .region-pr{background-position:0 -1620px}#loco-admin.wrap .region-si{background-position:0 -1632px}#loco-admin.wrap .region-ht{background-position:0 -1644px}#loco-admin.wrap .region-es{background-position:0 -1656px}#loco-admin.wrap .region-gl{background-position:0 -1668px}#loco-admin.wrap .region-gm{background-position:0 -1680px}#loco-admin.wrap .region-er{background-position:0 -1692px}#loco-admin.wrap .region-fi{background-position:0 -1704px}#loco-admin.wrap .region-ee{background-position:0 -1716px}#loco-admin.wrap .region-kn{background-position:0 -1728px}#loco-admin.wrap .region-hu{background-position:0 -1740px}#loco-admin.wrap .region-iq{background-position:0 -1752px}#loco-admin.wrap .region-ky{background-position:0 -1764px}#loco-admin.wrap .region-sh{background-position:0 -1776px}#loco-admin.wrap .region-ps{background-position:0 -1788px}#loco-admin.wrap .region-pf{background-position:0 -1800px}#loco-admin.wrap .region-sj{background-position:0 -1812px}#loco-admin.wrap .region-id{background-position:0 -1824px}#loco-admin.wrap .region-is{background-position:0 -1836px}#loco-admin.wrap .region-eg{background-position:0 -1848px}#loco-admin.wrap .region-fk{background-position:0 -1860px}#loco-admin.wrap .region-fj{background-position:0 -1872px}#loco-admin.wrap .region-gn{background-position:0 -1884px}#loco-admin.wrap .region-gy{background-position:0 -1896px}#loco-admin.wrap .region-ir{background-position:0 -1908px}#loco-admin.wrap .region-km{background-position:0 -1920px}#loco-admin.wrap .region-ie{background-position:0 -1932px}#loco-admin.wrap .region-kz{background-position:0 -1944px}#loco-admin.wrap .region-ro{background-position:0 -1956px}#loco-admin.wrap .region-sk{background-position:0 -1968px}#loco-admin.wrap .region-pg{background-position:0 -1980px}#loco-admin.wrap .region-pt{background-position:0 -1992px}#loco-admin.wrap .region-so{background-position:0 -2004px}#loco-admin.wrap .region-sx{background-position:0 -2016px}#loco-admin.wrap .region-hr{background-position:0 -2033px}#loco-admin.wrap .region-ki{background-position:0 -2045px}#loco-admin.wrap .region-jm{background-position:0 -2057px}#loco-admin.wrap .region-ec{background-position:0 -2069px}#loco-admin.wrap .region-et{background-position:0 -2081px}#loco-admin.wrap .region-fo{background-position:0 -2093px}#loco-admin.wrap .region-kh{background-position:0 -2105px}#loco-admin.wrap .region-sy{background-position:0 -2117px}#loco-admin.wrap .region-sn{background-position:0 -2129px}#loco-admin.wrap .region-pw{background-position:0 -2141px}#loco-admin.wrap .region-sl{background-position:0 -2153px}#loco-admin.wrap .region-fm{background-position:0 -2165px}#loco-admin.wrap .region-gi{background-position:0 -2177px}#loco-admin.wrap .region-de{background-position:0 -2189px}#loco-admin.wrap .region-gh{background-position:0 -2201px}#loco-admin.wrap .region-jo{background-position:0 -2213px}#loco-admin.wrap .region-it{background-position:0 -2225px}#loco-admin.wrap .region-pa{background-position:0 -2237px}#loco-admin.wrap .region-sz{background-position:0 -2249px}#loco-admin.wrap .region-sm{background-position:0 -2261px}#loco-admin.wrap .region-tn{background-position:0 -2273px}#loco-admin.wrap .region-ml{background-position:0 -2285px}#loco-admin.wrap .region-cg{background-position:0 -2297px}#loco-admin.wrap .region-ax{background-position:0 -2309px}#loco-admin.wrap .region-ao{background-position:0 -2321px}#loco-admin.wrap .region-bt{background-position:0 -2333px}#loco-admin.wrap .region-an{background-position:0 -2345px}#loco-admin.wrap .region-bb{background-position:0 -2357px}#loco-admin.wrap .region-cf{background-position:0 -2369px}#loco-admin.wrap .region-mm{background-position:0 -2381px}#loco-admin.wrap .region-li{background-position:0 -2393px}#loco-admin.wrap .region-na{background-position:0 -2405px}#loco-admin.wrap .region-mz{background-position:0 -2417px}#loco-admin.wrap .region-to{background-position:0 -2429px}#loco-admin.wrap .region-vg{background-position:0 -2441px}#loco-admin.wrap .region-ve{background-position:0 -2453px}#loco-admin.wrap .region-tz{background-position:0 -2465px}#loco-admin.wrap .region-tm{background-position:0 -2477px}#loco-admin.wrap .region-mx{background-position:0 -2489px}#loco-admin.wrap .region-nc{background-position:0 -2501px}#loco-admin.wrap .region-mo{background-position:0 -2513px}#loco-admin.wrap .region-lk{background-position:0 -2525px}#loco-admin.wrap .region-cd{background-position:0 -2537px}#loco-admin.wrap .region-al{background-position:0 -2549px}#loco-admin.wrap .region-bw{background-position:0 -2561px}#loco-admin.wrap .region-cs{background-position:0 -2573px}#loco-admin.wrap .region-cr{background-position:0 -2585px}#loco-admin.wrap .region-bv{background-position:0 -2597px}#loco-admin.wrap .region-am{background-position:0 -2609px}#loco-admin.wrap .region-az{background-position:0 -2621px}#loco-admin.wrap .region-ba{background-position:0 -2633px}#loco-admin.wrap .region-mn{background-position:0 -2645px}#loco-admin.wrap .region-nu{background-position:0 -2657px}#loco-admin.wrap .region-my{background-position:0 -2669px}#loco-admin.wrap .region-tl{background-position:0 -2681px}#loco-admin.wrap .region-ws{background-position:0 -2693px}#loco-admin.wrap .region-th{background-position:0 -2705px}#loco-admin.wrap .region-nf{background-position:0 -2717px}#loco-admin.wrap .region-ly{background-position:0 -2729px}#loco-admin.wrap .region-ai{background-position:0 -2741px}#loco-admin.wrap .region-br{background-position:0 -2753px}#loco-admin.wrap .region-cv{background-position:0 -2765px}#loco-admin.wrap .region-be{background-position:0 -2777px}#loco-admin.wrap .region-ca{background-position:0 -2789px}#loco-admin.wrap .region-bd{background-position:0 -2801px}#loco-admin.wrap .region-cw{background-position:0 -2813px}#loco-admin.wrap .region-bs{background-position:0 -2830px}#loco-admin.wrap .region-ng{background-position:0 -2842px}#loco-admin.wrap .region-mk{background-position:0 -2854px}#loco-admin.wrap .region-np{background-position:0 -2866px}#loco-admin.wrap .region-va{background-position:0 -2878px}#loco-admin.wrap .region-uz{background-position:0 -2890px}#loco-admin.wrap .region-um{background-position:0 -2902px}#loco-admin.wrap .region-tk{background-position:0 -2914px}#loco-admin.wrap .region-vc{background-position:0 -2926px}#loco-admin.wrap .region-zw{background-position:0 -2938px}#loco-admin.wrap .region-nr{background-position:0 -2950px}#loco-admin.wrap .region-ne{background-position:0 -2962px}#loco-admin.wrap .region-cu{background-position:0 -2974px}#loco-admin.wrap .region-bq{background-position:0 -2986px}#loco-admin.wrap .region-bf{background-position:0 -2998px}#loco-admin.wrap .region-bg{background-position:0 -3010px}#loco-admin.wrap .region-cc{background-position:0 -3022px}#loco-admin.wrap .region-mh{background-position:0 -3034px}#loco-admin.wrap .region-za{background-position:0 -3046px}#loco-admin.wrap .region-uy{background-position:0 -3058px}#loco-admin.wrap .region-wf{background-position:0 -3070px}#loco-admin.wrap .region-vu{background-position:0 -3082px}#loco-admin.wrap .region-tj{background-position:0 -3094px}#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd{background-position:0 -3106px}#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia{background-position:0 -3118px}#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy{background-position:0 -3130px}#loco-admin.wrap .x-eu{background-position:0 -3142px}#loco-admin.wrap span.lang code{display:none}#loco-admin.wrap .icon-notag:before{content:""}#loco-admin.wrap .icon-magnify:before{content:"🔍"}#loco-admin.wrap .icon-python:before{content:"🐍"}#loco-admin.wrap .icon-unicode:before{content:"u"}#loco-admin.wrap .icon-json:before{content:"{"}#loco-admin.wrap .icon-bullist:before{content:""}#loco-admin.wrap .icon-numlist:before{content:""}#loco-admin.wrap .icon-indent:before{content:""}#loco-admin.wrap .icon-outdent:before{content:""}#loco-admin.wrap .icon-link:before{content:""}#loco-admin.wrap .icon-unlink:before{content:""}#loco-admin.wrap .icon-bold:before{content:"B"}#loco-admin.wrap .icon-italic:before{content:"I"}#loco-admin.wrap .icon-translate:before{content:""}#loco-admin.wrap .icon-proj:before{content:""}#loco-admin.wrap .icon-plural:before{content:"᛬"}#loco-admin.wrap .icon-max:before,#loco-admin.wrap .icon-full-screen:before{content:""}#loco-admin.wrap .icon-min:before{content:""}#loco-admin.wrap .icon-sort:before{content:""}#loco-admin.wrap .icon-ok:before,#loco-admin.wrap .notice-success>.has-icon:before,#loco-admin.wrap .notice-success p>strong.has-icon:before{content:"✓"}#loco-admin.wrap .icon-ok-empty:before{content:"🗌"}#loco-admin.wrap .icon-checkbox-checked:before,#loco-admin.wrap .selector.multi li.checked .icon-checkbox:before{content:"☑"}#loco-admin.wrap .icon-checkbox-unchecked:before{content:"☐"}#loco-admin.wrap .icon-checkbox-partial:before{content:"☉"}#loco-admin.wrap .icon-radio-checked:before{content:"⚫"}#loco-admin.wrap .icon-radio-unchecked:before{content:"⚪"}#loco-admin.wrap .icon-ext:before{content:"⬈"}#loco-admin.wrap .icon-share:before{content:""}#loco-admin.wrap .icon-star:before{content:""}#loco-admin.wrap .icon-user:before{content:""}#loco-admin.wrap .icon-remove:before,#loco-admin.wrap a.icon.close:before{content:"×"}#loco-admin.wrap .icon-cog:before{content:""}#loco-admin.wrap .icon-trash:before{content:""}#loco-admin.wrap .icon-time:before,#loco-admin.wrap .icon-history:before{content:""}#loco-admin.wrap .icon-download:before{content:""}#loco-admin.wrap .icon-revert:before{content:""}#loco-admin.wrap .icon-sync:before{content:""}#loco-admin.wrap .icon-lock:before,#loco-admin.wrap .notice-locked>.has-icon:before,#loco-admin.wrap .notice-locked p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-flag:before{content:""}#loco-admin.wrap .icon-tag:before{content:""}#loco-admin.wrap .icon-tags:before{content:""}#loco-admin.wrap .icon-print:before{content:""}#loco-admin.wrap .icon-camera:before{content:""}#loco-admin.wrap .icon-pencil:before{content:""}#loco-admin.wrap .icon-add:before{content:""}#loco-admin.wrap .icon-del:before{content:""}#loco-admin.wrap .icon-clear:before,#loco-admin.wrap a.icon.clear:before{content:""}#loco-admin.wrap .icon-ok-sign:before{content:"✔"}#loco-admin.wrap .icon-help:before{content:"?"}#loco-admin.wrap .icon-info:before,#loco-admin.wrap .notice-info>.has-icon:before,#loco-admin.wrap .notice-info p>strong.has-icon:before{content:"ℹ"}#loco-admin.wrap .icon-cancel:before{content:""}#loco-admin.wrap .icon-warn:before,#loco-admin.wrap .notice-error>.has-icon:before,#loco-admin.wrap .notice-error p>strong.has-icon:before,#loco-admin.wrap .notice-warning>.has-icon:before,#loco-admin.wrap .notice-warning p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-comment:before{content:""}#loco-admin.wrap .icon-bar-chart:before{content:""}#loco-admin.wrap .icon-key:before{content:""}#loco-admin.wrap .icon-cogs:before{content:""}#loco-admin.wrap .icon-comments:before{content:""}#loco-admin.wrap .icon-signout:before{content:""}#loco-admin.wrap .icon-signin:before{content:""}#loco-admin.wrap .icon-upload:before{content:""}#loco-admin.wrap .icon-twitter:before{content:"🐦"}#loco-admin.wrap .icon-facebook:before{content:""}#loco-admin.wrap .icon-github:before{content:""}#loco-admin.wrap .icon-feed:before{content:""}#loco-admin.wrap .icon-globe:before{content:""}#loco-admin.wrap .icon-wrench:before,#loco-admin.wrap .notice-debug>.has-icon:before,#loco-admin.wrap .notice-debug p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-group:before{content:""}#loco-admin.wrap .icon-cloud:before{content:""}#loco-admin.wrap .icon-copy:before{content:""}#loco-admin.wrap .icon-save:before{content:""}#loco-admin.wrap .icon-menu:before{content:""}#loco-admin.wrap .icon-table:before{content:""}#loco-admin.wrap .icon-caret-down:before{content:"▼"}#loco-admin.wrap .icon-caret-up:before{content:"▲"}#loco-admin.wrap .icon-caret-right:before{content:"▶"}#loco-admin.wrap .icon-mail:before{content:""}#loco-admin.wrap .icon-cloud-upload:before{content:""}#loco-admin.wrap .icon-file:before{content:""}#loco-admin.wrap .icon-circle-white:before{content:"⚬"}#loco-admin.wrap .icon-circle-black:before{content:"●"}#loco-admin.wrap .icon-eraser:before{content:""}#loco-admin.wrap .icon-unlock:before{content:""}#loco-admin.wrap .icon-apple:before{content:""}#loco-admin.wrap .icon-android:before{content:""}#loco-admin.wrap .icon-robot:before{content:"🤖"}#loco-admin.wrap .icon-back:before{content:"⬅"}#loco-admin.wrap .icon-next:before{content:"➔"}#loco-admin.wrap .icon-arrow-up:before{content:""}#loco-admin.wrap .icon-ccard:before{content:""}#loco-admin.wrap .icon-caret-left:before{content:"◀"}#loco-admin.wrap .icon-pro:before{content:"⚡"}#loco-admin.wrap .icon-bell:before{content:""}#loco-admin.wrap .icon-code:before{content:""}#loco-admin.wrap .icon-privacy:before{content:"🛡"}#loco-admin.wrap .icon-hellip:before{content:"…"}#loco-admin.wrap .icon-vellip:before{content:"⁞"}#loco-admin.wrap .icon-collapse:before{content:""}#loco-admin.wrap .icon-expand:before{content:""}#loco-admin.wrap .icon-wordpress:before{content:""}#loco-admin.wrap .icon-database:before{content:""}#loco-admin.wrap .icon-restore:before{content:""}#loco-admin.wrap .icon-pilcrow:before{content:"¶"}#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before,#loco-admin.wrap .has-dashicon:before{speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco"}#loco-admin.wrap .has-dashicon:before{font-family:"dashicons";font-size:1.4em}#loco-admin.wrap .has-icon:before,#loco-admin.wrap .has-dashicon:before,#loco-admin.wrap .has-icon>span{display:inline-block;vertical-align:middle}#loco-admin.wrap .only-icon{text-align:center}#loco-admin.wrap .only-icon:before{text-align:center;padding:0}#loco-admin.wrap .only-icon span{display:none}#loco-admin.wrap a,#loco-admin.wrap .wp-core-ui .button-link{text-decoration:none}#loco-admin.wrap h3:hover>a.loco-anchor{color:#ccc}#loco-admin.wrap h3:hover>a.loco-anchor:before{content:"¶"}#loco-admin.wrap .has-lang>span{display:inline-block;vertical-align:middle}#loco-admin.wrap a.has-lang:hover>span:last-child{text-decoration:underline}#loco-admin.wrap h1 ul,#loco-admin.wrap h1 li{margin:0;padding:0}#loco-admin.wrap h1 li{display:inline-block}#loco-admin.wrap h1 li:after{content:"/";color:#999;text-shadow:none;display:inline-block}#loco-admin.wrap h1 li:last-child:after{content:""}#loco-admin.wrap h1 li:last-child a{color:inherit;pointer-events:none;cursor:auto}#loco-admin.wrap h2 span{color:#999;font-weight:normal}#loco-admin.wrap h2 .loco-meta,#loco-admin.wrap h3 .loco-meta{color:inherit;font-size:14px;font-weight:normal;vertical-align:middle}#loco-admin.wrap .wp-list-table td:first-child .icon{width:16px;display:inline-block;text-align:center}#loco-admin.wrap .wp-list-table td{white-space:nowrap}#loco-admin.wrap .wp-list-table td>a,#loco-admin.wrap .wp-list-table td>time{display:inline-block;max-width:100%;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;-o-text-overflow:ellipsis;-ms-text-overflow:ellipsis}#loco-admin.wrap .wp-list-table th.loco-sort{cursor:pointer}#loco-admin.wrap .wp-list-table th.loco-sort:hover{color:#000}#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after{padding:0 0 0 4px;color:#999}#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after{content:"▼"}#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after{content:"▲"}#loco-admin.wrap .wp-list-table td.has-row-actions{overflow:visible}#loco-admin.wrap form.loco-filter{display:block;margin-bottom:5px}#loco-admin.wrap form.loco-filter .icon-filter{color:#999}#loco-admin.wrap nav.above-list-table{margin-bottom:1em}#loco-admin.wrap nav.above-list-table a{display:inline-block;margin-right:1em}#loco-admin.wrap .wp-core-ui button.inverted,#loco-admin.wrap .wp-core-ui button.inverted:hover,#loco-admin.wrap .po-fuzzy button.icon-cloud{background:-moz-linear-gradient(top, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);background:-webkit-linear-gradient(top, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);background:linear-gradient(to bottom, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);-webkit-box-shadow:0 1px 0 #fff;-moz-box-shadow:0 1px 0 #fff;box-shadow:0 1px 0 #fff;border-color:gray}#loco-admin.wrap .wp-core-ui button:active,#loco-admin.wrap .wp-core-ui button.inverted:active{border-color:#5b9dd9}#loco-admin.wrap .loco-clearable{display:inline-block;vertical-align:middle;position:relative}#loco-admin.wrap .loco-clearable a.clear,#loco-admin.wrap .auto-comp-wrap a.clear{top:0;right:0;outline:none;margin:0;border:solid 1px transparent;padding:5px 5px;position:absolute;font-size:1em;line-height:normal}#loco-admin.wrap .loco-clearable a.clear:before,#loco-admin.wrap .auto-comp-wrap a.clear:before{vertical-align:middle;padding:0;color:#999}#loco-admin.wrap .loco-clearable a.clear:hover:before,#loco-admin.wrap .auto-comp-wrap a.clear:hover:before{color:#333}#loco-admin.wrap .loco-clearable a.clear span,#loco-admin.wrap .auto-comp-wrap a.clear span{display:none}#loco-admin.wrap .loco-clearable ::-ms-clear,#loco-admin.wrap .auto-comp-wrap ::-ms-clear{display:none}#loco-admin.wrap div.progress{color:#000;background:transparent !important}#loco-admin.wrap div.progress *{height:100%;overflow:hidden;white-space:nowrap}#loco-admin.wrap div.progress .t{background-color:#ddd;border:1px solid #ccc}#loco-admin.wrap div.progress .t .bar{float:left;clear:none;background-color:#3db63d}#loco-admin.wrap div.progress .t .bar.f{background-color:#bd2c00}#loco-admin.wrap div.progress .l{display:block}#loco-admin.wrap td div.progress .t{border:none}#loco-admin.wrap td div.progress .l{display:none}#loco-admin.wrap code.path{color:#333;margin:0;padding:0;display:inline;background:transparent}#loco-admin.wrap .loco-danger{color:#d54e21}#loco-admin.wrap .notice,#loco-admin.wrap .panel{background:#fff;position:relative;margin:1em 0;padding:1px 12px}#loco-admin.wrap .notice-generic{border-color:#ddd}#loco-admin.wrap .notice-success>.has-icon,#loco-admin.wrap .notice-success p>strong.has-icon{color:#000}#loco-admin.wrap .notice-warning{border-color:orange}#loco-admin.wrap .notice-error{border-color:#dc3232}#loco-admin.wrap .notice-debug{border-color:#00a0d2}#loco-admin.wrap .notice-danger{border-color:#dc3232}#loco-admin.wrap .notice-locked{border-color:orange}#loco-admin.wrap .notice>.has-icon:before,#loco-admin.wrap .notice p>strong.has-icon:before{padding-right:6px}#loco-admin.wrap .notice>p>a.button.has-icon:before{width:1.2em}#loco-admin.wrap .notice>p>em{color:#d54e21;font-style:normal}#loco-admin.wrap .notice>p>em a{color:inherit}#loco-admin.wrap .notice>p a:hover,#loco-admin.wrap .notice>nav a:hover{text-decoration:underline}#loco-admin.wrap .notice>p a.button,#loco-admin.wrap .notice>nav a.button{text-decoration:inherit}#loco-admin.wrap .notice.has-nav{display:flex;flex-direction:row}#loco-admin.wrap .notice.has-nav p,#loco-admin.wrap .notice.has-nav nav{line-height:22px;flex-grow:1}#loco-admin.wrap .notice.has-nav nav{text-align:right;padding:2px;margin:.5em 0}#loco-admin.wrap .notice.has-nav.is-dismissible{padding-right:38px}#loco-admin.wrap .notice.has-nav a{white-space:nowrap}#loco-admin.wrap .notice.has-nav nav>span{color:#666}#loco-admin.wrap .notice>h3>span{display:inline-block;vertical-align:middle}#loco-admin.wrap ul.problems li{font-style:italic}#loco-admin.wrap label{position:relative}#loco-admin.wrap label.for-disabled,#loco-admin.wrap label.for-disabled>input{cursor:default !important}#loco-admin.wrap input.regular-text,#loco-admin.wrap textarea.regular-text{width:25em}#loco-admin.wrap .button-link{padding:0 10px 1px}#loco-admin.wrap .button-danger{background:#ba0000;border-color:#900 #600 #600;-webkit-box-shadow:0 1px 0 #600;-moz-box-shadow:0 1px 0 #600;box-shadow:0 1px 0 #600;color:#fff;text-shadow:0 -1px 1px #600,1px 0 1px #600,0 1px 1px #600,-1px 0 1px #600}#loco-admin.wrap .button-success{background:#00b500;border-color:#090 #2e892e #2e892e;-webkit-box-shadow:0 1px 0 #2e892e;-moz-box-shadow:0 1px 0 #2e892e;box-shadow:0 1px 0 #2e892e;color:#fff;text-shadow:0 -1px 1px #2e892e,1px 0 1px #2e892e,0 1px 1px #2e892e,-1px 0 1px #2e892e}#loco-admin.wrap .button-success:hover{background:#3db63d}#loco-admin.wrap .button-danger[disabled],#loco-admin.wrap .button-success[disabled]{text-shadow:none !important}#loco-admin.wrap form button.loco-loading.button-large{padding-left:0}#loco-admin.wrap form button.loco-loading.button-large:before{width:16px;height:16px;margin:0 4px;content:" ";font-size:16px;line-height:1;display:inline-block;vertical-align:sub}#loco-admin.wrap ::placeholder{color:#ccc}#loco-admin.wrap ::-webkit-input-placeholder{color:#ccc}#loco-admin.wrap :-moz-placeholder{color:#ccc;opacity:1}#loco-admin.wrap ::-moz-placeholder{color:#ccc;opacity:1}#loco-admin.wrap :-ms-input-placeholder{color:#ccc}#loco-admin.wrap .ielt10 .placeheld{color:#ccc}#loco-admin.wrap a.has-raquo:after{content:" »"}#loco-admin.wrap a.has-laquo:before{content:"« "}#loco-admin.wrap span.inline-spinner{display:inline-block;min-width:16px;min-height:16px;background:transparent url(../img/spin-modal.gif?v=2.5.2) 0 0 no-repeat}.js #wpbody-content>.notice{display:none}.js #wpbody-content>.notice.inline{display:block}.js #loco-admin.wrap .jshide,.no-js #loco-admin.wrap .jsonly{display:none !important}#loco-admin.wrap .invis{visibility:hidden}.form-table tr td{vertical-align:top}.form-table tr.compact td{padding-top:0}.form-table tr th a.icon-help{display:none}.loco-modal{min-width:50%;min-height:100px}.loco-modal-wide{min-width:90% !important}.loco-modal-no-close .ui-dialog-titlebar-close{display:none}.loco-modal .ui-dialog-titlebar-close{overflow:hidden}.loco-modal.request-filesystem-credentials-dialog{top:15% !important;max-height:85% !important}.loco-modal.request-filesystem-credentials-dialog>.ui-dialog-content{background:inherit}.loco-modal.request-filesystem-credentials-dialog .ftp-password>label>em:last-child{display:none}.ui-dialog-content>div.loco-loading{height:100%;background:transparent url(../img/spin-modal.gif?v=2.5.2) center 20px no-repeat}#loco-po-ref ol li{color:#aaa;margin:0;white-space:pre;padding:0 0 0 1em;font:normal 12px/17px Consolas,Monaco,monospace;background:transparent;border-left:1px solid #eee}#loco-po-ref ol li code{margin:0;padding:0;display:inline;background:inherit}#loco-po-ref ol li.highlighted{color:#666;background-color:#f8eec7}#loco-po-ref ol li.highlighted code.T_CONSTANT_ENCAPSED_STRING{color:#c931c7}#loco-credit>*{vertical-align:middle}#loco-credit>a{display:inline-block;position:relative;overflow:hidden;background:transparent url(../img/logo-foot.gif?v=2.5.2) 0 0 no-repeat;height:30px;width:100px;text-indent:200px;-webkit-transition-duration:0s;transition-duration:0s}#loco-credit>a:hover{background-position:0 -35px}#loco-content{position:relative}#footer-upgrade span:before{color:#ccc;content:" | ";display:inline;padding-left:.5em;padding-right:.5em}#footer-upgrade span:first-child:before{content:"";display:none}.loco-clearfix:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}dl.debug dt{font-weight:bold}dl.debug dt,dl.debug dd{white-space:pre}.wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(0,115,170,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#0073aa;foo:#0073aa}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#66c6e4 !important;background:#008ec2 !important;border-color:#008ec2 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../img/skins/fresh/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.3) 0 0 no-repeat;min-height:75px}._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.3);background-size:16px}._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.3);background-size:16px}}._green_glow_inner{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}.loco-font,#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after,#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}@font-face{font-family:"loco";src:url("../font/loco.eot?v=2.5.3");src:url("../font/loco.eot?v=2.5.3?#iefix") format("embedded-opentype"),url("../font/loco.woff?v=2.5.3") format("woff"),url("../font/loco.ttf?v=2.5.3") format("truetype"),url("../font/loco.svg?v=2.5.3#loco") format("svg");font-weight:normal;font-style:normal}.tipsy{font-size:11px;position:absolute;padding:5px;z-index:500001;opacity:0;-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.tipsy.in{opacity:1}.tipsy-inner{background-color:#000;color:#fff;white-space:nowrap;padding:6px 8px;line-height:1.3em;text-align:center;-webkit-border-radius:3px;-moz-border-radius:3px;-ms-border-radius:3px;-o-border-radius:3px;border-radius:3px;-webkit-font-smoothing:subpixel-antialiased}.tipsy-arrow{position:absolute;width:0;height:0;line-height:0;border:5px dashed #000}.tipsy-n .tipsy-arrow{top:0px;left:50%;margin-left:-5px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-nw .tipsy-arrow{top:0;left:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-ne .tipsy-arrow{top:0;right:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.tipsy-s .tipsy-arrow{bottom:0;left:50%;margin-left:-5px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-sw .tipsy-arrow{bottom:0;left:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-se .tipsy-arrow{bottom:0;right:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.tipsy-e .tipsy-arrow{right:0;top:50%;margin-top:-5px;border-left-style:solid;border-right:none;border-top-color:transparent;border-bottom-color:transparent}.tipsy-w .tipsy-arrow{left:0;top:50%;margin-top:-5px;border-right-style:solid;border-left:none;border-top-color:transparent;border-bottom-color:transparent}#loco-admin.wrap .selector li,#loco-admin.wrap .selector .handle,#loco-admin.wrap .selectoradd a,#loco-admin.wrap .selectorsep:before,#loco-admin.wrap .selectorsep span{padding:.3em .75em}#loco-admin.wrap .selector{text-align:left;display:inline-block;white-space:nowrap}#loco-admin.wrap .selectoradd a,#loco-admin.wrap .selector .handle{cursor:default;display:block;position:relative;border-top:solid 1px #fff;border-right:solid 1px #ddd;border-bottom:solid 1px #ddd;border-left:solid 1px #fff;color:#666;height:1.3em;overflow:hidden;white-space:normal}#loco-admin.wrap .selectorsep{display:inline-block;border:solid 1px transparent}#loco-admin.wrap .selectorsep:before{display:block;position:relative;color:#999;height:1.3em;overflow:hidden}#loco-admin.wrap .selectorsep>*{display:block;line-height:1em;color:#666;height:1.3em;overflow:hidden}#loco-admin.wrap .selector .handle{outline:none;white-space:nowrap;padding-right:2.3em;max-width:250px;text-overflow:ellipsis}#loco-admin.wrap .selector .handle .prefix{padding-right:.6ex}#loco-admin.wrap .selector .handle:after{font-family:loco;font-size:1.3em;color:#ccc;display:block;position:absolute;top:.25em;right:.6em;content:"▼"}#loco-admin.wrap .selector .handle:focus:after,#loco-admin.wrap .selector .handle:hover:after{color:#666}#loco-admin.wrap .selector.no-caret .handle{padding-right:.75em}#loco-admin.wrap .selector.no-caret .handle:after{display:none}#loco-admin.wrap .selector.no-title .handle{padding-left:.5em;padding-right:.5em}#loco-admin.wrap .selector.no-title .handle .label{display:none}#loco-admin.wrap .selector.no-title .handle .icon{margin-right:0px}#loco-admin.wrap .selector.dummy .handle{border-color:transparent}#loco-admin.wrap .selector.dummy .handle:after{display:none}#loco-admin.wrap .selectoradd{position:relative}#loco-admin.wrap .selectoradd>*{display:block;float:left;clear:none}#loco-admin.wrap .selectoradd>a.has-icon{width:1.3em}#loco-admin.wrap .selectoradd>a.has-icon:before{color:#999;display:inline;padding-left:0;padding-right:0;line-height:1.4em}#loco-admin.wrap .selectoradd>a.has-icon:hover:after{color:#2e892e}#loco-admin.wrap .selectorsep{display:inline-block}#loco-admin.wrap .selectorsep span{color:#666;height:1.3em}#loco-admin.wrap .selector ul{padding:0}#loco-admin.wrap .selector ul,#loco-admin.wrap .selector li{display:block;position:relative;cursor:default;margin:0}#loco-admin.wrap .selector ul{z-index:5;position:absolute;left:0;top:0;background:#f5f5f5;box-shadow:0 10px 5px rgba(0,0,0,.2);border:solid 1px #ccc;overflow:auto}#loco-admin.wrap .selector.up ul{margin-top:0}#loco-admin.wrap .selector.multi li input{display:none}#loco-admin.wrap .selector.multi li.checked{background:#e5e5e5}#loco-admin.wrap .selector li.active{background:#e5e5e5 !important}#loco-admin.wrap .selector li.over{background:#ccc !important;color:#fff;text-shadow:1px 1px #aaa}#loco-admin.wrap .selector li.over .label{color:#fff}#loco-admin.wrap .selector .label{font:inherit;color:inherit}#loco-admin.wrap .selector .icon{display:inline-block;min-width:1.2em;text-align:center;font-size:14px}#loco-admin.wrap .selector .icon.no-icon{display:none}#loco-admin.wrap .selector .icon:before{color:#666}#loco-admin.wrap .selector .avtr{width:18px;height:18px;background-size:18px;background-repeat:no-repeat}#loco-admin.wrap .selector .label{line-height:1}#loco-admin.wrap .selector .icon,#loco-admin.wrap .selector .icon-16{vertical-align:bottom}#loco-admin.wrap .selector .icon,#loco-admin.wrap .selector .lang,#loco-admin.wrap .selector .icon-16{margin-right:5px}#loco-admin.wrap .selector .region,#loco-admin.wrap .selector .variant-wales,#loco-admin.wrap .selector .region-gb.lang-cy,#loco-admin.wrap .selector .variant-scotland,#loco-admin.wrap .selector .region-gb.lang-gd,#loco-admin.wrap .selector .variant-valencia,#loco-admin.wrap .selector .region-es.variant-valencia,#loco-admin.wrap .selector .lang-ca,#loco-admin.wrap .selector .region-es.lang-ca,#loco-admin.wrap .selector .lang-eo,#loco-admin.wrap .selector .lang-eu{margin-left:2px;margin-right:7px}#loco-admin.wrap .selector.ticked .icon.no-icon{font-size:12px;display:inline-block}#loco-admin.wrap .selector.ticked .active .icon.no-icon:before{content:"✓"}#loco-admin.wrap .selectoradd a:hover,#loco-admin.wrap .selector a.handle:focus,#loco-admin.wrap .selector a.handle:hover{color:#000;border-color:#999}#loco-admin.wrap .selector.active .handle{border-color:#999;background-color:#eee;color:#999}#loco-admin.wrap .selector.active .handle:after{color:#999;content:"▲"}#loco-admin.wrap .selector.disabled{cursor:default;cursor:no-drop;cursor:not-allowed}#loco-admin.wrap .selector.disabled .handle{pointer-events:none;border-top:solid 1px #fff;border-right:solid 1px #ddd;border-bottom:solid 1px #ddd;border-left:solid 1px #fff;color:#999;padding-right:1em}#loco-admin.wrap .selector.disabled .handle:after{display:none}#loco-admin.wrap .selector.disabled .handle span.icon{color:#999 !important}#loco-admin.wrap .selector li.disabled,#loco-admin.wrap .selector li.disabled.over{color:#aaa;text-shadow:1px 1px #fff;pointer-events:none}#loco-admin.wrap .selector li.disabled *{cursor:text}#loco-admin.wrap .selector li.disabled .icon:before{color:#aaa}#loco-admin.wrap .selector li.disabled .flag,#loco-admin.wrap .selector li.disabled .icon-16{opacity:.4}#loco-admin.wrap .selector.lefty ul{left:auto;right:0}#loco-admin.wrap .selector.lefty ul .icon,#loco-admin.wrap .selector.lefty ul .icon-32{display:block;float:right;clear:none}#loco-admin.wrap .selector.lefty ul .label{padding-right:32px;padding-left:0}#loco-admin.wrap .selector ul>form{margin:0;display:block}#loco-admin.wrap .selector ul>form input{margin:0;-webkit-border-radius:0;-moz-border-radius:0;-ms-border-radius:0;-o-border-radius:0;border-radius:0}#loco-admin.wrap .selector ul>form input:focus{-webkit-box-shadow:inset 0 0 5px 0 #3db63d;-moz-box-shadow:inset 0 0 5px 0 #3db63d;box-shadow:inset 0 0 5px 0 #3db63d}#loco-admin.wrap .selector ul>form input.error{border-color:#c00;-webkit-box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5);-moz-box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5);box-shadow:inset 0 0 5px 0 rgba(153,0,0,.5)}#loco-admin.wrap .selector ul>form a.clear{margin:0;border:none}#loco-admin.wrap .selector ul>form ::placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form ::-webkit-input-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form :-moz-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block;opacity:1}#loco-admin.wrap .selector ul>form ::-moz-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block;opacity:1}#loco-admin.wrap .selector ul>form :-ms-input-placeholder{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap .selector ul>form .ielt10 .placeheld{color:gray;font-size:16px;font-family:"loco";text-align:right;display:block}#loco-admin.wrap div.auto-comp-wrap{width:100%}#loco-admin.wrap div.auto-comp-wrap input{display:inline-block}#loco-admin.wrap div.auto-comp-wrap.loading input{background:transparent url(../img/ajax-loader.gif?v=2.5.3) right 2px no-repeat}#loco-admin.wrap div.auto-comp-drop{color:#333;background:#fff;border-top:none;position:absolute;width:auto;top:0;left:0;z-index:99;-webkit-box-shadow:0 5px 5px rgba(0,0,0,.4);-moz-box-shadow:0 5px 5px rgba(0,0,0,.4);box-shadow:0 5px 5px rgba(0,0,0,.4)}#loco-admin.wrap div.auto-comp-result{padding:5px 10px;cursor:pointer;background:#f0f0f0;border-top:solid 1px #fff;border-bottom:solid 1px #ddd;white-space:nowrap}#loco-admin.wrap div.auto-comp-result:first-child{border-top:solid 1px #ddd}#loco-admin.wrap div.auto-comp-result>*{display:inline-block;vertical-align:middle;line-height:normal}#loco-admin.wrap div.auto-comp-result .icon:before{padding-right:5px}#loco-admin.wrap div.auto-comp-result:hover{background:#a8a8a8;color:#fff;border-top-color:#a8a8a8;border-bottom-color:#999}#loco-admin.wrap div.auto-comp-result.selected{background:#666 !important;color:#fff;border-top-color:#666;border-bottom-color:#666}#loco-admin.wrap div.auto-comp-result .lang,#loco-admin.wrap div.auto-comp-result .region,#loco-admin.wrap div.auto-comp-result .variant-wales,#loco-admin.wrap div.auto-comp-result .region-gb.lang-cy,#loco-admin.wrap div.auto-comp-result .variant-scotland,#loco-admin.wrap div.auto-comp-result .region-gb.lang-gd,#loco-admin.wrap div.auto-comp-result .variant-valencia,#loco-admin.wrap div.auto-comp-result .region-es.variant-valencia,#loco-admin.wrap div.auto-comp-result .lang-ca,#loco-admin.wrap div.auto-comp-result .region-es.lang-ca,#loco-admin.wrap div.auto-comp-result .lang-eo,#loco-admin.wrap div.auto-comp-result .lang-eu,#loco-admin.wrap div.auto-comp-result .avtr{margin-right:5px}#loco-admin.wrap div.auto-comp-wrap.error a.icon.clear:before{color:#c00;opacity:1}#loco-admin.wrap div.auto-comp-wrap.error input[type=text]{border-color:#c00;color:#c00}#loco-admin.wrap div.auto-comp-wrap.error input[type=text]:focus{-webkit-box-shadow:0 0 .5em 0 rgba(153,0,0,.5);-moz-box-shadow:0 0 .5em 0 rgba(153,0,0,.5);box-shadow:0 0 .5em 0 rgba(153,0,0,.5)}#loco-admin.wrap ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}#loco-admin.wrap ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.3) 0 0 no-repeat;min-height:75px}#loco-admin.wrap ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-admin.wrap ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.3);background-size:16px}#loco-admin.wrap ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.3);background-size:16px}}#loco-admin.wrap ._green_glow_inner{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-admin.wrap ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-admin.wrap .loco-font,#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after,#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-admin.wrap .has-icon:before{display:inline-block;padding-right:.3em}#loco-admin.wrap a.icon-help{cursor:help}#loco-admin.wrap a.icon-help span{display:none}#loco-admin.wrap .icon-notag:before{content:""}#loco-admin.wrap .icon-magnify:before{content:"🔍"}#loco-admin.wrap .icon-python:before{content:"🐍"}#loco-admin.wrap .icon-unicode:before{content:"u"}#loco-admin.wrap .icon-json:before{content:"{"}#loco-admin.wrap .icon-bullist:before{content:""}#loco-admin.wrap .icon-numlist:before{content:""}#loco-admin.wrap .icon-indent:before{content:""}#loco-admin.wrap .icon-outdent:before{content:""}#loco-admin.wrap .icon-link:before{content:""}#loco-admin.wrap .icon-unlink:before{content:""}#loco-admin.wrap .icon-bold:before{content:"B"}#loco-admin.wrap .icon-italic:before{content:"I"}#loco-admin.wrap .icon-translate:before{content:""}#loco-admin.wrap .icon-proj:before{content:""}#loco-admin.wrap .icon-plural:before{content:"᛬"}#loco-admin.wrap .icon-max:before,#loco-admin.wrap .icon-full-screen:before{content:""}#loco-admin.wrap .icon-min:before{content:""}#loco-admin.wrap .icon-sort:before{content:""}#loco-admin.wrap .icon-ok:before,#loco-admin.wrap .notice-success>.has-icon:before,#loco-admin.wrap .notice-success p>strong.has-icon:before{content:"✓"}#loco-admin.wrap .icon-ok-empty:before{content:"🗌"}#loco-admin.wrap .icon-checkbox-checked:before,#loco-admin.wrap .selector.multi li.checked .icon-checkbox:before{content:"☑"}#loco-admin.wrap .icon-checkbox-unchecked:before{content:"☐"}#loco-admin.wrap .icon-checkbox-partial:before{content:"☉"}#loco-admin.wrap .icon-radio-checked:before{content:"⚫"}#loco-admin.wrap .icon-radio-unchecked:before{content:"⚪"}#loco-admin.wrap .icon-ext:before{content:"⬈"}#loco-admin.wrap .icon-share:before{content:""}#loco-admin.wrap .icon-star:before{content:""}#loco-admin.wrap .icon-user:before{content:""}#loco-admin.wrap .icon-remove:before,#loco-admin.wrap a.icon.close:before{content:"×"}#loco-admin.wrap .icon-cog:before{content:""}#loco-admin.wrap .icon-trash:before{content:""}#loco-admin.wrap .icon-time:before,#loco-admin.wrap .icon-history:before{content:""}#loco-admin.wrap .icon-download:before{content:""}#loco-admin.wrap .icon-revert:before{content:""}#loco-admin.wrap .icon-sync:before{content:""}#loco-admin.wrap .icon-lock:before,#loco-admin.wrap .notice-locked>.has-icon:before,#loco-admin.wrap .notice-locked p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-flag:before{content:""}#loco-admin.wrap .icon-tag:before{content:""}#loco-admin.wrap .icon-tags:before{content:""}#loco-admin.wrap .icon-print:before{content:""}#loco-admin.wrap .icon-camera:before{content:""}#loco-admin.wrap .icon-pencil:before{content:""}#loco-admin.wrap .icon-add:before{content:""}#loco-admin.wrap .icon-del:before{content:""}#loco-admin.wrap .icon-clear:before,#loco-admin.wrap a.icon.clear:before{content:""}#loco-admin.wrap .icon-ok-sign:before{content:"✔"}#loco-admin.wrap .icon-help:before{content:"?"}#loco-admin.wrap .icon-info:before,#loco-admin.wrap .notice-info>.has-icon:before,#loco-admin.wrap .notice-info p>strong.has-icon:before{content:"ℹ"}#loco-admin.wrap .icon-cancel:before{content:""}#loco-admin.wrap .icon-warn:before,#loco-admin.wrap .notice-error>.has-icon:before,#loco-admin.wrap .notice-error p>strong.has-icon:before,#loco-admin.wrap .notice-warning>.has-icon:before,#loco-admin.wrap .notice-warning p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-comment:before{content:""}#loco-admin.wrap .icon-bar-chart:before{content:""}#loco-admin.wrap .icon-key:before{content:""}#loco-admin.wrap .icon-cogs:before{content:""}#loco-admin.wrap .icon-comments:before{content:""}#loco-admin.wrap .icon-signout:before{content:""}#loco-admin.wrap .icon-signin:before{content:""}#loco-admin.wrap .icon-upload:before{content:""}#loco-admin.wrap .icon-twitter:before{content:"🐦"}#loco-admin.wrap .icon-facebook:before{content:""}#loco-admin.wrap .icon-github:before{content:""}#loco-admin.wrap .icon-feed:before{content:""}#loco-admin.wrap .icon-globe:before{content:""}#loco-admin.wrap .icon-wrench:before,#loco-admin.wrap .notice-debug>.has-icon:before,#loco-admin.wrap .notice-debug p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-group:before{content:""}#loco-admin.wrap .icon-cloud:before{content:""}#loco-admin.wrap .icon-copy:before{content:""}#loco-admin.wrap .icon-save:before{content:""}#loco-admin.wrap .icon-menu:before{content:""}#loco-admin.wrap .icon-table:before{content:""}#loco-admin.wrap .icon-caret-down:before{content:"▼"}#loco-admin.wrap .icon-caret-up:before{content:"▲"}#loco-admin.wrap .icon-caret-right:before{content:"▶"}#loco-admin.wrap .icon-mail:before{content:""}#loco-admin.wrap .icon-cloud-upload:before{content:""}#loco-admin.wrap .icon-file:before{content:""}#loco-admin.wrap .icon-circle-white:before{content:"⚬"}#loco-admin.wrap .icon-circle-black:before{content:"●"}#loco-admin.wrap .icon-eraser:before{content:""}#loco-admin.wrap .icon-unlock:before{content:""}#loco-admin.wrap .icon-apple:before{content:""}#loco-admin.wrap .icon-android:before{content:""}#loco-admin.wrap .icon-robot:before{content:"🤖"}#loco-admin.wrap .icon-back:before{content:"⬅"}#loco-admin.wrap .icon-next:before{content:"➔"}#loco-admin.wrap .icon-arrow-up:before{content:""}#loco-admin.wrap .icon-ccard:before{content:""}#loco-admin.wrap .icon-caret-left:before{content:"◀"}#loco-admin.wrap .icon-pro:before{content:"⚡"}#loco-admin.wrap .icon-bell:before{content:""}#loco-admin.wrap .icon-code:before{content:""}#loco-admin.wrap .icon-privacy:before{content:"🛡"}#loco-admin.wrap .icon-hellip:before{content:"…"}#loco-admin.wrap .icon-vellip:before{content:"⁞"}#loco-admin.wrap .icon-collapse:before{content:""}#loco-admin.wrap .icon-expand:before{content:""}#loco-admin.wrap .icon-wordpress:before{content:""}#loco-admin.wrap .icon-database:before{content:""}#loco-admin.wrap .icon-restore:before{content:""}#loco-admin.wrap .icon-pilcrow:before{content:"¶"}#loco-admin.wrap .icon-status.is-translated:before,#loco-admin.wrap .is-translated>header>.icon-status:before{color:#2e892e;content:"✓";text-align:center}#loco-admin.wrap .icon-status.is-untranslated:before,#loco-admin.wrap .is-untranslated>header>.icon-status:before{color:#aaa;content:"×";text-align:center;font-size:1.1em}#loco-admin.wrap .icon-status.is-flagged:before,#loco-admin.wrap .is-flagged>header>.icon-status:before{color:#bd2c00;content:"";text-align:center}#loco-admin.wrap .icon-status.is-translated.is-blank:before,#loco-admin.wrap .icon-status.is-translated.is-inherit:before,#loco-admin.wrap .is-translated.is-blank>header>.icon-status:before,#loco-admin.wrap .is-translated.is-inherit>header>.icon-status:before{content:"🗌"}#loco-admin.wrap .icon-status.is-fuzzy:before,#loco-admin.wrap .is-fuzzy>header>.icon-status:before{color:#666;content:""}#loco-admin.wrap .lang,#loco-admin.wrap .region,#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy,#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd,#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia,#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca,#loco-admin.wrap .lang-eo,#loco-admin.wrap .lang-eu{color:#fff;background:#2e892e;display:inline-block;text-transform:uppercase;overflow:hidden;font-family:Verdana,Arial,sans-serif;font-size:9px;font-weight:normal;font-style:normal;line-height:12px;text-align:center;white-space:normal;text-shadow:none}#loco-admin.wrap .lang{width:20px;height:12px;line-height:12px;vertical-align:middle}#loco-admin.wrap .lang:before{content:attr(lang);vertical-align:baseline}#loco-admin.wrap .no-lang{width:18px;height:10px;border:solid 1px #2e892e;background:transparent}#loco-admin.wrap .lang-el{background-color:#1d48a3}#loco-admin.wrap .lang-el:before{content:"Ελ"}#loco-admin.wrap .region,#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy,#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd,#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia,#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca,#loco-admin.wrap .lang-eo,#loco-admin.wrap .lang-eu{width:16px;height:12px;margin:0 2px;background-image:url(../img/flags.png?v=2.5.3);background-repeat:no-repeat;background-color:transparent}#loco-admin.wrap .region:before,#loco-admin.wrap .variant-wales:before,#loco-admin.wrap .region-gb.lang-cy:before,#loco-admin.wrap .variant-scotland:before,#loco-admin.wrap .region-gb.lang-gd:before,#loco-admin.wrap .variant-valencia:before,#loco-admin.wrap .region-es.variant-valencia:before,#loco-admin.wrap .lang-ca:before,#loco-admin.wrap .region-es.lang-ca:before,#loco-admin.wrap .lang-eo:before,#loco-admin.wrap .lang-eu:before{visibility:hidden}#loco-admin.wrap .lang-zh{background-color:#b90000}#loco-admin.wrap .lang-zh.script-hans:before{content:"中国"}#loco-admin.wrap .lang-zh.script-hant:before{content:"中國"}#loco-admin.wrap .__{background-position:0 0}#loco-admin.wrap .lang-eo{background-position:0 -12px}#loco-admin.wrap .lang-eu{background-position:0 -24px}#loco-admin.wrap .lang-ca,#loco-admin.wrap .region-es.lang-ca{background-position:0 -36px}#loco-admin.wrap .region-tg{background-position:0 -48px}#loco-admin.wrap .region-me{background-position:0 -60px}#loco-admin.wrap .region-la{background-position:0 -73px}#loco-admin.wrap .region-mr{background-position:0 -85px}#loco-admin.wrap .region-ni{background-position:0 -97px}#loco-admin.wrap .region-lv{background-position:0 -109px}#loco-admin.wrap .region-om{background-position:0 -121px}#loco-admin.wrap .region-af{background-position:0 -133px}#loco-admin.wrap .region-cy{background-position:0 -145px}#loco-admin.wrap .region-bj{background-position:0 -157px}#loco-admin.wrap .region-aq{background-position:0 -169px}#loco-admin.wrap .region-cn{background-position:0 -186px}#loco-admin.wrap .region-co{background-position:0 -198px}#loco-admin.wrap .region-cx{background-position:0 -210px}#loco-admin.wrap .region-ag{background-position:0 -222px}#loco-admin.wrap .region-ms{background-position:0 -234px}#loco-admin.wrap .region-md{background-position:0 -246px}#loco-admin.wrap .region-zm{background-position:0 -258px}#loco-admin.wrap .region-vn{background-position:0 -270px}#loco-admin.wrap .region-tf{background-position:0 -282px}#loco-admin.wrap .region-td{background-position:0 -294px}#loco-admin.wrap .region-yt{background-position:0 -306px}#loco-admin.wrap .region-lb{background-position:0 -318px}#loco-admin.wrap .region-mf{background-position:0 -330px}#loco-admin.wrap .region-lu{background-position:0 -347px}#loco-admin.wrap .region-mq{background-position:0 -359px}#loco-admin.wrap .region-cz{background-position:0 -371px}#loco-admin.wrap .region-ae{background-position:0 -383px}#loco-admin.wrap .region-cm{background-position:0 -395px}#loco-admin.wrap .region-bi{background-position:0 -407px}#loco-admin.wrap .region-ar{background-position:0 -419px}#loco-admin.wrap .region-as{background-position:0 -431px}#loco-admin.wrap .region-bh{background-position:0 -443px}#loco-admin.wrap .region-cl{background-position:0 -455px}#loco-admin.wrap .region-ad{background-position:0 -467px}#loco-admin.wrap .region-mp{background-position:0 -479px}#loco-admin.wrap .region-lt{background-position:0 -491px}#loco-admin.wrap .region-mg{background-position:0 -503px}#loco-admin.wrap .region-lc{background-position:0 -515px}#loco-admin.wrap .region-tr{background-position:0 -527px}#loco-admin.wrap .region-ua{background-position:0 -539px}#loco-admin.wrap .region-tv{background-position:0 -551px}#loco-admin.wrap .region-vi{background-position:0 -563px}#loco-admin.wrap .region-mt{background-position:0 -575px}#loco-admin.wrap .region-no{background-position:0 -587px}#loco-admin.wrap .region-mc{background-position:0 -599px}#loco-admin.wrap .region-ch{background-position:0 -611px}#loco-admin.wrap .region-bl{background-position:0 -623px}#loco-admin.wrap .region-aw{background-position:0 -640px}#loco-admin.wrap .region-bz{background-position:0 -652px}#loco-admin.wrap .region-bm{background-position:0 -664px}#loco-admin.wrap .region-ci{background-position:0 -676px}#loco-admin.wrap .region-mu{background-position:0 -688px}#loco-admin.wrap .region-us{background-position:0 -700px}#loco-admin.wrap .region-tw{background-position:0 -712px}#loco-admin.wrap .region-ye{background-position:0 -724px}#loco-admin.wrap .region-mw{background-position:0 -736px}#loco-admin.wrap .region-nl{background-position:0 -748px}#loco-admin.wrap .region-ls{background-position:0 -760px}#loco-admin.wrap .region-bo{background-position:0 -772px}#loco-admin.wrap .region-at{background-position:0 -784px}#loco-admin.wrap .region-ck{background-position:0 -796px}#loco-admin.wrap .region-by{background-position:0 -808px}#loco-admin.wrap .region-au{background-position:0 -820px}#loco-admin.wrap .region-bn{background-position:0 -832px}#loco-admin.wrap .region-ma{background-position:0 -844px}#loco-admin.wrap .region-nz{background-position:0 -856px}#loco-admin.wrap .region-lr{background-position:0 -868px}#loco-admin.wrap .region-mv{background-position:0 -880px}#loco-admin.wrap .region-tc{background-position:0 -892px}#loco-admin.wrap .region-ug{background-position:0 -904px}#loco-admin.wrap .region-tt{background-position:0 -916px}#loco-admin.wrap .region-pl{background-position:0 -928px}#loco-admin.wrap .region-rs{background-position:0 -940px}#loco-admin.wrap .region-in{background-position:0 -952px}#loco-admin.wrap .region-ge{background-position:0 -964px}#loco-admin.wrap .region-gr{background-position:0 -976px}#loco-admin.wrap .region-gs{background-position:0 -988px}#loco-admin.wrap .region-gd{background-position:0 -1000px}#loco-admin.wrap .region-io{background-position:0 -1012px}#loco-admin.wrap .region-hk{background-position:0 -1024px}#loco-admin.wrap .region-kp{background-position:0 -1036px}#loco-admin.wrap .region-kg{background-position:0 -1048px}#loco-admin.wrap .region-pm{background-position:0 -1060px}#loco-admin.wrap .region-sv{background-position:0 -1072px}#loco-admin.wrap .region-re{background-position:0 -1084px}#loco-admin.wrap .region-sa{background-position:0 -1096px}#loco-admin.wrap .region-sc{background-position:0 -1108px}#loco-admin.wrap .region-st{background-position:0 -1120px}#loco-admin.wrap .region-ke{background-position:0 -1132px}#loco-admin.wrap .region-im{background-position:0 -1144px}#loco-admin.wrap .region-kr{background-position:0 -1161px}#loco-admin.wrap .region-gf{background-position:0 -1173px}#loco-admin.wrap .region-dj{background-position:0 -1185px}#loco-admin.wrap .region-gq{background-position:0 -1197px}#loco-admin.wrap .region-gp{background-position:0 -1209px}#loco-admin.wrap .region-dk{background-position:0 -1221px}#loco-admin.wrap .region-gg{background-position:0 -1233px}#loco-admin.wrap .region-il{background-position:0 -1250px}#loco-admin.wrap .region-pn{background-position:0 -1262px}#loco-admin.wrap .region-sb{background-position:0 -1274px}#loco-admin.wrap .region-py{background-position:0 -1286px}#loco-admin.wrap .region-ru{background-position:0 -1298px}#loco-admin.wrap .region-kw{background-position:0 -1310px}#loco-admin.wrap .region-do{background-position:0 -1322px}#loco-admin.wrap .region-gt{background-position:0 -1334px}#loco-admin.wrap .region-gb{background-position:0 -1346px}#loco-admin.wrap .region-gu{background-position:0 -1358px}#loco-admin.wrap .region-je{background-position:0 -1370px}#loco-admin.wrap .region-hm{background-position:0 -1387px}#loco-admin.wrap .region-sg{background-position:0 -1399px}#loco-admin.wrap .region-pk{background-position:0 -1411px}#loco-admin.wrap .region-sr{background-position:0 -1423px}#loco-admin.wrap .region-se{background-position:0 -1435px}#loco-admin.wrap .region-jp{background-position:0 -1447px}#loco-admin.wrap .region-gw{background-position:0 -1459px}#loco-admin.wrap .region-eh{background-position:0 -1471px}#loco-admin.wrap .region-dz{background-position:0 -1483px}#loco-admin.wrap .region-ga{background-position:0 -1495px}#loco-admin.wrap .region-fr{background-position:0 -1507px}#loco-admin.wrap .region-dm{background-position:0 -1519px}#loco-admin.wrap .region-hn{background-position:0 -1531px}#loco-admin.wrap .region-sd{background-position:0 -1543px}#loco-admin.wrap .region-rw{background-position:0 -1555px}#loco-admin.wrap .region-ph{background-position:0 -1567px}#loco-admin.wrap .region-ss{background-position:0 -1579px}#loco-admin.wrap .region-qa{background-position:0 -1596px}#loco-admin.wrap .region-pe{background-position:0 -1608px}#loco-admin.wrap .region-pr{background-position:0 -1620px}#loco-admin.wrap .region-si{background-position:0 -1632px}#loco-admin.wrap .region-ht{background-position:0 -1644px}#loco-admin.wrap .region-es{background-position:0 -1656px}#loco-admin.wrap .region-gl{background-position:0 -1668px}#loco-admin.wrap .region-gm{background-position:0 -1680px}#loco-admin.wrap .region-er{background-position:0 -1692px}#loco-admin.wrap .region-fi{background-position:0 -1704px}#loco-admin.wrap .region-ee{background-position:0 -1716px}#loco-admin.wrap .region-kn{background-position:0 -1728px}#loco-admin.wrap .region-hu{background-position:0 -1740px}#loco-admin.wrap .region-iq{background-position:0 -1752px}#loco-admin.wrap .region-ky{background-position:0 -1764px}#loco-admin.wrap .region-sh{background-position:0 -1776px}#loco-admin.wrap .region-ps{background-position:0 -1788px}#loco-admin.wrap .region-pf{background-position:0 -1800px}#loco-admin.wrap .region-sj{background-position:0 -1812px}#loco-admin.wrap .region-id{background-position:0 -1824px}#loco-admin.wrap .region-is{background-position:0 -1836px}#loco-admin.wrap .region-eg{background-position:0 -1848px}#loco-admin.wrap .region-fk{background-position:0 -1860px}#loco-admin.wrap .region-fj{background-position:0 -1872px}#loco-admin.wrap .region-gn{background-position:0 -1884px}#loco-admin.wrap .region-gy{background-position:0 -1896px}#loco-admin.wrap .region-ir{background-position:0 -1908px}#loco-admin.wrap .region-km{background-position:0 -1920px}#loco-admin.wrap .region-ie{background-position:0 -1932px}#loco-admin.wrap .region-kz{background-position:0 -1944px}#loco-admin.wrap .region-ro{background-position:0 -1956px}#loco-admin.wrap .region-sk{background-position:0 -1968px}#loco-admin.wrap .region-pg{background-position:0 -1980px}#loco-admin.wrap .region-pt{background-position:0 -1992px}#loco-admin.wrap .region-so{background-position:0 -2004px}#loco-admin.wrap .region-sx{background-position:0 -2016px}#loco-admin.wrap .region-hr{background-position:0 -2033px}#loco-admin.wrap .region-ki{background-position:0 -2045px}#loco-admin.wrap .region-jm{background-position:0 -2057px}#loco-admin.wrap .region-ec{background-position:0 -2069px}#loco-admin.wrap .region-et{background-position:0 -2081px}#loco-admin.wrap .region-fo{background-position:0 -2093px}#loco-admin.wrap .region-kh{background-position:0 -2105px}#loco-admin.wrap .region-sy{background-position:0 -2117px}#loco-admin.wrap .region-sn{background-position:0 -2129px}#loco-admin.wrap .region-pw{background-position:0 -2141px}#loco-admin.wrap .region-sl{background-position:0 -2153px}#loco-admin.wrap .region-fm{background-position:0 -2165px}#loco-admin.wrap .region-gi{background-position:0 -2177px}#loco-admin.wrap .region-de{background-position:0 -2189px}#loco-admin.wrap .region-gh{background-position:0 -2201px}#loco-admin.wrap .region-jo{background-position:0 -2213px}#loco-admin.wrap .region-it{background-position:0 -2225px}#loco-admin.wrap .region-pa{background-position:0 -2237px}#loco-admin.wrap .region-sz{background-position:0 -2249px}#loco-admin.wrap .region-sm{background-position:0 -2261px}#loco-admin.wrap .region-tn{background-position:0 -2273px}#loco-admin.wrap .region-ml{background-position:0 -2285px}#loco-admin.wrap .region-cg{background-position:0 -2297px}#loco-admin.wrap .region-ax{background-position:0 -2309px}#loco-admin.wrap .region-ao{background-position:0 -2321px}#loco-admin.wrap .region-bt{background-position:0 -2333px}#loco-admin.wrap .region-an{background-position:0 -2345px}#loco-admin.wrap .region-bb{background-position:0 -2357px}#loco-admin.wrap .region-cf{background-position:0 -2369px}#loco-admin.wrap .region-mm{background-position:0 -2381px}#loco-admin.wrap .region-li{background-position:0 -2393px}#loco-admin.wrap .region-na{background-position:0 -2405px}#loco-admin.wrap .region-mz{background-position:0 -2417px}#loco-admin.wrap .region-to{background-position:0 -2429px}#loco-admin.wrap .region-vg{background-position:0 -2441px}#loco-admin.wrap .region-ve{background-position:0 -2453px}#loco-admin.wrap .region-tz{background-position:0 -2465px}#loco-admin.wrap .region-tm{background-position:0 -2477px}#loco-admin.wrap .region-mx{background-position:0 -2489px}#loco-admin.wrap .region-nc{background-position:0 -2501px}#loco-admin.wrap .region-mo{background-position:0 -2513px}#loco-admin.wrap .region-lk{background-position:0 -2525px}#loco-admin.wrap .region-cd{background-position:0 -2537px}#loco-admin.wrap .region-al{background-position:0 -2549px}#loco-admin.wrap .region-bw{background-position:0 -2561px}#loco-admin.wrap .region-cs{background-position:0 -2573px}#loco-admin.wrap .region-cr{background-position:0 -2585px}#loco-admin.wrap .region-bv{background-position:0 -2597px}#loco-admin.wrap .region-am{background-position:0 -2609px}#loco-admin.wrap .region-az{background-position:0 -2621px}#loco-admin.wrap .region-ba{background-position:0 -2633px}#loco-admin.wrap .region-mn{background-position:0 -2645px}#loco-admin.wrap .region-nu{background-position:0 -2657px}#loco-admin.wrap .region-my{background-position:0 -2669px}#loco-admin.wrap .region-tl{background-position:0 -2681px}#loco-admin.wrap .region-ws{background-position:0 -2693px}#loco-admin.wrap .region-th{background-position:0 -2705px}#loco-admin.wrap .region-nf{background-position:0 -2717px}#loco-admin.wrap .region-ly{background-position:0 -2729px}#loco-admin.wrap .region-ai{background-position:0 -2741px}#loco-admin.wrap .region-br{background-position:0 -2753px}#loco-admin.wrap .region-cv{background-position:0 -2765px}#loco-admin.wrap .region-be{background-position:0 -2777px}#loco-admin.wrap .region-ca{background-position:0 -2789px}#loco-admin.wrap .region-bd{background-position:0 -2801px}#loco-admin.wrap .region-cw{background-position:0 -2813px}#loco-admin.wrap .region-bs{background-position:0 -2830px}#loco-admin.wrap .region-ng{background-position:0 -2842px}#loco-admin.wrap .region-mk{background-position:0 -2854px}#loco-admin.wrap .region-np{background-position:0 -2866px}#loco-admin.wrap .region-va{background-position:0 -2878px}#loco-admin.wrap .region-uz{background-position:0 -2890px}#loco-admin.wrap .region-um{background-position:0 -2902px}#loco-admin.wrap .region-tk{background-position:0 -2914px}#loco-admin.wrap .region-vc{background-position:0 -2926px}#loco-admin.wrap .region-zw{background-position:0 -2938px}#loco-admin.wrap .region-nr{background-position:0 -2950px}#loco-admin.wrap .region-ne{background-position:0 -2962px}#loco-admin.wrap .region-cu{background-position:0 -2974px}#loco-admin.wrap .region-bq{background-position:0 -2986px}#loco-admin.wrap .region-bf{background-position:0 -2998px}#loco-admin.wrap .region-bg{background-position:0 -3010px}#loco-admin.wrap .region-cc{background-position:0 -3022px}#loco-admin.wrap .region-mh{background-position:0 -3034px}#loco-admin.wrap .region-za{background-position:0 -3046px}#loco-admin.wrap .region-uy{background-position:0 -3058px}#loco-admin.wrap .region-wf{background-position:0 -3070px}#loco-admin.wrap .region-vu{background-position:0 -3082px}#loco-admin.wrap .region-tj{background-position:0 -3094px}#loco-admin.wrap .variant-scotland,#loco-admin.wrap .region-gb.lang-gd{background-position:0 -3106px}#loco-admin.wrap .variant-valencia,#loco-admin.wrap .region-es.variant-valencia{background-position:0 -3118px}#loco-admin.wrap .variant-wales,#loco-admin.wrap .region-gb.lang-cy{background-position:0 -3130px}#loco-admin.wrap .x-eu{background-position:0 -3142px}#loco-admin.wrap span.lang code{display:none}#loco-admin.wrap .icon-notag:before{content:""}#loco-admin.wrap .icon-magnify:before{content:"🔍"}#loco-admin.wrap .icon-python:before{content:"🐍"}#loco-admin.wrap .icon-unicode:before{content:"u"}#loco-admin.wrap .icon-json:before{content:"{"}#loco-admin.wrap .icon-bullist:before{content:""}#loco-admin.wrap .icon-numlist:before{content:""}#loco-admin.wrap .icon-indent:before{content:""}#loco-admin.wrap .icon-outdent:before{content:""}#loco-admin.wrap .icon-link:before{content:""}#loco-admin.wrap .icon-unlink:before{content:""}#loco-admin.wrap .icon-bold:before{content:"B"}#loco-admin.wrap .icon-italic:before{content:"I"}#loco-admin.wrap .icon-translate:before{content:""}#loco-admin.wrap .icon-proj:before{content:""}#loco-admin.wrap .icon-plural:before{content:"᛬"}#loco-admin.wrap .icon-max:before,#loco-admin.wrap .icon-full-screen:before{content:""}#loco-admin.wrap .icon-min:before{content:""}#loco-admin.wrap .icon-sort:before{content:""}#loco-admin.wrap .icon-ok:before,#loco-admin.wrap .notice-success>.has-icon:before,#loco-admin.wrap .notice-success p>strong.has-icon:before{content:"✓"}#loco-admin.wrap .icon-ok-empty:before{content:"🗌"}#loco-admin.wrap .icon-checkbox-checked:before,#loco-admin.wrap .selector.multi li.checked .icon-checkbox:before{content:"☑"}#loco-admin.wrap .icon-checkbox-unchecked:before{content:"☐"}#loco-admin.wrap .icon-checkbox-partial:before{content:"☉"}#loco-admin.wrap .icon-radio-checked:before{content:"⚫"}#loco-admin.wrap .icon-radio-unchecked:before{content:"⚪"}#loco-admin.wrap .icon-ext:before{content:"⬈"}#loco-admin.wrap .icon-share:before{content:""}#loco-admin.wrap .icon-star:before{content:""}#loco-admin.wrap .icon-user:before{content:""}#loco-admin.wrap .icon-remove:before,#loco-admin.wrap a.icon.close:before{content:"×"}#loco-admin.wrap .icon-cog:before{content:""}#loco-admin.wrap .icon-trash:before{content:""}#loco-admin.wrap .icon-time:before,#loco-admin.wrap .icon-history:before{content:""}#loco-admin.wrap .icon-download:before{content:""}#loco-admin.wrap .icon-revert:before{content:""}#loco-admin.wrap .icon-sync:before{content:""}#loco-admin.wrap .icon-lock:before,#loco-admin.wrap .notice-locked>.has-icon:before,#loco-admin.wrap .notice-locked p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-flag:before{content:""}#loco-admin.wrap .icon-tag:before{content:""}#loco-admin.wrap .icon-tags:before{content:""}#loco-admin.wrap .icon-print:before{content:""}#loco-admin.wrap .icon-camera:before{content:""}#loco-admin.wrap .icon-pencil:before{content:""}#loco-admin.wrap .icon-add:before{content:""}#loco-admin.wrap .icon-del:before{content:""}#loco-admin.wrap .icon-clear:before,#loco-admin.wrap a.icon.clear:before{content:""}#loco-admin.wrap .icon-ok-sign:before{content:"✔"}#loco-admin.wrap .icon-help:before{content:"?"}#loco-admin.wrap .icon-info:before,#loco-admin.wrap .notice-info>.has-icon:before,#loco-admin.wrap .notice-info p>strong.has-icon:before{content:"ℹ"}#loco-admin.wrap .icon-cancel:before{content:""}#loco-admin.wrap .icon-warn:before,#loco-admin.wrap .notice-error>.has-icon:before,#loco-admin.wrap .notice-error p>strong.has-icon:before,#loco-admin.wrap .notice-warning>.has-icon:before,#loco-admin.wrap .notice-warning p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-comment:before{content:""}#loco-admin.wrap .icon-bar-chart:before{content:""}#loco-admin.wrap .icon-key:before{content:""}#loco-admin.wrap .icon-cogs:before{content:""}#loco-admin.wrap .icon-comments:before{content:""}#loco-admin.wrap .icon-signout:before{content:""}#loco-admin.wrap .icon-signin:before{content:""}#loco-admin.wrap .icon-upload:before{content:""}#loco-admin.wrap .icon-twitter:before{content:"🐦"}#loco-admin.wrap .icon-facebook:before{content:""}#loco-admin.wrap .icon-github:before{content:""}#loco-admin.wrap .icon-feed:before{content:""}#loco-admin.wrap .icon-globe:before{content:""}#loco-admin.wrap .icon-wrench:before,#loco-admin.wrap .notice-debug>.has-icon:before,#loco-admin.wrap .notice-debug p>strong.has-icon:before{content:""}#loco-admin.wrap .icon-group:before{content:""}#loco-admin.wrap .icon-cloud:before{content:""}#loco-admin.wrap .icon-copy:before{content:""}#loco-admin.wrap .icon-save:before{content:""}#loco-admin.wrap .icon-menu:before{content:""}#loco-admin.wrap .icon-table:before{content:""}#loco-admin.wrap .icon-caret-down:before{content:"▼"}#loco-admin.wrap .icon-caret-up:before{content:"▲"}#loco-admin.wrap .icon-caret-right:before{content:"▶"}#loco-admin.wrap .icon-mail:before{content:""}#loco-admin.wrap .icon-cloud-upload:before{content:""}#loco-admin.wrap .icon-file:before{content:""}#loco-admin.wrap .icon-circle-white:before{content:"⚬"}#loco-admin.wrap .icon-circle-black:before{content:"●"}#loco-admin.wrap .icon-eraser:before{content:""}#loco-admin.wrap .icon-unlock:before{content:""}#loco-admin.wrap .icon-apple:before{content:""}#loco-admin.wrap .icon-android:before{content:""}#loco-admin.wrap .icon-robot:before{content:"🤖"}#loco-admin.wrap .icon-back:before{content:"⬅"}#loco-admin.wrap .icon-next:before{content:"➔"}#loco-admin.wrap .icon-arrow-up:before{content:""}#loco-admin.wrap .icon-ccard:before{content:""}#loco-admin.wrap .icon-caret-left:before{content:"◀"}#loco-admin.wrap .icon-pro:before{content:"⚡"}#loco-admin.wrap .icon-bell:before{content:""}#loco-admin.wrap .icon-code:before{content:""}#loco-admin.wrap .icon-privacy:before{content:"🛡"}#loco-admin.wrap .icon-hellip:before{content:"…"}#loco-admin.wrap .icon-vellip:before{content:"⁞"}#loco-admin.wrap .icon-collapse:before{content:""}#loco-admin.wrap .icon-expand:before{content:""}#loco-admin.wrap .icon-wordpress:before{content:""}#loco-admin.wrap .icon-database:before{content:""}#loco-admin.wrap .icon-restore:before{content:""}#loco-admin.wrap .icon-pilcrow:before{content:"¶"}#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before,#loco-admin.wrap .has-dashicon:before{speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-admin.wrap .icon,#loco-admin.wrap .has-icon:before{font-family:"loco"}#loco-admin.wrap .has-dashicon:before{font-family:"dashicons";font-size:1.4em}#loco-admin.wrap .has-icon:before,#loco-admin.wrap .has-dashicon:before,#loco-admin.wrap .has-icon>span{display:inline-block;vertical-align:middle}#loco-admin.wrap .only-icon{text-align:center}#loco-admin.wrap .only-icon:before{text-align:center;padding:0}#loco-admin.wrap .only-icon span{display:none}#loco-admin.wrap a,#loco-admin.wrap .wp-core-ui .button-link{text-decoration:none}#loco-admin.wrap h3:hover>a.loco-anchor{color:#ccc}#loco-admin.wrap h3:hover>a.loco-anchor:before{content:"¶"}#loco-admin.wrap .has-lang>span{display:inline-block;vertical-align:middle}#loco-admin.wrap a.has-lang:hover>span:last-child{text-decoration:underline}#loco-admin.wrap h1 ul,#loco-admin.wrap h1 li{margin:0;padding:0}#loco-admin.wrap h1 li{display:inline-block}#loco-admin.wrap h1 li:after{content:"/";color:#999;text-shadow:none;display:inline-block}#loco-admin.wrap h1 li:last-child:after{content:""}#loco-admin.wrap h1 li:last-child a{color:inherit;pointer-events:none;cursor:auto}#loco-admin.wrap h2 span{color:#999;font-weight:normal}#loco-admin.wrap h2 .loco-meta,#loco-admin.wrap h3 .loco-meta{color:inherit;font-size:14px;font-weight:normal;vertical-align:middle}#loco-admin.wrap .wp-list-table td:first-child .icon{width:16px;display:inline-block;text-align:center}#loco-admin.wrap .wp-list-table td{white-space:nowrap}#loco-admin.wrap .wp-list-table td>a,#loco-admin.wrap .wp-list-table td>time{display:inline-block;max-width:100%;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;-o-text-overflow:ellipsis;-ms-text-overflow:ellipsis}#loco-admin.wrap .wp-list-table th.loco-sort{cursor:pointer}#loco-admin.wrap .wp-list-table th.loco-sort:hover{color:#000}#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after,#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after{padding:0 0 0 4px;color:#999}#loco-admin.wrap .wp-list-table th.loco-sort.loco-desc:after{content:"▼"}#loco-admin.wrap .wp-list-table th.loco-sort.loco-asc:after{content:"▲"}#loco-admin.wrap .wp-list-table td.has-row-actions{overflow:visible}#loco-admin.wrap form.loco-filter{display:block;margin-bottom:5px}#loco-admin.wrap form.loco-filter .icon-filter{color:#999}#loco-admin.wrap nav.above-list-table{margin-bottom:1em}#loco-admin.wrap nav.above-list-table a{display:inline-block;margin-right:1em}#loco-admin.wrap .wp-core-ui button.inverted,#loco-admin.wrap .wp-core-ui button.inverted:hover,#loco-admin.wrap .po-fuzzy button.icon-cloud{background:-moz-linear-gradient(top, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);background:-webkit-linear-gradient(top, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);background:linear-gradient(to bottom, #cccccc 0%, #e0e0e0 30%, #fefefe 100%);-webkit-box-shadow:0 1px 0 #fff;-moz-box-shadow:0 1px 0 #fff;box-shadow:0 1px 0 #fff;border-color:gray}#loco-admin.wrap .wp-core-ui button:active,#loco-admin.wrap .wp-core-ui button.inverted:active{border-color:#5b9dd9}#loco-admin.wrap .loco-clearable{display:inline-block;vertical-align:middle;position:relative}#loco-admin.wrap .loco-clearable a.clear,#loco-admin.wrap .auto-comp-wrap a.clear{top:0;right:0;outline:none;margin:0;border:solid 1px transparent;padding:5px 5px;position:absolute;font-size:1em;line-height:normal}#loco-admin.wrap .loco-clearable a.clear:before,#loco-admin.wrap .auto-comp-wrap a.clear:before{vertical-align:middle;padding:0;color:#999}#loco-admin.wrap .loco-clearable a.clear:hover:before,#loco-admin.wrap .auto-comp-wrap a.clear:hover:before{color:#333}#loco-admin.wrap .loco-clearable a.clear span,#loco-admin.wrap .auto-comp-wrap a.clear span{display:none}#loco-admin.wrap .loco-clearable ::-ms-clear,#loco-admin.wrap .auto-comp-wrap ::-ms-clear{display:none}#loco-admin.wrap div.progress{color:#000;background:transparent !important}#loco-admin.wrap div.progress *{height:100%;overflow:hidden;white-space:nowrap}#loco-admin.wrap div.progress .t{background-color:#ddd;border:1px solid #ccc}#loco-admin.wrap div.progress .t .bar{float:left;clear:none;background-color:#3db63d}#loco-admin.wrap div.progress .t .bar.f{background-color:#bd2c00}#loco-admin.wrap div.progress .l{display:block}#loco-admin.wrap td div.progress .t{border:none}#loco-admin.wrap td div.progress .l{display:none}#loco-admin.wrap code.path{color:#333;margin:0;padding:0;display:inline;background:transparent}#loco-admin.wrap .loco-danger{color:#d54e21}#loco-admin.wrap .notice,#loco-admin.wrap .panel{background:#fff;position:relative;margin:1em 0;padding:1px 12px}#loco-admin.wrap .notice-generic{border-color:#ddd}#loco-admin.wrap .notice-success>.has-icon,#loco-admin.wrap .notice-success p>strong.has-icon{color:#000}#loco-admin.wrap .notice-warning{border-color:orange}#loco-admin.wrap .notice-error{border-color:#dc3232}#loco-admin.wrap .notice-debug{border-color:#00a0d2}#loco-admin.wrap .notice-danger{border-color:#dc3232}#loco-admin.wrap .notice-locked{border-color:orange}#loco-admin.wrap .notice>.has-icon:before,#loco-admin.wrap .notice p>strong.has-icon:before{padding-right:6px}#loco-admin.wrap .notice>p>a.button.has-icon:before{width:1.2em}#loco-admin.wrap .notice>p>em{color:#d54e21;font-style:normal}#loco-admin.wrap .notice>p>em a{color:inherit}#loco-admin.wrap .notice>p a:hover,#loco-admin.wrap .notice>nav a:hover{text-decoration:underline}#loco-admin.wrap .notice>p a.button,#loco-admin.wrap .notice>nav a.button{text-decoration:inherit}#loco-admin.wrap .notice.has-nav{display:flex;flex-direction:row}#loco-admin.wrap .notice.has-nav p,#loco-admin.wrap .notice.has-nav nav{line-height:22px;flex-grow:1}#loco-admin.wrap .notice.has-nav nav{text-align:right;padding:2px;margin:.5em 0}#loco-admin.wrap .notice.has-nav.is-dismissible{padding-right:38px}#loco-admin.wrap .notice.has-nav a{white-space:nowrap}#loco-admin.wrap .notice.has-nav nav>span{color:#666}#loco-admin.wrap .notice>h3>span{display:inline-block;vertical-align:middle}#loco-admin.wrap ul.problems li{font-style:italic}#loco-admin.wrap label{position:relative}#loco-admin.wrap label.for-disabled,#loco-admin.wrap label.for-disabled>input{cursor:default !important}#loco-admin.wrap input.regular-text,#loco-admin.wrap textarea.regular-text{width:25em}#loco-admin.wrap .button-link{padding:0 10px 1px}#loco-admin.wrap .button-danger{background:#ba0000;border-color:#900 #600 #600;-webkit-box-shadow:0 1px 0 #600;-moz-box-shadow:0 1px 0 #600;box-shadow:0 1px 0 #600;color:#fff;text-shadow:0 -1px 1px #600,1px 0 1px #600,0 1px 1px #600,-1px 0 1px #600}#loco-admin.wrap .button-success{background:#00b500;border-color:#090 #2e892e #2e892e;-webkit-box-shadow:0 1px 0 #2e892e;-moz-box-shadow:0 1px 0 #2e892e;box-shadow:0 1px 0 #2e892e;color:#fff;text-shadow:0 -1px 1px #2e892e,1px 0 1px #2e892e,0 1px 1px #2e892e,-1px 0 1px #2e892e}#loco-admin.wrap .button-success:hover{background:#3db63d}#loco-admin.wrap .button-danger[disabled],#loco-admin.wrap .button-success[disabled]{text-shadow:none !important}#loco-admin.wrap form button.loco-loading.button-large{padding-left:0}#loco-admin.wrap form button.loco-loading.button-large:before{width:16px;height:16px;margin:0 4px;content:" ";font-size:16px;line-height:1;display:inline-block;vertical-align:sub}#loco-admin.wrap ::placeholder{color:#ccc}#loco-admin.wrap ::-webkit-input-placeholder{color:#ccc}#loco-admin.wrap :-moz-placeholder{color:#ccc;opacity:1}#loco-admin.wrap ::-moz-placeholder{color:#ccc;opacity:1}#loco-admin.wrap :-ms-input-placeholder{color:#ccc}#loco-admin.wrap .ielt10 .placeheld{color:#ccc}#loco-admin.wrap a.has-raquo:after{content:" »"}#loco-admin.wrap a.has-laquo:before{content:"« "}#loco-admin.wrap span.inline-spinner{display:inline-block;min-width:16px;min-height:16px;background:transparent url(../img/spin-modal.gif?v=2.5.3) 0 0 no-repeat}.js #wpbody-content>.notice{display:none}.js #wpbody-content>.notice.inline{display:block}.js #loco-admin.wrap .jshide,.no-js #loco-admin.wrap .jsonly{display:none !important}#loco-admin.wrap .invis{visibility:hidden}.form-table tr td{vertical-align:top}.form-table tr.compact td{padding-top:0}.form-table tr th a.icon-help{display:none}.loco-modal{min-width:50%;min-height:100px}.loco-modal-wide{min-width:90% !important}.loco-modal-no-close .ui-dialog-titlebar-close{display:none}.loco-modal .ui-dialog-titlebar-close{overflow:hidden}.loco-modal.request-filesystem-credentials-dialog{top:15% !important;max-height:85% !important}.loco-modal.request-filesystem-credentials-dialog>.ui-dialog-content{background:inherit}.loco-modal.request-filesystem-credentials-dialog .ftp-password>label>em:last-child{display:none}.ui-dialog-content>div.loco-loading{height:100%;background:transparent url(../img/spin-modal.gif?v=2.5.3) center 20px no-repeat}#loco-po-ref ol li{color:#aaa;margin:0;white-space:pre;padding:0 0 0 1em;font:normal 12px/17px Consolas,Monaco,monospace;background:transparent;border-left:1px solid #eee}#loco-po-ref ol li code{margin:0;padding:0;display:inline;background:inherit}#loco-po-ref ol li.highlighted{color:#666;background-color:#f8eec7}#loco-po-ref ol li.highlighted code.T_CONSTANT_ENCAPSED_STRING{color:#c931c7}#loco-credit>*{vertical-align:middle}#loco-credit>a{display:inline-block;position:relative;overflow:hidden;background:transparent url(../img/logo-foot.gif?v=2.5.3) 0 0 no-repeat;height:30px;width:100px;text-indent:200px;-webkit-transition-duration:0s;transition-duration:0s}#loco-credit>a:hover{background-position:0 -35px}#loco-content{position:relative}#footer-upgrade span:before{color:#ccc;content:" | ";display:inline;padding-left:.5em;padding-right:.5em}#footer-upgrade span:first-child:before{content:"";display:none}.loco-clearfix:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}dl.debug dt{font-weight:bold}dl.debug dt,dl.debug dd{white-space:pre}.wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(0,115,170,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#0073aa;foo:#0073aa}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#66c6e4 !important;background:#008ec2 !important;border-color:#008ec2 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../img/skins/fresh/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/editor.css CHANGED Viewed

@@ -1 +1 @@

- #loco-editor{border:solid 1px #ccc}#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}#loco-editor ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.2) 0 0 no-repeat;min-height:75px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.2);background-size:16px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.2);background-size:16px}}#loco-editor ._green_glow_inner,#loco-editor .is-editable>.wg-content>textarea:focus,#loco-editor .is-editable>.wg-content.has-focus .ace_scroller,#loco-editor .is-editable>.wg-content.has-focus .wysihtml-editor,#loco-editor .is-editable>.wg-content.has-focus .mce-content-body{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-editor ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-editor .loco-font,#loco-editor .is-table .wg-thead .wg-sortable>header:after{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-editor div.ta-mirror{position:absolute;top:0;border:solid 1px transparent;color:transparent;padding:.4em .6em;pointer-events:none}#loco-editor div.ta-mirror span{position:relative}#loco-editor div.ta-mirror span:after{color:#ccc;white-space:pre;display:inline-block;position:absolute;top:0;line-height:normal}#loco-editor div.ta-mirror .crlf:after{content:"¬"}#loco-editor div.ta-mirror .eof:after{content:"¶"}#loco-editor div.ta-mirror .x20:after{content:"·";color:#aaa}#loco-editor div.ta-mirror .x9:after{content:"⟶"}#loco-editor div.ta-mirror,#loco-editor .has-mirror textarea{white-space:pre-wrap;word-wrap:break-word;word-spacing:0px}#loco-editor .has-mirror ::placeholder{color:transparent}#loco-editor .has-mirror ::-webkit-input-placeholder{color:transparent}#loco-editor .has-mirror :-moz-placeholder{color:transparent;opacity:1}#loco-editor .has-mirror ::-moz-placeholder{color:transparent;opacity:1}#loco-editor .has-mirror :-ms-input-placeholder{color:transparent}#loco-editor .has-mirror .ielt10 .placeheld{color:transparent}#loco-editor div.ta-mirror{left:0;text-align:left}#loco-editor div.ta-mirror span:after{left:0}#loco-editor div.ta-mirror .eol:after{padding-left:.2em}#loco-editor [dir=RTL] div.ta-mirror{left:auto;right:0;text-align:right}#loco-editor [dir=RTL] div.ta-mirror span:after{right:0}#loco-editor [dir=RTL] div.ta-mirror .eol:after{padding-left:0;padding-right:.2em}#loco-editor .has-proxy>textarea{display:none !important}#loco-editor .has-proxy .ace_editor{height:100%;font-size:13px !important;line-height:1.4 !important}#loco-editor .has-proxy .ace_editor .ace_marker-layer .ace_bracket{display:none}#loco-editor .has-proxy .ace_print-margin{display:none}#loco-editor .ace_printf{color:#b90690;background-color:#edf1be}#loco-editor .ace_locked{color:gray}#loco-editor .ace_icu-quoted{color:gray}#loco-editor .ace_icu{color:#697eb9}#loco-editor .ace_icu.ace_name{color:#b90600}#loco-editor .resizer{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0 0 6px 0;background:#f0f0f0 url(../img/wg/splity.png?v=2.5.2) center bottom no-repeat;border:1px solid #ddd;overflow:hidden;cursor:move;cursor:row-resize;cursor:s-resize}#loco-editor .resizer>*{height:100%;border:none}#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}#loco-editor ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.2) 0 0 no-repeat;min-height:75px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.2);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.2);background-size:16px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.2);background-size:16px}}#loco-editor ._green_glow_inner,#loco-editor .is-editable>.wg-content>textarea:focus,#loco-editor .is-editable>.wg-content.has-focus .ace_scroller,#loco-editor .is-editable>.wg-content.has-focus .wysihtml-editor,#loco-editor .is-editable>.wg-content.has-focus .mce-content-body{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-editor ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-editor .loco-font,#loco-editor .is-table .wg-thead .wg-sortable>header:after{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-editor .wg-cell,#loco-editor .wg-cell>div{clear:both;position:relative;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;outline:none}#loco-editor .wg-cell{left:0;top:0;padding:0;margin:0;overflow:hidden}#loco-editor .wg-split{background:#eee}#loco-editor .wg-body:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}#loco-editor .wg-split-x>div>.not-first>*{margin-left:6px}#loco-editor .wg-split-y>div>.not-first>*{margin-top:6px}#loco-editor .wg-split>div>.has-title .wg-content{margin-top:0}#loco-editor .wg-split-x>div>.wg-cell{float:left;clear:none;height:100%}#loco-editor .wg-split-x>div{cursor:move;cursor:ew-resize;cursor:col-resize}#loco-editor .wg-split>div>.not-first:before{display:block;position:absolute;overflow:hidden;content:" "}#loco-editor .wg-split-x>div>.not-first:before{width:6px;height:100%;background:transparent url(../img/wg/splitx.png?v=2.5.2) center center no-repeat}#loco-editor .wg-split-y>div{cursor:move;cursor:ns-resize;cursor:row-resize}#loco-editor .wg-split-y>div>.not-first:before{height:6px;width:100%;background:transparent url(../img/wg/splity.png?v=2.5.2) center center no-repeat}#loco-editor .wg-split>div.locked{cursor:default}#loco-editor .wg-split-x>div.locked>.not-first>*{margin-left:0px}#loco-editor .wg-split-y>div.locked>.not-first>*{margin-top:0px}#loco-editor .wg-split>div.locked>.not-first:before{display:none}#loco-editor .has-title>header{background:#e2e2e2;cursor:default !important;margin:0;white-space:nowrap}#loco-editor .wg-content{background:#fff;cursor:default;padding:4px 6px;overflow:hidden;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#loco-editor .wg-toolbar{top:0;right:0;margin-top:6px;position:absolute}#loco-editor .wg-toolbar>span{color:#fff;background:#000;display:block;padding:0 6px;cursor:default !important}#loco-editor .wg-toolbar>span:active{color:#000;background-color:#fff}#loco-editor .wg-content,#loco-editor .wg-tbody>div{overflow:scroll;overflow-x:hidden;overflow-y:auto}#loco-editor .is-table{background-color:#fff}#loco-editor .is-table .wg-thead .has-title>header{font-weight:normal;background:transparent;padding:4px 0;margin:0 0 0 10px}#loco-editor .is-table .wg-thead>div>.not-first:before{background-position:center center}#loco-editor .is-table .wg-thead{background:#e2e2e2;border-bottom:solid 1px #ccc}#loco-editor .is-table .wg-tbody{background-image:url(data:image/gif;base64,R0lGODlhAQAsAIABAPz8/P///yH5BAEAAAEALAAAAAABACwAAAIIjI+pAe0PIygAOw==);position:relative}#loco-editor .is-table .wg-cols>div{float:left;clear:none}#loco-editor .is-table .wg-cols>div>div{white-space:nowrap;line-height:1.7em;padding-left:10px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;-o-text-overflow:ellipsis;-ms-text-overflow:ellipsis;background-color:#fff}#loco-editor .is-table .wg-cols>div>div:nth-child(even){background-color:#f7f7f7}#loco-editor .is-table .wg-cols>div>div.selected{background-color:#3db63d;color:#fff}#loco-editor .is-table .wg-cols>div>div.selected::selection{background-color:#fff;color:#000}#loco-editor .is-table .wg-cols>div:first-child>div{padding-left:4px}#loco-editor .is-table .wg-dead{clear:both}#loco-editor .is-table .wg-thead .wg-sortable>header{cursor:pointer !important}#loco-editor .is-table .wg-thead .wg-sortable>header:after{padding:0 0 0 5px;color:#999}#loco-editor .is-table .wg-thead .wg-sortable.wg-asc>header:after{content:"▲"}#loco-editor .is-table .wg-thead .wg-sortable.wg-desc>header:after{content:"▼"}#loco-editor .is-table .wg-thead .wg-sortable:hover>header:after{color:#000}#loco-editor .is-field>.wg-content{cursor:text;padding:0;line-height:normal;overflow:hidden;overflow-y:hidden}#loco-editor .is-field>.wg-content>div,#loco-editor .is-field>.wg-content>textarea{font-size:14px;line-height:1.4;border:1px solid #ddd;width:100%;height:100%;padding:8px 10px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;-webkit-border-radius:0;-moz-border-radius:0;-ms-border-radius:0;-o-border-radius:0;border-radius:0}#loco-editor .is-field>.wg-content textarea{resize:none;overflow:auto;display:block}#loco-editor .is-field>.wg-content>.ace_editor{padding:0;border-width:0}#loco-editor .is-field>.wg-content>div[contenteditable]{overflow:scroll;overflow-x:hidden;overflow-y:auto}#loco-editor .is-readonly>.wg-content{cursor:default}#loco-editor .is-readonly>.wg-content>div,#loco-editor .is-readonly>.wg-content>textarea,#loco-editor .is-readonly>.wg-content>textarea[readonly]{background:#f8f8f8;text-shadow:0 1px #fff;color:inherit}#loco-editor .is-readonly>.wg-content .ace_scroller{cursor:default;background:#f8f8f8}#loco-editor .is-readonly>.wg-content .ace_cursor-layer{display:none}#loco-editor .is-readonly>.wg-content>textarea[readonly]{cursor:default}#loco-editor .is-editable>.wg-content[dir=RTL] .ace_editor .ace_line{direction:ltr;unicode-bidi:bidi-override}#loco-editor .wg-split-x>nav.wg-tabs{white-space:nowrap;text-align:center;cursor:default}#loco-editor .wg-split-x>nav.wg-tabs>a{display:inline-block;padding:.5em 1em;margin-top:.2em;color:#000;text-decoration:none;-webkit-border-radius:.2em .2em 0 0;-moz-border-radius:.2em .2em 0 0;-ms-border-radius:.2em .2em 0 0;-o-border-radius:.2em .2em 0 0;border-radius:.2em .2em 0 0;background-color:#f3f7fd}#loco-editor .wg-split-x>nav.wg-tabs>a:hover{background-color:#fff}#loco-editor .wg-split-x>nav.wg-tabs>a.active{background-color:#3db63d;color:#fff}#loco-editor .wg-split>div>.has-nav>.wg-body{margin-top:0px}#loco-editor .wg-dead{visibility:hidden}@media all and (max-width: 768px){#loco-editor .wg-split-x>div>.not-first>*{margin-left:20px}#loco-editor .wg-split-y>div>.not-first>*{margin-top:20px}#loco-editor .wg-split-x>div>.not-first:before{width:20px}#loco-editor .wg-split-y>div>.not-first:before{height:20px}#loco-editor .is-table .wg-thead header{padding-left:20px}}#loco-editor .is-table .po-fuzzy{color:#b59829;font-weight:bold}#loco-editor .is-table .po-empty{color:#1f507a;font-weight:bold}#loco-editor .is-table .po-flagged{color:#bd2c00}#loco-editor .is-table .wg-cols>div:first-child>div:before{font-family:loco;vertical-align:inherit;display:inline-block;content:" ";width:1.3em;line-height:1}#loco-editor .is-table .wg-cols>div:first-child>div.po-fuzzy:before{content:""}#loco-editor .is-table .wg-cols>div:first-child>div.po-flagged:before{content:""}#loco-editor .is-table .wg-cols>div:first-child>div.po-comment:before{content:"";color:#999}#loco-editor .is-table .wg-cols>div:first-child>div.po-unsaved:before{content:"";color:#f1d040}#loco-editor .is-table .wg-cols>div:first-child>div.selected:before{color:#fff !important}#loco-editor .wg-cell>.meta{color:#333;margin:0 !important;padding:6px 10px;font-weight:normal;font-size:13px;line-height:1.4em;cursor:default !important}#loco-editor .wg-cell>.meta>*{display:inline-block;margin-top:3px;margin-bottom:3px}#loco-editor .wg-cell>.meta>span{border:1px solid transparent;border-left:none}#loco-editor .wg-cell>.meta>mark{color:#fff;border-radius:2px;background-color:silver;border:1px solid silver;padding:0 .3em}#loco-editor .wg-cell>.meta>mark.tag{color:#999;background-color:#eee}#loco-editor .wg-cell>.meta>p{display:block;white-space:pre-line}#loco-editor .wg-cell>.meta .icon-warn{color:#c00}#loco-editor .wg-cell>.meta .has-icon:before{padding-right:0;width:17px}#loco-editor .wg-cell>.meta code{font-size:12px}#loco-editor .is-table .wg-cols>div>div>mark{display:inline-block;vertical-align:text-bottom;font:inherit;font-weight:normal;color:#fff;border-radius:2px;font-size:90%;line-height:1;padding:.2em .3em;background-color:rgba(0,0,0,.25)}#loco-editor .is-table .wg-cols>div>div.selected.po-flagged{background-color:#bd2c00}#loco-editor .is-table .wg-cols>div>div.selected.po-fuzzy{background-color:#b59829}#loco-editor .is-table .wg-cols>div>div.selected.po-empty{background-color:#999}#loco-editor #po-target header nav{display:block;position:absolute;right:0px;top:0px;padding:2px}#loco-editor #po-target header nav button{margin-left:5px}#loco-editor #po-target header nav.po-empty .icon-cloud{display:none !important}#loco-editor #po-list .wg-content{padding:0}#loco-editor #po-source>.wg-body>.has-title>header{background:transparent;font-weight:normal;float:left;clear:none;min-width:3.4em}#loco-editor #po-source>.wg-body>.has-title>.wg-content{clear:none}#loco-editor .has-title>header{line-height:normal;padding:6px}#loco-editor .has-title>header .lang{margin-right:6px;margin-bottom:1px}#loco-editor .trg-rtl #po-list-tbody .wg-cols>div[for=po-list-col-target]>div,#loco-editor .src-rtl #po-list-tbody .wg-cols>div[for=po-list-col-source]>div{direction:rtl;padding-left:0;padding-right:10px;text-align:right}#loco-editor #po-source>.wg-body>.has-title>h2{min-width:4.5em}#loco-editor .is-table .wg-td{font-size:13px}#loco-editor header,#loco-editor nav{display:block;position:relative}#loco-editor-inner{min-height:600px;font-size:14px;clear:both}#loco-editor-inner>div.loco-loading{height:100px;background:transparent url(../img/spin-editor-button.gif?v=2.5.2) center 20px no-repeat}#loco-editor-inner h2{color:#000;line-height:1}#loco-editor-inner .wg-cell>.meta code{padding:0;color:#0073aa;background:inherit;cursor:pointer}#loco-editor-inner .wg-cell>.meta code:hover{text-decoration:underline}#loco-admin.wrap #loco-editor>nav{font-size:14px;height:50px}#loco-admin.wrap #loco-editor>nav form{display:block;float:left;clear:none;padding:0;margin:0}#loco-admin.wrap #loco-editor>nav form.aux{float:right;margin-right:5px}#loco-admin.wrap #loco-editor>nav fieldset{display:block;position:relative;float:left;clear:none}#loco-admin.wrap #loco-editor>nav button,#loco-admin.wrap #loco-editor>nav input[type=text]{display:block;position:relative;float:left;clear:none;margin:5px 0 0 5px;height:36px;text-align:left;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#loco-admin.wrap #loco-editor>nav input[type=text]{padding:0 10px;font-size:14px;line-height:normal}#loco-admin.wrap #loco-editor>nav .invalid input[type=text]:focus{border-color:#c00;-webkit-box-shadow:0 0 2px rgba(153,0,0,.5);-moz-box-shadow:0 0 2px rgba(153,0,0,.5);box-shadow:0 0 2px rgba(153,0,0,.5)}#loco-admin.wrap #loco-editor>nav .loco-clearable{padding:0 20px}#loco-admin.wrap #loco-editor>nav .loco-clearable.invalid a.clear:before{color:#c00}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear{right:25px;line-height:2}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:focus{-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:hover:before{color:#c00}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:active:before{color:#000}#loco-admin.wrap #loco-editor>nav button.only-icon{width:40px}#loco-admin.wrap button.has-icon:before{width:16px;padding:0}#loco-admin.wrap button.has-icon.loco-loading:before{content:" ";height:16px;background:transparent url(../img/spin-editor-button.gif?v=2.5.2) 0 0 no-repeat}#loco-admin.wrap .button,#loco-admin.wrap .button-link,#loco-admin.wrap input[type=text]{border-color:#aaa;color:#444}#loco-admin.wrap .button:hover,#loco-admin.wrap .button-link:hover{color:#000}#loco-admin.wrap .button-primary,#loco-admin.wrap .button-primary:hover{color:#fff}#loco-admin.wrap button.icon-translate:before{font-size:16px}.loco-modal .loco-api{position:relative;padding:10px;background:#f7f7f7;border:solid 1px #eee;font-size:14px;margin-bottom:16px}.loco-modal .loco-api p{padding:0;margin:0;font-size:inherit}.loco-modal .loco-api blockquote{font-weight:bold;margin:0;padding:10px 0}.loco-modal .loco-api a.loco-api-credit{padding:0;display:block;position:absolute;right:10px;bottom:10px;text-decoration:none;white-space:nowrap;overflow:hidden;font-size:12px}.loco-modal .loco-api a.loco-api-credit:hover{text-decoration:underline}.loco-modal .loco-api-loading{text-indent:20px;background:transparent url(../img/spin-modal.gif?v=2.5.2) 10px center no-repeat}.loco-modal .loco-alert p{margin-bottom:2em;font-size:14px}.loco-modal .loco-alert nav{display:block;position:relative;margin:1em 0}.loco-modal .loco-alert nav a{display:inline-block;margin-right:1em;padding:10px}#loco-auto{display:none;min-width:50%;min-height:300px;position:relative}#loco-auto form blockquote{margin:0;padding:1em 0;font-size:14px}.loco-api a.loco-api-credit{color:inherit}.loco-api-yandex a.loco-api-credit:before{content:"Powered by "}.loco-api-google a.loco-api-credit{text-indent:200px;width:122px;height:16px;background:transparent url(../img/api/google.png?v=2.5.2) 0 0 no-repeat}.loco-api-microsoft a.loco-api-credit{text-indent:200px;width:152px;height:16px;background:transparent url(../img/api/microsoft.png?v=2.5.2) 0 0 no-repeat}.loco-api-deepl a.loco-api-credit{text-indent:200px;width:122px;height:16px;background:transparent url(../img/api/deepl.png?v=2.5.2) 0 0 no-repeat}

+ #loco-editor{border:solid 1px #ccc}#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}#loco-editor ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.3) 0 0 no-repeat;min-height:75px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.3);background-size:16px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.3);background-size:16px}}#loco-editor ._green_glow_inner,#loco-editor .is-editable>.wg-content>textarea:focus,#loco-editor .is-editable>.wg-content.has-focus .ace_scroller,#loco-editor .is-editable>.wg-content.has-focus .wysihtml-editor,#loco-editor .is-editable>.wg-content.has-focus .mce-content-body{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-editor ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-editor .loco-font,#loco-editor .is-table .wg-thead .wg-sortable>header:after{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-editor div.ta-mirror{position:absolute;top:0;border:solid 1px transparent;color:transparent;padding:.4em .6em;pointer-events:none}#loco-editor div.ta-mirror span{position:relative}#loco-editor div.ta-mirror span:after{color:#ccc;white-space:pre;display:inline-block;position:absolute;top:0;line-height:normal}#loco-editor div.ta-mirror .crlf:after{content:"¬"}#loco-editor div.ta-mirror .eof:after{content:"¶"}#loco-editor div.ta-mirror .x20:after{content:"·";color:#aaa}#loco-editor div.ta-mirror .x9:after{content:"⟶"}#loco-editor div.ta-mirror,#loco-editor .has-mirror textarea{white-space:pre-wrap;word-wrap:break-word;word-spacing:0px}#loco-editor .has-mirror ::placeholder{color:transparent}#loco-editor .has-mirror ::-webkit-input-placeholder{color:transparent}#loco-editor .has-mirror :-moz-placeholder{color:transparent;opacity:1}#loco-editor .has-mirror ::-moz-placeholder{color:transparent;opacity:1}#loco-editor .has-mirror :-ms-input-placeholder{color:transparent}#loco-editor .has-mirror .ielt10 .placeheld{color:transparent}#loco-editor div.ta-mirror{left:0;text-align:left}#loco-editor div.ta-mirror span:after{left:0}#loco-editor div.ta-mirror .eol:after{padding-left:.2em}#loco-editor [dir=RTL] div.ta-mirror{left:auto;right:0;text-align:right}#loco-editor [dir=RTL] div.ta-mirror span:after{right:0}#loco-editor [dir=RTL] div.ta-mirror .eol:after{padding-left:0;padding-right:.2em}#loco-editor .has-proxy>textarea{display:none !important}#loco-editor .has-proxy .ace_editor{height:100%;font-size:13px !important;line-height:1.4 !important}#loco-editor .has-proxy .ace_editor .ace_marker-layer .ace_bracket{display:none}#loco-editor .has-proxy .ace_print-margin{display:none}#loco-editor .ace_printf{color:#b90690;background-color:#edf1be}#loco-editor .ace_locked{color:gray}#loco-editor .ace_icu-quoted{color:gray}#loco-editor .ace_icu{color:#697eb9}#loco-editor .ace_icu.ace_name{color:#b90600}#loco-editor .resizer{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0 0 6px 0;background:#f0f0f0 url(../img/wg/splity.png?v=2.5.3) center bottom no-repeat;border:1px solid #ddd;overflow:hidden;cursor:move;cursor:row-resize;cursor:s-resize}#loco-editor .resizer>*{height:100%;border:none}#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}#loco-editor ._ajax_loader_f2x4{background:transparent url(../img/ajax-loader-f2-x4.gif?v=2.5.3) 0 0 no-repeat;min-height:75px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc.gif?v=2.5.3);background-repeat:no-repeat;min-height:16px}@media only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx){#loco-editor ._ajax_loader_f2{background-image:url(../img/ajax-loader-f2-x2.gif?v=2.5.3);background-size:16px}#loco-editor ._ajax_loader_cc{background-image:url(../img/ajax-loader-cc-x2.gif?v=2.5.3);background-size:16px}}#loco-editor ._green_glow_inner,#loco-editor .is-editable>.wg-content>textarea:focus,#loco-editor .is-editable>.wg-content.has-focus .ace_scroller,#loco-editor .is-editable>.wg-content.has-focus .wysihtml-editor,#loco-editor .is-editable>.wg-content.has-focus .mce-content-body{-webkit-box-shadow:inset 0 0 10px 0 #3db63d;-moz-box-shadow:inset 0 0 10px 0 #3db63d;box-shadow:inset 0 0 10px 0 #3db63d}#loco-editor ._green_glow_outer{-webkit-box-shadow:0 0 .5em 0 #3db63d;-moz-box-shadow:0 0 .5em 0 #3db63d;box-shadow:0 0 .5em 0 #3db63d}#loco-editor .loco-font,#loco-editor .is-table .wg-thead .wg-sortable>header:after{font-family:"loco";speak:none;font-style:normal;font-weight:normal;font-variant:normal;text-transform:none;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}#loco-editor .wg-cell,#loco-editor .wg-cell>div{clear:both;position:relative;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;outline:none}#loco-editor .wg-cell{left:0;top:0;padding:0;margin:0;overflow:hidden}#loco-editor .wg-split{background:#eee}#loco-editor .wg-body:after{content:".";display:block;clear:both;visibility:hidden;line-height:0;height:0}#loco-editor .wg-split-x>div>.not-first>*{margin-left:6px}#loco-editor .wg-split-y>div>.not-first>*{margin-top:6px}#loco-editor .wg-split>div>.has-title .wg-content{margin-top:0}#loco-editor .wg-split-x>div>.wg-cell{float:left;clear:none;height:100%}#loco-editor .wg-split-x>div{cursor:move;cursor:ew-resize;cursor:col-resize}#loco-editor .wg-split>div>.not-first:before{display:block;position:absolute;overflow:hidden;content:" "}#loco-editor .wg-split-x>div>.not-first:before{width:6px;height:100%;background:transparent url(../img/wg/splitx.png?v=2.5.3) center center no-repeat}#loco-editor .wg-split-y>div{cursor:move;cursor:ns-resize;cursor:row-resize}#loco-editor .wg-split-y>div>.not-first:before{height:6px;width:100%;background:transparent url(../img/wg/splity.png?v=2.5.3) center center no-repeat}#loco-editor .wg-split>div.locked{cursor:default}#loco-editor .wg-split-x>div.locked>.not-first>*{margin-left:0px}#loco-editor .wg-split-y>div.locked>.not-first>*{margin-top:0px}#loco-editor .wg-split>div.locked>.not-first:before{display:none}#loco-editor .has-title>header{background:#e2e2e2;cursor:default !important;margin:0;white-space:nowrap}#loco-editor .wg-content{background:#fff;cursor:default;padding:4px 6px;overflow:hidden;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#loco-editor .wg-toolbar{top:0;right:0;margin-top:6px;position:absolute}#loco-editor .wg-toolbar>span{color:#fff;background:#000;display:block;padding:0 6px;cursor:default !important}#loco-editor .wg-toolbar>span:active{color:#000;background-color:#fff}#loco-editor .wg-content,#loco-editor .wg-tbody>div{overflow:scroll;overflow-x:hidden;overflow-y:auto}#loco-editor .is-table{background-color:#fff}#loco-editor .is-table .wg-thead .has-title>header{font-weight:normal;background:transparent;padding:4px 0;margin:0 0 0 10px}#loco-editor .is-table .wg-thead>div>.not-first:before{background-position:center center}#loco-editor .is-table .wg-thead{background:#e2e2e2;border-bottom:solid 1px #ccc}#loco-editor .is-table .wg-tbody{background-image:url(data:image/gif;base64,R0lGODlhAQAsAIABAPz8/P///yH5BAEAAAEALAAAAAABACwAAAIIjI+pAe0PIygAOw==);position:relative}#loco-editor .is-table .wg-cols>div{float:left;clear:none}#loco-editor .is-table .wg-cols>div>div{white-space:nowrap;line-height:1.7em;padding-left:10px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;-o-text-overflow:ellipsis;-ms-text-overflow:ellipsis;background-color:#fff}#loco-editor .is-table .wg-cols>div>div:nth-child(even){background-color:#f7f7f7}#loco-editor .is-table .wg-cols>div>div.selected{background-color:#3db63d;color:#fff}#loco-editor .is-table .wg-cols>div>div.selected::selection{background-color:#fff;color:#000}#loco-editor .is-table .wg-cols>div:first-child>div{padding-left:4px}#loco-editor .is-table .wg-dead{clear:both}#loco-editor .is-table .wg-thead .wg-sortable>header{cursor:pointer !important}#loco-editor .is-table .wg-thead .wg-sortable>header:after{padding:0 0 0 5px;color:#999}#loco-editor .is-table .wg-thead .wg-sortable.wg-asc>header:after{content:"▲"}#loco-editor .is-table .wg-thead .wg-sortable.wg-desc>header:after{content:"▼"}#loco-editor .is-table .wg-thead .wg-sortable:hover>header:after{color:#000}#loco-editor .is-field>.wg-content{cursor:text;padding:0;line-height:normal;overflow:hidden;overflow-y:hidden}#loco-editor .is-field>.wg-content>div,#loco-editor .is-field>.wg-content>textarea{font-size:14px;line-height:1.4;border:1px solid #ddd;width:100%;height:100%;padding:8px 10px;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;-webkit-border-radius:0;-moz-border-radius:0;-ms-border-radius:0;-o-border-radius:0;border-radius:0}#loco-editor .is-field>.wg-content textarea{resize:none;overflow:auto;display:block}#loco-editor .is-field>.wg-content>.ace_editor{padding:0;border-width:0}#loco-editor .is-field>.wg-content>div[contenteditable]{overflow:scroll;overflow-x:hidden;overflow-y:auto}#loco-editor .is-readonly>.wg-content{cursor:default}#loco-editor .is-readonly>.wg-content>div,#loco-editor .is-readonly>.wg-content>textarea,#loco-editor .is-readonly>.wg-content>textarea[readonly]{background:#f8f8f8;text-shadow:0 1px #fff;color:inherit}#loco-editor .is-readonly>.wg-content .ace_scroller{cursor:default;background:#f8f8f8}#loco-editor .is-readonly>.wg-content .ace_cursor-layer{display:none}#loco-editor .is-readonly>.wg-content>textarea[readonly]{cursor:default}#loco-editor .is-editable>.wg-content[dir=RTL] .ace_editor .ace_line{direction:ltr;unicode-bidi:bidi-override}#loco-editor .wg-split-x>nav.wg-tabs{white-space:nowrap;text-align:center;cursor:default}#loco-editor .wg-split-x>nav.wg-tabs>a{display:inline-block;padding:.5em 1em;margin-top:.2em;color:#000;text-decoration:none;-webkit-border-radius:.2em .2em 0 0;-moz-border-radius:.2em .2em 0 0;-ms-border-radius:.2em .2em 0 0;-o-border-radius:.2em .2em 0 0;border-radius:.2em .2em 0 0;background-color:#f3f7fd}#loco-editor .wg-split-x>nav.wg-tabs>a:hover{background-color:#fff}#loco-editor .wg-split-x>nav.wg-tabs>a.active{background-color:#3db63d;color:#fff}#loco-editor .wg-split>div>.has-nav>.wg-body{margin-top:0px}#loco-editor .wg-dead{visibility:hidden}@media all and (max-width: 768px){#loco-editor .wg-split-x>div>.not-first>*{margin-left:20px}#loco-editor .wg-split-y>div>.not-first>*{margin-top:20px}#loco-editor .wg-split-x>div>.not-first:before{width:20px}#loco-editor .wg-split-y>div>.not-first:before{height:20px}#loco-editor .is-table .wg-thead header{padding-left:20px}}#loco-editor .is-table .po-fuzzy{color:#b59829;font-weight:bold}#loco-editor .is-table .po-empty{color:#1f507a;font-weight:bold}#loco-editor .is-table .po-flagged{color:#bd2c00}#loco-editor .is-table .wg-cols>div:first-child>div:before{font-family:loco;vertical-align:inherit;display:inline-block;content:" ";width:1.3em;line-height:1}#loco-editor .is-table .wg-cols>div:first-child>div.po-fuzzy:before{content:""}#loco-editor .is-table .wg-cols>div:first-child>div.po-flagged:before{content:""}#loco-editor .is-table .wg-cols>div:first-child>div.po-comment:before{content:"";color:#999}#loco-editor .is-table .wg-cols>div:first-child>div.po-unsaved:before{content:"";color:#f1d040}#loco-editor .is-table .wg-cols>div:first-child>div.selected:before{color:#fff !important}#loco-editor .wg-cell>.meta{color:#333;margin:0 !important;padding:6px 10px;font-weight:normal;font-size:13px;line-height:1.4em;cursor:default !important}#loco-editor .wg-cell>.meta>*{display:inline-block;margin-top:3px;margin-bottom:3px}#loco-editor .wg-cell>.meta>span{border:1px solid transparent;border-left:none}#loco-editor .wg-cell>.meta>mark{color:#fff;border-radius:2px;background-color:silver;border:1px solid silver;padding:0 .3em}#loco-editor .wg-cell>.meta>mark.tag{color:#999;background-color:#eee}#loco-editor .wg-cell>.meta>p{display:block;white-space:pre-line}#loco-editor .wg-cell>.meta .icon-warn{color:#c00}#loco-editor .wg-cell>.meta .has-icon:before{padding-right:0;width:17px}#loco-editor .wg-cell>.meta code{font-size:12px}#loco-editor .is-table .wg-cols>div>div>mark{display:inline-block;vertical-align:text-bottom;font:inherit;font-weight:normal;color:#fff;border-radius:2px;font-size:90%;line-height:1;padding:.2em .3em;background-color:rgba(0,0,0,.25)}#loco-editor .is-table .wg-cols>div>div.selected.po-flagged{background-color:#bd2c00}#loco-editor .is-table .wg-cols>div>div.selected.po-fuzzy{background-color:#b59829}#loco-editor .is-table .wg-cols>div>div.selected.po-empty{background-color:#999}#loco-editor #po-target header nav{display:block;position:absolute;right:0px;top:0px;padding:2px}#loco-editor #po-target header nav button{margin-left:5px}#loco-editor #po-target header nav.po-empty .icon-cloud{display:none !important}#loco-editor #po-list .wg-content{padding:0}#loco-editor #po-source>.wg-body>.has-title>header{background:transparent;font-weight:normal;float:left;clear:none;min-width:3.4em}#loco-editor #po-source>.wg-body>.has-title>.wg-content{clear:none}#loco-editor .has-title>header{line-height:normal;padding:6px}#loco-editor .has-title>header .lang{margin-right:6px;margin-bottom:1px}#loco-editor .trg-rtl #po-list-tbody .wg-cols>div[for=po-list-col-target]>div,#loco-editor .src-rtl #po-list-tbody .wg-cols>div[for=po-list-col-source]>div{direction:rtl;padding-left:0;padding-right:10px;text-align:right}#loco-editor #po-source>.wg-body>.has-title>h2{min-width:4.5em}#loco-editor .is-table .wg-td{font-size:13px}#loco-editor header,#loco-editor nav{display:block;position:relative}#loco-editor-inner{min-height:600px;font-size:14px;clear:both}#loco-editor-inner>div.loco-loading{height:100px;background:transparent url(../img/spin-editor-button.gif?v=2.5.3) center 20px no-repeat}#loco-editor-inner h2{color:#000;line-height:1}#loco-editor-inner .wg-cell>.meta code{padding:0;color:#0073aa;background:inherit;cursor:pointer}#loco-editor-inner .wg-cell>.meta code:hover{text-decoration:underline}#loco-admin.wrap #loco-editor>nav{font-size:14px;height:50px}#loco-admin.wrap #loco-editor>nav form{display:block;float:left;clear:none;padding:0;margin:0}#loco-admin.wrap #loco-editor>nav form.aux{float:right;margin-right:5px}#loco-admin.wrap #loco-editor>nav fieldset{display:block;position:relative;float:left;clear:none}#loco-admin.wrap #loco-editor>nav button,#loco-admin.wrap #loco-editor>nav input[type=text]{display:block;position:relative;float:left;clear:none;margin:5px 0 0 5px;height:36px;text-align:left;-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}#loco-admin.wrap #loco-editor>nav input[type=text]{padding:0 10px;font-size:14px;line-height:normal}#loco-admin.wrap #loco-editor>nav .invalid input[type=text]:focus{border-color:#c00;-webkit-box-shadow:0 0 2px rgba(153,0,0,.5);-moz-box-shadow:0 0 2px rgba(153,0,0,.5);box-shadow:0 0 2px rgba(153,0,0,.5)}#loco-admin.wrap #loco-editor>nav .loco-clearable{padding:0 20px}#loco-admin.wrap #loco-editor>nav .loco-clearable.invalid a.clear:before{color:#c00}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear{right:25px;line-height:2}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:focus{-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:hover:before{color:#c00}#loco-admin.wrap #loco-editor>nav .loco-clearable a.clear:active:before{color:#000}#loco-admin.wrap #loco-editor>nav button.only-icon{width:40px}#loco-admin.wrap button.has-icon:before{width:16px;padding:0}#loco-admin.wrap button.has-icon.loco-loading:before{content:" ";height:16px;background:transparent url(../img/spin-editor-button.gif?v=2.5.3) 0 0 no-repeat}#loco-admin.wrap .button,#loco-admin.wrap .button-link,#loco-admin.wrap input[type=text]{border-color:#aaa;color:#444}#loco-admin.wrap .button:hover,#loco-admin.wrap .button-link:hover{color:#000}#loco-admin.wrap .button-primary,#loco-admin.wrap .button-primary:hover{color:#fff}#loco-admin.wrap button.icon-translate:before{font-size:16px}.loco-modal .loco-api{position:relative;padding:10px;background:#f7f7f7;border:solid 1px #eee;font-size:14px;margin-bottom:16px}.loco-modal .loco-api p{padding:0;margin:0;font-size:inherit}.loco-modal .loco-api blockquote{font-weight:bold;margin:0;padding:10px 0}.loco-modal .loco-api a.loco-api-credit{padding:0;display:block;position:absolute;right:10px;bottom:10px;text-decoration:none;white-space:nowrap;overflow:hidden;font-size:12px}.loco-modal .loco-api a.loco-api-credit:hover{text-decoration:underline}.loco-modal .loco-api-loading{text-indent:20px;background:transparent url(../img/spin-modal.gif?v=2.5.3) 10px center no-repeat}.loco-modal .loco-alert p{margin-bottom:2em;font-size:14px}.loco-modal .loco-alert nav{display:block;position:relative;margin:1em 0}.loco-modal .loco-alert nav a{display:inline-block;margin-right:1em;padding:10px}#loco-auto{display:none;min-width:50%;min-height:300px;position:relative}#loco-auto form blockquote{margin:0;padding:1em 0;font-size:14px}.loco-api a.loco-api-credit{color:inherit}.loco-api-yandex a.loco-api-credit:before{content:"Powered by "}.loco-api-google a.loco-api-credit{text-indent:200px;width:122px;height:16px;background:transparent url(../img/api/google.png?v=2.5.3) 0 0 no-repeat}.loco-api-microsoft a.loco-api-credit{text-indent:200px;width:152px;height:16px;background:transparent url(../img/api/microsoft.png?v=2.5.3) 0 0 no-repeat}.loco-api-deepl a.loco-api-credit{text-indent:200px;width:122px;height:16px;background:transparent url(../img/api/deepl.png?v=2.5.3) 0 0 no-repeat}

pub/css/fileinfo.css CHANGED Viewed

@@ -1 +1 @@

- #loco-admin.wrap .notice-info nav{display:block;position:absolute;right:0;top:0;font-size:1.3em;padding:1em}#loco-admin.wrap .notice-info nav a{color:#666}#loco-admin.wrap .notice-info nav a:hover{color:#000;text-decoration:none}#loco-admin.wrap .notice-info dl{margin-top:0;display:inline-block}#loco-admin.wrap .notice-info dl dt,#loco-admin.wrap .notice-info dl dd{line-height:1.4em}#loco-admin.wrap .notice-info dl dt{font-weight:bold;color:#555}#loco-admin.wrap .notice-info dl dd{margin-left:0;margin-bottom:.8em}#loco-admin.wrap .notice-info dl div.progress .l{display:none}

+ #loco-admin.wrap .notice-info nav{display:block;position:absolute;right:0;top:0;font-size:1.3em;padding:1em}#loco-admin.wrap .notice-info nav a{color:#666;margin-left:10px}#loco-admin.wrap .notice-info nav a:hover{color:#000;text-decoration:none}#loco-admin.wrap .notice-info dl{margin-top:0;display:inline-block}#loco-admin.wrap .notice-info dl dt,#loco-admin.wrap .notice-info dl dd{line-height:1.4em}#loco-admin.wrap .notice-info dl dt{font-weight:bold;color:#555}#loco-admin.wrap .notice-info dl dd{margin-left:0;margin-bottom:.8em}#loco-admin.wrap .notice-info dl div.progress .l{display:none}

pub/css/podiff.css CHANGED Viewed

@@ -1 +1 @@

- #loco-admin.wrap .revisions-diff{padding:10px;min-height:20px}#loco-admin.wrap table.diff{border-collapse:collapse}#loco-admin.wrap table.diff td{white-space:nowrap;overflow:hidden;font:normal 12px/17px "Monaco","Menlo","Ubuntu Mono","Consolas","source-code-pro",monospace;padding:2px}#loco-admin.wrap table.diff td>span{color:#aaa}#loco-admin.wrap table.diff td>span:after{content:". "}#loco-admin.wrap table.diff tbody{border-top:1px dashed #ccc}#loco-admin.wrap table.diff tbody:first-child{border-top:none}#loco-admin.wrap .revisions.loading .diff-meta{color:#eee}#loco-admin.wrap .revisions.loading .loading-indicator span.spinner{visibility:visible;background:#fff url(../img/spin-modal.gif?v=2.5.2) center center no-repeat}#loco-admin.wrap .revisions-meta{clear:both;padding:10px 12px;margin:0;position:relative;top:10px}#loco-admin.wrap .revisions-meta .diff-meta{clear:none;float:left;width:50%;padding:0;min-height:auto}#loco-admin.wrap .revisions-meta .diff-meta button{margin-top:5px}#loco-admin.wrap .revisions-meta .diff-meta-current{float:right;text-align:right}#loco-admin.wrap .revisions-meta time{color:#72777c}#loco-admin.wrap .revisions-control-frame{margin:10px 0}#loco-admin.wrap .revisions-diff-frame{margin-top:20px}

+ #loco-admin.wrap .revisions-diff{padding:10px;min-height:20px}#loco-admin.wrap table.diff{border-collapse:collapse}#loco-admin.wrap table.diff td{white-space:nowrap;overflow:hidden;font:normal 12px/17px "Monaco","Menlo","Ubuntu Mono","Consolas","source-code-pro",monospace;padding:2px}#loco-admin.wrap table.diff td>span{color:#aaa}#loco-admin.wrap table.diff td>span:after{content:". "}#loco-admin.wrap table.diff tbody{border-top:1px dashed #ccc}#loco-admin.wrap table.diff tbody:first-child{border-top:none}#loco-admin.wrap .revisions.loading .diff-meta{color:#eee}#loco-admin.wrap .revisions.loading .loading-indicator span.spinner{visibility:visible;background:#fff url(../img/spin-modal.gif?v=2.5.3) center center no-repeat}#loco-admin.wrap .revisions-meta{clear:both;padding:10px 12px;margin:0;position:relative;top:10px}#loco-admin.wrap .revisions-meta .diff-meta{clear:none;float:left;width:50%;padding:0;min-height:auto}#loco-admin.wrap .revisions-meta .diff-meta button{margin-top:5px}#loco-admin.wrap .revisions-meta .diff-meta-current{float:right;text-align:right}#loco-admin.wrap .revisions-meta time{color:#72777c}#loco-admin.wrap .revisions-control-frame{margin:10px 0}#loco-admin.wrap .revisions-diff-frame{margin-top:20px}

pub/css/poview.css CHANGED Viewed

@@ -1 +1 @@

- .js #loco-admin.wrap .loco-loading{min-height:100px;background:#fff url(../img/spin-modal.gif?v=2.5.2) center center no-repeat}.js #loco-admin.wrap .loco-loading ol.msgcat{display:none}#loco-admin.wrap #loco-po{padding-right:0;overflow:auto}#loco-admin.wrap ol.msgcat{margin-left:3em;padding-top:1em;border-top:1px dashed #ccc}#loco-admin.wrap ol.msgcat:first-child{padding-top:0;border-top:none}#loco-admin.wrap ol.msgcat li{color:#aaa;margin:0;padding:0 0 0 1em;font:normal 12px/17px "Monaco","Menlo","Ubuntu Mono","Consolas","source-code-pro",monospace;border-left:1px solid #eee}#loco-admin.wrap ol.msgcat li>*{color:#333;white-space:pre}#loco-admin.wrap ol.msgcat li>.po-comment{color:#3cc200}#loco-admin.wrap ol.msgcat li>.po-refs{color:#0073aa}#loco-admin.wrap ol.msgcat li>.po-refs a{color:inherit;text-decoration:none}#loco-admin.wrap ol.msgcat li>.po-refs a:hover{text-decoration:underline}#loco-admin.wrap ol.msgcat li>.po-flags{color:#77904a}#loco-admin.wrap ol.msgcat li>.po-flags em{font-style:normal}#loco-admin.wrap ol.msgcat li>.po-word{color:#000}#loco-admin.wrap ol.msgcat li>.po-junk{font-style:italic;color:#ccc}#loco-admin.wrap ol.msgcat li>.po-string>span{color:#c931c7}#loco-admin.wrap form.loco-filter{top:0;right:0;position:absolute}#loco-admin.wrap .loco-invalid form.loco-filter input[type=text]:focus{border-color:#c00;-webkit-box-shadow:0 0 2px rgba(153,0,0,.5);-moz-box-shadow:0 0 2px rgba(153,0,0,.5);box-shadow:0 0 2px rgba(153,0,0,.5)}#loco-admin.wrap .loco-invalid ol.msgcat{list-style-type:none}#loco-admin.wrap .loco-invalid ol.msgcat li{color:#000}

+ .js #loco-admin.wrap .loco-loading{min-height:100px;background:#fff url(../img/spin-modal.gif?v=2.5.3) center center no-repeat}.js #loco-admin.wrap .loco-loading ol.msgcat{display:none}#loco-admin.wrap #loco-po{padding-right:0;overflow:auto}#loco-admin.wrap ol.msgcat{margin-left:3em;padding-top:1em;border-top:1px dashed #ccc}#loco-admin.wrap ol.msgcat:first-child{padding-top:0;border-top:none}#loco-admin.wrap ol.msgcat li{color:#aaa;margin:0;padding:0 0 0 1em;font:normal 12px/17px "Monaco","Menlo","Ubuntu Mono","Consolas","source-code-pro",monospace;border-left:1px solid #eee}#loco-admin.wrap ol.msgcat li>*{color:#333;white-space:pre}#loco-admin.wrap ol.msgcat li>.po-comment{color:#3cc200}#loco-admin.wrap ol.msgcat li>.po-refs{color:#0073aa}#loco-admin.wrap ol.msgcat li>.po-refs a{color:inherit;text-decoration:none}#loco-admin.wrap ol.msgcat li>.po-refs a:hover{text-decoration:underline}#loco-admin.wrap ol.msgcat li>.po-flags{color:#77904a}#loco-admin.wrap ol.msgcat li>.po-flags em{font-style:normal}#loco-admin.wrap ol.msgcat li>.po-word{color:#000}#loco-admin.wrap ol.msgcat li>.po-junk{font-style:italic;color:#ccc}#loco-admin.wrap ol.msgcat li>.po-string>span{color:#c931c7}#loco-admin.wrap form.loco-filter{top:0;right:0;position:absolute}#loco-admin.wrap .loco-invalid form.loco-filter input[type=text]:focus{border-color:#c00;-webkit-box-shadow:0 0 2px rgba(153,0,0,.5);-moz-box-shadow:0 0 2px rgba(153,0,0,.5);box-shadow:0 0 2px rgba(153,0,0,.5)}#loco-admin.wrap .loco-invalid ol.msgcat{list-style-type:none}#loco-admin.wrap .loco-invalid ol.msgcat li{color:#000}

pub/css/skins/blue.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(9,100,132,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#096484;foo:#096484}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1cdc7 !important;background:#db9925 !important;border-color:#db9925 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/blue/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(9,100,132,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#096484;foo:#096484}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1cdc7 !important;background:#db9925 !important;border-color:#db9925 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/blue/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/coffee.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(199,165,137,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#c7a589;foo:#c7a589}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1ccc7 !important;background:#ba906d !important;border-color:#ba906d !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/coffee/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(199,165,137,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#c7a589;foo:#c7a589}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1ccc7 !important;background:#ba906d !important;border-color:#ba906d !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/coffee/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/ectoplasm.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(163,183,69,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#a3b745;foo:#a3b745}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#cfd1c7 !important;background:#89993a !important;border-color:#89993a !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/ectoplasm/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(163,183,69,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#a3b745;foo:#a3b745}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#cfd1c7 !important;background:#89993a !important;border-color:#89993a !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/ectoplasm/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/light.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(136,136,136,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#888;foo:#04a4cc}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7cfd1 !important;background:#0384a4 !important;border-color:#0384a4 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/light/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(136,136,136,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#888;foo:#04a4cc}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7cfd1 !important;background:#0384a4 !important;border-color:#0384a4 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/light/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/midnight.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(225,77,67,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#e14d43;foo:#e14d43}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1c8c7 !important;background:#d92e23 !important;border-color:#d92e23 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/midnight/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(225,77,67,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#e14d43;foo:#e14d43}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1c8c7 !important;background:#d92e23 !important;border-color:#d92e23 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/midnight/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/modern.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(56,88,233,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#3858e9;foo:#3858e9}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7c9d1 !important;background:#193ddf !important;border-color:#193ddf !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/modern/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(56,88,233,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#3858e9;foo:#3858e9}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7c9d1 !important;background:#193ddf !important;border-color:#193ddf !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/modern/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/ocean.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(158,186,160,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#9ebaa0;foo:#9ebaa0}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7d1c8 !important;background:#86a989 !important;border-color:#86a989 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/ocean/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(158,186,160,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#9ebaa0;foo:#9ebaa0}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#c7d1c8 !important;background:#86a989 !important;border-color:#86a989 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/ocean/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/css/skins/sunrise.css CHANGED Viewed

@@ -1 +1 @@

- .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(221,130,59,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#dd823b;foo:#dd823b}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1cbc7 !important;background:#cc6d23 !important;border-color:#cc6d23 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/sunrise/spin-primary-button.gif?v=2.5.2) 0 0 no-repeat !important}

+ .wrap #loco-editor .is-table .wg-tr:nth-child(even){background-color:rgba(221,130,59,.05)}.wrap #loco-editor .wg-split-x>nav.wg-tabs>a.active,.wrap #loco-editor .is-table .wg-cols>div>div.selected{background-color:#dd823b;foo:#dd823b}.wrap #loco-editor .is-editable>.wg-content>textarea:focus,.wrap #loco-editor .is-editable>.wg-content.has-focus .ace_scroller,.wrap #loco-editor .is-editable>.wg-content.has-focus .mce-content-body{border-color:#5b9dd9;-webkit-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);-moz-box-shadow:inset 0 0 .6em rgba(30,140,190,.8);box-shadow:inset 0 0 .6em rgba(30,140,190,.8)}.wp-core-ui .button-primary.loco-loading[disabled]{color:#d1cbc7 !important;background:#cc6d23 !important;border-color:#cc6d23 !important}.wp-core-ui .button-primary.loco-loading[disabled]:before{background:transparent url(../../img/skins/sunrise/spin-primary-button.gif?v=2.5.3) 0 0 no-repeat !important}

pub/js/min/admin.js CHANGED Viewed

@@ -1,196 +1,4914 @@
-            -
            (function(v,w,h,J){var m=function(){function f(d){throw Error("Failed to require "+d);}var d={};return{register:function(f,l){d[f]=l},require:function(h,l){return d[h]||f(l)},include:function(h,l,g){return d[h]||(g?f(l):null)}}}();m.register("$1",function(f,d,h){function l(g){var c=typeof g;if("string"===c)if(/[^ <>!=()%^&|?:n0-9]/.test(g))console.error("Invalid plural: "+g);else return new Function("n","return "+g);"function"!==c&&(g=function(b){return 1!=b});return g}f.init=function(g){function c(a,
-            -
            b,e){return(a=p[a])&&a[e]?a[e]:b||""}function b(a){return c(a,a,0)}function a(a,b){return c(b+"\u0004"+a,a,0)}function e(a,b,e){e=Number(g(e));isNaN(e)&&(e=0);return c(a,e?b:a,e)}g=l(g);var p={};return{__:b,_x:a,_n:e,_:b,x:a,n:e,load:function(a){p=a||{};return this},pluraleq:function(a){g=l(a);return this}}};return f}({},v,w));m.register("$2",function(f,d,h){f.ie=function(){var l=!1,g=0;d.attachEvent&&d.navigator&&/MSIE (\d+)\./.exec(String(navigator.appVersion))&&(g=Number(RegExp.$1),l=11>g);return function(){return l}}();
-            -
            f.init=function(){return f};return f}({},v,w));m.register("$3",function(f,d,h){Number.prototype.format=function(d){d=Math.pow(10,d||0);var g=Math.round(d*this)/d;d=[];var g=String(g),c=g.split("."),g=c[0],c=c[1],b=g.length;do d.unshift(g.substring(b-3,b));while(0<(b-=3));g=d.join(",");if(d=c){d=c;for(var a,c=d.length;"0"===d.charAt(--c);)a=c;a&&(d=d.substring(0,a));d=c=d}d&&(g+="."+c);return g};Number.prototype.percent=function(d){var g=0,c=this&&d?100*(this/d):0;if(0===c)return"0";if(100===c)return"100";
-            -
            if(99<c)c=Math.min(c,99.9),d=c.format(++g);else if(0.5>c){c=Math.max(c,1E-4);do d=c.format(++g);while("0"===d&&4>g);d=d.substr(1)}else d=c.format(0);return d};return f}({},v,w));m.register("$4",function(f,d,h){Array.prototype.indexOf||(Array.prototype.indexOf=function(d){if(null==this)throw new TypeError;var g,c=Object(this),b=c.length>>>0;if(0===b)return-1;g=0;1<arguments.length&&(g=Number(arguments[1]),g!=g?g=0:0!=g&&Infinity!=g&&-Infinity!=g&&(g=(0<g||-1)*Math.floor(Math.abs(g))));if(g>=b)return-1;
-            -
            for(g=0<=g?g:Math.max(b-Math.abs(g),0);g<b;g++)if(g in c&&c[g]===d)return g;return-1});return f}({},v,w));m.register("$5",function(f,d,m){d.JSON||(d.JSON={parse:h.parseJSON,stringify:null});return f=d.JSON}({},v,w));m.register("$6",function(f,d,h){f.trim=function(d,g){for(g||(g=" \n");d&&-1!==g.indexOf(d.substr(0,1));)d=d.substr(1);for(;d&&-1!==g.indexOf(d.substr(-1));)d=d.substr(0,d.length-1);return d};f.sprintf=function(d){var g=0,c=[].slice.call(arguments,1);return d.replace(/%(?:([1-9][0-9]*)\$)?([sud%])/g,
-            -
            function(b,a,e){return"%"===e?"%":(a?c[Number(a)-1]:c[g++])||""})};return f}({},v,w));m.register("$21",function(f,d,h){function l(g){return function(c,b){for(var a=c[g]||0;(c=c.offsetParent)&&c!==(b||h.body);)a+=c[g]||0;return a}}f.top=l("offsetTop");f.left=l("offsetLeft");f.el=function(g,c){var b=h.createElement(g||"div");c&&(b.className=c);return b};f.txt=function(g){return h.createTextNode(g||"")};return f}({},v,w));m.register("$7",function(f,d,E){function l(a,b,e){function r(){c();x=setTimeout(b,
-            -
            e)}function c(){x&&clearTimeout(x);x=null}var x;r();h(a).on("mouseenter",c).on("mouseleave",r);return{die:function(){c();h(a).off("mouseenter mouseleave")}}}function g(a,b){a.fadeTo(b,0,function(){a.slideUp(b,function(){a.remove();h(d).triggerHandler("resize")})});return a}function c(a,b){function e(b){n[x]=null;g(h(a),250);c&&c.die();var r;if(r=b)b.stopPropagation(),b.preventDefault(),r=!1;return r}function r(b){c&&c.die();return c=l(a,e,b)}var c,x,p,k=h(a),q=k.find("button");0===q.length&&(k.addClass("is-dismissible"),
-            -
            q=h('<button type="button" class="notice-dismiss"> </a>').appendTo(k));q.off("click").on("click",e);h(d).triggerHandler("resize");y();x=n.length;n.push(e);b&&(c=r(b));return{link:function(b,x){var e=x||b,r=h(a).find("nav"),e=h("<nav></nav>").append(h("<a></a>").attr("href",b).text(e));p?(p.push(e.html()),r.html(p.join("<span> | </span>"))):(p=[e.html()],h(a).addClass("has-nav").append(e));return this},stick:function(){c&&c.die();c=null;n[x]=null;return this},slow:function(a){r(a||1E4);return this}}}
-            -
            function b(a,b,e){var r=m.require("$21","dom.js").el;a=h('<div class="notice notice-'+a+' loco-notice inline"></div>').prependTo(h("#loco-notices"));var c=h(r("p"));e=h(r("span")).text(e);b=h(r("strong","has-icon")).text(b+": ");c.append(b).append(e).appendTo(a);return a}function a(a,e,r,p){a=b(r,e,a).css("opacity","0").fadeTo(500,1);h(d).triggerHandler("resize");return c(a,p)}function e(b){return a(b,q,"warning")}function p(){h("#loco-notices").find("div.notice").each(function(a,b){if(-1===b.className.indexOf("jshide")){var e=
-            -
            -1===b.className.indexOf("notice-success")?null:5E3;c(b,e)}})}var n=[],k=d.console||{log:function(){}},y=Date.now||function(){return(new Date).getTime()},z,q,r,D;f.error=function(b){return a(b,z,"error")};f.warn=e;f.info=function(b){return a(b,r,"info")};f.success=function(b){return a(b,D,"success",5E3)};f.warning=e;f.log=function(){k.log.apply(k,arguments)};f.debug=function(){(k.debug||k.log).apply(k,arguments)};f.clear=function(){for(var a=-1,b,e=n,r=e.length;++a<r;)(b=e[a])&&b.call&&b();n=[];return f};
-            -
            f.create=b;f.raise=function(a){(f[a.type]||f.error).call(f,a.message)};f.convert=c;f.init=function(a){z=a._("Error");q=a._("Warning");r=a._("Notice");D=a._("OK");setTimeout(p,1E3);return f};return f}({},v,w));m.register("$8",function(f,d,E){function l(a){var b=h("<pre>"+a+"</pre>").text();b&&(b=b.replace(/[\r\n]+/g,"\n").replace(/(^|\n)\s+/g,"$1").replace(/\s+$/,""));b||(b=a)||(b="Blank response from server");return b}function g(a){return(a=a.split(/[\r\n]/)[0])?(a=a.replace(/ +in +\S+ on line \d+/,
-            -
            ""),a=a.replace(/^[()! ]+Fatal error:\s*/,"")):t._("Server returned invalid data")}function c(a){d.console&&console.error&&console.error('No nonce for "'+a+'"');return""}function b(a,b,e){a[b]=e}function a(a,b,e){a.push({name:b,value:e})}function e(a,b,e){a.append(b,e)}function p(a,b,e,c){function p(b,c,x){if("abort"!==c){var r=k||{_:function(a){return a}},A=b.status||0,d=b.responseText,s=l(d),f=b.getResponseHeader("Content-Type")||"Unknown type",z=b.getResponseHeader("Content-Length")||d.length;
-            -
            "success"===c&&x?n.error(x):(n.error(g(s)+".\n"+r._("Check console output for debugging information")),n.log("Ajax failure for "+a,{status:A,error:c,message:x,output:d}),"parsererror"===c&&(x="Response not JSON"),n.log([r._("Provide the following text when reporting a problem")+":","----","Status "+A+' "'+(x||r._("Unknown error"))+'" ('+f+" "+z+" bytes)",s,"===="].join("\n")));e&&e.call&&e(b,c,x);y=b}}c.url=z;c.dataType="json";var n=m.require("$7","notices.js").clear();y=null;return h.ajax(c).fail(p).done(function(a,
-            -
            e,x){var c=a&&a.data,k=a&&a.notices,y=k&&k.length,g=-1;for(!c||a.error?p(x,e,a&&a.error&&a.error.message):b&&b(c,e,x);++g<y;)n.raise(k[g])})}var n={},k,y,z=d.ajaxurl||"/wp-admin/admin-ajax.php";f.init=function(a){n=a.nonces||n;return f};f.localise=function(a){k=a;return f};f.xhr=function(){return y};f.strip=l;f.parse=g;f.submit=function(a,b,e){function c(a,b){b.disabled?b.setAttribute("data-was-disabled","true"):b.disabled=!0}function k(a,b){b.getAttribute("data-was-disabled")||(b.disabled=!1)}function n(a){a.find(".button-primary").removeClass("loading");
-            -
            a.find("button").each(k);a.find("input").each(k);a.find("select").each(k);a.find("textarea").each(k);a.removeClass("disabled loading")}var y=h(a),g=y.serialize();(function(a){a.find(".button-primary").addClass("loading");a.find("button").each(c);a.find("input").each(c);a.find("select").each(c);a.find("textarea").each(c);a.addClass("disabled loading")})(y);return p(a.route.value,function(a,e,c){n(y);b&&b(a,e,c)},function(a,b,c){n(y);e&&e(a,b,c)},{type:a.method,data:g})};f.post=function(k,r,y,g){var A=
-            -
            !0,G=r||{},B=n[k]||c(k);d.FormData&&G instanceof FormData?(A=!1,r=e):r=Array.isArray(G)?a:b;r(G,"action","loco_json");r(G,"route",k);r(G,"loco-nonce",B);return p(k,y,g,{type:"post",data:G,processData:A,contentType:A?"application/x-www-form-urlencoded; charset=UTF-8":!1})};f.get=function(a,b,e,k){b=b||{};var y=n[a]||c(a);b.action="loco_json";b.route=a;b["loco-nonce"]=y;return p(a,e,k,{type:"get",data:b})};f.setNonce=function(a,b){n[a]=b;return f};return f}({},v,w));m.register("$22",{arab:1,aran:1,
-            -
            hebr:1,nkoo:1,syrc:1,syrn:1,syrj:1,syre:1,samr:1,mand:1,mend:1,thaa:1,adlm:1,cprt:1,phnx:1,armi:1,prti:1,phli:1,phlp:1,phlv:1,avst:1,mani:1,khar:1,orkh:1,ital:1,lydi:1,ar:1,ary:1,ckb:1,dv:1,fa:1,he:1,nqo:1,ps:1,ur:1,yi:1});m.register("$9",function(f,d,h){function l(){}var g,c=m.require("$22","rtl.json");f.init=function(){return new l};f.cast=function(b){return b instanceof l?b:"string"===typeof b?f.parse(b):f.clone(b)};f.clone=function(b){var a,e=new l;for(a in b)e[a]=b[a];return e};f.parse=function(b){if(!(g||
-            -
            (g=/^([a-z]{2,3})(?:[-_]([a-z]{2}))?(?:[-_]([a-z0-9]{3,8}))?$/i)).exec(b))return null;var a=new l;a.lang=RegExp.$1.toLowerCase();if(b=RegExp.$2)a.region=b.toUpperCase();if(b=RegExp.$3)a.variant=b.toLowerCase();return a};d=l.prototype;d.isValid=function(){return!!this.lang};d.isKnown=function(){var b=this.lang;return!(!b||"zxx"===b)};d.toString=function(b){b=b||"_";var a,e=this.lang||"zxx";if(a=this.region)e+=b+a;if(a=this.variant)e+=b+a;return e};d.getIcon=function(){for(var b=3,a,e,c=["variant",
-            -
            "region","lang"],n=[];0!==b--;)if(a=c[b],e=this[a])n.push(a),n.push(a+"-"+e.toLowerCase());return n.join(" ")};d.isRTL=function(){return!!c[String(this.lang).toLowerCase()]};d=null;return f}({},v,w));m.register("$23",{"\u00e1":"a","\u00e0":"a","\u0103":"a","\u1eaf":"a","\u1eb1":"a","\u1eb5":"a","\u1eb3":"a","\u00e2":"a","\u1ea5":"a","\u1ea7":"a","\u1eab":"a","\u1ea9":"a","\u01ce":"a","\u00e5":"a","\u01fb":"a","\u00e4":"a","\u01df":"a","\u00e3":"a","\u0227":"a","\u01e1":"a","\u0105":"a","\u0101":"a",
-            -
            "\u1ea3":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1eb7":"a","\u1ead":"a","\u1e01":"a","\u01fd":"\u00e6","\u01e3":"\u00e6","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0107":"c","\u0109":"c","\u010d":"c","\u010b":"c","\u00e7":"c","\u1e09":"c","\u010f":"d","\u1e0b":"d","\u1e11":"d","\u0111":"d","\u1e0d":"d","\u1e13":"d","\u1e0f":"d","\u00f0":"d","\ua77a":"d","\u01c6":"\u01f3","\u00e9":"e","\u00e8":"e","\u0115":"e","\u00ea":"e","\u1ebf":"e","\u1ec1":"e","\u1ec5":"e","\u1ec3":"e","\u011b":"e","\u00eb":"e",
-            -
            "\u1ebd":"e","\u0117":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u0113":"e","\u1e17":"e","\u1e15":"e","\u1ebb":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u1e19":"e","\u1e1b":"e","\u1e1f":"f","\ua77c":"f","\u01f5":"g","\u011f":"g","\u011d":"g","\u01e7":"g","\u0121":"g","\u0123":"g","\u1e21":"g","\ua7a1":"g","\u1d79":"g","\u0125":"h","\u021f":"h","\u1e27":"h","\u1e23":"h","\u1e29":"h","\u0127":"h","\u210f":"h","\u1e25":"h","\u1e2b":"h","\u1e96":"h","\u00ed":"i","\u00ec":"i","\u012d":"i",
-            -
            "\u00ee":"i","\u01d0":"i","\u00ef":"i","\u1e2f":"i","\u0129":"i","\u012f":"i","\u012b":"i","\u1ec9":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u1e2d":"i","\u0135":"j","\u01f0":"j","\u1e31":"k","\u01e9":"k","\u0137":"k","\ua7a3":"k","\u1e33":"k","\u1e35":"k","\u013a":"l","\u013e":"l","\u013c":"l","\u0142":"l","\u1e37":"l","\u1e39":"l","\u1e3d":"l","\u1e3b":"l","\u0140":"l","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0144":"n","\u01f9":"n","\u0148":"n","\u00f1":"n","\u1e45":"n","\u0146":"n","\ua7a5":"n",
-            -
            "\u1e47":"n","\u1e4b":"n","\u1e49":"n","\u00f3":"o","\u00f2":"o","\u014f":"o","\u00f4":"o","\u1ed1":"o","\u1ed3":"o","\u1ed7":"o","\u1ed5":"o","\u01d2":"o","\u00f6":"o","\u022b":"o","\u0151":"o","\u00f5":"o","\u1e4d":"o","\u1e4f":"o","\u022d":"o","\u022f":"o","\u0231":"o","\u00f8":"o","\u01ff":"o","\u01eb":"o","\u01ed":"o","\u014d":"o","\u1e53":"o","\u1e51":"o","\u1ecf":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edb":"o","\u1edd":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o",
-            -
            "\u1e55":"p","\u1e57":"p","\u0155":"r","\u0159":"r","\u1e59":"r","\u0157":"r","\ua7a7":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u1e5f":"r","\ua783":"r","\u015b":"s","\u1e65":"s","\u015d":"s","\u0161":"s","\u1e67":"s","\u1e61":"s","\u015f":"s","\ua7a9":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u017f":"s","\ua785":"s","\u1e9b":"s","\u0165":"t","\u1e97":"t","\u1e6b":"t","\u0163":"t","\u1e6d":"t","\u021b":"t","\u1e71":"t","\u1e6f":"t","\ua787":"t","\u00fa":"u","\u00f9":"u","\u016d":"u",
-            -
            "\u00fb":"u","\u01d4":"u","\u016f":"u","\u00fc":"u","\u01d8":"u","\u01dc":"u","\u01da":"u","\u01d6":"u","\u0171":"u","\u0169":"u","\u1e79":"u","\u0173":"u","\u016b":"u","\u1e7b":"u","\u1ee7":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1ee9":"u","\u1eeb":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u1e77":"u","\u1e75":"u","\u1e7d":"v","\u1e7f":"v","\u1e83":"w","\u1e81":"w","\u0175":"w","\u1e98":"w","\u1e85":"w","\u1e87":"w","\u1e89":"w","\u1e8d":"x","\u1e8b":"x","\u00fd":"y",
-            -
            "\u1ef3":"y","\u0177":"y","\u1e99":"y","\u00ff":"y","\u1ef9":"y","\u1e8f":"y","\u0233":"y","\u1ef7":"y","\u1ef5":"y","\u017a":"z","\u1e91":"z","\u017e":"z","\u017c":"z","\u1e93":"z","\u1e95":"z","\u01ef":"\u0292","\u1f00":"\u03b1","\u1f04":"\u03b1","\u1f84":"\u03b1","\u1f02":"\u03b1","\u1f82":"\u03b1","\u1f06":"\u03b1","\u1f86":"\u03b1","\u1f80":"\u03b1","\u1f01":"\u03b1","\u1f05":"\u03b1","\u1f85":"\u03b1","\u1f03":"\u03b1","\u1f83":"\u03b1","\u1f07":"\u03b1","\u1f87":"\u03b1","\u1f81":"\u03b1",
-            -
            "\u03ac":"\u03b1","\u1f71":"\u03b1","\u1fb4":"\u03b1","\u1f70":"\u03b1","\u1fb2":"\u03b1","\u1fb0":"\u03b1","\u1fb6":"\u03b1","\u1fb7":"\u03b1","\u1fb1":"\u03b1","\u1fb3":"\u03b1","\u1f10":"\u03b5","\u1f14":"\u03b5","\u1f12":"\u03b5","\u1f11":"\u03b5","\u1f15":"\u03b5","\u1f13":"\u03b5","\u03ad":"\u03b5","\u1f73":"\u03b5","\u1f72":"\u03b5","\u1f20":"\u03b7","\u1f24":"\u03b7","\u1f94":"\u03b7","\u1f22":"\u03b7","\u1f92":"\u03b7","\u1f26":"\u03b7","\u1f96":"\u03b7","\u1f90":"\u03b7","\u1f21":"\u03b7",
-            -
            "\u1f25":"\u03b7","\u1f95":"\u03b7","\u1f23":"\u03b7","\u1f93":"\u03b7","\u1f27":"\u03b7","\u1f97":"\u03b7","\u1f91":"\u03b7","\u03ae":"\u03b7","\u1f75":"\u03b7","\u1fc4":"\u03b7","\u1f74":"\u03b7","\u1fc2":"\u03b7","\u1fc6":"\u03b7","\u1fc7":"\u03b7","\u1fc3":"\u03b7","\u1f30":"\u03b9","\u1f34":"\u03b9","\u1f32":"\u03b9","\u1f36":"\u03b9","\u1f31":"\u03b9","\u1f35":"\u03b9","\u1f33":"\u03b9","\u1f37":"\u03b9","\u03af":"\u03b9","\u1f77":"\u03b9","\u1f76":"\u03b9","\u1fd0":"\u03b9","\u1fd6":"\u03b9",
-            -
            "\u03ca":"\u03b9","\u0390":"\u03b9","\u1fd3":"\u03b9","\u1fd2":"\u03b9","\u1fd7":"\u03b9","\u1fd1":"\u03b9","\u1f40":"\u03bf","\u1f44":"\u03bf","\u1f42":"\u03bf","\u1f41":"\u03bf","\u1f45":"\u03bf","\u1f43":"\u03bf","\u03cc":"\u03bf","\u1f79":"\u03bf","\u1f78":"\u03bf","\u1fe4":"\u03c1","\u1fe5":"\u03c1","\u1f50":"\u03c5","\u1f54":"\u03c5","\u1f52":"\u03c5","\u1f56":"\u03c5","\u1f51":"\u03c5","\u1f55":"\u03c5","\u1f53":"\u03c5","\u1f57":"\u03c5","\u03cd":"\u03c5","\u1f7b":"\u03c5","\u1f7a":"\u03c5",
-            -
            "\u1fe0":"\u03c5","\u1fe6":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u1fe3":"\u03c5","\u1fe2":"\u03c5","\u1fe7":"\u03c5","\u1fe1":"\u03c5","\u1f60":"\u03c9","\u1f64":"\u03c9","\u1fa4":"\u03c9","\u1f62":"\u03c9","\u1fa2":"\u03c9","\u1f66":"\u03c9","\u1fa6":"\u03c9","\u1fa0":"\u03c9","\u1f61":"\u03c9","\u1f65":"\u03c9","\u1fa5":"\u03c9","\u1f63":"\u03c9","\u1fa3":"\u03c9","\u1f67":"\u03c9","\u1fa7":"\u03c9","\u1fa1":"\u03c9","\u03ce":"\u03c9","\u1f7d":"\u03c9","\u1ff4":"\u03c9","\u1f7c":"\u03c9",
-            -
            "\u1ff2":"\u03c9","\u1ff6":"\u03c9","\u1ff7":"\u03c9","\u1ff3":"\u03c9","\u0491":"\u0433","\u0450":"\u0435","\u0451":"\u0435","\u04c2":"\u0436","\u045d":"\u0438","\u04e3":"\u0438","\u04ef":"\u0443"});m.register("$10",function(f,d,h){f.init=function(){function d(a){return k[a]||a}function g(a,b,e,c){b=a.split(b);for(var p=b.length;0!==p--;)(a=b[p])&&null==c[a]&&(e.push(a),c[a]=!0);return e}function c(a){return g(String(a||"").toLowerCase().replace(p,d),n,[],{})}function b(a,b){for(var c=[],r={},k,
-            -
            s=b.length,A=n;0!==s--;)(k=b[s])&&g(String(k||"").toLowerCase().replace(p,d),A,c,r);e[a]=c}function a(a,b){var c=[],r=-1,p=e,k=p.length,n,g,d,u,x,F,f=a.length,l=b?!0:!1;a:for(;++r<k;)if(d=p[r],null!=d&&(u=d.length)){x=0;b:for(;x<f;x++){F=a[x];for(n=0;n<u;n++)if(g=d[n],0===g.indexOf(F))continue b;continue a}c.push(l?b[r]:r)}return c}var e=[],p=/[^a-z0-9]/g,n=/[\-_\s.?!;:,*^+=~`"(){}<>\[\]\/\\\u00a0\u1680\u180e\u2000-\u206f\u2e00-\u2e7f\u3000-\u303f]+/,k=m.require("$23","flatten.json");return{split:c,
-            -
            pull:function(b,e){return a(b,e)},find:function(b,e){return a(c(b),e)},add:function(a,b){e[a]=c(b)},push:function(a){b(e.length,a)},index:function(a,e){b(a,e)},size:function(){return e.length},clear:function(){e=[]},remove:function(a){e[a]=null}}};return f}({},v,w));m.register("$11",function(f,d,m){f.listen=function(f,g){function c(){q[p?"show":"hide"]()}function b(a){z&&f.setAttribute("size",2+a.length);p=a;c();return a}function a(){n=null;g(p)}function e(){var e=f.value;y&&e===y&&(e="");e!==p&&
-            -
            (n&&clearTimeout(n),b(e),k?n=setTimeout(a,k):a())}f instanceof jQuery&&(f=f[0]);var p,n,k=150,y=d.attachEvent&&f.getAttribute("placeholder"),z=1===Number(f.size),q=h('<a href="#clear" tabindex="-1" class="icon clear"><span>clear</span></a>').on("click",function(){f.value="";e();return!1});b(f.value);h(f).on("input blur focus",function(){e();return!0}).after(q);c();return{delay:function(a){k=a},ping:function(c){c?(n&&clearTimeout(n),c=f.value,y&&c===y&&(c=""),b(c),a(),c=void 0):c=e();return c},val:function(a){if(null==
-            -
            a)return p;n&&clearTimeout(n);f.value=b(a);c()},el:function(){return f},blur:function(a){return h(f).on("blur",a)},destroy:function(){n&&clearTimeout(n)}}};return f}({},v,w));m.register("$12",function(f,d,m){function l(b,a){this.$element=h(b);this.options=a;this.enabled=!0;this.fixTitle()}f.init=function(b,a){var e={fade:!0,offset:5,delayIn:g,delayOut:c,anchor:b.attr("data-anchor"),gravity:b.attr("data-gravity")||"s"};a&&(e=h.extend({},e,a));b.tipsy(e)};f.delays=function(b,a){g=b||150;c=a||100};f.kill=
-            -
            function(){h("div.tipsy").remove()};f.text=function(b,a){a.data("tipsy").setTitle(b)};var g,c;f.delays();h(m.body).on("overlayOpened overlayClosing",function(b){f.kill();return!0});l.prototype={show:function(){var b=this.getTitle();if(b&&this.enabled){var a=this.tip();a.find(".tipsy-inner")[this.options.html?"html":"text"](b);a[0].className="tipsy";a.remove().css({top:0,left:0}).prependTo(m.body);var b=(b=this.options.anchor)?this.$element.find(b):this.$element,b=h.extend({},b.offset(),{width:b[0].offsetWidth,
-            -
            height:b[0].offsetHeight}),e=a[0].offsetWidth,c=a[0].offsetHeight,n="function"==typeof this.options.gravity?this.options.gravity.call(this.$element[0]):this.options.gravity,k;switch(n.charAt(0)){case "n":k={top:b.top+b.height+this.options.offset,left:b.left+b.width/2-e/2};break;case "s":k={top:b.top-c-this.options.offset,left:b.left+b.width/2-e/2};break;case "e":k={top:b.top+b.height/2-c/2,left:b.left-e-this.options.offset};break;case "w":k={top:b.top+b.height/2-c/2,left:b.left+b.width+this.options.offset}}2==
-            -
            n.length&&("w"==n.charAt(1)?k.left=b.left+b.width/2-15:k.left=b.left+b.width/2-e+15);a.css(k).addClass("tipsy-"+n);a.find(".tipsy-arrow")[0].className="tipsy-arrow tipsy-arrow-"+n.charAt(0);this.options.className&&a.addClass("function"==typeof this.options.className?this.options.className.call(this.$element[0]):this.options.className);a.addClass("in")}},hide:function(){this.tip().remove()},fixTitle:function(){var b=this.$element,a=b.attr("title")||"";(a||"string"!==typeof b.attr("original-title"))&&
-            -
            b.attr("original-title",a).removeAttr("title")},getTitle:function(){var b,a=this.$element,e=this.options;this.fixTitle();"string"==typeof e.title?b=a.attr("title"==e.title?"original-title":e.title):"function"==typeof e.title&&(b=e.title.call(a[0]));return(b=(""+b).replace(/(^\s*|\s*$)/,""))||e.fallback},setTitle:function(b){var a=this.$element;a.attr("default-title")||a.attr("default-title",this.getTitle());null==b&&(b=a.attr("default-title")||this.getTitle());a.attr("original-title",b);if(this.$tip)this.$tip.find(".tipsy-inner")[this.options.html?
-            -
            "html":"text"](b)},tip:function(){this.$tip||(this.$tip=h('<div class="tipsy"></div>').html('<div class="tipsy-arrow"></div><div class="tipsy-inner"></div>'),this.$tip.data("tipsy-pointee",this.$element[0]));return this.$tip},validate:function(){this.$element[0].parentNode||(this.hide(),this.options=this.$element=null)},enable:function(){this.enabled=!0},disable:function(){this.hide();this.enabled=!1},toggleEnabled:function(){this.enabled=!this.enabled}};h.fn.tipsy=function(b){function a(a){var e=
-            -
            h.data(a,"tipsy");e||(e=new l(a,h.fn.tipsy.elementOptions(a,b)),h.data(a,"tipsy",e));return e}function e(){var e=a(this),c=b.delayIn;e.hoverState="in";0==c?e.show():(e.fixTitle(),setTimeout(function(){"in"==e.hoverState&&e.show()},c))}function c(){var e=a(this),p=b.delayOut;e.hoverState="out";0==p?e.hide():(e.tip().removeClass("in"),setTimeout(function(){"out"==e.hoverState&&e.hide()},p))}b=h.extend({},h.fn.tipsy.defaults,b);b.live||this.each(function(){a(this)});if("manual"!=b.trigger){var n=b.live?
-            -
            "live":"bind",k="hover"==b.trigger?"mouseleave":"blur";this[n]("hover"==b.trigger?"mouseenter":"focus",e)[n](k,c)}return this};h.fn.tipsy.defaults={className:null,delayIn:0,delayOut:0,fade:!1,fallback:"",gravity:"n",html:!1,live:!1,offset:0,opacity:0.8,title:"title",trigger:"hover",anchor:null};h.fn.tipsy.elementOptions=function(b,a){return h.metadata?h.extend({},a,h(b).metadata()):a};h.fn.tipsy.autoNS=function(){return h(this).offset().top>h(m).scrollTop()+h(d).height()/2?"s":"n"};h.fn.tipsy.autoWE=
-            -
            function(){return h(this).offset().left>h(m).scrollLeft()+h(d).width()/2?"e":"w"};h.fn.tipsy.autoBounds=function(b,a){return function(){var e=a[0],c=1<a.length?a[1]:!1,n=h(m).scrollTop()+b,k=h(m).scrollLeft()+b,g=h(this);g.offset().top<n&&(e="n");g.offset().left<k&&(c="w");h(d).width()+h(m).scrollLeft()-g.offset().left<b&&(c="e");h(d).height()+h(m).scrollTop()-g.offset().top<b&&(e="s");return e+(c?c:"")}};return f}({},v,w));m.register("$35",function(f,d,h){"".localeCompare||(String.prototype.localeCompare=
-            -
            function(){return 0});"".trim||(String.prototype.trim=function(){return m.require("$6","string.js").trim(this," \n\r\t")});f.html=function(){function d(){b=/[<>&]/g;a=/(\r\n|\n|\r)/g;e=/(?:https?):\/\/(\S+)/ig;p=location.hostname;d=null}function g(a){return"&#"+a.charCodeAt(0)+";"}function c(a,b){return'<a href="'+a+'" target="'+(b.indexOf(p)?"_blank":"_top")+'">'+b+"</a>"}var b,a,e,p;return function(p,k){d&&d();var y=p.replace(b,g);k&&(y=y.replace(e,c).replace(a,"<br />"));return y}}();return f}({},
-            -
            v,w));m.register("$36",function(f,d,h){function l(){}var g,c,b=m.require("$22","rtl.json");f.init=function(){return new l};f.cast=function(a){return a instanceof l?a:"string"===typeof a?f.parse(a):f.clone(a)};f.clone=function(a){var b,c=new l;for(b in a)c[b]=a[b];return c};f.parse=function(a){g||(c=/[-_+]/,g=/^([a-z]{2,3})(?:-([a-z]{4}))?(?:-([a-z]{2}|[0-9]{3}))?(?:-([0-9][a-z0-9]{3,8}|[a-z0-9]{5,8}))?(?:-([a-z]-[-a-z]+))?$/i);a=String(a).split(c).join("-");if(!g.exec(a))return null;var b=new l;b.lang=
-            -
            RegExp.$1.toLowerCase();if(a=RegExp.$2)b.script=a.charAt(0).toUpperCase()+a.substr(1).toLowerCase();if(a=RegExp.$3)b.region=a.toUpperCase();if(a=RegExp.$4)b.variant=a.toLowerCase();if(a=RegExp.$5)b.extension=a;return b};d=l.prototype;d.isValid=function(){return!!this.lang};d.isKnown=function(){var a=this.lang;return!(!a||"zxx"===a)};d.toString=function(a){a=a||"-";var b,c=this.lang||"zxx";if(b=this.script)c+=a+b;if(b=this.region)c+=a+b;if(b=this.variant)c+=a+b;if(b=this.extension)c+=a+b;return c};
-            -
            d.getIcon=function(){for(var a=4,b,c,n=["variant","region","script","lang"],k=[];0!==a--;)if(b=n[a],c=this[b])c.join&&(c=c.join("-")),1===a&&3===c.length?k.push("region-m49"):k=k.concat([b,b+"-"+c.toLowerCase()]);return k.join(" ")};d.isRTL=function(){return!!b[String(this.script||this.lang).toLowerCase()]};d=null;return f}({},v,w));m.register("$37",function(f,d,h){function l(a){d.console&&console.error&&console.error(a)}function g(){l("Method not implemented")}function c(){}function b(a){}c.prototype.toString=
-            -
            function(){return"[Undefined]"};b.prototype._validate=function(a){var b,p,n=!0;for(b in this)p=this[b],p===g?(l(a+"."+b+"() must be implemented"),n=!1):p instanceof c&&(l(a+"."+b+" must be defined"),n=!1);return n};f.init=function(a,e){var p,n=new b;if(a)for(p=a.length;0!==p--;)n[a[p]]=g;if(e)for(p=e.length;0!==p--;)n[e[p]]=new c;return n};f.validate=function(a){var b=/function (\w+)\(/.exec(a.toString())?RegExp.$1:"";a.prototype._validate(b||"Object")};return f}({},v,w));m.register("$48",function(f,
-            -
            d,h){var l=d.requestAnimationFrame,g=d.cancelAnimationFrame,c=0;if(!l||!g)for(var b in{ms:1,moz:1,webkit:1,o:1})if(l=d[b+"RequestAnimationFrame"])if(g=d[b+"CancelAnimationFrame"]||d[b+"CancelRequestAnimationFrame"])break;l&&g||(l=function(b){var p=a();timeToCall=Math.max(0,16-(p-c));nextTime=p+timeToCall;timerId=d.setTimeout(function(){b(nextTime)},timeToCall);c=nextTime;return timerId},g=function(a){clearTimeout(a)});var a=Date.now||function(){return(new Date).getTime()};f.loop=function(a,b){function c(){d=
-            -
            l(c,b);a(k++)}var k=0,d;c();return{stop:function(){d&&g(d);d=null}}};return f}({},v,w));m.register("$45",function(f,d,h){function l(a,c,e,r){if(b){var k=e;e=function(a){if((a.MSPOINTER_TYPE_TOUCH||"touch")===a.pointerType)return k(a)}}a.addEventListener(c,e,r);return{unbind:function(){a.removeEventListener(c,e,r)}}}function g(a){a.preventDefault();a.stopPropagation();return!1}var c,b=!!d.navigator.msPointerEnabled,a=b?"MSPointerDown":"touchstart",e=b?"MSPointerMove":"touchmove",p=b?"MSPointerUp":
-            -
            "touchend";f.ok=function(a){null==c&&(c="function"===typeof h.body.addEventListener);c&&a&&a(f);return c};f.ms=function(){return b};f.dragger=function(b,c){function k(a){b.addEventListener(a,d[a],!1)}function r(a){b.removeEventListener(a,d[a],!1)}var d={};d[a]=function(b){n(b,function(e,k){k.type=a;c(b,k,f)});k(e);k(p);return!0};d[p]=function(a){r(e);r(p);n(a,function(b,e){e.type=p;c(a,e,f)});return!0};d[e]=function(a){n(a,function(b,k){k.type=e;c(a,k,f)});return g(a)};k(a);var f={kill:function(){r(a);
-            -
            r(e);r(p);b=f=c=null}};return f};f.swiper=function(c,d,f){function r(a){c.addEventListener(a,u[a],!1)}function D(a){c.removeEventListener(a,u[a],!1)}function s(){A&&A.stop();A=null}var A,G,B,u={},x=[],F=[],h=[];u[a]=function(a){G=!1;s();var b=k();n(a,function(a,c){x[a]=b;F[a]=c.clientX;h[a]=c.clientY});B=c.scrollLeft;return!0};u[p]=function(a){n(a,function(a,b){var c=k()-x[a],e=F[a]-b.clientX,c=Math.abs(e)/c;d(c,e?0>e?-1:1:0)});B=null;return!0};u[e]=function(a){var b,e;null==B||n(a,function(a,c){b=
-            -
            F[a]-c.clientX;e=h[a]-c.clientY});if(e&&Math.abs(e)>Math.abs(b))return G=!0;b&&(G=!0,c.scrollLeft=Math.max(0,B+b));return g(a)};if(!b||f)r(a),r(e),r(p),b&&(c.className+=" mstouch");return{kill:function(){D(a);D(e);D(p);s()},swiped:function(){return G},ms:function(){return b},snap:function(a){b&&!f&&(c.style["-ms-scroll-snap-points-x"]="snapInterval(0px,"+a+"px)",c.style["-ms-scroll-snap-type"]="mandatory",c.style["-ms-scroll-chaining"]="none")},scroll:function(a,b,e){s();var x=c.scrollLeft,k=a>x?
-            -
            1:-1,r=Math[1===k?"min":"max"],d=Math.round(16*b*k);return A=m.require("$48","fps.js").loop(function(b){b&&(x=Math.max(0,r(a,x+d)),c.scrollLeft=x,a===x&&(s(),e&&e(x)))},c)}}};f.start=function(b,c){return l(b,a,c,!1)};f.move=function(a,b){return l(a,e,b,!1)};f.end=function(a,b){return l(a,p,b,!1)};var n=f.each=function(a,c){if(b)(a.MSPOINTER_TYPE_TOUCH||"touch")===a.pointerType&&c(0,a);else for(var e=-1,k=(a.originalEvent||a).changedTouches||[];++e<k.length;)c(e,k[e])},k=Date.now||function(){return(new Date).getTime()};
-            -
            return f}({},v,w));m.register("$49",function(f,d,m){f.init=function(d){function g(){e.style.top=String(-d.scrollTop)+"px";return!0}function c(){var a=e;a.textContent=d.value;a.innerHTML=a.innerHTML.replace(/[ \t]/g,b).split(/(?:\n|\r\n?)/).join('<span class="eol crlf"></span>\r\n')+'<span class="eol eof"></span>';return!0}function b(a){return'<span class="x'+a.charCodeAt(0).toString(16)+'">'+a+"</span>"}var a=d.parentNode,e=a.insertBefore(m.createElement("div"),d);h(d).on("input",c).on("scroll",g);
-            -
            h(a).addClass("has-mirror");e.className="ta-mirror";var p=d.offsetWidth-d.clientWidth;2<p&&(e.style.marginRight=String(p-2)+"px");c();g();return{kill:function(){h(d).off("input",c).off("scroll",g);a.removeChild(e);e=null;h(a).removeClass("has-mirror")}}};return f}({},v,w));m.register("$29",function(f,d,h){function l(b,a){for(var c=0,p=-1,n=a&&d[a],k=g[b]||[],f=k.length;++p<f;)callback=k[p],"function"===typeof callback&&(callback(n),c++);return c}var g={},c;f.load=function(b,a,c){function p(){f&&(clearTimeout(f),
-            -
            f=null);z&&(z.onreadystatechange=null,z=z=z.onload=null);b&&(delete g[b],b=null)}function n(a,k){var d=z&&z.readyState;if(k||!d||"loaded"===d||"complete"===d)k||l(b,c),p()}function k(){if(0===l(b))throw Error('Failed to load "'+(c||b)+'"');p()}if(c&&d[c])"function"===typeof a&&a(d[c]);else if(null!=g[b])g[b].push(a);else{g[b]=[a];var f=setTimeout(k,4E3),z=h.createElement("script");z.setAttribute("src",b);z.setAttribute("async","true");z.onreadystatechange=n;z.onload=n;z.onerror=k;z.onabort=p;h.getElementsByTagName("head")[0].appendChild(z)}};
-            -
            f.stat=function(b){var a;if(!(a=c)){for(var e,d,g=h.getElementsByTagName("script"),k=-1,f=g.length;++k<f;)if(a=g[k].getAttribute("src"))if(e=a.indexOf("/lib/vendor"),-1!==e){d=a.substr(0,e);break}a=c=d||"/static"}return a+b};return f}({},v,w));m.register("$16",function(f,d,E){function l(a,b){a.setReadOnly(!1);a.on("change",function(a,c){return b.val(c.getValue())});a.on("focus",function(){return b.focus()});a.on("blur",function(){return b.blur()})}function g(a){a.off("change");a.off("focus");a.off("blur")}
-            -
            function c(a){g(a);a.setReadOnly(!0);a.setHighlightGutterLine(!1);a.setHighlightActiveLine(!1)}function b(b,c){function e(){this.HighlightRules=d}var d=a(c),r=b.require,g=r("ace/lib/oop");g.inherits(d,r("ace/mode/text_highlight_rules").TextHighlightRules);g.inherits(e,r("ace/mode/text").Mode);return new e}function a(a){return function(){var b={start:[{token:"empty_line",regex:/^$/},{token:"constant.language",regex:"(?:&#[0-9]+;)|(?:&#x[0-9a-fA-F]+;)|(?:&[a-zA-Z0-9_:\\.-]+;)"},{token:"constant.language",
-            -
            regex:/<!\[CDATA\[/},{token:"constant.language",regex:/\]\]>/},{token:"locked",regex:/<(?:xliff:)?(?:g|ph)[^>]*>[^<]*<\/(?:xliff:)?(?:g|ph)>/},{token:"locked",regex:/<(?:xliff:)?(bx|ex|x)[^\/>]*\/>/},{token:"constant.language",regex:/<\/?[:a-z]+[^>]*>/}]},c=e(a);"icu"===a?b={start:b.start.concat([{token:"icu-quoted",regex:/'([{}][^']*)?'/},{token:"printf",regex:"{[^!-/:-@\\[-^{-~\u00a1\u00a2\u00a3\u00a4\u00a5\u00a6\u00a7\u00a9\u00ab\u00ac\u00ae\u00b0\u00b1\u00b6\u00bb\u00bf\u00d7\u00f7\\u2010-\\u2027\\u2030-\\u203E\\u2041-\\u2053\\u2055-\\u205E\\u2190-\\u245F\\u2500-\\u2775\\u2794-\\u2BFF\\u2E00-\\u2E7F\\u3001-\\u3003\\u3008-\\u3020\\u3030\\uFD3E\\uFD3F\\uFE45\\uFE46]+(,[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]*(?:number|date|time|spellout|ordinal|duration)[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]*(,[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]*[^{}]+)?)?}"},
-            -
            {token:"icu",regex:/{/,next:"icuName"},{token:"icu",regex:/}/,next:"icuType"}]),icuName:[{token:"icu",regex:"[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]+"},{token:"icu.name",regex:"[^\\s\\u0085\\u200E\\u200F\\u2028\\u2029!-/:-@\\[-^{-~\u00a1\u00a2\u00a3\u00a4\u00a5\u00a6\u00a7\u00a9\u00ab\u00ac\u00ae\u00b0\u00b1\u00b6\u00bb\u00bf\u00d7\u00f7\\u2010-\\u2027\\u2030-\\u203E\\u2041-\\u2053\\u2055-\\u205E\\u2190-\\u245F\\u2500-\\u2775\\u2794-\\u2BFF\\u2E00-\\u2E7F\\u3001-\\u3003\\u3008-\\u3020\\u3030\\uFD3E\\uFD3F\\uFE45\\uFE46]+",
-            -
            next:"icuType"},{defaultToken:"icu",next:"icuType"}],icuType:[{token:"icu",regex:/[{}]/,next:"start"},{defaultToken:"icu"}]}:c&&b.start.push({token:"printf",regex:c});this.$rules=b}}function e(a){switch(a){case "objc":return/%(?:\d+\$)?[-+'0# ]*\d*(?:\.\d+|\.\*(?:\d+\$)?)?(?:hh?|ll?|[qjzTL])?[sScCdDioOuUxXfFeEgGaAp%@]/;case "java":return/%(?:\d+\$)?[-+,(0# ]*\d*(?:\.\d+)?(?:[bBhHsScCdoxXeEfgGaA%n]|[tT][HIklMSLNpzZsQBbhAaCYyjmdeRTrDFc])/;case "php":return/%(?:\d+\$)?(?:'.|[-+0 ])*\d*(?:\.\d+)?[suxXbcdeEfFgGo%]/;
-            -
            case "python":return/%(?:\([a-z]+\))?[-+0# ]*(?:\d+|\*)?(?:\.\d+|\.\*)?(?:[hlL])?[sdiouxXeEfFgGcra%]/;case "javascript":return/%(?:[1-9]\d*\$)?\+?(?:0|'[^$])?-?\d*(?:\.\d+)?[b-gijostTuvxX%]/;case "auto":return/%(?:\d+\$|\([a-z]+\))?(?:[-+0]?\d*(\.\d+)?[duxoefgaDUXOEFGA]|[@scSC%])/;case n:return p||"%%"}}var p,n="auto";f.init=function(a,e,p){var f,r=!1,D=p||n,s=a.parentNode,A=s.appendChild(E.createElement("div"));h(s).addClass("has-proxy has-ace");m.require("$29","remote.js").load("https://cdnjs.cloudflare.com/ajax/libs/ace/1.4.1/ace.js",
-            -
            function(d){if(A){if(!d)throw Error("Failed to load code editor");f=d.edit(A);var g=f.session,p=f.renderer;f.$blockScrolling=Infinity;f.setShowInvisibles(r);f.setWrapBehavioursEnabled(!1);f.setBehavioursEnabled(!1);f.setHighlightActiveLine(!1);g.setUseSoftTabs(!1);p.setShowGutter(!0);p.setPadding(10);p.setScrollMargin(8);g.setMode(b(d,D));f.setValue(a.value,-1);g.setUseWrapMode(!0);e?l(f,e):c(f)}},"ace");return{kill:function(){f&&(g(f),f.destroy(),f=null);A&&(s.removeChild(A),h(s).removeClass("has-proxy has-ace"),
-            -
            A=null);return this},disable:function(){f&&c(f);e=null;return this},enable:function(a){e=a;f&&l(f,a);return this},resize:function(){f&&f.resize();return this},val:function(a){f&&a!==f.getValue()&&f.setValue(a,-1);return this},invs:function(a){a=a||!1;r!==a&&(r=a,f&&f.setShowInvisibles(a));return this},strf:function(a){a=a||n;a!==D&&(D=a,f&&f.session.setMode(b(d.ace,a)));return this},focus:function(){return this}}};f.strf=function(a,b){n=a;p=b;return f};return f}({},v,w));m.register("$50",function(f,
-            -
            d,E){function l(a,b){function c(){return b.val(a.getContent())}a.on("input",c);a.on("change",c);a.on("focus",function(){return b.focus()});a.on("blur",function(){return b.blur()});a.setMode("design")}function g(a){a.off("input");a.off("change");a.off("focus");a.off("blur")}function c(a){g(a);a.setMode("readonly")}var b=0;f.load=function(a){var b=m.require("$29","remote.js");b.load(b.stat("/lib/tinymce.min.js"),a,"tinymce");return f};f.init=function(a,e){function d(a){z=a;q="<p>"===a.substr(0,3)&&
-            -
            "</p>"===a.substr(-4);return a.replace(/(<\/?)script/ig,"$1loco:script")}function n(a){k=a;a._getContent=a.getContent;a.getContent=function(a){a=this._getContent(a);a=a.replace(/(<\/?)loco:script/ig,"$1script");if(!q&&"<p>"===a.substr(0,3)&&"</p>"===a.substr(-4)){var b=a.substr(3,a.length-7);if(b===z||-1===b.indexOf("</p>"))a=b}return a};a._setContent=a.setContent;a.setContent=function(a,b){return this._setContent(d(a),b)};e?(l(a,e),e.reset()):c(a);h(s).removeClass("loading")}var k,y=!1,z="",q=!1,
-            -
            r=a.parentNode,D=r.parentNode,s=r.appendChild(E.createElement("div")),A=D.insertBefore(E.createElement("nav"),r);A.id="_tb"+String(++b);h(r).addClass("has-proxy has-mce");h(s).addClass("mce-content-body loading").html(d(a.value));f.load(function(a){if(!a)throw Error("Failed to load HTML editor");s&&a.init({inline:!0,target:s,hidden_input:!1,theme:"modern",skin:!1,plugins:"link lists",browser_spellcheck:!0,menubar:!1,fixed_toolbar_container:"#"+A.id,toolbar:"formatselect | bold italic link unlink | bullist numlist outdent indent",
-            -
            block_formats:"Paragraph=p;Heading 1=h1;Heading 2=h2;Heading 3=h4;Heading 4=h4;Heading 5=h5;Heading 6=h6;",forced_root_block:"p",relative_urls:!1,convert_urls:!1,remove_script_host:!1,document_base_url:"",allow_script_urls:!1,formats:{alignleft:{classes:"alignleft"},alignright:{selector:"p,h1,h2,h3,h4,span,strong,em,a",classes:"alignright"},aligncenter:{selector:"p,h1,h2,h3,h4,span,strong,em,a",classes:"aligncenter"},strikethrough:{inline:"del"}},fix_list_elements:!0,extended_valid_elements:"span,b,i,u,loco:script",
-            -
            entities:"38,amp,60,lt,62,gt,160,nbsp",entity_encoding:"named",keep_styles:!1,init_instance_callback:n})});return{val:function(b){b=d(b);null==k?(a.value=b,h(s).html(b)):k.getContent()!==b&&k.setContent(b);e&&e.val(b);return this},kill:function(){k&&(e&&e.val(k.getContent()),g(k),k.destroy(),k=null);s&&(r.removeChild(s),h(r).removeClass("has-proxy has-mce"),s=null);A&&(D.removeChild(A),A=null);return this},enable:function(a){e=a;k&&l(k,a);return this},disable:function(){k&&c(k);e=null;return this},
-            -
            focus:function(){k&&e&&k.focus();return this},invs:function(a){a=a||!1;y!==a&&(y=a,h(r)[a?"addClass":"removeClass"]("show-invs"));return this}}};return f}({},v,w));m.register("$46",function(f,d,E){function l(b){function a(){f&&(z.off("input",e),f=!1)}function e(){var a=b.value;a!==r&&(z.trigger("changing",[a,r]),r=a)}function d(){e();f&&D!==r&&z.trigger("changed",[r])}function g(){c=b;D=r;f||(z.on("input",e),f=!0);z.trigger("editFocus");q.addClass("has-focus");return!0}function k(){c===b&&(c=null);
-            -
            z.trigger("editBlur");q.removeClass("has-focus");f&&(d(),a());return!0}var f=!1,z=h(b),q=h(b.parentNode),r=b.value,D;z.on("blur",k).on("focus",g);return{val:function(a){r!==a&&(b.value=a,z.triggerHandler("input"),r=a);return!0},kill:function(){a();z.off("blur",k).off("focus",g)},fire:function(){r=null;e()},ping:d,blur:k,focus:g,reset:function(){D=r=b.value}}}function g(b){this.e=b}var c;f._new=function(b){return new g(b)};f.init=function(b){var a=new g(b);b.disabled?(b.removeAttribute("disabled"),
-            -
            a.disable()):b.readOnly?a.disable():a.enable();return a};TextAreaPrototype=g.prototype;TextAreaPrototype.destroy=function(){this.unlisten();var b=this.p;b&&(b.kill(),this.p=null);this.e=null};TextAreaPrototype.reload=function(b,a){var c=this.l;c&&!a&&(this.disable(),c=null);this.val(b||"");a&&!c&&this.enable();return this};TextAreaPrototype.val=function(b){var a=this.e;if(null==b)return a.value;var c=this.l,d=this.p;d&&d.val(b);c&&c.val(b);c||a.value===b||(a.value=b,h(a).triggerHandler("input"));
-            -
            return this};TextAreaPrototype.fire=function(){this.l&&this.l.fire();return this};TextAreaPrototype.ping=function(){this.l&&this.l.ping();return this};TextAreaPrototype.focus=function(){var b=this.p;b?b.focus():h(this.e).focus()};TextAreaPrototype.focused=function(){return c&&c===this.el};TextAreaPrototype.parent=function(){return this.e.parentNode};TextAreaPrototype.attr=function(b,a){var c=this.e;if(1===arguments.length)return c.getAttribute(b);null==a?c.removeAttribute(b):c.setAttribute(b,a);return this};
-            -
            TextAreaPrototype.editable=function(){return!!this.l};TextAreaPrototype.enable=function(){var b=this.p;this.e.removeAttribute("readonly");this.listen();b&&b.enable&&b.enable(this.l);return this};TextAreaPrototype.disable=function(){var b=this.p;this.e.setAttribute("readonly",!0);this.unlisten();b&&b.disable&&b.disable();return this};TextAreaPrototype.listen=function(){var b=this.l;b&&b.kill();this.l=l(this.e);return this};TextAreaPrototype.unlisten=function(){var b=this.l;b&&(b.kill(),this.l=null);
-            -
            return this};TextAreaPrototype.setInvs=function(b,a){var c=this.i||!1;if(a||c!==b)this._i&&(this._i.kill(),delete this._i),(c=this.p)?c.invs&&c.invs(b):b&&(this._i=m.require("$49","mirror.js").init(this.e)),this.i=b;return this};TextAreaPrototype.getInvs=function(){return this.i||!1};TextAreaPrototype.setMode=function(b){var a=this.p,e=this.i||!1;b!==(this.m||"")&&(this.m=b,a&&a.kill(),this.p=a="code"===b?m.require("$16","ace.js").init(this.e,this.l,this["%"]):"html"===b?m.require("$50","mce.js").init(this.e,
-            -
            this.l):null,this.setInvs(e,!0),c&&this.focus());return this};TextAreaPrototype.setStrf=function(b){this["%"]=b;"code"===this.m&&this.p.strf(b);return this};TextAreaPrototype.name=function(b){this.e.setAttribute("name",b);return this};TextAreaPrototype.placeholder=function(b){this.e.setAttribute("placeholder",b);return this};TextAreaPrototype.redraw=function(){var b=this.p;b&&b.resize&&b.resize()};TextAreaPrototype=null;return f}({},v,w));m.register("$47",function(f,d,m){function l(a){var b=d.console;
-            -
            b&&b.error&&b.error(a)}function g(a){var b=m.createElement("div");a&&b.setAttribute("class",a);return b}function c(a){return function(){a.resize();return this}}function b(a){return function(b){for(var c=b.target,e=c.$index;null==e&&"DIV"!==c.nodeName&&(c=c.parentElement);)e=c.$index;null!=e&&(b.stopImmediatePropagation(),a.select(e));return!0}}function a(a){return function(){a.redrawDirty()&&a.redraw();return!0}}function e(a){return function(b){var c;c=b.keyCode;if(40===c)c=1;else if(38===c)c=-1;
-            -
            else return!0;if(b.shiftKey||b.ctrlKey||b.metaKey||b.altKey)return!0;a.selectNext(c);b.stopPropagation();b.preventDefault();return!1}}function p(a,b,c){function e(a){l("row["+a+"] disappeared");return{cellVal:function(){return""}}}return function(d){var g=b||0,k=c?-1:1,x=a.rows||[];d.sort(function(a,b){return k*(x[a]||e(a)).cellVal(g).localeCompare((x[b]||e(b)).cellVal(g))})}}function n(a){this.w=a}function k(a){this.t=a;this.length=0}function y(a,b,c){var e=m.createElement("div");e.className=c||
-            -
            "";this._=e;this.d=b||[];this.i=a||0;this.length=b.length}function z(a){this.live=a;this.rows=[]}f.create=function(a){return new n(a)};var q=n.prototype;q.init=function(d){var k=this.w,p=k.id,n=k.splity(p+"-thead",p+"-tbody"),f=n[0],n=n[1],B=[],u=[],x=[],F=[];if(d)this.ds=d,this.idxs=u,this._idxs=null;else if(!(d=this.ds))throw Error("No datasource");f.css.push("wg-thead");n.css.push("wg-tbody");d.eachCol(function(a,b,c){x[a]=p+"-col-"+b;F[a]=c||b});for(var N=g(),q=-1,z=x.length,l=g("wg-cols"),m=
-            -
            f.splitx.apply(f,x);++q<z;)m[q].header(F[q]),l.appendChild(N.cloneNode(!1)).setAttribute("for",x[q]);d.eachRow(function(a,b,c){B[a]=new y(a,b,c);u[a]=a});this.rows=B;this.cols=l;this.ww=null;this.root=N=n.body;this.head=f;f.redraw=c(this);f=n.fixed=m[0].bodyY()||20;k.lock().resize(f,n);k.css.push("is-table");k.restyle();this.sc?this._re_sort(z):d.sort&&d.sort(u);this.redrawDirty();this.render();h(N).attr("tabindex","-1").on("keydown",e(this)).on("mousedown",b(this)).on("scroll",a(this));return this};
-            -
            q.clear=function(){for(var a=this.pages||[],b=a.length;0!==b--;)a[b].destroy();this.pages=[];this.sy=this.mx=this.mn=this.vh=null;void 0;return this};q.render=function(){for(var a,b,c=[],e=this.rows||[],d=-1,k,g=this.idxs,x=g.length,p=this.idxr={},n=this.r,f=this._r,h=this.root,y=this.cols;++d<x;){0===d%100&&(a=y.cloneNode(!0),b=new z(a),b.h=2200,b.insert(h),c.push(b));k=g[d];p[k]=d;a=e[k];if(null==a)throw Error("Render error, no data at ["+k+"]");a.page=b;b.rows.push(a)}b&&100!==b.size()&&b.sleepH(22);
-            -
            this.pages=c;this.mx=this.mn=null;this.redrawDirty();this.redraw();null==n?null!=f&&(a=e[f])&&a.page&&(delete this._r,this.select(f,!0)):(a=e[n])&&a.page?this.select(n,!0):(this.deselect(),this._r=n);return this};q.resize=function(){var a=-1,b=this.ww||(this.ww=[]),c=this.w,e=c.cells[0],d=e.body.childNodes,k=d.length,g=this.pages||[],x=g.length;for(c.redraw.call(e);++a<k;)b[a]=d[a].style.width;if(x){c=this.mx;for(a=this.mn;a<=c;a++)g[a].widths(b);this.redrawDirty()&&this.redraw()}};q.redrawDirty=
-            -
            function(){var a=!1,b=this.root,c=b.scrollTop,b=b.clientHeight;this.sy!==c&&(a=!0,this.sy=c);this.vh!==b&&(a=!0,this.vh=b);return a};q.redraw=function(){for(var a=0,b=-1,c=null,e=null,d=this.ww,k=this.sy,g=this.vh,x=this.mn,n=this.mx,p=Math.max(0,k-100),k=g+k+100,f=this.pages||[],h=f.length;++b<h&&!(a>k);)g=f[b],a+=g.height(),a<p||(null===c&&(c=b),e=b,g.rendered||g.render(d));if(x!==c){if(null!==x&&c>x)for(b=x;b<c;b++){g=f[b];if(!g)throw Error("Shit!");g.rendered&&g.sleep()}this.mn=c}if(n!==e){if(null!==
-            -
            n&&e<n)for(b=n;b>e;b--)g=f[b],g.rendered&&g.sleep();this.mx=e}};q.selected=function(){return this.r};q.thead=function(){return this.w.cells[0]};q.tbody=function(){return this.w.cells[1]};q.tr=function(a){return(a=this.row(a))?a.cells():[]};q.row=function(a){return this.rows[a]};q.td=function(a,b){return this.tr(a)[b]};q.next=function(a,b,c){null==c&&(c=this.r||0);var e=this.idxs,d=e.length,g=(this.idxr||{})[c];for(c=g;c!==(g+=a)&&!(0<=g&&d>g);)if(b&&d)g=1===a?-1:d,b=!1;else return null;c=e[g];return null==
-            -
            c||null==this.rows[c]?(l("Bad next: ["+g+"] does not map to data row"),null):c};q.selectNext=function(a,b,c){a=this.next(a,b);null!=a&&this.r!==a&&this.select(a,c);return this};q.deselect=function(a){var b=this.r;null!=b&&(this.r=null,h(this.tr(b)).removeClass("selected"),this.w.fire("wgRowDeselect",[b,a]));return this};q.selectRow=function(a,b){return this.select(this.idxs[a])};q.select=function(a,b){var c=this.rows[a],e=c&&c.page;if(!e)return this.deselect(!1),l("Row is filtered out"),this;this.deselect(!0);
-            -
            var d,g=this.w.cells[1];e.rendered||(d=e.top(),g.scrollY(d),this.redrawDirty()&&this.redraw());if(!c.rendered)return e.rendered||l("Failed to render page"),l("Row ["+c.i+"] not rendered"),this;e=c.cells();h(e).addClass("selected");this.r=a;b||(d=g.scrollY(),h(this.root).focus(),d!==g.scrollY()&&g.scrollY(d));g.scrollTo(e[0],!0);this.w.fire("wgRowSelect",[a,c.data()]);return this};q.unfilter=function(){this._idxs&&(this.idxs=this._sort(this._idxs),this._idxs=null,this.clear().render());return this};
-            -
            q.filter=function(a){this._idxs||(this._idxs=this.idxs);this.idxs=this._sort(a);return this.clear().render()};q.each=function(a){for(var b,c=-1,e=this.rows||[],d=this.idxs||[],g=d.length;++c<g;)b=d[c],a(e[b],c,b);return this};q.sortable=function(a){var b=this.sc||(this.sc=new k(this));b.has(a)||b.add(a);return this};q._re_sort=function(a){var b=-1,c=this.sc,e=c.active;for(this.sc=c=new k(this);++b<a;)c.add(b);e&&(b=this.head.indexOf(e.id),-1===b&&(b=Math.min(e.idx,a-1)),this.sort(b,e.desc));return this};
-            -
            q._sort=function(a,b){b?(this.s=b,b(a)):(b=this.s)&&b(a);return a};q.sort=function(a,b){this._sort(this.idxs,p(this,a,b));this.sc.activate(a,b);return this};q=null;q=k.prototype;q.has=function(a){return null!=this[a]};q.add=function(a){var b=this,c=b.t.head.cells[a];b[a]={desc:null,idx:a,id:c.id};b.length++;c.addClass("wg-sortable").on("click",function(c){if("header"===c.target.nodeName.toLowerCase())return c.stopImmediatePropagation(),b.toggle(a),!1});return b};q.toggle=function(a){this.t.sort(a,
-            -
            !this[a].desc).clear().render();return this};q.activate=function(a,b){var c,e;c=this.active;var d=this[a],g=this.t.head.cells;c&&(e=g[c.idx])&&(e.removeClass(c.css),c!==d&&e.restyle());(e=g[a])?(d.desc=b,this.active=d,c="wg-"+(b?"desc":"asc"),e.addClass(c).restyle(),d.css=c):this.active=null;return this};q=null;q=y.prototype;q.render=function(a){var b,c=[],e=this._,d=this.length;if(e){for(this.c=c;0!==d--;)b=e.cloneNode(!1),c[d]=this.update(d,b),b.$index=this.i,a[d].appendChild(b);this._=null}else for(c=
-            -
            this.c;0!==d--;)a[d].appendChild(c[d]);this.rendered=!0;return this};q.update=function(a,b){var c=b||this.c[a]||{},e=(this.d[a]||function(){})()||"\u00a0";null==e.innerHTML?c.textContent=e:c.innerHTML=e.innerHTML;return c};q.cells=function(){return this.c||[this._]};q.data=function(){for(var a=-1,b=[],c=this.length;++a<c;)b[a]=this.cellVal(a);return b};q.destroy=function(){this.page=null;this.rendered=!1};q.cellVal=function(a){a=this.d[a]()||"";return String(a.textContent||a)};q=null;q=z.prototype;
-            -
            q.size=function(){return this.rows.length};q.insert=function(a){var b=this.h,c=g("wg-dead");c.style.height=String(b)+"px";a.appendChild(c);return this.dead=c};q.top=function(){return(this.rendered?this.live:this.dead).offsetTop};q.height=function(){var a=this.h;null==a&&(this.h=a=this.rendered?this.live.firstChild.offsetHeight:this.dead.offsetHight);a||l("row has zero height");return a};q.render=function(a){for(var b,c=-1,e=this.rows,d=e.length,g=this.dead,k=this.live,x=k.childNodes;++c<d;)b=e[c],
-            -
            b.rendered||b.render(x);d=a.length;for(c=0;c<d;c++)x[c].style.width=a[c];g.parentNode.replaceChild(k,g);this.rendered=!0;this.h=null;return this};q.sleep=function(){var a=this.height(),b=this.live,c=this.dead;c.style.height=String(a)+"px";b.parentNode.replaceChild(c,b);this.rendered=!1;this.h=a;return this};q.sleepH=function(a){a*=this.rows.length;var b=this.dead;b&&(b.style.height=String(a)+"px");this.rendered||(this.h=a);return this};q.widths=function(a){for(var b=this.live.childNodes,c=a.length;0!==
-            -
            c--;)b[c].style.width=a[c];return this};q.destroy=function(){var a=this.rendered?this.live:this.dead,b=this.rows,c=b.length;for(a.parentNode.removeChild(a);0!==c--;)b[c].destroy()};q=null;return f}({},v,w));m.register("$38",function(f,d,E){function l(a,b){var c=a.id,e=c&&r[c],d=e&&e.parent();if(!e||!d)return null;var g=d.dir===q,c=g?"X":"Y",k="page"+c,g=g?z:y,n=g(d.el),c=b["offset"+c],p=d.el,f=p.className;null==c&&(c=b[k]-g(a));c&&(n+=c);p.className=f+" is-resizing";return{done:function(){p.className=
-            -
            f},move:function(a){d.resize(a[k]-n,e);return!0}}}function g(a,c){function e(){h(E).off("mousemove",d);s&&(s.done(),s=null);return!0}function d(a){s?s.move(a):e();return!0}if(s)return!0;s=l(a.target,a);if(!s)return!0;h(E).one("mouseup",e).on("mousemove",d);return b(a)}function c(a,b){var c=b.type;"touchmove"===c?s&&s.move(b):"touchstart"===c?s=l(a.target,b):"touchend"===c&&s&&(s.done(),s=null)}function b(a){a.stopPropagation();a.preventDefault();return!1}function a(a){var b=D;b&&b.redraw();a&&a.redraw();
-            -
            return D=a}function e(b,c){var e=h(c).on("editFocus",function(){e.trigger("wgFocus",[a(b)])}).on("editBlur",function(){e.trigger("wgBlur",[a(null)])})}function p(a){var b=a.id,c=a.className;this.id=b;this.el=a;this.pos=this.index=0;this.css=[c||"wg-root","wg-cell"];this._cn=c;r[b]=this;this.clear()}var n=m.include("$44","html.js")||m.include("$2","html.js",!0),k=m.require("$21","dom.js"),y=k.top,z=k.left,q=1,r={},D,s=!1;f.init=function(a){var b=new p(a);b.redraw();m.require("$45","touch.js").ok(function(b){b.dragger(a,
-            -
            c)});h(a).on("mousedown",g);return b};d=p.prototype;d.fire=function(a,b){var c=h.Event(a);c.cell=this;h(this.el).trigger(c,b);return this};d.each=function(a){for(var b=-1,c=this.cells,e=c.length;++b<e;)a(c[b],b);return this};d.indexOf=function(a){return(a=r[a.id||String(a)])&&a.pid===this.id?a.index:-1};d.on=function(){return this.$("on",arguments)};d.off=function(){return this.$("off",arguments)};d.find=function(a){return h(this.el).find(a)};d.$=function(a,b){h.fn[a].apply(h(this.el),b);return this};
-            -
            d.addClass=function(a){this.css.push(a);return this};d.removeClass=function(a){a=this.css.indexOf(a);-1!==a&&this.css.splice(a,1);return this};d.parent=function(){return this.pid&&r[this.pid]};d.splitx=function(){return this._split(q,arguments)};d.splity=function(){return this._split(2,arguments)};d._split=function(a,b){(this.length||this.field)&&this.clear();for(var c=-1,e,d=b.length,g=1/d,n=0;++c<d;){e=k.el();this.body.appendChild(e);for(var f=e,h=b[c],y=h,q=1;r[h];)h=y+"-"+ ++q;f.id=h;e=new p(e);
-            -
            e.index=c;e.pid=this.id;e._locale(this.lang,this.rtl);e.pos=n;n+=g;this.cells.push(e);this.length++}this.dir=a;this.redraw();return this.cells};d.destroy=function(){this.clear();delete r[this.id];var a=this.el;a.innerHTML="";this.body=null;a.className=this._cn||"";h(a).off();return this};d.exists=function(){return this===r[this.id]};d.clear=function(){for(var a=this.el,b=this.cells,c=this.field,e=this.body,d=this.nav,g=this.length||0;0!==g--;)delete r[b[g].destroy().id];this.cells=[];this.length=
-            -
            0;d&&(a.removeChild(d),this.nav=null);e&&(c&&(n.ie()&&h(e).triggerHandler("blur"),c.destroy(),this.field=null),this.table&&(this.table=null),a===e.parentNode&&a.removeChild(e));this.body=a.appendChild(k.el("","wg-body"));this._h=null;return this};d.resize=function(a,b){if(!b&&(b=this.cells[1],!b))return;var c=b.index,e=this.cells,d=h(this.el)[this.dir===q?"width":"height"](),g=e[c+1],c=e[c-1];pad=(b.body||b.el.firstChild).offsetTop||0;max=(g?g.pos*d:d)-pad;min=c?c.pos*d:0;b.pos=Math.min(max,Math.max(min,
-            -
            a))/d;this.redraw();return this};d.distribute=function(a){for(var b=-1,c=0,e,d=this.cells,g=a.length;++b<g&&(e=d[++c]);)e.pos=Math.max(0,Math.min(1,a[b]));this.redraw();return this};d.distribution=function(){for(var a=[],b=0,c=this.cells,e=c.length-1;b<e;)a[b]=c[++b].pos;return a};d.restyle=function(){var a=this.css.concat();0===this.index?a.push("first"):a.push("not-first");this.dir&&(a.push("wg-split"),2===this.dir?a.push("wg-split-y"):a.push("wg-split-x"));this.t&&a.push("has-title");this.nav&&
-            -
            a.push("has-nav");this.field&&(a.push("is-field"),this.field.editable()?a.push("is-editable"):a.push("is-readonly"));a=a.join(" ");a!==this._css&&(this._css=a,this.el.className=a);return this};d.redraw=function(a){this.restyle();var b=this.el,c=this.body,e=this.field;if(c){var d,g=b.clientWidth||0,k=b.clientHeight||0,n=c.offsetTop||0,k=n>k?0:k-n;this._h!==k&&(this._h=k,c.style.height=String(k)+"px",d=e);this._w!==g&&(this._w=g,d=e);d&&d.redraw()}c=this.length;g=1;k=this.nav;for(n=2===this.dir?"height":
-            -
            "width";0!==c--;)e=this.cells[c],k?d=1:(e.fixed&&(e.pos=e.fixed/h(b)[n]()),d=g-e.pos,g=e.pos),e.el.style[n]=String(100*d)+"%",e.redraw(a);return this};d.contents=function(a,b){var c=this.el,e=this.body;if(null==a)return e.innerHTML;this.length?this.clear():e&&(c.removeChild(e),e=null);e||(this.body=e=c.appendChild(k.el("",b||"wg-content")),this._h=null,(c=this.lang)&&this._locale(c,this.rtl,!0));"string"===typeof a?h(e)._html(a):a&&this.append(a);this.redraw();return this};d.textarea=function(a,b){var c=
-            -
            this.field;if(c){var d=c.editable();c.reload(a,b);d!==b&&this.restyle()}else this.length&&this.clear(),d=k.el("textarea"),d.setAttribute("wrap","virtual"),d.value=a,this.contents(d),c=m.require("$46","field.js")._new(d)[b?"enable":"disable"](),e(this,d),this.field=c,this.restyle();this.lang||this.locale("en");return c};d.locale=function(a){a=m.require("$36","locale.js").cast(a);return this._locale(String(a),a.isRTL())};d._locale=function(a,b,c){var e=this.body;if(c||a!==this.lang)this.lang=a,e&&e.setAttribute("lang",
-            -
            a);if(c||b!==this.rtl)this.rtl=b,e&&e.setAttribute("dir",b?"RTL":"LTR");return this};d.editable=function(){var a=this.field;if(a)return a.editable()?a:null;var b=this.cells,c=b.length,e=this.navigated();if(null!=e)return b[e].editable();for(;++e<c;){for(e=0;e<c;c++);if(a=b[e].editable())return a}};d.eachTextarea=function(a){var b=this.field;b?a(b):this.each(function(b){b.eachTextarea(a)});return this};d.append=function(a){a&&(a.nodeType?n.init(this.body.appendChild(a)):n.init(h(a).appendTo(this.body)));
-            -
            return this};d.prepend=function(a){var b=this.body;if(a.nodeType){var c=b.firstChild;n.init(c?b.insertBefore(a,c):b.appendChild(a))}else n.init(h(a).prependTo(b));return this};d.before=function(a){var b=this.body;a.nodeType?n.init(this.el.insertBefore(a,b)):n.init(h(a).insertBefore(b));return this};d.header=function(a,b){if(null==a&&null==b)return this.el.getElementsByTagName("header")[0];this.t=k.txt(a||"");this.el.insertBefore(k.el("header",b),this.body).appendChild(this.t);this.redraw();return this};
-            -
            d.title=function(a){var b=this.t;if(b)return b.nodeValue=a||"",b;this.header(a);return this.t};d.titled=function(){var a=this.t;return a&&a.nodeValue};d.bodyY=function(){return y(this.body,this.el)};d.scrollY=function(a){if(J===a)return this.body.scrollTop;this.body.scrollTop=a};d.tabulate=function(a){var b=this.table;b?b.clear():b=m.require("$47","wgtable.js").create(this);b.init(a);return this.table=b};d.lock=function(){this.body.className+=" locked";return this};d.scrollTo=function(a,b){var c,
-            -
            e=this.body;c=e.scrollTop;var d=y(a,e);if(c>d)c=d;else{var g=e.clientHeight,d=d+h(a).outerHeight();if(g+c<d)c=d-g;else return}b?e.scrollTop=c:h(e).stop(!0).animate({scrollTop:c},250)};d.navigize=function(a,c){function e(a){var b=g[a],c=f[a],d=h(b.el).show();c.addClass("active");p=a;y.data("idx",a);b.fire("wgTabSelect",[a]);return d}var d=this,g=d.cells,n=d.nav,p,f=[];n&&d.el.removeChild(n);var n=d.nav=d.el.insertBefore(k.el("nav","wg-tabs"),d.body),y=h(n).on("click",function(a){var c=h(a.target).data("idx");
-            -
            if(null==c)return!0;if(null!=p){var k=f[p];h(g[p].el).hide();k.removeClass("active")}e(c);d.redraw();return b(a)});null==c&&(c=y.data("idx")||0);d.each(function(b,c){f[c]=h('<a href="#'+b.id+'"></a>').data("idx",c).text(a[c]).appendTo(y);b.pos=0;h(b.el).hide()});e(g[c]?c:0);d.lock();d.redraw();return d};d.navigated=function(){var a=this.nav;if(a)return h(a).data("idx")};d=null;return f}({},v,w));m.register("$24",function(f,d,E){function l(a){var b=[];a&&(a.saved()||b.push("po-unsaved"),a.fuzzy()?
-            -
            b.push("po-fuzzy"):a.flagged()&&b.push("po-flagged"),a.translation()||b.push("po-empty"),a.comment()&&b.push("po-comment"));return b.join(" ")}function g(a,b,c){b=h(a.title(b).parentNode);var e=b.find("span.lang");c?(c=m.require("$36","locale.js").cast(c),e.length||(e=h("<span></span>").prependTo(b)),e.attr("lang",c.lang).attr("class",c.getIcon()||"lang region region-"+(c.region||"zz").toLowerCase())):(e.remove(),c="en");a.locale(c);return b}function c(a,b,c){b.on("click",function(b){var e=a.fire(c,
-            -
            [b.target]);e||b.preventDefault();return e})}function b(){this.dirty=0}m.require("$3","number.js");var a="poUpdate",e="changing",p="changed",n=0,k=1,y=2,z=3,q=4,r=5,D,s,A=m.require("$35","string.js").html,v=m.require("$6","string.js").sprintf;f.extend=function(a){return a.prototype=new b};f.localise=function(a){s=a;return f};var B=function(){var a=E.createElement("p");return function(b){a.innerHTML=b.replace("src=","x=");return a.textContent.trim()||b.trim()}}(),u=b.prototype=m.require("$37","abstract.js").init(["getListColumns",
-            -
            "getListHeadings","getListEntry"],["editable","t"]);u.init=function(){this.localise();this.editable={source:!0,target:!0};this.mode="";this.html=!1;return this};u.localise=function(a){a||(a=s||m.require("$1","t.js").init());var b=[];b[n]=a._x("Source text","Editor")+":";b[z]=a._x("%s translation","Editor")+":";b[q]=a._x("Context","Editor")+":";b[r]=a._x("Comments","Editor")+":";b[k]=a._x("Single","Editor")+":";b[y]=a._x("Plural","Editor")+":";b[6]=a._x("Untranslated","Editor");b[7]=a._x("Translated",
-            -
            "Editor");b[8]=a._x("Toggle Fuzzy","Editor");b[9]=a._x("Suggest translation","Editor");this.labels=b;this.t=a;return this};u.setRootCell=function(a){function b(a){c.redraw(!0,a);return!0}var c=m.require("$38","wingrid.js").init(a);h(d).on("resize",b);this.redraw=b;h(a).on("wgFocus wgBlur",function(a,b){a.stopPropagation();D=b});this.destroy=function(){c.destroy();h(d).off("resize",b)};this.rootDiv=a;return c};u.$=function(){return h(this.rootDiv)};u.setListCell=function(a){var b=this;b.listCell=a;
-            -
            a.on("wgRowSelect",function(a,c){b.loadMessage(b.po.row(c));return!0}).on("wgRowDeselect",function(a,c,e){e||b.loadNothing();return!0})};u.setSourceCell=function(a){this.sourceCell=a};u.setTargetCell=function(a){this.targetCell=a};u.next=function(a,b,c){for(var e=this.listTable,d=e.selected(),g=d,k,n=this.po;null!=(d=e.next(a,c,d));){if(g===d){d=null;break}if(b&&(k=n.row(d),k.translated(0)))continue;break}null!=d&&e.select(d,!0);return d};u.current=function(a){var b=this.active;if(null==a)return b;
-            -
            a?a.is(b)?this.reloadMessage(a):this.loadMessage(a):this.unloadActive();return this};u.getTargetOffset=function(){if(this.active)return this.targetCell&&this.targetCell.navigated()||0};u.getTargetEditable=function(){return this.editable.target&&this.targetCell&&this.targetCell.editable()};u.getSourceEditable=function(){return this.editable.source&&this.sourceCell&&this.sourceCell.editable()};u.getContextEditable=function(){return this.editable.context&&this.contextCell&&this.contextCell.editable()};
-            -
            u.getFirstEditable=function(){return this.getTargetEditable()||this.getSourceEditable()||this.getContextEditable()};u.searchable=function(a){a&&(this.dict=a,this.po&&this.rebuildSearch());return this.dict&&!0};u.rebuildSearch=function(){var a=-1,b=this.po.rows,c=b.length,e=this.dict;for(e.clear();++a<c;)e.add(a,b[a].toText())};u.filtered=function(){return this.lastSearch||""};u.filter=function(a,b){var c,e=this.listTable,d=this.lastFound,g=this.lastSearch;if(a){if(g===a)return d||0;if(g&&!d&&0===
-            -
            a.indexOf(g))return 0;c=this.dict.find(a)}this.lastSearch=g=a;this.lastFound=d=c?c.length:this.po.length;c?e.filter(c):e.unfilter();b||this.fire("poFilter",[g,d]);return d};u.countFiltered=function(){return this.lastSearch?this.lastFound:this.po.length};u.unsave=function(a,b){var c=!1;if(a){if(c=a.saved(b))this.dirty++,a.unsave(b),this.fire("poUnsaved",[a,b]);this.markUnsaved(a)}return c};u.markUnsaved=function(a){var b=this.po.indexOf(a);if((b=this.listTable.tr(b))&&b.length){var c=b[0].className;
-            -
            a=c.replace(/(?:^| +)po-[a-z]+/g,"")+" "+l(a);a!==c&&h(b).attr("class",a)}};u.save=function(a){var b=this.po;if(this.dirty||a)b.each(function(a,b){b.save()}),this.listCell.find("div.po-unsaved").removeClass("po-unsaved"),this.dirty=0,this.fire("poSave");return b};u.fire=function(a,b){var c=this.handle;if(c&&c[a]&&(c=c[a].apply(this,b||[]),!1===c))return!1;c=h.Event(a);this.$().trigger(c,b);return!c.isDefaultPrevented()};u.on=function(a,b){this.$().on(a,b);return this};u.getSorter=function(){return null};
-            -
            u.reload=function(){var a=this,b,c=a.listCell,e=a.listTable,d=a.po,g=d&&d.locale(),k=g&&g.isRTL(),n=d&&d.length||0;if(!d||!d.row)return c&&c.clear().header("Error").contents("Invalid messages list"),!1;a.targetLocale=g;a.lastSearch&&(a.lastSearch="",a.lastFound=n,a.fire("poFilter",["",n]));e&&(b=e.thead().distribution());a.listTable=e=c.tabulate({eachCol:function(b){var c,e,d=a.getListColumns(),g=a.getListHeadings();for(e in d)c=d[e],b(c,e,g[c])},eachRow:function(b){d.each(function(c,e){b(e.idx,a.getListEntry(e),
-            -
            l(e))})},sort:a.getSorter()});var p,c=a.getListColumns();for(p in c)e.sortable(c[p]);b&&e.thead().distribute(b);e.tbody().$(k?"addClass":"removeClass",["is-rtl"]);a.fire("poLoad");return!!n};u.load=function(a,b){this.po=a;this.dict&&this.rebuildSearch();this.reload()&&(-1!==b?this.listTable.selectRow(b||0):this.active&&this.unloadActive())};u.pasteMessage=function(a){var b,c=0;this.active===a&&((b=this.sourceCell)&&b.eachTextarea(function(b){b.val(a.source(null,c++))}),(b=this.contextCell)&&b.eachTextarea(function(b){b.val(a.context())}),
-            -
            b=this.targetCell)&&(c=0,b.eachTextarea(function(b){b.val(a.translation(c++))}));this.updateListCell(a,"source");this.updateListCell(a,"target");return this};u.reloadMessage=function(a){var b=this.sourceCell,c=this.targetCell,e;this.pasteMessage(a);b&&this.setSrcMeta(a,b)&&b.redraw();c&&(e=c.navigated()||0,e=this.setTrgMeta(a,e,c),!b&&this.setSrcMeta(a,c)&&(e=!0),e&&c.redraw());return this};u.setStatus=function(){return null};u.setSrcMeta=function(a,b){var e=[],d,g=!1,k=this.$smeta,n=this.labels,
-            -
            p=[],f=a.tags(),y=f&&f.length;if(d=a.context())p.push("<span>"+A(n[q])+"</span>"),p.push("<mark>"+A(d)+"</mark>");if(y&&this.getTag)for(p.push("<span>Tagged:</span>");0<=--y;)(d=this.getTag(f[y]))&&p.push('<mark class="tag">'+A(d.mod_name)+"</mark>");p.length&&e.push(p.join(" "));if(this.getMono()&&(d=a.refs())&&(f=d.split(/\s/),y=f.length)){for(p=[];0<=--y;)d=f[y],p.push("<code>"+A(d)+"</code>");e.push('<p class="has-icon icon-file">'+p.join(" ")+"</p>")}(d=a.notes())&&e.push('<p class="has-icon icon-info">'+
-            -
            A(d,!0)+"</p>");e.length?(k||(k=b.find("div.meta"),k.length||(k=h('<div class="meta"></div>').insertAfter(b.header())),c(this,k,"poMeta"),this.$smeta=k),k.html(e.join("\n")).show(),g=!0):k&&k.text()&&(k.text("").hide(),g=!0);return g};u.setTrgMeta=function(a,b,c){var e=[],d=!1,g=this.$tmeta;b=(a=a.errors(b))&&a.length;var k;if(b)for(k=0;k<b;k++)e.push('<p class="has-icon icon-warn">'+A(a[k],!0)+".</p>");e.length?(g||(g=c.find("div.meta"),g.length||(g=h('<div class="meta"></div>').insertAfter(c.header())),
-            -
            this.$tmeta=g),g.html(e.join("\n")).show(),d=!0):g&&g.text()&&(g.text("").hide(),d=!0);return d};u.loadMessage=function(b){function c(a,b){var e=b?a.split(" "):a.split(" ",1);a=e[0];"="===a.charAt(0)&&(a=a.substr(1),a=["zero","one","two"][Number(a)]||a);e[0]=a.charAt(0).toUpperCase()+a.substr(1).toLowerCase();return e.join(" ")}function d(a,e){var p=J,h=L[n];a.off();a.titled()!==h&&g(a,h,e||"en");h=!1;s.setSrcMeta(b,a)&&(h=!0);if(b.plural()){var h=-1,q=[],r=[],l=a.id+"-",z=b.sourceForms()||e&&e.plurals||
-            -
            ["One","Other"],m=z.length;if(2!==m||"="===z[0].charAt(0)&&"=1"!==z[0])for(;++h<m;)q[h]=l+String(h),r[h]=c(z[h])+":";else q=[l+"-0",l+"-1"],r=[L[k],L[y]];a.splity.apply(a,q);a.each(function(a,c){a.header(r[c]).textarea(b.source(null,c),p).setStrf(C).setMode(A).setInvs(B)});a.lock();p&&a.each(function(a,b){f(a,b)})}else h&&a.redraw(),a.textarea(b.source(),p).setStrf(C).setMode(A).setInvs(B),p&&f(a,0)}function f(c,d){c.on(e,function(a,c){b.source(c,d);0===d&&s.updateListCell(b,"source");s.unsave(b,
-            -
            d)}).on(p,function(){0===d&&s.po.reIndex(b);s.dict&&s.rebuildSearch();s.fire(a,[b])})}function h(a,e,d){M&&a.eachTextarea(function(a){a.ping()});a.off();var k=e.isKnown()&&e.label||"Target",k=v(L[z],k);a.titled()!==k&&g(a,k,e);k=!1;!this.sourceCell&&s.setSrcMeta(b,a)&&(k=!0);s.setTrgMeta(b,d,a)&&(k=!0);s.setStatus(b,d);if(b.pluralized()){var n=[],p=[],f=a.id+"-",y=b.targetForms()||e.plurals||["One","Other"],k=y.length,q=function(a){var b=y[a];p.push(b?c(b,!0):"Form "+a);n.push(f+String(a))};for(b.each(q);(e=
-            -
            n.length)<k;)q(e);a.splitx.apply(a,n);a.each(function(a,c){var e=M&&!b.disabled(c);a.textarea(b.translation(c),e).setStrf(C).setMode(A).setInvs(B);M&&l(a,c)});a.navigize(p,d||null).on("wgTabSelect",function(c,e){var d=M&&c.cell.editable();d&&d.focus();s.setTrgMeta(b,e,a);s.setStatus(b,e);s.fire("poTab",[e])})}else k&&a.redraw(),a.textarea(b.translation(),M&&!b.disabled(0)).setStrf(C).setMode(A).setInvs(B),M&&l(a,0)}function l(c,d){c.on(e,function(a,c,e){b.translate(c,d);0===d&&s.updateListCell(b,
-            -
            "target");b.fuzzy(d)?s.fuzzy(!1,b,d):s.unsave(b,d);""===c?(s.fire("poEmpty",[!0,b,d]),s.setStatus(b,d)):""===e&&(s.fire("poEmpty",[!1,b,d]),s.setStatus(b,d))}).on(p,function(){s.dict&&s.rebuildSearch();s.fire(a,[b])})}function m(c){c.off();var d=L[q];c.titled()!==d&&(g(c,d),s.setStatus(null));c.textarea(b.context(),!0).setMode(A).setInvs(B);X&&c.on(e,function(a,c){b.context(c);s.updateListCell(b,"source");s.unsave(b,O)}).on(p,function(){s.po.reIndex(b);s.dict&&s.rebuildSearch();s.fire(a,[b])})}function u(a){var c=
-            -
            L[r];a.titled()!==c&&g(a,c);a.off().on(e,function(a,c){b.comment(c);s.fire("poComment",[b,c]);s.unsave(b,O)}).textarea(b.comment(),!0)}var s=this,A=s.mode,E=b.isHTML(),B=s.inv||!1,w=this.fmt||null,C=b.format()||null,I=b.is(s.active),O=0,T=s.sourceCell,S=s.targetCell,U=s.contextCell,V=s.commentCell,M=s.editable.target,J=s.editable.source,X=s.editable.context,P=D,Y=s.sourceLocale,W=s.targetLocale,L=s.labels;s.html!==E&&(s.html=E,"code"!==s.mode&&(A=E?"html":"",s.setMode(A)));s.active=b;T&&d(T,Y);U&&
-            -
            m(U);S&&W&&(O=S.navigated()||0,h(S,W,O));V&&u(V);P&&(P.exists()||(P=P.parent()),(E=P.editable())&&E.focus());w!==C&&(this.fmt=C);I||s.fire("poSelected",[b,O])};u.unloadActive=function(){function a(b){b&&b.text("").hide()}function b(a){a&&a.off().clear()}a(this.$smeta);a(this.$tmeta);b(this.sourceCell);b(this.contextCell);b(this.targetCell);this.commentCell&&this.commentCell.off();this.active&&(this.fire("poDeselected",[this.active]),this.active=null);return this};u.loadNothing=function(){var a,b=
-            -
            this.t,c=this.mode||"",e=this.inv||!1,d=this.fmt;this.unloadActive();this.setStatus(null);(a=this.commentCell)&&a.textarea("",!1);if(a=this.sourceCell)a.textarea("",!1).setStrf(d).setMode(c).setInvs(e),a.title(b._x("Source text not loaded","Editor")+":");if(a=this.contextCell)a.textarea("",!1).setMode(c).setInvs(e),a.title(b._x("Context not loaded","Editor")+":");if(a=this.targetCell)a.textarea("",!1).setStrf(d).setMode(c).setInvs(e),a.title(b._x("Translation not loaded","Editor")+":");this.fire("poSelected",
-            -
            [null])};u.updateListCell=function(a,b){var c=this.getListColumns()[b],e=this.po.indexOf(a);(e=this.listTable.row(e))&&e.rendered&&e.update(c)};u.cellText=function(a){return(a=-1!==a.indexOf("<")||-1!==a.indexOf("&")?B(a):a.trim())||"\u00a0"};u.fuzzy=function(a,b,c){b=b||this.active;var e=b.fuzzy(c);!0!==a||e?!1===a&&e&&this.flag(0,b,c)&&this.fire("poFuzzy",[b,!1,c]):this.flag(4,b,c)&&this.fire("poFuzzy",[b,!0,c]);return e};u.flag=function(b,c,e){if(!c){c=this.active;e=this.getTargetOffset();if(null==
-            -
            e)return null;e&&c.targetForms()&&(e=0)}var d=c.flagged(e);if(null==b)return d;if(d===b||b&&!c.translated(e)||!this.fire("poFlag",[b,d,c,e]))return!1;c.flag(b,e);this.fire(a,[c])&&this.unsave(c,e);this.setStatus(c,e);return!0};u.add=function(b,c){var e,d=this.po.get(b,c);d?e=this.po.indexOf(d):(e=this.po.length,d=this.po.add(b,c),this.load(this.po,-1),this.fire("poAdd",[d]),this.fire(a,[d]));this.lastSearch&&this.filter("");this.listTable.select(e);return d};u.del=function(b){if(b=b||this.active){var c=
-            -
            this.lastSearch,e=this.po.del(b);null!=e&&(this.unsave(b),this.fire("poDel",[b]),this.fire(a,[b]),this.reload(),this.dict&&this.rebuildSearch(),this.active&&this.active.equals(b)&&this.unloadActive(),this.po.length&&(c&&this.filter(c),this.active||(e=Math.min(e,this.po.length-1),this.listTable.select(e))))}};u.setMono=function(a){return this.setMode(a?"code":this.html?"html":"")};u.setMode=function(a){if(this.mode!==a){this.mode=a;this.callTextareas(function(b){b.setMode(a)});var b=this.active,c=
-            -
            this.sourceCell;b&&b.refs()&&c&&this.setSrcMeta(b,c)&&c.redraw()}return this};u.getMono=function(){return"code"===this.mode};u.setInvs=function(a){(this.inv||!1)!==a&&(this.inv=a,this.callTextareas(function(b){b.setInvs(a)}),this.fire("poInvs",[a]));return this};u.getInvs=function(){return this.inv||!1};u.callTextareas=function(a){var b=this.targetCell;b&&b.eachTextarea(a);(b=this.contextCell)&&b.eachTextarea(a);(b=this.sourceCell)&&b.eachTextarea(a);return this};u.focus=function(){var a=this.getTargetEditable();
-            -
            a&&a.focus();return this};u=null;return f}({},v,w));m.register("$13",function(f,d,E){function l(){this.init()._validate();this.sourceLocale={lang:"en",label:"English",plurals:["One","Other"]}}function g(a){a=h('<button type="button" class="button button-small icon icon-'+a+' hastip"></button>');m.require("$12","tooltip.js").init(a);return a}function c(a){return g("cloud").attr("title",a.labels[8]+" (Ctrl-U)").on("click",function(b){b.preventDefault();a.focus().fuzzy(!a.fuzzy())})}function b(a){return g("robot").attr("title",
-            -
            a.labels[9]+" (Ctrl-J)").on("click",function(b){b.preventDefault();a.fire("poHint")})}d=m.require("$24","base.js");f.init=function(a){var b=new l;a=b.setRootCell(a);var c=a.splity("po-list","po-edit"),d=c[0],g=c[1],c=g.splitx("po-trans","po-comment"),f=c[0],h=c[1].header("Loading.."),c=f.splity("po-source","po-target"),f=c[0].header("Loading.."),c=c[1].header("Loading..");a.distribute([0.34]);g.distribute([0.8]);b.setListCell(d);b.setSourceCell(f);b.setTargetCell(c);b.commentCell=h;b.editable.source=
-            -
            !1;return b};d=l.prototype=d.extend(l);d.getListHeadings=function(){var a=this.t||{_x:function(a){return a}},b=[a._x("Source text","Editor")];this.targetLocale&&(b[1]=a._x("Translation","Editor"));return b};d.getListColumns=function(){var a={source:0};this.targetLocale&&(a.target=1);return a};d.getListEntry=function(a){var b=this.cellText,c=[function(){var c,d=b(a.source()||""),g=a.context();return g?(c=E.createElement("p"),c.appendChild(E.createElement("mark")).innerText=g,c.appendChild(E.createTextNode("\u00a0"+
-            -
            d)),c):d}];this.targetLocale&&(c[1]=function(){return b(a.translation()||"")});return c};d.stats=function(){var a=this.po,b=a.length,c=0,d=0,g=0;a.each(function(a,b){b.fuzzy()?g++:b.translated()?c++:d++});return{t:b,p:c.percent(b)+"%",f:g,u:d}};d.unlock=function(){var a=this.targetLocale;this._unlocked||(this.editable={source:!0,context:!0,target:!1},this.po&&this.po.unlock(),this.contextCell=this.targetCell,delete this.targetCell,a&&(this._unlocked=a,delete this.targetLocale,this.reload(),this.fire("poLock",
-            -
            [!1])),this.active&&this.loadMessage(this.active))};d.lock=function(){var a=this._unlocked;a&&(this.targetLocale=a,delete this._unlocked,this.po&&this.po.lock(a),this.editable={source:!1,context:!1,target:!0},this.targetCell=this.contextCell,delete this.contextCell,this.reload(),this.fire("poLock",[!0,a]),this.active&&this.loadMessage(this.active))};d.locked=function(){return!this._unlocked};d.setStatus=function(a){var e=this.$tnav;if(null==a)e&&(e.remove(),this.$tnav=null);else{e||(this.$tnav=e=
-            -
            h("<nav></nav>").append(c(this)).append(b(this)).appendTo(this.targetCell.header()));var d=[];a.translated()?a.fuzzy()&&d.push("po-fuzzy"):d.push("po-empty");e.attr("class",d.join(" "))}};d.getSorter=function(){function a(a,c){var d=a.weight(),g=c.weight();return d===g?b(a,c):d>g?-1:1}function b(a,c){return a.hash().localeCompare(c.hash())}var c=this;return function(d){var g=c.po,f=c.locked()?a:b;d.sort(function(a,b){return f(g.row(a),g.row(b))})}};return f}({},v,w));m.register("$14",function(f,d,
-            -
            m){var l={copy:66,clear:75,save:83,fuzzy:85,next:40,prev:38,enter:13,invis:73,hint:74},g={38:!0,40:!0,73:!0},c={66:function(b,a){var c=a.current();c&&(c.normalize(),a.focus().pasteMessage(c))},75:function(b,a){var c=a.current();c&&(c.untranslate(),a.focus().pasteMessage(c))},85:function(b,a){a.focus().fuzzy(!a.fuzzy())},13:function(b,a){a.getFirstEditable()&&a.next(1,!0,!0)},40:function(b,a){var c=b.shiftKey;a.next(1,c,c)},38:function(b,a){var c=b.shiftKey;a.next(-1,c,c)},73:function(b,a){if(!b.shiftKey)return!1;
-            -
            a.setInvs(!a.getInvs())}};f.init=function(b,a){function e(a){if(a.isDefaultPrevented()||!a.metaKey&&!a.ctrlKey)return!0;var e=a.which;if(!f[e])return!0;var d=c[e];if(!d)throw Error("command undefined #"+e);if(a.altKey||a.shiftKey&&!g[e]||!1===d(a,b))return!0;a.stopPropagation();a.preventDefault();return!1}var f={};h(a||d).on("keydown",e);return{add:function(a,b){c[l[a]]=b;return this},enable:function(){var a,b;for(b in arguments)a=l[arguments[b]],f[a]=!0;return this},disable:function(){h(a||d).off("keydown",
-            -
            e);b=a=f=null}}};return f}({},v,w));m.register("$25",function(f,d,h){function l(){this.reIndex([])}f.init=function(){return new l};d=l.prototype;d.reIndex=function(d){for(var c={},b=-1,a=d.length;++b<a;)c[d[b]]=b;this.keys=d;this.length=b;this.ords=c};d.key=function(d,c){if(null==c)return this.keys[d];var b=this.keys[d],a=this.ords[c];if(c!==b){if(null!=a)throw Error("Clash with item at ["+a+"]");this.keys[d]=c;delete this.ords[b];this.ords[c]=d}return d};d.indexOf=function(d){d=this.ords[d];return null==
-            -
            d?-1:d};d.add=function(d,c){var b=this.ords[d];null==b&&(this.keys[this.length]=d,b=this.ords[d]=this.length++);this[b]=c;return b};d.get=function(d){return this[this.ords[d]]};d.has=function(d){return null!=this.ords[d]};d.del=function(d){this.cut(this.ords[d],1)};d.cut=function(d,c){c=c||1;var b=[].splice.call(this,d,c);this.keys.splice(d,c);this.reIndex(this.keys);return b};d.each=function(d){for(var c=-1,b=this.keys,a=this.length;++c<a;)d(b[c],this[c],c);return this};d.sort=function(d){for(var c=
-            -
            -1,b=this.length,a,e=this.keys,f=this.ords,n=[];++c<b;)n[c]=[this[c],e[c]];n.sort(function(a,b){return d(a[0],b[0])});for(c=0;c<b;c++)a=n[c],this[c]=a[0],a=a[1],e[c]=a,f[a]=c;return this};d.join=function(d){return[].join.call(this,d)};d=null;return f}({},v,w));m.register("$26",function(f,d,h){function l(d,c){var b=RegExp("^.{0,"+(d-1)+"}["+c+"]"),a=RegExp("^[^"+c+"]+");return function(c,f){for(var n=c.length,k;n>d;){k=b.exec(c)||a.exec(c);if(null==k)break;k=k[0];f.push(k);k=k.length;n-=k;c=c.substr(k)}0!==
-            -
            n&&f.push(c);return f}}f.create=function(d){function c(a){return k[a]||"\\"+a}var b,a,e=/(?:\r\n|[\r\n\v\f\u2028\u2029])/g,f=/[ \r\n]+/g,n=/[\t\v\f\x07\x08\\\"]/g,k={"\t":"\\t","\v":"\\v","\f":"\\f","\u0007":"\\a","\b":"\\b"};if(null==d||isNaN(d=Number(d)))d=79;0<d&&(b=l(d-3," "),a=l(d-2,"-\u2013 \\.,:;\\?!\\)\\]\\}\\>"));return{pair:function(b,k){if(!k)return b+' ""';k=k.replace(n,c);var f=0;k=k.replace(e,function(){f++;return"\\n\n"});if(!(f||d&&d<k.length+b.length+3))return b+' "'+k+'"';var p=
-            -
            [b+' "'],h=k.split("\n");if(a)for(var l=-1,m=h.length;++l<m;)a(h[l],p);else p=p.concat(h);return p.join('"\n"')+'"'},prefix:function(a,b){var c=a.split(e);return b+c.join("\n"+b)},refs:function(a){a=a.replace(f," ",a);b&&(a=b(a,[]).join("\n#: "));return"#: "+a}}};return f}({},v,w));m.register("$39",function(f,d,h){function l(){this.length=0}f.init=function(){return new l};d=l.prototype;d.push=function(d){this[this.length++]=d;return this};d.sort=function(d){[].sort.call(this,d);return this};d.each=
-            -
            function(d){for(var c=-1,b=this.length;++c<b;)d(c,this[c]);return this};return f}({},v,w));m.register("$27",function(f,d,h){function l(){}f.extend=function(d){return d.prototype=new l};d=l.prototype=m.require("$37","abstract.js").init(["add","load"]);d.row=function(d){return this.rows[d]};d.lock=function(d){return this.locale(d||{lang:"zxx",label:"Unknown",nplurals:1,pluraleq:"n!=1"})};d.unlock=function(){var d=this.loc;this.loc=null;return d};d.locale=function(d){null==d?d=this.loc:this.loc=d=m.require("$36",
-            -
            "locale.js").cast(d);return d};d.each=function(d){this.rows.each(d);return this};d.indexOf=function(d){"object"!==typeof d&&(d=this.get(d));if(!d)return-1;null==d.idx&&(d.idx=this.rows.indexOf(d.hash()));return d.idx};d.get=function(d){return this.rows&&this.rows.get(d)};d.has=function(d){return this.rows&&this.rows.has(d)};d.del=function(d){d=this.indexOf(d);if(-1!==d){var c=this.rows.cut(d,1);if(c&&c.length)return this.length=this.rows.length,this.rows.each(function(b,a,c){a.idx=c}),d}};d.reIndex=
-            -
            function(d,c){var b=this.indexOf(d),a=d.hash(),e=this.rows.indexOf(a);return e===b?b:-1!==e?(c=(c||0)+1,d.source("Error, duplicate "+String(c)+": "+d.source()),this.reIndex(d,c)):this.rows.key(b,a)};d.sort=function(d){this.rows.sort(d);return this};d["export"]=function(){for(var d=-1,c=this.rows,b=c.length,a=m.require("$39","list.js").init();++d<b;)a.push(c[d]);return a};d=null;return f}({},v,w));m.register("$28",function(f,d,h){function l(c,b,a){if(null==a)return c[b]||"";c[b]=a||"";return c}function g(){this._id=
-            -
            this.id=""}f.extend=function(c){return c.prototype=new g};d=g.prototype;d.flag=function(c,b){var a=this.flg||(this.flg=[]);if(null!=b)a[b]=c;else for(var d=Math.max(a.length,this.src.length,this.msg.length);0!==d--;)a[d]=c;return this};d.flagged=function(c){var b=this.flg||[];if(null!=c)return b[c]||0;for(c=b.length;0!==c--;)if(b[c])return!0;return!1};d.flags=function(){for(var c,b={},a=[],d=this.flg||[],f=d.length;0!==f--;)c=d[f],b[c]||(b[c]=!0,a.push(c));return a};d.flaggedAs=function(c,b){var a=
-            -
            this.flg||[];if(null!=b)return c===a[b]||0;for(var d=a.length;0!==d--;)if(a[d]===c)return!0;return!1};d.fuzzy=function(c,b){var a=this.flaggedAs(4,c);null!=b&&this.flag(b?4:0,c);return a};d.source=function(c,b){if(null==c)return this.src[b||0]||"";this.src[b||0]=c;return this};d.plural=function(c,b){if(null==c)return this.src[b||1]||"";this.src[b||1]=c||"";return this};d.sourceForms=function(){return this.srcF};d.targetForms=function(){return this.msgF};d.each=function(c){for(var b=-1,a=this.src,
-            -
            d=this.msg,f=Math.max(a.length,d.length);++b<f;)c(b,a[b],d[b]);return this};d.count=function(){return Math.max(this.src.length,this.msg.length)};d.pluralized=function(){return 1<this.src.length||1<this.msg.length};d.translate=function(c,b){this.msg[b||0]=c||"";return this};d.untranslate=function(c){if(null!=c)this.msg[c]="";else{var b=this.msg,a=b.length;for(c=0;c<a;c++)b[c]=""}return this};d.translation=function(c){return this.msg[c||0]||""};d.errors=function(c){return this.err&&this.err[c||0]||
-            -
            []};d.translated=function(c){if(null!=c)return!!this.msg[c];var b=this.msg,a=b.length;for(c=0;c<a;c++)if(!b[c])return!1;return!0};d.untranslated=function(c){if(null!=c)return!this.msg[c];var b=this.msg,a=b.length;for(c=0;c<a;c++)if(b[c])return!1;return!0};d.comment=function(c){return l(this,"cmt",c)};d.notes=function(c){return l(this,"xcmt",c)};d.refs=function(c){return l(this,"rf",c)};d.format=function(c){return l(this,"fmt",c)};d.context=function(c){return l(this,"ctx",c)};d.tags=function(){return this.tg};
-            -
            d.toString=d.toText=function(){return this.src.concat(this.msg,this.id,this.ctx).join(" ")};d.weight=function(){var c=0;this.translation()||(c+=2);this.fuzzy()&&(c+=1);return c};d.equals=function(c){return this===c||this.hash()===c.hash()};d.hash=function(){return this.id};d.normalize=function(){for(var c=this.msg.length;0!==c--;)this.msg[c]=this.src[c]||""};d.disabled=function(c){return!!(this.lck||[])[c||0]};d.disable=function(c){(this.lck||(this.lck=[]))[c||0]=!0;return this};d.saved=function(c){var b=
-            -
            this.drt;if(null==b)return!0;if(null!=c)return!b[c];for(c=b.length;0!==c--;)if(b[c])return!1;return!0};d.unsave=function(c){(this.drt||(this.drt=[]))[c||0]=!0;return this};d.save=function(c){null==c?this.drt=null:(this.drt||(this.drt=[]))[c]=!1;return this};d.is=function(c){return c&&(c===this||c.idx===this.idx)};d.isHTML=function(c){if(null==c)return this.htm||!1;this.htm=c};d=null;return f}({},v,w));m.register("$15",function(f,d,h){function l(a){return{"Project-Id-Version":"PACKAGE VERSION","Report-Msgid-Bugs-To":"",
-            -
            "POT-Creation-Date":a||"","PO-Revision-Date":a||"","Last-Translator":"","Language-Team":"",Language:"","Plural-Forms":"","MIME-Version":"1.0","Content-Type":"text/plain; charset=UTF-8","Content-Transfer-Encoding":"8bit"}}function g(a,b){var c=a||"";b&&(c+="\x00"+b);return c}function c(a){var b=d.console;b&&b.error&&b.error(a.message||String(a))}function b(a){return m.require("$26","format.js").create(a)}function a(a){this.locale(a);this.clear();this.head=l(this.now())}function e(a,b){this.src=[a||
-            -
            ""];this.msg=[b||""]}f.create=function(b){return new a(b)};h=m.require("$27","messages.js").extend(a);h.clear=function(){this.rows=m.require("$25","collection.js").init();this.length=0;return this};h.now=function(){function a(b,c){for(var d=String(b);d.length<c;)d="0"+d;return d}var b=new Date,c=b.getUTCFullYear(),d=b.getUTCMonth()+1,e=b.getUTCDate(),f=b.getUTCHours(),b=b.getUTCMinutes();return a(c,4)+"-"+a(d,2)+"-"+a(e,2)+" "+a(f,2)+":"+a(b,2)+"+0000"};h.header=function(a,b){var c=this.head||(this.head=
-            -
            {});if(null==b)return this.headers()[a]||"";c[a]=b||"";return this};h.headers=function(a){var b,c=this.now(),d=this.head||(this.head=l(c));if(null!=a){for(b in a)d[b]=a[b];return this}var e=this.locale();a={};for(b in d)a[b]=String(d[b]);e?(a.Language=String(e)||"zxx",a["Language-Team"]=e.label||a.Language,a["Plural-Forms"]="nplurals="+(e.nplurals||"2")+"; plural="+(e.pluraleq||"n!=1")+";",b="PO-Revision-Date"):(a.Language="",a["Plural-Forms"]="nplurals=INTEGER; plural=EXPRESSION;",a["PO-Revision-Date"]=
-            -
            "YEAR-MO-DA HO:MI+ZONE",b="POT-Creation-Date");a[b]||(a[b]=c);a["X-Generator"]="Loco https://localise.biz/";return a};h.get=function(a,b){var c=g(a,b);return this.rows.get(c)};h.add=function(a,b){a instanceof e||(a=new e(a));b&&a.context(b);var d=a.hash();this.rows.get(d)?c("Duplicate message at index "+this.indexOf(a)):(a.idx=this.rows.add(d,a),this.length=this.rows.length);return a};h.load=function(a){for(var b=-1,d,f,g,h,l,m,s=(g=this.locale())&&g.nplurals||2,A=[];++b<a.length;)d=a[b],null==d.parent?
-            -
            (f=d.source||d.id,g=d.target||"",h=d.context,f||h?(l=new e(f,g),l._id=d._id,h&&l.context(h),d.flag&&l.flag(d.flag,0),d.comment&&l.comment(d.comment),d.notes&&l.notes(d.notes),d.refs&&l.refs(d.refs),l.format(d.format),d.message=l,this.add(l),d.prev&&d.prev[0]&&(l.prev(d.prev[0].source,d.prev[0].context),d.prev[1]&&l._src.push(d.prev[1].source||""))):0===b&&"object"===typeof g&&(this.head=g,this.headcmt=d.comment)):A.push(d);for(b=-1;++b<A.length;)try{d=A[b];f=d.source||d.id;l=a[d.parent]&&a[d.parent].message;
-            -
            if(!l)throw Error("parent missing for plural "+f);m=d.plural;1===m&&l.plural(f);m>=s||(d.flag&&l.flag(d.flag,m),l.translate(d.target||"",m),d.format&&!l.format()&&l.format(d.format))}catch(v){c(v)}return this};h.wrap=function(a){this.fmtr=b(a);return this};h.toString=function(){var a,c=this.locale(),d=[],f=[],g=this.headers(),h=!c,l=c&&c.nplurals||2,m=this.fmtr||b();g[c?"PO-Revision-Date":"POT-Creation-Date"]=this.now();for(a in g)f.push(a+": "+g[a]);f=new e("",f.join("\n"));f.comment(this.headcmt||
-            -
            "");h&&f.fuzzy(0,!0);d.push(f.toString());d.push("");this.rows.each(function(a,b){a&&(d.push(b.cat(m,h,l)),d.push(""))});return d.join("\n")};h=m.require("$28","message.js").extend(e);h.prev=function(a,b){this._src=[a||""];this._ctx=b};h.hash=function(){return g(this.source(),this.context())};h.toString=function(){return this.cat(b())};h.cat=function(a,b,c){var d,e=[],f;(f=this.cmt)&&e.push(a.prefix(f,"# "));(f=this.xcmt)&&e.push(a.prefix(f,"#. "));d=this.rf;if(f=this._id)d+=(d?" ":"")+"loco:"+f;
-            -
            d&&/\S/.test(d)&&e.push(a.refs(d));!b&&this.fuzzy()&&e.push("#, fuzzy");(f=this.fmt)&&e.push("#, "+f+"-format");(f=this._ctx)&&e.push(a.prefix(a.pair("msgctxt",f),"#| "));if(f=this._src)f[0]&&e.push(a.prefix(a.pair("msgid",f[0]),"#| ")),f[1]&&e.push(a.prefix(a.pair("msgid_plural",f[1]),"#| "));(f=this.ctx)&&e.push(a.pair("msgctxt",f));e.push(a.pair("msgid",this.src[0]));if(null==this.src[1])e.push(a.pair("msgstr",b?"":this.msg[0]));else for(d=-1,e.push(a.pair("msgid_plural",this.src[1])),f=this.msg||
-            -
            ["",""],c=c||f.length;++d<c;)e.push(a.pair("msgstr["+d+"]",b?"":f[d]||""));return e.join("\n")};h.compare=function(a,b){var c=this.weight(),d=a.weight();if(c>d)return 1;if(c<d)return-1;if(b){c=this.hash().toLowerCase();d=a.hash().toLowerCase();if(c<d)return 1;if(c>d)return-1}return 0};h.copy=function(){var a=new e,b,c;for(b in this)this.hasOwnProperty(b)&&((c=this[b])&&c.concat&&(c=c.concat()),a[b]=c);return a};h=h=null;return f}({},v,w));m.register("$17",function(f,d,m){f.init=function(d,f){function c(){return p||
-            -
            (p=h('<div id="loco-po-ref"></div>').dialog({dialogClass:"loco-modal loco-modal-wide",modal:!0,autoOpen:!1,closeOnEscape:!0,resizable:!1,height:500}))}function b(a,b,d){a=h("<p></p>").text(d);c().dialog("close").html("").dialog("option","title","Error").append(a).dialog("open")}function a(a){var b=a&&a.code;if(b){for(var d=-1,e=b.length,f=h("<ol></ol>").attr("class",a.type);++d<e;)h("<li></li>").html(b[d]).appendTo(f);f.find("li").eq(a.line-1).attr("class","highlighted");c().dialog("close").html("").dialog("option",
-            -
            "title",a.path+":"+a.line).append(f).dialog("open")}}function e(a){a=a.target;var b=h(a).find("li.highlighted")[0],b=Math.max(0,(b&&b.offsetTop||0)-Math.floor(a.clientHeight/2));a.scrollTop=b}var p;return{load:function(n){c().html('<div class="loco-loading"></div>').dialog("option","title","Loading..").off("dialogopen").dialog("open").on("dialogopen",e);n=h.extend({ref:n,path:f.popath},f.project||{});d.ajax.post("fsReference",n,a,b)}}};return f}({},v,w));m.register("$30",function(f,d,h){function l(d){this.api=
-            -
            d;this.chars=0}f.create=function(d){return new l(d)};d=l.prototype;d.init=function(d,c){function b(a){var b={length:0,html:a.html,sources:[]};q.push(b);return r[a.html?1:0]=b}function a(a,d){var g=a.source(null,d);if(g&&(a.untranslated(d)||c)){var q=m[g];if(q)q.push(a);else{var q=g.length,B=e.isHtml(g),B=r[B?1:0],u=B.sources;if(B.length+q>l||u.length===k)B=b(B),u=B.sources;u.push(g);m[g]=[a];B.length+=q;f+=q;h+=1}}}var e=this.api,f=0,h=0,k=50,l=5E3,m={},q=[],r=[];b({html:!1});b({html:!0});d.each(function(b,
-            -
            c){a(c,0);a(c,1)});r=null;this.map=m;this.chars=f;this.length=h;this.batches=q;this.locale=d.locale()};d.abort=function(){this.state="abort";return this};d.dispatch=function(){function d(a,b){function e(c,d,g){b!==g&&(a===d||1<c&&f.source(null,1)===a)&&(f.translate(b,c),l++,A++);return l}if(!c())return!1;if(!b)return!0;var f,g=m[a]||[],k=g.length,p=-1,l;for(v++;++p<k;)if(f=g[p])l=0,f.each(e),l&&h("each",[f]);return!0}function c(){return"abort"===k.state?(l&&(l.abort(),f()),!1):!0}function b(){var b=
-            -
            q.shift(),c;b?(c=b.sources)&&c.length?l.batch(c,r,b.html,d).fail(a).always(e):e():f()}function a(){k.abort();f()}function e(){s++;h("prog",[s,B]);c()&&b()}function f(){l=q=null;h("done")}function h(a,b){for(var c=u[a]||[],d=c.length;0<=--d;)c[d].apply(null,b)}var k=this,l=k.api,m=k.map,q=k.batches||[],r=k.locale,v=0,s=0,A=0,w=k.length,B=q.length,u={done:[],each:[],prog:[]};k.state="";b();return{done:function(a){u.done.push(a);return this},each:function(a){u.each.push(a);return this},prog:function(a){u.prog.push(a);
-            -
            return this},stat:function(){return{todo:function(){return Math.max(w-v,0)},did:function(){return v}}}}};return f}({},v,w));m.register("$40",{nn:["no"]});m.register("$31",function(f,d,h){function l(){}function g(c){c.parseError=function(b){return b&&b.code&&200!==b.code&&b.message?"Error "+b.code+": "+b.message:""};c.batch=function(b,a,d,f){function g(c){for(var d=b.length,e=-1;++e<d&&!1!==f(b[e],c[e]||"",a););}d=d?"html":"plain";var k=this.toLang(a);return c._call({url:"https://translate.yandex.net/api/v1.5/tr.json/translate?format="+
-            -
            d+"&lang=en-"+k,method:"POST",traditional:!0,data:{key:c.key(),text:b}}).done(function(a,b,d){a&&200===a.code?g(a.text||[]):(c.stderr(c.parseError(a)||c.httpError(d)),g([]))}).fail(function(){g([])})}}f.create=function(c){var b=l.prototype=new c;b.toString=function(){return"Yandex.Translate"};b.getId=function(){return"yandex"};b.getUrl=function(){return"https://translate.yandex.com/"};b.init=function(a){c.prototype.init.call(this,a);/^trnsl\./.test(this.key())&&g(this)};b.toLang=function(a){return this.mapLang(a,
-            -
            m.require("$40","yandex.json"))};return new l};return f}({},v,w));m.register("$41",{zh:["zh","zh-CN","zh-TW"],he:["iw"],jv:["jw"]});m.register("$32",function(f,d,h){function l(){}f.create=function(d){d=l.prototype=new d;d.toString=function(){return"Google Translate"};d.getId=function(){return"google"};d.getUrl=function(){return"https://translate.google.com/"};d.parseError=function(c){if(c.error){for(var b=[],a=c.error.errors||[],d=a.length,f=-1;++f<d;)b.push(a[f].message||"");return"Error "+c.error.code+
-            -
            ": "+b.join(";")}return""};d.batch=function(c,b,a,d){function f(a){for(var g=c.length,k=-1,h;++k<g&&(h=a[k]||{},!1!==d(c[k],h.translatedText||"",b)););}var g=this;a=a?"html":"text";var k=g.mapLang(b,m.require("$41","google.json"));return g._call({url:"https://translation.googleapis.com/language/translate/v2?source=en&target="+k+"&format="+a,method:"POST",traditional:!0,data:{key:g.key(),q:c}}).done(function(a,b,c){a.data?f(a.data.translations||[]):(g.stderr(g.parseError(a)||g.httpError(c)),f([]))}).fail(function(){f([])})};
-            -
            return new l};return f}({},v,w));m.register("$42",{nn:["no"],pt:["pt","pt-pt"],sr:["sr-Cyrl","sr-Latn"],sr_RS:["sr-Cyrl"],tlh:["tlh-Latn","tlh-Piqd"],zh:["zh-Hans","zh-Hant"],zh_CN:["zh-Hans"],zh_HK:["zh-Hans"],zh_SG:["zh-Hans"],zh_TW:["zh-Hant"]});m.register("$33",function(f,d,h){function l(){}f.create=function(d){d=l.prototype=new d;d.toString=function(){return"Microsoft Translator text API"};d.getId=function(){return"microsoft"};d.getUrl=function(){return"https://aka.ms/MicrosoftTranslatorAttribution"};
-            -
            d.parseError=function(c){return c&&c.error?c.error.message:""};d.batch=function(c,b,a,d){function f(a){for(var g=-1,k;++g<h&&(k=a[g]||{},k=k.translations||[],k=k[0]||{},!1!==d(c[g],k.text||"",b)););}var g=this,k=[],h=c.length,l=-1;a=a?"html":"plain";for(var q=g.mapLang(b,m.require("$42","ms.json"));++l<h;)k.push({text:c[l]});return g._call({url:"https://api.cognitive.microsofttranslator.com/translate?api-version=3.0&from=en&to="+q+"&textType="+a,method:"POST",data:JSON.stringify(k),headers:{"Content-Type":"application/json; charset=UTF-8",
-            -
            "Ocp-Apim-Subscription-Key":this.key(),"Ocp-Apim-Subscription-Region":g.param("region")||"global"}}).done(function(a,b,c){a&&a.length?f(a):(g.stderr(g.parseError(a)||g.httpError(c)),f([]))}).fail(function(){f([])})};return new l};return f}({},v,w));m.register("$43",{pt:["pt-PT","pt-BR"]});m.register("$34",function(f,d,h){function l(){}f.create=function(d){d=l.prototype=new d;d.toString=function(){return"DeepL Translator"};d.getId=function(){return"deepl"};d.getUrl=function(){return"https://www.deepl.com/translator"};
-            -
            d.parseError=function(c){return c.message};d.batch=function(c,b,a,d){function f(a){for(var g=c.length,k=-1,h;++k<g&&(h=a[k]||{},!1!==d(c[k],h.text||"",b)););}var g=this;a=g.mapLang(b,m.require("$43","deepl.json"));var k=b.tone,h="default";null==k&&(k=String(b.variant||"").toLowerCase());"formal"===k?h="more":"informal"===k&&(h="less");return g._call({url:"https://api.deepl.com/v2/translate",method:"POST",traditional:!0,data:{source_lang:"EN",target_lang:a.toUpperCase(),formality:h,preserve_formatting:"1",
-            -
            auth_key:g.key(),text:c}}).done(function(a,b,c){a.translations?f(a.translations):(g.stderr(g.parseError(a)||g.httpError(c)),f([]))}).fail(function(){f([])})};return new l};return f}({},v,w));m.register("$18",function(f,d,v){function l(){this.inf={}}function g(){var a=v.createElement("p"),b=/&(#\d+|#x[0-9a-f]|[a-z]+);/i,c=/<[a-z]+\s/i,d,f;return{sniff:function(g){if(g===d)return f;d=g;if(b.test(g)||c.test(g))if(a.innerHTML=g,a.textContent!==g)return f=!0;return f=!1}}}var c=l.prototype;c.init=function(a){this.inf=
-            -
            a||{}};c.param=function(a){return this.inf[a]||""};c.key=function(){return this.param("key")};c.getId=function(){return this.param("id")||"none"};c.getUrl=function(){return this.param("url")||"#"};c.toString=function(){return this.param("name")||this.getId()};c.stderr=function(a){var b=(d.loco||{}).notices||d.console;b&&b.error&&b.error(String(this)+": "+String(a))};c.httpError=function(a){return(a=a&&a.status)&&200!==a?"Responded status "+a:"Unknown error"};c.parseError=function(){return""};c.mapLang=
-            -
            function(a,b){var c=String(a).replace("-","_"),d=a.lang,f=b[c]||b[d]||[],g=f.length;if(0===g)return d;if(1<g)for(var c=c.toLowerCase(),d=-1,h;++d<g;)if(h=f[d],h.toLowerCase().replace("-","_")===c)return h;return f[0]};c.toLang=function(a){return String(a)};c.translate=function(a,b,c){return this.batch([a],b,this.isHtml(a),c)};c._call=function(a){var b=this;b.state=null;a.cache=!0;a.dataType="json";a.error=function(a,c,d){try{var f=a.responseText,g=f&&m.require("$5","json.js").parse(f);d=g&&b.parseError(g)||
-            -
            d}catch(h){}b.stderr(d||b.httpError(a))};return b.abortable(h.ajax(a))};c.abortable=function(a){var b=this;a.always(function(){b.$r===a&&(b.$r=null)});return b.$r=a};c.abort=function(){var a=this.$r;a&&a.abort()};c.isHtml=function(a){return(b||(b=g())).sniff(a)};c.createJob=function(){return m.require("$30","job.js").create(this)};c.batch=function(a,b,c,f){function g(c){for(var d=a.length,k=-1;++k<d&&!1!==f(a[k],c[k],b););}var l=d.loco.ajax;c={hook:this.getId(),type:c?"html":"text",locale:this.toLang(b),
-            -
            sources:a};var m=h.Deferred();this.abortable(l.post("apis",c,function(a){g(a&&a.targets||[]);m.resolve()},function(){g([]);m.reject()}));return m.promise()};f.create=function(a){var b;b=a.id;b="yandex"===b?m.require("$31","yandex.js").create(l):"google"===b?m.require("$32","google.js").create(l):"microsoft"===b?m.require("$33","ms.js").create(l):"deepl"===b?m.require("$34","deepl.js").create(l):new l;b.init(a);return b};f.suggest=function(a,b,c,d){var f,g,h=a.length;for(f=0;f<h;f++)g=a[f],g.translate(b,
-            -
            c,d)};var b;return f}({},v,w));m.register("$19",function(f,d,m){f.init=function(f){function g(){H||(I.on("click",k),H=h('<div id="loco-fs-creds"></div>').dialog({dialogClass:"request-filesystem-credentials-dialog loco-modal",minWidth:580,modal:!0,autoOpen:!1,closeOnEscape:!0}).on("change",'input[name="connection_type"]',function(){this.checked&&h("#ssh-keys").toggleClass("hidden","ssh"!==h(this).val())}));return H}function c(){R&&(b(h(s)),R=!1);if(B&&J){var a=J,c=h(Q);c.find("span.loco-msg").text(a);
-            -
            K||(c.removeClass("jshide").hide().fadeIn(500),K=!0)}else K&&(b(h(Q)),K=!1)}function b(a){a.slideUp(250).fadeOut(250,function(){h(this).addClass("jshide")})}function a(){if(B)return H&&H.dialog("close"),c(),h(f).find('button[type="submit"]').attr("disabled",!1),h(d).triggerHandler("resize"),w&&w(!0),!0;x&&H?(R||(h(s).removeClass("jshide").hide().fadeIn(500),R=!0),K&&(b(h(Q)),K=!1)):c();h(f).find('input[type="submit"]').attr("disabled",!0);w&&w(!1);return!1}function e(a){var b,c,d=r||{};for(b in d)d.hasOwnProperty(b)&&
-            -
            (c=d[b],a[b]?a[b].value=c:h('<input type="hidden" />').attr("name",b).appendTo(a).val(c))}function p(a){a.preventDefault();a=h(a.target).serializeArray();q(a);C=!0;return!1}function n(a){a.preventDefault();H.dialog("close");return!1}function k(a){a.preventDefault();H.dialog("open").find('input[name="connection_type"]').change();return!1}function y(b){B=b.authed;A=b.method;h(s).find("span.loco-msg").text(b.message||"Something went wrong.");J=b.warning||"";b.notice&&u.notices.info(b.notice);if(B)"direct"!==
-            -
            A&&(r=b.creds,e(f),C&&b.success&&u.notices.success(b.success)),a();else if(b.reason)u.notices.info(b.reason);else if(b=b.prompt){var c=g();c.html(b).find("form").on("submit",p);c.dialog("option","title",c.find("h2").remove().text());c.find("button.cancel-button").show().on("click",n);c.find('input[type="submit"]').addClass("button-primary");a();h(d).triggerHandler("resize")}else u.notices.error("Server didn't return credentials, nor a prompt for credentials")}function v(){a()}function q(a){C=!1;u.ajax.setNonce("fsConnect",
-            -
            N).post("fsConnect",a,y,v);return a}var r,w,s=f,A=null,C=!1,B=!1,u=d.loco,x=f.path.value,F=f.auth.value,N=f["loco-nonce"].value,I=h(s).find("button.button-primary"),Q=m.getElementById(s.id+"-warn"),R=!1,K=!1,J="",H;u.notices.convert(Q).stick();f.connection_type?(r={},r.connection_type=f.connection_type.value,B=!0):x&&F&&q({path:x,auth:F});a();return{applyCreds:function(a){if(a.nodeType)e(a);else{var b,c=r||{};for(b in c)c.hasOwnProperty(b)&&(a[b]=c[b])}return this},setForm:function(b){f=b;a();e(b);
-            -
            return this},connect:function(){x=f.path.value;F=f.auth.value;q(h(f).serializeArray());return this},listen:function(a){w=a;B&&a(!0);return this},authed:function(){return B}}};return f}({},v,w));m.register("$20",function(f,d,v){function l(d,f,h,k){f="n"===h?c(f):b(f);k&&(f=a(f));return g([].sort,[f])(d)}function g(a,b){return function(c){a.apply(c,b);return c}}function c(a){return function(b,c){var d=b&&b[a]||0,f=c&&c[a]||0;return d===f?0:d>f?1:-1}}function b(a){return function(b,c){return(b&&b[a]||
-            -
            "").localeCompare(c&&c[a]||"")}}function a(a){return function(b,c){return-1*a(b,c)}}f.init=function(a){function b(a){var c=-1,d=a.length;for(h("tr",s).remove();++c<d;)s.appendChild(a[c].$)}function c(a){q=a?C.find(a,d):d.slice(0);v&&(a=f[v],q=l(q,v,a.type,a.desc));b(q)}var d=[],f=[],g=0,q,r,v,s=a.getElementsByTagName("tbody")[0],w=a.getElementsByTagName("thead")[0],C=m.require("$10","fulltext.js").init();w&&s&&(h("th",w).each(function(a,c){var e=c.getAttribute("data-sort-type");e&&(a=g,h(c).addClass("loco-sort").on("click",
-            -
            function(c){c.preventDefault();c=a;var e=f[c],g=e.type,m=!(e.desc=!e.desc);q=l(q||d.slice(0),c,g,m);b(q);r&&r.removeClass("loco-desc loco-asc");r=h(e.$).addClass(m?"loco-desc":"loco-asc").removeClass(m?"loco-asc":"loco-desc");v=c;return!1}),f[g]={$:c,type:e});c.hasAttribute("colspan")?g+=Number(c.getAttribute("colspan")):g++}),h("tr",s).each(function(a,b){var c,e,g,h=[],l={_:a,$:b},m=b.getElementsByTagName("td");for(e in f){c=m[e];(g=c.textContent.replace(/(^\s+|\s+$)/g,""))&&h.push(g);c.hasAttribute("data-sort-value")&&
-            -
            (g=c.getAttribute("data-sort-value"));switch(f[e].type){case "n":g=Number(g)}l[e]=g}d[a]=l;C.index(a,h)}),a=h('form.loco-filter input[type="text"]',a.parentNode),a.length&&(a=a[0],w=h(a.form),1<d.length?m.require("$11","LocoTextListener.js").listen(a,c):w.hide(),w.on("submit",function(a){a.preventDefault();return!1})))};return f}({},v,w));var C=v.loco||{},I=C.conf||{$v:[0,0]};v=m.require("$1","t.js").init();w=I.wplang;C.version=function(f){return I.$v[f||0]};m.require("$2","html.js");m.require("$3",
-            -
            "number.js");m.require("$4","array.js");m.require("$5","json.js");C.l10n=v;v.load(I.wpl10n);w&&v.pluraleq(w.pluraleq);C.string=m.require("$6","string.js");C.notices=m.require("$7","notices.js").init(v);C.ajax=m.require("$8","ajax.js").init(I).localise(v);C.locale=m.require("$9","wplocale.js");C.fulltext=m.require("$10","fulltext.js");C.watchtext=m.require("$11","LocoTextListener.js").listen;C.tooltip=m.require("$12","tooltip.js");C.po={ed:m.require("$13","poedit.js"),kbd:m.require("$14","hotkeys.js"),
-            -
            init:m.require("$15","po.js").create,ace:m.require("$16","ace.js").strf("php"),ref:m.require("$17","refs.js")};C.apis=m.require("$18","apis.js");C.fs=m.require("$19","fsconn.js");h("#loco-admin.wrap table.wp-list-table").each(function(f,d){m.require("$20","tables.js").init(d)});C.validate=function(f){return"2.5.2"!==(/^\d+\.\d+\.\d+/.exec(f&&f[0]||"")&&RegExp.lastMatch)?(C.notices.warn("admin.js is the wrong version (2.5.2). Please empty all relevant caches and reload this page."),!1):!0}})(window,
-            -
            document,window.jQuery);


1	+ (function(v, w, h, J) {
2	+ var n = function() {
3	+ function f(d) {
4	+ throw Error("Failed to require " + d);
5	+ }
6	+ var d = {};
7	+ return {
8	+ register: function(f, m) {
9	+ d[f] = m;
10	+ },
11	+ require: function(h, m) {
12	+ return d[h] \|\| f(m);
13	+ },
14	+ include: function(h, m, k) {
15	+ return d[h] \|\| (k ? f(m) : null);
16	+ }
17	+ };
18	+ }();
19	+ n.register("$1", function(f, d, h) {
20	+ function m(k) {
21	+ var c = typeof k;
22	+ if ("string" === c) if (/[^ <>!=()%^&\|?:n0-9]/.test(k)) console.error("Invalid plural: " + k); else return new Function("n", "return " + k);
23	+ "function" !== c && (k = function(b) {
24	+ return 1 != b;
25	+ });
26	+ return k;
27	+ }
28	+ f.init = function(k) {
29	+ function c(a, b, e) {
30	+ return (a = p[a]) && a[e] ? a[e] : b \|\| "";
31	+ }
32	+ function b(a) {
33	+ return c(a, a, 0);
34	+ }
35	+ function a(a, b) {
36	+ return c(b + "" + a, a, 0);
37	+ }
38	+ function e(a, b, e) {
39	+ e = Number(k(e));
40	+ isNaN(e) && (e = 0);
41	+ return c(a, e ? b : a, e);
42	+ }
43	+ k = m(k);
44	+ var p = {};
45	+ return {
46	+ __: b,
47	+ _x: a,
48	+ _n: e,
49	+ _: b,
50	+ x: a,
51	+ n: e,
52	+ load: function(a) {
53	+ p = a \|\| {};
54	+ return this;
55	+ },
56	+ pluraleq: function(a) {
57	+ k = m(a);
58	+ return this;
59	+ }
60	+ };
61	+ };
62	+ return f;
63	+ }({}, v, w));
64	+ n.register("$2", function(f, d, h) {
65	+ f.ie = function() {
66	+ var m = !1, k = 0;
67	+ d.attachEvent && d.navigator && /MSIE (\d+)\./.exec(String(navigator.appVersion)) && (k = Number(RegExp.$1),
68	+ m = 11 > k);
69	+ return function() {
70	+ return m;
71	+ };
72	+ }();
73	+ f.init = function() {
74	+ return f;
75	+ };
76	+ return f;
77	+ }({}, v, w));
78	+ n.register("$3", function(f, d, h) {
79	+ Number.prototype.format = function(d, k, c) {
80	+ d = Math.pow(10, d \|\| 0);
81	+ var b = Math.round(d * this) / d;
82	+ d = [];
83	+ var b = String(b), a = b.split("."), b = a[0], a = a[1], e = b.length;
84	+ do {
85	+ d.unshift(b.substring(e - 3, e));
86	+ } while (0 < (e -= 3));
87	+ b = d.join(c \|\| ",");
88	+ if (a) {
89	+ c = a;
90	+ var p;
91	+ for (d = c.length; "0" === c.charAt(--d); ) p = d;
92	+ p && (c = c.substring(0, p));
93	+ (a = c) && (b += (k \|\| ".") + a);
94	+ }
95	+ return b;
96	+ };
97	+ Number.prototype.percent = function(d) {
98	+ var k = 0, c = this && d ? 100 * (this / d) : 0;
99	+ if (0 === c) return "0";
100	+ if (100 === c) return "100";
101	+ if (99 < c) c = Math.min(c, 99.9), d = c.format(++k); else if (.5 > c) {
102	+ c = Math.max(c, 1e-4);
103	+ do {
104	+ d = c.format(++k);
105	+ } while ("0" === d && 4 > k);
106	+ d = d.substr(1);
107	+ } else d = c.format(0);
108	+ return d;
109	+ };
110	+ return f;
111	+ }({}, v, w));
112	+ n.register("$4", function(f, d, h) {
113	+ Array.prototype.indexOf \|\| (Array.prototype.indexOf = function(d) {
114	+ if (null == this) throw new TypeError();
115	+ var k, c = Object(this), b = c.length >>> 0;
116	+ if (0 === b) return -1;
117	+ k = 0;
118	+ 1 < arguments.length && (k = Number(arguments[1]), k != k ? k = 0 : 0 != k && Infinity != k && -Infinity != k && (k = (0 < k \|\| -1) * Math.floor(Math.abs(k))));
119	+ if (k >= b) return -1;
120	+ for (k = 0 <= k ? k : Math.max(b - Math.abs(k), 0); k < b; k++) if (k in c && c[k] === d) return k;
121	+ return -1;
122	+ });
123	+ return f;
124	+ }({}, v, w));
125	+ n.register("$5", function(f, d, n) {
126	+ d.JSON \|\| (d.JSON = {
127	+ parse: h.parseJSON,
128	+ stringify: null
129	+ });
130	+ return f = d.JSON;
131	+ }({}, v, w));
132	+ n.register("$6", function(f, d, h) {
133	+ f.trim = function(d, k) {
134	+ for (k \|\| (k = " \n"); d && -1 !== k.indexOf(d.substr(0, 1)); ) d = d.substr(1);
135	+ for (;d && -1 !== k.indexOf(d.substr(-1)); ) d = d.substr(0, d.length - 1);
136	+ return d;
137	+ };
138	+ f.sprintf = function(d) {
139	+ var k = 0, c = [].slice.call(arguments, 1);
140	+ return d.replace(/%(?:([1-9][0-9]*)\$)?([sud%])/g, function(b, a, e) {
141	+ return "%" === e ? "%" : (a ? c[Number(a) - 1] : c[k++]) \|\| "";
142	+ });
143	+ };
144	+ return f;
145	+ }({}, v, w));
146	+ n.register("$21", function(f, d, h) {
147	+ function m(k) {
148	+ return function(c, b) {
149	+ for (var a = c[k] \|\| 0; (c = c.offsetParent) && c !== (b \|\| h.body); ) a += c[k] \|\| 0;
150	+ return a;
151	+ };
152	+ }
153	+ f.top = m("offsetTop");
154	+ f.left = m("offsetLeft");
155	+ f.el = function(k, c) {
156	+ var b = h.createElement(k \|\| "div");
157	+ c && (b.className = c);
158	+ return b;
159	+ };
160	+ f.txt = function(k) {
161	+ return h.createTextNode(k \|\| "");
162	+ };
163	+ return f;
164	+ }({}, v, w));
165	+ n.register("$7", function(f, d, E) {
166	+ function m(a, b, e) {
167	+ function q() {
168	+ c();
169	+ x = setTimeout(b, e);
170	+ }
171	+ function c() {
172	+ x && clearTimeout(x);
173	+ x = null;
174	+ }
175	+ var x;
176	+ q();
177	+ h(a).on("mouseenter", c).on("mouseleave", q);
178	+ return {
179	+ die: function() {
180	+ c();
181	+ h(a).off("mouseenter mouseleave");
182	+ }
183	+ };
184	+ }
185	+ function k(a, b) {
186	+ a.fadeTo(b, 0, function() {
187	+ a.slideUp(b, function() {
188	+ a.remove();
189	+ h(d).triggerHandler("resize");
190	+ });
191	+ });
192	+ return a;
193	+ }
194	+ function c(a, b) {
195	+ function e(b) {
196	+ g[x] = null;
197	+ k(h(a), 250);
198	+ c && c.die();
199	+ var q;
200	+ if (q = b) b.stopPropagation(), b.preventDefault(), q = !1;
201	+ return q;
202	+ }
203	+ function q(b) {
204	+ c && c.die();
205	+ return c = m(a, e, b);
206	+ }
207	+ var c, x, p, l = h(a), s = l.find("button");
208	+ 0 === s.length && (l.addClass("is-dismissible"), s = h('<button type="button" class="notice-dismiss"> </a>').appendTo(l));
209	+ s.off("click").on("click", e);
210	+ h(d).triggerHandler("resize");
211	+ y();
212	+ x = g.length;
213	+ g.push(e);
214	+ b && (c = q(b));
215	+ return {
216	+ link: function(b, x) {
217	+ var e = x \|\| b, q = h(a).find("nav"), e = h("<nav></nav>").append(h("<a></a>").attr("href", b).text(e));
218	+ p ? (p.push(e.html()), q.html(p.join("<span> \| </span>"))) : (p = [ e.html() ],
219	+ h(a).addClass("has-nav").append(e));
220	+ return this;
221	+ },
222	+ stick: function() {
223	+ c && c.die();
224	+ c = null;
225	+ g[x] = null;
226	+ return this;
227	+ },
228	+ slow: function(a) {
229	+ q(a \|\| 1e4);
230	+ return this;
231	+ }
232	+ };
233	+ }
234	+ function b(a, b, e) {
235	+ var q = n.require("$21", "dom.js").el;
236	+ a = h('<div class="notice notice-' + a + ' loco-notice inline"></div>').prependTo(h("#loco-notices"));
237	+ var c = h(q("p"));
238	+ e = h(q("span")).text(e);
239	+ b = h(q("strong", "has-icon")).text(b + ": ");
240	+ c.append(b).append(e).appendTo(a);
241	+ return a;
242	+ }
243	+ function a(a, e, q, p) {
244	+ a = b(q, e, a).css("opacity", "0").fadeTo(500, 1);
245	+ h(d).triggerHandler("resize");
246	+ return c(a, p);
247	+ }
248	+ function e(b) {
249	+ return a(b, s, "warning");
250	+ }
251	+ function p() {
252	+ h("#loco-notices").find("div.notice").each(function(a, b) {
253	+ if (-1 === b.className.indexOf("jshide")) {
254	+ var e = -1 === b.className.indexOf("notice-success") ? null : 5e3;
255	+ c(b, e);
256	+ }
257	+ });
258	+ }
259	+ var g = [], l = d.console \|\| {
260	+ log: function() {}
261	+ }, y = Date.now \|\| function() {
262	+ return new Date().getTime();
263	+ }, A, s, q, D;
264	+ f.error = function(b) {
265	+ return a(b, A, "error");
266	+ };
267	+ f.warn = e;
268	+ f.info = function(b) {
269	+ return a(b, q, "info");
270	+ };
271	+ f.success = function(b) {
272	+ return a(b, D, "success", 5e3);
273	+ };
274	+ f.warning = e;
275	+ f.log = function() {
276	+ l.log.apply(l, arguments);
277	+ };
278	+ f.debug = function() {
279	+ (l.debug \|\| l.log).apply(l, arguments);
280	+ };
281	+ f.clear = function() {
282	+ for (var a = -1, b, e = g, q = e.length; ++a < q; ) (b = e[a]) && b.call && b();
283	+ g = [];
284	+ return f;
285	+ };
286	+ f.create = b;
287	+ f.raise = function(a) {
288	+ (f[a.type] \|\| f.error).call(f, a.message);
289	+ };
290	+ f.convert = c;
291	+ f.init = function(a) {
292	+ A = a._("Error");
293	+ s = a._("Warning");
294	+ q = a._("Notice");
295	+ D = a._("OK");
296	+ setTimeout(p, 1e3);
297	+ return f;
298	+ };
299	+ return f;
300	+ }({}, v, w));
301	+ n.register("$8", function(f, d, E) {
302	+ function m(a) {
303	+ var b = h("<pre>" + a + "</pre>").text();
304	+ b && (b = b.replace(/[\r\n]+/g, "\n").replace(/(^\|\n)\s+/g, "$1").replace(/\s+$/, ""));
305	+ b \|\| (b = a) \|\| (b = "Blank response from server");
306	+ return b;
307	+ }
308	+ function k(a) {
309	+ return (a = a.split(/[\r\n]/)[0]) ? (a = a.replace(/ +in +\S+ on line \d+/, ""),
310	+ a = a.replace(/^[()! ]+Fatal error:\s*/, "")) : t._("Server returned invalid data");
311	+ }
312	+ function c(a) {
313	+ d.console && console.error && console.error('No nonce for "' + a + '"');
314	+ return "";
315	+ }
316	+ function b(a, b, e) {
317	+ a[b] = e;
318	+ }
319	+ function a(a, b, e) {
320	+ a.push({
321	+ name: b,
322	+ value: e
323	+ });
324	+ }
325	+ function e(a, b, e) {
326	+ a.append(b, e);
327	+ }
328	+ function p(a, b, e, c) {
329	+ function p(b, c, x) {
330	+ if ("abort" !== c) {
331	+ var q = l \|\| {
332	+ _: function(a) {
333	+ return a;
334	+ }
335	+ }, z = b.status \|\| 0, d = b.responseText \|\| "", r = m(d), f = b.getResponseHeader("Content-Type") \|\| "Unknown type", A = b.getResponseHeader("Content-Length") \|\| d.length;
336	+ "success" === c && x ? g.error(x) : (g.error(k(r) + ".\n" + q._("Check console output for debugging information")),
337	+ g.log("Ajax failure for " + a, {
338	+ status: z,
339	+ error: c,
340	+ message: x,
341	+ output: d
342	+ }), "parsererror" === c && (x = "Response not JSON"), g.log([ q._("Provide the following text when reporting a problem") + ":", "----", "Status " + z + ' "' + (x \|\| q._("Unknown error")) + '" (' + f + " " + A + " bytes)", r, "====" ].join("\n")));
343	+ e && e.call && e(b, c, x);
344	+ y = b;
345	+ }
346	+ }
347	+ c.url = A;
348	+ c.dataType = "json";
349	+ var g = n.require("$7", "notices.js").clear();
350	+ y = null;
351	+ return h.ajax(c).fail(p).done(function(a, e, x) {
352	+ var c = a && a.data, l = a && a.notices, y = l && l.length, k = -1;
353	+ for (!c \|\| a.error ? p(x, e, a && a.error && a.error.message) : b && b(c, e, x); ++k < y; ) g.raise(l[k]);
354	+ });
355	+ }
356	+ var g = {}, l, y, A = d.ajaxurl \|\| "/wp-admin/admin-ajax.php";
357	+ f.init = function(a) {
358	+ g = a.nonces \|\| g;
359	+ return f;
360	+ };
361	+ f.localise = function(a) {
362	+ l = a;
363	+ return f;
364	+ };
365	+ f.xhr = function() {
366	+ return y;
367	+ };
368	+ f.strip = m;
369	+ f.parse = k;
370	+ f.submit = function(a, b, e) {
371	+ function c(a, b) {
372	+ b.disabled ? b.setAttribute("data-was-disabled", "true") : b.disabled = !0;
373	+ }
374	+ function g(a, b) {
375	+ b.getAttribute("data-was-disabled") \|\| (b.disabled = !1);
376	+ }
377	+ function l(a) {
378	+ a.find(".button-primary").removeClass("loading");
379	+ a.find("button").each(g);
380	+ a.find("input").each(g);
381	+ a.find("select").each(g);
382	+ a.find("textarea").each(g);
383	+ a.removeClass("disabled loading");
384	+ }
385	+ var y = h(a), k = y.serialize();
386	+ (function(a) {
387	+ a.find(".button-primary").addClass("loading");
388	+ a.find("button").each(c);
389	+ a.find("input").each(c);
390	+ a.find("select").each(c);
391	+ a.find("textarea").each(c);
392	+ a.addClass("disabled loading");
393	+ })(y);
394	+ return p(a.route.value, function(a, e, c) {
395	+ l(y);
396	+ b && b(a, e, c);
397	+ }, function(a, b, c) {
398	+ l(y);
399	+ e && e(a, b, c);
400	+ }, {
401	+ type: a.method,
402	+ data: k
403	+ });
404	+ };
405	+ f.post = function(l, q, y, k) {
406	+ var z = !0, G = q \|\| {}, C = g[l] \|\| c(l);
407	+ d.FormData && G instanceof FormData ? (z = !1, q = e) : q = Array.isArray(G) ? a : b;
408	+ q(G, "action", "loco_json");
409	+ q(G, "route", l);
410	+ q(G, "loco-nonce", C);
411	+ return p(l, y, k, {
412	+ type: "post",
413	+ data: G,
414	+ processData: z,
415	+ contentType: z ? "application/x-www-form-urlencoded; charset=UTF-8" : !1
416	+ });
417	+ };
418	+ f.get = function(a, b, e, l) {
419	+ b = b \|\| {};
420	+ var y = g[a] \|\| c(a);
421	+ b.action = "loco_json";
422	+ b.route = a;
423	+ b["loco-nonce"] = y;
424	+ return p(a, e, l, {
425	+ type: "get",
426	+ data: b
427	+ });
428	+ };
429	+ f.setNonce = function(a, b) {
430	+ g[a] = b;
431	+ return f;
432	+ };
433	+ return f;
434	+ }({}, v, w));
435	+ n.register("$22", {
436	+ arab: 1,
437	+ aran: 1,
438	+ hebr: 1,
439	+ nkoo: 1,
440	+ syrc: 1,
441	+ syrn: 1,
442	+ syrj: 1,
443	+ syre: 1,
444	+ samr: 1,
445	+ mand: 1,
446	+ mend: 1,
447	+ thaa: 1,
448	+ adlm: 1,
449	+ cprt: 1,
450	+ phnx: 1,
451	+ armi: 1,
452	+ prti: 1,
453	+ phli: 1,
454	+ phlp: 1,
455	+ phlv: 1,
456	+ avst: 1,
457	+ mani: 1,
458	+ khar: 1,
459	+ orkh: 1,
460	+ ital: 1,
461	+ lydi: 1,
462	+ ar: 1,
463	+ ary: 1,
464	+ ckb: 1,
465	+ dv: 1,
466	+ fa: 1,
467	+ he: 1,
468	+ nqo: 1,
469	+ ps: 1,
470	+ ur: 1,
471	+ yi: 1
472	+ });
473	+ n.register("$9", function(f, d, h) {
474	+ function m() {}
475	+ var k, c = n.require("$22", "rtl.json");
476	+ f.init = function() {
477	+ return new m();
478	+ };
479	+ f.cast = function(b) {
480	+ return b instanceof m ? b : "string" === typeof b ? f.parse(b) : f.clone(b);
481	+ };
482	+ f.clone = function(b) {
483	+ var a, e = new m();
484	+ for (a in b) e[a] = b[a];
485	+ return e;
486	+ };
487	+ f.parse = function(b) {
488	+ if (!(k \|\| (k = /^([a-z]{2,3})(?:[-_]([a-z]{2}))?(?:[-_]([a-z0-9]{3,8}))?$/i)).exec(b)) return null;
489	+ var a = new m();
490	+ a.lang = RegExp.$1.toLowerCase();
491	+ if (b = RegExp.$2) a.region = b.toUpperCase();
492	+ if (b = RegExp.$3) a.variant = b.toLowerCase();
493	+ return a;
494	+ };
495	+ d = m.prototype;
496	+ d.isValid = function() {
497	+ return !!this.lang;
498	+ };
499	+ d.isKnown = function() {
500	+ var b = this.lang;
501	+ return !(!b \|\| "zxx" === b);
502	+ };
503	+ d.toString = function(b) {
504	+ b = b \|\| "_";
505	+ var a, e = this.lang \|\| "zxx";
506	+ if (a = this.region) e += b + a;
507	+ if (a = this.variant) e += b + a;
508	+ return e;
509	+ };
510	+ d.getIcon = function() {
511	+ for (var b = 3, a, e, c = [ "variant", "region", "lang" ], g = []; 0 !== b--; ) if (a = c[b],
512	+ e = this[a]) g.push(a), g.push(a + "-" + e.toLowerCase());
513	+ return g.join(" ");
514	+ };
515	+ d.isRTL = function() {
516	+ return !!c[String(this.lang).toLowerCase()];
517	+ };
518	+ d = null;
519	+ return f;
520	+ }({}, v, w));
521	+ n.register("$23", {
522	+ "á": "a",
523	+ "à": "a",
524	+ "ă": "a",
525	+ "ắ": "a",
526	+ "ằ": "a",
527	+ "ẵ": "a",
528	+ "ẳ": "a",
529	+ "â": "a",
530	+ "ấ": "a",
531	+ "ầ": "a",
532	+ "ẫ": "a",
533	+ "ẩ": "a",
534	+ "ǎ": "a",
535	+ "å": "a",
536	+ "ǻ": "a",
537	+ "ä": "a",
538	+ "ǟ": "a",
539	+ "ã": "a",
540	+ "ȧ": "a",
541	+ "ǡ": "a",
542	+ "ą": "a",
543	+ "ā": "a",
544	+ "ả": "a",
545	+ "ȁ": "a",
546	+ "ȃ": "a",
547	+ "ạ": "a",
548	+ "ặ": "a",
549	+ "ậ": "a",
550	+ "ḁ": "a",
551	+ "ǽ": "æ",
552	+ "ǣ": "æ",
553	+ "ḃ": "b",
554	+ "ḅ": "b",
555	+ "ḇ": "b",
556	+ "ć": "c",
557	+ "ĉ": "c",
558	+ "č": "c",
559	+ "ċ": "c",
560	+ "ç": "c",
561	+ "ḉ": "c",
562	+ "ď": "d",
563	+ "ḋ": "d",
564	+ "ḑ": "d",
565	+ "đ": "d",
566	+ "ḍ": "d",
567	+ "ḓ": "d",
568	+ "ḏ": "d",
569	+ "ð": "d",
570	+ "ꝺ": "d",
571	+ "ǆ": "ǳ",
572	+ "é": "e",
573	+ "è": "e",
574	+ "ĕ": "e",
575	+ "ê": "e",
576	+ "ế": "e",
577	+ "ề": "e",
578	+ "ễ": "e",
579	+ "ể": "e",
580	+ "ě": "e",
581	+ "ë": "e",
582	+ "ẽ": "e",
583	+ "ė": "e",
584	+ "ȩ": "e",
585	+ "ḝ": "e",
586	+ "ę": "e",
587	+ "ē": "e",
588	+ "ḗ": "e",
589	+ "ḕ": "e",
590	+ "ẻ": "e",
591	+ "ȅ": "e",
592	+ "ȇ": "e",
593	+ "ẹ": "e",
594	+ "ệ": "e",
595	+ "ḙ": "e",
596	+ "ḛ": "e",
597	+ "ḟ": "f",
598	+ "ꝼ": "f",
599	+ "ǵ": "g",
600	+ "ğ": "g",
601	+ "ĝ": "g",
602	+ "ǧ": "g",
603	+ "ġ": "g",
604	+ "ģ": "g",
605	+ "ḡ": "g",
606	+ "ꞡ": "g",
607	+ "ᵹ": "g",
608	+ "ĥ": "h",
609	+ "ȟ": "h",
610	+ "ḧ": "h",
611	+ "ḣ": "h",
612	+ "ḩ": "h",
613	+ "ħ": "h",
614	+ "ℏ": "h",
615	+ "ḥ": "h",
616	+ "ḫ": "h",
617	+ "ẖ": "h",
618	+ "í": "i",
619	+ "ì": "i",
620	+ "ĭ": "i",
621	+ "î": "i",
622	+ "ǐ": "i",
623	+ "ï": "i",
624	+ "ḯ": "i",
625	+ "ĩ": "i",
626	+ "į": "i",
627	+ "ī": "i",
628	+ "ỉ": "i",
629	+ "ȉ": "i",
630	+ "ȋ": "i",
631	+ "ị": "i",
632	+ "ḭ": "i",
633	+ "ĵ": "j",
634	+ "ǰ": "j",
635	+ "ḱ": "k",
636	+ "ǩ": "k",
637	+ "ķ": "k",
638	+ "ꞣ": "k",
639	+ "ḳ": "k",
640	+ "ḵ": "k",
641	+ "ĺ": "l",
642	+ "ľ": "l",
643	+ "ļ": "l",
644	+ "ł": "l",
645	+ "ḷ": "l",
646	+ "ḹ": "l",
647	+ "ḽ": "l",
648	+ "ḻ": "l",
649	+ "ŀ": "l",
650	+ "ḿ": "m",
651	+ "ṁ": "m",
652	+ "ṃ": "m",
653	+ "ń": "n",
654	+ "ǹ": "n",
655	+ "ň": "n",
656	+ "ñ": "n",
657	+ "ṅ": "n",
658	+ "ņ": "n",
659	+ "ꞥ": "n",
660	+ "ṇ": "n",
661	+ "ṋ": "n",
662	+ "ṉ": "n",
663	+ "ó": "o",
664	+ "ò": "o",
665	+ "ŏ": "o",
666	+ "ô": "o",
667	+ "ố": "o",
668	+ "ồ": "o",
669	+ "ỗ": "o",
670	+ "ổ": "o",
671	+ "ǒ": "o",
672	+ "ö": "o",
673	+ "ȫ": "o",
674	+ "ő": "o",
675	+ "õ": "o",
676	+ "ṍ": "o",
677	+ "ṏ": "o",
678	+ "ȭ": "o",
679	+ "ȯ": "o",
680	+ "ȱ": "o",
681	+ "ø": "o",
682	+ "ǿ": "o",
683	+ "ǫ": "o",
684	+ "ǭ": "o",
685	+ "ō": "o",
686	+ "ṓ": "o",
687	+ "ṑ": "o",
688	+ "ỏ": "o",
689	+ "ȍ": "o",
690	+ "ȏ": "o",
691	+ "ơ": "o",
692	+ "ớ": "o",
693	+ "ờ": "o",
694	+ "ỡ": "o",
695	+ "ở": "o",
696	+ "ợ": "o",
697	+ "ọ": "o",
698	+ "ộ": "o",
699	+ "ṕ": "p",
700	+ "ṗ": "p",
701	+ "ŕ": "r",
702	+ "ř": "r",
703	+ "ṙ": "r",
704	+ "ŗ": "r",
705	+ "ꞧ": "r",
706	+ "ȑ": "r",
707	+ "ȓ": "r",
708	+ "ṛ": "r",
709	+ "ṝ": "r",
710	+ "ṟ": "r",
711	+ "ꞃ": "r",
712	+ "ś": "s",
713	+ "ṥ": "s",
714	+ "ŝ": "s",
715	+ "š": "s",
716	+ "ṧ": "s",
717	+ "ṡ": "s",
718	+ "ş": "s",
719	+ "ꞩ": "s",
720	+ "ṣ": "s",
721	+ "ṩ": "s",
722	+ "ș": "s",
723	+ "ſ": "s",
724	+ "ꞅ": "s",
725	+ "ẛ": "s",
726	+ "ť": "t",
727	+ "ẗ": "t",
728	+ "ṫ": "t",
729	+ "ţ": "t",
730	+ "ṭ": "t",
731	+ "ț": "t",
732	+ "ṱ": "t",
733	+ "ṯ": "t",
734	+ "ꞇ": "t",
735	+ "ú": "u",
736	+ "ù": "u",
737	+ "ŭ": "u",
738	+ "û": "u",
739	+ "ǔ": "u",
740	+ "ů": "u",
741	+ "ü": "u",
742	+ "ǘ": "u",
743	+ "ǜ": "u",
744	+ "ǚ": "u",
745	+ "ǖ": "u",
746	+ "ű": "u",
747	+ "ũ": "u",
748	+ "ṹ": "u",
749	+ "ų": "u",
750	+ "ū": "u",
751	+ "ṻ": "u",
752	+ "ủ": "u",
753	+ "ȕ": "u",
754	+ "ȗ": "u",
755	+ "ư": "u",
756	+ "ứ": "u",
757	+ "ừ": "u",
758	+ "ữ": "u",
759	+ "ử": "u",
760	+ "ự": "u",
761	+ "ụ": "u",
762	+ "ṳ": "u",
763	+ "ṷ": "u",
764	+ "ṵ": "u",
765	+ "ṽ": "v",
766	+ "ṿ": "v",
767	+ "ẃ": "w",
768	+ "ẁ": "w",
769	+ "ŵ": "w",
770	+ "ẘ": "w",
771	+ "ẅ": "w",
772	+ "ẇ": "w",
773	+ "ẉ": "w",
774	+ "ẍ": "x",
775	+ "ẋ": "x",
776	+ "ý": "y",
777	+ "ỳ": "y",
778	+ "ŷ": "y",
779	+ "ẙ": "y",
780	+ "ÿ": "y",
781	+ "ỹ": "y",
782	+ "ẏ": "y",
783	+ "ȳ": "y",
784	+ "ỷ": "y",
785	+ "ỵ": "y",
786	+ "ź": "z",
787	+ "ẑ": "z",
788	+ "ž": "z",
789	+ "ż": "z",
790	+ "ẓ": "z",
791	+ "ẕ": "z",
792	+ "ǯ": "ʒ",
793	+ "ἀ": "α",
794	+ "ἄ": "α",
795	+ "ᾄ": "α",
796	+ "ἂ": "α",
797	+ "ᾂ": "α",
798	+ "ἆ": "α",
799	+ "ᾆ": "α",
800	+ "ᾀ": "α",
801	+ "ἁ": "α",
802	+ "ἅ": "α",
803	+ "ᾅ": "α",
804	+ "ἃ": "α",
805	+ "ᾃ": "α",
806	+ "ἇ": "α",
807	+ "ᾇ": "α",
808	+ "ᾁ": "α",
809	+ "ά": "α",
810	+ "ά": "α",
811	+ "ᾴ": "α",
812	+ "ὰ": "α",
813	+ "ᾲ": "α",
814	+ "ᾰ": "α",
815	+ "ᾶ": "α",
816	+ "ᾷ": "α",
817	+ "ᾱ": "α",
818	+ "ᾳ": "α",
819	+ "ἐ": "ε",
820	+ "ἔ": "ε",
821	+ "ἒ": "ε",
822	+ "ἑ": "ε",
823	+ "ἕ": "ε",
824	+ "ἓ": "ε",
825	+ "έ": "ε",
826	+ "έ": "ε",
827	+ "ὲ": "ε",
828	+ "ἠ": "η",
829	+ "ἤ": "η",
830	+ "ᾔ": "η",
831	+ "ἢ": "η",
832	+ "ᾒ": "η",
833	+ "ἦ": "η",
834	+ "ᾖ": "η",
835	+ "ᾐ": "η",
836	+ "ἡ": "η",
837	+ "ἥ": "η",
838	+ "ᾕ": "η",
839	+ "ἣ": "η",
840	+ "ᾓ": "η",
841	+ "ἧ": "η",
842	+ "ᾗ": "η",
843	+ "ᾑ": "η",
844	+ "ή": "η",
845	+ "ή": "η",
846	+ "ῄ": "η",
847	+ "ὴ": "η",
848	+ "ῂ": "η",
849	+ "ῆ": "η",
850	+ "ῇ": "η",
851	+ "ῃ": "η",
852	+ "ἰ": "ι",
853	+ "ἴ": "ι",
854	+ "ἲ": "ι",
855	+ "ἶ": "ι",
856	+ "ἱ": "ι",
857	+ "ἵ": "ι",
858	+ "ἳ": "ι",
859	+ "ἷ": "ι",
860	+ "ί": "ι",
861	+ "ί": "ι",
862	+ "ὶ": "ι",
863	+ "ῐ": "ι",
864	+ "ῖ": "ι",
865	+ "ϊ": "ι",
866	+ "ΐ": "ι",
867	+ "ΐ": "ι",
868	+ "ῒ": "ι",
869	+ "ῗ": "ι",
870	+ "ῑ": "ι",
871	+ "ὀ": "ο",
872	+ "ὄ": "ο",
873	+ "ὂ": "ο",
874	+ "ὁ": "ο",
875	+ "ὅ": "ο",
876	+ "ὃ": "ο",
877	+ "ό": "ο",
878	+ "ό": "ο",
879	+ "ὸ": "ο",
880	+ "ῤ": "ρ",
881	+ "ῥ": "ρ",
882	+ "ὐ": "υ",
883	+ "ὔ": "υ",
884	+ "ὒ": "υ",
885	+ "ὖ": "υ",
886	+ "ὑ": "υ",
887	+ "ὕ": "υ",
888	+ "ὓ": "υ",
889	+ "ὗ": "υ",
890	+ "ύ": "υ",
891	+ "ύ": "υ",
892	+ "ὺ": "υ",
893	+ "ῠ": "υ",
894	+ "ῦ": "υ",
895	+ "ϋ": "υ",
896	+ "ΰ": "υ",
897	+ "ΰ": "υ",
898	+ "ῢ": "υ",
899	+ "ῧ": "υ",
900	+ "ῡ": "υ",
901	+ "ὠ": "ω",
902	+ "ὤ": "ω",
903	+ "ᾤ": "ω",
904	+ "ὢ": "ω",
905	+ "ᾢ": "ω",
906	+ "ὦ": "ω",
907	+ "ᾦ": "ω",
908	+ "ᾠ": "ω",
909	+ "ὡ": "ω",
910	+ "ὥ": "ω",
911	+ "ᾥ": "ω",
912	+ "ὣ": "ω",
913	+ "ᾣ": "ω",
914	+ "ὧ": "ω",
915	+ "ᾧ": "ω",
916	+ "ᾡ": "ω",
917	+ "ώ": "ω",
918	+ "ώ": "ω",
919	+ "ῴ": "ω",
920	+ "ὼ": "ω",
921	+ "ῲ": "ω",
922	+ "ῶ": "ω",
923	+ "ῷ": "ω",
924	+ "ῳ": "ω",
925	+ "ґ": "г",
926	+ "ѐ": "е",
927	+ "ё": "е",
928	+ "ӂ": "ж",
929	+ "ѝ": "и",
930	+ "ӣ": "и",
931	+ "ӯ": "у"
932	+ });
933	+ n.register("$10", function(f, d, h) {
934	+ f.init = function() {
935	+ function d(a) {
936	+ return l[a] \|\| a;
937	+ }
938	+ function k(a, b, e, c) {
939	+ b = a.split(b);
940	+ for (var p = b.length; 0 !== p--; ) (a = b[p]) && null == c[a] && (e.push(a), c[a] = !0);
941	+ return e;
942	+ }
943	+ function c(a) {
944	+ return k(String(a \|\| "").toLowerCase().replace(p, d), g, [], {});
945	+ }
946	+ function b(a, b) {
947	+ for (var c = [], q = {}, l, r = b.length, z = g; 0 !== r--; ) (l = b[r]) && k(String(l \|\| "").toLowerCase().replace(p, d), z, c, q);
948	+ e[a] = c;
949	+ }
950	+ function a(a, b) {
951	+ var c = [], q = -1, p = e, l = p.length, g, k, d, u, x, F, f = a.length, m = b ? !0 : !1;
952	+ a: for (;++q < l; ) if (d = p[q], null != d && (u = d.length)) {
953	+ x = 0;
954	+ b: for (;x < f; x++) {
955	+ F = a[x];
956	+ for (g = 0; g < u; g++) if (k = d[g], 0 === k.indexOf(F)) continue b;
957	+ continue a;
958	+ }
959	+ c.push(m ? b[q] : q);
960	+ }
961	+ return c;
962	+ }
963	+ var e = [], p = /[^a-z0-9]/g, g = /[\-_\s.?!;:,*^+=~`"(){}<>\[\]\/\\\u00a0\u1680\u180e\u2000-\u206f\u2e00-\u2e7f\u3000-\u303f]+/, l = n.require("$23", "flatten.json");
964	+ return {
965	+ split: c,
966	+ pull: function(b, e) {
967	+ return a(b, e);
968	+ },
969	+ find: function(b, e) {
970	+ return a(c(b), e);
971	+ },
972	+ add: function(a, b) {
973	+ e[a] = c(b);
974	+ },
975	+ push: function(a) {
976	+ b(e.length, a);
977	+ },
978	+ index: function(a, e) {
979	+ b(a, e);
980	+ },
981	+ size: function() {
982	+ return e.length;
983	+ },
984	+ clear: function() {
985	+ e = [];
986	+ },
987	+ remove: function(a) {
988	+ e[a] = null;
989	+ }
990	+ };
991	+ };
992	+ return f;
993	+ }({}, v, w));
994	+ n.register("$11", function(f, d, n) {
995	+ f.listen = function(f, k) {
996	+ function c() {
997	+ s[p ? "show" : "hide"]();
998	+ }
999	+ function b(a) {
1000	+ A && f.setAttribute("size", 2 + a.length);
1001	+ p = a;
1002	+ c();
1003	+ return a;
1004	+ }
1005	+ function a() {
1006	+ g = null;
1007	+ k(p);
1008	+ }
1009	+ function e() {
1010	+ var e = f.value;
1011	+ y && e === y && (e = "");
1012	+ e !== p && (g && clearTimeout(g), b(e), l ? g = setTimeout(a, l) : a());
1013	+ }
1014	+ f instanceof jQuery && (f = f[0]);
1015	+ var p, g, l = 150, y = d.attachEvent && f.getAttribute("placeholder"), A = 1 === Number(f.size), s = h('<a href="#clear" tabindex="-1" class="icon clear"><span>clear</span></a>').on("click", function() {
1016	+ f.value = "";
1017	+ e();
1018	+ return !1;
1019	+ });
1020	+ b(f.value);
1021	+ h(f).on("input blur focus", function() {
1022	+ e();
1023	+ return !0;
1024	+ }).after(s);
1025	+ c();
1026	+ return {
1027	+ delay: function(a) {
1028	+ l = a;
1029	+ },
1030	+ ping: function(c) {
1031	+ c ? (g && clearTimeout(g), c = f.value, y && c === y && (c = ""), b(c), a(), c = void 0) : c = e();
1032	+ return c;
1033	+ },
1034	+ val: function(a) {
1035	+ if (null == a) return p;
1036	+ g && clearTimeout(g);
1037	+ f.value = b(a);
1038	+ c();
1039	+ },
1040	+ el: function() {
1041	+ return f;
1042	+ },
1043	+ blur: function(a) {
1044	+ return h(f).on("blur", a);
1045	+ },
1046	+ destroy: function() {
1047	+ g && clearTimeout(g);
1048	+ }
1049	+ };
1050	+ };
1051	+ return f;
1052	+ }({}, v, w));
1053	+ n.register("$12", function(f, d, n) {
1054	+ function m(b, a) {
1055	+ this.$element = h(b);
1056	+ this.options = a;
1057	+ this.enabled = !0;
1058	+ this.fixTitle();
1059	+ }
1060	+ f.init = function(b, a) {
1061	+ var e = {
1062	+ fade: !0,
1063	+ offset: 5,
1064	+ delayIn: k,
1065	+ delayOut: c,
1066	+ anchor: b.attr("data-anchor"),
1067	+ gravity: b.attr("data-gravity") \|\| "s"
1068	+ };
1069	+ a && (e = h.extend({}, e, a));
1070	+ b.tipsy(e);
1071	+ };
1072	+ f.delays = function(b, a) {
1073	+ k = b \|\| 150;
1074	+ c = a \|\| 100;
1075	+ };
1076	+ f.kill = function() {
1077	+ h("div.tipsy").remove();
1078	+ };
1079	+ f.text = function(b, a) {
1080	+ a.data("tipsy").setTitle(b);
1081	+ };
1082	+ var k, c;
1083	+ f.delays();
1084	+ h(n.body).on("overlayOpened overlayClosing", function(b) {
1085	+ f.kill();
1086	+ return !0;
1087	+ });
1088	+ m.prototype = {
1089	+ show: function() {
1090	+ var b = this.getTitle();
1091	+ if (b && this.enabled) {
1092	+ var a = this.tip();
1093	+ a.find(".tipsy-inner")[this.options.html ? "html" : "text"](b);
1094	+ a[0].className = "tipsy";
1095	+ a.remove().css({
1096	+ top: 0,
1097	+ left: 0
1098	+ }).prependTo(n.body);
1099	+ var b = (b = this.options.anchor) ? this.$element.find(b) : this.$element, b = h.extend({}, b.offset(), {
1100	+ width: b[0].offsetWidth,
1101	+ height: b[0].offsetHeight
1102	+ }), e = a[0].offsetWidth, c = a[0].offsetHeight, g = "function" == typeof this.options.gravity ? this.options.gravity.call(this.$element[0]) : this.options.gravity, l;
1103	+ switch (g.charAt(0)) {
1104	+ case "n":
1105	+ l = {
1106	+ top: b.top + b.height + this.options.offset,
1107	+ left: b.left + b.width / 2 - e / 2
1108	+ };
1109	+ break;
1110	+
1111	+ case "s":
1112	+ l = {
1113	+ top: b.top - c - this.options.offset,
1114	+ left: b.left + b.width / 2 - e / 2
1115	+ };
1116	+ break;
1117	+
1118	+ case "e":
1119	+ l = {
1120	+ top: b.top + b.height / 2 - c / 2,
1121	+ left: b.left - e - this.options.offset
1122	+ };
1123	+ break;
1124	+
1125	+ case "w":
1126	+ l = {
1127	+ top: b.top + b.height / 2 - c / 2,
1128	+ left: b.left + b.width + this.options.offset
1129	+ };
1130	+ }
1131	+ 2 == g.length && ("w" == g.charAt(1) ? l.left = b.left + b.width / 2 - 15 : l.left = b.left + b.width / 2 - e + 15);
1132	+ a.css(l).addClass("tipsy-" + g);
1133	+ a.find(".tipsy-arrow")[0].className = "tipsy-arrow tipsy-arrow-" + g.charAt(0);
1134	+ this.options.className && a.addClass("function" == typeof this.options.className ? this.options.className.call(this.$element[0]) : this.options.className);
1135	+ a.addClass("in");
1136	+ }
1137	+ },
1138	+ hide: function() {
1139	+ this.tip().remove();
1140	+ },
1141	+ fixTitle: function() {
1142	+ var b = this.$element, a = b.attr("title") \|\| "";
1143	+ (a \|\| "string" !== typeof b.attr("original-title")) && b.attr("original-title", a).removeAttr("title");
1144	+ },
1145	+ getTitle: function() {
1146	+ var b, a = this.$element, e = this.options;
1147	+ this.fixTitle();
1148	+ "string" == typeof e.title ? b = a.attr("title" == e.title ? "original-title" : e.title) : "function" == typeof e.title && (b = e.title.call(a[0]));
1149	+ return (b = ("" + b).replace(/(^\s\|\s$)/, "")) \|\| e.fallback;
1150	+ },
1151	+ setTitle: function(b) {
1152	+ var a = this.$element;
1153	+ a.attr("default-title") \|\| a.attr("default-title", this.getTitle());
1154	+ null == b && (b = a.attr("default-title") \|\| this.getTitle());
1155	+ a.attr("original-title", b);
1156	+ if (this.$tip) this.$tip.find(".tipsy-inner")[this.options.html ? "html" : "text"](b);
1157	+ },
1158	+ tip: function() {
1159	+ this.$tip \|\| (this.$tip = h('<div class="tipsy"></div>').html('<div class="tipsy-arrow"></div><div class="tipsy-inner"></div>'),
1160	+ this.$tip.data("tipsy-pointee", this.$element[0]));
1161	+ return this.$tip;
1162	+ },
1163	+ validate: function() {
1164	+ this.$element[0].parentNode \|\| (this.hide(), this.options = this.$element = null);
1165	+ },
1166	+ enable: function() {
1167	+ this.enabled = !0;
1168	+ },
1169	+ disable: function() {
1170	+ this.hide();
1171	+ this.enabled = !1;
1172	+ },
1173	+ toggleEnabled: function() {
1174	+ this.enabled = !this.enabled;
1175	+ }
1176	+ };
1177	+ h.fn.tipsy = function(b) {
1178	+ function a(a) {
1179	+ var e = h.data(a, "tipsy");
1180	+ e \|\| (e = new m(a, h.fn.tipsy.elementOptions(a, b)), h.data(a, "tipsy", e));
1181	+ return e;
1182	+ }
1183	+ function e() {
1184	+ var e = a(this), c = b.delayIn;
1185	+ e.hoverState = "in";
1186	+ 0 == c ? e.show() : (e.fixTitle(), setTimeout(function() {
1187	+ "in" == e.hoverState && e.show();
1188	+ }, c));
1189	+ }
1190	+ function c() {
1191	+ var e = a(this), p = b.delayOut;
1192	+ e.hoverState = "out";
1193	+ 0 == p ? e.hide() : (e.tip().removeClass("in"), setTimeout(function() {
1194	+ "out" == e.hoverState && e.hide();
1195	+ }, p));
1196	+ }
1197	+ b = h.extend({}, h.fn.tipsy.defaults, b);
1198	+ b.live \|\| this.each(function() {
1199	+ a(this);
1200	+ });
1201	+ if ("manual" != b.trigger) {
1202	+ var g = b.live ? "live" : "bind", l = "hover" == b.trigger ? "mouseleave" : "blur";
1203	+ this[g]("hover" == b.trigger ? "mouseenter" : "focus", e)[g](l, c);
1204	+ }
1205	+ return this;
1206	+ };
1207	+ h.fn.tipsy.defaults = {
1208	+ className: null,
1209	+ delayIn: 0,
1210	+ delayOut: 0,
1211	+ fade: !1,
1212	+ fallback: "",
1213	+ gravity: "n",
1214	+ html: !1,
1215	+ live: !1,
1216	+ offset: 0,
1217	+ opacity: .8,
1218	+ title: "title",
1219	+ trigger: "hover",
1220	+ anchor: null
1221	+ };
1222	+ h.fn.tipsy.elementOptions = function(b, a) {
1223	+ return h.metadata ? h.extend({}, a, h(b).metadata()) : a;
1224	+ };
1225	+ h.fn.tipsy.autoNS = function() {
1226	+ return h(this).offset().top > h(n).scrollTop() + h(d).height() / 2 ? "s" : "n";
1227	+ };
1228	+ h.fn.tipsy.autoWE = function() {
1229	+ return h(this).offset().left > h(n).scrollLeft() + h(d).width() / 2 ? "e" : "w";
1230	+ };
1231	+ h.fn.tipsy.autoBounds = function(b, a) {
1232	+ return function() {
1233	+ var e = a[0], c = 1 < a.length ? a[1] : !1, g = h(n).scrollTop() + b, l = h(n).scrollLeft() + b, k = h(this);
1234	+ k.offset().top < g && (e = "n");
1235	+ k.offset().left < l && (c = "w");
1236	+ h(d).width() + h(n).scrollLeft() - k.offset().left < b && (c = "e");
1237	+ h(d).height() + h(n).scrollTop() - k.offset().top < b && (e = "s");
1238	+ return e + (c ? c : "");
1239	+ };
1240	+ };
1241	+ return f;
1242	+ }({}, v, w));
1243	+ n.register("$35", function(f, d, h) {
1244	+ "".localeCompare \|\| (String.prototype.localeCompare = function() {
1245	+ return 0;
1246	+ });
1247	+ "".trim \|\| (String.prototype.trim = function() {
1248	+ return n.require("$6", "string.js").trim(this, " \n\r\t");
1249	+ });
1250	+ f.html = function() {
1251	+ function d() {
1252	+ b = /[<>&]/g;
1253	+ a = /(\r\n\|\n\|\r)/g;
1254	+ e = /(?:https?):\/\/(\S+)/gi;
1255	+ p = location.hostname;
1256	+ d = null;
1257	+ }
1258	+ function k(a) {
1259	+ return "&#" + a.charCodeAt(0) + ";";
1260	+ }
1261	+ function c(a, b) {
1262	+ return '<a href="' + a + '" target="' + (b.indexOf(p) ? "_blank" : "_top") + '">' + b + "</a>";
1263	+ }
1264	+ var b, a, e, p;
1265	+ return function(p, l) {
1266	+ d && d();
1267	+ var y = p.replace(b, k);
1268	+ l && (y = y.replace(e, c).replace(a, "<br />"));
1269	+ return y;
1270	+ };
1271	+ }();
1272	+ return f;
1273	+ }({}, v, w));
1274	+ n.register("$36", function(f, d, h) {
1275	+ function m() {}
1276	+ var k, c, b = n.require("$22", "rtl.json");
1277	+ f.init = function() {
1278	+ return new m();
1279	+ };
1280	+ f.cast = function(a) {
1281	+ return a instanceof m ? a : "string" === typeof a ? f.parse(a) : f.clone(a);
1282	+ };
1283	+ f.clone = function(a) {
1284	+ var b, c = new m();
1285	+ for (b in a) c[b] = a[b];
1286	+ return c;
1287	+ };
1288	+ f.parse = function(a) {
1289	+ k \|\| (c = /[-_+]/, k = /^([a-z]{2,3})(?:-([a-z]{4}))?(?:-([a-z]{2}\|[0-9]{3}))?(?:-([0-9][a-z0-9]{3,8}\|[a-z0-9]{5,8}))?(?:-([a-z]-[-a-z]+))?$/i);
1290	+ a = String(a).split(c).join("-");
1291	+ if (!k.exec(a)) return null;
1292	+ var b = new m();
1293	+ b.lang = RegExp.$1.toLowerCase();
1294	+ if (a = RegExp.$2) b.script = a.charAt(0).toUpperCase() + a.substr(1).toLowerCase();
1295	+ if (a = RegExp.$3) b.region = a.toUpperCase();
1296	+ if (a = RegExp.$4) b.variant = a.toLowerCase();
1297	+ if (a = RegExp.$5) b.extension = a;
1298	+ return b;
1299	+ };
1300	+ d = m.prototype;
1301	+ d.isValid = function() {
1302	+ return !!this.lang;
1303	+ };
1304	+ d.isKnown = function() {
1305	+ var a = this.lang;
1306	+ return !(!a \|\| "zxx" === a);
1307	+ };
1308	+ d.toString = function(a) {
1309	+ a = a \|\| "-";
1310	+ var b, c = this.lang \|\| "zxx";
1311	+ if (b = this.script) c += a + b;
1312	+ if (b = this.region) c += a + b;
1313	+ if (b = this.variant) c += a + b;
1314	+ if (b = this.extension) c += a + b;
1315	+ return c;
1316	+ };
1317	+ d.getIcon = function() {
1318	+ for (var a = 4, b, c, g = [ "variant", "region", "script", "lang" ], l = []; 0 !== a--; ) if (b = g[a],
1319	+ c = this[b]) c.join && (c = c.join("-")), 1 === a && 3 === c.length ? l.push("region-m49") : l = l.concat([ b, b + "-" + c.toLowerCase() ]);
1320	+ return l.join(" ");
1321	+ };
1322	+ d.isRTL = function() {
1323	+ return !!b[String(this.script \|\| this.lang).toLowerCase()];
1324	+ };
1325	+ d = null;
1326	+ return f;
1327	+ }({}, v, w));
1328	+ n.register("$37", function(f, d, h) {
1329	+ function m(a) {
1330	+ d.console && console.error && console.error(a);
1331	+ }
1332	+ function k() {
1333	+ m("Method not implemented");
1334	+ }
1335	+ function c() {}
1336	+ function b(a) {}
1337	+ c.prototype.toString = function() {
1338	+ return "[Undefined]";
1339	+ };
1340	+ b.prototype._validate = function(a) {
1341	+ var b, p, g = !0;
1342	+ for (b in this) p = this[b], p === k ? (m(a + "." + b + "() must be implemented"),
1343	+ g = !1) : p instanceof c && (m(a + "." + b + " must be defined"), g = !1);
1344	+ return g;
1345	+ };
1346	+ f.init = function(a, e) {
1347	+ var p, g = new b();
1348	+ if (a) for (p = a.length; 0 !== p--; ) g[a[p]] = k;
1349	+ if (e) for (p = e.length; 0 !== p--; ) g[e[p]] = new c();
1350	+ return g;
1351	+ };
1352	+ f.validate = function(a) {
1353	+ var b = /function (\w+)\(/.exec(a.toString()) ? RegExp.$1 : "";
1354	+ a.prototype._validate(b \|\| "Object");
1355	+ };
1356	+ return f;
1357	+ }({}, v, w));
1358	+ n.register("$48", function(f, d, h) {
1359	+ var m = d.requestAnimationFrame, k = d.cancelAnimationFrame, c = 0;
1360	+ if (!m \|\| !k) for (var b in {
1361	+ ms: 1,
1362	+ moz: 1,
1363	+ webkit: 1,
1364	+ o: 1
1365	+ }) if (m = d[b + "RequestAnimationFrame"]) if (k = d[b + "CancelAnimationFrame"] \|\| d[b + "CancelRequestAnimationFrame"]) break;
1366	+ m && k \|\| (m = function(b) {
1367	+ var p = a();
1368	+ timeToCall = Math.max(0, 16 - (p - c));
1369	+ nextTime = p + timeToCall;
1370	+ timerId = d.setTimeout(function() {
1371	+ b(nextTime);
1372	+ }, timeToCall);
1373	+ c = nextTime;
1374	+ return timerId;
1375	+ }, k = function(a) {
1376	+ clearTimeout(a);
1377	+ });
1378	+ var a = Date.now \|\| function() {
1379	+ return new Date().getTime();
1380	+ };
1381	+ f.loop = function(a, b) {
1382	+ function c() {
1383	+ d = m(c, b);
1384	+ a(l++);
1385	+ }
1386	+ var l = 0, d;
1387	+ c();
1388	+ return {
1389	+ stop: function() {
1390	+ d && k(d);
1391	+ d = null;
1392	+ }
1393	+ };
1394	+ };
1395	+ return f;
1396	+ }({}, v, w));
1397	+ n.register("$45", function(f, d, h) {
1398	+ function m(a, c, e, q) {
1399	+ if (b) {
1400	+ var l = e;
1401	+ e = function(a) {
1402	+ if ((a.MSPOINTER_TYPE_TOUCH \|\| "touch") === a.pointerType) return l(a);
1403	+ };
1404	+ }
1405	+ a.addEventListener(c, e, q);
1406	+ return {
1407	+ unbind: function() {
1408	+ a.removeEventListener(c, e, q);
1409	+ }
1410	+ };
1411	+ }
1412	+ function k(a) {
1413	+ a.preventDefault();
1414	+ a.stopPropagation();
1415	+ return !1;
1416	+ }
1417	+ var c, b = !!d.navigator.msPointerEnabled, a = b ? "MSPointerDown" : "touchstart", e = b ? "MSPointerMove" : "touchmove", p = b ? "MSPointerUp" : "touchend";
1418	+ f.ok = function(a) {
1419	+ null == c && (c = "function" === typeof h.body.addEventListener);
1420	+ c && a && a(f);
1421	+ return c;
1422	+ };
1423	+ f.ms = function() {
1424	+ return b;
1425	+ };
1426	+ f.dragger = function(b, c) {
1427	+ function l(a) {
1428	+ b.addEventListener(a, d[a], !1);
1429	+ }
1430	+ function q(a) {
1431	+ b.removeEventListener(a, d[a], !1);
1432	+ }
1433	+ var d = {};
1434	+ d[a] = function(b) {
1435	+ g(b, function(e, l) {
1436	+ l.type = a;
1437	+ c(b, l, f);
1438	+ });
1439	+ l(e);
1440	+ l(p);
1441	+ return !0;
1442	+ };
1443	+ d[p] = function(a) {
1444	+ q(e);
1445	+ q(p);
1446	+ g(a, function(b, e) {
1447	+ e.type = p;
1448	+ c(a, e, f);
1449	+ });
1450	+ return !0;
1451	+ };
1452	+ d[e] = function(a) {
1453	+ g(a, function(b, l) {
1454	+ l.type = e;
1455	+ c(a, l, f);
1456	+ });
1457	+ return k(a);
1458	+ };
1459	+ l(a);
1460	+ var f = {
1461	+ kill: function() {
1462	+ q(a);
1463	+ q(e);
1464	+ q(p);
1465	+ b = f = c = null;
1466	+ }
1467	+ };
1468	+ return f;
1469	+ };
1470	+ f.swiper = function(c, d, f) {
1471	+ function q(a) {
1472	+ c.addEventListener(a, u[a], !1);
1473	+ }
1474	+ function D(a) {
1475	+ c.removeEventListener(a, u[a], !1);
1476	+ }
1477	+ function r() {
1478	+ z && z.stop();
1479	+ z = null;
1480	+ }
1481	+ var z, G, C, u = {}, x = [], F = [], h = [];
1482	+ u[a] = function(a) {
1483	+ G = !1;
1484	+ r();
1485	+ var b = l();
1486	+ g(a, function(a, c) {
1487	+ x[a] = b;
1488	+ F[a] = c.clientX;
1489	+ h[a] = c.clientY;
1490	+ });
1491	+ C = c.scrollLeft;
1492	+ return !0;
1493	+ };
1494	+ u[p] = function(a) {
1495	+ g(a, function(a, b) {
1496	+ var c = l() - x[a], e = F[a] - b.clientX, c = Math.abs(e) / c;
1497	+ d(c, e ? 0 > e ? -1 : 1 : 0);
1498	+ });
1499	+ C = null;
1500	+ return !0;
1501	+ };
1502	+ u[e] = function(a) {
1503	+ var b, e;
1504	+ null == C \|\| g(a, function(a, c) {
1505	+ b = F[a] - c.clientX;
1506	+ e = h[a] - c.clientY;
1507	+ });
1508	+ if (e && Math.abs(e) > Math.abs(b)) return G = !0;
1509	+ b && (G = !0, c.scrollLeft = Math.max(0, C + b));
1510	+ return k(a);
1511	+ };
1512	+ if (!b \|\| f) q(a), q(e), q(p), b && (c.className += " mstouch");
1513	+ return {
1514	+ kill: function() {
1515	+ D(a);
1516	+ D(e);
1517	+ D(p);
1518	+ r();
1519	+ },
1520	+ swiped: function() {
1521	+ return G;
1522	+ },
1523	+ ms: function() {
1524	+ return b;
1525	+ },
1526	+ snap: function(a) {
1527	+ b && !f && (c.style["-ms-scroll-snap-points-x"] = "snapInterval(0px," + a + "px)",
1528	+ c.style["-ms-scroll-snap-type"] = "mandatory", c.style["-ms-scroll-chaining"] = "none");
1529	+ },
1530	+ scroll: function(a, b, e) {
1531	+ r();
1532	+ var x = c.scrollLeft, l = a > x ? 1 : -1, q = Math[1 === l ? "min" : "max"], p = Math.round(16 * b * l);
1533	+ return z = n.require("$48", "fps.js").loop(function(b) {
1534	+ b && (x = Math.max(0, q(a, x + p)), c.scrollLeft = x, a === x && (r(), e && e(x)));
1535	+ }, c);
1536	+ }
1537	+ };
1538	+ };
1539	+ f.start = function(b, c) {
1540	+ return m(b, a, c, !1);
1541	+ };
1542	+ f.move = function(a, b) {
1543	+ return m(a, e, b, !1);
1544	+ };
1545	+ f.end = function(a, b) {
1546	+ return m(a, p, b, !1);
1547	+ };
1548	+ var g = f.each = function(a, c) {
1549	+ if (b) (a.MSPOINTER_TYPE_TOUCH \|\| "touch") === a.pointerType && c(0, a); else for (var e = -1, l = (a.originalEvent \|\| a).changedTouches \|\| []; ++e < l.length; ) c(e, l[e]);
1550	+ }, l = Date.now \|\| function() {
1551	+ return new Date().getTime();
1552	+ };
1553	+ return f;
1554	+ }({}, v, w));
1555	+ n.register("$49", function(f, d, n) {
1556	+ f.init = function(d) {
1557	+ function k() {
1558	+ e.style.top = String(-d.scrollTop) + "px";
1559	+ return !0;
1560	+ }
1561	+ function c() {
1562	+ var a = e;
1563	+ a.textContent = d.value;
1564	+ a.innerHTML = a.innerHTML.replace(/[ \t]/g, b).split(/(?:\n\|\r\n?)/).join('<span class="eol crlf"></span>\r\n') + '<span class="eol eof"></span>';
1565	+ return !0;
1566	+ }
1567	+ function b(a) {
1568	+ return '<span class="x' + a.charCodeAt(0).toString(16) + '">' + a + "</span>";
1569	+ }
1570	+ var a = d.parentNode, e = a.insertBefore(n.createElement("div"), d);
1571	+ h(d).on("input", c).on("scroll", k);
1572	+ h(a).addClass("has-mirror");
1573	+ e.className = "ta-mirror";
1574	+ var p = d.offsetWidth - d.clientWidth;
1575	+ 2 < p && (e.style.marginRight = String(p - 2) + "px");
1576	+ c();
1577	+ k();
1578	+ return {
1579	+ kill: function() {
1580	+ h(d).off("input", c).off("scroll", k);
1581	+ a.removeChild(e);
1582	+ e = null;
1583	+ h(a).removeClass("has-mirror");
1584	+ }
1585	+ };
1586	+ };
1587	+ return f;
1588	+ }({}, v, w));
1589	+ n.register("$29", function(f, d, h) {
1590	+ function m(b, a) {
1591	+ for (var c = 0, p = -1, g = a && d[a], l = k[b] \|\| [], f = l.length; ++p < f; ) callback = l[p],
1592	+ "function" === typeof callback && (callback(g), c++);
1593	+ return c;
1594	+ }
1595	+ var k = {}, c;
1596	+ f.load = function(b, a, c) {
1597	+ function p() {
1598	+ f && (clearTimeout(f), f = null);
1599	+ A && (A.onreadystatechange = null, A = A = A.onload = null);
1600	+ b && (delete k[b], b = null);
1601	+ }
1602	+ function g(a, l) {
1603	+ var d = A && A.readyState;
1604	+ if (l \|\| !d \|\| "loaded" === d \|\| "complete" === d) l \|\| m(b, c), p();
1605	+ }
1606	+ function l() {
1607	+ if (0 === m(b)) throw Error('Failed to load "' + (c \|\| b) + '"');
1608	+ p();
1609	+ }
1610	+ if (c && d[c]) "function" === typeof a && a(d[c]); else if (null != k[b]) k[b].push(a); else {
1611	+ k[b] = [ a ];
1612	+ var f = setTimeout(l, 4e3), A = h.createElement("script");
1613	+ A.setAttribute("src", b);
1614	+ A.setAttribute("async", "true");
1615	+ A.onreadystatechange = g;
1616	+ A.onload = g;
1617	+ A.onerror = l;
1618	+ A.onabort = p;
1619	+ h.getElementsByTagName("head")[0].appendChild(A);
1620	+ }
1621	+ };
1622	+ f.stat = function(b) {
1623	+ var a;
1624	+ if (!(a = c)) {
1625	+ for (var e, d, g = h.getElementsByTagName("script"), l = -1, k = g.length; ++l < k; ) if (a = g[l].getAttribute("src")) if (e = a.indexOf("/lib/vendor"),
1626	+ -1 !== e) {
1627	+ d = a.substr(0, e);
1628	+ break;
1629	+ }
1630	+ a = c = d \|\| "/static";
1631	+ }
1632	+ return a + b;
1633	+ };
1634	+ return f;
1635	+ }({}, v, w));
1636	+ n.register("$16", function(f, d, E) {
1637	+ function m(a, b) {
1638	+ a.setReadOnly(!1);
1639	+ a.on("change", function(a, c) {
1640	+ return b.val(c.getValue());
1641	+ });
1642	+ a.on("focus", function() {
1643	+ return b.focus();
1644	+ });
1645	+ a.on("blur", function() {
1646	+ return b.blur();
1647	+ });
1648	+ }
1649	+ function k(a) {
1650	+ a.off("change");
1651	+ a.off("focus");
1652	+ a.off("blur");
1653	+ }
1654	+ function c(a) {
1655	+ k(a);
1656	+ a.setReadOnly(!0);
1657	+ a.setHighlightGutterLine(!1);
1658	+ a.setHighlightActiveLine(!1);
1659	+ }
1660	+ function b(b, c) {
1661	+ function e() {
1662	+ this.HighlightRules = d;
1663	+ }
1664	+ var d = a(c), q = b.require, p = q("ace/lib/oop");
1665	+ p.inherits(d, q("ace/mode/text_highlight_rules").TextHighlightRules);
1666	+ p.inherits(e, q("ace/mode/text").Mode);
1667	+ return new e();
1668	+ }
1669	+ function a(a) {
1670	+ return function() {
1671	+ var b = {
1672	+ start: [ {
1673	+ token: "empty_line",
1674	+ regex: /^$/
1675	+ }, {
1676	+ token: "constant.language",
1677	+ regex: "(?:&#[0-9]+;)\|(?:&#x[0-9a-fA-F]+;)\|(?:&[a-zA-Z0-9_:\\.-]+;)"
1678	+ }, {
1679	+ token: "constant.language",
1680	+ regex: /<!\[CDATA\[/
1681	+ }, {
1682	+ token: "constant.language",
1683	+ regex: /\]\]>/
1684	+ }, {
1685	+ token: "locked",
1686	+ regex: /<(?:xliff:)?(?:g\|ph)[^>]>[^<]<\/(?:xliff:)?(?:g\|ph)>/
1687	+ }, {
1688	+ token: "locked",
1689	+ regex: /<(?:xliff:)?(bx\|ex\|x)[^\/>]*\/>/
1690	+ }, {
1691	+ token: "constant.language",
1692	+ regex: /<\/?[:a-z]+[^>]*>/
1693	+ } ]
1694	+ }, c = e(a);
1695	+ "icu" === a ? b = {
1696	+ start: b.start.concat([ {
1697	+ token: "icu-quoted",
1698	+ regex: /'([{}][^']*)?'/
1699	+ }, {
1700	+ token: "printf",
1701	+ regex: "{[^!-/:-@\\[-^{-~¡¢£¤¥¦§©«¬®°±¶»¿×÷\\u2010-\\u2027\\u2030-\\u203E\\u2041-\\u2053\\u2055-\\u205E\\u2190-\\u245F\\u2500-\\u2775\\u2794-\\u2BFF\\u2E00-\\u2E7F\\u3001-\\u3003\\u3008-\\u3020\\u3030\\uFD3E\\uFD3F\\uFE45\\uFE46]+(,[\\s\\u0085\\u200E\\u200F\\u2028\\u2029](?:number\|date\|time\|spellout\|ordinal\|duration)[\\s\\u0085\\u200E\\u200F\\u2028\\u2029](,[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]*[^{}]+)?)?}"
1702	+ }, {
1703	+ token: "icu",
1704	+ regex: /{/,
1705	+ next: "icuName"
1706	+ }, {
1707	+ token: "icu",
1708	+ regex: /}/,
1709	+ next: "icuType"
1710	+ } ]),
1711	+ icuName: [ {
1712	+ token: "icu",
1713	+ regex: "[\\s\\u0085\\u200E\\u200F\\u2028\\u2029]+"
1714	+ }, {
1715	+ token: "icu.name",
1716	+ regex: "[^\\s\\u0085\\u200E\\u200F\\u2028\\u2029!-/:-@\\[-^{-~¡¢£¤¥¦§©«¬®°±¶»¿×÷\\u2010-\\u2027\\u2030-\\u203E\\u2041-\\u2053\\u2055-\\u205E\\u2190-\\u245F\\u2500-\\u2775\\u2794-\\u2BFF\\u2E00-\\u2E7F\\u3001-\\u3003\\u3008-\\u3020\\u3030\\uFD3E\\uFD3F\\uFE45\\uFE46]+",
1717	+ next: "icuType"
1718	+ }, {
1719	+ defaultToken: "icu",
1720	+ next: "icuType"
1721	+ } ],
1722	+ icuType: [ {
1723	+ token: "icu",
1724	+ regex: /[{}]/,
1725	+ next: "start"
1726	+ }, {
1727	+ defaultToken: "icu"
1728	+ } ]
1729	+ } : c && b.start.push({
1730	+ token: "printf",
1731	+ regex: c
1732	+ });
1733	+ this.$rules = b;
1734	+ };
1735	+ }
1736	+ function e(a) {
1737	+ switch (a) {
1738	+ case "objc":
1739	+ return /%(?:\d+\$)?[-+'0# ]\d(?:\.\d+\|\.\*(?:\d+\$)?)?(?:hh?\|ll?\|[qjzTL])?[sScCdDioOuUxXfFeEgGaAp%@]/;
1740	+
1741	+ case "java":
1742	+ return /%(?:\d+\$)?[-+,(0# ]\d(?:\.\d+)?(?:[bBhHsScCdoxXeEfgGaA%n]\|[tT][HIklMSLNpzZsQBbhAaCYyjmdeRTrDFc])/;
1743	+
1744	+ case "php":
1745	+ return /%(?:\d+\$)?(?:'.\|[-+0 ])\d(?:\.\d+)?[suxXbcdeEfFgGo%]/;
1746	+
1747	+ case "python":
1748	+ return /%(?:$[_A-Za-z][_A-Za-z0-9]$)?[-+0# ](?:\d+\|\)?(?:\.\d+\|\.\)?(?:[hlL])?[sdiouxXeEfFgGcra%]/;
1749	+
1750	+ case "javascript":
1751	+ return /%(?:[1-9]\d\$)?\+?(?:0\|'[^$])?-?\d(?:\.\d+)?[b-gijostTuvxX%]/;
1752	+
1753	+ case "auto":
1754	+ return /%(?:\d+\$\|$[_A-Za-z][_A-Za-z0-9]$)?(?:[-+0]?\d(\.\d+)?[duxoefgaDUXOEFGA]\|[@scSC%])/;
1755	+
1756	+ case g:
1757	+ return p \|\| "%%";
1758	+ }
1759	+ }
1760	+ var p, g = "auto";
1761	+ f.init = function(a, e, p) {
1762	+ var f, q = !1, D = p \|\| g, r = a.parentNode, z = r.appendChild(E.createElement("div"));
1763	+ h(r).addClass("has-proxy has-ace");
1764	+ n.require("$29", "remote.js").load("https://cdnjs.cloudflare.com/ajax/libs/ace/1.4.1/ace.js", function(d) {
1765	+ if (z) {
1766	+ if (!d) throw Error("Failed to load code editor");
1767	+ f = d.edit(z);
1768	+ var p = f.session, g = f.renderer;
1769	+ f.$blockScrolling = Infinity;
1770	+ f.setShowInvisibles(q);
1771	+ f.setWrapBehavioursEnabled(!1);
1772	+ f.setBehavioursEnabled(!1);
1773	+ f.setHighlightActiveLine(!1);
1774	+ p.setUseSoftTabs(!1);
1775	+ g.setShowGutter(!0);
1776	+ g.setPadding(10);
1777	+ g.setScrollMargin(8);
1778	+ p.setMode(b(d, D));
1779	+ f.setValue(a.value, -1);
1780	+ p.setUseWrapMode(!0);
1781	+ e ? m(f, e) : c(f);
1782	+ }
1783	+ }, "ace");
1784	+ return {
1785	+ kill: function() {
1786	+ f && (k(f), f.destroy(), f = null);
1787	+ z && (r.removeChild(z), h(r).removeClass("has-proxy has-ace"), z = null);
1788	+ return this;
1789	+ },
1790	+ disable: function() {
1791	+ f && c(f);
1792	+ e = null;
1793	+ return this;
1794	+ },
1795	+ enable: function(a) {
1796	+ e = a;
1797	+ f && m(f, a);
1798	+ return this;
1799	+ },
1800	+ resize: function() {
1801	+ f && f.resize();
1802	+ return this;
1803	+ },
1804	+ val: function(a) {
1805	+ f && a !== f.getValue() && f.setValue(a, -1);
1806	+ return this;
1807	+ },
1808	+ invs: function(a) {
1809	+ a = a \|\| !1;
1810	+ q !== a && (q = a, f && f.setShowInvisibles(a));
1811	+ return this;
1812	+ },
1813	+ strf: function(a) {
1814	+ a = a \|\| g;
1815	+ a !== D && (D = a, f && f.session.setMode(b(d.ace, a)));
1816	+ return this;
1817	+ },
1818	+ focus: function() {
1819	+ return this;
1820	+ }
1821	+ };
1822	+ };
1823	+ f.strf = function(a, b) {
1824	+ g = a;
1825	+ p = b;
1826	+ return f;
1827	+ };
1828	+ return f;
1829	+ }({}, v, w));
1830	+ n.register("$50", function(f, d, E) {
1831	+ function m(a, b) {
1832	+ function c() {
1833	+ return b.val(a.getContent());
1834	+ }
1835	+ a.on("input", c);
1836	+ a.on("change", c);
1837	+ a.on("focus", function() {
1838	+ return b.focus();
1839	+ });
1840	+ a.on("blur", function() {
1841	+ return b.blur();
1842	+ });
1843	+ a.setMode("design");
1844	+ }
1845	+ function k(a) {
1846	+ a.off("input");
1847	+ a.off("change");
1848	+ a.off("focus");
1849	+ a.off("blur");
1850	+ }
1851	+ function c(a) {
1852	+ k(a);
1853	+ a.setMode("readonly");
1854	+ }
1855	+ var b = 0;
1856	+ f.load = function(a) {
1857	+ var b = n.require("$29", "remote.js");
1858	+ b.load(b.stat("/lib/tinymce.min.js"), a, "tinymce");
1859	+ return f;
1860	+ };
1861	+ f.init = function(a, e) {
1862	+ function d(a) {
1863	+ A = a;
1864	+ s = "<p>" === a.substr(0, 3) && "</p>" === a.substr(-4);
1865	+ return a.replace(/(<\/?)script/gi, "$1loco:script");
1866	+ }
1867	+ function g(a) {
1868	+ l = a;
1869	+ a._getContent = a.getContent;
1870	+ a.getContent = function(a) {
1871	+ a = this._getContent(a);
1872	+ a = a.replace(/(<\/?)loco:script/gi, "$1script");
1873	+ if (!s && "<p>" === a.substr(0, 3) && "</p>" === a.substr(-4)) {
1874	+ var b = a.substr(3, a.length - 7);
1875	+ if (b === A \|\| -1 === b.indexOf("</p>")) a = b;
1876	+ }
1877	+ return a;
1878	+ };
1879	+ a._setContent = a.setContent;
1880	+ a.setContent = function(a, b) {
1881	+ return this._setContent(d(a), b);
1882	+ };
1883	+ e ? (m(a, e), e.reset()) : c(a);
1884	+ h(r).removeClass("loading");
1885	+ }
1886	+ var l, y = !1, A = "", s = !1, q = a.parentNode, D = q.parentNode, r = q.appendChild(E.createElement("div")), z = D.insertBefore(E.createElement("nav"), q);
1887	+ z.id = "_tb" + String(++b);
1888	+ h(q).addClass("has-proxy has-mce");
1889	+ h(r).addClass("mce-content-body loading").html(d(a.value));
1890	+ f.load(function(a) {
1891	+ if (!a) throw Error("Failed to load HTML editor");
1892	+ r && a.init({
1893	+ inline: !0,
1894	+ target: r,
1895	+ hidden_input: !1,
1896	+ theme: "modern",
1897	+ skin: !1,
1898	+ plugins: "link lists",
1899	+ browser_spellcheck: !0,
1900	+ menubar: !1,
1901	+ fixed_toolbar_container: "#" + z.id,
1902	+ toolbar: "formatselect \| bold italic link unlink \| bullist numlist outdent indent",
1903	+ block_formats: "Paragraph=p;Heading 1=h1;Heading 2=h2;Heading 3=h4;Heading 4=h4;Heading 5=h5;Heading 6=h6;",
1904	+ forced_root_block: "p",
1905	+ relative_urls: !1,
1906	+ convert_urls: !1,
1907	+ remove_script_host: !1,
1908	+ document_base_url: "",
1909	+ allow_script_urls: !1,
1910	+ formats: {
1911	+ alignleft: {
1912	+ classes: "alignleft"
1913	+ },
1914	+ alignright: {
1915	+ selector: "p,h1,h2,h3,h4,span,strong,em,a",
1916	+ classes: "alignright"
1917	+ },
1918	+ aligncenter: {
1919	+ selector: "p,h1,h2,h3,h4,span,strong,em,a",
1920	+ classes: "aligncenter"
1921	+ },
1922	+ strikethrough: {
1923	+ inline: "del"
1924	+ }
1925	+ },
1926	+ fix_list_elements: !0,
1927	+ extended_valid_elements: "span,b,i,u,loco:script",
1928	+ entities: "38,amp,60,lt,62,gt,160,nbsp",
1929	+ entity_encoding: "named",
1930	+ keep_styles: !1,
1931	+ init_instance_callback: g
1932	+ });
1933	+ });
1934	+ return {
1935	+ val: function(b) {
1936	+ b = d(b);
1937	+ null == l ? (a.value = b, h(r).html(b)) : l.getContent() !== b && l.setContent(b);
1938	+ e && e.val(b);
1939	+ return this;
1940	+ },
1941	+ kill: function() {
1942	+ l && (e && e.val(l.getContent()), k(l), l.destroy(), l = null);
1943	+ r && (q.removeChild(r), h(q).removeClass("has-proxy has-mce"), r = null);
1944	+ z && (D.removeChild(z), z = null);
1945	+ return this;
1946	+ },
1947	+ enable: function(a) {
1948	+ e = a;
1949	+ l && m(l, a);
1950	+ return this;
1951	+ },
1952	+ disable: function() {
1953	+ l && c(l);
1954	+ e = null;
1955	+ return this;
1956	+ },
1957	+ focus: function() {
1958	+ l && e && l.focus();
1959	+ return this;
1960	+ },
1961	+ invs: function(a) {
1962	+ a = a \|\| !1;
1963	+ y !== a && (y = a, h(q)[a ? "addClass" : "removeClass"]("show-invs"));
1964	+ return this;
1965	+ }
1966	+ };
1967	+ };
1968	+ return f;
1969	+ }({}, v, w));
1970	+ n.register("$46", function(f, d, E) {
1971	+ function m(b) {
1972	+ function a() {
1973	+ k && (f.off("input", e), k = !1);
1974	+ }
1975	+ function e() {
1976	+ var a = b.value;
1977	+ a !== q && (f.trigger("changing", [ a, q ]), q = a);
1978	+ }
1979	+ function d() {
1980	+ e();
1981	+ k && D !== q && f.trigger("changed", [ q ]);
1982	+ }
1983	+ function g() {
1984	+ c = b;
1985	+ D = q;
1986	+ k \|\| (f.on("input", e), k = !0);
1987	+ f.trigger("editFocus");
1988	+ s.addClass("has-focus");
1989	+ return !0;
1990	+ }
1991	+ function l() {
1992	+ c === b && (c = null);
1993	+ f.trigger("editBlur");
1994	+ s.removeClass("has-focus");
1995	+ k && (d(), a());
1996	+ return !0;
1997	+ }
1998	+ var k = !1, f = h(b), s = h(b.parentNode), q = b.value, D;
1999	+ f.on("blur", l).on("focus", g);
2000	+ return {
2001	+ val: function(a) {
2002	+ q !== a && (b.value = a, f.triggerHandler("input"), q = a);
2003	+ return !0;
2004	+ },
2005	+ kill: function() {
2006	+ a();
2007	+ f.off("blur", l).off("focus", g);
2008	+ },
2009	+ fire: function() {
2010	+ q = null;
2011	+ e();
2012	+ },
2013	+ ping: d,
2014	+ blur: l,
2015	+ focus: g,
2016	+ reset: function() {
2017	+ D = q = b.value;
2018	+ }
2019	+ };
2020	+ }
2021	+ function k(b) {
2022	+ this.e = b;
2023	+ }
2024	+ var c;
2025	+ f._new = function(b) {
2026	+ return new k(b);
2027	+ };
2028	+ f.init = function(b) {
2029	+ var a = new k(b);
2030	+ b.disabled ? (b.removeAttribute("disabled"), a.disable()) : b.readOnly ? a.disable() : a.enable();
2031	+ return a;
2032	+ };
2033	+ TextAreaPrototype = k.prototype;
2034	+ TextAreaPrototype.destroy = function() {
2035	+ this.unlisten();
2036	+ var b = this.p;
2037	+ b && (b.kill(), this.p = null);
2038	+ this.e = null;
2039	+ };
2040	+ TextAreaPrototype.reload = function(b, a) {
2041	+ var c = this.l;
2042	+ c && !a && (this.disable(), c = null);
2043	+ this.val(b \|\| "");
2044	+ a && !c && this.enable();
2045	+ return this;
2046	+ };
2047	+ TextAreaPrototype.val = function(b) {
2048	+ var a = this.e;
2049	+ if (null == b) return a.value;
2050	+ var c = this.l, d = this.p;
2051	+ d && d.val(b);
2052	+ c && c.val(b);
2053	+ c \|\| a.value === b \|\| (a.value = b, h(a).triggerHandler("input"));
2054	+ return this;
2055	+ };
2056	+ TextAreaPrototype.fire = function() {
2057	+ this.l && this.l.fire();
2058	+ return this;
2059	+ };
2060	+ TextAreaPrototype.ping = function() {
2061	+ this.l && this.l.ping();
2062	+ return this;
2063	+ };
2064	+ TextAreaPrototype.focus = function() {
2065	+ var b = this.p;
2066	+ b ? b.focus() : h(this.e).focus();
2067	+ };
2068	+ TextAreaPrototype.focused = function() {
2069	+ return c && c === this.el;
2070	+ };
2071	+ TextAreaPrototype.parent = function() {
2072	+ return this.e.parentNode;
2073	+ };
2074	+ TextAreaPrototype.attr = function(b, a) {
2075	+ var c = this.e;
2076	+ if (1 === arguments.length) return c.getAttribute(b);
2077	+ null == a ? c.removeAttribute(b) : c.setAttribute(b, a);
2078	+ return this;
2079	+ };
2080	+ TextAreaPrototype.editable = function() {
2081	+ return !!this.l;
2082	+ };
2083	+ TextAreaPrototype.enable = function() {
2084	+ var b = this.p;
2085	+ this.e.removeAttribute("readonly");
2086	+ this.listen();
2087	+ b && b.enable && b.enable(this.l);
2088	+ return this;
2089	+ };
2090	+ TextAreaPrototype.disable = function() {
2091	+ var b = this.p;
2092	+ this.e.setAttribute("readonly", !0);
2093	+ this.unlisten();
2094	+ b && b.disable && b.disable();
2095	+ return this;
2096	+ };
2097	+ TextAreaPrototype.listen = function() {
2098	+ var b = this.l;
2099	+ b && b.kill();
2100	+ this.l = m(this.e);
2101	+ return this;
2102	+ };
2103	+ TextAreaPrototype.unlisten = function() {
2104	+ var b = this.l;
2105	+ b && (b.kill(), this.l = null);
2106	+ return this;
2107	+ };
2108	+ TextAreaPrototype.setInvs = function(b, a) {
2109	+ var c = this.i \|\| !1;
2110	+ if (a \|\| c !== b) this._i && (this._i.kill(), delete this._i), (c = this.p) ? c.invs && c.invs(b) : b && (this._i = n.require("$49", "mirror.js").init(this.e)),
2111	+ this.i = b;
2112	+ return this;
2113	+ };
2114	+ TextAreaPrototype.getInvs = function() {
2115	+ return this.i \|\| !1;
2116	+ };
2117	+ TextAreaPrototype.setMode = function(b) {
2118	+ var a = this.p, e = this.i \|\| !1;
2119	+ b !== (this.m \|\| "") && (this.m = b, a && a.kill(), this.p = a = "code" === b ? n.require("$16", "ace.js").init(this.e, this.l, this["%"]) : "html" === b ? n.require("$50", "mce.js").init(this.e, this.l) : null,
2120	+ this.setInvs(e, !0), c && this.focus());
2121	+ return this;
2122	+ };
2123	+ TextAreaPrototype.setStrf = function(b) {
2124	+ this["%"] = b;
2125	+ "code" === this.m && this.p.strf(b);
2126	+ return this;
2127	+ };
2128	+ TextAreaPrototype.name = function(b) {
2129	+ this.e.setAttribute("name", b);
2130	+ return this;
2131	+ };
2132	+ TextAreaPrototype.placeholder = function(b) {
2133	+ this.e.setAttribute("placeholder", b);
2134	+ return this;
2135	+ };
2136	+ TextAreaPrototype.redraw = function() {
2137	+ var b = this.p;
2138	+ b && b.resize && b.resize();
2139	+ };
2140	+ TextAreaPrototype = null;
2141	+ return f;
2142	+ }({}, v, w));
2143	+ n.register("$47", function(f, d, n) {
2144	+ function m(a) {
2145	+ var b = d.console;
2146	+ b && b.error && b.error(a);
2147	+ }
2148	+ function k(a) {
2149	+ var b = n.createElement("div");
2150	+ a && b.setAttribute("class", a);
2151	+ return b;
2152	+ }
2153	+ function c(a) {
2154	+ return function() {
2155	+ a.resize();
2156	+ return this;
2157	+ };
2158	+ }
2159	+ function b(a) {
2160	+ return function(b) {
2161	+ for (var c = b.target, e = c.$index; null == e && "DIV" !== c.nodeName && (c = c.parentElement); ) e = c.$index;
2162	+ null != e && (b.stopImmediatePropagation(), a.select(e));
2163	+ return !0;
2164	+ };
2165	+ }
2166	+ function a(a) {
2167	+ return function() {
2168	+ a.redrawDirty() && a.redraw();
2169	+ return !0;
2170	+ };
2171	+ }
2172	+ function e(a) {
2173	+ return function(b) {
2174	+ var c;
2175	+ c = b.keyCode;
2176	+ if (40 === c) c = 1; else if (38 === c) c = -1; else return !0;
2177	+ if (b.shiftKey \|\| b.ctrlKey \|\| b.metaKey \|\| b.altKey) return !0;
2178	+ a.selectNext(c);
2179	+ b.stopPropagation();
2180	+ b.preventDefault();
2181	+ return !1;
2182	+ };
2183	+ }
2184	+ function p(a, b, c) {
2185	+ function e(a) {
2186	+ m("row[" + a + "] disappeared");
2187	+ return {
2188	+ cellVal: function() {
2189	+ return "";
2190	+ }
2191	+ };
2192	+ }
2193	+ return function(d) {
2194	+ var l = b \|\| 0, k = c ? -1 : 1, x = a.rows \|\| [];
2195	+ d.sort(function(a, b) {
2196	+ return k * (x[a] \|\| e(a)).cellVal(l).localeCompare((x[b] \|\| e(b)).cellVal(l));
2197	+ });
2198	+ };
2199	+ }
2200	+ function g(a) {
2201	+ this.w = a;
2202	+ }
2203	+ function l(a) {
2204	+ this.t = a;
2205	+ this.length = 0;
2206	+ }
2207	+ function y(a, b, c) {
2208	+ var e = n.createElement("div");
2209	+ e.className = c \|\| "";
2210	+ this._ = e;
2211	+ this.d = b \|\| [];
2212	+ this.i = a \|\| 0;
2213	+ this.length = b.length;
2214	+ }
2215	+ function A(a) {
2216	+ this.live = a;
2217	+ this.rows = [];
2218	+ }
2219	+ f.create = function(a) {
2220	+ return new g(a);
2221	+ };
2222	+ var s = g.prototype;
2223	+ s.init = function(d) {
2224	+ var l = this.w, p = l.id, g = l.splity(p + "-thead", p + "-tbody"), f = g[0], g = g[1], C = [], u = [], x = [], F = [];
2225	+ if (d) this.ds = d, this.idxs = u, this._idxs = null; else if (!(d = this.ds)) throw Error("No datasource");
2226	+ f.css.push("wg-thead");
2227	+ g.css.push("wg-tbody");
2228	+ d.eachCol(function(a, b, c) {
2229	+ x[a] = p + "-col-" + b;
2230	+ F[a] = c \|\| b;
2231	+ });
2232	+ for (var N = k(), s = -1, m = x.length, n = k("wg-cols"), A = f.splitx.apply(f, x); ++s < m; ) A[s].header(F[s]),
2233	+ n.appendChild(N.cloneNode(!1)).setAttribute("for", x[s]);
2234	+ d.eachRow(function(a, b, c) {
2235	+ C[a] = new y(a, b, c);
2236	+ u[a] = a;
2237	+ });
2238	+ this.rows = C;
2239	+ this.cols = n;
2240	+ this.ww = null;
2241	+ this.root = N = g.body;
2242	+ this.head = f;
2243	+ f.redraw = c(this);
2244	+ f = g.fixed = A[0].bodyY() \|\| 20;
2245	+ l.lock().resize(f, g);
2246	+ l.css.push("is-table");
2247	+ l.restyle();
2248	+ this.sc ? this._re_sort(m) : d.sort && d.sort(u);
2249	+ this.redrawDirty();
2250	+ this.render();
2251	+ h(N).attr("tabindex", "-1").on("keydown", e(this)).on("mousedown", b(this)).on("scroll", a(this));
2252	+ return this;
2253	+ };
2254	+ s.clear = function() {
2255	+ for (var a = this.pages \|\| [], b = a.length; 0 !== b--; ) a[b].destroy();
2256	+ this.pages = [];
2257	+ this.sy = this.mx = this.mn = this.vh = null;
2258	+ void 0;
2259	+ return this;
2260	+ };
2261	+ s.render = function() {
2262	+ for (var a, b, c = [], e = this.rows \|\| [], d = -1, l, g = this.idxs, x = g.length, p = this.idxr = {}, k = this.r, f = this._r, h = this.root, y = this.cols; ++d < x; ) {
2263	+ 0 === d % 100 && (a = y.cloneNode(!0), b = new A(a), b.h = 2200, b.insert(h), c.push(b));
2264	+ l = g[d];
2265	+ p[l] = d;
2266	+ a = e[l];
2267	+ if (null == a) throw Error("Render error, no data at [" + l + "]");
2268	+ a.page = b;
2269	+ b.rows.push(a);
2270	+ }
2271	+ b && 100 !== b.size() && b.sleepH(22);
2272	+ this.pages = c;
2273	+ this.mx = this.mn = null;
2274	+ this.redrawDirty();
2275	+ this.redraw();
2276	+ null == k ? null != f && (a = e[f]) && a.page && (delete this._r, this.select(f, !0)) : (a = e[k]) && a.page ? this.select(k, !0) : (this.deselect(),
2277	+ this._r = k);
2278	+ return this;
2279	+ };
2280	+ s.resize = function() {
2281	+ var a = -1, b = this.ww \|\| (this.ww = []), c = this.w, e = c.cells[0], d = e.body.childNodes, l = d.length, g = this.pages \|\| [], x = g.length;
2282	+ for (c.redraw.call(e); ++a < l; ) b[a] = d[a].style.width;
2283	+ if (x) {
2284	+ c = this.mx;
2285	+ for (a = this.mn; a <= c; a++) g[a].widths(b);
2286	+ this.redrawDirty() && this.redraw();
2287	+ }
2288	+ };
2289	+ s.redrawDirty = function() {
2290	+ var a = !1, b = this.root, c = b.scrollTop, b = b.clientHeight;
2291	+ this.sy !== c && (a = !0, this.sy = c);
2292	+ this.vh !== b && (a = !0, this.vh = b);
2293	+ return a;
2294	+ };
2295	+ s.redraw = function() {
2296	+ for (var a = 0, b = -1, c = null, e = null, d = this.ww, l = this.sy, g = this.vh, x = this.mn, k = this.mx, p = Math.max(0, l - 100), l = g + l + 100, f = this.pages \|\| [], h = f.length; ++b < h && !(a > l); ) g = f[b],
2297	+ a += g.height(), a < p \|\| (null === c && (c = b), e = b, g.rendered \|\| g.render(d));
2298	+ if (x !== c) {
2299	+ if (null !== x && c > x) for (b = x; b < c; b++) {
2300	+ g = f[b];
2301	+ if (!g) throw Error("Shit!");
2302	+ g.rendered && g.sleep();
2303	+ }
2304	+ this.mn = c;
2305	+ }
2306	+ if (k !== e) {
2307	+ if (null !== k && e < k) for (b = k; b > e; b--) g = f[b], g.rendered && g.sleep();
2308	+ this.mx = e;
2309	+ }
2310	+ };
2311	+ s.selected = function() {
2312	+ return this.r;
2313	+ };
2314	+ s.thead = function() {
2315	+ return this.w.cells[0];
2316	+ };
2317	+ s.tbody = function() {
2318	+ return this.w.cells[1];
2319	+ };
2320	+ s.tr = function(a) {
2321	+ return (a = this.row(a)) ? a.cells() : [];
2322	+ };
2323	+ s.row = function(a) {
2324	+ return this.rows[a];
2325	+ };
2326	+ s.td = function(a, b) {
2327	+ return this.tr(a)[b];
2328	+ };
2329	+ s.next = function(a, b, c) {
2330	+ null == c && (c = this.r \|\| 0);
2331	+ var e = this.idxs, d = e.length, g = (this.idxr \|\| {})[c];
2332	+ for (c = g; c !== (g += a) && !(0 <= g && d > g); ) if (b && d) g = 1 === a ? -1 : d,
2333	+ b = !1; else return null;
2334	+ c = e[g];
2335	+ return null == c \|\| null == this.rows[c] ? (m("Bad next: [" + g + "] does not map to data row"),
2336	+ null) : c;
2337	+ };
2338	+ s.selectNext = function(a, b, c) {
2339	+ a = this.next(a, b);
2340	+ null != a && this.r !== a && this.select(a, c);
2341	+ return this;
2342	+ };
2343	+ s.deselect = function(a) {
2344	+ var b = this.r;
2345	+ null != b && (this.r = null, h(this.tr(b)).removeClass("selected"), this.w.fire("wgRowDeselect", [ b, a ]));
2346	+ return this;
2347	+ };
2348	+ s.selectRow = function(a, b) {
2349	+ return this.select(this.idxs[a]);
2350	+ };
2351	+ s.select = function(a, b) {
2352	+ var c = this.rows[a], e = c && c.page;
2353	+ if (!e) return this.deselect(!1), m("Row is filtered out"), this;
2354	+ this.deselect(!0);
2355	+ var d, g = this.w.cells[1];
2356	+ e.rendered \|\| (d = e.top(), g.scrollY(d), this.redrawDirty() && this.redraw());
2357	+ if (!c.rendered) return e.rendered \|\| m("Failed to render page"), m("Row [" + c.i + "] not rendered"),
2358	+ this;
2359	+ e = c.cells();
2360	+ h(e).addClass("selected");
2361	+ this.r = a;
2362	+ b \|\| (d = g.scrollY(), h(this.root).focus(), d !== g.scrollY() && g.scrollY(d));
2363	+ g.scrollTo(e[0], !0);
2364	+ this.w.fire("wgRowSelect", [ a, c.data() ]);
2365	+ return this;
2366	+ };
2367	+ s.unfilter = function() {
2368	+ this._idxs && (this.idxs = this._sort(this._idxs), this._idxs = null, this.clear().render());
2369	+ return this;
2370	+ };
2371	+ s.filter = function(a) {
2372	+ this._idxs \|\| (this._idxs = this.idxs);
2373	+ this.idxs = this._sort(a);
2374	+ return this.clear().render();
2375	+ };
2376	+ s.each = function(a) {
2377	+ for (var b, c = -1, e = this.rows \|\| [], d = this.idxs \|\| [], g = d.length; ++c < g; ) b = d[c],
2378	+ a(e[b], c, b);
2379	+ return this;
2380	+ };
2381	+ s.sortable = function(a) {
2382	+ var b = this.sc \|\| (this.sc = new l(this));
2383	+ b.has(a) \|\| b.add(a);
2384	+ return this;
2385	+ };
2386	+ s._re_sort = function(a) {
2387	+ var b = -1, c = this.sc, e = c.active;
2388	+ for (this.sc = c = new l(this); ++b < a; ) c.add(b);
2389	+ e && (b = this.head.indexOf(e.id), -1 === b && (b = Math.min(e.idx, a - 1)), this.sort(b, e.desc));
2390	+ return this;
2391	+ };
2392	+ s._sort = function(a, b) {
2393	+ b ? (this.s = b, b(a)) : (b = this.s) && b(a);
2394	+ return a;
2395	+ };
2396	+ s.sort = function(a, b) {
2397	+ this._sort(this.idxs, p(this, a, b));
2398	+ this.sc.activate(a, b);
2399	+ return this;
2400	+ };
2401	+ s = null;
2402	+ s = l.prototype;
2403	+ s.has = function(a) {
2404	+ return null != this[a];
2405	+ };
2406	+ s.add = function(a) {
2407	+ var b = this, c = b.t.head.cells[a];
2408	+ b[a] = {
2409	+ desc: null,
2410	+ idx: a,
2411	+ id: c.id
2412	+ };
2413	+ b.length++;
2414	+ c.addClass("wg-sortable").on("click", function(c) {
2415	+ if ("header" === c.target.nodeName.toLowerCase()) return c.stopImmediatePropagation(),
2416	+ b.toggle(a), !1;
2417	+ });
2418	+ return b;
2419	+ };
2420	+ s.toggle = function(a) {
2421	+ this.t.sort(a, !this[a].desc).clear().render();
2422	+ return this;
2423	+ };
2424	+ s.activate = function(a, b) {
2425	+ var c, e;
2426	+ c = this.active;
2427	+ var d = this[a], g = this.t.head.cells;
2428	+ c && (e = g[c.idx]) && (e.removeClass(c.css), c !== d && e.restyle());
2429	+ (e = g[a]) ? (d.desc = b, this.active = d, c = "wg-" + (b ? "desc" : "asc"), e.addClass(c).restyle(),
2430	+ d.css = c) : this.active = null;
2431	+ return this;
2432	+ };
2433	+ s = null;
2434	+ s = y.prototype;
2435	+ s.render = function(a) {
2436	+ var b, c = [], e = this._, d = this.length;
2437	+ if (e) {
2438	+ for (this.c = c; 0 !== d--; ) b = e.cloneNode(!1), c[d] = this.update(d, b), b.$index = this.i,
2439	+ a[d].appendChild(b);
2440	+ this._ = null;
2441	+ } else for (c = this.c; 0 !== d--; ) a[d].appendChild(c[d]);
2442	+ this.rendered = !0;
2443	+ return this;
2444	+ };
2445	+ s.update = function(a, b) {
2446	+ var c = b \|\| this.c[a] \|\| {}, e = (this.d[a] \|\| function() {})() \|\| " ";
2447	+ null == e.innerHTML ? c.textContent = e : c.innerHTML = e.innerHTML;
2448	+ return c;
2449	+ };
2450	+ s.cells = function() {
2451	+ return this.c \|\| [ this._ ];
2452	+ };
2453	+ s.data = function() {
2454	+ for (var a = -1, b = [], c = this.length; ++a < c; ) b[a] = this.cellVal(a);
2455	+ return b;
2456	+ };
2457	+ s.destroy = function() {
2458	+ this.page = null;
2459	+ this.rendered = !1;
2460	+ };
2461	+ s.cellVal = function(a) {
2462	+ a = this.d[a]() \|\| "";
2463	+ return String(a.textContent \|\| a);
2464	+ };
2465	+ s = null;
2466	+ s = A.prototype;
2467	+ s.size = function() {
2468	+ return this.rows.length;
2469	+ };
2470	+ s.insert = function(a) {
2471	+ var b = this.h, c = k("wg-dead");
2472	+ c.style.height = String(b) + "px";
2473	+ a.appendChild(c);
2474	+ return this.dead = c;
2475	+ };
2476	+ s.top = function() {
2477	+ return (this.rendered ? this.live : this.dead).offsetTop;
2478	+ };
2479	+ s.height = function() {
2480	+ var a = this.h;
2481	+ null == a && (this.h = a = this.rendered ? this.live.firstChild.offsetHeight : this.dead.offsetHight);
2482	+ a \|\| m("row has zero height");
2483	+ return a;
2484	+ };
2485	+ s.render = function(a) {
2486	+ for (var b, c = -1, e = this.rows, d = e.length, g = this.dead, l = this.live, x = l.childNodes; ++c < d; ) b = e[c],
2487	+ b.rendered \|\| b.render(x);
2488	+ d = a.length;
2489	+ for (c = 0; c < d; c++) x[c].style.width = a[c];
2490	+ g.parentNode.replaceChild(l, g);
2491	+ this.rendered = !0;
2492	+ this.h = null;
2493	+ return this;
2494	+ };
2495	+ s.sleep = function() {
2496	+ var a = this.height(), b = this.live, c = this.dead;
2497	+ c.style.height = String(a) + "px";
2498	+ b.parentNode.replaceChild(c, b);
2499	+ this.rendered = !1;
2500	+ this.h = a;
2501	+ return this;
2502	+ };
2503	+ s.sleepH = function(a) {
2504	+ a *= this.rows.length;
2505	+ var b = this.dead;
2506	+ b && (b.style.height = String(a) + "px");
2507	+ this.rendered \|\| (this.h = a);
2508	+ return this;
2509	+ };
2510	+ s.widths = function(a) {
2511	+ for (var b = this.live.childNodes, c = a.length; 0 !== c--; ) b[c].style.width = a[c];
2512	+ return this;
2513	+ };
2514	+ s.destroy = function() {
2515	+ var a = this.rendered ? this.live : this.dead, b = this.rows, c = b.length;
2516	+ for (a.parentNode.removeChild(a); 0 !== c--; ) b[c].destroy();
2517	+ };
2518	+ s = null;
2519	+ return f;
2520	+ }({}, v, w));
2521	+ n.register("$38", function(f, d, E) {
2522	+ function m(a, b) {
2523	+ var c = a.id, e = c && q[c], d = e && e.parent();
2524	+ if (!e \|\| !d) return null;
2525	+ var g = d.dir === s, c = g ? "X" : "Y", l = "page" + c, g = g ? A : y, k = g(d.el), c = b["offset" + c], p = d.el, f = p.className;
2526	+ null == c && (c = b[l] - g(a));
2527	+ c && (k += c);
2528	+ p.className = f + " is-resizing";
2529	+ return {
2530	+ done: function() {
2531	+ p.className = f;
2532	+ },
2533	+ move: function(a) {
2534	+ d.resize(a[l] - k, e);
2535	+ return !0;
2536	+ }
2537	+ };
2538	+ }
2539	+ function k(a, c) {
2540	+ function e() {
2541	+ h(E).off("mousemove", d);
2542	+ r && (r.done(), r = null);
2543	+ return !0;
2544	+ }
2545	+ function d(a) {
2546	+ r ? r.move(a) : e();
2547	+ return !0;
2548	+ }
2549	+ if (r) return !0;
2550	+ r = m(a.target, a);
2551	+ if (!r) return !0;
2552	+ h(E).one("mouseup", e).on("mousemove", d);
2553	+ return b(a);
2554	+ }
2555	+ function c(a, b) {
2556	+ var c = b.type;
2557	+ "touchmove" === c ? r && r.move(b) : "touchstart" === c ? r = m(a.target, b) : "touchend" === c && r && (r.done(),
2558	+ r = null);
2559	+ }
2560	+ function b(a) {
2561	+ a.stopPropagation();
2562	+ a.preventDefault();
2563	+ return !1;
2564	+ }
2565	+ function a(a) {
2566	+ var b = D;
2567	+ b && b.redraw();
2568	+ a && a.redraw();
2569	+ return D = a;
2570	+ }
2571	+ function e(b, c) {
2572	+ var e = h(c).on("editFocus", function() {
2573	+ e.trigger("wgFocus", [ a(b) ]);
2574	+ }).on("editBlur", function() {
2575	+ e.trigger("wgBlur", [ a(null) ]);
2576	+ });
2577	+ }
2578	+ function p(a) {
2579	+ var b = a.id, c = a.className;
2580	+ this.id = b;
2581	+ this.el = a;
2582	+ this.pos = this.index = 0;
2583	+ this.css = [ c \|\| "wg-root", "wg-cell" ];
2584	+ this._cn = c;
2585	+ q[b] = this;
2586	+ this.clear();
2587	+ }
2588	+ var g = n.include("$44", "html.js") \|\| n.include("$2", "html.js", !0), l = n.require("$21", "dom.js"), y = l.top, A = l.left, s = 1, q = {}, D, r = !1;
2589	+ f.init = function(a) {
2590	+ var b = new p(a);
2591	+ b.redraw();
2592	+ n.require("$45", "touch.js").ok(function(b) {
2593	+ b.dragger(a, c);
2594	+ });
2595	+ h(a).on("mousedown", k);
2596	+ return b;
2597	+ };
2598	+ d = p.prototype;
2599	+ d.fire = function(a, b) {
2600	+ var c = h.Event(a);
2601	+ c.cell = this;
2602	+ h(this.el).trigger(c, b);
2603	+ return this;
2604	+ };
2605	+ d.each = function(a) {
2606	+ for (var b = -1, c = this.cells, e = c.length; ++b < e; ) a(c[b], b);
2607	+ return this;
2608	+ };
2609	+ d.indexOf = function(a) {
2610	+ return (a = q[a.id \|\| String(a)]) && a.pid === this.id ? a.index : -1;
2611	+ };
2612	+ d.on = function() {
2613	+ return this.$("on", arguments);
2614	+ };
2615	+ d.off = function() {
2616	+ return this.$("off", arguments);
2617	+ };
2618	+ d.find = function(a) {
2619	+ return h(this.el).find(a);
2620	+ };
2621	+ d.$ = function(a, b) {
2622	+ h.fn[a].apply(h(this.el), b);
2623	+ return this;
2624	+ };
2625	+ d.addClass = function(a) {
2626	+ this.css.push(a);
2627	+ return this;
2628	+ };
2629	+ d.removeClass = function(a) {
2630	+ a = this.css.indexOf(a);
2631	+ -1 !== a && this.css.splice(a, 1);
2632	+ return this;
2633	+ };
2634	+ d.parent = function() {
2635	+ return this.pid && q[this.pid];
2636	+ };
2637	+ d.splitx = function() {
2638	+ return this._split(s, arguments);
2639	+ };
2640	+ d.splity = function() {
2641	+ return this._split(2, arguments);
2642	+ };
2643	+ d._split = function(a, b) {
2644	+ (this.length \|\| this.field) && this.clear();
2645	+ for (var c = -1, e, d = b.length, g = 1 / d, k = 0; ++c < d; ) {
2646	+ e = l.el();
2647	+ this.body.appendChild(e);
2648	+ for (var f = e, h = b[c], y = h, s = 1; q[h]; ) h = y + "-" + ++s;
2649	+ f.id = h;
2650	+ e = new p(e);
2651	+ e.index = c;
2652	+ e.pid = this.id;
2653	+ e._locale(this.lang, this.rtl);
2654	+ e.pos = k;
2655	+ k += g;
2656	+ this.cells.push(e);
2657	+ this.length++;
2658	+ }
2659	+ this.dir = a;
2660	+ this.redraw();
2661	+ return this.cells;
2662	+ };
2663	+ d.destroy = function() {
2664	+ this.clear();
2665	+ delete q[this.id];
2666	+ var a = this.el;
2667	+ a.innerHTML = "";
2668	+ this.body = null;
2669	+ a.className = this._cn \|\| "";
2670	+ h(a).off();
2671	+ return this;
2672	+ };
2673	+ d.exists = function() {
2674	+ return this === q[this.id];
2675	+ };
2676	+ d.clear = function() {
2677	+ for (var a = this.el, b = this.cells, c = this.field, e = this.body, d = this.nav, k = this.length \|\| 0; 0 !== k--; ) delete q[b[k].destroy().id];
2678	+ this.cells = [];
2679	+ this.length = 0;
2680	+ d && (a.removeChild(d), this.nav = null);
2681	+ e && (c && (g.ie() && h(e).triggerHandler("blur"), c.destroy(), this.field = null),
2682	+ this.table && (this.table = null), a === e.parentNode && a.removeChild(e));
2683	+ this.body = a.appendChild(l.el("", "wg-body"));
2684	+ this._h = null;
2685	+ return this;
2686	+ };
2687	+ d.resize = function(a, b) {
2688	+ if (!b && (b = this.cells[1], !b)) return;
2689	+ var c = b.index, e = this.cells, d = h(this.el)[this.dir === s ? "width" : "height"](), g = e[c + 1], c = e[c - 1];
2690	+ pad = (b.body \|\| b.el.firstChild).offsetTop \|\| 0;
2691	+ max = (g ? g.pos * d : d) - pad;
2692	+ min = c ? c.pos * d : 0;
2693	+ b.pos = Math.min(max, Math.max(min, a)) / d;
2694	+ this.redraw();
2695	+ return this;
2696	+ };
2697	+ d.distribute = function(a) {
2698	+ for (var b = -1, c = 0, e, d = this.cells, g = a.length; ++b < g && (e = d[++c]); ) e.pos = Math.max(0, Math.min(1, a[b]));
2699	+ this.redraw();
2700	+ return this;
2701	+ };
2702	+ d.distribution = function() {
2703	+ for (var a = [], b = 0, c = this.cells, e = c.length - 1; b < e; ) a[b] = c[++b].pos;
2704	+ return a;
2705	+ };
2706	+ d.restyle = function() {
2707	+ var a = this.css.concat();
2708	+ 0 === this.index ? a.push("first") : a.push("not-first");
2709	+ this.dir && (a.push("wg-split"), 2 === this.dir ? a.push("wg-split-y") : a.push("wg-split-x"));
2710	+ this.t && a.push("has-title");
2711	+ this.nav && a.push("has-nav");
2712	+ this.field && (a.push("is-field"), this.field.editable() ? a.push("is-editable") : a.push("is-readonly"));
2713	+ a = a.join(" ");
2714	+ a !== this._css && (this._css = a, this.el.className = a);
2715	+ return this;
2716	+ };
2717	+ d.redraw = function(a) {
2718	+ this.restyle();
2719	+ var b = this.el, c = this.body, e = this.field;
2720	+ if (c) {
2721	+ var d, g = b.clientWidth \|\| 0, l = b.clientHeight \|\| 0, k = c.offsetTop \|\| 0, l = k > l ? 0 : l - k;
2722	+ this._h !== l && (this._h = l, c.style.height = String(l) + "px", d = e);
2723	+ this._w !== g && (this._w = g, d = e);
2724	+ d && d.redraw();
2725	+ }
2726	+ c = this.length;
2727	+ g = 1;
2728	+ l = this.nav;
2729	+ for (k = 2 === this.dir ? "height" : "width"; 0 !== c--; ) e = this.cells[c], l ? d = 1 : (e.fixed && (e.pos = e.fixed / h(b)[k]()),
2730	+ d = g - e.pos, g = e.pos), e.el.style[k] = String(100 * d) + "%", e.redraw(a);
2731	+ return this;
2732	+ };
2733	+ d.contents = function(a, b) {
2734	+ var c = this.el, e = this.body;
2735	+ if (null == a) return e.innerHTML;
2736	+ this.length ? this.clear() : e && (c.removeChild(e), e = null);
2737	+ e \|\| (this.body = e = c.appendChild(l.el("", b \|\| "wg-content")), this._h = null,
2738	+ (c = this.lang) && this._locale(c, this.rtl, !0));
2739	+ "string" === typeof a ? h(e)._html(a) : a && this.append(a);
2740	+ this.redraw();
2741	+ return this;
2742	+ };
2743	+ d.textarea = function(a, b) {
2744	+ var c = this.field;
2745	+ if (c) {
2746	+ var d = c.editable();
2747	+ c.reload(a, b);
2748	+ d !== b && this.restyle();
2749	+ } else this.length && this.clear(), d = l.el("textarea"), d.setAttribute("wrap", "virtual"),
2750	+ d.value = a, this.contents(d), c = n.require("$46", "field.js")._new(d)[b ? "enable" : "disable"](),
2751	+ e(this, d), this.field = c, this.restyle();
2752	+ this.lang \|\| this.locale("en");
2753	+ return c;
2754	+ };
2755	+ d.locale = function(a) {
2756	+ a = n.require("$36", "locale.js").cast(a);
2757	+ return this._locale(String(a), a.isRTL());
2758	+ };
2759	+ d._locale = function(a, b, c) {
2760	+ var e = this.body;
2761	+ if (c \|\| a !== this.lang) this.lang = a, e && e.setAttribute("lang", a);
2762	+ if (c \|\| b !== this.rtl) this.rtl = b, e && e.setAttribute("dir", b ? "RTL" : "LTR");
2763	+ return this;
2764	+ };
2765	+ d.editable = function() {
2766	+ var a = this.field;
2767	+ if (a) return a.editable() ? a : null;
2768	+ var b = this.cells, c = b.length, e = this.navigated();
2769	+ if (null != e) return b[e].editable();
2770	+ for (;++e < c; ) {
2771	+ for (e = 0; e < c; c++) ;
2772	+ if (a = b[e].editable()) return a;
2773	+ }
2774	+ };
2775	+ d.eachTextarea = function(a) {
2776	+ var b = this.field;
2777	+ b ? a(b) : this.each(function(b) {
2778	+ b.eachTextarea(a);
2779	+ });
2780	+ return this;
2781	+ };
2782	+ d.append = function(a) {
2783	+ a && (a.nodeType ? g.init(this.body.appendChild(a)) : g.init(h(a).appendTo(this.body)));
2784	+ return this;
2785	+ };
2786	+ d.prepend = function(a) {
2787	+ var b = this.body;
2788	+ if (a.nodeType) {
2789	+ var c = b.firstChild;
2790	+ g.init(c ? b.insertBefore(a, c) : b.appendChild(a));
2791	+ } else g.init(h(a).prependTo(b));
2792	+ return this;
2793	+ };
2794	+ d.before = function(a) {
2795	+ var b = this.body;
2796	+ a.nodeType ? g.init(this.el.insertBefore(a, b)) : g.init(h(a).insertBefore(b));
2797	+ return this;
2798	+ };
2799	+ d.header = function(a, b) {
2800	+ if (null == a && null == b) return this.el.getElementsByTagName("header")[0];
2801	+ this.t = l.txt(a \|\| "");
2802	+ this.el.insertBefore(l.el("header", b), this.body).appendChild(this.t);
2803	+ this.redraw();
2804	+ return this;
2805	+ };
2806	+ d.title = function(a) {
2807	+ var b = this.t;
2808	+ if (b) return b.nodeValue = a \|\| "", b;
2809	+ this.header(a);
2810	+ return this.t;
2811	+ };
2812	+ d.titled = function() {
2813	+ var a = this.t;
2814	+ return a && a.nodeValue;
2815	+ };
2816	+ d.bodyY = function() {
2817	+ return y(this.body, this.el);
2818	+ };
2819	+ d.scrollY = function(a) {
2820	+ if (J === a) return this.body.scrollTop;
2821	+ this.body.scrollTop = a;
2822	+ };
2823	+ d.tabulate = function(a) {
2824	+ var b = this.table;
2825	+ b ? b.clear() : b = n.require("$47", "wgtable.js").create(this);
2826	+ b.init(a);
2827	+ return this.table = b;
2828	+ };
2829	+ d.lock = function() {
2830	+ this.body.className += " locked";
2831	+ return this;
2832	+ };
2833	+ d.scrollTo = function(a, b) {
2834	+ var c, e = this.body;
2835	+ c = e.scrollTop;
2836	+ var d = y(a, e);
2837	+ if (c > d) c = d; else {
2838	+ var g = e.clientHeight, d = d + h(a).outerHeight();
2839	+ if (g + c < d) c = d - g; else return;
2840	+ }
2841	+ b ? e.scrollTop = c : h(e).stop(!0).animate({
2842	+ scrollTop: c
2843	+ }, 250);
2844	+ };
2845	+ d.navigize = function(a, c) {
2846	+ function e(a) {
2847	+ var b = g[a], c = f[a], d = h(b.el).show();
2848	+ c.addClass("active");
2849	+ p = a;
2850	+ y.data("idx", a);
2851	+ b.fire("wgTabSelect", [ a ]);
2852	+ return d;
2853	+ }
2854	+ var d = this, g = d.cells, k = d.nav, p, f = [];
2855	+ k && d.el.removeChild(k);
2856	+ var k = d.nav = d.el.insertBefore(l.el("nav", "wg-tabs"), d.body), y = h(k).on("click", function(a) {
2857	+ var c = h(a.target).data("idx");
2858	+ if (null == c) return !0;
2859	+ if (null != p) {
2860	+ var l = f[p];
2861	+ h(g[p].el).hide();
2862	+ l.removeClass("active");
2863	+ }
2864	+ e(c);
2865	+ d.redraw();
2866	+ return b(a);
2867	+ });
2868	+ null == c && (c = y.data("idx") \|\| 0);
2869	+ d.each(function(b, c) {
2870	+ f[c] = h('<a href="#' + b.id + '"></a>').data("idx", c).text(a[c]).appendTo(y);
2871	+ b.pos = 0;
2872	+ h(b.el).hide();
2873	+ });
2874	+ e(g[c] ? c : 0);
2875	+ d.lock();
2876	+ d.redraw();
2877	+ return d;
2878	+ };
2879	+ d.navigated = function() {
2880	+ var a = this.nav;
2881	+ if (a) return h(a).data("idx");
2882	+ };
2883	+ d = null;
2884	+ return f;
2885	+ }({}, v, w));
2886	+ n.register("$24", function(f, d, E) {
2887	+ function m(a) {
2888	+ var b = [];
2889	+ a && (a.saved() \|\| b.push("po-unsaved"), a.fuzzy() ? b.push("po-fuzzy") : a.flagged() && b.push("po-flagged"),
2890	+ a.translation() \|\| b.push("po-empty"), a.comment() && b.push("po-comment"));
2891	+ return b.join(" ");
2892	+ }
2893	+ function k(a, b, c) {
2894	+ b = h(a.title(b).parentNode);
2895	+ var e = b.find("span.lang");
2896	+ c ? (c = n.require("$36", "locale.js").cast(c), e.length \|\| (e = h("<span></span>").prependTo(b)),
2897	+ e.attr("lang", c.lang).attr("class", c.getIcon() \|\| "lang region region-" + (c.region \|\| "zz").toLowerCase())) : (e.remove(),
2898	+ c = "en");
2899	+ a.locale(c);
2900	+ return b;
2901	+ }
2902	+ function c(a, b, c) {
2903	+ b.on("click", function(b) {
2904	+ var e = a.fire(c, [ b.target ]);
2905	+ e \|\| b.preventDefault();
2906	+ return e;
2907	+ });
2908	+ }
2909	+ function b() {
2910	+ this.dirty = 0;
2911	+ }
2912	+ n.require("$3", "number.js");
2913	+ var a = "poUpdate", e = "changing", p = "changed", g = 0, l = 1, y = 2, A = 3, s = 4, q = 5, D, r, z = n.require("$35", "string.js").html, v = n.require("$6", "string.js").sprintf;
2914	+ f.extend = function(a) {
2915	+ return a.prototype = new b();
2916	+ };
2917	+ f.localise = function(a) {
2918	+ r = a;
2919	+ return f;
2920	+ };
2921	+ var C = function() {
2922	+ var a = E.createElement("p");
2923	+ return function(b) {
2924	+ a.innerHTML = b.replace("src=", "x=");
2925	+ return a.textContent.trim() \|\| b.trim();
2926	+ };
2927	+ }(), u = b.prototype = n.require("$37", "abstract.js").init([ "getListColumns", "getListHeadings", "getListEntry" ], [ "editable", "t" ]);
2928	+ u.init = function() {
2929	+ this.localise();
2930	+ this.editable = {
2931	+ source: !0,
2932	+ target: !0
2933	+ };
2934	+ this.mode = "";
2935	+ this.html = !1;
2936	+ return this;
2937	+ };
2938	+ u.localise = function(a) {
2939	+ a \|\| (a = r \|\| n.require("$1", "t.js").init());
2940	+ var b = [];
2941	+ b[g] = a._x("Source text", "Editor") + ":";
2942	+ b[A] = a._x("%s translation", "Editor") + ":";
2943	+ b[s] = a._x("Context", "Editor") + ":";
2944	+ b[q] = a._x("Comments", "Editor") + ":";
2945	+ b[l] = a._x("Single", "Editor") + ":";
2946	+ b[y] = a._x("Plural", "Editor") + ":";
2947	+ b[6] = a._x("Untranslated", "Editor");
2948	+ b[7] = a._x("Translated", "Editor");
2949	+ b[8] = a._x("Toggle Fuzzy", "Editor");
2950	+ b[9] = a._x("Suggest translation", "Editor");
2951	+ this.labels = b;
2952	+ this.t = a;
2953	+ return this;
2954	+ };
2955	+ u.setRootCell = function(a) {
2956	+ function b(a) {
2957	+ c.redraw(!0, a);
2958	+ return !0;
2959	+ }
2960	+ var c = n.require("$38", "wingrid.js").init(a);
2961	+ h(d).on("resize", b);
2962	+ this.redraw = b;
2963	+ h(a).on("wgFocus wgBlur", function(a, b) {
2964	+ a.stopPropagation();
2965	+ D = b;
2966	+ });
2967	+ this.destroy = function() {
2968	+ c.destroy();
2969	+ h(d).off("resize", b);
2970	+ };
2971	+ this.rootDiv = a;
2972	+ return c;
2973	+ };
2974	+ u.$ = function() {
2975	+ return h(this.rootDiv);
2976	+ };
2977	+ u.setListCell = function(a) {
2978	+ var b = this;
2979	+ b.listCell = a;
2980	+ a.on("wgRowSelect", function(a, c) {
2981	+ b.loadMessage(b.po.row(c));
2982	+ return !0;
2983	+ }).on("wgRowDeselect", function(a, c, e) {
2984	+ e \|\| b.loadNothing();
2985	+ return !0;
2986	+ });
2987	+ };
2988	+ u.setSourceCell = function(a) {
2989	+ this.sourceCell = a;
2990	+ };
2991	+ u.setTargetCell = function(a) {
2992	+ this.targetCell = a;
2993	+ };
2994	+ u.next = function(a, b, c) {
2995	+ for (var e = this.listTable, d = e.selected(), g = d, l, k = this.po; null != (d = e.next(a, c, d)); ) {
2996	+ if (g === d) {
2997	+ d = null;
2998	+ break;
2999	+ }
3000	+ if (b && (l = k.row(d), l.translated(0))) continue;
3001	+ break;
3002	+ }
3003	+ null != d && e.select(d, !0);
3004	+ return d;
3005	+ };
3006	+ u.current = function(a) {
3007	+ var b = this.active;
3008	+ if (null == a) return b;
3009	+ a ? a.is(b) ? this.reloadMessage(a) : this.loadMessage(a) : this.unloadActive();
3010	+ return this;
3011	+ };
3012	+ u.getTargetOffset = function() {
3013	+ if (this.active) return this.targetCell && this.targetCell.navigated() \|\| 0;
3014	+ };
3015	+ u.getTargetEditable = function() {
3016	+ return this.editable.target && this.targetCell && this.targetCell.editable();
3017	+ };
3018	+ u.getSourceEditable = function() {
3019	+ return this.editable.source && this.sourceCell && this.sourceCell.editable();
3020	+ };
3021	+ u.getContextEditable = function() {
3022	+ return this.editable.context && this.contextCell && this.contextCell.editable();
3023	+ };
3024	+ u.getFirstEditable = function() {
3025	+ return this.getTargetEditable() \|\| this.getSourceEditable() \|\| this.getContextEditable();
3026	+ };
3027	+ u.searchable = function(a) {
3028	+ a && (this.dict = a, this.po && this.rebuildSearch());
3029	+ return this.dict && !0;
3030	+ };
3031	+ u.rebuildSearch = function() {
3032	+ var a = -1, b = this.po.rows, c = b.length, e = this.dict;
3033	+ for (e.clear(); ++a < c; ) e.add(a, b[a].toText());
3034	+ };
3035	+ u.filtered = function() {
3036	+ return this.lastSearch \|\| "";
3037	+ };
3038	+ u.filter = function(a, b) {
3039	+ var c, e = this.listTable, d = this.lastFound, g = this.lastSearch;
3040	+ if (a) {
3041	+ if (g === a) return d \|\| 0;
3042	+ if (g && !d && 0 === a.indexOf(g)) return 0;
3043	+ c = this.dict.find(a);
3044	+ }
3045	+ this.lastSearch = g = a;
3046	+ this.lastFound = d = c ? c.length : this.po.length;
3047	+ c ? e.filter(c) : e.unfilter();
3048	+ b \|\| this.fire("poFilter", [ g, d ]);
3049	+ return d;
3050	+ };
3051	+ u.countFiltered = function() {
3052	+ return this.lastSearch ? this.lastFound : this.po.length;
3053	+ };
3054	+ u.unsave = function(a, b) {
3055	+ var c = !1;
3056	+ if (a) {
3057	+ if (c = a.saved(b)) this.dirty++, a.unsave(b), this.fire("poUnsaved", [ a, b ]);
3058	+ this.markUnsaved(a);
3059	+ }
3060	+ return c;
3061	+ };
3062	+ u.markUnsaved = function(a) {
3063	+ var b = this.po.indexOf(a);
3064	+ if ((b = this.listTable.tr(b)) && b.length) {
3065	+ var c = b[0].className;
3066	+ a = c.replace(/(?:^\| +)po-[a-z]+/g, "") + " " + m(a);
3067	+ a !== c && h(b).attr("class", a);
3068	+ }
3069	+ };
3070	+ u.save = function(a) {
3071	+ var b = this.po;
3072	+ if (this.dirty \|\| a) b.each(function(a, b) {
3073	+ b.save();
3074	+ }), this.listCell.find("div.po-unsaved").removeClass("po-unsaved"), this.dirty = 0,
3075	+ this.fire("poSave");
3076	+ return b;
3077	+ };
3078	+ u.fire = function(a, b) {
3079	+ var c = this.handle;
3080	+ if (c && c[a] && (c = c[a].apply(this, b \|\| []), !1 === c)) return !1;
3081	+ c = h.Event(a);
3082	+ this.$().trigger(c, b);
3083	+ return !c.isDefaultPrevented();
3084	+ };
3085	+ u.on = function(a, b) {
3086	+ this.$().on(a, b);
3087	+ return this;
3088	+ };
3089	+ u.getSorter = function() {
3090	+ return null;
3091	+ };
3092	+ u.reload = function() {
3093	+ var a = this, b, c = a.listCell, e = a.listTable, d = a.po, g = d && d.locale(), l = g && g.isRTL(), k = d && d.length \|\| 0;
3094	+ if (!d \|\| !d.row) return c && c.clear().header("Error").contents("Invalid messages list"),
3095	+ !1;
3096	+ a.targetLocale = g;
3097	+ a.lastSearch && (a.lastSearch = "", a.lastFound = k, a.fire("poFilter", [ "", k ]));
3098	+ e && (b = e.thead().distribution());
3099	+ a.listTable = e = c.tabulate({
3100	+ eachCol: function(b) {
3101	+ var c, e, d = a.getListColumns(), g = a.getListHeadings();
3102	+ for (e in d) c = d[e], b(c, e, g[c]);
3103	+ },
3104	+ eachRow: function(b) {
3105	+ d.each(function(c, e) {
3106	+ b(e.idx, a.getListEntry(e), m(e));
3107	+ });
3108	+ },
3109	+ sort: a.getSorter()
3110	+ });
3111	+ var p, c = a.getListColumns();
3112	+ for (p in c) e.sortable(c[p]);
3113	+ b && e.thead().distribute(b);
3114	+ e.tbody().$(l ? "addClass" : "removeClass", [ "is-rtl" ]);
3115	+ a.fire("poLoad");
3116	+ return !!k;
3117	+ };
3118	+ u.load = function(a, b) {
3119	+ this.po = a;
3120	+ this.dict && this.rebuildSearch();
3121	+ this.reload() && (-1 !== b ? this.listTable.selectRow(b \|\| 0) : this.active && this.unloadActive());
3122	+ };
3123	+ u.pasteMessage = function(a) {
3124	+ var b, c = 0;
3125	+ this.active === a && ((b = this.sourceCell) && b.eachTextarea(function(b) {
3126	+ b.val(a.source(null, c++));
3127	+ }), (b = this.contextCell) && b.eachTextarea(function(b) {
3128	+ b.val(a.context());
3129	+ }), b = this.targetCell) && (c = 0, b.eachTextarea(function(b) {
3130	+ b.val(a.translation(c++));
3131	+ }));
3132	+ this.updateListCell(a, "source");
3133	+ this.updateListCell(a, "target");
3134	+ return this;
3135	+ };
3136	+ u.reloadMessage = function(a) {
3137	+ var b = this.sourceCell, c = this.targetCell, e;
3138	+ this.pasteMessage(a);
3139	+ b && this.setSrcMeta(a, b) && b.redraw();
3140	+ c && (e = c.navigated() \|\| 0, e = this.setTrgMeta(a, e, c), !b && this.setSrcMeta(a, c) && (e = !0),
3141	+ e && c.redraw());
3142	+ return this;
3143	+ };
3144	+ u.setStatus = function() {
3145	+ return null;
3146	+ };
3147	+ u.setSrcMeta = function(a, b) {
3148	+ var e = [], d, g = !1, l = this.$smeta, k = this.labels, p = [], f = a.tags(), y = f && f.length;
3149	+ if (d = a.context()) p.push("<span>" + z(k[s]) + "</span>"), p.push("<mark>" + z(d) + "</mark>");
3150	+ if (y && this.getTag) for (p.push("<span>Tagged:</span>"); 0 <= --y; ) (d = this.getTag(f[y])) && p.push('<mark class="tag">' + z(d.mod_name) + "</mark>");
3151	+ p.length && e.push(p.join(" "));
3152	+ if (this.getMono() && (d = a.refs()) && (f = d.split(/\s/), y = f.length)) {
3153	+ for (p = []; 0 <= --y; ) d = f[y], p.push("<code>" + z(d) + "</code>");
3154	+ e.push('<p class="has-icon icon-file">' + p.join(" ") + "</p>");
3155	+ }
3156	+ (d = a.notes()) && e.push('<p class="has-icon icon-info">' + z(d, !0) + "</p>");
3157	+ e.length ? (l \|\| (l = b.find("div.meta"), l.length \|\| (l = h('<div class="meta"></div>').insertAfter(b.header())),
3158	+ c(this, l, "poMeta"), this.$smeta = l), l.html(e.join("\n")).show(), g = !0) : l && l.text() && (l.text("").hide(),
3159	+ g = !0);
3160	+ return g;
3161	+ };
3162	+ u.setTrgMeta = function(a, b, c) {
3163	+ var e = [], d = !1, g = this.$tmeta;
3164	+ b = (a = a.errors(b)) && a.length;
3165	+ var l;
3166	+ if (b) for (l = 0; l < b; l++) e.push('<p class="has-icon icon-warn">' + z(a[l], !0) + ".</p>");
3167	+ e.length ? (g \|\| (g = c.find("div.meta"), g.length \|\| (g = h('<div class="meta"></div>').insertAfter(c.header())),
3168	+ this.$tmeta = g), g.html(e.join("\n")).show(), d = !0) : g && g.text() && (g.text("").hide(),
3169	+ d = !0);
3170	+ return d;
3171	+ };
3172	+ u.loadMessage = function(b) {
3173	+ function c(a, b) {
3174	+ var e = b ? a.split(" ") : a.split(" ", 1);
3175	+ a = e[0];
3176	+ "=" === a.charAt(0) && (a = a.substr(1), a = [ "zero", "one", "two" ][Number(a)] \|\| a);
3177	+ e[0] = a.charAt(0).toUpperCase() + a.substr(1).toLowerCase();
3178	+ return e.join(" ");
3179	+ }
3180	+ function d(a, e) {
3181	+ var p = J, h = L[g];
3182	+ a.off();
3183	+ a.titled() !== h && k(a, h, e \|\| "en");
3184	+ h = !1;
3185	+ r.setSrcMeta(b, a) && (h = !0);
3186	+ if (b.plural()) {
3187	+ var h = -1, s = [], q = [], m = a.id + "-", n = b.sourceForms() \|\| e && e.plurals \|\| [ "One", "Other" ], A = n.length;
3188	+ if (2 !== A \|\| "=" === n[0].charAt(0) && "=1" !== n[0]) for (;++h < A; ) s[h] = m + String(h),
3189	+ q[h] = c(n[h]) + ":"; else s = [ m + "-0", m + "-1" ], q = [ L[l], L[y] ];
3190	+ a.splity.apply(a, s);
3191	+ a.each(function(a, c) {
3192	+ a.header(q[c]).textarea(b.source(null, c), p).setStrf(B).setMode(z).setInvs(C);
3193	+ });
3194	+ a.lock();
3195	+ p && a.each(function(a, b) {
3196	+ f(a, b);
3197	+ });
3198	+ } else h && a.redraw(), a.textarea(b.source(), p).setStrf(B).setMode(z).setInvs(C),
3199	+ p && f(a, 0);
3200	+ }
3201	+ function f(c, d) {
3202	+ c.on(e, function(a, c) {
3203	+ b.source(c, d);
3204	+ 0 === d && r.updateListCell(b, "source");
3205	+ r.unsave(b, d);
3206	+ }).on(p, function() {
3207	+ 0 === d && r.po.reIndex(b);
3208	+ r.dict && r.rebuildSearch();
3209	+ r.fire(a, [ b ]);
3210	+ });
3211	+ }
3212	+ function h(a, e, d) {
3213	+ M && a.eachTextarea(function(a) {
3214	+ a.ping();
3215	+ });
3216	+ a.off();
3217	+ var g = e.isKnown() && e.label \|\| "Target", g = v(L[A], g);
3218	+ a.titled() !== g && k(a, g, e);
3219	+ g = !1;
3220	+ !this.sourceCell && r.setSrcMeta(b, a) && (g = !0);
3221	+ r.setTrgMeta(b, d, a) && (g = !0);
3222	+ r.setStatus(b, d);
3223	+ if (b.pluralized()) {
3224	+ var l = [], p = [], f = a.id + "-", y = b.targetForms() \|\| e.plurals \|\| [ "One", "Other" ], g = y.length, s = function(a) {
3225	+ var b = y[a];
3226	+ p.push(b ? c(b, !0) : "Form " + a);
3227	+ l.push(f + String(a));
3228	+ };
3229	+ for (b.each(s); (e = l.length) < g; ) s(e);
3230	+ a.splitx.apply(a, l);
3231	+ a.each(function(a, c) {
3232	+ var e = M && !b.disabled(c);
3233	+ a.textarea(b.translation(c), e).setStrf(B).setMode(z).setInvs(C);
3234	+ M && m(a, c);
3235	+ });
3236	+ a.navigize(p, d \|\| null).on("wgTabSelect", function(c, e) {
3237	+ var d = M && c.cell.editable();
3238	+ d && d.focus();
3239	+ r.setTrgMeta(b, e, a);
3240	+ r.setStatus(b, e);
3241	+ r.fire("poTab", [ e ]);
3242	+ });
3243	+ } else g && a.redraw(), a.textarea(b.translation(), M && !b.disabled(0)).setStrf(B).setMode(z).setInvs(C),
3244	+ M && m(a, 0);
3245	+ }
3246	+ function m(c, d) {
3247	+ c.on(e, function(a, c, e) {
3248	+ b.translate(c, d);
3249	+ 0 === d && r.updateListCell(b, "target");
3250	+ b.fuzzy(d) ? r.fuzzy(!1, b, d) : r.unsave(b, d);
3251	+ "" === c ? (r.fire("poEmpty", [ !0, b, d ]), r.setStatus(b, d)) : "" === e && (r.fire("poEmpty", [ !1, b, d ]),
3252	+ r.setStatus(b, d));
3253	+ }).on(p, function() {
3254	+ r.dict && r.rebuildSearch();
3255	+ r.fire(a, [ b ]);
3256	+ });
3257	+ }
3258	+ function n(c) {
3259	+ c.off();
3260	+ var d = L[s];
3261	+ c.titled() !== d && (k(c, d), r.setStatus(null));
3262	+ c.textarea(b.context(), !0).setMode(z).setInvs(C);
3263	+ X && c.on(e, function(a, c) {
3264	+ b.context(c);
3265	+ r.updateListCell(b, "source");
3266	+ r.unsave(b, O);
3267	+ }).on(p, function() {
3268	+ r.po.reIndex(b);
3269	+ r.dict && r.rebuildSearch();
3270	+ r.fire(a, [ b ]);
3271	+ });
3272	+ }
3273	+ function u(a) {
3274	+ var c = L[q];
3275	+ a.titled() !== c && k(a, c);
3276	+ a.off().on(e, function(a, c) {
3277	+ b.comment(c);
3278	+ r.fire("poComment", [ b, c ]);
3279	+ r.unsave(b, O);
3280	+ }).textarea(b.comment(), !0);
3281	+ }
3282	+ var r = this, z = r.mode, E = b.isHTML(), C = r.inv \|\| !1, w = this.fmt \|\| null, B = b.format() \|\| null, I = b.is(r.active), O = 0, T = r.sourceCell, S = r.targetCell, U = r.contextCell, V = r.commentCell, M = r.editable.target, J = r.editable.source, X = r.editable.context, P = D, Y = r.sourceLocale, W = r.targetLocale, L = r.labels;
3283	+ r.html !== E && (r.html = E, "code" !== r.mode && (z = E ? "html" : "", r.setMode(z)));
3284	+ r.active = b;
3285	+ T && d(T, Y);
3286	+ U && n(U);
3287	+ S && W && (O = S.navigated() \|\| 0, h(S, W, O));
3288	+ V && u(V);
3289	+ P && (P.exists() \|\| (P = P.parent()), (E = P.editable()) && E.focus());
3290	+ w !== B && (this.fmt = B);
3291	+ I \|\| r.fire("poSelected", [ b, O ]);
3292	+ };
3293	+ u.unloadActive = function() {
3294	+ function a(b) {
3295	+ b && b.text("").hide();
3296	+ }
3297	+ function b(a) {
3298	+ a && a.off().clear();
3299	+ }
3300	+ a(this.$smeta);
3301	+ a(this.$tmeta);
3302	+ b(this.sourceCell);
3303	+ b(this.contextCell);
3304	+ b(this.targetCell);
3305	+ this.commentCell && this.commentCell.off();
3306	+ this.active && (this.fire("poDeselected", [ this.active ]), this.active = null);
3307	+ return this;
3308	+ };
3309	+ u.loadNothing = function() {
3310	+ var a, b = this.t, c = this.mode \|\| "", e = this.inv \|\| !1, d = this.fmt;
3311	+ this.unloadActive();
3312	+ this.setStatus(null);
3313	+ (a = this.commentCell) && a.textarea("", !1);
3314	+ if (a = this.sourceCell) a.textarea("", !1).setStrf(d).setMode(c).setInvs(e), a.title(b._x("Source text not loaded", "Editor") + ":");
3315	+ if (a = this.contextCell) a.textarea("", !1).setMode(c).setInvs(e), a.title(b._x("Context not loaded", "Editor") + ":");
3316	+ if (a = this.targetCell) a.textarea("", !1).setStrf(d).setMode(c).setInvs(e), a.title(b._x("Translation not loaded", "Editor") + ":");
3317	+ this.fire("poSelected", [ null ]);
3318	+ };
3319	+ u.updateListCell = function(a, b) {
3320	+ var c = this.getListColumns()[b], e = this.po.indexOf(a);
3321	+ (e = this.listTable.row(e)) && e.rendered && e.update(c);
3322	+ };
3323	+ u.cellText = function(a) {
3324	+ return (a = -1 !== a.indexOf("<") \|\| -1 !== a.indexOf("&") ? C(a) : a.trim()) \|\| " ";
3325	+ };
3326	+ u.fuzzy = function(a, b, c) {
3327	+ b = b \|\| this.active;
3328	+ var e = b.fuzzy(c);
3329	+ !0 !== a \|\| e ? !1 === a && e && this.flag(0, b, c) && this.fire("poFuzzy", [ b, !1, c ]) : this.flag(4, b, c) && this.fire("poFuzzy", [ b, !0, c ]);
3330	+ return e;
3331	+ };
3332	+ u.flag = function(b, c, e) {
3333	+ if (!c) {
3334	+ c = this.active;
3335	+ e = this.getTargetOffset();
3336	+ if (null == e) return null;
3337	+ e && c.targetForms() && (e = 0);
3338	+ }
3339	+ var d = c.flagged(e);
3340	+ if (null == b) return d;
3341	+ if (d === b \|\| b && !c.translated(e) \|\| !this.fire("poFlag", [ b, d, c, e ])) return !1;
3342	+ c.flag(b, e);
3343	+ this.fire(a, [ c ]) && this.unsave(c, e);
3344	+ this.setStatus(c, e);
3345	+ return !0;
3346	+ };
3347	+ u.add = function(b, c) {
3348	+ var e, d = this.po.get(b, c);
3349	+ d ? e = this.po.indexOf(d) : (e = this.po.length, d = this.po.add(b, c), this.load(this.po, -1),
3350	+ this.fire("poAdd", [ d ]), this.fire(a, [ d ]));
3351	+ this.lastSearch && this.filter("");
3352	+ this.listTable.select(e);
3353	+ return d;
3354	+ };
3355	+ u.del = function(b) {
3356	+ if (b = b \|\| this.active) {
3357	+ var c = this.lastSearch, e = this.po.del(b);
3358	+ null != e && (this.unsave(b), this.fire("poDel", [ b ]), this.fire(a, [ b ]), this.reload(),
3359	+ this.dict && this.rebuildSearch(), this.active && this.active.equals(b) && this.unloadActive(),
3360	+ this.po.length && (c && this.filter(c), this.active \|\| (e = Math.min(e, this.po.length - 1),
3361	+ this.listTable.select(e))));
3362	+ }
3363	+ };
3364	+ u.setMono = function(a) {
3365	+ return this.setMode(a ? "code" : this.html ? "html" : "");
3366	+ };
3367	+ u.setMode = function(a) {
3368	+ if (this.mode !== a) {
3369	+ this.mode = a;
3370	+ this.callTextareas(function(b) {
3371	+ b.setMode(a);
3372	+ });
3373	+ var b = this.active, c = this.sourceCell;
3374	+ b && b.refs() && c && this.setSrcMeta(b, c) && c.redraw();
3375	+ }
3376	+ return this;
3377	+ };
3378	+ u.getMono = function() {
3379	+ return "code" === this.mode;
3380	+ };
3381	+ u.setInvs = function(a) {
3382	+ (this.inv \|\| !1) !== a && (this.inv = a, this.callTextareas(function(b) {
3383	+ b.setInvs(a);
3384	+ }), this.fire("poInvs", [ a ]));
3385	+ return this;
3386	+ };
3387	+ u.getInvs = function() {
3388	+ return this.inv \|\| !1;
3389	+ };
3390	+ u.callTextareas = function(a) {
3391	+ var b = this.targetCell;
3392	+ b && b.eachTextarea(a);
3393	+ (b = this.contextCell) && b.eachTextarea(a);
3394	+ (b = this.sourceCell) && b.eachTextarea(a);
3395	+ return this;
3396	+ };
3397	+ u.focus = function() {
3398	+ var a = this.getTargetEditable();
3399	+ a && a.focus();
3400	+ return this;
3401	+ };
3402	+ u = null;
3403	+ return f;
3404	+ }({}, v, w));
3405	+ n.register("$13", function(f, d, E) {
3406	+ function m() {
3407	+ this.init()._validate();
3408	+ this.sourceLocale = {
3409	+ lang: "en",
3410	+ label: "English",
3411	+ plurals: [ "One", "Other" ]
3412	+ };
3413	+ }
3414	+ function k(a) {
3415	+ a = h('<button type="button" class="button button-small icon icon-' + a + ' hastip"></button>');
3416	+ n.require("$12", "tooltip.js").init(a);
3417	+ return a;
3418	+ }
3419	+ function c(a) {
3420	+ return k("cloud").attr("title", a.labels[8] + " (Ctrl-U)").on("click", function(b) {
3421	+ b.preventDefault();
3422	+ a.focus().fuzzy(!a.fuzzy());
3423	+ });
3424	+ }
3425	+ function b(a) {
3426	+ return k("robot").attr("title", a.labels[9] + " (Ctrl-J)").on("click", function(b) {
3427	+ b.preventDefault();
3428	+ a.fire("poHint");
3429	+ });
3430	+ }
3431	+ d = n.require("$24", "base.js");
3432	+ f.init = function(a) {
3433	+ var b = new m();
3434	+ a = b.setRootCell(a);
3435	+ var c = a.splity("po-list", "po-edit"), d = c[0], l = c[1], c = l.splitx("po-trans", "po-comment"), k = c[0], f = c[1].header("Loading.."), c = k.splity("po-source", "po-target"), k = c[0].header("Loading.."), c = c[1].header("Loading..");
3436	+ a.distribute([ .34 ]);
3437	+ l.distribute([ .8 ]);
3438	+ b.setListCell(d);
3439	+ b.setSourceCell(k);
3440	+ b.setTargetCell(c);
3441	+ b.commentCell = f;
3442	+ b.editable.source = !1;
3443	+ return b;
3444	+ };
3445	+ d = m.prototype = d.extend(m);
3446	+ d.getListHeadings = function() {
3447	+ var a = this.t \|\| {
3448	+ _x: function(a) {
3449	+ return a;
3450	+ }
3451	+ }, b = [ a._x("Source text", "Editor") ];
3452	+ this.targetLocale && (b[1] = a._x("Translation", "Editor"));
3453	+ return b;
3454	+ };
3455	+ d.getListColumns = function() {
3456	+ var a = {
3457	+ source: 0
3458	+ };
3459	+ this.targetLocale && (a.target = 1);
3460	+ return a;
3461	+ };
3462	+ d.getListEntry = function(a) {
3463	+ var b = this.cellText, c = [ function() {
3464	+ var c, d = b(a.source() \|\| ""), k = a.context();
3465	+ return k ? (c = E.createElement("p"), c.appendChild(E.createElement("mark")).innerText = k,
3466	+ c.appendChild(E.createTextNode(" " + d)), c) : d;
3467	+ } ];
3468	+ this.targetLocale && (c[1] = function() {
3469	+ return b(a.translation() \|\| "");
3470	+ });
3471	+ return c;
3472	+ };
3473	+ d.stats = function() {
3474	+ var a = this.po, b = a.length, c = 0, d = 0, l = 0;
3475	+ a.each(function(a, b) {
3476	+ b.fuzzy() ? l++ : b.translated() ? c++ : d++;
3477	+ });
3478	+ return {
3479	+ t: b,
3480	+ p: c.percent(b) + "%",
3481	+ f: l,
3482	+ u: d
3483	+ };
3484	+ };
3485	+ d.unlock = function() {
3486	+ var a = this.targetLocale;
3487	+ this._unlocked \|\| (this.editable = {
3488	+ source: !0,
3489	+ context: !0,
3490	+ target: !1
3491	+ }, this.po && this.po.unlock(), this.contextCell = this.targetCell, delete this.targetCell,
3492	+ a && (this._unlocked = a, delete this.targetLocale, this.reload(), this.fire("poLock", [ !1 ])),
3493	+ this.active && this.loadMessage(this.active));
3494	+ };
3495	+ d.lock = function() {
3496	+ var a = this._unlocked;
3497	+ a && (this.targetLocale = a, delete this._unlocked, this.po && this.po.lock(a),
3498	+ this.editable = {
3499	+ source: !1,
3500	+ context: !1,
3501	+ target: !0
3502	+ }, this.targetCell = this.contextCell, delete this.contextCell, this.reload(), this.fire("poLock", [ !0, a ]),
3503	+ this.active && this.loadMessage(this.active));
3504	+ };
3505	+ d.locked = function() {
3506	+ return !this._unlocked;
3507	+ };
3508	+ d.setStatus = function(a) {
3509	+ var e = this.$tnav;
3510	+ if (null == a) e && (e.remove(), this.$tnav = null); else {
3511	+ e \|\| (this.$tnav = e = h("<nav></nav>").append(c(this)).append(b(this)).appendTo(this.targetCell.header()));
3512	+ var d = [];
3513	+ a.translated() ? a.fuzzy() && d.push("po-fuzzy") : d.push("po-empty");
3514	+ e.attr("class", d.join(" "));
3515	+ }
3516	+ };
3517	+ d.getSorter = function() {
3518	+ function a(a, c) {
3519	+ var d = a.weight(), k = c.weight();
3520	+ return d === k ? b(a, c) : d > k ? -1 : 1;
3521	+ }
3522	+ function b(a, c) {
3523	+ return a.hash().localeCompare(c.hash());
3524	+ }
3525	+ var c = this;
3526	+ return function(d) {
3527	+ var l = c.po, k = c.locked() ? a : b;
3528	+ d.sort(function(a, b) {
3529	+ return k(l.row(a), l.row(b));
3530	+ });
3531	+ };
3532	+ };
3533	+ return f;
3534	+ }({}, v, w));
3535	+ n.register("$14", function(f, d, n) {
3536	+ var m = {
3537	+ copy: 66,
3538	+ clear: 75,
3539	+ save: 83,
3540	+ fuzzy: 85,
3541	+ next: 40,
3542	+ prev: 38,
3543	+ enter: 13,
3544	+ invis: 73,
3545	+ hint: 74
3546	+ }, k = {
3547	+ 38: !0,
3548	+ 40: !0,
3549	+ 73: !0
3550	+ }, c = {
3551	+ 66: function(b, a) {
3552	+ var c = a.current();
3553	+ c && (c.normalize(), a.focus().pasteMessage(c));
3554	+ },
3555	+ 75: function(b, a) {
3556	+ var c = a.current();
3557	+ c && (c.untranslate(), a.focus().pasteMessage(c));
3558	+ },
3559	+ 85: function(b, a) {
3560	+ a.focus().fuzzy(!a.fuzzy());
3561	+ },
3562	+ 13: function(b, a) {
3563	+ a.getFirstEditable() && a.next(1, !0, !0);
3564	+ },
3565	+ 40: function(b, a) {
3566	+ var c = b.shiftKey;
3567	+ a.next(1, c, c);
3568	+ },
3569	+ 38: function(b, a) {
3570	+ var c = b.shiftKey;
3571	+ a.next(-1, c, c);
3572	+ },
3573	+ 73: function(b, a) {
3574	+ if (!b.shiftKey) return !1;
3575	+ a.setInvs(!a.getInvs());
3576	+ }
3577	+ };
3578	+ f.init = function(b, a) {
3579	+ function e(a) {
3580	+ if (a.isDefaultPrevented() \|\| !a.metaKey && !a.ctrlKey) return !0;
3581	+ var e = a.which;
3582	+ if (!f[e]) return !0;
3583	+ var d = c[e];
3584	+ if (!d) throw Error("command undefined #" + e);
3585	+ if (a.altKey \|\| a.shiftKey && !k[e] \|\| !1 === d(a, b)) return !0;
3586	+ a.stopPropagation();
3587	+ a.preventDefault();
3588	+ return !1;
3589	+ }
3590	+ var f = {};
3591	+ h(a \|\| d).on("keydown", e);
3592	+ return {
3593	+ add: function(a, b) {
3594	+ c[m[a]] = b;
3595	+ return this;
3596	+ },
3597	+ enable: function() {
3598	+ var a, b;
3599	+ for (b in arguments) a = m[arguments[b]], f[a] = !0;
3600	+ return this;
3601	+ },
3602	+ disable: function() {
3603	+ h(a \|\| d).off("keydown", e);
3604	+ b = a = f = null;
3605	+ }
3606	+ };
3607	+ };
3608	+ return f;
3609	+ }({}, v, w));
3610	+ n.register("$25", function(f, d, h) {
3611	+ function m() {
3612	+ this.reIndex([]);
3613	+ }
3614	+ f.init = function() {
3615	+ return new m();
3616	+ };
3617	+ d = m.prototype;
3618	+ d.reIndex = function(d) {
3619	+ for (var c = {}, b = -1, a = d.length; ++b < a; ) c[d[b]] = b;
3620	+ this.keys = d;
3621	+ this.length = b;
3622	+ this.ords = c;
3623	+ };
3624	+ d.key = function(d, c) {
3625	+ if (null == c) return this.keys[d];
3626	+ var b = this.keys[d], a = this.ords[c];
3627	+ if (c !== b) {
3628	+ if (null != a) throw Error("Clash with item at [" + a + "]");
3629	+ this.keys[d] = c;
3630	+ delete this.ords[b];
3631	+ this.ords[c] = d;
3632	+ }
3633	+ return d;
3634	+ };
3635	+ d.indexOf = function(d) {
3636	+ d = this.ords[d];
3637	+ return null == d ? -1 : d;
3638	+ };
3639	+ d.add = function(d, c) {
3640	+ var b = this.ords[d];
3641	+ null == b && (this.keys[this.length] = d, b = this.ords[d] = this.length++);
3642	+ this[b] = c;
3643	+ return b;
3644	+ };
3645	+ d.get = function(d) {
3646	+ return this[this.ords[d]];
3647	+ };
3648	+ d.has = function(d) {
3649	+ return null != this.ords[d];
3650	+ };
3651	+ d.del = function(d) {
3652	+ this.cut(this.ords[d], 1);
3653	+ };
3654	+ d.cut = function(d, c) {
3655	+ c = c \|\| 1;
3656	+ var b = [].splice.call(this, d, c);
3657	+ this.keys.splice(d, c);
3658	+ this.reIndex(this.keys);
3659	+ return b;
3660	+ };
3661	+ d.each = function(d) {
3662	+ for (var c = -1, b = this.keys, a = this.length; ++c < a; ) d(b[c], this[c], c);
3663	+ return this;
3664	+ };
3665	+ d.sort = function(d) {
3666	+ for (var c = -1, b = this.length, a, e = this.keys, f = this.ords, g = []; ++c < b; ) g[c] = [ this[c], e[c] ];
3667	+ g.sort(function(a, b) {
3668	+ return d(a[0], b[0]);
3669	+ });
3670	+ for (c = 0; c < b; c++) a = g[c], this[c] = a[0], a = a[1], e[c] = a, f[a] = c;
3671	+ return this;
3672	+ };
3673	+ d.join = function(d) {
3674	+ return [].join.call(this, d);
3675	+ };
3676	+ d = null;
3677	+ return f;
3678	+ }({}, v, w));
3679	+ n.register("$26", function(f, d, h) {
3680	+ function m(d, c) {
3681	+ var b = RegExp("^.{0," + (d - 1) + "}[" + c + "]"), a = RegExp("^[^" + c + "]+");
3682	+ return function(c, f) {
3683	+ for (var g = c.length, l; g > d; ) {
3684	+ l = b.exec(c) \|\| a.exec(c);
3685	+ if (null == l) break;
3686	+ l = l[0];
3687	+ f.push(l);
3688	+ l = l.length;
3689	+ g -= l;
3690	+ c = c.substr(l);
3691	+ }
3692	+ 0 !== g && f.push(c);
3693	+ return f;
3694	+ };
3695	+ }
3696	+ f.create = function(d) {
3697	+ function c(a) {
3698	+ return l[a] \|\| "\\" + a;
3699	+ }
3700	+ var b, a, e = /(?:\r\n\|[\r\n\v\f\u2028\u2029])/g, f = /[ \r\n]+/g, g = /[\t\v\f\x07\x08\\\"]/g, l = {
3701	+ "\t": "\\t",
3702	+ "\v": "\\v",
3703	+ "\f": "\\f",
3704	+ "": "\\a",
3705	+ "\b": "\\b"
3706	+ };
3707	+ if (null == d \|\| isNaN(d = Number(d))) d = 79;
3708	+ 0 < d && (b = m(d - 3, " "), a = m(d - 2, "-– \\.,:;\\?!\\)\\]\\}\\>"));
3709	+ return {
3710	+ pair: function(b, l) {
3711	+ if (!l) return b + ' ""';
3712	+ l = l.replace(g, c);
3713	+ var f = 0;
3714	+ l = l.replace(e, function() {
3715	+ f++;
3716	+ return "\\n\n";
3717	+ });
3718	+ if (!(f \|\| d && d < l.length + b.length + 3)) return b + ' "' + l + '"';
3719	+ var p = [ b + ' "' ], h = l.split("\n");
3720	+ if (a) for (var m = -1, n = h.length; ++m < n; ) a(h[m], p); else p = p.concat(h);
3721	+ return p.join('"\n"') + '"';
3722	+ },
3723	+ prefix: function(a, b) {
3724	+ var c = a.split(e);
3725	+ return b + c.join("\n" + b);
3726	+ },
3727	+ refs: function(a) {
3728	+ a = a.replace(f, " ", a);
3729	+ b && (a = b(a, []).join("\n#: "));
3730	+ return "#: " + a;
3731	+ }
3732	+ };
3733	+ };
3734	+ return f;
3735	+ }({}, v, w));
3736	+ n.register("$39", function(f, d, h) {
3737	+ function m() {
3738	+ this.length = 0;
3739	+ }
3740	+ f.init = function() {
3741	+ return new m();
3742	+ };
3743	+ d = m.prototype;
3744	+ d.push = function(d) {
3745	+ this[this.length++] = d;
3746	+ return this;
3747	+ };
3748	+ d.sort = function(d) {
3749	+ [].sort.call(this, d);
3750	+ return this;
3751	+ };
3752	+ d.each = function(d) {
3753	+ for (var c = -1, b = this.length; ++c < b; ) d(c, this[c]);
3754	+ return this;
3755	+ };
3756	+ return f;
3757	+ }({}, v, w));
3758	+ n.register("$27", function(f, d, h) {
3759	+ function m() {}
3760	+ f.extend = function(d) {
3761	+ return d.prototype = new m();
3762	+ };
3763	+ d = m.prototype = n.require("$37", "abstract.js").init([ "add", "load" ]);
3764	+ d.row = function(d) {
3765	+ return this.rows[d];
3766	+ };
3767	+ d.lock = function(d) {
3768	+ return this.locale(d \|\| {
3769	+ lang: "zxx",
3770	+ label: "Unknown",
3771	+ nplurals: 1,
3772	+ pluraleq: "n!=1"
3773	+ });
3774	+ };
3775	+ d.unlock = function() {
3776	+ var d = this.loc;
3777	+ this.loc = null;
3778	+ return d;
3779	+ };
3780	+ d.locale = function(d) {
3781	+ null == d ? d = this.loc : this.loc = d = n.require("$36", "locale.js").cast(d);
3782	+ return d;
3783	+ };
3784	+ d.each = function(d) {
3785	+ this.rows.each(d);
3786	+ return this;
3787	+ };
3788	+ d.indexOf = function(d) {
3789	+ "object" !== typeof d && (d = this.get(d));
3790	+ if (!d) return -1;
3791	+ null == d.idx && (d.idx = this.rows.indexOf(d.hash()));
3792	+ return d.idx;
3793	+ };
3794	+ d.get = function(d) {
3795	+ return this.rows && this.rows.get(d);
3796	+ };
3797	+ d.has = function(d) {
3798	+ return this.rows && this.rows.has(d);
3799	+ };
3800	+ d.del = function(d) {
3801	+ d = this.indexOf(d);
3802	+ if (-1 !== d) {
3803	+ var c = this.rows.cut(d, 1);
3804	+ if (c && c.length) return this.length = this.rows.length, this.rows.each(function(b, a, c) {
3805	+ a.idx = c;
3806	+ }), d;
3807	+ }
3808	+ };
3809	+ d.reIndex = function(d, c) {
3810	+ var b = this.indexOf(d), a = d.hash(), e = this.rows.indexOf(a);
3811	+ return e === b ? b : -1 !== e ? (c = (c \|\| 0) + 1, d.source("Error, duplicate " + String(c) + ": " + d.source()),
3812	+ this.reIndex(d, c)) : this.rows.key(b, a);
3813	+ };
3814	+ d.sort = function(d) {
3815	+ this.rows.sort(d);
3816	+ return this;
3817	+ };
3818	+ d["export"] = function() {
3819	+ for (var d = -1, c = this.rows, b = c.length, a = n.require("$39", "list.js").init(); ++d < b; ) a.push(c[d]);
3820	+ return a;
3821	+ };
3822	+ d = null;
3823	+ return f;
3824	+ }({}, v, w));
3825	+ n.register("$28", function(f, d, h) {
3826	+ function m(c, b, a) {
3827	+ if (null == a) return c[b] \|\| "";
3828	+ c[b] = a \|\| "";
3829	+ return c;
3830	+ }
3831	+ function k() {
3832	+ this._id = this.id = "";
3833	+ }
3834	+ f.extend = function(c) {
3835	+ return c.prototype = new k();
3836	+ };
3837	+ d = k.prototype;
3838	+ d.flag = function(c, b) {
3839	+ var a = this.flg \|\| (this.flg = []);
3840	+ if (null != b) a[b] = c; else for (var d = Math.max(a.length, this.src.length, this.msg.length); 0 !== d--; ) a[d] = c;
3841	+ return this;
3842	+ };
3843	+ d.flagged = function(c) {
3844	+ var b = this.flg \|\| [];
3845	+ if (null != c) return b[c] \|\| 0;
3846	+ for (c = b.length; 0 !== c--; ) if (b[c]) return !0;
3847	+ return !1;
3848	+ };
3849	+ d.flags = function() {
3850	+ for (var c, b = {}, a = [], d = this.flg \|\| [], f = d.length; 0 !== f--; ) c = d[f],
3851	+ b[c] \|\| (b[c] = !0, a.push(c));
3852	+ return a;
3853	+ };
3854	+ d.flaggedAs = function(c, b) {
3855	+ var a = this.flg \|\| [];
3856	+ if (null != b) return c === a[b] \|\| 0;
3857	+ for (var d = a.length; 0 !== d--; ) if (a[d] === c) return !0;
3858	+ return !1;
3859	+ };
3860	+ d.fuzzy = function(c, b) {
3861	+ var a = this.flaggedAs(4, c);
3862	+ null != b && this.flag(b ? 4 : 0, c);
3863	+ return a;
3864	+ };
3865	+ d.source = function(c, b) {
3866	+ if (null == c) return this.src[b \|\| 0] \|\| "";
3867	+ this.src[b \|\| 0] = c;
3868	+ return this;
3869	+ };
3870	+ d.plural = function(c, b) {
3871	+ if (null == c) return this.src[b \|\| 1] \|\| "";
3872	+ this.src[b \|\| 1] = c \|\| "";
3873	+ return this;
3874	+ };
3875	+ d.sourceForms = function() {
3876	+ return this.srcF;
3877	+ };
3878	+ d.targetForms = function() {
3879	+ return this.msgF;
3880	+ };
3881	+ d.each = function(c) {
3882	+ for (var b = -1, a = this.src, d = this.msg, f = Math.max(a.length, d.length); ++b < f; ) c(b, a[b], d[b]);
3883	+ return this;
3884	+ };
3885	+ d.count = function() {
3886	+ return Math.max(this.src.length, this.msg.length);
3887	+ };
3888	+ d.pluralized = function() {
3889	+ return 1 < this.src.length \|\| 1 < this.msg.length;
3890	+ };
3891	+ d.translate = function(c, b) {
3892	+ this.msg[b \|\| 0] = c \|\| "";
3893	+ return this;
3894	+ };
3895	+ d.untranslate = function(c) {
3896	+ if (null != c) this.msg[c] = ""; else {
3897	+ var b = this.msg, a = b.length;
3898	+ for (c = 0; c < a; c++) b[c] = "";
3899	+ }
3900	+ return this;
3901	+ };
3902	+ d.translation = function(c) {
3903	+ return this.msg[c \|\| 0] \|\| "";
3904	+ };
3905	+ d.errors = function(c) {
3906	+ return this.err && this.err[c \|\| 0] \|\| [];
3907	+ };
3908	+ d.translated = function(c) {
3909	+ if (null != c) return !!this.msg[c];
3910	+ var b = this.msg, a = b.length;
3911	+ for (c = 0; c < a; c++) if (!b[c]) return !1;
3912	+ return !0;
3913	+ };
3914	+ d.untranslated = function(c) {
3915	+ if (null != c) return !this.msg[c];
3916	+ var b = this.msg, a = b.length;
3917	+ for (c = 0; c < a; c++) if (b[c]) return !1;
3918	+ return !0;
3919	+ };
3920	+ d.comment = function(c) {
3921	+ return m(this, "cmt", c);
3922	+ };
3923	+ d.notes = function(c) {
3924	+ return m(this, "xcmt", c);
3925	+ };
3926	+ d.refs = function(c) {
3927	+ return m(this, "rf", c);
3928	+ };
3929	+ d.format = function(c) {
3930	+ return m(this, "fmt", c);
3931	+ };
3932	+ d.context = function(c) {
3933	+ return m(this, "ctx", c);
3934	+ };
3935	+ d.tags = function() {
3936	+ return this.tg;
3937	+ };
3938	+ d.toString = d.toText = function() {
3939	+ return this.src.concat(this.msg, this.id, this.ctx).join(" ");
3940	+ };
3941	+ d.weight = function() {
3942	+ var c = 0;
3943	+ this.translation() \|\| (c += 2);
3944	+ this.fuzzy() && (c += 1);
3945	+ return c;
3946	+ };
3947	+ d.equals = function(c) {
3948	+ return this === c \|\| this.hash() === c.hash();
3949	+ };
3950	+ d.hash = function() {
3951	+ return this.id;
3952	+ };
3953	+ d.normalize = function() {
3954	+ for (var c = this.msg.length; 0 !== c--; ) this.msg[c] = this.src[c] \|\| "";
3955	+ };
3956	+ d.disabled = function(c) {
3957	+ return !!(this.lck \|\| [])[c \|\| 0];
3958	+ };
3959	+ d.disable = function(c) {
3960	+ (this.lck \|\| (this.lck = []))[c \|\| 0] = !0;
3961	+ return this;
3962	+ };
3963	+ d.saved = function(c) {
3964	+ var b = this.drt;
3965	+ if (null == b) return !0;
3966	+ if (null != c) return !b[c];
3967	+ for (c = b.length; 0 !== c--; ) if (b[c]) return !1;
3968	+ return !0;
3969	+ };
3970	+ d.unsave = function(c) {
3971	+ (this.drt \|\| (this.drt = []))[c \|\| 0] = !0;
3972	+ return this;
3973	+ };
3974	+ d.save = function(c) {
3975	+ null == c ? this.drt = null : (this.drt \|\| (this.drt = []))[c] = !1;
3976	+ return this;
3977	+ };
3978	+ d.is = function(c) {
3979	+ return c && (c === this \|\| c.idx === this.idx);
3980	+ };
3981	+ d.isHTML = function(c) {
3982	+ if (null == c) return this.htm \|\| !1;
3983	+ this.htm = c;
3984	+ };
3985	+ d = null;
3986	+ return f;
3987	+ }({}, v, w));
3988	+ n.register("$15", function(f, d, h) {
3989	+ function m(a) {
3990	+ return {
3991	+ "Project-Id-Version": "PACKAGE VERSION",
3992	+ "Report-Msgid-Bugs-To": "",
3993	+ "POT-Creation-Date": a \|\| "",
3994	+ "PO-Revision-Date": a \|\| "",
3995	+ "Last-Translator": "",
3996	+ "Language-Team": "",
3997	+ Language: "",
3998	+ "Plural-Forms": "",
3999	+ "MIME-Version": "1.0",
4000	+ "Content-Type": "text/plain; charset=UTF-8",
4001	+ "Content-Transfer-Encoding": "8bit"
4002	+ };
4003	+ }
4004	+ function k(a, b) {
4005	+ var c = a \|\| "";
4006	+ b && (c += "\0" + b);
4007	+ return c;
4008	+ }
4009	+ function c(a) {
4010	+ var b = d.console;
4011	+ b && b.error && b.error(a.message \|\| String(a));
4012	+ }
4013	+ function b(a) {
4014	+ return n.require("$26", "format.js").create(a);
4015	+ }
4016	+ function a(a) {
4017	+ this.locale(a);
4018	+ this.clear();
4019	+ this.head = m(this.now());
4020	+ }
4021	+ function e(a, b) {
4022	+ this.src = [ a \|\| "" ];
4023	+ this.msg = [ b \|\| "" ];
4024	+ }
4025	+ f.create = function(b) {
4026	+ return new a(b);
4027	+ };
4028	+ h = n.require("$27", "messages.js").extend(a);
4029	+ h.clear = function() {
4030	+ this.rows = n.require("$25", "collection.js").init();
4031	+ this.length = 0;
4032	+ return this;
4033	+ };
4034	+ h.now = function() {
4035	+ function a(b, c) {
4036	+ for (var d = String(b); d.length < c; ) d = "0" + d;
4037	+ return d;
4038	+ }
4039	+ var b = new Date(), c = b.getUTCFullYear(), d = b.getUTCMonth() + 1, e = b.getUTCDate(), f = b.getUTCHours(), b = b.getUTCMinutes();
4040	+ return a(c, 4) + "-" + a(d, 2) + "-" + a(e, 2) + " " + a(f, 2) + ":" + a(b, 2) + "+0000";
4041	+ };
4042	+ h.header = function(a, b) {
4043	+ var c = this.head \|\| (this.head = {});
4044	+ if (null == b) return this.headers()[a] \|\| "";
4045	+ c[a] = b \|\| "";
4046	+ return this;
4047	+ };
4048	+ h.headers = function(a) {
4049	+ var b, c = this.now(), d = this.head \|\| (this.head = m(c));
4050	+ if (null != a) {
4051	+ for (b in a) d[b] = a[b];
4052	+ return this;
4053	+ }
4054	+ var e = this.locale();
4055	+ a = {};
4056	+ for (b in d) a[b] = String(d[b]);
4057	+ e ? (a.Language = String(e) \|\| "zxx", a["Language-Team"] = e.label \|\| a.Language,
4058	+ a["Plural-Forms"] = "nplurals=" + (e.nplurals \|\| "2") + "; plural=" + (e.pluraleq \|\| "n!=1") + ";",
4059	+ b = "PO-Revision-Date") : (a.Language = "", a["Plural-Forms"] = "nplurals=INTEGER; plural=EXPRESSION;",
4060	+ a["PO-Revision-Date"] = "YEAR-MO-DA HO:MI+ZONE", b = "POT-Creation-Date");
4061	+ a[b] \|\| (a[b] = c);
4062	+ a["X-Generator"] = "Loco https://localise.biz/";
4063	+ return a;
4064	+ };
4065	+ h.get = function(a, b) {
4066	+ var c = k(a, b);
4067	+ return this.rows.get(c);
4068	+ };
4069	+ h.add = function(a, b) {
4070	+ a instanceof e \|\| (a = new e(a));
4071	+ b && a.context(b);
4072	+ var d = a.hash();
4073	+ this.rows.get(d) ? c("Duplicate message at index " + this.indexOf(a)) : (a.idx = this.rows.add(d, a),
4074	+ this.length = this.rows.length);
4075	+ return a;
4076	+ };
4077	+ h.load = function(a) {
4078	+ for (var b = -1, d, f, k, h, m, n, r = (k = this.locale()) && k.nplurals \|\| 2, z = []; ++b < a.length; ) d = a[b],
4079	+ null == d.parent ? (f = d.source \|\| d.id, k = d.target \|\| "", h = d.context, f \|\| h ? (m = new e(f, k),
4080	+ m._id = d._id, h && m.context(h), d.flag && m.flag(d.flag, 0), d.comment && m.comment(d.comment),
4081	+ d.notes && m.notes(d.notes), d.refs && m.refs(d.refs), m.format(d.format), d.message = m,
4082	+ this.add(m), d.prev && d.prev[0] && (m.prev(d.prev[0].source, d.prev[0].context),
4083	+ d.prev[1] && m._src.push(d.prev[1].source \|\| ""))) : 0 === b && "object" === typeof k && (this.head = k,
4084	+ this.headcmt = d.comment)) : z.push(d);
4085	+ for (b = -1; ++b < z.length; ) try {
4086	+ d = z[b];
4087	+ f = d.source \|\| d.id;
4088	+ m = a[d.parent] && a[d.parent].message;
4089	+ if (!m) throw Error("parent missing for plural " + f);
4090	+ n = d.plural;
4091	+ 1 === n && m.plural(f);
4092	+ n >= r \|\| (d.flag && m.flag(d.flag, n), m.translate(d.target \|\| "", n), d.format && !m.format() && m.format(d.format));
4093	+ } catch (v) {
4094	+ c(v);
4095	+ }
4096	+ return this;
4097	+ };
4098	+ h.wrap = function(a) {
4099	+ this.fmtr = b(a);
4100	+ return this;
4101	+ };
4102	+ h.toString = function() {
4103	+ var a, c = this.locale(), d = [], f = [], k = this.headers(), h = !c, m = c && c.nplurals \|\| 2, n = this.fmtr \|\| b();
4104	+ k[c ? "PO-Revision-Date" : "POT-Creation-Date"] = this.now();
4105	+ for (a in k) f.push(a + ": " + k[a]);
4106	+ f = new e("", f.join("\n"));
4107	+ f.comment(this.headcmt \|\| "");
4108	+ h && f.fuzzy(0, !0);
4109	+ d.push(f.toString());
4110	+ d.push("");
4111	+ this.rows.each(function(a, b) {
4112	+ a && (d.push(b.cat(n, h, m)), d.push(""));
4113	+ });
4114	+ return d.join("\n");
4115	+ };
4116	+ h = n.require("$28", "message.js").extend(e);
4117	+ h.prev = function(a, b) {
4118	+ this._src = [ a \|\| "" ];
4119	+ this._ctx = b;
4120	+ };
4121	+ h.hash = function() {
4122	+ return k(this.source(), this.context());
4123	+ };
4124	+ h.toString = function() {
4125	+ return this.cat(b());
4126	+ };
4127	+ h.cat = function(a, b, c) {
4128	+ var d, e = [], f;
4129	+ (f = this.cmt) && e.push(a.prefix(f, "# "));
4130	+ (f = this.xcmt) && e.push(a.prefix(f, "#. "));
4131	+ d = this.rf;
4132	+ if (f = this._id) d += (d ? " " : "") + "loco:" + f;
4133	+ d && /\S/.test(d) && e.push(a.refs(d));
4134	+ !b && this.fuzzy() && e.push("#, fuzzy");
4135	+ (f = this.fmt) && e.push("#, " + f + "-format");
4136	+ (f = this._ctx) && e.push(a.prefix(a.pair("msgctxt", f), "#\| "));
4137	+ if (f = this._src) f[0] && e.push(a.prefix(a.pair("msgid", f[0]), "#\| ")), f[1] && e.push(a.prefix(a.pair("msgid_plural", f[1]), "#\| "));
4138	+ (f = this.ctx) && e.push(a.pair("msgctxt", f));
4139	+ e.push(a.pair("msgid", this.src[0]));
4140	+ if (null == this.src[1]) e.push(a.pair("msgstr", b ? "" : this.msg[0])); else for (d = -1,
4141	+ e.push(a.pair("msgid_plural", this.src[1])), f = this.msg \|\| [ "", "" ], c = c \|\| f.length; ++d < c; ) e.push(a.pair("msgstr[" + d + "]", b ? "" : f[d] \|\| ""));
4142	+ return e.join("\n");
4143	+ };
4144	+ h.compare = function(a, b) {
4145	+ var c = this.weight(), d = a.weight();
4146	+ if (c > d) return 1;
4147	+ if (c < d) return -1;
4148	+ if (b) {
4149	+ c = this.hash().toLowerCase();
4150	+ d = a.hash().toLowerCase();
4151	+ if (c < d) return 1;
4152	+ if (c > d) return -1;
4153	+ }
4154	+ return 0;
4155	+ };
4156	+ h.copy = function() {
4157	+ var a = new e(), b, c;
4158	+ for (b in this) this.hasOwnProperty(b) && ((c = this[b]) && c.concat && (c = c.concat()),
4159	+ a[b] = c);
4160	+ return a;
4161	+ };
4162	+ h = h = null;
4163	+ return f;
4164	+ }({}, v, w));
4165	+ n.register("$17", function(f, d, n) {
4166	+ f.init = function(d, f) {
4167	+ function c() {
4168	+ return p \|\| (p = h('<div id="loco-po-ref"></div>').dialog({
4169	+ dialogClass: "loco-modal loco-modal-wide",
4170	+ modal: !0,
4171	+ autoOpen: !1,
4172	+ closeOnEscape: !0,
4173	+ resizable: !1,
4174	+ height: 500
4175	+ }));
4176	+ }
4177	+ function b(a, b, d) {
4178	+ a = h("<p></p>").text(d);
4179	+ c().dialog("close").html("").dialog("option", "title", "Error").append(a).dialog("open");
4180	+ }
4181	+ function a(a) {
4182	+ var b = a && a.code;
4183	+ if (b) {
4184	+ for (var d = -1, e = b.length, f = h("<ol></ol>").attr("class", a.type); ++d < e; ) h("<li></li>").html(b[d]).appendTo(f);
4185	+ f.find("li").eq(a.line - 1).attr("class", "highlighted");
4186	+ c().dialog("close").html("").dialog("option", "title", a.path + ":" + a.line).append(f).dialog("open");
4187	+ }
4188	+ }
4189	+ function e(a) {
4190	+ a = a.target;
4191	+ var b = h(a).find("li.highlighted")[0], b = Math.max(0, (b && b.offsetTop \|\| 0) - Math.floor(a.clientHeight / 2));
4192	+ a.scrollTop = b;
4193	+ }
4194	+ var p;
4195	+ return {
4196	+ load: function(g) {
4197	+ c().html('<div class="loco-loading"></div>').dialog("option", "title", "Loading..").off("dialogopen").dialog("open").on("dialogopen", e);
4198	+ g = h.extend({
4199	+ ref: g,
4200	+ path: f.popath
4201	+ }, f.project \|\| {});
4202	+ d.ajax.post("fsReference", g, a, b);
4203	+ }
4204	+ };
4205	+ };
4206	+ return f;
4207	+ }({}, v, w));
4208	+ n.register("$30", function(f, d, h) {
4209	+ function m(d) {
4210	+ this.api = d;
4211	+ this.chars = 0;
4212	+ }
4213	+ f.create = function(d) {
4214	+ return new m(d);
4215	+ };
4216	+ d = m.prototype;
4217	+ d.init = function(d, c) {
4218	+ function b(a) {
4219	+ var b = {
4220	+ length: 0,
4221	+ html: a.html,
4222	+ sources: []
4223	+ };
4224	+ n.push(b);
4225	+ return q[a.html ? 1 : 0] = b;
4226	+ }
4227	+ function a(a, d) {
4228	+ var k = a.source(null, d);
4229	+ if (k && (a.untranslated(d) \|\| c)) {
4230	+ var n = m[k];
4231	+ if (n) n.push(a); else {
4232	+ var n = k.length, s = e.isHtml(k), s = q[s ? 1 : 0], u = s.sources;
4233	+ if (s.length + n > h \|\| u.length === l) s = b(s), u = s.sources;
4234	+ u.push(k);
4235	+ m[k] = [ a ];
4236	+ s.length += n;
4237	+ f += n;
4238	+ g += 1;
4239	+ }
4240	+ }
4241	+ }
4242	+ var e = this.api, f = 0, g = 0, l = 50, h = 5e3, m = {}, n = [], q = [];
4243	+ b({
4244	+ html: !1
4245	+ });
4246	+ b({
4247	+ html: !0
4248	+ });
4249	+ d.each(function(b, c) {
4250	+ a(c, 0);
4251	+ a(c, 1);
4252	+ });
4253	+ q = null;
4254	+ this.map = m;
4255	+ this.chars = f;
4256	+ this.length = g;
4257	+ this.batches = n;
4258	+ this.locale = d.locale();
4259	+ };
4260	+ d.abort = function() {
4261	+ this.state = "abort";
4262	+ return this;
4263	+ };
4264	+ d.dispatch = function() {
4265	+ function d(a, b) {
4266	+ function e(c, d, g) {
4267	+ b !== g && (a === d \|\| 1 < c && f.source(null, 1) === a) && (f.translate(b, c),
4268	+ p++, z++);
4269	+ return p;
4270	+ }
4271	+ if (!c()) return !1;
4272	+ if (!b) return !0;
4273	+ var f, l = m[a] \|\| [], k = l.length, h = -1, p;
4274	+ for (v++; ++h < k; ) if (f = l[h]) p = 0, f.each(e), p && g("each", [ f ]);
4275	+ return !0;
4276	+ }
4277	+ function c() {
4278	+ return "abort" === l.state ? (h && (h.abort(), f()), !1) : !0;
4279	+ }
4280	+ function b() {
4281	+ var b = n.shift(), c;
4282	+ b ? (c = b.sources) && c.length ? h.batch(c, q, b.html, d).fail(a).always(e) : e() : f();
4283	+ }
4284	+ function a() {
4285	+ l.abort();
4286	+ f();
4287	+ }
4288	+ function e() {
4289	+ r++;
4290	+ g("prog", [ r, C ]);
4291	+ c() && b();
4292	+ }
4293	+ function f() {
4294	+ h = n = null;
4295	+ g("done");
4296	+ }
4297	+ function g(a, b) {
4298	+ for (var c = u[a] \|\| [], d = c.length; 0 <= --d; ) c[d].apply(null, b);
4299	+ }
4300	+ var l = this, h = l.api, m = l.map, n = l.batches \|\| [], q = l.locale, v = 0, r = 0, z = 0, w = l.length, C = n.length, u = {
4301	+ done: [],
4302	+ each: [],
4303	+ prog: []
4304	+ };
4305	+ l.state = "";
4306	+ b();
4307	+ return {
4308	+ done: function(a) {
4309	+ u.done.push(a);
4310	+ return this;
4311	+ },
4312	+ each: function(a) {
4313	+ u.each.push(a);
4314	+ return this;
4315	+ },
4316	+ prog: function(a) {
4317	+ u.prog.push(a);
4318	+ return this;
4319	+ },
4320	+ stat: function() {
4321	+ return {
4322	+ todo: function() {
4323	+ return Math.max(w - v, 0);
4324	+ },
4325	+ did: function() {
4326	+ return v;
4327	+ }
4328	+ };
4329	+ }
4330	+ };
4331	+ };
4332	+ return f;
4333	+ }({}, v, w));
4334	+ n.register("$40", {
4335	+ nn: [ "no" ]
4336	+ });
4337	+ n.register("$31", function(f, d, h) {
4338	+ function m() {}
4339	+ function k(c) {
4340	+ c.parseError = function(b) {
4341	+ return b && b.code && 200 !== b.code && b.message ? "Error " + b.code + ": " + b.message : "";
4342	+ };
4343	+ c.batch = function(b, a, d, f) {
4344	+ function g(c) {
4345	+ for (var d = b.length, e = -1; ++e < d && !1 !== f(b[e], c[e] \|\| "", a); ) ;
4346	+ }
4347	+ d = d ? "html" : "plain";
4348	+ var l = this.toLang(a);
4349	+ return c._call({
4350	+ url: "https://translate.yandex.net/api/v1.5/tr.json/translate?format=" + d + "&lang=en-" + l,
4351	+ method: "POST",
4352	+ traditional: !0,
4353	+ data: {
4354	+ key: c.key(),
4355	+ text: b
4356	+ }
4357	+ }).done(function(a, b, d) {
4358	+ a && 200 === a.code ? g(a.text \|\| []) : (c.stderr(c.parseError(a) \|\| c.httpError(d)),
4359	+ g([]));
4360	+ }).fail(function() {
4361	+ g([]);
4362	+ });
4363	+ };
4364	+ }
4365	+ f.create = function(c) {
4366	+ var b = m.prototype = new c();
4367	+ b.toString = function() {
4368	+ return "Yandex.Translate";
4369	+ };
4370	+ b.getId = function() {
4371	+ return "yandex";
4372	+ };
4373	+ b.getUrl = function() {
4374	+ return "https://translate.yandex.com/";
4375	+ };
4376	+ b.init = function(a) {
4377	+ c.prototype.init.call(this, a);
4378	+ /^trnsl\./.test(this.key()) && k(this);
4379	+ };
4380	+ b.toLang = function(a) {
4381	+ return this.mapLang(a, n.require("$40", "yandex.json"));
4382	+ };
4383	+ return new m();
4384	+ };
4385	+ return f;
4386	+ }({}, v, w));
4387	+ n.register("$41", {
4388	+ zh: [ "zh", "zh-CN", "zh-TW" ],
4389	+ he: [ "iw" ],
4390	+ jv: [ "jw" ]
4391	+ });
4392	+ n.register("$32", function(f, d, h) {
4393	+ function m() {}
4394	+ f.create = function(d) {
4395	+ d = m.prototype = new d();
4396	+ d.toString = function() {
4397	+ return "Google Translate";
4398	+ };
4399	+ d.getId = function() {
4400	+ return "google";
4401	+ };
4402	+ d.getUrl = function() {
4403	+ return "https://translate.google.com/";
4404	+ };
4405	+ d.parseError = function(c) {
4406	+ if (c.error) {
4407	+ for (var b = [], a = c.error.errors \|\| [], d = a.length, f = -1; ++f < d; ) b.push(a[f].message \|\| "");
4408	+ return "Error " + c.error.code + ": " + b.join(";");
4409	+ }
4410	+ return "";
4411	+ };
4412	+ d.batch = function(c, b, a, d) {
4413	+ function f(a) {
4414	+ for (var g = c.length, l = -1, k; ++l < g && (k = a[l] \|\| {}, !1 !== d(c[l], k.translatedText \|\| "", b)); ) ;
4415	+ }
4416	+ var g = this;
4417	+ a = a ? "html" : "text";
4418	+ var l = g.mapLang(b, n.require("$41", "google.json"));
4419	+ return g._call({
4420	+ url: "https://translation.googleapis.com/language/translate/v2?source=en&target=" + l + "&format=" + a,
4421	+ method: "POST",
4422	+ traditional: !0,
4423	+ data: {
4424	+ key: g.key(),
4425	+ q: c
4426	+ }
4427	+ }).done(function(a, b, c) {
4428	+ a.data ? f(a.data.translations \|\| []) : (g.stderr(g.parseError(a) \|\| g.httpError(c)),
4429	+ f([]));
4430	+ }).fail(function() {
4431	+ f([]);
4432	+ });
4433	+ };
4434	+ return new m();
4435	+ };
4436	+ return f;
4437	+ }({}, v, w));
4438	+ n.register("$42", {
4439	+ nn: [ "no" ],
4440	+ pt: [ "pt", "pt-pt" ],
4441	+ sr: [ "sr-Cyrl", "sr-Latn" ],
4442	+ sr_RS: [ "sr-Cyrl" ],
4443	+ tlh: [ "tlh-Latn", "tlh-Piqd" ],
4444	+ zh: [ "zh-Hans", "zh-Hant" ],
4445	+ zh_CN: [ "zh-Hans" ],
4446	+ zh_HK: [ "zh-Hans" ],
4447	+ zh_SG: [ "zh-Hans" ],
4448	+ zh_TW: [ "zh-Hant" ]
4449	+ });
4450	+ n.register("$33", function(f, d, h) {
4451	+ function m() {}
4452	+ f.create = function(d) {
4453	+ d = m.prototype = new d();
4454	+ d.toString = function() {
4455	+ return "Microsoft Translator text API";
4456	+ };
4457	+ d.getId = function() {
4458	+ return "microsoft";
4459	+ };
4460	+ d.getUrl = function() {
4461	+ return "https://aka.ms/MicrosoftTranslatorAttribution";
4462	+ };
4463	+ d.parseError = function(c) {
4464	+ return c && c.error ? c.error.message : "";
4465	+ };
4466	+ d.batch = function(c, b, a, d) {
4467	+ function f(a) {
4468	+ for (var g = -1, l; ++g < h && (l = a[g] \|\| {}, l = l.translations \|\| [], l = l[0] \|\| {},
4469	+ !1 !== d(c[g], l.text \|\| "", b)); ) ;
4470	+ }
4471	+ var g = this, l = [], h = c.length, k = -1;
4472	+ a = a ? "html" : "plain";
4473	+ for (var m = g.mapLang(b, n.require("$42", "ms.json")); ++k < h; ) l.push({
4474	+ text: c[k]
4475	+ });
4476	+ return g._call({
4477	+ url: "https://api.cognitive.microsofttranslator.com/translate?api-version=3.0&from=en&to=" + m + "&textType=" + a,
4478	+ method: "POST",
4479	+ data: JSON.stringify(l),
4480	+ headers: {
4481	+ "Content-Type": "application/json; charset=UTF-8",
4482	+ "Ocp-Apim-Subscription-Key": this.key(),
4483	+ "Ocp-Apim-Subscription-Region": g.param("region") \|\| "global"
4484	+ }
4485	+ }).done(function(a, b, c) {
4486	+ a && a.length ? f(a) : (g.stderr(g.parseError(a) \|\| g.httpError(c)), f([]));
4487	+ }).fail(function() {
4488	+ f([]);
4489	+ });
4490	+ };
4491	+ return new m();
4492	+ };
4493	+ return f;
4494	+ }({}, v, w));
4495	+ n.register("$43", {
4496	+ pt: [ "pt-PT", "pt-BR" ]
4497	+ });
4498	+ n.register("$34", function(f, d, h) {
4499	+ function m() {}
4500	+ f.create = function(d) {
4501	+ d = m.prototype = new d();
4502	+ d.toString = function() {
4503	+ return "DeepL Translator";
4504	+ };
4505	+ d.getId = function() {
4506	+ return "deepl";
4507	+ };
4508	+ d.getUrl = function() {
4509	+ return "https://www.deepl.com/translator";
4510	+ };
4511	+ d.parseError = function(c) {
4512	+ return c.message;
4513	+ };
4514	+ d.batch = function(c, b, a, d) {
4515	+ function f(a) {
4516	+ for (var g = c.length, l = -1, h; ++l < g && (h = a[l] \|\| {}, !1 !== d(c[l], h.text \|\| "", b)); ) ;
4517	+ }
4518	+ var g = this;
4519	+ a = g.param("url") \|\| "https://api.deepl.com";
4520	+ var l = g.mapLang(b, n.require("$43", "deepl.json")), h = b.tone, k = "default";
4521	+ null == h && (h = String(b.variant \|\| "").toLowerCase());
4522	+ "formal" === h ? k = "more" : "informal" === h && (k = "less");
4523	+ return g._call({
4524	+ url: g.fixURL(a + "/v2/translate"),
4525	+ method: "POST",
4526	+ traditional: !0,
4527	+ data: {
4528	+ source_lang: "EN",
4529	+ target_lang: l.toUpperCase(),
4530	+ formality: k,
4531	+ preserve_formatting: "1",
4532	+ auth_key: g.key(),
4533	+ text: c
4534	+ }
4535	+ }).done(function(a, b, c) {
4536	+ a.translations ? f(a.translations) : (g.stderr(g.parseError(a) \|\| g.httpError(c)),
4537	+ f([]));
4538	+ }).fail(function() {
4539	+ f([]);
4540	+ });
4541	+ };
4542	+ d.fixURL = function(c) {
4543	+ c = c.split("://", 2);
4544	+ 1 === c.length && c.unshift("https");
4545	+ return c[0] + "://" + c[1].replace(/\/{2,}/g, "/");
4546	+ };
4547	+ return new m();
4548	+ };
4549	+ return f;
4550	+ }({}, v, w));
4551	+ n.register("$18", function(f, d, v) {
4552	+ function m() {
4553	+ this.inf = {};
4554	+ }
4555	+ function k() {
4556	+ var a = v.createElement("p"), b = /&(#\d+\|#x[0-9a-f]\|[a-z]+);/i, c = /<[a-z]+\s/i, d, f;
4557	+ return {
4558	+ sniff: function(h) {
4559	+ if (h === d) return f;
4560	+ d = h;
4561	+ if (b.test(h) \|\| c.test(h)) if (a.innerHTML = h, a.textContent !== h) return f = !0;
4562	+ return f = !1;
4563	+ }
4564	+ };
4565	+ }
4566	+ var c = m.prototype;
4567	+ c.init = function(a) {
4568	+ this.inf = a \|\| {};
4569	+ };
4570	+ c.param = function(a) {
4571	+ return this.inf[a] \|\| "";
4572	+ };
4573	+ c.key = function() {
4574	+ return this.param("key");
4575	+ };
4576	+ c.getId = function() {
4577	+ return this.param("id") \|\| "none";
4578	+ };
4579	+ c.getUrl = function() {
4580	+ return this.param("url") \|\| "#";
4581	+ };
4582	+ c.toString = function() {
4583	+ return this.param("name") \|\| this.getId();
4584	+ };
4585	+ c.stderr = function(a) {
4586	+ var b = (d.loco \|\| {}).notices \|\| d.console;
4587	+ b && b.error && b.error(String(this) + ": " + String(a));
4588	+ };
4589	+ c.httpError = function(a) {
4590	+ return (a = a && a.status) && 200 !== a ? "Responded status " + a : "Unknown error";
4591	+ };
4592	+ c.parseError = function() {
4593	+ return "";
4594	+ };
4595	+ c.mapLang = function(a, b) {
4596	+ var c = String(a).replace("-", "_"), d = a.lang, f = b[c] \|\| b[d] \|\| [], h = f.length;
4597	+ if (0 === h) return d;
4598	+ if (1 < h) for (var c = c.toLowerCase(), d = -1, k; ++d < h; ) if (k = f[d], k.toLowerCase().replace("-", "_") === c) return k;
4599	+ return f[0];
4600	+ };
4601	+ c.toLang = function(a) {
4602	+ return String(a);
4603	+ };
4604	+ c.translate = function(a, b, c) {
4605	+ return this.batch([ a ], b, this.isHtml(a), c);
4606	+ };
4607	+ c._call = function(a) {
4608	+ var b = this;
4609	+ b.state = null;
4610	+ a.cache = !0;
4611	+ a.dataType = "json";
4612	+ a.error = function(a, c, d) {
4613	+ try {
4614	+ var f = a.responseText, h = f && n.require("$5", "json.js").parse(f);
4615	+ d = h && b.parseError(h) \|\| d;
4616	+ } catch (k) {}
4617	+ b.stderr(d \|\| b.httpError(a));
4618	+ };
4619	+ return b.abortable(h.ajax(a));
4620	+ };
4621	+ c.abortable = function(a) {
4622	+ var b = this;
4623	+ a.always(function() {
4624	+ b.$r === a && (b.$r = null);
4625	+ });
4626	+ return b.$r = a;
4627	+ };
4628	+ c.abort = function() {
4629	+ var a = this.$r;
4630	+ a && a.abort();
4631	+ };
4632	+ c.isHtml = function(a) {
4633	+ return (b \|\| (b = k())).sniff(a);
4634	+ };
4635	+ c.createJob = function() {
4636	+ return n.require("$30", "job.js").create(this);
4637	+ };
4638	+ c.batch = function(a, b, c, f) {
4639	+ function l(c) {
4640	+ for (var d = a.length, h = -1; ++h < d && !1 !== f(a[h], c[h], b); ) ;
4641	+ }
4642	+ var k = d.loco.ajax;
4643	+ c = {
4644	+ hook: this.getId(),
4645	+ type: c ? "html" : "text",
4646	+ locale: this.toLang(b),
4647	+ sources: a
4648	+ };
4649	+ var m = h.Deferred();
4650	+ this.abortable(k.post("apis", c, function(a) {
4651	+ l(a && a.targets \|\| []);
4652	+ m.resolve();
4653	+ }, function() {
4654	+ l([]);
4655	+ m.reject();
4656	+ }));
4657	+ return m.promise();
4658	+ };
4659	+ f.create = function(a) {
4660	+ var b;
4661	+ b = a.id;
4662	+ b = "yandex" === b ? n.require("$31", "yandex.js").create(m) : "google" === b ? n.require("$32", "google.js").create(m) : "microsoft" === b ? n.require("$33", "ms.js").create(m) : "deepl" === b ? n.require("$34", "deepl.js").create(m) : new m();
4663	+ b.init(a);
4664	+ return b;
4665	+ };
4666	+ f.suggest = function(a, b, c, d) {
4667	+ var f, h, k = a.length;
4668	+ for (f = 0; f < k; f++) h = a[f], h.translate(b, c, d);
4669	+ };
4670	+ var b;
4671	+ return f;
4672	+ }({}, v, w));
4673	+ n.register("$19", function(f, d, n) {
4674	+ f.init = function(f) {
4675	+ function k() {
4676	+ H \|\| (I.on("click", l), H = h('<div id="loco-fs-creds"></div>').dialog({
4677	+ dialogClass: "request-filesystem-credentials-dialog loco-modal",
4678	+ minWidth: 580,
4679	+ modal: !0,
4680	+ autoOpen: !1,
4681	+ closeOnEscape: !0
4682	+ }).on("change", 'input[name="connection_type"]', function() {
4683	+ this.checked && h("#ssh-keys").toggleClass("hidden", "ssh" !== h(this).val());
4684	+ }));
4685	+ return H;
4686	+ }
4687	+ function c() {
4688	+ R && (b(h(r)), R = !1);
4689	+ if (C && J) {
4690	+ var a = J, c = h(Q);
4691	+ c.find("span.loco-msg").text(a);
4692	+ K \|\| (c.removeClass("jshide").hide().fadeIn(500), K = !0);
4693	+ } else K && (b(h(Q)), K = !1);
4694	+ }
4695	+ function b(a) {
4696	+ a.slideUp(250).fadeOut(250, function() {
4697	+ h(this).addClass("jshide");
4698	+ });
4699	+ }
4700	+ function a() {
4701	+ if (C) return H && H.dialog("close"), c(), h(f).find('button[type="submit"]').attr("disabled", !1),
4702	+ h(d).triggerHandler("resize"), w && w(!0), !0;
4703	+ x && H ? (R \|\| (h(r).removeClass("jshide").hide().fadeIn(500), R = !0), K && (b(h(Q)),
4704	+ K = !1)) : c();
4705	+ h(f).find('input[type="submit"]').attr("disabled", !0);
4706	+ w && w(!1);
4707	+ return !1;
4708	+ }
4709	+ function e(a) {
4710	+ var b, c, d = q \|\| {};
4711	+ for (b in d) d.hasOwnProperty(b) && (c = d[b], a[b] ? a[b].value = c : h('<input type="hidden" />').attr("name", b).appendTo(a).val(c));
4712	+ }
4713	+ function p(a) {
4714	+ a.preventDefault();
4715	+ a = h(a.target).serializeArray();
4716	+ s(a);
4717	+ B = !0;
4718	+ return !1;
4719	+ }
4720	+ function g(a) {
4721	+ a.preventDefault();
4722	+ H.dialog("close");
4723	+ return !1;
4724	+ }
4725	+ function l(a) {
4726	+ a.preventDefault();
4727	+ H.dialog("open").find('input[name="connection_type"]').change();
4728	+ return !1;
4729	+ }
4730	+ function y(b) {
4731	+ C = b.authed;
4732	+ z = b.method;
4733	+ h(r).find("span.loco-msg").text(b.message \|\| "Something went wrong.");
4734	+ J = b.warning \|\| "";
4735	+ b.notice && u.notices.info(b.notice);
4736	+ if (C) "direct" !== z && (q = b.creds, e(f), B && b.success && u.notices.success(b.success)),
4737	+ a(); else if (b.reason) u.notices.info(b.reason); else if (b = b.prompt) {
4738	+ var c = k();
4739	+ c.html(b).find("form").on("submit", p);
4740	+ c.dialog("option", "title", c.find("h2").remove().text());
4741	+ c.find("button.cancel-button").show().on("click", g);
4742	+ c.find('input[type="submit"]').addClass("button-primary");
4743	+ a();
4744	+ h(d).triggerHandler("resize");
4745	+ } else u.notices.error("Server didn't return credentials, nor a prompt for credentials");
4746	+ }
4747	+ function v() {
4748	+ a();
4749	+ }
4750	+ function s(a) {
4751	+ B = !1;
4752	+ u.ajax.setNonce("fsConnect", N).post("fsConnect", a, y, v);
4753	+ return a;
4754	+ }
4755	+ var q, w, r = f, z = null, B = !1, C = !1, u = d.loco, x = f.path.value, F = f.auth.value, N = f["loco-nonce"].value, I = h(r).find("button.button-primary"), Q = n.getElementById(r.id + "-warn"), R = !1, K = !1, J = "", H;
4756	+ u.notices.convert(Q).stick();
4757	+ f.connection_type ? (q = {}, q.connection_type = f.connection_type.value, C = !0) : x && F && s({
4758	+ path: x,
4759	+ auth: F
4760	+ });
4761	+ a();
4762	+ return {
4763	+ applyCreds: function(a) {
4764	+ if (a.nodeType) e(a); else {
4765	+ var b, c = q \|\| {};
4766	+ for (b in c) c.hasOwnProperty(b) && (a[b] = c[b]);
4767	+ }
4768	+ return this;
4769	+ },
4770	+ setForm: function(b) {
4771	+ f = b;
4772	+ a();
4773	+ e(b);
4774	+ return this;
4775	+ },
4776	+ connect: function() {
4777	+ x = f.path.value;
4778	+ F = f.auth.value;
4779	+ s(h(f).serializeArray());
4780	+ return this;
4781	+ },
4782	+ listen: function(a) {
4783	+ w = a;
4784	+ C && a(!0);
4785	+ return this;
4786	+ },
4787	+ authed: function() {
4788	+ return C;
4789	+ }
4790	+ };
4791	+ };
4792	+ return f;
4793	+ }({}, v, w));
4794	+ n.register("$20", function(f, d, v) {
4795	+ function m(d, f, g, h) {
4796	+ f = "n" === g ? c(f) : b(f);
4797	+ h && (f = a(f));
4798	+ return k([].sort, [ f ])(d);
4799	+ }
4800	+ function k(a, b) {
4801	+ return function(c) {
4802	+ a.apply(c, b);
4803	+ return c;
4804	+ };
4805	+ }
4806	+ function c(a) {
4807	+ return function(b, c) {
4808	+ var d = b && b[a] \|\| 0, f = c && c[a] \|\| 0;
4809	+ return d === f ? 0 : d > f ? 1 : -1;
4810	+ };
4811	+ }
4812	+ function b(a) {
4813	+ return function(b, c) {
4814	+ return (b && b[a] \|\| "").localeCompare(c && c[a] \|\| "");
4815	+ };
4816	+ }
4817	+ function a(a) {
4818	+ return function(b, c) {
4819	+ return -1 * a(b, c);
4820	+ };
4821	+ }
4822	+ f.init = function(a) {
4823	+ function b(a) {
4824	+ var c = -1, d = a.length;
4825	+ for (h("tr", r).remove(); ++c < d; ) r.appendChild(a[c].$);
4826	+ }
4827	+ function c(a) {
4828	+ s = a ? B.find(a, d) : d.slice(0);
4829	+ v && (a = f[v], s = m(s, v, a.type, a.desc));
4830	+ b(s);
4831	+ }
4832	+ var d = [], f = [], k = 0, s, q, v, r = a.getElementsByTagName("tbody")[0], w = a.getElementsByTagName("thead")[0], B = n.require("$10", "fulltext.js").init();
4833	+ w && r && (h("th", w).each(function(a, c) {
4834	+ var e = c.getAttribute("data-sort-type");
4835	+ e && (a = k, h(c).addClass("loco-sort").on("click", function(c) {
4836	+ c.preventDefault();
4837	+ c = a;
4838	+ var e = f[c], g = e.type, k = !(e.desc = !e.desc);
4839	+ s = m(s \|\| d.slice(0), c, g, k);
4840	+ b(s);
4841	+ q && q.removeClass("loco-desc loco-asc");
4842	+ q = h(e.$).addClass(k ? "loco-desc" : "loco-asc").removeClass(k ? "loco-asc" : "loco-desc");
4843	+ v = c;
4844	+ return !1;
4845	+ }), f[k] = {
4846	+ $: c,
4847	+ type: e
4848	+ });
4849	+ c.hasAttribute("colspan") ? k += Number(c.getAttribute("colspan")) : k++;
4850	+ }), h("tr", r).each(function(a, b) {
4851	+ var c, e, g, h = [], k = {
4852	+ _: a,
4853	+ $: b
4854	+ }, m = b.getElementsByTagName("td");
4855	+ for (e in f) {
4856	+ c = m[e];
4857	+ (g = c.textContent.replace(/(^\s+\|\s+$)/g, "")) && h.push(g);
4858	+ c.hasAttribute("data-sort-value") && (g = c.getAttribute("data-sort-value"));
4859	+ switch (f[e].type) {
4860	+ case "n":
4861	+ g = Number(g);
4862	+ }
4863	+ k[e] = g;
4864	+ }
4865	+ d[a] = k;
4866	+ B.index(a, h);
4867	+ }), a = h('form.loco-filter input[type="text"]', a.parentNode), a.length && (a = a[0],
4868	+ w = h(a.form), 1 < d.length ? n.require("$11", "LocoTextListener.js").listen(a, c) : w.hide(),
4869	+ w.on("submit", function(a) {
4870	+ a.preventDefault();
4871	+ return !1;
4872	+ })));
4873	+ };
4874	+ return f;
4875	+ }({}, v, w));
4876	+ var B = v.loco \|\| {}, I = B.conf \|\| {
4877	+ $v: [ 0, 0 ]
4878	+ };
4879	+ v = n.require("$1", "t.js").init();
4880	+ w = I.wplang;
4881	+ B.version = function(f) {
4882	+ return I.$v[f \|\| 0];
4883	+ };
4884	+ n.require("$2", "html.js");
4885	+ n.require("$3", "number.js");
4886	+ n.require("$4", "array.js");
4887	+ n.require("$5", "json.js");
4888	+ B.l10n = v;
4889	+ v.load(I.wpl10n);
4890	+ w && v.pluraleq(w.pluraleq);
4891	+ B.string = n.require("$6", "string.js");
4892	+ B.notices = n.require("$7", "notices.js").init(v);
4893	+ B.ajax = n.require("$8", "ajax.js").init(I).localise(v);
4894	+ B.locale = n.require("$9", "wplocale.js");
4895	+ B.fulltext = n.require("$10", "fulltext.js");
4896	+ B.watchtext = n.require("$11", "LocoTextListener.js").listen;
4897	+ B.tooltip = n.require("$12", "tooltip.js");
4898	+ B.po = {
4899	+ ed: n.require("$13", "poedit.js"),
4900	+ kbd: n.require("$14", "hotkeys.js"),
4901	+ init: n.require("$15", "po.js").create,
4902	+ ace: n.require("$16", "ace.js").strf("php"),
4903	+ ref: n.require("$17", "refs.js")
4904	+ };
4905	+ B.apis = n.require("$18", "apis.js");
4906	+ B.fs = n.require("$19", "fsconn.js");
4907	+ h("#loco-admin.wrap table.wp-list-table").each(function(f, d) {
4908	+ n.require("$20", "tables.js").init(d);
4909	+ });
4910	+ B.validate = function(f) {
4911	+ return "2.5.3" !== (/^\d+\.\d+\.\d+/.exec(f && f[0] \|\| "") && RegExp.lastMatch) ? (B.notices.warn("admin.js is the wrong version (2.5.3). Please empty all relevant caches and reload this page."),
4912	+ !1) : !0;
4913	+ };
4914	+ })(window, document, window.jQuery);

pub/js/min/config.js CHANGED Viewed

	@@ -1 +1,32 @@
1	- !function(n,~~o,c){function~~ ~~e(){var n=c("#loco-conf > div"),~~o~~=n.eq(0).clone()~~,~~e=n.length,t="["+e+"]";function~~ ~~i(n,o){var e=o.name.replace("[0]",t);~~c(o)~~.attr("name",e).val("")}o.attr("id","loco-conf-"+e),o.find("input").each(i),o.find("textarea").each(i),o.find("h2").eq(0).html("New~~ ~~set <span>(untitled)</span>"),o.insertBefore("#loco-form-foot"),f(o.find("a.icon-del"),e),o.hide().slideDown(500),c("html, body").animate(~~{scrollTop:function(n,o){for(var e=n.offsetTop;(n=n.offsetParent)&&n!==o;)e+=n.offsetTop;return e}(o[0])},500)}function f(n,o){return n.on("click",function(n){return n.preventDefault(),function(n){var o=c("#loco-conf-"+n);o.find('input[name="conf['+n+'][removed]"]').val("1"),o.slideUp(500,function(){c(this).hide().find("table").remove()})}(o),!1})}c("#loco-conf > div").each(function(n,o){f(c(o).find("a.icon-del"),n)}),c("#loco-add-butt").attr("disabled",!1).on("click",function(n){return n.preventDefault(),e(),!1})}(window,document,jQuery);


1	+ !function(n, o, c) {
2	+ function e() {
3	+ var n = c("#loco-conf > div"), o = n.eq(0).clone(), e = n.length, t = "[" + e + "]";
4	+ function i(n, o) {
5	+ var e = o.name.replace("[0]", t);
6	+ c(o).attr("name", e).val("");
7	+ }
8	+ o.attr("id", "loco-conf-" + e), o.find("input").each(i), o.find("textarea").each(i),
9	+ o.find("h2").eq(0).html("New set <span>(untitled)</span>"), o.insertBefore("#loco-form-foot"),
10	+ f(o.find("a.icon-del"), e), o.hide().slideDown(500), c("html, body").animate({
11	+ scrollTop: function(n, o) {
12	+ for (var e = n.offsetTop; (n = n.offsetParent) && n !== o; ) e += n.offsetTop;
13	+ return e;
14	+ }(o[0])
15	+ }, 500);
16	+ }
17	+ function f(n, o) {
18	+ return n.on("click", function(n) {
19	+ return n.preventDefault(), function(n) {
20	+ var o = c("#loco-conf-" + n);
21	+ o.find('input[name="conf[' + n + '][removed]"]').val("1"), o.slideUp(500, function() {
22	+ c(this).hide().find("table").remove();
23	+ });
24	+ }(o), !1;
25	+ });
26	+ }
27	+ c("#loco-conf > div").each(function(n, o) {
28	+ f(c(o).find("a.icon-del"), n);
29	+ }), c("#loco-add-butt").attr("disabled", !1).on("click", function(n) {
30	+ return n.preventDefault(), e(), !1;
31	+ });
32	+ }(window, document, jQuery);

pub/js/min/debug.js CHANGED Viewed

	@@ -1 +1,31 @@
1	- !function(a,~~r){var~~ ~~e=a.conf,o=~~r~~("#loco-utf8-check"~~)~~[0].textContent;function~~ ~~t(e,o,n)~~{"success"!==o&&(n=a.ajax.parse(a.ajax.strip(e.responseText))),r("#loco-ajax-check").text("FAILED: "+n).addClass("loco-danger")}1===o.length&&10003===o.charCodeAt(0)\|\|a.notices.warn("This page has a problem rendering UTF-8").stick(),window.ajaxurl&&r("#loco-ajax-url").text(window.ajaxurl),r("#loco-vers-jquery").text([r.fn&&r.fn.jquery\|\|"unknown","ui/"+(r.ui&&r.ui.version\|\|"none"),"migrate/"+(r.migrateVersion\|\|"none")].join("; ")),a.ajax.post("ping",{echo:"ΟΚ ✓"},function(e,o,n){e&&e.ping?r("#loco-ajax-check").text(e.ping):t(n,o,e&&e.error&&e.error.message)},t);var n,i=e.apis,c=i.length,s=-1,l=a.locale.parse("fr");function u(e,o){return r("#loco-api-"+e).text(o)}function d(e){var n=e.getId();e.key()?e.translate("OK",l,function(e,o){o?u(n,"OK ✓"):u(n,"FAILED").addClass("loco-danger")}):u(n,"No API key")}if(a.apis)for(;++s<c;){n=i[s];try{d(a.apis.create(n))}catch(e){u(n.id,String(e))}}else a.notices.error("admin.js is out of date. Please empty your browser cache.")}(window.loco,window.jQuery,window.wp);


1	+ !function(a, r) {
2	+ var e = a.conf, o = r("#loco-utf8-check")[0].textContent;
3	+ function t(e, o, n) {
4	+ "success" !== o && (n = a.ajax.parse(a.ajax.strip(e.responseText))), r("#loco-ajax-check").text("FAILED: " + n).addClass("loco-danger");
5	+ }
6	+ 1 === o.length && 10003 === o.charCodeAt(0) \|\| a.notices.warn("This page has a problem rendering UTF-8").stick(),
7	+ window.ajaxurl && r("#loco-ajax-url").text(window.ajaxurl), r("#loco-vers-jquery").text([ r.fn && r.fn.jquery \|\| "unknown", "ui/" + (r.ui && r.ui.version \|\| "none"), "migrate/" + (r.migrateVersion \|\| "none") ].join("; ")),
8	+ a.ajax.post("ping", {
9	+ echo: "ΟΚ ✓"
10	+ }, function(e, o, n) {
11	+ e && e.ping ? r("#loco-ajax-check").text(e.ping) : t(n, o, e && e.error && e.error.message);
12	+ }, t);
13	+ var n, i = e.apis, c = i.length, s = -1, l = a.locale.parse("fr");
14	+ function u(e, o) {
15	+ return r("#loco-api-" + e).text(o);
16	+ }
17	+ function d(e) {
18	+ var n = e.getId();
19	+ e.key() ? e.translate("OK", l, function(e, o) {
20	+ o ? u(n, "OK ✓") : u(n, "FAILED").addClass("loco-danger");
21	+ }) : u(n, "No API key");
22	+ }
23	+ if (a.apis) for (;++s < c; ) {
24	+ n = i[s];
25	+ try {
26	+ d(a.apis.create(n));
27	+ } catch (e) {
28	+ u(n.id, String(e));
29	+ }
30	+ } else a.notices.error("admin.js is out of date. Please empty your browser cache.");
31	+ }(window.loco, window.jQuery, window.wp);

pub/js/min/delete.js CHANGED Viewed

	@@ -1 +1,4 @@
1	- !function(o,e){~~var n=e.getElementById("loco-fs"),t=e.getElementById("loco-del");n&&t&&o.loco.fs.init(n).setForm(t)}(window,document,window.jQuery);~~


1	+ !function(o, e) {
2	+ var n = e.getElementById("loco-fs"), t = e.getElementById("loco-del");
3	+ n && t && o.loco.fs.init(n).setForm(t);
4	+ }(window, document, window.jQuery);

pub/js/min/editor.js CHANGED Viewed

	@@ -1 +1,354 @@
1	- !function(S,k){var C=S.loco,i=C&&C.conf,c=document.getElementById("loco-editor-inner");if(C&&i&&c){var D,r,n,z,m,a,u=!!i.WP_DEBUG,l=C.po.ref&&C.po.ref.init(C,i),d=null,s=null,o=i.multipart,t=C.l10n,h=C.string.sprintf,T=i.locale,b=C.po.init(T).wrap(i.powrap),p=!T,e=document.getElementById("loco-actions"),f=i.popath,g=i.potpath,v=String(i.syncmode).toLowerCase(),y=document.getElementById("loco-fs"),w=y&&C.fs.init(y),x=i.readonly,I=!x,j={},M=0,L={my:"top",at:"top",of:"#loco-content"};!o\|\|S.FormData&&S.Blob\|\|(o=!1,C.notices.warn("Your browser doesn't support Ajax file uploads. Falling back to standard postdata")),l\|\|C.notices.warn("admin.js is out of date. Please empty your browser cache and reload the page.");var E,U,P=(U=parseInt(k(c).css("min-height")\|\|0),function(){var n=function(n,t){for(var o=n.offsetTop\|\|0;(n=n.offsetParent)&&n!==t;)o+=n.offsetTop\|\|0;return o}(c,document.body),t=S.innerHeight,o=Math.max(U,t-n-20);E!==o&&(c.style.height=String(o)+"px",E=o)});P(),k(S).resize(P),c.innerHTML="",D=C.po.ed.init(c).localise(t),C.po.kbd.init(D).add("save",I?function(){D.dirty&&W()}:J).add("hint",T&&I&&R\|\|J).enable("copy","clear","enter","next","prev","fuzzy","save","invis","hint");var q={save:I&&function(t){function o(){t.disabled=!0}function n(){t.disabled=!1}function e(){n(),k(t).removeClass("loco-loading")}return t,D.on("poUnsaved",function(){n(),k(t).addClass("button-primary")}).on("poSave",function(){o(),k(t).removeClass("button-primary")}),s=k.extend({path:f},i.project\|\|{}),k(t).on("click",function(n){return n.preventDefault(),o(),k(t).addClass("loco-loading"),W(e),!1}),!0},sync:I&&function(t){var n=i.project;if(n){function o(){t.disabled=!0}function e(){t.disabled=!1}function a(){e(),k(t).removeClass("loco-loading")}D.on("poUnsaved",function(){o()}).on("poSave",function(){e()}),d={bundle:n.bundle,domain:n.domain,type:p?"pot":"po",path:f\|\|"",sync:g\|\|"",strip:"pot"===v?"1":""},k(t).on("click",function(n){return n.preventDefault(),o(),k(t).addClass("loco-loading"),O(a),!1}),e()}return!0},revert:function(n){return D.on("poUnsaved",function(){n.disabled=!1}).on("poSave",function(){n.disabled=!0}),k(n).on("click",function(n){return n.preventDefault(),location.reload(),!1}),!0},invs:function(n){var o=k(n);return n.disabled=!1,D.on("poInvs",function(n,t){o[t?"addClass":"removeClass"]("inverted")}),o.on("click",function(n){return n.preventDefault(),D.setInvs(!D.getInvs()),!1}),C.tooltip.init(o),!0},code:function(n){var o=k(n);return n.disabled=!1,o.on("click",function(n){n.preventDefault();var t=!D.getMono();return o[t?"addClass":"removeClass"]("inverted"),D.setMono(t),!1}),C.tooltip.init(o),!0},source:G,binary:p?null:G};p?(q.add=I&&function(n){return n.disabled=!1,k(n).on("click",function(n){n.preventDefault();var t,o=1,e=/(\d+)$/;for(t="New message";b.get(t);)o=e.exec(t)?Math.max(o,Number(RegExp.$1)):o,t="New message "+ ++o;return D.add(t),!1}),!0},q.del=I&&function(n){return n.disabled=!1,k(n).on("click",function(n){return n.preventDefault(),D.del(),!1}),!0}):q.auto=function(n){function t(){n.disabled=!1}return D.on("poUnsaved",function(){n.disabled=!0}).on("poSave poAuto",function(){t()}),k(n).on("click",H),t(),!0},k("#loco-editor > nav .button").each(function(n,t){var o=t.getAttribute("data-loco"),e=q[o];e&&e(t,o)\|\|k(t).addClass("loco-noop")}),k(e).on("submit",J),function(t){function e(n){k(t.parentNode)[n\|\|null==n?"removeClass":"addClass"]("invalid")}D.searchable(C.fulltext.init()),t.disabled=!1;var a=t.value="",i=C.watchtext(t,function(n){e(D.filter(n,!0))});D.on("poFilter",function(n,t,o){a=i.val(),i.val(t\|\|""),e(o)}).on("poMerge",function(){a&&D.filter(a)})}(document.getElementById("loco-search")),D.on("poUnsaved",function(){S.onbeforeunload=Y}).on("poSave",function(){K(),S.onbeforeunload=null}).on("poHint",R).on("poUpdate",K).on("poMeta",function(n,t){var o,e,a=(e="CODE",(o=t).tagName===e?o:o.getElementsByTagName(e)[0]);return!a\|\|!l\|\|(l.load(a.textContent),n.preventDefault(),!1)}),b.load(i.podata),D.load(b),(T=D.targetLocale)?T.isRTL()&&k(c).addClass("trg-rtl"):D.unlock(),K(),delete C.conf,i=q=null}function B(n){return C.l10n._(n)}function N(n,t,o){return C.l10n.n(n,t,o)}function O(s){C.ajax.post("sync",d,function(n){var t=[],o=n.pot,e=n.po,a=n.done\|\|{add:[],del:[],fuz:[]},i=a.add.length,r=a.del.length,l=a.fuz.length;b.clear().load(e),D.load(b),i\|\|r\|\|l?(o?t.push(h(B("Merged from %s"),o)):t.push(B("Merged from source code")),i&&t.push(h(N("%s new string added","%s new strings added",i),i.format(0))),r&&t.push(h(N("%s obsolete string removed","%s obsolete strings removed",r),r.format(0))),l&&t.push(h(N("%s string marked Fuzzy","%s strings marked Fuzzy",l),l.format(0))),k(c).trigger("poUnsaved",[]),K(),u&&S.console&&function(n,t){var o=-1,e=t.add.length;for(;++o<e;)n.log(" + "+String(t.add[o]));for(e=t.del.length,o=0;o<e;o++)n.log(" - "+String(t.del[o]));for(e=t.fuz.length,o=0;o<e;o++)n.log(" ~ "+String(t.fuz[o]))}(console,a)):o?t.push(h(B("Strings up to date with %s"),o)):t.push(B("Strings up to date with source code")),C.notices.success(t.join(". ")),k(c).trigger("poMerge",[n]),s&&s()},s)}function A(){return n=n\|\|function(){for(var n,t=-1,o=[],e=r,a=e.length;++t<a;)try{n=e[t],o.push(C.apis.create(n))}catch(n){C.notices.error(String(n))}return o}()}function F(t){var o;function e(){return(new Date).getTime()}p\|\|x?C.notices.error("Logic error. APIs not available in current mode"):null==r\|\|0===r.length\|\|10<Math.round((e()-M)/1e3)?(a&&a.remove(),a=null,m&&m.remove(),m=null,z&&z.remove(),r=z=null,o=k('<div><div class="loco-loading"></div></div>').dialog({dialogClass:"loco-modal loco-modal-no-close",appendTo:"#loco-admin.wrap",title:"Loading..",modal:!0,autoOpen:!0,closeOnEscape:!1,resizable:!1,draggable:!1,position:L,height:200}),C.ajax.get("apis",{locale:String(T)},function(n){M=e(),0===(r=n&&n.apis\|\|[]).length?a=$("loco-apis-empty",n.html):m=$("loco-apis-batch",n.html),o.remove(),t(r)})):(M=e(),t(r))}function $(n,t){var o=k(t);return o.attr("id",n),o.dialog({dialogClass:"loco-modal",appendTo:"#loco-admin.wrap",title:o.attr("title"),modal:!0,autoOpen:!1,closeOnEscape:!0,resizable:!1,draggable:!1,position:L}),o}function R(){F(function(n){n.length?function(){var n=D.current(),t=D.getTargetOffset(),o=n&&n.source(null,t),p='lang="'+String(T)+'" dir="'+(T.isRTL()?"RTL":"LTR")+'"',f=99;if(!o)return;function e(n){return!n.isDefaultPrevented()&&(!(0<=(t=n.which-49)&&t<10&&(o=v&&v.find("button.button-primary").eq(t))&&1===o.length)\|\|(n.preventDefault(),n.stopPropagation(),o.click(),!1));var t,o}function a(n,t,o,e){var a=e.getId(),i=w[a],r=String(i+1),l=e.getUrl(),s=B("Use this translation"),c=String(e),u=b&&b[a],d=k('<button class="button button-primary"></button>').attr("tabindex",String(1+f+i)).on("click",function(e,a){return function(n){n.preventDefault(),n.stopPropagation(),g();var t=D.current(),o=D.getTargetOffset();t&&t.source(null,o)===e?(t.translate(a,o),D.focus().reloadMessage(t)):C.notices.warn("Source changed since suggestion")}}(n,t));d.attr("accesskey",r),1<m.length&&(s+=" ("+r+")"),d.text(s),u&&u.replaceWith(k('<div class="loco-api loco-api-'+a+'"></div>').append(k('<a class="loco-api-credit" target="_blank" tabindex="-1"></a>').attr("href",l).text(c)).append(k("<blockquote "+p+"></blockquote>").text(t\|\|"FAILED")).append(d)),++y===h&&(v&&v.dialog("option","title",B("Suggested translations")+" — "+o.label),f+=y),0===i&&d.focus()}function g(n){v&&null==n&&v.dialog("close"),b=v=null,k(S).off("keydown",e)}function i(e){return function(n,t,o){a(n,u[e.getId()]=t,o,e)}}var v=(z=z\|\|$("loco-apis-hint","<div></div>")).html("").append(k('<div class="loco-api"><p>Source text:</p></div>').append(k('<blockquote lang="en"></blockquote>').text(o))).dialog("option","title",B("Loading suggestions")+"...").off("dialogclose").on("dialogclose",g).dialog("open"),r=n.translation(t);r&&k('<div class="loco-api"><p>Current translation:</p></div>').append(k("<blockquote "+p+"></blockquote>").text(r)).append(k('<button class="button"></button>').attr("tabindex",String(++f)).text(B("Keep this translation")).on("click",function(n){n.preventDefault(),g()})).appendTo(v);var l,s,m=A(),h=m.length,c=-1,u=j[o]\|\|(j[o]={}),b={},y=0,w={};for(;++c<h;)l=m[c],v.append((d=l,void 0,x=k('<div class="loco-api loco-api-loading"></div>').text("Calling "+d+" ..."),b[d.getId()]=x)),s=l.getId(),w[s]=c,u[s]?a(o,u[s],T,l):l.translate(o,T,i(l));var d,x;k(S).on("keydown",e)}():_()})}function H(n){return n.preventDefault(),F(function(n){n.length?function(){var e,a,i,r=0,t=!1,l=m.dialog("open"),n=l.find("form"),s=n.find("button.button-primary"),o=k("#loco-job-progress");function c(){s[0].disabled=!0}function u(){s.removeClass("loco-loading")}function d(n){o.text(n)}function p(n){var t=function(n){for(var t,o=A(),e=o.length,a=-1;++a<e;)if((t=o[a]).getId()===n)return t;C.notices.error("No "+n+" client")}(k(n.api).val()),o=n.existing.checked;d("Calculating...."),(e=t.createJob()).init(b,o),a=t.toString(),d(h(B("%s unique source strings."),e.length.format(0))+" "+h(B("%s characters will be sent for translation."),e.chars.format(0))),e.length?s[0].disabled=!1:c(),i=null}function f(n){e&&(t&&n.fuzzy(0,!0),D.pasteMessage(n),n===D.active&&D.setStatus(n),D.unsave(n,0),r++)}function g(n,t){var o=t?100*n/t:0;d(h(B("Translation progress %s%%"),o.format(0)))}function v(){if(u(),e&&i){var n=i.todo();n&&C.notices.warn(h(N("Translation job aborted with %s string remaining","Translation job aborted with %s strings remaining",n),n.format(0))).slow();var t=[],o=i.did();o&&t.push(h(N("%1$s string translated via %2$s","%1$s strings translated via %2$s",o),o.format(0),a)),r?t.push(h(N("%s string updated","%s strings updated",r),r.format(0))):t.push(B("Nothing needed updating")),C.notices.success(t.join(". ")).slow(),i=e=null}r&&(K(),D.rebuildSearch()),l&&(l.off("dialogclose").dialog("close"),l=null),D.fire("poAuto")}u(),c(),C.notices.clear(),n.off("submit change"),p(n[0]),n.on("change",function(n){var t=n.target,o=t.name;return"api"!==o&&"existing"!==o\|\|p(t.form),!0}).on("submit",function(n){n.preventDefault(),s.addClass("loco-loading"),c(),g(r=0),t=n.target.fuzzy.checked,i=e.dispatch().done(v).each(f).prog(g).stat()}),l.off("dialogclose").on("dialogclose",function(){e.abort(),l=null,v()})}():_()}),!1}function _(){a?a.dialog("open"):C.notices.error("Logic error. Unconfigured API modal missing")}function W(t){var n=k.extend({locale:String(b.locale()\|\|"")},s\|\|{});w&&w.applyCreds(n),o?(n=function(n){var t,o=new FormData;for(t in n)n.hasOwnProperty(t)&&o.append(t,n[t]);return o}(n)).append("po",new Blob([String(b)],{type:"application/x-gettext"}),String(n.path).split("/").pop()\|\|"untitled.po"):n.data=String(b),C.ajax.post("save",n,function(n){t&&t(),D.save(!0),k("#loco-po-modified").text(n.datetime\|\|"[datetime error]")},t)}function Y(){return B("Your changes will be lost if you continue without saving")}function G(o,e){return o.disabled=!1,k(o).on("click",function(){var n=o.form,t=f;return"binary"===e&&(t=t.replace(/\.po$/,".mo")),n.path.value=t,n.source.value=b.toString(),!0}),!0}function J(n){return n.preventDefault(),!1}function K(){var n=D.stats(),t=n.t,o=n.f,e=n.u,a=h(N("%s string","%s strings",t),t.format(0)),i=[];T&&(a=h(B("%s%% translated"),n.p.replace("%",""))+", "+a,o&&i.push(h(B("%s fuzzy"),o.format(0))),e&&i.push(h(B("%s untranslated"),e.format(0))),i.length&&(a+=" ("+i.join(", ")+")")),k("#loco-po-status").text(a)}}(window,window.jQuery);


1	+ !function(k, S) {
2	+ var C = k.loco, i = C && C.conf, u = document.getElementById("loco-editor-inner");
3	+ if (C && i && u) {
4	+ var D, r, n, z, h, a, d = !!i.WP_DEBUG, l = C.po.ref && C.po.ref.init(C, i), s = null, c = null, o = i.multipart, t = C.l10n, m = C.string.sprintf, e = i.wpnum && i.wpnum.thousands_sep \|\| ",", T = i.locale, b = C.po.init(T).wrap(i.powrap), p = !T, f = document.getElementById("loco-actions"), g = i.popath, v = i.potpath, y = i.syncmode, w = document.getElementById("loco-fs"), x = w && C.fs.init(w), I = i.readonly, j = !I, M = {}, E = 0, L = {
5	+ my: "top",
6	+ at: "top",
7	+ of: "#loco-content"
8	+ };
9	+ !o \|\| k.FormData && k.Blob \|\| (o = !1, C.notices.warn("Your browser doesn't support Ajax file uploads. Falling back to standard postdata")),
10	+ l \|\| C.notices.warn("admin.js is out of date. Please empty your browser cache and reload the page.");
11	+ var U, P, q = (P = parseInt(S(u).css("min-height") \|\| 0), function() {
12	+ var n = function(n, t) {
13	+ for (var o = n.offsetTop \|\| 0; (n = n.offsetParent) && n !== t; ) o += n.offsetTop \|\| 0;
14	+ return o;
15	+ }(u, document.body), t = k.innerHeight, o = Math.max(P, t - n - 20);
16	+ U !== o && (u.style.height = String(o) + "px", U = o);
17	+ });
18	+ q(), S(k).resize(q), u.innerHTML = "", D = C.po.ed.init(u).localise(t), C.po.kbd.init(D).add("save", j ? function() {
19	+ D.dirty && G();
20	+ } : Q).add("hint", T && j && H \|\| Q).enable("copy", "clear", "enter", "next", "prev", "fuzzy", "save", "invis", "hint");
21	+ var B = {
22	+ save: j && function(t) {
23	+ function o() {
24	+ t.disabled = !0;
25	+ }
26	+ function n() {
27	+ t.disabled = !1;
28	+ }
29	+ function e() {
30	+ n(), S(t).removeClass("loco-loading");
31	+ }
32	+ return t, D.on("poUnsaved", function() {
33	+ n(), S(t).addClass("button-primary");
34	+ }).on("poSave", function() {
35	+ o(), S(t).removeClass("button-primary");
36	+ }), c = S.extend({
37	+ path: g
38	+ }, i.project \|\| {}), S(t).on("click", function(n) {
39	+ return n.preventDefault(), o(), S(t).addClass("loco-loading"), G(e), !1;
40	+ }), !0;
41	+ },
42	+ sync: j && function(t) {
43	+ var n = i.project;
44	+ if (n) {
45	+ function o() {
46	+ t.disabled = !0;
47	+ }
48	+ function e() {
49	+ t.disabled = !1;
50	+ }
51	+ function a() {
52	+ e(), S(t).removeClass("loco-loading");
53	+ }
54	+ D.on("poUnsaved", function() {
55	+ o();
56	+ }).on("poSave", function() {
57	+ e();
58	+ }), s = {
59	+ bundle: n.bundle,
60	+ domain: n.domain,
61	+ type: p ? "pot" : "po",
62	+ path: g \|\| "",
63	+ sync: v \|\| "",
64	+ mode: y \|\| ""
65	+ }, S(t).on("click", function(n) {
66	+ return n.preventDefault(), o(), S(t).addClass("loco-loading"), F(a), !1;
67	+ }), e();
68	+ }
69	+ return !0;
70	+ },
71	+ revert: function(n) {
72	+ return D.on("poUnsaved", function() {
73	+ n.disabled = !1;
74	+ }).on("poSave", function() {
75	+ n.disabled = !0;
76	+ }), S(n).on("click", function(n) {
77	+ return n.preventDefault(), location.reload(), !1;
78	+ }), !0;
79	+ },
80	+ invs: function(n) {
81	+ var o = S(n);
82	+ return n.disabled = !1, D.on("poInvs", function(n, t) {
83	+ o[t ? "addClass" : "removeClass"]("inverted");
84	+ }), o.on("click", function(n) {
85	+ return n.preventDefault(), D.setInvs(!D.getInvs()), !1;
86	+ }), C.tooltip.init(o), !0;
87	+ },
88	+ code: function(n) {
89	+ var o = S(n);
90	+ return n.disabled = !1, o.on("click", function(n) {
91	+ n.preventDefault();
92	+ var t = !D.getMono();
93	+ return o[t ? "addClass" : "removeClass"]("inverted"), D.setMono(t), !1;
94	+ }), C.tooltip.init(o), !0;
95	+ },
96	+ source: K,
97	+ binary: p ? null : K
98	+ };
99	+ p ? (B.add = j && function(n) {
100	+ return n.disabled = !1, S(n).on("click", function(n) {
101	+ n.preventDefault();
102	+ var t, o = 1, e = /(\d+)$/;
103	+ for (t = "New message"; b.get(t); ) o = e.exec(t) ? Math.max(o, Number(RegExp.$1)) : o,
104	+ t = "New message " + ++o;
105	+ return D.add(t), !1;
106	+ }), !0;
107	+ }, B.del = j && function(n) {
108	+ return n.disabled = !1, S(n).on("click", function(n) {
109	+ return n.preventDefault(), D.del(), !1;
110	+ }), !0;
111	+ }) : B.auto = function(n) {
112	+ function t() {
113	+ n.disabled = !1;
114	+ }
115	+ return D.on("poUnsaved", function() {
116	+ n.disabled = !0;
117	+ }).on("poSave poAuto", function() {
118	+ t();
119	+ }), S(n).on("click", W), t(), !0;
120	+ }, S("#loco-editor > nav .button").each(function(n, t) {
121	+ var o = t.getAttribute("data-loco"), e = B[o];
122	+ e && e(t, o) \|\| S(t).addClass("loco-noop");
123	+ }), S(f).on("submit", Q), function(t) {
124	+ function e(n) {
125	+ S(t.parentNode)[n \|\| null == n ? "removeClass" : "addClass"]("invalid");
126	+ }
127	+ D.searchable(C.fulltext.init()), t.disabled = !1;
128	+ var a = t.value = "", i = C.watchtext(t, function(n) {
129	+ e(D.filter(n, !0));
130	+ });
131	+ D.on("poFilter", function(n, t, o) {
132	+ a = i.val(), i.val(t \|\| ""), e(o);
133	+ }).on("poMerge", function() {
134	+ a && D.filter(a);
135	+ });
136	+ }(document.getElementById("loco-search")), D.on("poUnsaved", function() {
137	+ k.onbeforeunload = J;
138	+ }).on("poSave", function() {
139	+ V(), k.onbeforeunload = null;
140	+ }).on("poHint", H).on("poUpdate", V).on("poMeta", function(n, t) {
141	+ var o, e, a = (e = "CODE", (o = t).tagName === e ? o : o.getElementsByTagName(e)[0]);
142	+ return !a \|\| !l \|\| (l.load(a.textContent), n.preventDefault(), !1);
143	+ }), b.load(i.podata), D.load(b), (T = D.targetLocale) ? T.isRTL() && S(u).addClass("trg-rtl") : D.unlock(),
144	+ V(), delete C.conf, i = B = null;
145	+ }
146	+ function N(n) {
147	+ return C.l10n._(n);
148	+ }
149	+ function O(n, t, o) {
150	+ return C.l10n.n(n, t, o);
151	+ }
152	+ function A(n) {
153	+ return n.format(0, ".", e);
154	+ }
155	+ function F(c) {
156	+ C.ajax.post("sync", s, function(n) {
157	+ var t = [], o = n.pot, e = n.po, a = n.done \|\| {
158	+ add: [],
159	+ del: [],
160	+ fuz: []
161	+ }, i = a.add.length, r = a.del.length, l = a.fuz.length, s = a.trn \|\| 0;
162	+ b.clear().load(e), D.load(b), i \|\| r \|\| l \|\| s ? (o ? t.push(m(N("Merged from %s"), o)) : t.push(N("Merged from source code")),
163	+ i && t.push(m(O("%s new string added", "%s new strings added", i), A(i))), r && t.push(m(O("%s obsolete string removed", "%s obsolete strings removed", r), A(r))),
164	+ l && t.push(m(O("%s string marked Fuzzy", "%s strings marked Fuzzy", l), A(l))),
165	+ s && t.push(m(O("%s translation copied", "%s translations copied", s), A(s))), S(u).trigger("poUnsaved", []),
166	+ V(), d && k.console && function(n, t) {
167	+ var o = -1, e = t.add.length;
168	+ for (;++o < e; ) n.log(" + " + String(t.add[o]));
169	+ for (e = t.del.length, o = 0; o < e; o++) n.log(" - " + String(t.del[o]));
170	+ for (e = t.fuz.length, o = 0; o < e; o++) n.log(" ~ " + String(t.fuz[o]));
171	+ }(console, a)) : o ? t.push(m(N("Strings up to date with %s"), o)) : t.push(N("Strings up to date with source code")),
172	+ C.notices.success(t.join(". ")), S(u).trigger("poMerge", [ n ]), c && c();
173	+ }, c);
174	+ }
175	+ function $() {
176	+ return n = n \|\| function() {
177	+ for (var n, t = -1, o = [], e = r, a = e.length; ++t < a; ) try {
178	+ n = e[t], o.push(C.apis.create(n));
179	+ } catch (n) {
180	+ C.notices.error(String(n));
181	+ }
182	+ return o;
183	+ }();
184	+ }
185	+ function R(t) {
186	+ var o;
187	+ function e() {
188	+ return new Date().getTime();
189	+ }
190	+ p \|\| I ? C.notices.error("Logic error. APIs not available in current mode") : null == r \|\| 0 === r.length \|\| 10 < Math.round((e() - E) / 1e3) ? (a && a.remove(),
191	+ a = null, h && h.remove(), h = null, z && z.remove(), r = z = null, o = S('<div><div class="loco-loading"></div></div>').dialog({
192	+ dialogClass: "loco-modal loco-modal-no-close",
193	+ appendTo: "#loco-admin.wrap",
194	+ title: "Loading..",
195	+ modal: !0,
196	+ autoOpen: !0,
197	+ closeOnEscape: !1,
198	+ resizable: !1,
199	+ draggable: !1,
200	+ position: L,
201	+ height: 200
202	+ }), C.ajax.get("apis", {
203	+ locale: String(T)
204	+ }, function(n) {
205	+ E = e(), 0 === (r = n && n.apis \|\| []).length ? a = _("loco-apis-empty", n.html) : h = _("loco-apis-batch", n.html),
206	+ o.remove(), t(r);
207	+ })) : (E = e(), t(r));
208	+ }
209	+ function _(n, t) {
210	+ var o = S(t);
211	+ return o.attr("id", n), o.dialog({
212	+ dialogClass: "loco-modal",
213	+ appendTo: "#loco-admin.wrap",
214	+ title: o.attr("title"),
215	+ modal: !0,
216	+ autoOpen: !1,
217	+ closeOnEscape: !0,
218	+ resizable: !1,
219	+ draggable: !1,
220	+ position: L
221	+ }), o;
222	+ }
223	+ function H() {
224	+ R(function(n) {
225	+ n.length ? function() {
226	+ var n = D.current(), t = D.getTargetOffset(), o = n && n.source(null, t), p = 'lang="' + String(T) + '" dir="' + (T.isRTL() ? "RTL" : "LTR") + '"', f = 99;
227	+ if (!o) return;
228	+ function e(n) {
229	+ return !n.isDefaultPrevented() && (!(0 <= (t = n.which - 49) && t < 10 && (o = v && v.find("button.button-primary").eq(t)) && 1 === o.length) \|\| (n.preventDefault(),
230	+ n.stopPropagation(), o.click(), !1));
231	+ var t, o;
232	+ }
233	+ function a(n, t, o, e) {
234	+ var a = e.getId(), i = w[a], r = String(i + 1), l = e.getUrl(), s = N("Use this translation"), c = String(e), u = b && b[a], d = S('<button class="button button-primary"></button>').attr("tabindex", String(1 + f + i)).on("click", function(e, a) {
235	+ return function(n) {
236	+ n.preventDefault(), n.stopPropagation(), g();
237	+ var t = D.current(), o = D.getTargetOffset();
238	+ t && t.source(null, o) === e ? (t.translate(a, o), D.focus().reloadMessage(t)) : C.notices.warn("Source changed since suggestion");
239	+ };
240	+ }(n, t));
241	+ d.attr("accesskey", r), 1 < h.length && (s += " (" + r + ")"), d.text(s), u && u.replaceWith(S('<div class="loco-api loco-api-' + a + '"></div>').append(S('<a class="loco-api-credit" target="_blank" tabindex="-1"></a>').attr("href", l).text(c)).append(S("<blockquote " + p + "></blockquote>").text(t \|\| "FAILED")).append(d)),
242	+ ++y === m && (v && v.dialog("option", "title", N("Suggested translations") + " — " + o.label),
243	+ f += y), 0 === i && d.focus();
244	+ }
245	+ function g(n) {
246	+ v && null == n && v.dialog("close"), b = v = null, S(k).off("keydown", e);
247	+ }
248	+ function i(e) {
249	+ return function(n, t, o) {
250	+ a(n, u[e.getId()] = t, o, e);
251	+ };
252	+ }
253	+ var v = (z = z \|\| _("loco-apis-hint", "<div></div>")).html("").append(S('<div class="loco-api"><p>Source text:</p></div>').append(S('<blockquote lang="en"></blockquote>').text(o))).dialog("option", "title", N("Loading suggestions") + "...").off("dialogclose").on("dialogclose", g).dialog("open"), r = n.translation(t);
254	+ r && S('<div class="loco-api"><p>Current translation:</p></div>').append(S("<blockquote " + p + "></blockquote>").text(r)).append(S('<button class="button"></button>').attr("tabindex", String(++f)).text(N("Keep this translation")).on("click", function(n) {
255	+ n.preventDefault(), g();
256	+ })).appendTo(v);
257	+ var l, s, h = $(), m = h.length, c = -1, u = M[o] \|\| (M[o] = {}), b = {}, y = 0, w = {};
258	+ for (;++c < m; ) l = h[c], v.append((d = l, void 0, x = S('<div class="loco-api loco-api-loading"></div>').text("Calling " + d + " ..."),
259	+ b[d.getId()] = x)), s = l.getId(), w[s] = c, u[s] ? a(o, u[s], T, l) : l.translate(o, T, i(l));
260	+ var d, x;
261	+ S(k).on("keydown", e);
262	+ }() : Y();
263	+ });
264	+ }
265	+ function W(n) {
266	+ return n.preventDefault(), R(function(n) {
267	+ n.length ? function() {
268	+ var e, a, i, r = 0, t = !1, l = h.dialog("open"), n = l.find("form"), s = n.find("button.button-primary"), o = S("#loco-job-progress");
269	+ function c() {
270	+ s[0].disabled = !0;
271	+ }
272	+ function u() {
273	+ s.removeClass("loco-loading");
274	+ }
275	+ function d(n) {
276	+ o.text(n);
277	+ }
278	+ function p(n) {
279	+ var t = function(n) {
280	+ for (var t, o = $(), e = o.length, a = -1; ++a < e; ) if ((t = o[a]).getId() === n) return t;
281	+ C.notices.error("No " + n + " client");
282	+ }(S(n.api).val()), o = n.existing.checked;
283	+ d("Calculating...."), (e = t.createJob()).init(b, o), a = t.toString(), d(m(N("%s unique source strings."), A(e.length)) + " " + m(N("%s characters will be sent for translation."), A(e.chars))),
284	+ e.length ? s[0].disabled = !1 : c(), i = null;
285	+ }
286	+ function f(n) {
287	+ e && (t && n.fuzzy(0, !0), D.pasteMessage(n), n === D.active && D.setStatus(n),
288	+ D.unsave(n, 0), r++);
289	+ }
290	+ function g(n, t) {
291	+ var o = t ? 100 * n / t : 0;
292	+ d(m(N("Translation progress %s%%"), A(o)));
293	+ }
294	+ function v() {
295	+ if (u(), e && i) {
296	+ var n = i.todo();
297	+ n && C.notices.warn(m(O("Translation job aborted with %s string remaining", "Translation job aborted with %s strings remaining", n), A(n))).slow();
298	+ var t = [], o = i.did();
299	+ o && t.push(m(O("%1$s string translated via %2$s", "%1$s strings translated via %2$s", o), A(o), a)),
300	+ r ? t.push(m(O("%s string updated", "%s strings updated", r), A(r))) : t.push(N("Nothing needed updating")),
301	+ C.notices.success(t.join(". ")).slow(), i = e = null;
302	+ }
303	+ r && (V(), D.rebuildSearch()), l && (l.off("dialogclose").dialog("close"), l = null),
304	+ D.fire("poAuto");
305	+ }
306	+ u(), c(), C.notices.clear(), n.off("submit change"), p(n[0]), n.on("change", function(n) {
307	+ var t = n.target, o = t.name;
308	+ return "api" !== o && "existing" !== o \|\| p(t.form), !0;
309	+ }).on("submit", function(n) {
310	+ n.preventDefault(), s.addClass("loco-loading"), c(), g(r = 0), t = n.target.fuzzy.checked,
311	+ i = e.dispatch().done(v).each(f).prog(g).stat();
312	+ }), l.off("dialogclose").on("dialogclose", function() {
313	+ e.abort(), l = null, v();
314	+ });
315	+ }() : Y();
316	+ }), !1;
317	+ }
318	+ function Y() {
319	+ a ? a.dialog("open") : C.notices.error("Logic error. Unconfigured API modal missing");
320	+ }
321	+ function G(t) {
322	+ var n = S.extend({
323	+ locale: String(b.locale() \|\| "")
324	+ }, c \|\| {});
325	+ x && x.applyCreds(n), o ? (n = function(n) {
326	+ var t, o = new FormData();
327	+ for (t in n) n.hasOwnProperty(t) && o.append(t, n[t]);
328	+ return o;
329	+ }(n)).append("po", new Blob([ String(b) ], {
330	+ type: "application/x-gettext"
331	+ }), String(n.path).split("/").pop() \|\| "untitled.po") : n.data = String(b), C.ajax.post("save", n, function(n) {
332	+ t && t(), D.save(!0), S("#loco-po-modified").text(n.datetime \|\| "[datetime error]");
333	+ }, t);
334	+ }
335	+ function J() {
336	+ return N("Your changes will be lost if you continue without saving");
337	+ }
338	+ function K(o, e) {
339	+ return o.disabled = !1, S(o).on("click", function() {
340	+ var n = o.form, t = g;
341	+ return "binary" === e && (t = t.replace(/\.po$/, ".mo")), n.path.value = t, n.source.value = b.toString(),
342	+ !0;
343	+ }), !0;
344	+ }
345	+ function Q(n) {
346	+ return n.preventDefault(), !1;
347	+ }
348	+ function V() {
349	+ var n = D.stats(), t = n.t, o = n.f, e = n.u, a = m(O("%s string", "%s strings", t), A(t)), i = [];
350	+ T && (a = m(N("%s%% translated"), n.p.replace("%", "")) + ", " + a, o && i.push(m(N("%s fuzzy"), A(o))),
351	+ e && i.push(m(N("%s untranslated"), A(e))), i.length && (a += " (" + i.join(", ") + ")")),
352	+ S("#loco-po-status").text(a);
353	+ }
354	+ }(window, window.jQuery);

pub/js/min/head.js ADDED Viewed

	@@ -0,0 +1,4 @@


1	+ !function(o, e) {
2	+ var n = e.getElementById("loco-fs"), t = e.getElementById("loco-main");
3	+ n && t && o.loco.fs.init(n).setForm(t);
4	+ }(window, document, window.jQuery);

pub/js/min/move.js CHANGED Viewed

	@@ -1 +1,17 @@
1	- !function(t,~~e,o){var~~ ~~c,i,u=~~e~~.getElementById("loco-fs")~~,~~a=e.getElementById("loco-main"),d=a.path.value;function~~ ~~l(n){~~o(a)~~.find("button.button-primary").each(function(t,e){e.disabled=n})}u&&a&&(c=t.loco.fs.init(u).setForm(a).listen(function(t){l(!(t&&i))}),o(a).change(function(t){var~~ ~~e,n=t.target\|\|~~{};"dest"!==n.name\|\|!n.checked&&"text"!==n.type\|\|(e=n.value)&&e!==i&&(i=e,l(!0),d!==e&&(u.dest.value=e,c.connect()))}).submit(function(t){return!!i\|\|(t.preventDefault(),!1)}))}(window,document,window.jQuery);


1	+ !function(t, e, o) {
2	+ var c, i, u = e.getElementById("loco-fs"), a = e.getElementById("loco-main"), d = a.path.value;
3	+ function l(n) {
4	+ o(a).find("button.button-primary").each(function(t, e) {
5	+ e.disabled = n;
6	+ });
7	+ }
8	+ u && a && (c = t.loco.fs.init(u).setForm(a).listen(function(t) {
9	+ l(!(t && i));
10	+ }), o(a).change(function(t) {
11	+ var e, n = t.target \|\| {};
12	+ "dest" !== n.name \|\| !n.checked && "text" !== n.type \|\| (e = n.value) && e !== i && (i = e,
13	+ l(!0), d !== e && (u.dest.value = e, c.connect()));
14	+ }).submit(function(t) {
15	+ return !!i \|\| (t.preventDefault(), !1);
16	+ }));
17	+ }(window, document, window.jQuery);

pub/js/min/podiff.js CHANGED Viewed

	@@ -1 +1,44 @@
1	- !function(e,~~t,u){var~~ ~~i,o=[],n=e.loco,s=n.conf,a=0,r=s.paths.length-2,d=~~t~~.getElementById("loco-ui")~~,~~f=t.getElementById("loco-fs"),l=d.getElementsByTagName("form").item(0),m=d.getElementsByTagName("button"),c=u(d).find("div.diff-meta"),g=m.item(0),p=m.item(1);function~~ ~~h(){return~~ u(d)~~.removeClass("loading")}function~~ ~~v(e)~~{return u(d).find("div.diff").html(e)}function C(e){return h(),u('<p class="error"></p>').text(e).appendTo(v(""))}function y(e,t){var n,a=t.getElementsByTagName("tr"),r=a.length,i=t.getAttribute("data-diff").split(/\D+/),o=i[0],s=i[1],d=i[2],f=i[3];function l(e,t,n){t<=n&&u("<span></span>").text(String(t)).prependTo(e)}for(e=0;e<r;e++)l((n=a[e].getElementsByTagName("td"))[0],o++,s),l(n[2],d++,f)}function j(a){i&&i.abort();var r=o[a];if(null!=r)return v(r),void h();v(""),u(d).addClass("loading"),i=n.ajax.post("diff",{lhs:s.paths[a],rhs:s.paths[a+1]},function(e,t,n){n===i&&((r=e&&e.html)?(v(o[a]=r).find("tbody").each(y),h()):C(e&&e.error\|\|"Unknown error"))},function(e,t,n){e===i&&(i=null,C("Failed to generate diff"))})}function b(e){0<=e&&e<=r&&(j(a=e),function(){var e=a,t=e+1;g.disabled=r<=e,p.disabled=e<=0,c.addClass("jshide").removeClass("diff-meta-current"),c.eq(e).removeClass("jshide").addClass("diff-meta-current"),c.eq(t).removeClass("jshide")}())}f&&l&&n.fs.init(f).setForm(l),r&&(u(g).on("click",function(e){return e.preventDefault(),b(a+1),!1}).parent().removeClass("jshide"),u(p).on("click",function(e){return e.preventDefault(),b(a-1),!1}).parent().removeClass("jshide")),b(0)}(window,document,jQuery);


1	+ !function(e, t, u) {
2	+ var i, o = [], n = e.loco, s = n.conf, a = 0, r = s.paths.length - 2, d = t.getElementById("loco-ui"), f = t.getElementById("loco-fs"), l = d.getElementsByTagName("form").item(0), m = d.getElementsByTagName("button"), c = u(d).find("div.diff-meta"), g = m.item(0), p = m.item(1);
3	+ function h() {
4	+ return u(d).removeClass("loading");
5	+ }
6	+ function v(e) {
7	+ return u(d).find("div.diff").html(e);
8	+ }
9	+ function C(e) {
10	+ return h(), u('<p class="error"></p>').text(e).appendTo(v(""));
11	+ }
12	+ function y(e, t) {
13	+ var n, a = t.getElementsByTagName("tr"), r = a.length, i = t.getAttribute("data-diff").split(/\D+/), o = i[0], s = i[1], d = i[2], f = i[3];
14	+ function l(e, t, n) {
15	+ t <= n && u("<span></span>").text(String(t)).prependTo(e);
16	+ }
17	+ for (e = 0; e < r; e++) l((n = a[e].getElementsByTagName("td"))[0], o++, s), l(n[2], d++, f);
18	+ }
19	+ function j(a) {
20	+ i && i.abort();
21	+ var r = o[a];
22	+ if (null != r) return v(r), void h();
23	+ v(""), u(d).addClass("loading"), i = n.ajax.post("diff", {
24	+ lhs: s.paths[a],
25	+ rhs: s.paths[a + 1]
26	+ }, function(e, t, n) {
27	+ n === i && ((r = e && e.html) ? (v(o[a] = r).find("tbody").each(y), h()) : C(e && e.error \|\| "Unknown error"));
28	+ }, function(e, t, n) {
29	+ e === i && (i = null, C("Failed to generate diff"));
30	+ });
31	+ }
32	+ function b(e) {
33	+ 0 <= e && e <= r && (j(a = e), function() {
34	+ var e = a, t = e + 1;
35	+ g.disabled = r <= e, p.disabled = e <= 0, c.addClass("jshide").removeClass("diff-meta-current"),
36	+ c.eq(e).removeClass("jshide").addClass("diff-meta-current"), c.eq(t).removeClass("jshide");
37	+ }());
38	+ }
39	+ f && l && n.fs.init(f).setForm(l), r && (u(g).on("click", function(e) {
40	+ return e.preventDefault(), b(a + 1), !1;
41	+ }).parent().removeClass("jshide"), u(p).on("click", function(e) {
42	+ return e.preventDefault(), b(a - 1), !1;
43	+ }).parent().removeClass("jshide")), b(0);
44	+ }(window, document, jQuery);

pub/js/min/poinit.js CHANGED Viewed

	@@ -1 +1,85 @@
1	- !function(n,~~t,c){var~~ ~~i,e,a,l,o,r,u,s=n.loco,f=~~t~~.getElementById("loco-fs")~~,d=t.getElementById("loco-poinit"),v=f&&s.fs.init(f),g=(a=(e=d)["select-locale"],l=e["custom-locale"],o=e["use-selector"],r=c(a).on("focus",p).closest("fieldset").on("click",p)[0],u=c(l).on("focus",x).closest("fieldset").on("click",x)[0],c(o).change(m),m(),s.watchtext(l,function(n){c(l.form).triggerHandler("change")}),{val:function(){var n=b();return n?s.locale.parse(n):s.locale.clone({lang:"zxx"})}});function h(){return o[0].checked}function p(){y(o[0].checked=!0)}function x(){l.value\|\|(l.value=b()),y(!(o[1].checked=!0))}function b(){var n=c~~(h(~~)~~?a:l).serializeArray();return~~ ~~n[0]&&n[0].value\|\|""}function m()~~{return y(h()),!0}function y(n){l.disabled=n,a.disabled=!n,u.className=n?"disabled":"active",r.className=n?"active":"disabled",I()}var z,A=(z=d["select-path"],{val:function(){var n=k("path");return n&&n.value},txt:function(){var n=k("path");return n&&c(n.parentNode).find("code.path").text()}});function k(n){var t=function(){var n=c(z).serializeArray()[0];return n&&n.value\|\|null}();return t&&d[n+"["+t+"]"]}function w(e){c(d).find("button.button-primary").each(function(n,t){t.disabled=e})}function I(){var n=g&&g.val(),t=n&&n.isValid()&&"zxx"!==n.lang,e=A&&A.val(),a=t&&e;if(j(n),w(!0),a){var c=A.txt();c!==i?(i=c,f.path.value=i,v.listen(N).connect()):w(!1)}}function N(n){w(!n)}function j(e){var n=c(d),t=e&&e.toString("_")\|\|"",a=t?"zxx"===t?"{locale}":t:"{invalid}";n.find("code.path span").each(function(n,t){t.textContent=a}),n.find("span.lang").each(function(n,t){!function(n,t){t&&"zxx"!==t.lang?(n.setAttribute("lang",t.lang),n.setAttribute("class",t.getIcon())):(n.setAttribute("lang",""),n.setAttribute("class","lang nolang"))}(t,e)})}function B(n){var t=n&&n.redirect;t&&location.assign(t)}c(d).on("change",I).on("submit",function(n){return n.preventDefault(),v.applyCreds(d),s.ajax.submit(n.target,B),!1}),j(g.val())}(window,document,jQuery);


1	+ !function(n, t, c) {
2	+ var i, e, a, l, o, r, u, s = n.loco, f = t.getElementById("loco-fs"), d = t.getElementById("loco-poinit"), v = f && s.fs.init(f), g = (a = (e = d)["select-locale"],
3	+ l = e["custom-locale"], o = e["use-selector"], r = c(a).on("focus", p).closest("fieldset").on("click", p)[0],
4	+ u = c(l).on("focus", x).closest("fieldset").on("click", x)[0], c(o).change(m), m(),
5	+ s.watchtext(l, function(n) {
6	+ c(l.form).triggerHandler("change");
7	+ }), {
8	+ val: function() {
9	+ var n = b();
10	+ return n ? s.locale.parse(n) : s.locale.clone({
11	+ lang: "zxx"
12	+ });
13	+ }
14	+ });
15	+ function h() {
16	+ return o[0].checked;
17	+ }
18	+ function p() {
19	+ y(o[0].checked = !0);
20	+ }
21	+ function x() {
22	+ l.value \|\| (l.value = b()), y(!(o[1].checked = !0));
23	+ }
24	+ function b() {
25	+ var n = c(h() ? a : l).serializeArray();
26	+ return n[0] && n[0].value \|\| "";
27	+ }
28	+ function m() {
29	+ return y(h()), !0;
30	+ }
31	+ function y(n) {
32	+ l.disabled = n, a.disabled = !n, u.className = n ? "disabled" : "active", r.className = n ? "active" : "disabled",
33	+ I();
34	+ }
35	+ var z, A = (z = d["select-path"], {
36	+ val: function() {
37	+ var n = k("path");
38	+ return n && n.value;
39	+ },
40	+ txt: function() {
41	+ var n = k("path");
42	+ return n && c(n.parentNode).find("code.path").text();
43	+ }
44	+ });
45	+ function k(n) {
46	+ var t = function() {
47	+ var n = c(z).serializeArray()[0];
48	+ return n && n.value \|\| null;
49	+ }();
50	+ return t && d[n + "[" + t + "]"];
51	+ }
52	+ function w(e) {
53	+ c(d).find("button.button-primary").each(function(n, t) {
54	+ t.disabled = e;
55	+ });
56	+ }
57	+ function I() {
58	+ var n = g && g.val(), t = n && n.isValid() && "zxx" !== n.lang, e = A && A.val(), a = t && e;
59	+ if (j(n), w(!0), a) {
60	+ var c = A.txt();
61	+ c !== i ? (i = c, f.path.value = i, v.listen(N).connect()) : w(!1);
62	+ }
63	+ }
64	+ function N(n) {
65	+ w(!n);
66	+ }
67	+ function j(e) {
68	+ var n = c(d), t = e && e.toString("_") \|\| "", a = t ? "zxx" === t ? "{locale}" : t : "{invalid}";
69	+ n.find("code.path span").each(function(n, t) {
70	+ t.textContent = a;
71	+ }), n.find("span.lang").each(function(n, t) {
72	+ !function(n, t) {
73	+ t && "zxx" !== t.lang ? (n.setAttribute("lang", t.lang), n.setAttribute("class", t.getIcon())) : (n.setAttribute("lang", ""),
74	+ n.setAttribute("class", "lang nolang"));
75	+ }(t, e);
76	+ });
77	+ }
78	+ function B(n) {
79	+ var t = n && n.redirect;
80	+ t && location.assign(t);
81	+ }
82	+ c(d).on("change", I).on("submit", function(n) {
83	+ return n.preventDefault(), v.applyCreds(d), s.ajax.submit(n.target, B), !1;
84	+ }), j(g.val());
85	+ }(window, document, jQuery);

pub/js/min/potinit.js CHANGED Viewed

	@@ -1 +1,10 @@
1	- !function(t,~~n,e){var~~ ~~o=t.loco,i=~~n~~.getElementById("loco-fs")~~,~~r=n.getElementById("loco-potinit");function~~ ~~c(t~~)~~{var~~ ~~n=t&&t.redirect;n&&location.assign(n)}e(r).on("submit",function(t)~~{~~return t.preventDefault(),o.ajax.submit(t.target,c),!1}),i&&o.fs.init(i).setForm(r)}(window,document,jQuery);~~


1	+ !function(t, n, e) {
2	+ var o = t.loco, i = n.getElementById("loco-fs"), r = n.getElementById("loco-potinit");
3	+ function c(t) {
4	+ var n = t && t.redirect;
5	+ n && location.assign(n);
6	+ }
7	+ e(r).on("submit", function(t) {
8	+ return t.preventDefault(), o.ajax.submit(t.target, c), !1;
9	+ }), i && o.fs.init(i).setForm(r);
10	+ }(window, document, jQuery);

pub/js/min/poview.js CHANGED Viewed

	@@ -1 +1,37 @@
1	- !function(e,~~o,f){var~~ ~~a,c,i,l,r,p,n,s,u,d=e.loco,t=d.conf,h=d.po.ref.init(d,t),v=~~o~~.getElementById("loco-po");function g(){r.length&&(p.push([i~~,~~l]),c.push(r),r=[]),i=null}function~~ ~~m(t){return~~ f~~('<ol class="msgcat"></ol>'~~)~~.attr("start",t).appendTo(a)}function~~ ~~x(t)~~{n!==t&&(f("#loco-content")[t?"removeClass":"addClass"]("loco-invalid"),n=t)}a=v,c=d.fulltext.init(),r=[],p=[],s=!(n=!0),(u=f(a).find("li")).each(function(t,n){var e,o=f(n);o.find("span.po-none").length?g():(l=t,null==i&&(i=t),(e=o.find(".po-text").text())&&(r=r.concat(e.replace(/\\[ntvfab\\"]/g," ").split(" "))))}),g(),d.watchtext(f(a.parentNode).find("form.loco-filter")[0].q,function(t){t?function(t){var n,e,o,i=c.find(t),l=-1,r=i.length;if(f("ol",a).remove(),r){for(;++l<r;)for(o=m((n=(e=p[i[l]])[0])+1);n<=e[1];n++)o.append(u[n]);x(!0)}else x(!1),m(0).append(f("<li></li>").text(d.l10n._("Nothing matches the text filter")));s=!0,C()}(t):s&&(x(!0),s=!1,f("ol",a).remove(),m(1).append(u),C())}),f(v).removeClass("loco-loading");var w,y,C=(y=v.clientHeight-2,function(){var t=function(t,n){for(var e=t.offsetTop\|\|0;(t=t.offsetParent)&&t!==n;)e+=t.offsetTop\|\|0;return e}(v,o.body),n=e.innerHeight-t-20;w!==n&&(v.style.height=n<y?String(n)+"px":"",w=n)});C(),f(e).resize(C),f(v).on("click",function(t){var n=t.target;if(n.hasAttribute("href"))return t.preventDefault(),h.load(n.textContent),!1})}(window,document,window.jQuery);


1	+ !function(e, o, f) {
2	+ var a, c, i, l, r, p, n, s, u, d = e.loco, t = d.conf, h = d.po.ref.init(d, t), v = o.getElementById("loco-po");
3	+ function g() {
4	+ r.length && (p.push([ i, l ]), c.push(r), r = []), i = null;
5	+ }
6	+ function m(t) {
7	+ return f('<ol class="msgcat"></ol>').attr("start", t).appendTo(a);
8	+ }
9	+ function x(t) {
10	+ n !== t && (f("#loco-content")[t ? "removeClass" : "addClass"]("loco-invalid"),
11	+ n = t);
12	+ }
13	+ a = v, c = d.fulltext.init(), r = [], p = [], s = !(n = !0), (u = f(a).find("li")).each(function(t, n) {
14	+ var e, o = f(n);
15	+ o.find("span.po-none").length ? g() : (l = t, null == i && (i = t), (e = o.find(".po-text").text()) && (r = r.concat(e.replace(/\\[ntvfab\\"]/g, " ").split(" "))));
16	+ }), g(), d.watchtext(f(a.parentNode).find("form.loco-filter")[0].q, function(t) {
17	+ t ? function(t) {
18	+ var n, e, o, i = c.find(t), l = -1, r = i.length;
19	+ if (f("ol", a).remove(), r) {
20	+ for (;++l < r; ) for (o = m((n = (e = p[i[l]])[0]) + 1); n <= e[1]; n++) o.append(u[n]);
21	+ x(!0);
22	+ } else x(!1), m(0).append(f("<li></li>").text(d.l10n._("Nothing matches the text filter")));
23	+ s = !0, C();
24	+ }(t) : s && (x(!0), s = !1, f("ol", a).remove(), m(1).append(u), C());
25	+ }), f(v).removeClass("loco-loading");
26	+ var w, y, C = (y = v.clientHeight - 2, function() {
27	+ var t = function(t, n) {
28	+ for (var e = t.offsetTop \|\| 0; (t = t.offsetParent) && t !== n; ) e += t.offsetTop \|\| 0;
29	+ return e;
30	+ }(v, o.body), n = e.innerHeight - t - 20;
31	+ w !== n && (v.style.height = n < y ? String(n) + "px" : "", w = n);
32	+ });
33	+ C(), f(e).resize(C), f(v).on("click", function(t) {
34	+ var n = t.target;
35	+ if (n.hasAttribute("href")) return t.preventDefault(), h.load(n.textContent), !1;
36	+ });
37	+ }(window, document, window.jQuery);

pub/js/min/setup.js CHANGED Viewed

	@@ -1 +1,51 @@
1	- !function(e,~~o,a){function~~ ~~n(e,~~o,~~n){function~~ ~~r(){i("Failed to contact remote API"),c=null}function u(){c&&(clearTimeout(c),c=null)}var c=setTimeout(r,3e3);return i(""),~~a~~.ajax({url:s.apiUrl+"/"+e+"/"+o+".jsonp?version="+encodeURIComponent(n~~)~~,dataType:"jsonp",success:function(e,o,n){if(c){u();var~~ ~~t=e&&e.exact;o=e&&e.status;t?function(e)~~{d["json-content"].value=e,a("#loco-remote-empty").hide(),a("#loco-remote-found").show()}(t):404===o?i("Sorry, we don't know a bundle by this name"):(l.notices.error(e.error\|\|"Unknown server error"),r())}},error:function(){c&&(u(),r())},cache:!0}),{abort:u}}function i(e){d["json-content"].value="",a("#loco-remote-empty").show().find("span").text(e),a("#loco-remote-found").hide().removeClass("jshide")}var t,l=e.loco,s=l.conf\|\|{},d=o.getElementById("loco-remote");a(d).find('button[type="button"]').on("click",function(e){return e.preventDefault(),t&&t.abort(),t=n(d.vendor.value,d.slug.value,d.version.value),!1}),a(d).find('input[type="reset"]').on("click",function(e){return e.preventDefault(),i(""),!1}),a.ajax({url:s.apiUrl+"/vendors.jsonp",dataType:"jsonp",success:function(e){for(var o,n,t=-1,r=e.length,u=a(d.vendor).html("");++t<r;)o=e[t][0],n=e[t][1],u.append(a("<option></option>").attr("value",o).text(n))},cache:!0})}(window,document,jQuery);


1	+ !function(e, o, a) {
2	+ function n(e, o, n) {
3	+ function r() {
4	+ i("Failed to contact remote API"), c = null;
5	+ }
6	+ function u() {
7	+ c && (clearTimeout(c), c = null);
8	+ }
9	+ var c = setTimeout(r, 3e3);
10	+ return i(""), a.ajax({
11	+ url: s.apiUrl + "/" + e + "/" + o + ".jsonp?version=" + encodeURIComponent(n),
12	+ dataType: "jsonp",
13	+ success: function(e, o, n) {
14	+ if (c) {
15	+ u();
16	+ var t = e && e.exact;
17	+ o = e && e.status;
18	+ t ? function(e) {
19	+ d["json-content"].value = e, a("#loco-remote-empty").hide(), a("#loco-remote-found").show();
20	+ }(t) : 404 === o ? i("Sorry, we don't know a bundle by this name") : (l.notices.error(e.error \|\| "Unknown server error"),
21	+ r());
22	+ }
23	+ },
24	+ error: function() {
25	+ c && (u(), r());
26	+ },
27	+ cache: !0
28	+ }), {
29	+ abort: u
30	+ };
31	+ }
32	+ function i(e) {
33	+ d["json-content"].value = "", a("#loco-remote-empty").show().find("span").text(e),
34	+ a("#loco-remote-found").hide().removeClass("jshide");
35	+ }
36	+ var t, l = e.loco, s = l.conf \|\| {}, d = o.getElementById("loco-remote");
37	+ a(d).find('button[type="button"]').on("click", function(e) {
38	+ return e.preventDefault(), t && t.abort(), t = n(d.vendor.value, d.slug.value, d.version.value),
39	+ !1;
40	+ }), a(d).find('input[type="reset"]').on("click", function(e) {
41	+ return e.preventDefault(), i(""), !1;
42	+ }), a.ajax({
43	+ url: s.apiUrl + "/vendors.jsonp",
44	+ dataType: "jsonp",
45	+ success: function(e) {
46	+ for (var o, n, t = -1, r = e.length, u = a(d.vendor).html(""); ++t < r; ) o = e[t][0],
47	+ n = e[t][1], u.append(a("<option></option>").attr("value", o).text(n));
48	+ },
49	+ cache: !0
50	+ });
51	+ }(window, document, jQuery);

pub/js/min/upload.js CHANGED Viewed

	@@ -1 +1,47 @@
1	- !function(o,~~n,t){var~~ ~~e,i,r,a=o.loco,u=(a&&a.conf\|\|{}).multipart&&o.FormData&&o.Blob,c=~~n~~.getElementById("loco-fs")~~,~~f=n.getElementById("loco-main");function~~ ~~l(e){var n=~~t(f)~~.find("button.button-primary");return~~ ~~n.each(function(n,t)~~{t.disabled=e}),n}function d(){l(!0).addClass("loco-loading")}function s(n){l(n).removeClass("loco-loading")}function m(){f.path.value=i+"/"+r,d(),e.connect()}function v(){return i&&r&&e.authed()}function p(n,t,e){n.redirect?(s(!0),o.location.assign(n.redirect)):s(!1)}function g(){s(!1)}c&&f&&(e=o.loco.fs.init(c).setForm(f).listen(function(n){s(!(n&&i&&r))}),t(f).change(function(n){r=String(f.f.value).split(/[\\\/]/).pop();var t,e=n.target\|\|{};if("dir"===e.name&&e.checked){if((t=e.value)&&t!==i&&(i=t,r))return void m()}else if("f"===e.name&&i)return void m();l(!v())}).submit(function(n){if(v()){if(u){n.preventDefault();var t=new FormData(f);return d(),a.ajax.post("upload",t,p,g),!1}return!0}return n.preventDefault(),!1}))}(window,document,window.jQuery);


1	+ !function(o, n, t) {
2	+ var e, i, r, a = o.loco, u = (a && a.conf \|\| {}).multipart && o.FormData && o.Blob, c = n.getElementById("loco-fs"), f = n.getElementById("loco-main");
3	+ function l(e) {
4	+ var n = t(f).find("button.button-primary");
5	+ return n.each(function(n, t) {
6	+ t.disabled = e;
7	+ }), n;
8	+ }
9	+ function d() {
10	+ l(!0).addClass("loco-loading");
11	+ }
12	+ function s(n) {
13	+ l(n).removeClass("loco-loading");
14	+ }
15	+ function m() {
16	+ f.path.value = i + "/" + r, d(), e.connect();
17	+ }
18	+ function v() {
19	+ return i && r && e.authed();
20	+ }
21	+ function p(n, t, e) {
22	+ n.redirect ? (s(!0), o.location.assign(n.redirect)) : s(!1);
23	+ }
24	+ function g() {
25	+ s(!1);
26	+ }
27	+ c && f && (e = o.loco.fs.init(c).setForm(f).listen(function(n) {
28	+ s(!(n && i && r));
29	+ }), t(f).change(function(n) {
30	+ r = String(f.f.value).split(/[\\\/]/).pop();
31	+ var t, e = n.target \|\| {};
32	+ if ("dir" === e.name && e.checked) {
33	+ if ((t = e.value) && t !== i && (i = t, r)) return void m();
34	+ } else if ("f" === e.name && i) return void m();
35	+ l(!v());
36	+ }).submit(function(n) {
37	+ if (v()) {
38	+ if (u) {
39	+ n.preventDefault();
40	+ var t = new FormData(f);
41	+ return d(), a.ajax.post("upload", t, p, g), !1;
42	+ }
43	+ return !0;
44	+ }
45	+ return n.preventDefault(), !1;
46	+ }));
47	+ }(window, document, window.jQuery);

readme.txt CHANGED Viewed

	@@ -3,8 +3,8 @@ Contributors: timwhitlock
3	Tags: translation, translators, localization, localisation, l10n, i18n, Gettext, PO, MO, productivity, multilingual, internationalization
4	Requires at least: 4.1
5	Requires PHP: 5.2.4
6	- Tested up to: 5.7
7	- Stable tag: 2.5.2
8	License: GPLv2 or later
9	License URI: http://www.gnu.org/licenses/gpl-2.0.html
10
	@@ -100,6 +100,16 @@ We don't collect your data or snoop on you. See the [plugin privacy notice](http
100
101	== Changelog ==
102










103	= 2.5.2 =
104	* Added implied formality and loco_locale_formality filter
105	* Added cli fetch command (experimental)
	@@ -412,7 +422,7 @@ We don't collect your data or snoop on you. See the [plugin privacy notice](http
412
413	== Upgrade Notice ==
414
415	- = 2.5.2 =
416	* Various improvements and bugfixes
417
418


3	Tags: translation, translators, localization, localisation, l10n, i18n, Gettext, PO, MO, productivity, multilingual, internationalization
4	Requires at least: 4.1
5	Requires PHP: 5.2.4
6	+ Tested up to: 5.7.1
7	+ Stable tag: 2.5.3
8	License: GPLv2 or later
9	License URI: http://www.gnu.org/licenses/gpl-2.0.html
10

100
101	== Changelog ==
102
103	+ = 2.5.3 =
104	+ * Adds option to merge JSON translations when syncing from PO
105	+ * Adds screen for editing file headers and sync options
106	+ * Fix for missing responseText in failed Ajax responses
107	+ * Fix for HTML entities returned from `number_format_i18n`
108	+ * Localized number formatting in JavaScript
109	+ * Replaced usage of date_i18n with wp_date
110	+ * Added configurable API endpoint for DeepL
111	+ * Bumped WordPress version to 5.7.2
112	+
113	= 2.5.2 =
114	* Added implied formality and loco_locale_formality filter
115	* Added cli fetch command (experimental)

422
423	== Upgrade Notice ==
424
425	+ = 2.5.3 =
426	* Various improvements and bugfixes
427
428

src/admin/config/ApisController.php CHANGED Viewed

	@@ -63,6 +63,7 @@ class Loco_admin_config_ApisController extends Loco_admin_config_BaseController
63	// common ui elements / labels
64	$this->set( 'ui', new Loco_mvc_ViewParams( array(
65	'api_key' => __('API key','loco-translate'),

66	'api_region' => __('API region','loco-translate'),
67	) ) );
68


63	// common ui elements / labels
64	$this->set( 'ui', new Loco_mvc_ViewParams( array(
65	'api_key' => __('API key','loco-translate'),
66	+ 'api_url' => __('API URL','loco-translate'),
67	'api_region' => __('API region','loco-translate'),
68	) ) );
69

src/admin/file/DiffController.php CHANGED Viewed

	@@ -92,8 +92,9 @@ class Loco_admin_file_DiffController extends Loco_admin_file_BaseController {
92	// $info['mtime'] = $backups->getTimestamp($path);
93	// pull "real" update time, meaning when the revision was last updated as current version
94	try {
95	- $head = Loco_gettext_Data::head($tmp)~~->getHeaders()~~;
96	- ~~if(~~ $value = $head->trimmed($podate) ){

97	$info['potime'] = Loco_gettext_Data::parseDate($value);
98	}
99	else {


92	// $info['mtime'] = $backups->getTimestamp($path);
93	// pull "real" update time, meaning when the revision was last updated as current version
94	try {
95	+ $head = Loco_gettext_Data::head($tmp);
96	+ $value = $head->trimmed($podate);
97	+ if( '' !== $value ){
98	$info['potime'] = Loco_gettext_Data::parseDate($value);
99	}
100	else {

src/admin/file/EditController.php CHANGED Viewed

	@@ -90,15 +90,12 @@ class Loco_admin_file_EditController extends Loco_admin_file_BaseController {
90	$syncmode = null;
91	$locale = $this->getLocale();
92	if( $locale instanceof Loco_Locale ){
93	- // alternative POT file may be forced by PO ~~headers~~
94	- if( $head~~->has('X-Loco-Template'~~) ){
95	- $~~potfile~~ = ~~new Loco_fs_File~~( ~~$head['X-Loco-Template']~~ );


96	$potfile->normalize( $bundle->getDirectoryPath() );
97	- // sync mode permits copying of translations since 2.4.3
98	- // legacy sync behaviour was copy msgstr fields when they exist (no strip)
99	- if( $head->has('X-Loco-Template-Mode') ){
100	- $syncmode = $head['X-Loco-Template-Mode'];
101	- }
102	}
103	// else use project-configured template, assuming there is one
104	// no way to get configured POT if invalid project
	@@ -161,7 +158,8 @@ class Loco_admin_file_EditController extends Loco_admin_file_BaseController {
161	else if( 1 === $settings->pot_protect ){
162	Loco_error_AdminNotices::warn( __("This is NOT a translation file. Manual editing of source strings is not recommended.",'loco-translate') )
163	->addLink( Loco_mvc_AdminRouter::generate('config').'#loco--pot-protect', __('Settings','loco-translate') )
164	- ->addLink( apply_filters('loco_external','https://localise.biz/wordpress/plugin/manual/templates'), __('Documentation','loco-translate') );

165	}
166	}
167


90	$syncmode = null;
91	$locale = $this->getLocale();
92	if( $locale instanceof Loco_Locale ){
93	+ // alternative POT file may be forced by sync options
94	+ $sync = new Loco_gettext_SyncOptions($head);
95	+ $syncmode = $sync->getSyncMode();
96	+ if( $sync->hasTemplate() ){
97	+ $potfile = $sync->getTemplate();
98	$potfile->normalize( $bundle->getDirectoryPath() );





99	}
100	// else use project-configured template, assuming there is one
101	// no way to get configured POT if invalid project

158	else if( 1 === $settings->pot_protect ){
159	Loco_error_AdminNotices::warn( __("This is NOT a translation file. Manual editing of source strings is not recommended.",'loco-translate') )
160	->addLink( Loco_mvc_AdminRouter::generate('config').'#loco--pot-protect', __('Settings','loco-translate') )
161	+ ->addLink( apply_filters('loco_external','https://localise.biz/wordpress/plugin/manual/templates'), __('Documentation','loco-translate') )
162	+ ->noLog();
163	}
164	}
165

src/admin/file/HeadController.php ADDED Viewed

	@@ -0,0 +1,169 @@


1	+ <?php
2	+ /**
3	+ * Controller to edit PO file header values and sync settings
4	+ */
5	+ class Loco_admin_file_HeadController extends Loco_admin_file_BaseController {
6	+
7	+
8	+ /**
9	+ * {@inheritdoc}
10	+ */
11	+ public function init(){
12	+ parent::init();
13	+ $file = $this->get('file');
14	+ /* @var Loco_fs_File $file */
15	+ if( $file->exists() && ! $file->isDirectory() ){
16	+ // nonce action will be specific to file for extra security
17	+ $path = $file->getPath();
18	+ $action = 'head:'.$path;
19	+ // set up view now in case of late failure
20	+ $fields = new Loco_mvc_HiddenFields( array() );
21	+ $fields->setNonce( $action );
22	+ $fields['auth'] = 'update';
23	+ $fields['path'] = $this->get('path');
24	+ $this->set('hidden',$fields );
25	+ // attempt update if valid nonce posted back
26	+ while( $this->checkNonce($action) ) {
27	+ $data = Loco_gettext_Data::load($file);
28	+ // check some headers prior ro updating
29	+ $head = $data->getHeaders();
30	+ $plurals = $head['Plural-Forms'];
31	+ // in advanced mode we will set all headers from form as-is.
32	+ $post = Loco_mvc_PostParams::get();
33	+ if( $post->has('headers') ){
34	+ $raw = (array) $post->headers;
35	+ $head = new LocoPoHeaders($raw);
36	+ $data->setHeaders($head);
37	+ // modifying character encoding is not currently supported
38	+ if( 'UTF-8' !== $head->getCharset() ){
39	+ Loco_error_AdminNotices::warn('Loco Translate only supports UTF-8 encoded files');
40	+ $head['Content-Type'] = 'text/plain; charset=UTF-8';
41	+ }
42	+ }
43	+ // in basic mode we save PO sync settings only
44	+ else if( 'po' !== $file->extension() ){
45	+ throw new Exception( 'Sync settings apply to PO files only' );
46	+ }
47	+ else if( ! $post->has('conf') ){
48	+ throw new Exception( 'Unexpected post data' );
49	+ }
50	+ else {
51	+ $conf = new Loco_gettext_SyncOptions($head);
52	+ $raw = (array) $post->conf;
53	+ $conf->setTemplate( $raw['template'] );
54	+ $mode = isset($raw['mode']) ? $raw['mode'] : 'pot';
55	+ if( isset($raw['json']) ){
56	+ $mode .= ',json';
57	+ }
58	+ $conf->setSyncMode($mode);
59	+ }
60	+ // Validate and remove redundant headers
61	+ $conf = new Loco_gettext_SyncOptions($head);
62	+ $head = $conf->getHeaders();
63	+ // Render PO without modifying sort order
64	+ if( $file instanceof Loco_fs_LocaleFile && $file->getLocale()->isValid() ){
65	+ $compiler = new Loco_gettext_Compiler($file);
66	+ $compiler->writePo($data);
67	+ // If we save the PO we should recompile MO, but only actually required if plural forms have changed
68	+ if( $head['Plural-Forms'] !== $plurals ){
69	+ $compiler->writeMo($data);
70	+ }
71	+ }
72	+ // else save just the actual file. Probably .pot, or wrongly named .po file.
73	+ else {
74	+ $api = new Loco_api_WordPressFileSystem;
75	+ $api->authorizeUpdate($file);
76	+ $file->putContents( $data->msgcat() );
77	+ }
78	+ // flash message for display after redirect
79	+ try {
80	+ Loco_data_Session::get()->flash('success',sprintf( __('%s file saved','loco-translate'), strtoupper($file->extension()) ));
81	+ Loco_data_Session::close();
82	+ }
83	+ catch( Exception $e ){
84	+ // tolerate session failure
85	+ }
86	+ if( wp_redirect($_SERVER['REQUEST_URI']) ){
87	+ exit;
88	+ }
89	+ break;
90	+ }
91	+
92	+ }
93	+
94	+ $bundle = $this->getBundle();
95	+ $this->set('title', 'Configure '.$file->basename().' &lsaquo; '.$bundle->getName() );
96	+ }
97	+
98	+
99	+
100	+
101	+ /**
102	+ * {@inheritdoc}
103	+ */
104	+ public function render(){
105	+
106	+ $file = $this->get('file');
107	+ $fail = $this->getFileError($file);
108	+ if( is_string($fail) && '' !== $fail ){
109	+ return $fail;
110	+ }
111	+
112	+ // parse PO header
113	+ $head = Loco_gettext_Data::head($file);
114	+ $this->set('head',$head);
115	+
116	+ // Remote file system required if file is not directly writable
117	+ $this->prepareFsConnect( 'update', $this->get('path') );
118	+ $this->enqueueScript('head');
119	+
120	+ // set simpler title for breadcrumb
121	+ $this->set('title', $file->basename() );
122	+
123	+ // localized files only can have sync settings
124	+ $localized = $file instanceof Loco_fs_LocaleFile && $file->getLocale()->isValid();
125	+
126	+ // Advanced mode shows all headers in one form
127	+ if( $this->get('advanced') \|\| ! $localized ){
128	+ return $this->view('admin/file/head');
129	+ }
130	+
131	+ // link to advanced mode and display sync settings form (PO only)
132	+ $this->set('advanced', $_SERVER['REQUEST_URI'].'&advanced=1' );
133	+
134	+ $conf = new Loco_gettext_SyncOptions($head);
135	+ $this->set('conf', $conf );
136	+
137	+ // perform some basic validation of sync mode
138	+ if( $conf->hasTemplate() ){
139	+ $potfile = $conf->getTemplate();
140	+ }
141	+ else {
142	+ $potfile = new Loco_fs_LocaleFile( (string) $this->getProject()->getPot() );
143	+ }
144	+ if( $conf->mergeMsgstr() && 'po' !== $potfile->extension() ){
145	+ Loco_error_AdminNotices::warn('Copying translations requires template is a PO file');
146	+ }
147	+ if( $conf->mergeJson() && ! $potfile->getLocale()->isValid() ){
148	+ Loco_error_AdminNotices::warn('Merging JSON files requires template has a localized file path');
149	+ }
150	+
151	+ // may or may not already have a custom template with a known locale
152	+ $this->set('potName','--');
153	+ if( $conf->hasTemplate() ){
154	+ $file = $conf->getTemplate();
155	+ $file->normalize( $this->getBundle()->getDirectoryPath() );
156	+ if( ! $file->exists() ){
157	+ Loco_error_AdminNotices::warn('Configured template does not currently exist');
158	+ }
159	+ $this->set('potName', $file->basename() );
160	+ }
161	+ // force basic POT mode for unconfigured templates
162	+ else if( '' === $conf->getSyncMode() ){
163	+ $conf->setSyncMode('pot');
164	+ }
165	+
166	+ return $this->view('admin/file/conf');
167	+ }
168	+
169	+ }

src/admin/file/InfoController.php CHANGED Viewed

	@@ -32,7 +32,7 @@ class Loco_admin_file_InfoController extends Loco_admin_file_BaseController {
32	* {@inheritdoc}
33	*/
34	public function render(){
35	- /* @var ~~Loco_fs_File~~ $file */
36	$file = $this->get('file');
37	$name = $file->basename();
38	$this->set('title', $name );
	@@ -76,7 +76,10 @@ class Loco_admin_file_InfoController extends Loco_admin_file_BaseController {
76	) );
77	$args->setNonce('download');
78	$finfo['download'] = $args->getHref( admin_url('admin-ajax.php','relative') );
79	-



80	// collect note worthy problems with file headers
81	$debugging = loco_debugging();
82	$debug = array();
	@@ -110,7 +113,6 @@ class Loco_admin_file_InfoController extends Loco_admin_file_BaseController {
110	// don't attempt to pull locale of template file
111	if( 'pot' !== $ext && ! $isTemplate ){
112	$locale = $file->getLocale();
113	- $code = (string) $locale;
114	if( $locale->isValid() ){
115	// find PO/MO counter parts
116	if( 'po' === $ext ){
	@@ -143,8 +145,9 @@ class Loco_admin_file_InfoController extends Loco_admin_file_BaseController {
143	$meta = Loco_gettext_Metadata::create($file,$data);
144	$this->set( 'meta', $meta );
145	// allow PO header to specify alternative template for sync
146	- if( $head~~->has('X-Loco-Template'~~) ){
147	- $~~altpot = new Loco_fs_File~~(~~$head['X-Loco-Template']~~);

148	$altpot->normalize( $this->getBundle()->getDirectoryPath() );
149	if( $altpot->exists() && ( ! $template \|\| ! $template->equal($altpot) ) ){
150	$template = $altpot;
	@@ -168,13 +171,14 @@ class Loco_admin_file_InfoController extends Loco_admin_file_BaseController {
168	}
169	// Language header sanity checks, raising developer (debug) warnings
170	if( $locale ){
171	- ~~if(~~ $value = $head['Language'] ){
172	- ~~$check~~ = ~~(string)~~ ~~Loco_Locale::parse(~~$value);
173	- if( $~~check~~ !== $~~code~~ ){
174	- $debug[]= sprintf( __('Language header is "%s" but file name contains "%s"','loco-translate'), $value, $~~code~~ );
175	}
176	}
177	- ~~if(~~ $value = $head['Plural-Forms'] ){

178	try {
179	$locale->setPluralFormsHeader($value);
180	}


32	* {@inheritdoc}
33	*/
34	public function render(){
35	+ /* @var Loco_fs_LocaleFile $file */
36	$file = $this->get('file');
37	$name = $file->basename();
38	$this->set('title', $name );

76	) );
77	$args->setNonce('download');
78	$finfo['download'] = $args->getHref( admin_url('admin-ajax.php','relative') );
79	+
80	+ // allow link to modify headers/settings
81	+ $finfo['configure'] = str_replace('file-info','file-head',$_SERVER['REQUEST_URI']);
82	+
83	// collect note worthy problems with file headers
84	$debugging = loco_debugging();
85	$debug = array();

113	// don't attempt to pull locale of template file
114	if( 'pot' !== $ext && ! $isTemplate ){
115	$locale = $file->getLocale();

116	if( $locale->isValid() ){
117	// find PO/MO counter parts
118	if( 'po' === $ext ){

145	$meta = Loco_gettext_Metadata::create($file,$data);
146	$this->set( 'meta', $meta );
147	// allow PO header to specify alternative template for sync
148	+ $opts = new Loco_gettext_SyncOptions($head);
149	+ if( $opts->hasTemplate() ){
150	+ $altpot = $opts->getTemplate();
151	$altpot->normalize( $this->getBundle()->getDirectoryPath() );
152	if( $altpot->exists() && ( ! $template \|\| ! $template->equal($altpot) ) ){
153	$template = $altpot;

171	}
172	// Language header sanity checks, raising developer (debug) warnings
173	if( $locale ){
174	+ $value = $head->trimmed('Language');
175	+ if( '' !== $value ){
176	+ if( Loco_Locale::parse($value)->__toString() !== $locale->__toString() ){
177	+ $debug[]= sprintf( __('Language header is "%s" but file name contains "%s"','loco-translate'), $value, $locale );
178	}
179	}
180	+ $value = $head->trimmed('Plural-Forms');
181	+ if( '' !== $value ){
182	try {
183	$locale->setPluralFormsHeader($value);
184	}

src/ajax/MsginitController.php CHANGED Viewed

@@ -59,27 +59,36 @@ class Loco_ajax_MsginitController extends Loco_ajax_common_BundleController {
                     if( $mofile->exists() ){
                         throw new Loco_error_Exception( __('MO file exists for this language already. Delete it first','loco-translate') );
+                    }
-            -
-            -
                    /*/ Same for JSON file, but WordPress >= only 5
-            -
                    $jsfile = function_exists('wp_set_script_translations') ? $pofile->cloneExtension('json') : null;
-            -
                    if( $jsfile && $jsfile->exists() ){
-            -
                        throw new Loco_error_Exception( __('JSON file exists for this language already. Delete it first','loco-translate') );
-            -
                    }*/
                     // Permit forcing of any parsable file as strings template
                     $source = (string) $post->source;
                     $compile = false;
                     if( '' !== $source ){
                         $potfile = new Loco_fs_LocaleFile( $source );
                         $potfile->normalize( $base );
                         $data = Loco_gettext_Data::load($potfile);
-            -
                        // Remove target strings when copying PO
-            -
                        if( $post->strip ){
-            -
                            $data->strip();
+                        }
-            -
                        // else we're copying target translations from given file
-            -
                        else {
-            -
                            $compile = true;
+                        }
+                    }
                     // else parse POT file if project defines one that exists
@@ -102,25 +111,31 @@ class Loco_ajax_MsginitController extends Loco_ajax_common_BundleController {
                     if( ! $vers || 'PACKAGE VERSION' === $vers ){
                         $headers['Project-Id-Version'] = $project->getName();
+                    }
-            -
                    // relative path from bundle root to the template/source this file was created from
-            -
                    if( $potfile && $post->link ){
-            -
                        $headers['X-Loco-Template'] = $potfile->getRelativePath( $bundle->getDirectoryPath() );
-            -
                        // legacy behaviour was to sync source AND target strings in the absence of the following
-            -
                        if( $post->strip ){
-            -
                            $headers['X-Loco-Template-Mode'] = 'POT';
-            -
                        }
-            -
                        // without strip argument we need to remember the source PO is effectively a fallback locale
-            -
                        else {
-            -
                            $fallback = $potfile instanceof Loco_fs_LocaleFile ? $potfile->getLocale() : $locale;
                             $headers['X-Loco-Fallback'] = (string) $fallback;
-            -
                            $headers['X-Loco-Template-Mode'] = 'PO';
+                        }
+                    }
-            -
                     // finalize PO data ready to write to new file
                     $locale->ensureName( new Loco_api_WordPressTranslations );
                     $data->localize( $locale, $headers );
                     // compile all files in this set when copying target translation
                     $compiler = new Loco_gettext_Compiler($pofile);
                     if( $compile ){


59	if( $mofile->exists() ){
60	throw new Loco_error_Exception( __('MO file exists for this language already. Delete it first','loco-translate') );
61	}






62
63	// Permit forcing of any parsable file as strings template
64	$source = (string) $post->source;
65	$compile = false;
66	+ $mergejson = false;
67	if( '' !== $source ){
68	+ $translate = ! $post->strip;
69	+ $compile = $translate;
70	$potfile = new Loco_fs_LocaleFile( $source );
71	$potfile->normalize( $base );
72	$data = Loco_gettext_Data::load($potfile);
73	+ // When copying a PO file we may need to augment with JSON strings
74	+ if( $post->json ){
75	+ $mergejson = true;
76	+ $siblings = new Loco_fs_Siblings($potfile);
77	+ $jsons = $siblings->getJsons();
78	+ if( $jsons ){
79	+ $refs = clone $data;
80	+ $merge = new Loco_gettext_Matcher();
81	+ $merge->loadRefs($refs,$translate);
82	+ $merge->loadJsons($jsons);
83	+ // resolve faux merge into empty instance
84	+ $data->clear();
85	+ $merge->mergeValid($refs,$data);
86	+ $merge->mergeAdded($data);
87	+ }
88	}
89	+ // Remove target strings when copying PO without msgstr fields
90	+ if( ! $translate && 'pot' !== $potfile->extension() ){
91	+ $data->strip();
92	}
93	}
94	// else parse POT file if project defines one that exists

111	if( ! $vers \|\| 'PACKAGE VERSION' === $vers ){
112	$headers['Project-Id-Version'] = $project->getName();
113	}
114	+ // fallback header not actually used, but keeping for informational purposes
115	+ if( $potfile instanceof Loco_fs_LocaleFile && $post->link ){
116	+ $fallback = $potfile->getLocale();
117	+ if( $fallback->isValid() ){






118	$headers['X-Loco-Fallback'] = (string) $fallback;

119	}
120	}
121	+
122	// finalize PO data ready to write to new file
123	$locale->ensureName( new Loco_api_WordPressTranslations );
124	$data->localize( $locale, $headers );
125
126	+ // save sync options in PO headers if linked to a custom template.
127	+ if( $potfile && $post->link ){
128	+ $opts = new Loco_gettext_SyncOptions( $data->getHeaders() );
129	+ $opts->setTemplate( $potfile->getRelativePath( $bundle->getDirectoryPath() ) );
130	+ // legacy behaviour was to sync source AND target strings in the absence of the following
131	+ $mode = $post->strip ? 'POT' : 'PO';
132	+ // even if no JSONs were merged we need to keep this option in case JSONs are added in future.
133	+ if( $mergejson ){
134	+ $mode.= ',JSON';
135	+ }
136	+ $opts->setSyncMode($mode);
137	+ }
138	+
139	// compile all files in this set when copying target translation
140	$compiler = new Loco_gettext_Compiler($pofile);
141	if( $compile ){

src/ajax/SyncController.php CHANGED Viewed

	@@ -57,6 +57,10 @@ class Loco_ajax_SyncController extends Loco_mvc_AjaxController {
57	$potfile = null;
58	}
59




60	// Parse existing POT for source
61	if( $potfile ){
62	$this->set('pot', $potfile->basename() );
	@@ -68,8 +72,16 @@ class Loco_ajax_SyncController extends Loco_mvc_AjaxController {
68	throw new Loco_error_ParseException( sprintf( __('Translation template is invalid (%s)','loco-translate'), $potfile->basename() ) );
69	}
70	// Only copy msgstr fields from source if it's a user-defined PO template and "copy translations" was selected.
71	- $~~strip~~ = (~~bool~~) ~~$post->strip~~;
72	- $~~translate~~ ~~= 'pot' !==~~ $~~potfile~~->~~extension(~~) ~~&& ! $strip~~;








73	}
74	// else extract POT from source code
75	else {
	@@ -90,12 +102,13 @@ class Loco_ajax_SyncController extends Loco_mvc_AjaxController {
90	}
91	// Have source strings. These cannot contain any translations.
92	$source = $extr->includeMeta()->getTemplate($domain);
93	- $translate = false;
94	}
95
96	// establish on back end what strings will be added, removed, and which could be fuzzy-matches
97	$matcher = new Loco_gettext_Matcher;
98	$matcher->loadRefs($source,$translate);


99	// Fuzzy matching only applies to syncing PO files. POT files will always do hard sync (add/remove)
100	if( 'po' === $type ){
101	$fuzziness = Loco_data_Settings::get()->fuzziness;


57	$potfile = null;
58	}
59
60	+ // defaults: no msgstr and no json
61	+ $translate = false;
62	+ $syncjsons = array();
63	+
64	// Parse existing POT for source
65	if( $potfile ){
66	$this->set('pot', $potfile->basename() );

72	throw new Loco_error_ParseException( sprintf( __('Translation template is invalid (%s)','loco-translate'), $potfile->basename() ) );
73	}
74	// Only copy msgstr fields from source if it's a user-defined PO template and "copy translations" was selected.
75	+ $opts = new Loco_gettext_SyncOptions( new LocoPoHeaders );
76	+ $opts->setSyncMode( $post->mode );
77	+ if( 'pot' !== $potfile->extension() ){
78	+ $translate = $opts->mergeMsgstr();
79	+ }
80	+ // related JSONs will only wor if source is a localized PO.
81	+ if( $opts->mergeJson() ){
82	+ $siblings = new Loco_fs_Siblings($potfile);
83	+ $syncjsons = $siblings->getJsons();
84	+ }
85	}
86	// else extract POT from source code
87	else {

102	}
103	// Have source strings. These cannot contain any translations.
104	$source = $extr->includeMeta()->getTemplate($domain);

105	}
106
107	// establish on back end what strings will be added, removed, and which could be fuzzy-matches
108	$matcher = new Loco_gettext_Matcher;
109	$matcher->loadRefs($source,$translate);
110	+ // merging JSONs must be done before fuzzy matching as it may add source strings
111	+ $matcher->loadJsons($syncjsons);
112	// Fuzzy matching only applies to syncing PO files. POT files will always do hard sync (add/remove)
113	if( 'po' === $type ){
114	$fuzziness = Loco_data_Settings::get()->fuzziness;

src/api/Providers.php CHANGED Viewed

	@@ -24,6 +24,7 @@ abstract class Loco_api_Providers {
24	'id' => 'deepl',
25	'name' => 'DeepL Translator',
26	'key' => $settings->offsetGet('deepl_api_key'),

27	),
28	array (
29	'id' => 'google',


24	'id' => 'deepl',
25	'name' => 'DeepL Translator',
26	'key' => $settings->offsetGet('deepl_api_key'),
27	+ 'url' => $settings->offsetGet('deepl_api_url'),
28	),
29	array (
30	'id' => 'google',

src/cli/FetchCommand.php CHANGED Viewed

	@@ -158,7 +158,7 @@ abstract class Loco_cli_FetchCommand {
158	$podata->clear();
159	$stats = $matcher->merge($original,$podata);
160	$original = null;
161	- if( ! $stats['add'] && ! $stats['del'] && ! $stats['fuz'] ){
162	WP_CLI::log( sprintf('%s unchanged in "%s". Skipping %s', $project,$locale,$info->relpath) );
163	continue;
164	}


158	$podata->clear();
159	$stats = $matcher->merge($original,$podata);
160	$original = null;
161	+ if( ! $stats['add'] && ! $stats['del'] && ! $stats['fuz'] && ! $stats['str'] ){
162	WP_CLI::log( sprintf('%s unchanged in "%s". Skipping %s', $project,$locale,$info->relpath) );
163	continue;
164	}

src/cli/SyncCommand.php CHANGED Viewed

	@@ -68,20 +68,17 @@ abstract class Loco_cli_SyncCommand {
68	}
69	// Check if PO defines alternative template (reference)
70	$ref = $pot;
71	- $translate = true;
72	$head = $def->getHeaders();
73	- if( $head~~->has('X-Loco-Template'~~) ){


74	$ref = null;
75	- $potfile = ~~new Loco_fs_File~~( ~~$head['X-Loco-Template']~~ );
76	$potfile->normalize( $base_dir );
77	if( $potfile->exists() ){
78	try {
79	Loco_cli_Utils::debug('> Parsing alternative template: %s',$potfile->getRelativePath($content_dir) );
80	$ref = Loco_gettext_Data::fromSource( $potfile->getContents() );
81	- // Default sync behaviour is to copy msgstr fields unless in POT mode
82	- if( $head->has('X-Loco-Template-Mode') && 'POT' === $head['X-Loco-Template-Mode'] ){
83	- $translate = false;
84	- }
85	}
86	catch( Loco_error_ParseException $e ){
87	WP_CLI::error( $e->getMessage().' in '.$potfile->getRelativePath($content_dir), false );
	@@ -99,6 +96,14 @@ abstract class Loco_cli_SyncCommand {
99	Loco_cli_Utils::debug('Merging %s <- %s', $pofile->basename(), $potfile->basename() );
100	$matcher = new Loco_gettext_Matcher;
101	$matcher->loadRefs($ref,$translate );








102	// Get fuzzy matching tolerance from plugin settings, can be set temporarily in command line
103	$fuzziness = Loco_data_Settings::get()->fuzziness;
104	$matcher->setFuzziness( (string) $fuzziness );


68	}
69	// Check if PO defines alternative template (reference)
70	$ref = $pot;

71	$head = $def->getHeaders();
72	+ $opts = new Loco_gettext_SyncOptions($head);
73	+ $translate = $opts->mergeMsgstr();
74	+ if( $opts->hasTemplate() ){
75	$ref = null;
76	+ $potfile = $opts->getTemplate();
77	$potfile->normalize( $base_dir );
78	if( $potfile->exists() ){
79	try {
80	Loco_cli_Utils::debug('> Parsing alternative template: %s',$potfile->getRelativePath($content_dir) );
81	$ref = Loco_gettext_Data::fromSource( $potfile->getContents() );




82	}
83	catch( Loco_error_ParseException $e ){
84	WP_CLI::error( $e->getMessage().' in '.$potfile->getRelativePath($content_dir), false );

96	Loco_cli_Utils::debug('Merging %s <- %s', $pofile->basename(), $potfile->basename() );
97	$matcher = new Loco_gettext_Matcher;
98	$matcher->loadRefs($ref,$translate );
99	+ // Merge jsons if configured and available
100	+ if( $opts->mergeJson() ){
101	+ $siblings = new Loco_fs_Siblings($potfile);
102	+ $njson = $matcher->loadJsons( $siblings->getJsons() );
103	+ if( 0 !== $njson ){
104	+ Loco_cli_Utils::debug('> merged json files:%u', $njson );
105	+ }
106	+ }
107	// Get fuzzy matching tolerance from plugin settings, can be set temporarily in command line
108	$fuzziness = Loco_data_Settings::get()->fuzziness;
109	$matcher->setFuzziness( (string) $fuzziness );

src/compat/PosixExtension.php CHANGED Viewed

	@@ -59,7 +59,7 @@ abstract class Loco_compat_PosixExtension {
59	public static function getuidViaTempDir(){
60	$dir = get_temp_dir();
61	if( 04000 & fileperms($dir) ){
62	- trigger_error( sprintf('%s directory has setuid bit, getuid may not be accurate'), E_USER_NOTICE );
63	}
64	$path = wp_tempnam( 'loco-sniff-'.time(), $dir );
65	$uid = fileowner($path);
	@@ -76,7 +76,7 @@ abstract class Loco_compat_PosixExtension {
76	public static function getgidViaTempDir(){
77	$dir = get_temp_dir();
78	if( 02000 & fileperms($dir) ){
79	- trigger_error( sprintf('%s directory has setgid bit, getgid may not be accurate'), E_USER_NOTICE );
80	}
81	$path = wp_tempnam( 'loco-sniff-'.time(), $dir );
82	$gid = filegroup($path);
	@@ -92,9 +92,11 @@ abstract class Loco_compat_PosixExtension {
92	* @return string
93	*/
94	public static function getHttpdUser(){
95	- if( function_exists('~~posix_geteuid~~') ){
96	- $info = posix_getpwuid( ~~posix_geteuid~~() );
97	- ~~return~~ $info['name'];


98	}
99	// @codeCoverageIgnoreStart
100	foreach( array('apache','nginx') as $name ){


59	public static function getuidViaTempDir(){
60	$dir = get_temp_dir();
61	if( 04000 & fileperms($dir) ){
62	+ trigger_error( sprintf('%s directory has setuid bit, getuid may not be accurate',basename($dir) ), E_USER_NOTICE );
63	}
64	$path = wp_tempnam( 'loco-sniff-'.time(), $dir );
65	$uid = fileowner($path);

76	public static function getgidViaTempDir(){
77	$dir = get_temp_dir();
78	if( 02000 & fileperms($dir) ){
79	+ trigger_error( sprintf('%s directory has setgid bit, getgid may not be accurate',basename($dir) ), E_USER_NOTICE );
80	}
81	$path = wp_tempnam( 'loco-sniff-'.time(), $dir );
82	$gid = filegroup($path);

92	* @return string
93	*/
94	public static function getHttpdUser(){
95	+ if( function_exists('posix_getpwuid') ){
96	+ $info = posix_getpwuid( self::getuid() );
97	+ if( isset($info['name']) ){
98	+ return $info['name'];
99	+ }
100	}
101	// @codeCoverageIgnoreStart
102	foreach( array('apache','nginx') as $name ){

src/data/Settings.php CHANGED Viewed

	@@ -22,6 +22,7 @@
22	* @property bool $ajax_files Whether to submit PO data as concrete files (requires Blob support in Ajax)
23	*
24	* @property string $deepl_api_key API key for DeepL Translator

25	* @property string $google_api_key API key for Google Translate
26	* @property string $yandex_api_key API key for Yandex.Translate
27	* @property string $microsoft_api_key API key for Microsoft Translator text API
	@@ -61,6 +62,7 @@ class Loco_data_Settings extends Loco_data_Serializable {
61	'jed_clean' => false,
62	'ajax_files' => true,
63	'deepl_api_key' => '',

64	'google_api_key' => '',
65	'yandex_api_key' => '',
66	'microsoft_api_key' => '',


22	* @property bool $ajax_files Whether to submit PO data as concrete files (requires Blob support in Ajax)
23	*
24	* @property string $deepl_api_key API key for DeepL Translator
25	+ * @property string $deepl_api_url Base URL for DeepL Translator version
26	* @property string $google_api_key API key for Google Translate
27	* @property string $yandex_api_key API key for Yandex.Translate
28	* @property string $microsoft_api_key API key for Microsoft Translator text API

62	'jed_clean' => false,
63	'ajax_files' => true,
64	'deepl_api_key' => '',
65	+ 'deepl_api_url' => '',
66	'google_api_key' => '',
67	'yandex_api_key' => '',
68	'microsoft_api_key' => '',

src/error/AdminNotices.php CHANGED Viewed

	@@ -35,10 +35,10 @@ class Loco_error_AdminNotices extends Loco_hooks_Hookable {
35	public static function add( Loco_error_Exception $error ){
36	$notices = self::get();
37	// if exception wasn't thrown we have to do some work to establish where it was invoked
38	- if( __FILE__ === $error->~~getFile~~() ){
39	$error->setCallee(1);
40	}
41	- // write error immediately under ~~WP_CLIT~~
42	if( 'cli' === PHP_SAPI && class_exists('WP_CLI',false) ){
43	$error->logCli();
44	return $error;
	@@ -52,10 +52,8 @@ class Loco_error_AdminNotices extends Loco_hooks_Hookable {
52	if( did_action('admin_notices') ){
53	$notices->on_admin_notices();
54	}
55	- // Log ~~messages~~ of ~~minimum~~ ~~priority and up, depending on debug mode~~
56	- // ~~note that non-debug level is in line with error_reporting set by WordPress~~ (~~notices~~ ~~ignored~~)
57	- $priority = loco_debugging() ? Loco_error_Exception::LEVEL_DEBUG : Loco_error_Exception::LEVEL_WARNING;
58	- if( $error->getLevel() <= $priority ){
59	$error->log();
60	}
61	return $error;


35	public static function add( Loco_error_Exception $error ){
36	$notices = self::get();
37	// if exception wasn't thrown we have to do some work to establish where it was invoked
38	+ if( __FILE__ === $error->getRealFile() ){
39	$error->setCallee(1);
40	}
41	+ // write error immediately under WP_CLI
42	if( 'cli' === PHP_SAPI && class_exists('WP_CLI',false) ){
43	$error->logCli();
44	return $error;

52	if( did_action('admin_notices') ){
53	$notices->on_admin_notices();
54	}
55	+ // Log message automatically if enabled
56	+ if( $error->loggable() ){


57	$error->log();
58	}
59	return $error;

src/error/Exception.php CHANGED Viewed

@@ -28,6 +28,12 @@ class Loco_error_Exception extends Exception implements JsonSerializable {
                  */
                 private $_line;
                 /**
                  * {@inheritdoc}
                  */
@@ -65,7 +71,7 @@ class Loco_error_Exception extends Exception implements JsonSerializable {
                  */
                 public function getRealLine(){
                     if( $this->_line ){
-            -
                        return $this->getLine();
+                    }
                     return $this->getRootException()->getLine();
+                }
@@ -205,6 +211,32 @@ class Loco_error_Exception extends Exception implements JsonSerializable {
                         return $e;
+                    }
                     return new Loco_error_Exception( $e->getMessage(), $e->getCode(), $e );
-            -
                }
+            }


28	*/
29	private $_line;
30
31	+ /**
32	+ * Whether log file writing is enabled
33	+ * @var bool
34	+ */
35	+ private $_log = true;
36	+
37	/**
38	* {@inheritdoc}
39	*/

71	*/
72	public function getRealLine(){
73	if( $this->_line ){
74	+ return $this->_line;
75	}
76	return $this->getRootException()->getLine();
77	}

211	return $e;
212	}
213	return new Loco_error_Exception( $e->getMessage(), $e->getCode(), $e );
214	+ }
215	+
216	+
217	+ /**
218	+ * Test if this error should be automatically logged
219	+ * @return bool
220	+ */
221	+ public function loggable(){
222	+ if( $this->_log ){
223	+ // Log messages of minimum priority and up, depending on debug mode
224	+ // note that non-debug level is in line with error_reporting set by WordPress (notices ignored)
225	+ $priority = loco_debugging() ? Loco_error_Exception::LEVEL_DEBUG : Loco_error_Exception::LEVEL_WARNING;
226	+ return $this->getLevel() <= $priority;
227	+ }
228	+ return false;
229	+ }
230	+
231	+
232	+ /**
233	+ * Suppress logging for this error. e.g if you want to warn in UI but don't want to pollute log files.
234	+ * @return self
235	+ */
236	+ public function noLog(){
237	+ $this->_log = false;
238	+ return $this;
239	+ }
240	+
241
242	}

src/fs/Directory.php CHANGED Viewed

	@@ -45,9 +45,7 @@ class Loco_fs_Directory extends Loco_fs_File {
45	* @return Loco_fs_Directory
46	*/
47	public function mkdir(){
48	- ~~if( !~~ $this->~~exists~~() ){
49	- $this->getWriteContext()->mkdir();
50	- }
51	return $this;
52	}
53


45	* @return Loco_fs_Directory
46	*/
47	public function mkdir(){
48	+ $this->getWriteContext()->mkdir();


49	return $this;
50	}
51

src/fs/File.php CHANGED Viewed

	@@ -618,13 +618,12 @@ class Loco_fs_File {
618
619	/**
620	* Ensure full parent directory tree exists
621	- * @return Loco_fs_Directory
622	*/
623	public function createParent(){
624	- ~~if(~~ $dir = $this->getParent() ){
625	- if( ! $dir->exists() ){
626	- $dir->mkdir();
627	- }
628	}
629	return $dir;
630	}


618
619	/**
620	* Ensure full parent directory tree exists
621	+ * @return Loco_fs_Directory\|null
622	*/
623	public function createParent(){
624	+ $dir = $this->getParent();
625	+ if( $dir instanceof Loco_fs_Directory && ! $dir->exists() ){
626	+ $dir->mkdir();

627	}
628	return $dir;
629	}

src/fs/Siblings.php CHANGED Viewed

	@@ -80,7 +80,7 @@ class Loco_fs_Siblings {
80	* @return Loco_fs_File[]
81	*/
82	public function getJsons(){
83	- $~~jsons~~ = ~~array()~~;
84	$name = $this->po->filename();
85	$finder = new Loco_fs_FileFinder( $this->po->dirname() );
86	// match .json files with same name as .po, plus hashed names
	@@ -90,17 +90,17 @@ class Loco_fs_Siblings {
90	foreach( $files as $file ){
91	$match = $file->filename();
92	if( $match === $name \|\| preg_match($regex,$match) ) {
93	- $~~jsons[] =~~ $file;
94	}
95	}
96	}
97	// append single json using our filter
98	$path = apply_filters('loco_compile_single_json', '', $this->po->getPath() );
99	- if( is_string($path) && '' !== $path && file_exists($path) ~~&& ! in_array($path,$jsons~~) ){
100	- $~~jsons[]~~ = $path;
101	}
102
103	- return $~~jsons~~;
104	}
105
106	}


80	* @return Loco_fs_File[]
81	*/
82	public function getJsons(){
83	+ $list = new Loco_fs_FileList;
84	$name = $this->po->filename();
85	$finder = new Loco_fs_FileFinder( $this->po->dirname() );
86	// match .json files with same name as .po, plus hashed names

90	foreach( $files as $file ){
91	$match = $file->filename();
92	if( $match === $name \|\| preg_match($regex,$match) ) {
93	+ $list->add($file);
94	}
95	}
96	}
97	// append single json using our filter
98	$path = apply_filters('loco_compile_single_json', '', $this->po->getPath() );
99	+ if( is_string($path) && '' !== $path && file_exists($path) ){
100	+ $list->add( new Loco_fs_File($path) );
101	}
102
103	+ return $list->getArrayCopy();
104	}
105
106	}

src/gettext/Compiler.php CHANGED Viewed

	@@ -182,7 +182,7 @@ class Loco_gettext_Compiler {
182	Loco_error_AdminNotices::debug( sprintf('Skipping JSON for %s; script not found in bundle',$ref) );
183	}
184	}
185	- // write all buffered fragments to their ~~calculated~~ JSON paths
186	foreach( $buffer as $ref => $fragment ) {
187	$jsonfile = $pofile->cloneJson($ref);
188	try {


182	Loco_error_AdminNotices::debug( sprintf('Skipping JSON for %s; script not found in bundle',$ref) );
183	}
184	}
185	+ // write all buffered fragments to their computed JSON paths
186	foreach( $buffer as $ref => $fragment ) {
187	$jsonfile = $pofile->cloneJson($ref);
188	try {

src/gettext/Data.php CHANGED Viewed

	@@ -50,15 +50,16 @@ class Loco_gettext_Data extends LocoPoIterator implements JsonSerializable {
50	/**
51	* Like load but just pulls header, saving a full parse. PO only
52	* @param Loco_fs_File
53	- * @return ~~Loco_gettext_Data~~
54	* @throws InvalidArgumentException
55	*/
56	public static function head( Loco_fs_File $file ){
57	if( 'mo' === self::ext($file) ){
58	throw new InvalidArgumentException('PO only');
59	}
60	- $po = new LocoPoParser( $file->getContents() );
61	- ~~return new Loco_gettext_Data(~~ $po->parse(1) );

62	}
63
64


50	/**
51	* Like load but just pulls header, saving a full parse. PO only
52	* @param Loco_fs_File
53	+ * @return LocoPoHeaders
54	* @throws InvalidArgumentException
55	*/
56	public static function head( Loco_fs_File $file ){
57	if( 'mo' === self::ext($file) ){
58	throw new InvalidArgumentException('PO only');
59	}
60	+ $p = new LocoPoParser( $file->getContents() );
61	+ $p->parse(0);
62	+ return $p->getHeader();
63	}
64
65

src/gettext/Matcher.php CHANGED Viewed

@@ -8,7 +8,13 @@ class Loco_gettext_Matcher extends LocoFuzzyMatcher {
                  * Whether copying translation from source references (normally for a POT we won't)
                  * @var bool
                  */
-            -
                private $translate = false;
                 /**
@@ -20,6 +26,7 @@ class Loco_gettext_Matcher extends LocoFuzzyMatcher {
                 public function loadRefs( Loco_gettext_Data $pot, $translate = false ){
                     $ntotal = 0;
                     $this->translate = (bool) $translate;
                     /* @var LocoPoMessage $new */
                     foreach( $pot as $new ){
                         $ntotal++;
@@ -29,6 +36,113 @@ class Loco_gettext_Matcher extends LocoFuzzyMatcher {
+                }
                 /**
                  * Update still-valid sources, deferring unmatched (new strings) for deferred fuzzy match
                  * @param LocoPoIterator Existing definitions
@@ -47,6 +161,10 @@ class Loco_gettext_Matcher extends LocoFuzzyMatcher {
                             $p->merge($new,$translate);
                             $merged->push($p);
                             $valid[] = $p->getKey();
+                        }
+                    }
                     return $valid;
@@ -113,7 +231,24 @@ class Loco_gettext_Matcher extends LocoFuzzyMatcher {
                         'add' => $added,
                         'fuz' => $fuzzy,
                         'del' => $dropped,
                     );
+                }
+            }


8	* Whether copying translation from source references (normally for a POT we won't)
9	* @var bool
10	*/
11	+ private $translate;
12	+
13	+ /**
14	+ * Number of translations pulled from source (when source is PO)
15	+ * @var int
16	+ */
17	+ private $translated;
18
19
20	/**

26	public function loadRefs( Loco_gettext_Data $pot, $translate = false ){
27	$ntotal = 0;
28	$this->translate = (bool) $translate;
29	+ $this->translated = 0;
30	/* @var LocoPoMessage $new */
31	foreach( $pot as $new ){
32	$ntotal++;

36	}
37
38
39	+ /**
40	+ * Add further source strings from JSON/JED file
41	+ * @param Loco_fs_File json file
42	+ * @return int
43	+ */
44	+ public function loadJson( Loco_fs_File $file ){
45	+ $unique = 0;
46	+ $jed = json_decode( $file->getContents(), true );
47	+ if( ! is_array($jed) \|\| ! array_key_exists('locale_data',$jed) \|\| ! is_array($jed['locale_data']) ){
48	+ throw new Loco_error_Debug( $file->basename().' is not JED formatted');
49	+ }
50	+ // Without a file reference strings will never be compiled back to the correct JSON.
51	+ // JSON files will not contain full line references, but we may know the file at least
52	+ if( ! array_key_exists('source',$jed) \|\| ! $jed['source'] ){
53	+ throw new Loco_error_Debug( $file->basename().' has no "source" key');
54	+ }
55	+ $ref = $jed['source'];
56	+ // not checking domain key. Should be valid if passed here and should only be one.
57	+ foreach( $jed['locale_data'] as $domain => $keys ){
58	+ foreach( $keys as $msgid => $arr ){
59	+ if( '' === $msgid \|\| ! is_array($arr) \|\| ! isset($arr[0]) ){
60	+ continue;
61	+ }
62	+ $msgctxt = '';
63	+ // Unglue "msgctxt\4msgid" unique key
64	+ $parts = explode("\4",$msgid,2);
65	+ if( array_key_exists(1,$parts) ){
66	+ list($msgctxt,$msgid) = $parts;
67	+ // TODO handle empty msgid case that uses weird "msgctxt\4(msgctxt)" format?
68	+ }
69	+ // string may exist in original template, and also in multiple JSONs.
70	+ $new = array('source'=>$msgid,'context'=>$msgctxt,'refs'=>$ref );
71	+ $old = $this->getArrayRef($new);
72	+ if( $old ){
73	+ $refs = array_key_exists('refs',$old) ? (string) $old['refs'] : '';
74	+ if( '' === $refs ){
75	+ $old['refs'] = $ref;
76	+ }
77	+ else if( 0 === preg_match('/\\b'.preg_quote($ref,'/').'\\b/',$refs) ){
78	+ $old['refs'].= ' '.$ref;
79	+ }
80	+ $new = $old;
81	+ }
82	+ else {
83	+ $unique++;
84	+ }
85	+ // Add translation from JSON only if not present in merged PO already
86	+ if( $this->translate && ( ! array_key_exists('target',$new) \|\| '' === $new['target'] ) ){
87	+ $new['target'] = $arr[0];
88	+ }
89	+ $message = new LocoPoMessage($new);
90	+ $this->add($message);
91	+ // handle plurals, noting that msgid_plural is not stored in JED structure
92	+ if( 1 < count($arr) ){
93	+ $index = 0;
94	+ $plurals = $old && array_key_exists('plurals',$old) ? $old['plurals'] : array();
95	+ while( array_key_exists(++$index,$arr) ){
96	+ if( array_key_exists($index,$plurals) ){
97	+ $raw = $plurals[$index];
98	+ if( $raw instanceof ArrayObject ){
99	+ $raw = $raw->getArrayCopy();
100	+ }
101	+ }
102	+ else {
103	+ $raw = array('source'=>'','target'=>'');
104	+ }
105	+ if( $this->translate && ( ! array_key_exists('target',$raw) \|\| '' === $raw['target'] ) ){
106	+ $raw['target'] = $arr[$index];
107	+ }
108	+ // use translation as missing msgid_plural only if msgid matches msgstr (English file)
109	+ if( 1 === $index && '' === $raw['source'] ){
110	+ if( $arr[0] === $msgid ){
111	+ $raw['source'] = $arr[1];
112	+ }
113	+ /*else {
114	+ Loco_error_AdminNotices::debug('msgid_plural missing for msgid '.json_encode($msgid) );
115	+ }*/
116	+ }
117	+ $plurals[$index] = new LocoPoMessage($raw);
118	+ }
119	+ $message['plurals'] = $plurals;
120	+ }
121	+ }
122	+ }
123	+ return $unique;
124	+ }
125	+
126	+
127	+ /**
128	+ * Shortcut for loading multiple jsons with error tolerance
129	+ * @param Loco_fs_File[]
130	+ * @return int
131	+ */
132	+ public function loadJsons( array $jsons ){
133	+ $n = 0;
134	+ foreach( $jsons as $jsonfile ){
135	+ try {
136	+ $n += $this->loadJson($jsonfile);
137	+ }
138	+ catch( Loco_error_Exception $e ){
139	+ Loco_error_AdminNotices::add($e);
140	+ }
141	+ }
142	+ return $n;
143	+ }
144	+
145	+
146	/**
147	* Update still-valid sources, deferring unmatched (new strings) for deferred fuzzy match
148	* @param LocoPoIterator Existing definitions

161	$p->merge($new,$translate);
162	$merged->push($p);
163	$valid[] = $p->getKey();
164	+ // increment counter if translation was merged
165	+ if( $translate && ! $old->translated() ){
166	+ $this->translated += $new->translated();
167	+ }
168	}
169	}
170	return $valid;

231	'add' => $added,
232	'fuz' => $fuzzy,
233	'del' => $dropped,
234	+ 'trn' => $this->translated,
235	);
236	}
237
238	+
239	+ /**
240	+ * @param array
241	+ * @return array
242	+ */
243	+ private function getArrayRef( array $a ){
244	+ $r = $this->getRef($a);
245	+ if( is_null($r) ){
246	+ return array();
247	+ }
248	+ if( $r instanceof ArrayObject ){
249	+ return $r->getArrayCopy();
250	+ }
251	+ throw new Exception( (is_object($r)?get_class($r):gettype($r) ).' returned from '.get_class($this).'::getRef');
252	+ }
253	+
254	}

src/gettext/SyncOptions.php ADDED Viewed

	@@ -0,0 +1,100 @@


1	+ <?php
2	+ /**
3	+ * Abstracts PO sync options held in custom headers
4	+ */
5	+ class Loco_gettext_SyncOptions {
6	+
7	+ /**
8	+ * @var LocoPoHeaders
9	+ */
10	+ private $head;
11	+
12	+
13	+ public function __construct( LocoPoHeaders $head ){
14	+ $this->head = $head;
15	+ }
16	+
17	+
18	+ /**
19	+ * Test if PO file has alternative template path
20	+ * @return bool
21	+ */
22	+ public function hasTemplate(){
23	+ return '' !== $this->head->trimmed('X-Loco-Template');
24	+ }
25	+
26	+
27	+ /**
28	+ * Get relative path to alternative template path.
29	+ * @return Loco_fs_LocaleFile
30	+ */
31	+ public function getTemplate(){
32	+ return new Loco_fs_LocaleFile( $this->head['X-Loco-Template'] );
33	+ }
34	+
35	+
36	+ /**
37	+ * Set relative path to alternative template path.
38	+ * @param string
39	+ */
40	+ public function setTemplate( $path ){
41	+ $this->head['X-Loco-Template'] = (string) $path;
42	+ }
43	+
44	+
45	+ /**
46	+ * Test if translations (msgstr fields) are to be merged.
47	+ *
48	+ * @return bool
49	+ */
50	+ public function mergeMsgstr(){
51	+ return 0 === preg_match( '/\\bpot\\b/', $this->getSyncMode() );
52	+ }
53	+
54	+
55	+ /**
56	+ * Test if JSON files are to be merged.
57	+ * @return bool
58	+ */
59	+ public function mergeJson(){
60	+ return 1 === preg_match( '/\\bjson\\b/', $this->getSyncMode() );
61	+ }
62	+
63	+
64	+ /**
65	+ * @return string
66	+ */
67	+ public function getSyncMode(){
68	+ $mode = strtolower( $this->head->trimmed('X-Loco-Template-Mode') );
69	+ // Default sync mode when undefined is to honour the type of source.
70	+ // i.e. for legacy compatibility, copy msgstr fields if source is a PO file.
71	+ if( '' === $mode ){
72	+ $mode = $this->hasTemplate() ? strtolower( $this->getTemplate()->extension() ) : 'pot';
73	+ }
74	+ return $mode;
75	+ }
76	+
77	+
78	+ /**
79	+ * @param string
80	+ */
81	+ public function setSyncMode( $mode ){
82	+ $this->head['X-Loco-Template-Mode'] = (string) $mode;
83	+ }
84	+
85	+
86	+ /**
87	+ * Remove redundant headers
88	+ * @return LocoPoHeaders
89	+ */
90	+ public function getHeaders(){
91	+ if( ! $this->hasTemplate() ){
92	+ $this->head->offsetUnset('X-Loco-Template');
93	+ if( 'pot' === $this->getSyncMode() ){
94	+ $this->head->offsetUnset('X-Loco-Template-Mode');
95	+ }
96	+ }
97	+ return $this->head;
98	+ }
99	+
100	+ }

src/hooks/LoadHelper.php CHANGED Viewed

	@@ -1,4 +1,4 @@
1	- <?php ~~/** @noinspection PhpUnusedParameterInspection */~~
2
3	/**
4	* Text Domain loading helper.
	@@ -206,6 +206,7 @@ class Loco_hooks_LoadHelper extends Loco_hooks_Hookable {
206	* @param string path relating to given JSON (not used here)
207	* @param string script handle for registered merge
208	* @return string final JSON translations

209	*/
210	public function filter_load_script_translations( $json = '', $path = '', $handle = '' ){
211	if( array_key_exists($handle,$this->json) ){


1	+ <?php
2
3	/**
4	* Text Domain loading helper.

206	* @param string path relating to given JSON (not used here)
207	* @param string script handle for registered merge
208	* @return string final JSON translations
209	+ * @noinspection PhpUnusedParameterInspection
210	*/
211	public function filter_load_script_translations( $json = '', $path = '', $handle = '' ){
212	if( array_key_exists($handle,$this->json) ){

src/js/Strings.php CHANGED Viewed

	@@ -32,6 +32,10 @@ class Loco_js_Strings extends Loco_hooks_TranslateBuffer {
32	* xgettext: javascript-format */
33	_n("%s string marked Fuzzy","%s strings marked Fuzzy",0,'loco-translate');
34




35	/* Message appears after sync operation, where %s refers to a POT file.
36	* xgettext: javascript-format */
37	__("Strings up to date with %s",'loco-translate');


32	* xgettext: javascript-format */
33	_n("%s string marked Fuzzy","%s strings marked Fuzzy",0,'loco-translate');
34
35	+ /* Summary of translations copied from a PO file during Sync
36	+ * xgettext: javascript-format */
37	+ _n("%s translation copied","%s translations copied",0,'loco-translate');
38	+
39	/* Message appears after sync operation, where %s refers to a POT file.
40	* xgettext: javascript-format */
41	__("Strings up to date with %s",'loco-translate');

src/mvc/AdminController.php CHANGED Viewed

	@@ -119,7 +119,7 @@ abstract class Loco_mvc_AdminController extends Loco_mvc_Controller {
119	/**
120	* "update_footer" filter, prints Loco version number in admin footer
121	*/
122	- public function filter_update_footer( $text ){
123	$html = sprintf( '<span>v%s</span>', loco_plugin_version() );
124	if( $this->bench && ( $info = $this->get('_debug') ) ){
125	$html .= sprintf('<span>%ss</span>', number_format_i18n($info['time'],2) );
	@@ -219,6 +219,11 @@ abstract class Loco_mvc_AdminController extends Loco_mvc_Controller {
219	$tag = apply_filters( 'plugin_locale', get_locale(), 'loco-translate' );
220	$jsConf->offsetSet('wplang', Loco_Locale::parse($tag) );
221	}





222	}
223	// take benchmark for debugger to be rendered in footer
224	if( $this->bench ){


119	/**
120	* "update_footer" filter, prints Loco version number in admin footer
121	*/
122	+ public function filter_update_footer( /$text/ ){
123	$html = sprintf( '<span>v%s</span>', loco_plugin_version() );
124	if( $this->bench && ( $info = $this->get('_debug') ) ){
125	$html .= sprintf('<span>%ss</span>', number_format_i18n($info['time'],2) );

219	$tag = apply_filters( 'plugin_locale', get_locale(), 'loco-translate' );
220	$jsConf->offsetSet('wplang', Loco_Locale::parse($tag) );
221	}
222	+ // localized formatting from core translations
223	+ global $wp_locale;
224	+ if( is_object($wp_locale) && property_exists($wp_locale,'number_format') ){
225	+ $jsConf->offsetSet('wpnum', array_map(array($this,'filter_number_format_i18n'),$wp_locale->number_format) );
226	+ }
227	}
228	// take benchmark for debugger to be rendered in footer
229	if( $this->bench ){

src/mvc/AdminRouter.php CHANGED Viewed

	@@ -201,6 +201,7 @@ class Loco_mvc_AdminRouter extends Loco_hooks_Hookable {
201	'{type}-file-view' => 'file_View',
202	'{type}-file-edit' => 'file_Edit',
203	'{type}-file-info' => 'file_Info',

204	'{type}-file-diff' => 'file_Diff',
205	'{type}-file-move' => 'file_Move',
206	'{type}-file-delete' => 'file_Delete',


201	'{type}-file-view' => 'file_View',
202	'{type}-file-edit' => 'file_Edit',
203	'{type}-file-info' => 'file_Info',
204	+ '{type}-file-head' => 'file_Head',
205	'{type}-file-diff' => 'file_Diff',
206	'{type}-file-move' => 'file_Move',
207	'{type}-file-delete' => 'file_Delete',

src/mvc/Controller.php CHANGED Viewed

@@ -114,4 +114,13 @@ abstract class Loco_mvc_Controller extends Loco_hooks_Hookable {
+                }
+            }


114	}
115
116
117	+ /**
118	+ * number_format_i18n filter callback because our admin screens assume number_format_i18n() returns unescaped text, not HTML.
119	+ * @param string
120	+ * @return string
121	+ */
122	+ public function filter_number_format_i18n( $formatted = '' ){
123	+ return html_entity_decode($formatted,ENT_NOQUOTES,'UTF-8');
124	+ }
125	+
126	}

src/mvc/FileParams.php CHANGED Viewed

	@@ -142,7 +142,7 @@ class Loco_mvc_FileParams extends Loco_mvc_ViewParams {
142	$time_diff = time() - $time;
143	// use same time format as posts listing when in future or more than a day ago
144	if( $time_diff < 0 \|\| $time_diff >= 86400 ){
145	- return date_i18n( __('Y/m/d','default'), ~~$time~~ );
146	}
147	if( $time_diff < 30 ){
148	// translators: relative time when something happened in the last 30 seconds


142	$time_diff = time() - $time;
143	// use same time format as posts listing when in future or more than a day ago
144	if( $time_diff < 0 \|\| $time_diff >= 86400 ){
145	+ return Loco_mvc_ViewParams::date_i18n( $time, __('Y/m/d','default') );
146	}
147	if( $time_diff < 30 ){
148	// translators: relative time when something happened in the last 30 seconds

src/mvc/ViewParams.php CHANGED Viewed

	@@ -17,27 +17,35 @@ class Loco_mvc_ViewParams extends ArrayObject implements JsonSerializable {
17	/**
18	* format integer as string date, including time according to user settings
19	* @param int unix timestamp
20	- * @param string date format
21	* @return string
22	*/
23	public static function date_i18n( $u, $f = null ){
24	static $tf, $df, $tz;
25	if( is_null($f) ){
26	- if( ! $tf ){
27	$tf = get_option('time_format') or $tf = 'g:i A';
28	$df = get_option('date_format') or $df= 'M jS Y';
29	}
30	$f = $df.' '.$tf;
31	}
32	- // ~~Fix~~ ~~Wordpress's~~ ~~broken~~ ~~timezone~~ ~~implementation~~




33	if( is_null($tz) ){
34	- ~~$tz~~ ~~= date_default_timezone_get() or $tz = 'UTC';~~
35	- $wp = get_option('timezone_string') or $wp = ~~$tz~~;
36	- ~~if(~~ $tz ~~!==~~ $wp ){
37	- ~~date_default_timezone_set( $wp );~~


38	}
39	}
40	- ~~return~~ ~~date_i18n(~~ ~~$f,~~ $u );


41	}
42
43
	@@ -85,13 +93,10 @@ class Loco_mvc_ViewParams extends ArrayObject implements JsonSerializable {
85	* @return string empty string
86	*/
87	public function date( $p, $f = null ){
88	- ~~if(~~ $u = $this->__get($p) ){
89	- ~~$s = self::date_i18n~~( $u, $f );
90	- }
91	- else {
92	- $s = '';
93	}
94	- echo $this->escape($s);
95	return '';
96	}
97


17	/**
18	* format integer as string date, including time according to user settings
19	* @param int unix timestamp
20	+ * @param string\|null date format
21	* @return string
22	*/
23	public static function date_i18n( $u, $f = null ){
24	static $tf, $df, $tz;
25	if( is_null($f) ){
26	+ if( is_null($tf) ){
27	$tf = get_option('time_format') or $tf = 'g:i A';
28	$df = get_option('date_format') or $df= 'M jS Y';
29	}
30	$f = $df.' '.$tf;
31	}
32	+ // date_i18n was replaced with wp_date in WP 5.3
33	+ if( function_exists('wp_date') ){
34	+ return wp_date($f,$u);
35	+ }
36	+ // date_i18n expects timestamp to include offset
37	if( is_null($tz) ){
38	+ try {
39	+ $wp = get_option('timezone_string') or $wp = date_default_timezone_get();
40	+ $tz = new DateTimeZone($wp);
41	+ }
42	+ catch( Exception $e ){
43	+ $tz = new DateTimeZone('UTC');
44	}
45	}
46	+ $d = new DateTime(null,$tz);
47	+ $d->setTimestamp($u);
48	+ return date_i18n( $f, $u + $d->getOffset() );
49	}
50
51

93	* @return string empty string
94	*/
95	public function date( $p, $f = null ){
96	+ $u = (int) $this->__get($p);
97	+ if( $u > 0 ){
98	+ echo $this->escape( self::date_i18n($u,$f) );


99	}

100	return '';
101	}
102

src/test/WordPressTestCase.php CHANGED Viewed

	@@ -433,7 +433,7 @@ abstract class Loco_test_WordPressTestCase extends WP_UnitTestCase {
433
434	public static function filter_allows_fake_plugins_to_exist( array $data, $handle ){
435	$file = LOCO_TEST_DATA_ROOT.'/plugins/'.$handle;
436	- if( file_exists($file) ) {
437	$data = get_plugin_data($file);
438	$snip = -strlen($handle);
439	$data['basedir'] = substr($file,0,--$snip);


433
434	public static function filter_allows_fake_plugins_to_exist( array $data, $handle ){
435	$file = LOCO_TEST_DATA_ROOT.'/plugins/'.$handle;
436	+ if( file_exists($file) && is_file($file) ) {
437	$data = get_plugin_data($file);
438	$snip = -strlen($handle);
439	$data['basedir'] = substr($file,0,--$snip);

tpl/admin/config/apis.php CHANGED Viewed

	@@ -29,6 +29,12 @@ $help = apply_filters('loco_external','https://localise.biz/wordpress/plugin/man
29	</label>
30	<input type="text" size="50" name="api[deepl][key]" id="loco--deepl_api_key" value="<?php $api->e('key')?>" spellcheck="false" />
31	</p>






32	<p>
33	<span class="description"><a href="https://www.deepl.com/translator" target="_blank" tabindex="-1">https://www.deepl.com/translator</a></span>
34	</p>


29	</label>
30	<input type="text" size="50" name="api[deepl][key]" id="loco--deepl_api_key" value="<?php $api->e('key')?>" spellcheck="false" />
31	</p>
32	+ <p>
33	+ <label for="loco--deepl_api_url">
34	+ <?php $ui->e('api_url')?>:
35	+ </label>
36	+ <input type="text" size="50" name="api[deepl][url]" id="loco--deepl_api_url" value="<?php $api->e('url')?>" spellcheck="false" placeholder="https://api.deepl.com" />
37	+ </p>
38	<p>
39	<span class="description"><a href="https://www.deepl.com/translator" target="_blank" tabindex="-1">https://www.deepl.com/translator</a></span>
40	</p>

tpl/admin/file/conf.php ADDED Viewed

	@@ -0,0 +1,63 @@


1	+ <?php
2	+ /**
3	+ * PO file options form
4	+ */
5	+ $this->extend('../layout');
6	+ /* @var Loco_gettext_SyncOptions $conf */
7	+ /* @var Loco_mvc_ViewParams $params */
8	+ ?>
9	+
10	+ <div class="panel">
11	+ <h3>
12	+ <?php esc_html_e('Template options','loco-translate')?>
13	+ </h3>
14	+
15	+ <form action="" method="post" enctype="application/x-www-form-urlencoded" id="loco-main"><?php
16	+ /* @var Loco_mvc_HiddenFields $hidden */
17	+ $hidden->_e();?>
18	+
19	+ <table class="form-table">
20	+ <tbody>
21	+ <tr valign="top" class="compact">
22	+ <td>
23	+ <label for="loco-conf-template">Relative path to template file:</label><br />
24	+ <input type="text" name="conf[template]" value="<?php self::e( (string) $conf->getTemplate() )?>" size="100" id="loco-conf-template" />
25	+ </td>
26	+ </tr>
27	+ <tr valign="top" class="compact">
28	+ <td>
29	+ <p>
30	+ <label>
31	+ <input type="radio" name="conf[mode]" value="po" <?php echo $conf->mergeMsgstr()?'checked ':''?>/>
32	+ <?php $params->f('potName', __('Copy target translations from "%s"','loco-translate') )?>
33	+ </label>
34	+ </p>
35	+ <p>
36	+ <label>
37	+ <input type="radio" name="conf[mode]" value="pot" <?php echo $conf->mergeMsgstr()?'':'checked '?>/>
38	+ <?php esc_html_e('Just copy English source strings','loco-translate')?>
39	+ </label>
40	+ </p>
41	+ </td>
42	+ </tr>
43	+ <tr valign="top" class="compact">
44	+ <td>
45	+ <p>
46	+ <label>
47	+ <input type="checkbox" name="conf[json]" value="1" <?php echo $conf->mergeJson()?'checked ':''?>/>
48	+ <?php esc_html_e('Merge strings from related JSON files','loco-translate')?>
49	+ </label>
50	+ </p>
51	+ </td>
52	+ </tr>
53	+ </tbody>
54	+ </table>
55	+
56	+ <p class="submit">
57	+ <button type="submit" class="button button-primary" disabled><?php esc_html_e('Save','loco-translate')?></button>
58	+ <a href="<?php $params->e('advanced')?>" class="button button-link"><?php esc_html_e('Advanced','loco-translate')?></a>
59	+ </p>
60	+
61	+ </form>
62	+
63	+ </div>

tpl/admin/file/head.php ADDED Viewed

	@@ -0,0 +1,39 @@


1	+ <?php
2	+ /**
3	+ * PO/POT headers form
4	+ */
5	+ $this->extend('../layout');
6	+ ?>
7	+
8	+ <div class="panel">
9	+ <h3>
10	+ Edit file headers:
11	+ </h3>
12	+
13	+ <form action="" method="post" enctype="application/x-www-form-urlencoded" id="loco-main"><?php
14	+ /* @var Loco_mvc_HiddenFields $hidden */
15	+ $hidden->_e();?>
16	+
17	+ <table class="form-table">
18	+ <tbody><?php
19	+ /* @var LocoPoHeaders $head */
20	+ foreach( $head as $key => $value ): if( preg_match('/^[-A-Za-z]+$/',$key) ):?>
21	+ <tr>
22	+ <th scope="row">
23	+ <label for="loco-header-<?php echo $key?>"><?php echo $key?></label>
24	+ </th>
25	+ <td>
26	+ <input type="text" name="headers[<?php echo $key?>]" value="<?php self::e($value) ?>" size="100" id="loco-header-<?php echo $key?>" />
27	+ </td>
28	+ </tr><?php
29	+ endif; endforeach;?>
30	+ </tbody>
31	+ </table>
32	+
33	+ <p class="submit">
34	+ <button type="submit" class="button button-primary" disabled><?php esc_html_e('Save','loco-translate')?></button>
35	+ </p>
36	+
37	+ </form>
38	+
39	+ </div>

tpl/admin/file/info-po.php CHANGED Viewed

	@@ -11,6 +11,7 @@ $this->start('header');
11
12	<div class="notice inline notice-info">
13	<nav>

14	<a class="icon only-icon icon-download" title="Download" href="<?php $file->e('download')?>"><span>download</span></a>
15	</nav>
16	<h3>


11
12	<div class="notice inline notice-info">
13	<nav>
14	+ <a class="icon only-icon icon-cog" title="Configure" href="<?php $file->e('configure')?>"><span>configure</span></a>
15	<a class="icon only-icon icon-download" title="Download" href="<?php $file->e('download')?>"><span>download</span></a>
16	</nav>
17	<h3>

tpl/admin/init/init-po.php CHANGED Viewed

	@@ -132,7 +132,7 @@ $this->extend('../layout');
132	if( $params->has('sourceLocale') ):?>
133	<tbody>
134	<tr valign="top">
135	- <th scope="row" rowspan="3">
136	3. <?php esc_html_e('Template options','loco-translate')?>:
137	</th>
138	<td>
	@@ -154,13 +154,23 @@ $this->extend('../layout');
154	</label>
155	</p>
156	</td>
157	- </tr>










158	<tr valign="top" class="compact">
159	<td>
160	<p>
161	<label>
162	<input type="checkbox" name="link" value="1" />
163	- <?php esc_html_e('Use this file as template when running Sync','loco-translate')?>
164	</label>
165	</p>
166	</td>


132	if( $params->has('sourceLocale') ):?>
133	<tbody>
134	<tr valign="top">
135	+ <th scope="row" rowspan="4">
136	3. <?php esc_html_e('Template options','loco-translate')?>:
137	</th>
138	<td>

154	</label>
155	</p>
156	</td>
157	+ </tr>
158	+ <tr valign="top" class="compact">
159	+ <td>
160	+ <p>
161	+ <label>
162	+ <input type="checkbox" name="json" value="1" />
163	+ <?php esc_html_e('Merge strings from related JSON files','loco-translate')?>
164	+ </label>
165	+ </p>
166	+ </td>
167	+ </tr>
168	<tr valign="top" class="compact">
169	<td>
170	<p>
171	<label>
172	<input type="checkbox" name="link" value="1" />
173	+ <?php esc_html_e('Use this file as template when running Sync','loco-translate')?>
174	</label>
175	</p>
176	</td>