Max Mega Menu - Version 2.1

Version Description

[14/03/2016] =

New Feature: Drag and drop designer for the mobile toggle bar
Fix: WPML Language switcher flags
New Feature: Export menu theme in PHP format (for inclusion in a functions.php file)
Change: Remove CSS Enqueue via admin-ajax.php option due to slow performance

Release Info

Developer	megamenu
Plugin	Max Mega Menu
Version	2.1
Comparing to
See all releases

Version 2.1

Files changed (53) hide show

classes/menu-item-manager.class.php +750 -0
classes/nav-menus.class.php +455 -0
classes/scssc.inc.php +4443 -0
classes/settings.class.php +3441 -0
classes/style-manager.class.php +1018 -0
classes/toggle-blocks.class.php +642 -0
classes/walker.class.php +163 -0
classes/widget-manager.class.php +1017 -0
classes/widget.class.php +116 -0
css/admin/global.css +25 -0
css/admin/menus.css +999 -0
css/admin/settings.css +603 -0
css/megamenu.scss +690 -0
css/mixin.scss +42 -0
css/reset.scss +59 -0
css/toggle-blocks.scss +64 -0
font/maxmegamenu.eot +0 -0
font/maxmegamenu.svg +12 -0
font/maxmegamenu.ttf +0 -0
font/maxmegamenu.woff +0 -0
js/admin.js +598 -0
js/codemirror/codemirror.css +301 -0
js/codemirror/codemirror.js +13 -0
js/colorbox/colorbox.css +86 -0
js/colorbox/images/border.png +0 -0
js/colorbox/images/controls.png +0 -0
js/colorbox/images/ie6/borderBottomCenter.png +0 -0
js/colorbox/images/ie6/borderBottomLeft.png +0 -0
js/colorbox/images/ie6/borderBottomRight.png +0 -0
js/colorbox/images/ie6/borderMiddleLeft.png +0 -0
js/colorbox/images/ie6/borderMiddleRight.png +0 -0
js/colorbox/images/ie6/borderTopCenter.png +0 -0
js/colorbox/images/ie6/borderTopLeft.png +0 -0
js/colorbox/images/ie6/borderTopRight.png +0 -0
js/colorbox/images/loading.gif +0 -0
js/colorbox/images/loading_background.png +0 -0
js/colorbox/images/overlay.png +0 -0
js/colorbox/jquery.colorbox-min.js +1061 -0
js/maxmegamenu.js +264 -0
js/select2/select2.css +702 -0
js/select2/select2.min.js +23 -0
js/settings.js +105 -0
js/spectrum/spectrum.css +446 -0
js/spectrum/spectrum.js +2109 -0
js/toggledesigner.js +153 -0
languages/megamenu-de_DE.mo +0 -0
languages/megamenu-de_DE.po +1122 -0
languages/megamenu-fr_FR.mo +0 -0
languages/megamenu-fr_FR.po +1580 -0
languages/megamenu-it_IT.mo +0 -0
languages/megamenu-it_IT.po +1039 -0
languages/megamenu.mo +0 -0
languages/megamenu.po +1020 -0

classes/menu-item-manager.class.php ADDED Viewed

	@@ -0,0 +1,750 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists('Mega_Menu_Menu_Item_Manager') ) :
8	+
9	+ /**
10	+ *
11	+ * @since 1.4
12	+ */
13	+ class Mega_Menu_Menu_Item_Manager {
14	+
15	+ var $menu_id = 0;
16	+
17	+ var $menu_item_id = 0;
18	+
19	+ var $menu_item_depth = 0;
20	+
21	+ var $menu_item_meta = array();
22	+
23	+
24	+ /**
25	+ * Constructor
26	+ *
27	+ * @since 1.4
28	+ */
29	+ public function __construct() {
30	+
31	+ add_action( 'wp_ajax_mm_get_lightbox_html', array( $this, 'ajax_get_lightbox_html' ) );
32	+ add_action( 'wp_ajax_mm_save_menu_item_settings', array( $this, 'ajax_save_menu_item_settings') );
33	+
34	+ add_filter( 'megamenu_tabs', array( $this, 'add_mega_menu_tab'), 10, 5 );
35	+ add_filter( 'megamenu_tabs', array( $this, 'add_general_settings_tab'), 10, 5 );
36	+ add_filter( 'megamenu_tabs', array( $this, 'add_icon_tab'), 10, 5 );
37	+
38	+ }
39	+
40	+
41	+ /**
42	+ * Set up the class
43	+ *
44	+ * @since 1.4
45	+ */
46	+ private function init() {
47	+
48	+ if ( isset( $_POST['menu_item_id'] ) ) {
49	+
50	+ $this->menu_item_id = absint( $_POST['menu_item_id'] );
51	+
52	+ $saved_settings = array_filter( (array) get_post_meta( $this->menu_item_id, '_megamenu', true ) );
53	+
54	+ $this->menu_item_meta = array_merge( Mega_Menu_Nav_Menus::get_menu_item_defaults(), $saved_settings );
55	+
56	+ }
57	+
58	+ if ( isset( $_POST['menu_item_depth'] ) ) {
59	+
60	+ $this->menu_item_depth = absint( $_POST['menu_item_depth'] );
61	+
62	+ }
63	+
64	+ if ( isset( $_POST['menu_id'] ) ) {
65	+
66	+ $this->menu_id = absint( $_POST['menu_id'] );
67	+
68	+ }
69	+
70	+ }
71	+
72	+
73	+ /**
74	+ * Save custom menu item fields.
75	+ *
76	+ * @since 1.4
77	+ */
78	+ public static function ajax_save_menu_item_settings() {
79	+
80	+ check_ajax_referer( 'megamenu_edit' );
81	+
82	+ $submitted_settings = isset( $_POST['settings'] ) ? $_POST['settings'] : array();
83	+
84	+ $menu_item_id = absint( $_POST['menu_item_id'] );
85	+
86	+ if ( $menu_item_id > 0 && is_array( $submitted_settings ) ) {
87	+
88	+ // only check the checkbox values if the general settings form was submitted
89	+ if ( isset( $_POST['tab'] ) && $_POST['tab'] == 'general_settings' ) {
90	+
91	+ // Hide Text checkbox is unchecked
92	+ if ( ! isset( $submitted_settings['hide_text'] ) ) {
93	+
94	+ $submitted_settings['hide_text'] = 'false';
95	+
96	+ }
97	+
98	+ // Disable Link checkbox is unchecked
99	+ if ( ! isset( $submitted_settings['disable_link'] ) ) {
100	+
101	+ $submitted_settings['disable_link'] = 'false';
102	+
103	+ }
104	+
105	+ // Disable arrow checkbox is unchecked
106	+ if ( ! isset ( $submitted_settings['hide_arrow'] ) ) {
107	+
108	+ $submitted_settings['hide_arrow'] = 'false';
109	+
110	+ }
111	+
112	+ // Hide on mobile checkbox is unchecked
113	+ if ( ! isset ( $submitted_settings['hide_on_mobile'] ) ) {
114	+
115	+ $submitted_settings['hide_on_mobile'] = 'false';
116	+
117	+ }
118	+
119	+ // Hide on mobile checkbox is unchecked
120	+ if ( ! isset ( $submitted_settings['hide_sub_menu_on_mobile'] ) ) {
121	+
122	+ $submitted_settings['hide_sub_menu_on_mobile'] = 'false';
123	+
124	+ }
125	+
126	+ // Hide on desktop checkbox is unchecked
127	+ if ( ! isset ( $submitted_settings['hide_on_desktop'] ) ) {
128	+
129	+ $submitted_settings['hide_on_desktop'] = 'false';
130	+
131	+ }
132	+
133	+ }
134	+
135	+ $submitted_settings = apply_filters( "megamenu_menu_item_submitted_settings", $submitted_settings, $menu_item_id );
136	+
137	+ $existing_settings = get_post_meta( $menu_item_id, '_megamenu', true);
138	+
139	+ if ( is_array( $existing_settings ) ) {
140	+
141	+ $submitted_settings = array_merge( $existing_settings, $submitted_settings );
142	+
143	+ }
144	+
145	+ update_post_meta( $menu_item_id, '_megamenu', $submitted_settings );
146	+
147	+ do_action( "megamenu_save_menu_item_settings", $menu_item_id );
148	+
149	+ }
150	+
151	+ if ( isset( $_POST['clear_cache'] ) ) {
152	+
153	+ do_action("megamenu_delete_cache");
154	+
155	+ }
156	+
157	+ if ( ob_get_contents() ) ob_clean(); // remove any warnings or output from other plugins which may corrupt the response
158	+
159	+ wp_send_json_success();
160	+
161	+ }
162	+
163	+
164	+ /**
165	+ * Return the HTML to display in the Lightbox
166	+ *
167	+ * @since 1.4
168	+ * @return string
169	+ */
170	+ public function ajax_get_lightbox_html() {
171	+
172	+ check_ajax_referer( 'megamenu_edit' );
173	+
174	+ $this->init();
175	+
176	+ $tabs = array();
177	+
178	+ $tabs = apply_filters( "megamenu_tabs", $tabs, $this->menu_item_id, $this->menu_id, $this->menu_item_depth, $this->menu_item_meta );
179	+
180	+ if ( ob_get_contents() ) ob_clean(); // remove any warnings or output from other plugins which may corrupt the response
181	+
182	+ wp_send_json_success( json_encode( $tabs ) );
183	+ }
184	+
185	+
186	+ /**
187	+ * Return the HTML to display in the 'Mega Menu' tab
188	+ *
189	+ * @since 1.7
190	+ * @return string
191	+ */
192	+ public function add_mega_menu_tab( $tabs, $menu_item_id, $menu_id, $menu_item_depth, $menu_item_meta ) {
193	+
194	+ if ( $menu_item_depth > 0 ) {
195	+ $tabs['mega_menu'] = array(
196	+ 'title' => __('Sub Menu', 'megamenu'),
197	+ 'content' => '<em>' . __( "Mega Menus can only be created on top level menu items.", "megamenu" ) . '</em>'
198	+ );
199	+
200	+ return $tabs;
201	+ }
202	+
203	+ $widget_manager = new Mega_Menu_Widget_Manager();
204	+
205	+ $all_widgets = $widget_manager->get_available_widgets();
206	+
207	+ $return = "<label for='mm_enable_mega_menu'>" . __("Sub menu display mode", "megamenu") . "</label>";
208	+ $return .= "<select id='mm_enable_mega_menu' name='settings[type]'>";
209	+ $return .= " <option value='flyout'>" . __("Flyout Menu", "megamenu") . "</option>";
210	+ $return .= " <option id='megamenu' value='megamenu' " . selected( $menu_item_meta['type'], 'megamenu', false ) . ">" . __("Mega Menu", "megamenu") . "</option>";
211	+ $return .= "</select>";
212	+
213	+
214	+ $return .= "<select id='mm_number_of_columns' name='settings[panel_columns]'>";
215	+ $return .= " <option value='1' " . selected( $menu_item_meta['panel_columns'], 1, false ) . ">1 " . __("column", "megamenu") . "</option>";
216	+ $return .= " <option value='2' " . selected( $menu_item_meta['panel_columns'], 2, false ) . ">2 " . __("columns", "megamenu") . "</option>";
217	+ $return .= " <option value='3' " . selected( $menu_item_meta['panel_columns'], 3, false ) . ">3 " . __("columns", "megamenu") . "</option>";
218	+ $return .= " <option value='4' " . selected( $menu_item_meta['panel_columns'], 4, false ) . ">4 " . __("columns", "megamenu") . "</option>";
219	+ $return .= " <option value='5' " . selected( $menu_item_meta['panel_columns'], 5, false ) . ">5 " . __("columns", "megamenu") . "</option>";
220	+ $return .= " <option value='6' " . selected( $menu_item_meta['panel_columns'], 6, false ) . ">6 " . __("columns", "megamenu") . "</option>";
221	+ $return .= " <option value='7' " . selected( $menu_item_meta['panel_columns'], 7, false ) . ">7 " . __("columns", "megamenu") . "</option>";
222	+ $return .= " <option value='8' " . selected( $menu_item_meta['panel_columns'], 8, false ) . ">8 " . __("columns", "megamenu") . "</option>";
223	+ $return .= "</select>";
224	+
225	+ $return .= "<select id='mm_widget_selector'>";
226	+ $return .= " <option value='disabled'>" . __("Select a Widget to add to the panel", "megamenu") . "</option>";
227	+
228	+ foreach ( $all_widgets as $widget ) {
229	+ $return .= "<option value='" . $widget['value'] . "'>" . $widget['text'] . "</option>";
230	+ }
231	+
232	+ $return .= "</select>";
233	+
234	+ $class = $menu_item_meta['type'] == 'megamenu' ? 'enabled' : 'disabled';
235	+
236	+ $return .= "<div id='widgets' class='{$class}' data-columns='{$this->menu_item_meta['panel_columns']}'>";
237	+
238	+ $items = $widget_manager->get_widgets_and_menu_items_for_menu_id( $menu_item_id, $this->menu_id );
239	+
240	+ if ( count ( $items ) ) {
241	+
242	+ foreach ( $items as $item ) {
243	+ $return .= '<div class="widget" title="' . esc_attr( $item['title'] ) . '" id="' . esc_attr( $item['id'] ) . '" data-columns="' . esc_attr( $item['columns'] ) . '" data-type="' . esc_attr( $item['type'] ) . '" data-id="' . esc_attr( $item['id'] ) . '">';
244	+ $return .= ' <div class="widget-top">';
245	+ $return .= ' <div class="widget-title-action">';
246	+ $return .= ' <a class="widget-option widget-contract" title="' . esc_attr( __("Contract", "megamenu") ) . '"></a>';
247	+ $return .= ' <span class="widget-cols"><span class="widget-num-cols">' . $item['columns'] . '</span><span class="widget-of">/</span><span class="widget-total-cols">' . $menu_item_meta['panel_columns'] . '</span></span>';
248	+ $return .= ' <a class="widget-option widget-expand" title="' . esc_attr( __("Expand", "megamenu") ) . '"></a>';
249	+ $return .= ' <a class="widget-option widget-action" title="' . esc_attr( __("Edit", "megamenu") ) . '"></a>';
250	+ $return .= ' </div>';
251	+ $return .= ' <div class="widget-title">';
252	+ $return .= ' <h4>' . esc_html( $item['title'] ) . '</h4>';
253	+ $return .= ' </div>';
254	+ $return .= ' </div>';
255	+ $return .= ' <div class="widget-inner"></div>';
256	+ $return .= '</div>';
257	+ }
258	+
259	+ } else {
260	+ $return .= "<p class='no_widgets'>" . __("No widgets found. Add a widget to this area using the Widget Selector (top right)") . "</p>";
261	+ }
262	+
263	+ $return .= "</div>";
264	+
265	+ $tabs['mega_menu'] = array(
266	+ 'title' => __('Mega Menu', 'megamenu'),
267	+ 'content' => $return
268	+ );
269	+
270	+ return $tabs;
271	+ }
272	+
273	+
274	+ /**
275	+ * Return the HTML to display in the 'General Settings' tab
276	+ *
277	+ * @since 1.7
278	+ * @return string
279	+ */
280	+ public function add_general_settings_tab( $tabs, $menu_item_id, $menu_id, $menu_item_depth, $menu_item_meta ) {
281	+
282	+ $return = '<form>';
283	+ $return .= ' <input type="hidden" name="menu_item_id" value="' . $menu_item_id . '" />';
284	+ $return .= ' <input type="hidden" name="action" value="mm_save_menu_item_settings" />';
285	+ $return .= ' <input type="hidden" name="_wpnonce" value="' . wp_create_nonce('megamenu_edit') . '" />';
286	+ $return .= ' <input type="hidden" name="tab" value="general_settings" />';
287	+ $return .= ' <h4 class="first">' . __("Menu Item Settings", "megamenu") . '</h4>';
288	+ $return .= ' <table>';
289	+ $return .= ' <tr>';
290	+ $return .= ' <td class="mega-name">';
291	+ $return .= __("Hide Text", "megamenu");
292	+ $return .= ' </td>';
293	+ $return .= ' <td class="mega-value">';
294	+
295	+ if ( $this->menu_item_depth == 0 ) {
296	+ $return .= '<input type="checkbox" name="settings[hide_text]" value="true" ' . checked( $menu_item_meta['hide_text'], 'true', false ) . ' />';
297	+ } else {
298	+ $return .= '<em>' . __("Option only available for top level menu items", "megamenu") . '</em>';
299	+ }
300	+
301	+ $return .= ' </td>';
302	+ $return .= ' </tr>';
303	+ $return .= ' <tr>';
304	+ $return .= ' <td class="mega-name">';
305	+ $return .= __("Hide Arrow", "megamenu");
306	+ $return .= ' </td>';
307	+ $return .= ' <td class="mega-value">';
308	+ $return .= ' <input type="checkbox" name="settings[hide_arrow]" value="true" ' . checked( $menu_item_meta['hide_arrow'], 'true', false ) . ' />';
309	+ $return .= ' </td>';
310	+ $return .= ' </tr>';
311	+ $return .= ' <tr>';
312	+ $return .= ' <td class="mega-name">';
313	+ $return .= __("Disable Link", "megamenu");
314	+ $return .= ' </td>';
315	+ $return .= ' <td class="mega-value">';
316	+ $return .= ' <input type="checkbox" name="settings[disable_link]" value="true" ' . checked( $menu_item_meta['disable_link'], 'true', false ) . ' />';
317	+ $return .= ' </td>';
318	+ $return .= ' </tr>';
319	+ $return .= ' <tr>';
320	+ $return .= ' <td class="mega-name">';
321	+ $return .= __("Hide Item on Mobile", "megamenu");
322	+ $return .= ' </td>';
323	+ $return .= ' <td class="mega-value">';
324	+ $return .= ' <input type="checkbox" name="settings[hide_on_mobile]" value="true" ' . checked( $menu_item_meta['hide_on_mobile'], 'true', false ) . ' />';
325	+ $return .= ' </td>';
326	+ $return .= ' </tr>';
327	+ $return .= ' <tr>';
328	+ $return .= ' <td class="mega-name">';
329	+ $return .= __("Hide Item on Desktop", "megamenu");
330	+ $return .= ' </td>';
331	+ $return .= ' <td class="mega-value">';
332	+ $return .= ' <input type="checkbox" name="settings[hide_on_desktop]" value="true" ' . checked( $menu_item_meta['hide_on_desktop'], 'true', false ) . ' />';
333	+ $return .= ' </td>';
334	+ $return .= ' </tr>';
335	+ $return .= ' <tr>';
336	+ $return .= ' <td class="mega-name">';
337	+ $return .= __("Menu Item Align", "megamenu");
338	+ $return .= ' </td>';
339	+ $return .= ' <td class="mega-value">';
340	+
341	+ if ( $menu_item_depth == 0 ) {
342	+ $return .= ' <select name="settings[item_align]">';
343	+ $return .= ' <option value="left" ' . selected( $menu_item_meta['item_align'], 'left', false ) . '>' . __("Left", "megamenu") . '</option>';
344	+ $return .= ' <option value="right" ' . selected( $menu_item_meta['item_align'], 'right', false ) . '>' . __("Right", "megamenu") . '</option>';
345	+ $return .= ' </select>';
346	+ $return .= ' <div class="mega-description">';
347	+ $return .= __("Right aligned items will appear in reverse order on the right hand side of the menu bar", "megamenu");
348	+ $return .= ' </div>';
349	+ } else {
350	+ $return .= '<em>' . __("Option only available for top level menu items", "megamenu") . '</em>';
351	+ }
352	+
353	+ $return .= ' </td>';
354	+ $return .= ' </tr>';
355	+ $return .= ' </table>';
356	+
357	+ $return .= ' <h4>' . __("Sub Menu Settings", "megamenu") . '</h4>';
358	+
359	+ $return .= ' <table>';
360	+ $return .= ' <tr>';
361	+ $return .= ' <td class="mega-name">';
362	+ $return .= __("Sub Menu Align", "megamenu");
363	+ $return .= ' </td>';
364	+ $return .= ' <td class="mega-value">';
365	+
366	+ if ( $menu_item_depth == 0 ) {
367	+ $return .= ' <select name="settings[align]">';
368	+ $return .= ' <option value="bottom-left" ' . selected( $menu_item_meta['align'], 'bottom-left', false ) . '>' . __("Left edge of Parent", "megamenu") . '</option>';
369	+ $return .= ' <option value="bottom-right" ' . selected( $menu_item_meta['align'], 'bottom-right', false ) . '>' . __("Right edge of Parent", "megamenu") . '</option>';
370	+ $return .= ' </select>';
371	+ $return .= ' <div class="mega-description">';
372	+ $return .= __("Right aligned flyout menus will expand to the left", "megamenu");
373	+ $return .= ' </div>';
374	+ } else {
375	+ $return .= '<em>' . __("Option only available for top level menu items", "megamenu") . '</em>';
376	+ }
377	+
378	+ $return .= ' </td>';
379	+ $return .= ' </tr>';
380	+ $return .= ' <tr>';
381	+ $return .= ' <td class="mega-name">';
382	+ $return .= __("Hide Sub Menu on Mobile", "megamenu");
383	+ $return .= ' </td>';
384	+ $return .= ' <td class="mega-value">';
385	+ $return .= ' <input type="checkbox" name="settings[hide_sub_menu_on_mobile]" value="true" ' . checked( $menu_item_meta['hide_sub_menu_on_mobile'], 'true', false ) . ' />';
386	+ $return .= ' </td>';
387	+ $return .= ' </tr>';
388	+ $return .= ' </table>';
389	+ $return .= get_submit_button();
390	+ $return .= '</form>';
391	+
392	+ $tabs['general_settings'] = array(
393	+ 'title' => __('Settings', 'megamenu'),
394	+ 'content' => $return
395	+ );
396	+
397	+ return $tabs;
398	+
399	+ }
400	+
401	+
402	+ /**
403	+ * Return the HTML to display in the 'menu icon' tab
404	+ *
405	+ * @since 1.7
406	+ * @return string
407	+ */
408	+ public function add_icon_tab( $tabs, $menu_item_id, $menu_id, $menu_item_depth, $menu_item_meta ) {
409	+
410	+ $icon_tabs = array(
411	+ 'dashicons' => array(
412	+ 'title' => __("Dashicons", "megamenu"),
413	+ 'active' => ! isset( $menu_item_meta['icon'] ) \|\| ( isset( $menu_item_meta['icon'] ) && substr( $menu_item_meta['icon'], 0, strlen("dash") ) === "dash" \|\| $menu_item_meta['icon'] == 'disabled' ),
414	+ 'content' => $this->dashicon_selector()
415	+ ),
416	+ 'fontawesome' => array(
417	+ 'title' => __("Font Awesome", "megamenu"),
418	+ 'active' => false,
419	+ 'content' => str_replace( "{link}", "<a href='https://www.maxmegamenu.com/upgrade/?utm_source=free&utm_medium=link&utm_campaign=pro'>" . __("Max Mega Menu Pro", "megamenu") . "</a>", __("Get access to over 400 Font Awesome Icons with {link}", "megamenu") )
420	+ ),
421	+ 'genericons' => array(
422	+ 'title' => __("Genericons", "megamenu"),
423	+ 'active' => false,
424	+ 'content' => str_replace( "{link}", "<a href='https://www.maxmegamenu.com/upgrade/?utm_source=free&utm_medium=link&utm_campaign=pro'>" . __("Max Mega Menu Pro", "megamenu") . "</a>", __("Choose from over 100 genericons with {link}", "megamenu") )
425	+ ),
426	+ 'custom' => array(
427	+ 'title' => __("Custom Icon", "megamenu"),
428	+ 'active' => false,
429	+ 'content' => str_replace( "{link}", "<a href='https://www.maxmegamenu.com/upgrade/?utm_source=free&utm_medium=link&utm_campaign=pro'>" . __("Max Mega Menu Pro", "megamenu") . "</a>", __("Select icons from your media library with {link}", "megamenu") )
430	+ ),
431	+ );
432	+
433	+ $icon_tabs = apply_filters( "megamenu_icon_tabs", $icon_tabs, $menu_item_id, $menu_id, $menu_item_depth, $menu_item_meta );
434	+
435	+ $return = ' <h4 class="first">' . __("Menu Item Icon", "megamenu") . '</h4>';
436	+ $return .= "<ul class='mm_tabs horizontal'>";
437	+
438	+ foreach ( $icon_tabs as $id => $icon_tab ) {
439	+
440	+ $active = $icon_tab['active'] \|\| count( $icon_tabs ) === 1 ? "active" : "";
441	+
442	+ $return .= "<li rel='mm_tab_{$id}' class='{$active}'>";
443	+ $return .= esc_html( $icon_tab['title'] );
444	+ $return .= "</li>";
445	+
446	+ }
447	+
448	+ $return .= "</ul>";
449	+
450	+ foreach ($icon_tabs as $id => $icon_tab) {
451	+
452	+ $display = $icon_tab['active'] ? "block" : "none";
453	+
454	+ $return .= "<div class='mm_tab_{$id}' style='display: {$display}'>";
455	+ $return .= " <form class='icon_selector'>";
456	+ $return .= " <input type='hidden' name='_wpnonce' value='" . wp_create_nonce('megamenu_edit') . "' />";
457	+ $return .= " <input type='hidden' name='menu_item_id' value='{$menu_item_id}' />";
458	+ $return .= " <input type='hidden' name='action' value='mm_save_menu_item_settings' />";
459	+ $return .= $icon_tab['content'];
460	+ $return .= " </form>";
461	+ $return .= "</div>";
462	+
463	+ }
464	+
465	+ $tabs['menu_icon'] = array(
466	+ 'title' => __('Icon', 'megamenu'),
467	+ 'content' => $return
468	+ );
469	+
470	+ return $tabs;
471	+
472	+ }
473	+
474	+ /**
475	+ * Return the form to select a dashicon
476	+ *
477	+ * @since 1.5.2
478	+ */
479	+ private function dashicon_selector() {
480	+
481	+ $return = "<div class='disabled'><input id='disabled' class='radio' type='radio' rel='disabled' name='settings[icon]' value='disabled' " . checked( $this->menu_item_meta['icon'], 'disabled', false ) . " />";
482	+ $return .= "<label for='disabled'></label></div>";
483	+
484	+ foreach ( $this->all_icons() as $code => $class ) {
485	+
486	+ $bits = explode( "-", $code );
487	+ $code = "&#x" . $bits[1] . "";
488	+ $type = $bits[0];
489	+
490	+ $return .= "<div class='{$type}'>";
491	+ $return .= " <input class='radio' id='{$class}' type='radio' rel='{$code}' name='settings[icon]' value='{$class}' " . checked( $this->menu_item_meta['icon'], $class, false ) . " />";
492	+ $return .= " <label rel='{$code}' for='{$class}'></label>";
493	+ $return .= "</div>";
494	+
495	+ }
496	+
497	+ return $return;
498	+ }
499	+
500	+
501	+ /**
502	+ * List of all available DashIcon classes.
503	+ *
504	+ * @since 1.0
505	+ * @return array - Sorted list of icon classes
506	+ */
507	+ public function all_icons() {
508	+
509	+ $icons = array(
510	+ 'dash-f333' => 'dashicons-menu',
511	+ 'dash-f319' => 'dashicons-admin-site',
512	+ 'dash-f226' => 'dashicons-dashboard',
513	+ 'dash-f109' => 'dashicons-admin-post',
514	+ 'dash-f104' => 'dashicons-admin-media',
515	+ 'dash-f103' => 'dashicons-admin-links',
516	+ 'dash-f105' => 'dashicons-admin-page',
517	+ 'dash-f101' => 'dashicons-admin-comments',
518	+ 'dash-f100' => 'dashicons-admin-appearance',
519	+ 'dash-f106' => 'dashicons-admin-plugins',
520	+ 'dash-f110' => 'dashicons-admin-users',
521	+ 'dash-f107' => 'dashicons-admin-tools',
522	+ 'dash-f108' => 'dashicons-admin-settings',
523	+ 'dash-f112' => 'dashicons-admin-network',
524	+ 'dash-f102' => 'dashicons-admin-home',
525	+ 'dash-f111' => 'dashicons-admin-generic',
526	+ 'dash-f148' => 'dashicons-admin-collapse',
527	+ 'dash-f536' => 'dashicons-filter',
528	+ 'dash-f540' => 'dashicons-admin-customizer',
529	+ 'dash-f541' => 'dashicons-admin-multisite',
530	+ 'dash-f119' => 'dashicons-welcome-write-blog',
531	+ 'dash-f133' => 'dashicons-welcome-add-page',
532	+ 'dash-f115' => 'dashicons-welcome-view-site',
533	+ 'dash-f116' => 'dashicons-welcome-widgets-menus',
534	+ 'dash-f117' => 'dashicons-welcome-comments',
535	+ 'dash-f118' => 'dashicons-welcome-learn-more',
536	+ 'dash-f123' => 'dashicons-format-aside',
537	+ 'dash-f128' => 'dashicons-format-image',
538	+ 'dash-f161' => 'dashicons-format-gallery',
539	+ 'dash-f126' => 'dashicons-format-video',
540	+ 'dash-f130' => 'dashicons-format-status',
541	+ 'dash-f122' => 'dashicons-format-quote',
542	+ 'dash-f125' => 'dashicons-format-chat',
543	+ 'dash-f127' => 'dashicons-format-audio',
544	+ 'dash-f306' => 'dashicons-camera',
545	+ 'dash-f232' => 'dashicons-images-alt',
546	+ 'dash-f233' => 'dashicons-images-alt2',
547	+ 'dash-f234' => 'dashicons-video-alt',
548	+ 'dash-f235' => 'dashicons-video-alt2',
549	+ 'dash-f236' => 'dashicons-video-alt3',
550	+ 'dash-f501' => 'dashicons-media-archive',
551	+ 'dash-f500' => 'dashicons-media-audio',
552	+ 'dash-f499' => 'dashicons-media-code',
553	+ 'dash-f498' => 'dashicons-media-default',
554	+ 'dash-f497' => 'dashicons-media-document',
555	+ 'dash-f496' => 'dashicons-media-interactive',
556	+ 'dash-f495' => 'dashicons-media-spreadsheet',
557	+ 'dash-f491' => 'dashicons-media-text',
558	+ 'dash-f490' => 'dashicons-media-video',
559	+ 'dash-f492' => 'dashicons-playlist-audio',
560	+ 'dash-f493' => 'dashicons-playlist-video',
561	+ 'dash-f522' => 'dashicons-controls-play',
562	+ 'dash-f523' => 'dashicons-controls-pause',
563	+ 'dash-f519' => 'dashicons-controls-forward',
564	+ 'dash-f517' => 'dashicons-controls-skipforward',
565	+ 'dash-f518' => 'dashicons-controls-back',
566	+ 'dash-f516' => 'dashicons-controls-skipback',
567	+ 'dash-f515' => 'dashicons-controls-repeat',
568	+ 'dash-f521' => 'dashicons-controls-volumeon',
569	+ 'dash-f520' => 'dashicons-controls-volumeoff',
570	+ 'dash-f165' => 'dashicons-image-crop',
571	+ 'dash-f531' => 'dashicons-image-rotate',
572	+ 'dash-f166' => 'dashicons-image-rotate-left',
573	+ 'dash-f167' => 'dashicons-image-rotate-right',
574	+ 'dash-f168' => 'dashicons-image-flip-vertical',
575	+ 'dash-f169' => 'dashicons-image-flip-horizontal',
576	+ 'dash-f533' => 'dashicons-image-filter',
577	+ 'dash-f171' => 'dashicons-undo',
578	+ 'dash-f172' => 'dashicons-redo',
579	+ 'dash-f200' => 'dashicons-editor-bold',
580	+ 'dash-f201' => 'dashicons-editor-italic',
581	+ 'dash-f203' => 'dashicons-editor-ul',
582	+ 'dash-f204' => 'dashicons-editor-ol',
583	+ 'dash-f205' => 'dashicons-editor-quote',
584	+ 'dash-f206' => 'dashicons-editor-alignleft',
585	+ 'dash-f207' => 'dashicons-editor-aligncenter',
586	+ 'dash-f208' => 'dashicons-editor-alignright',
587	+ 'dash-f209' => 'dashicons-editor-insertmore',
588	+ 'dash-f210' => 'dashicons-editor-spellcheck',
589	+ 'dash-f211' => 'dashicons-editor-expand',
590	+ 'dash-f506' => 'dashicons-editor-contract',
591	+ 'dash-f212' => 'dashicons-editor-kitchensink',
592	+ 'dash-f213' => 'dashicons-editor-underline',
593	+ 'dash-f214' => 'dashicons-editor-justify',
594	+ 'dash-f215' => 'dashicons-editor-textcolor',
595	+ 'dash-f216' => 'dashicons-editor-paste-word',
596	+ 'dash-f217' => 'dashicons-editor-paste-text',
597	+ 'dash-f218' => 'dashicons-editor-removeformatting',
598	+ 'dash-f219' => 'dashicons-editor-video',
599	+ 'dash-f220' => 'dashicons-editor-customchar',
600	+ 'dash-f221' => 'dashicons-editor-outdent',
601	+ 'dash-f222' => 'dashicons-editor-indent',
602	+ 'dash-f223' => 'dashicons-editor-help',
603	+ 'dash-f224' => 'dashicons-editor-strikethrough',
604	+ 'dash-f225' => 'dashicons-editor-unlink',
605	+ 'dash-f320' => 'dashicons-editor-rtl',
606	+ 'dash-f474' => 'dashicons-editor-break',
607	+ 'dash-f475' => 'dashicons-editor-code',
608	+ 'dash-f476' => 'dashicons-editor-paragraph',
609	+ 'dash-f535' => 'dashicons-editor-table',
610	+ 'dash-f135' => 'dashicons-align-left',
611	+ 'dash-f136' => 'dashicons-align-right',
612	+ 'dash-f134' => 'dashicons-align-center',
613	+ 'dash-f138' => 'dashicons-align-none',
614	+ 'dash-f160' => 'dashicons-lock',
615	+ 'dash-f528' => 'dashicons-unlock',
616	+ 'dash-f145' => 'dashicons-calendar',
617	+ 'dash-f508' => 'dashicons-calendar-alt',
618	+ 'dash-f177' => 'dashicons-visibility',
619	+ 'dash-f530' => 'dashicons-hidden',
620	+ 'dash-f173' => 'dashicons-post-status',
621	+ 'dash-f464' => 'dashicons-edit',
622	+ 'dash-f182' => 'dashicons-trash',
623	+ 'dash-f537' => 'dashicons-sticky',
624	+ 'dash-f504' => 'dashicons-external',
625	+ 'dash-f142' => 'dashicons-arrow-up',
626	+ 'dash-f140' => 'dashicons-arrow-down',
627	+ 'dash-f139' => 'dashicons-arrow-right',
628	+ 'dash-f141' => 'dashicons-arrow-left',
629	+ 'dash-f342' => 'dashicons-arrow-up-alt',
630	+ 'dash-f346' => 'dashicons-arrow-down-alt',
631	+ 'dash-f344' => 'dashicons-arrow-right-alt',
632	+ 'dash-f340' => 'dashicons-arrow-left-alt',
633	+ 'dash-f343' => 'dashicons-arrow-up-alt2',
634	+ 'dash-f347' => 'dashicons-arrow-down-alt2',
635	+ 'dash-f345' => 'dashicons-arrow-right-alt2',
636	+ 'dash-f341' => 'dashicons-arrow-left-alt2',
637	+ 'dash-f156' => 'dashicons-sort',
638	+ 'dash-f229' => 'dashicons-leftright',
639	+ 'dash-f503' => 'dashicons-randomize',
640	+ 'dash-f163' => 'dashicons-list-view',
641	+ 'dash-f164' => 'dashicons-exerpt-view',
642	+ 'dash-f509' => 'dashicons-grid-view',
643	+ 'dash-f237' => 'dashicons-share',
644	+ 'dash-f240' => 'dashicons-share-alt',
645	+ 'dash-f242' => 'dashicons-share-alt2',
646	+ 'dash-f301' => 'dashicons-twitter',
647	+ 'dash-f303' => 'dashicons-rss',
648	+ 'dash-f465' => 'dashicons-email',
649	+ 'dash-f466' => 'dashicons-email-alt',
650	+ 'dash-f304' => 'dashicons-facebook',
651	+ 'dash-f305' => 'dashicons-facebook-alt',
652	+ 'dash-f462' => 'dashicons-googleplus',
653	+ 'dash-f325' => 'dashicons-networking',
654	+ 'dash-f308' => 'dashicons-hammer',
655	+ 'dash-f309' => 'dashicons-art',
656	+ 'dash-f310' => 'dashicons-migrate',
657	+ 'dash-f311' => 'dashicons-performance',
658	+ 'dash-f483' => 'dashicons-universal-access',
659	+ 'dash-f507' => 'dashicons-universal-access-alt',
660	+ 'dash-f486' => 'dashicons-tickets',
661	+ 'dash-f484' => 'dashicons-nametag',
662	+ 'dash-f481' => 'dashicons-clipboard',
663	+ 'dash-f487' => 'dashicons-heart',
664	+ 'dash-f488' => 'dashicons-megaphone',
665	+ 'dash-f489' => 'dashicons-schedule',
666	+ 'dash-f120' => 'dashicons-wordpress',
667	+ 'dash-f324' => 'dashicons-wordpress-alt',
668	+ 'dash-f157' => 'dashicons-pressthis',
669	+ 'dash-f463' => 'dashicons-update',
670	+ 'dash-f180' => 'dashicons-screenoptions',
671	+ 'dash-f348' => 'dashicons-info',
672	+ 'dash-f174' => 'dashicons-cart',
673	+ 'dash-f175' => 'dashicons-feedback',
674	+ 'dash-f176' => 'dashicons-cloud',
675	+ 'dash-f326' => 'dashicons-translation',
676	+ 'dash-f323' => 'dashicons-tag',
677	+ 'dash-f318' => 'dashicons-category',
678	+ 'dash-f480' => 'dashicons-archive',
679	+ 'dash-f479' => 'dashicons-tagcloud',
680	+ 'dash-f478' => 'dashicons-text',
681	+ 'dash-f147' => 'dashicons-yes',
682	+ 'dash-f158' => 'dashicons-no',
683	+ 'dash-f335' => 'dashicons-no-alt',
684	+ 'dash-f132' => 'dashicons-plus',
685	+ 'dash-f502' => 'dashicons-plus-alt',
686	+ 'dash-f460' => 'dashicons-minus',
687	+ 'dash-f153' => 'dashicons-dismiss',
688	+ 'dash-f159' => 'dashicons-marker',
689	+ 'dash-f155' => 'dashicons-star-filled',
690	+ 'dash-f459' => 'dashicons-star-half',
691	+ 'dash-f154' => 'dashicons-star-empty',
692	+ 'dash-f227' => 'dashicons-flag',
693	+ 'dash-f534' => 'dashicons-warning',
694	+ 'dash-f230' => 'dashicons-location',
695	+ 'dash-f231' => 'dashicons-location-alt',
696	+ 'dash-f178' => 'dashicons-vault',
697	+ 'dash-f332' => 'dashicons-shield',
698	+ 'dash-f334' => 'dashicons-shield-alt',
699	+ 'dash-f468' => 'dashicons-sos',
700	+ 'dash-f179' => 'dashicons-search',
701	+ 'dash-f181' => 'dashicons-slides',
702	+ 'dash-f183' => 'dashicons-analytics',
703	+ 'dash-f184' => 'dashicons-chart-pie',
704	+ 'dash-f185' => 'dashicons-chart-bar',
705	+ 'dash-f238' => 'dashicons-chart-line',
706	+ 'dash-f239' => 'dashicons-chart-area',
707	+ 'dash-f307' => 'dashicons-groups',
708	+ 'dash-f338' => 'dashicons-businessman',
709	+ 'dash-f336' => 'dashicons-id',
710	+ 'dash-f337' => 'dashicons-id-alt',
711	+ 'dash-f312' => 'dashicons-products',
712	+ 'dash-f313' => 'dashicons-awards',
713	+ 'dash-f314' => 'dashicons-forms',
714	+ 'dash-f473' => 'dashicons-testimonial',
715	+ 'dash-f322' => 'dashicons-portfolio',
716	+ 'dash-f330' => 'dashicons-book',
717	+ 'dash-f331' => 'dashicons-book-alt',
718	+ 'dash-f316' => 'dashicons-download',
719	+ 'dash-f317' => 'dashicons-upload',
720	+ 'dash-f321' => 'dashicons-backup',
721	+ 'dash-f469' => 'dashicons-clock',
722	+ 'dash-f339' => 'dashicons-lightbulb',
723	+ 'dash-f482' => 'dashicons-microphone',
724	+ 'dash-f472' => 'dashicons-desktop',
725	+ 'dash-f471' => 'dashicons-tablet',
726	+ 'dash-f470' => 'dashicons-smartphone',
727	+ 'dash-f525' => 'dashicons-phone',
728	+ 'dash-f510' => 'dashicons-index-card',
729	+ 'dash-f511' => 'dashicons-carrot',
730	+ 'dash-f512' => 'dashicons-building',
731	+ 'dash-f513' => 'dashicons-store',
732	+ 'dash-f514' => 'dashicons-album',
733	+ 'dash-f527' => 'dashicons-palmtree',
734	+ 'dash-f524' => 'dashicons-tickets-alt',
735	+ 'dash-f526' => 'dashicons-money',
736	+ 'dash-f328' => 'dashicons-smiley',
737	+ 'dash-f529' => 'dashicons-thumbs-up',
738	+ 'dash-f542' => 'dashicons-thumbs-down',
739	+ 'dash-f538' => 'dashicons-layout'
740	+ );
741	+
742	+ $icons = apply_filters( "megamenu_dashicons", $icons );
743	+
744	+ ksort( $icons );
745	+
746	+ return $icons;
747	+ }
748	+ }
749	+
750	+ endif;

classes/nav-menus.class.php ADDED Viewed

	@@ -0,0 +1,455 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists( 'Mega_Menu_Nav_Menus' ) ) :
8	+ /**
9	+ * Handles all admin related functionality.
10	+ */
11	+ class Mega_Menu_Nav_Menus {
12	+
13	+ /**
14	+ * Return the default settings for each menu item
15	+ *
16	+ * @since 1.5
17	+ */
18	+ public static function get_menu_item_defaults() {
19	+
20	+ $defaults = array(
21	+ 'type' => 'flyout',
22	+ 'align' => 'bottom-left',
23	+ 'icon' => 'disabled',
24	+ 'hide_text' => 'false',
25	+ 'disable_link' => 'false',
26	+ 'hide_on_mobile' => 'false',
27	+ 'hide_on_desktop' => 'false',
28	+ 'hide_sub_menu_on_mobile' => 'false',
29	+ 'hide_arrow' => 'false',
30	+ 'item_align' => 'left',
31	+ 'panel_columns' => 6, // total number of columns displayed in the panel
32	+ 'mega_menu_columns' => 1, // for sub menu items, how many columns to span in the panel,
33	+ 'mega_menu_order' => 0
34	+ );
35	+
36	+ return apply_filters( "megamenu_menu_item_defaults", $defaults );
37	+
38	+ }
39	+
40	+ /**
41	+ * Constructor
42	+ *
43	+ * @since 1.0
44	+ */
45	+ public function __construct() {
46	+
47	+ add_action( 'admin_init', array( $this, 'register_nav_meta_box' ), 9 );
48	+ add_action( 'megamenu_nav_menus_scripts', array( $this, 'enqueue_menu_page_scripts' ), 9 );
49	+ add_action( 'megamenu_save_settings', array($this, 'save') );
50	+ add_filter( 'hidden_meta_boxes', array( $this, 'show_mega_menu_metabox' ) );
51	+
52	+ if ( function_exists( 'siteorigin_panels_admin_enqueue_scripts' ) ) {
53	+ add_action( 'admin_print_scripts-nav-menus.php', array( $this, 'siteorigin_panels_admin_enqueue_scripts') );
54	+ }
55	+
56	+ if ( function_exists( 'siteorigin_panels_admin_enqueue_styles' ) ) {
57	+ add_action( 'admin_print_styles-nav-menus.php', array( $this, 'siteorigin_panels_admin_enqueue_styles') );
58	+ }
59	+
60	+ }
61	+
62	+
63	+ /**
64	+ * Enqueue Page Builder scripts (https://wordpress.org/plugins/siteorigin-panels/)
65	+ * @since 1.9
66	+ */
67	+ public function siteorigin_panels_admin_enqueue_scripts() {
68	+ siteorigin_panels_admin_enqueue_scripts('', true);
69	+ }
70	+
71	+
72	+ /**
73	+ * Enqueue Page Builder styles (https://wordpress.org/plugins/siteorigin-panels/)
74	+ * @since 1.9
75	+ */
76	+ public function siteorigin_panels_admin_enqueue_styles() {
77	+ siteorigin_panels_admin_enqueue_styles('', true);
78	+ }
79	+
80	+
81	+ /**
82	+ * By default the mega menu meta box is hidden - show it.
83	+ *
84	+ * @since 1.0
85	+ * @param array $hidden
86	+ * @return array
87	+ */
88	+ public function show_mega_menu_metabox( $hidden ) {
89	+
90	+ if ( is_array( $hidden ) && count( $hidden ) > 0 ) {
91	+ foreach ( $hidden as $key => $value ) {
92	+ if ( $value == 'mega_menu_meta_box' ) {
93	+ unset( $hidden[$key] );
94	+ }
95	+ }
96	+ }
97	+
98	+ return $hidden;
99	+ }
100	+
101	+
102	+ /**
103	+ * Adds the meta box container
104	+ *
105	+ * @since 1.0
106	+ */
107	+ public function register_nav_meta_box() {
108	+ global $pagenow;
109	+
110	+ if ( 'nav-menus.php' == $pagenow ) {
111	+
112	+ if ( isset( $_GET['mmm_get_started'] ) && ( ! isset( $_POST ) \|\| ! count( $_POST ) ) ) {
113	+ $class = 'mega_menu_meta_box mmm_get_started';
114	+ } else {
115	+ $class = 'mega_menu_meta_box';
116	+ }
117	+
118	+ add_meta_box(
119	+ $class,
120	+ __("Max Mega Menu Settings", "megamenu"),
121	+ array( $this, 'metabox_contents' ),
122	+ 'nav-menus',
123	+ 'side',
124	+ 'high'
125	+ );
126	+
127	+ }
128	+
129	+ }
130	+
131	+
132	+ /**
133	+ * Enqueue required CSS and JS for Mega Menu
134	+ *
135	+ * @since 1.0
136	+ */
137	+ public function enqueue_menu_page_scripts($hook) {
138	+
139	+ if( 'nav-menus.php' != $hook )
140	+ return;
141	+
142	+ // http://wordpress.org/plugins/image-widget/
143	+ if ( class_exists( 'Tribe_Image_Widget' ) ) {
144	+ $image_widget = new Tribe_Image_Widget;
145	+ $image_widget->admin_setup();
146	+ }
147	+
148	+ // Compatibility fix for SlideDeck Pro
149	+ wp_deregister_script('codemirror');
150	+ wp_deregister_style('codemirror');
151	+
152	+ // Compatibility fix for Pinboard Theme
153	+ wp_deregister_script('colorbox');
154	+ wp_deregister_style('colorbox');
155	+
156	+ // Compatibility fix for AGP Font Awesome Collection
157	+ wp_deregister_script('colorbox-js');
158	+ wp_deregister_style('colorbox-css');
159	+
160	+ wp_enqueue_style( 'colorbox', MEGAMENU_BASE_URL . 'js/colorbox/colorbox.css', false, MEGAMENU_VERSION );
161	+ wp_enqueue_style( 'mega-menu', MEGAMENU_BASE_URL . 'css/admin/menus.css', false, MEGAMENU_VERSION );
162	+
163	+ wp_enqueue_script( 'mega-menu', MEGAMENU_BASE_URL . 'js/admin.js', array(
164	+ 'jquery',
165	+ 'jquery-ui-core',
166	+ 'jquery-ui-sortable',
167	+ 'jquery-ui-accordion'),
168	+ MEGAMENU_VERSION );
169	+
170	+ wp_enqueue_script( 'colorbox', MEGAMENU_BASE_URL . 'js/colorbox/jquery.colorbox-min.js', array( 'jquery' ), MEGAMENU_VERSION );
171	+
172	+ wp_localize_script( 'mega-menu', 'megamenu',
173	+ array(
174	+ 'debug_launched' => __("Launched for Menu ID", "megamenu"),
175	+ 'get_started' => __("Use these settings to enable Max Mega Menu", "megamenu"),
176	+ 'launch_lightbox' => __("Mega Menu", "megamenu"),
177	+ 'is_disabled_error' => __("Please enable Max Mega Menu using the settings on the left of this page.", "megamenu"),
178	+ 'saving' => __("Saving", "megamenu"),
179	+ 'nonce' => wp_create_nonce('megamenu_edit'),
180	+ 'nonce_check_failed' => __("Oops. Something went wrong. Please reload the page.", "megamenu")
181	+ )
182	+ );
183	+
184	+ do_action("megamenu_enqueue_admin_scripts");
185	+
186	+ }
187	+
188	+ /**
189	+ * Show the Meta Menu settings
190	+ *
191	+ * @since 1.0
192	+ */
193	+ public function metabox_contents() {
194	+
195	+ $menu_id = $this->get_selected_menu_id();
196	+
197	+ do_action("megamenu_save_settings");
198	+
199	+ $this->print_enable_megamenu_options( $menu_id );
200	+
201	+ }
202	+
203	+
204	+ /**
205	+ * Save the mega menu settings (submitted from Menus Page Meta Box)
206	+ *
207	+ * @since 1.0
208	+ */
209	+ public function save() {
210	+
211	+ if ( isset( $_POST['menu'] ) && $_POST['menu'] > 0 && is_nav_menu( $_POST['menu'] ) && isset( $_POST['megamenu_meta'] ) ) {
212	+
213	+ $submitted_settings = $_POST['megamenu_meta'];
214	+
215	+ if ( ! get_option( 'megamenu_settings' ) ) {
216	+
217	+ add_option( 'megamenu_settings', $submitted_settings );
218	+
219	+ } else {
220	+
221	+ $existing_settings = get_option( 'megamenu_settings' );
222	+
223	+ $new_settings = array_merge( $existing_settings, $submitted_settings );
224	+
225	+ update_option( 'megamenu_settings', $new_settings );
226	+
227	+ }
228	+
229	+ do_action( "megamenu_after_save_settings" );
230	+
231	+ do_action( "megamenu_delete_cache" );
232	+
233	+ }
234	+
235	+ }
236	+
237	+
238	+ /**
239	+ * Print the custom Meta Box settings
240	+ *
241	+ * @param int $menu_id
242	+ * @since 1.0
243	+ */
244	+ public function print_enable_megamenu_options( $menu_id ) {
245	+
246	+ $tagged_menu_locations = $this->get_tagged_theme_locations_for_menu_id( $menu_id );
247	+ $theme_locations = get_registered_nav_menus();
248	+
249	+ $saved_settings = get_option( 'megamenu_settings' );
250	+
251	+ if ( ! count( $theme_locations ) ) {
252	+
253	+ $link = '<a href="https://www.maxmegamenu.com/documentation/getting-started/max-mega-menu-widget/?utm_source=free&utm_medium=link&utm_campaign=pro" target="_blank">' . __("here", "megamenu") . '</a>';
254	+
255	+ echo "<p>" . __("This theme does not register any menu locations.", "megamenu") . "</p>";
256	+ echo "<p>" . __("You will need to create a new menu location and use the Max Mega Menu widget or shortcode to display the menu on your site.", "megamenu") . "</p>";
257	+ echo "<p>" . str_replace( "{link}", $link, __("Click {link} for instructions.", "megamenu") ) . "</p>";
258	+
259	+ } else if ( ! count ( $tagged_menu_locations ) ) {
260	+
261	+ echo "<p>" . __("Please assign this menu to a theme location to enable the Mega Menu settings.", "megamenu") . "</p>";
262	+
263	+ } else { ?>
264	+
265	+ <?php if ( count( $tagged_menu_locations ) == 1 ) : ?>
266	+
267	+ <?php
268	+
269	+ $locations = array_keys( $tagged_menu_locations );
270	+ $location = $locations[0];
271	+
272	+ if (isset( $tagged_menu_locations[ $location ] ) ) {
273	+ $this->settings_table( $location, $saved_settings );
274	+ }
275	+
276	+ ?>
277	+
278	+ <?php else: ?>
279	+
280	+ <div id='megamenu_accordion'>
281	+
282	+ <?php foreach ( $theme_locations as $location => $name ) : ?>
283	+
284	+ <?php if ( isset( $tagged_menu_locations[ $location ] ) ): ?>
285	+
286	+ <h3 class='theme_settings'><?php echo esc_html( $name ); ?></h3>
287	+
288	+ <div class='accordion_content' style='display: none;'>
289	+ <?php $this->settings_table( $location, $saved_settings ); ?>
290	+ </div>
291	+
292	+ <?php endif; ?>
293	+
294	+ <?php endforeach;?>
295	+ </div>
296	+
297	+ <?php endif; ?>
298	+
299	+ <?php
300	+
301	+ submit_button( __( 'Save' ), 'max-mega-menu-save button-primary alignright');
302	+
303	+ }
304	+
305	+ }
306	+
307	+ /**
308	+ * Print the list of Mega Menu settings
309	+ *
310	+ * @since 1.0
311	+ */
312	+ public function settings_table( $location, $settings ) {
313	+ ?>
314	+ <table>
315	+ <tr>
316	+ <td><?php _e("Enable", "megamenu") ?></td>
317	+ <td>
318	+ <input type='checkbox' class='megamenu_enabled' name='megamenu_meta[<?php echo $location ?>][enabled]' value='1' <?php checked( isset( $settings[$location]['enabled'] ) ); ?> />
319	+ </td>
320	+ </tr>
321	+ <tr>
322	+ <td><?php _e("Event", "megamenu") ?></td>
323	+ <td>
324	+ <select name='megamenu_meta[<?php echo $location ?>][event]'>
325	+ <option value='hover' <?php selected( isset( $settings[$location]['event'] ) && $settings[$location]['event'] == 'hover'); ?>><?php _e("Hover", "megamenu"); ?></option>
326	+ <option value='click' <?php selected( isset( $settings[$location]['event'] ) && $settings[$location]['event'] == 'click'); ?>><?php _e("Click", "megamenu"); ?></option>
327	+ </select>
328	+ </td>
329	+ </tr>
330	+ <tr>
331	+ <td><?php _e("Effect", "megamenu") ?></td>
332	+ <td>
333	+ <select name='megamenu_meta[<?php echo $location ?>][effect]'>
334	+ <?php
335	+
336	+ $selected = isset( $settings[$location]['effect'] ) ? $settings[$location]['effect'] : 'disabled';
337	+
338	+ $options = apply_filters("megamenu_effects", array(
339	+ "disabled" => array(
340	+ 'label' => __("None", "megamenu"),
341	+ 'selected' => $selected == 'disabled',
342	+ ),
343	+ "fade" => array(
344	+ 'label' => __("Fade", "megamenu"),
345	+ 'selected' => $selected == 'fade',
346	+ ),
347	+ "slide" => array(
348	+ 'label' => __("Slide", "megamenu"),
349	+ 'selected' => $selected == 'slide',
350	+ )
351	+ ), $selected );
352	+
353	+ foreach ( $options as $key => $value ) {
354	+ ?><option value='<?php echo $key ?>' <?php selected( $value['selected'] ); ?>><?php echo $value['label'] ?></option><?php
355	+ }
356	+
357	+ ?>
358	+ </select>
359	+ </td>
360	+ </tr>
361	+ <tr>
362	+ <td><?php _e("Theme", "megamenu"); ?></td>
363	+ <td>
364	+
365	+ <select name='megamenu_meta[<?php echo $location ?>][theme]'>
366	+ <?php
367	+ $style_manager = new Mega_Menu_Style_Manager();
368	+ $themes = $style_manager->get_themes();
369	+ $selected_theme = isset( $settings[$location]['theme'] ) ? $settings[$location]['theme'] : 'default';
370	+
371	+ foreach ( $themes as $key => $theme ) {
372	+ echo "<option value='{$key}' " . selected( $selected_theme, $key ) . ">{$theme['title']}</option>";
373	+ }
374	+ ?>
375	+ </select>
376	+ </td>
377	+ </tr>
378	+
379	+ <?php do_action( 'megamenu_settings_table', $location, $settings ); ?>
380	+ </table>
381	+ <?php
382	+ }
383	+
384	+
385	+ /**
386	+ * Return the locations that a specific menu ID has been tagged to.
387	+ *
388	+ * @param $menu_id int
389	+ * @return array
390	+ */
391	+ public function get_tagged_theme_locations_for_menu_id( $menu_id ) {
392	+
393	+ $locations = array();
394	+
395	+ $nav_menu_locations = get_nav_menu_locations();
396	+
397	+ foreach ( get_registered_nav_menus() as $id => $name ) {
398	+
399	+ if ( isset( $nav_menu_locations[ $id ] ) && $nav_menu_locations[$id] == $menu_id )
400	+ $locations[$id] = $name;
401	+
402	+ }
403	+
404	+ return $locations;
405	+ }
406	+
407	+ /**
408	+ * Get the current menu ID.
409	+ *
410	+ * Most of this taken from wp-admin/nav-menus.php (no built in functions to do this)
411	+ *
412	+ * @since 1.0
413	+ * @return int
414	+ */
415	+ public function get_selected_menu_id() {
416	+
417	+ $nav_menus = wp_get_nav_menus( array('orderby' => 'name') );
418	+
419	+ $menu_count = count( $nav_menus );
420	+
421	+ $nav_menu_selected_id = isset( $_REQUEST['menu'] ) ? (int) $_REQUEST['menu'] : 0;
422	+
423	+ $add_new_screen = ( isset( $_GET['menu'] ) && 0 == $_GET['menu'] ) ? true : false;
424	+
425	+ // If we have one theme location, and zero menus, we take them right into editing their first menu
426	+ $page_count = wp_count_posts( 'page' );
427	+ $one_theme_location_no_menus = ( 1 == count( get_registered_nav_menus() ) && ! $add_new_screen && empty( $nav_menus ) && ! empty( $page_count->publish ) ) ? true : false;
428	+
429	+ // Get recently edited nav menu
430	+ $recently_edited = absint( get_user_option( 'nav_menu_recently_edited' ) );
431	+ if ( empty( $recently_edited ) && is_nav_menu( $nav_menu_selected_id ) )
432	+ $recently_edited = $nav_menu_selected_id;
433	+
434	+ // Use $recently_edited if none are selected
435	+ if ( empty( $nav_menu_selected_id ) && ! isset( $_GET['menu'] ) && is_nav_menu( $recently_edited ) )
436	+ $nav_menu_selected_id = $recently_edited;
437	+
438	+ // On deletion of menu, if another menu exists, show it
439	+ if ( ! $add_new_screen && 0 < $menu_count && isset( $_GET['action'] ) && 'delete' == $_GET['action'] )
440	+ $nav_menu_selected_id = $nav_menus[0]->term_id;
441	+
442	+ // Set $nav_menu_selected_id to 0 if no menus
443	+ if ( $one_theme_location_no_menus ) {
444	+ $nav_menu_selected_id = 0;
445	+ } elseif ( empty( $nav_menu_selected_id ) && ! empty( $nav_menus ) && ! $add_new_screen ) {
446	+ // if we have no selection yet, and we have menus, set to the first one in the list
447	+ $nav_menu_selected_id = $nav_menus[0]->term_id;
448	+ }
449	+
450	+ return $nav_menu_selected_id;
451	+
452	+ }
453	+ }
454	+
455	+ endif;

classes/scssc.inc.php ADDED Viewed

	@@ -0,0 +1,4443 @@


1	+ <?php
2	+ /**
3	+ * SCSS compiler written in PHP
4	+ *
5	+ * @copyright 2012-2013 Leaf Corcoran
6	+ *
7	+ * @license http://opensource.org/licenses/gpl-license GPL-3.0
8	+ * @license http://opensource.org/licenses/MIT MIT
9	+ *
10	+ * @link http://leafo.net/scssphp
11	+ */
12	+
13	+ /**
14	+ * The scss compiler and parser.
15	+ *
16	+ * Converting SCSS to CSS is a three stage process. The incoming file is parsed
17	+ * by `scssc_parser` into a syntax tree, then it is compiled into another tree
18	+ * representing the CSS structure by `scssc`. The CSS tree is fed into a
19	+ * formatter, like `scssc_formatter` which then outputs CSS as a string.
20	+ *
21	+ * During the first compile, all values are reduced, which means that their
22	+ * types are brought to the lowest form before being dump as strings. This
23	+ * handles math equations, variable dereferences, and the like.
24	+ *
25	+ * The `parse` function of `scssc` is the entry point.
26	+ *
27	+ * In summary:
28	+ *
29	+ * The `scssc` class creates an instance of the parser, feeds it SCSS code,
30	+ * then transforms the resulting tree to a CSS tree. This class also holds the
31	+ * evaluation context, such as all available mixins and variables at any given
32	+ * time.
33	+ *
34	+ * The `scssc_parser` class is only concerned with parsing its input.
35	+ *
36	+ * The `scssc_formatter` takes a CSS tree, and dumps it to a formatted string,
37	+ * handling things like indentation.
38	+ */
39	+
40	+ if (!class_exists("scssc")) :
41	+ /**
42	+ * SCSS compiler
43	+ *
44	+ * @author Leaf Corcoran <leafot@gmail.com>
45	+ */
46	+ class scssc {
47	+ static public $VERSION = "v0.0.10";
48	+
49	+ static protected $operatorNames = array(
50	+ '+' => "add",
51	+ '-' => "sub",
52	+ '*' => "mul",
53	+ '/' => "div",
54	+ '%' => "mod",
55	+
56	+ '==' => "eq",
57	+ '!=' => "neq",
58	+ '<' => "lt",
59	+ '>' => "gt",
60	+
61	+ '<=' => "lte",
62	+ '>=' => "gte",
63	+ );
64	+
65	+ static protected $namespaces = array(
66	+ "special" => "%",
67	+ "mixin" => "@",
68	+ "function" => "^",
69	+ );
70	+
71	+ static protected $unitTable = array(
72	+ "in" => array(
73	+ "in" => 1,
74	+ "pt" => 72,
75	+ "pc" => 6,
76	+ "cm" => 2.54,
77	+ "mm" => 25.4,
78	+ "px" => 96,
79	+ )
80	+ );
81	+
82	+ static public $true = array("keyword", "true");
83	+ static public $false = array("keyword", "false");
84	+ static public $null = array("null");
85	+
86	+ static public $defaultValue = array("keyword", "");
87	+ static public $selfSelector = array("self");
88	+
89	+ protected $importPaths = array("");
90	+ protected $importCache = array();
91	+
92	+ protected $userFunctions = array();
93	+
94	+ protected $numberPrecision = 5;
95	+
96	+ protected $formatter = "scss_formatter_nested";
97	+
98	+ public function compile($code, $name=null) {
99	+ $this->indentLevel = -1;
100	+ $this->commentsSeen = array();
101	+ $this->extends = array();
102	+ $this->extendsMap = array();
103	+
104	+ $locale = setlocale(LC_NUMERIC, 0);
105	+ setlocale(LC_NUMERIC, "C");
106	+
107	+ $this->parsedFiles = array();
108	+ $this->parser = new scss_parser($name);
109	+ $tree = $this->parser->parse($code);
110	+
111	+ $this->formatter = new $this->formatter();
112	+
113	+ $this->env = null;
114	+ $this->scope = null;
115	+
116	+ $this->compileRoot($tree);
117	+
118	+ $out = $this->formatter->format($this->scope);
119	+
120	+ setlocale(LC_NUMERIC, $locale);
121	+ return $out;
122	+ }
123	+
124	+ protected function isSelfExtend($target, $origin) {
125	+ foreach ($origin as $sel) {
126	+ if (in_array($target, $sel)) {
127	+ return true;
128	+ }
129	+ }
130	+
131	+ return false;
132	+ }
133	+
134	+ protected function pushExtends($target, $origin) {
135	+ if ($this->isSelfExtend($target, $origin)) {
136	+ return;
137	+ }
138	+
139	+ $i = count($this->extends);
140	+ $this->extends[] = array($target, $origin);
141	+
142	+ foreach ($target as $part) {
143	+ if (isset($this->extendsMap[$part])) {
144	+ $this->extendsMap[$part][] = $i;
145	+ } else {
146	+ $this->extendsMap[$part] = array($i);
147	+ }
148	+ }
149	+ }
150	+
151	+ protected function makeOutputBlock($type, $selectors = null) {
152	+ $out = new stdClass;
153	+ $out->type = $type;
154	+ $out->lines = array();
155	+ $out->children = array();
156	+ $out->parent = $this->scope;
157	+ $out->selectors = $selectors;
158	+ $out->depth = $this->env->depth;
159	+
160	+ return $out;
161	+ }
162	+
163	+ protected function matchExtendsSingle($single, &$outOrigin) {
164	+ $counts = array();
165	+ foreach ($single as $part) {
166	+ if (!is_string($part)) return false; // hmm
167	+
168	+ if (isset($this->extendsMap[$part])) {
169	+ foreach ($this->extendsMap[$part] as $idx) {
170	+ $counts[$idx] =
171	+ isset($counts[$idx]) ? $counts[$idx] + 1 : 1;
172	+ }
173	+ }
174	+ }
175	+
176	+ $outOrigin = array();
177	+ $found = false;
178	+
179	+ foreach ($counts as $idx => $count) {
180	+ list($target, $origin) = $this->extends[$idx];
181	+
182	+ // check count
183	+ if ($count != count($target)) continue;
184	+
185	+ // check if target is subset of single
186	+ if (array_diff(array_intersect($single, $target), $target)) continue;
187	+
188	+ $rem = array_diff($single, $target);
189	+
190	+ foreach ($origin as $j => $new) {
191	+ // prevent infinite loop when target extends itself
192	+ foreach ($new as $new_selector) {
193	+ if (!array_diff($single, $new_selector)) {
194	+ continue 2;
195	+ }
196	+ }
197	+
198	+ $origin[$j][count($origin[$j]) - 1] = $this->combineSelectorSingle(end($new), $rem);
199	+ }
200	+
201	+ $outOrigin = array_merge($outOrigin, $origin);
202	+
203	+ $found = true;
204	+ }
205	+
206	+ return $found;
207	+ }
208	+
209	+ protected function combineSelectorSingle($base, $other) {
210	+ $tag = null;
211	+ $out = array();
212	+
213	+ foreach (array($base, $other) as $single) {
214	+ foreach ($single as $part) {
215	+ if (preg_match('/^[^\[.#:]/', $part)) {
216	+ $tag = $part;
217	+ } else {
218	+ $out[] = $part;
219	+ }
220	+ }
221	+ }
222	+
223	+ if ($tag) {
224	+ array_unshift($out, $tag);
225	+ }
226	+
227	+ return $out;
228	+ }
229	+
230	+ protected function matchExtends($selector, &$out, $from = 0, $initial=true) {
231	+ foreach ($selector as $i => $part) {
232	+ if ($i < $from) continue;
233	+
234	+ if ($this->matchExtendsSingle($part, $origin)) {
235	+ $before = array_slice($selector, 0, $i);
236	+ $after = array_slice($selector, $i + 1);
237	+
238	+ foreach ($origin as $new) {
239	+ $k = 0;
240	+
241	+ // remove shared parts
242	+ if ($initial) {
243	+ foreach ($before as $k => $val) {
244	+ if (!isset($new[$k]) \|\| $val != $new[$k]) {
245	+ break;
246	+ }
247	+ }
248	+ }
249	+
250	+ $result = array_merge(
251	+ $before,
252	+ $k > 0 ? array_slice($new, $k) : $new,
253	+ $after);
254	+
255	+
256	+ if ($result == $selector) continue;
257	+ $out[] = $result;
258	+
259	+ // recursively check for more matches
260	+ $this->matchExtends($result, $out, $i, false);
261	+
262	+ // selector sequence merging
263	+ if (!empty($before) && count($new) > 1) {
264	+ $result2 = array_merge(
265	+ array_slice($new, 0, -1),
266	+ $k > 0 ? array_slice($before, $k) : $before,
267	+ array_slice($new, -1),
268	+ $after);
269	+
270	+ $out[] = $result2;
271	+ }
272	+ }
273	+ }
274	+ }
275	+ }
276	+
277	+ protected function flattenSelectors($block, $parentKey = null) {
278	+ if ($block->selectors) {
279	+ $selectors = array();
280	+ foreach ($block->selectors as $s) {
281	+ $selectors[] = $s;
282	+ if (!is_array($s)) continue;
283	+ // check extends
284	+ if (!empty($this->extendsMap)) {
285	+ $this->matchExtends($s, $selectors);
286	+ }
287	+ }
288	+
289	+ $block->selectors = array();
290	+ $placeholderSelector = false;
291	+ foreach ($selectors as $selector) {
292	+ if ($this->hasSelectorPlaceholder($selector)) {
293	+ $placeholderSelector = true;
294	+ continue;
295	+ }
296	+ $block->selectors[] = $this->compileSelector($selector);
297	+ }
298	+
299	+ if ($placeholderSelector && 0 == count($block->selectors) && null !== $parentKey) {
300	+ unset($block->parent->children[$parentKey]);
301	+ return;
302	+ }
303	+ }
304	+
305	+ foreach ($block->children as $key => $child) {
306	+ $this->flattenSelectors($child, $key);
307	+ }
308	+ }
309	+
310	+ protected function compileRoot($rootBlock) {
311	+ $this->pushEnv($rootBlock);
312	+ $this->scope = $this->makeOutputBlock("root");
313	+
314	+ $this->compileChildren($rootBlock->children, $this->scope);
315	+ $this->flattenSelectors($this->scope);
316	+
317	+ $this->popEnv();
318	+ }
319	+
320	+ protected function compileMedia($media) {
321	+ $this->pushEnv($media);
322	+
323	+ $mediaQuery = $this->compileMediaQuery($this->multiplyMedia($this->env));
324	+
325	+ if (!empty($mediaQuery)) {
326	+
327	+ $this->scope = $this->makeOutputBlock("media", array($mediaQuery));
328	+
329	+ $parentScope = $this->mediaParent($this->scope);
330	+
331	+ $parentScope->children[] = $this->scope;
332	+
333	+ // top level properties in a media cause it to be wrapped
334	+ $needsWrap = false;
335	+ foreach ($media->children as $child) {
336	+ $type = $child[0];
337	+ if ($type !== 'block' && $type !== 'media' && $type !== 'directive') {
338	+ $needsWrap = true;
339	+ break;
340	+ }
341	+ }
342	+
343	+ if ($needsWrap) {
344	+ $wrapped = (object)array(
345	+ "selectors" => array(),
346	+ "children" => $media->children
347	+ );
348	+ $media->children = array(array("block", $wrapped));
349	+ }
350	+
351	+ $this->compileChildren($media->children, $this->scope);
352	+
353	+ $this->scope = $this->scope->parent;
354	+ }
355	+
356	+ $this->popEnv();
357	+ }
358	+
359	+ protected function mediaParent($scope) {
360	+ while (!empty($scope->parent)) {
361	+ if (!empty($scope->type) && $scope->type != "media") {
362	+ break;
363	+ }
364	+ $scope = $scope->parent;
365	+ }
366	+
367	+ return $scope;
368	+ }
369	+
370	+ // TODO refactor compileNestedBlock and compileMedia into same thing
371	+ protected function compileNestedBlock($block, $selectors) {
372	+ $this->pushEnv($block);
373	+
374	+ $this->scope = $this->makeOutputBlock($block->type, $selectors);
375	+ $this->scope->parent->children[] = $this->scope;
376	+ $this->compileChildren($block->children, $this->scope);
377	+
378	+ $this->scope = $this->scope->parent;
379	+ $this->popEnv();
380	+ }
381	+
382	+ /**
383	+ * Recursively compiles a block.
384	+ *
385	+ * A block is analogous to a CSS block in most cases. A single SCSS document
386	+ * is encapsulated in a block when parsed, but it does not have parent tags
387	+ * so all of its children appear on the root level when compiled.
388	+ *
389	+ * Blocks are made up of selectors and children.
390	+ *
391	+ * The children of a block are just all the blocks that are defined within.
392	+ *
393	+ * Compiling the block involves pushing a fresh environment on the stack,
394	+ * and iterating through the props, compiling each one.
395	+ *
396	+ * @see scss::compileChild()
397	+ *
398	+ * @param \StdClass $block
399	+ */
400	+ protected function compileBlock($block) {
401	+ $env = $this->pushEnv($block);
402	+
403	+ $env->selectors =
404	+ array_map(array($this, "evalSelector"), $block->selectors);
405	+
406	+ $out = $this->makeOutputBlock(null, $this->multiplySelectors($env));
407	+ $this->scope->children[] = $out;
408	+ $this->compileChildren($block->children, $out);
409	+
410	+ $this->popEnv();
411	+ }
412	+
413	+ // joins together .classes and #ids
414	+ protected function flattenSelectorSingle($single) {
415	+ $joined = array();
416	+ foreach ($single as $part) {
417	+ if (empty($joined) \|\|
418	+ !is_string($part) \|\|
419	+ preg_match('/[\[.:#%]/', $part))
420	+ {
421	+ $joined[] = $part;
422	+ continue;
423	+ }
424	+
425	+ if (is_array(end($joined))) {
426	+ $joined[] = $part;
427	+ } else {
428	+ $joined[count($joined) - 1] .= $part;
429	+ }
430	+ }
431	+
432	+ return $joined;
433	+ }
434	+
435	+ // replaces all the interpolates
436	+ protected function evalSelector($selector) {
437	+ return array_map(array($this, "evalSelectorPart"), $selector);
438	+ }
439	+
440	+ protected function evalSelectorPart($piece) {
441	+ foreach ($piece as &$p) {
442	+ if (!is_array($p)) continue;
443	+
444	+ switch ($p[0]) {
445	+ case "interpolate":
446	+ $p = $this->compileValue($p);
447	+ break;
448	+ case "string":
449	+ $p = $this->compileValue($p);
450	+ break;
451	+ }
452	+ }
453	+
454	+ return $this->flattenSelectorSingle($piece);
455	+ }
456	+
457	+ // compiles to string
458	+ // self(&) should have been replaced by now
459	+ protected function compileSelector($selector) {
460	+ if (!is_array($selector)) return $selector; // media and the like
461	+
462	+ return implode(" ", array_map(
463	+ array($this, "compileSelectorPart"), $selector));
464	+ }
465	+
466	+ protected function compileSelectorPart($piece) {
467	+ foreach ($piece as &$p) {
468	+ if (!is_array($p)) continue;
469	+
470	+ switch ($p[0]) {
471	+ case "self":
472	+ $p = "&";
473	+ break;
474	+ default:
475	+ $p = $this->compileValue($p);
476	+ break;
477	+ }
478	+ }
479	+
480	+ return implode($piece);
481	+ }
482	+
483	+ protected function hasSelectorPlaceholder($selector)
484	+ {
485	+ if (!is_array($selector)) return false;
486	+
487	+ foreach ($selector as $parts) {
488	+ foreach ($parts as $part) {
489	+ if ('%' == $part[0]) {
490	+ return true;
491	+ }
492	+ }
493	+ }
494	+
495	+ return false;
496	+ }
497	+
498	+ protected function compileChildren($stms, $out) {
499	+ foreach ($stms as $stm) {
500	+ $ret = $this->compileChild($stm, $out);
501	+ if (isset($ret)) return $ret;
502	+ }
503	+ }
504	+
505	+ protected function compileMediaQuery($queryList) {
506	+ $out = "@media";
507	+ $first = true;
508	+ foreach ($queryList as $query){
509	+ $type = null;
510	+ $parts = array();
511	+ foreach ($query as $q) {
512	+ switch ($q[0]) {
513	+ case "mediaType":
514	+ if ($type) {
515	+ $type = $this->mergeMediaTypes($type, array_map(array($this, "compileValue"), array_slice($q, 1)));
516	+ if (empty($type)) { // merge failed
517	+ return null;
518	+ }
519	+ } else {
520	+ $type = array_map(array($this, "compileValue"), array_slice($q, 1));
521	+ }
522	+ break;
523	+ case "mediaExp":
524	+ if (isset($q[2])) {
525	+ $parts[] = "(". $this->compileValue($q[1]) . $this->formatter->assignSeparator . $this->compileValue($q[2]) . ")";
526	+ } else {
527	+ $parts[] = "(" . $this->compileValue($q[1]) . ")";
528	+ }
529	+ break;
530	+ }
531	+ }
532	+ if ($type) {
533	+ array_unshift($parts, implode(' ', array_filter($type)));
534	+ }
535	+ if (!empty($parts)) {
536	+ if ($first) {
537	+ $first = false;
538	+ $out .= " ";
539	+ } else {
540	+ $out .= $this->formatter->tagSeparator;
541	+ }
542	+ $out .= implode(" and ", $parts);
543	+ }
544	+ }
545	+ return $out;
546	+ }
547	+
548	+ protected function mergeMediaTypes($type1, $type2) {
549	+ if (empty($type1)) {
550	+ return $type2;
551	+ }
552	+ if (empty($type2)) {
553	+ return $type1;
554	+ }
555	+ $m1 = '';
556	+ $t1 = '';
557	+ if (count($type1) > 1) {
558	+ $m1= strtolower($type1[0]);
559	+ $t1= strtolower($type1[1]);
560	+ } else {
561	+ $t1 = strtolower($type1[0]);
562	+ }
563	+ $m2 = '';
564	+ $t2 = '';
565	+ if (count($type2) > 1) {
566	+ $m2 = strtolower($type2[0]);
567	+ $t2 = strtolower($type2[1]);
568	+ } else {
569	+ $t2 = strtolower($type2[0]);
570	+ }
571	+ if (($m1 == 'not') ^ ($m2 == 'not')) {
572	+ if ($t1 == $t2) {
573	+ return null;
574	+ }
575	+ return array(
576	+ $m1 == 'not' ? $m2 : $m1,
577	+ $m1 == 'not' ? $t2 : $t1
578	+ );
579	+ } elseif ($m1 == 'not' && $m2 == 'not') {
580	+ # CSS has no way of representing "neither screen nor print"
581	+ if ($t1 != $t2) {
582	+ return null;
583	+ }
584	+ return array('not', $t1);
585	+ } elseif ($t1 != $t2) {
586	+ return null;
587	+ } else { // t1 == t2, neither m1 nor m2 are "not"
588	+ return array(empty($m1)? $m2 : $m1, $t1);
589	+ }
590	+ }
591	+
592	+ // returns true if the value was something that could be imported
593	+ protected function compileImport($rawPath, $out) {
594	+ if ($rawPath[0] == "string") {
595	+ $path = $this->compileStringContent($rawPath);
596	+ if ($path = $this->findImport($path)) {
597	+ $this->importFile($path, $out);
598	+ return true;
599	+ }
600	+ return false;
601	+ }
602	+ if ($rawPath[0] == "list") {
603	+ // handle a list of strings
604	+ if (count($rawPath[2]) == 0) return false;
605	+ foreach ($rawPath[2] as $path) {
606	+ if ($path[0] != "string") return false;
607	+ }
608	+
609	+ foreach ($rawPath[2] as $path) {
610	+ $this->compileImport($path, $out);
611	+ }
612	+
613	+ return true;
614	+ }
615	+
616	+ return false;
617	+ }
618	+
619	+ // return a value to halt execution
620	+ protected function compileChild($child, $out) {
621	+ $this->sourcePos = isset($child[-1]) ? $child[-1] : -1;
622	+ $this->sourceParser = isset($child[-2]) ? $child[-2] : $this->parser;
623	+
624	+ switch ($child[0]) {
625	+ case "import":
626	+ list(,$rawPath) = $child;
627	+ $rawPath = $this->reduce($rawPath);
628	+ if (!$this->compileImport($rawPath, $out)) {
629	+ $out->lines[] = "@import " . $this->compileValue($rawPath) . ";";
630	+ }
631	+ break;
632	+ case "directive":
633	+ list(, $directive) = $child;
634	+ $s = "@" . $directive->name;
635	+ if (!empty($directive->value)) {
636	+ $s .= " " . $this->compileValue($directive->value);
637	+ }
638	+ $this->compileNestedBlock($directive, array($s));
639	+ break;
640	+ case "media":
641	+ $this->compileMedia($child[1]);
642	+ break;
643	+ case "block":
644	+ $this->compileBlock($child[1]);
645	+ break;
646	+ case "charset":
647	+ $out->lines[] = "@charset ".$this->compileValue($child[1]).";";
648	+ break;
649	+ case "assign":
650	+ list(,$name, $value) = $child;
651	+ if ($name[0] == "var") {
652	+ $isDefault = !empty($child[3]);
653	+
654	+ if ($isDefault) {
655	+ $existingValue = $this->get($name[1], true);
656	+ $shouldSet = $existingValue === true \|\| $existingValue == self::$null;
657	+ }
658	+
659	+ if (!$isDefault \|\| $shouldSet) {
660	+ $this->set($name[1], $this->reduce($value));
661	+ }
662	+ break;
663	+ }
664	+
665	+ // if the value reduces to null from something else then
666	+ // the property should be discarded
667	+ if ($value[0] != "null") {
668	+ $value = $this->reduce($value);
669	+ if ($value[0] == "null") {
670	+ break;
671	+ }
672	+ }
673	+
674	+ $compiledValue = $this->compileValue($value);
675	+ $out->lines[] = $this->formatter->property(
676	+ $this->compileValue($name),
677	+ $compiledValue);
678	+ break;
679	+ case "comment":
680	+ $out->lines[] = $child[1];
681	+ break;
682	+ case "mixin":
683	+ case "function":
684	+ list(,$block) = $child;
685	+ $this->set(self::$namespaces[$block->type] . $block->name, $block);
686	+ break;
687	+ case "extend":
688	+ list(, $selectors) = $child;
689	+ foreach ($selectors as $sel) {
690	+ // only use the first one
691	+ $sel = current($this->evalSelector($sel));
692	+ $this->pushExtends($sel, $out->selectors);
693	+ }
694	+ break;
695	+ case "if":
696	+ list(, $if) = $child;
697	+ if ($this->isTruthy($this->reduce($if->cond, true))) {
698	+ return $this->compileChildren($if->children, $out);
699	+ } else {
700	+ foreach ($if->cases as $case) {
701	+ if ($case->type == "else" \|\|
702	+ $case->type == "elseif" && $this->isTruthy($this->reduce($case->cond)))
703	+ {
704	+ return $this->compileChildren($case->children, $out);
705	+ }
706	+ }
707	+ }
708	+ break;
709	+ case "return":
710	+ return $this->reduce($child[1], true);
711	+ case "each":
712	+ list(,$each) = $child;
713	+ $list = $this->coerceList($this->reduce($each->list));
714	+ foreach ($list[2] as $item) {
715	+ $this->pushEnv();
716	+ $this->set($each->var, $item);
717	+ // TODO: allow return from here
718	+ $this->compileChildren($each->children, $out);
719	+ $this->popEnv();
720	+ }
721	+ break;
722	+ case "while":
723	+ list(,$while) = $child;
724	+ while ($this->isTruthy($this->reduce($while->cond, true))) {
725	+ $ret = $this->compileChildren($while->children, $out);
726	+ if ($ret) return $ret;
727	+ }
728	+ break;
729	+ case "for":
730	+ list(,$for) = $child;
731	+ $start = $this->reduce($for->start, true);
732	+ $start = $start[1];
733	+ $end = $this->reduce($for->end, true);
734	+ $end = $end[1];
735	+ $d = $start < $end ? 1 : -1;
736	+
737	+ while (true) {
738	+ if ((!$for->until && $start - $d == $end) \|\|
739	+ ($for->until && $start == $end))
740	+ {
741	+ break;
742	+ }
743	+
744	+ $this->set($for->var, array("number", $start, ""));
745	+ $start += $d;
746	+
747	+ $ret = $this->compileChildren($for->children, $out);
748	+ if ($ret) return $ret;
749	+ }
750	+
751	+ break;
752	+ case "nestedprop":
753	+ list(,$prop) = $child;
754	+ $prefixed = array();
755	+ $prefix = $this->compileValue($prop->prefix) . "-";
756	+ foreach ($prop->children as $child) {
757	+ if ($child[0] == "assign") {
758	+ array_unshift($child[1][2], $prefix);
759	+ }
760	+ if ($child[0] == "nestedprop") {
761	+ array_unshift($child[1]->prefix[2], $prefix);
762	+ }
763	+ $prefixed[] = $child;
764	+ }
765	+ $this->compileChildren($prefixed, $out);
766	+ break;
767	+ case "include": // including a mixin
768	+ list(,$name, $argValues, $content) = $child;
769	+ $mixin = $this->get(self::$namespaces["mixin"] . $name, false);
770	+ if (!$mixin) {
771	+ $this->throwError("Undefined mixin $name");
772	+ }
773	+
774	+ $callingScope = $this->env;
775	+
776	+ // push scope, apply args
777	+ $this->pushEnv();
778	+ if ($this->env->depth > 0) {
779	+ $this->env->depth--;
780	+ }
781	+
782	+ if (isset($content)) {
783	+ $content->scope = $callingScope;
784	+ $this->setRaw(self::$namespaces["special"] . "content", $content);
785	+ }
786	+
787	+ if (isset($mixin->args)) {
788	+ $this->applyArguments($mixin->args, $argValues);
789	+ }
790	+
791	+ foreach ($mixin->children as $child) {
792	+ $this->compileChild($child, $out);
793	+ }
794	+
795	+ $this->popEnv();
796	+
797	+ break;
798	+ case "mixin_content":
799	+ $content = $this->get(self::$namespaces["special"] . "content");
800	+ if (!isset($content)) {
801	+ $this->throwError("Expected @content inside of mixin");
802	+ }
803	+
804	+ $strongTypes = array('include', 'block', 'for', 'while');
805	+ foreach ($content->children as $child) {
806	+ $this->storeEnv = (in_array($child[0], $strongTypes))
807	+ ? null
808	+ : $content->scope;
809	+
810	+ $this->compileChild($child, $out);
811	+ }
812	+
813	+ unset($this->storeEnv);
814	+ break;
815	+ case "debug":
816	+ list(,$value, $pos) = $child;
817	+ $line = $this->parser->getLineNo($pos);
818	+ $value = $this->compileValue($this->reduce($value, true));
819	+ fwrite(STDERR, "Line $line DEBUG: $value\n");
820	+ break;
821	+ default:
822	+ $this->throwError("unknown child type: $child[0]");
823	+ }
824	+ }
825	+
826	+ protected function expToString($exp) {
827	+ list(, $op, $left, $right, $inParens, $whiteLeft, $whiteRight) = $exp;
828	+ $content = array($this->reduce($left));
829	+ if ($whiteLeft) $content[] = " ";
830	+ $content[] = $op;
831	+ if ($whiteRight) $content[] = " ";
832	+ $content[] = $this->reduce($right);
833	+ return array("string", "", $content);
834	+ }
835	+
836	+ protected function isTruthy($value) {
837	+ return $value != self::$false && $value != self::$null;
838	+ }
839	+
840	+ // should $value cause its operand to eval
841	+ protected function shouldEval($value) {
842	+ switch ($value[0]) {
843	+ case "exp":
844	+ if ($value[1] == "/") {
845	+ return $this->shouldEval($value[2], $value[3]);
846	+ }
847	+ case "var":
848	+ case "fncall":
849	+ return true;
850	+ }
851	+ return false;
852	+ }
853	+
854	+ protected function reduce($value, $inExp = false) {
855	+ list($type) = $value;
856	+ switch ($type) {
857	+ case "exp":
858	+ list(, $op, $left, $right, $inParens) = $value;
859	+ $opName = isset(self::$operatorNames[$op]) ? self::$operatorNames[$op] : $op;
860	+
861	+ $inExp = $inExp \|\| $this->shouldEval($left) \|\| $this->shouldEval($right);
862	+
863	+ $left = $this->reduce($left, true);
864	+ $right = $this->reduce($right, true);
865	+
866	+ // only do division in special cases
867	+ if ($opName == "div" && !$inParens && !$inExp) {
868	+ if ($left[0] != "color" && $right[0] != "color") {
869	+ return $this->expToString($value);
870	+ }
871	+ }
872	+
873	+ $left = $this->coerceForExpression($left);
874	+ $right = $this->coerceForExpression($right);
875	+
876	+ $ltype = $left[0];
877	+ $rtype = $right[0];
878	+
879	+ // this tries:
880	+ // 1. op_[op name]_[left type]_[right type]
881	+ // 2. op_[left type]_[right type] (passing the op as first arg
882	+ // 3. op_[op name]
883	+ $fn = "op_${opName}_${ltype}_${rtype}";
884	+ if (is_callable(array($this, $fn)) \|\|
885	+ (($fn = "op_${ltype}_${rtype}") &&
886	+ is_callable(array($this, $fn)) &&
887	+ $passOp = true) \|\|
888	+ (($fn = "op_${opName}") &&
889	+ is_callable(array($this, $fn)) &&
890	+ $genOp = true))
891	+ {
892	+ $unitChange = false;
893	+ if (!isset($genOp) &&
894	+ $left[0] == "number" && $right[0] == "number")
895	+ {
896	+ if ($opName == "mod" && $right[2] != "") {
897	+ $this->throwError("Cannot modulo by a number with units: $right[1]$right[2].");
898	+ }
899	+
900	+ $unitChange = true;
901	+ $emptyUnit = $left[2] == "" \|\| $right[2] == "";
902	+ $targetUnit = "" != $left[2] ? $left[2] : $right[2];
903	+
904	+ if ($opName != "mul") {
905	+ $left[2] = "" != $left[2] ? $left[2] : $targetUnit;
906	+ $right[2] = "" != $right[2] ? $right[2] : $targetUnit;
907	+ }
908	+
909	+ if ($opName != "mod") {
910	+ $left = $this->normalizeNumber($left);
911	+ $right = $this->normalizeNumber($right);
912	+ }
913	+
914	+ if ($opName == "div" && !$emptyUnit && $left[2] == $right[2]) {
915	+ $targetUnit = "";
916	+ }
917	+
918	+ if ($opName == "mul") {
919	+ $left[2] = "" != $left[2] ? $left[2] : $right[2];
920	+ $right[2] = "" != $right[2] ? $right[2] : $left[2];
921	+ } elseif ($opName == "div" && $left[2] == $right[2]) {
922	+ $left[2] = "";
923	+ $right[2] = "";
924	+ }
925	+ }
926	+
927	+ $shouldEval = $inParens \|\| $inExp;
928	+ if (isset($passOp)) {
929	+ $out = $this->$fn($op, $left, $right, $shouldEval);
930	+ } else {
931	+ $out = $this->$fn($left, $right, $shouldEval);
932	+ }
933	+
934	+ if (isset($out)) {
935	+ if ($unitChange && $out[0] == "number") {
936	+ $out = $this->coerceUnit($out, $targetUnit);
937	+ }
938	+ return $out;
939	+ }
940	+ }
941	+
942	+ return $this->expToString($value);
943	+ case "unary":
944	+ list(, $op, $exp, $inParens) = $value;
945	+ $inExp = $inExp \|\| $this->shouldEval($exp);
946	+
947	+ $exp = $this->reduce($exp);
948	+ if ($exp[0] == "number") {
949	+ switch ($op) {
950	+ case "+":
951	+ return $exp;
952	+ case "-":
953	+ $exp[1] *= -1;
954	+ return $exp;
955	+ }
956	+ }
957	+
958	+ if ($op == "not") {
959	+ if ($inExp \|\| $inParens) {
960	+ if ($exp == self::$false) {
961	+ return self::$true;
962	+ } else {
963	+ return self::$false;
964	+ }
965	+ } else {
966	+ $op = $op . " ";
967	+ }
968	+ }
969	+
970	+ return array("string", "", array($op, $exp));
971	+ case "var":
972	+ list(, $name) = $value;
973	+ return $this->reduce($this->get($name));
974	+ case "list":
975	+ foreach ($value[2] as &$item) {
976	+ $item = $this->reduce($item);
977	+ }
978	+ return $value;
979	+ case "string":
980	+ foreach ($value[2] as &$item) {
981	+ if (is_array($item)) {
982	+ $item = $this->reduce($item);
983	+ }
984	+ }
985	+ return $value;
986	+ case "interpolate":
987	+ $value[1] = $this->reduce($value[1]);
988	+ return $value;
989	+ case "fncall":
990	+ list(,$name, $argValues) = $value;
991	+
992	+ // user defined function?
993	+ $func = $this->get(self::$namespaces["function"] . $name, false);
994	+ if ($func) {
995	+ $this->pushEnv();
996	+
997	+ // set the args
998	+ if (isset($func->args)) {
999	+ $this->applyArguments($func->args, $argValues);
1000	+ }
1001	+
1002	+ // throw away lines and children
1003	+ $tmp = (object)array(
1004	+ "lines" => array(),
1005	+ "children" => array()
1006	+ );
1007	+ $ret = $this->compileChildren($func->children, $tmp);
1008	+ $this->popEnv();
1009	+
1010	+ return !isset($ret) ? self::$defaultValue : $ret;
1011	+ }
1012	+
1013	+ // built in function
1014	+ if ($this->callBuiltin($name, $argValues, $returnValue)) {
1015	+ return $returnValue;
1016	+ }
1017	+
1018	+ // need to flatten the arguments into a list
1019	+ $listArgs = array();
1020	+ foreach ((array)$argValues as $arg) {
1021	+ if (empty($arg[0])) {
1022	+ $listArgs[] = $this->reduce($arg[1]);
1023	+ }
1024	+ }
1025	+ return array("function", $name, array("list", ",", $listArgs));
1026	+ default:
1027	+ return $value;
1028	+ }
1029	+ }
1030	+
1031	+ public function normalizeValue($value) {
1032	+ $value = $this->coerceForExpression($this->reduce($value));
1033	+ list($type) = $value;
1034	+
1035	+ switch ($type) {
1036	+ case "list":
1037	+ $value = $this->extractInterpolation($value);
1038	+ if ($value[0] != "list") {
1039	+ return array("keyword", $this->compileValue($value));
1040	+ }
1041	+ foreach ($value[2] as $key => $item) {
1042	+ $value[2][$key] = $this->normalizeValue($item);
1043	+ }
1044	+ return $value;
1045	+ case "number":
1046	+ return $this->normalizeNumber($value);
1047	+ default:
1048	+ return $value;
1049	+ }
1050	+ }
1051	+
1052	+ // just does physical lengths for now
1053	+ protected function normalizeNumber($number) {
1054	+ list(, $value, $unit) = $number;
1055	+ if (isset(self::$unitTable["in"][$unit])) {
1056	+ $conv = self::$unitTable["in"][$unit];
1057	+ return array("number", $value / $conv, "in");
1058	+ }
1059	+ return $number;
1060	+ }
1061	+
1062	+ // $number should be normalized
1063	+ protected function coerceUnit($number, $unit) {
1064	+ list(, $value, $baseUnit) = $number;
1065	+ if (isset(self::$unitTable[$baseUnit][$unit])) {
1066	+ $value = $value * self::$unitTable[$baseUnit][$unit];
1067	+ }
1068	+
1069	+ return array("number", $value, $unit);
1070	+ }
1071	+
1072	+ protected function op_add_number_number($left, $right) {
1073	+ return array("number", $left[1] + $right[1], $left[2]);
1074	+ }
1075	+
1076	+ protected function op_mul_number_number($left, $right) {
1077	+ return array("number", $left[1] * $right[1], $left[2]);
1078	+ }
1079	+
1080	+ protected function op_sub_number_number($left, $right) {
1081	+ return array("number", $left[1] - $right[1], $left[2]);
1082	+ }
1083	+
1084	+ protected function op_div_number_number($left, $right) {
1085	+ return array("number", $left[1] / $right[1], $left[2]);
1086	+ }
1087	+
1088	+ protected function op_mod_number_number($left, $right) {
1089	+ return array("number", $left[1] % $right[1], $left[2]);
1090	+ }
1091	+
1092	+ // adding strings
1093	+ protected function op_add($left, $right) {
1094	+ if ($strLeft = $this->coerceString($left)) {
1095	+ if ($right[0] == "string") {
1096	+ $right[1] = "";
1097	+ }
1098	+ $strLeft[2][] = $right;
1099	+ return $strLeft;
1100	+ }
1101	+
1102	+ if ($strRight = $this->coerceString($right)) {
1103	+ if ($left[0] == "string") {
1104	+ $left[1] = "";
1105	+ }
1106	+ array_unshift($strRight[2], $left);
1107	+ return $strRight;
1108	+ }
1109	+ }
1110	+
1111	+ protected function op_and($left, $right, $shouldEval) {
1112	+ if (!$shouldEval) return;
1113	+ if ($left != self::$false) return $right;
1114	+ return $left;
1115	+ }
1116	+
1117	+ protected function op_or($left, $right, $shouldEval) {
1118	+ if (!$shouldEval) return;
1119	+ if ($left != self::$false) return $left;
1120	+ return $right;
1121	+ }
1122	+
1123	+ protected function op_color_color($op, $left, $right) {
1124	+ $out = array('color');
1125	+ foreach (range(1, 3) as $i) {
1126	+ $lval = isset($left[$i]) ? $left[$i] : 0;
1127	+ $rval = isset($right[$i]) ? $right[$i] : 0;
1128	+ switch ($op) {
1129	+ case '+':
1130	+ $out[] = $lval + $rval;
1131	+ break;
1132	+ case '-':
1133	+ $out[] = $lval - $rval;
1134	+ break;
1135	+ case '*':
1136	+ $out[] = $lval * $rval;
1137	+ break;
1138	+ case '%':
1139	+ $out[] = $lval % $rval;
1140	+ break;
1141	+ case '/':
1142	+ if ($rval == 0) {
1143	+ $this->throwError("color: Can't divide by zero");
1144	+ }
1145	+ $out[] = $lval / $rval;
1146	+ break;
1147	+ case "==":
1148	+ return $this->op_eq($left, $right);
1149	+ case "!=":
1150	+ return $this->op_neq($left, $right);
1151	+ default:
1152	+ $this->throwError("color: unknown op $op");
1153	+ }
1154	+ }
1155	+
1156	+ if (isset($left[4])) $out[4] = $left[4];
1157	+ elseif (isset($right[4])) $out[4] = $right[4];
1158	+
1159	+ return $this->fixColor($out);
1160	+ }
1161	+
1162	+ protected function op_color_number($op, $left, $right) {
1163	+ $value = $right[1];
1164	+ return $this->op_color_color($op, $left,
1165	+ array("color", $value, $value, $value));
1166	+ }
1167	+
1168	+ protected function op_number_color($op, $left, $right) {
1169	+ $value = $left[1];
1170	+ return $this->op_color_color($op,
1171	+ array("color", $value, $value, $value), $right);
1172	+ }
1173	+
1174	+ protected function op_eq($left, $right) {
1175	+ if (($lStr = $this->coerceString($left)) && ($rStr = $this->coerceString($right))) {
1176	+ $lStr[1] = "";
1177	+ $rStr[1] = "";
1178	+ return $this->toBool($this->compileValue($lStr) == $this->compileValue($rStr));
1179	+ }
1180	+
1181	+ return $this->toBool($left == $right);
1182	+ }
1183	+
1184	+ protected function op_neq($left, $right) {
1185	+ return $this->toBool($left != $right);
1186	+ }
1187	+
1188	+ protected function op_gte_number_number($left, $right) {
1189	+ return $this->toBool($left[1] >= $right[1]);
1190	+ }
1191	+
1192	+ protected function op_gt_number_number($left, $right) {
1193	+ return $this->toBool($left[1] > $right[1]);
1194	+ }
1195	+
1196	+ protected function op_lte_number_number($left, $right) {
1197	+ return $this->toBool($left[1] <= $right[1]);
1198	+ }
1199	+
1200	+ protected function op_lt_number_number($left, $right) {
1201	+ return $this->toBool($left[1] < $right[1]);
1202	+ }
1203	+
1204	+ public function toBool($thing) {
1205	+ return $thing ? self::$true : self::$false;
1206	+ }
1207	+
1208	+ /**
1209	+ * Compiles a primitive value into a CSS property value.
1210	+ *
1211	+ * Values in scssphp are typed by being wrapped in arrays, their format is
1212	+ * typically:
1213	+ *
1214	+ * array(type, contents [, additional_contents]*)
1215	+ *
1216	+ * The input is expected to be reduced. This function will not work on
1217	+ * things like expressions and variables.
1218	+ *
1219	+ * @param array $value
1220	+ */
1221	+ protected function compileValue($value) {
1222	+ $value = $this->reduce($value);
1223	+
1224	+ list($type) = $value;
1225	+ switch ($type) {
1226	+ case "keyword":
1227	+ return $value[1];
1228	+ case "color":
1229	+ // [1] - red component (either number for a %)
1230	+ // [2] - green component
1231	+ // [3] - blue component
1232	+ // [4] - optional alpha component
1233	+ list(, $r, $g, $b) = $value;
1234	+
1235	+ $r = round($r);
1236	+ $g = round($g);
1237	+ $b = round($b);
1238	+
1239	+ if (count($value) == 5 && $value[4] != 1) { // rgba
1240	+ return 'rgba('.$r.', '.$g.', '.$b.', '.$value[4].')';
1241	+ }
1242	+
1243	+ $h = sprintf("#%02x%02x%02x", $r, $g, $b);
1244	+
1245	+ // Converting hex color to short notation (e.g. #003399 to #039)
1246	+ if ($h[1] === $h[2] && $h[3] === $h[4] && $h[5] === $h[6]) {
1247	+ $h = '#' . $h[1] . $h[3] . $h[5];
1248	+ }
1249	+
1250	+ return $h;
1251	+ case "number":
1252	+ return round($value[1], $this->numberPrecision) . $value[2];
1253	+ case "string":
1254	+ return $value[1] . $this->compileStringContent($value) . $value[1];
1255	+ case "function":
1256	+ $args = !empty($value[2]) ? $this->compileValue($value[2]) : "";
1257	+ return "$value[1]($args)";
1258	+ case "list":
1259	+ $value = $this->extractInterpolation($value);
1260	+ if ($value[0] != "list") return $this->compileValue($value);
1261	+
1262	+ list(, $delim, $items) = $value;
1263	+
1264	+ $filtered = array();
1265	+ foreach ($items as $item) {
1266	+ if ($item[0] == "null") continue;
1267	+ $filtered[] = $this->compileValue($item);
1268	+ }
1269	+
1270	+ return implode("$delim ", $filtered);
1271	+ case "interpolated": # node created by extractInterpolation
1272	+ list(, $interpolate, $left, $right) = $value;
1273	+ list(,, $whiteLeft, $whiteRight) = $interpolate;
1274	+
1275	+ $left = count($left[2]) > 0 ?
1276	+ $this->compileValue($left).$whiteLeft : "";
1277	+
1278	+ $right = count($right[2]) > 0 ?
1279	+ $whiteRight.$this->compileValue($right) : "";
1280	+
1281	+ return $left.$this->compileValue($interpolate).$right;
1282	+
1283	+ case "interpolate": # raw parse node
1284	+ list(, $exp) = $value;
1285	+
1286	+ // strip quotes if it's a string
1287	+ $reduced = $this->reduce($exp);
1288	+ switch ($reduced[0]) {
1289	+ case "string":
1290	+ $reduced = array("keyword",
1291	+ $this->compileStringContent($reduced));
1292	+ break;
1293	+ case "null":
1294	+ $reduced = array("keyword", "");
1295	+ }
1296	+
1297	+ return $this->compileValue($reduced);
1298	+ case "null":
1299	+ return "null";
1300	+ default:
1301	+ $this->throwError("unknown value type: $type");
1302	+ }
1303	+ }
1304	+
1305	+ protected function compileStringContent($string) {
1306	+ $parts = array();
1307	+ foreach ($string[2] as $part) {
1308	+ if (is_array($part)) {
1309	+ $parts[] = $this->compileValue($part);
1310	+ } else {
1311	+ $parts[] = $part;
1312	+ }
1313	+ }
1314	+
1315	+ return implode($parts);
1316	+ }
1317	+
1318	+ // doesn't need to be recursive, compileValue will handle that
1319	+ protected function extractInterpolation($list) {
1320	+ $items = $list[2];
1321	+ foreach ($items as $i => $item) {
1322	+ if ($item[0] == "interpolate") {
1323	+ $before = array("list", $list[1], array_slice($items, 0, $i));
1324	+ $after = array("list", $list[1], array_slice($items, $i + 1));
1325	+ return array("interpolated", $item, $before, $after);
1326	+ }
1327	+ }
1328	+ return $list;
1329	+ }
1330	+
1331	+ // find the final set of selectors
1332	+ protected function multiplySelectors($env) {
1333	+ $envs = array();
1334	+ while (null !== $env) {
1335	+ if (!empty($env->selectors)) {
1336	+ $envs[] = $env;
1337	+ }
1338	+ $env = $env->parent;
1339	+ };
1340	+
1341	+ $selectors = array();
1342	+ $parentSelectors = array(array());
1343	+ while ($env = array_pop($envs)) {
1344	+ $selectors = array();
1345	+ foreach ($env->selectors as $selector) {
1346	+ foreach ($parentSelectors as $parent) {
1347	+ $selectors[] = $this->joinSelectors($parent, $selector);
1348	+ }
1349	+ }
1350	+ $parentSelectors = $selectors;
1351	+ }
1352	+
1353	+ return $selectors;
1354	+ }
1355	+
1356	+ // looks for & to replace, or append parent before child
1357	+ protected function joinSelectors($parent, $child) {
1358	+ $setSelf = false;
1359	+ $out = array();
1360	+ foreach ($child as $part) {
1361	+ $newPart = array();
1362	+ foreach ($part as $p) {
1363	+ if ($p == self::$selfSelector) {
1364	+ $setSelf = true;
1365	+ foreach ($parent as $i => $parentPart) {
1366	+ if ($i > 0) {
1367	+ $out[] = $newPart;
1368	+ $newPart = array();
1369	+ }
1370	+
1371	+ foreach ($parentPart as $pp) {
1372	+ $newPart[] = $pp;
1373	+ }
1374	+ }
1375	+ } else {
1376	+ $newPart[] = $p;
1377	+ }
1378	+ }
1379	+
1380	+ $out[] = $newPart;
1381	+ }
1382	+
1383	+ return $setSelf ? $out : array_merge($parent, $child);
1384	+ }
1385	+
1386	+ protected function multiplyMedia($env, $childQueries = null) {
1387	+ if (!isset($env) \|\|
1388	+ !empty($env->block->type) && $env->block->type != "media")
1389	+ {
1390	+ return $childQueries;
1391	+ }
1392	+
1393	+ // plain old block, skip
1394	+ if (empty($env->block->type)) {
1395	+ return $this->multiplyMedia($env->parent, $childQueries);
1396	+ }
1397	+
1398	+ $parentQueries = $env->block->queryList;
1399	+ if ($childQueries == null) {
1400	+ $childQueries = $parentQueries;
1401	+ } else {
1402	+ $originalQueries = $childQueries;
1403	+ $childQueries = array();
1404	+
1405	+ foreach ($parentQueries as $parentQuery){
1406	+ foreach ($originalQueries as $childQuery) {
1407	+ $childQueries []= array_merge($parentQuery, $childQuery);
1408	+ }
1409	+ }
1410	+ }
1411	+
1412	+ return $this->multiplyMedia($env->parent, $childQueries);
1413	+ }
1414	+
1415	+ // convert something to list
1416	+ protected function coerceList($item, $delim = ",") {
1417	+ if (isset($item) && $item[0] == "list") {
1418	+ return $item;
1419	+ }
1420	+
1421	+ return array("list", $delim, !isset($item) ? array(): array($item));
1422	+ }
1423	+
1424	+ protected function applyArguments($argDef, $argValues) {
1425	+ $hasVariable = false;
1426	+ $args = array();
1427	+ foreach ($argDef as $i => $arg) {
1428	+ list($name, $default, $isVariable) = $argDef[$i];
1429	+ $args[$name] = array($i, $name, $default, $isVariable);
1430	+ $hasVariable \|= $isVariable;
1431	+ }
1432	+
1433	+ $keywordArgs = array();
1434	+ $deferredKeywordArgs = array();
1435	+ $remaining = array();
1436	+ // assign the keyword args
1437	+ foreach ((array) $argValues as $arg) {
1438	+ if (!empty($arg[0])) {
1439	+ if (!isset($args[$arg[0][1]])) {
1440	+ if ($hasVariable) {
1441	+ $deferredKeywordArgs[$arg[0][1]] = $arg[1];
1442	+ } else {
1443	+ $this->throwError("Mixin or function doesn't have an argument named $%s.", $arg[0][1]);
1444	+ }
1445	+ } elseif ($args[$arg[0][1]][0] < count($remaining)) {
1446	+ $this->throwError("The argument $%s was passed both by position and by name.", $arg[0][1]);
1447	+ } else {
1448	+ $keywordArgs[$arg[0][1]] = $arg[1];
1449	+ }
1450	+ } elseif (count($keywordArgs)) {
1451	+ $this->throwError('Positional arguments must come before keyword arguments.');
1452	+ } elseif ($arg[2] == true) {
1453	+ $val = $this->reduce($arg[1], true);
1454	+ if ($val[0] == "list") {
1455	+ foreach ($val[2] as $name => $item) {
1456	+ if (!is_numeric($name)) {
1457	+ $keywordArgs[$name] = $item;
1458	+ } else {
1459	+ $remaining[] = $item;
1460	+ }
1461	+ }
1462	+ } else {
1463	+ $remaining[] = $val;
1464	+ }
1465	+ } else {
1466	+ $remaining[] = $arg[1];
1467	+ }
1468	+ }
1469	+
1470	+ foreach ($args as $arg) {
1471	+ list($i, $name, $default, $isVariable) = $arg;
1472	+ if ($isVariable) {
1473	+ $val = array("list", ",", array());
1474	+ for ($count = count($remaining); $i < $count; $i++) {
1475	+ $val[2][] = $remaining[$i];
1476	+ }
1477	+ foreach ($deferredKeywordArgs as $itemName => $item) {
1478	+ $val[2][$itemName] = $item;
1479	+ }
1480	+ } elseif (isset($remaining[$i])) {
1481	+ $val = $remaining[$i];
1482	+ } elseif (isset($keywordArgs[$name])) {
1483	+ $val = $keywordArgs[$name];
1484	+ } elseif (!empty($default)) {
1485	+ $val = $default;
1486	+ } else {
1487	+ $this->throwError("Missing argument $name");
1488	+ }
1489	+
1490	+ $this->set($name, $this->reduce($val, true), true);
1491	+ }
1492	+ }
1493	+
1494	+ protected function pushEnv($block=null) {
1495	+ $env = new stdClass;
1496	+ $env->parent = $this->env;
1497	+ $env->store = array();
1498	+ $env->block = $block;
1499	+ $env->depth = isset($this->env->depth) ? $this->env->depth + 1 : 0;
1500	+
1501	+ $this->env = $env;
1502	+ return $env;
1503	+ }
1504	+
1505	+ protected function normalizeName($name) {
1506	+ return str_replace("-", "_", $name);
1507	+ }
1508	+
1509	+ protected function getStoreEnv() {
1510	+ return isset($this->storeEnv) ? $this->storeEnv : $this->env;
1511	+ }
1512	+
1513	+ protected function set($name, $value, $shadow=false) {
1514	+ $name = $this->normalizeName($name);
1515	+
1516	+ if ($shadow) {
1517	+ $this->setRaw($name, $value);
1518	+ } else {
1519	+ $this->setExisting($name, $value);
1520	+ }
1521	+ }
1522	+
1523	+ protected function setExisting($name, $value, $env = null) {
1524	+ if (!isset($env)) $env = $this->getStoreEnv();
1525	+
1526	+ if (isset($env->store[$name]) \|\| !isset($env->parent)) {
1527	+ $env->store[$name] = $value;
1528	+ } else {
1529	+ $this->setExisting($name, $value, $env->parent);
1530	+ }
1531	+ }
1532	+
1533	+ protected function setRaw($name, $value) {
1534	+ $env = $this->getStoreEnv();
1535	+ $env->store[$name] = $value;
1536	+ }
1537	+
1538	+ public function get($name, $defaultValue = null, $env = null) {
1539	+ $name = $this->normalizeName($name);
1540	+
1541	+ if (!isset($env)) $env = $this->getStoreEnv();
1542	+ if (!isset($defaultValue)) $defaultValue = self::$defaultValue;
1543	+
1544	+ if (isset($env->store[$name])) {
1545	+ return $env->store[$name];
1546	+ } elseif (isset($env->parent)) {
1547	+ return $this->get($name, $defaultValue, $env->parent);
1548	+ }
1549	+
1550	+ return $defaultValue; // found nothing
1551	+ }
1552	+
1553	+ protected function popEnv() {
1554	+ $env = $this->env;
1555	+ $this->env = $this->env->parent;
1556	+ return $env;
1557	+ }
1558	+
1559	+ public function getParsedFiles() {
1560	+ return $this->parsedFiles;
1561	+ }
1562	+
1563	+ public function addImportPath($path) {
1564	+ $this->importPaths[] = $path;
1565	+ }
1566	+
1567	+ public function setImportPaths($path) {
1568	+ $this->importPaths = (array)$path;
1569	+ }
1570	+
1571	+ public function setNumberPrecision($numberPrecision) {
1572	+ $this->numberPrecision = $numberPrecision;
1573	+ }
1574	+
1575	+ public function setFormatter($formatterName) {
1576	+ $this->formatter = $formatterName;
1577	+ }
1578	+
1579	+ public function registerFunction($name, $func) {
1580	+ $this->userFunctions[$this->normalizeName($name)] = $func;
1581	+ }
1582	+
1583	+ public function unregisterFunction($name) {
1584	+ unset($this->userFunctions[$this->normalizeName($name)]);
1585	+ }
1586	+
1587	+ protected function importFile($path, $out) {
1588	+ // see if tree is cached
1589	+ $realPath = realpath($path);
1590	+ if (isset($this->importCache[$realPath])) {
1591	+ $tree = $this->importCache[$realPath];
1592	+ } else {
1593	+ $code = file_get_contents($path);
1594	+ $parser = new scss_parser($path, false);
1595	+ $tree = $parser->parse($code);
1596	+ $this->parsedFiles[] = $path;
1597	+
1598	+ $this->importCache[$realPath] = $tree;
1599	+ }
1600	+
1601	+ $pi = pathinfo($path);
1602	+ array_unshift($this->importPaths, $pi['dirname']);
1603	+ $this->compileChildren($tree->children, $out);
1604	+ array_shift($this->importPaths);
1605	+ }
1606	+
1607	+ // results the file path for an import url if it exists
1608	+ public function findImport($url) {
1609	+ $urls = array();
1610	+
1611	+ // for "normal" scss imports (ignore vanilla css and external requests)
1612	+ //if (!preg_match('/\.css\|^http:\/\/$/', $url)) {
1613	+ // try both normal and the _partial filename
1614	+ $urls = array($url, preg_replace('/[^\/]+$/', '_\0', $url));
1615	+ //}
1616	+
1617	+ foreach ($this->importPaths as $dir) {
1618	+ if (is_string($dir)) {
1619	+ // check urls for normal import paths
1620	+ foreach ($urls as $full) {
1621	+ $full = $dir .
1622	+ (!empty($dir) && substr($dir, -1) != '/' ? '/' : '') .
1623	+ $full;
1624	+
1625	+ if ($this->fileExists($file = $full.'.scss') \|\|
1626	+ $this->fileExists($file = $full))
1627	+ {
1628	+ return $file;
1629	+ }
1630	+ }
1631	+ } else {
1632	+ // check custom callback for import path
1633	+ $file = call_user_func($dir,$url,$this);
1634	+ if ($file !== null) {
1635	+ return $file;
1636	+ }
1637	+ }
1638	+ }
1639	+
1640	+ return null;
1641	+ }
1642	+
1643	+ protected function fileExists($name) {
1644	+ return is_file($name);
1645	+ }
1646	+
1647	+ protected function callBuiltin($name, $args, &$returnValue) {
1648	+ // try a lib function
1649	+ $name = $this->normalizeName($name);
1650	+ $libName = "lib_".$name;
1651	+ $f = array($this, $libName);
1652	+ if (is_callable($f)) {
1653	+ $prototype = isset(self::$$libName) ? self::$$libName : null;
1654	+ $sorted = $this->sortArgs($prototype, $args);
1655	+ foreach ($sorted as &$val) {
1656	+ $val = $this->reduce($val, true);
1657	+ }
1658	+ $returnValue = call_user_func($f, $sorted, $this);
1659	+ } elseif (isset($this->userFunctions[$name])) {
1660	+ // see if we can find a user function
1661	+ $fn = $this->userFunctions[$name];
1662	+
1663	+ foreach ($args as &$val) {
1664	+ $val = $this->reduce($val[1], true);
1665	+ }
1666	+
1667	+ $returnValue = call_user_func($fn, $args, $this);
1668	+ }
1669	+
1670	+ if (isset($returnValue)) {
1671	+ // coerce a php value into a scss one
1672	+ if (is_numeric($returnValue)) {
1673	+ $returnValue = array('number', $returnValue, "");
1674	+ } elseif (is_bool($returnValue)) {
1675	+ $returnValue = $returnValue ? self::$true : self::$false;
1676	+ } elseif (!is_array($returnValue)) {
1677	+ $returnValue = array('keyword', $returnValue);
1678	+ }
1679	+
1680	+ return true;
1681	+ }
1682	+
1683	+ return false;
1684	+ }
1685	+
1686	+ // sorts any keyword arguments
1687	+ // TODO: merge with apply arguments
1688	+ protected function sortArgs($prototype, $args) {
1689	+ $keyArgs = array();
1690	+ $posArgs = array();
1691	+
1692	+ foreach ($args as $arg) {
1693	+ list($key, $value) = $arg;
1694	+ $key = $key[1];
1695	+ if (empty($key)) {
1696	+ $posArgs[] = $value;
1697	+ } else {
1698	+ $keyArgs[$key] = $value;
1699	+ }
1700	+ }
1701	+
1702	+ if (!isset($prototype)) return $posArgs;
1703	+
1704	+ $finalArgs = array();
1705	+ foreach ($prototype as $i => $names) {
1706	+ if (isset($posArgs[$i])) {
1707	+ $finalArgs[] = $posArgs[$i];
1708	+ continue;
1709	+ }
1710	+
1711	+ $set = false;
1712	+ foreach ((array)$names as $name) {
1713	+ if (isset($keyArgs[$name])) {
1714	+ $finalArgs[] = $keyArgs[$name];
1715	+ $set = true;
1716	+ break;
1717	+ }
1718	+ }
1719	+
1720	+ if (!$set) {
1721	+ $finalArgs[] = null;
1722	+ }
1723	+ }
1724	+
1725	+ return $finalArgs;
1726	+ }
1727	+
1728	+ protected function coerceForExpression($value) {
1729	+ if ($color = $this->coerceColor($value)) {
1730	+ return $color;
1731	+ }
1732	+
1733	+ return $value;
1734	+ }
1735	+
1736	+ protected function coerceColor($value) {
1737	+ switch ($value[0]) {
1738	+ case "color": return $value;
1739	+ case "keyword":
1740	+ $name = $value[1];
1741	+ if (isset(self::$cssColors[$name])) {
1742	+ $rgba = explode(',', self::$cssColors[$name]);
1743	+ return isset($rgba[3])
1744	+ ? array('color', (int) $rgba[0], (int) $rgba[1], (int) $rgba[2], (int) $rgba[3])
1745	+ : array('color', (int) $rgba[0], (int) $rgba[1], (int) $rgba[2]);
1746	+ }
1747	+ return null;
1748	+ }
1749	+
1750	+ return null;
1751	+ }
1752	+
1753	+ protected function coerceString($value) {
1754	+ switch ($value[0]) {
1755	+ case "string":
1756	+ return $value;
1757	+ case "keyword":
1758	+ return array("string", "", array($value[1]));
1759	+ }
1760	+ return null;
1761	+ }
1762	+
1763	+ public function assertList($value) {
1764	+ if ($value[0] != "list")
1765	+ $this->throwError("expecting list");
1766	+ return $value;
1767	+ }
1768	+
1769	+ public function assertColor($value) {
1770	+ if ($color = $this->coerceColor($value)) return $color;
1771	+ $this->throwError("expecting color");
1772	+ }
1773	+
1774	+ public function assertNumber($value) {
1775	+ if ($value[0] != "number")
1776	+ $this->throwError("expecting number");
1777	+ return $value[1];
1778	+ }
1779	+
1780	+ protected function coercePercent($value) {
1781	+ if ($value[0] == "number") {
1782	+ if ($value[2] == "%") {
1783	+ return $value[1] / 100;
1784	+ }
1785	+ return $value[1];
1786	+ }
1787	+ return 0;
1788	+ }
1789	+
1790	+ // make sure a color's components don't go out of bounds
1791	+ protected function fixColor($c) {
1792	+ foreach (range(1, 3) as $i) {
1793	+ if ($c[$i] < 0) $c[$i] = 0;
1794	+ if ($c[$i] > 255) $c[$i] = 255;
1795	+ }
1796	+
1797	+ return $c;
1798	+ }
1799	+
1800	+ public function toHSL($red, $green, $blue) {
1801	+ $min = min($red, $green, $blue);
1802	+ $max = max($red, $green, $blue);
1803	+
1804	+ $l = $min + $max;
1805	+
1806	+ if ($min == $max) {
1807	+ $s = $h = 0;
1808	+ } else {
1809	+ $d = $max - $min;
1810	+
1811	+ if ($l < 255)
1812	+ $s = $d / $l;
1813	+ else
1814	+ $s = $d / (510 - $l);
1815	+
1816	+ if ($red == $max)
1817	+ $h = 60 * ($green - $blue) / $d;
1818	+ elseif ($green == $max)
1819	+ $h = 60 * ($blue - $red) / $d + 120;
1820	+ elseif ($blue == $max)
1821	+ $h = 60 * ($red - $green) / $d + 240;
1822	+ }
1823	+
1824	+ return array('hsl', fmod($h, 360), $s * 100, $l / 5.1);
1825	+ }
1826	+
1827	+ public function hueToRGB($m1, $m2, $h) {
1828	+ if ($h < 0)
1829	+ $h += 1;
1830	+ elseif ($h > 1)
1831	+ $h -= 1;
1832	+
1833	+ if ($h * 6 < 1)
1834	+ return $m1 + ($m2 - $m1) * $h * 6;
1835	+
1836	+ if ($h * 2 < 1)
1837	+ return $m2;
1838	+
1839	+ if ($h * 3 < 2)
1840	+ return $m1 + ($m2 - $m1) * (2/3 - $h) * 6;
1841	+
1842	+ return $m1;
1843	+ }
1844	+
1845	+ // H from 0 to 360, S and L from 0 to 100
1846	+ public function toRGB($hue, $saturation, $lightness) {
1847	+ if ($hue < 0) {
1848	+ $hue += 360;
1849	+ }
1850	+
1851	+ $h = $hue / 360;
1852	+ $s = min(100, max(0, $saturation)) / 100;
1853	+ $l = min(100, max(0, $lightness)) / 100;
1854	+
1855	+ $m2 = $l <= 0.5 ? $l * ($s + 1) : $l + $s - $l * $s;
1856	+ $m1 = $l * 2 - $m2;
1857	+
1858	+ $r = $this->hueToRGB($m1, $m2, $h + 1/3) * 255;
1859	+ $g = $this->hueToRGB($m1, $m2, $h) * 255;
1860	+ $b = $this->hueToRGB($m1, $m2, $h - 1/3) * 255;
1861	+
1862	+ $out = array('color', $r, $g, $b);
1863	+ return $out;
1864	+ }
1865	+
1866	+ // Built in functions
1867	+
1868	+ protected static $lib_if = array("condition", "if-true", "if-false");
1869	+ protected function lib_if($args) {
1870	+ list($cond,$t, $f) = $args;
1871	+ if (!$this->isTruthy($cond)) return $f;
1872	+ return $t;
1873	+ }
1874	+
1875	+ protected static $lib_index = array("list", "value");
1876	+ protected function lib_index($args) {
1877	+ list($list, $value) = $args;
1878	+ $list = $this->assertList($list);
1879	+
1880	+ $values = array();
1881	+ foreach ($list[2] as $item) {
1882	+ $values[] = $this->normalizeValue($item);
1883	+ }
1884	+ $key = array_search($this->normalizeValue($value), $values);
1885	+
1886	+ return false === $key ? false : $key + 1;
1887	+ }
1888	+
1889	+ protected static $lib_rgb = array("red", "green", "blue");
1890	+ protected function lib_rgb($args) {
1891	+ list($r,$g,$b) = $args;
1892	+ return array("color", $r[1], $g[1], $b[1]);
1893	+ }
1894	+
1895	+ protected static $lib_rgba = array(
1896	+ array("red", "color"),
1897	+ "green", "blue", "alpha");
1898	+ protected function lib_rgba($args) {
1899	+ if ($color = $this->coerceColor($args[0])) {
1900	+ $num = !isset($args[1]) ? $args[3] : $args[1];
1901	+ $alpha = $this->assertNumber($num);
1902	+ $color[4] = $alpha;
1903	+ return $color;
1904	+ }
1905	+
1906	+ list($r,$g,$b, $a) = $args;
1907	+ return array("color", $r[1], $g[1], $b[1], $a[1]);
1908	+ }
1909	+
1910	+ // helper function for adjust_color, change_color, and scale_color
1911	+ protected function alter_color($args, $fn) {
1912	+ $color = $this->assertColor($args[0]);
1913	+
1914	+ foreach (array(1,2,3,7) as $i) {
1915	+ if (isset($args[$i])) {
1916	+ $val = $this->assertNumber($args[$i]);
1917	+ $ii = $i == 7 ? 4 : $i; // alpha
1918	+ $color[$ii] =
1919	+ $this->$fn(isset($color[$ii]) ? $color[$ii] : 0, $val, $i);
1920	+ }
1921	+ }
1922	+
1923	+ if (isset($args[4]) \|\| isset($args[5]) \|\| isset($args[6])) {
1924	+ $hsl = $this->toHSL($color[1], $color[2], $color[3]);
1925	+ foreach (array(4,5,6) as $i) {
1926	+ if (isset($args[$i])) {
1927	+ $val = $this->assertNumber($args[$i]);
1928	+ $hsl[$i - 3] = $this->$fn($hsl[$i - 3], $val, $i);
1929	+ }
1930	+ }
1931	+
1932	+ $rgb = $this->toRGB($hsl[1], $hsl[2], $hsl[3]);
1933	+ if (isset($color[4])) $rgb[4] = $color[4];
1934	+ $color = $rgb;
1935	+ }
1936	+
1937	+ return $color;
1938	+ }
1939	+
1940	+ protected static $lib_adjust_color = array(
1941	+ "color", "red", "green", "blue",
1942	+ "hue", "saturation", "lightness", "alpha"
1943	+ );
1944	+ protected function adjust_color_helper($base, $alter, $i) {
1945	+ return $base += $alter;
1946	+ }
1947	+ protected function lib_adjust_color($args) {
1948	+ return $this->alter_color($args, "adjust_color_helper");
1949	+ }
1950	+
1951	+ protected static $lib_change_color = array(
1952	+ "color", "red", "green", "blue",
1953	+ "hue", "saturation", "lightness", "alpha"
1954	+ );
1955	+ protected function change_color_helper($base, $alter, $i) {
1956	+ return $alter;
1957	+ }
1958	+ protected function lib_change_color($args) {
1959	+ return $this->alter_color($args, "change_color_helper");
1960	+ }
1961	+
1962	+ protected static $lib_scale_color = array(
1963	+ "color", "red", "green", "blue",
1964	+ "hue", "saturation", "lightness", "alpha"
1965	+ );
1966	+ protected function scale_color_helper($base, $scale, $i) {
1967	+ // 1,2,3 - rgb
1968	+ // 4, 5, 6 - hsl
1969	+ // 7 - a
1970	+ switch ($i) {
1971	+ case 1:
1972	+ case 2:
1973	+ case 3:
1974	+ $max = 255; break;
1975	+ case 4:
1976	+ $max = 360; break;
1977	+ case 7:
1978	+ $max = 1; break;
1979	+ default:
1980	+ $max = 100;
1981	+ }
1982	+
1983	+ $scale = $scale / 100;
1984	+ if ($scale < 0) {
1985	+ return $base * $scale + $base;
1986	+ } else {
1987	+ return ($max - $base) * $scale + $base;
1988	+ }
1989	+ }
1990	+ protected function lib_scale_color($args) {
1991	+ return $this->alter_color($args, "scale_color_helper");
1992	+ }
1993	+
1994	+ protected static $lib_ie_hex_str = array("color");
1995	+ protected function lib_ie_hex_str($args) {
1996	+ $color = $this->coerceColor($args[0]);
1997	+ $color[4] = isset($color[4]) ? round(255*$color[4]) : 255;
1998	+
1999	+ return sprintf('#%02X%02X%02X%02X', $color[4], $color[1], $color[2], $color[3]);
2000	+ }
2001	+
2002	+ protected static $lib_red = array("color");
2003	+ protected function lib_red($args) {
2004	+ $color = $this->coerceColor($args[0]);
2005	+ return $color[1];
2006	+ }
2007	+
2008	+ protected static $lib_green = array("color");
2009	+ protected function lib_green($args) {
2010	+ $color = $this->coerceColor($args[0]);
2011	+ return $color[2];
2012	+ }
2013	+
2014	+ protected static $lib_blue = array("color");
2015	+ protected function lib_blue($args) {
2016	+ $color = $this->coerceColor($args[0]);
2017	+ return $color[3];
2018	+ }
2019	+
2020	+ protected static $lib_alpha = array("color");
2021	+ protected function lib_alpha($args) {
2022	+ if ($color = $this->coerceColor($args[0])) {
2023	+ return isset($color[4]) ? $color[4] : 1;
2024	+ }
2025	+
2026	+ // this might be the IE function, so return value unchanged
2027	+ return null;
2028	+ }
2029	+
2030	+ protected static $lib_opacity = array("color");
2031	+ protected function lib_opacity($args) {
2032	+ $value = $args[0];
2033	+ if ($value[0] === 'number') return null;
2034	+ return $this->lib_alpha($args);
2035	+ }
2036	+
2037	+ // mix two colors
2038	+ protected static $lib_mix = array("color-1", "color-2", "weight");
2039	+ protected function lib_mix($args) {
2040	+ list($first, $second, $weight) = $args;
2041	+ $first = $this->assertColor($first);
2042	+ $second = $this->assertColor($second);
2043	+
2044	+ if (!isset($weight)) {
2045	+ $weight = 0.5;
2046	+ } else {
2047	+ $weight = $this->coercePercent($weight);
2048	+ }
2049	+
2050	+ $firstAlpha = isset($first[4]) ? $first[4] : 1;
2051	+ $secondAlpha = isset($second[4]) ? $second[4] : 1;
2052	+
2053	+ $w = $weight * 2 - 1;
2054	+ $a = $firstAlpha - $secondAlpha;
2055	+
2056	+ $w1 = (($w * $a == -1 ? $w : ($w + $a)/(1 + $w * $a)) + 1) / 2.0;
2057	+ $w2 = 1.0 - $w1;
2058	+
2059	+ $new = array('color',
2060	+ $w1 * $first[1] + $w2 * $second[1],
2061	+ $w1 * $first[2] + $w2 * $second[2],
2062	+ $w1 * $first[3] + $w2 * $second[3],
2063	+ );
2064	+
2065	+ if ($firstAlpha != 1.0 \|\| $secondAlpha != 1.0) {
2066	+ $new[] = $firstAlpha * $weight + $secondAlpha * ($weight - 1);
2067	+ }
2068	+
2069	+ return $this->fixColor($new);
2070	+ }
2071	+
2072	+ protected static $lib_hsl = array("hue", "saturation", "lightness");
2073	+ protected function lib_hsl($args) {
2074	+ list($h, $s, $l) = $args;
2075	+ return $this->toRGB($h[1], $s[1], $l[1]);
2076	+ }
2077	+
2078	+ protected static $lib_hsla = array("hue", "saturation",
2079	+ "lightness", "alpha");
2080	+ protected function lib_hsla($args) {
2081	+ list($h, $s, $l, $a) = $args;
2082	+ $color = $this->toRGB($h[1], $s[1], $l[1]);
2083	+ $color[4] = $a[1];
2084	+ return $color;
2085	+ }
2086	+
2087	+ protected static $lib_hue = array("color");
2088	+ protected function lib_hue($args) {
2089	+ $color = $this->assertColor($args[0]);
2090	+ $hsl = $this->toHSL($color[1], $color[2], $color[3]);
2091	+ return array("number", $hsl[1], "deg");
2092	+ }
2093	+
2094	+ protected static $lib_saturation = array("color");
2095	+ protected function lib_saturation($args) {
2096	+ $color = $this->assertColor($args[0]);
2097	+ $hsl = $this->toHSL($color[1], $color[2], $color[3]);
2098	+ return array("number", $hsl[2], "%");
2099	+ }
2100	+
2101	+ protected static $lib_lightness = array("color");
2102	+ protected function lib_lightness($args) {
2103	+ $color = $this->assertColor($args[0]);
2104	+ $hsl = $this->toHSL($color[1], $color[2], $color[3]);
2105	+ return array("number", $hsl[3], "%");
2106	+ }
2107	+
2108	+ protected function adjustHsl($color, $idx, $amount) {
2109	+ $hsl = $this->toHSL($color[1], $color[2], $color[3]);
2110	+ $hsl[$idx] += $amount;
2111	+ $out = $this->toRGB($hsl[1], $hsl[2], $hsl[3]);
2112	+ if (isset($color[4])) $out[4] = $color[4];
2113	+ return $out;
2114	+ }
2115	+
2116	+ protected static $lib_adjust_hue = array("color", "degrees");
2117	+ protected function lib_adjust_hue($args) {
2118	+ $color = $this->assertColor($args[0]);
2119	+ $degrees = $this->assertNumber($args[1]);
2120	+ return $this->adjustHsl($color, 1, $degrees);
2121	+ }
2122	+
2123	+ protected static $lib_lighten = array("color", "amount");
2124	+ protected function lib_lighten($args) {
2125	+ $color = $this->assertColor($args[0]);
2126	+ $amount = 100*$this->coercePercent($args[1]);
2127	+ return $this->adjustHsl($color, 3, $amount);
2128	+ }
2129	+
2130	+ protected static $lib_darken = array("color", "amount");
2131	+ protected function lib_darken($args) {
2132	+ $color = $this->assertColor($args[0]);
2133	+ $amount = 100*$this->coercePercent($args[1]);
2134	+ return $this->adjustHsl($color, 3, -$amount);
2135	+ }
2136	+
2137	+ protected static $lib_saturate = array("color", "amount");
2138	+ protected function lib_saturate($args) {
2139	+ $value = $args[0];
2140	+ if ($value[0] === 'number') return null;
2141	+ $color = $this->assertColor($value);
2142	+ $amount = 100*$this->coercePercent($args[1]);
2143	+ return $this->adjustHsl($color, 2, $amount);
2144	+ }
2145	+
2146	+ protected static $lib_desaturate = array("color", "amount");
2147	+ protected function lib_desaturate($args) {
2148	+ $color = $this->assertColor($args[0]);
2149	+ $amount = 100*$this->coercePercent($args[1]);
2150	+ return $this->adjustHsl($color, 2, -$amount);
2151	+ }
2152	+
2153	+ protected static $lib_grayscale = array("color");
2154	+ protected function lib_grayscale($args) {
2155	+ $value = $args[0];
2156	+ if ($value[0] === 'number') return null;
2157	+ return $this->adjustHsl($this->assertColor($value), 2, -100);
2158	+ }
2159	+
2160	+ protected static $lib_complement = array("color");
2161	+ protected function lib_complement($args) {
2162	+ return $this->adjustHsl($this->assertColor($args[0]), 1, 180);
2163	+ }
2164	+
2165	+ protected static $lib_invert = array("color");
2166	+ protected function lib_invert($args) {
2167	+ $value = $args[0];
2168	+ if ($value[0] === 'number') return null;
2169	+ $color = $this->assertColor($value);
2170	+ $color[1] = 255 - $color[1];
2171	+ $color[2] = 255 - $color[2];
2172	+ $color[3] = 255 - $color[3];
2173	+ return $color;
2174	+ }
2175	+
2176	+ // increases opacity by amount
2177	+ protected static $lib_opacify = array("color", "amount");
2178	+ protected function lib_opacify($args) {
2179	+ $color = $this->assertColor($args[0]);
2180	+ $amount = $this->coercePercent($args[1]);
2181	+
2182	+ $color[4] = (isset($color[4]) ? $color[4] : 1) + $amount;
2183	+ $color[4] = min(1, max(0, $color[4]));
2184	+ return $color;
2185	+ }
2186	+
2187	+ protected static $lib_fade_in = array("color", "amount");
2188	+ protected function lib_fade_in($args) {
2189	+ return $this->lib_opacify($args);
2190	+ }
2191	+
2192	+ // decreases opacity by amount
2193	+ protected static $lib_transparentize = array("color", "amount");
2194	+ protected function lib_transparentize($args) {
2195	+ $color = $this->assertColor($args[0]);
2196	+ $amount = $this->coercePercent($args[1]);
2197	+
2198	+ $color[4] = (isset($color[4]) ? $color[4] : 1) - $amount;
2199	+ $color[4] = min(1, max(0, $color[4]));
2200	+ return $color;
2201	+ }
2202	+
2203	+ protected static $lib_fade_out = array("color", "amount");
2204	+ protected function lib_fade_out($args) {
2205	+ return $this->lib_transparentize($args);
2206	+ }
2207	+
2208	+ protected static $lib_unquote = array("string");
2209	+ protected function lib_unquote($args) {
2210	+ $str = $args[0];
2211	+ if ($str[0] == "string") $str[1] = "";
2212	+ return $str;
2213	+ }
2214	+
2215	+ protected static $lib_quote = array("string");
2216	+ protected function lib_quote($args) {
2217	+ $value = $args[0];
2218	+ if ($value[0] == "string" && !empty($value[1]))
2219	+ return $value;
2220	+ return array("string", '"', array($value));
2221	+ }
2222	+
2223	+ protected static $lib_percentage = array("value");
2224	+ protected function lib_percentage($args) {
2225	+ return array("number",
2226	+ $this->coercePercent($args[0]) * 100,
2227	+ "%");
2228	+ }
2229	+
2230	+ protected static $lib_round = array("value");
2231	+ protected function lib_round($args) {
2232	+ $num = $args[0];
2233	+ $num[1] = round($num[1]);
2234	+ return $num;
2235	+ }
2236	+
2237	+ protected static $lib_floor = array("value");
2238	+ protected function lib_floor($args) {
2239	+ $num = $args[0];
2240	+ $num[1] = floor($num[1]);
2241	+ return $num;
2242	+ }
2243	+
2244	+ protected static $lib_ceil = array("value");
2245	+ protected function lib_ceil($args) {
2246	+ $num = $args[0];
2247	+ $num[1] = ceil($num[1]);
2248	+ return $num;
2249	+ }
2250	+
2251	+ protected static $lib_abs = array("value");
2252	+ protected function lib_abs($args) {
2253	+ $num = $args[0];
2254	+ $num[1] = abs($num[1]);
2255	+ return $num;
2256	+ }
2257	+
2258	+ protected function lib_min($args) {
2259	+ $numbers = $this->getNormalizedNumbers($args);
2260	+ $min = null;
2261	+ foreach ($numbers as $key => $number) {
2262	+ if (null === $min \|\| $number[1] <= $min[1]) {
2263	+ $min = array($key, $number[1]);
2264	+ }
2265	+ }
2266	+
2267	+ return $args[$min[0]];
2268	+ }
2269	+
2270	+ protected function lib_max($args) {
2271	+ $numbers = $this->getNormalizedNumbers($args);
2272	+ $max = null;
2273	+ foreach ($numbers as $key => $number) {
2274	+ if (null === $max \|\| $number[1] >= $max[1]) {
2275	+ $max = array($key, $number[1]);
2276	+ }
2277	+ }
2278	+
2279	+ return $args[$max[0]];
2280	+ }
2281	+
2282	+ protected function getNormalizedNumbers($args) {
2283	+ $unit = null;
2284	+ $originalUnit = null;
2285	+ $numbers = array();
2286	+ foreach ($args as $key => $item) {
2287	+ if ('number' != $item[0]) {
2288	+ $this->throwError("%s is not a number", $item[0]);
2289	+ }
2290	+ $number = $this->normalizeNumber($item);
2291	+
2292	+ if (null === $unit) {
2293	+ $unit = $number[2];
2294	+ $originalUnit = $item[2];
2295	+ } elseif ($unit !== $number[2]) {
2296	+ $this->throwError('Incompatible units: "%s" and "%s".', $originalUnit, $item[2]);
2297	+ }
2298	+
2299	+ $numbers[$key] = $number;
2300	+ }
2301	+
2302	+ return $numbers;
2303	+ }
2304	+
2305	+ protected static $lib_length = array("list");
2306	+ protected function lib_length($args) {
2307	+ $list = $this->coerceList($args[0]);
2308	+ return count($list[2]);
2309	+ }
2310	+
2311	+ protected static $lib_nth = array("list", "n");
2312	+ protected function lib_nth($args) {
2313	+ $list = $this->coerceList($args[0]);
2314	+ $n = $this->assertNumber($args[1]) - 1;
2315	+ return isset($list[2][$n]) ? $list[2][$n] : self::$defaultValue;
2316	+ }
2317	+
2318	+ protected function listSeparatorForJoin($list1, $sep) {
2319	+ if (!isset($sep)) return $list1[1];
2320	+ switch ($this->compileValue($sep)) {
2321	+ case "comma":
2322	+ return ",";
2323	+ case "space":
2324	+ return "";
2325	+ default:
2326	+ return $list1[1];
2327	+ }
2328	+ }
2329	+
2330	+ protected static $lib_join = array("list1", "list2", "separator");
2331	+ protected function lib_join($args) {
2332	+ list($list1, $list2, $sep) = $args;
2333	+ $list1 = $this->coerceList($list1, " ");
2334	+ $list2 = $this->coerceList($list2, " ");
2335	+ $sep = $this->listSeparatorForJoin($list1, $sep);
2336	+ return array("list", $sep, array_merge($list1[2], $list2[2]));
2337	+ }
2338	+
2339	+ protected static $lib_append = array("list", "val", "separator");
2340	+ protected function lib_append($args) {
2341	+ list($list1, $value, $sep) = $args;
2342	+ $list1 = $this->coerceList($list1, " ");
2343	+ $sep = $this->listSeparatorForJoin($list1, $sep);
2344	+ return array("list", $sep, array_merge($list1[2], array($value)));
2345	+ }
2346	+
2347	+ protected function lib_zip($args) {
2348	+ foreach ($args as $arg) {
2349	+ $this->assertList($arg);
2350	+ }
2351	+
2352	+ $lists = array();
2353	+ $firstList = array_shift($args);
2354	+ foreach ($firstList[2] as $key => $item) {
2355	+ $list = array("list", "", array($item));
2356	+ foreach ($args as $arg) {
2357	+ if (isset($arg[2][$key])) {
2358	+ $list[2][] = $arg[2][$key];
2359	+ } else {
2360	+ break 2;
2361	+ }
2362	+ }
2363	+ $lists[] = $list;
2364	+ }
2365	+
2366	+ return array("list", ",", $lists);
2367	+ }
2368	+
2369	+ protected static $lib_type_of = array("value");
2370	+ protected function lib_type_of($args) {
2371	+ $value = $args[0];
2372	+ switch ($value[0]) {
2373	+ case "keyword":
2374	+ if ($value == self::$true \|\| $value == self::$false) {
2375	+ return "bool";
2376	+ }
2377	+
2378	+ if ($this->coerceColor($value)) {
2379	+ return "color";
2380	+ }
2381	+
2382	+ return "string";
2383	+ default:
2384	+ return $value[0];
2385	+ }
2386	+ }
2387	+
2388	+ protected static $lib_unit = array("number");
2389	+ protected function lib_unit($args) {
2390	+ $num = $args[0];
2391	+ if ($num[0] == "number") {
2392	+ return array("string", '"', array($num[2]));
2393	+ }
2394	+ return "";
2395	+ }
2396	+
2397	+ protected static $lib_unitless = array("number");
2398	+ protected function lib_unitless($args) {
2399	+ $value = $args[0];
2400	+ return $value[0] == "number" && empty($value[2]);
2401	+ }
2402	+
2403	+ protected static $lib_comparable = array("number-1", "number-2");
2404	+ protected function lib_comparable($args) {
2405	+ list($number1, $number2) = $args;
2406	+ if (!isset($number1[0]) \|\| $number1[0] != "number" \|\| !isset($number2[0]) \|\| $number2[0] != "number") {
2407	+ $this->throwError('Invalid argument(s) for "comparable"');
2408	+ }
2409	+
2410	+ $number1 = $this->normalizeNumber($number1);
2411	+ $number2 = $this->normalizeNumber($number2);
2412	+
2413	+ return $number1[2] == $number2[2] \|\| $number1[2] == "" \|\| $number2[2] == "";
2414	+ }
2415	+
2416	+ /**
2417	+ * Workaround IE7's content counter bug.
2418	+ *
2419	+ * @param array $args
2420	+ */
2421	+ protected function lib_counter($args) {
2422	+ $list = array_map(array($this, 'compileValue'), $args);
2423	+ return array('string', '', array('counter(' . implode(',', $list) . ')'));
2424	+ }
2425	+
2426	+ public function throwError($msg = null) {
2427	+ if (func_num_args() > 1) {
2428	+ $msg = call_user_func_array("sprintf", func_get_args());
2429	+ }
2430	+
2431	+ if ($this->sourcePos >= 0 && isset($this->sourceParser)) {
2432	+ $this->sourceParser->throwParseError($msg, $this->sourcePos);
2433	+ }
2434	+
2435	+ throw new Exception($msg);
2436	+ }
2437	+
2438	+ /**
2439	+ * CSS Colors
2440	+ *
2441	+ * @see http://www.w3.org/TR/css3-color
2442	+ */
2443	+ static protected $cssColors = array(
2444	+ 'aliceblue' => '240,248,255',
2445	+ 'antiquewhite' => '250,235,215',
2446	+ 'aqua' => '0,255,255',
2447	+ 'aquamarine' => '127,255,212',
2448	+ 'azure' => '240,255,255',
2449	+ 'beige' => '245,245,220',
2450	+ 'bisque' => '255,228,196',
2451	+ 'black' => '0,0,0',
2452	+ 'blanchedalmond' => '255,235,205',
2453	+ 'blue' => '0,0,255',
2454	+ 'blueviolet' => '138,43,226',
2455	+ 'brown' => '165,42,42',
2456	+ 'burlywood' => '222,184,135',
2457	+ 'cadetblue' => '95,158,160',
2458	+ 'chartreuse' => '127,255,0',
2459	+ 'chocolate' => '210,105,30',
2460	+ 'coral' => '255,127,80',
2461	+ 'cornflowerblue' => '100,149,237',
2462	+ 'cornsilk' => '255,248,220',
2463	+ 'crimson' => '220,20,60',
2464	+ 'cyan' => '0,255,255',
2465	+ 'darkblue' => '0,0,139',
2466	+ 'darkcyan' => '0,139,139',
2467	+ 'darkgoldenrod' => '184,134,11',
2468	+ 'darkgray' => '169,169,169',
2469	+ 'darkgreen' => '0,100,0',
2470	+ 'darkgrey' => '169,169,169',
2471	+ 'darkkhaki' => '189,183,107',
2472	+ 'darkmagenta' => '139,0,139',
2473	+ 'darkolivegreen' => '85,107,47',
2474	+ 'darkorange' => '255,140,0',
2475	+ 'darkorchid' => '153,50,204',
2476	+ 'darkred' => '139,0,0',
2477	+ 'darksalmon' => '233,150,122',
2478	+ 'darkseagreen' => '143,188,143',
2479	+ 'darkslateblue' => '72,61,139',
2480	+ 'darkslategray' => '47,79,79',
2481	+ 'darkslategrey' => '47,79,79',
2482	+ 'darkturquoise' => '0,206,209',
2483	+ 'darkviolet' => '148,0,211',
2484	+ 'deeppink' => '255,20,147',
2485	+ 'deepskyblue' => '0,191,255',
2486	+ 'dimgray' => '105,105,105',
2487	+ 'dimgrey' => '105,105,105',
2488	+ 'dodgerblue' => '30,144,255',
2489	+ 'firebrick' => '178,34,34',
2490	+ 'floralwhite' => '255,250,240',
2491	+ 'forestgreen' => '34,139,34',
2492	+ 'fuchsia' => '255,0,255',
2493	+ 'gainsboro' => '220,220,220',
2494	+ 'ghostwhite' => '248,248,255',
2495	+ 'gold' => '255,215,0',
2496	+ 'goldenrod' => '218,165,32',
2497	+ 'gray' => '128,128,128',
2498	+ 'green' => '0,128,0',
2499	+ 'greenyellow' => '173,255,47',
2500	+ 'grey' => '128,128,128',
2501	+ 'honeydew' => '240,255,240',
2502	+ 'hotpink' => '255,105,180',
2503	+ 'indianred' => '205,92,92',
2504	+ 'indigo' => '75,0,130',
2505	+ 'ivory' => '255,255,240',
2506	+ 'khaki' => '240,230,140',
2507	+ 'lavender' => '230,230,250',
2508	+ 'lavenderblush' => '255,240,245',
2509	+ 'lawngreen' => '124,252,0',
2510	+ 'lemonchiffon' => '255,250,205',
2511	+ 'lightblue' => '173,216,230',
2512	+ 'lightcoral' => '240,128,128',
2513	+ 'lightcyan' => '224,255,255',
2514	+ 'lightgoldenrodyellow' => '250,250,210',
2515	+ 'lightgray' => '211,211,211',
2516	+ 'lightgreen' => '144,238,144',
2517	+ 'lightgrey' => '211,211,211',
2518	+ 'lightpink' => '255,182,193',
2519	+ 'lightsalmon' => '255,160,122',
2520	+ 'lightseagreen' => '32,178,170',
2521	+ 'lightskyblue' => '135,206,250',
2522	+ 'lightslategray' => '119,136,153',
2523	+ 'lightslategrey' => '119,136,153',
2524	+ 'lightsteelblue' => '176,196,222',
2525	+ 'lightyellow' => '255,255,224',
2526	+ 'lime' => '0,255,0',
2527	+ 'limegreen' => '50,205,50',
2528	+ 'linen' => '250,240,230',
2529	+ 'magenta' => '255,0,255',
2530	+ 'maroon' => '128,0,0',
2531	+ 'mediumaquamarine' => '102,205,170',
2532	+ 'mediumblue' => '0,0,205',
2533	+ 'mediumorchid' => '186,85,211',
2534	+ 'mediumpurple' => '147,112,219',
2535	+ 'mediumseagreen' => '60,179,113',
2536	+ 'mediumslateblue' => '123,104,238',
2537	+ 'mediumspringgreen' => '0,250,154',
2538	+ 'mediumturquoise' => '72,209,204',
2539	+ 'mediumvioletred' => '199,21,133',
2540	+ 'midnightblue' => '25,25,112',
2541	+ 'mintcream' => '245,255,250',
2542	+ 'mistyrose' => '255,228,225',
2543	+ 'moccasin' => '255,228,181',
2544	+ 'navajowhite' => '255,222,173',
2545	+ 'navy' => '0,0,128',
2546	+ 'oldlace' => '253,245,230',
2547	+ 'olive' => '128,128,0',
2548	+ 'olivedrab' => '107,142,35',
2549	+ 'orange' => '255,165,0',
2550	+ 'orangered' => '255,69,0',
2551	+ 'orchid' => '218,112,214',
2552	+ 'palegoldenrod' => '238,232,170',
2553	+ 'palegreen' => '152,251,152',
2554	+ 'paleturquoise' => '175,238,238',
2555	+ 'palevioletred' => '219,112,147',
2556	+ 'papayawhip' => '255,239,213',
2557	+ 'peachpuff' => '255,218,185',
2558	+ 'peru' => '205,133,63',
2559	+ 'pink' => '255,192,203',
2560	+ 'plum' => '221,160,221',
2561	+ 'powderblue' => '176,224,230',
2562	+ 'purple' => '128,0,128',
2563	+ 'red' => '255,0,0',
2564	+ 'rosybrown' => '188,143,143',
2565	+ 'royalblue' => '65,105,225',
2566	+ 'saddlebrown' => '139,69,19',
2567	+ 'salmon' => '250,128,114',
2568	+ 'sandybrown' => '244,164,96',
2569	+ 'seagreen' => '46,139,87',
2570	+ 'seashell' => '255,245,238',
2571	+ 'sienna' => '160,82,45',
2572	+ 'silver' => '192,192,192',
2573	+ 'skyblue' => '135,206,235',
2574	+ 'slateblue' => '106,90,205',
2575	+ 'slategray' => '112,128,144',
2576	+ 'slategrey' => '112,128,144',
2577	+ 'snow' => '255,250,250',
2578	+ 'springgreen' => '0,255,127',
2579	+ 'steelblue' => '70,130,180',
2580	+ 'tan' => '210,180,140',
2581	+ 'teal' => '0,128,128',
2582	+ 'thistle' => '216,191,216',
2583	+ 'tomato' => '255,99,71',
2584	+ 'transparent' => '0,0,0,0',
2585	+ 'turquoise' => '64,224,208',
2586	+ 'violet' => '238,130,238',
2587	+ 'wheat' => '245,222,179',
2588	+ 'white' => '255,255,255',
2589	+ 'whitesmoke' => '245,245,245',
2590	+ 'yellow' => '255,255,0',
2591	+ 'yellowgreen' => '154,205,50'
2592	+ );
2593	+ }
2594	+
2595	+ /**
2596	+ * SCSS parser
2597	+ *
2598	+ * @author Leaf Corcoran <leafot@gmail.com>
2599	+ */
2600	+ class scss_parser {
2601	+ static protected $precedence = array(
2602	+ "or" => 0,
2603	+ "and" => 1,
2604	+
2605	+ '==' => 2,
2606	+ '!=' => 2,
2607	+ '<=' => 2,
2608	+ '>=' => 2,
2609	+ '=' => 2,
2610	+ '<' => 3,
2611	+ '>' => 2,
2612	+
2613	+ '+' => 3,
2614	+ '-' => 3,
2615	+ '*' => 4,
2616	+ '/' => 4,
2617	+ '%' => 4,
2618	+ );
2619	+
2620	+ static protected $operators = array("+", "-", "*", "/", "%",
2621	+ "==", "!=", "<=", ">=", "<", ">", "and", "or");
2622	+
2623	+ static protected $operatorStr;
2624	+ static protected $whitePattern;
2625	+ static protected $commentMulti;
2626	+
2627	+ static protected $commentSingle = "//";
2628	+ static protected $commentMultiLeft = "/*";
2629	+ static protected $commentMultiRight = "*/";
2630	+
2631	+ public function __construct($sourceName = null, $rootParser = true) {
2632	+ $this->sourceName = $sourceName;
2633	+ $this->rootParser = $rootParser;
2634	+
2635	+ if (empty(self::$operatorStr)) {
2636	+ self::$operatorStr = $this->makeOperatorStr(self::$operators);
2637	+
2638	+ $commentSingle = $this->preg_quote(self::$commentSingle);
2639	+ $commentMultiLeft = $this->preg_quote(self::$commentMultiLeft);
2640	+ $commentMultiRight = $this->preg_quote(self::$commentMultiRight);
2641	+ self::$commentMulti = $commentMultiLeft.'.*?'.$commentMultiRight;
2642	+ self::$whitePattern = '/'.$commentSingle.'[^\n]\s\|('.self::$commentMulti.')\s*\|\s+/Ais';
2643	+ }
2644	+ }
2645	+
2646	+ static protected function makeOperatorStr($operators) {
2647	+ return '('.implode('\|', array_map(array('scss_parser','preg_quote'),
2648	+ $operators)).')';
2649	+ }
2650	+
2651	+ public function parse($buffer) {
2652	+ $this->count = 0;
2653	+ $this->env = null;
2654	+ $this->inParens = false;
2655	+ $this->pushBlock(null); // root block
2656	+ $this->eatWhiteDefault = true;
2657	+ $this->insertComments = true;
2658	+
2659	+ $this->buffer = $buffer;
2660	+
2661	+ $this->whitespace();
2662	+ while (false !== $this->parseChunk());
2663	+
2664	+ if ($this->count != strlen($this->buffer))
2665	+ $this->throwParseError();
2666	+
2667	+ if (!empty($this->env->parent)) {
2668	+ $this->throwParseError("unclosed block");
2669	+ }
2670	+
2671	+ $this->env->isRoot = true;
2672	+ return $this->env;
2673	+ }
2674	+
2675	+ /**
2676	+ * Parse a single chunk off the head of the buffer and append it to the
2677	+ * current parse environment.
2678	+ *
2679	+ * Returns false when the buffer is empty, or when there is an error.
2680	+ *
2681	+ * This function is called repeatedly until the entire document is
2682	+ * parsed.
2683	+ *
2684	+ * This parser is most similar to a recursive descent parser. Single
2685	+ * functions represent discrete grammatical rules for the language, and
2686	+ * they are able to capture the text that represents those rules.
2687	+ *
2688	+ * Consider the function scssc::keyword(). (All parse functions are
2689	+ * structured the same.)
2690	+ *
2691	+ * The function takes a single reference argument. When calling the
2692	+ * function it will attempt to match a keyword on the head of the buffer.
2693	+ * If it is successful, it will place the keyword in the referenced
2694	+ * argument, advance the position in the buffer, and return true. If it
2695	+ * fails then it won't advance the buffer and it will return false.
2696	+ *
2697	+ * All of these parse functions are powered by scssc::match(), which behaves
2698	+ * the same way, but takes a literal regular expression. Sometimes it is
2699	+ * more convenient to use match instead of creating a new function.
2700	+ *
2701	+ * Because of the format of the functions, to parse an entire string of
2702	+ * grammatical rules, you can chain them together using &&.
2703	+ *
2704	+ * But, if some of the rules in the chain succeed before one fails, then
2705	+ * the buffer position will be left at an invalid state. In order to
2706	+ * avoid this, scssc::seek() is used to remember and set buffer positions.
2707	+ *
2708	+ * Before parsing a chain, use $s = $this->seek() to remember the current
2709	+ * position into $s. Then if a chain fails, use $this->seek($s) to
2710	+ * go back where we started.
2711	+ *
2712	+ * @return boolean
2713	+ */
2714	+ protected function parseChunk() {
2715	+ $s = $this->seek();
2716	+
2717	+ // the directives
2718	+ if (isset($this->buffer[$this->count]) && $this->buffer[$this->count] == "@") {
2719	+ if ($this->literal("@media") && $this->mediaQueryList($mediaQueryList) && $this->literal("{")) {
2720	+ $media = $this->pushSpecialBlock("media");
2721	+ $media->queryList = $mediaQueryList[2];
2722	+ return true;
2723	+ } else {
2724	+ $this->seek($s);
2725	+ }
2726	+
2727	+ if ($this->literal("@mixin") &&
2728	+ $this->keyword($mixinName) &&
2729	+ ($this->argumentDef($args) \|\| true) &&
2730	+ $this->literal("{"))
2731	+ {
2732	+ $mixin = $this->pushSpecialBlock("mixin");
2733	+ $mixin->name = $mixinName;
2734	+ $mixin->args = $args;
2735	+ return true;
2736	+ } else {
2737	+ $this->seek($s);
2738	+ }
2739	+
2740	+ if ($this->literal("@include") &&
2741	+ $this->keyword($mixinName) &&
2742	+ ($this->literal("(") &&
2743	+ ($this->argValues($argValues) \|\| true) &&
2744	+ $this->literal(")") \|\| true) &&
2745	+ ($this->end() \|\|
2746	+ $this->literal("{") && $hasBlock = true))
2747	+ {
2748	+ $child = array("include",
2749	+ $mixinName, isset($argValues) ? $argValues : null, null);
2750	+
2751	+ if (!empty($hasBlock)) {
2752	+ $include = $this->pushSpecialBlock("include");
2753	+ $include->child = $child;
2754	+ } else {
2755	+ $this->append($child, $s);
2756	+ }
2757	+
2758	+ return true;
2759	+ } else {
2760	+ $this->seek($s);
2761	+ }
2762	+
2763	+ if ($this->literal("@import") &&
2764	+ $this->valueList($importPath) &&
2765	+ $this->end())
2766	+ {
2767	+ $this->append(array("import", $importPath), $s);
2768	+ return true;
2769	+ } else {
2770	+ $this->seek($s);
2771	+ }
2772	+
2773	+ if ($this->literal("@extend") &&
2774	+ $this->selectors($selector) &&
2775	+ $this->end())
2776	+ {
2777	+ $this->append(array("extend", $selector), $s);
2778	+ return true;
2779	+ } else {
2780	+ $this->seek($s);
2781	+ }
2782	+
2783	+ if ($this->literal("@function") &&
2784	+ $this->keyword($fnName) &&
2785	+ $this->argumentDef($args) &&
2786	+ $this->literal("{"))
2787	+ {
2788	+ $func = $this->pushSpecialBlock("function");
2789	+ $func->name = $fnName;
2790	+ $func->args = $args;
2791	+ return true;
2792	+ } else {
2793	+ $this->seek($s);
2794	+ }
2795	+
2796	+ if ($this->literal("@return") && $this->valueList($retVal) && $this->end()) {
2797	+ $this->append(array("return", $retVal), $s);
2798	+ return true;
2799	+ } else {
2800	+ $this->seek($s);
2801	+ }
2802	+
2803	+ if ($this->literal("@each") &&
2804	+ $this->variable($varName) &&
2805	+ $this->literal("in") &&
2806	+ $this->valueList($list) &&
2807	+ $this->literal("{"))
2808	+ {
2809	+ $each = $this->pushSpecialBlock("each");
2810	+ $each->var = $varName[1];
2811	+ $each->list = $list;
2812	+ return true;
2813	+ } else {
2814	+ $this->seek($s);
2815	+ }
2816	+
2817	+ if ($this->literal("@while") &&
2818	+ $this->expression($cond) &&
2819	+ $this->literal("{"))
2820	+ {
2821	+ $while = $this->pushSpecialBlock("while");
2822	+ $while->cond = $cond;
2823	+ return true;
2824	+ } else {
2825	+ $this->seek($s);
2826	+ }
2827	+
2828	+ if ($this->literal("@for") &&
2829	+ $this->variable($varName) &&
2830	+ $this->literal("from") &&
2831	+ $this->expression($start) &&
2832	+ ($this->literal("through") \|\|
2833	+ ($forUntil = true && $this->literal("to"))) &&
2834	+ $this->expression($end) &&
2835	+ $this->literal("{"))
2836	+ {
2837	+ $for = $this->pushSpecialBlock("for");
2838	+ $for->var = $varName[1];
2839	+ $for->start = $start;
2840	+ $for->end = $end;
2841	+ $for->until = isset($forUntil);
2842	+ return true;
2843	+ } else {
2844	+ $this->seek($s);
2845	+ }
2846	+
2847	+ if ($this->literal("@if") && $this->valueList($cond) && $this->literal("{")) {
2848	+ $if = $this->pushSpecialBlock("if");
2849	+ $if->cond = $cond;
2850	+ $if->cases = array();
2851	+ return true;
2852	+ } else {
2853	+ $this->seek($s);
2854	+ }
2855	+
2856	+ if (($this->literal("@debug") \|\| $this->literal("@warn")) &&
2857	+ $this->valueList($value) &&
2858	+ $this->end()) {
2859	+ $this->append(array("debug", $value, $s), $s);
2860	+ return true;
2861	+ } else {
2862	+ $this->seek($s);
2863	+ }
2864	+
2865	+ if ($this->literal("@content") && $this->end()) {
2866	+ $this->append(array("mixin_content"), $s);
2867	+ return true;
2868	+ } else {
2869	+ $this->seek($s);
2870	+ }
2871	+
2872	+ $last = $this->last();
2873	+ if (isset($last) && $last[0] == "if") {
2874	+ list(, $if) = $last;
2875	+ if ($this->literal("@else")) {
2876	+ if ($this->literal("{")) {
2877	+ $else = $this->pushSpecialBlock("else");
2878	+ } elseif ($this->literal("if") && $this->valueList($cond) && $this->literal("{")) {
2879	+ $else = $this->pushSpecialBlock("elseif");
2880	+ $else->cond = $cond;
2881	+ }
2882	+
2883	+ if (isset($else)) {
2884	+ $else->dontAppend = true;
2885	+ $if->cases[] = $else;
2886	+ return true;
2887	+ }
2888	+ }
2889	+
2890	+ $this->seek($s);
2891	+ }
2892	+
2893	+ if ($this->literal("@charset") &&
2894	+ $this->valueList($charset) && $this->end())
2895	+ {
2896	+ $this->append(array("charset", $charset), $s);
2897	+ return true;
2898	+ } else {
2899	+ $this->seek($s);
2900	+ }
2901	+
2902	+ // doesn't match built in directive, do generic one
2903	+ if ($this->literal("@", false) && $this->keyword($dirName) &&
2904	+ ($this->openString("{", $dirValue) \|\| true) &&
2905	+ $this->literal("{"))
2906	+ {
2907	+ $directive = $this->pushSpecialBlock("directive");
2908	+ $directive->name = $dirName;
2909	+ if (isset($dirValue)) $directive->value = $dirValue;
2910	+ return true;
2911	+ }
2912	+
2913	+ $this->seek($s);
2914	+ return false;
2915	+ }
2916	+
2917	+ // property shortcut
2918	+ // captures most properties before having to parse a selector
2919	+ if ($this->keyword($name, false) &&
2920	+ $this->literal(": ") &&
2921	+ $this->valueList($value) &&
2922	+ $this->end())
2923	+ {
2924	+ $name = array("string", "", array($name));
2925	+ $this->append(array("assign", $name, $value), $s);
2926	+ return true;
2927	+ } else {
2928	+ $this->seek($s);
2929	+ }
2930	+
2931	+ // variable assigns
2932	+ if ($this->variable($name) &&
2933	+ $this->literal(":") &&
2934	+ $this->valueList($value) && $this->end())
2935	+ {
2936	+ // check for !default
2937	+ $defaultVar = $value[0] == "list" && $this->stripDefault($value);
2938	+ $this->append(array("assign", $name, $value, $defaultVar), $s);
2939	+ return true;
2940	+ } else {
2941	+ $this->seek($s);
2942	+ }
2943	+
2944	+ // misc
2945	+ if ($this->literal("-->")) {
2946	+ return true;
2947	+ }
2948	+
2949	+ // opening css block
2950	+ $oldComments = $this->insertComments;
2951	+ $this->insertComments = false;
2952	+ if ($this->selectors($selectors) && $this->literal("{")) {
2953	+ $this->pushBlock($selectors);
2954	+ $this->insertComments = $oldComments;
2955	+ return true;
2956	+ } else {
2957	+ $this->seek($s);
2958	+ }
2959	+ $this->insertComments = $oldComments;
2960	+
2961	+ // property assign, or nested assign
2962	+ if ($this->propertyName($name) && $this->literal(":")) {
2963	+ $foundSomething = false;
2964	+ if ($this->valueList($value)) {
2965	+ $this->append(array("assign", $name, $value), $s);
2966	+ $foundSomething = true;
2967	+ }
2968	+
2969	+ if ($this->literal("{")) {
2970	+ $propBlock = $this->pushSpecialBlock("nestedprop");
2971	+ $propBlock->prefix = $name;
2972	+ $foundSomething = true;
2973	+ } elseif ($foundSomething) {
2974	+ $foundSomething = $this->end();
2975	+ }
2976	+
2977	+ if ($foundSomething) {
2978	+ return true;
2979	+ }
2980	+
2981	+ $this->seek($s);
2982	+ } else {
2983	+ $this->seek($s);
2984	+ }
2985	+
2986	+ // closing a block
2987	+ if ($this->literal("}")) {
2988	+ $block = $this->popBlock();
2989	+ if (isset($block->type) && $block->type == "include") {
2990	+ $include = $block->child;
2991	+ unset($block->child);
2992	+ $include[3] = $block;
2993	+ $this->append($include, $s);
2994	+ } elseif (empty($block->dontAppend)) {
2995	+ $type = isset($block->type) ? $block->type : "block";
2996	+ $this->append(array($type, $block), $s);
2997	+ }
2998	+ return true;
2999	+ }
3000	+
3001	+ // extra stuff
3002	+ if ($this->literal(";") \|\|
3003	+ $this->literal("<!--"))
3004	+ {
3005	+ return true;
3006	+ }
3007	+
3008	+ return false;
3009	+ }
3010	+
3011	+ protected function stripDefault(&$value) {
3012	+ $def = end($value[2]);
3013	+ if ($def[0] == "keyword" && $def[1] == "!default") {
3014	+ array_pop($value[2]);
3015	+ $value = $this->flattenList($value);
3016	+ return true;
3017	+ }
3018	+
3019	+ if ($def[0] == "list") {
3020	+ return $this->stripDefault($value[2][count($value[2]) - 1]);
3021	+ }
3022	+
3023	+ return false;
3024	+ }
3025	+
3026	+ protected function literal($what, $eatWhitespace = null) {
3027	+ if (!isset($eatWhitespace)) $eatWhitespace = $this->eatWhiteDefault;
3028	+
3029	+ // shortcut on single letter
3030	+ if (!isset($what[1]) && isset($this->buffer[$this->count])) {
3031	+ if ($this->buffer[$this->count] == $what) {
3032	+ if (!$eatWhitespace) {
3033	+ $this->count++;
3034	+ return true;
3035	+ }
3036	+ // goes below...
3037	+ } else {
3038	+ return false;
3039	+ }
3040	+ }
3041	+
3042	+ return $this->match($this->preg_quote($what), $m, $eatWhitespace);
3043	+ }
3044	+
3045	+ // tree builders
3046	+
3047	+ protected function pushBlock($selectors) {
3048	+ $b = new stdClass;
3049	+ $b->parent = $this->env; // not sure if we need this yet
3050	+
3051	+ $b->selectors = $selectors;
3052	+ $b->children = array();
3053	+
3054	+ $this->env = $b;
3055	+ return $b;
3056	+ }
3057	+
3058	+ protected function pushSpecialBlock($type) {
3059	+ $block = $this->pushBlock(null);
3060	+ $block->type = $type;
3061	+ return $block;
3062	+ }
3063	+
3064	+ protected function popBlock() {
3065	+ if (empty($this->env->parent)) {
3066	+ $this->throwParseError("unexpected }");
3067	+ }
3068	+
3069	+ $old = $this->env;
3070	+ $this->env = $this->env->parent;
3071	+ unset($old->parent);
3072	+ return $old;
3073	+ }
3074	+
3075	+ protected function append($statement, $pos=null) {
3076	+ if ($pos !== null) {
3077	+ $statement[-1] = $pos;
3078	+ if (!$this->rootParser) $statement[-2] = $this;
3079	+ }
3080	+ $this->env->children[] = $statement;
3081	+ }
3082	+
3083	+ // last child that was appended
3084	+ protected function last() {
3085	+ $i = count($this->env->children) - 1;
3086	+ if (isset($this->env->children[$i]))
3087	+ return $this->env->children[$i];
3088	+ }
3089	+
3090	+ // high level parsers (they return parts of ast)
3091	+
3092	+ protected function mediaQueryList(&$out) {
3093	+ return $this->genericList($out, "mediaQuery", ",", false);
3094	+ }
3095	+
3096	+ protected function mediaQuery(&$out) {
3097	+ $s = $this->seek();
3098	+
3099	+ $expressions = null;
3100	+ $parts = array();
3101	+
3102	+ if (($this->literal("only") && ($only = true) \|\| $this->literal("not") && ($not = true) \|\| true) && $this->mixedKeyword($mediaType)) {
3103	+ $prop = array("mediaType");
3104	+ if (isset($only)) $prop[] = array("keyword", "only");
3105	+ if (isset($not)) $prop[] = array("keyword", "not");
3106	+ $media = array("list", "", array());
3107	+ foreach ((array)$mediaType as $type) {
3108	+ if (is_array($type)) {
3109	+ $media[2][] = $type;
3110	+ } else {
3111	+ $media[2][] = array("keyword", $type);
3112	+ }
3113	+ }
3114	+ $prop[] = $media;
3115	+ $parts[] = $prop;
3116	+ }
3117	+
3118	+ if (empty($parts) \|\| $this->literal("and")) {
3119	+ $this->genericList($expressions, "mediaExpression", "and", false);
3120	+ if (is_array($expressions)) $parts = array_merge($parts, $expressions[2]);
3121	+ }
3122	+
3123	+ $out = $parts;
3124	+ return true;
3125	+ }
3126	+
3127	+ protected function mediaExpression(&$out) {
3128	+ $s = $this->seek();
3129	+ $value = null;
3130	+ if ($this->literal("(") &&
3131	+ $this->expression($feature) &&
3132	+ ($this->literal(":") && $this->expression($value) \|\| true) &&
3133	+ $this->literal(")"))
3134	+ {
3135	+ $out = array("mediaExp", $feature);
3136	+ if ($value) $out[] = $value;
3137	+ return true;
3138	+ }
3139	+
3140	+ $this->seek($s);
3141	+ return false;
3142	+ }
3143	+
3144	+ protected function argValues(&$out) {
3145	+ if ($this->genericList($list, "argValue", ",", false)) {
3146	+ $out = $list[2];
3147	+ return true;
3148	+ }
3149	+ return false;
3150	+ }
3151	+
3152	+ protected function argValue(&$out) {
3153	+ $s = $this->seek();
3154	+
3155	+ $keyword = null;
3156	+ if (!$this->variable($keyword) \|\| !$this->literal(":")) {
3157	+ $this->seek($s);
3158	+ $keyword = null;
3159	+ }
3160	+
3161	+ if ($this->genericList($value, "expression")) {
3162	+ $out = array($keyword, $value, false);
3163	+ $s = $this->seek();
3164	+ if ($this->literal("...")) {
3165	+ $out[2] = true;
3166	+ } else {
3167	+ $this->seek($s);
3168	+ }
3169	+ return true;
3170	+ }
3171	+
3172	+ return false;
3173	+ }
3174	+
3175	+
3176	+ protected function valueList(&$out) {
3177	+ return $this->genericList($out, "spaceList", ",");
3178	+ }
3179	+
3180	+ protected function spaceList(&$out) {
3181	+ return $this->genericList($out, "expression");
3182	+ }
3183	+
3184	+ protected function genericList(&$out, $parseItem, $delim="", $flatten=true) {
3185	+ $s = $this->seek();
3186	+ $items = array();
3187	+ while ($this->$parseItem($value)) {
3188	+ $items[] = $value;
3189	+ if ($delim) {
3190	+ if (!$this->literal($delim)) break;
3191	+ }
3192	+ }
3193	+
3194	+ if (count($items) == 0) {
3195	+ $this->seek($s);
3196	+ return false;
3197	+ }
3198	+
3199	+ if ($flatten && count($items) == 1) {
3200	+ $out = $items[0];
3201	+ } else {
3202	+ $out = array("list", $delim, $items);
3203	+ }
3204	+
3205	+ return true;
3206	+ }
3207	+
3208	+ protected function expression(&$out) {
3209	+ $s = $this->seek();
3210	+
3211	+ if ($this->literal("(")) {
3212	+ if ($this->literal(")")) {
3213	+ $out = array("list", "", array());
3214	+ return true;
3215	+ }
3216	+
3217	+ if ($this->valueList($out) && $this->literal(')') && $out[0] == "list") {
3218	+ return true;
3219	+ }
3220	+
3221	+ $this->seek($s);
3222	+ }
3223	+
3224	+ if ($this->value($lhs)) {
3225	+ $out = $this->expHelper($lhs, 0);
3226	+ return true;
3227	+ }
3228	+
3229	+ return false;
3230	+ }
3231	+
3232	+ protected function expHelper($lhs, $minP) {
3233	+ $opstr = self::$operatorStr;
3234	+
3235	+ $ss = $this->seek();
3236	+ $whiteBefore = isset($this->buffer[$this->count - 1]) &&
3237	+ ctype_space($this->buffer[$this->count - 1]);
3238	+ while ($this->match($opstr, $m) && self::$precedence[$m[1]] >= $minP) {
3239	+ $whiteAfter = isset($this->buffer[$this->count - 1]) &&
3240	+ ctype_space($this->buffer[$this->count - 1]);
3241	+
3242	+ $op = $m[1];
3243	+
3244	+ // don't turn negative numbers into expressions
3245	+ if ($op == "-" && $whiteBefore) {
3246	+ if (!$whiteAfter) break;
3247	+ }
3248	+
3249	+ if (!$this->value($rhs)) break;
3250	+
3251	+ // peek and see if rhs belongs to next operator
3252	+ if ($this->peek($opstr, $next) && self::$precedence[$next[1]] > self::$precedence[$op]) {
3253	+ $rhs = $this->expHelper($rhs, self::$precedence[$next[1]]);
3254	+ }
3255	+
3256	+ $lhs = array("exp", $op, $lhs, $rhs, $this->inParens, $whiteBefore, $whiteAfter);
3257	+ $ss = $this->seek();
3258	+ $whiteBefore = isset($this->buffer[$this->count - 1]) &&
3259	+ ctype_space($this->buffer[$this->count - 1]);
3260	+ }
3261	+
3262	+ $this->seek($ss);
3263	+ return $lhs;
3264	+ }
3265	+
3266	+ protected function value(&$out) {
3267	+ $s = $this->seek();
3268	+
3269	+ if ($this->literal("not", false) && $this->whitespace() && $this->value($inner)) {
3270	+ $out = array("unary", "not", $inner, $this->inParens);
3271	+ return true;
3272	+ } else {
3273	+ $this->seek($s);
3274	+ }
3275	+
3276	+ if ($this->literal("+") && $this->value($inner)) {
3277	+ $out = array("unary", "+", $inner, $this->inParens);
3278	+ return true;
3279	+ } else {
3280	+ $this->seek($s);
3281	+ }
3282	+
3283	+ // negation
3284	+ if ($this->literal("-", false) &&
3285	+ ($this->variable($inner) \|\|
3286	+ $this->unit($inner) \|\|
3287	+ $this->parenValue($inner)))
3288	+ {
3289	+ $out = array("unary", "-", $inner, $this->inParens);
3290	+ return true;
3291	+ } else {
3292	+ $this->seek($s);
3293	+ }
3294	+
3295	+ if ($this->parenValue($out)) return true;
3296	+ if ($this->interpolation($out)) return true;
3297	+ if ($this->variable($out)) return true;
3298	+ if ($this->color($out)) return true;
3299	+ if ($this->unit($out)) return true;
3300	+ if ($this->string($out)) return true;
3301	+ if ($this->func($out)) return true;
3302	+ if ($this->progid($out)) return true;
3303	+
3304	+ if ($this->keyword($keyword)) {
3305	+ if ($keyword == "null") {
3306	+ $out = array("null");
3307	+ } else {
3308	+ $out = array("keyword", $keyword);
3309	+ }
3310	+ return true;
3311	+ }
3312	+
3313	+ return false;
3314	+ }
3315	+
3316	+ // value wrappen in parentheses
3317	+ protected function parenValue(&$out) {
3318	+ $s = $this->seek();
3319	+
3320	+ $inParens = $this->inParens;
3321	+ if ($this->literal("(") &&
3322	+ ($this->inParens = true) && $this->expression($exp) &&
3323	+ $this->literal(")"))
3324	+ {
3325	+ $out = $exp;
3326	+ $this->inParens = $inParens;
3327	+ return true;
3328	+ } else {
3329	+ $this->inParens = $inParens;
3330	+ $this->seek($s);
3331	+ }
3332	+
3333	+ return false;
3334	+ }
3335	+
3336	+ protected function progid(&$out) {
3337	+ $s = $this->seek();
3338	+ if ($this->literal("progid:", false) &&
3339	+ $this->openString("(", $fn) &&
3340	+ $this->literal("("))
3341	+ {
3342	+ $this->openString(")", $args, "(");
3343	+ if ($this->literal(")")) {
3344	+ $out = array("string", "", array(
3345	+ "progid:", $fn, "(", $args, ")"
3346	+ ));
3347	+ return true;
3348	+ }
3349	+ }
3350	+
3351	+ $this->seek($s);
3352	+ return false;
3353	+ }
3354	+
3355	+ protected function func(&$func) {
3356	+ $s = $this->seek();
3357	+
3358	+ if ($this->keyword($name, false) &&
3359	+ $this->literal("("))
3360	+ {
3361	+ if ($name == "alpha" && $this->argumentList($args)) {
3362	+ $func = array("function", $name, array("string", "", $args));
3363	+ return true;
3364	+ }
3365	+
3366	+ if ($name != "expression" && !preg_match("/^(-[a-z]+-)?calc$/", $name)) {
3367	+ $ss = $this->seek();
3368	+ if ($this->argValues($args) && $this->literal(")")) {
3369	+ $func = array("fncall", $name, $args);
3370	+ return true;
3371	+ }
3372	+ $this->seek($ss);
3373	+ }
3374	+
3375	+ if (($this->openString(")", $str, "(") \|\| true ) &&
3376	+ $this->literal(")"))
3377	+ {
3378	+ $args = array();
3379	+ if (!empty($str)) {
3380	+ $args[] = array(null, array("string", "", array($str)));
3381	+ }
3382	+
3383	+ $func = array("fncall", $name, $args);
3384	+ return true;
3385	+ }
3386	+ }
3387	+
3388	+ $this->seek($s);
3389	+ return false;
3390	+ }
3391	+
3392	+ protected function argumentList(&$out) {
3393	+ $s = $this->seek();
3394	+ $this->literal("(");
3395	+
3396	+ $args = array();
3397	+ while ($this->keyword($var)) {
3398	+ $ss = $this->seek();
3399	+
3400	+ if ($this->literal("=") && $this->expression($exp)) {
3401	+ $args[] = array("string", "", array($var."="));
3402	+ $arg = $exp;
3403	+ } else {
3404	+ break;
3405	+ }
3406	+
3407	+ $args[] = $arg;
3408	+
3409	+ if (!$this->literal(",")) break;
3410	+
3411	+ $args[] = array("string", "", array(", "));
3412	+ }
3413	+
3414	+ if (!$this->literal(")") \|\| !count($args)) {
3415	+ $this->seek($s);
3416	+ return false;
3417	+ }
3418	+
3419	+ $out = $args;
3420	+ return true;
3421	+ }
3422	+
3423	+ protected function argumentDef(&$out) {
3424	+ $s = $this->seek();
3425	+ $this->literal("(");
3426	+
3427	+ $args = array();
3428	+ while ($this->variable($var)) {
3429	+ $arg = array($var[1], null, false);
3430	+
3431	+ $ss = $this->seek();
3432	+ if ($this->literal(":") && $this->genericList($defaultVal, "expression")) {
3433	+ $arg[1] = $defaultVal;
3434	+ } else {
3435	+ $this->seek($ss);
3436	+ }
3437	+
3438	+ $ss = $this->seek();
3439	+ if ($this->literal("...")) {
3440	+ $sss = $this->seek();
3441	+ if (!$this->literal(")")) {
3442	+ $this->throwParseError("... has to be after the final argument");
3443	+ }
3444	+ $arg[2] = true;
3445	+ $this->seek($sss);
3446	+ } else {
3447	+ $this->seek($ss);
3448	+ }
3449	+
3450	+ $args[] = $arg;
3451	+ if (!$this->literal(",")) break;
3452	+ }
3453	+
3454	+ if (!$this->literal(")")) {
3455	+ $this->seek($s);
3456	+ return false;
3457	+ }
3458	+
3459	+ $out = $args;
3460	+ return true;
3461	+ }
3462	+
3463	+ protected function color(&$out) {
3464	+ $color = array('color');
3465	+
3466	+ if ($this->match('(#([0-9a-f]{6})\|#([0-9a-f]{3}))', $m)) {
3467	+ if (isset($m[3])) {
3468	+ $num = $m[3];
3469	+ $width = 16;
3470	+ } else {
3471	+ $num = $m[2];
3472	+ $width = 256;
3473	+ }
3474	+
3475	+ $num = hexdec($num);
3476	+ foreach (array(3,2,1) as $i) {
3477	+ $t = $num % $width;
3478	+ $num /= $width;
3479	+
3480	+ $color[$i] = $t * (256/$width) + $t * floor(16/$width);
3481	+ }
3482	+
3483	+ $out = $color;
3484	+ return true;
3485	+ }
3486	+
3487	+ return false;
3488	+ }
3489	+
3490	+ protected function unit(&$unit) {
3491	+ if ($this->match('([0-9]*(\.)?[0-9]+)([%a-zA-Z]+)?', $m)) {
3492	+ $unit = array("number", $m[1], empty($m[3]) ? "" : $m[3]);
3493	+ return true;
3494	+ }
3495	+ return false;
3496	+ }
3497	+
3498	+ protected function string(&$out) {
3499	+ $s = $this->seek();
3500	+ if ($this->literal('"', false)) {
3501	+ $delim = '"';
3502	+ } elseif ($this->literal("'", false)) {
3503	+ $delim = "'";
3504	+ } else {
3505	+ return false;
3506	+ }
3507	+
3508	+ $content = array();
3509	+ $oldWhite = $this->eatWhiteDefault;
3510	+ $this->eatWhiteDefault = false;
3511	+
3512	+ while ($this->matchString($m, $delim)) {
3513	+ $content[] = $m[1];
3514	+ if ($m[2] == "#{") {
3515	+ $this->count -= strlen($m[2]);
3516	+ if ($this->interpolation($inter, false)) {
3517	+ $content[] = $inter;
3518	+ } else {
3519	+ $this->count += strlen($m[2]);
3520	+ $content[] = "#{"; // ignore it
3521	+ }
3522	+ } elseif ($m[2] == '\\') {
3523	+ $content[] = $m[2];
3524	+ if ($this->literal($delim, false)) {
3525	+ $content[] = $delim;
3526	+ }
3527	+ } else {
3528	+ $this->count -= strlen($delim);
3529	+ break; // delim
3530	+ }
3531	+ }
3532	+
3533	+ $this->eatWhiteDefault = $oldWhite;
3534	+
3535	+ if ($this->literal($delim)) {
3536	+ $out = array("string", $delim, $content);
3537	+ return true;
3538	+ }
3539	+
3540	+ $this->seek($s);
3541	+ return false;
3542	+ }
3543	+
3544	+ protected function mixedKeyword(&$out) {
3545	+ $s = $this->seek();
3546	+
3547	+ $parts = array();
3548	+
3549	+ $oldWhite = $this->eatWhiteDefault;
3550	+ $this->eatWhiteDefault = false;
3551	+
3552	+ while (true) {
3553	+ if ($this->keyword($key)) {
3554	+ $parts[] = $key;
3555	+ continue;
3556	+ }
3557	+
3558	+ if ($this->interpolation($inter)) {
3559	+ $parts[] = $inter;
3560	+ continue;
3561	+ }
3562	+
3563	+ break;
3564	+ }
3565	+
3566	+ $this->eatWhiteDefault = $oldWhite;
3567	+
3568	+ if (count($parts) == 0) return false;
3569	+
3570	+ if ($this->eatWhiteDefault) {
3571	+ $this->whitespace();
3572	+ }
3573	+
3574	+ $out = $parts;
3575	+ return true;
3576	+ }
3577	+
3578	+ // an unbounded string stopped by $end
3579	+ protected function openString($end, &$out, $nestingOpen=null) {
3580	+ $oldWhite = $this->eatWhiteDefault;
3581	+ $this->eatWhiteDefault = false;
3582	+
3583	+ $stop = array("'", '"', "#{", $end);
3584	+ $stop = array_map(array($this, "preg_quote"), $stop);
3585	+ $stop[] = self::$commentMulti;
3586	+
3587	+ $patt = '(.*?)('.implode("\|", $stop).')';
3588	+
3589	+ $nestingLevel = 0;
3590	+
3591	+ $content = array();
3592	+ while ($this->match($patt, $m, false)) {
3593	+ if (isset($m[1]) && $m[1] !== '') {
3594	+ $content[] = $m[1];
3595	+ if ($nestingOpen) {
3596	+ $nestingLevel += substr_count($m[1], $nestingOpen);
3597	+ }
3598	+ }
3599	+
3600	+ $tok = $m[2];
3601	+
3602	+ $this->count-= strlen($tok);
3603	+ if ($tok == $end) {
3604	+ if ($nestingLevel == 0) {
3605	+ break;
3606	+ } else {
3607	+ $nestingLevel--;
3608	+ }
3609	+ }
3610	+
3611	+ if (($tok == "'" \|\| $tok == '"') && $this->string($str)) {
3612	+ $content[] = $str;
3613	+ continue;
3614	+ }
3615	+
3616	+ if ($tok == "#{" && $this->interpolation($inter)) {
3617	+ $content[] = $inter;
3618	+ continue;
3619	+ }
3620	+
3621	+ $content[] = $tok;
3622	+ $this->count+= strlen($tok);
3623	+ }
3624	+
3625	+ $this->eatWhiteDefault = $oldWhite;
3626	+
3627	+ if (count($content) == 0) return false;
3628	+
3629	+ // trim the end
3630	+ if (is_string(end($content))) {
3631	+ $content[count($content) - 1] = rtrim(end($content));
3632	+ }
3633	+
3634	+ $out = array("string", "", $content);
3635	+ return true;
3636	+ }
3637	+
3638	+ // $lookWhite: save information about whitespace before and after
3639	+ protected function interpolation(&$out, $lookWhite=true) {
3640	+ $oldWhite = $this->eatWhiteDefault;
3641	+ $this->eatWhiteDefault = true;
3642	+
3643	+ $s = $this->seek();
3644	+ if ($this->literal("#{") && $this->valueList($value) && $this->literal("}", false)) {
3645	+
3646	+ // TODO: don't error if out of bounds
3647	+
3648	+ if ($lookWhite) {
3649	+ $left = preg_match('/\s/', $this->buffer[$s - 1]) ? " " : "";
3650	+ $right = preg_match('/\s/', $this->buffer[$this->count]) ? " ": "";
3651	+ } else {
3652	+ $left = $right = false;
3653	+ }
3654	+
3655	+ $out = array("interpolate", $value, $left, $right);
3656	+ $this->eatWhiteDefault = $oldWhite;
3657	+ if ($this->eatWhiteDefault) $this->whitespace();
3658	+ return true;
3659	+ }
3660	+
3661	+ $this->seek($s);
3662	+ $this->eatWhiteDefault = $oldWhite;
3663	+ return false;
3664	+ }
3665	+
3666	+ // low level parsers
3667	+
3668	+ // returns an array of parts or a string
3669	+ protected function propertyName(&$out) {
3670	+ $s = $this->seek();
3671	+ $parts = array();
3672	+
3673	+ $oldWhite = $this->eatWhiteDefault;
3674	+ $this->eatWhiteDefault = false;
3675	+
3676	+ while (true) {
3677	+ if ($this->interpolation($inter)) {
3678	+ $parts[] = $inter;
3679	+ } elseif ($this->keyword($text)) {
3680	+ $parts[] = $text;
3681	+ } elseif (count($parts) == 0 && $this->match('[:.#]', $m, false)) {
3682	+ // css hacks
3683	+ $parts[] = $m[0];
3684	+ } else {
3685	+ break;
3686	+ }
3687	+ }
3688	+
3689	+ $this->eatWhiteDefault = $oldWhite;
3690	+ if (count($parts) == 0) return false;
3691	+
3692	+ // match comment hack
3693	+ if (preg_match(self::$whitePattern,
3694	+ $this->buffer, $m, null, $this->count))
3695	+ {
3696	+ if (!empty($m[0])) {
3697	+ $parts[] = $m[0];
3698	+ $this->count += strlen($m[0]);
3699	+ }
3700	+ }
3701	+
3702	+ $this->whitespace(); // get any extra whitespace
3703	+
3704	+ $out = array("string", "", $parts);
3705	+ return true;
3706	+ }
3707	+
3708	+ // comma separated list of selectors
3709	+ protected function selectors(&$out) {
3710	+ $s = $this->seek();
3711	+ $selectors = array();
3712	+ while ($this->selector($sel)) {
3713	+ $selectors[] = $sel;
3714	+ if (!$this->literal(",")) break;
3715	+ while ($this->literal(",")); // ignore extra
3716	+ }
3717	+
3718	+ if (count($selectors) == 0) {
3719	+ $this->seek($s);
3720	+ return false;
3721	+ }
3722	+
3723	+ $out = $selectors;
3724	+ return true;
3725	+ }
3726	+
3727	+ // whitespace separated list of selectorSingle
3728	+ protected function selector(&$out) {
3729	+ $selector = array();
3730	+
3731	+ while (true) {
3732	+ if ($this->match('[>+~]+', $m)) {
3733	+ $selector[] = array($m[0]);
3734	+ } elseif ($this->selectorSingle($part)) {
3735	+ $selector[] = $part;
3736	+ $this->whitespace();
3737	+ } elseif ($this->match('\/[^\/]+\/', $m)) {
3738	+ $selector[] = array($m[0]);
3739	+ } else {
3740	+ break;
3741	+ }
3742	+
3743	+ }
3744	+
3745	+ if (count($selector) == 0) {
3746	+ return false;
3747	+ }
3748	+
3749	+ $out = $selector;
3750	+ return true;
3751	+ }
3752	+
3753	+ // the parts that make up
3754	+ // div[yes=no]#something.hello.world:nth-child(-2n+1)%placeholder
3755	+ protected function selectorSingle(&$out) {
3756	+ $oldWhite = $this->eatWhiteDefault;
3757	+ $this->eatWhiteDefault = false;
3758	+
3759	+ $parts = array();
3760	+
3761	+ if ($this->literal("*", false)) {
3762	+ $parts[] = "*";
3763	+ }
3764	+
3765	+ while (true) {
3766	+ // see if we can stop early
3767	+ if ($this->match("\s*[{,]", $m)) {
3768	+ $this->count--;
3769	+ break;
3770	+ }
3771	+
3772	+ $s = $this->seek();
3773	+ // self
3774	+ if ($this->literal("&", false)) {
3775	+ $parts[] = scssc::$selfSelector;
3776	+ continue;
3777	+ }
3778	+
3779	+ if ($this->literal(".", false)) {
3780	+ $parts[] = ".";
3781	+ continue;
3782	+ }
3783	+
3784	+ if ($this->literal("\|", false)) {
3785	+ $parts[] = "\|";
3786	+ continue;
3787	+ }
3788	+
3789	+ // for keyframes
3790	+ if ($this->unit($unit)) {
3791	+ $parts[] = $unit;
3792	+ continue;
3793	+ }
3794	+
3795	+ if ($this->keyword($name)) {
3796	+ $parts[] = $name;
3797	+ continue;
3798	+ }
3799	+
3800	+ if ($this->interpolation($inter)) {
3801	+ $parts[] = $inter;
3802	+ continue;
3803	+ }
3804	+
3805	+ if ($this->literal('%', false) && $this->placeholder($placeholder)) {
3806	+ $parts[] = '%';
3807	+ $parts[] = $placeholder;
3808	+ continue;
3809	+ }
3810	+
3811	+ if ($this->literal("#", false)) {
3812	+ $parts[] = "#";
3813	+ continue;
3814	+ }
3815	+
3816	+ // a pseudo selector
3817	+ if ($this->match("::?", $m) && $this->mixedKeyword($nameParts)) {
3818	+ $parts[] = $m[0];
3819	+ foreach ($nameParts as $sub) {
3820	+ $parts[] = $sub;
3821	+ }
3822	+
3823	+ $ss = $this->seek();
3824	+ if ($this->literal("(") &&
3825	+ ($this->openString(")", $str, "(") \|\| true ) &&
3826	+ $this->literal(")"))
3827	+ {
3828	+ $parts[] = "(";
3829	+ if (!empty($str)) $parts[] = $str;
3830	+ $parts[] = ")";
3831	+ } else {
3832	+ $this->seek($ss);
3833	+ }
3834	+
3835	+ continue;
3836	+ } else {
3837	+ $this->seek($s);
3838	+ }
3839	+
3840	+ // attribute selector
3841	+ // TODO: replace with open string?
3842	+ if ($this->literal("[", false)) {
3843	+ $attrParts = array("[");
3844	+ // keyword, string, operator
3845	+ while (true) {
3846	+ if ($this->literal("]", false)) {
3847	+ $this->count--;
3848	+ break; // get out early
3849	+ }
3850	+
3851	+ if ($this->match('\s+', $m)) {
3852	+ $attrParts[] = " ";
3853	+ continue;
3854	+ }
3855	+ if ($this->string($str)) {
3856	+ $attrParts[] = $str;
3857	+ continue;
3858	+ }
3859	+
3860	+ if ($this->keyword($word)) {
3861	+ $attrParts[] = $word;
3862	+ continue;
3863	+ }
3864	+
3865	+ if ($this->interpolation($inter, false)) {
3866	+ $attrParts[] = $inter;
3867	+ continue;
3868	+ }
3869	+
3870	+ // operator, handles attr namespace too
3871	+ if ($this->match('[\|-~\$\*\^=]+', $m)) {
3872	+ $attrParts[] = $m[0];
3873	+ continue;
3874	+ }
3875	+
3876	+ break;
3877	+ }
3878	+
3879	+ if ($this->literal("]", false)) {
3880	+ $attrParts[] = "]";
3881	+ foreach ($attrParts as $part) {
3882	+ $parts[] = $part;
3883	+ }
3884	+ continue;
3885	+ }
3886	+ $this->seek($s);
3887	+ // should just break here?
3888	+ }
3889	+
3890	+ break;
3891	+ }
3892	+
3893	+ $this->eatWhiteDefault = $oldWhite;
3894	+
3895	+ if (count($parts) == 0) return false;
3896	+
3897	+ $out = $parts;
3898	+ return true;
3899	+ }
3900	+
3901	+ protected function variable(&$out) {
3902	+ $s = $this->seek();
3903	+ if ($this->literal("$", false) && $this->keyword($name)) {
3904	+ $out = array("var", $name);
3905	+ return true;
3906	+ }
3907	+ $this->seek($s);
3908	+ return false;
3909	+ }
3910	+
3911	+ protected function keyword(&$word, $eatWhitespace = null) {
3912	+ if ($this->match('([\w_\-\!"\'\\\\][\w\-_"\'\\\\])',
3913	+ $m, $eatWhitespace))
3914	+ {
3915	+ $word = $m[1];
3916	+ return true;
3917	+ }
3918	+ return false;
3919	+ }
3920	+
3921	+ protected function placeholder(&$placeholder) {
3922	+ if ($this->match('([\w\-_]+)', $m)) {
3923	+ $placeholder = $m[1];
3924	+ return true;
3925	+ }
3926	+ return false;
3927	+ }
3928	+
3929	+ // consume an end of statement delimiter
3930	+ protected function end() {
3931	+ if ($this->literal(';')) {
3932	+ return true;
3933	+ } elseif ($this->count == strlen($this->buffer) \|\| $this->buffer[$this->count] == '}') {
3934	+ // if there is end of file or a closing block next then we don't need a ;
3935	+ return true;
3936	+ }
3937	+ return false;
3938	+ }
3939	+
3940	+ // advance counter to next occurrence of $what
3941	+ // $until - don't include $what in advance
3942	+ // $allowNewline, if string, will be used as valid char set
3943	+ protected function to($what, &$out, $until = false, $allowNewline = false) {
3944	+ if (is_string($allowNewline)) {
3945	+ $validChars = $allowNewline;
3946	+ } else {
3947	+ $validChars = $allowNewline ? "." : "[^\n]";
3948	+ }
3949	+ if (!$this->match('('.$validChars.'*?)'.$this->preg_quote($what), $m, !$until)) return false;
3950	+ if ($until) $this->count -= strlen($what); // give back $what
3951	+ $out = $m[1];
3952	+ return true;
3953	+ }
3954	+
3955	+ public function throwParseError($msg = "parse error", $count = null) {
3956	+ $count = !isset($count) ? $this->count : $count;
3957	+
3958	+ $line = $this->getLineNo($count);
3959	+
3960	+ if (!empty($this->sourceName)) {
3961	+ $loc = "$this->sourceName on line $line";
3962	+ } else {
3963	+ $loc = "line: $line";
3964	+ }
3965	+
3966	+ if ($this->peek("(.*?)(\n\|$)", $m, $count)) {
3967	+ throw new Exception("$msg: failed at `$m[1]` $loc");
3968	+ } else {
3969	+ throw new Exception("$msg: $loc");
3970	+ }
3971	+ }
3972	+
3973	+ public function getLineNo($pos) {
3974	+ return 1 + substr_count(substr($this->buffer, 0, $pos), "\n");
3975	+ }
3976	+
3977	+ /**
3978	+ * Match string looking for either ending delim, escape, or string interpolation
3979	+ *
3980	+ * {@internal This is a workaround for preg_match's 250K string match limit. }}
3981	+ *
3982	+ * @param array $m Matches (passed by reference)
3983	+ * @param string $delim Delimeter
3984	+ *
3985	+ * @return boolean True if match; false otherwise
3986	+ */
3987	+ protected function matchString(&$m, $delim) {
3988	+ $token = null;
3989	+
3990	+ $end = strpos($this->buffer, "\n", $this->count);
3991	+ if ($end === false \|\| $this->buffer[$end - 1] == '\\' \|\| $this->buffer[$end - 2] == '\\' && $this->buffer[$end - 1] == "\r") {
3992	+ $end = strlen($this->buffer);
3993	+ }
3994	+
3995	+ // look for either ending delim, escape, or string interpolation
3996	+ foreach (array('#{', '\\', $delim) as $lookahead) {
3997	+ $pos = strpos($this->buffer, $lookahead, $this->count);
3998	+ if ($pos !== false && $pos < $end) {
3999	+ $end = $pos;
4000	+ $token = $lookahead;
4001	+ }
4002	+ }
4003	+
4004	+ if (!isset($token)) {
4005	+ return false;
4006	+ }
4007	+
4008	+ $match = substr($this->buffer, $this->count, $end - $this->count);
4009	+ $m = array(
4010	+ $match . $token,
4011	+ $match,
4012	+ $token
4013	+ );
4014	+ $this->count = $end + strlen($token);
4015	+
4016	+ return true;
4017	+ }
4018	+
4019	+ // try to match something on head of buffer
4020	+ protected function match($regex, &$out, $eatWhitespace = null) {
4021	+ if (!isset($eatWhitespace)) $eatWhitespace = $this->eatWhiteDefault;
4022	+
4023	+ $r = '/'.$regex.'/Ais';
4024	+ if (preg_match($r, $this->buffer, $out, null, $this->count)) {
4025	+ $this->count += strlen($out[0]);
4026	+ if ($eatWhitespace) $this->whitespace();
4027	+ return true;
4028	+ }
4029	+ return false;
4030	+ }
4031	+
4032	+ // match some whitespace
4033	+ protected function whitespace() {
4034	+ $gotWhite = false;
4035	+ while (preg_match(self::$whitePattern, $this->buffer, $m, null, $this->count)) {
4036	+ if ($this->insertComments) {
4037	+ if (isset($m[1]) && empty($this->commentsSeen[$this->count])) {
4038	+ $this->append(array("comment", $m[1]));
4039	+ $this->commentsSeen[$this->count] = true;
4040	+ }
4041	+ }
4042	+ $this->count += strlen($m[0]);
4043	+ $gotWhite = true;
4044	+ }
4045	+ return $gotWhite;
4046	+ }
4047	+
4048	+ protected function peek($regex, &$out, $from=null) {
4049	+ if (!isset($from)) $from = $this->count;
4050	+
4051	+ $r = '/'.$regex.'/Ais';
4052	+ $result = preg_match($r, $this->buffer, $out, null, $from);
4053	+
4054	+ return $result;
4055	+ }
4056	+
4057	+ protected function seek($where = null) {
4058	+ if ($where === null) return $this->count;
4059	+ else $this->count = $where;
4060	+ return true;
4061	+ }
4062	+
4063	+ static function preg_quote($what) {
4064	+ return preg_quote($what, '/');
4065	+ }
4066	+
4067	+ protected function show() {
4068	+ if ($this->peek("(.*?)(\n\|$)", $m, $this->count)) {
4069	+ return $m[1];
4070	+ }
4071	+ return "";
4072	+ }
4073	+
4074	+ // turn list of length 1 into value type
4075	+ protected function flattenList($value) {
4076	+ if ($value[0] == "list" && count($value[2]) == 1) {
4077	+ return $this->flattenList($value[2][0]);
4078	+ }
4079	+ return $value;
4080	+ }
4081	+ }
4082	+
4083	+ /**
4084	+ * SCSS base formatter
4085	+ *
4086	+ * @author Leaf Corcoran <leafot@gmail.com>
4087	+ */
4088	+ class scss_formatter {
4089	+ public $indentChar = " ";
4090	+
4091	+ public $break = "\n";
4092	+ public $open = " {";
4093	+ public $close = "}";
4094	+ public $tagSeparator = ", ";
4095	+ public $assignSeparator = ": ";
4096	+
4097	+ public function __construct() {
4098	+ $this->indentLevel = 0;
4099	+ }
4100	+
4101	+ public function indentStr($n = 0) {
4102	+ return str_repeat($this->indentChar, max($this->indentLevel + $n, 0));
4103	+ }
4104	+
4105	+ public function property($name, $value) {
4106	+ return $name . $this->assignSeparator . $value . ";";
4107	+ }
4108	+
4109	+ protected function block($block) {
4110	+ if (empty($block->lines) && empty($block->children)) return;
4111	+
4112	+ $inner = $pre = $this->indentStr();
4113	+
4114	+ if (!empty($block->selectors)) {
4115	+ echo $pre .
4116	+ implode($this->tagSeparator, $block->selectors) .
4117	+ $this->open . $this->break;
4118	+ $this->indentLevel++;
4119	+ $inner = $this->indentStr();
4120	+ }
4121	+
4122	+ if (!empty($block->lines)) {
4123	+ $glue = $this->break.$inner;
4124	+ echo $inner . implode($glue, $block->lines);
4125	+ if (!empty($block->children)) {
4126	+ echo $this->break;
4127	+ }
4128	+ }
4129	+
4130	+ foreach ($block->children as $child) {
4131	+ $this->block($child);
4132	+ }
4133	+
4134	+ if (!empty($block->selectors)) {
4135	+ $this->indentLevel--;
4136	+ if (empty($block->children)) echo $this->break;
4137	+ echo $pre . $this->close . $this->break;
4138	+ }
4139	+ }
4140	+
4141	+ public function format($block) {
4142	+ ob_start();
4143	+ $this->block($block);
4144	+ $out = ob_get_clean();
4145	+
4146	+ return $out;
4147	+ }
4148	+ }
4149	+
4150	+ /**
4151	+ * SCSS nested formatter
4152	+ *
4153	+ * @author Leaf Corcoran <leafot@gmail.com>
4154	+ */
4155	+ class scss_formatter_nested extends scss_formatter {
4156	+ public $close = " }";
4157	+
4158	+ // adjust the depths of all children, depth first
4159	+ public function adjustAllChildren($block) {
4160	+ // flatten empty nested blocks
4161	+ $children = array();
4162	+ foreach ($block->children as $i => $child) {
4163	+ if (empty($child->lines) && empty($child->children)) {
4164	+ if (isset($block->children[$i + 1])) {
4165	+ $block->children[$i + 1]->depth = $child->depth;
4166	+ }
4167	+ continue;
4168	+ }
4169	+ $children[] = $child;
4170	+ }
4171	+
4172	+ $count = count($children);
4173	+ for ($i = 0; $i < $count; $i++) {
4174	+ $depth = $children[$i]->depth;
4175	+ $j = $i + 1;
4176	+ if (isset($children[$j]) && $depth < $children[$j]->depth) {
4177	+ $childDepth = $children[$j]->depth;
4178	+ for (; $j < $count; $j++) {
4179	+ if ($depth < $children[$j]->depth && $childDepth >= $children[$j]->depth) {
4180	+ $children[$j]->depth = $depth + 1;
4181	+ }
4182	+ }
4183	+ }
4184	+ }
4185	+
4186	+ $block->children = $children;
4187	+
4188	+ // make relative to parent
4189	+ foreach ($block->children as $child) {
4190	+ $this->adjustAllChildren($child);
4191	+ $child->depth = $child->depth - $block->depth;
4192	+ }
4193	+ }
4194	+
4195	+ protected function block($block) {
4196	+ if ($block->type == "root") {
4197	+ $this->adjustAllChildren($block);
4198	+ }
4199	+
4200	+ $inner = $pre = $this->indentStr($block->depth - 1);
4201	+ if (!empty($block->selectors)) {
4202	+ echo $pre .
4203	+ implode($this->tagSeparator, $block->selectors) .
4204	+ $this->open . $this->break;
4205	+ $this->indentLevel++;
4206	+ $inner = $this->indentStr($block->depth - 1);
4207	+ }
4208	+
4209	+ if (!empty($block->lines)) {
4210	+ $glue = $this->break.$inner;
4211	+ echo $inner . implode($glue, $block->lines);
4212	+ if (!empty($block->children)) echo $this->break;
4213	+ }
4214	+
4215	+ foreach ($block->children as $i => $child) {
4216	+ // echo "*** block: ".$block->depth." child: ".$child->depth."\n";
4217	+ $this->block($child);
4218	+ if ($i < count($block->children) - 1) {
4219	+ echo $this->break;
4220	+
4221	+ if (isset($block->children[$i + 1])) {
4222	+ $next = $block->children[$i + 1];
4223	+ if ($next->depth == max($block->depth, 1) && $child->depth >= $next->depth) {
4224	+ echo $this->break;
4225	+ }
4226	+ }
4227	+ }
4228	+ }
4229	+
4230	+ if (!empty($block->selectors)) {
4231	+ $this->indentLevel--;
4232	+ echo $this->close;
4233	+ }
4234	+
4235	+ if ($block->type == "root") {
4236	+ echo $this->break;
4237	+ }
4238	+ }
4239	+ }
4240	+
4241	+ /**
4242	+ * SCSS compressed formatter
4243	+ *
4244	+ * @author Leaf Corcoran <leafot@gmail.com>
4245	+ */
4246	+ class scss_formatter_compressed extends scss_formatter {
4247	+ public $open = "{";
4248	+ public $tagSeparator = ",";
4249	+ public $assignSeparator = ":";
4250	+ public $break = "";
4251	+
4252	+ public function indentStr($n = 0) {
4253	+ return "";
4254	+ }
4255	+ }
4256	+
4257	+ /**
4258	+ * SCSS server
4259	+ *
4260	+ * @author Leaf Corcoran <leafot@gmail.com>
4261	+ */
4262	+ class scss_server {
4263	+ /**
4264	+ * Join path components
4265	+ *
4266	+ * @param string $left Path component, left of the directory separator
4267	+ * @param string $right Path component, right of the directory separator
4268	+ *
4269	+ * @return string
4270	+ */
4271	+ protected function join($left, $right) {
4272	+ return rtrim($left, '/\\') . DIRECTORY_SEPARATOR . ltrim($right, '/\\');
4273	+ }
4274	+
4275	+ /**
4276	+ * Get name of requested .scss file
4277	+ *
4278	+ * @return string\|null
4279	+ */
4280	+ protected function inputName() {
4281	+ switch (true) {
4282	+ case isset($_GET['p']):
4283	+ return $_GET['p'];
4284	+ case isset($_SERVER['PATH_INFO']):
4285	+ return $_SERVER['PATH_INFO'];
4286	+ case isset($_SERVER['DOCUMENT_URI']):
4287	+ return substr($_SERVER['DOCUMENT_URI'], strlen($_SERVER['SCRIPT_NAME']));
4288	+ }
4289	+ }
4290	+
4291	+ /**
4292	+ * Get path to requested .scss file
4293	+ *
4294	+ * @return string
4295	+ */
4296	+ protected function findInput() {
4297	+ if (($input = $this->inputName())
4298	+ && strpos($input, '..') === false
4299	+ && substr($input, -5) === '.scss'
4300	+ ) {
4301	+ $name = $this->join($this->dir, $input);
4302	+
4303	+ if (is_file($name) && is_readable($name)) {
4304	+ return $name;
4305	+ }
4306	+ }
4307	+
4308	+ return false;
4309	+ }
4310	+
4311	+ /**
4312	+ * Get path to cached .css file
4313	+ *
4314	+ * @return string
4315	+ */
4316	+ protected function cacheName($fname) {
4317	+ return $this->join($this->cacheDir, md5($fname) . '.css');
4318	+ }
4319	+
4320	+ /**
4321	+ * Get path to cached imports
4322	+ *
4323	+ * @return string
4324	+ */
4325	+ protected function importsCacheName($out) {
4326	+ return $out . '.imports';
4327	+ }
4328	+
4329	+ /**
4330	+ * Determine whether .scss file needs to be re-compiled.
4331	+ *
4332	+ * @param string $in Input path
4333	+ * @param string $out Output path
4334	+ *
4335	+ * @return boolean True if compile required.
4336	+ */
4337	+ protected function needsCompile($in, $out) {
4338	+ if (!is_file($out)) return true;
4339	+
4340	+ $mtime = filemtime($out);
4341	+ if (filemtime($in) > $mtime) return true;
4342	+
4343	+ // look for modified imports
4344	+ $icache = $this->importsCacheName($out);
4345	+ if (is_readable($icache)) {
4346	+ $imports = unserialize(file_get_contents($icache));
4347	+ foreach ($imports as $import) {
4348	+ if (filemtime($import) > $mtime) return true;
4349	+ }
4350	+ }
4351	+ return false;
4352	+ }
4353	+
4354	+ /**
4355	+ * Compile .scss file
4356	+ *
4357	+ * @param string $in Input path (.scss)
4358	+ * @param string $out Output path (.css)
4359	+ *
4360	+ * @return string
4361	+ */
4362	+ protected function compile($in, $out) {
4363	+ $start = microtime(true);
4364	+ $css = $this->scss->compile(file_get_contents($in), $in);
4365	+ $elapsed = round((microtime(true) - $start), 4);
4366	+
4367	+ $v = scssc::$VERSION;
4368	+ $t = date('r');
4369	+ $css = "/* compiled by scssphp $v on $t (${elapsed}s) */\n\n" . $css;
4370	+
4371	+ file_put_contents($out, $css);
4372	+ file_put_contents($this->importsCacheName($out),
4373	+ serialize($this->scss->getParsedFiles()));
4374	+ return $css;
4375	+ }
4376	+
4377	+ /**
4378	+ * Compile requested scss and serve css. Outputs HTTP response.
4379	+ *
4380	+ * @param string $salt Prefix a string to the filename for creating the cache name hash
4381	+ */
4382	+ public function serve($salt = '') {
4383	+ if ($input = $this->findInput()) {
4384	+ $output = $this->cacheName($salt . $input);
4385	+ header('Content-type: text/css');
4386	+
4387	+ if ($this->needsCompile($input, $output)) {
4388	+ try {
4389	+ echo $this->compile($input, $output);
4390	+ } catch (Exception $e) {
4391	+ header('HTTP/1.1 500 Internal Server Error');
4392	+ echo 'Parse error: ' . $e->getMessage() . "\n";
4393	+ }
4394	+ } else {
4395	+ header('X-SCSS-Cache: true');
4396	+ echo file_get_contents($output);
4397	+ }
4398	+
4399	+ return;
4400	+ }
4401	+
4402	+ header('HTTP/1.0 404 Not Found');
4403	+ header('Content-type: text');
4404	+ $v = scssc::$VERSION;
4405	+ echo "/* INPUT NOT FOUND scss $v */\n";
4406	+ }
4407	+
4408	+ /**
4409	+ * Constructor
4410	+ *
4411	+ * @param string $dir Root directory to .scss files
4412	+ * @param string $cacheDir Cache directory
4413	+ * @param \scssc\|null $scss SCSS compiler instance
4414	+ */
4415	+ public function __construct($dir, $cacheDir=null, $scss=null) {
4416	+ $this->dir = $dir;
4417	+
4418	+ if (!isset($cacheDir)) {
4419	+ $cacheDir = $this->join($dir, 'scss_cache');
4420	+ }
4421	+
4422	+ $this->cacheDir = $cacheDir;
4423	+ if (!is_dir($this->cacheDir)) mkdir($this->cacheDir, 0755, true);
4424	+
4425	+ if (!isset($scss)) {
4426	+ $scss = new scssc();
4427	+ $scss->setImportPaths($this->dir);
4428	+ }
4429	+ $this->scss = $scss;
4430	+ }
4431	+
4432	+ /**
4433	+ * Helper method to serve compiled scss
4434	+ *
4435	+ * @param string $path Root path
4436	+ */
4437	+ static public function serveFrom($path) {
4438	+ $server = new self($path);
4439	+ $server->serve();
4440	+ }
4441	+ }
4442	+
4443	+ endif;

classes/settings.class.php ADDED Viewed

	@@ -0,0 +1,3441 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists( 'Mega_Menu_Settings' ) ) :
8	+
9	+ /**
10	+ * Handles all admin related functionality.
11	+ */
12	+ class Mega_Menu_Settings {
13	+
14	+
15	+ /**
16	+ * All themes (default and custom)
17	+ */
18	+ var $themes = array();
19	+
20	+
21	+ /**
22	+ * Active theme
23	+ */
24	+ var $active_theme = array();
25	+
26	+
27	+ /**
28	+ * Active theme ID
29	+ */
30	+ var $id = "";
31	+
32	+
33	+ /**
34	+ * Constructor
35	+ *
36	+ * @since 1.0
37	+ */
38	+ public function __construct() {
39	+
40	+ add_action( 'admin_post_megamenu_save_theme', array( $this, 'save_theme') );
41	+ add_action( 'admin_post_megamenu_add_theme', array( $this, 'create_theme') );
42	+ add_action( 'admin_post_megamenu_delete_theme', array( $this, 'delete_theme') );
43	+ add_action( 'admin_post_megamenu_revert_theme', array( $this, 'revert_theme') );
44	+ add_action( 'admin_post_megamenu_import_theme', array( $this, 'import_theme') );
45	+ add_action( 'admin_post_megamenu_duplicate_theme', array( $this, 'duplicate_theme') );
46	+
47	+ add_action( 'admin_post_megamenu_add_menu_location', array( $this, 'add_menu_location') );
48	+ add_action( 'admin_post_megamenu_delete_menu_location', array( $this, 'delete_menu_location') );
49	+
50	+ add_action( 'admin_post_megamenu_save_settings', array( $this, 'save_settings') );
51	+ add_action( 'admin_post_megamenu_clear_css_cache', array( $this, 'tools_clear_css_cache') );
52	+ add_action( 'admin_post_megamenu_delete_data', array( $this, 'delete_data') );
53	+
54	+ add_action( 'megamenu_page_theme_editor', array( $this, 'theme_editor_page'));
55	+ add_action( 'megamenu_page_tools', array( $this, 'tools_page'));
56	+ add_action( 'megamenu_page_general_settings', array( $this, 'general_settings_page'));
57	+
58	+ add_action( 'admin_menu', array( $this, 'megamenu_themes_page') );
59	+ add_action( 'megamenu_admin_scripts', array( $this, 'enqueue_scripts' ) );
60	+
61	+ }
62	+
63	+ /**
64	+ *
65	+ * @since 1.4
66	+ */
67	+ public function init() {
68	+
69	+ if ( class_exists( "Mega_Menu_Style_Manager" ) ) {
70	+
71	+ $style_manager = new Mega_Menu_Style_Manager();
72	+
73	+ $this->themes = $style_manager->get_themes();
74	+ $this->id = isset( $_GET['theme'] ) ? $_GET['theme'] : 'default';
75	+ $this->active_theme = $this->themes[$this->id];
76	+
77	+ }
78	+
79	+ }
80	+
81	+ /**
82	+ * Save changes to an exiting theme.
83	+ *
84	+ * @since 1.0
85	+ */
86	+ public function save_theme() {
87	+
88	+ check_admin_referer( 'megamenu_save_theme' );
89	+
90	+ $theme = esc_attr( $_POST['theme_id'] );
91	+
92	+ $saved_themes = get_site_option( "megamenu_themes" );
93	+
94	+ if ( isset( $saved_themes[ $theme ] ) ) {
95	+ unset( $saved_themes[ $theme ] );
96	+ }
97	+
98	+ $submitted_settings = $_POST['settings'];
99	+
100	+ if ( isset( $_POST['checkboxes'] ) ) {
101	+
102	+ foreach ( $_POST['checkboxes'] as $checkbox => $value ) {
103	+
104	+ if ( isset( $submitted_settings[ $checkbox ] ) ) {
105	+
106	+ $submitted_settings[ $checkbox ] = 'on';
107	+
108	+ } else {
109	+
110	+ $submitted_settings[ $checkbox ] = 'off';
111	+
112	+ }
113	+
114	+ }
115	+
116	+ }
117	+
118	+ if ( isset( $submitted_settings['toggle_blocks'] ) ) {
119	+ unset( $submitted_settings['toggle_blocks'] );
120	+ }
121	+
122	+ $saved_themes[ $theme ] = array_map( 'esc_attr', $submitted_settings );
123	+
124	+ update_site_option( "megamenu_themes", $saved_themes );
125	+
126	+ do_action("megamenu_after_theme_save");
127	+
128	+ do_action("megamenu_delete_cache");
129	+
130	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme={$theme}&saved=true" ) );
131	+
132	+ }
133	+
134	+
135	+ /**
136	+ * Add a new menu location.
137	+ *
138	+ * @since 1.8
139	+ */
140	+ public function add_menu_location() {
141	+
142	+ check_admin_referer( 'megamenu_add_menu_location' );
143	+
144	+ $locations = get_option( 'megamenu_locations' );
145	+
146	+ $next_id = $this->get_next_menu_location_id();
147	+
148	+ $new_menu_location_id = "max_mega_menu_" . $next_id;
149	+
150	+ $locations[$new_menu_location_id] = "Max Mega Menu Location " . $next_id;
151	+
152	+ update_option( 'megamenu_locations', $locations );
153	+
154	+ do_action("megamenu_after_add_menu_location");
155	+
156	+ $this->redirect( admin_url( 'admin.php?page=maxmegamenu&add_location=true' ) );
157	+
158	+ }
159	+
160	+
161	+ /**
162	+ * Delete a menu location.
163	+ *
164	+ * @since 1.8
165	+ */
166	+ public function delete_menu_location() {
167	+
168	+ check_admin_referer( 'megamenu_delete_menu_location' );
169	+
170	+ $locations = get_option( 'megamenu_locations' );
171	+
172	+ $location_to_delete = esc_attr( $_GET['location'] );
173	+
174	+ if ( isset( $locations[ $location_to_delete ] ) ) {
175	+ unset( $locations[ $location_to_delete ] );
176	+ update_option( 'megamenu_locations', $locations );
177	+ }
178	+
179	+ do_action("megamenu_after_delete_menu_location");
180	+
181	+ do_action("megamenu_delete_cache");
182	+
183	+ $this->redirect( admin_url( 'admin.php?page=maxmegamenu&delete_location=true' ) );
184	+
185	+ }
186	+
187	+ /**
188	+ * Clear the CSS cache.
189	+ *
190	+ * @since 1.5
191	+ */
192	+ public function tools_clear_css_cache() {
193	+
194	+ check_admin_referer( 'megamenu_clear_css_cache' );
195	+
196	+ do_action( 'megamenu_delete_cache' );
197	+
198	+ $this->redirect( admin_url( 'admin.php?page=maxmegamenu_tools&clear_css_cache=true' ) );
199	+
200	+ }
201	+
202	+
203	+ /**
204	+ * Deletes all Max Mega Menu data from the database
205	+ *
206	+ * @since 1.5
207	+ */
208	+ public function delete_data() {
209	+
210	+ check_admin_referer( 'megamenu_delete_data' );
211	+
212	+ do_action("megamenu_delete_cache");
213	+
214	+ // delete menu settings
215	+ delete_option("megamenu_settings");
216	+
217	+ // delete menu locations
218	+ delete_option("megamenu_locations");
219	+
220	+ // delete all widgets assigned to menus
221	+ $widget_manager = new Mega_Menu_Widget_Manager();
222	+
223	+ if ( $mega_menu_widgets = $widget_manager->get_mega_menu_sidebar_widgets() ) {
224	+
225	+ foreach ( $mega_menu_widgets as $widget_id ) {
226	+
227	+ $widget_manager->delete_widget( $widget_id );
228	+
229	+ }
230	+
231	+ }
232	+
233	+ // delete all mega menu metadata stored against menu items
234	+ delete_metadata( 'post', 0, '_megamenu', '', true );
235	+
236	+ // clear cache
237	+ delete_transient( "megamenu_css" );
238	+
239	+ // delete custom themes
240	+ delete_site_option( "megamenu_themes" );
241	+
242	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_tools&delete_data=true" ) );
243	+
244	+ }
245	+
246	+ /**
247	+ * Save menu general settings.
248	+ *
249	+ * @since 1.0
250	+ */
251	+ public function save_settings() {
252	+
253	+ check_admin_referer( 'megamenu_save_settings' );
254	+
255	+ $submitted_settings = apply_filters( "megamenu_submitted_settings", $_POST['settings'] );
256	+
257	+ $existing_settings = get_option( 'megamenu_settings' );
258	+
259	+ $new_settings = array_merge( (array)$existing_settings, $submitted_settings );
260	+
261	+ update_option( 'megamenu_settings', $new_settings );
262	+
263	+ // update location description
264	+ if ( isset( $_POST['location'] ) && is_array( $_POST['location'] ) ) {
265	+
266	+ $locations = get_option('megamenu_locations');
267	+
268	+ $new_locations = array_merge( (array)$locations, $_POST['location'] );
269	+
270	+ update_option( 'megamenu_locations', $new_locations );
271	+ }
272	+
273	+ do_action("megamenu_after_save_general_settings");
274	+
275	+ do_action("megamenu_delete_cache");
276	+
277	+ $url = isset( $_POST['_wp_http_referer'] ) ? $_POST['_wp_http_referer'] : admin_url( "admin.php?page=maxmegamenu&saved=true" );
278	+
279	+ $this->redirect( $url );
280	+
281	+ }
282	+
283	+
284	+ /**
285	+ * Duplicate an existing theme.
286	+ *
287	+ * @since 1.8
288	+ */
289	+ public function import_theme() {
290	+
291	+ check_admin_referer( 'megamenu_import_theme' );
292	+
293	+ $this->init();
294	+
295	+ $import = json_decode( stripslashes( $_POST['data'] ), true );
296	+
297	+ if ( is_array( $import ) ) {
298	+
299	+ $saved_themes = get_site_option( "megamenu_themes" );
300	+
301	+ $next_id = $this->get_next_theme_id();
302	+
303	+ $import['title'] = $import['title'] . " " . __('(Imported)', 'megamenu');
304	+
305	+ $new_theme_id = "custom_theme_" . $next_id;
306	+
307	+ $saved_themes[ $new_theme_id ] = $import;
308	+
309	+ update_site_option( "megamenu_themes", $saved_themes );
310	+
311	+ do_action("megamenu_after_theme_import");
312	+
313	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_tools&theme_imported=true") );
314	+
315	+ } else {
316	+
317	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_tools&theme_imported=false") );
318	+
319	+ }
320	+
321	+
322	+ }
323	+
324	+ /**
325	+ * Duplicate an existing theme.
326	+ *
327	+ * @since 1.0
328	+ */
329	+ public function duplicate_theme() {
330	+
331	+ check_admin_referer( 'megamenu_duplicate_theme' );
332	+
333	+ $this->init();
334	+
335	+ $theme = esc_attr( $_GET['theme_id'] );
336	+
337	+ $copy = $this->themes[$theme];
338	+
339	+ $saved_themes = get_site_option( "megamenu_themes" );
340	+
341	+ $next_id = $this->get_next_theme_id();
342	+
343	+ $copy['title'] = $copy['title'] . " " . __('Copy', 'megamenu');
344	+
345	+ $new_theme_id = "custom_theme_" . $next_id;
346	+
347	+ $saved_themes[ $new_theme_id ] = $copy;
348	+
349	+ update_site_option( "megamenu_themes", $saved_themes );
350	+
351	+ do_action("megamenu_after_theme_duplicate");
352	+
353	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme={$new_theme_id}&duplicated=true") );
354	+
355	+ }
356	+
357	+
358	+ /**
359	+ * Delete a theme
360	+ *
361	+ * @since 1.0
362	+ */
363	+ public function delete_theme() {
364	+
365	+ check_admin_referer( 'megamenu_delete_theme' );
366	+
367	+ $theme = esc_attr( $_GET['theme_id'] );
368	+
369	+ if ( $this->theme_is_being_used_by_location( $theme ) ) {
370	+
371	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme={$theme}&deleted=false") );
372	+ return;
373	+ }
374	+
375	+ $saved_themes = get_site_option( "megamenu_themes" );
376	+
377	+ if ( isset( $saved_themes[$theme] ) ) {
378	+ unset( $saved_themes[$theme] );
379	+ }
380	+
381	+ update_site_option( "megamenu_themes", $saved_themes );
382	+
383	+ do_action("megamenu_after_theme_delete");
384	+
385	+ do_action("megamenu_delete_cache");
386	+
387	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme=default&deleted=true") );
388	+
389	+ }
390	+
391	+
392	+ /**
393	+ * Revert a theme (only available for default themes, you can't revert a custom theme)
394	+ *
395	+ * @since 1.0
396	+ */
397	+ public function revert_theme() {
398	+
399	+ check_admin_referer( 'megamenu_revert_theme' );
400	+
401	+ $theme = esc_attr( $_GET['theme_id'] );
402	+
403	+ $saved_themes = get_site_option( "megamenu_themes" );
404	+
405	+ if ( isset( $saved_themes[$theme] ) ) {
406	+ unset( $saved_themes[$theme] );
407	+ }
408	+
409	+ update_site_option( "megamenu_themes", $saved_themes );
410	+
411	+ do_action("megamenu_after_theme_revert");
412	+
413	+ do_action("megamenu_delete_cache");
414	+
415	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme={$theme}&reverted=true") );
416	+
417	+ }
418	+
419	+
420	+ /**
421	+ * Create a new custom theme
422	+ *
423	+ * @since 1.0
424	+ */
425	+ public function create_theme() {
426	+
427	+ check_admin_referer( 'megamenu_create_theme' );
428	+
429	+ $this->init();
430	+
431	+ $saved_themes = get_site_option( "megamenu_themes" );
432	+
433	+ $next_id = $this->get_next_theme_id();
434	+
435	+ $new_theme_id = "custom_theme_" . $next_id;
436	+
437	+ $new_theme = $this->themes['default'];
438	+
439	+ $new_theme['title'] = "Custom {$next_id}";
440	+
441	+ $saved_themes[$new_theme_id] = $new_theme;
442	+
443	+ update_site_option( "megamenu_themes", $saved_themes );
444	+
445	+ do_action("megamenu_after_theme_create");
446	+
447	+ $this->redirect( admin_url( "admin.php?page=maxmegamenu_theme_editor&theme={$new_theme_id}&created=true") );
448	+
449	+ }
450	+
451	+
452	+ /**
453	+ * Redirect and exit
454	+ *
455	+ * @since 1.8
456	+ */
457	+ public function redirect( $url ) {
458	+
459	+ wp_redirect( $url );
460	+ exit;
461	+
462	+ }
463	+
464	+
465	+ /**
466	+ * Returns the next available menu location ID
467	+ *
468	+ * @since 1.0
469	+ */
470	+ public function get_next_menu_location_id() {
471	+
472	+ $last_id = 0;
473	+
474	+ if ( $locations = get_option( "megamenu_locations" ) ) {
475	+
476	+ foreach ( $locations as $key => $value ) {
477	+
478	+ if ( strpos( $key, 'max_mega_menu_' ) !== FALSE ) {
479	+
480	+ $parts = explode( "_", $key );
481	+ $menu_id = end( $parts );
482	+
483	+ if ($menu_id > $last_id) {
484	+ $last_id = $menu_id;
485	+ }
486	+
487	+ }
488	+
489	+ }
490	+
491	+ }
492	+
493	+ $next_id = $last_id + 1;
494	+
495	+ return $next_id;
496	+ }
497	+
498	+ /**
499	+ * Returns the next available custom theme ID
500	+ *
501	+ * @since 1.0
502	+ */
503	+ public function get_next_theme_id() {
504	+
505	+ $last_id = 0;
506	+
507	+ if ( $saved_themes = get_site_option( "megamenu_themes" ) ) {
508	+
509	+ foreach ( $saved_themes as $key => $value ) {
510	+
511	+ if ( strpos( $key, 'custom_theme' ) !== FALSE ) {
512	+
513	+ $parts = explode( "_", $key );
514	+ $theme_id = end( $parts );
515	+
516	+ if ($theme_id > $last_id) {
517	+ $last_id = $theme_id;
518	+ }
519	+
520	+ }
521	+
522	+ }
523	+
524	+ }
525	+
526	+ $next_id = $last_id + 1;
527	+
528	+ return $next_id;
529	+ }
530	+
531	+
532	+ /**
533	+ * Checks to see if a certain theme is in use.
534	+ *
535	+ * @since 1.0
536	+ * @param string $theme
537	+ */
538	+ public function theme_is_being_used_by_location( $theme ) {
539	+ $settings = get_option( "megamenu_settings" );
540	+
541	+ if ( ! $settings ) {
542	+ return false;
543	+ }
544	+
545	+ $locations = get_nav_menu_locations();
546	+
547	+ $menus = get_registered_nav_menus();
548	+
549	+
550	+ $theme_in_use_locations = array();
551	+
552	+ if ( count( $locations ) ) {
553	+
554	+ foreach ( $locations as $location => $menu_id ) {
555	+
556	+ if ( has_nav_menu( $location ) && isset( $settings[ $location ]['theme'] ) && $settings[ $location ]['theme'] == $theme ) {
557	+ $theme_in_use_locations[] = isset( $menus[ $location ] ) ? $menus[ $location ] : $location;
558	+ }
559	+
560	+ }
561	+
562	+ if ( count( $theme_in_use_locations ) ) {
563	+ return $theme_in_use_locations;
564	+ }
565	+
566	+ }
567	+
568	+ return false;
569	+ }
570	+
571	+
572	+ /**
573	+ * Adds the "Menu Themes" menu item and page.
574	+ *
575	+ * @since 1.0
576	+ */
577	+ public function megamenu_themes_page() {
578	+
579	+ $page = add_menu_page( __('Max Mega Menu', 'megamenu'), __('Mega Menu', 'megamenu'), 'edit_theme_options', 'maxmegamenu', array($this, 'page') );
580	+
581	+
582	+ $tabs = apply_filters("megamenu_menu_tabs", array(
583	+ 'general_settings' => __("General Settings", "megamenu"),
584	+ 'theme_editor' => __("Menu Themes", "megamenu"),
585	+ 'tools' => __("Tools", "megamenu")
586	+ ));
587	+
588	+ foreach ( $tabs as $key => $title ) {
589	+ if ( $key == 'general_settings') {
590	+ add_submenu_page( 'maxmegamenu', __('Max Mega Menu', 'megamenu') . ' - ' . $title, $title, 'edit_theme_options', 'maxmegamenu', array($this, 'page') );
591	+ } else {
592	+ add_submenu_page( 'maxmegamenu', __('Max Mega Menu', 'megamenu') . ' - ' . $title, $title, 'edit_theme_options', 'maxmegamenu_' . $key, array($this, 'page') );
593	+ }
594	+ }
595	+
596	+ }
597	+
598	+
599	+ /**
600	+ * Content for 'Settings' tab
601	+ *
602	+ * @since 1.4
603	+ */
604	+ public function general_settings_page( $saved_settings ) {
605	+
606	+ $all_locations = get_registered_nav_menus();
607	+ $locations = array();
608	+
609	+ if ( count( $all_locations ) ) {
610	+
611	+ $megamenu_locations = array();
612	+
613	+ // reorder locations so custom MMM locations are listed at the bottom
614	+ foreach ( $all_locations as $location => $val ) {
615	+
616	+ if ( strpos( $location, 'max_mega_menu_' ) === FALSE ) {
617	+ $locations[$location] = $val;
618	+ } else {
619	+ $megamenu_locations[$location] = $val;
620	+ }
621	+
622	+ }
623	+
624	+ $locations = array_merge( $locations, $megamenu_locations );
625	+ }
626	+
627	+ $css = isset( $saved_settings['css'] ) ? $saved_settings['css'] : 'fs';
628	+ $mobile_second_click = isset( $saved_settings['second_click'] ) ? $saved_settings['second_click'] : 'close';
629	+ $mobile_behaviour = isset( $saved_settings['mobile_behaviour'] ) ? $saved_settings['mobile_behaviour'] : 'standard';
630	+
631	+
632	+ ?>
633	+
634	+ <div class='menu_settings'>
635	+
636	+ <form action="<?php echo admin_url('admin-post.php'); ?>" method="post">
637	+ <input type="hidden" name="action" value="megamenu_save_settings" />
638	+ <?php wp_nonce_field( 'megamenu_save_settings' ); ?>
639	+
640	+ <h3 class='first'><?php _e("General Settings", "megamenu"); ?></h3>
641	+
642	+ <table>
643	+ <tr>
644	+ <td class='mega-name'>
645	+ <?php _e("Click Event Behaviour", "megamenu"); ?>
646	+ <div class='mega-description'>
647	+ <?php _e("Define what should happen when the event is set to 'click'. This also applies to mobiles.", "megamenu"); ?>
648	+ </div>
649	+ </td>
650	+ <td class='mega-value'>
651	+ <select name='settings[second_click]'>
652	+ <option value='close' <?php echo selected( $mobile_second_click == 'close'); ?>><?php _e("First click will open a sub menu, second click will close the sub menu.", "megamenu"); ?></option>
653	+ <option value='go' <?php echo selected( $mobile_second_click == 'go'); ?>><?php _e("First click will open a sub menu, second click will follow the link.", "megamenu"); ?></option>
654	+ <select>
655	+ <div class='mega-description'>
656	+ </div>
657	+ </td>
658	+ </tr>
659	+ <tr>
660	+ <td class='mega-name'>
661	+ <?php _e("Mobile Menu Behaviour", "megamenu"); ?>
662	+ <div class='mega-description'>
663	+ <?php _e("Define the sub menu toggle behaviour for the mobile menu.", "megamenu"); ?>
664	+ </div>
665	+ </td>
666	+ <td class='mega-value'>
667	+ <select name='settings[mobile_behaviour]'>
668	+ <option value='standard' <?php echo selected( $mobile_behaviour == 'standard'); ?>><?php _e("Standard - Open sub menus will remain open until closed by the user.", "megamenu"); ?></option>
669	+ <option value='accordion' <?php echo selected( $mobile_behaviour == 'accordion'); ?>><?php _e("Accordion - Open sub menus will automatically close when another one is opened.", "megamenu"); ?></option>
670	+ <select>
671	+ <div class='mega-description'>
672	+ </div>
673	+ </td>
674	+ </tr>
675	+ <tr>
676	+ <td class='mega-name'>
677	+ <?php _e("CSS Output", "megamenu"); ?>
678	+ <div class='mega-description'>
679	+ </div>
680	+ </td>
681	+ <td class='mega-value'>
682	+ <select name='settings[css]' id='mega_css'>
683	+ <option value='fs' <?php echo selected( $css == 'fs'); ?>><?php _e("Save to filesystem", "megamenu"); ?></option>
684	+ <option value='head' <?php echo selected( $css == 'head'); ?>><?php _e("Output in <head>", "megamenu"); ?></option>
685	+ <option value='disabled' <?php echo selected( $css == 'disabled'); ?>><?php _e("Don't output CSS", "megamenu"); ?></option>
686	+ <select>
687	+ <div class='mega-description'>
688	+ <div class='fs' style='display: <?php echo $css == 'fs' ? 'block' : 'none' ?>'><?php _e("CSS will be saved to wp-content/uploads/maxmegamenu/style.css and enqueued from there.", "megamenu"); ?></div>
689	+ <div class='head' style='display: <?php echo $css == 'head' ? 'block' : 'none' ?>'><?php _e("CSS will be loaded from the cache in a <style> tag in the <head> of the page.", "megamenu"); ?></div>
690	+ <div class='disabled' style='display: <?php echo $css == 'disabled' ? 'block' : 'none' ?>'><?php _e("CSS will not be output, you must enqueue the CSS for the menu manually.", "megamenu"); ?></div>
691	+ </div>
692	+ </td>
693	+ </tr>
694	+ </table>
695	+
696	+ <h3 class='first'><?php _e("Menu Locations", "megamenu"); ?></h3>
697	+
698	+ <table>
699	+ <tr>
700	+ <td class='mega-name'>
701	+ <?php _e("Registered Menu Locations", "megamenu"); ?>
702	+ <div class='mega-description'><?php _e("An overview of the menu locations supported by your theme. You can enable Max Mega Menu and adjust the settings for a specific menu location by going to Appearance > Menus."); ?></div>
703	+ </td>
704	+ <td class='mega-value'>
705	+ <p>
706	+ <?php
707	+ $none = __("Your theme does not natively support menus, but you can add a new menu location using Max Mega Menu and display the menu using the Max Mega Menu widget or shortcode.", "megamenu");
708	+ $one = __("Your theme supports one menu.", "megamenu");
709	+ $some = __("Your theme supports {number} menus.", "megamenu");
710	+
711	+ if ( ! count($locations)) {
712	+ echo $none;
713	+ } else if ( count($locations) == 1) {
714	+ echo $one;
715	+ } else {
716	+ echo str_replace( "{number}", count( $locations ), $some );
717	+ }
718	+
719	+ $add_location_url = esc_url( add_query_arg(
720	+ array(
721	+ 'action'=>'megamenu_add_menu_location'
722	+ ),
723	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_add_menu_location' )
724	+ ) );
725	+ echo " <a href='{$add_location_url}'>" . __("Add another menu location.") . "</a>";
726	+
727	+ ?>
728	+ </p>
729	+
730	+ <?php
731	+
732	+ if ( count ( $locations ) ) {
733	+
734	+ echo "<div class='accordion-container'>";
735	+ echo "<ul class='outer-border'>";
736	+
737	+ foreach ( $locations as $location => $description ) {
738	+
739	+ $menu_id = $this->get_menu_id_for_location( $location );
740	+
741	+ $is_custom_location = strpos( $location, 'max_mega_menu_' ) !== FALSE;
742	+
743	+ ?>
744	+
745	+
746	+ <li class='control-section accordion-section mega-location'>
747	+ <h4 class='accordion-section-title hndle'>
748	+
749	+ <?php echo $description ?>
750	+
751	+ <?php
752	+
753	+ echo "<div class='mega-assigned-menu'>";
754	+ echo __("Menu", "megamenu") . ": ";
755	+
756	+ if ($menu_id) {
757	+ echo "<a href='" . admin_url("nav-menus.php?action=edit&menu={$menu_id}") . "'>" . $this->get_menu_name_for_location( $location ) . "</a>";
758	+ } else {
759	+ echo "<a href='" . admin_url('nav-menus.php?action=locations') . "'>" . __("Assign a menu", "megamenu") . "</a>";
760	+ }
761	+
762	+ echo "</div>";
763	+ ?>
764	+
765	+ </h4>
766	+ <div class='accordion-section-content'>
767	+
768	+ <table>
769	+ <?php if ( $is_custom_location ) : ?>
770	+ <tr>
771	+ <td class='mega-name'>
772	+ <?php _e("Location Description", "megamenu"); ?>
773	+ <div class='mega-description'><?php _e("Change the name of the location.", "megamenu"); ?></div>
774	+ </td>
775	+ <td class='mega-value wide'>
776	+ <input type='text' name='location[<?php echo $location ?>]' value='<?php echo $description; ?>' />
777	+ </td>
778	+ </tr>
779	+ <?php endif; ?>
780	+ </table>
781	+
782	+ <h5><?php _e("Menu Display Options", "megamenu"); ?></h5>
783	+
784	+ <?php if ( ! $is_custom_location ) : ?>
785	+ <p><?php _e("These options are for advanced users only. Your theme should already include the code required to display this menu on your site."); ?>
786	+ <?php endif; ?>
787	+
788	+ <table>
789	+ <tr>
790	+ <td class='mega-name'>
791	+ <?php _e("PHP Function", "megamenu"); ?>
792	+ <div class='mega-description'><?php _e("For use in a theme template (usually header.php)", "megamenu"); ?></div>
793	+ </td>
794	+ <td class='mega-value'>
795	+ <textarea><?php wp_nav_menu( array( 'theme_location' => '<?php echo $location ?>' ) ); ?></textarea>
796	+ </td>
797	+ </tr>
798	+ <tr>
799	+ <td class='mega-name'>
800	+ <?php _e("Shortcode", "megamenu"); ?>
801	+ <div class='mega-description'><?php _e("For use in a post or page.", "megamenu"); ?></div>
802	+ </td>
803	+ <td class='mega-value'>
804	+ <textarea>[maxmegamenu location=<?php echo $location ?>]</textarea>
805	+ </td>
806	+ </tr>
807	+ <tr>
808	+ <td class='mega-name'>
809	+ <?php _e("Widget", "megamenu"); ?>
810	+ <div class='mega-description'><?php _e("For use in a widget area.", "megamenu"); ?></div>
811	+ </td>
812	+ <td class='mega-value'>
813	+ <?php _e("Add the 'Max Mega Menu' widget to a widget area.", "megamenu") ?>
814	+ </td>
815	+ </tr>
816	+ </table>
817	+
818	+
819	+ <?php
820	+
821	+ if ( $is_custom_location ) {
822	+
823	+ $delete_location_url = esc_url( add_query_arg(
824	+ array(
825	+ 'action' => 'megamenu_delete_menu_location',
826	+ 'location' => $location
827	+ ),
828	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_delete_menu_location' )
829	+ ) );
830	+
831	+ echo "<a class='confirm mega-delete button button-secondary' href='{$delete_location_url}'>" . __("Delete location") . "</a>";
832	+
833	+ }
834	+
835	+ ?>
836	+
837	+ </div>
838	+ </li>
839	+ <?php
840	+ }
841	+
842	+ echo "</div>";
843	+ echo "</div>";
844	+
845	+ }?>
846	+
847	+ </td>
848	+ </tr>
849	+ </table>
850	+
851	+
852	+
853	+ <?php do_action( "megamenu_general_settings", $saved_settings ); ?>
854	+
855	+ <?php
856	+
857	+ submit_button();
858	+
859	+ ?>
860	+ </form>
861	+ </div>
862	+
863	+ <?php
864	+ }
865	+
866	+
867	+ /**
868	+ * Returns the menu ID for a specified menu location, defaults to 0
869	+ *
870	+ * @since 1.8
871	+ * @param string $location
872	+ */
873	+ private function get_menu_id_for_location( $location ) {
874	+
875	+ $locations = get_nav_menu_locations();
876	+
877	+ $id = isset( $locations[ $location ] ) ? $locations[ $location ] : 0;
878	+
879	+ return $id;
880	+
881	+ }
882	+
883	+ /**
884	+ * Returns the menu name for a specified menu location
885	+ *
886	+ * @since 1.8
887	+ * @param string $location
888	+ */
889	+ private function get_menu_name_for_location( $location ) {
890	+
891	+ $id = $this->get_menu_id_for_location( $location );
892	+
893	+ $menus = wp_get_nav_menus();
894	+
895	+ foreach ( $menus as $menu ) {
896	+ if ( $menu->term_id == $id ) {
897	+ return $menu->name;
898	+ }
899	+ }
900	+
901	+ return false;
902	+ }
903	+
904	+
905	+ /**
906	+ * Content for 'Tools' tab
907	+ *
908	+ * @since 1.4
909	+ */
910	+ public function tools_page( $saved_settings ) {
911	+
912	+ ?>
913	+
914	+ <div class='menu_settings'>
915	+
916	+ <h3 class='first'><?php _e("Tools", "megamenu"); ?></h3>
917	+
918	+ <table>
919	+ <tr>
920	+ <td class='mega-name'>
921	+ <?php _e("Cache", "megamenu"); ?>
922	+ <div class='mega-description'><?php _e("Use this tool to clear the CSS cache.", "megamenu"); ?></div>
923	+ </td>
924	+ <td class='mega-value'>
925	+ <form action="<?php echo admin_url('admin-post.php'); ?>" method="post">
926	+ <?php wp_nonce_field( 'megamenu_clear_css_cache' ); ?>
927	+ <input type="hidden" name="action" value="megamenu_clear_css_cache" />
928	+
929	+ <input type='submit' class='button button-secondary' value='<?php _e("Clear CSS Cache", "megamenu"); ?>' />
930	+ </form>
931	+ </td>
932	+ </tr>
933	+ <tr>
934	+ <td class='mega-name'>
935	+ <?php _e("Plugin Data", "megamenu"); ?>
936	+ <div class='mega-description'><?php _e("Delete all saved Max Mega Menu plugin data from the database. Use with caution!", "megamenu"); ?></div>
937	+ </td>
938	+ <td class='mega-value'>
939	+ <form action="<?php echo admin_url('admin-post.php'); ?>" method="post">
940	+ <?php wp_nonce_field( 'megamenu_delete_data' ); ?>
941	+ <input type="hidden" name="action" value="megamenu_delete_data" />
942	+
943	+ <input type='submit' class='button button-secondary confirm' value='<?php _e("Delete Data", "megamenu"); ?>' />
944	+ </form>
945	+ </td>
946	+ </tr>
947	+ <tr>
948	+ <td class='mega-name'>
949	+ <?php _e("Export Theme", "megamenu"); ?>
950	+ <div class='mega-description'><?php _e("Export a menu theme", "megamenu"); ?></div>
951	+ </td>
952	+ <td class='mega-value'>
953	+ <form method="post" action="<?php admin_url( "admin.php?page=maxmegamenu&tab=tools") ?>">
954	+
955	+ <?php
956	+
957	+ if ( isset( $_POST['theme_export'] ) ) {
958	+
959	+ $style_manager = new Mega_Menu_Style_Manager();
960	+
961	+ $default_theme = $style_manager->get_default_theme();
962	+
963	+ $theme_to_export = $_POST['theme_export'];
964	+
965	+ if ( isset( $this->themes[ $theme_to_export ] ) ) {
966	+
967	+ $theme_to_export = $this->themes[ $theme_to_export ];
968	+
969	+ $diff = array();
970	+
971	+ foreach ( $default_theme as $key => $value ) {
972	+ if ( isset( $theme_to_export[$key] ) && $theme_to_export[$key] != $value) {
973	+ $diff[$key] = $theme_to_export[$key];
974	+ }
975	+ }
976	+ if ( isset( $_POST['json'] ) ) {
977	+
978	+ echo "<p>" . __("Log into the site you wish to import the theme to. Go to Mega Menu > Tools and paste this into the 'Import Theme' text area:") . "</p>";
979	+
980	+ echo "<textarea>" . htmlentities( json_encode( $diff ) ) . "</textarea>";
981	+
982	+ } else {
983	+ $key = strtolower( str_replace(" ", "_", $theme_to_export['title'] ) );
984	+
985	+ $key .= "_" . time();
986	+
987	+ echo "<p>" . __("Paste this code into your themes functions.php file:") . "</p>";
988	+
989	+ echo '<textarea>';
990	+ echo 'function megamenu_add_theme_' . $key . '($themes) {';
991	+ echo "\n" . ' $themes["' . $key .'"] = array(';
992	+
993	+ foreach ($diff as $theme_key => $value) {
994	+ echo "\n '" . $theme_key . "' => '" . $value . "',";
995	+ }
996	+
997	+ echo "\n" . ' );';
998	+ echo "\n" . ' return $themes;';
999	+ echo "\n" . '}';
1000	+ echo "\n" . 'add_filter("megamenu_themes", "megamenu_add_theme_' . $key . '");';
1001	+ echo '</textarea>';
1002	+
1003	+ }
1004	+
1005	+ }
1006	+ } else {
1007	+
1008	+ echo "<select name='theme_export'>";
1009	+ foreach ( $this->themes as $id => $theme ) {
1010	+ echo "<option value='{$id}'>{$theme['title']}</option>";
1011	+ }
1012	+ echo "</select>";
1013	+
1014	+ echo "<h4>" . __("Export Format", "megamenu") . "</h4>";
1015	+ echo "<input value='json' type='radio' name='format'>" . __("JSON - I want to import this theme into another site I'm developing") . "<br />";
1016	+ echo "<input value='php' type='radio' name='format'>" . __("PHP - I want to distribute this Menu Theme in a WordPress Theme I'm developing") . "<br />";
1017	+
1018	+ echo "<input type='submit' name='export' class='button button-secondary' value='" . __("Export Theme", "megamenu") . "' />";
1019	+
1020	+ }
1021	+
1022	+ ?>
1023	+ </form>
1024	+ </td>
1025	+ </tr>
1026	+ <tr>
1027	+ <td class='mega-name'>
1028	+ <?php _e("Import Theme", "megamenu"); ?>
1029	+ <div class='mega-description'><?php _e("Import a menu theme", "megamenu"); ?></div>
1030	+ </td>
1031	+ <td class='mega-value'>
1032	+ <form action="<?php echo admin_url('admin-post.php'); ?>" method="post">
1033	+ <?php wp_nonce_field( 'megamenu_import_theme' ); ?>
1034	+ <input type="hidden" name="action" value="megamenu_import_theme" />
1035	+ <textarea name='data'></textarea>
1036	+ <input type='submit' class='button button-secondary' value='<?php _e("Import Theme", "megamenu"); ?>' />
1037	+ </form>
1038	+ </td>
1039	+ </tr>
1040	+ </table>
1041	+ </div>
1042	+
1043	+ <?php
1044	+ }
1045	+
1046	+
1047	+ /**
1048	+ * Main settings page wrapper.
1049	+ *
1050	+ * @since 1.4
1051	+ */
1052	+ public function page() {
1053	+
1054	+ $tab = isset( $_GET['page'] ) ? substr( $_GET['page'], 12 ) : false;
1055	+
1056	+ // backwards compatibility
1057	+ if ( isset ( $_GET['tab'] ) ) {
1058	+ $tab = $_GET['tab'];
1059	+ }
1060	+
1061	+ if ( ! $tab ) {
1062	+ $tab = 'general_settings';
1063	+ }
1064	+
1065	+ $header_links = apply_filters( "megamenu_header_links", array(
1066	+ 'homepage' => array(
1067	+ 'url' => 'https://www.maxmegamenu.com/?utm_source=free&utm_medium=link&utm_campaign=pro',
1068	+ 'target' => '_mmmpro',
1069	+ 'text' => __("Homepage", "megamenu"),
1070	+ 'class' => ''
1071	+ ),
1072	+ 'documentation' => array(
1073	+ 'url' => 'https://www.maxmegamenu.com/documentation/getting-started/installation/?utm_source=free&utm_medium=link&utm_campaign=pro',
1074	+ 'text' => __("Documentation", "megamenu"),
1075	+ 'target' => '_mmmpro',
1076	+ 'class' => ''
1077	+ )
1078	+ ) );
1079	+
1080	+ if ( ! is_plugin_active('megamenu-pro/megamenu-pro.php') ) {
1081	+ $header_links['pro'] = array(
1082	+ 'url' => 'https://www.maxmegamenu.com/upgrade/?utm_source=free&utm_medium=link&utm_campaign=pro',
1083	+ 'target' => '_mmmpro',
1084	+ 'text' => __("Upgrade to Pro - $19", "megamenu"),
1085	+ 'class' => 'mega-highlight'
1086	+ );
1087	+ }
1088	+
1089	+ $versions = apply_filters( "megamenu_versions", array(
1090	+ 'core' => array(
1091	+ 'version' => MEGAMENU_VERSION,
1092	+ 'text' => __("Core version", "megamenu")
1093	+ ),
1094	+ 'pro' => array(
1095	+ 'version' => "<a href='https://www.maxmegamenu.com/upgrade/?utm_source=free&utm_medium=link&utm_campaign=pro' target='_mmmpro'>not installed</a>",
1096	+ 'text' => __("Pro extension", "megamenu")
1097	+ )
1098	+ ) );
1099	+
1100	+ ?>
1101	+
1102	+ <div class='megamenu_outer_wrap'>
1103	+ <div class='megamenu_header_top'>
1104	+ <ul>
1105	+ <?php
1106	+ foreach ( $header_links as $id => $data ) {
1107	+ echo "<li class='{$data['class']}'><a href='{$data['url']}' target='{$data['target']}'>{$data['text']}";
1108	+ echo "</a>";
1109	+ echo "</li>";
1110	+ }
1111	+ ?>
1112	+ </ul>
1113	+ </div>
1114	+ <div class='megamenu_header'>
1115	+ <div class='megamenu_header_left'>
1116	+ <h2><?php _e("Max Mega Menu", "megamenu"); ?></h2>
1117	+ <div class='version'>
1118	+ <?php
1119	+
1120	+ $total = count( $versions );
1121	+ $count = 0;
1122	+ $separator = ' - ';
1123	+
1124	+ foreach ( $versions as $id => $data ) {
1125	+ echo $data['text'] . ": <b>" . $data['version'] . "</b>";
1126	+
1127	+ $count = $count + 1;
1128	+
1129	+ if ( $total > 0 && $count != $total ) {
1130	+ echo $separator;
1131	+ }
1132	+ }
1133	+ ?>
1134	+ </div>
1135	+ </div>
1136	+ </div>
1137	+ <div class='megamenu_wrap'>
1138	+ <div class='megamenu_right'>
1139	+ <?php $this->print_messages(); ?>
1140	+
1141	+ <?php
1142	+
1143	+ $saved_settings = get_option("megamenu_settings");
1144	+
1145	+ if ( has_action( "megamenu_page_{$tab}" ) ) {
1146	+ do_action( "megamenu_page_{$tab}", $saved_settings );
1147	+ } else {
1148	+ do_action( "megamenu_page_general_settings", $saved_settings );
1149	+ }
1150	+
1151	+ ?>
1152	+ </div>
1153	+ </div>
1154	+
1155	+ <div class='megamenu_left'>
1156	+ <ul>
1157	+ <?php
1158	+
1159	+ $tabs = apply_filters("megamenu_menu_tabs", array(
1160	+ 'general_settings' => __("General Settings", "megamenu"),
1161	+ 'theme_editor' => __("Menu Themes", "megamenu"),
1162	+ 'tools' => __("Tools", "megamenu")
1163	+ ));
1164	+
1165	+ foreach ( $tabs as $key => $title ) {
1166	+ $class = $tab == $key ? 'active' : '';
1167	+
1168	+
1169	+ if ( $key == 'general_settings' ) {
1170	+ $args = array( 'page' => 'maxmegamenu' );
1171	+ } else {
1172	+ $args = array( 'page' => 'maxmegamenu_' . $key );
1173	+ }
1174	+
1175	+ $url = esc_url( add_query_arg( $args, admin_url("admin.php") ) );
1176	+
1177	+ echo "<li><a class='{$class}' href='{$url}'>{$title}</a></li>";
1178	+ }
1179	+
1180	+ ?>
1181	+ </ul>
1182	+ </div>
1183	+
1184	+ </div>
1185	+
1186	+ <?php
1187	+ }
1188	+
1189	+
1190	+ /**
1191	+ * Display messages to the user
1192	+ *
1193	+ * @since 1.0
1194	+ */
1195	+ public function print_messages() {
1196	+
1197	+ $this->init();
1198	+
1199	+ $style_manager = new Mega_Menu_Style_Manager();
1200	+
1201	+ $menu_id = 0;
1202	+
1203	+ $menus = get_registered_nav_menus();
1204	+
1205	+ if ( count( $menus ) ) {
1206	+
1207	+ $locations = get_nav_menu_locations();
1208	+
1209	+ foreach ($menus as $location => $description ) {
1210	+
1211	+ if ( isset( $locations[ $location ] ) ) {
1212	+
1213	+ $menu_id = $locations[ $location ];
1214	+ continue;
1215	+
1216	+ }
1217	+
1218	+ }
1219	+
1220	+ }
1221	+
1222	+ $test = $style_manager->generate_css_for_location( 'test', $this->active_theme, $menu_id );
1223	+
1224	+ if ( is_wp_error( $test ) ) {
1225	+ echo "<p class='fail'>" . $test->get_error_message() . "</p>";
1226	+ }
1227	+
1228	+ if ( isset( $_GET['deleted'] ) && $_GET['deleted'] == 'false' ) {
1229	+ echo "<p class='fail'>" . __("Failed to delete theme. The theme is in use by a menu.", "megamenu") . "</p>";
1230	+ }
1231	+
1232	+ if ( isset( $_GET['clear_css_cache'] ) && $_GET['clear_css_cache'] == 'true' ) {
1233	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("CSS cache cleared", "megamenu") . "</p>";
1234	+ }
1235	+
1236	+ if ( isset( $_GET['delete_data'] ) && $_GET['delete_data'] == 'true' ) {
1237	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("All plugin data removed", "megamenu") . "</p>";
1238	+ }
1239	+
1240	+ if ( isset( $_GET['deleted'] ) && $_GET['deleted'] == 'true' ) {
1241	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Theme Deleted", "megamenu") . "</p>";
1242	+ }
1243	+
1244	+ if ( isset( $_GET['duplicated'] ) ) {
1245	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Theme Duplicated", "megamenu") . "</p>";
1246	+ }
1247	+
1248	+ if ( isset( $_GET['saved'] ) ) {
1249	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Changes Saved", "megamenu") . "</p>";
1250	+ }
1251	+
1252	+ if ( isset( $_GET['reverted'] ) ) {
1253	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Theme Reverted", "megamenu") . "</p>";
1254	+ }
1255	+
1256	+ if ( isset( $_GET['created'] ) ) {
1257	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("New Theme Created", "megamenu") . "</p>";
1258	+ }
1259	+
1260	+ if ( isset( $_GET['add_location'] ) ) {
1261	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("New Menu Location Created", "megamenu") . "</p>";
1262	+ }
1263	+
1264	+ if ( isset( $_GET['delete_location'] ) ) {
1265	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Menu Location Deleted", "megamenu") . "</p>";
1266	+ }
1267	+
1268	+ if ( isset( $_GET['theme_imported'] ) && $_GET['theme_imported'] == 'true' ) {
1269	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Theme Imported", "megamenu") . "</p>";
1270	+ }
1271	+
1272	+ if ( isset( $_GET['theme_imported'] ) && $_GET['theme_imported'] == 'false' ) {
1273	+ echo "<p class='fail'>" . __("Theme Import Failed", "megamenu") . "</p>";
1274	+ }
1275	+
1276	+ if ( isset( $_POST['theme_export'] ) ) {
1277	+ echo "<p class='success'><i class='dashicons dashicons-yes'></i>" . __("Theme Exported", "megamenu") . "</p>";
1278	+ }
1279	+
1280	+ do_action("megamenu_print_messages");
1281	+
1282	+ }
1283	+
1284	+
1285	+ /**
1286	+ * Lists the available themes
1287	+ *
1288	+ * @since 1.0
1289	+ */
1290	+ public function theme_selector() {
1291	+
1292	+ $list_items = "<select id='theme_selector'>";
1293	+
1294	+ foreach ( $this->themes as $id => $theme ) {
1295	+
1296	+ $locations = $this->theme_is_being_used_by_location( $id );
1297	+
1298	+ $selected = $id == $this->id ? 'selected=selected' : '';
1299	+
1300	+ $list_items .= "<option {$selected} value='" . admin_url("admin.php?page=maxmegamenu_theme_editor&theme={$id}") . "'>";
1301	+ $list_items .= $theme['title'];
1302	+
1303	+ if ( is_array( $locations ) ) {
1304	+ $list_items .= " (" . implode( ", ", $locations ) . ")";
1305	+ }
1306	+
1307	+ $list_items .= "</option>";
1308	+ }
1309	+
1310	+ return $list_items .= "</select>";
1311	+
1312	+ }
1313	+
1314	+ /**
1315	+ * Checks to see if a given string contains any of the provided search terms
1316	+ *
1317	+ * @param srgin $key
1318	+ * @param array $needles
1319	+ * @since 1.0
1320	+ */
1321	+ private function string_contains( $key, $needles ) {
1322	+
1323	+ foreach ( $needles as $needle ) {
1324	+
1325	+ if ( strpos( $key, $needle ) !== FALSE ) {
1326	+ return true;
1327	+ }
1328	+ }
1329	+
1330	+ return false;
1331	+
1332	+ }
1333	+
1334	+
1335	+ /**
1336	+ * Displays the theme editor form.
1337	+ *
1338	+ * @since 1.0
1339	+ */
1340	+ public function theme_editor_page( $saved_settings ) {
1341	+
1342	+ $this->init();
1343	+
1344	+ $create_url = esc_url( add_query_arg(
1345	+ array(
1346	+ 'action'=>'megamenu_add_theme'
1347	+ ),
1348	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_create_theme' )
1349	+ ) );
1350	+
1351	+ $duplicate_url = esc_url( add_query_arg(
1352	+ array(
1353	+ 'action'=>'megamenu_duplicate_theme',
1354	+ 'theme_id' => $this->id
1355	+ ),
1356	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_duplicate_theme' )
1357	+ ) );
1358	+
1359	+ $delete_url = esc_url( add_query_arg(
1360	+ array(
1361	+ 'action'=>'megamenu_delete_theme',
1362	+ 'theme_id' => $this->id
1363	+ ),
1364	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_delete_theme' )
1365	+ ) );
1366	+
1367	+ $revert_url = esc_url( add_query_arg(
1368	+ array(
1369	+ 'action'=>'megamenu_revert_theme',
1370	+ 'theme_id' => $this->id
1371	+ ),
1372	+ wp_nonce_url( admin_url("admin-post.php"), 'megamenu_revert_theme' )
1373	+ ) );
1374	+
1375	+ ?>
1376	+
1377	+ <div class='menu_settings'>
1378	+
1379	+ <div class='theme_selector'>
1380	+ <?php _e("Select theme to edit", "megamenu"); ?> <?php echo $this->theme_selector(); ?> <?php _e("or", "megamenu"); ?>
1381	+ <a href='<?php echo $create_url ?>'><?php _e("create a new theme", "megamenu"); ?></a> <?php _e("or", "megamenu"); ?>
1382	+ <a href='<?php echo $duplicate_url ?>'><?php _e("duplicate this theme", "megamenu"); ?></a>
1383	+ </div>
1384	+
1385	+ <h3 class='editing_theme'><?php echo __("Editing theme", "megamenu") . ": " . $this->active_theme['title']; ?></h3>
1386	+
1387	+ <form action="<?php echo admin_url('admin-post.php'); ?>" method="post" class="theme_editor">
1388	+ <input type="hidden" name="theme_id" value="<?php echo $this->id; ?>" />
1389	+ <input type="hidden" name="action" value="megamenu_save_theme" />
1390	+ <?php wp_nonce_field( 'megamenu_save_theme' ); ?>
1391	+
1392	+ <?php
1393	+
1394	+ $settings = apply_filters( 'megamenu_theme_editor_settings', array(
1395	+
1396	+ 'general' => array(
1397	+ 'title' => __( "General Theme Settings", "megamenu" ),
1398	+ 'settings' => array(
1399	+ 'title' => array(
1400	+ 'priority' => 10,
1401	+ 'title' => __( "Theme Title", "megamenu" ),
1402	+ 'description' => __( "", "megamenu" ),
1403	+ 'settings' => array(
1404	+ array(
1405	+ 'title' => __( "", "megamenu" ),
1406	+ 'type' => 'freetext',
1407	+ 'key' => 'title'
1408	+ )
1409	+ )
1410	+ ),
1411	+ 'arrow' => array(
1412	+ 'priority' => 20,
1413	+ 'title' => __( "Arrow", "megamenu" ),
1414	+ 'description' => __( "Select the arrow styles.", "megamenu" ),
1415	+ 'settings' => array(
1416	+ array(
1417	+ 'title' => __( "Up", "megamenu" ),
1418	+ 'type' => 'arrow',
1419	+ 'key' => 'arrow_up'
1420	+ ),
1421	+ array(
1422	+ 'title' => __( "Down", "megamenu" ),
1423	+ 'type' => 'arrow',
1424	+ 'key' => 'arrow_down'
1425	+ ),
1426	+ array(
1427	+ 'title' => __( "Left", "megamenu" ),
1428	+ 'type' => 'arrow',
1429	+ 'key' => 'arrow_left'
1430	+ ),
1431	+ array(
1432	+ 'title' => __( "Right", "megamenu" ),
1433	+ 'type' => 'arrow',
1434	+ 'key' => 'arrow_right'
1435	+ )
1436	+ )
1437	+ ),
1438	+ 'line_height' => array(
1439	+ 'priority' => 30,
1440	+ 'title' => __( "Line Height", "megamenu" ),
1441	+ 'description' => __( "Set the general line height to use in the panel contents.", "megamenu" ),
1442	+ 'settings' => array(
1443	+ array(
1444	+ 'title' => __( "", "megamenu" ),
1445	+ 'type' => 'freetext',
1446	+ 'key' => 'line_height'
1447	+ )
1448	+ )
1449	+ ),
1450	+ 'z_index' => array(
1451	+ 'priority' => 40,
1452	+ 'title' => __( "Z Index", "megamenu" ),
1453	+ 'description' => __( "Set the z-index to ensure the panels appear ontop of other content.", "megamenu" ),
1454	+ 'settings' => array(
1455	+ array(
1456	+ 'title' => __( "", "megamenu" ),
1457	+ 'type' => 'freetext',
1458	+ 'key' => 'z_index',
1459	+ 'validation' => 'int'
1460	+ )
1461	+ )
1462	+ ),
1463	+ 'shadow' => array(
1464	+ 'priority' => 50,
1465	+ 'title' => __( "Shadow", "megamenu" ),
1466	+ 'description' => __( "Apply a shadow to mega and flyout menus.", "megamenu" ),
1467	+ 'settings' => array(
1468	+ array(
1469	+ 'title' => __( "Enabled", "megamenu" ),
1470	+ 'type' => 'checkbox',
1471	+ 'key' => 'shadow'
1472	+ ),
1473	+ array(
1474	+ 'title' => __( "Horizontal", "megamenu" ),
1475	+ 'type' => 'freetext',
1476	+ 'key' => 'shadow_horizontal',
1477	+ 'validation' => 'px'
1478	+ ),
1479	+ array(
1480	+ 'title' => __( "Vertical", "megamenu" ),
1481	+ 'type' => 'freetext',
1482	+ 'key' => 'shadow_vertical',
1483	+ 'validation' => 'px'
1484	+ ),
1485	+ array(
1486	+ 'title' => __( "Blur", "megamenu" ),
1487	+ 'type' => 'freetext',
1488	+ 'key' => 'shadow_blur',
1489	+ 'validation' => 'px'
1490	+ ),
1491	+ array(
1492	+ 'title' => __( "Spread", "megamenu" ),
1493	+ 'type' => 'freetext',
1494	+ 'key' => 'shadow_spread',
1495	+ 'validation' => 'px'
1496	+ ),
1497	+ array(
1498	+ 'title' => __( "Color", "megamenu" ),
1499	+ 'type' => 'color',
1500	+ 'key' => 'shadow_color'
1501	+ )
1502	+ )
1503	+ ),
1504	+ 'transitions' => array(
1505	+ 'priority' => 60,
1506	+ 'title' => __( "Hover Transitions", "megamenu" ),
1507	+ 'description' => __( "Apply hover transitions to menu items. Note: Transitions will not apply to gradient backgrounds.", "megamenu" ),
1508	+ 'settings' => array(
1509	+ array(
1510	+ 'title' => __( "Enabled", "megamenu" ),
1511	+ 'type' => 'checkbox',
1512	+ 'key' => 'transitions'
1513	+ )
1514	+ )
1515	+ ),
1516	+ 'resets' => array(
1517	+ 'priority' => 70,
1518	+ 'title' => __( "Reset Widget Styling", "megamenu" ),
1519	+ 'description' => __( "Reset the styling of widgets within the mega menu?", "megamenu" ),
1520	+ 'settings' => array(
1521	+ array(
1522	+ 'title' => __( "Enabled", "megamenu" ),
1523	+ 'type' => 'checkbox',
1524	+ 'key' => 'resets'
1525	+ )
1526	+ )
1527	+ )
1528	+ )
1529	+ ),
1530	+ 'menu_bar' => array(
1531	+ 'title' => __( "Menu Bar", "megamenu" ),
1532	+ 'settings' => array(
1533	+ 'menu_background' => array(
1534	+ 'priority' => 10,
1535	+ 'title' => __( "Menu Background", "megamenu" ),
1536	+ 'description' => __( "The background color for the main menu bar. Set each value to transparent for a 'button' style menu.", "megamenu" ),
1537	+ 'settings' => array(
1538	+ array(
1539	+ 'title' => __( "From", "megamenu" ),
1540	+ 'type' => 'color',
1541	+ 'key' => 'container_background_from'
1542	+ ),
1543	+ array(
1544	+ 'title' => __( "To", "megamenu" ),
1545	+ 'type' => 'color',
1546	+ 'key' => 'container_background_to'
1547	+ )
1548	+ )
1549	+ ),
1550	+ 'menu_padding' => array(
1551	+ 'priority' => 20,
1552	+ 'title' => __( "Menu Padding", "megamenu" ),
1553	+ 'description' => __( "Padding for the main menu bar.", "megamenu" ),
1554	+ 'settings' => array(
1555	+ array(
1556	+ 'title' => __( "Top", "megamenu" ),
1557	+ 'type' => 'freetext',
1558	+ 'key' => 'container_padding_top',
1559	+ 'validation' => 'px'
1560	+ ),
1561	+ array(
1562	+ 'title' => __( "Right", "megamenu" ),
1563	+ 'type' => 'freetext',
1564	+ 'key' => 'container_padding_right',
1565	+ 'validation' => 'px'
1566	+ ),
1567	+ array(
1568	+ 'title' => __( "Bottom", "megamenu" ),
1569	+ 'type' => 'freetext',
1570	+ 'key' => 'container_padding_bottom',
1571	+ 'validation' => 'px'
1572	+ ),
1573	+ array(
1574	+ 'title' => __( "Left", "megamenu" ),
1575	+ 'type' => 'freetext',
1576	+ 'key' => 'container_padding_left',
1577	+ 'validation' => 'px'
1578	+ )
1579	+ )
1580	+ ),
1581	+ 'menu_border_radius' => array(
1582	+ 'priority' => 30,
1583	+ 'title' => __( "Menu Border Radius", "megamenu" ),
1584	+ 'description' => __( "Set a border radius on the main menu bar.", "megamenu" ),
1585	+ 'settings' => array(
1586	+ array(
1587	+ 'title' => __( "Top Left", "megamenu" ),
1588	+ 'type' => 'freetext',
1589	+ 'key' => 'container_border_radius_top_left',
1590	+ 'validation' => 'px'
1591	+ ),
1592	+ array(
1593	+ 'title' => __( "Top Right", "megamenu" ),
1594	+ 'type' => 'freetext',
1595	+ 'key' => 'container_border_radius_top_right',
1596	+ 'validation' => 'px'
1597	+ ),
1598	+ array(
1599	+ 'title' => __( "Bottom Right", "megamenu" ),
1600	+ 'type' => 'freetext',
1601	+ 'key' => 'container_border_radius_bottom_right',
1602	+ 'validation' => 'px'
1603	+ ),
1604	+ array(
1605	+ 'title' => __( "Bottom Left", "megamenu" ),
1606	+ 'type' => 'freetext',
1607	+ 'key' => 'container_border_radius_bottom_left',
1608	+ 'validation' => 'px'
1609	+ )
1610	+ )
1611	+ ),
1612	+ 'menu_item_align' => array(
1613	+ 'priority' => 40,
1614	+ 'title' => __( "Menu Items Align", "megamenu" ),
1615	+ 'description' => __( "Align <i>all</i> menu items to the left (default), centrally or to the right.", "megamenu" ),
1616	+ 'info' => array( __( "This option will apply to all menu items. To align an individual menu item to the right, edit the menu item itself and set 'Menu Item Align' to 'Right'.", "megamenu" ) ),
1617	+ 'settings' => array(
1618	+ array(
1619	+ 'title' => __( "", "megamenu" ),
1620	+ 'type' => 'align',
1621	+ 'key' => 'menu_item_align'
1622	+ )
1623	+ )
1624	+ ),
1625	+ 'top_level_menu_items' => array(
1626	+ 'priority' => 50,
1627	+ 'title' => __( "Top Level Menu Items", "megamenu" ),
1628	+ 'description' => '',
1629	+ ),
1630	+ 'menu_item_background' => array(
1631	+ 'priority' => 60,
1632	+ 'title' => __( "Menu Item Background", "megamenu" ),
1633	+ 'description' => __( "The background color for each top level menu item. Tip: Set these values to transparent if you've already set a background color on the menu bar.", "megamenu" ),
1634	+ 'settings' => array(
1635	+ array(
1636	+ 'title' => __( "From", "megamenu" ),
1637	+ 'type' => 'color',
1638	+ 'key' => 'menu_item_background_from'
1639	+ ),
1640	+ array(
1641	+ 'title' => __( "To", "megamenu" ),
1642	+ 'type' => 'color',
1643	+ 'key' => 'menu_item_background_to'
1644	+ )
1645	+ )
1646	+ ),
1647	+ 'menu_item_background_hover' => array(
1648	+ 'priority' => 70,
1649	+ 'title' => __( "Menu Item Background (Hover)", "megamenu" ),
1650	+ 'description' => __( "The background color for a top level menu item (on hover).", "megamenu" ),
1651	+ 'settings' => array(
1652	+ array(
1653	+ 'title' => __( "From", "megamenu" ),
1654	+ 'type' => 'color',
1655	+ 'key' => 'menu_item_background_hover_from'
1656	+ ),
1657	+ array(
1658	+ 'title' => __( "To", "megamenu" ),
1659	+ 'type' => 'color',
1660	+ 'key' => 'menu_item_background_hover_to'
1661	+ )
1662	+ )
1663	+ ),
1664	+ 'menu_item_spacing' => array(
1665	+ 'priority' => 80,
1666	+ 'title' => __( "Menu Item Spacing", "megamenu" ),
1667	+ 'description' => __( "Define the size of the gap between each top level menu item.", "megamenu" ),
1668	+ 'settings' => array(
1669	+ array(
1670	+ 'title' => __( "", "megamenu" ),
1671	+ 'type' => 'freetext',
1672	+ 'key' => 'menu_item_spacing',
1673	+ 'validation' => 'px'
1674	+ )
1675	+ )
1676	+ ),
1677	+ 'menu_item_height' => array(
1678	+ 'priority' => 90,
1679	+ 'title' => __( "Menu Item Height", "megamenu" ),
1680	+ 'description' => __( "Define the height of each top level menu item. This value, plus the container top and bottom padding values define the overall height of the menu bar.", "megamenu" ),
1681	+ 'settings' => array(
1682	+ array(
1683	+ 'title' => __( "", "megamenu" ),
1684	+ 'type' => 'freetext',
1685	+ 'key' => 'menu_item_link_height',
1686	+ 'validation' => 'px'
1687	+ )
1688	+ )
1689	+ ),
1690	+ 'menu_item_font' => array(
1691	+ 'priority' => 100,
1692	+ 'title' => __( "Font", "megamenu" ),
1693	+ 'description' => __( "The font to use for each top level menu item.", "megamenu" ),
1694	+ 'settings' => array(
1695	+ array(
1696	+ 'title' => __( "Color", "megamenu" ),
1697	+ 'type' => 'color',
1698	+ 'key' => 'menu_item_link_color'
1699	+ ),
1700	+ array(
1701	+ 'title' => __( "Size", "megamenu" ),
1702	+ 'type' => 'freetext',
1703	+ 'key' => 'menu_item_link_font_size',
1704	+ 'validation' => 'px'
1705	+ ),
1706	+ array(
1707	+ 'title' => __( "Family", "megamenu" ),
1708	+ 'type' => 'font',
1709	+ 'key' => 'menu_item_link_font'
1710	+ ),
1711	+ array(
1712	+ 'title' => __( "Transform", "megamenu" ),
1713	+ 'type' => 'transform',
1714	+ 'key' => 'menu_item_link_text_transform'
1715	+ ),
1716	+ array(
1717	+ 'title' => __( "Weight", "megamenu" ),
1718	+ 'type' => 'weight',
1719	+ 'key' => 'menu_item_link_weight'
1720	+ ),
1721	+ array(
1722	+ 'title' => __( "Decoration", "megamenu" ),
1723	+ 'type' => 'decoration',
1724	+ 'key' => 'menu_item_link_text_decoration'
1725	+ ),
1726	+ )
1727	+ ),
1728	+ 'menu_item_font_hover' => array(
1729	+ 'priority' => 110,
1730	+ 'title' => __( "Font (Hover)", "megamenu" ),
1731	+ 'description' => __( "Set the font to use for each top level menu item (on hover).", "megamenu" ),
1732	+ 'settings' => array(
1733	+ array(
1734	+ 'title' => __( "Color", "megamenu" ),
1735	+ 'type' => 'color',
1736	+ 'key' => 'menu_item_link_color_hover'
1737	+ ),
1738	+ array(
1739	+ 'title' => __( "Weight", "megamenu" ),
1740	+ 'type' => 'weight',
1741	+ 'key' => 'menu_item_link_weight_hover'
1742	+ ),
1743	+ array(
1744	+ 'title' => __( "Decoration", "megamenu" ),
1745	+ 'type' => 'decoration',
1746	+ 'key' => 'menu_item_link_text_decoration_hover'
1747	+ ),
1748	+ )
1749	+ ),
1750	+ 'menu_item_padding' => array(
1751	+ 'priority' => 120,
1752	+ 'title' => __( "Menu Item Padding", "megamenu" ),
1753	+ 'description' => __( "Set the padding for each top level menu item.", "megamenu" ),
1754	+ 'settings' => array(
1755	+ array(
1756	+ 'title' => __( "Top", "megamenu" ),
1757	+ 'type' => 'freetext',
1758	+ 'key' => 'menu_item_link_padding_top',
1759	+ 'validation' => 'px'
1760	+ ),
1761	+ array(
1762	+ 'title' => __( "Right", "megamenu" ),
1763	+ 'type' => 'freetext',
1764	+ 'key' => 'menu_item_link_padding_right',
1765	+ 'validation' => 'px'
1766	+ ),
1767	+ array(
1768	+ 'title' => __( "Bottom", "megamenu" ),
1769	+ 'type' => 'freetext',
1770	+ 'key' => 'menu_item_link_padding_bottom',
1771	+ 'validation' => 'px'
1772	+ ),
1773	+ array(
1774	+ 'title' => __( "Left", "megamenu" ),
1775	+ 'type' => 'freetext',
1776	+ 'key' => 'menu_item_link_padding_left',
1777	+ 'validation' => 'px'
1778	+ )
1779	+ )
1780	+ ),
1781	+ 'menu_item_border' => array(
1782	+ 'priority' => 130,
1783	+ 'title' => __( "Menu Item Border", "megamenu" ),
1784	+ 'description' => __( "Set the border to display on each top level menu item.", "megamenu" ),
1785	+ 'settings' => array(
1786	+ array(
1787	+ 'title' => __( "Color", "megamenu" ),
1788	+ 'type' => 'color',
1789	+ 'key' => 'menu_item_border_color'
1790	+ ),
1791	+ array(
1792	+ 'title' => __( "Top", "megamenu" ),
1793	+ 'type' => 'freetext',
1794	+ 'key' => 'menu_item_border_top',
1795	+ 'validation' => 'px'
1796	+ ),
1797	+ array(
1798	+ 'title' => __( "Right", "megamenu" ),
1799	+ 'type' => 'freetext',
1800	+ 'key' => 'menu_item_border_right',
1801	+ 'validation' => 'px'
1802	+ ),
1803	+ array(
1804	+ 'title' => __( "Bottom", "megamenu" ),
1805	+ 'type' => 'freetext',
1806	+ 'key' => 'menu_item_border_bottom',
1807	+ 'validation' => 'px'
1808	+ ),
1809	+ array(
1810	+ 'title' => __( "Left", "megamenu" ),
1811	+ 'type' => 'freetext',
1812	+ 'key' => 'menu_item_border_left',
1813	+ 'validation' => 'px'
1814	+ )
1815	+ )
1816	+ ),
1817	+ 'menu_item_border_hover' => array(
1818	+ 'priority' => 140,
1819	+ 'title' => __( "Menu Item Border (Hover)", "megamenu" ),
1820	+ 'description' => __( "Set the hover border color.", "megamenu" ),
1821	+ 'settings' => array(
1822	+ array(
1823	+ 'title' => __( "Color", "megamenu" ),
1824	+ 'type' => 'color',
1825	+ 'key' => 'menu_item_border_color_hover'
1826	+ )
1827	+ )
1828	+ ),
1829	+ 'menu_item_border_radius' => array(
1830	+ 'priority' => 150,
1831	+ 'title' => __( "Menu Item Border Radius", "megamenu" ),
1832	+ 'description' => __( "Set rounded corners for each top level menu item.", "megamenu" ),
1833	+ 'settings' => array(
1834	+ array(
1835	+ 'title' => __( "Top Left", "megamenu" ),
1836	+ 'type' => 'freetext',
1837	+ 'key' => 'menu_item_link_border_radius_top_left',
1838	+ 'validation' => 'px'
1839	+ ),
1840	+ array(
1841	+ 'title' => __( "Top Right", "megamenu" ),
1842	+ 'type' => 'freetext',
1843	+ 'key' => 'menu_item_link_border_radius_top_right',
1844	+ 'validation' => 'px'
1845	+ ),
1846	+ array(
1847	+ 'title' => __( "Bottom Right", "megamenu" ),
1848	+ 'type' => 'freetext',
1849	+ 'key' => 'menu_item_link_border_radius_bottom_right',
1850	+ 'validation' => 'px'
1851	+ ),
1852	+ array(
1853	+ 'title' => __( "Bottom Left", "megamenu" ),
1854	+ 'type' => 'freetext',
1855	+ 'key' => 'menu_item_link_border_radius_bottom_left',
1856	+ 'validation' => 'px'
1857	+ )
1858	+ )
1859	+ ),
1860	+ 'menu_item_divider' => array(
1861	+ 'priority' => 160,
1862	+ 'title' => __( "Menu Item Divider", "megamenu" ),
1863	+ 'description' => __( "Show a small divider bar between each menu item.", "megamenu" ),
1864	+ 'settings' => array(
1865	+ array(
1866	+ 'title' => __( "Enabled", "megamenu" ),
1867	+ 'type' => 'checkbox',
1868	+ 'key' => 'menu_item_divider'
1869	+ ),
1870	+ array(
1871	+ 'title' => __( "Color", "megamenu" ),
1872	+ 'type' => 'color',
1873	+ 'key' => 'menu_item_divider_color'
1874	+ ),
1875	+ array(
1876	+ 'title' => __( "Glow Opacity", "megamenu" ),
1877	+ 'type' => 'freetext',
1878	+ 'key' => 'menu_item_divider_glow_opacity',
1879	+ 'validation' => 'float'
1880	+ )
1881	+ )
1882	+ ),
1883	+ 'menu_item_highlight' => array(
1884	+ 'priority' => 170,
1885	+ 'title' => __( "Highlight Current Item", "megamenu" ),
1886	+ 'description' => __( "Apply the 'hover' styling to current menu items.", "megamenu" ),
1887	+ 'settings' => array(
1888	+ array(
1889	+ 'title' => __( "Enabled", "megamenu" ),
1890	+ 'type' => 'checkbox',
1891	+ 'key' => 'menu_item_highlight_current'
1892	+ )
1893	+ )
1894	+ )
1895	+ )
1896	+ ),
1897	+ 'mega_panels' => array(
1898	+ 'title' => __( "Mega Menus", "megamenu" ),
1899	+ 'settings' => array(
1900	+ 'panel_background' => array(
1901	+ 'priority' => 10,
1902	+ 'title' => __( "Panel Background", "megamenu" ),
1903	+ 'description' => __( "Set a background color for a whole panel.", "megamenu" ),
1904	+ 'settings' => array(
1905	+ array(
1906	+ 'title' => __( "From", "megamenu" ),
1907	+ 'type' => 'color',
1908	+ 'key' => 'panel_background_from'
1909	+ ),
1910	+ array(
1911	+ 'title' => __( "To", "megamenu" ),
1912	+ 'type' => 'color',
1913	+ 'key' => 'panel_background_to'
1914	+ )
1915	+ )
1916	+ ),
1917	+ 'panel_width' => array(
1918	+ 'priority' => 20,
1919	+ 'title' => __( "Panel Width", "megamenu" ),
1920	+ 'description' => __( "Mega Panel width.", "megamenu" ),
1921	+ 'info' => array(
1922	+ __("A 100% wide panel will only ever be as wide as the menu itself. For a fixed panel width set this to a pixel value.", "megamenu"),
1923	+ __("Advanced: Enter a jQuery selector to synchronize the width and position of the sub menu with existing page element (e.g. body, #container, .page).", "megamenu")
1924	+ ),
1925	+ 'settings' => array(
1926	+ array(
1927	+ 'title' => __( "Outer Width", "megamenu" ),
1928	+ 'type' => 'freetext',
1929	+ 'key' => 'panel_width'
1930	+ ),
1931	+ array(
1932	+ 'title' => __( "Inner Width", "megamenu" ),
1933	+ 'type' => 'freetext',
1934	+ 'key' => 'panel_inner_width'
1935	+ )
1936	+ )
1937	+ ),
1938	+ 'panel_padding' => array(
1939	+ 'priority' => 30,
1940	+ 'title' => __( "Panel Padding", "megamenu" ),
1941	+ 'description' => __( "Set the padding for the whole panel. Set these values 0px if you wish your panel content to go edge-to-edge.", "megamenu" ),
1942	+ 'settings' => array(
1943	+ array(
1944	+ 'title' => __( "Top", "megamenu" ),
1945	+ 'type' => 'freetext',
1946	+ 'key' => 'panel_padding_top',
1947	+ 'validation' => 'px'
1948	+ ),
1949	+ array(
1950	+ 'title' => __( "Right", "megamenu" ),
1951	+ 'type' => 'freetext',
1952	+ 'key' => 'panel_padding_right',
1953	+ 'validation' => 'px'
1954	+ ),
1955	+ array(
1956	+ 'title' => __( "Bottom", "megamenu" ),
1957	+ 'type' => 'freetext',
1958	+ 'key' => 'panel_padding_bottom',
1959	+ 'validation' => 'px'
1960	+ ),
1961	+ array(
1962	+ 'title' => __( "Left", "megamenu" ),
1963	+ 'type' => 'freetext',
1964	+ 'key' => 'panel_padding_left',
1965	+ 'validation' => 'px'
1966	+ )
1967	+ )
1968	+ ),
1969	+ 'panel_border' => array(
1970	+ 'priority' => 40,
1971	+ 'title' => __( "Panel Border", "megamenu" ),
1972	+ 'description' => __( "Set the border to display on the Mega Panel.", "megamenu" ),
1973	+ 'settings' => array(
1974	+ array(
1975	+ 'title' => __( "Color", "megamenu" ),
1976	+ 'type' => 'color',
1977	+ 'key' => 'panel_border_color'
1978	+ ),
1979	+ array(
1980	+ 'title' => __( "Top", "megamenu" ),
1981	+ 'type' => 'freetext',
1982	+ 'key' => 'panel_border_top',
1983	+ 'validation' => 'px'
1984	+ ),
1985	+ array(
1986	+ 'title' => __( "Right", "megamenu" ),
1987	+ 'type' => 'freetext',
1988	+ 'key' => 'panel_border_right',
1989	+ 'validation' => 'px'
1990	+ ),
1991	+ array(
1992	+ 'title' => __( "Bottom", "megamenu" ),
1993	+ 'type' => 'freetext',
1994	+ 'key' => 'panel_border_bottom',
1995	+ 'validation' => 'px'
1996	+ ),
1997	+ array(
1998	+ 'title' => __( "Left", "megamenu" ),
1999	+ 'type' => 'freetext',
2000	+ 'key' => 'panel_border_left',
2001	+ 'validation' => 'px'
2002	+ )
2003	+ )
2004	+ ),
2005	+ 'panel_border_radius' => array(
2006	+ 'priority' => 50,
2007	+ 'title' => __( "Panel Border Radius", "megamenu" ),
2008	+ 'description' => __( "Set rounded corners for the panel.", "megamenu" ),
2009	+ 'settings' => array(
2010	+ array(
2011	+ 'title' => __( "Top Left", "megamenu" ),
2012	+ 'type' => 'freetext',
2013	+ 'key' => 'panel_border_radius_top_left',
2014	+ 'validation' => 'px'
2015	+ ),
2016	+ array(
2017	+ 'title' => __( "Top Right", "megamenu" ),
2018	+ 'type' => 'freetext',
2019	+ 'key' => 'panel_border_radius_top_right',
2020	+ 'validation' => 'px'
2021	+ ),
2022	+ array(
2023	+ 'title' => __( "Bottom Right", "megamenu" ),
2024	+ 'type' => 'freetext',
2025	+ 'key' => 'panel_border_radius_bottom_right',
2026	+ 'validation' => 'px'
2027	+ ),
2028	+ array(
2029	+ 'title' => __( "Bottom Left", "megamenu" ),
2030	+ 'type' => 'freetext',
2031	+ 'key' => 'panel_border_radius_bottom_left',
2032	+ 'validation' => 'px'
2033	+ )
2034	+ )
2035	+ ),
2036	+ 'widget_padding' => array(
2037	+ 'priority' => 60,
2038	+ 'title' => __( "Widget Padding", "megamenu" ),
2039	+ 'description' => __( "Use this to define the spacing between each widget in the panel.", "megamenu" ),
2040	+ 'settings' => array(
2041	+ array(
2042	+ 'title' => __( "Top", "megamenu" ),
2043	+ 'type' => 'freetext',
2044	+ 'key' => 'panel_widget_padding_top',
2045	+ 'validation' => 'px'
2046	+ ),
2047	+ array(
2048	+ 'title' => __( "Right", "megamenu" ),
2049	+ 'type' => 'freetext',
2050	+ 'key' => 'panel_widget_padding_right',
2051	+ 'validation' => 'px'
2052	+ ),
2053	+ array(
2054	+ 'title' => __( "Bottom", "megamenu" ),
2055	+ 'type' => 'freetext',
2056	+ 'key' => 'panel_widget_padding_bottom',
2057	+ 'validation' => 'px'
2058	+ ),
2059	+ array(
2060	+ 'title' => __( "Left", "megamenu" ),
2061	+ 'type' => 'freetext',
2062	+ 'key' => 'panel_widget_padding_left',
2063	+ 'validation' => 'px'
2064	+ )
2065	+ )
2066	+ ),
2067	+ 'widget_heading_font' => array(
2068	+ 'priority' => 70,
2069	+ 'title' => __( "Widget Heading Font", "megamenu" ),
2070	+ 'description' => __( "Set the font to use Widget headers in the mega menu. Tip: set this to the same style as the Second Level Menu Item Header font to keep your styling consistent.", "megamenu" ),
2071	+ 'settings' => array(
2072	+ array(
2073	+ 'title' => __( "Color", "megamenu" ),
2074	+ 'type' => 'color',
2075	+ 'key' => 'panel_header_color'
2076	+ ),
2077	+ array(
2078	+ 'title' => __( "Size", "megamenu" ),
2079	+ 'type' => 'freetext',
2080	+ 'key' => 'panel_header_font_size',
2081	+ 'validation' => 'px'
2082	+ ),
2083	+ array(
2084	+ 'title' => __( "Family", "megamenu" ),
2085	+ 'type' => 'font',
2086	+ 'key' => 'panel_header_font'
2087	+ ),
2088	+ array(
2089	+ 'title' => __( "Transform", "megamenu" ),
2090	+ 'type' => 'transform',
2091	+ 'key' => 'panel_header_text_transform'
2092	+ ),
2093	+ array(
2094	+ 'title' => __( "Weight", "megamenu" ),
2095	+ 'type' => 'weight',
2096	+ 'key' => 'panel_header_font_weight'
2097	+ ),
2098	+ array(
2099	+ 'title' => __( "Decoration", "megamenu" ),
2100	+ 'type' => 'decoration',
2101	+ 'key' => 'panel_header_text_decoration'
2102	+ ),
2103	+ )
2104	+ ),
2105	+ 'widget_content_font' => array(
2106	+ 'priority' => 80,
2107	+ 'title' => __( "Widget Content Font", "megamenu" ),
2108	+ 'description' => __( "Set the font to use for panel contents.", "megamenu" ),
2109	+ 'settings' => array(
2110	+ array(
2111	+ 'title' => __( "Color", "megamenu" ),
2112	+ 'type' => 'color',
2113	+ 'key' => 'panel_font_color'
2114	+ ),
2115	+ array(
2116	+ 'title' => __( "Size", "megamenu" ),
2117	+ 'type' => 'freetext',
2118	+ 'key' => 'panel_font_size',
2119	+ 'validation' => 'px'
2120	+ ),
2121	+ array(
2122	+ 'title' => __( "Family", "megamenu" ),
2123	+ 'type' => 'font',
2124	+ 'key' => 'panel_font_family'
2125	+ )
2126	+ )
2127	+ ),
2128	+ 'widget_heading_padding' => array(
2129	+ 'priority' => 90,
2130	+ 'title' => __( "Widget Heading Padding", "megamenu" ),
2131	+ 'description' => __( "Set the padding for the widget headings.", "megamenu" ),
2132	+ 'settings' => array(
2133	+ array(
2134	+ 'title' => __( "Top", "megamenu" ),
2135	+ 'type' => 'freetext',
2136	+ 'key' => 'panel_header_padding_top',
2137	+ 'validation' => 'px'
2138	+ ),
2139	+ array(
2140	+ 'title' => __( "Right", "megamenu" ),
2141	+ 'type' => 'freetext',
2142	+ 'key' => 'panel_header_padding_right',
2143	+ 'validation' => 'px'
2144	+ ),
2145	+ array(
2146	+ 'title' => __( "Bottom", "megamenu" ),
2147	+ 'type' => 'freetext',
2148	+ 'key' => 'panel_header_padding_bottom',
2149	+ 'validation' => 'px'
2150	+ ),
2151	+ array(
2152	+ 'title' => __( "Left", "megamenu" ),
2153	+ 'type' => 'freetext',
2154	+ 'key' => 'panel_header_padding_left',
2155	+ 'validation' => 'px'
2156	+ )
2157	+ )
2158	+ ),
2159	+ 'widget_heading_margin' => array(
2160	+ 'priority' => 100,
2161	+ 'title' => __( "Widget Heading Margin", "megamenu" ),
2162	+ 'description' => __( "Set the margin for the widget headings.", "megamenu" ),
2163	+ 'settings' => array(
2164	+ array(
2165	+ 'title' => __( "Top", "megamenu" ),
2166	+ 'type' => 'freetext',
2167	+ 'key' => 'panel_header_margin_top',
2168	+ 'validation' => 'px'
2169	+ ),
2170	+ array(
2171	+ 'title' => __( "Right", "megamenu" ),
2172	+ 'type' => 'freetext',
2173	+ 'key' => 'panel_header_margin_right',
2174	+ 'validation' => 'px'
2175	+ ),
2176	+ array(
2177	+ 'title' => __( "Bottom", "megamenu" ),
2178	+ 'type' => 'freetext',
2179	+ 'key' => 'panel_header_margin_bottom',
2180	+ 'validation' => 'px'
2181	+ ),
2182	+ array(
2183	+ 'title' => __( "Left", "megamenu" ),
2184	+ 'type' => 'freetext',
2185	+ 'key' => 'panel_header_margin_left',
2186	+ 'validation' => 'px'
2187	+ )
2188	+ )
2189	+ ),
2190	+ 'widget_header_border' => array(
2191	+ 'priority' => 110,
2192	+ 'title' => __( "Widget Header Border", "megamenu" ),
2193	+ 'description' => __( "Set the border for the widget headings.", "megamenu" ),
2194	+ 'settings' => array(
2195	+ array(
2196	+ 'title' => __( "Color", "megamenu" ),
2197	+ 'type' => 'color',
2198	+ 'key' => 'panel_header_border_color'
2199	+ ),
2200	+ array(
2201	+ 'title' => __( "Top", "megamenu" ),
2202	+ 'type' => 'freetext',
2203	+ 'key' => 'panel_header_border_top',
2204	+ 'validation' => 'px'
2205	+ ),
2206	+ array(
2207	+ 'title' => __( "Right", "megamenu" ),
2208	+ 'type' => 'freetext',
2209	+ 'key' => 'panel_header_border_right',
2210	+ 'validation' => 'px'
2211	+ ),
2212	+ array(
2213	+ 'title' => __( "Bottom", "megamenu" ),
2214	+ 'type' => 'freetext',
2215	+ 'key' => 'panel_header_border_bottom',
2216	+ 'validation' => 'px'
2217	+ ),
2218	+ array(
2219	+ 'title' => __( "Left", "megamenu" ),
2220	+ 'type' => 'freetext',
2221	+ 'key' => 'panel_header_border_left',
2222	+ 'validation' => 'px'
2223	+ )
2224	+ )
2225	+ ),
2226	+ 'second_level_menu_items' => array(
2227	+ 'priority' => 120,
2228	+ 'title' => __( "Second Level Menu Items", "megamenu" ),
2229	+ 'description' => '',
2230	+ ),
2231	+ 'second_level_font' => array(
2232	+ 'priority' => 130,
2233	+ 'title' => __( "Font", "megamenu" ),
2234	+ 'description' => __( "Set the font for second level menu items when they're displayed in a Mega Menu.", "megamenu" ),
2235	+ 'settings' => array(
2236	+ array(
2237	+ 'title' => __( "Color", "megamenu" ),
2238	+ 'type' => 'color',
2239	+ 'key' => 'panel_second_level_font_color'
2240	+ ),
2241	+ array(
2242	+ 'title' => __( "Size", "megamenu" ),
2243	+ 'type' => 'freetext',
2244	+ 'key' => 'panel_second_level_font_size',
2245	+ 'validation' => 'px'
2246	+ ),
2247	+ array(
2248	+ 'title' => __( "Family", "megamenu" ),
2249	+ 'type' => 'font',
2250	+ 'key' => 'panel_second_level_font'
2251	+ ),
2252	+ array(
2253	+ 'title' => __( "Transform", "megamenu" ),
2254	+ 'type' => 'transform',
2255	+ 'key' => 'panel_second_level_text_transform'
2256	+ ),
2257	+ array(
2258	+ 'title' => __( "Weight", "megamenu" ),
2259	+ 'type' => 'weight',
2260	+ 'key' => 'panel_second_level_font_weight'
2261	+ ),
2262	+ array(
2263	+ 'title' => __( "Decoration", "megamenu" ),
2264	+ 'type' => 'decoration',
2265	+ 'key' => 'panel_second_level_text_decoration'
2266	+ ),
2267	+ )
2268	+ ),
2269	+ 'second_level_font_hover' => array(
2270	+ 'priority' => 140,
2271	+ 'title' => __( "Font (Hover)", "megamenu" ),
2272	+ 'description' => __( "Set the font style on hover.", "megamenu" ),
2273	+ 'settings' => array(
2274	+ array(
2275	+ 'title' => __( "Color", "megamenu" ),
2276	+ 'type' => 'color',
2277	+ 'key' => 'panel_second_level_font_color_hover'
2278	+ ),
2279	+ array(
2280	+ 'title' => __( "Weight", "megamenu" ),
2281	+ 'type' => 'weight',
2282	+ 'key' => 'panel_second_level_font_weight_hover'
2283	+ ),
2284	+ array(
2285	+ 'title' => __( "Decoration", "megamenu" ),
2286	+ 'type' => 'decoration',
2287	+ 'key' => 'panel_second_level_text_decoration_hover'
2288	+ ),
2289	+ )
2290	+ ),
2291	+ 'second_level_background_hover' => array(
2292	+ 'priority' => 150,
2293	+ 'title' => __( "Background (Hover)", "megamenu" ),
2294	+ 'description' => __( "Set the background hover color for second level menu items.", "megamenu" ),
2295	+ 'settings' => array(
2296	+ array(
2297	+ 'title' => __( "From", "megamenu" ),
2298	+ 'type' => 'color',
2299	+ 'key' => 'panel_second_level_background_hover_from'
2300	+ ),
2301	+ array(
2302	+ 'title' => __( "To", "megamenu" ),
2303	+ 'type' => 'color',
2304	+ 'key' => 'panel_second_level_background_hover_to'
2305	+ )
2306	+ )
2307	+ ),
2308	+ 'second_level_padding' => array(
2309	+ 'priority' => 160,
2310	+ 'title' => __( "Padding", "megamenu" ),
2311	+ 'description' => __( "Set the padding for the second level menu items.", "megamenu" ),
2312	+ 'settings' => array(
2313	+ array(
2314	+ 'title' => __( "Top", "megamenu" ),
2315	+ 'type' => 'freetext',
2316	+ 'key' => 'panel_second_level_padding_top',
2317	+ 'validation' => 'px'
2318	+ ),
2319	+ array(
2320	+ 'title' => __( "Right", "megamenu" ),
2321	+ 'type' => 'freetext',
2322	+ 'key' => 'panel_second_level_padding_right',
2323	+ 'validation' => 'px'
2324	+ ),
2325	+ array(
2326	+ 'title' => __( "Bottom", "megamenu" ),
2327	+ 'type' => 'freetext',
2328	+ 'key' => 'panel_second_level_padding_bottom',
2329	+ 'validation' => 'px'
2330	+ ),
2331	+ array(
2332	+ 'title' => __( "Left", "megamenu" ),
2333	+ 'type' => 'freetext',
2334	+ 'key' => 'panel_second_level_padding_left',
2335	+ 'validation' => 'px'
2336	+ )
2337	+ )
2338	+ ),
2339	+ 'second_level_margin' => array(
2340	+ 'priority' => 170,
2341	+ 'title' => __( "Margin", "megamenu" ),
2342	+ 'description' => __( "Set the margin for the second level menu items.", "megamenu" ),
2343	+ 'settings' => array(
2344	+ array(
2345	+ 'title' => __( "Top", "megamenu" ),
2346	+ 'type' => 'freetext',
2347	+ 'key' => 'panel_second_level_margin_top',
2348	+ 'validation' => 'px'
2349	+ ),
2350	+ array(
2351	+ 'title' => __( "Right", "megamenu" ),
2352	+ 'type' => 'freetext',
2353	+ 'key' => 'panel_second_level_margin_right',
2354	+ 'validation' => 'px'
2355	+ ),
2356	+ array(
2357	+ 'title' => __( "Bottom", "megamenu" ),
2358	+ 'type' => 'freetext',
2359	+ 'key' => 'panel_second_level_margin_bottom',
2360	+ 'validation' => 'px'
2361	+ ),
2362	+ array(
2363	+ 'title' => __( "Left", "megamenu" ),
2364	+ 'type' => 'freetext',
2365	+ 'key' => 'panel_second_level_margin_left',
2366	+ 'validation' => 'px'
2367	+ )
2368	+ )
2369	+ ),
2370	+ 'second_level_border' => array(
2371	+ 'priority' => 180,
2372	+ 'title' => __( "Border", "megamenu" ),
2373	+ 'description' => __( "Set the border for the second level menu items.", "megamenu" ),
2374	+ 'settings' => array(
2375	+ array(
2376	+ 'title' => __( "Color", "megamenu" ),
2377	+ 'type' => 'color',
2378	+ 'key' => 'panel_second_level_border_color'
2379	+ ),
2380	+ array(
2381	+ 'title' => __( "Top", "megamenu" ),
2382	+ 'type' => 'freetext',
2383	+ 'key' => 'panel_second_level_border_top',
2384	+ 'validation' => 'px'
2385	+ ),
2386	+ array(
2387	+ 'title' => __( "Right", "megamenu" ),
2388	+ 'type' => 'freetext',
2389	+ 'key' => 'panel_second_level_border_right',
2390	+ 'validation' => 'px'
2391	+ ),
2392	+ array(
2393	+ 'title' => __( "Bottom", "megamenu" ),
2394	+ 'type' => 'freetext',
2395	+ 'key' => 'panel_second_level_border_bottom',
2396	+ 'validation' => 'px'
2397	+ ),
2398	+ array(
2399	+ 'title' => __( "Left", "megamenu" ),
2400	+ 'type' => 'freetext',
2401	+ 'key' => 'panel_second_level_border_left',
2402	+ 'validation' => 'px'
2403	+ )
2404	+ )
2405	+ ),
2406	+ 'third_level_menu_items' => array(
2407	+ 'priority' => 190,
2408	+ 'title' => __( "Third Level Menu Items", "megamenu" ),
2409	+ 'description' => '',
2410	+ ),
2411	+ 'third_level_font' => array(
2412	+ 'priority' => 200,
2413	+ 'title' => __( "Font", "megamenu" ),
2414	+ 'description' => __( "Set the font for third level menu items when they're displayed in a Mega Menu.", "megamenu" ),
2415	+ 'settings' => array(
2416	+ array(
2417	+ 'title' => __( "Color", "megamenu" ),
2418	+ 'type' => 'color',
2419	+ 'key' => 'panel_third_level_font_color'
2420	+ ),
2421	+ array(
2422	+ 'title' => __( "Size", "megamenu" ),
2423	+ 'type' => 'freetext',
2424	+ 'key' => 'panel_third_level_font_size',
2425	+ 'validation' => 'px'
2426	+ ),
2427	+ array(
2428	+ 'title' => __( "Family", "megamenu" ),
2429	+ 'type' => 'font',
2430	+ 'key' => 'panel_third_level_font'
2431	+ ),
2432	+ array(
2433	+ 'title' => __( "Transform", "megamenu" ),
2434	+ 'type' => 'transform',
2435	+ 'key' => 'panel_third_level_text_transform'
2436	+ ),
2437	+ array(
2438	+ 'title' => __( "Weight", "megamenu" ),
2439	+ 'type' => 'weight',
2440	+ 'key' => 'panel_third_level_font_weight'
2441	+ ),
2442	+ array(
2443	+ 'title' => __( "Decoration", "megamenu" ),
2444	+ 'type' => 'decoration',
2445	+ 'key' => 'panel_third_level_text_decoration'
2446	+ ),
2447	+ )
2448	+ ),
2449	+ 'third_level_font_hover' => array(
2450	+ 'priority' => 210,
2451	+ 'title' => __( "Font (Hover)", "megamenu" ),
2452	+ 'description' => __( "Set the font style on hover.", "megamenu" ),
2453	+ 'settings' => array(
2454	+ array(
2455	+ 'title' => __( "Color", "megamenu" ),
2456	+ 'type' => 'color',
2457	+ 'key' => 'panel_third_level_font_color_hover'
2458	+ ),
2459	+ array(
2460	+ 'title' => __( "Weight", "megamenu" ),
2461	+ 'type' => 'weight',
2462	+ 'key' => 'panel_third_level_font_weight_hover'
2463	+ ),
2464	+ array(
2465	+ 'title' => __( "Decoration", "megamenu" ),
2466	+ 'type' => 'decoration',
2467	+ 'key' => 'panel_third_level_text_decoration_hover'
2468	+ ),
2469	+ )
2470	+ ),
2471	+ 'third_level_background_hover' => array(
2472	+ 'priority' => 220,
2473	+ 'title' => __( "Background (Hover)", "megamenu" ),
2474	+ 'description' => __( "Set the background hover color for third level menu items.", "megamenu" ),
2475	+ 'settings' => array(
2476	+ array(
2477	+ 'title' => __( "From", "megamenu" ),
2478	+ 'type' => 'color',
2479	+ 'key' => 'panel_third_level_background_hover_from'
2480	+ ),
2481	+ array(
2482	+ 'title' => __( "To", "megamenu" ),
2483	+ 'type' => 'color',
2484	+ 'key' => 'panel_third_level_background_hover_to'
2485	+ )
2486	+ )
2487	+ ),
2488	+ 'third_level_padding' => array(
2489	+ 'priority' => 230,
2490	+ 'title' => __( "Padding", "megamenu" ),
2491	+ 'description' => __( "Set the padding for the third level menu items.", "megamenu" ),
2492	+ 'settings' => array(
2493	+ array(
2494	+ 'title' => __( "Top", "megamenu" ),
2495	+ 'type' => 'freetext',
2496	+ 'key' => 'panel_third_level_padding_top',
2497	+ 'validation' => 'px'
2498	+ ),
2499	+ array(
2500	+ 'title' => __( "Right", "megamenu" ),
2501	+ 'type' => 'freetext',
2502	+ 'key' => 'panel_third_level_padding_right',
2503	+ 'validation' => 'px'
2504	+ ),
2505	+ array(
2506	+ 'title' => __( "Bottom", "megamenu" ),
2507	+ 'type' => 'freetext',
2508	+ 'key' => 'panel_third_level_padding_bottom',
2509	+ 'validation' => 'px'
2510	+ ),
2511	+ array(
2512	+ 'title' => __( "Left", "megamenu" ),
2513	+ 'type' => 'freetext',
2514	+ 'key' => 'panel_third_level_padding_left',
2515	+ 'validation' => 'px'
2516	+ )
2517	+ )
2518	+ )
2519	+ )
2520	+ ),
2521	+ 'flyout_menus' => array(
2522	+ 'title' => __( "Flyout Menus", "megamenu"),
2523	+ 'settings' => array(
2524	+ 'flyout_menu_background' => array(
2525	+ 'priority' => 10,
2526	+ 'title' => __( "Menu Background", "megamenu" ),
2527	+ 'description' => __( "Set the background color for the flyout menu.", "megamenu" ),
2528	+ 'settings' => array(
2529	+ array(
2530	+ 'title' => __( "From", "megamenu" ),
2531	+ 'type' => 'color',
2532	+ 'key' => 'flyout_menu_background_from'
2533	+ ),
2534	+ array(
2535	+ 'title' => __( "To", "megamenu" ),
2536	+ 'type' => 'color',
2537	+ 'key' => 'flyout_menu_background_to'
2538	+ )
2539	+ )
2540	+ ),
2541	+ 'flyout_menu_width' => array(
2542	+ 'priority' => 20,
2543	+ 'title' => __( "Menu Width", "megamenu" ),
2544	+ 'description' => __( "The width of each flyout menu. This must be a fixed pixel value.", "megamenu" ),
2545	+ 'info' => array( __( "Set this value to the width of your longest menu item title to stop menu items wrapping onto 2 lines.", "megamenu" ) ),
2546	+ 'settings' => array(
2547	+ array(
2548	+ 'title' => __( "", "megamenu" ),
2549	+ 'type' => 'freetext',
2550	+ 'key' => 'flyout_width',
2551	+ 'validation' => 'px'
2552	+ )
2553	+ )
2554	+ ),
2555	+ 'flyout_menu_padding' => array(
2556	+ 'priority' => 30,
2557	+ 'title' => __( "Menu Padding", "megamenu" ),
2558	+ 'description' => __( "Set the padding for the whole flyout menu.", "megamenu" ),
2559	+ 'info' => array( __( "Only suitable for single level flyout menus. If you're using multi level flyout menus set these values to 0px.", "megamenu" ) ),
2560	+ 'settings' => array(
2561	+ array(
2562	+ 'title' => __( "Top", "megamenu" ),
2563	+ 'type' => 'freetext',
2564	+ 'key' => 'flyout_padding_top',
2565	+ 'validation' => 'px'
2566	+ ),
2567	+ array(
2568	+ 'title' => __( "Right", "megamenu" ),
2569	+ 'type' => 'freetext',
2570	+ 'key' => 'flyout_padding_right',
2571	+ 'validation' => 'px'
2572	+ ),
2573	+ array(
2574	+ 'title' => __( "Bottom", "megamenu" ),
2575	+ 'type' => 'freetext',
2576	+ 'key' => 'flyout_padding_bottom',
2577	+ 'validation' => 'px'
2578	+ ),
2579	+ array(
2580	+ 'title' => __( "Left", "megamenu" ),
2581	+ 'type' => 'freetext',
2582	+ 'key' => 'flyout_padding_left',
2583	+ 'validation' => 'px'
2584	+ )
2585	+ )
2586	+ ),
2587	+ 'flyout_menu_border' => array(
2588	+ 'priority' => 40,
2589	+ 'title' => __( "Menu Border", "megamenu" ),
2590	+ 'description' => __( "Set the border for the flyout menu.", "megamenu" ),
2591	+ 'settings' => array(
2592	+ array(
2593	+ 'title' => __( "Color", "megamenu" ),
2594	+ 'type' => 'color',
2595	+ 'key' => 'flyout_border_color'
2596	+ ),
2597	+ array(
2598	+ 'title' => __( "Top", "megamenu" ),
2599	+ 'type' => 'freetext',
2600	+ 'key' => 'flyout_border_top',
2601	+ 'validation' => 'px'
2602	+ ),
2603	+ array(
2604	+ 'title' => __( "Right", "megamenu" ),
2605	+ 'type' => 'freetext',
2606	+ 'key' => 'flyout_border_right',
2607	+ 'validation' => 'px'
2608	+ ),
2609	+ array(
2610	+ 'title' => __( "Bottom", "megamenu" ),
2611	+ 'type' => 'freetext',
2612	+ 'key' => 'flyout_border_bottom',
2613	+ 'validation' => 'px'
2614	+ ),
2615	+ array(
2616	+ 'title' => __( "Left", "megamenu" ),
2617	+ 'type' => 'freetext',
2618	+ 'key' => 'flyout_border_left',
2619	+ 'validation' => 'px'
2620	+ )
2621	+ )
2622	+ ),
2623	+ 'flyout_menu_border_radius' => array(
2624	+ 'priority' => 50,
2625	+ 'title' => __( "Menu Border Radius", "megamenu" ),
2626	+ 'description' => __( "Set rounded corners for flyout menus. Rounded corners will be applied to all flyout menu levels.", "megamenu" ),
2627	+ 'settings' => array(
2628	+ array(
2629	+ 'title' => __( "Top Left", "megamenu" ),
2630	+ 'type' => 'freetext',
2631	+ 'key' => 'flyout_border_radius_top_left',
2632	+ 'validation' => 'px'
2633	+ ),
2634	+ array(
2635	+ 'title' => __( "Top Right", "megamenu" ),
2636	+ 'type' => 'freetext',
2637	+ 'key' => 'flyout_border_radius_top_right',
2638	+ 'validation' => 'px'
2639	+ ),
2640	+ array(
2641	+ 'title' => __( "Bottom Right", "megamenu" ),
2642	+ 'type' => 'freetext',
2643	+ 'key' => 'flyout_border_radius_bottom_right',
2644	+ 'validation' => 'px'
2645	+ ),
2646	+ array(
2647	+ 'title' => __( "Bottom Left", "megamenu" ),
2648	+ 'type' => 'freetext',
2649	+ 'key' => 'flyout_border_radius_bottom_left',
2650	+ 'validation' => 'px'
2651	+ )
2652	+ )
2653	+ ),
2654	+ 'flyout_menu_item_background' => array(
2655	+ 'priority' => 60,
2656	+ 'title' => __( "Item Background", "megamenu" ),
2657	+ 'description' => __( "Set the background color for a flyout menu item.", "megamenu" ),
2658	+ 'settings' => array(
2659	+ array(
2660	+ 'title' => __( "From", "megamenu" ),
2661	+ 'type' => 'color',
2662	+ 'key' => 'flyout_background_from'
2663	+ ),
2664	+ array(
2665	+ 'title' => __( "To", "megamenu" ),
2666	+ 'type' => 'color',
2667	+ 'key' => 'flyout_background_to'
2668	+ )
2669	+ )
2670	+ ),
2671	+ 'flyout_menu_item_background_hover' => array(
2672	+ 'priority' => 70,
2673	+ 'title' => __( "Item Background (Hover)", "megamenu" ),
2674	+ 'description' => __( "Set the background color for a flyout menu item (on hover).", "megamenu" ),
2675	+ 'settings' => array(
2676	+ array(
2677	+ 'title' => __( "From", "megamenu" ),
2678	+ 'type' => 'color',
2679	+ 'key' => 'flyout_background_hover_from'
2680	+ ),
2681	+ array(
2682	+ 'title' => __( "To", "megamenu" ),
2683	+ 'type' => 'color',
2684	+ 'key' => 'flyout_background_hover_to'
2685	+ )
2686	+ )
2687	+ ),
2688	+ 'flyout_menu_item_height' => array(
2689	+ 'priority' => 80,
2690	+ 'title' => __( "Item Height", "megamenu" ),
2691	+ 'description' => __( "The height of each flyout menu item.", "megamenu" ),
2692	+ 'settings' => array(
2693	+ array(
2694	+ 'title' => __( "", "megamenu" ),
2695	+ 'type' => 'freetext',
2696	+ 'key' => 'flyout_link_height',
2697	+ 'validation' => 'px'
2698	+ )
2699	+ )
2700	+ ),
2701	+ 'flyout_menu_item_padding' => array(
2702	+ 'priority' => 90,
2703	+ 'title' => __( "Item Padding", "megamenu" ),
2704	+ 'description' => __( "Set the padding for each flyout menu item.", "megamenu" ),
2705	+ 'settings' => array(
2706	+ array(
2707	+ 'title' => __( "Top", "megamenu" ),
2708	+ 'type' => 'freetext',
2709	+ 'key' => 'flyout_link_padding_top',
2710	+ 'validation' => 'px'
2711	+ ),
2712	+ array(
2713	+ 'title' => __( "Right", "megamenu" ),
2714	+ 'type' => 'freetext',
2715	+ 'key' => 'flyout_link_padding_right',
2716	+ 'validation' => 'px'
2717	+ ),
2718	+ array(
2719	+ 'title' => __( "Bottom", "megamenu" ),
2720	+ 'type' => 'freetext',
2721	+ 'key' => 'flyout_link_padding_bottom',
2722	+ 'validation' => 'px'
2723	+ ),
2724	+ array(
2725	+ 'title' => __( "Left", "megamenu" ),
2726	+ 'type' => 'freetext',
2727	+ 'key' => 'flyout_link_padding_left',
2728	+ 'validation' => 'px'
2729	+ )
2730	+ )
2731	+ ),
2732	+ 'flyout_menu_item_font' => array(
2733	+ 'priority' => 100,
2734	+ 'title' => __( "Item Font", "megamenu" ),
2735	+ 'description' => __( "Set the font for the flyout menu items.", "megamenu" ),
2736	+ 'settings' => array(
2737	+ array(
2738	+ 'title' => __( "Color", "megamenu" ),
2739	+ 'type' => 'color',
2740	+ 'key' => 'flyout_link_color'
2741	+ ),
2742	+ array(
2743	+ 'title' => __( "Size", "megamenu" ),
2744	+ 'type' => 'freetext',
2745	+ 'key' => 'flyout_link_size',
2746	+ 'validation' => 'px'
2747	+ ),
2748	+ array(
2749	+ 'title' => __( "Family", "megamenu" ),
2750	+ 'type' => 'font',
2751	+ 'key' => 'flyout_link_family'
2752	+ ),
2753	+ array(
2754	+ 'title' => __( "Transform", "megamenu" ),
2755	+ 'type' => 'transform',
2756	+ 'key' => 'flyout_link_text_transform'
2757	+ ),
2758	+ array(
2759	+ 'title' => __( "Weight", "megamenu" ),
2760	+ 'type' => 'weight',
2761	+ 'key' => 'flyout_link_weight'
2762	+ ),
2763	+ array(
2764	+ 'title' => __( "Decoration", "megamenu" ),
2765	+ 'type' => 'decoration',
2766	+ 'key' => 'flyout_link_text_decoration'
2767	+ ),
2768	+ )
2769	+ ),
2770	+ 'flyout_menu_item_font_hover' => array(
2771	+ 'priority' => 110,
2772	+ 'title' => __( "Item Font (Hover)", "megamenu" ),
2773	+ 'description' => __( "Set the font for the flyout menu items.", "megamenu" ),
2774	+ 'settings' => array(
2775	+ array(
2776	+ 'title' => __( "Color", "megamenu" ),
2777	+ 'type' => 'color',
2778	+ 'key' => 'flyout_link_color_hover'
2779	+ ),
2780	+ array(
2781	+ 'title' => __( "Weight", "megamenu" ),
2782	+ 'type' => 'weight',
2783	+ 'key' => 'flyout_link_weight_hover'
2784	+ ),
2785	+ array(
2786	+ 'title' => __( "Decoration", "megamenu" ),
2787	+ 'type' => 'decoration',
2788	+ 'key' => 'flyout_link_text_decoration_hover'
2789	+ ),
2790	+ )
2791	+ ),
2792	+ 'flyout_menu_item_divider' => array(
2793	+ 'priority' => 120,
2794	+ 'title' => __( "Item Divider", "megamenu" ),
2795	+ 'description' => __( "Show a line divider below each menu item.", "megamenu" ),
2796	+ 'settings' => array(
2797	+ array(
2798	+ 'title' => __( "Enabled", "megamenu" ),
2799	+ 'type' => 'checkbox',
2800	+ 'key' => 'flyout_menu_item_divider'
2801	+ ),
2802	+ array(
2803	+ 'title' => __( "Color", "megamenu" ),
2804	+ 'type' => 'color',
2805	+ 'key' => 'flyout_menu_item_divider_color'
2806	+ )
2807	+ )
2808	+ ),
2809	+ )
2810	+ ),
2811	+ 'mobile_menu' => array(
2812	+ 'title' => __( "Mobile Menu", "megamenu" ),
2813	+ 'settings' => array(
2814	+ 'responsive_breakpoint' => array(
2815	+ 'priority' => 10,
2816	+ 'title' => __( "Responsive Breakpoint", "megamenu" ),
2817	+ 'description' => __( "Set the width at which the menu turns into a mobile menu. Set to 0px to disable responsive menu.", "megamenu" ),
2818	+ 'settings' => array(
2819	+ array(
2820	+ 'title' => __( "", "megamenu" ),
2821	+ 'type' => 'freetext',
2822	+ 'key' => 'responsive_breakpoint',
2823	+ 'validation' => 'px'
2824	+ )
2825	+ ),
2826	+ ),
2827	+ /**'responsive_text' => array(
2828	+ 'title' => __( "Toggle Bar Text", "megamenu" ),
2829	+ 'description' => __( "Text to display next to the mobile toggle icon.", "megamenu" ),
2830	+ 'settings' => array(
2831	+ array(
2832	+ 'title' => __( "", "megamenu" ),
2833	+ 'type' => 'freetext',
2834	+ 'key' => 'responsive_text'
2835	+ )
2836	+ )
2837	+ ),**/
2838	+ /**'toggle_font' => array(
2839	+ 'title' => __( "Toggle Bar Text Color", "megamenu" ),
2840	+ 'description' => __( "Set the font color for the toggle bar.", "megamenu" ),
2841	+ 'settings' => array(
2842	+ array(
2843	+ 'title' => __( "", "megamenu" ),
2844	+ 'type' => 'color',
2845	+ 'key' => 'toggle_font_color'
2846	+ )
2847	+ )
2848	+ ),**/
2849	+ 'toggle_bar_background' => array(
2850	+ 'priority' => 20,
2851	+ 'title' => __( "Toggle Bar Background", "megamenu" ),
2852	+ 'description' => __( "Set the background color for the mobile menu toggle bar.", "megamenu" ),
2853	+ 'settings' => array(
2854	+ array(
2855	+ 'title' => __( "From", "megamenu" ),
2856	+ 'type' => 'color',
2857	+ 'key' => 'toggle_background_from'
2858	+ ),
2859	+ array(
2860	+ 'title' => __( "To", "megamenu" ),
2861	+ 'type' => 'color',
2862	+ 'key' => 'toggle_background_to'
2863	+ )
2864	+ )
2865	+ ),
2866	+ 'mobile_columns' => array(
2867	+ 'priority' => 30,
2868	+ 'title' => __( "Mega Menu Columns", "megamenu" ),
2869	+ 'description' => __( "Number of columns to display widgets/second level menu items in.", "megamenu" ),
2870	+ 'settings' => array(
2871	+ array(
2872	+ 'title' => __( "", "megamenu" ),
2873	+ 'type' => 'mobile_columns',
2874	+ 'key' => 'mobile_columns'
2875	+ )
2876	+ )
2877	+ ),
2878	+ 'mobile_menu_item_height' => array(
2879	+ 'priority' => 40,
2880	+ 'title' => __( "Menu Item Height", "megamenu" ),
2881	+ 'description' => __( "Height of each top level item in the mobile menu.", "megamenu" ),
2882	+ 'settings' => array(
2883	+ array(
2884	+ 'title' => __( "", "megamenu" ),
2885	+ 'type' => 'freetext',
2886	+ 'key' => 'mobile_menu_item_height'
2887	+ )
2888	+ )
2889	+ )
2890	+ )
2891	+ ),
2892	+ 'custom_styling' => array(
2893	+ 'title' => __( "Custom Styling", "megamenu"),
2894	+ 'settings' => array(
2895	+ 'custom_styling' => array(
2896	+ 'priority' => 40,
2897	+ 'title' => __( "CSS Editor", "megamenu" ),
2898	+ 'description' => __( "Define any custom CSS you wish to add to menus using this theme. You can use standard CSS or SCSS.", "megamenu"),
2899	+ 'settings' => array(
2900	+ array(
2901	+ 'title' => __( "", "megamenu" ),
2902	+ 'type' => 'textarea',
2903	+ 'key' => 'custom_css'
2904	+ )
2905	+ )
2906	+ )
2907	+ )
2908	+ )
2909	+ ) );
2910	+
2911	+ echo "<div class='accordion-container'>";
2912	+ echo "<ul class='outer-border'>";
2913	+
2914	+ foreach ( $settings as $section_id => $section ) {
2915	+
2916	+ echo " <li class='control-section accordion-section open mega-{$section_id}'>";
2917	+ echo " <h4 class='accordion-section-title hndle'>".$section['title'] . "</h4>";
2918	+ echo " <div class='accordion-section-content '>";
2919	+ echo " <table class='{$section_id}'>";
2920	+
2921	+ // order the fields by priority
2922	+ uasort( $section['settings'], array( $this, "compare_elems" ) );
2923	+
2924	+ foreach ( $section['settings'] as $group_id => $group ) {
2925	+
2926	+ echo "<tr class='mega-{$group_id}'>";
2927	+
2928	+ if ( isset( $group['settings'] ) ) {
2929	+
2930	+ echo "<td class='mega-name'>" . $group['title'] . "<div class='mega-description'>" . $group['description'] . "</div></td>";
2931	+ echo "<td class='mega-value'>";
2932	+
2933	+ foreach ( $group['settings'] as $setting_id => $setting ) {
2934	+
2935	+ if ( isset( $setting['validation'] ) ) {
2936	+ echo "<label class='mega-{$setting['key']}' data-validation='{$setting['validation']}'>";
2937	+ } else {
2938	+ echo "<label class='mega-{$setting['key']}'>";
2939	+ }
2940	+ echo "<span class='mega-short-desc'>{$setting['title']}</span>";
2941	+
2942	+ switch ( $setting['type'] ) {
2943	+ case "freetext":
2944	+ $this->print_theme_freetext_option( $setting['key'] );
2945	+ break;
2946	+ case "textarea":
2947	+ $this->print_theme_textarea_option( $setting['key'] );
2948	+ break;
2949	+ case "align":
2950	+ $this->print_theme_align_option( $setting['key'] );
2951	+ break;
2952	+ case "checkbox":
2953	+ $this->print_theme_checkbox_option( $setting['key'] );
2954	+ break;
2955	+ case "arrow":
2956	+ $this->print_theme_arrow_option( $setting['key'] );
2957	+ break;
2958	+ case "color":
2959	+ $this->print_theme_color_option( $setting['key'] );
2960	+ break;
2961	+ case "weight":
2962	+ $this->print_theme_weight_option( $setting['key'] );
2963	+ break;
2964	+ case "font":
2965	+ $this->print_theme_font_option( $setting['key'] );
2966	+ break;
2967	+ case "transform":
2968	+ $this->print_theme_transform_option( $setting['key'] );
2969	+ break;
2970	+ case "decoration":
2971	+ $this->print_theme_text_decoration_option( $setting['key'] );
2972	+ break;
2973	+ case "mobile_columns":
2974	+ $this->print_theme_mobile_columns_option( $setting['key'] );
2975	+ break;
2976	+ default:
2977	+ do_action("megamenu_print_theme_option_{$setting['type']}", $setting['key'], $this->id );
2978	+ break;
2979	+ }
2980	+
2981	+ echo "</label>";
2982	+
2983	+ }
2984	+
2985	+ if ( isset( $group['info'] ) ) {
2986	+ foreach ( $group['info'] as $paragraph ) {
2987	+ echo "<div class='mega-info'>{$paragraph}</div>";
2988	+ }
2989	+ }
2990	+
2991	+ foreach ( $group['settings'] as $setting_id => $setting ) {
2992	+ if ( isset( $setting['validation'] ) ) {
2993	+
2994	+ echo "<div class='mega-validation-message mega-validation-message-{$setting['key']}'>";
2995	+
2996	+ if ( $setting['validation'] == 'int' ) {
2997	+ $message = __("Enter a whole number (e.g. 1, 5, 100, 999)");
2998	+ }
2999	+
3000	+ if ( $setting['validation'] == 'px' ) {
3001	+ $message = __("Enter a value including a unit (e.g. 10px, 10rem, 10%)");
3002	+ }
3003	+
3004	+ if ( $setting['validation'] == 'float' ) {
3005	+ $message = __("Enter a valid number (e.g. 0.1, 1, 10, 999)");
3006	+ }
3007	+
3008	+ if ( strlen( $setting['title'] ) ) {
3009	+ echo $setting['title'] . ": " . $message;
3010	+ } else {
3011	+ echo $message;
3012	+ }
3013	+
3014	+ echo "</div>";
3015	+ }
3016	+ }
3017	+
3018	+ echo "</td>";
3019	+ } else {
3020	+ echo "<td colspan='2'><h5>{$group['title']}</h5></td>";
3021	+ }
3022	+
3023	+ echo "</tr>";
3024	+
3025	+ }
3026	+
3027	+ echo "</table>";
3028	+ echo "</div>";
3029	+ echo "</li>";
3030	+
3031	+ }
3032	+
3033	+ ?>
3034	+ </ul>
3035	+ </div>
3036	+
3037	+ <div class='megamenu_submit'>
3038	+ <div class='mega_left'>
3039	+ <?php submit_button(); ?>
3040	+ </div>
3041	+ <div class='mega_right'>
3042	+ <?php if ( $this->string_contains( $this->id, array("custom") ) ) : ?>
3043	+ <a class='delete confirm' href='<?php echo $delete_url; ?>'><?php _e("Delete Theme", "megamenu"); ?></a>
3044	+ <?php else : ?>
3045	+ <a class='revert confirm' href='<?php echo $revert_url; ?>'><?php _e("Revert Theme", "megamenu"); ?></a>
3046	+ <?php endif; ?>
3047	+ </div>
3048	+ </div>
3049	+ </form>
3050	+ </div>
3051	+
3052	+ <?php
3053	+
3054	+ }
3055	+
3056	+
3057	+ /**
3058	+ * Compare array values
3059	+ *
3060	+ * @param array $elem1
3061	+ * @param array $elem2
3062	+ * @return bool
3063	+ * @since 2.1
3064	+ */
3065	+ private function compare_elems( $elem1, $elem2 ) {
3066	+
3067	+ return $elem1['priority'] > $elem2['priority'];
3068	+
3069	+ }
3070	+
3071	+
3072	+ /**
3073	+ * Print a select dropdown with left, center and right options
3074	+ *
3075	+ * @since 1.6.1
3076	+ * @param string $key
3077	+ * @param string $value
3078	+ */
3079	+ public function print_theme_align_option( $key ) {
3080	+
3081	+ $value = $this->active_theme[$key];
3082	+
3083	+ ?>
3084	+
3085	+ <select name='settings[<?php echo $key ?>]'>
3086	+ <option value='left' <?php selected( $value, 'left' ); ?>><?php _e("Left", "megamenu") ?></option>
3087	+ <option value='center' <?php selected( $value, 'center' ); ?>><?php _e("Center", "megamenu") ?></option>
3088	+ <option value='right' <?php selected( $value, 'right' ); ?>><?php _e("Right", "megamenu") ?></option>
3089	+ </select>
3090	+
3091	+ <?php
3092	+ }
3093	+
3094	+
3095	+ /**
3096	+ * Print a select dropdown with 1 and 2 options
3097	+ *
3098	+ * @since 1.2.0
3099	+ * @param string $key
3100	+ * @param string $value
3101	+ */
3102	+ public function print_theme_mobile_columns_option( $key ) {
3103	+
3104	+ $value = $this->active_theme[$key];
3105	+
3106	+ ?>
3107	+
3108	+ <select name='settings[<?php echo $key ?>]'>
3109	+ <option value='1' <?php selected( $value, '1' ); ?>><?php _e("1 Column", "megamenu") ?></option>
3110	+ <option value='2' <?php selected( $value, '2' ); ?>><?php _e("2 Columns", "megamenu") ?></option>
3111	+ </select>
3112	+
3113	+ <?php
3114	+ }
3115	+
3116	+
3117	+ /**
3118	+ * Print a select dropdown with text decoration options
3119	+ *
3120	+ * @since 1.6.1
3121	+ * @param string $key
3122	+ * @param string $value
3123	+ */
3124	+ public function print_theme_text_decoration_option( $key ) {
3125	+
3126	+ $value = $this->active_theme[$key];
3127	+
3128	+ ?>
3129	+
3130	+ <select name='settings[<?php echo $key ?>]'>
3131	+ <option value='none' <?php selected( $value, 'none' ); ?>><?php _e("None", "megamenu") ?></option>
3132	+ <option value='underline' <?php selected( $value, 'underline' ); ?>><?php _e("Underline", "megamenu") ?></option>
3133	+ </select>
3134	+
3135	+ <?php
3136	+ }
3137	+
3138	+
3139	+ /**
3140	+ * Print a checkbox option
3141	+ *
3142	+ * @since 1.6.1
3143	+ * @param string $key
3144	+ * @param string $value
3145	+ */
3146	+ public function print_theme_checkbox_option( $key ) {
3147	+
3148	+ $value = $this->active_theme[$key];
3149	+
3150	+ ?>
3151	+
3152	+ <input type='hidden' name='checkboxes[<?php echo $key ?>]' />
3153	+ <input type='checkbox' name='settings[<?php echo $key ?>]' <?php checked( $value, 'on' ); ?> />
3154	+
3155	+ <?php
3156	+ }
3157	+
3158	+
3159	+ /**
3160	+ * Print an arrow dropdown selection box
3161	+ *
3162	+ * @since 1.0
3163	+ * @param string $key
3164	+ * @param string $value
3165	+ */
3166	+ public function print_theme_arrow_option( $key ) {
3167	+
3168	+ $value = $this->active_theme[$key];
3169	+
3170	+ $arrow_icons = $this->arrow_icons();
3171	+
3172	+ ?>
3173	+ <select class='icon_dropdown' name='settings[<?php echo $key ?>]'>
3174	+ <?php
3175	+
3176	+ echo "<option value='disabled'>" . __("Disabled", "megamenu") . "</option>";
3177	+
3178	+ foreach ($arrow_icons as $code => $class) {
3179	+ $name = str_replace('dashicons-', '', $class);
3180	+ $name = ucwords(str_replace(array('-','arrow'), ' ', $name));
3181	+ echo "<option data-class='{$class}' value='{$code}' " . selected( $value, $code, false ) . ">" . $name . "</option>";
3182	+ }
3183	+
3184	+ ?>
3185	+ </select>
3186	+
3187	+ <?php
3188	+ }
3189	+
3190	+
3191	+
3192	+ /**
3193	+ * Print a colorpicker
3194	+ *
3195	+ * @since 1.0
3196	+ * @param string $key
3197	+ * @param string $value
3198	+ */
3199	+ public function print_theme_color_option( $key ) {
3200	+
3201	+ $value = $this->active_theme[$key];
3202	+
3203	+ if ( $value == 'transparent' ) {
3204	+ $value = 'rgba(0,0,0,0)';
3205	+ }
3206	+
3207	+ if ( $value == 'rgba(0,0,0,0)' ) {
3208	+ $value_text = 'transparent';
3209	+ } else {
3210	+ $value_text = $value;
3211	+ }
3212	+
3213	+ echo "<div class='mm-picker-container'>";
3214	+ echo " <input type='text' class='mm_colorpicker' name='settings[$key]' value='{$value}' />";
3215	+ echo " <div class='chosen-color'>{$value_text}</div>";
3216	+ echo "</div>";
3217	+
3218	+ }
3219	+
3220	+
3221	+ /**
3222	+ * Print a font weight selector
3223	+ *
3224	+ * @since 1.0
3225	+ * @param string $key
3226	+ * @param string $value
3227	+ */
3228	+ public function print_theme_weight_option( $key ) {
3229	+
3230	+ $value = $this->active_theme[$key];
3231	+
3232	+ $options = apply_filters( "megamenu_font_weights", array(
3233	+ 'inherit' => __("Theme Default", "megamenu"),
3234	+ '300' => __("Light (300)", "megamenu"),
3235	+ 'normal' => __("Normal (400)", "megamenu"),
3236	+ 'bold' => __("Bold (700)", "megamenu"),
3237	+ ) );
3238	+
3239	+ /**
3240	+ * '100' => __("Thin (100)", "megamenu"),
3241	+ * '200' => __("Extra Light (200)", "megamenu"),
3242	+ * '300' => __("Light (300)", "megamenu"),
3243	+ * 'normal' => __("Normal (400)", "megamenu"),
3244	+ * '500' => __("Medium (500)", "megamenu"),
3245	+ * '600' => __("Semi Bold (600)", "megamenu"),
3246	+ * 'bold' => __("Bold (700)", "megamenu"),
3247	+ * '800' => __("Extra Bold (800)", "megamenu"),
3248	+ * '900' => __("Black (900)", "megamenu")
3249	+ */
3250	+
3251	+ echo "<select name='settings[$key]'>";
3252	+
3253	+ foreach ( $options as $weight => $name ) {
3254	+ echo "<option value='{$weight}' " . selected( $value, $weight, true ) . ">{$name}</option>";
3255	+ }
3256	+
3257	+ echo "</select>";
3258	+
3259	+ }
3260	+
3261	+
3262	+ /**
3263	+ * Print a font transform selector
3264	+ *
3265	+ * @since 1.0
3266	+ * @param string $key
3267	+ * @param string $value
3268	+ */
3269	+ public function print_theme_transform_option( $key ) {
3270	+
3271	+ $value = $this->active_theme[$key];
3272	+
3273	+ echo "<select name='settings[$key]'>";
3274	+ echo " <option value='none' " . selected( $value, 'none', true) . ">" . __("Normal", "megamenu") . "</option>";
3275	+ echo " <option value='capitalize'" . selected( $value, 'capitalize', true) . ">" . __("Capitalize", "megamenu") . "</option>";
3276	+ echo " <option value='uppercase'" . selected( $value, 'uppercase', true) . ">" . __("Uppercase", "megamenu") . "</option>";
3277	+ echo " <option value='lowercase'" . selected( $value, 'lowercase', true) . ">" . __("Lowercase", "megamenu") . "</option>";
3278	+ echo "</select>";
3279	+
3280	+ }
3281	+
3282	+
3283	+ /**
3284	+ * Print a textarea
3285	+ *
3286	+ * @since 1.0
3287	+ * @param string $key
3288	+ * @param string $value
3289	+ */
3290	+ public function print_theme_textarea_option( $key ) {
3291	+
3292	+ $value = $this->active_theme[$key];
3293	+ ?>
3294	+
3295	+ <textarea id='codemirror' name='settings[<?php echo $key ?>]'><?php echo stripslashes( $value ) ?></textarea>
3296	+
3297	+ <p><b><?php _e("Custom Styling Tips", "megamenu"); ?></b></p>
3298	+ <ul class='custom_styling_tips'>
3299	+ <li><code>#{$wrap}</code> <?php _e("converts to the ID selector of the menu wrapper, e.g. div#mega-menu-wrap-primary", "megamenu"); ?></li>
3300	+ <li><code>#{$menu}</code> <?php _e("converts to the ID selector of the menu, e.g. ul#mega-menu-primary", "megamenu"); ?></li>
3301	+ <li><?php _e("Use @import rules to import CSS from other plugins or your theme directory, e.g:"); ?>
3302	+ <br /><br /><code>#{$wrap} #{$menu} {<br />    @import "shortcodes-ultimate/assets/css/box-shortcodes.css";<br />}</code></li>
3303	+ </ul>
3304	+
3305	+ <?php
3306	+
3307	+ }
3308	+
3309	+
3310	+ /**
3311	+ * Print a font selector
3312	+ *
3313	+ * @since 1.0
3314	+ * @param string $key
3315	+ * @param string $value
3316	+ */
3317	+ public function print_theme_font_option( $key ) {
3318	+
3319	+ $value = $this->active_theme[$key];
3320	+
3321	+ echo "<select name='settings[$key]'>";
3322	+
3323	+ echo "<option value='inherit'>" . __("Theme Default", "megamenu") . "</option>";
3324	+
3325	+ foreach ( $this->fonts() as $font ) {
3326	+ $parts = explode(",", $font);
3327	+ $font_name = trim($parts[0]);
3328	+ echo "<option value=\"{$font}\" " . selected( $font, $value ) . ">{$font_name}</option>";
3329	+ }
3330	+
3331	+ echo "</select>";
3332	+ }
3333	+
3334	+
3335	+ /**
3336	+ * Print a text input
3337	+ *
3338	+ * @since 1.0
3339	+ * @param string $key
3340	+ * @param string $value
3341	+ */
3342	+ public function print_theme_freetext_option( $key ) {
3343	+
3344	+ $value = $this->active_theme[$key];
3345	+
3346	+ echo "<input class='mega-setting-{$key}' type='text' name='settings[$key]' value='{$value}' />";
3347	+
3348	+ }
3349	+
3350	+
3351	+ /**
3352	+ * Returns a list of available fonts.
3353	+ *
3354	+ * @since 1.0
3355	+ */
3356	+ public function fonts() {
3357	+
3358	+ $fonts = array(
3359	+ "Georgia, serif",
3360	+ "Palatino Linotype, Book Antiqua, Palatino, serif",
3361	+ "Times New Roman, Times, serif",
3362	+ "Arial, Helvetica, sans-serif",
3363	+ "Arial Black, Gadget, sans-serif",
3364	+ "Comic Sans MS, cursive, sans-serif",
3365	+ "Impact, Charcoal, sans-serif",
3366	+ "Lucida Sans Unicode, Lucida Grande, sans-serif",
3367	+ "Tahoma, Geneva, sans-serif",
3368	+ "Trebuchet MS, Helvetica, sans-serif",
3369	+ "Verdana, Geneva, sans-serif",
3370	+ "Courier New, Courier, monospace",
3371	+ "Lucida Console, Monaco, monospace"
3372	+ );
3373	+
3374	+ $fonts = apply_filters( "megamenu_fonts", $fonts );
3375	+
3376	+ return $fonts;
3377	+
3378	+ }
3379	+
3380	+
3381	+ /**
3382	+ * List of all available arrow DashIcon classes.
3383	+ *
3384	+ * @since 1.0
3385	+ * @return array - Sorted list of icon classes
3386	+ */
3387	+ private function arrow_icons() {
3388	+
3389	+ $icons = array(
3390	+ 'dash-f142' => 'dashicons-arrow-up',
3391	+ 'dash-f140' => 'dashicons-arrow-down',
3392	+ 'dash-f141' => 'dashicons-arrow-left',
3393	+ 'dash-f139' => 'dashicons-arrow-right',
3394	+ 'dash-f342' => 'dashicons-arrow-up-alt',
3395	+ 'dash-f346' => 'dashicons-arrow-down-alt',
3396	+ 'dash-f340' => 'dashicons-arrow-left-alt',
3397	+ 'dash-f344' => 'dashicons-arrow-right-alt',
3398	+ 'dash-f343' => 'dashicons-arrow-up-alt2',
3399	+ 'dash-f347' => 'dashicons-arrow-down-alt2',
3400	+ 'dash-f341' => 'dashicons-arrow-left-alt2',
3401	+ 'dash-f345' => 'dashicons-arrow-right-alt2'
3402	+ );
3403	+
3404	+ $icons = apply_filters( "megamenu_arrow_icons", $icons );
3405	+
3406	+ return $icons;
3407	+
3408	+ }
3409	+
3410	+
3411	+
3412	+ /**
3413	+ * Enqueue nav-menus.php scripts
3414	+ *
3415	+ * @since 1.8.3
3416	+ */
3417	+ public function enqueue_scripts() {
3418	+ wp_enqueue_script('accordion');
3419	+
3420	+ wp_enqueue_style( 'spectrum', MEGAMENU_BASE_URL . 'js/spectrum/spectrum.css', false, MEGAMENU_VERSION );
3421	+ wp_enqueue_style( 'mega-menu-settings', MEGAMENU_BASE_URL . 'css/admin/settings.css', false, MEGAMENU_VERSION );
3422	+ wp_enqueue_style( 'codemirror', MEGAMENU_BASE_URL . 'js/codemirror/codemirror.css', false, MEGAMENU_VERSION );
3423	+ wp_enqueue_style( 'select2', MEGAMENU_BASE_URL . 'js/select2/select2.css', false, MEGAMENU_VERSION );
3424	+
3425	+
3426	+ wp_enqueue_script( 'spectrum', MEGAMENU_BASE_URL . 'js/spectrum/spectrum.js', array( 'jquery' ), MEGAMENU_VERSION );
3427	+ wp_enqueue_script( 'codemirror', MEGAMENU_BASE_URL . 'js/codemirror/codemirror.js', array(), MEGAMENU_VERSION );
3428	+ wp_enqueue_script( 'mega-menu-select2', MEGAMENU_BASE_URL . 'js/select2/select2.min.js', array(), MEGAMENU_VERSION );
3429	+ wp_enqueue_script( 'mega-menu-theme-editor', MEGAMENU_BASE_URL . 'js/settings.js', array( 'jquery', 'spectrum', 'codemirror' ), MEGAMENU_VERSION );
3430	+
3431	+ wp_localize_script( 'mega-menu-theme-editor', 'megamenu_settings',
3432	+ array(
3433	+ 'confirm' => __("Are you sure?", "megamenu")
3434	+ )
3435	+ );
3436	+
3437	+ }
3438	+
3439	+ }
3440	+
3441	+ endif;

classes/style-manager.class.php ADDED Viewed

	@@ -0,0 +1,1018 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists( 'Mega_Menu_Style_Manager' ) ) :
8	+
9	+ /**
10	+ *
11	+ */
12	+ final class Mega_Menu_Style_Manager {
13	+
14	+ /**
15	+ *
16	+ */
17	+ var $settings = array();
18	+
19	+
20	+ /**
21	+ * Constructor
22	+ *
23	+ * @since 1.0
24	+ */
25	+ public function __construct() {
26	+
27	+ $this->settings = get_option( "megamenu_settings" );
28	+
29	+ }
30	+
31	+
32	+ /**
33	+ * Setup actions
34	+ *
35	+ * @since 1.0
36	+ */
37	+ public function setup_actions() {
38	+
39	+ add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_styles' ) );
40	+ add_action( 'wp_enqueue_scripts', array( $this, 'enqueue_scripts' ), 999 );
41	+ add_action( 'wp_head', array( $this, 'head_css' ), 9999 );
42	+
43	+ add_action( 'megamenu_delete_cache', array( $this, 'delete_cache' ) );
44	+ add_action( 'after_switch_theme', array( $this, 'delete_cache') );
45	+
46	+ // PolyLang
47	+ if ( function_exists( 'pll_current_language' ) ) {
48	+ add_filter( 'megamenu_css_transient_key', array( $this, 'polylang_transient_key') );
49	+ add_filter( 'megamenu_css_filename', array( $this, 'polylang_css_filename') );
50	+ add_action( 'megamenu_after_delete_cache', array( $this, 'polylang_delete_cache') );
51	+ } else if ( defined( 'ICL_LANGUAGE_CODE' ) ) { // WPML
52	+ add_filter( 'megamenu_css_transient_key', array( $this, 'wpml_transient_key') );
53	+ add_filter( 'megamenu_css_filename', array( $this, 'wpml_css_filename') );
54	+ add_action( 'megamenu_after_delete_cache', array( $this, 'wpml_delete_cache') );
55	+ }
56	+
57	+
58	+ }
59	+
60	+
61	+ /**
62	+ *
63	+ */
64	+ public function get_default_theme() {
65	+ return array(
66	+ 'title' => __("Default", "megamenu"),
67	+ 'container_background_from' => '#222',
68	+ 'container_background_to' => '#222',
69	+ 'container_padding_left' => '0px',
70	+ 'container_padding_right' => '0px',
71	+ 'container_padding_top' => '0px',
72	+ 'container_padding_bottom' => '0px',
73	+ 'container_border_radius_top_left' => '0px',
74	+ 'container_border_radius_top_right' => '0px',
75	+ 'container_border_radius_bottom_left' => '0px',
76	+ 'container_border_radius_bottom_right' => '0px',
77	+ 'arrow_up' => 'dash-f142',
78	+ 'arrow_down' => 'dash-f140',
79	+ 'arrow_left' => 'dash-f141',
80	+ 'arrow_right' => 'dash-f139',
81	+ 'font_size' => '14px', // deprecated
82	+ 'font_color' => '#666', // deprecated
83	+ 'font_family' => 'inherit', // deprecated
84	+ 'menu_item_align' => 'left',
85	+ 'menu_item_background_from' => 'transparent',
86	+ 'menu_item_background_to' => 'transparent',
87	+ 'menu_item_background_hover_from' => '#333',
88	+ 'menu_item_background_hover_to' => '#333',
89	+ 'menu_item_spacing' => '0px',
90	+ 'menu_item_link_font' => 'inherit',
91	+ 'menu_item_link_font_size' => '14px',
92	+ 'menu_item_link_height' => '40px',
93	+ 'menu_item_link_color' => '#ffffff',
94	+ 'menu_item_link_weight' => 'normal',
95	+ 'menu_item_link_text_transform' => 'normal',
96	+ 'menu_item_link_text_decoration' => 'none',
97	+ 'menu_item_link_color_hover' => '#ffffff',
98	+ 'menu_item_link_weight_hover' => 'normal',
99	+ 'menu_item_link_text_decoration_hover' => 'none',
100	+ 'menu_item_link_padding_left' => '10px',
101	+ 'menu_item_link_padding_right' => '10px',
102	+ 'menu_item_link_padding_top' => '0px',
103	+ 'menu_item_link_padding_bottom' => '0px',
104	+ 'menu_item_link_border_radius_top_left' => '0px',
105	+ 'menu_item_link_border_radius_top_right' => '0px',
106	+ 'menu_item_link_border_radius_bottom_left' => '0px',
107	+ 'menu_item_link_border_radius_bottom_right' => '0px',
108	+ 'menu_item_border_color' => '#fff',
109	+ 'menu_item_border_left' => '0px',
110	+ 'menu_item_border_right' => '0px',
111	+ 'menu_item_border_top' => '0px',
112	+ 'menu_item_border_bottom' => '0px',
113	+ 'menu_item_border_color_hover' => '#fff',
114	+ 'menu_item_highlight_current' => 'off',
115	+ 'menu_item_divider' => 'off',
116	+ 'menu_item_divider_color' => 'rgba(255, 255, 255, 0.1)',
117	+ 'menu_item_divider_glow_opacity' => '0.1',
118	+ 'panel_background_from' => '#f1f1f1',
119	+ 'panel_background_to' => '#f1f1f1',
120	+ 'panel_width' => '100%',
121	+ 'panel_inner_width' => '100%',
122	+ 'panel_border_color' => '#fff',
123	+ 'panel_border_left' => '0px',
124	+ 'panel_border_right' => '0px',
125	+ 'panel_border_top' => '0px',
126	+ 'panel_border_bottom' => '0px',
127	+ 'panel_border_radius_top_left' => '0px',
128	+ 'panel_border_radius_top_right' => '0px',
129	+ 'panel_border_radius_bottom_left' => '0px',
130	+ 'panel_border_radius_bottom_right' => '0px',
131	+ 'panel_header_color' => '#555',
132	+ 'panel_header_text_transform' => 'uppercase',
133	+ 'panel_header_font' => 'inherit',
134	+ 'panel_header_font_size' => '16px',
135	+ 'panel_header_font_weight' => 'bold',
136	+ 'panel_header_text_decoration' => 'none',
137	+ 'panel_header_padding_top' => '0px',
138	+ 'panel_header_padding_right' => '0px',
139	+ 'panel_header_padding_bottom' => '5px',
140	+ 'panel_header_padding_left' => '0px',
141	+ 'panel_header_margin_top' => '0px',
142	+ 'panel_header_margin_right' => '0px',
143	+ 'panel_header_margin_bottom' => '0px',
144	+ 'panel_header_margin_left' => '0px',
145	+ 'panel_header_border_color' => 'panel_header_color',
146	+ 'panel_header_border_left' => '0px',
147	+ 'panel_header_border_right' => '0px',
148	+ 'panel_header_border_top' => '0px',
149	+ 'panel_header_border_bottom' => '0px',
150	+ 'panel_padding_left' => '0px',
151	+ 'panel_padding_right' => '0px',
152	+ 'panel_padding_top' => '0px',
153	+ 'panel_padding_bottom' => '0px',
154	+ 'panel_widget_padding_left' => '15px',
155	+ 'panel_widget_padding_right' => '15px',
156	+ 'panel_widget_padding_top' => '15px',
157	+ 'panel_widget_padding_bottom' => '15px',
158	+ 'panel_font_size' => 'font_size',
159	+ 'panel_font_color' => 'font_color',
160	+ 'panel_font_family' => 'font_family',
161	+ 'panel_second_level_font_color' => 'panel_header_color',
162	+ 'panel_second_level_font_color_hover' => 'panel_header_color',
163	+ 'panel_second_level_text_transform' => 'panel_header_text_transform',
164	+ 'panel_second_level_font' => 'panel_header_font',
165	+ 'panel_second_level_font_size' => 'panel_header_font_size',
166	+ 'panel_second_level_font_weight' => 'panel_header_font_weight',
167	+ 'panel_second_level_font_weight_hover' => 'panel_header_font_weight',
168	+ 'panel_second_level_text_decoration' => 'panel_header_text_decoration',
169	+ 'panel_second_level_text_decoration_hover' => 'panel_header_text_decoration',
170	+ 'panel_second_level_background_hover_from' => 'transparent',
171	+ 'panel_second_level_background_hover_to' => 'transparent',
172	+ 'panel_second_level_padding_left' => '0px',
173	+ 'panel_second_level_padding_right' => '0px',
174	+ 'panel_second_level_padding_top' => '0px',
175	+ 'panel_second_level_padding_bottom' => '0px',
176	+ 'panel_second_level_margin_left' => '0px',
177	+ 'panel_second_level_margin_right' => '0px',
178	+ 'panel_second_level_margin_top' => '0px',
179	+ 'panel_second_level_margin_bottom' => '0px',
180	+ 'panel_second_level_border_color' => 'panel_header_color',
181	+ 'panel_second_level_border_left' => '0px',
182	+ 'panel_second_level_border_right' => '0px',
183	+ 'panel_second_level_border_top' => '0px',
184	+ 'panel_second_level_border_bottom' => '0px',
185	+ 'panel_third_level_font_color' => 'panel_font_color',
186	+ 'panel_third_level_font_color_hover' => 'panel_font_color',
187	+ 'panel_third_level_text_transform' => 'none',
188	+ 'panel_third_level_font' => 'panel_font_family',
189	+ 'panel_third_level_font_size' => 'panel_font_size',
190	+ 'panel_third_level_font_weight' => 'normal',
191	+ 'panel_third_level_font_weight_hover' => 'normal',
192	+ 'panel_third_level_text_decoration' => 'none',
193	+ 'panel_third_level_text_decoration_hover' => 'none',
194	+ 'panel_third_level_background_hover_from' => 'transparent',
195	+ 'panel_third_level_background_hover_to' => 'transparent',
196	+ 'panel_third_level_padding_left' => '0px',
197	+ 'panel_third_level_padding_right' => '0px',
198	+ 'panel_third_level_padding_top' => '0px',
199	+ 'panel_third_level_padding_bottom' => '0px',
200	+ 'flyout_width' => '150px',
201	+ 'flyout_menu_background_from' => '#f1f1f1',
202	+ 'flyout_menu_background_to' => '#f1f1f1',
203	+ 'flyout_border_color' => '#ffffff',
204	+ 'flyout_border_left' => '0px',
205	+ 'flyout_border_right' => '0px',
206	+ 'flyout_border_top' => '0px',
207	+ 'flyout_border_bottom' => '0px',
208	+ 'flyout_border_radius_top_left' => '0px',
209	+ 'flyout_border_radius_top_right' => '0px',
210	+ 'flyout_border_radius_bottom_left' => '0px',
211	+ 'flyout_border_radius_bottom_right' => '0px',
212	+ 'flyout_menu_item_divider' => 'off',
213	+ 'flyout_menu_item_divider_color' => 'rgba(255, 255, 255, 0.1)',
214	+ 'flyout_padding_top' => '0px',
215	+ 'flyout_padding_right' => '0px',
216	+ 'flyout_padding_bottom' => '0px',
217	+ 'flyout_padding_left' => '0px',
218	+ 'flyout_link_padding_left' => '10px',
219	+ 'flyout_link_padding_right' => '10px',
220	+ 'flyout_link_padding_top' => '0px',
221	+ 'flyout_link_padding_bottom' => '0px',
222	+ 'flyout_link_weight' => 'normal',
223	+ 'flyout_link_weight_hover' => 'normal',
224	+ 'flyout_link_height' => '35px',
225	+ 'flyout_link_text_decoration' => 'none',
226	+ 'flyout_link_text_decoration_hover' => 'none',
227	+ 'flyout_background_from' => '#f1f1f1',
228	+ 'flyout_background_to' => '#f1f1f1',
229	+ 'flyout_background_hover_from' => '#dddddd',
230	+ 'flyout_background_hover_to' => '#dddddd',
231	+ 'flyout_link_size' => 'font_size',
232	+ 'flyout_link_color' => 'font_color',
233	+ 'flyout_link_color_hover' => 'font_color',
234	+ 'flyout_link_family' => 'font_family',
235	+ 'flyout_link_text_transform' => 'normal',
236	+ 'responsive_breakpoint' => '600px',
237	+ 'responsive_text' => 'MENU', // deprecated
238	+ 'line_height' => '1.7',
239	+ 'z_index' => '999',
240	+ 'shadow' => 'off',
241	+ 'shadow_horizontal' => '0px',
242	+ 'shadow_vertical' => '0px',
243	+ 'shadow_blur' => '5px',
244	+ 'shadow_spread' => '0px',
245	+ 'shadow_color' => 'rgba(0, 0, 0, 0.1)',
246	+ 'transitions' => 'off',
247	+ 'resets' => 'on',
248	+ 'mobile_columns' => '2',
249	+ 'toggle_background_from' => 'container_background_from',
250	+ 'toggle_background_to' => 'container_background_to',
251	+ 'toggle_font_color' => 'menu_item_link_color', // deprecated
252	+ 'mobile_menu_item_height' => '40px',
253	+ 'custom_css' => '
254	+ #{$wrap} #{$menu} {
255	+ / Custom styles should be added below this line /
256	+ }
257	+ #{$wrap} {
258	+ clear: both;
259	+ }'
260	+ );
261	+ }
262	+
263	+
264	+ /**
265	+ *
266	+ * @since 1.0
267	+ */
268	+ public function default_themes() {
269	+
270	+ $themes['default'] = $this->get_default_theme();
271	+
272	+ return apply_filters( "megamenu_themes", $themes );
273	+ }
274	+
275	+
276	+ /**
277	+ * Merge the saved themes (from options table) into array of complete themes
278	+ *
279	+ * @since 2.1
280	+ */
281	+ private function merge_in_saved_themes( $all_themes ) {
282	+
283	+ if ( $saved_themes = get_site_option( "megamenu_themes" ) ) {
284	+
285	+ foreach ( $saved_themes as $key => $settings ) {
286	+
287	+ if ( isset( $all_themes[ $key ] ) ) {
288	+ // merge modifications to default themes
289	+ $all_themes[ $key ] = array_merge( $all_themes[ $key ], $saved_themes[ $key ] );
290	+ } else {
291	+ // add in new themes
292	+ $all_themes[ $key ] = $settings;
293	+ }
294	+
295	+ }
296	+ }
297	+
298	+ return $all_themes;
299	+
300	+ }
301	+
302	+
303	+ /**
304	+ * Populate all themes with all keys from the default theme
305	+ *
306	+ * @since 2.1
307	+ */
308	+ private function ensure_all_themes_have_all_default_theme_settings( $all_themes ) {
309	+
310	+ $default_theme = $this->get_default_theme();
311	+
312	+ $themes = array();
313	+
314	+ foreach ( $all_themes as $theme_id => $theme ) {
315	+ $themes[ $theme_id ] = array_merge( $default_theme, $theme );
316	+ }
317	+
318	+ return $themes;
319	+ }
320	+
321	+
322	+ /**
323	+ * For backwards compatibility, copy old settings into new values
324	+ *
325	+ * @since 2.1
326	+ */
327	+ private function process_theme_replacements( $all_themes ) {
328	+
329	+ foreach ( $all_themes as $key => $settings ) {
330	+
331	+ // process replacements
332	+ foreach ( $settings as $var => $val ) {
333	+
334	+ if ( ! is_array( $val ) && isset( $all_themes[$key][$val] ) ) {
335	+
336	+ $all_themes[$key][$var] = $all_themes[$key][$val];
337	+
338	+ }
339	+
340	+ }
341	+
342	+ }
343	+
344	+ return $all_themes;
345	+ }
346	+
347	+
348	+ /**
349	+ * Return a filtered list of themes
350	+ *
351	+ * @since 1.0
352	+ * @return array
353	+ */
354	+ public function get_themes() {
355	+
356	+ $default_themes = $this->default_themes();
357	+
358	+ $all_themes = $this->merge_in_saved_themes( $default_themes );
359	+
360	+ $all_themes = $this->ensure_all_themes_have_all_default_theme_settings( $all_themes );
361	+
362	+ $all_themes = $this->process_theme_replacements( $all_themes );
363	+
364	+ uasort( $all_themes, array( $this, 'sort_by_title' ) );
365	+
366	+ return $all_themes;
367	+
368	+ }
369	+
370	+
371	+ /**
372	+ * Sorts a 2d array by the 'title' key
373	+ *
374	+ * @since 1.0
375	+ * @param array $a
376	+ * @param array $b
377	+ */
378	+ private function sort_by_title( $a, $b ) {
379	+
380	+ return strcmp( $a['title'], $b['title'] );
381	+
382	+ }
383	+
384	+
385	+ /**
386	+ *
387	+ * @since 1.3.1
388	+ */
389	+ private function is_debug_mode() {
390	+
391	+ return ( defined( 'MEGAMENU_DEBUG' ) && MEGAMENU_DEBUG === true ) \|\| isset( $_GET['nocache'] );
392	+
393	+ }
394	+
395	+
396	+ /**
397	+ * Return the menu CSS for use in inline CSS block. Use the cache if possible.
398	+ *
399	+ * @since 1.3.1
400	+ */
401	+ public function get_css() {
402	+
403	+ if ( ( $css = $this->get_cached_css() ) && ! $this->is_debug_mode() ) {
404	+
405	+ return $css;
406	+
407	+ } else {
408	+
409	+ return $this->generate_css();
410	+
411	+ }
412	+
413	+ }
414	+
415	+
416	+ /**
417	+ * Generate and cache the CSS for our menus.
418	+ * The CSS is compiled by scssphp using the file located in /css/megamenu.scss
419	+ *
420	+ * @since 1.0
421	+ * @return string
422	+ * @param boolean $debug_mode (prints error messages to the CSS when enabled)
423	+ */
424	+ public function generate_css() {
425	+
426	+ // the settings may have changed since the class was instantiated,
427	+ // reset them here
428	+ $this->settings = get_option( "megamenu_settings" );
429	+
430	+ if ( ! $this->settings ) {
431	+ return "/ CSS Generation Failed. No menu settings found /";
432	+ }
433	+
434	+ $css = "";
435	+
436	+ foreach ( $this->settings as $location => $settings ) {
437	+
438	+ if ( isset( $settings['enabled'] ) && has_nav_menu( $location ) ) {
439	+
440	+ $theme = $this->get_theme_settings_for_location( $location );
441	+ $menu_id = $this->get_menu_id_for_location( $location );
442	+
443	+ $compiled_css = $this->generate_css_for_location( $location, $theme, $menu_id );
444	+
445	+ if ( ! is_wp_error( $compiled_css ) ) {
446	+
447	+ $css .= $compiled_css;
448	+
449	+ }
450	+
451	+ }
452	+
453	+ }
454	+
455	+ if ( strlen( $css ) ) {
456	+
457	+ $css .= "/ " . date('l jS \of F Y h:i:s A') . " /";
458	+
459	+ $this->set_cached_css( $css );
460	+
461	+ if ( $this->get_css_output_method() == 'fs' ) {
462	+ $this->save_to_filesystem( $css );
463	+ }
464	+
465	+ }
466	+
467	+ return $css;
468	+ }
469	+
470	+
471	+ /**
472	+ *
473	+ * @since 1.6.1
474	+ */
475	+ private function save_to_filesystem( $css ) {
476	+ global $wp_filesystem;
477	+
478	+ if ( ! $wp_filesystem ) {
479	+ require_once( ABSPATH . 'wp-admin/includes/file.php' );
480	+ }
481	+
482	+ $upload_dir = wp_upload_dir();
483	+ $filename = $this->get_css_filename();
484	+ $dir = trailingslashit( $upload_dir['basedir'] ) . 'maxmegamenu/';
485	+
486	+ WP_Filesystem( false, $upload_dir['basedir'], true );
487	+ $wp_filesystem->mkdir( $dir );
488	+
489	+ if ( ! $wp_filesystem->put_contents( $dir . $filename, $css ) ) {
490	+
491	+ // File write failed.
492	+ // Update CSS output option to 'head' to stop us from attempting to regenerate the CSS on every request.
493	+ $settings = get_option( 'megamenu_settings' );
494	+ $settings['css'] = 'head';
495	+ update_option( 'megamenu_settings', $settings );
496	+
497	+ }
498	+
499	+ }
500	+
501	+
502	+ /**
503	+ * Return the path to the megamenu.scss file, look for custom files before
504	+ * loading the core version.
505	+ *
506	+ * @since 1.0
507	+ * @return string
508	+ */
509	+ private function load_scss_file() {
510	+
511	+ $scss = file_get_contents( MEGAMENU_PATH . trailingslashit('css') . 'mixin.scss' );
512	+ $scss .= file_get_contents( MEGAMENU_PATH . trailingslashit('css') . 'reset.scss' );
513	+
514	+ $locations = apply_filters( "megamenu_scss_locations", array(
515	+ trailingslashit( get_stylesheet_directory() ) . trailingslashit("megamenu") . 'megamenu.scss', // child theme
516	+ trailingslashit( get_template_directory() ) . trailingslashit("megamenu") . 'megamenu.scss', // parent theme
517	+ MEGAMENU_PATH . trailingslashit('css') . 'megamenu.scss' // default
518	+ ));
519	+
520	+ foreach ( $locations as $path ) {
521	+
522	+ if ( file_exists( $path ) ) {
523	+
524	+ $scss .= file_get_contents( $path );
525	+
526	+ }
527	+
528	+ }
529	+
530	+ return apply_filters( "megamenu_load_scss_file_contents", $scss);
531	+
532	+ }
533	+
534	+ /**
535	+ * Compiles raw SCSS into CSS for a particular menu location.
536	+ *
537	+ * @since 1.3
538	+ * @return mixed
539	+ * @param array $settings
540	+ * @param string $location
541	+ */
542	+ public function generate_css_for_location( $location, $theme, $menu_id ) {
543	+
544	+ $scssc = new scssc();
545	+ $scssc->setFormatter( 'scss_formatter' );
546	+
547	+ $import_paths = apply_filters('megamenu_scss_import_paths', array(
548	+ trailingslashit( get_stylesheet_directory() ) . trailingslashit("megamenu"),
549	+ trailingslashit( get_stylesheet_directory() ),
550	+ trailingslashit( get_template_directory() ) . trailingslashit("megamenu"),
551	+ trailingslashit( get_template_directory() ),
552	+ trailingslashit( WP_PLUGIN_DIR )
553	+ ));
554	+
555	+ foreach ( $import_paths as $path ) {
556	+ $scssc->addImportPath( $path );
557	+ }
558	+
559	+ try {
560	+ return $scssc->compile( $this->get_complete_scss_for_location( $location, $theme, $menu_id ) );
561	+ }
562	+ catch ( Exception $e ) {
563	+ $message = __("Warning: CSS compilation failed. Please check your changes or revert the theme.", "megamenu");
564	+
565	+ return new WP_Error( 'scss_compile_fail', $message . "<br /><br />" . $e->getMessage() );
566	+ }
567	+
568	+ }
569	+
570	+
571	+ /**
572	+ * Generates a SCSS string which includes the variables for a menu theme,
573	+ * for a particular menu location.
574	+ *
575	+ * @since 1.3
576	+ * @return string
577	+ * @param string $theme
578	+ * @param string $location
579	+ * @param int $menu_id
580	+ */
581	+ private function get_complete_scss_for_location( $location, $theme, $menu_id ) {
582	+
583	+ $sanitized_location = str_replace( apply_filters("megamenu_location_replacements", array("-", " ") ), "-", $location );
584	+
585	+ $wrap_selector = apply_filters( "megamenu_scss_wrap_selector", "#mega-menu-wrap-{$sanitized_location}", $menu_id, $location );
586	+ $menu_selector = apply_filters( "megamenu_scss_menu_selector", "#mega-menu-{$sanitized_location}", $menu_id, $location );
587	+
588	+ $vars['wrap'] = "'$wrap_selector'";
589	+ $vars['menu'] = "'$menu_selector'";
590	+ $vars['menu_id'] = "'$menu_id'";
591	+
592	+ foreach( $theme as $name => $value ) {
593	+
594	+ if ( in_array( $name, array( 'arrow_up', 'arrow_down', 'arrow_left', 'arrow_right' ) ) ) {
595	+
596	+ $parts = explode( '-', $value );
597	+ $code = end( $parts );
598	+
599	+ $arrow_icon = $code == 'disabled' ? "''" : "'\\" . $code . "'";
600	+
601	+ $vars[$name] = $arrow_icon;
602	+
603	+ continue;
604	+ }
605	+
606	+ if ( in_array( $name, array( 'responsive_text' ) ) ) {
607	+
608	+ if ( strlen( $value ) ) {
609	+ $vars[$name] = "'" . do_shortcode( $value ) . "'";
610	+ } else {
611	+ $vars[$name] = "''";
612	+ }
613	+
614	+ continue;
615	+ }
616	+
617	+ if ( in_array( $name, array( 'panel_width', 'panel_inner_width' ) ) ) {
618	+
619	+ if ( preg_match('/^\d/', $value) !== 1 ) { // doesn't start with number (jQuery selector)
620	+ $vars[$name] = '100%';
621	+
622	+ continue;
623	+ }
624	+
625	+ }
626	+
627	+ if ( $name != 'custom_css' ) {
628	+ $vars[$name] = $value;
629	+ }
630	+
631	+ }
632	+
633	+ // Non-standard characters in the title will break CSS compilation, unset it here as it's not needed.
634	+ if ( isset( $vars['title'] ) ) {
635	+ unset( $vars['title'] );
636	+ }
637	+
638	+ $vars = apply_filters( "megamenu_scss_variables", $vars, $location, $theme, $menu_id, $this->get_theme_id_for_location($location) );
639	+
640	+ $scss = "";
641	+
642	+ foreach ($vars as $name => $value) {
643	+ $scss .= "$" . $name . ": " . $value . ";\n";
644	+ }
645	+
646	+ $scss .= $this->load_scss_file();
647	+
648	+ $scss .= stripslashes( html_entity_decode( $theme['custom_css'] ) );
649	+
650	+ return apply_filters( "megamenu_scss", $scss, $location, $theme, $menu_id );
651	+
652	+ }
653	+
654	+
655	+ /**
656	+ * Returns the menu ID for a specified menu location, defaults to 0
657	+ *
658	+ * @since 1.3
659	+ */
660	+ private function get_menu_id_for_location( $location ) {
661	+
662	+ $locations = get_nav_menu_locations();
663	+
664	+ $menu_id = isset( $locations[ $location ] ) ? $locations[ $location ] : 0;
665	+
666	+ return $menu_id;
667	+
668	+ }
669	+
670	+
671	+ /**
672	+ * Returns the theme ID for a specified menu location, defaults to 'default'
673	+ *
674	+ * @since 2.1
675	+ */
676	+ private function get_theme_id_for_location( $location ) {
677	+
678	+ $settings = $this->settings;
679	+
680	+ $theme_id = isset( $settings[ $location ]['theme'] ) ? $settings[ $location ]['theme'] : 'default';
681	+
682	+ return $theme_id;
683	+
684	+ }
685	+
686	+
687	+ /**
688	+ * Returns the theme settings for a specified location. Defaults to the default theme.
689	+ *
690	+ * @since 1.3
691	+ */
692	+ private function get_theme_settings_for_location( $location ) {
693	+
694	+ $theme_id = $this->get_theme_id_for_location( $location );
695	+
696	+ $all_themes = $this->get_themes();
697	+
698	+ $theme_settings = isset( $all_themes[ $theme_id ] ) ? $all_themes[ $theme_id ] : $all_themes[ 'default' ];
699	+
700	+ return $theme_settings;
701	+
702	+ }
703	+
704	+
705	+ /**
706	+ * Enqueue public CSS and JS files required by Mega Menu
707	+ *
708	+ * @since 1.0
709	+ */
710	+ public function enqueue_styles() {
711	+
712	+ $this->enqueue_fs_style();
713	+
714	+ wp_enqueue_style( 'dashicons' );
715	+
716	+ do_action( 'megamenu_enqueue_public_scripts' );
717	+
718	+ }
719	+
720	+ /**
721	+ * Enqueue public CSS and JS files required by Mega Menu
722	+ *
723	+ * @since 1.0
724	+ */
725	+ public function enqueue_scripts() {
726	+
727	+ wp_enqueue_script( 'hoverIntent' );
728	+ wp_enqueue_script( 'megamenu', MEGAMENU_BASE_URL . "js/maxmegamenu.js", array('jquery', 'hoverIntent'), MEGAMENU_VERSION, true );
729	+
730	+ $params = apply_filters("megamenu_javascript_localisation",
731	+ array(
732	+ "effect" => array(
733	+ "fade" => array(
734	+ "in" => array(
735	+ "animate" => array("opacity" => "show"),
736	+ "css" => array("display" => "none")
737	+ ),
738	+ "out" => array(
739	+ "animate" => array("opacity" => "hide")
740	+ ),
741	+ "speed" => "fast"
742	+ ),
743	+ "slide" => array(
744	+ "in" => array(
745	+ "animate" => array("height" => "show"),
746	+ "css" => array("display" => "none")
747	+ ),
748	+ "out" => array(
749	+ "animate" => array("height" => "hide")
750	+ ),
751	+ "speed" => "fast"
752	+ )
753	+ ),
754	+ "timeout" => 300,
755	+ "interval" => 100
756	+ )
757	+ );
758	+
759	+ wp_localize_script( 'megamenu', 'megamenu', $params );
760	+
761	+ }
762	+
763	+
764	+ /**
765	+ * Enqueue the stylesheet held on the filesystem.
766	+ *
767	+ * @since 1.6.1
768	+ */
769	+ private function enqueue_fs_style() {
770	+
771	+ $upload_dir = wp_upload_dir();
772	+
773	+ $filename = $this->get_css_filename();
774	+
775	+ $filepath = trailingslashit( $upload_dir['basedir'] ) . 'maxmegamenu/' . $filename;
776	+
777	+ if ( ! is_file( $filepath ) \|\| $this->is_debug_mode()) {
778	+ // regenerate the CSS and save to filesystem
779	+ $this->generate_css();
780	+
781	+ }
782	+
783	+ // file should now exist
784	+ if ( is_file( $filepath ) ) {
785	+
786	+ $css_url = trailingslashit( $upload_dir['baseurl'] ) . 'maxmegamenu/' . $filename;
787	+
788	+ $protocol = is_ssl() ? 'https://' : 'http://';
789	+
790	+ // ensure we're using the correct protocol
791	+ $css_url = str_replace( array( "http://", "https://" ), $protocol, $css_url );
792	+
793	+ wp_enqueue_style( 'megamenu', $css_url, false, substr( md5( filemtime( $filepath ) ), 0, 6 ) );
794	+
795	+ }
796	+
797	+ }
798	+
799	+
800	+ /**
801	+ *
802	+ * @since 1.6.1
803	+ */
804	+ private function set_cached_css( $css ) {
805	+
806	+ set_transient( $this->get_transient_key(), $css, 0 );
807	+ set_transient( 'megamenu_css_version', MEGAMENU_VERSION, 0 );
808	+
809	+ }
810	+
811	+
812	+ /**
813	+ * Return the cached css if it exists
814	+ *
815	+ * @since 1.9
816	+ * @return mixed
817	+ */
818	+ private function get_cached_css() {
819	+
820	+ return get_transient( $this->get_transient_key() );
821	+
822	+ }
823	+
824	+
825	+ /**
826	+ * Delete the cached CSS
827	+ *
828	+ * @since 1.9
829	+ * @return mixed
830	+ */
831	+ public function delete_cache() {
832	+ global $wp_filesystem;
833	+
834	+ if ( ! $wp_filesystem ) {
835	+ require_once( ABSPATH . 'wp-admin/includes/file.php' );
836	+ }
837	+
838	+ $upload_dir = wp_upload_dir();
839	+ $filename = $this->get_css_filename();
840	+ $dir = trailingslashit( $upload_dir['basedir'] ) . 'maxmegamenu/';
841	+
842	+ WP_Filesystem( false, $upload_dir['basedir'], true );
843	+ $wp_filesystem->rmdir( $dir, true );
844	+
845	+ delete_transient( $this->get_transient_key() );
846	+
847	+ $this->generate_css();
848	+
849	+ do_action( "megamenu_after_delete_cache" );
850	+
851	+ return true;
852	+
853	+ }
854	+
855	+
856	+ /**
857	+ * Return the key to use for the CSS transient
858	+ *
859	+ * @since 1.9
860	+ * @return string
861	+ */
862	+ private function get_transient_key() {
863	+
864	+ return apply_filters( 'megamenu_css_transient_key', 'megamenu_css' );
865	+
866	+ }
867	+
868	+
869	+ /**
870	+ * Return the filename to use for the stylesheet, ensuring the filename is unique
871	+ * for multi site setups
872	+ *
873	+ * @since 1.6.1
874	+ */
875	+ private function get_css_filename() {
876	+
877	+ return apply_filters( "megamenu_css_filename", 'style' ) . '.css';
878	+
879	+ }
880	+
881	+
882	+ /**
883	+ * Return the CSS output method, default to filesystem
884	+ *
885	+ * @return string
886	+ */
887	+ private function get_css_output_method() {
888	+
889	+ return isset( $this->settings['css'] ) ? $this->settings['css'] : 'fs';
890	+
891	+ }
892	+
893	+
894	+ /**
895	+ * Print CSS to <head>
896	+ *
897	+ * @since 1.3.1
898	+ */
899	+ public function head_css() {
900	+
901	+ $upload_dir = wp_upload_dir();
902	+
903	+ $filename = $this->get_css_filename();
904	+
905	+ $filepath = trailingslashit( $upload_dir['basedir'] ) . 'maxmegamenu/' . $filename;
906	+
907	+ if ( ! is_file( $filepath ) ) {
908	+
909	+ $css = $this->get_css();
910	+
911	+ echo '<style type="text/css">' . str_replace( array( " ", "\n" ), '', $css ) . "</style>\n";
912	+
913	+ }
914	+
915	+ }
916	+
917	+
918	+ /**
919	+ * Delete language specific transients created when PolyLang is installed
920	+ *
921	+ * @since 1.9
922	+ */
923	+ public function polylang_delete_cache() {
924	+ global $polylang;
925	+
926	+ foreach ( $polylang->model->get_languages_list() as $term ) {
927	+ delete_transient( apply_filters( 'megamenu_css_transient_key', 'megamenu_css_' . strtolower( $term->locale ) ) );
928	+ }
929	+ }
930	+
931	+
932	+ /**
933	+ * Modify the CSS transient key to make it unique to the current language
934	+ *
935	+ * @since 1.9
936	+ * @return string
937	+ */
938	+ public function polylang_transient_key( $key ) {
939	+
940	+ $locale = strtolower( pll_current_language('locale') );
941	+
942	+ if ( strlen( $locale ) ) {
943	+ $key .= $locale;
944	+ }
945	+
946	+ return $key;
947	+
948	+ }
949	+
950	+
951	+ /**
952	+ * Modify the CSS filename to make it unique to the current language
953	+ *
954	+ * @since 1.9
955	+ * @return string
956	+ */
957	+ public function polylang_css_filename( $filename ) {
958	+
959	+ $locale = strtolower( pll_current_language('locale') );
960	+
961	+ if ( strlen( $locale ) ) {
962	+ $filename .= "_" . $locale;
963	+ }
964	+
965	+ return $filename;
966	+
967	+ }
968	+
969	+
970	+ /**
971	+ * Delete language specific transients created when WPML is installed
972	+ *
973	+ * @since 1.9
974	+ */
975	+ public function wpml_delete_cache() {
976	+
977	+ $languages = icl_get_languages('skip_missing=N');
978	+
979	+ foreach ( $languages as $language ) {
980	+ delete_transient( apply_filters( 'megamenu_css_transient_key', 'megamenu_css_' . $language['language_code'] ) );
981	+ }
982	+
983	+ }
984	+
985	+
986	+ /**
987	+ * Modify the CSS transient key to make it unique to the current language
988	+ *
989	+ * @since 1.9
990	+ * @return string
991	+ */
992	+ public function wpml_transient_key( $key ) {
993	+
994	+ $key .= "_" . ICL_LANGUAGE_CODE;
995	+
996	+ return $key;
997	+
998	+ }
999	+
1000	+
1001	+ /**
1002	+ * Modify the CSS filename to make it unique to the current language
1003	+ *
1004	+ * @since 1.9
1005	+ * @return string
1006	+ */
1007	+ public function wpml_css_filename( $filename ) {
1008	+
1009	+ $filename .= "_" . ICL_LANGUAGE_CODE;
1010	+
1011	+ return $filename;
1012	+
1013	+ }
1014	+
1015	+
1016	+ }
1017	+
1018	+ endif;

classes/toggle-blocks.class.php ADDED Viewed

	@@ -0,0 +1,642 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists('Mega_Menu_Toggle_Blocks') ) :
8	+
9	+ /**
10	+ * Mobile Toggle Blocks
11	+ */
12	+ class Mega_Menu_Toggle_Blocks {
13	+
14	+ /**
15	+ * Constructor
16	+ *
17	+ * @since 2.1
18	+ */
19	+ public function __construct() {
20	+
21	+ add_filter( 'megamenu_scss_variables', array( $this, 'add_menu_toggle_block_vars_to_scss'), 10, 5 );
22	+ add_filter( 'megamenu_scss_variables', array( $this, 'add_spacer_block_vars_to_scss'), 10, 5 );
23	+ add_filter( 'megamenu_load_scss_file_contents', array( $this, 'append_scss'), 10 );
24	+ add_filter( 'megamenu_toggle_bar_content', array( $this, 'output_public_toggle_blocks' ), 10, 4 );
25	+
26	+ add_action( 'wp_ajax_mm_get_toggle_block_menu_toggle', array( $this, 'output_menu_toggle_block_html' ) );
27	+ add_action( 'megamenu_output_admin_toggle_block_menu_toggle', array( $this, 'output_menu_toggle_block_html'), 10, 2 );
28	+ add_action( 'wp_ajax_mm_get_toggle_block_spacer', array( $this, 'output_spacer_block_html' ) );
29	+ add_action( 'megamenu_output_admin_toggle_block_spacer', array( $this, 'output_spacer_block_html'), 10, 2 );
30	+
31	+ add_action( 'megamenu_after_theme_revert', array($this, 'revert_toggle_blocks') );
32	+ add_action( 'megamenu_after_theme_save', array( $this, 'save_toggle_blocks' ) );
33	+
34	+ add_action( 'megamenu_admin_scripts', array( $this, 'enqueue_scripts' ) );
35	+ add_action( 'megamenu_print_theme_option_toggle_blocks', array( $this, 'print_theme_toggle_bar_designer_option'), 10, 2);
36	+
37	+ add_filter( 'megamenu_theme_editor_settings', array( $this, 'add_toggle_designer_to_theme_editor'), 10 );
38	+
39	+ }
40	+
41	+
42	+ /**
43	+ * Return the saved toggle blocks for a specified theme
44	+ *
45	+ * @param string $theme_id
46	+ * @since 2.1
47	+ * @return array
48	+ */
49	+ private function get_toggle_blocks_for_theme( $theme_id ) {
50	+
51	+ $blocks = get_site_option( "megamenu_toggle_blocks" );
52	+
53	+ if ( isset( $blocks[ $theme_id ] ) ) {
54	+ return $blocks[ $theme_id ];
55	+ }
56	+
57	+ // backwards compatibility
58	+ // default to right aligned menu toggle using existing theme settings
59	+ $blocks[1] = $this->get_default_menu_toggle_block();
60	+
61	+ return $blocks;
62	+
63	+ }
64	+
65	+
66	+ /**
67	+ * Return default menu toggle block settings
68	+ *
69	+ * @since 2.1
70	+ * @return array
71	+ */
72	+ private function get_default_menu_toggle_block() {
73	+
74	+ $style_manager = new Mega_Menu_Style_Manager();
75	+
76	+ $themes = $style_manager->get_themes();
77	+
78	+ $menu_theme = isset( $themes[ $theme_id ] ) ? $themes[ $theme_id ] : $themes['default'];
79	+
80	+ $defaults = array(
81	+ 'type' => 'menu_toggle',
82	+ 'align' => 'right',
83	+ 'closed_text' => isset($menu_theme['responsive_text']) ? $menu_theme['responsive_text'] : "MENU",
84	+ 'open_text' => isset($menu_theme['responsive_text']) ? $menu_theme['responsive_text'] : "MENU",
85	+ 'closed_icon' => 'dash-f333',
86	+ 'open_icon' => 'dash-f153',
87	+ 'icon_position' => 'after',
88	+ 'text_color' => isset($menu_theme['toggle_font_color']) ? $menu_theme['toggle_font_color'] : '#fff',
89	+ 'icon_color' => isset($menu_theme['toggle_font_color']) ? $menu_theme['toggle_font_color'] : '#fff'
90	+ );
91	+
92	+ return $defaults;
93	+ }
94	+
95	+
96	+ /**
97	+ * Get the HTML output for the toggle blocks
98	+ *
99	+ * @since 2.1
100	+ * @param string $content
101	+ * @param string $nav_menu
102	+ * @param array $args
103	+ * @param string $theme_id
104	+ * @return string
105	+ */
106	+ public function output_public_toggle_blocks( $content, $nav_menu, $args, $theme_id ) {
107	+
108	+ $toggle_blocks = $this->get_toggle_blocks_for_theme( $theme_id );
109	+
110	+ $blocks_html = "";
111	+
112	+ if ( is_array( $toggle_blocks ) ) {
113	+ foreach ( $toggle_blocks as $block_id => $block ) {
114	+
115	+ if ( isset( $block['type'] ) ) {
116	+ $class = "mega-" . str_replace("_", "-", $block['type']) . "-block";
117	+ } else {
118	+ $class = "";
119	+ }
120	+
121	+ if ( isset( $block['align'] ) ) {
122	+ $align = "mega-toggle-block-" . $block['align'];
123	+ } else {
124	+ $align = "mega-toggle-block-left";
125	+ }
126	+
127	+ $blocks_html .= "<div class='mega-toggle-block {$class} {$align}' id='mega-toggle-block-{$block_id}'>";
128	+ $blocks_html .= apply_filters("megamenu_output_public_toggle_block_{$block['type']}", "", $block);
129	+ $blocks_html .= "</div>";
130	+ }
131	+ }
132	+
133	+ $content .= $blocks_html;
134	+
135	+ return $content;
136	+
137	+ }
138	+
139	+
140	+ /**
141	+ * Save the toggle blocks when the theme is saved
142	+ *
143	+ * @since 2.1
144	+ */
145	+ public function save_toggle_blocks() {
146	+
147	+ $theme = esc_attr( $_POST['theme_id'] );
148	+
149	+ $saved_blocks = get_site_option( "megamenu_toggle_blocks" );
150	+
151	+ if ( isset( $saved_blocks[ $theme ] ) ) {
152	+ unset( $saved_blocks[ $theme ] );
153	+ }
154	+
155	+ $submitted_settings = $_POST['toggle_blocks'];
156	+
157	+ $saved_blocks[ $theme ] = $submitted_settings;
158	+
159	+ update_site_option( "megamenu_toggle_blocks", $saved_blocks );
160	+
161	+ }
162	+
163	+
164	+ /**
165	+ * Revert the toggle blocks when a theme is reverted
166	+ *
167	+ * @since 2.1
168	+ */
169	+ public function revert_toggle_blocks() {
170	+
171	+ $theme = esc_attr( $_POST['theme_id'] );
172	+
173	+ $saved_toggle_blocks = get_site_option( "megamenu_toggle_blocks" );
174	+
175	+ if ( isset( $saved_toggle_blocks[$theme] ) ) {
176	+ unset( $saved_toggle_blocks[$theme] );
177	+ }
178	+
179	+ update_site_option( "megamenu_toggle_blocks", $saved_themes );
180	+ }
181	+
182	+
183	+ /**
184	+ * Add the toggle bar designer to the theme editor
185	+ *
186	+ * @since 2.1
187	+ * @return array
188	+ */
189	+ public function add_toggle_designer_to_theme_editor( $settings ) {
190	+
191	+ $settings['mobile_menu']['settings']['toggle_blocks'] = array(
192	+ 'priority' => 5,
193	+ 'title' => __( "Toggle Bar Designer", "megamenu" ),
194	+ 'description' => __( "Configure the contents of the mobile toggle bar", "megamenu" ),
195	+ 'settings' => array(
196	+ array(
197	+ 'title' => __( "", "megamenu" ),
198	+ 'type' => 'toggle_blocks',
199	+ 'key' => 'toggle_blocks'
200	+ )
201	+ ),
202	+ );
203	+
204	+ return $settings;
205	+ }
206	+
207	+
208	+ /**
209	+ * Enqueue nav-menus.php scripts
210	+ *
211	+ * @since 2.1
212	+ */
213	+ public function enqueue_scripts() {
214	+
215	+ wp_enqueue_script( 'mega-menu-toggle-bar-designer', MEGAMENU_BASE_URL . 'js/toggledesigner.js', array( 'jquery', 'jquery-ui-core', 'jquery-ui-sortable' ), MEGAMENU_VERSION );
216	+
217	+ wp_localize_script( 'mega-menu-toggle-bar-designer', 'megamenu',
218	+ array(
219	+ 'nonce' => wp_create_nonce('megamenu_edit')
220	+ )
221	+ );
222	+
223	+ }
224	+
225	+
226	+ /**
227	+ * Append the logo SCSS to the main SCSS file
228	+ *
229	+ * @since 2.1
230	+ * @param string $scss
231	+ * @param string
232	+ */
233	+ public function append_scss( $scss ) {
234	+
235	+ $path = MEGAMENU_PATH . 'css/toggle-blocks.scss';
236	+
237	+ $contents = file_get_contents( $path );
238	+
239	+ return $scss . $contents;
240	+
241	+ }
242	+
243	+
244	+ /**
245	+ * Create a new variable containing the toggle blocks to be used by the SCSS file
246	+ *
247	+ * @param array $vars
248	+ * @param string $location
249	+ * @param string $theme
250	+ * @param int $menu_id
251	+ * @param string $theme_id
252	+ * @return array - all custom SCSS vars
253	+ * @since 2.1
254	+ */
255	+ public function add_menu_toggle_block_vars_to_scss( $vars, $location, $theme, $menu_id, $theme_id ) {
256	+
257	+ $toggle_blocks = $this->get_toggle_blocks_for_theme( $theme_id );
258	+
259	+ $menu_toggle_blocks = array();
260	+
261	+ if ( is_array( $toggle_blocks ) ) {
262	+
263	+ foreach( $toggle_blocks as $index => $settings ) {
264	+
265	+ if ( isset( $settings['type'] ) && $settings['type'] == 'menu_toggle' ) {
266	+
267	+ $styles = array(
268	+ 'id' => $index,
269	+ 'align' => isset($settings['align']) ? "'" . $settings['align'] . "'" : "'right'",
270	+ 'closed_text' => isset($settings['closed_text']) ? "'" . $settings['closed_text'] . "'" : "'MENU'",
271	+ 'open_text' => isset($settings['open_text']) ? "'" . $settings['open_text'] . "'" : "''",
272	+ 'closed_icon' => isset($settings['closed_icon']) && $settings['closed_icon'] != 'disabled' ? "'\\" . end( explode( '-', $settings['closed_icon'] ) ) . "'" : "''",
273	+ 'open_icon' => isset($settings['open_icon']) && $settings['open_icon'] != 'disabled' ? "'\\" . end( explode( '-', $settings['open_icon'] ) ) . "'" : "''",
274	+ 'text_color' => isset($settings['text_color']) ? $settings['text_color'] : '#fff',
275	+ 'icon_color' => isset($settings['icon_color']) ? $settings['icon_color'] : '#fff',
276	+ 'icon_position' => isset($settings['icon_position']) ? "'" . $settings['icon_position'] . "'" : 'after'
277	+ );
278	+
279	+ $menu_toggle_blocks[ $index ] = $styles;
280	+ }
281	+
282	+ }
283	+ }
284	+
285	+ //$menu_toggle_blocks(
286	+ // (123, red, 150px),
287	+ // (456, green, null),
288	+ // (789, blue, 90%),());
289	+ if ( count( $menu_toggle_blocks ) ) {
290	+
291	+ $list = "(";
292	+
293	+ foreach ( $menu_toggle_blocks as $id => $vals ) {
294	+ $list .= "(" . implode( ",", $vals ) . "),";
295	+ }
296	+
297	+ // Always add an empty list item to meke sure there are always at least 2 items in the list
298	+ // Lists with a single item are not treated the same way by SASS
299	+ $list .= "());";
300	+
301	+ $vars['menu_toggle_blocks'] = $list;
302	+
303	+ } else {
304	+
305	+ $vars['menu_toggle_blocks'] = "()";
306	+
307	+ }
308	+
309	+ return $vars;
310	+ }
311	+
312	+ /**
313	+ * Create a new variable containing the spacer blocks to be used by the SCSS file
314	+ *
315	+ * @param array $vars
316	+ * @param string $location
317	+ * @param string $theme
318	+ * @param int $menu_id
319	+ * @param string $theme_id
320	+ * @return array - all custom SCSS vars
321	+ * @since 2.1
322	+ */
323	+ public function add_spacer_block_vars_to_scss( $vars, $location, $theme, $menu_id, $theme_id ) {
324	+
325	+ $toggle_blocks = $this->get_toggle_blocks_for_theme( $theme_id );
326	+
327	+ $menu_toggle_blocks = array();
328	+
329	+ if ( is_array( $toggle_blocks ) ) {
330	+
331	+ foreach( $toggle_blocks as $index => $settings ) {
332	+
333	+ if ( isset( $settings['type'] ) && $settings['type'] == 'spacer' ) {
334	+
335	+ $styles = array(
336	+ 'id' => $index,
337	+ 'align' => isset($settings['align']) ? "'" . $settings['align'] . "'" : "'right'",
338	+ 'width' => isset($settings['width']) ? "'" . $settings['width'] . "'" : '0px',
339	+ );
340	+
341	+ $spacer_blocks[ $index ] = $styles;
342	+ }
343	+
344	+ }
345	+ }
346	+
347	+ //$menu_toggle_blocks(
348	+ // (123, red, 150px),
349	+ // (456, green, null),
350	+ // (789, blue, 90%),());
351	+ if ( count( $spacer_blocks ) ) {
352	+
353	+ $list = "(";
354	+
355	+ foreach ( $spacer_blocks as $id => $vals ) {
356	+ $list .= "(" . implode( ",", $vals ) . "),";
357	+ }
358	+
359	+ // Always add an empty list item to meke sure there are always at least 2 items in the list
360	+ // Lists with a single item are not treated the same way by SASS
361	+ $list .= "());";
362	+
363	+ $vars['spacer_blocks'] = $list;
364	+
365	+ } else {
366	+
367	+ $vars['spacer_blocks'] = "()";
368	+
369	+ }
370	+
371	+ return $vars;
372	+
373	+ }
374	+
375	+
376	+ /**
377	+ * Print the toggle bar designer option
378	+ *
379	+ * @since 2.1
380	+ * @param string $key
381	+ * @param string $theme_id
382	+ */
383	+ public function print_theme_toggle_bar_designer_option( $key, $theme_id ) {
384	+
385	+ $toggle_blocks = $this->get_toggle_blocks_for_theme( $theme_id );
386	+
387	+ $block_types = apply_filters("megamenu_registered_toggle_blocks", array(
388	+ 'title' => __("Add block to toggle bar", "megamenu"),
389	+ 'menu_toggle' => __("Menu Toggle", "megamenu"),
390	+ 'spacer' => __("Spacer", "megamenu")
391	+ ));
392	+
393	+ ?>
394	+
395	+ <select id='toggle-block-selector'>
396	+ <?php foreach( $block_types as $block_id => $block_name ) : ?>
397	+ <option value='<?php echo $block_id; ?>'><?php echo $block_name ?></option>
398	+ <?php endforeach; ?>
399	+ </select>
400	+
401	+ <div class='toggle-bar-designer'>
402	+ <div class='mega-blocks'>
403	+ <div class='mega-left'>
404	+ <?php
405	+
406	+ if ( is_array( $toggle_blocks ) ) {
407	+ foreach( $toggle_blocks as $block_id => $settings ) {
408	+ if ( is_int( $block_id ) && is_array( $settings ) && isset( $settings['align'] ) && $settings['align'] == 'left' \|\| ! isset( $settings['align'] ) ) {
409	+ do_action( "megamenu_output_admin_toggle_block_{$settings['type']}", $block_id, $settings );
410	+ }
411	+ }
412	+ }
413	+
414	+ ?>
415	+ </div>
416	+ <div class='mega-center'>
417	+ <?php
418	+
419	+ if ( is_array( $toggle_blocks ) ) {
420	+ foreach( $toggle_blocks as $block_id => $settings ) {
421	+ if ( is_int( $block_id ) && is_array( $settings ) && isset( $settings['align'] ) && $settings['align'] == 'center' ) {
422	+ do_action( "megamenu_output_admin_toggle_block_{$settings['type']}", $block_id, $settings );
423	+ }
424	+ }
425	+ }
426	+
427	+ ?>
428	+ </div>
429	+ <div class='mega-right'>
430	+ <?php
431	+
432	+ if ( is_array( $toggle_blocks ) ) {
433	+ foreach( $toggle_blocks as $block_id => $settings ) {
434	+ if ( is_int( $block_id ) && is_array( $settings ) && isset( $settings['align'] ) && $settings['align'] == 'right' ) {
435	+ do_action( "megamenu_output_admin_toggle_block_{$settings['type']}", $block_id, $settings );
436	+ }
437	+ }
438	+ }
439	+
440	+ ?>
441	+ </div>
442	+
443	+ </div>
444	+ </div>
445	+
446	+ <?php
447	+ }
448	+
449	+
450	+ /**
451	+ * Output the HTML for the "Spacer" toggle block settings
452	+ *
453	+ * @since 2.1
454	+ * @param int $block_id
455	+ * @param array $settings
456	+ */
457	+ public function output_spacer_block_html( $block_id, $settings = array() ) {
458	+
459	+ if ( empty( $settings ) ) {
460	+ $block_id = "0";
461	+ }
462	+
463	+ $defaults = array(
464	+ 'align' => 'right',
465	+ 'width' => '0px'
466	+ );
467	+
468	+ $settings = array_merge( $defaults, $settings );
469	+
470	+ ?>
471	+
472	+ <div class='block'>
473	+ <div class='block-title'><span title='<?php _e("Spacer", "megamenu"); ?>' class="dashicons dashicons-leftright"></span></div>
474	+ <div class='block-settings'>
475	+ <h3><?php _e("Spacer Settings", "megamenu") ?></h3>
476	+ <input type='hidden' class='type' name='toggle_blocks[<?php echo $block_id; ?>][type]' value='spacer' />
477	+ <input type='hidden' class='align' name='toggle_blocks[<?php echo $block_id; ?>][align]' value='<?php echo $settings['align'] ?>'>
478	+ <label>
479	+ <?php _e("Width", "megamenu") ?><input type='text' class='closed_text' name='toggle_blocks[<?php echo $block_id; ?>][width]' value='<?php echo $settings['width'] ?>' />
480	+ </label>
481	+ <a class='mega-delete'><?php _e("Delete", "megamenu"); ?></a>
482	+ </div>
483	+ </div>
484	+
485	+ <?php
486	+ }
487	+
488	+
489	+ /**
490	+ * Output the HTML for the "Menu Toggle" block settings
491	+ *
492	+ * @since 2.1
493	+ * @param int $block_id
494	+ * @param array $settings
495	+ */
496	+ public function output_menu_toggle_block_html( $block_id, $settings = array() ) {
497	+
498	+ if ( empty( $settings ) ) {
499	+ $block_id = "0";
500	+ }
501	+
502	+ $defaults = $this->get_default_menu_toggle_block();
503	+
504	+ $settings = array_merge( $defaults, $settings );
505	+
506	+ ?>
507	+
508	+ <div class='block'>
509	+ <div class='block-title'><span title='<?php _e("Menu Toggle", "megamenu"); ?>' class="dashicons dashicons-menu"></span></div>
510	+ <div class='block-settings'>
511	+ <h3><?php _e("Menu Toggle Settings", "megamenu") ?></h3>
512	+ <input type='hidden' class='type' name='toggle_blocks[<?php echo $block_id; ?>][type]' value='menu_toggle' />
513	+ <input type='hidden' class='align' name='toggle_blocks[<?php echo $block_id; ?>][align]' value='<?php echo $settings['align'] ?>'>
514	+ <label>
515	+ <?php _e("Closed Text", "megamenu") ?><input type='text' class='closed_text' name='toggle_blocks[<?php echo $block_id; ?>][closed_text]' value='<?php echo $settings['closed_text'] ?>' />
516	+ </label>
517	+ <label>
518	+ <?php _e("Open Text", "megamenu") ?><input type='text' class='open_text' name='toggle_blocks[<?php echo $block_id; ?>][open_text]' value='<?php echo $settings['open_text'] ?>' />
519	+ </label>
520	+ <label>
521	+ <?php _e("Closed Icon", "megamenu") ?>
522	+ <?php $this->print_toggle_icon_option( 'closed_icon', $block_id, $settings['closed_icon'] ); ?>
523	+ </label>
524	+ <label>
525	+ <?php _e("Open Icon", "megamenu") ?>
526	+ <?php $this->print_toggle_icon_option( 'open_icon', $block_id, $settings['open_icon'] ); ?>
527	+ </label>
528	+ <label>
529	+ <?php _e("Text Color", "megamenu") ?>
530	+ <?php $this->print_toggle_color_option( 'text_color', $block_id, $settings['text_color'] ); ?>
531	+ </label>
532	+ <label>
533	+ <?php _e("Icon Color", "megamenu") ?>
534	+ <?php $this->print_toggle_color_option( 'icon_color', $block_id, $settings['icon_color'] ); ?>
535	+ </label>
536	+ <label>
537	+ <?php _e("Icon Position", "megamenu") ?><select name='toggle_blocks[<?php echo $block_id; ?>][icon_position]'>
538	+ <option value='before' <?php selected( $settings['icon_position'], "before" ) ?> ><?php _e("Before", "megamenu") ?></option>
539	+ <option value='after' <?php selected( $settings['icon_position'], "after" ) ?> ><?php _e("After", "megamenu") ?></option>
540	+ </select>
541	+ </label>
542	+ <a class='mega-delete'><?php _e("Delete", "megamenu"); ?></a>
543	+ </div>
544	+ </div>
545	+
546	+ <?php
547	+ }
548	+
549	+
550	+ /**
551	+ * Print a toggle icon selection box
552	+ *
553	+ * @since 2.1
554	+ * @param string $key
555	+ * @param int $block_id
556	+ * @param string $value
557	+ */
558	+ public function print_toggle_icon_option( $key, $block_id, $value ) {
559	+
560	+ $all_icons = $this->toggle_icons();
561	+
562	+ ?>
563	+ <select class='icon_dropdown' name='toggle_blocks[<?php echo $block_id ?>][<?php echo $key ?>]'>
564	+ <?php
565	+
566	+ echo "<option value='disabled'>" . __("Disabled", "megamenu") . "</option>";
567	+
568	+ foreach ($all_icons as $code => $class) {
569	+ $name = str_replace('dashicons-', '', $class);
570	+ $name = ucwords(str_replace(array('-','arrow'), ' ', $name));
571	+ echo "<option data-class='{$class}' value='{$code}'" . selected( $value, $code, false ) . ">" . $name . "</option>";
572	+ }
573	+
574	+ ?>
575	+ </select>
576	+
577	+ <?php
578	+ }
579	+
580	+
581	+ /**
582	+ * Print a color picker
583	+ *
584	+ * @since 2.1
585	+ * @param string $key
586	+ * @param int $block_id
587	+ * @param string $value
588	+ */
589	+ public function print_toggle_color_option( $key, $block_id, $value ) {
590	+
591	+ if ( $value == 'transparent' ) {
592	+ $value = 'rgba(0,0,0,0)';
593	+ }
594	+
595	+ if ( $value == 'rgba(0,0,0,0)' ) {
596	+ $value_text = 'transparent';
597	+ } else {
598	+ $value_text = $value;
599	+ }
600	+
601	+ echo "<div class='mm-picker-container'>";
602	+ echo " <input type='text' class='mm_colorpicker' name='toggle_blocks[{$block_id}][{$key}]' value='{$value}' />";
603	+ echo " <div class='chosen-color'>{$value_text}</div>";
604	+ echo "</div>";
605	+
606	+ }
607	+
608	+
609	+ /**
610	+ * List of all available toggle DashIcon classes.
611	+ *
612	+ * @since 2.1
613	+ * @return array - Sorted list of toggle classes
614	+ */
615	+ private function toggle_icons() {
616	+
617	+ $icons = array(
618	+ 'dash-f333' => 'dashicons-menu',
619	+ 'dash-f214' => 'dashicons-editor-justify',
620	+ 'dash-f158' => 'dashicons-no',
621	+ 'dash-f335' => 'dashicons-no-alt',
622	+ 'dash-f132' => 'dashicons-plus',
623	+ 'dash-f502' => 'dashicons-plus-alt',
624	+ 'dash-f460' => 'dashicons-minus',
625	+ 'dash-f153' => 'dashicons-dismiss',
626	+ 'dash-f142' => 'dashicons-arrow-up',
627	+ 'dash-f140' => 'dashicons-arrow-down',
628	+ 'dash-f342' => 'dashicons-arrow-up-alt',
629	+ 'dash-f346' => 'dashicons-arrow-down-alt',
630	+ 'dash-f343' => 'dashicons-arrow-up-alt2',
631	+ 'dash-f347' => 'dashicons-arrow-down-alt2',
632	+ );
633	+
634	+ $icons = apply_filters( "megamenu_toggle_icons", $icons );
635	+
636	+ return $icons;
637	+
638	+ }
639	+
640	+ }
641	+
642	+ endif;

classes/walker.class.php ADDED Viewed

	@@ -0,0 +1,163 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if( ! class_exists( 'Mega_Menu_Walker' ) ) :
8	+
9	+ /**
10	+ * @package WordPress
11	+ * @since 1.0.0
12	+ * @uses Walker
13	+ */
14	+ class Mega_Menu_Walker extends Walker_Nav_Menu {
15	+
16	+ /**
17	+ * Starts the list before the elements are added.
18	+ *
19	+ * @see Walker::start_lvl()
20	+ *
21	+ * @since 1.0
22	+ *
23	+ * @param string $output Passed by reference. Used to append additional content.
24	+ * @param int $depth Depth of menu item. Used for padding.
25	+ * @param array $args An array of arguments. @see wp_nav_menu()
26	+ */
27	+ function start_lvl( &$output, $depth = 0, $args = array() ) {
28	+
29	+ $indent = str_repeat("\t", $depth);
30	+
31	+ $output .= "\n$indent<ul class=\"mega-sub-menu\">\n";
32	+ }
33	+
34	+ /**
35	+ * Ends the list of after the elements are added.
36	+ *
37	+ * @see Walker::end_lvl()
38	+ *
39	+ * @since 1.0
40	+ *
41	+ * @param string $output Passed by reference. Used to append additional content.
42	+ * @param int $depth Depth of menu item. Used for padding.
43	+ * @param array $args An array of arguments. @see wp_nav_menu()
44	+ */
45	+ function end_lvl( &$output, $depth = 0, $args = array() ) {
46	+ $indent = str_repeat("\t", $depth);
47	+ $output .= "$indent</ul>\n";
48	+ }
49	+
50	+ /**
51	+ * Custom walker. Add the widgets into the menu.
52	+ *
53	+ * @see Walker::start_el()
54	+ *
55	+ * @since 1.0
56	+ *
57	+ * @param string $output Passed by reference. Used to append additional content.
58	+ * @param object $item Menu item data object.
59	+ * @param int $depth Depth of menu item. Used for padding.
60	+ * @param array $args An array of arguments. @see wp_nav_menu()
61	+ * @param int $id Current item ID.
62	+ */
63	+ function start_el( &$output, $item, $depth = 0, $args = array(), $id = 0 ) {
64	+
65	+ $indent = ( $depth ) ? str_repeat( "\t", $depth ) : '';
66	+
67	+ if ( property_exists( $item, 'megamenu_settings' ) ) {
68	+ $settings = $item->megamenu_settings;
69	+ } else {
70	+ $settings = Mega_Menu_Nav_Menus::get_menu_item_defaults();
71	+ }
72	+
73	+ // Item Class
74	+ $classes = empty( $item->classes ) ? array() : (array) $item->classes;
75	+
76	+ $classes[] = 'menu-item-' . $item->ID;
77	+
78	+ $class = join( ' ', apply_filters( 'megamenu_nav_menu_css_class', array_filter( $classes ), $item, $args ) );
79	+
80	+ // strip widget classes back to how they're intended to be output
81	+ $class = str_replace( "mega-menu-widget-class-", "", $class );
82	+
83	+ // Item ID
84	+ $id = esc_attr( apply_filters( 'megamenu_nav_menu_item_id', "mega-menu-item-{$item->ID}", $item, $args ) );
85	+
86	+ $output .= "<li class='{$class}' id='{$id}'>";
87	+
88	+ // output the widgets
89	+ if ( $item->type == 'widget' && $item->content ) {
90	+
91	+ $item_output = $item->content;
92	+
93	+ } else {
94	+
95	+ $atts = array();
96	+
97	+ $atts['title'] = ! empty( $item->attr_title ) ? $item->attr_title : '';
98	+ $atts['target'] = ! empty( $item->target ) ? $item->target : '';
99	+ $atts['class'] = '';
100	+ $atts['rel'] = ! empty( $item->xfn ) ? $item->xfn : '';
101	+
102	+ if ( $settings['disable_link'] != 'true') {
103	+ $atts['href'] = ! empty( $item->url ) ? $item->url : '';
104	+ }
105	+
106	+ if ( isset( $settings['icon']) && $settings['icon'] != 'disabled' ) {
107	+ $atts['class'] = $settings['icon'];
108	+ }
109	+
110	+ $atts = apply_filters( 'megamenu_nav_menu_link_attributes', $atts, $item, $args );
111	+
112	+ if ( strlen( $atts['class'] ) ) {
113	+ $atts['class'] = $atts['class'] . ' mega-menu-link';
114	+ } else {
115	+ $atts['class'] = 'mega-menu-link';
116	+ }
117	+
118	+ $attributes = '';
119	+
120	+ foreach ( $atts as $attr => $value ) {
121	+
122	+ if ( ! empty( $value ) ) {
123	+ $value = ( 'href' === $attr ) ? esc_url( $value ) : esc_attr( $value );
124	+ $attributes .= ' ' . $attr . '="' . $value . '"';
125	+ }
126	+
127	+ }
128	+
129	+ $item_output = $args->before;
130	+ $item_output .= '<a'. $attributes .'>';
131	+
132	+ if ( $settings['hide_text'] == 'true' && $depth == 0 ) {
133	+ /** This filter is documented in wp-includes/post-template.php */
134	+ } else {
135	+ $item_output .= $args->link_before . apply_filters( 'megamenu_the_title', $item->title, $item->ID ) . $args->link_after;
136	+ }
137	+
138	+ $item_output .= '</a>';
139	+ $item_output .= $args->after;
140	+
141	+ }
142	+
143	+ $output .= apply_filters( 'megamenu_walker_nav_menu_start_el', $item_output, $item, $depth, $args );
144	+ }
145	+
146	+ /**
147	+ * Ends the element output, if needed.
148	+ *
149	+ * @see Walker::end_el()
150	+ *
151	+ * @since 1.7
152	+ *
153	+ * @param string $output Passed by reference. Used to append additional content.
154	+ * @param object $item Page data object. Not used.
155	+ * @param int $depth Depth of page. Not Used.
156	+ * @param array $args An array of arguments. @see wp_nav_menu()
157	+ */
158	+ public function end_el( &$output, $item, $depth = 0, $args = array() ) {
159	+ $output .= "</li>"; // remove new line to remove the 4px gap between menu items
160	+ }
161	+ }
162	+
163	+ endif;

classes/widget-manager.class.php ADDED Viewed

	@@ -0,0 +1,1017 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists('Mega_Menu_Widget_Manager') ) :
8	+
9	+ /**
10	+ * Processes AJAX requests from the Mega Menu panel editor.
11	+ * Also registers our widget sidebar.
12	+ *
13	+ * There is very little in WordPress core to help with listing, editing, saving,
14	+ * deleting widgets etc so this class implements that functionality.
15	+ */
16	+ class Mega_Menu_Widget_Manager {
17	+
18	+ /**
19	+ * Constructor
20	+ *
21	+ * @since 1.0
22	+ */
23	+ public function __construct() {
24	+
25	+ add_action( 'init', array( $this, 'register_sidebar' ) );
26	+
27	+ add_action( 'wp_ajax_mm_edit_widget', array( $this, 'ajax_show_widget_form' ) );
28	+ add_action( 'wp_ajax_mm_save_widget', array( $this, 'ajax_save_widget' ) );
29	+ add_action( 'wp_ajax_mm_update_widget_columns', array( $this, 'ajax_update_widget_columns' ) );
30	+ add_action( 'wp_ajax_mm_update_menu_item_columns', array( $this, 'ajax_update_menu_item_columns' ) );
31	+ add_action( 'wp_ajax_mm_delete_widget', array( $this, 'ajax_delete_widget' ) );
32	+ add_action( 'wp_ajax_mm_add_widget', array( $this, 'ajax_add_widget' ) );
33	+ add_action( 'wp_ajax_mm_reorder_items', array( $this, 'ajax_reorder_items' ) );
34	+
35	+ add_filter( 'widget_update_callback', array( $this, 'persist_mega_menu_widget_settings'), 10, 4 );
36	+
37	+ add_action( 'megamenu_after_widget_add', array( $this, 'clear_caches' ) );
38	+ add_action( 'megamenu_after_widget_save', array( $this, 'clear_caches' ) );
39	+ add_action( 'megamenu_after_widget_delete', array( $this, 'clear_caches' ) );
40	+
41	+ }
42	+
43	+
44	+ /**
45	+ * Depending on how a widget has been written, it may not necessarily base the new widget settings on
46	+ * a copy the old settings. If this is the case, the mega menu data will be lost. This function
47	+ * checks to make sure widgets persist the mega menu data when they're saved.
48	+ *
49	+ * @since 1.0
50	+ */
51	+ public function persist_mega_menu_widget_settings( $instance, $new_instance, $old_instance, $that ) {
52	+
53	+ if ( isset( $old_instance["mega_menu_columns"] ) && ! isset( $new_instance["mega_menu_columns"] ) ) {
54	+ $instance["mega_menu_columns"] = $old_instance["mega_menu_columns"];
55	+ }
56	+
57	+ if ( isset( $old_instance["mega_menu_order"] ) && ! isset( $new_instance["mega_menu_order"] ) ) {
58	+ $instance["mega_menu_order"] = $old_instance["mega_menu_order"];
59	+ }
60	+
61	+ if ( isset( $old_instance["mega_menu_parent_menu_id"] ) && ! isset( $new_instance["mega_menu_parent_menu_id"] ) ) {
62	+ $instance["mega_menu_parent_menu_id"] = $old_instance["mega_menu_parent_menu_id"];
63	+ }
64	+
65	+ return $instance;
66	+ }
67	+
68	+
69	+ /**
70	+ * Create our own widget area to store all mega menu widgets.
71	+ * All widgets from all menus are stored here, they are filtered later
72	+ * to ensure the correct widgets show under the correct menu item.
73	+ *
74	+ * @since 1.0
75	+ */
76	+ public function register_sidebar() {
77	+
78	+ register_sidebar(
79	+ array(
80	+ 'id' => 'mega-menu',
81	+ 'name' => __("Mega Menu Widgets", "megamenu"),
82	+ 'description' => __("Do not manually edit this area.", "megamenu")
83	+ )
84	+ );
85	+ }
86	+
87	+
88	+ /**
89	+ * Display a widget settings form
90	+ *
91	+ * @since 1.0
92	+ */
93	+ public function ajax_show_widget_form() {
94	+
95	+ check_ajax_referer( 'megamenu_edit' );
96	+
97	+ $widget_id = sanitize_text_field( $_POST['widget_id'] );
98	+
99	+ if ( ob_get_contents() ) ob_clean(); // remove any warnings or output from other plugins which may corrupt the response
100	+
101	+ wp_die( trim( $this->show_widget_form( $widget_id ) ) );
102	+
103	+ }
104	+
105	+
106	+ /**
107	+ * Save a widget
108	+ *
109	+ * @since 1.0
110	+ */
111	+ public function ajax_save_widget() {
112	+
113	+ $widget_id = sanitize_text_field( $_POST['widget_id'] );
114	+ $id_base = sanitize_text_field( $_POST['id_base'] );
115	+
116	+ check_ajax_referer( 'megamenu_save_widget_' . $widget_id );
117	+
118	+ $saved = $this->save_widget( $id_base );
119	+
120	+ if ( $saved ) {
121	+ $this->send_json_success( sprintf( __("Saved %s", "megamenu"), $id_base ) );
122	+ } else {
123	+ $this->send_json_error( sprintf( __("Failed to save %s", "megamenu"), $id_base ) );
124	+ }
125	+
126	+ }
127	+
128	+
129	+ /**
130	+ * Update the number of mega columns for a widget
131	+ *
132	+ * @since 1.0
133	+ */
134	+ public function ajax_update_widget_columns() {
135	+
136	+ check_ajax_referer( 'megamenu_edit' );
137	+
138	+ $widget_id = sanitize_text_field( $_POST['id'] );
139	+ $columns = absint( $_POST['columns'] );
140	+
141	+ $updated = $this->update_widget_columns( $widget_id, $columns );
142	+
143	+ if ( $updated ) {
144	+ $this->send_json_success( sprintf( __( "Updated %s (new columns: %d)", "megamenu"), $widget_id, $columns ) );
145	+ } else {
146	+ $this->send_json_error( sprintf( __( "Failed to update %s", "megamenu"), $widget_id ) );
147	+ }
148	+
149	+ }
150	+
151	+
152	+ /**
153	+ * Update the number of mega columns for a widget
154	+ *
155	+ * @since 1.0
156	+ */
157	+ public function ajax_update_menu_item_columns() {
158	+
159	+ check_ajax_referer( 'megamenu_edit' );
160	+
161	+ $id = absint( $_POST['id'] );
162	+ $columns = absint( $_POST['columns'] );
163	+
164	+ $updated = $this->update_menu_item_columns( $id, $columns );
165	+
166	+ if ( $updated ) {
167	+ $this->send_json_success( sprintf( __( "Updated %s (new columns: %d)", "megamenu"), $id, $columns ) );
168	+ } else {
169	+ $this->send_json_error( sprintf( __( "Failed to update %s", "megamenu"), $id ) );
170	+ }
171	+
172	+ }
173	+
174	+
175	+ /**
176	+ * Add a widget to the panel
177	+ *
178	+ * @since 1.0
179	+ */
180	+ public function ajax_add_widget() {
181	+
182	+ check_ajax_referer( 'megamenu_edit' );
183	+
184	+ $id_base = sanitize_text_field( $_POST['id_base'] );
185	+ $menu_item_id = absint( $_POST['menu_item_id'] );
186	+ $title = sanitize_text_field( $_POST['title'] );
187	+
188	+ $added = $this->add_widget( $id_base, $menu_item_id, $title );
189	+
190	+ if ( $added ) {
191	+ $this->send_json_success( $added );
192	+ } else {
193	+ $this->send_json_error( sprintf( __("Failed to add %s to %d", "megamenu"), $id_base, $menu_item_id ) );
194	+ }
195	+
196	+ }
197	+
198	+
199	+ /**
200	+ * Deletes a widget
201	+ *
202	+ * @since 1.0
203	+ */
204	+ public function ajax_delete_widget() {
205	+
206	+ check_ajax_referer( 'megamenu_edit' );
207	+
208	+ $widget_id = sanitize_text_field( $_POST['widget_id'] );
209	+
210	+ $deleted = $this->delete_widget( $widget_id );
211	+
212	+ if ( $deleted ) {
213	+ $this->send_json_success( sprintf( __( "Deleted %s", "megamenu"), $widget_id ) );
214	+ } else {
215	+ $this->send_json_error( sprintf( __( "Failed to delete %s", "megamenu"), $widget_id ) );
216	+ }
217	+
218	+ }
219	+
220	+
221	+ /**
222	+ * Moves a widget to a new position
223	+ *
224	+ * @since 1.0
225	+ */
226	+ public function ajax_reorder_items() {
227	+
228	+ check_ajax_referer( 'megamenu_edit' );
229	+
230	+ $items = isset( $_POST['items'] ) ? $_POST['items'] : false;
231	+
232	+ $saved = false;
233	+
234	+ if ( $items ) {
235	+ $moved = $this->reorder_items( $items );
236	+ }
237	+
238	+ if ( $moved ) {
239	+ $this->send_json_success( sprintf( __( "Moved (%s)", "megamenu"), json_encode( $items ) ) );
240	+ } else {
241	+ $this->send_json_error( sprintf( __( "Didn't move items", "megamenu"), json_encode( $items ) ) );
242	+ }
243	+
244	+ }
245	+
246	+
247	+ /**
248	+ * Returns an object representing all widgets registered in WordPress
249	+ *
250	+ * @since 1.0
251	+ */
252	+ public function get_available_widgets() {
253	+ global $wp_widget_factory;
254	+
255	+ $widgets = array();
256	+
257	+ foreach( $wp_widget_factory->widgets as $widget ) {
258	+
259	+ $disabled_widgets = array('maxmegamenu');
260	+
261	+ $disabled_widgets = apply_filters( "megamenu_incompatible_widgets", $disabled_widgets );
262	+
263	+ if ( ! in_array( $widget->id_base, $disabled_widgets ) ) {
264	+
265	+ $widgets[] = array(
266	+ 'text' => $widget->name,
267	+ 'value' => $widget->id_base
268	+ );
269	+
270	+ }
271	+
272	+ }
273	+
274	+ uasort( $widgets, array( $this, 'sort_by_text' ) );
275	+
276	+ return $widgets;
277	+
278	+ }
279	+
280	+
281	+ /**
282	+ * Sorts a 2d array by the 'text' key
283	+ *
284	+ * @since 1.2
285	+ * @param array $a
286	+ * @param array $b
287	+ */
288	+ function sort_by_text( $a, $b ) {
289	+ return strcmp( $a['text'], $b['text'] );
290	+ }
291	+
292	+
293	+ /**
294	+ * Sorts a 2d array by the 'order' key
295	+ *
296	+ * @since 2.0
297	+ * @param array $a
298	+ * @param array $b
299	+ */
300	+ function sort_by_order( $a, $b ) {
301	+
302	+ if ($a['order'] == $b['order']) {
303	+ return 1;
304	+ }
305	+ return ($a['order'] < $b['order']) ? -1 : 1;
306	+
307	+ }
308	+
309	+
310	+ /**
311	+ * Returns an array of immediate child menu items for the current item
312	+ *
313	+ * @since 1.5
314	+ * @return array
315	+ */
316	+ private function get_second_level_menu_items( $parent_menu_item_id, $menu_id ) {
317	+
318	+ $items = array();
319	+
320	+ // check we're using a valid menu ID
321	+ if ( ! is_nav_menu( $menu_id ) ) {
322	+ return $items;
323	+ }
324	+
325	+ $menu = wp_get_nav_menu_items( $menu_id );
326	+
327	+ if ( count( $menu ) ) {
328	+
329	+ foreach ( $menu as $item ) {
330	+
331	+ // find the child menu items
332	+ if ( $item->menu_item_parent == $parent_menu_item_id ) {
333	+
334	+ $saved_settings = array_filter( (array) get_post_meta( $item->ID, '_megamenu', true ) );
335	+
336	+ $settings = array_merge( Mega_Menu_Nav_Menus::get_menu_item_defaults(), $saved_settings );
337	+
338	+ $items[ $item->ID ] = array(
339	+ 'id' => $item->ID,
340	+ 'type' => 'menu_item',
341	+ 'title' => $item->title,
342	+ 'columns' => $settings['mega_menu_columns'],
343	+ 'order' => isset( $settings['mega_menu_order'][ $parent_menu_item_id ] ) ? $settings['mega_menu_order'][ $parent_menu_item_id ] : 0
344	+ );
345	+
346	+ }
347	+
348	+ }
349	+
350	+ }
351	+
352	+ return $items;
353	+ }
354	+
355	+ /**
356	+ * Returns an array of all widgets belonging to a specified menu item ID.
357	+ *
358	+ * @since 1.0
359	+ * @param int $menu_item_id
360	+ */
361	+ public function get_widgets_for_menu_id( $parent_menu_item_id, $menu_id ) {
362	+
363	+ $widgets = array();
364	+
365	+ if ( $mega_menu_widgets = $this->get_mega_menu_sidebar_widgets() ) {
366	+
367	+ foreach ( $mega_menu_widgets as $widget_id ) {
368	+
369	+ $settings = $this->get_settings_for_widget_id( $widget_id );
370	+
371	+ if ( isset( $settings['mega_menu_parent_menu_id'] ) && $settings['mega_menu_parent_menu_id'] == $parent_menu_item_id ) {
372	+
373	+ $name = $this->get_name_for_widget_id( $widget_id );
374	+
375	+ $widgets[ $widget_id ] = array(
376	+ 'id' => $widget_id,
377	+ 'type' => 'widget',
378	+ 'title' => $name,
379	+ 'columns' => $settings['mega_menu_columns'],
380	+ 'order' => isset( $settings['mega_menu_order'][ $parent_menu_item_id ] ) ? $settings['mega_menu_order'][ $parent_menu_item_id ] : 0
381	+ );
382	+
383	+ }
384	+
385	+ }
386	+
387	+ }
388	+
389	+ return $widgets;
390	+
391	+ }
392	+
393	+
394	+ /**
395	+ * Returns an array of widgets and second level menu items for a specified parent menu item.
396	+ * Used to display the widgets/menu items in the mega menu builder.
397	+ *
398	+ * @since 2.0
399	+ * @param int $parent_menu_item_id
400	+ * @param int $menu_id
401	+ * @return array
402	+ */
403	+ public function get_widgets_and_menu_items_for_menu_id( $parent_menu_item_id, $menu_id ) {
404	+
405	+ $menu_items = $this->get_second_level_menu_items( $parent_menu_item_id, $menu_id );
406	+ $widgets = $this->get_widgets_for_menu_id( $parent_menu_item_id, $menu_id );
407	+
408	+ $items = array_merge( $menu_items, $widgets );
409	+
410	+ $parent_settings = get_post_meta( $parent_menu_item_id, '_megamenu', true );
411	+
412	+ $ordering = isset( $parent_settings['submenu_ordering'] ) ? $parent_settings['submenu_ordering'] : 'natural';
413	+
414	+ if ( $ordering == 'forced' ) {
415	+
416	+ uasort( $items, array( $this, 'sort_by_order' ) );
417	+
418	+ $new_items = $items;
419	+ $end_items = array();
420	+
421	+ foreach ( $items as $key => $value ) {
422	+ if ( $value['order'] == 0 ) {
423	+ unset( $new_items[$key] );
424	+ $end_items[] = $value;
425	+ }
426	+ }
427	+
428	+ $items = array_merge( $new_items, $end_items );
429	+
430	+ }
431	+
432	+ return $items;
433	+ }
434	+
435	+
436	+ /**
437	+ * Returns the widget data as stored in the options table
438	+ *
439	+ * @since 1.8.1
440	+ * @param string $widget_id
441	+ */
442	+ public function get_settings_for_widget_id( $widget_id ) {
443	+
444	+ $id_base = $this->get_id_base_for_widget_id( $widget_id );
445	+
446	+ if ( ! $id_base ) {
447	+ return false;
448	+ }
449	+
450	+ $widget_number = $this->get_widget_number_for_widget_id( $widget_id );
451	+
452	+ $current_widgets = get_option( 'widget_' . $id_base );
453	+
454	+ return $current_widgets[ $widget_number ];
455	+
456	+ }
457	+
458	+
459	+ /**
460	+ * Returns the widget ID (number)
461	+ *
462	+ * @since 1.0
463	+ * @param string $widget_id - id_base-ID (eg meta-3)
464	+ * @return int
465	+ */
466	+ public function get_widget_number_for_widget_id( $widget_id ) {
467	+
468	+ $parts = explode( "-", $widget_id );
469	+
470	+ return absint( end( $parts ) );
471	+
472	+ }
473	+
474	+
475	+ /**
476	+ * Returns the name/title of a Widget
477	+ *
478	+ * @since 1.0
479	+ * @param $widget_id - id_base-ID (eg meta-3)
480	+ */
481	+ public function get_name_for_widget_id( $widget_id ) {
482	+ global $wp_registered_widgets;
483	+
484	+ $registered_widget = $wp_registered_widgets[$widget_id];
485	+
486	+ return $registered_widget['name'];
487	+
488	+ }
489	+
490	+
491	+ /**
492	+ * Returns the id_base value for a Widget ID
493	+ *
494	+ * @since 1.0
495	+ */
496	+ public function get_id_base_for_widget_id( $widget_id ) {
497	+ global $wp_registered_widget_controls;
498	+
499	+ if ( ! isset( $wp_registered_widget_controls[ $widget_id ] ) ) {
500	+ return false;
501	+ }
502	+
503	+ $control = $wp_registered_widget_controls[ $widget_id ];
504	+
505	+ $id_base = isset( $control['id_base'] ) ? $control['id_base'] : $control['id'];
506	+
507	+ return $id_base;
508	+
509	+ }
510	+
511	+
512	+ /**
513	+ * Returns the HTML for a single widget instance.
514	+ *
515	+ * @since 1.0
516	+ * @param string widget_id Something like meta-3
517	+ */
518	+ public function show_widget( $id ) {
519	+ global $wp_registered_widgets;
520	+
521	+ $params = array_merge(
522	+ array( array_merge( array( 'widget_id' => $id, 'widget_name' => $wp_registered_widgets[$id]['name'] ) ) ),
523	+ (array) $wp_registered_widgets[$id]['params']
524	+ );
525	+
526	+ $params[0]['before_title'] = apply_filters( "megamenu_before_widget_title", '<h4 class="mega-block-title">', $wp_registered_widgets[$id] );
527	+ $params[0]['after_title'] = apply_filters( "megamenu_after_widget_title", '</h4>', $wp_registered_widgets[$id] );
528	+ $params[0]['before_widget'] = apply_filters( "megamenu_before_widget", "", $wp_registered_widgets[$id] );
529	+ $params[0]['after_widget'] = apply_filters( "megamenu_after_widget", "", $wp_registered_widgets[$id] );
530	+
531	+ $callback = $wp_registered_widgets[$id]['callback'];
532	+
533	+ if ( is_callable( $callback ) ) {
534	+ ob_start();
535	+ call_user_func_array( $callback, $params );
536	+ return ob_get_clean();
537	+ }
538	+
539	+ }
540	+
541	+
542	+ /**
543	+ * Returns the class name for a widget instance.
544	+ *
545	+ * @since 1.8.1
546	+ * @param string widget_id Something like meta-3
547	+ */
548	+ public function get_widget_class( $id ) {
549	+ global $wp_registered_widgets;
550	+
551	+ if ( isset ( $wp_registered_widgets[$id]['classname'] ) ) {
552	+ return $wp_registered_widgets[$id]['classname'];
553	+ }
554	+
555	+ return "";
556	+ }
557	+
558	+
559	+ /**
560	+ * Shows the widget edit form for the specified widget.
561	+ *
562	+ * @since 1.0
563	+ * @param $widget_id - id_base-ID (eg meta-3)
564	+ */
565	+ public function show_widget_form( $widget_id ) {
566	+ global $wp_registered_widget_controls;
567	+
568	+ $control = $wp_registered_widget_controls[ $widget_id ];
569	+
570	+ $id_base = $this->get_id_base_for_widget_id( $widget_id );
571	+
572	+ $widget_number = $this->get_widget_number_for_widget_id( $widget_id );
573	+
574	+ $nonce = wp_create_nonce('megamenu_save_widget_' . $widget_id);
575	+
576	+ ?>
577	+
578	+ <div class='widget-content'>
579	+ <form method='post'>
580	+ <input type="hidden" name="widget-id" class="widget-id" value="<?php echo $widget_id ?>" />
581	+ <input type='hidden' name='action' value='mm_save_widget' />
582	+ <input type='hidden' name='id_base' value='<?php echo $id_base; ?>' />
583	+ <input type='hidden' name='widget_id' value='<?php echo $widget_id ?>' />
584	+ <input type='hidden' name='_wpnonce' value='<?php echo $nonce ?>' />
585	+
586	+ <?php
587	+ if ( is_callable( $control['callback'] ) ) {
588	+ call_user_func_array( $control['callback'], $control['params'] );
589	+ }
590	+ ?>
591	+
592	+ <div class='widget-controls'>
593	+ <a class='delete' href='#delete'><?php _e("Delete", "megamenu"); ?></a> \|
594	+ <a class='close' href='#close'><?php _e("Close", "megamenu"); ?></a>
595	+ </div>
596	+
597	+ <?php
598	+ submit_button( __( 'Save' ), 'button-primary alignright', 'savewidget', false );
599	+ ?>
600	+ </form>
601	+ </div>
602	+
603	+ <?php
604	+ }
605	+
606	+
607	+ /**
608	+ * Saves a widget. Calls the update callback on the widget.
609	+ * The callback inspects the post values and updates all widget instances which match the base ID.
610	+ *
611	+ * @since 1.0
612	+ * @param string $id_base - e.g. 'meta'
613	+ * @return bool
614	+ */
615	+ public function save_widget( $id_base ) {
616	+ global $wp_registered_widget_updates;
617	+
618	+ $control = $wp_registered_widget_updates[$id_base];
619	+
620	+ if ( is_callable( $control['callback'] ) ) {
621	+
622	+ call_user_func_array( $control['callback'], $control['params'] );
623	+
624	+ do_action( "megamenu_after_widget_save" );
625	+
626	+ return true;
627	+ }
628	+
629	+ return false;
630	+
631	+ }
632	+
633	+
634	+ /**
635	+ * Adds a widget to WordPress. First creates a new widget instance, then
636	+ * adds the widget instance to the mega menu widget sidebar area.
637	+ *
638	+ * @since 1.0
639	+ * @param string $id_base
640	+ * @param int $menu_item_id
641	+ * @param string $title
642	+ */
643	+ public function add_widget( $id_base, $menu_item_id, $title ) {
644	+
645	+ require_once( ABSPATH . 'wp-admin/includes/widgets.php' );
646	+
647	+ $next_id = next_widget_id_number( $id_base );
648	+
649	+ $this->add_widget_instance( $id_base, $next_id, $menu_item_id );
650	+
651	+ $widget_id = $this->add_widget_to_sidebar( $id_base, $next_id );
652	+
653	+ $return = '<div class="widget" title="' . esc_attr( $title ) . '" data-columns="2" id="' . $widget_id . '" data-type="widget" data-id="' . $widget_id . '">';
654	+ $return .= ' <div class="widget-top">';
655	+ $return .= ' <div class="widget-title-action">';
656	+ $return .= ' <a class="widget-option widget-contract" title="' . esc_attr( __("Contract", "megamenu") ) . '"></a>';
657	+ $return .= ' <span class="widget-cols"><span class="widget-num-cols">2</span><span class="widget-of">/</span><span class="widget-total-cols">X</span></span>';
658	+ $return .= ' <a class="widget-option widget-expand" title="' . esc_attr( __("Expand", "megamenu") ) . '"></a>';
659	+ $return .= ' <a class="widget-option widget-action" title="' . esc_attr( __("Edit", "megamenu") ) . '"></a>';
660	+ $return .= ' </div>';
661	+ $return .= ' <div class="widget-title">';
662	+ $return .= ' <h4>' . esc_html( $title ) . '</h4>';
663	+ $return .= ' </div>';
664	+ $return .= ' </div>';
665	+ $return .= ' <div class="widget-inner"></div>';
666	+ $return .= '</div>';
667	+
668	+ return $return;
669	+
670	+ }
671	+
672	+
673	+ /**
674	+ * Adds a new widget instance of the specified base ID to the database.
675	+ *
676	+ * @since 1.0
677	+ * @param string $id_base
678	+ * @param int $next_id
679	+ * @param int $menu_item_id
680	+ */
681	+ private function add_widget_instance( $id_base, $next_id, $menu_item_id ) {
682	+
683	+ $current_widgets = get_option( 'widget_' . $id_base );
684	+
685	+ $current_widgets[ $next_id ] = array(
686	+ "mega_menu_columns" => 2,
687	+ "mega_menu_parent_menu_id" => $menu_item_id
688	+ );
689	+
690	+ update_option( 'widget_' . $id_base, $current_widgets );
691	+
692	+ }
693	+
694	+ /**
695	+ * Removes a widget instance from the database
696	+ *
697	+ * @since 1.0
698	+ * @param string $widget_id e.g. meta-3
699	+ * @return bool. True if widget has been deleted.
700	+ */
701	+ private function remove_widget_instance( $widget_id ) {
702	+
703	+ $id_base = $this->get_id_base_for_widget_id( $widget_id );
704	+ $widget_number = $this->get_widget_number_for_widget_id( $widget_id );
705	+
706	+ // add blank widget
707	+ $current_widgets = get_option( 'widget_' . $id_base );
708	+
709	+ if ( isset( $current_widgets[ $widget_number ] ) ) {
710	+
711	+ unset( $current_widgets[ $widget_number ] );
712	+
713	+ update_option( 'widget_' . $id_base, $current_widgets );
714	+
715	+ return true;
716	+
717	+ }
718	+
719	+ return false;
720	+
721	+ }
722	+
723	+
724	+ /**
725	+ * Updates the number of mega columns for a specified widget.
726	+ *
727	+ * @since 1.0
728	+ * @param string $widget_id
729	+ * @param int $columns
730	+ */
731	+ public function update_widget_columns( $widget_id, $columns ) {
732	+
733	+ $id_base = $this->get_id_base_for_widget_id( $widget_id );
734	+
735	+ $widget_number = $this->get_widget_number_for_widget_id( $widget_id );
736	+
737	+ $current_widgets = get_option( 'widget_' . $id_base );
738	+
739	+ $current_widgets[ $widget_number ]["mega_menu_columns"] = absint( $columns) ;
740	+
741	+ update_option( 'widget_' . $id_base, $current_widgets );
742	+
743	+ do_action( "megamenu_after_widget_save" );
744	+
745	+ return true;
746	+
747	+ }
748	+
749	+
750	+ /**
751	+ * Updates the number of mega columns for a specified widget.
752	+ *
753	+ * @since 1.10
754	+ * @param string $menu_item_id
755	+ * @param int $columns
756	+ */
757	+ public function update_menu_item_columns( $menu_item_id, $columns ) {
758	+
759	+ $settings = get_post_meta( $menu_item_id, '_megamenu', true);
760	+
761	+ $settings['mega_menu_columns'] = absint( $columns );
762	+
763	+ update_post_meta( $menu_item_id, '_megamenu', $settings );
764	+
765	+ return true;
766	+
767	+ }
768	+
769	+
770	+ /**
771	+ * Updates the order of a specified widget.
772	+ *
773	+ * @since 1.10
774	+ * @param string $widget_id
775	+ * @param int $columns
776	+ */
777	+ public function update_widget_order( $widget_id, $order, $parent_menu_item_id ) {
778	+
779	+ $id_base = $this->get_id_base_for_widget_id( $widget_id );
780	+
781	+ $widget_number = $this->get_widget_number_for_widget_id( $widget_id );
782	+
783	+ $current_widgets = get_option( 'widget_' . $id_base );
784	+
785	+ $current_widgets[ $widget_number ]["mega_menu_order"] = array( $parent_menu_item_id => absint( $order ) );
786	+
787	+ update_option( 'widget_' . $id_base, $current_widgets );
788	+
789	+ return true;
790	+
791	+ }
792	+
793	+
794	+ /**
795	+ * Updates the order of a specified menu item.
796	+ *
797	+ * @since 1.10
798	+ * @param string $menu_item_id
799	+ * @param int $order
800	+ */
801	+ public function update_menu_item_order( $menu_item_id, $order, $parent_menu_item_id ) {
802	+
803	+ $submitted_settings['mega_menu_order'] = array( $parent_menu_item_id => absint( $order ) );
804	+
805	+ $existing_settings = get_post_meta( $menu_item_id, '_megamenu', true);
806	+
807	+ if ( is_array( $existing_settings ) ) {
808	+
809	+ $submitted_settings = array_merge( $existing_settings, $submitted_settings );
810	+
811	+ }
812	+
813	+ update_post_meta( $menu_item_id, '_megamenu', $submitted_settings );
814	+
815	+ return true;
816	+
817	+ }
818	+
819	+
820	+ /**
821	+ * Deletes a widget from WordPress
822	+ *
823	+ * @since 1.0
824	+ * @param string $widget_id e.g. meta-3
825	+ */
826	+ public function delete_widget( $widget_id ) {
827	+
828	+ $this->remove_widget_from_sidebar( $widget_id );
829	+ $this->remove_widget_instance( $widget_id );
830	+
831	+ do_action( "megamenu_after_widget_delete" );
832	+
833	+ return true;
834	+
835	+ }
836	+
837	+
838	+ /**
839	+ * Moves a widget from one position to another.
840	+ *
841	+ * @since 1.10
842	+ * @param array $items
843	+ * @return string $widget_id. The widget that has been moved.
844	+ */
845	+ public function reorder_items( $items ) {
846	+
847	+ foreach ( $items as $item ) {
848	+
849	+ if ( $item['parent_menu_item'] ) {
850	+
851	+ $submitted_settings = array( 'submenu_ordering' => 'forced' );
852	+
853	+ $existing_settings = get_post_meta( $item['parent_menu_item'], '_megamenu', true );
854	+
855	+ if ( is_array( $existing_settings ) ) {
856	+
857	+ $submitted_settings = array_merge( $existing_settings, $submitted_settings );
858	+
859	+ }
860	+
861	+ update_post_meta( $item['parent_menu_item'], '_megamenu', $submitted_settings );
862	+ }
863	+
864	+ if ( $item['type'] == 'widget' ) {
865	+
866	+ $this->update_widget_order( $item['id'], $item['order'], $item['parent_menu_item'] );
867	+
868	+ }
869	+
870	+ if ( $item['type'] == 'menu_item' ) {
871	+
872	+ $this->update_menu_item_order( $item['id'], $item['order'], $item['parent_menu_item'] );
873	+
874	+ }
875	+
876	+ }
877	+
878	+ return true;
879	+
880	+ }
881	+
882	+
883	+ /**
884	+ * Adds a widget to the Mega Menu widget sidebar
885	+ *
886	+ * @since 1.0
887	+ */
888	+ private function add_widget_to_sidebar( $id_base, $next_id ) {
889	+
890	+ $widget_id = $id_base . '-' . $next_id;
891	+
892	+ $sidebar_widgets = $this->get_mega_menu_sidebar_widgets();
893	+
894	+ $sidebar_widgets[] = $widget_id;
895	+
896	+ $this->set_mega_menu_sidebar_widgets($sidebar_widgets);
897	+
898	+ do_action( "megamenu_after_widget_add" );
899	+
900	+ return $widget_id;
901	+
902	+ }
903	+
904	+
905	+ /**
906	+ * Removes a widget from the Mega Menu widget sidebar
907	+ *
908	+ * @since 1.0
909	+ * @return string The widget that was removed
910	+ */
911	+ private function remove_widget_from_sidebar($widget_id) {
912	+
913	+ $widgets = $this->get_mega_menu_sidebar_widgets();
914	+
915	+ $new_mega_menu_widgets = array();
916	+
917	+ foreach ( $widgets as $widget ) {
918	+
919	+ if ( $widget != $widget_id )
920	+ $new_mega_menu_widgets[] = $widget;
921	+
922	+ }
923	+
924	+ $this->set_mega_menu_sidebar_widgets($new_mega_menu_widgets);
925	+
926	+ return $widget_id;
927	+
928	+ }
929	+
930	+
931	+ /**
932	+ * Returns an unfiltered array of all widgets in our sidebar
933	+ *
934	+ * @since 1.0
935	+ * @return array
936	+ */
937	+ public function get_mega_menu_sidebar_widgets() {
938	+
939	+ $sidebar_widgets = wp_get_sidebars_widgets();
940	+
941	+ if ( ! isset( $sidebar_widgets[ 'mega-menu'] ) ) {
942	+ return false;
943	+ }
944	+
945	+ return $sidebar_widgets[ 'mega-menu' ];
946	+
947	+ }
948	+
949	+
950	+ /**
951	+ * Sets the sidebar widgets
952	+ *
953	+ * @since 1.0
954	+ */
955	+ private function set_mega_menu_sidebar_widgets( $widgets ) {
956	+
957	+ $sidebar_widgets = wp_get_sidebars_widgets();
958	+
959	+ $sidebar_widgets[ 'mega-menu' ] = $widgets;
960	+
961	+ wp_set_sidebars_widgets( $sidebar_widgets );
962	+
963	+ }
964	+
965	+
966	+ /**
967	+ * Clear the cache when the Mega Menu is updated.
968	+ *
969	+ * @since 1.0
970	+ */
971	+ public function clear_caches() {
972	+
973	+ // https://wordpress.org/plugins/widget-output-cache/
974	+ if ( function_exists( 'menu_output_cache_bump' ) ) {
975	+ menu_output_cache_bump();
976	+ }
977	+
978	+ // https://wordpress.org/plugins/widget-output-cache/
979	+ if ( function_exists( 'widget_output_cache_bump' ) ) {
980	+ widget_output_cache_bump();
981	+ }
982	+
983	+ }
984	+
985	+
986	+ /**
987	+ * Send JSON response.
988	+ *
989	+ * Remove any warnings or output from other plugins which may corrupt the response
990	+ *
991	+ * @param string $json
992	+ * @since 1.8
993	+ */
994	+ public function send_json_success( $json ) {
995	+ if ( ob_get_contents() ) ob_clean();
996	+
997	+ wp_send_json_success( $json );
998	+ }
999	+
1000	+
1001	+ /**
1002	+ * Send JSON response.
1003	+ *
1004	+ * Remove any warnings or output from other plugins which may corrupt the response
1005	+ *
1006	+ * @param string $json
1007	+ * @since 1.8
1008	+ */
1009	+ public function send_json_error( $json ) {
1010	+ if ( ob_get_contents() ) ob_clean();
1011	+
1012	+ wp_send_json_error( $json );
1013	+ }
1014	+
1015	+ }
1016	+
1017	+ endif;

classes/widget.class.php ADDED Viewed

	@@ -0,0 +1,116 @@


1	+ <?php
2	+
3	+ if ( ! defined( 'ABSPATH' ) ) {
4	+ exit; // disable direct access
5	+ }
6	+
7	+ if ( ! class_exists('Mega_Menu_Widget') ) :
8	+
9	+ /**
10	+ * Outputs a registered menu location using wp_nav_menu
11	+ */
12	+ class Mega_Menu_Widget extends WP_Widget {
13	+
14	+ /**
15	+ * Register widget with WordPress.
16	+ */
17	+ public function __construct() {
18	+ parent::__construct(
19	+ 'maxmegamenu', // Base ID
20	+ 'Max Mega Menu', // Name
21	+ array( 'description' => __( 'Outputs a menu for a selected theme location.', 'megamenu' ) ) // Args
22	+ );
23	+ }
24	+
25	+ /**
26	+ * Front-end display of widget.
27	+ *
28	+ * @since 1.7.4
29	+ * @see WP_Widget::widget()
30	+ * @param array $args Widget arguments.
31	+ * @param array $instance Saved values from database.
32	+ */
33	+ public function widget( $args, $instance ) {
34	+ extract( $args );
35	+
36	+ if ( isset( $instance['location'] ) ) {
37	+ $location = $instance['location'];
38	+
39	+ $title = apply_filters( 'widget_title', $instance['title'] );
40	+
41	+ echo $before_widget;
42	+
43	+ if ( ! empty( $title ) ) {
44	+ echo $before_title . $title . $after_title;
45	+ }
46	+
47	+ if ( has_nav_menu( $location ) ) {
48	+ wp_nav_menu( array( 'theme_location' => $location ) );
49	+ }
50	+
51	+ echo $after_widget;
52	+ }
53	+ }
54	+
55	+ /**
56	+ * Sanitize widget form values as they are saved.
57	+ *
58	+ * @since 1.7.4
59	+ * @see WP_Widget::update()
60	+ * @param array $new_instance Values just sent to be saved.
61	+ * @param array $old_instance Previously saved values from database.
62	+ * @return array Updated safe values to be saved.
63	+ */
64	+ public function update( $new_instance, $old_instance ) {
65	+ $instance = array();
66	+ $instance['location'] = strip_tags( $new_instance['location'] );
67	+ $instance['title'] = strip_tags( $new_instance['title'] );
68	+
69	+ return $instance;
70	+ }
71	+
72	+ /**
73	+ * Back-end widget form.
74	+ *
75	+ * @since 1.7.4
76	+ * @see WP_Widget::form()
77	+ * @param array $instance Previously saved values from database.
78	+ */
79	+ public function form( $instance ) {
80	+
81	+ $selected_location = 0;
82	+ $title = "";
83	+ $locations = get_registered_nav_menus();
84	+
85	+ if ( isset( $instance['location'] ) ) {
86	+ $selected_location = $instance['location'];
87	+ }
88	+
89	+ if ( isset( $instance['title'] ) ) {
90	+ $title = $instance['title'];
91	+ }
92	+
93	+ ?>
94	+ <p>
95	+ <?php if ( $locations ) { ?>
96	+ <p>
97	+ <label for="<?php echo $this->get_field_id( 'title' ); ?>"><?php _e( 'Title:', 'megamenu' ); ?></label>
98	+ <input class="widefat" id="<?php echo $this->get_field_id( 'title' ); ?>" name="<?php echo $this->get_field_name( 'title' ); ?>" type="text" value="<?php echo esc_attr( $title ); ?>" />
99	+ </p>
100	+ <label for="<?php echo $this->get_field_id( 'location' ); ?>"><?php _e( 'Menu Location:', 'megamenu' ); ?></label>
101	+ <select id="<?php echo $this->get_field_id( 'location' ); ?>" name="<?php echo $this->get_field_name( 'location' ); ?>">
102	+ <?php
103	+ foreach ( $locations as $location => $description ) {
104	+ echo "<option value='{$location}'" . selected($location, $selected_location) . ">{$description}</option>";
105	+ }
106	+ ?>
107	+ </select>
108	+ <?php } else {
109	+ _e( 'No menu locations found', 'megamenu' );
110	+ } ?>
111	+ </p>
112	+ <?php
113	+ }
114	+ }
115	+
116	+ endif;

css/admin/global.css ADDED Viewed

	@@ -0,0 +1,25 @@


1	+ @font-face {
2	+ font-family: 'maxmegamenu';
3	+ src: url('../../font/maxmegamenu.eot?86003086');
4	+ src: url('../../font/maxmegamenu.eot?86003086#iefix') format('embedded-opentype'),
5	+ url('../../font/maxmegamenu.woff?86003086') format('woff'),
6	+ url('../../font/maxmegamenu.ttf?86003086') format('truetype'),
7	+ url('../../font/maxmegamenu.svg?86003086#maxmegamenu') format('svg');
8	+ font-weight: normal;
9	+ font-style: normal;
10	+ }
11	+
12	+ #adminmenu .toplevel_page_maxmegamenu div.wp-menu-image:before {
13	+ content: "\e800" !important;
14	+ font-family: "maxmegamenu" !important;
15	+ font-style: normal !important;
16	+ font-weight: normal !important;
17	+ font-variant: normal !important;
18	+ text-transform: none !important;
19	+ speak: none;
20	+ font-size: 20px;
21	+ line-height: 1.3;
22	+ margin-top: -3px;
23	+ -webkit-font-smoothing: antialiased;
24	+ -moz-osx-font-smoothing: grayscale;
25	+ }

css/admin/menus.css ADDED Viewed

	@@ -0,0 +1,999 @@


1	+ #cboxContent {
2	+ padding: 0;
3	+ -webkit-user-select: none;
4	+ -moz-user-select: none;
5	+ -ms-user-select: none;
6	+ user-select: none;
7	+ }
8	+
9	+
10	+ #cboxClose {
11	+ text-indent: 0;
12	+ background: none;
13	+ width: auto;
14	+ height: auto;
15	+ color: white;
16	+ right: -28px;
17	+ top: 2px;
18	+ }
19	+
20	+ #cboxClose:before {
21	+ content: "\f335";
22	+ font: normal 24px/29px 'dashicons';
23	+ }
24	+ #cboxClose:hover {
25	+ color: #0074a2;
26	+ }
27	+
28	+ #cboxContent .mm_tabs.horizontal li {
29	+ float: left;
30	+ margin-right: 10px;
31	+ cursor: pointer;
32	+ padding: 3px 5px;
33	+ font-size: 0.9em;
34	+ color: #999;
35	+ transition: all 0.05s linear;
36	+ }
37	+
38	+ #cboxContent .mm_tabs.horizontal li:hover,
39	+ #cboxContent .mm_tabs.horizontal li.active {
40	+ background: #2ea2cc;
41	+ color: white;
42	+ }
43	+
44	+ #cboxContent .mm_tabs.horizontal {
45	+ width: 100%;
46	+ float: left;
47	+ margin-top: 0;
48	+ }
49	+
50	+ #cboxContent .mm_header_container {
51	+ float: left;
52	+ width: 100%;
53	+ border-bottom: 1px solid #eeeeee;
54	+ }
55	+
56	+ #cboxContent .mm_title {
57	+ padding: 0 20px;
58	+ background: white;
59	+ font-size: 1.3em;
60	+ line-height: 75px;
61	+ float: left;
62	+ }
63	+
64	+
65	+ #cboxContent .mm_tab_container .mm_tab {
66	+ text-decoration: none;
67	+ color: #333;
68	+ width: 100%;
69	+ display: block;
70	+ padding: 10px 0px 10px 20px;
71	+ box-sizing: border-box;
72	+ outline: 0;
73	+ position: relative;
74	+ transition: all 0.05s linear;
75	+ font-size: 12px;
76	+ }
77	+
78	+ #cboxContent .mm_tab_container .mm_tab.active {
79	+ color: #333;
80	+ color: white;
81	+ }
82	+
83	+ #cboxContent .mm_tab_container .mm_tab:hover {
84	+ background: #dfdfdf;
85	+ }
86	+
87	+ #cboxContent .mm_tab_container .mm_tab.active {
88	+ background: #2ea2cc;
89	+ }
90	+
91	+ #cboxContent .mm_tab_container .mm_tab.active:after {
92	+ right: 0;
93	+ border: solid 5px transparent;
94	+ content: " ";
95	+ height: 0;
96	+ width: 0;
97	+ position: absolute;
98	+ pointer-events: none;
99	+ border-right-color: white;
100	+ top: 50%;
101	+ margin-top: -5px;
102	+ }
103	+
104	+ #cboxContent .mm_tab_container {
105	+ width: 20%;
106	+ float: left;
107	+ position: relative;
108	+ height: 424px;
109	+ background: white;
110	+ -webkit-box-shadow: inset -10px 0px 7px -12px rgba(0,0,0,0.2);
111	+ -moz-box-shadow: inset -10px 0px 7px -12px rgba(0,0,0,0.2);
112	+ box-shadow: inset -10px 0px 7px -12px rgba(0,0,0,0.2);
113	+ }
114	+ #cboxContent .mm_content_container {
115	+ padding: 20px;
116	+ float: right;
117	+ height: 424px;
118	+ width: 80%;
119	+ overflow: auto;
120	+ box-sizing: border-box;
121	+
122	+ }
123	+
124	+ #cboxContent .mega_menu #widgets .no_widgets {
125	+ font-size: 0.9em;
126	+ margin-left: 10px;
127	+ font-style: italic;
128	+ margin-top: 10px;
129	+ clear: both;
130	+ color: #999;
131	+ float: left;
132	+ }
133	+
134	+ #cboxContent label[for='mm_enable_mega_menu'] {
135	+ font-size: 12px;
136	+ }
137	+ #cboxContent .mega_menu #mm_enable_mega_menu {
138	+ margin-bottom: 0;
139	+ font-size: 0.9em;
140	+ margin-left: 5px;
141	+ }
142	+ #cboxContent .mega_menu #mm_widget_selector {
143	+ margin-bottom: 0;
144	+ font-size: 0.9em;
145	+ float: right;
146	+ margin-right: 5px;
147	+ margin-top: 5px;
148	+ margin-bottom: 5px;
149	+ }
150	+ #cboxContent .mega_menu #mm_number_of_columns {
151	+ font-size: 0.9em;
152	+ float: right;
153	+ margin-top: 5px;
154	+ margin-right: 10px;
155	+ margin-bottom: 5px;
156	+ }
157	+
158	+ #cboxContent .mega_menu .ui-sortable-helper {
159	+ display: block;
160	+ }
161	+
162	+ #cboxContent .mega_menu .drop-area {
163	+ display: inline-block;
164	+ border: 1px solid #eeeeee;
165	+ float: left;
166	+ -webkit-box-sizing: border-box; /* Safari/Chrome, other WebKit */
167	+ -moz-box-sizing: border-box; /* Firefox, other Gecko */
168	+ box-sizing: border-box; /* Opera/IE 8+ */
169	+ }
170	+
171	+ #cboxContent .mega_menu #widgets {
172	+ float: left;
173	+ background: #FAFAFA;
174	+ border: 1px solid #DFDFDF;
175	+ width: 760px;
176	+ position: relative;
177	+ margin-top: 15px;
178	+ padding: 5px;
179	+ float: left;
180	+ width: 100%;
181	+ box-sizing: border-box;
182	+ min-height: 200px;
183	+ }
184	+
185	+
186	+ #cboxContent .mega_menu .mm_header {
187	+ float: right;
188	+ }
189	+
190	+ #cboxContent .mega_menu .widget {
191	+ -webkit-transition: width 0.3s ease;
192	+ -moz-transition: width 0.3s ease;
193	+ -o-transition: width 0.3s ease;
194	+ -ms-transition: width 0.3s ease;
195	+ transition: width 0.3s ease;
196	+ -webkit-box-sizing: border-box; /* Safari/Chrome, other WebKit */
197	+ -moz-box-sizing: border-box; /* Firefox, other Gecko */
198	+ box-sizing: border-box; /* Opera/IE 8+ */
199	+ width: 160px;
200	+ margin: 0;
201	+ color: #333;
202	+ font-size: 12px;
203	+ display: inline-block;
204	+ float: left;
205	+ border: 5px solid transparent;
206	+ }
207	+
208	+ #cboxContent .mega_menu .widget.open {
209	+ z-index: 999;
210	+ }
211	+
212	+ #cboxContent .mega_menu .widget:hover .widget-top,
213	+ #cboxContent .mega_menu .widget:hover .widget-inner,
214	+ #cboxContent .mega_menu .widget.open .widget-top,
215	+ #cboxContent .mega_menu .widget.open .widget-inner {
216	+ border: 1px solid #555;
217	+ }
218	+
219	+ #cboxContent .mega_menu .widget-top {
220	+ border: 0;
221	+ -webkit-box-shadow: 0 0 0;
222	+ box-shadow: 0 0 0;
223	+ border: 1px solid #999;
224	+ padding: 0 10px;
225	+ background: white;
226	+ }
227	+
228	+ #cboxContent .mega_menu .widget.open .widget-top {
229	+ cursor: move;
230	+ z-index: 1001;
231	+ position: relative;
232	+ border-bottom: 0;
233	+ }
234	+ #cboxContent .mega_menu .widget.sub_menu .widget-top {
235	+ cursor: default;
236	+ }
237	+
238	+ #cboxContent .mega_menu .widget.open .widget-inner {
239	+ position: absolute;
240	+ z-index: 1000;
241	+ border: 1px solid #dfdfdf;
242	+ -webkit-box-shadow: 0 1px 1px rgba(0,0,0,.04);
243	+ box-shadow: 0 1px 1px rgba(0,0,0,.04);
244	+ margin-top: -1px;
245	+ background: white;
246	+ min-width: 240px;
247	+ border: 1px solid #999;
248	+ box-sizing: border-box;
249	+ }
250	+
251	+
252	+ #cboxContent .mega_menu .widget-title {
253	+ display: inline-block;
254	+ }
255	+
256	+ #cboxContent .mega_menu .widget-title h4 {
257	+ float: left;
258	+ margin: 0;
259	+ padding: 0;
260	+ overflow: hidden;
261	+ white-space: nowrap;
262	+ border-bottom: 0;
263	+ font-size: 1em;
264	+ text-overflow: ellipsis;
265	+ line-height: 40px;
266	+ }
267	+
268	+ #cboxContent .mega_menu .widget[data-type='menu_item'] .widget-title h4:before {
269	+ color: #333;
270	+ font: normal 16px/1 'dashicons';
271	+ speak: none;
272	+ -webkit-font-smoothing: antialiased;
273	+ -moz-osx-font-smoothing: grayscale;
274	+ vertical-align: top;
275	+ margin-right: 2px;
276	+ content: "\f333";
277	+ vertical-align: middle;
278	+ top: -1px;
279	+ position: relative;
280	+ }
281	+
282	+ #cboxContent .mega_menu .widget-title h4:after {
283	+ color: #d54e21;
284	+ display: none;
285	+ font: normal 20px/1 'dashicons';
286	+ speak: none;
287	+ -webkit-font-smoothing: antialiased;
288	+ -moz-osx-font-smoothing: grayscale;
289	+ vertical-align: top;
290	+ margin-left: 5px;
291	+ content: '\f463';
292	+ -webkit-animation: rotation 2s infinite linear;
293	+ animation: rotation 2s infinite linear;
294	+ vertical-align: middle;
295	+ }
296	+
297	+ #cboxContent .mega_menu .widget-title h4.loading:after {
298	+ display: inline-block;
299	+ }
300	+
301	+ #cboxContent .mega_menu .widget-controls {
302	+ float: left;
303	+ }
304	+
305	+ #cboxContent .mega_menu .widget-controls .delete:hover {
306	+ text-decoration: none;
307	+ color: red;
308	+ }
309	+
310	+ #cboxContent .mega_menu .widget-inner form {
311	+ padding: 0 15px 15px 15px;
312	+ margin-bottom: 30px;
313	+ }
314	+ #cboxContent .mega_menu .widget-inner {
315	+ display: none;
316	+ float: left;
317	+ width: 100%;
318	+ background: white;
319	+ }
320	+
321	+ #cboxContent .mega_menu .widget.open .widget-inner {
322	+ display: block;
323	+ }
324	+
325	+ #cboxContent .mega_menu .widget-inner p,
326	+ #cboxContent .mega_menu .widget-inner select,
327	+ #cboxContent .mega_menu .widget-inner input {
328	+ font-size: 12px;
329	+ }
330	+
331	+
332	+ #cboxContent .mega_menu .widget-title-action {
333	+ padding: 0;
334	+ float: right;
335	+ position: relative;
336	+ opacity: 0.6;
337	+ font-weight: normal;
338	+ }
339	+
340	+ #cboxContent .mega_menu .widget:hover .widget-title-action {
341	+ opacity: 1;
342	+ }
343	+
344	+ #cboxContent .mega_menu .widget-title-action a {
345	+ display: inline-block;
346	+ line-height: 40px;
347	+ }
348	+
349	+ #cboxContent .mega_menu #widgets .widget[data-type='menu_item'] .widget-action {
350	+ display: none;
351	+ }
352	+
353	+ #cboxContent .mega_menu .widget-option {
354	+ right: 0;
355	+ border: 0;
356	+ background: 0 0;
357	+ font: 400 16px/1 dashicons;
358	+ speak: none;
359	+ display: block;
360	+ padding: 0;
361	+ text-indent: 0;
362	+ text-align: center;
363	+ position: relative;
364	+ -webkit-font-smoothing: antialiased;
365	+ -moz-osx-font-smoothing: grayscale;
366	+ text-decoration: none!important;
367	+ color: #999;
368	+ }
369	+
370	+ #cboxContent .mega_menu .widget-cols {
371	+ line-height: 40px;
372	+ vertical-align: top;
373	+ display: inline-block;
374	+ color: #999;
375	+ font-size: 11px;
376	+ vertical-align: bottom;
377	+ }
378	+
379	+ #cboxContent .mega_menu .widget-option:hover {
380	+ color: #333;
381	+ cursor: pointer;
382	+ }
383	+
384	+ #cboxContent .mega_menu h5 {
385	+ margin: 10px 0 0 10px;
386	+ text-transform: uppercase;
387	+ float: left;
388	+ }
389	+ #cboxContent .mega_menu .widget-option::after {
390	+ padding: 0;
391	+ font: 400 14px/40px dashicons;
392	+ display: inline;
393	+ }
394	+ #cboxContent .mega_menu .widget-expand::after {
395	+ content: '\f345';
396	+ }
397	+
398	+ #cboxContent .mega_menu .widget-contract::after {
399	+ content: '\f341';
400	+ }
401	+
402	+ #cboxContent .mega_menu .widget-action::after {
403	+ content: '\f107';
404	+ margin: 0;
405	+ }
406	+
407	+ #cboxContent .mega_menu .widget.open .widget-action::after {
408	+ content: '\f142';
409	+ }
410	+
411	+ #cboxContent .mega_menu .widget-option.disabled:hover {
412	+ color: #999;
413	+ }
414	+
415	+ #cboxContent .mega_menu #widgets .widget {
416	+ width: 100%;
417	+ }
418	+
419	+
420	+ #cboxContent .mega_menu #widgets[data-columns='1'] .widget[data-columns='1'] {
421	+ width: 100%;
422	+ }
423	+
424	+
425	+
426	+ #cboxContent .mega_menu #widgets[data-columns='2'] .widget[data-columns='1'] {
427	+ width: 50%;
428	+ }
429	+ #cboxContent .mega_menu #widgets[data-columns='2'] .widget[data-columns='2'] {
430	+ width: 100%;
431	+ }
432	+
433	+
434	+ #cboxContent .mega_menu #widgets[data-columns='3'] .widget[data-columns='1'] {
435	+ width: 33.3%;
436	+ }
437	+ #cboxContent .mega_menu #widgets[data-columns='3'] .widget[data-columns='2'] {
438	+ width: 66.6%;
439	+ }
440	+ #cboxContent .mega_menu #widgets[data-columns='3'] .widget[data-columns='3'] {
441	+ width: 100%;
442	+ }
443	+
444	+
445	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='1'] {
446	+ width: 25%;
447	+ }
448	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='2'] {
449	+ width: 50%;
450	+ }
451	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='3'] {
452	+ width: 75%;
453	+ }
454	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='4'] {
455	+ width: 100%;
456	+ }
457	+
458	+
459	+
460	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='1'] {
461	+ width: 20%;
462	+ }
463	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='2'] {
464	+ width: 40%;
465	+ }
466	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='3'] {
467	+ width: 60%;
468	+ }
469	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='4'] {
470	+ width: 80%;
471	+ }
472	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='5'] {
473	+ width: 100%;
474	+ }
475	+
476	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='1'] {
477	+ width: 16.6%;
478	+ }
479	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='2'] {
480	+ width: 33.3%;
481	+ }
482	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='3'] {
483	+ width: 50%;
484	+ }
485	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='4'] {
486	+ width: 66.6%;
487	+ }
488	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='5'] {
489	+ width: 83.3%;
490	+ }
491	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='6'] {
492	+ width: 100%;
493	+ }
494	+
495	+
496	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='1'] {
497	+ width: 14.28%;
498	+ }
499	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='2'] {
500	+ width: 28.57%;
501	+ }
502	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='3'] {
503	+ width: 42.85%;
504	+ }
505	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='4'] {
506	+ width: 57.14%;
507	+ }
508	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='5'] {
509	+ width: 71.42%;
510	+ }
511	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='6'] {
512	+ width: 85.71%;
513	+ }
514	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='7'] {
515	+ width: 100%;
516	+ }
517	+
518	+
519	+
520	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='1'] {
521	+ width: 12.5%;
522	+ }
523	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='2'] {
524	+ width: 25%;
525	+ }
526	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='3'] {
527	+ width: 37.5%;
528	+ }
529	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='4'] {
530	+ width: 50%;
531	+ }
532	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='5'] {
533	+ width: 62.5%;
534	+ }
535	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='6'] {
536	+ width: 75%;
537	+ }
538	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='7'] {
539	+ width: 87.5%;
540	+ }
541	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='8'] {
542	+ width: 100%;
543	+ }
544	+
545	+
546	+ #cboxContent .mega_menu #widgets .widget h4 {
547	+ max-width: 700px;
548	+ }
549	+
550	+ #cboxContent .mega_menu #widgets[data-columns='2'] .widget[data-columns='1'] h4 {
551	+ max-width: 280px;
552	+ }
553	+
554	+ #cboxContent .mega_menu #widgets[data-columns='3'] .widget[data-columns='1'] h4 {
555	+ max-width: 165px;
556	+ }
557	+ #cboxContent .mega_menu #widgets[data-columns='3'] .widget[data-columns='2'] h4 {
558	+ max-width: 430px;
559	+ }
560	+
561	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='1'] h4 {
562	+ max-width: 105px;
563	+ }
564	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='2'] h4 {
565	+ max-width: 280px;
566	+ }
567	+ #cboxContent .mega_menu #widgets[data-columns='4'] .widget[data-columns='3'] h4 {
568	+ max-width: 500px;
569	+ }
570	+
571	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='1'] h4 {
572	+ max-width: 65px;
573	+ }
574	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='2'] h4 {
575	+ max-width: 220px;
576	+ }
577	+ #cboxContent .mega_menu #widgets[data-columns='5'] .widget[data-columns='3'] h4 {
578	+ max-width: 380px;
579	+ }
580	+
581	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='1'] h4 {
582	+ max-width: 40px;
583	+ }
584	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='2'] h4 {
585	+ max-width: 170px;
586	+ }
587	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='3'] h4 {
588	+ max-width: 300px;
589	+ }
590	+ #cboxContent .mega_menu #widgets[data-columns='6'] .widget[data-columns='4'] h4 {
591	+ max-width: 430px;
592	+ }
593	+
594	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='1'] h4 {
595	+ max-width: 24px;
596	+ }
597	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='2'] h4 {
598	+ max-width: 130px;
599	+ }
600	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='3'] h4 {
601	+ max-width: 240px;
602	+ }
603	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='4'] h4 {
604	+ max-width: 350px;
605	+ }
606	+ #cboxContent .mega_menu #widgets[data-columns='7'] .widget[data-columns='5'] h4 {
607	+ max-width: 480px;
608	+ }
609	+
610	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='1'] h4 {
611	+ max-width: 8px;
612	+ }
613	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='2'] h4 {
614	+ max-width: 100px;
615	+ }
616	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='3'] h4 {
617	+ max-width: 200px;
618	+ }
619	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='4'] h4 {
620	+ max-width: 300px;
621	+ }
622	+ #cboxContent .mega_menu #widgets[data-columns='8'] .widget[data-columns='5'] h4 {
623	+ max-width: 400px;
624	+ }
625	+
626	+
627	+ #cboxContent .mega_menu .widget textarea {
628	+ max-height: 100px;
629	+ }
630	+
631	+ #cboxContent .menu_icon .icon_selector > div {
632	+ float: left;
633	+ padding: 0 19px 19px 0;
634	+ width: 24px;
635	+ height: 24px;
636	+ }
637	+
638	+ #cboxContent .menu_icon .icon_selector label {
639	+ float: left;
640	+ display: block;
641	+ width: 24px;
642	+ height: 24px;
643	+ }
644	+
645	+ #cboxContent .menu_icon .icon_selector input.radio:empty {
646	+ margin-left: -9999px;
647	+ }
648	+
649	+ #cboxContent .menu_icon .icon_selector input.radio:empty ~ label {
650	+ position: relative;
651	+ cursor: pointer;
652	+ -webkit-user-select: none;
653	+ -moz-user-select: none;
654	+ -ms-user-select: none;
655	+ user-select: none;
656	+ }
657	+ #cboxContent .menu_icon .icon_selector .dash label:before {
658	+ font: 400 24px/1 dashicons;
659	+ }
660	+ #cboxContent .menu_icon .icon_selector label:before {
661	+ width: 24px;
662	+ height: 24px;
663	+ display: inline-block;
664	+ content: attr(rel);
665	+ border: 1px solid #dfdfdf;
666	+ padding: 6px;
667	+ background: #FAFAFA;
668	+ color: #999;
669	+
670	+ }
671	+ #cboxContent .menu_icon .icon_selector input.radio:not(:checked) ~ label:before {
672	+
673	+ }
674	+
675	+ #cboxContent .menu_icon .icon_selector input.radio:checked ~ label:before,
676	+ #cboxContent .menu_icon .icon_selector input.radio:hover:checked ~ label:before {
677	+ border: 1px solid #0074a2;
678	+ color: #0074a2;
679	+ background: white;
680	+
681	+ }
682	+
683	+ #cboxContent .menu_icon .icon_selector input.radio:hover ~ label:before {
684	+ color: #0074a2;
685	+ }
686	+
687	+ #cboxContent .menu_icon .icon_selector input.radio:checked ~ label {
688	+ color: #999;
689	+ }
690	+
691	+ #cboxContent table td {
692	+ padding-bottom: 10px;
693	+ }
694	+ #cboxContent h4.first {
695	+ margin: 0em 0 0.7em 0;
696	+ }
697	+ #cboxContent h4 {
698	+ clear: both;
699	+ border-bottom: 1px solid #bfbfbf;
700	+ padding: 0 0 10px 0;
701	+ font-size: 1em;
702	+ margin: 1.33em 0 0.7em 0;
703	+ }
704	+ #cboxContent table td.mega-name {
705	+ width: 27%;
706	+ line-height: 2em;
707	+ padding-right: 30px;
708	+ vertical-align: top;
709	+ font-size: 12px;
710	+ }
711	+ #cboxContent table td.mega-value {
712	+ font-size: 12px;
713	+ }
714	+ #cboxContent table td.mega-value select {
715	+ font-size: 0.9em;
716	+ }
717	+ #cboxContent table td.mega-name .mega-description,
718	+ #cboxContent table td.mega-value .mega-description {
719	+ font-size: 0.9em;
720	+ color: #999;
721	+ line-height: 1.5em;
722	+ }
723	+
724	+ #cboxContent table td.mega-value .mega-description {
725	+ text-indent: 2px;
726	+ margin-top: 5px;
727	+ }
728	+ #cboxContent table input {
729	+ width: 70px;
730	+ margin-right: 20px;
731	+ }
732	+ #cboxContent table label {
733	+ font-size: 0.9em;
734	+ }
735	+ #cboxContent table input[type=checkbox] {
736	+ width: 16px;
737	+ height: 16px;
738	+ margin-right: 10px;
739	+ vertical-align: middle;
740	+ }
741	+ #cboxContent table {
742	+ width: 100%;
743	+ border-collapse: collapse;
744	+ }
745	+ #cboxContent .mega_menu #widgets.disabled {
746	+ opacity: 0.5;
747	+ }
748	+
749	+ #cboxContent .mega_menu #widgets.disabled:after {
750	+ background: #ccc;
751	+ display: block;
752	+ position: absolute;
753	+ top: 0;
754	+ left: 0;
755	+ height: 100%;
756	+ width: 100%;
757	+ content: "";
758	+ opacity: 0.3;
759	+
760	+ }
761	+
762	+
763	+ /**
764	+ * NAV MENUS
765	+ */
766	+ / TRIBE IMAGE WIDGET /
767	+ .uploader input.button {
768	+ width: 100%;
769	+ height: 34px;
770	+ line-height: 33px;
771	+ margin-top: 15px;
772	+ }
773	+ .tribe_preview .aligncenter {
774	+ display: block;
775	+ margin-left: auto !important;
776	+ margin-right: auto !important;
777	+ }
778	+ .tribe_preview {
779	+ overflow: hidden;
780	+ max-height: 300px;
781	+ }
782	+ .tribe_preview img {
783	+ margin: 10px 0;
784	+ height: auto;
785	+ max-width: 100%;
786	+ }
787	+ / END TRIBE IMAGE WIDGET /
788	+
789	+ .megamenu_enabled .mm_launch {
790	+ background: #2ea2cc;
791	+ border-color: #0074a2;
792	+ }
793	+ .mm_launch {
794	+ margin-left: 10px;
795	+ font-size: 0.8em;
796	+ cursor: pointer;
797	+ color: white;
798	+ display: inline-block;
799	+ width: auto;
800	+ font-weight: normal;
801	+ height: auto;
802	+ background: #999;
803	+ border-color: #333;
804	+ border-width: 1px;
805	+ padding: 0 5px;
806	+ border-radius: 3px;
807	+ opacity: 0;
808	+ -webkit-transition: all 0.3s ease;
809	+ -moz-transition: all 0.3s ease;
810	+ -o-transition: all 0.3s ease;
811	+ -ms-transition: all 0.3s ease;
812	+ transition: all 0.3s ease;
813	+ }
814	+
815	+ .mm_launch:before {
816	+ font-family: dashicons;
817	+ content: "\f111";
818	+ font-size: 10px;
819	+ margin-right: 2px;
820	+ display: inline-block;
821	+ vertical-align: bottom;
822	+ }
823	+
824	+ .menu-item-bar .menu-item-handle:hover .mm_launch {
825	+ opacity: 1;
826	+ }
827	+ .menu-item-bar .dashicons-admin-generic:before {
828	+ font-size: 1.2em;
829	+ margin-right: 1px;
830	+ height: auto;
831	+ }
832	+ .mega_menu_meta_box.mmm_get_started:before {
833	+ content: attr(data-get-started);
834	+ padding: 10px;
835	+ display: block;
836	+ background: green;
837	+ color: white;
838	+ }
839	+ .mega_menu_meta_box.mmm_get_started h3 {
840	+ border-left: 1px solid green;
841	+ border-right: 1px solid green;
842	+ }
843	+ .mega_menu_meta_box.mmm_get_started .accordion-section-content {
844	+ border-left: 1px solid green;
845	+ border-right: 1px solid green;
846	+ border-bottom: 1px solid green;
847	+ }
848	+ .mega_menu_meta_box div#megamenu_accordion h3 {
849	+ padding: 0 0 10px 0;
850	+ margin: 0;
851	+ cursor: pointer;
852	+ outline: none;
853	+ float: left;
854	+ width: 100%;
855	+ color: #999;
856	+ font-size: 14px;
857	+ font-weight: normal;
858	+ }
859	+
860	+ .mega_menu_meta_box div#megamenu_accordion h3.ui-state-active,
861	+ .mega_menu_meta_box div#megamenu_accordion h3:hover {
862	+ color: #333;
863	+ }
864	+
865	+ .mega_menu_meta_box div#megamenu_accordion h3:hover::before {
866	+ color: black;
867	+ }
868	+
869	+ .mega_menu_meta_box div#megamenu_accordion th::before,
870	+ .mega_menu_meta_box div#megamenu_accordion h3::before {
871	+ right: 0;
872	+ content: '\f139';
873	+ border: 0;
874	+ background: 0 0;
875	+ font: 400 20px/1 dashicons;
876	+ speak: none;
877	+ float: left;
878	+ padding: 0;
879	+ text-indent: 0;
880	+ text-align: center;
881	+ position: relative;
882	+ -webkit-font-smoothing: antialiased;
883	+ -moz-osx-font-smoothing: grayscale;
884	+ text-decoration: none!important;
885	+ margin-right: 6px;
886	+ }
887	+
888	+ .mega_menu_meta_box div#megamenu_accordion h3.ui-state-active::before {
889	+ content: '\f140';
890	+ }
891	+
892	+ .mega_menu_meta_box div.accordion_content {
893	+ padding-bottom: 20px;
894	+ float: left;
895	+ width: 100%;
896	+ }
897	+ .mega_menu_meta_box div table {
898	+ font-size: 0.9em;
899	+ width: 100%;
900	+ margin-bottom: 5px;
901	+ }
902	+
903	+ .mega_menu_meta_box div table select {
904	+ font-size: 0.9em;
905	+ max-width: 120px;
906	+ }
907	+
908	+ .mega_menu_meta_box div table tr {
909	+ height: 29px;
910	+ vertical-align: middle;
911	+ }
912	+
913	+ .mega_menu_meta_box div table th {
914	+ border-bottom: 1px solid #bfbfbf;
915	+ font-size: 1.1em;
916	+ }
917	+
918	+ .mega_menu_meta_box div table td:nth-child(1) {
919	+ padding-left: 5px;
920	+ }
921	+
922	+ .mega_menu_meta_box div table td:nth-child(2) {
923	+ text-align: right;
924	+ min-width: 150px;
925	+ }
926	+
927	+ .mega_menu_meta_box th::before {
928	+ content: '\f100';
929	+ }
930	+
931	+ .mega_menu_meta_box th.settings::before {
932	+ content: '\f111';
933	+ }
934	+
935	+ .mega_menu_meta_box p.submit {
936	+ float: left;
937	+ text-align: right;
938	+ width: 100%;
939	+ margin: 0 0 15px 0;
940	+ padding: 0;
941	+ }
942	+
943	+ #nav-menu-meta .mega_menu_meta_box .accordion-section-content {
944	+ padding: 0 10px;
945	+ }
946	+
947	+ .menu-item-handle .item-title {
948	+ margin-right: 0;
949	+ }
950	+
951	+ .mm_saving {
952	+ font-size: 12px;
953	+ text-align: right;
954	+ padding: 0 20px;
955	+ display: none;
956	+ line-height: 75px;
957	+ text-transform: uppercase;
958	+ color: white;
959	+ font-size: 11px;
960	+ font-weight: bold;
961	+ float: right;
962	+ background: #2ea2cc;
963	+ }
964	+
965	+ .mm_saving:before {
966	+ color: white;
967	+ display: inline-block;
968	+ font: normal 20px/75px 'dashicons';
969	+ speak: none;
970	+ -webkit-font-smoothing: antialiased;
971	+ -moz-osx-font-smoothing: grayscale;
972	+ vertical-align: top;
973	+ margin-right: 5px;
974	+ content: '\f463';
975	+ -webkit-animation: rotation 2s infinite linear;
976	+ animation: rotation 2s infinite linear;
977	+ }
978	+
979	+ @-webkit-keyframes rotation {
980	+ 0% {
981	+ -webkit-transform: rotate(0deg);
982	+ transform: rotate(0deg);
983	+ }
984	+ 100% {
985	+ -webkit-transform: rotate(359deg);
986	+ transform: rotate(359deg);
987	+ }
988	+ }
989	+
990	+ @keyframes rotation {
991	+ 0% {
992	+ -webkit-transform: rotate(0deg);
993	+ transform: rotate(0deg);
994	+ }
995	+ 100% {
996	+ -webkit-transform: rotate(359deg);
997	+ transform: rotate(359deg);
998	+ }
999	+ }

css/admin/settings.css ADDED Viewed

	@@ -0,0 +1,603 @@


1	+
2	+ .toplevel_page_maxmegamenu .notice,
3	+ .toplevel_page_maxmegamenu div.updated,
4	+ .toplevel_page_maxmegamenu div.error {
5	+ margin-left: 0;
6	+ }
7	+ .megamenu_outer_wrap .megamenu_wrap {
8	+ width: 100%;
9	+ float: left;
10	+ }
11	+ .megamenu_outer_wrap .megamenu_left {
12	+ float: left;
13	+ width: 190px;
14	+ margin-left: -100%;
15	+ }
16	+
17	+ .megamenu_outer_wrap .megamenu_left ul li a:hover,
18	+ .megamenu_outer_wrap .megamenu_left ul li a.active {
19	+ border-left: 2px solid #0074a2;
20	+ color: #0074a2;
21	+ }
22	+ .megamenu_outer_wrap *:focus {
23	+ box-shadow: 0 0 0;
24	+ }
25	+ .megamenu_outer_wrap .megamenu_left ul li a {
26	+ text-decoration: none;
27	+ color: #333;
28	+ width: 100%;
29	+ display: block;
30	+ padding: 5px 0px 5px 17px;
31	+ box-sizing: border-box;
32	+ border-left: 2px solid white;
33	+ outline: 0;
34	+ }
35	+
36	+
37	+ .megamenu_outer_wrap .megamenu_left ul li.error {
38	+ border-left: 3px solid #dd3d36;
39	+ }
40	+ .megamenu_outer_wrap .megamenu_left ul li.mega_active {
41	+ font-weight: bold;
42	+ }
43	+ .megamenu_outer_wrap .megamenu_left ul li.mega_active a:after {
44	+ right: 0;
45	+ content: '\f139';
46	+ border: 0;
47	+ background: 0 0;
48	+ font: 400 20px/1 dashicons;
49	+ speak: none;
50	+ float: right;
51	+ padding: 0;
52	+ text-indent: 0;
53	+ text-align: center;
54	+ position: relative;
55	+ -webkit-font-smoothing: antialiased;
56	+ -moz-osx-font-smoothing: grayscale;
57	+ text-decoration: none!important;
58	+ margin-right: 0;
59	+ }
60	+
61	+ .megamenu_outer_wrap .megamenu_right {
62	+ margin-left: 190px;
63	+ padding: 20px;
64	+ box-sizing: border-box;
65	+ border-left: 1px solid #f1f1f1;
66	+ min-height: 400px;
67	+ }
68	+ .megamenu_outer_wrap .megamenu_right h3 {
69	+ clear: both;
70	+ font-size: 1.1em;
71	+ margin: 17px 0;
72	+ }
73	+ .megamenu_outer_wrap .megamenu_right h3.first {
74	+ margin-top: 0;
75	+ }
76	+ .mega-menu_page_maxmegamenu_tools .menu_settings h3,
77	+ .toplevel_page_maxmegamenu .menu_settings h3 {
78	+ border-bottom: 1px solid #CAC4C4;
79	+ padding: 0 0 10px 0;
80	+ }
81	+ .megamenu_outer_wrap .megamenu_right h3 span {
82	+ margin-right: 10px;
83	+ }
84	+ .megamenu_outer_wrap .megamenu_right h5 {
85	+ clear: both;
86	+ font-size: 1.1em;
87	+ margin: 15px 0 0px 0;
88	+ padding: 0;
89	+ }
90	+ .megamenu_outer_wrap .megamenu_right ul.bullets {
91	+ list-style-type: disc;
92	+ margin-left: 30px;
93	+ }
94	+ .megamenu_outer_wrap a {
95	+ text-decoration: none;
96	+ }
97	+ .megamenu_outer_wrap .theme_selector {
98	+ margin-bottom: 20px;
99	+ }
100	+ .megamenu_outer_wrap h3 {
101	+ margin: 0 0 40px 0;
102	+ }
103	+ .megamenu_outer_wrap .megamenu_right .menu_settings .duplicate {
104	+ margin-left: 15px;
105	+ }
106	+ .megamenu_outer_wrap {
107	+ padding: 20px 20px 0 0;
108	+ }
109	+ .megamenu_outer_wrap .megamenu_submit {
110	+ margin-bottom: 40px;
111	+ padding-top: 35px;
112	+ }
113	+ .megamenu_outer_wrap .megamenu_submit .mega_left,
114	+ .megamenu_outer_wrap .megamenu_submit .mega_right {
115	+ float: left;
116	+ width: 50%;
117	+ }
118	+ .megamenu_outer_wrap .megamenu_submit p {
119	+ margin: 0;
120	+ padding: 0;
121	+ }
122	+ .megamenu_outer_wrap .megamenu_submit .mega_right {
123	+ text-align: right;
124	+ }
125	+ .megamenu_outer_wrap .megamenu_submit .mega_right a {
126	+ color: #a00;
127	+ }
128	+ .megamenu_outer_wrap .megamenu_header {
129	+ background: white;
130	+ padding: 10px 17px;
131	+ border-bottom: 1px solid #f1f1f1;
132	+ float: left;
133	+ width: 100%;
134	+ box-sizing: border-box;
135	+ }
136	+
137	+ .megamenu_outer_wrap .megamenu_header .version {
138	+ font-style: italic;
139	+ color: #888;
140	+ margin-bottom: 15px;
141	+ }
142	+
143	+
144	+ .megamenu_outer_wrap .megamenu_header_top {
145	+ font-size: 0.9em;
146	+ display: block;
147	+ width: 100%;
148	+ height: 30px;
149	+ line-height: 30px;
150	+ margin-bottom: 10px;
151	+ box-sizing: border-box;
152	+ }
153	+ .megamenu_outer_wrap .megamenu_header_top ul {
154	+ margin: 0;
155	+ float: right;
156	+ position: relative;
157	+ }
158	+ .megamenu_outer_wrap .megamenu_header_top ul li {
159	+ display: inline-block;
160	+ margin: 0 0 0 10px;
161	+ line-height: 30px;
162	+ }
163	+ .megamenu_outer_wrap .megamenu_header_top ul li.mega-highlight {
164	+ background: #00b7bf;
165	+ border-radius: 5px;
166	+ }
167	+ .megamenu_outer_wrap .megamenu_header_top ul li.mega-highlight a {
168	+ color: white;
169	+ line-height: 30px;
170	+ padding: 0 10px;
171	+ }
172	+ .megamenu_outer_wrap .megamenu_wrap {
173	+ background: white;
174	+ }
175	+ .megamenu_outer_wrap .megamenu_right .nav-tab-active {
176	+ background: white;
177	+ }
178	+ .megamenu_outer_wrap .megamenu_right .menu_settings tr:first-child td {
179	+ border-top: 0;
180	+ }
181	+ .megamenu_outer_wrap .megamenu_right .menu_settings th {
182	+ text-align: left;
183	+ }
184	+ .megamenu_outer_wrap .megamenu_right .menu_settings td {
185	+ padding-bottom: 25px;
186	+ padding-top: 10px;
187	+ border-top: 1px solid #efefef;
188	+ }
189	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-name {
190	+ width: 27%;
191	+ line-height: 2em;
192	+ padding-right: 30px;
193	+ vertical-align: top;
194	+ }
195	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-value {
196	+ padding-top: 10px;
197	+ }
198	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-name .mega-description,
199	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-value .mega-description {
200	+ font-size: 0.9em;
201	+ color: #aaa;
202	+ line-height: 1.5em;
203	+ }
204	+
205	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-value .mega-info {
206	+ clear: both;
207	+ margin-top: 15px;
208	+ display: block;
209	+ float: left;
210	+ font-size: 0.9em;
211	+ color: #aaa;
212	+ line-height: 20px;
213	+ width: 100%;
214	+ }
215	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-value .mega-info:before {
216	+ font: 400 20px/1 dashicons;
217	+ content: "\f348";
218	+ speak: none;
219	+ padding: 0;
220	+ margin-right: 6px;
221	+ display: inline-block;
222	+ vertical-align: top;
223	+ -webkit-font-smoothing: antialiased;
224	+ -moz-osx-font-smoothing: grayscale;
225	+ }
226	+ .megamenu_outer_wrap .megamenu_right .menu_settings td .mega-custom_css {
227	+ width: 100%;
228	+ margin-bottom: 0;
229	+ }
230	+ .megamenu_outer_wrap .megamenu_right .menu_settings td.mega-value .mega-description {
231	+ margin-top: 5px;
232	+ }
233	+
234	+ .megamenu_outer_wrap .megamenu_right .menu_settings table textarea,
235	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[type=text],
236	+ .megamenu_outer_wrap .megamenu_right .menu_settings table select {
237	+ font-size: 0.9em;
238	+ height: 28px;
239	+ line-height: 28px;
240	+ vertical-align: top;
241	+ }
242	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[type=number] {
243	+ height: auto;
244	+ line-height: 1.2em;
245	+ }
246	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[name=export] {
247	+ margin-top: 20px;
248	+ }
249	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input.mega-setting-title {
250	+ width: 100px;
251	+ }
252	+
253	+ .megamenu_outer_wrap .megamenu_right textarea {
254	+ width: 100%;
255	+ height: 150px;
256	+ font-family: monospace;
257	+ line-height: 1.5em;
258	+ font-size: 0.8em;
259	+ }
260	+
261	+ .megamenu_outer_wrap .megamenu_right .menu_settings table textarea {
262	+ width: 100%;
263	+ height: 150px;
264	+ font-family: monospace;
265	+ line-height: 1.5em;
266	+ }
267	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .CodeMirror {
268	+ height: 150px;
269	+ border: 1px solid #aaa;
270	+ }
271	+
272	+ .megamenu_outer_wrap .megamenu_right .menu_settings table ul.custom_styling_tips {
273	+ list-style-type: disc;
274	+ list-style-position: inside;
275	+ }
276	+ .megamenu_outer_wrap .megamenu_right .menu_settings table ul.custom_styling_tips code {
277	+ margin: 10px 0 0 0;
278	+ font-size: 0.9em;
279	+ }
280	+ .megamenu_outer_wrap .megamenu_right .menu_settings table label.mega-error input {
281	+ border: 1px solid red;
282	+ background: #FFDDDD;
283	+ }
284	+
285	+ .megamenu_outer_wrap .megamenu_right .menu_settings table label.mega-toggle_blocks {
286	+ width: 100%;
287	+ cursor: auto;
288	+ }
289	+
290	+
291	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block {
292	+ position: relative;
293	+ display: inline-block;
294	+ vertical-align: top;
295	+ margin: 0 5px 0 0;
296	+ }
297	+
298	+ .megamenu_outer_wrap .select2-container-sm .select2-choice>.select2-chosen {
299	+ line-height: 28px;
300	+ margin-right: 0px;
301	+ }
302	+ .megamenu_outer_wrap .tpx-select2-container .select2-choice .select2-arrow:before {
303	+ font: 400 17px/26px dashicons;
304	+ }
305	+
306	+ .mega-menu_page_maxmegamenu_theme_editor .tpx-select2-drop {
307	+ box-shadow: 0 0 0;
308	+ }
309	+ .megamenu_outer_wrap .select2-container-sm .select2-choice .select2-arrow {
310	+ display: none;
311	+ }
312	+ .mega-menu_page_maxmegamenu_theme_editor .select2-results li:first-child {
313	+ float: none;
314	+ }
315	+ .mega-menu_page_maxmegamenu_theme_editor .select2-results li:first-child i {
316	+ display: none;
317	+ }
318	+ .mega-menu_page_maxmegamenu_theme_editor .select2-results li {
319	+ float: left;
320	+ }
321	+ .megamenu_outer_wrap .select2-container-sm .select2-choice {
322	+ padding: 0 5px 0 5px;
323	+ height: 28px;
324	+ color: #B5B5B5;
325	+ }
326	+
327	+ .megamenu_outer_wrap .icon_dropdown .select2-chosen i:before {
328	+ line-height: 28px;
329	+ font-size: 16px;
330	+ color: #333;
331	+ }
332	+
333	+
334	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-left,
335	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-center,
336	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-right {
337	+ box-sizing: border-box;
338	+ border: 1px solid #ccc;
339	+ background: #f7f7f7;
340	+ width: 33%;
341	+ height: 60px;
342	+ padding: 10px;
343	+ margin-top: 15px;
344	+ float: left;
345	+ }
346	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-left {
347	+ border-right: 0px;
348	+ }
349	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-center {
350	+ border-left: 1px dashed #ccc;
351	+ border-right: 1px dashed #ccc;
352	+ text-align: center;
353	+ }
354	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-right {
355	+ border-left: 0px;
356	+ }
357	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-right .block {
358	+ float: right;
359	+ margin: 0 0 0 5px;
360	+ }
361	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block.mega-open .block-title {
362	+ border-bottom: 1px solid white;
363	+ border-radius: 3px 3px 0 0;
364	+ }
365	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block .block-title {
366	+ padding: 0 10px;
367	+ display: inline-block;
368	+ height: 35px;
369	+ line-height: 35px;
370	+ background: white;
371	+ color: #555;
372	+ cursor: move;
373	+ border: 1px solid #ccc;
374	+ position: relative;
375	+ z-index: 2;
376	+ border-radius: 3px;
377	+ }
378	+
379	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block .block-title .dashicons {
380	+ line-height: 35px;
381	+ cursor: pointer;
382	+ font-size: 20px;
383	+ }
384	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block .block-settings {
385	+ padding: 10px;
386	+ display: none;
387	+ width: 200px;
388	+ vertical-align: top;
389	+ background: white;
390	+ text-align: left;
391	+ color: #ccc;
392	+ position: absolute;
393	+ left: 0px;
394	+ top: 36px;
395	+ z-index: 1;
396	+ border: 1px solid #ccc;
397	+ }
398	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .mega-right .block .block-settings {
399	+ left: auto;
400	+ right: 0;
401	+ }
402	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .mega-blocks .block h3 {
403	+ margin-top: 5px;
404	+ border-bottom: 1px solid #ccc;
405	+ padding-bottom: 10px;
406	+ }
407	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .block-settings label {
408	+ width: 100%;
409	+ clear: both;
410	+ color: #333;
411	+ font-size: 1em;
412	+ }
413	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .block-settings label input,
414	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .block-settings label select,
415	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .block-settings label input,
416	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .block-settings label .icon_dropdown {
417	+ float: right;
418	+ font-size: 0.9em;
419	+ }
420	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .toggle-left {
421	+ border-right: 1px dashed #ccc;
422	+ }
423	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .toggle-bar-designer .toggle-right {
424	+ border-left: 0px solid #ccc;
425	+ text-align: right;
426	+
427	+ }
428	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[type=text] {
429	+ width: 70px;
430	+ }
431	+ .megamenu_outer_wrap .megamenu_right .menu_settings table label {
432	+ font-size: 0.9em;
433	+ float: left;
434	+ margin-right: 10px;
435	+ margin-bottom: 10px;
436	+ }
437	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .mega-validation-message {
438	+ display: none;
439	+ clear: both;
440	+ font-size: 0.8em;
441	+ color: red;
442	+ }
443	+ .megamenu_outer_wrap .megamenu_right .menu_settings table label span.mega-short-desc {
444	+ font-size: 0.8em;
445	+ text-transform: uppercase;
446	+ color: #aaa;
447	+ display: block;
448	+ margin: 0 0 2px 1px;
449	+ }
450	+ .megamenu_outer_wrap .megamenu_right .menu_settings table .wide input[type=text] {
451	+ width: 300px;
452	+ }
453	+
454	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[type=submit] {
455	+ width: auto;
456	+ }
457	+ .megamenu_outer_wrap .megamenu_right .menu_settings table input[type=checkbox] {
458	+ width: 16px;
459	+ height: 16px;
460	+ vertical-align: middle;
461	+ }
462	+ .megamenu_outer_wrap .megamenu_right .menu_settings table {
463	+ width: 100%;
464	+ border-collapse: collapse;
465	+ }
466	+ .megamenu_outer_wrap .megamenu_right .menu_settings .accordion-container h4 {
467	+ margin: 0;
468	+ }
469	+ .megamenu_outer_wrap .megamenu_right .menu_settings .accordion-container {
470	+ border: 1px solid #dfdfdf;
471	+ }
472	+
473	+ .megamenu_outer_wrap .megamenu_right .menu_settings .accordion-container .accordion-section-content {
474	+ padding-left: 10px;
475	+ padding-right: 10px;
476	+ }
477	+
478	+ .megamenu_outer_wrap .megamenu_right .menu_settings .row h5 {
479	+ margin: 0;
480	+ font-weight: normal;
481	+ float: left;
482	+ width: 250px;
483	+ font-size: 1em;
484	+ }
485	+
486	+ .megamenu_outer_wrap .megamenu_right .fail {
487	+ border: 1px solid #aaa;
488	+ border-left: 4px solid #dd3d36;
489	+ background: #fff;
490	+ box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
491	+ padding: 7px 0 7px 15px;
492	+ margin: 0 0 20px 0;
493	+ }
494	+ .megamenu_outer_wrap .megamenu_wrap .success {
495	+ border: 1px solid #aaa;
496	+ border-left: 4px solid #7ad03a;
497	+ background: #fff;
498	+ box-shadow: 0 1px 1px 0 rgba(0,0,0,.1);
499	+ padding: 7px 0 7px 7px;
500	+ margin: 0 0 20px 0;
501	+ }
502	+ .megamenu_outer_wrap .megamenu_wrap .success .dashicons {
503	+ color: #7ad03a;
504	+ margin-right: 7px;
505	+ }
506	+ .megamenu_outer_wrap .megamenu_right .menu_settings select.icon_dropdown {
507	+ margin-right: 0;
508	+ }
509	+ .select2-drop {
510	+ min-width: 150px;
511	+ }
512	+ .select2-results .select2-result-label {
513	+ font-size: 0.9em;
514	+ }
515	+ .megamenu_outer_wrap .megamenu_right .menu_settings h3.editing_theme {
516	+ margin: 0px 0 30px 0;
517	+ }
518	+
519	+ .megamenu_outer_wrap .mm-picker-container .sp-replacer {
520	+ margin: 0;
521	+ float: left;
522	+ }
523	+
524	+ .megamenu_outer_wrap .mm-picker-container .sp-replacer .sp-preview {
525	+ border: 0;
526	+ height: 26px;
527	+ width: 26px;
528	+ margin: 0;
529	+ }
530	+ .megamenu_outer_wrap .mm-picker-container input.mm_colorpicker {
531	+ float: left;
532	+ border: 0;
533	+ height: 23px;
534	+ box-shadow: 0 0 0;
535	+ margin: 0;
536	+ }
537	+
538	+
539	+
540	+ .megamenu_outer_wrap .mm-picker-container {
541	+ border-radius: 3px;
542	+ box-shadow: 0 1px 0 rgba(0,0,0,.08);
543	+ border: 1px solid #ccc;
544	+ font-size: 0.9em;
545	+ margin-right: 10px;
546	+ float: left;
547	+ }
548	+
549	+ .megamenu_outer_wrap .block .mm-picker-container {
550	+ float: right;
551	+ margin-right: 0;
552	+ }
553	+
554	+ .megamenu_outer_wrap .mm-picker-container div.chosen-color {
555	+ background: #f7f7f7;
556	+ -webkit-border-radius: 0 2px 2px 0;
557	+ border-radius: 0 2px 2px 0;
558	+ border-left: 1px solid #ccc;
559	+ color: #555;
560	+ font-size: 11px;
561	+ line-height: 26px;
562	+ padding: 0 6px;
563	+ text-align: center;
564	+ -webkit-box-shadow: inset 0 1px 0 #fff;
565	+ box-shadow: inset 0 1px 0 #fff;
566	+ float: left;
567	+ cursor: default;
568	+ }
569	+ .megamenu_outer_wrap .megamenu_right .mega-location .mega-assigned-menu:before {
570	+ font: 400 20px/21px dashicons;
571	+ content: "\f142";
572	+ speak: none;
573	+ padding: 0;
574	+ display: inline-block;
575	+ vertical-align: top;
576	+ -webkit-font-smoothing: antialiased;
577	+ -moz-osx-font-smoothing: grayscale;
578	+ }
579	+ .megamenu_outer_wrap .mega-delete {
580	+ margin-bottom: 15px;
581	+ cursor: pointer;
582	+ }
583	+ .megamenu_outer_wrap .megamenu_right .mega-location .mega-assigned-menu:before {
584	+ content: "\f333";
585	+ font-size: 16px;
586	+ margin-right: 2px;
587	+ }
588	+ .megamenu_outer_wrap .megamenu_right .mega-location .mega-assigned-menu {
589	+ float: right;
590	+ text-transform: uppercase;
591	+ font-weight: bold;
592	+ opacity: 0.7;
593	+ margin-right: 28px;
594	+ font-size: 0.8em;
595	+ }
596	+ .megamenu_outer_wrap .megamenu_right .menu_settings .mega-location table textarea {
597	+ height: 30px;
598	+ }
599	+ .megamenu_outer_wrap .megamenu_right .mega-location .accordion-section-content {
600	+ width: 100%;
601	+ box-sizing: border-box;
602	+ }
603	+

css/megamenu.scss ADDED Viewed

	@@ -0,0 +1,690 @@


1	+ // ---------------- DO NOT EDIT THIS FILE DIRECTLY ---------------
2	+ // Copy this file to the wp-content/themes/YOUR_THEME/megamenu/megamenu.scss
3	+ //
4	+ // Important Note: Re-save your menu in WordPress after copying this
5	+ // file in order to regenerate the cached CSS.
6	+ //
7	+ // Developer Tips
8	+ // -- Set "define("MEGAMENU_DEBUG", true);" in wp-config.php to disable CSS cache
9	+ // -- Add &nocache to the CSS URL to regenerate cache
10	+
11	+ #{$wrap},
12	+ #{$wrap} #{$menu},
13	+ #{$wrap} #{$menu} ul.mega-sub-menu,
14	+ #{$wrap} #{$menu} li.mega-menu-item,
15	+ #{$wrap} #{$menu} a.mega-menu-link {
16	+ -moz-transition: none;
17	+ -o-transition: none;
18	+ -webkit-transition: none;
19	+ transition: none;
20	+ @include border-radius(0, 0, 0, 0);
21	+ @include box-shadow(none);
22	+ background: none;
23	+ border: 0;
24	+ bottom: auto;
25	+ box-sizing: border-box;
26	+ clip: auto;
27	+ color: $panel_font_color;
28	+ display: block;
29	+ float: none;
30	+ font-family: $panel_font_family;
31	+ font-size: $panel_font_size;
32	+ height: auto;
33	+ left: auto;
34	+ line-height: $line_height;
35	+ list-style-type: none;
36	+ margin: 0;
37	+ min-height: 0;
38	+ opacity: 1;
39	+ outline: none;
40	+ overflow: visible;
41	+ padding: 0;
42	+ position: relative;
43	+ right: auto;
44	+ text-align: left;
45	+ text-decoration: none;
46	+ text-transform: none;
47	+ top: auto;
48	+ vertical-align: baseline;
49	+ visibility: inherit;
50	+ width: auto;
51	+
52	+ &:before,
53	+ &:after {
54	+ display: none;
55	+ }
56	+ }
57	+
58	+ #{$wrap} {
59	+ @include background($container_background_from, $container_background_to);
60	+ @include border-radius($container_border_radius_top_left, $container_border_radius_top_right, $container_border_radius_bottom_right, $container_border_radius_bottom_left);
61	+
62	+ #{$menu} {
63	+ visibility: visible;
64	+ text-align: $menu_item_align;
65	+ padding: $container_padding_top $container_padding_right $container_padding_bottom $container_padding_left;
66	+
67	+ a.mega-menu-link {
68	+ display: inline;
69	+
70	+ @if $transitions == 'on' {
71	+ -webkit-transition: background 200ms linear, color 200ms linear;
72	+ -moz-transition: background 200ms linear, color 200ms linear;
73	+ -o-transition: background 200ms linear, color 200ms linear;
74	+ transition: background 200ms linear, color 200ms linear;
75	+ }
76	+ }
77	+
78	+ p {
79	+ margin-bottom: 10px;
80	+ }
81	+
82	+ input,
83	+ img {
84	+ max-width: 100%;
85	+ }
86	+
87	+ li.mega-menu-item > ul.mega-sub-menu {
88	+ display: block;
89	+ visibility: hidden;
90	+ opacity: 1;
91	+ }
92	+
93	+ &.mega-no-js li.mega-menu-item:hover > ul.mega-sub-menu,
94	+ &.mega-no-js li.mega-menu-item:focus > ul.mega-sub-menu,
95	+ li.mega-menu-item.mega-toggle-on > ul.mega-sub-menu,
96	+ li.mega-menu-item.mega-menu-megamenu.mega-toggle-on ul.mega-sub-menu {
97	+ visibility: visible;
98	+ }
99	+
100	+ li.mega-menu-item a[class^='dashicons']:before {
101	+ font-family: dashicons;
102	+ }
103	+
104	+ li.mega-disable-link > a.mega-menu-link {
105	+ cursor: default;
106	+ }
107	+
108	+ li.mega-menu-item a.mega-menu-link:before {
109	+ display: inline-block;
110	+ font: inherit;
111	+ font-family: dashicons;
112	+ position: static;
113	+ margin: 0 6px 0 0px;
114	+ vertical-align: top;
115	+ -webkit-font-smoothing: antialiased;
116	+ -moz-osx-font-smoothing: grayscale;
117	+ color: inherit;
118	+ }
119	+
120	+ li.mega-menu-item.mega-hide-text a.mega-menu-link:before {
121	+ margin: 0;
122	+ }
123	+
124	+ li.mega-align-bottom-left {
125	+ > ul.mega-sub-menu {
126	+
127	+ }
128	+
129	+ &.mega-toggle-on > a.mega-menu-link {
130	+ @include border-radius($menu_item_link_border_radius_top_left, $menu_item_link_border_radius_top_right, 0, 0);
131	+ }
132	+ }
133	+
134	+ li.mega-align-bottom-right {
135	+ > ul.mega-sub-menu {
136	+ right: 0;
137	+ }
138	+
139	+ &.mega-toggle-on > a.mega-menu-link {
140	+ @include border-radius($menu_item_link_border_radius_top_left, $menu_item_link_border_radius_top_right, 0, 0);
141	+ }
142	+ }
143	+
144	+ @if unit($panel_width) == '%' {
145	+ > li.mega-menu-megamenu.mega-menu-item {
146	+ position: static;
147	+ }
148	+ }
149	+
150	+ // top level items
151	+ > li.mega-menu-item {
152	+
153	+ margin: 0 $menu_item_spacing 0 0;
154	+ display: inline-block;
155	+ height: auto;
156	+
157	+ @if $menu_item_divider == 'on' {
158	+ border-left: 1px solid $menu_item_divider_color;
159	+ -webkit-box-shadow: inset 1px 0 0 0 rgba(255,255,255,$menu_item_divider_glow_opacity);
160	+ -moz-box-shadow: inset 1px 0 0 0 rgba(255,255,255,$menu_item_divider_glow_opacity);
161	+ box-shadow: inset 1px 0 0 0 rgba(255,255,255,$menu_item_divider_glow_opacity);
162	+
163	+ /* Hide divider on first menu item */
164	+ &:first-of-type {
165	+ border-left: 0;
166	+ -webkit-box-shadow: none;
167	+ -moz-box-shadow: none;
168	+ box-shadow: none;
169	+ }
170	+ }
171	+
172	+ &.mega-item-align-right {
173	+ float: right;
174	+ margin: 0 0 0 $menu_item_spacing;
175	+ }
176	+
177	+ &.mega-toggle-on > a.mega-menu-link,
178	+ > a.mega-menu-link:hover,
179	+ > a.mega-menu-link:focus {
180	+ @include background($menu_item_background_hover_from, $menu_item_background_hover_to);
181	+ color: $menu_item_link_color_hover;
182	+ font-weight: $menu_item_link_weight_hover;
183	+ text-decoration: $menu_item_link_text_decoration_hover;
184	+ border-color: $menu_item_border_color_hover;
185	+ }
186	+
187	+ @if $menu_item_highlight_current == 'on' {
188	+
189	+ &.mega-current-menu-item,
190	+ &.mega-current-menu-ancestor {
191	+ > a.mega-menu-link {
192	+ @include background($menu_item_background_hover_from, $menu_item_background_hover_to);
193	+ color: $menu_item_link_color_hover;
194	+ font-weight: $menu_item_link_weight_hover;
195	+ text-decoration: $menu_item_link_text_decoration_hover;
196	+ }
197	+ }
198	+
199	+ }
200	+
201	+ > a.mega-menu-link {
202	+ border-top: $menu_item_border_top solid $menu_item_border_color;
203	+ border-left: $menu_item_border_left solid $menu_item_border_color;
204	+ border-right: $menu_item_border_right solid $menu_item_border_color;
205	+ border-bottom: $menu_item_border_bottom solid $menu_item_border_color;
206	+ outline: none;
207	+ text-decoration: none;
208	+ padding: $menu_item_link_padding_top $menu_item_link_padding_right $menu_item_link_padding_bottom $menu_item_link_padding_left;
209	+ line-height: $menu_item_link_height;
210	+ font-weight: $menu_item_link_weight;
211	+ height: $menu_item_link_height;
212	+ vertical-align: baseline;
213	+ text-align: left;
214	+ width: auto;
215	+ display: block;
216	+ color: $menu_item_link_color;
217	+ text-transform: $menu_item_link_text_transform;
218	+ text-decoration: $menu_item_link_text_decoration;
219	+ @include background($menu_item_background_from, $menu_item_background_to);
220	+ @include border-radius($menu_item_link_border_radius_top_left, $menu_item_link_border_radius_top_right, $menu_item_link_border_radius_bottom_right, $menu_item_link_border_radius_bottom_left);
221	+ font-family: $menu_item_link_font;
222	+ font-size: $menu_item_link_font_size;
223	+ cursor: pointer;
224	+ }
225	+
226	+ @include mobile {
227	+ display: list-item;
228	+ margin: 0;
229	+ clear: both;
230	+ border: 0;
231	+
232	+ &.mega-item-align-right {
233	+ float: none;
234	+ }
235	+
236	+ > a.mega-menu-link {
237	+ @include border-radius(0 0 0 0);
238	+ border: 0;
239	+ margin: 0;
240	+ line-height: $mobile_menu_item_height;
241	+ height: $mobile_menu_item_height;
242	+ padding: 0 10px;
243	+ }
244	+
245	+ }
246	+
247	+ }
248	+
249	+ // sub menu items (megamenu)
250	+
251	+ > li.mega-menu-megamenu > ul.mega-sub-menu {
252	+ z-index: $z_index;
253	+ @include border-radius($panel_border_radius_top_left, $panel_border_radius_top_right, $panel_border_radius_bottom_right, $panel_border_radius_bottom_left);
254	+ @include background($panel_background_from, $panel_background_to);
255	+ padding: $panel_padding_top $panel_padding_right $panel_padding_bottom $panel_padding_left;
256	+ position: absolute;
257	+ width: $panel_width;
258	+ border-top: $panel_border_top solid $panel_border_color;
259	+ border-left: $panel_border_left solid $panel_border_color;
260	+ border-right: $panel_border_right solid $panel_border_color;
261	+ border-bottom: $panel_border_bottom solid $panel_border_color;
262	+
263	+ @if unit($panel_width) == '%' {
264	+ left: 0;
265	+ }
266	+
267	+ @if unit($panel_inner_width) == '%' and $panel_inner_width < 100% {
268	+ padding-left: (100 - $panel_inner_width) / 2;
269	+ padding-right: (100 - $panel_inner_width) / 2;
270	+ }
271	+
272	+ @if $shadow == 'on' {
273	+ @include box-shadow($shadow_horizontal $shadow_vertical $shadow_blur $shadow_spread $shadow_color);
274	+ }
275	+
276	+ @include mobile {
277	+ float: left;
278	+ position: static;
279	+ width: 100% !important;
280	+ }
281	+
282	+ @for $of from 1 through 8 {
283	+
284	+ @for $cols from 1 through $of {
285	+
286	+ > li.mega-menu-columns-#{$cols}-of-#{$of} {
287	+ width: (100% / $of) * $cols;
288	+ }
289	+
290	+ }
291	+ }
292	+
293	+
294	+ > li.mega-menu-item ul.mega-sub-menu {
295	+ clear: both;
296	+
297	+ li.mega-menu-item ul.mega-sub-menu {
298	+ margin-left: 10px;
299	+
300	+ li.mega-menu-item ul.mega-sub-menu {
301	+ margin-left: 20px;
302	+ }
303	+ }
304	+ }
305	+
306	+ > li.mega-menu-item {
307	+ color: $panel_font_color;
308	+ font-family: $panel_font_family;
309	+ font-size: $panel_font_size;
310	+ display: block;
311	+ float: left;
312	+ clear: none;
313	+ padding: $panel_widget_padding_top $panel_widget_padding_right $panel_widget_padding_bottom $panel_widget_padding_left;
314	+ vertical-align: top;
315	+
316	+ &.mega-menu-clear {
317	+ clear: left;
318	+ }
319	+
320	+ /* Widget titles */
321	+ h4.mega-block-title {
322	+ color: $panel_header_color;
323	+ font-family: $panel_header_font;
324	+ font-size: $panel_header_font_size;
325	+ text-transform: $panel_header_text_transform;
326	+ text-decoration: $panel_header_text_decoration;
327	+ font-weight: $panel_header_font_weight;
328	+ margin: $panel_header_margin_top $panel_header_margin_right $panel_header_margin_bottom $panel_header_margin_left;
329	+ padding: $panel_header_padding_top $panel_header_padding_right $panel_header_padding_bottom $panel_header_padding_left;
330	+ vertical-align: top;
331	+ display: block;
332	+ border-top: $panel_header_border_top solid $panel_header_border_color;
333	+ border-left: $panel_header_border_left solid $panel_header_border_color;
334	+ border-right: $panel_header_border_right solid $panel_header_border_color;
335	+ border-bottom: $panel_header_border_bottom solid $panel_header_border_color;
336	+ }
337	+
338	+ /* Second level menu item */
339	+ > a.mega-menu-link {
340	+ color: $panel_second_level_font_color;
341	+ font-family: $panel_second_level_font;
342	+ font-size: $panel_second_level_font_size;
343	+ text-transform: $panel_second_level_text_transform;
344	+ text-decoration: $panel_second_level_text_decoration;
345	+ font-weight: $panel_second_level_font_weight;
346	+ margin: $panel_second_level_margin_top $panel_second_level_margin_right $panel_second_level_margin_bottom $panel_second_level_margin_left;
347	+ padding: $panel_second_level_padding_top $panel_second_level_padding_right $panel_second_level_padding_bottom $panel_second_level_padding_left;
348	+ vertical-align: top;
349	+ display: block;
350	+ border-top: $panel_second_level_border_top solid $panel_second_level_border_color;
351	+ border-left: $panel_second_level_border_left solid $panel_second_level_border_color;
352	+ border-right: $panel_second_level_border_right solid $panel_second_level_border_color;
353	+ border-bottom: $panel_second_level_border_bottom solid $panel_second_level_border_color;
354	+ }
355	+
356	+ /* Second level menu item hover */
357	+ > a.mega-menu-link:hover,
358	+ > a.mega-menu-link:focus {
359	+ color: $panel_second_level_font_color_hover;
360	+ font-weight: $panel_second_level_font_weight_hover;
361	+ text-decoration: $panel_second_level_text_decoration_hover;
362	+ @include background($panel_second_level_background_hover_from, $panel_second_level_background_hover_to);
363	+ }
364	+
365	+ /* Third level menu item */
366	+ li.mega-menu-item > a.mega-menu-link {
367	+ color: $panel_third_level_font_color;
368	+ font-family: $panel_third_level_font;
369	+ font-size: $panel_third_level_font_size;
370	+ text-transform: $panel_third_level_text_transform;
371	+ text-decoration: $panel_third_level_text_decoration;
372	+ font-weight: $panel_third_level_font_weight;
373	+ margin: 0;
374	+ padding: $panel_third_level_padding_top $panel_third_level_padding_right $panel_third_level_padding_bottom $panel_third_level_padding_left;
375	+ vertical-align: top;
376	+ display: block;
377	+ }
378	+
379	+ /* Third level menu item hover */
380	+ li.mega-menu-item > a.mega-menu-link:hover,
381	+ li.mega-menu-item > a.mega-menu-link:focus {
382	+ color: $panel_third_level_font_color_hover;
383	+ font-weight: $panel_third_level_font_weight_hover;
384	+ text-decoration: $panel_third_level_text_decoration_hover;
385	+ @include background($panel_third_level_background_hover_from, $panel_third_level_background_hover_to);
386	+ }
387	+ }
388	+
389	+ @include mobile {
390	+ border: 0;
391	+ padding: 10px;
392	+ @include border-radius(0,0,0,0);
393	+
394	+ @if $mobile_columns == 2 {
395	+ > li.mega-menu-item {
396	+ width: 50%;
397	+ }
398	+
399	+ > li:nth-child(odd) {
400	+ clear: left;
401	+ }
402	+ } @else {
403	+ > li.mega-menu-item {
404	+ width: 100%;
405	+ clear: both;
406	+ }
407	+ }
408	+ }
409	+ }
410	+
411	+ // sub menu items (flyout)
412	+
413	+ > li.mega-menu-flyout ul.mega-sub-menu {
414	+ z-index: $z_index;
415	+ position: absolute;
416	+ width: $flyout_width;
417	+ border-top: $flyout_border_top solid $flyout_border_color;
418	+ border-left: $flyout_border_left solid $flyout_border_color;
419	+ border-right: $flyout_border_right solid $flyout_border_color;
420	+ border-bottom: $flyout_border_bottom solid $flyout_border_color;
421	+ padding: $flyout_padding_top $flyout_padding_right $flyout_padding_bottom $flyout_padding_left;
422	+ @include background($flyout_menu_background_from, $flyout_menu_background_to);
423	+
424	+ @if $shadow == 'on' {
425	+ @include box-shadow($shadow_horizontal $shadow_vertical $shadow_blur $shadow_spread $shadow_color);
426	+ }
427	+
428	+ @include mobile {
429	+ float: left;
430	+ position: static;
431	+ width: 100% !important;
432	+ padding: 0;
433	+ border: 0;
434	+ }
435	+
436	+ li.mega-menu-item {
437	+
438	+ @if $flyout_menu_item_divider == 'on' {
439	+ border-bottom: 1px solid $flyout_menu_item_divider_color;
440	+
441	+ /* Hide divider on last menu item */
442	+ &:last-child {
443	+ border-bottom: 0;
444	+ -webkit-box-shadow: none;
445	+ -moz-box-shadow: none;
446	+ box-shadow: none;
447	+ }
448	+ }
449	+
450	+ @include mobile {
451	+ clear: both;
452	+ }
453	+
454	+ a.mega-menu-link {
455	+ display: block;
456	+ @include background($flyout_background_from, $flyout_background_to);
457	+ color: $flyout_link_color;
458	+ font-family: $flyout_link_family;
459	+ font-size: $flyout_link_size;
460	+ font-weight: $flyout_link_weight;
461	+ padding: $flyout_link_padding_top $flyout_link_padding_right $flyout_link_padding_bottom $flyout_link_padding_left;
462	+ line-height: $flyout_link_height;
463	+ text-decoration: $flyout_link_text_decoration;
464	+ text-transform: $flyout_link_text_transform;
465	+ vertical-align: baseline;
466	+ }
467	+
468	+ &:first-child a.mega-menu-link {
469	+ border-top-left-radius: $flyout_border_radius_top_left;
470	+ border-top-right-radius: $flyout_border_radius_top_right;
471	+
472	+ @include mobile {
473	+ border-top-left-radius: 0;
474	+ border-top-right-radius: 0;
475	+ }
476	+ }
477	+
478	+ &:last-child a.mega-menu-link {
479	+ border-bottom-right-radius: $flyout_border_radius_bottom_right;
480	+ border-bottom-left-radius: $flyout_border_radius_bottom_left;
481	+
482	+ @include mobile {
483	+ border-bottom-right-radius: 0;
484	+ border-bottom-left-radius: 0;
485	+ }
486	+ }
487	+
488	+ a.mega-menu-link:hover,
489	+ a.mega-menu-link:focus {
490	+ @include background($flyout_background_hover_from, $flyout_background_hover_to);
491	+ font-weight: $flyout_link_weight_hover;
492	+ text-decoration: $flyout_link_text_decoration_hover;
493	+ color: $flyout_link_color_hover;
494	+ }
495	+
496	+ ul.mega-sub-menu {
497	+ position: absolute;
498	+ left: 100%;
499	+ top: 0;
500	+ }
501	+
502	+ @include mobile {
503	+ ul.mega-sub-menu {
504	+ position: static;
505	+ left: 0;
506	+ width: 100%;
507	+
508	+ a.mega-menu-link {
509	+ padding-left: 20px;
510	+ }
511	+ }
512	+ }
513	+ }
514	+ }
515	+
516	+ // arrows
517	+ li.mega-menu-flyout.mega-menu-item-has-children,
518	+ li.mega-menu-flyout li.mega-menu-item-has-children,
519	+ > li.mega-menu-item-has-children {
520	+
521	+ > a.mega-menu-link:after {
522	+ content: $arrow_down;
523	+ display: inline-block;
524	+ font: inherit;
525	+ font-family: dashicons;
526	+ margin: 0 0 0 6px;
527	+ vertical-align: top;
528	+ -webkit-font-smoothing: antialiased;
529	+ -moz-osx-font-smoothing: grayscale;
530	+ -webkit-transform: rotate(0);
531	+ -moz-transform: rotate(0);
532	+ -ms-transform: rotate(0);
533	+ -o-transform: rotate(0);
534	+ transform: rotate(0);
535	+ color: inherit;
536	+ }
537	+
538	+ @include mobile {
539	+ a.mega-menu-link:after {
540	+ float: right;
541	+ }
542	+
543	+ &.mega-toggle-on > a.mega-menu-link:after {
544	+ content: $arrow_up;
545	+ }
546	+
547	+ &.mega-hide-sub-menu-on-mobile > a.mega-menu-link:after {
548	+ display: none;
549	+ }
550	+ }
551	+ }
552	+
553	+ // arrows
554	+ li.mega-menu-flyout.mega-menu-item-has-children.mega-hide-arrow > a.mega-menu-link:after,
555	+ li.mega-menu-flyout li.mega-menu-item-has-children.mega-hide-arrow > a.mega-menu-link:after,
556	+ > li.mega-menu-item-has-children.mega-hide-arrow > a.mega-menu-link:after {
557	+ display: none;
558	+ }
559	+
560	+
561	+ li.mega-menu-item li.mega-menu-item-has-children > a.mega-menu-link:after {
562	+ content: $arrow_right;
563	+ float: right;
564	+ margin: 0;
565	+
566	+ @include mobile {
567	+ content: $arrow_down;
568	+ }
569	+ }
570	+
571	+ li.mega-menu-flyout.mega-align-bottom-right {
572	+
573	+ li.mega-menu-item a.mega-menu-link {
574	+ text-align: right;
575	+
576	+ @include mobile {
577	+ text-align: left;
578	+ }
579	+ }
580	+
581	+ li.mega-menu-item a.mega-menu-link:before {
582	+ float: right;
583	+ margin: 0 0 0 6px;
584	+
585	+ @include mobile {
586	+ float: left;
587	+ margin: 0 6px 0 0;
588	+ }
589	+ }
590	+
591	+ li.mega-menu-item-has-children > a.mega-menu-link:after {
592	+ content: $arrow_left;
593	+ float: left;
594	+ margin: 0;
595	+
596	+ @include mobile {
597	+ content: $arrow_down;
598	+ float: right;
599	+ }
600	+ }
601	+
602	+ ul.mega-sub-menu li.mega-menu-item ul.mega-sub-menu {
603	+ left: -100%;
604	+ top: 0;
605	+ }
606	+ }
607	+
608	+ // polylang Language Switcher
609	+ li[class^='mega-lang-item'] > a.mega-menu-link > img {
610	+ display: inline;
611	+ }
612	+
613	+ // WPML Flags
614	+ a.mega-menu-link > img.iclflag {
615	+ display: inline;
616	+ margin-right: 8px;
617	+ }
618	+
619	+ @include mobile {
620	+ li.mega-menu-item.mega-hide-on-mobile,
621	+ > li.mega-menu-megamenu > ul.mega-sub-menu > li.mega-menu-item.mega-hide-on-mobile {
622	+ display: none;
623	+ }
624	+ }
625	+
626	+ @include desktop {
627	+ li.mega-menu-item.mega-hide-on-desktop,
628	+ > li.mega-menu-megamenu > ul.mega-sub-menu > li.mega-menu-item.mega-hide-on-desktop {
629	+ display: none;
630	+ }
631	+ }
632	+
633	+ }
634	+
635	+ // responsive toggle hamburger
636	+ .mega-menu-toggle {
637	+ display: none;
638	+ z-index: 1;
639	+ cursor: pointer;
640	+ @include background($toggle_background_from, $toggle_background_to);
641	+ @include border-radius(2px, 2px, 2px, 2px);
642	+ line-height: 40px;
643	+ height: 40px;
644	+ text-align: center;
645	+
646	+ @include mobile {
647	+ display: block;
648	+ }
649	+
650	+ .mega-toggle-block {
651	+ text-align: left;
652	+ display: inline-block;
653	+ padding: 0 10px;
654	+ height: 100%;
655	+ }
656	+
657	+ .mega-toggle-block-left {
658	+ float: left;
659	+ }
660	+
661	+ .mega-toggle-block-center {
662	+ float: none;
663	+ }
664	+
665	+ .mega-toggle-block-right {
666	+ float: right;
667	+ }
668	+
669	+ @include mobile {
670	+ + #{$menu} {
671	+ display: none;
672	+
673	+ li.mega-menu-item > ul.mega-sub-menu {
674	+ display: none;
675	+ visibility: visible;
676	+ opacity: 1;
677	+ }
678	+
679	+ li.mega-menu-item.mega-toggle-on > ul.mega-sub-menu,
680	+ li.mega-menu-item.mega-menu-megamenu.mega-toggle-on ul.mega-sub-menu {
681	+ display: block;
682	+ }
683	+ }
684	+
685	+ &.mega-menu-open + #{$menu} {
686	+ display: block;
687	+ }
688	+ }
689	+ }
690	+ }

css/mixin.scss ADDED Viewed

	@@ -0,0 +1,42 @@


1	+ @mixin border-radius($topleft: 0, $topright: 0, $bottomright: 0, $bottomleft: 0) {
2	+ -webkit-border-radius: $topleft $topright $bottomright $bottomleft;
3	+ -moz-border-radius: $topleft $topright $bottomright $bottomleft;
4	+ -ms-border-radius: $topleft $topright $bottomright $bottomleft;
5	+ -o-border-radius: $topleft $topright $bottomright $bottomleft;
6	+ border-radius: $topleft $topright $bottomright $bottomleft;
7	+ }
8	+
9	+ @mixin box-shadow($value) {
10	+ -webkit-box-shadow: $value;
11	+ -moz-box-shadow: $value;
12	+ -ms-box-shadow: $value;
13	+ -o-box-shadow: $value;
14	+ box-shadow: $value;
15	+ }
16	+
17	+ @mixin background($from, $to) {
18	+ @if $to == $from {
19	+ background: $to;
20	+ } @else {
21	+ background: $to;
22	+ background: -webkit-gradient(linear, left top, left bottom, from($from), to($to));
23	+ background: -moz-linear-gradient(top, $from, $to);
24	+ background: -ms-linear-gradient(top, $from, $to);
25	+ background: -o-linear-gradient(top, $from, $to);
26	+ background: linear-gradient(to bottom, $from, $to);
27	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#{ie_hex_str($from)}', endColorstr='#{ie_hex_str($to)}');
28	+ }
29	+ }
30	+
31	+ @mixin mobile {
32	+ @media only screen and (max-width : $responsive_breakpoint) {
33	+ @content;
34	+ }
35	+ }
36	+
37	+ @mixin desktop {
38	+ @media only screen and (min-width : $responsive_breakpoint + 1) {
39	+ @content;
40	+ }
41	+ }
42	+

css/reset.scss ADDED Viewed

	@@ -0,0 +1,59 @@


1	+ @if $resets == 'on' {
2	+ #{$wrap} #{$menu} ul,
3	+ #{$wrap} #{$menu} li,
4	+ #{$wrap} #{$menu} p,
5	+ #{$wrap} #{$menu} img,
6	+ #{$wrap} #{$menu} div,
7	+ #{$wrap} #{$menu} a {
8	+ color: $panel_font_color;
9	+ font-family: $panel_font_family;
10	+ font-size: $panel_font_size;
11	+ background: none;
12	+ border: 0;
13	+ @include border-radius(0, 0, 0, 0);
14	+ margin: 0;
15	+ opacity: 1;
16	+ padding: 0;
17	+ position: relative;
18	+ right: auto;
19	+ top: auto;
20	+ bottom: auto;
21	+ left: auto;
22	+ text-align: left;
23	+ text-transform: none;
24	+ vertical-align: baseline;
25	+ @include box-shadow(none);
26	+ list-style-type: none;
27	+ line-height: $line_height;
28	+ box-sizing: border-box;
29	+ float: none;
30	+ overflow: visible;
31	+ display: block;
32	+ min-height: 0;
33	+ -webkit-transition: none;
34	+ -moz-transition: none;
35	+ -o-transition: none;
36	+ transition: none;
37	+ text-decoration: none;
38	+ width: auto;
39	+ clip: auto;
40	+ height: auto;
41	+ outline: none;
42	+ visibility: inherit;
43	+
44	+ &:before,
45	+ &:after {
46	+ display: none;
47	+ }
48	+ }
49	+
50	+ #{$wrap} #{$menu} table,
51	+ #{$wrap} #{$menu} td,
52	+ #{$wrap} #{$menu} tr,
53	+ #{$wrap} #{$menu} th {
54	+ border: 0;
55	+ margin: 0;
56	+ padding: 0;
57	+ background: none;
58	+ }
59	+ }

css/toggle-blocks.scss ADDED Viewed

	@@ -0,0 +1,64 @@


1	+ #{$wrap} .mega-menu-toggle {
2	+
3	+ / Menu Toggle Blocks /
4	+ @each $item in $menu_toggle_blocks {
5	+ $id: nth($item, 1);
6	+ $align: nth($item, 2);
7	+ $closed_text: nth($item, 3);
8	+ $open_text: nth($item, 4);
9	+ $closed_icon: nth($item, 5);
10	+ $open_icon: nth($item, 6);
11	+ $text_color: nth($item, 7);
12	+ $icon_color: nth($item, 8);
13	+ $icon_position: nth($item, 9);
14	+
15	+ @if type-of($id) == number {
16	+
17	+ #mega-toggle-block-#{$id}:before {
18	+ content: $closed_icon;
19	+ font-family: 'dashicons';
20	+ font-size: 24px;
21	+ margin: 0 0 0 5px;
22	+ color: $icon_color;
23	+ }
24	+
25	+ &.mega-menu-open #mega-toggle-block-#{$id}:before {
26	+ content: $open_icon;
27	+ }
28	+
29	+ #mega-toggle-block-#{$id}:after {
30	+ content: $closed_text;
31	+ color: $text_color;
32	+ float: left;
33	+
34	+ @if $icon_position == before {
35	+ float: right;
36	+ }
37	+ }
38	+
39	+ &.mega-menu-open #mega-toggle-block-#{$id}:after {
40	+ content: $open_text;
41	+ }
42	+ }
43	+
44	+ }
45	+
46	+ / Spacer Toggle Blocks /
47	+ @each $item in $spacer_toggle_blocks {
48	+
49	+ $id: nth($item, 1);
50	+ $type: nth($item, 2);
51	+ $align: nth($item, 3);
52	+ $width: nth($item, 4);
53	+
54	+ @if $type == spacer and type-of($id) == number {
55	+
56	+ #mega-toggle-block-#{$id} {
57	+ width: $width;
58	+ }
59	+
60	+ }
61	+
62	+ }
63	+
64	+ }

font/maxmegamenu.eot ADDED Viewed

Binary file

font/maxmegamenu.svg ADDED Viewed

	@@ -0,0 +1,12 @@


1	+ <?xml version="1.0" standalone="no"?>
2	+ <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
3	+ <svg xmlns="http://www.w3.org/2000/svg">
4	+ <metadata>Copyright (C) 2015 by original authors @ fontello.com</metadata>
5	+ <defs>
6	+ <font id="maxmegamenu" horiz-adv-x="1000" >
7	+ <font-face font-family="maxmegamenu" font-weight="400" font-stretch="normal" units-per-em="1000" ascent="850" descent="-150" />
8	+ <missing-glyph horiz-adv-x="1000" />
9	+ <glyph glyph-name="logo-best" unicode="" d="m392 850l1 0c1-1 1-1 2-2 31-23 63-44 95-65 89-61 178-121 267-181 9-6 18-12 27-18l0-1c-13-8-26-17-39-25-117-79-234-157-351-235-2 0-4-1-6 0-89 60-179 120-269 180-40 27-79 54-119 80l0 1c16 11 32 22 48 33 111 74 221 149 331 224 5 3 9 5 13 9l0 0z m-392-386c70-46 140-93 211-139 60-40 120-80 181-119 130 86 261 172 392 258l0-355c-6-4-12-7-17-11-34-22-67-44-101-67 0 10 0 19 0 29 0 69 0 139 0 208-88-58-176-116-264-174-3-2-6-4-10-6-1-1-1 0-2 0-91 60-182 120-273 180 0-79 0-158 0-237-39 26-78 52-117 78l0 355 0 0z m236-392c52-35 104-69 156-103 52 34 104 69 156 103 0-30 0-60 0-90 0-9 0-19 1-28-53-35-105-69-157-104-50 33-100 66-150 99-2 2-6 3-6 5 0 39 0 79 0 118l0 0z" horiz-adv-x="784" />
10	+ </font>
11	+ </defs>
12	+ </svg>

font/maxmegamenu.ttf ADDED Viewed

Binary file

font/maxmegamenu.woff ADDED Viewed

Binary file

js/admin.js ADDED Viewed

	@@ -0,0 +1,598 @@


1	+ /global console,ajaxurl,$,jQuery/
2	+
3	+ /**
4	+ * Mega Menu jQuery Plugin
5	+ */
6	+ (function ($) {
7	+ "use strict";
8	+
9	+ $.fn.megaMenu = function (options) {
10	+
11	+ var panel = $("<div />");
12	+
13	+ panel.settings = options;
14	+
15	+ panel.log = function (message) {
16	+ if (window.console && console.log) {
17	+ console.log(message.data);
18	+ }
19	+
20	+ if (message.success !== true) {
21	+ alert(message.data);
22	+ }
23	+ };
24	+
25	+
26	+ panel.init = function () {
27	+
28	+ panel.log({success: true, data: megamenu.debug_launched + " " + panel.settings.menu_item_id});
29	+
30	+ $.colorbox({
31	+ html: "",
32	+ initialWidth: '1000',
33	+ scrolling: true,
34	+ fixed: true,
35	+ top: '10%',
36	+ initialHeight: '472',
37	+ maxHeight: '500'
38	+ });
39	+
40	+ $.ajax({
41	+ type: 'POST',
42	+ url: ajaxurl,
43	+ data: {
44	+ action: "mm_get_lightbox_html",
45	+ _wpnonce: megamenu.nonce,
46	+ menu_item_id: panel.settings.menu_item_id,
47	+ menu_item_depth: panel.settings.menu_item_depth,
48	+ menu_id: panel.settings.menu_id
49	+ },
50	+ cache: false,
51	+ beforeSend: function() {
52	+ $('#cboxLoadedContent').empty();
53	+ $('#cboxClose').empty();
54	+ $('#cboxLoadingGraphic').show();
55	+ },
56	+ complete: function() {
57	+ $('#cboxLoadingGraphic').hide();
58	+ $('#cboxLoadingOverlay').remove();
59	+ },
60	+ success: function(response) {
61	+ var json = $.parseJSON(response.data);
62	+
63	+ var header_container = $("<div />").addClass("mm_header_container");
64	+
65	+ var title = $("<div />").addClass("mm_title").html(panel.settings.menu_item_title);
66	+
67	+ var saving = $("<div class='mm_saving '>" + megamenu.saving + "</div>");
68	+
69	+ header_container.append(title).append(saving);
70	+
71	+ var tabs_container = $("<div class='mm_tab_container' />");
72	+
73	+ var content_container = $("<div class='mm_content_container' />");
74	+
75	+ $.each(json, function(idx, obj) {
76	+
77	+ var content = $("<div />").addClass('mm_content').addClass(idx).html(this.content).hide();
78	+
79	+ // bind save button action
80	+ content.find('form').on("submit", function (e) {
81	+
82	+ start_saving();
83	+
84	+ e.preventDefault();
85	+
86	+ var data = $(this).serialize();
87	+
88	+ $.post(ajaxurl, data, function (submit_response) {
89	+
90	+ end_saving();
91	+
92	+ panel.log(submit_response);
93	+ });
94	+
95	+ });
96	+
97	+ if (idx == 'menu_icon') {
98	+
99	+ var form = content.find('form');
100	+
101	+ // bind save button action
102	+ form.on("change", function (e) {
103	+
104	+ start_saving();
105	+
106	+ e.preventDefault();
107	+
108	+ $("input", form).not(e.target).removeAttr('checked');
109	+
110	+ var data = $(this).serialize();
111	+
112	+ $.post(ajaxurl, data, function (submit_response) {
113	+
114	+ end_saving();
115	+
116	+ panel.log(submit_response);
117	+ });
118	+
119	+ });
120	+ }
121	+
122	+ if (idx == 'general_settings') {
123	+
124	+ }
125	+
126	+ if (idx == 'mega_menu') {
127	+
128	+ var submenu_type = content.find('#mm_enable_mega_menu');
129	+
130	+ submenu_type.on('change', function() {
131	+
132	+ if ( $(this).val() == 'megamenu' ) {
133	+ $("#widgets").removeClass('disabled');
134	+ } else {
135	+ $("#widgets").addClass('disabled');
136	+ }
137	+
138	+ start_saving();
139	+
140	+ var postdata = {
141	+ action: "mm_save_menu_item_settings",
142	+ settings: { type: $(this).val() },
143	+ menu_item_id: panel.settings.menu_item_id,
144	+ _wpnonce: megamenu.nonce
145	+ };
146	+
147	+
148	+
149	+ $.post(ajaxurl, postdata, function (select_response) {
150	+
151	+ end_saving();
152	+
153	+ panel.log(select_response);
154	+ });
155	+
156	+ });
157	+
158	+ var number_of_columns = content.find('#mm_number_of_columns');
159	+
160	+ number_of_columns.on('change', function() {
161	+
162	+ content.find("#widgets").attr('data-columns', $(this).val());
163	+
164	+ content.find(".widget-total-cols").html($(this).val());
165	+
166	+ start_saving();
167	+
168	+ var postdata = {
169	+ action: "mm_save_menu_item_settings",
170	+ settings: { panel_columns: $(this).val() },
171	+ menu_item_id: panel.settings.menu_item_id,
172	+ _wpnonce: megamenu.nonce
173	+ };
174	+
175	+ $.post(ajaxurl, postdata, function (select_response) {
176	+
177	+ end_saving();
178	+
179	+ panel.log(select_response);
180	+ });
181	+
182	+ });
183	+
184	+ var widget_area = content.find('#widgets');
185	+
186	+ widget_area.bind("reorder_widgets", function () {
187	+
188	+ start_saving();
189	+
190	+ var items = [];
191	+
192	+ $(".widget").each(function() {
193	+ items.push({
194	+ 'type' : $(this).attr('data-type'),
195	+ 'order' : $(this).index() + 1,
196	+ 'id' : $(this).attr('data-id'),
197	+ 'parent_menu_item' : panel.settings.menu_item_id
198	+ });
199	+ });
200	+
201	+ $.post(ajaxurl, {
202	+ action: "mm_reorder_items",
203	+ items: items,
204	+ _wpnonce: megamenu.nonce
205	+ }, function (move_response) {
206	+ end_saving();
207	+ panel.log(move_response);
208	+ });
209	+ });
210	+
211	+ widget_area.sortable({
212	+ forcePlaceholderSize: true,
213	+ items : '.widget:not(.sub_menu)',
214	+ placeholder: "drop-area",
215	+ start: function (event, ui) {
216	+ $(".widget").removeClass("open");
217	+ ui.item.data('start_pos', ui.item.index());
218	+ },
219	+ stop: function (event, ui) {
220	+ // clean up
221	+ ui.item.removeAttr('style');
222	+
223	+ var start_pos = ui.item.data('start_pos');
224	+
225	+ if (start_pos !== ui.item.index()) {
226	+ widget_area.trigger("reorder_widgets");
227	+ }
228	+ }
229	+ });
230	+
231	+
232	+ var widget_selector = content.find('#mm_widget_selector');
233	+
234	+ widget_selector.on('change', function() {
235	+
236	+ var selector = $(this);
237	+
238	+ if (selector.val() != 'disabled') {
239	+
240	+ start_saving();
241	+
242	+ var postdata = {
243	+ action: "mm_add_widget",
244	+ id_base: selector.val(),
245	+ menu_item_id: panel.settings.menu_item_id,
246	+ title: selector.find('option:selected').text(),
247	+ _wpnonce: megamenu.nonce
248	+ };
249	+
250	+ $.post(ajaxurl, postdata, function (response) {
251	+
252	+ $(".no_widgets").hide();
253	+
254	+ var widget = $(response.data);
255	+
256	+ var number_of_columns = content.find('#mm_number_of_columns').val();
257	+
258	+ widget.find(".widget-total-cols").html(number_of_columns);
259	+
260	+ add_events_to_widget(widget);
261	+
262	+ $("#widgets").append(widget);
263	+
264	+ widget_area.trigger("reorder_widgets");
265	+
266	+ end_saving();
267	+
268	+ // reset the dropdown
269	+ selector.val('disabled');
270	+
271	+ });
272	+
273	+ }
274	+
275	+ });
276	+
277	+
278	+ $('.widget', widget_area).each(function() {
279	+ add_events_to_widget($(this));
280	+ });
281	+
282	+ }
283	+
284	+ var tab = $("<div />").addClass('mm_tab').addClass(idx).html(this.title).css('cursor', 'pointer').on('click', function() {
285	+ $(".mm_content").hide();
286	+ $(".mm_tab").removeClass('active');
287	+ $(this).addClass('active');
288	+ content.show();
289	+ });
290	+
291	+ if ( ( panel.settings.menu_item_depth == 0 && idx == 'mega_menu' ) \|\|
292	+ ( panel.settings.menu_item_depth > 0 && idx == 'general_settings' ) ) {
293	+ content.show();
294	+ tab.addClass('active');
295	+ }
296	+
297	+ tabs_container.append(tab);
298	+ content_container.append(content);
299	+ });
300	+
301	+ $('#cboxLoadedContent').addClass('depth-' + panel.settings.menu_item_depth).append(header_container).append(tabs_container).append(content_container);
302	+ $('#cboxLoadedContent').css({'width': '100%', 'height': '100%', 'display':'block'});
303	+ $('#cboxLoadedContent').trigger('megamenu_content_loaded');
304	+
305	+ }
306	+ });
307	+
308	+ };
309	+
310	+ var start_saving = function() {
311	+ $('.mm_saving').show();
312	+ }
313	+
314	+ var end_saving = function() {
315	+ $('.mm_saving').fadeOut('fast');
316	+ }
317	+
318	+ var add_events_to_widget = function (widget) {
319	+
320	+ var widget_title = widget.find(".widget-title h4");
321	+ var expand = widget.find(".widget-expand");
322	+ var contract = widget.find(".widget-contract");
323	+ var edit = widget.find(".widget-action");
324	+ var widget_inner = widget.find(".widget-inner");
325	+ var id = widget.attr("data-id");
326	+ var type = widget.attr('data-type');
327	+
328	+ expand.on("click", function () {
329	+
330	+ var cols = parseInt(widget.attr("data-columns"), 10);
331	+ var maxcols = parseInt($("#mm_number_of_columns").val(), 10);
332	+
333	+ if (cols < maxcols) {
334	+ cols = cols + 1;
335	+
336	+ widget.attr("data-columns", cols);
337	+
338	+ $('.widget-num-cols', widget).html(cols);
339	+
340	+ start_saving();
341	+
342	+ if (type == 'widget') {
343	+
344	+ $.post(ajaxurl, {
345	+ action: "mm_update_widget_columns",
346	+ id: id,
347	+ columns: cols,
348	+ _wpnonce: megamenu.nonce
349	+ }, function (expand_response) {
350	+ end_saving();
351	+ panel.log(expand_response);
352	+ });
353	+
354	+ }
355	+
356	+ if (type == 'menu_item' ) {
357	+
358	+ $.post(ajaxurl, {
359	+ action: "mm_update_menu_item_columns",
360	+ id: id,
361	+ columns: cols,
362	+ _wpnonce: megamenu.nonce
363	+ }, function (contract_response) {
364	+ end_saving();
365	+ panel.log(contract_response);
366	+ });
367	+
368	+ }
369	+
370	+ }
371	+
372	+ });
373	+
374	+ contract.on("click", function () {
375	+
376	+ var cols = parseInt(widget.attr("data-columns"), 10);
377	+
378	+ // account for widgets that have say 8 columns but the panel is only 6 wide
379	+ var maxcols = parseInt($("#mm_number_of_columns").val(), 10);
380	+
381	+ if (cols > maxcols) {
382	+ cols = maxcols;
383	+ }
384	+
385	+ if (cols > 1) {
386	+ cols = cols - 1;
387	+ widget.attr("data-columns", cols);
388	+
389	+ $('.widget-num-cols', widget).html(cols);
390	+ } else {
391	+ return;
392	+ }
393	+
394	+ start_saving();
395	+
396	+ if (type == 'widget') {
397	+
398	+ $.post(ajaxurl, {
399	+ action: "mm_update_widget_columns",
400	+ id: id,
401	+ columns: cols,
402	+ _wpnonce: megamenu.nonce
403	+ }, function (contract_response) {
404	+ end_saving();
405	+ panel.log(contract_response);
406	+ });
407	+
408	+ }
409	+
410	+ if (type == 'menu_item') {
411	+
412	+ $.post(ajaxurl, {
413	+ action: "mm_update_menu_item_columns",
414	+ id: id,
415	+ columns: cols,
416	+ _wpnonce: megamenu.nonce
417	+ }, function (contract_response) {
418	+ end_saving();
419	+ panel.log(contract_response);
420	+ });
421	+
422	+ }
423	+
424	+ });
425	+
426	+
427	+ edit.on("click", function () {
428	+
429	+ if (! widget.hasClass("open") && ! widget.data("loaded")) {
430	+
431	+ widget_title.addClass('loading');
432	+
433	+ // retrieve the widget settings form
434	+ $.post(ajaxurl, {
435	+ action: "mm_edit_widget",
436	+ widget_id: id,
437	+ _wpnonce: megamenu.nonce
438	+ }, function (response) {
439	+
440	+ var $response = $(response);
441	+ var $form = $response.find('form');
442	+
443	+ // bind delete button action
444	+ $(".delete", $form).on("click", function (e) {
445	+ e.preventDefault();
446	+
447	+ var data = {
448	+ action: "mm_delete_widget",
449	+ widget_id: id,
450	+ _wpnonce: megamenu.nonce
451	+ };
452	+
453	+ $.post(ajaxurl, data, function (delete_response) {
454	+ widget.remove();
455	+ panel.log(delete_response);
456	+ });
457	+
458	+ });
459	+
460	+ // bind close button action
461	+ $(".close", $form).on("click", function (e) {
462	+ e.preventDefault();
463	+
464	+ widget.toggleClass("open");
465	+ });
466	+
467	+ // bind save button action
468	+ $form.on("submit", function (e) {
469	+ e.preventDefault();
470	+
471	+ var data = $(this).serialize();
472	+
473	+ start_saving();
474	+
475	+ $.post(ajaxurl, data, function (submit_response) {
476	+ end_saving();
477	+ panel.log(submit_response);
478	+ });
479	+
480	+ });
481	+
482	+ widget_inner.html($response);
483	+
484	+ widget.data("loaded", true).toggleClass("open");
485	+
486	+ widget_title.removeClass('loading');
487	+
488	+ // Init Black Studio TinyMCE
489	+ if ( widget.is( '[id*=black-studio-tinymce]' ) ) {
490	+ bstw( widget ).deactivate().activate();
491	+ }
492	+
493	+ });
494	+
495	+ } else {
496	+ widget.toggleClass("open");
497	+ }
498	+
499	+ // close all other widgets
500	+ $(".widget").not(widget).removeClass("open");
501	+
502	+ });
503	+
504	+ return widget;
505	+ };
506	+
507	+ panel.init();
508	+
509	+ };
510	+
511	+ }(jQuery));
512	+
513	+ /**
514	+ *
515	+ */
516	+ jQuery(function ($) {
517	+ "use strict";
518	+
519	+ $(".megamenu_launch").live("click", function (e) {
520	+ e.preventDefault();
521	+
522	+ $(this).megaMenu();
523	+ });
524	+
525	+ $('#megamenu_accordion').accordion({
526	+ heightStyle: "content",
527	+ collapsible: true,
528	+ active: false,
529	+ animate: 200
530	+ });
531	+
532	+ var apply_megamenu_enabled_class = function() {
533	+ if ( $('input.megamenu_enabled:checked') && $('input.megamenu_enabled:checked').length ) {
534	+ $('body').addClass('megamenu_enabled');
535	+ } else {
536	+ $('body').removeClass('megamenu_enabled');
537	+ }
538	+ }
539	+
540	+ $('input.megamenu_enabled').on('change', function() {
541	+ apply_megamenu_enabled_class();
542	+ });
543	+
544	+ apply_megamenu_enabled_class();
545	+
546	+ $('.mega_menu_meta_box.mmm_get_started').attr('data-get-started', megamenu.get_started);
547	+
548	+ $('#menu-to-edit li.menu-item').each(function() {
549	+
550	+ var menu_item = $(this);
551	+ var menu_id = $('input#menu').val();
552	+ var title = menu_item.find('.menu-item-title').text();
553	+
554	+ // fix for Jupiter theme
555	+ if ( ! title ) {
556	+ title = menu_item.find('.item-title').text();
557	+ }
558	+
559	+ var id = parseInt(menu_item.attr('id').match(/[0-9]+/)[0], 10);
560	+
561	+ var button = $("<span>").addClass("mm_launch")
562	+ .html(megamenu.launch_lightbox)
563	+ .on('click', function(e) {
564	+ e.preventDefault();
565	+
566	+ if ( ! $('body').hasClass('megamenu_enabled') ) {
567	+ alert(megamenu.is_disabled_error);
568	+ return;
569	+ }
570	+
571	+ var depth = menu_item.attr('class').match(/\menu-item-depth-(\d+)\b/)[1];
572	+
573	+ $(this).megaMenu({
574	+ menu_item_id: id,
575	+ menu_item_title: title,
576	+ menu_item_depth: depth,
577	+ menu_id: menu_id
578	+ });
579	+ });
580	+
581	+ $('.item-title', menu_item).append(button);
582	+ });
583	+
584	+ $(".mm_tabs li").live('click', function() {
585	+ var tab = $(this);
586	+ var tab_id = $(this).attr('rel');
587	+
588	+ tab.addClass('active');
589	+ tab.siblings().removeClass('active');
590	+ tab.parent().siblings().not('h4').hide();
591	+ tab.parent().siblings("." + tab_id).show();
592	+ });
593	+
594	+ // Polylang Fix - stop Language Switcher item being added every time the MMM settings are saved
595	+ $(".max-mega-menu-save").on('click', function() {
596	+ $(".nav-menu-meta").find('input[value="#pll_switcher"]').val("");
597	+ });
598	+ });

js/codemirror/codemirror.css ADDED Viewed

	@@ -0,0 +1,301 @@


1	+ /* BASICS */
2	+
3	+ .CodeMirror {
4	+ /* Set height, width, borders, and global font properties here */
5	+ font-family: monospace;
6	+ height: 300px;
7	+ }
8	+ .CodeMirror-scroll {
9	+ /* Set scrolling behaviour here */
10	+ overflow: auto;
11	+ }
12	+
13	+ /* PADDING */
14	+
15	+ .CodeMirror-lines {
16	+ padding: 4px 0; /* Vertical padding around content */
17	+ }
18	+ .CodeMirror pre {
19	+ padding: 0 4px; /* Horizontal padding of content */
20	+ }
21	+
22	+ .CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {
23	+ background-color: white; /* The little square between H and V scrollbars */
24	+ }
25	+
26	+ /* GUTTER */
27	+
28	+ .CodeMirror-gutters {
29	+ border-right: 1px solid #ddd;
30	+ background-color: #f7f7f7;
31	+ white-space: nowrap;
32	+ }
33	+ .CodeMirror-linenumbers {}
34	+ .CodeMirror-linenumber {
35	+ padding: 0 3px 0 5px;
36	+ min-width: 20px;
37	+ text-align: right;
38	+ color: #999;
39	+ -moz-box-sizing: content-box;
40	+ box-sizing: content-box;
41	+ }
42	+
43	+ .CodeMirror-guttermarker { color: black; }
44	+ .CodeMirror-guttermarker-subtle { color: #999; }
45	+
46	+ /* CURSOR */
47	+
48	+ .CodeMirror div.CodeMirror-cursor {
49	+ border-left: 1px solid black;
50	+ }
51	+ /* Shown when moving in bi-directional text */
52	+ .CodeMirror div.CodeMirror-secondarycursor {
53	+ border-left: 1px solid silver;
54	+ }
55	+ .CodeMirror.cm-keymap-fat-cursor div.CodeMirror-cursor {
56	+ width: auto;
57	+ border: 0;
58	+ background: #7e7;
59	+ }
60	+ .cm-animate-fat-cursor {
61	+ width: auto;
62	+ border: 0;
63	+ -webkit-animation: blink 1.06s steps(1) infinite;
64	+ -moz-animation: blink 1.06s steps(1) infinite;
65	+ animation: blink 1.06s steps(1) infinite;
66	+ }
67	+ @-moz-keyframes blink {
68	+ 0% { background: #7e7; }
69	+ 50% { background: none; }
70	+ 100% { background: #7e7; }
71	+ }
72	+ @-webkit-keyframes blink {
73	+ 0% { background: #7e7; }
74	+ 50% { background: none; }
75	+ 100% { background: #7e7; }
76	+ }
77	+ @keyframes blink {
78	+ 0% { background: #7e7; }
79	+ 50% { background: none; }
80	+ 100% { background: #7e7; }
81	+ }
82	+
83	+ /* Can style cursor different in overwrite (non-insert) mode */
84	+ div.CodeMirror-overwrite div.CodeMirror-cursor {}
85	+
86	+ .cm-tab { display: inline-block; }
87	+
88	+ .CodeMirror-ruler {
89	+ border-left: 1px solid #ccc;
90	+ position: absolute;
91	+ }
92	+
93	+ /* DEFAULT THEME */
94	+
95	+ .cm-s-default .cm-keyword {color: #708;}
96	+ .cm-s-default .cm-atom {color: #219;}
97	+ .cm-s-default .cm-number {color: #164;}
98	+ .cm-s-default .cm-def {color: #00f;}
99	+ .cm-s-default .cm-variable,
100	+ .cm-s-default .cm-punctuation,
101	+ .cm-s-default .cm-property,
102	+ .cm-s-default .cm-operator {}
103	+ .cm-s-default .cm-variable-2 {color: #05a;}
104	+ .cm-s-default .cm-variable-3 {color: #085;}
105	+ .cm-s-default .cm-comment {color: #a50;}
106	+ .cm-s-default .cm-string {color: #a11;}
107	+ .cm-s-default .cm-string-2 {color: #f50;}
108	+ .cm-s-default .cm-meta {color: #555;}
109	+ .cm-s-default .cm-qualifier {color: #555;}
110	+ .cm-s-default .cm-builtin {color: #30a;}
111	+ .cm-s-default .cm-bracket {color: #997;}
112	+ .cm-s-default .cm-tag {color: #170;}
113	+ .cm-s-default .cm-attribute {color: #00c;}
114	+ .cm-s-default .cm-header {color: blue;}
115	+ .cm-s-default .cm-quote {color: #090;}
116	+ .cm-s-default .cm-hr {color: #999;}
117	+ .cm-s-default .cm-link {color: #00c;}
118	+
119	+ .cm-negative {color: #d44;}
120	+ .cm-positive {color: #292;}
121	+ .cm-header, .cm-strong {font-weight: bold;}
122	+ .cm-em {font-style: italic;}
123	+ .cm-link {text-decoration: underline;}
124	+
125	+ .cm-s-default .cm-error {color: #f00;}
126	+ .cm-invalidchar {color: #f00;}
127	+
128	+ /* Default styles for common addons */
129	+
130	+ div.CodeMirror span.CodeMirror-matchingbracket {color: #0f0;}
131	+ div.CodeMirror span.CodeMirror-nonmatchingbracket {color: #f22;}
132	+ .CodeMirror-matchingtag { background: rgba(255, 150, 0, .3); }
133	+ .CodeMirror-activeline-background {background: #e8f2ff;}
134	+
135	+ /* STOP */
136	+
137	+ /* The rest of this file contains styles related to the mechanics of
138	+ the editor. You probably shouldn't touch them. */
139	+
140	+ .CodeMirror {
141	+ line-height: 1;
142	+ position: relative;
143	+ overflow: hidden;
144	+ background: white;
145	+ color: black;
146	+ }
147	+
148	+ .CodeMirror-scroll {
149	+ /* 30px is the magic margin used to hide the element's real scrollbars */
150	+ /* See overflow: hidden in .CodeMirror */
151	+ margin-bottom: -30px; margin-right: -30px;
152	+ padding-bottom: 30px;
153	+ height: 100%;
154	+ outline: none; /* Prevent dragging from highlighting the element */
155	+ position: relative;
156	+ -moz-box-sizing: content-box;
157	+ box-sizing: content-box;
158	+ }
159	+ .CodeMirror-sizer {
160	+ position: relative;
161	+ border-right: 30px solid transparent;
162	+ -moz-box-sizing: content-box;
163	+ box-sizing: content-box;
164	+ }
165	+
166	+ /* The fake, visible scrollbars. Used to force redraw during scrolling
167	+ before actuall scrolling happens, thus preventing shaking and
168	+ flickering artifacts. */
169	+ .CodeMirror-vscrollbar, .CodeMirror-hscrollbar, .CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {
170	+ position: absolute;
171	+ z-index: 6;
172	+ display: none;
173	+ }
174	+ .CodeMirror-vscrollbar {
175	+ right: 0; top: 0;
176	+ overflow-x: hidden;
177	+ overflow-y: scroll;
178	+ }
179	+ .CodeMirror-hscrollbar {
180	+ bottom: 0; left: 0;
181	+ overflow-y: hidden;
182	+ overflow-x: scroll;
183	+ }
184	+ .CodeMirror-scrollbar-filler {
185	+ right: 0; bottom: 0;
186	+ }
187	+ .CodeMirror-gutter-filler {
188	+ left: 0; bottom: 0;
189	+ }
190	+
191	+ .CodeMirror-gutters {
192	+ position: absolute; left: 0; top: 0;
193	+ padding-bottom: 30px;
194	+ z-index: 3;
195	+ }
196	+ .CodeMirror-gutter {
197	+ white-space: normal;
198	+ height: 100%;
199	+ -moz-box-sizing: content-box;
200	+ box-sizing: content-box;
201	+ padding-bottom: 30px;
202	+ margin-bottom: -32px;
203	+ display: inline-block;
204	+ /* Hack to make IE7 behave */
205	+ *zoom:1;
206	+ *display:inline;
207	+ }
208	+ .CodeMirror-gutter-elt {
209	+ position: absolute;
210	+ cursor: default;
211	+ z-index: 4;
212	+ }
213	+
214	+ .CodeMirror-lines {
215	+ cursor: text;
216	+ }
217	+ .CodeMirror pre {
218	+ /* Reset some styles that the rest of the page might have set */
219	+ -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0;
220	+ border-width: 0;
221	+ background: transparent;
222	+ font-family: inherit;
223	+ font-size: inherit;
224	+ margin: 0;
225	+ white-space: pre;
226	+ word-wrap: normal;
227	+ line-height: inherit;
228	+ color: inherit;
229	+ z-index: 2;
230	+ position: relative;
231	+ overflow: visible;
232	+ }
233	+ .CodeMirror-wrap pre {
234	+ word-wrap: break-word;
235	+ white-space: pre-wrap;
236	+ word-break: normal;
237	+ }
238	+
239	+ .CodeMirror-linebackground {
240	+ position: absolute;
241	+ left: 0; right: 0; top: 0; bottom: 0;
242	+ z-index: 0;
243	+ }
244	+
245	+ .CodeMirror-linewidget {
246	+ position: relative;
247	+ z-index: 2;
248	+ overflow: auto;
249	+ }
250	+
251	+ .CodeMirror-widget {}
252	+
253	+ .CodeMirror-wrap .CodeMirror-scroll {
254	+ overflow-x: hidden;
255	+ }
256	+
257	+ .CodeMirror-measure {
258	+ position: absolute;
259	+ width: 100%;
260	+ height: 0;
261	+ overflow: hidden;
262	+ visibility: hidden;
263	+ }
264	+ .CodeMirror-measure pre { position: static; }
265	+
266	+ .CodeMirror div.CodeMirror-cursor {
267	+ position: absolute;
268	+ border-right: none;
269	+ width: 0;
270	+ }
271	+
272	+ div.CodeMirror-cursors {
273	+ visibility: hidden;
274	+ position: relative;
275	+ z-index: 1;
276	+ }
277	+ .CodeMirror-focused div.CodeMirror-cursors {
278	+ visibility: visible;
279	+ }
280	+
281	+ .CodeMirror-selected { background: #d9d9d9; }
282	+ .CodeMirror-focused .CodeMirror-selected { background: #d7d4f0; }
283	+ .CodeMirror-crosshair { cursor: crosshair; }
284	+
285	+ .cm-searching {
286	+ background: #ffa;
287	+ background: rgba(255, 255, 0, .4);
288	+ }
289	+
290	+ /* IE7 hack to prevent it from returning funny offsetTops on the spans */
291	+ .CodeMirror span { *vertical-align: text-bottom; }
292	+
293	+ /* Used to force a border model for a node */
294	+ .cm-force-border { padding-right: .1px; }
295	+
296	+ @media print {
297	+ /* Hide the cursor when printing */
298	+ .CodeMirror div.CodeMirror-cursors {
299	+ visibility: hidden;
300	+ }
301	+ }

js/codemirror/codemirror.js ADDED Viewed

	@@ -0,0 +1,13 @@


1	+ /* CodeMirror - Minified & Bundled
2	+ Generated on 7/30/2014 with http://codemirror.net/doc/compress.html
3	+ Version: HEAD
4	+
5	+ CodeMirror Library:
6	+ - codemirror.js
7	+ */
8	+
9	+ !function(a){if("object"==typeof exports&&"object"==typeof module)module.exports=a();else{if("function"==typeof define&&define.amd)return define([],a);this.CodeMirror=a()}}(function(){"use strict";function w(a,b){if(!(this instanceof w))return new w(a,b);this.options=b=b\|\|{},Pg(je,b,!1),K(b);var c=b.value;"string"==typeof c&&(c=new Kf(c,b.mode)),this.doc=c;var f=this.display=new x(a,c);f.wrapper.CodeMirror=this,G(this),E(this),b.lineWrapping&&(this.display.wrapper.className+=" CodeMirror-wrap"),b.autofocus&&!o&&ad(this),this.state={keyMaps:[],overlays:[],modeGen:0,overwrite:!1,focused:!1,suppressEdits:!1,pasteIncoming:!1,cutIncoming:!1,draggingText:!1,highlight:new Fg},d&&11>e&&setTimeout(Qg(_c,this,!0),20),dd(this),hh();var g=this;Kc(this,function(){g.curOp.forceUpdate=!0,Of(g,c),b.autofocus&&!o\|\|ah()==f.input?setTimeout(Qg(Hd,g),20):Id(g);for(var a in ke)ke.hasOwnProperty(a)&&ke[a](g,b[a],me);Q(g);for(var d=0;d<qe.length;++d)qe[d](g)})}function x(a,b){var c=this,g=c.input=Xg("textarea",null,null,"position: absolute; padding: 0; width: 1px; height: 1em; outline: none");f?g.style.width="1000px":g.setAttribute("wrap","off"),n&&(g.style.border="1px solid black"),g.setAttribute("autocorrect","off"),g.setAttribute("autocapitalize","off"),g.setAttribute("spellcheck","false"),c.inputDiv=Xg("div",[g],null,"overflow: hidden; position: relative; width: 3px; height: 0px;"),c.scrollbarH=Xg("div",[Xg("div",null,null,"height: 100%; min-height: 1px")],"CodeMirror-hscrollbar"),c.scrollbarV=Xg("div",[Xg("div",null,null,"min-width: 1px")],"CodeMirror-vscrollbar"),c.scrollbarFiller=Xg("div",null,"CodeMirror-scrollbar-filler"),c.gutterFiller=Xg("div",null,"CodeMirror-gutter-filler"),c.lineDiv=Xg("div",null,"CodeMirror-code"),c.selectionDiv=Xg("div",null,null,"position: relative; z-index: 1"),c.cursorDiv=Xg("div",null,"CodeMirror-cursors"),c.measure=Xg("div",null,"CodeMirror-measure"),c.lineMeasure=Xg("div",null,"CodeMirror-measure"),c.lineSpace=Xg("div",[c.measure,c.lineMeasure,c.selectionDiv,c.cursorDiv,c.lineDiv],null,"position: relative; outline: none"),c.mover=Xg("div",[Xg("div",[c.lineSpace],"CodeMirror-lines")],null,"position: relative"),c.sizer=Xg("div",[c.mover],"CodeMirror-sizer"),c.heightForcer=Xg("div",null,null,"position: absolute; height: "+Ag+"px; width: 1px;"),c.gutters=Xg("div",null,"CodeMirror-gutters"),c.lineGutter=null,c.scroller=Xg("div",[c.sizer,c.heightForcer,c.gutters],"CodeMirror-scroll"),c.scroller.setAttribute("tabIndex","-1"),c.wrapper=Xg("div",[c.inputDiv,c.scrollbarH,c.scrollbarV,c.scrollbarFiller,c.gutterFiller,c.scroller],"CodeMirror"),d&&8>e&&(c.gutters.style.zIndex=-1,c.scroller.style.paddingRight=0),n&&(g.style.width="0px"),f\|\|(c.scroller.draggable=!0),k&&(c.inputDiv.style.height="1px",c.inputDiv.style.position="absolute"),d&&8>e&&(c.scrollbarH.style.minHeight=c.scrollbarV.style.minWidth="18px"),a.appendChild?a.appendChild(c.wrapper):a(c.wrapper),c.viewFrom=c.viewTo=b.first,c.view=[],c.externalMeasured=null,c.viewOffset=0,c.lastSizeC=0,c.updateLineNumbers=null,c.lineNumWidth=c.lineNumInnerWidth=c.lineNumChars=null,c.prevInput="",c.alignWidgets=!1,c.pollingFast=!1,c.poll=new Fg,c.cachedCharWidth=c.cachedTextHeight=c.cachedPaddingH=null,c.inaccurateSelection=!1,c.maxLine=null,c.maxLineLength=0,c.maxLineChanged=!1,c.wheelDX=c.wheelDY=c.wheelStartX=c.wheelStartY=null,c.shift=!1,c.selForContextMenu=null}function y(a){a.doc.mode=w.getMode(a.options,a.doc.modeOption),z(a)}function z(a){a.doc.iter(function(a){a.stateAfter&&(a.stateAfter=null),a.styles&&(a.styles=null)}),a.doc.frontier=a.doc.first,Ub(a,100),a.state.modeGen++,a.curOp&&Qc(a)}function A(a){a.options.lineWrapping?(dh(a.display.wrapper,"CodeMirror-wrap"),a.display.sizer.style.minWidth=""):(ch(a.display.wrapper,"CodeMirror-wrap"),J(a)),C(a),Qc(a),lc(a),setTimeout(function(){N(a)},100)}function B(a){var b=xc(a.display),c=a.options.lineWrapping,d=c&&Math.max(5,a.display.scroller.clientWidth/yc(a.display)-3);return function(e){if(ef(a.doc,e))return 0;var f=0;if(e.widgets)for(var g=0;g<e.widgets.length;g++)e.widgets[g].height&&(f+=e.widgets[g].height);return c?f+(Math.ceil(e.text.length/d)\|\|1)b:f+b}}function C(a){var b=a.doc,c=B(a);b.iter(function(a){var b=c(a);b!=a.height&&Sf(a,b)})}function D(a){var b=ve[a.options.keyMap],c=b.style;a.display.wrapper.className=a.display.wrapper.className.replace(/\scm-keymap-\S+/g,"")+(c?" cm-keymap-"+c:"")}function E(a){a.display.wrapper.className=a.display.wrapper.className.replace(/\scm-s-\S+/g,"")+a.options.theme.replace(/(^\|\s)\s/g," cm-s-"),lc(a)}function F(a){G(a),Qc(a),setTimeout(function(){P(a)},20)}function G(a){var b=a.display.gutters,c=a.options.gutters;Zg(b);for(var d=0;d<c.length;++d){var e=c[d],f=b.appendChild(Xg("div",null,"CodeMirror-gutter "+e));"CodeMirror-linenumbers"==e&&(a.display.lineGutter=f,f.style.width=(a.display.lineNumWidth\|\|1)+"px")}b.style.display=d?"":"none",H(a)}function H(a){var b=a.display.gutters.offsetWidth;a.display.sizer.style.marginLeft=b+"px",a.display.scrollbarH.style.left=a.options.fixedGutter?b+"px":0}function I(a){if(0==a.height)return 0;for(var c,b=a.text.length,d=a;c=Ze(d);){var e=c.find(0,!0);d=e.from.line,b+=e.from.ch-e.to.ch}for(d=a;c=$e(d);){var e=c.find(0,!0);b-=d.text.length-e.from.ch,d=e.to.line,b+=d.text.length-e.to.ch}return b}function J(a){var b=a.display,c=a.doc;b.maxLine=Pf(c,c.first),b.maxLineLength=I(b.maxLine),b.maxLineChanged=!0,c.iter(function(a){var c=I(a);c>b.maxLineLength&&(b.maxLineLength=c,b.maxLine=a)})}function K(a){var b=Mg(a.gutters,"CodeMirror-linenumbers");-1==b&&a.lineNumbers?a.gutters=a.gutters.concat(["CodeMirror-linenumbers"]):b>-1&&!a.lineNumbers&&(a.gutters=a.gutters.slice(0),a.gutters.splice(b,1))}function L(a){return a.display.scroller.clientHeight-a.display.wrapper.clientHeight<Ag-3}function M(a){var b=a.display.scroller;return{clientHeight:b.clientHeight,barHeight:a.display.scrollbarV.clientHeight,scrollWidth:b.scrollWidth,clientWidth:b.clientWidth,hScrollbarTakesSpace:L(a),barWidth:a.display.scrollbarH.clientWidth,docHeight:Math.round(a.doc.height+Zb(a.display))}}function N(a,b){b\|\|(b=M(a));var c=a.display,d=lh(c.measure),e=b.docHeight+Ag,f=b.scrollWidth>b.clientWidth;f&&b.scrollWidth<=b.clientWidth+1&&d>0&&!b.hScrollbarTakesSpace&&(f=!1);var g=e>b.clientHeight;if(g?(c.scrollbarV.style.display="block",c.scrollbarV.style.bottom=f?d+"px":"0",c.scrollbarV.firstChild.style.height=Math.max(0,e-b.clientHeight+(b.barHeight\|\|c.scrollbarV.clientHeight))+"px"):(c.scrollbarV.style.display="",c.scrollbarV.firstChild.style.height="0"),f?(c.scrollbarH.style.display="block",c.scrollbarH.style.right=g?d+"px":"0",c.scrollbarH.firstChild.style.width=b.scrollWidth-b.clientWidth+(b.barWidth\|\|c.scrollbarH.clientWidth)+"px"):(c.scrollbarH.style.display="",c.scrollbarH.firstChild.style.width="0"),f&&g?(c.scrollbarFiller.style.display="block",c.scrollbarFiller.style.height=c.scrollbarFiller.style.width=d+"px"):c.scrollbarFiller.style.display="",f&&a.options.coverGutterNextToScrollbar&&a.options.fixedGutter?(c.gutterFiller.style.display="block",c.gutterFiller.style.height=d+"px",c.gutterFiller.style.width=c.gutters.offsetWidth+"px"):c.gutterFiller.style.display="",!a.state.checkedOverlayScrollbar&&b.clientHeight>0){if(0===d){var h=p&&!l?"12px":"18px";c.scrollbarV.style.minWidth=c.scrollbarH.style.minHeight=h;var i=function(b){og(b)!=c.scrollbarV&&og(b)!=c.scrollbarH&&Lc(a,hd)(b)};qg(c.scrollbarV,"mousedown",i),qg(c.scrollbarH,"mousedown",i)}a.state.checkedOverlayScrollbar=!0}}function O(a,b,c){var d=c&&null!=c.top?Math.max(0,c.top):a.scroller.scrollTop;d=Math.floor(d-Yb(a));var e=c&&null!=c.bottom?c.bottom:d+a.wrapper.clientHeight,f=Uf(b,d),g=Uf(b,e);if(c&&c.ensure){var h=c.ensure.from.line,i=c.ensure.to.line;if(f>h)return{from:h,to:Uf(b,Vf(Pf(b,h))+a.wrapper.clientHeight)};if(Math.min(i,b.lastLine())>=g)return{from:Uf(b,Vf(Pf(b,i))-a.wrapper.clientHeight),to:i}}return{from:f,to:Math.max(g,f+1)}}function P(a){var b=a.display,c=b.view;if(b.alignWidgets\|\|b.gutters.firstChild&&a.options.fixedGutter){for(var d=S(b)-b.scroller.scrollLeft+a.doc.scrollLeft,e=b.gutters.offsetWidth,f=d+"px",g=0;g<c.length;g++)if(!c[g].hidden){a.options.fixedGutter&&c[g].gutter&&(c[g].gutter.style.left=f);var h=c[g].alignable;if(h)for(var i=0;i<h.length;i++)h[i].style.left=f}a.options.fixedGutter&&(b.gutters.style.left=d+e+"px")}}function Q(a){if(!a.options.lineNumbers)return!1;var b=a.doc,c=R(a.options,b.first+b.size-1),d=a.display;if(c.length!=d.lineNumChars){var e=d.measure.appendChild(Xg("div",[Xg("div",c)],"CodeMirror-linenumber CodeMirror-gutter-elt")),f=e.firstChild.offsetWidth,g=e.offsetWidth-f;return d.lineGutter.style.width="",d.lineNumInnerWidth=Math.max(f,d.lineGutter.offsetWidth-g),d.lineNumWidth=d.lineNumInnerWidth+g,d.lineNumChars=d.lineNumInnerWidth?c.length:-1,d.lineGutter.style.width=d.lineNumWidth+"px",H(a),!0}return!1}function R(a,b){return String(a.lineNumberFormatter(b+a.firstLineNumber))}function S(a){return a.scroller.getBoundingClientRect().left-a.sizer.getBoundingClientRect().left}function T(a,b,c){var d=a.display;this.viewport=b,this.visible=O(d,a.doc,b),this.editorIsHidden=!d.wrapper.offsetWidth,this.wrapperHeight=d.wrapper.clientHeight,this.oldViewFrom=d.viewFrom,this.oldViewTo=d.viewTo,this.oldScrollerWidth=d.scroller.clientWidth,this.force=c,this.dims=_(a)}function U(a,b){var c=a.display,d=a.doc;if(b.editorIsHidden)return Sc(a),!1;if(!b.force&&b.visible.from>=c.viewFrom&&b.visible.to<=c.viewTo&&(null==c.updateLineNumbers\|\|c.updateLineNumbers>=c.viewTo)&&0==Wc(a))return!1;Q(a)&&(Sc(a),b.dims=_(a));var e=d.first+d.size,f=Math.max(b.visible.from-a.options.viewportMargin,d.first),g=Math.min(e,b.visible.to+a.options.viewportMargin);c.viewFrom<f&&f-c.viewFrom<20&&(f=Math.max(d.first,c.viewFrom)),c.viewTo>g&&c.viewTo-g<20&&(g=Math.min(e,c.viewTo)),v&&(f=cf(a.doc,f),g=df(a.doc,g));var h=f!=c.viewFrom\|\|g!=c.viewTo\|\|c.lastSizeC!=b.wrapperHeight;Vc(a,f,g),c.viewOffset=Vf(Pf(a.doc,c.viewFrom)),a.display.mover.style.top=c.viewOffset+"px";var i=Wc(a);if(!h&&0==i&&!b.force&&(null==c.updateLineNumbers\|\|c.updateLineNumbers>=c.viewTo))return!1;var j=ah();return i>4&&(c.lineDiv.style.display="none"),ab(a,c.updateLineNumbers,b.dims),i>4&&(c.lineDiv.style.display=""),j&&ah()!=j&&j.offsetHeight&&j.focus(),Zg(c.cursorDiv),Zg(c.selectionDiv),h&&(c.lastSizeC=b.wrapperHeight,Ub(a,400)),c.updateLineNumbers=null,!0}function V(a,b){for(var c=b.force,d=b.viewport,e=!0;;e=!1){if(e&&a.options.lineWrapping&&b.oldScrollerWidth!=a.display.scroller.clientWidth)c=!0;else if(c=!1,d&&null!=d.top&&(d={top:Math.min(a.doc.height+Zb(a.display)-Ag-a.display.scroller.clientHeight,d.top)}),b.visible=O(a.display,a.doc,d),b.visible.from>=a.display.viewFrom&&b.visible.to<=a.display.viewTo)break;if(!U(a,b))break;Z(a);var f=M(a);Qb(a),X(a,f),N(a,f)}ug(a,"update",a),(a.display.viewFrom!=b.oldViewFrom\|\|a.display.viewTo!=b.oldViewTo)&&ug(a,"viewportChange",a,a.display.viewFrom,a.display.viewTo)}function W(a,b){var c=new T(a,b);if(U(a,c)){Z(a),V(a,c);var d=M(a);Qb(a),X(a,d),N(a,d)}}function X(a,b){a.display.sizer.style.minHeight=a.display.heightForcer.style.top=b.docHeight+"px",a.display.gutters.style.height=Math.max(b.docHeight,b.clientHeight-Ag)+"px"}function Y(a,b){a.display.sizer.offsetWidth+a.display.gutters.offsetWidth<a.display.scroller.clientWidth-1&&(a.display.sizer.style.minHeight=a.display.heightForcer.style.top="0px",a.display.gutters.style.height=b.docHeight+"px")}function Z(a){for(var b=a.display,c=b.lineDiv.offsetTop,f=0;f<b.view.length;f++){var h,g=b.view[f];if(!g.hidden){if(d&&8>e){var i=g.node.offsetTop+g.node.offsetHeight;h=i-c,c=i}else{var j=g.node.getBoundingClientRect();h=j.bottom-j.top}var k=g.line.height-h;if(2>h&&(h=xc(b)),(k>.001\|\|-.001>k)&&(Sf(g.line,h),$(g.line),g.rest))for(var l=0;l<g.rest.length;l++)$(g.rest[l])}}}function $(a){if(a.widgets)for(var b=0;b<a.widgets.length;++b)a.widgets[b].height=a.widgets[b].node.offsetHeight}function _(a){for(var b=a.display,c={},d={},e=b.gutters.firstChild,f=0;e;e=e.nextSibling,++f)c[a.options.gutters[f]]=e.offsetLeft,d[a.options.gutters[f]]=e.offsetWidth;return{fixedPos:S(b),gutterTotalWidth:b.gutters.offsetWidth,gutterLeft:c,gutterWidth:d,wrapperWidth:b.wrapper.clientWidth}}function ab(a,b,c){function i(b){var c=b.nextSibling;return f&&p&&a.display.currentWheelTarget==b?b.style.display="none":b.parentNode.removeChild(b),c}for(var d=a.display,e=a.options.lineNumbers,g=d.lineDiv,h=g.firstChild,j=d.view,k=d.viewFrom,l=0;l<j.length;l++){var m=j[l];if(m.hidden);else if(m.node){for(;h!=m.node;)h=i(h);var o=e&&null!=b&&k>=b&&m.lineNumber;m.changes&&(Mg(m.changes,"gutter")>-1&&(o=!1),bb(a,m,k,c)),o&&(Zg(m.lineNumber),m.lineNumber.appendChild(document.createTextNode(R(a.options,k)))),h=m.node.nextSibling}else{var n=jb(a,m,k,c);g.insertBefore(n,h)}k+=m.size}for(;h;)h=i(h)}function bb(a,b,c,d){for(var e=0;e<b.changes.length;e++){var f=b.changes[e];"text"==f?fb(a,b):"gutter"==f?hb(a,b,c,d):"class"==f?gb(b):"widget"==f&&ib(b,d)}b.changes=null}function cb(a){return a.node==a.text&&(a.node=Xg("div",null,null,"position: relative"),a.text.parentNode&&a.text.parentNode.replaceChild(a.node,a.text),a.node.appendChild(a.text),d&&8>e&&(a.node.style.zIndex=2)),a.node}function db(a){var b=a.bgClass?a.bgClass+" "+(a.line.bgClass\|\|""):a.line.bgClass;if(b&&(b+=" CodeMirror-linebackground"),a.background)b?a.background.className=b:(a.background.parentNode.removeChild(a.background),a.background=null);else if(b){var c=cb(a);a.background=c.insertBefore(Xg("div",null,b),c.firstChild)}}function eb(a,b){var c=a.display.externalMeasured;return c&&c.line==b.line?(a.display.externalMeasured=null,b.measure=c.measure,c.built):yf(a,b)}function fb(a,b){var c=b.text.className,d=eb(a,b);b.text==b.node&&(b.node=d.pre),b.text.parentNode.replaceChild(d.pre,b.text),b.text=d.pre,d.bgClass!=b.bgClass\|\|d.textClass!=b.textClass?(b.bgClass=d.bgClass,b.textClass=d.textClass,gb(b)):c&&(b.text.className=c)}function gb(a){db(a),a.line.wrapClass?cb(a).className=a.line.wrapClass:a.node!=a.text&&(a.node.className="");var b=a.textClass?a.textClass+" "+(a.line.textClass\|\|""):a.line.textClass;a.text.className=b\|\|""}function hb(a,b,c,d){b.gutter&&(b.node.removeChild(b.gutter),b.gutter=null);var e=b.line.gutterMarkers;if(a.options.lineNumbers\|\|e){var f=cb(b),g=b.gutter=f.insertBefore(Xg("div",null,"CodeMirror-gutter-wrapper","position: absolute; left: "+(a.options.fixedGutter?d.fixedPos:-d.gutterTotalWidth)+"px"),b.text);if(!a.options.lineNumbers\|\|e&&e["CodeMirror-linenumbers"]\|\|(b.lineNumber=g.appendChild(Xg("div",R(a.options,c),"CodeMirror-linenumber CodeMirror-gutter-elt","left: "+d.gutterLeft["CodeMirror-linenumbers"]+"px; width: "+a.display.lineNumInnerWidth+"px"))),e)for(var h=0;h<a.options.gutters.length;++h){var i=a.options.gutters[h],j=e.hasOwnProperty(i)&&e[i];j&&g.appendChild(Xg("div",[j],"CodeMirror-gutter-elt","left: "+d.gutterLeft[i]+"px; width: "+d.gutterWidth[i]+"px"))}}}function ib(a,b){a.alignable&&(a.alignable=null);for(var d,c=a.node.firstChild;c;c=d){var d=c.nextSibling;"CodeMirror-linewidget"==c.className&&a.node.removeChild(c)}kb(a,b)}function jb(a,b,c,d){var e=eb(a,b);return b.text=b.node=e.pre,e.bgClass&&(b.bgClass=e.bgClass),e.textClass&&(b.textClass=e.textClass),gb(b),hb(a,b,c,d),kb(b,d),b.node}function kb(a,b){if(lb(a.line,a,b,!0),a.rest)for(var c=0;c<a.rest.length;c++)lb(a.rest[c],a,b,!1)}function lb(a,b,c,d){if(a.widgets)for(var e=cb(b),f=0,g=a.widgets;f<g.length;++f){var h=g[f],i=Xg("div",[h.node],"CodeMirror-linewidget");h.handleMouseEvents\|\|(i.ignoreEvents=!0),mb(h,i,b,c),d&&h.above?e.insertBefore(i,b.gutter\|\|b.text):e.appendChild(i),ug(h,"redraw")}}function mb(a,b,c,d){if(a.noHScroll){(c.alignable\|\|(c.alignable=[])).push(b);var e=d.wrapperWidth;b.style.left=d.fixedPos+"px",a.coverGutter\|\|(e-=d.gutterTotalWidth,b.style.paddingLeft=d.gutterTotalWidth+"px"),b.style.width=e+"px"}a.coverGutter&&(b.style.zIndex=5,b.style.position="relative",a.noHScroll\|\|(b.style.marginLeft=-d.gutterTotalWidth+"px"))}function pb(a){return nb(a.line,a.ch)}function qb(a,b){return ob(a,b)<0?b:a}function rb(a,b){return ob(a,b)<0?a:b}function sb(a,b){this.ranges=a,this.primIndex=b}function tb(a,b){this.anchor=a,this.head=b}function ub(a,b){var c=a[b];a.sort(function(a,b){return ob(a.from(),b.from())}),b=Mg(a,c);for(var d=1;d<a.length;d++){var e=a[d],f=a[d-1];if(ob(f.to(),e.from())>=0){var g=rb(f.from(),e.from()),h=qb(f.to(),e.to()),i=f.empty()?e.from()==e.head:f.from()==f.head;b>=d&&--b,a.splice(--d,2,new tb(i?h:g,i?g:h))}}return new sb(a,b)}function vb(a,b){return new sb([new tb(a,b\|\|a)],0)}function wb(a,b){return Math.max(a.first,Math.min(b,a.first+a.size-1))}function xb(a,b){if(b.line<a.first)return nb(a.first,0);var c=a.first+a.size-1;return b.line>c?nb(c,Pf(a,c).text.length):yb(b,Pf(a,b.line).text.length)}function yb(a,b){var c=a.ch;return null==c\|\|c>b?nb(a.line,b):0>c?nb(a.line,0):a}function zb(a,b){return b>=a.first&&b<a.first+a.size}function Ab(a,b){for(var c=[],d=0;d<b.length;d++)c[d]=xb(a,b[d]);return c}function Bb(a,b,c,d){if(a.cm&&a.cm.display.shift\|\|a.extend){var e=b.anchor;if(d){var f=ob(c,e)<0;f!=ob(d,e)<0?(e=c,c=d):f!=ob(c,d)<0&&(c=d)}return new tb(e,c)}return new tb(d\|\|c,c)}function Cb(a,b,c,d){Ib(a,new sb([Bb(a,a.sel.primary(),b,c)],0),d)}function Db(a,b,c){for(var d=[],e=0;e<a.sel.ranges.length;e++)d[e]=Bb(a,a.sel.ranges[e],b[e],null);var f=ub(d,a.sel.primIndex);Ib(a,f,c)}function Eb(a,b,c,d){var e=a.sel.ranges.slice(0);e[b]=c,Ib(a,ub(e,a.sel.primIndex),d)}function Fb(a,b,c,d){Ib(a,vb(b,c),d)}function Gb(a,b){var c={ranges:b.ranges,update:function(b){this.ranges=[];for(var c=0;c<b.length;c++)this.ranges[c]=new tb(xb(a,b[c].anchor),xb(a,b[c].head))}};return sg(a,"beforeSelectionChange",a,c),a.cm&&sg(a.cm,"beforeSelectionChange",a.cm,c),c.ranges!=b.ranges?ub(c.ranges,c.ranges.length-1):b}function Hb(a,b,c){var d=a.history.done,e=Kg(d);e&&e.ranges?(d[d.length-1]=b,Jb(a,b,c)):Ib(a,b,c)}function Ib(a,b,c){Jb(a,b,c),bg(a,a.sel,a.cm?a.cm.curOp.id:0/0,c)}function Jb(a,b,c){(yg(a,"beforeSelectionChange")\|\|a.cm&&yg(a.cm,"beforeSelectionChange"))&&(b=Gb(a,b));var d=c&&c.bias\|\|(ob(b.primary().head,a.sel.primary().head)<0?-1:1);Kb(a,Mb(a,b,d,!0)),c&&c.scroll===!1\|\|!a.cm\|\|be(a.cm)}function Kb(a,b){b.equals(a.sel)\|\|(a.sel=b,a.cm&&(a.cm.curOp.updateInput=a.cm.curOp.selectionChanged=!0,xg(a.cm)),ug(a,"cursorActivity",a))}function Lb(a){Kb(a,Mb(a,a.sel,null,!1),Cg)}function Mb(a,b,c,d){for(var e,f=0;f<b.ranges.length;f++){var g=b.ranges[f],h=Nb(a,g.anchor,c,d),i=Nb(a,g.head,c,d);(e\|\|h!=g.anchor\|\|i!=g.head)&&(e\|\|(e=b.ranges.slice(0,f)),e[f]=new tb(h,i))}return e?ub(e,b.primIndex):b}function Nb(a,b,c,d){var e=!1,f=b,g=c\|\|1;a.cantEdit=!1;a:for(;;){var h=Pf(a,f.line);if(h.markedSpans)for(var i=0;i<h.markedSpans.length;++i){var j=h.markedSpans[i],k=j.marker;if((null==j.from\|\|(k.inclusiveLeft?j.from<=f.ch:j.from<f.ch))&&(null==j.to\|\|(k.inclusiveRight?j.to>=f.ch:j.to>f.ch))){if(d&&(sg(k,"beforeCursorEnter"),k.explicitlyCleared)){if(h.markedSpans){--i;continue}break}if(!k.atomic)continue;var l=k.find(0>g?-1:1);if(0==ob(l,f)&&(l.ch+=g,l.ch<0?l=l.line>a.first?xb(a,nb(l.line-1)):null:l.ch>h.text.length&&(l=l.line<a.first+a.size-1?nb(l.line+1,0):null),!l)){if(e)return d?(a.cantEdit=!0,nb(a.first,0)):Nb(a,b,c,!0);e=!0,l=b,g=-g}f=l;continue a}}return f}}function Ob(a){for(var b=a.display,c=a.doc,d={},e=d.cursors=document.createDocumentFragment(),f=d.selection=document.createDocumentFragment(),g=0;g<c.sel.ranges.length;g++){var h=c.sel.ranges[g],i=h.empty();(i\|\|a.options.showCursorWhenSelecting)&&Rb(a,h,e),i\|\|Sb(a,h,f)}if(a.options.moveInputWithCursor){var j=rc(a,c.sel.primary().head,"div"),k=b.wrapper.getBoundingClientRect(),l=b.lineDiv.getBoundingClientRect();d.teTop=Math.max(0,Math.min(b.wrapper.clientHeight-10,j.top+l.top-k.top)),d.teLeft=Math.max(0,Math.min(b.wrapper.clientWidth-10,j.left+l.left-k.left))}return d}function Pb(a,b){$g(a.display.cursorDiv,b.cursors),$g(a.display.selectionDiv,b.selection),null!=b.teTop&&(a.display.inputDiv.style.top=b.teTop+"px",a.display.inputDiv.style.left=b.teLeft+"px")}function Qb(a){Pb(a,Ob(a))}function Rb(a,b,c){var d=rc(a,b.head,"div",null,null,!a.options.singleCursorHeightPerLine),e=c.appendChild(Xg("div","\xa0","CodeMirror-cursor"));if(e.style.left=d.left+"px",e.style.top=d.top+"px",e.style.height=Math.max(0,d.bottom-d.top)a.options.cursorHeight+"px",d.other){var f=c.appendChild(Xg("div","\xa0","CodeMirror-cursor CodeMirror-secondarycursor"));f.style.display="",f.style.left=d.other.left+"px",f.style.top=d.other.top+"px",f.style.height=.85(d.other.bottom-d.other.top)+"px"}}function Sb(a,b,c){function j(a,b,c,d){0>b&&(b=0),b=Math.round(b),d=Math.round(d),f.appendChild(Xg("div",null,"CodeMirror-selected","position: absolute; left: "+a+"px; top: "+b+"px; width: "+(null==c?i-a:c)+"px; height: "+(d-b)+"px"))}function k(b,c,d){function m(c,d){return qc(a,nb(b,c),"div",f,d)}var k,l,f=Pf(e,b),g=f.text.length;return wh(Wf(f),c\|\|0,null==d?g:d,function(a,b,e){var n,o,p,f=m(a,"left");if(a==b)n=f,o=p=f.left;else{if(n=m(b-1,"right"),"rtl"==e){var q=f;f=n,n=q}o=f.left,p=n.right}null==c&&0==a&&(o=h),n.top-f.top>3&&(j(o,f.top,null,f.bottom),o=h,f.bottom<n.top&&j(o,f.bottom,null,n.top)),null==d&&b==g&&(p=i),(!k\|\|f.top<k.top\|\|f.top==k.top&&f.left<k.left)&&(k=f),(!l\|\|n.bottom>l.bottom\|\|n.bottom==l.bottom&&n.right>l.right)&&(l=n),h+1>o&&(o=h),j(o,n.top,p-o,n.bottom)}),{start:k,end:l}}var d=a.display,e=a.doc,f=document.createDocumentFragment(),g=$b(a.display),h=g.left,i=d.lineSpace.offsetWidth-g.right,l=b.from(),m=b.to();if(l.line==m.line)k(l.line,l.ch,m.ch);else{var n=Pf(e,l.line),o=Pf(e,m.line),p=af(n)==af(o),q=k(l.line,l.ch,p?n.text.length+1:null).end,r=k(m.line,p?0:null,m.ch).start;p&&(q.top<r.top-2?(j(q.right,q.top,null,q.bottom),j(h,r.top,r.left,r.bottom)):j(q.right,q.top,r.left-q.right,q.bottom)),q.bottom<r.top&&j(h,q.bottom,null,r.top)}c.appendChild(f)}function Tb(a){if(a.state.focused){var b=a.display;clearInterval(b.blinker);var c=!0;b.cursorDiv.style.visibility="",a.options.cursorBlinkRate>0?b.blinker=setInterval(function(){b.cursorDiv.style.visibility=(c=!c)?"":"hidden"},a.options.cursorBlinkRate):a.options.cursorBlinkRate<0&&(b.cursorDiv.style.visibility="hidden")}}function Ub(a,b){a.doc.mode.startState&&a.doc.frontier<a.display.viewTo&&a.state.highlight.set(b,Qg(Vb,a))}function Vb(a){var b=a.doc;if(b.frontier<b.first&&(b.frontier=b.first),!(b.frontier>=a.display.viewTo)){var c=+new Date+a.options.workTime,d=se(b.mode,Xb(a,b.frontier)),e=[];b.iter(b.frontier,Math.min(b.first+b.size,a.display.viewTo+500),function(f){if(b.frontier>=a.display.viewFrom){var g=f.styles,h=sf(a,f,d,!0);f.styles=h.styles;var i=f.styleClasses,j=h.classes;j?f.styleClasses=j:i&&(f.styleClasses=null);for(var k=!g\|\|g.length!=f.styles.length\|\|i!=j&&(!i\|\|!j\|\|i.bgClass!=j.bgClass\|\|i.textClass!=j.textClass),l=0;!k&&l<g.length;++l)k=g[l]!=f.styles[l];k&&e.push(b.frontier),f.stateAfter=se(b.mode,d)}else uf(a,f.text,d),f.stateAfter=0==b.frontier%5?se(b.mode,d):null;return++b.frontier,+new Date>c?(Ub(a,a.options.workDelay),!0):void 0}),e.length&&Kc(a,function(){for(var b=0;b<e.length;b++)Rc(a,e[b],"text")})}}function Wb(a,b,c){for(var d,e,f=a.doc,g=c?-1:b-(a.doc.mode.innerMode?1e3:100),h=b;h>g;--h){if(h<=f.first)return f.first;var i=Pf(f,h-1);if(i.stateAfter&&(!c\|\|h<=f.frontier))return h;var j=Gg(i.text,null,a.options.tabSize);(null==e\|\|d>j)&&(e=h-1,d=j)}return e}function Xb(a,b,c){var d=a.doc,e=a.display;if(!d.mode.startState)return!0;var f=Wb(a,b,c),g=f>d.first&&Pf(d,f-1).stateAfter;return g=g?se(d.mode,g):te(d.mode),d.iter(f,b,function(c){uf(a,c.text,g);var h=f==b-1\|\|0==f%5\|\|f>=e.viewFrom&&f<e.viewTo;c.stateAfter=h?se(d.mode,g):null,++f}),c&&(d.frontier=f),g}function Yb(a){return a.lineSpace.offsetTop}function Zb(a){return a.mover.offsetHeight-a.lineSpace.offsetHeight}function $b(a){if(a.cachedPaddingH)return a.cachedPaddingH;var b=$g(a.measure,Xg("pre","x")),c=window.getComputedStyle?window.getComputedStyle(b):b.currentStyle,d={left:parseInt(c.paddingLeft),right:parseInt(c.paddingRight)};return isNaN(d.left)\|\|isNaN(d.right)\|\|(a.cachedPaddingH=d),d}function _b(a,b,c){var d=a.options.lineWrapping,e=d&&a.display.scroller.clientWidth;if(!b.measure.heights\|\|d&&b.measure.width!=e){var f=b.measure.heights=[];if(d){b.measure.width=e;for(var g=b.text.firstChild.getClientRects(),h=0;h<g.length-1;h++){var i=g[h],j=g[h+1];Math.abs(i.bottom-j.bottom)>2&&f.push((i.bottom+j.top)/2-c.top)}}f.push(c.bottom-c.top)}}function ac(a,b,c){if(a.line==b)return{map:a.measure.map,cache:a.measure.cache};for(var d=0;d<a.rest.length;d++)if(a.rest[d]==b)return{map:a.measure.maps[d],cache:a.measure.caches[d]};for(var d=0;d<a.rest.length;d++)if(Tf(a.rest[d])>c)return{map:a.measure.maps[d],cache:a.measure.caches[d],before:!0}}function bc(a,b){b=af(b);var c=Tf(b),d=a.display.externalMeasured=new Oc(a.doc,b,c);d.lineN=c;var e=d.built=yf(a,d);return d.text=e.pre,$g(a.display.lineMeasure,e.pre),d}function cc(a,b,c,d){return fc(a,ec(a,b),c,d)}function dc(a,b){if(b>=a.display.viewFrom&&b<a.display.viewTo)return a.display.view[Tc(a,b)];var c=a.display.externalMeasured;return c&&b>=c.lineN&&b<c.lineN+c.size?c:void 0}function ec(a,b){var c=Tf(b),d=dc(a,c);d&&!d.text?d=null:d&&d.changes&&bb(a,d,c,_(a)),d\|\|(d=bc(a,b));var e=ac(d,b,c);return{line:b,view:d,rect:null,map:e.map,cache:e.cache,before:e.before,hasHeights:!1}}function fc(a,b,c,d,e){b.before&&(c=-1);var g,f=c+(d\|\|"");return b.cache.hasOwnProperty(f)?g=b.cache[f]:(b.rect\|\|(b.rect=b.view.text.getBoundingClientRect()),b.hasHeights\|\|(_b(a,b.view,b.rect),b.hasHeights=!0),g=hc(a,b,c,d),g.bogus\|\|(b.cache[f]=g)),{left:g.left,right:g.right,top:e?g.rtop:g.top,bottom:e?g.rbottom:g.bottom}}function hc(a,b,c,f){for(var h,i,j,k,g=b.map,l=0;l<g.length;l+=3){var m=g[l],n=g[l+1];if(m>c?(i=0,j=1,k="left"):n>c?(i=c-m,j=i+1):(l==g.length-3\|\|c==n&&g[l+3]>c)&&(j=n-m,i=j-1,c>=n&&(k="right")),null!=i){if(h=g[l+2],m==n&&f==(h.insertLeft?"left":"right")&&(k=f),"left"==f&&0==i)for(;l&&g[l-2]==g[l-3]&&g[l-1].insertLeft;)h=g[(l-=3)+2],k="left";if("right"==f&&i==n-m)for(;l<g.length-3&&g[l+3]==g[l+4]&&!g[l+5].insertLeft;)h=g[(l+=3)+2],k="right";break}}var o;if(3==h.nodeType){for(;i&&Wg(b.line.text.charAt(m+i));)--i;for(;n>m+j&&Wg(b.line.text.charAt(m+j));)++j;if(d&&9>e&&0==i&&j==n-m)o=h.parentNode.getBoundingClientRect();else if(d&&a.options.lineWrapping){var p=Yg(h,i,j).getClientRects();o=p.length?p["right"==f?p.length-1:0]:gc}else o=Yg(h,i,j).getBoundingClientRect()\|\|gc}else{i>0&&(k=f="right");var p;o=a.options.lineWrapping&&(p=h.getClientRects()).length>1?p["right"==f?p.length-1:0]:h.getBoundingClientRect()}if(d&&9>e&&!i&&(!o\|\|!o.left&&!o.right)){var q=h.parentNode.getClientRects()[0];o=q?{left:q.left,right:q.left+yc(a.display),top:q.top,bottom:q.bottom}:gc}d&&11>e&&(o=ic(a.display.measure,o));for(var r=o.top-b.rect.top,s=o.bottom-b.rect.top,t=(r+s)/2,u=b.view.measure.heights,l=0;l<u.length-1&&!(t<u[l]);l++);var v=l?u[l-1]:0,w=u[l],x={left:("right"==k?o.right:o.left)-b.rect.left,right:("left"==k?o.left:o.right)-b.rect.left,top:v,bottom:w};return o.left\|\|o.right\|\|(x.bogus=!0),a.options.singleCursorHeightPerLine\|\|(x.rtop=r,x.rbottom=s),x}function ic(a,b){if(!window.screen\|\|null==screen.logicalXDPI\|\|screen.logicalXDPI==screen.deviceXDPI\|\|!uh(a))return b;var c=screen.logicalXDPI/screen.deviceXDPI,d=screen.logicalYDPI/screen.deviceYDPI;return{left:b.leftc,right:b.rightc,top:b.topd,bottom:b.bottomd}}function jc(a){if(a.measure&&(a.measure.cache={},a.measure.heights=null,a.rest))for(var b=0;b<a.rest.length;b++)a.measure.caches[b]={}}function kc(a){a.display.externalMeasure=null,Zg(a.display.lineMeasure);for(var b=0;b<a.display.view.length;b++)jc(a.display.view[b])}function lc(a){kc(a),a.display.cachedCharWidth=a.display.cachedTextHeight=a.display.cachedPaddingH=null,a.options.lineWrapping\|\|(a.display.maxLineChanged=!0),a.display.lineNumChars=null}function mc(){return window.pageXOffset\|\|(document.documentElement\|\|document.body).scrollLeft}function nc(){return window.pageYOffset\|\|(document.documentElement\|\|document.body).scrollTop}function oc(a,b,c,d){if(b.widgets)for(var e=0;e<b.widgets.length;++e)if(b.widgets[e].above){var f=jf(b.widgets[e]);c.top+=f,c.bottom+=f}if("line"==d)return c;d\|\|(d="local");var g=Vf(b);if("local"==d?g+=Yb(a.display):g-=a.display.viewOffset,"page"==d\|\|"window"==d){var h=a.display.lineSpace.getBoundingClientRect();g+=h.top+("window"==d?0:nc());var i=h.left+("window"==d?0:mc());c.left+=i,c.right+=i}return c.top+=g,c.bottom+=g,c}function pc(a,b,c){if("div"==c)return b;var d=b.left,e=b.top;if("page"==c)d-=mc(),e-=nc();else if("local"==c\|\|!c){var f=a.display.sizer.getBoundingClientRect();d+=f.left,e+=f.top}var g=a.display.lineSpace.getBoundingClientRect();return{left:d-g.left,top:e-g.top}}function qc(a,b,c,d,e){return d\|\|(d=Pf(a.doc,b.line)),oc(a,d,cc(a,d,b.ch,e),c)}function rc(a,b,c,d,e,f){function g(b,g){var h=fc(a,e,b,g?"right":"left",f);return g?h.left=h.right:h.right=h.left,oc(a,d,h,c)}function h(a,b){var c=i[b],d=c.level%2;return a==xh(c)&&b&&c.level<i[b-1].level?(c=i[--b],a=yh(c)-(c.level%2?0:1),d=!0):a==yh(c)&&b<i.length-1&&c.level<i[b+1].level&&(c=i[++b],a=xh(c)-c.level%2,d=!1),d&&a==c.to&&a>c.from?g(a-1):g(a,d)}d=d\|\|Pf(a.doc,b.line),e\|\|(e=ec(a,d));var i=Wf(d),j=b.ch;if(!i)return g(j);var k=Gh(i,j),l=h(j,k);return null!=Fh&&(l.other=h(j,Fh)),l}function sc(a,b){var c=0,b=xb(a.doc,b);a.options.lineWrapping\|\|(c=yc(a.display)b.ch);var d=Pf(a.doc,b.line),e=Vf(d)+Yb(a.display);return{left:c,right:c,top:e,bottom:e+d.height}}function tc(a,b,c,d){var e=nb(a,b);return e.xRel=d,c&&(e.outside=!0),e}function uc(a,b,c){var d=a.doc;if(c+=a.display.viewOffset,0>c)return tc(d.first,0,!0,-1);var e=Uf(d,c),f=d.first+d.size-1;if(e>f)return tc(d.first+d.size-1,Pf(d,f).text.length,!0,1);0>b&&(b=0);for(var g=Pf(d,e);;){var h=vc(a,g,e,b,c),i=$e(g),j=i&&i.find(0,!0);if(!i\|\|!(h.ch>j.from.ch\|\|h.ch==j.from.ch&&h.xRel>0))return h;e=Tf(g=j.to.line)}}function vc(a,b,c,d,e){function j(d){var e=rc(a,nb(c,d),"line",b,i);return g=!0,f>e.bottom?e.left-h:f<e.top?e.left+h:(g=!1,e.left)}var f=e-Vf(b),g=!1,h=2a.display.wrapper.clientWidth,i=ec(a,b),k=Wf(b),l=b.text.length,m=zh(b),n=Ah(b),o=j(m),p=g,q=j(n),r=g;if(d>q)return tc(c,n,r,1);for(;;){if(k?n==m\|\|n==Ih(b,m,1):1>=n-m){for(var s=o>d\|\|q-d>=d-o?m:n,t=d-(s==m?o:q);Wg(b.text.charAt(s));)++s;var u=tc(c,s,s==m?p:r,-1>t?-1:t>1?1:0);return u}var v=Math.ceil(l/2),w=m+v;if(k){w=m;for(var x=0;v>x;++x)w=Ih(b,w,1)}var y=j(w);y>d?(n=w,q=y,(r=g)&&(q+=1e3),l=v):(m=w,o=y,p=g,l-=v)}}function xc(a){if(null!=a.cachedTextHeight)return a.cachedTextHeight;if(null==wc){wc=Xg("pre");for(var b=0;49>b;++b)wc.appendChild(document.createTextNode("x")),wc.appendChild(Xg("br"));wc.appendChild(document.createTextNode("x"))}$g(a.measure,wc);var c=wc.offsetHeight/50;return c>3&&(a.cachedTextHeight=c),Zg(a.measure),c\|\|1}function yc(a){if(null!=a.cachedCharWidth)return a.cachedCharWidth;var b=Xg("span","xxxxxxxxxx"),c=Xg("pre",[b]);$g(a.measure,c);var d=b.getBoundingClientRect(),e=(d.right-d.left)/10;return e>2&&(a.cachedCharWidth=e),e\|\|10}function Bc(a){a.curOp={cm:a,viewChanged:!1,startHeight:a.doc.height,forceUpdate:!1,updateInput:null,typing:!1,changeObjs:null,cursorActivityHandlers:null,cursorActivityCalled:0,selectionChanged:!1,updateMaxLine:!1,scrollLeft:null,scrollTop:null,scrollToPos:null,id:++Ac},zc?zc.ops.push(a.curOp):a.curOp.ownsGroup=zc={ops:[a.curOp],delayedCallbacks:[]}}function Cc(a){var b=a.delayedCallbacks,c=0;do{for(;c<b.length;c++)b[c]();for(var d=0;d<a.ops.length;d++){var e=a.ops[d];if(e.cursorActivityHandlers)for(;e.cursorActivityCalled<e.cursorActivityHandlers.length;)e.cursorActivityHandlers[e.cursorActivityCalled++](e.cm)}}while(c<b.length)}function Dc(a){var b=a.curOp,c=b.ownsGroup;if(c)try{Cc(c)}finally{zc=null;for(var d=0;d<c.ops.length;d++)c.ops[d].cm.curOp=null;Ec(c)}}function Ec(a){for(var b=a.ops,c=0;c<b.length;c++)Fc(b[c]);for(var c=0;c<b.length;c++)Gc(b[c]);for(var c=0;c<b.length;c++)Hc(b[c]);for(var c=0;c<b.length;c++)Ic(b[c]);for(var c=0;c<b.length;c++)Jc(b[c])}function Fc(a){var b=a.cm,c=b.display;a.updateMaxLine&&J(b),a.mustUpdate=a.viewChanged\|\|a.forceUpdate\|\|null!=a.scrollTop\|\|a.scrollToPos&&(a.scrollToPos.from.line<c.viewFrom\|\|a.scrollToPos.to.line>=c.viewTo)\|\|c.maxLineChanged&&b.options.lineWrapping,a.update=a.mustUpdate&&new T(b,a.mustUpdate&&{top:a.scrollTop,ensure:a.scrollToPos},a.forceUpdate)
10	+ }function Gc(a){a.updatedDisplay=a.mustUpdate&&U(a.cm,a.update)}function Hc(a){var b=a.cm,c=b.display;if(a.updatedDisplay&&Z(b),a.barMeasure=M(b),c.maxLineChanged&&!b.options.lineWrapping){a.adjustWidthTo=cc(b,c.maxLine,c.maxLine.text.length).left+3,a.maxScrollLeft=Math.max(0,c.sizer.offsetLeft+a.adjustWidthTo+Ag-c.scroller.clientWidth);var d=c.sizer.style.minWidth;d&&a.barMeasure.scrollWidth>a.barMeasure.clientWidth&&(a.barMeasure.scrollWidth+=a.adjustWidthTo-parseInt(d))}(a.updatedDisplay\|\|a.selectionChanged)&&(a.newSelectionNodes=Ob(b))}function Ic(a){var b=a.cm;null!=a.adjustWidthTo&&(b.display.sizer.style.minWidth=a.adjustWidthTo+"px",a.maxScrollLeft<b.doc.scrollLeft&&td(b,Math.min(b.display.scroller.scrollLeft,a.maxScrollLeft),!0),b.display.maxLineChanged=!1),a.newSelectionNodes&&Pb(b,a.newSelectionNodes),a.updatedDisplay&&X(b,a.barMeasure),(a.updatedDisplay\|\|a.startHeight!=b.doc.height)&&N(b,a.barMeasure),a.selectionChanged&&Tb(b),b.state.focused&&a.updateInput&&_c(b,a.typing)}function Jc(a){var b=a.cm,c=b.display,d=b.doc;if(a.updatedDisplay&&V(b,a.update),null==c.wheelStartX\|\|null==a.scrollTop&&null==a.scrollLeft&&!a.scrollToPos\|\|(c.wheelStartX=c.wheelStartY=null),null!=a.scrollTop&&c.scroller.scrollTop!=a.scrollTop){var e=Math.max(0,Math.min(c.scroller.scrollHeight-c.scroller.clientHeight,a.scrollTop));c.scroller.scrollTop=c.scrollbarV.scrollTop=d.scrollTop=e}if(null!=a.scrollLeft&&c.scroller.scrollLeft!=a.scrollLeft){var g=Math.max(0,Math.min(c.scroller.scrollWidth-c.scroller.clientWidth,a.scrollLeft));c.scroller.scrollLeft=c.scrollbarH.scrollLeft=d.scrollLeft=g,P(b)}if(a.scrollToPos){var h=Zd(b,xb(d,a.scrollToPos.from),xb(d,a.scrollToPos.to),a.scrollToPos.margin);a.scrollToPos.isCursor&&b.state.focused&&Yd(b,h)}var i=a.maybeHiddenMarkers,j=a.maybeUnhiddenMarkers;if(i)for(var k=0;k<i.length;++k)i[k].lines.length\|\|sg(i[k],"hide");if(j)for(var k=0;k<j.length;++k)j[k].lines.length&&sg(j[k],"unhide");c.wrapper.offsetHeight&&(d.scrollTop=b.display.scroller.scrollTop),a.updatedDisplay&&f&&(b.options.lineWrapping&&Y(b,a.barMeasure),a.barMeasure.scrollWidth>a.barMeasure.clientWidth&&a.barMeasure.scrollWidth<a.barMeasure.clientWidth+1&&!L(b)&&N(b)),a.changeObjs&&sg(b,"changes",b,a.changeObjs)}function Kc(a,b){if(a.curOp)return b();Bc(a);try{return b()}finally{Dc(a)}}function Lc(a,b){return function(){if(a.curOp)return b.apply(a,arguments);Bc(a);try{return b.apply(a,arguments)}finally{Dc(a)}}}function Mc(a){return function(){if(this.curOp)return a.apply(this,arguments);Bc(this);try{return a.apply(this,arguments)}finally{Dc(this)}}}function Nc(a){return function(){var b=this.cm;if(!b\|\|b.curOp)return a.apply(this,arguments);Bc(b);try{return a.apply(this,arguments)}finally{Dc(b)}}}function Oc(a,b,c){this.line=b,this.rest=bf(b),this.size=this.rest?Tf(Kg(this.rest))-c+1:1,this.node=this.text=null,this.hidden=ef(a,b)}function Pc(a,b,c){for(var e,d=[],f=b;c>f;f=e){var g=new Oc(a.doc,Pf(a.doc,f),f);e=f+g.size,d.push(g)}return d}function Qc(a,b,c,d){null==b&&(b=a.doc.first),null==c&&(c=a.doc.first+a.doc.size),d\|\|(d=0);var e=a.display;if(d&&c<e.viewTo&&(null==e.updateLineNumbers\|\|e.updateLineNumbers>b)&&(e.updateLineNumbers=b),a.curOp.viewChanged=!0,b>=e.viewTo)v&&cf(a.doc,b)<e.viewTo&&Sc(a);else if(c<=e.viewFrom)v&&df(a.doc,c+d)>e.viewFrom?Sc(a):(e.viewFrom+=d,e.viewTo+=d);else if(b<=e.viewFrom&&c>=e.viewTo)Sc(a);else if(b<=e.viewFrom){var f=Uc(a,c,c+d,1);f?(e.view=e.view.slice(f.index),e.viewFrom=f.lineN,e.viewTo+=d):Sc(a)}else if(c>=e.viewTo){var f=Uc(a,b,b,-1);f?(e.view=e.view.slice(0,f.index),e.viewTo=f.lineN):Sc(a)}else{var g=Uc(a,b,b,-1),h=Uc(a,c,c+d,1);g&&h?(e.view=e.view.slice(0,g.index).concat(Pc(a,g.lineN,h.lineN)).concat(e.view.slice(h.index)),e.viewTo+=d):Sc(a)}var i=e.externalMeasured;i&&(c<i.lineN?i.lineN+=d:b<i.lineN+i.size&&(e.externalMeasured=null))}function Rc(a,b,c){a.curOp.viewChanged=!0;var d=a.display,e=a.display.externalMeasured;if(e&&b>=e.lineN&&b<e.lineN+e.size&&(d.externalMeasured=null),!(b<d.viewFrom\|\|b>=d.viewTo)){var f=d.view[Tc(a,b)];if(null!=f.node){var g=f.changes\|\|(f.changes=[]);-1==Mg(g,c)&&g.push(c)}}}function Sc(a){a.display.viewFrom=a.display.viewTo=a.doc.first,a.display.view=[],a.display.viewOffset=0}function Tc(a,b){if(b>=a.display.viewTo)return null;if(b-=a.display.viewFrom,0>b)return null;for(var c=a.display.view,d=0;d<c.length;d++)if(b-=c[d].size,0>b)return d}function Uc(a,b,c,d){var f,e=Tc(a,b),g=a.display.view;if(!v\|\|c==a.doc.first+a.doc.size)return{index:e,lineN:c};for(var h=0,i=a.display.viewFrom;e>h;h++)i+=g[h].size;if(i!=b){if(d>0){if(e==g.length-1)return null;f=i+g[e].size-b,e++}else f=i-b;b+=f,c+=f}for(;cf(a.doc,c)!=c;){if(e==(0>d?0:g.length-1))return null;c+=dg[e-(0>d?1:0)].size,e+=d}return{index:e,lineN:c}}function Vc(a,b,c){var d=a.display,e=d.view;0==e.length\|\|b>=d.viewTo\|\|c<=d.viewFrom?(d.view=Pc(a,b,c),d.viewFrom=b):(d.viewFrom>b?d.view=Pc(a,b,d.viewFrom).concat(d.view):d.viewFrom<b&&(d.view=d.view.slice(Tc(a,b))),d.viewFrom=b,d.viewTo<c?d.view=d.view.concat(Pc(a,d.viewTo,c)):d.viewTo>c&&(d.view=d.view.slice(0,Tc(a,c)))),d.viewTo=c}function Wc(a){for(var b=a.display.view,c=0,d=0;d<b.length;d++){var e=b[d];e.hidden\|\|e.node&&!e.changes\|\|++c}return c}function Xc(a){a.display.pollingFast\|\|a.display.poll.set(a.options.pollInterval,function(){$c(a),a.state.focused&&Xc(a)})}function Yc(a){function c(){var d=$c(a);d\|\|b?(a.display.pollingFast=!1,Xc(a)):(b=!0,a.display.poll.set(60,c))}var b=!1;a.display.pollingFast=!0,a.display.poll.set(20,c)}function $c(a){var b=a.display.input,c=a.display.prevInput,f=a.doc;if(!a.state.focused\|\|rh(b)&&!c\|\|cd(a)\|\|a.options.disableInput)return!1;a.state.pasteIncoming&&a.state.fakedLastChar&&(b.value=b.value.substring(0,b.value.length-1),a.state.fakedLastChar=!1);var g=b.value;if(g==c&&!a.somethingSelected())return!1;if(d&&e>=9&&a.display.inputHasSelection===g\|\|p&&/[\uf700-\uf7ff]/.test(g))return _c(a),!1;var h=!a.curOp;h&&Bc(a),a.display.shift=!1,8203!=g.charCodeAt(0)\|\|f.sel!=a.display.selForContextMenu\|\|c\|\|(c="\u200b");for(var i=0,j=Math.min(c.length,g.length);j>i&&c.charCodeAt(i)==g.charCodeAt(i);)++i;var k=g.slice(i),l=qh(k),m=null;a.state.pasteIncoming&&f.sel.ranges.length>1&&(Zc&&Zc.join("\n")==k?m=0==f.sel.ranges.length%Zc.length&&Ng(Zc,qh):l.length==f.sel.ranges.length&&(m=Ng(l,function(a){return[a]})));for(var n=f.sel.ranges.length-1;n>=0;n--){var o=f.sel.ranges[n],q=o.from(),r=o.to();i<c.length?q=nb(q.line,q.ch-(c.length-i)):a.state.overwrite&&o.empty()&&!a.state.pasteIncoming&&(r=nb(r.line,Math.min(Pf(f,r.line).text.length,r.ch+Kg(l).length)));var s=a.curOp.updateInput,t={from:q,to:r,text:m?m[n%m.length]:l,origin:a.state.pasteIncoming?"paste":a.state.cutIncoming?"cut":"+input"};if(Rd(a.doc,t),ug(a,"inputRead",a,t),k&&!a.state.pasteIncoming&&a.options.electricChars&&a.options.smartIndent&&o.head.ch<100&&(!n\|\|f.sel.ranges[n-1].head.line!=o.head.line)){var u=a.getModeAt(o.head);if(u.electricChars){for(var v=0;v<u.electricChars.length;v++)if(k.indexOf(u.electricChars.charAt(v))>-1){de(a,o.head.line,"smart");break}}else if(u.electricInput){var w=Ld(t);u.electricInput.test(Pf(f,w.line).text.slice(0,w.ch))&&de(a,o.head.line,"smart")}}}return be(a),a.curOp.updateInput=s,a.curOp.typing=!0,g.length>1e3\|\|g.indexOf("\n")>-1?b.value=a.display.prevInput="":a.display.prevInput=g,h&&Dc(a),a.state.pasteIncoming=a.state.cutIncoming=!1,!0}function _c(a,b){var c,f,g=a.doc;if(a.somethingSelected()){a.display.prevInput="";var h=g.sel.primary();c=sh&&(h.to().line-h.from().line>100\|\|(f=a.getSelection()).length>1e3);var i=c?"-":f\|\|a.getSelection();a.display.input.value=i,a.state.focused&&Lg(a.display.input),d&&e>=9&&(a.display.inputHasSelection=i)}else b\|\|(a.display.prevInput=a.display.input.value="",d&&e>=9&&(a.display.inputHasSelection=null));a.display.inaccurateSelection=c}function ad(a){"nocursor"==a.options.readOnly\|\|o&&ah()==a.display.input\|\|a.display.input.focus()}function bd(a){a.state.focused\|\|(ad(a),Hd(a))}function cd(a){return a.options.readOnly\|\|a.doc.cantEdit}function dd(a){function c(){a.state.focused&&setTimeout(Qg(ad,a),0)}function g(b){wg(a,b)\|\|ng(b)}function h(c){if(a.somethingSelected())Zc=a.getSelections(),b.inaccurateSelection&&(b.prevInput="",b.inaccurateSelection=!1,b.input.value=Zc.join("\n"),Lg(b.input));else{for(var d=[],e=[],f=0;f<a.doc.sel.ranges.length;f++){var g=a.doc.sel.ranges[f].head.line,h={anchor:nb(g,0),head:nb(g+1,0)};e.push(h),d.push(a.getRange(h.anchor,h.head))}"cut"==c.type?a.setSelections(e,null,Cg):(b.prevInput="",b.input.value=d.join("\n"),Lg(b.input)),Zc=d}"cut"==c.type&&(a.state.cutIncoming=!0)}var b=a.display;qg(b.scroller,"mousedown",Lc(a,hd)),d&&11>e?qg(b.scroller,"dblclick",Lc(a,function(b){if(!wg(a,b)){var c=gd(a,b);if(c&&!od(a,b)&&!fd(a.display,b)){kg(b);var d=ie(a,c);Cb(a.doc,d.anchor,d.head)}}})):qg(b.scroller,"dblclick",function(b){wg(a,b)\|\|kg(b)}),qg(b.lineSpace,"selectstart",function(a){fd(b,a)\|\|kg(a)}),t\|\|qg(b.scroller,"contextmenu",function(b){Jd(a,b)}),qg(b.scroller,"scroll",function(){b.scroller.clientHeight&&(sd(a,b.scroller.scrollTop),td(a,b.scroller.scrollLeft,!0),sg(a,"scroll",a))}),qg(b.scrollbarV,"scroll",function(){b.scroller.clientHeight&&sd(a,b.scrollbarV.scrollTop)}),qg(b.scrollbarH,"scroll",function(){b.scroller.clientHeight&&td(a,b.scrollbarH.scrollLeft)}),qg(b.scroller,"mousewheel",function(b){wd(a,b)}),qg(b.scroller,"DOMMouseScroll",function(b){wd(a,b)}),qg(b.scrollbarH,"mousedown",c),qg(b.scrollbarV,"mousedown",c),qg(b.wrapper,"scroll",function(){b.wrapper.scrollTop=b.wrapper.scrollLeft=0}),qg(b.input,"keyup",function(b){Fd.call(a,b)}),qg(b.input,"input",function(){d&&e>=9&&a.display.inputHasSelection&&(a.display.inputHasSelection=null),Yc(a)}),qg(b.input,"keydown",Lc(a,Dd)),qg(b.input,"keypress",Lc(a,Gd)),qg(b.input,"focus",Qg(Hd,a)),qg(b.input,"blur",Qg(Id,a)),a.options.dragDrop&&(qg(b.scroller,"dragstart",function(b){rd(a,b)}),qg(b.scroller,"dragenter",g),qg(b.scroller,"dragover",g),qg(b.scroller,"drop",Lc(a,qd))),qg(b.scroller,"paste",function(c){fd(b,c)\|\|(a.state.pasteIncoming=!0,ad(a),Yc(a))}),qg(b.input,"paste",function(){if(f&&!a.state.fakedLastChar&&!(new Date-a.state.lastMiddleDown<200)){var c=b.input.selectionStart,d=b.input.selectionEnd;b.input.value+="$",b.input.selectionEnd=d,b.input.selectionStart=c,a.state.fakedLastChar=!0}a.state.pasteIncoming=!0,Yc(a)}),qg(b.input,"cut",h),qg(b.input,"copy",h),k&&qg(b.sizer,"mouseup",function(){ah()==b.input&&b.input.blur(),ad(a)})}function ed(a){var b=a.display;b.cachedCharWidth=b.cachedTextHeight=b.cachedPaddingH=null,a.setSize()}function fd(a,b){for(var c=og(b);c!=a.wrapper;c=c.parentNode)if(!c\|\|c.ignoreEvents\|\|c.parentNode==a.sizer&&c!=a.mover)return!0}function gd(a,b,c,d){var e=a.display;if(!c){var f=og(b);if(f==e.scrollbarH\|\|f==e.scrollbarV\|\|f==e.scrollbarFiller\|\|f==e.gutterFiller)return null}var g,h,i=e.lineSpace.getBoundingClientRect();try{g=b.clientX-i.left,h=b.clientY-i.top}catch(b){return null}var k,j=uc(a,g,h);if(d&&1==j.xRel&&(k=Pf(a.doc,j.line).text).length==j.ch){var l=Gg(k,k.length,a.options.tabSize)-k.length;j=nb(j.line,Math.max(0,Math.round((g-$b(a.display).left)/yc(a.display))-l))}return j}function hd(a){if(!wg(this,a)){var b=this,c=b.display;if(c.shift=a.shiftKey,fd(c,a))return f\|\|(c.scroller.draggable=!1,setTimeout(function(){c.scroller.draggable=!0},100)),void 0;if(!od(b,a)){var d=gd(b,a);switch(window.focus(),pg(a)){case 1:d?kd(b,a,d):og(a)==c.scroller&&kg(a);break;case 2:f&&(b.state.lastMiddleDown=+new Date),d&&Cb(b.doc,d),setTimeout(Qg(ad,b),20),kg(a);break;case 3:t&&Jd(b,a)}}}}function kd(a,b,c){setTimeout(Qg(bd,a),0);var e,d=+new Date;jd&&jd.time>d-400&&0==ob(jd.pos,c)?e="triple":id&&id.time>d-400&&0==ob(id.pos,c)?(e="double",jd={time:d,pos:c}):(e="single",id={time:d,pos:c});var f=a.doc.sel,g=p?b.metaKey:b.ctrlKey;a.options.dragDrop&&jh&&!cd(a)&&"single"==e&&f.contains(c)>-1&&f.somethingSelected()?ld(a,b,c,g):md(a,b,c,e,g)}function ld(a,b,c,g){var h=a.display,i=Lc(a,function(j){f&&(h.scroller.draggable=!1),a.state.draggingText=!1,rg(document,"mouseup",i),rg(h.scroller,"drop",i),Math.abs(b.clientX-j.clientX)+Math.abs(b.clientY-j.clientY)<10&&(kg(j),g\|\|Cb(a.doc,c),ad(a),d&&9==e&&setTimeout(function(){document.body.focus(),ad(a)},20))});f&&(h.scroller.draggable=!0),a.state.draggingText=i,h.scroller.dragDrop&&h.scroller.dragDrop(),qg(document,"mouseup",i),qg(h.scroller,"drop",i)}function md(a,b,c,d,e){function n(b){if(0!=ob(m,b))if(m=b,"rect"==d){for(var e=[],f=a.options.tabSize,k=Gg(Pf(g,c.line).text,c.ch,f),l=Gg(Pf(g,b.line).text,b.ch,f),n=Math.min(k,l),o=Math.max(k,l),p=Math.min(c.line,b.line),q=Math.min(a.lastLine(),Math.max(c.line,b.line));q>=p;p++){var r=Pf(g,p).text,s=Hg(r,n,f);n==o?e.push(new tb(nb(p,s),nb(p,s))):r.length>s&&e.push(new tb(nb(p,s),nb(p,Hg(r,o,f))))}e.length\|\|e.push(new tb(c,c)),Ib(g,ub(j.ranges.slice(0,i).concat(e),i),{origin:"mouse",scroll:!1}),a.scrollIntoView(b)}else{var t=h,u=t.anchor,v=b;if("single"!=d){if("double"==d)var w=ie(a,b);else var w=new tb(nb(b.line,0),xb(g,nb(b.line+1,0)));ob(w.anchor,u)>0?(v=w.head,u=rb(t.from(),w.anchor)):(v=w.anchor,u=qb(t.to(),w.head))}var e=j.ranges.slice(0);e[i]=new tb(xb(g,u),v),Ib(g,ub(e,i),Dg)}}function q(b){var c=++p,e=gd(a,b,!0,"rect"==d);if(e)if(0!=ob(e,m)){bd(a),n(e);var h=O(f,g);(e.line>=h.to\|\|e.line<h.from)&&setTimeout(Lc(a,function(){p==c&&q(b)}),150)}else{var i=b.clientY<o.top?-20:b.clientY>o.bottom?20:0;i&&setTimeout(Lc(a,function(){p==c&&(f.scroller.scrollTop+=i,q(b))}),50)}}function r(b){p=1/0,kg(b),ad(a),rg(document,"mousemove",s),rg(document,"mouseup",t),g.history.lastSelOrigin=null}var f=a.display,g=a.doc;kg(b);var h,i,j=g.sel;if(e&&!b.shiftKey?(i=g.sel.contains(c),h=i>-1?g.sel.ranges[i]:new tb(c,c)):h=g.sel.primary(),b.altKey)d="rect",e\|\|(h=new tb(c,c)),c=gd(a,b,!0,!0),i=-1;else if("double"==d){var k=ie(a,c);h=a.display.shift\|\|g.extend?Bb(g,h,k.anchor,k.head):k}else if("triple"==d){var l=new tb(nb(c.line,0),xb(g,nb(c.line+1,0)));h=a.display.shift\|\|g.extend?Bb(g,h,l.anchor,l.head):l}else h=Bb(g,h,c);e?i>-1?Eb(g,i,h,Dg):(i=g.sel.ranges.length,Ib(g,ub(g.sel.ranges.concat([h]),i),{scroll:!1,origin:"mouse"})):(i=0,Ib(g,new sb([h],0),Dg),j=g.sel);var m=c,o=f.wrapper.getBoundingClientRect(),p=0,s=Lc(a,function(a){pg(a)?q(a):r(a)}),t=Lc(a,r);qg(document,"mousemove",s),qg(document,"mouseup",t)}function nd(a,b,c,d,e){try{var f=b.clientX,g=b.clientY}catch(b){return!1}if(f>=Math.floor(a.display.gutters.getBoundingClientRect().right))return!1;d&&kg(b);var h=a.display,i=h.lineDiv.getBoundingClientRect();if(g>i.bottom\|\|!yg(a,c))return mg(b);g-=i.top-h.viewOffset;for(var j=0;j<a.options.gutters.length;++j){var k=h.gutters.childNodes[j];if(k&&k.getBoundingClientRect().right>=f){var l=Uf(a.doc,g),m=a.options.gutters[j];return e(a,c,a,l,m,b),mg(b)}}}function od(a,b){return nd(a,b,"gutterClick",!0,ug)}function qd(a){var b=this;if(!wg(b,a)&&!fd(b.display,a)){kg(a),d&&(pd=+new Date);var c=gd(b,a,!0),e=a.dataTransfer.files;if(c&&!cd(b))if(e&&e.length&&window.FileReader&&window.File)for(var f=e.length,g=Array(f),h=0,i=function(a,d){var e=new FileReader;e.onload=Lc(b,function(){if(g[d]=e.result,++h==f){c=xb(b.doc,c);var a={from:c,to:c,text:qh(g.join("\n")),origin:"paste"};Rd(b.doc,a),Hb(b.doc,vb(c,Ld(a)))}}),e.readAsText(a)},j=0;f>j;++j)i(e[j],j);else{if(b.state.draggingText&&b.doc.sel.contains(c)>-1)return b.state.draggingText(a),setTimeout(Qg(ad,b),20),void 0;try{var g=a.dataTransfer.getData("Text");if(g){if(b.state.draggingText&&!(p?a.metaKey:a.ctrlKey))var k=b.listSelections();if(Jb(b.doc,vb(c,c)),k)for(var j=0;j<k.length;++j)Xd(b.doc,"",k[j].anchor,k[j].head,"drag");b.replaceSelection(g,"around","paste"),ad(b)}}catch(a){}}}}function rd(a,b){if(d&&(!a.state.draggingText\|\|+new Date-pd<100))return ng(b),void 0;if(!wg(a,b)&&!fd(a.display,b)&&(b.dataTransfer.setData("Text",a.getSelection()),b.dataTransfer.setDragImage&&!j)){var c=Xg("img",null,null,"position: fixed; left: 0; top: 0;");c.src="data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==",i&&(c.width=c.height=1,a.display.wrapper.appendChild(c),c._top=c.offsetTop),b.dataTransfer.setDragImage(c,0,0),i&&c.parentNode.removeChild(c)}}function sd(b,c){Math.abs(b.doc.scrollTop-c)<2\|\|(b.doc.scrollTop=c,a\|\|W(b,{top:c}),b.display.scroller.scrollTop!=c&&(b.display.scroller.scrollTop=c),b.display.scrollbarV.scrollTop!=c&&(b.display.scrollbarV.scrollTop=c),a&&W(b),Ub(b,100))}function td(a,b,c){(c?b==a.doc.scrollLeft:Math.abs(a.doc.scrollLeft-b)<2)\|\|(b=Math.min(b,a.display.scroller.scrollWidth-a.display.scroller.clientWidth),a.doc.scrollLeft=b,P(a),a.display.scroller.scrollLeft!=b&&(a.display.scroller.scrollLeft=b),a.display.scrollbarH.scrollLeft!=b&&(a.display.scrollbarH.scrollLeft=b))}function wd(b,c){var d=c.wheelDeltaX,e=c.wheelDeltaY;null==d&&c.detail&&c.axis==c.HORIZONTAL_AXIS&&(d=c.detail),null==e&&c.detail&&c.axis==c.VERTICAL_AXIS?e=c.detail:null==e&&(e=c.wheelDelta);var g=b.display,h=g.scroller;if(d&&h.scrollWidth>h.clientWidth\|\|e&&h.scrollHeight>h.clientHeight){if(e&&p&&f)a:for(var j=c.target,k=g.view;j!=h;j=j.parentNode)for(var l=0;l<k.length;l++)if(k[l].node==j){b.display.currentWheelTarget=j;break a}if(d&&!a&&!i&&null!=vd)return e&&sd(b,Math.max(0,Math.min(h.scrollTop+evd,h.scrollHeight-h.clientHeight))),td(b,Math.max(0,Math.min(h.scrollLeft+dvd,h.scrollWidth-h.clientWidth))),kg(c),g.wheelStartX=null,void 0;if(e&&null!=vd){var m=evd,n=b.doc.scrollTop,o=n+g.wrapper.clientHeight;0>m?n=Math.max(0,n+m-50):o=Math.min(b.doc.height,o+m+50),W(b,{top:n,bottom:o})}20>ud&&(null==g.wheelStartX?(g.wheelStartX=h.scrollLeft,g.wheelStartY=h.scrollTop,g.wheelDX=d,g.wheelDY=e,setTimeout(function(){if(null!=g.wheelStartX){var a=h.scrollLeft-g.wheelStartX,b=h.scrollTop-g.wheelStartY,c=b&&g.wheelDY&&b/g.wheelDY\|\|a&&g.wheelDX&&a/g.wheelDX;g.wheelStartX=g.wheelStartY=null,c&&(vd=(vdud+c)/(ud+1),++ud)}},200)):(g.wheelDX+=d,g.wheelDY+=e))}}function xd(a,b,c){if("string"==typeof b&&(b=ue[b],!b))return!1;a.display.pollingFast&&$c(a)&&(a.display.pollingFast=!1);var d=a.display.shift,e=!1;try{cd(a)&&(a.state.suppressEdits=!0),c&&(a.display.shift=!1),e=b(a)!=Bg}finally{a.display.shift=d,a.state.suppressEdits=!1}return e}function yd(a){var b=a.state.keyMaps.slice(0);return a.options.extraKeys&&b.push(a.options.extraKeys),b.push(a.options.keyMap),b}function Ad(a,b){var c=we(a.options.keyMap),d=c.auto;clearTimeout(zd),d&&!ye(b)&&(zd=setTimeout(function(){we(a.options.keyMap)==c&&(a.options.keyMap=d.call?d.call(null,a):d,D(a))},50));var e=ze(b,!0),f=!1;if(!e)return!1;var g=yd(a);return f=b.shiftKey?xe("Shift-"+e,g,function(b){return xd(a,b,!0)})\|\|xe(e,g,function(b){return("string"==typeof b?/^go[A-Z]/.test(b):b.motion)?xd(a,b):void 0}):xe(e,g,function(b){return xd(a,b)}),f&&(kg(b),Tb(a),ug(a,"keyHandled",a,e,b)),f}function Bd(a,b,c){var d=xe("'"+c+"'",yd(a),function(b){return xd(a,b,!0)});return d&&(kg(b),Tb(a),ug(a,"keyHandled",a,"'"+c+"'",b)),d}function Dd(a){var b=this;if(bd(b),!wg(b,a)){d&&11>e&&27==a.keyCode&&(a.returnValue=!1);var c=a.keyCode;b.display.shift=16==c\|\|a.shiftKey;var f=Ad(b,a);i&&(Cd=f?c:null,!f&&88==c&&!sh&&(p?a.metaKey:a.ctrlKey)&&b.replaceSelection("",null,"cut")),18!=c\|\|/\bCodeMirror-crosshair\b/.test(b.display.lineDiv.className)\|\|Ed(b)}}function Ed(a){function c(a){18!=a.keyCode&&a.altKey\|\|(ch(b,"CodeMirror-crosshair"),rg(document,"keyup",c),rg(document,"mouseover",c))}var b=a.display.lineDiv;dh(b,"CodeMirror-crosshair"),qg(document,"keyup",c),qg(document,"mouseover",c)}function Fd(a){16==a.keyCode&&(this.doc.sel.shift=!1),wg(this,a)}function Gd(a){var b=this;if(!(wg(b,a)\|\|a.ctrlKey&&!a.altKey\|\|p&&a.metaKey)){var c=a.keyCode,f=a.charCode;if(i&&c==Cd)return Cd=null,kg(a),void 0;if(!(i&&(!a.which\|\|a.which<10)\|\|k)\|\|!Ad(b,a)){var g=String.fromCharCode(null==f?c:f);Bd(b,a,g)\|\|(d&&e>=9&&(b.display.inputHasSelection=null),Yc(b))}}}function Hd(a){"nocursor"!=a.options.readOnly&&(a.state.focused\|\|(sg(a,"focus",a),a.state.focused=!0,dh(a.display.wrapper,"CodeMirror-focused"),a.curOp\|\|a.display.selForContextMenu==a.doc.sel\|\|(_c(a),f&&setTimeout(Qg(_c,a,!0),0))),Xc(a),Tb(a))}function Id(a){a.state.focused&&(sg(a,"blur",a),a.state.focused=!1,ch(a.display.wrapper,"CodeMirror-focused")),clearInterval(a.display.blinker),setTimeout(function(){a.state.focused\|\|(a.display.shift=!1)},150)}function Jd(a,b){function m(){if(null!=c.input.selectionStart){var b=a.somethingSelected(),d=c.input.value="\u200b"+(b?c.input.value:"");c.prevInput=b?"":"\u200b",c.input.selectionStart=1,c.input.selectionEnd=d.length,c.selForContextMenu=a.doc.sel}}function n(){if(c.inputDiv.style.position="relative",c.input.style.cssText=k,d&&9>e&&(c.scrollbarV.scrollTop=c.scroller.scrollTop=h),Xc(a),null!=c.input.selectionStart){(!d\|\|d&&9>e)&&m();var b=0,f=function(){c.selForContextMenu==a.doc.sel&&0==c.input.selectionStart?Lc(a,ue.selectAll)(a):b++<10?c.detectingSelectAll=setTimeout(f,500):_c(a)};c.detectingSelectAll=setTimeout(f,200)}}if(!wg(a,b,"contextmenu")){var c=a.display;if(!fd(c,b)&&!Kd(a,b)){var g=gd(a,b),h=c.scroller.scrollTop;if(g&&!i){var j=a.options.resetSelectionOnContextMenu;j&&-1==a.doc.sel.contains(g)&&Lc(a,Ib)(a.doc,vb(g),Cg);var k=c.input.style.cssText;if(c.inputDiv.style.position="absolute",c.input.style.cssText="position: fixed; width: 30px; height: 30px; top: "+(b.clientY-5)+"px; left: "+(b.clientX-5)+"px; z-index: 1000; background: "+(d?"rgba(255, 255, 255, .05)":"transparent")+"; outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);",f)var l=window.scrollY;if(ad(a),f&&window.scrollTo(null,l),_c(a),a.somethingSelected()\|\|(c.input.value=c.prevInput=" "),c.selForContextMenu=a.doc.sel,clearTimeout(c.detectingSelectAll),d&&e>=9&&m(),t){ng(b);var o=function(){rg(window,"mouseup",o),setTimeout(n,20)};qg(window,"mouseup",o)}else setTimeout(n,50)}}}}function Kd(a,b){return yg(a,"gutterContextMenu")?nd(a,b,"gutterContextMenu",!1,sg):!1}function Md(a,b){if(ob(a,b.from)<0)return a;if(ob(a,b.to)<=0)return Ld(b);var c=a.line+b.text.length-(b.to.line-b.from.line)-1,d=a.ch;return a.line==b.to.line&&(d+=Ld(b).ch-b.to.ch),nb(c,d)}function Nd(a,b){for(var c=[],d=0;d<a.sel.ranges.length;d++){var e=a.sel.ranges[d];c.push(new tb(Md(e.anchor,b),Md(e.head,b)))}return ub(c,a.sel.primIndex)}function Od(a,b,c){return a.line==b.line?nb(c.line,a.ch-b.ch+c.ch):nb(c.line+(a.line-b.line),a.ch)}function Pd(a,b,c){for(var d=[],e=nb(a.first,0),f=e,g=0;g<b.length;g++){var h=b[g],i=Od(h.from,e,f),j=Od(Ld(h),e,f);if(e=h.to,f=j,"around"==c){var k=a.sel.ranges[g],l=ob(k.head,k.anchor)<0;d[g]=new tb(l?j:i,l?i:j)}else d[g]=new tb(i,i)}return new sb(d,a.sel.primIndex)}function Qd(a,b,c){var d={canceled:!1,from:b.from,to:b.to,text:b.text,origin:b.origin,cancel:function(){this.canceled=!0}};return c&&(d.update=function(b,c,d,e){b&&(this.from=xb(a,b)),c&&(this.to=xb(a,c)),d&&(this.text=d),void 0!==e&&(this.origin=e)}),sg(a,"beforeChange",a,d),a.cm&&sg(a.cm,"beforeChange",a.cm,d),d.canceled?null:{from:d.from,to:d.to,text:d.text,origin:d.origin}}function Rd(a,b,c){if(a.cm){if(!a.cm.curOp)return Lc(a.cm,Rd)(a,b,c);if(a.cm.state.suppressEdits)return}if(!(yg(a,"beforeChange")\|\|a.cm&&yg(a.cm,"beforeChange"))\|\|(b=Qd(a,b,!0))){var d=u&&!c&&Se(a,b.from,b.to);if(d)for(var e=d.length-1;e>=0;--e)Sd(a,{from:d[e].from,to:d[e].to,text:e?[""]:b.text});else Sd(a,b)}}function Sd(a,b){if(1!=b.text.length\|\|""!=b.text[0]\|\|0!=ob(b.from,b.to)){var c=Nd(a,b);_f(a,b,c,a.cm?a.cm.curOp.id:0/0),Vd(a,b,c,Pe(a,b));var d=[];Nf(a,function(a,c){c\|\|-1!=Mg(d,a.history)\|\|(jg(a.history,b),d.push(a.history)),Vd(a,b,null,Pe(a,b))})}}function Td(a,b,c){if(!a.cm\|\|!a.cm.state.suppressEdits){for(var e,d=a.history,f=a.sel,g="undo"==b?d.done:d.undone,h="undo"==b?d.undone:d.done,i=0;i<g.length&&(e=g[i],c?!e.ranges\|\|e.equals(a.sel):e.ranges);i++);if(i!=g.length){for(d.lastOrigin=d.lastSelOrigin=null;e=g.pop(),e.ranges;){if(cg(e,h),c&&!e.equals(a.sel))return Ib(a,e,{clearRedo:!1}),void 0;f=e}var j=[];cg(f,h),h.push({changes:j,generation:d.generation}),d.generation=e.generation\|\|++d.maxGeneration;for(var k=yg(a,"beforeChange")\|\|a.cm&&yg(a.cm,"beforeChange"),i=e.changes.length-1;i>=0;--i){var l=e.changes[i];if(l.origin=b,k&&!Qd(a,l,!1))return g.length=0,void 0;j.push(Yf(a,l));var m=i?Nd(a,l):Kg(g);Vd(a,l,m,Re(a,l)),!i&&a.cm&&a.cm.scrollIntoView({from:l.from,to:Ld(l)});var n=[];Nf(a,function(a,b){b\|\|-1!=Mg(n,a.history)\|\|(jg(a.history,l),n.push(a.history)),Vd(a,l,null,Re(a,l))})}}}}function Ud(a,b){if(0!=b&&(a.first+=b,a.sel=new sb(Ng(a.sel.ranges,function(a){return new tb(nb(a.anchor.line+b,a.anchor.ch),nb(a.head.line+b,a.head.ch))}),a.sel.primIndex),a.cm)){Qc(a.cm,a.first,a.first-b,b);for(var c=a.cm.display,d=c.viewFrom;d<c.viewTo;d++)Rc(a.cm,d,"gutter")}}function Vd(a,b,c,d){if(a.cm&&!a.cm.curOp)return Lc(a.cm,Vd)(a,b,c,d);if(b.to.line<a.first)return Ud(a,b.text.length-1-(b.to.line-b.from.line)),void 0;if(!(b.from.line>a.lastLine())){if(b.from.line<a.first){var e=b.text.length-1-(a.first-b.from.line);Ud(a,e),b={from:nb(a.first,0),to:nb(b.to.line+e,b.to.ch),text:[Kg(b.text)],origin:b.origin}}var f=a.lastLine();b.to.line>f&&(b={from:b.from,to:nb(f,Pf(a,f).text.length),text:[b.text[0]],origin:b.origin}),b.removed=Qf(a,b.from,b.to),c\|\|(c=Nd(a,b)),a.cm?Wd(a.cm,b,d):Gf(a,b,d),Jb(a,c,Cg)}}function Wd(a,b,c){var d=a.doc,e=a.display,f=b.from,g=b.to,h=!1,i=f.line;a.options.lineWrapping\|\|(i=Tf(af(Pf(d,f.line))),d.iter(i,g.line+1,function(a){return a==e.maxLine?(h=!0,!0):void 0})),d.sel.contains(b.from,b.to)>-1&&xg(a),Gf(d,b,c,B(a)),a.options.lineWrapping\|\|(d.iter(i,f.line+b.text.length,function(a){var b=I(a);b>e.maxLineLength&&(e.maxLine=a,e.maxLineLength=b,e.maxLineChanged=!0,h=!1)}),h&&(a.curOp.updateMaxLine=!0)),d.frontier=Math.min(d.frontier,f.line),Ub(a,400);var j=b.text.length-(g.line-f.line)-1;f.line!=g.line\|\|1!=b.text.length\|\|Ff(a.doc,b)?Qc(a,f.line,g.line+1,j):Rc(a,f.line,"text");var k=yg(a,"changes"),l=yg(a,"change");if(l\|\|k){var m={from:f,to:g,text:b.text,removed:b.removed,origin:b.origin};l&&ug(a,"change",a,m),k&&(a.curOp.changeObjs\|\|(a.curOp.changeObjs=[])).push(m)}a.display.selForContextMenu=null}function Xd(a,b,c,d,e){if(d\|\|(d=c),ob(d,c)<0){var f=d;d=c,c=f}"string"==typeof b&&(b=qh(b)),Rd(a,{from:c,to:d,text:b,origin:e})}function Yd(a,b){var c=a.display,d=c.sizer.getBoundingClientRect(),e=null;if(b.top+d.top<0?e=!0:b.bottom+d.top>(window.innerHeight\|\|document.documentElement.clientHeight)&&(e=!1),null!=e&&!m){var f=Xg("div","\u200b",null,"position: absolute; top: "+(b.top-c.viewOffset-Yb(a.display))+"px; height: "+(b.bottom-b.top+Ag)+"px; left: "+b.left+"px; width: 2px;");a.display.lineSpace.appendChild(f),f.scrollIntoView(e),a.display.lineSpace.removeChild(f)}}function Zd(a,b,c,d){for(null==d&&(d=0);;){var e=!1,f=rc(a,b),g=c&&c!=b?rc(a,c):f,h=_d(a,Math.min(f.left,g.left),Math.min(f.top,g.top)-d,Math.max(f.left,g.left),Math.max(f.bottom,g.bottom)+d),i=a.doc.scrollTop,j=a.doc.scrollLeft;if(null!=h.scrollTop&&(sd(a,h.scrollTop),Math.abs(a.doc.scrollTop-i)>1&&(e=!0)),null!=h.scrollLeft&&(td(a,h.scrollLeft),Math.abs(a.doc.scrollLeft-j)>1&&(e=!0)),!e)return f}}function $d(a,b,c,d,e){var f=_d(a,b,c,d,e);null!=f.scrollTop&&sd(a,f.scrollTop),null!=f.scrollLeft&&td(a,f.scrollLeft)}function _d(a,b,c,d,e){var f=a.display,g=xc(a.display);0>c&&(c=0);var h=a.curOp&&null!=a.curOp.scrollTop?a.curOp.scrollTop:f.scroller.scrollTop,i=f.scroller.clientHeight-Ag,j={};e-c>i&&(e=c+i);var k=a.doc.height+Zb(f),l=g>c,m=e>k-g;if(h>c)j.scrollTop=l?0:c;else if(e>h+i){var n=Math.min(c,(m?k:e)-i);n!=h&&(j.scrollTop=n)}var o=a.curOp&&null!=a.curOp.scrollLeft?a.curOp.scrollLeft:f.scroller.scrollLeft,p=f.scroller.clientWidth-Ag,q=d-b>p;return q&&(d=c+i),b<f.gutters.offsetWidth+10?j.scrollLeft=0:o>b?j.scrollLeft=Math.max(0,b-(q?0:10)):d>p+o-3&&(j.scrollLeft=d+(q?0:10)-p),j}function ae(a,b,c){(null!=b\|\|null!=c)&&ce(a),null!=b&&(a.curOp.scrollLeft=(null==a.curOp.scrollLeft?a.doc.scrollLeft:a.curOp.scrollLeft)+b),null!=c&&(a.curOp.scrollTop=(null==a.curOp.scrollTop?a.doc.scrollTop:a.curOp.scrollTop)+c)}function be(a){ce(a);var b=a.getCursor(),c=b,d=b;a.options.lineWrapping\|\|(c=b.ch?nb(b.line,b.ch-1):b,d=nb(b.line,b.ch+1)),a.curOp.scrollToPos={from:c,to:d,margin:a.options.cursorScrollMargin,isCursor:!0}}function ce(a){var b=a.curOp.scrollToPos;if(b){a.curOp.scrollToPos=null;var c=sc(a,b.from),d=sc(a,b.to),e=_d(a,Math.min(c.left,d.left),Math.min(c.top,d.top)-b.margin,Math.max(c.right,d.right),Math.max(c.bottom,d.bottom)+b.margin);a.scrollTo(e.scrollLeft,e.scrollTop)}}function de(a,b,c,d){var f,e=a.doc;null==c&&(c="add"),"smart"==c&&(e.mode.indent?f=Xb(a,b):c="prev");var g=a.options.tabSize,h=Pf(e,b),i=Gg(h.text,null,g);h.stateAfter&&(h.stateAfter=null);var k,j=h.text.match(/^\s/)[0];if(d\|\|/\S/.test(h.text)){if("smart"==c&&(k=e.mode.indent(f,h.text.slice(j.length),h.text),k==Bg\|\|k>150)){if(!d)return;c="prev"}}else k=0,c="not";"prev"==c?k=b>e.first?Gg(Pf(e,b-1).text,null,g):0:"add"==c?k=i+a.options.indentUnit:"subtract"==c?k=i-a.options.indentUnit:"number"==typeof c&&(k=i+c),k=Math.max(0,k);var l="",m=0;if(a.options.indentWithTabs)for(var n=Math.floor(k/g);n;--n)m+=g,l+=" ";if(k>m&&(l+=Jg(k-m)),l!=j)Xd(e,l,nb(b,0),nb(b,j.length),"+input");else for(var n=0;n<e.sel.ranges.length;n++){var o=e.sel.ranges[n];if(o.head.line==b&&o.head.ch<j.length){var m=nb(b,j.length);Eb(e,n,new tb(m,m));break}}h.stateAfter=null}function ee(a,b,c,d){var e=b,f=b;return"number"==typeof b?f=Pf(a,wb(a,b)):e=Tf(b),null==e?null:(d(f,e)&&a.cm&&Rc(a.cm,e,c),f)}function fe(a,b){for(var c=a.doc.sel.ranges,d=[],e=0;e<c.length;e++){for(var f=b(c[e]);d.length&&ob(f.from,Kg(d).to)<=0;){var g=d.pop();if(ob(g.from,f.from)<0){f.from=g.from;break}}d.push(f)}Kc(a,function(){for(var b=d.length-1;b>=0;b--)Xd(a.doc,"",d[b].from,d[b].to,"+delete");be(a)})}function ge(a,b,c,d,e){function k(){var b=f+c;return b<a.first\|\|b>=a.first+a.size?j=!1:(f=b,i=Pf(a,b))}function l(a){var b=(e?Ih:Jh)(i,g,c,!0);if(null==b){if(a\|\|!k())return j=!1;g=e?(0>c?Ah:zh)(i):0>c?i.text.length:0}else g=b;return!0}var f=b.line,g=b.ch,h=c,i=Pf(a,f),j=!0;if("char"==d)l();else if("column"==d)l(!0);else if("word"==d\|\|"group"==d)for(var m=null,n="group"==d,o=a.cm&&a.cm.getHelper(b,"wordChars"),p=!0;!(0>c)\|\|l(!p);p=!1){var q=i.text.charAt(g)\|\|"\n",r=Tg(q,o)?"w":n&&"\n"==q?"n":!n\|\|/\s/.test(q)?null:"p";if(!n\|\|p\|\|r\|\|(r="s"),m&&m!=r){0>c&&(c=1,l());break}if(r&&(m=r),c>0&&!l(!p))break}var s=Nb(a,nb(f,g),h,!0);return j\|\|(s.hitSide=!0),s}function he(a,b,c,d){var g,e=a.doc,f=b.left;if("page"==d){var h=Math.min(a.display.wrapper.clientHeight,window.innerHeight\|\|document.documentElement.clientHeight);g=b.top+c(h-(0>c?1.5:.5)xc(a.display))}else"line"==d&&(g=c>0?b.bottom+3:b.top-3);for(;;){var i=uc(a,f,g);if(!i.outside)break;if(0>c?0>=g:g>=e.height){i.hitSide=!0;break}g+=5*c}return i}function ie(a,b){var c=a.doc,d=Pf(c,b.line).text,e=b.ch,f=b.ch;if(d){var g=a.getHelper(b,"wordChars");(b.xRel<0\|\|f==d.length)&&e?--e:++f;for(var h=d.charAt(e),i=Tg(h,g)?function(a){return Tg(a,g)}:/\s/.test(h)?function(a){return/\s/.test(a)}:function(a){return!/\s/.test(a)&&!Tg(a)};e>0&&i(d.charAt(e-1));)--e;for(;f<d.length&&i(d.charAt(f));)++f}return new tb(nb(b.line,e),nb(b.line,f))}function le(a,b,c,d){w.defaults[a]=b,c&&(ke[a]=d?function(a,b,d){d!=me&&c(a,b,d)}:c)}function we(a){return"string"==typeof a?ve[a]:a}function De(a,b,c,d,e){if(d&&d.shared)return Fe(a,b,c,d,e);if(a.cm&&!a.cm.curOp)return Lc(a.cm,De)(a,b,c,d,e);var f=new Be(a,e),g=ob(b,c);if(d&&Pg(d,f,!1),g>0\|\|0==g&&f.clearWhenEmpty!==!1)return f;if(f.replacedWith&&(f.collapsed=!0,f.widgetNode=Xg("span",[f.replacedWith],"CodeMirror-widget"),d.handleMouseEvents\|\|(f.widgetNode.ignoreEvents=!0),d.insertLeft&&(f.widgetNode.insertLeft=!0)),f.collapsed){if(_e(a,b.line,b,c,f)\|\|b.line!=c.line&&_e(a,c.line,b,c,f))throw new Error("Inserting collapsed marker partially overlapping an existing one");v=!0}f.addToHistory&&_f(a,{from:b,to:c,origin:"markText"},a.sel,0/0);var j,h=b.line,i=a.cm;if(a.iter(h,c.line+1,function(a){i&&f.collapsed&&!i.options.lineWrapping&&af(a)==i.display.maxLine&&(j=!0),f.collapsed&&h!=b.line&&Sf(a,0),Me(a,new Je(f,h==b.line?b.ch:null,h==c.line?c.ch:null)),++h}),f.collapsed&&a.iter(b.line,c.line+1,function(b){ef(a,b)&&Sf(b,0)
11	+ }),f.clearOnEnter&&qg(f,"beforeCursorEnter",function(){f.clear()}),f.readOnly&&(u=!0,(a.history.done.length\|\|a.history.undone.length)&&a.clearHistory()),f.collapsed&&(f.id=++Ce,f.atomic=!0),i){if(j&&(i.curOp.updateMaxLine=!0),f.collapsed)Qc(i,b.line,c.line+1);else if(f.className\|\|f.title\|\|f.startStyle\|\|f.endStyle)for(var k=b.line;k<=c.line;k++)Rc(i,k,"text");f.atomic&&Lb(i.doc),ug(i,"markerAdded",i,f)}return f}function Fe(a,b,c,d,e){d=Pg(d),d.shared=!1;var f=[De(a,b,c,d,e)],g=f[0],h=d.widgetNode;return Nf(a,function(a){h&&(d.widgetNode=h.cloneNode(!0)),f.push(De(a,xb(a,b),xb(a,c),d,e));for(var i=0;i<a.linked.length;++i)if(a.linked[i].isParent)return;g=Kg(f)}),new Ee(f,g)}function Ge(a){return a.findMarks(nb(a.first,0),a.clipPos(nb(a.lastLine())),function(a){return a.parent})}function He(a,b){for(var c=0;c<b.length;c++){var d=b[c],e=d.find(),f=a.clipPos(e.from),g=a.clipPos(e.to);if(ob(f,g)){var h=De(a,f,g,d.primary,d.primary.type);d.markers.push(h),h.parent=d}}}function Ie(a){for(var b=0;b<a.length;b++){var c=a[b],d=[c.primary.doc];Nf(c.primary.doc,function(a){d.push(a)});for(var e=0;e<c.markers.length;e++){var f=c.markers[e];-1==Mg(d,f.doc)&&(f.parent=null,c.markers.splice(e--,1))}}}function Je(a,b,c){this.marker=a,this.from=b,this.to=c}function Ke(a,b){if(a)for(var c=0;c<a.length;++c){var d=a[c];if(d.marker==b)return d}}function Le(a,b){for(var c,d=0;d<a.length;++d)a[d]!=b&&(c\|\|(c=[])).push(a[d]);return c}function Me(a,b){a.markedSpans=a.markedSpans?a.markedSpans.concat([b]):[b],b.marker.attachLine(a)}function Ne(a,b,c){if(a)for(var e,d=0;d<a.length;++d){var f=a[d],g=f.marker,h=null==f.from\|\|(g.inclusiveLeft?f.from<=b:f.from<b);if(h\|\|f.from==b&&"bookmark"==g.type&&(!c\|\|!f.marker.insertLeft)){var i=null==f.to\|\|(g.inclusiveRight?f.to>=b:f.to>b);(e\|\|(e=[])).push(new Je(g,f.from,i?null:f.to))}}return e}function Oe(a,b,c){if(a)for(var e,d=0;d<a.length;++d){var f=a[d],g=f.marker,h=null==f.to\|\|(g.inclusiveRight?f.to>=b:f.to>b);if(h\|\|f.from==b&&"bookmark"==g.type&&(!c\|\|f.marker.insertLeft)){var i=null==f.from\|\|(g.inclusiveLeft?f.from<=b:f.from<b);(e\|\|(e=[])).push(new Je(g,i?null:f.from-b,null==f.to?null:f.to-b))}}return e}function Pe(a,b){var c=zb(a,b.from.line)&&Pf(a,b.from.line).markedSpans,d=zb(a,b.to.line)&&Pf(a,b.to.line).markedSpans;if(!c&&!d)return null;var e=b.from.ch,f=b.to.ch,g=0==ob(b.from,b.to),h=Ne(c,e,g),i=Oe(d,f,g),j=1==b.text.length,k=Kg(b.text).length+(j?e:0);if(h)for(var l=0;l<h.length;++l){var m=h[l];if(null==m.to){var n=Ke(i,m.marker);n?j&&(m.to=null==n.to?null:n.to+k):m.to=e}}if(i)for(var l=0;l<i.length;++l){var m=i[l];if(null!=m.to&&(m.to+=k),null==m.from){var n=Ke(h,m.marker);n\|\|(m.from=k,j&&(h\|\|(h=[])).push(m))}else m.from+=k,j&&(h\|\|(h=[])).push(m)}h&&(h=Qe(h)),i&&i!=h&&(i=Qe(i));var o=[h];if(!j){var q,p=b.text.length-2;if(p>0&&h)for(var l=0;l<h.length;++l)null==h[l].to&&(q\|\|(q=[])).push(new Je(h[l].marker,null,null));for(var l=0;p>l;++l)o.push(q);o.push(i)}return o}function Qe(a){for(var b=0;b<a.length;++b){var c=a[b];null!=c.from&&c.from==c.to&&c.marker.clearWhenEmpty!==!1&&a.splice(b--,1)}return a.length?a:null}function Re(a,b){var c=fg(a,b),d=Pe(a,b);if(!c)return d;if(!d)return c;for(var e=0;e<c.length;++e){var f=c[e],g=d[e];if(f&&g)a:for(var h=0;h<g.length;++h){for(var i=g[h],j=0;j<f.length;++j)if(f[j].marker==i.marker)continue a;f.push(i)}else g&&(c[e]=g)}return c}function Se(a,b,c){var d=null;if(a.iter(b.line,c.line+1,function(a){if(a.markedSpans)for(var b=0;b<a.markedSpans.length;++b){var c=a.markedSpans[b].marker;!c.readOnly\|\|d&&-1!=Mg(d,c)\|\|(d\|\|(d=[])).push(c)}}),!d)return null;for(var e=[{from:b,to:c}],f=0;f<d.length;++f)for(var g=d[f],h=g.find(0),i=0;i<e.length;++i){var j=e[i];if(!(ob(j.to,h.from)<0\|\|ob(j.from,h.to)>0)){var k=[i,1],l=ob(j.from,h.from),m=ob(j.to,h.to);(0>l\|\|!g.inclusiveLeft&&!l)&&k.push({from:j.from,to:h.from}),(m>0\|\|!g.inclusiveRight&&!m)&&k.push({from:h.to,to:j.to}),e.splice.apply(e,k),i+=k.length-1}}return e}function Te(a){var b=a.markedSpans;if(b){for(var c=0;c<b.length;++c)b[c].marker.detachLine(a);a.markedSpans=null}}function Ue(a,b){if(b){for(var c=0;c<b.length;++c)b[c].marker.attachLine(a);a.markedSpans=b}}function Ve(a){return a.inclusiveLeft?-1:0}function We(a){return a.inclusiveRight?1:0}function Xe(a,b){var c=a.lines.length-b.lines.length;if(0!=c)return c;var d=a.find(),e=b.find(),f=ob(d.from,e.from)\|\|Ve(a)-Ve(b);if(f)return-f;var g=ob(d.to,e.to)\|\|We(a)-We(b);return g?g:b.id-a.id}function Ye(a,b){var d,c=v&&a.markedSpans;if(c)for(var e,f=0;f<c.length;++f)e=c[f],e.marker.collapsed&&null==(b?e.from:e.to)&&(!d\|\|Xe(d,e.marker)<0)&&(d=e.marker);return d}function Ze(a){return Ye(a,!0)}function $e(a){return Ye(a,!1)}function _e(a,b,c,d,e){var f=Pf(a,b),g=v&&f.markedSpans;if(g)for(var h=0;h<g.length;++h){var i=g[h];if(i.marker.collapsed){var j=i.marker.find(0),k=ob(j.from,c)\|\|Ve(i.marker)-Ve(e),l=ob(j.to,d)\|\|We(i.marker)-We(e);if(!(k>=0&&0>=l\|\|0>=k&&l>=0)&&(0>=k&&(ob(j.to,c)>0\|\|i.marker.inclusiveRight&&e.inclusiveLeft)\|\|k>=0&&(ob(j.from,d)<0\|\|i.marker.inclusiveLeft&&e.inclusiveRight)))return!0}}}function af(a){for(var b;b=Ze(a);)a=b.find(-1,!0).line;return a}function bf(a){for(var b,c;b=$e(a);)a=b.find(1,!0).line,(c\|\|(c=[])).push(a);return c}function cf(a,b){var c=Pf(a,b),d=af(c);return c==d?b:Tf(d)}function df(a,b){if(b>a.lastLine())return b;var d,c=Pf(a,b);if(!ef(a,c))return b;for(;d=$e(c);)c=d.find(1,!0).line;return Tf(c)+1}function ef(a,b){var c=v&&b.markedSpans;if(c)for(var d,e=0;e<c.length;++e)if(d=c[e],d.marker.collapsed){if(null==d.from)return!0;if(!d.marker.widgetNode&&0==d.from&&d.marker.inclusiveLeft&&ff(a,b,d))return!0}}function ff(a,b,c){if(null==c.to){var d=c.marker.find(1,!0);return ff(a,d.line,Ke(d.line.markedSpans,c.marker))}if(c.marker.inclusiveRight&&c.to==b.text.length)return!0;for(var e,f=0;f<b.markedSpans.length;++f)if(e=b.markedSpans[f],e.marker.collapsed&&!e.marker.widgetNode&&e.from==c.to&&(null==e.to\|\|e.to!=c.from)&&(e.marker.inclusiveLeft\|\|c.marker.inclusiveRight)&&ff(a,b,e))return!0}function hf(a,b,c){Vf(b)<(a.curOp&&a.curOp.scrollTop\|\|a.doc.scrollTop)&&ae(a,null,c)}function jf(a){if(null!=a.height)return a.height;if(!_g(document.body,a.node)){var b="position: relative;";a.coverGutter&&(b+="margin-left: -"+a.cm.getGutterElement().offsetWidth+"px;"),$g(a.cm.display.measure,Xg("div",[a.node],null,b))}return a.height=a.node.offsetHeight}function kf(a,b,c,d){var e=new gf(a,c,d);return e.noHScroll&&(a.display.alignWidgets=!0),ee(a.doc,b,"widget",function(b){var c=b.widgets\|\|(b.widgets=[]);if(null==e.insertAt?c.push(e):c.splice(Math.min(c.length-1,Math.max(0,e.insertAt)),0,e),e.line=b,!ef(a.doc,b)){var d=Vf(b)<a.doc.scrollTop;Sf(b,b.height+jf(e)),d&&ae(a,null,e.height),a.curOp.forceUpdate=!0}return!0}),e}function mf(a,b,c,d){a.text=b,a.stateAfter&&(a.stateAfter=null),a.styles&&(a.styles=null),null!=a.order&&(a.order=null),Te(a),Ue(a,c);var e=d?d(a):1;e!=a.height&&Sf(a,e)}function nf(a){a.parent=null,Te(a)}function of(a,b){if(a)for(;;){var c=a.match(/(?:^\|\s+)line-(background-)?(\S+)/);if(!c)break;a=a.slice(0,c.index)+a.slice(c.index+c[0].length);var d=c[1]?"bgClass":"textClass";null==b[d]?b[d]=c[2]:new RegExp("(?:^\|s)"+c[2]+"(?:$\|s)").test(b[d])\|\|(b[d]+=" "+c[2])}return a}function pf(a,b){if(a.blankLine)return a.blankLine(b);if(a.innerMode){var c=w.innerMode(a,b);return c.mode.blankLine?c.mode.blankLine(c.state):void 0}}function qf(a,b,c){for(var d=0;10>d;d++){var e=a.token(b,c);if(b.pos>b.start)return e}throw new Error("Mode "+a.name+" failed to advance stream.")}function rf(a,b,c,d,e,f,g){var h=c.flattenSpans;null==h&&(h=a.options.flattenSpans);var l,i=0,j=null,k=new Ae(b,a.options.tabSize);for(""==b&&of(pf(c,d),f);!k.eol();){if(k.pos>a.options.maxHighlightLength?(h=!1,g&&uf(a,b,d,k.pos),k.pos=b.length,l=null):l=of(qf(c,k,d),f),a.options.addModeClass){var m=w.innerMode(c,d).mode.name;m&&(l="m-"+(l?m+" "+l:m))}h&&j==l\|\|(i<k.start&&e(k.start,j),i=k.start,j=l),k.start=k.pos}for(;i<k.pos;){var n=Math.min(k.pos,i+5e4);e(n,j),i=n}}function sf(a,b,c,d){var e=[a.state.modeGen],f={};rf(a,b.text,a.doc.mode,c,function(a,b){e.push(a,b)},f,d);for(var g=0;g<a.state.overlays.length;++g){var h=a.state.overlays[g],i=1,j=0;rf(a,b.text,h.mode,!0,function(a,b){for(var c=i;a>j;){var d=e[i];d>a&&e.splice(i,1,a,e[i+1],d),i+=2,j=Math.min(a,d)}if(b)if(h.opaque)e.splice(c,i-c,a,"cm-overlay "+b),i=c+2;else for(;i>c;c+=2){var f=e[c+1];e[c+1]=(f?f+" ":"")+"cm-overlay "+b}},f)}return{styles:e,classes:f.bgClass\|\|f.textClass?f:null}}function tf(a,b){if(!b.styles\|\|b.styles[0]!=a.state.modeGen){var c=sf(a,b,b.stateAfter=Xb(a,Tf(b)));b.styles=c.styles,c.classes?b.styleClasses=c.classes:b.styleClasses&&(b.styleClasses=null)}return b.styles}function uf(a,b,c,d){var e=a.doc.mode,f=new Ae(b,a.options.tabSize);for(f.start=f.pos=d\|\|0,""==b&&pf(e,c);!f.eol()&&f.pos<=a.options.maxHighlightLength;)qf(e,f,c),f.start=f.pos}function xf(a,b){if(!a\|\|/^\s$/.test(a))return null;var c=b.addModeClass?wf:vf;return c[a]\|\|(c[a]=a.replace(/\S+/g,"cm-$&"))}function yf(a,b){var c=Xg("span",null,null,f?"padding-right: .1px":null),e={pre:Xg("pre",[c]),content:c,col:0,pos:0,cm:a};b.measure={};for(var g=0;g<=(b.rest?b.rest.length:0);g++){var i,h=g?b.rest[g-1]:b.line;e.pos=0,e.addToken=Af,(d\|\|f)&&a.getOption("lineWrapping")&&(e.addToken=Bf(e.addToken)),ph(a.display.measure)&&(i=Wf(h))&&(e.addToken=Cf(e.addToken,i)),e.map=[],Ef(h,e,tf(a,h)),h.styleClasses&&(h.styleClasses.bgClass&&(e.bgClass=eh(h.styleClasses.bgClass,e.bgClass\|\|"")),h.styleClasses.textClass&&(e.textClass=eh(h.styleClasses.textClass,e.textClass\|\|""))),0==e.map.length&&e.map.push(0,0,e.content.appendChild(nh(a.display.measure))),0==g?(b.measure.map=e.map,b.measure.cache={}):((b.measure.maps\|\|(b.measure.maps=[])).push(e.map),(b.measure.caches\|\|(b.measure.caches=[])).push({}))}return sg(a,"renderLine",a,b.line,e.pre),e.pre.className&&(e.textClass=eh(e.pre.className,e.textClass\|\|"")),e}function zf(a){var b=Xg("span","\u2022","cm-invalidchar");return b.title="\\u"+a.charCodeAt(0).toString(16),b}function Af(a,b,c,f,g,h){if(b){var i=a.cm.options.specialChars,j=!1;if(i.test(b))for(var k=document.createDocumentFragment(),l=0;;){i.lastIndex=l;var m=i.exec(b),n=m?m.index-l:b.length-l;if(n){var o=document.createTextNode(b.slice(l,l+n));d&&9>e?k.appendChild(Xg("span",[o])):k.appendChild(o),a.map.push(a.pos,a.pos+n,o),a.col+=n,a.pos+=n}if(!m)break;if(l+=n+1," "==m[0]){var p=a.cm.options.tabSize,q=p-a.col%p,o=k.appendChild(Xg("span",Jg(q),"cm-tab"));a.col+=q}else{var o=a.cm.options.specialCharPlaceholder(m[0]);d&&9>e?k.appendChild(Xg("span",[o])):k.appendChild(o),a.col+=1}a.map.push(a.pos,a.pos+1,o),a.pos++}else{a.col+=b.length;var k=document.createTextNode(b);a.map.push(a.pos,a.pos+b.length,k),d&&9>e&&(j=!0),a.pos+=b.length}if(c\|\|f\|\|g\|\|j){var r=c\|\|"";f&&(r+=f),g&&(r+=g);var s=Xg("span",[k],r);return h&&(s.title=h),a.content.appendChild(s)}a.content.appendChild(k)}}function Bf(a){function b(a){for(var b=" ",c=0;c<a.length-2;++c)b+=c%2?" ":"\xa0";return b+=" "}return function(c,d,e,f,g,h){a(c,d.replace(/ {3,}/g,b),e,f,g,h)}}function Cf(a,b){return function(c,d,e,f,g,h){e=e?e+" cm-force-border":"cm-force-border";for(var i=c.pos,j=i+d.length;;){for(var k=0;k<b.length;k++){var l=b[k];if(l.to>i&&l.from<=i)break}if(l.to>=j)return a(c,d,e,f,g,h);a(c,d.slice(0,l.to-i),e,f,null,h),f=null,d=d.slice(l.to-i),i=l.to}}}function Df(a,b,c,d){var e=!d&&c.widgetNode;e&&(a.map.push(a.pos,a.pos+b,e),a.content.appendChild(e)),a.pos+=b}function Ef(a,b,c){var d=a.markedSpans,e=a.text,f=0;if(d)for(var k,m,n,o,p,q,h=e.length,i=0,g=1,j="",l=0;;){if(l==i){m=n=o=p="",q=null,l=1/0;for(var r=[],s=0;s<d.length;++s){var t=d[s],u=t.marker;t.from<=i&&(null==t.to\|\|t.to>i)?(null!=t.to&&l>t.to&&(l=t.to,n=""),u.className&&(m+=" "+u.className),u.startStyle&&t.from==i&&(o+=" "+u.startStyle),u.endStyle&&t.to==l&&(n+=" "+u.endStyle),u.title&&!p&&(p=u.title),u.collapsed&&(!q\|\|Xe(q.marker,u)<0)&&(q=t)):t.from>i&&l>t.from&&(l=t.from),"bookmark"==u.type&&t.from==i&&u.widgetNode&&r.push(u)}if(q&&(q.from\|\|0)==i&&(Df(b,(null==q.to?h+1:q.to)-i,q.marker,null==q.from),null==q.to))return;if(!q&&r.length)for(var s=0;s<r.length;++s)Df(b,0,r[s])}if(i>=h)break;for(var v=Math.min(h,l);;){if(j){var w=i+j.length;if(!q){var x=w>v?j.slice(0,v-i):j;b.addToken(b,x,k?k+m:m,o,i+x.length==l?n:"",p)}if(w>=v){j=j.slice(v-i),i=v;break}i=w,o=""}j=e.slice(f,f=c[g++]),k=xf(c[g++],b.cm.options)}}else for(var g=1;g<c.length;g+=2)b.addToken(b,e.slice(f,f=c[g]),xf(c[g+1],b.cm.options))}function Ff(a,b){return 0==b.from.ch&&0==b.to.ch&&""==Kg(b.text)&&(!a.cm\|\|a.cm.options.wholeLineUpdateBefore)}function Gf(a,b,c,d){function e(a){return c?c[a]:null}function f(a,c,e){mf(a,c,e,d),ug(a,"change",a,b)}var g=b.from,h=b.to,i=b.text,j=Pf(a,g.line),k=Pf(a,h.line),l=Kg(i),m=e(i.length-1),n=h.line-g.line;if(Ff(a,b)){for(var o=0,p=[];o<i.length-1;++o)p.push(new lf(i[o],e(o),d));f(k,k.text,m),n&&a.remove(g.line,n),p.length&&a.insert(g.line,p)}else if(j==k)if(1==i.length)f(j,j.text.slice(0,g.ch)+l+j.text.slice(h.ch),m);else{for(var p=[],o=1;o<i.length-1;++o)p.push(new lf(i[o],e(o),d));p.push(new lf(l+j.text.slice(h.ch),m,d)),f(j,j.text.slice(0,g.ch)+i[0],e(0)),a.insert(g.line+1,p)}else if(1==i.length)f(j,j.text.slice(0,g.ch)+i[0]+k.text.slice(h.ch),e(0)),a.remove(g.line+1,n);else{f(j,j.text.slice(0,g.ch)+i[0],e(0)),f(k,l+k.text.slice(h.ch),m);for(var o=1,p=[];o<i.length-1;++o)p.push(new lf(i[o],e(o),d));n>1&&a.remove(g.line+1,n-1),a.insert(g.line+1,p)}ug(a,"change",a,b)}function Hf(a){this.lines=a,this.parent=null;for(var b=0,c=0;b<a.length;++b)a[b].parent=this,c+=a[b].height;this.height=c}function If(a){this.children=a;for(var b=0,c=0,d=0;d<a.length;++d){var e=a[d];b+=e.chunkSize(),c+=e.height,e.parent=this}this.size=b,this.height=c,this.parent=null}function Nf(a,b,c){function d(a,e,f){if(a.linked)for(var g=0;g<a.linked.length;++g){var h=a.linked[g];if(h.doc!=e){var i=f&&h.sharedHist;(!c\|\|i)&&(b(h.doc,i),d(h.doc,a,i))}}}d(a,null,!0)}function Of(a,b){if(b.cm)throw new Error("This document is already in use.");a.doc=b,b.cm=a,C(a),y(a),a.options.lineWrapping\|\|J(a),a.options.mode=b.modeOption,Qc(a)}function Pf(a,b){if(b-=a.first,0>b\|\|b>=a.size)throw new Error("There is no line "+(b+a.first)+" in the document.");for(var c=a;!c.lines;)for(var d=0;;++d){var e=c.children[d],f=e.chunkSize();if(f>b){c=e;break}b-=f}return c.lines[b]}function Qf(a,b,c){var d=[],e=b.line;return a.iter(b.line,c.line+1,function(a){var f=a.text;e==c.line&&(f=f.slice(0,c.ch)),e==b.line&&(f=f.slice(b.ch)),d.push(f),++e}),d}function Rf(a,b,c){var d=[];return a.iter(b,c,function(a){d.push(a.text)}),d}function Sf(a,b){var c=b-a.height;if(c)for(var d=a;d;d=d.parent)d.height+=c}function Tf(a){if(null==a.parent)return null;for(var b=a.parent,c=Mg(b.lines,a),d=b.parent;d;b=d,d=d.parent)for(var e=0;d.children[e]!=b;++e)c+=d.children[e].chunkSize();return c+b.first}function Uf(a,b){var c=a.first;a:do{for(var d=0;d<a.children.length;++d){var e=a.children[d],f=e.height;if(f>b){a=e;continue a}b-=f,c+=e.chunkSize()}return c}while(!a.lines);for(var d=0;d<a.lines.length;++d){var g=a.lines[d],h=g.height;if(h>b)break;b-=h}return c+d}function Vf(a){a=af(a);for(var b=0,c=a.parent,d=0;d<c.lines.length;++d){var e=c.lines[d];if(e==a)break;b+=e.height}for(var f=c.parent;f;c=f,f=c.parent)for(var d=0;d<f.children.length;++d){var g=f.children[d];if(g==c)break;b+=g.height}return b}function Wf(a){var b=a.order;return null==b&&(b=a.order=Kh(a.text)),b}function Xf(a){this.done=[],this.undone=[],this.undoDepth=1/0,this.lastModTime=this.lastSelTime=0,this.lastOp=this.lastSelOp=null,this.lastOrigin=this.lastSelOrigin=null,this.generation=this.maxGeneration=a\|\|1}function Yf(a,b){var c={from:pb(b.from),to:Ld(b),text:Qf(a,b.from,b.to)};return dg(a,c,b.from.line,b.to.line+1),Nf(a,function(a){dg(a,c,b.from.line,b.to.line+1)},!0),c}function Zf(a){for(;a.length;){var b=Kg(a);if(!b.ranges)break;a.pop()}}function $f(a,b){return b?(Zf(a.done),Kg(a.done)):a.done.length&&!Kg(a.done).ranges?Kg(a.done):a.done.length>1&&!a.done[a.done.length-2].ranges?(a.done.pop(),Kg(a.done)):void 0}function _f(a,b,c,d){var e=a.history;e.undone.length=0;var g,f=+new Date;if((e.lastOp==d\|\|e.lastOrigin==b.origin&&b.origin&&("+"==b.origin.charAt(0)&&a.cm&&e.lastModTime>f-a.cm.options.historyEventDelay\|\|""==b.origin.charAt(0)))&&(g=$f(e,e.lastOp==d))){var h=Kg(g.changes);0==ob(b.from,b.to)&&0==ob(b.from,h.to)?h.to=Ld(b):g.changes.push(Yf(a,b))}else{var i=Kg(e.done);for(i&&i.ranges\|\|cg(a.sel,e.done),g={changes:[Yf(a,b)],generation:e.generation},e.done.push(g);e.done.length>e.undoDepth;)e.done.shift(),e.done[0].ranges\|\|e.done.shift()}e.done.push(c),e.generation=++e.maxGeneration,e.lastModTime=e.lastSelTime=f,e.lastOp=e.lastSelOp=d,e.lastOrigin=e.lastSelOrigin=b.origin,h\|\|sg(a,"historyAdded")}function ag(a,b,c,d){var e=b.charAt(0);return""==e\|\|"+"==e&&c.ranges.length==d.ranges.length&&c.somethingSelected()==d.somethingSelected()&&new Date-a.history.lastSelTime<=(a.cm?a.cm.options.historyEventDelay:500)}function bg(a,b,c,d){var e=a.history,f=d&&d.origin;c==e.lastSelOp\|\|f&&e.lastSelOrigin==f&&(e.lastModTime==e.lastSelTime&&e.lastOrigin==f\|\|ag(a,f,Kg(e.done),b))?e.done[e.done.length-1]=b:cg(b,e.done),e.lastSelTime=+new Date,e.lastSelOrigin=f,e.lastSelOp=c,d&&d.clearRedo!==!1&&Zf(e.undone)}function cg(a,b){var c=Kg(b);c&&c.ranges&&c.equals(a)\|\|b.push(a)}function dg(a,b,c,d){var e=b["spans_"+a.id],f=0;a.iter(Math.max(a.first,c),Math.min(a.first+a.size,d),function(c){c.markedSpans&&((e\|\|(e=b["spans_"+a.id]={}))[f]=c.markedSpans),++f})}function eg(a){if(!a)return null;for(var c,b=0;b<a.length;++b)a[b].marker.explicitlyCleared?c\|\|(c=a.slice(0,b)):c&&c.push(a[b]);return c?c.length?c:null:a}function fg(a,b){var c=b["spans_"+a.id];if(!c)return null;for(var d=0,e=[];d<b.text.length;++d)e.push(eg(c[d]));return e}function gg(a,b,c){for(var d=0,e=[];d<a.length;++d){var f=a[d];if(f.ranges)e.push(c?sb.prototype.deepCopy.call(f):f);else{var g=f.changes,h=[];e.push({changes:h});for(var i=0;i<g.length;++i){var k,j=g[i];if(h.push({from:j.from,to:j.to,text:j.text}),b)for(var l in j)(k=l.match(/^spans_(\d+)$/))&&Mg(b,Number(k[1]))>-1&&(Kg(h)[l]=j[l],delete j[l])}}}return e}function hg(a,b,c,d){c<a.line?a.line+=d:b<a.line&&(a.line=b,a.ch=0)}function ig(a,b,c,d){for(var e=0;e<a.length;++e){var f=a[e],g=!0;if(f.ranges){f.copied\|\|(f=a[e]=f.deepCopy(),f.copied=!0);for(var h=0;h<f.ranges.length;h++)hg(f.ranges[h].anchor,b,c,d),hg(f.ranges[h].head,b,c,d)}else{for(var h=0;h<f.changes.length;++h){var i=f.changes[h];if(c<i.from.line)i.from=nb(i.from.line+d,i.from.ch),i.to=nb(i.to.line+d,i.to.ch);else if(b<=i.to.line){g=!1;break}}g\|\|(a.splice(0,e+1),e=0)}}}function jg(a,b){var c=b.from.line,d=b.to.line,e=b.text.length-(d-c)-1;ig(a.done,c,d,e),ig(a.undone,c,d,e)}function mg(a){return null!=a.defaultPrevented?a.defaultPrevented:0==a.returnValue}function og(a){return a.target\|\|a.srcElement}function pg(a){var b=a.which;return null==b&&(1&a.button?b=1:2&a.button?b=3:4&a.button&&(b=2)),p&&a.ctrlKey&&1==b&&(b=3),b}function ug(a,b){function f(a){return function(){a.apply(null,d)}}var c=a._handlers&&a._handlers[b];if(c){var e,d=Array.prototype.slice.call(arguments,2);zc?e=zc.delayedCallbacks:tg?e=tg:(e=tg=[],setTimeout(vg,0));for(var g=0;g<c.length;++g)e.push(f(c[g]))}}function vg(){var a=tg;tg=null;for(var b=0;b<a.length;++b)a[b]()}function wg(a,b,c){return sg(a,c\|\|b.type,a,b),mg(b)\|\|b.codemirrorIgnore}function xg(a){var b=a._handlers&&a._handlers.cursorActivity;if(b)for(var c=a.curOp.cursorActivityHandlers\|\|(a.curOp.cursorActivityHandlers=[]),d=0;d<b.length;++d)-1==Mg(c,b[d])&&c.push(b[d])}function yg(a,b){var c=a._handlers&&a._handlers[b];return c&&c.length>0}function zg(a){a.prototype.on=function(a,b){qg(this,a,b)},a.prototype.off=function(a,b){rg(this,a,b)}}function Fg(){this.id=null}function Hg(a,b,c){for(var d=0,e=0;;){var f=a.indexOf(" ",d);-1==f&&(f=a.length);var g=f-d;if(f==a.length\|\|e+g>=b)return d+Math.min(g,b-e);if(e+=f-d,e+=c-e%c,d=f+1,e>=b)return d}}function Jg(a){for(;Ig.length<=a;)Ig.push(Kg(Ig)+" ");return Ig[a]}function Kg(a){return a[a.length-1]}function Mg(a,b){for(var c=0;c<a.length;++c)if(a[c]==b)return c;return-1}function Ng(a,b){for(var c=[],d=0;d<a.length;d++)c[d]=b(a[d],d);return c}function Og(a,b){var c;if(Object.create)c=Object.create(a);else{var d=function(){};d.prototype=a,c=new d}return b&&Pg(b,c),c}function Pg(a,b,c){b\|\|(b={});for(var d in a)!a.hasOwnProperty(d)\|\|c===!1&&b.hasOwnProperty(d)\|\|(b[d]=a[d]);return b}function Qg(a){var b=Array.prototype.slice.call(arguments,1);return function(){return a.apply(null,b)}}function Tg(a,b){return b?b.source.indexOf("\\w")>-1&&Sg(a)?!0:b.test(a):Sg(a)}function Ug(a){for(var b in a)if(a.hasOwnProperty(b)&&a[b])return!1;return!0}function Wg(a){return a.charCodeAt(0)>=768&&Vg.test(a)}function Xg(a,b,c,d){var e=document.createElement(a);if(c&&(e.className=c),d&&(e.style.cssText=d),"string"==typeof b)e.appendChild(document.createTextNode(b));else if(b)for(var f=0;f<b.length;++f)e.appendChild(b[f]);return e}function Zg(a){for(var b=a.childNodes.length;b>0;--b)a.removeChild(a.firstChild);return a}function $g(a,b){return Zg(a).appendChild(b)}function _g(a,b){if(a.contains)return a.contains(b);for(;b=b.parentNode;)if(b==a)return!0}function ah(){return document.activeElement}function bh(a){return new RegExp("\\b"+a+"\\b\\s")}function ch(a,b){var c=bh(b);c.test(a.className)&&(a.className=a.className.replace(c,""))}function dh(a,b){bh(b).test(a.className)\|\|(a.className+=" "+b)}function eh(a,b){for(var c=a.split(" "),d=0;d<c.length;d++)c[d]&&!bh(c[d]).test(b)&&(b+=" "+c[d]);return b}function fh(a){if(document.body.getElementsByClassName)for(var b=document.body.getElementsByClassName("CodeMirror"),c=0;c<b.length;c++){var d=b[c].CodeMirror;d&&a(d)}}function hh(){gh\|\|(ih(),gh=!0)}function ih(){var a;qg(window,"resize",function(){null==a&&(a=setTimeout(function(){a=null,kh=null,fh(ed)},100))}),qg(window,"blur",function(){fh(Id)})}function lh(a){if(null!=kh)return kh;var b=Xg("div",null,null,"width: 50px; height: 50px; overflow-x: scroll");return $g(a,b),b.offsetWidth&&(kh=b.offsetHeight-b.clientHeight),kh\|\|0}function nh(a){if(null==mh){var b=Xg("span","\u200b");$g(a,Xg("span",[b,document.createTextNode("x")])),0!=a.firstChild.offsetHeight&&(mh=b.offsetWidth<=1&&b.offsetHeight>2&&!(d&&8>e))}return mh?Xg("span","\u200b"):Xg("span","\xa0",null,"display: inline-block; width: 1px; margin-right: -1px")}function ph(a){if(null!=oh)return oh;var b=$g(a,document.createTextNode("A\u062eA")),c=Yg(b,0,1).getBoundingClientRect();if(c.left==c.right)return!1;var d=Yg(b,1,2).getBoundingClientRect();return oh=d.right-c.right<3}function uh(a){if(null!=th)return th;var b=$g(a,Xg("span","x")),c=b.getBoundingClientRect(),d=Yg(b,0,1).getBoundingClientRect();return th=Math.abs(c.left-d.left)>1}function wh(a,b,c,d){if(!a)return d(b,c,"ltr");for(var e=!1,f=0;f<a.length;++f){var g=a[f];(g.from<c&&g.to>b\|\|b==c&&g.to==b)&&(d(Math.max(g.from,b),Math.min(g.to,c),1==g.level?"rtl":"ltr"),e=!0)}e\|\|d(b,c,"ltr")}function xh(a){return a.level%2?a.to:a.from}function yh(a){return a.level%2?a.from:a.to}function zh(a){var b=Wf(a);return b?xh(b[0]):0}function Ah(a){var b=Wf(a);return b?yh(Kg(b)):a.text.length}function Bh(a,b){var c=Pf(a.doc,b),d=af(c);d!=c&&(b=Tf(d));var e=Wf(d),f=e?e[0].level%2?Ah(d):zh(d):0;return nb(b,f)}function Ch(a,b){for(var c,d=Pf(a.doc,b);c=$e(d);)d=c.find(1,!0).line,b=null;var e=Wf(d),f=e?e[0].level%2?zh(d):Ah(d):d.text.length;return nb(null==b?Tf(d):b,f)}function Dh(a,b){var c=Bh(a,b.line),d=Pf(a.doc,c.line),e=Wf(d);if(!e\|\|0==e[0].level){var f=Math.max(0,d.text.search(/\S/)),g=b.line==c.line&&b.ch<=f&&b.ch;return nb(c.line,g?0:f)}return c}function Eh(a,b,c){var d=a[0].level;return b==d?!0:c==d?!1:c>b}function Gh(a,b){Fh=null;for(var d,c=0;c<a.length;++c){var e=a[c];if(e.from<b&&e.to>b)return c;if(e.from==b\|\|e.to==b){if(null!=d)return Eh(a,e.level,a[d].level)?(e.from!=e.to&&(Fh=d),c):(e.from!=e.to&&(Fh=c),d);d=c}}return d}function Hh(a,b,c,d){if(!d)return b+c;do b+=c;while(b>0&&Wg(a.text.charAt(b)));return b}function Ih(a,b,c,d){var e=Wf(a);if(!e)return Jh(a,b,c,d);for(var f=Gh(e,b),g=e[f],h=Hh(a,b,g.level%2?-c:c,d);;){if(h>g.from&&h<g.to)return h;if(h==g.from\|\|h==g.to)return Gh(e,h)==f?h:(g=e[f+=c],c>0==g.level%2?g.to:g.from);if(g=e[f+=c],!g)return null;h=c>0==g.level%2?Hh(a,g.to,-1,d):Hh(a,g.from,1,d)}}function Jh(a,b,c,d){var e=b+c;if(d)for(;e>0&&Wg(a.text.charAt(e));)e+=c;return 0>e\|\|e>a.text.length?null:e}var a=/gecko\/\d/i.test(navigator.userAgent),b=/MSIE \d/.test(navigator.userAgent),c=/Trident\/(?:[7-9]\|\d{2,})\..rv:(\d+)/.exec(navigator.userAgent),d=b\|\|c,e=d&&(b?document.documentMode\|\|6:c[1]),f=/WebKit\//.test(navigator.userAgent),g=f&&/Qt\/\d+\.\d+/.test(navigator.userAgent),h=/Chrome\//.test(navigator.userAgent),i=/Opera\//.test(navigator.userAgent),j=/Apple Computer/.test(navigator.vendor),k=/KHTML\//.test(navigator.userAgent),l=/Mac OS X 1\d\D([8-9]\|\d\d)\D/.test(navigator.userAgent),m=/PhantomJS/.test(navigator.userAgent),n=/AppleWebKit/.test(navigator.userAgent)&&/Mobile\/\w+/.test(navigator.userAgent),o=n\|\|/Android\|webOS\|BlackBerry\|Opera Mini\|Opera Mobi\|IEMobile/i.test(navigator.userAgent),p=n\|\|/Mac/.test(navigator.platform),q=/win/i.test(navigator.platform),r=i&&navigator.userAgent.match(/Version\/(\d\.\d)/);r&&(r=Number(r[1])),r&&r>=15&&(i=!1,f=!0);var s=p&&(g\|\|i&&(null==r\|\|12.11>r)),t=a\|\|d&&e>=9,u=!1,v=!1,nb=w.Pos=function(a,b){return this instanceof nb?(this.line=a,this.ch=b,void 0):new nb(a,b)},ob=w.cmpPos=function(a,b){return a.line-b.line\|\|a.ch-b.ch};sb.prototype={primary:function(){return this.ranges[this.primIndex]},equals:function(a){if(a==this)return!0;if(a.primIndex!=this.primIndex\|\|a.ranges.length!=this.ranges.length)return!1;for(var b=0;b<this.ranges.length;b++){var c=this.ranges[b],d=a.ranges[b];if(0!=ob(c.anchor,d.anchor)\|\|0!=ob(c.head,d.head))return!1}return!0},deepCopy:function(){for(var a=[],b=0;b<this.ranges.length;b++)a[b]=new tb(pb(this.ranges[b].anchor),pb(this.ranges[b].head));return new sb(a,this.primIndex)},somethingSelected:function(){for(var a=0;a<this.ranges.length;a++)if(!this.ranges[a].empty())return!0;return!1},contains:function(a,b){b\|\|(b=a);for(var c=0;c<this.ranges.length;c++){var d=this.ranges[c];if(ob(b,d.from())>=0&&ob(a,d.to())<=0)return c}return-1}},tb.prototype={from:function(){return rb(this.anchor,this.head)},to:function(){return qb(this.anchor,this.head)},empty:function(){return this.head.line==this.anchor.line&&this.head.ch==this.anchor.ch}};var wc,id,jd,gc={left:0,right:0,top:0,bottom:0},zc=null,Ac=0,Zc=null,pd=0,ud=0,vd=null;d?vd=-.53:a?vd=15:h?vd=-.7:j&&(vd=-1/3);var zd,Cd=null,Ld=w.changeEnd=function(a){return a.text?nb(a.from.line+a.text.length-1,Kg(a.text).length+(1==a.text.length?a.from.ch:0)):a.to};w.prototype={constructor:w,focus:function(){window.focus(),ad(this),Yc(this)},setOption:function(a,b){var c=this.options,d=c[a];(c[a]!=b\|\|"mode"==a)&&(c[a]=b,ke.hasOwnProperty(a)&&Lc(this,ke[a])(this,b,d))},getOption:function(a){return this.options[a]},getDoc:function(){return this.doc},addKeyMap:function(a,b){this.state.keyMaps[b?"push":"unshift"](a)},removeKeyMap:function(a){for(var b=this.state.keyMaps,c=0;c<b.length;++c)if(b[c]==a\|\|"string"!=typeof b[c]&&b[c].name==a)return b.splice(c,1),!0},addOverlay:Mc(function(a,b){var c=a.token?a:w.getMode(this.options,a);if(c.startState)throw new Error("Overlays may not be stateful.");this.state.overlays.push({mode:c,modeSpec:a,opaque:b&&b.opaque}),this.state.modeGen++,Qc(this)}),removeOverlay:Mc(function(a){for(var b=this.state.overlays,c=0;c<b.length;++c){var d=b[c].modeSpec;if(d==a\|\|"string"==typeof a&&d.name==a)return b.splice(c,1),this.state.modeGen++,Qc(this),void 0}}),indentLine:Mc(function(a,b,c){"string"!=typeof b&&"number"!=typeof b&&(b=null==b?this.options.smartIndent?"smart":"prev":b?"add":"subtract"),zb(this.doc,a)&&de(this,a,b,c)}),indentSelection:Mc(function(a){for(var b=this.doc.sel.ranges,c=-1,d=0;d<b.length;d++){var e=b[d];if(e.empty())e.head.line>c&&(de(this,e.head.line,a,!0),c=e.head.line,d==this.doc.sel.primIndex&&be(this));else{var f=e.from(),g=e.to(),h=Math.max(c,f.line);c=Math.min(this.lastLine(),g.line-(g.ch?0:1))+1;for(var i=h;c>i;++i)de(this,i,a);var j=this.doc.sel.ranges;0==f.ch&&b.length==j.length&&j[d].from().ch>0&&Eb(this.doc,d,new tb(f,j[d].to()))}}}),getTokenAt:function(a,b){var c=this.doc;a=xb(c,a);for(var d=Xb(this,a.line,b),e=this.doc.mode,f=Pf(c,a.line),g=new Ae(f.text,this.options.tabSize);g.pos<a.ch&&!g.eol();){g.start=g.pos;var h=qf(e,g,d)}return{start:g.start,end:g.pos,string:g.current(),type:h\|\|null,state:d}},getTokenTypeAt:function(a){a=xb(this.doc,a);var f,b=tf(this,Pf(this.doc,a.line)),c=0,d=(b.length-1)/2,e=a.ch;if(0==e)f=b[2];else for(;;){var g=c+d>>1;if((g?b[2g-1]:0)>=e)d=g;else{if(!(b[2g+1]<e)){f=b[2g+2];break}c=g+1}}var h=f?f.indexOf("cm-overlay "):-1;return 0>h?f:0==h?null:f.slice(0,h-1)},getModeAt:function(a){var b=this.doc.mode;return b.innerMode?w.innerMode(b,this.getTokenAt(a).state).mode:b},getHelper:function(a,b){return this.getHelpers(a,b)[0]},getHelpers:function(a,b){var c=[];if(!re.hasOwnProperty(b))return re;var d=re[b],e=this.getModeAt(a);if("string"==typeof e[b])d[e[b]]&&c.push(d[e[b]]);else if(e[b])for(var f=0;f<e[b].length;f++){var g=d[e[b][f]];g&&c.push(g)}else e.helperType&&d[e.helperType]?c.push(d[e.helperType]):d[e.name]&&c.push(d[e.name]);for(var f=0;f<d._global.length;f++){var h=d._global[f];h.pred(e,this)&&-1==Mg(c,h.val)&&c.push(h.val)}return c},getStateAfter:function(a,b){var c=this.doc;return a=wb(c,null==a?c.first+c.size-1:a),Xb(this,a+1,b)},cursorCoords:function(a,b){var c,d=this.doc.sel.primary();return c=null==a?d.head:"object"==typeof a?xb(this.doc,a):a?d.from():d.to(),rc(this,c,b\|\|"page")},charCoords:function(a,b){return qc(this,xb(this.doc,a),b\|\|"page")},coordsChar:function(a,b){return a=pc(this,a,b\|\|"page"),uc(this,a.left,a.top)},lineAtHeight:function(a,b){return a=pc(this,{top:a,left:0},b\|\|"page").top,Uf(this.doc,a+this.display.viewOffset)},heightAtLine:function(a,b){var c=!1,d=this.doc.first+this.doc.size-1;a<this.doc.first?a=this.doc.first:a>d&&(a=d,c=!0);var e=Pf(this.doc,a);return oc(this,e,{top:0,left:0},b\|\|"page").top+(c?this.doc.height-Vf(e):0)},defaultTextHeight:function(){return xc(this.display)},defaultCharWidth:function(){return yc(this.display)},setGutterMarker:Mc(function(a,b,c){return ee(this.doc,a,"gutter",function(a){var d=a.gutterMarkers\|\|(a.gutterMarkers={});return d[b]=c,!c&&Ug(d)&&(a.gutterMarkers=null),!0})}),clearGutter:Mc(function(a){var b=this,c=b.doc,d=c.first;c.iter(function(c){c.gutterMarkers&&c.gutterMarkers[a]&&(c.gutterMarkers[a]=null,Rc(b,d,"gutter"),Ug(c.gutterMarkers)&&(c.gutterMarkers=null)),++d})}),addLineWidget:Mc(function(a,b,c){return kf(this,a,b,c)}),removeLineWidget:function(a){a.clear()},lineInfo:function(a){if("number"==typeof a){if(!zb(this.doc,a))return null;var b=a;if(a=Pf(this.doc,a),!a)return null}else{var b=Tf(a);if(null==b)return null}return{line:b,handle:a,text:a.text,gutterMarkers:a.gutterMarkers,textClass:a.textClass,bgClass:a.bgClass,wrapClass:a.wrapClass,widgets:a.widgets}},getViewport:function(){return{from:this.display.viewFrom,to:this.display.viewTo}},addWidget:function(a,b,c,d,e){var f=this.display;a=rc(this,xb(this.doc,a));var g=a.bottom,h=a.left;if(b.style.position="absolute",f.sizer.appendChild(b),"over"==d)g=a.top;else if("above"==d\|\|"near"==d){var i=Math.max(f.wrapper.clientHeight,this.doc.height),j=Math.max(f.sizer.clientWidth,f.lineSpace.clientWidth);("above"==d\|\|a.bottom+b.offsetHeight>i)&&a.top>b.offsetHeight?g=a.top-b.offsetHeight:a.bottom+b.offsetHeight<=i&&(g=a.bottom),h+b.offsetWidth>j&&(h=j-b.offsetWidth)}b.style.top=g+"px",b.style.left=b.style.right="","right"==e?(h=f.sizer.clientWidth-b.offsetWidth,b.style.right="0px"):("left"==e?h=0:"middle"==e&&(h=(f.sizer.clientWidth-b.offsetWidth)/2),b.style.left=h+"px"),c&&$d(this,h,g,h+b.offsetWidth,g+b.offsetHeight)},triggerOnKeyDown:Mc(Dd),triggerOnKeyPress:Mc(Gd),triggerOnKeyUp:Fd,execCommand:function(a){return ue.hasOwnProperty(a)?ue[a](this):void 0},findPosH:function(a,b,c,d){var e=1;0>b&&(e=-1,b=-b);
12	+ for(var f=0,g=xb(this.doc,a);b>f&&(g=ge(this.doc,g,e,c,d),!g.hitSide);++f);return g},moveH:Mc(function(a,b){var c=this;c.extendSelectionsBy(function(d){return c.display.shift\|\|c.doc.extend\|\|d.empty()?ge(c.doc,d.head,a,b,c.options.rtlMoveVisually):0>a?d.from():d.to()},Eg)}),deleteH:Mc(function(a,b){var c=this.doc.sel,d=this.doc;c.somethingSelected()?d.replaceSelection("",null,"+delete"):fe(this,function(c){var e=ge(d,c.head,a,b,!1);return 0>a?{from:e,to:c.head}:{from:c.head,to:e}})}),findPosV:function(a,b,c,d){var e=1,f=d;0>b&&(e=-1,b=-b);for(var g=0,h=xb(this.doc,a);b>g;++g){var i=rc(this,h,"div");if(null==f?f=i.left:i.left=f,h=he(this,i,e,c),h.hitSide)break}return h},moveV:Mc(function(a,b){var c=this,d=this.doc,e=[],f=!c.display.shift&&!d.extend&&d.sel.somethingSelected();if(d.extendSelectionsBy(function(g){if(f)return 0>a?g.from():g.to();var h=rc(c,g.head,"div");null!=g.goalColumn&&(h.left=g.goalColumn),e.push(h.left);var i=he(c,h,a,b);return"page"==b&&g==d.sel.primary()&&ae(c,null,qc(c,i,"div").top-h.top),i},Eg),e.length)for(var g=0;g<d.sel.ranges.length;g++)d.sel.ranges[g].goalColumn=e[g]}),toggleOverwrite:function(a){(null==a\|\|a!=this.state.overwrite)&&((this.state.overwrite=!this.state.overwrite)?dh(this.display.cursorDiv,"CodeMirror-overwrite"):ch(this.display.cursorDiv,"CodeMirror-overwrite"),sg(this,"overwriteToggle",this,this.state.overwrite))},hasFocus:function(){return ah()==this.display.input},scrollTo:Mc(function(a,b){(null!=a\|\|null!=b)&&ce(this),null!=a&&(this.curOp.scrollLeft=a),null!=b&&(this.curOp.scrollTop=b)}),getScrollInfo:function(){var a=this.display.scroller,b=Ag;return{left:a.scrollLeft,top:a.scrollTop,height:a.scrollHeight-b,width:a.scrollWidth-b,clientHeight:a.clientHeight-b,clientWidth:a.clientWidth-b}},scrollIntoView:Mc(function(a,b){if(null==a?(a={from:this.doc.sel.primary().head,to:null},null==b&&(b=this.options.cursorScrollMargin)):"number"==typeof a?a={from:nb(a,0),to:null}:null==a.from&&(a={from:a,to:null}),a.to\|\|(a.to=a.from),a.margin=b\|\|0,null!=a.from.line)ce(this),this.curOp.scrollToPos=a;else{var c=_d(this,Math.min(a.from.left,a.to.left),Math.min(a.from.top,a.to.top)-a.margin,Math.max(a.from.right,a.to.right),Math.max(a.from.bottom,a.to.bottom)+a.margin);this.scrollTo(c.scrollLeft,c.scrollTop)}}),setSize:Mc(function(a,b){function d(a){return"number"==typeof a\|\|/^\d+$/.test(String(a))?a+"px":a}var c=this;null!=a&&(c.display.wrapper.style.width=d(a)),null!=b&&(c.display.wrapper.style.height=d(b)),c.options.lineWrapping&&kc(this);var e=c.display.viewFrom;c.doc.iter(e,c.display.viewTo,function(a){if(a.widgets)for(var b=0;b<a.widgets.length;b++)if(a.widgets[b].noHScroll){Rc(c,e,"widget");break}++e}),c.curOp.forceUpdate=!0,sg(c,"refresh",this)}),operation:function(a){return Kc(this,a)},refresh:Mc(function(){var a=this.display.cachedTextHeight;Qc(this),this.curOp.forceUpdate=!0,lc(this),this.scrollTo(this.doc.scrollLeft,this.doc.scrollTop),H(this),(null==a\|\|Math.abs(a-xc(this.display))>.5)&&C(this),sg(this,"refresh",this)}),swapDoc:Mc(function(a){var b=this.doc;return b.cm=null,Of(this,a),lc(this),_c(this),this.scrollTo(a.scrollLeft,a.scrollTop),ug(this,"swapDoc",this,b),b}),getInputField:function(){return this.display.input},getWrapperElement:function(){return this.display.wrapper},getScrollerElement:function(){return this.display.scroller},getGutterElement:function(){return this.display.gutters}},zg(w);var je=w.defaults={},ke=w.optionHandlers={},me=w.Init={toString:function(){return"CodeMirror.Init"}};le("value","",function(a,b){a.setValue(b)},!0),le("mode",null,function(a,b){a.doc.modeOption=b,y(a)},!0),le("indentUnit",2,y,!0),le("indentWithTabs",!1),le("smartIndent",!0),le("tabSize",4,function(a){z(a),lc(a),Qc(a)},!0),le("specialChars",/[\t\u0000-\u0019\u00ad\u200b\u2028\u2029\ufeff]/g,function(a,b){a.options.specialChars=new RegExp(b.source+(b.test(" ")?"":"\| "),"g"),a.refresh()},!0),le("specialCharPlaceholder",zf,function(a){a.refresh()},!0),le("electricChars",!0),le("rtlMoveVisually",!q),le("wholeLineUpdateBefore",!0),le("theme","default",function(a){E(a),F(a)},!0),le("keyMap","default",D),le("extraKeys",null),le("lineWrapping",!1,A,!0),le("gutters",[],function(a){K(a.options),F(a)},!0),le("fixedGutter",!0,function(a,b){a.display.gutters.style.left=b?S(a.display)+"px":"0",a.refresh()},!0),le("coverGutterNextToScrollbar",!1,N,!0),le("lineNumbers",!1,function(a){K(a.options),F(a)},!0),le("firstLineNumber",1,F,!0),le("lineNumberFormatter",function(a){return a},F,!0),le("showCursorWhenSelecting",!1,Qb,!0),le("resetSelectionOnContextMenu",!0),le("readOnly",!1,function(a,b){"nocursor"==b?(Id(a),a.display.input.blur(),a.display.disabled=!0):(a.display.disabled=!1,b\|\|_c(a))}),le("disableInput",!1,function(a,b){b\|\|_c(a)},!0),le("dragDrop",!0),le("cursorBlinkRate",530),le("cursorScrollMargin",0),le("cursorHeight",1,Qb,!0),le("singleCursorHeightPerLine",!0,Qb,!0),le("workTime",100),le("workDelay",100),le("flattenSpans",!0,z,!0),le("addModeClass",!1,z,!0),le("pollInterval",100),le("undoDepth",200,function(a,b){a.doc.history.undoDepth=b}),le("historyEventDelay",1250),le("viewportMargin",10,function(a){a.refresh()},!0),le("maxHighlightLength",1e4,z,!0),le("moveInputWithCursor",!0,function(a,b){b\|\|(a.display.inputDiv.style.top=a.display.inputDiv.style.left=0)}),le("tabindex",null,function(a,b){a.display.input.tabIndex=b\|\|""}),le("autofocus",null);var ne=w.modes={},oe=w.mimeModes={};w.defineMode=function(a,b){if(w.defaults.mode\|\|"null"==a\|\|(w.defaults.mode=a),arguments.length>2){b.dependencies=[];for(var c=2;c<arguments.length;++c)b.dependencies.push(arguments[c])}ne[a]=b},w.defineMIME=function(a,b){oe[a]=b},w.resolveMode=function(a){if("string"==typeof a&&oe.hasOwnProperty(a))a=oe[a];else if(a&&"string"==typeof a.name&&oe.hasOwnProperty(a.name)){var b=oe[a.name];"string"==typeof b&&(b={name:b}),a=Og(b,a),a.name=b.name}else if("string"==typeof a&&/^[\w\-]+\/[\w\-]+\+xml$/.test(a))return w.resolveMode("application/xml");return"string"==typeof a?{name:a}:a\|\|{name:"null"}},w.getMode=function(a,b){var b=w.resolveMode(b),c=ne[b.name];if(!c)return w.getMode(a,"text/plain");var d=c(a,b);if(pe.hasOwnProperty(b.name)){var e=pe[b.name];for(var f in e)e.hasOwnProperty(f)&&(d.hasOwnProperty(f)&&(d["_"+f]=d[f]),d[f]=e[f])}if(d.name=b.name,b.helperType&&(d.helperType=b.helperType),b.modeProps)for(var f in b.modeProps)d[f]=b.modeProps[f];return d},w.defineMode("null",function(){return{token:function(a){a.skipToEnd()}}}),w.defineMIME("text/plain","null");var pe=w.modeExtensions={};w.extendMode=function(a,b){var c=pe.hasOwnProperty(a)?pe[a]:pe[a]={};Pg(b,c)},w.defineExtension=function(a,b){w.prototype[a]=b},w.defineDocExtension=function(a,b){Kf.prototype[a]=b},w.defineOption=le;var qe=[];w.defineInitHook=function(a){qe.push(a)};var re=w.helpers={};w.registerHelper=function(a,b,c){re.hasOwnProperty(a)\|\|(re[a]=w[a]={_global:[]}),re[a][b]=c},w.registerGlobalHelper=function(a,b,c,d){w.registerHelper(a,b,d),re[a]._global.push({pred:c,val:d})};var se=w.copyState=function(a,b){if(b===!0)return b;if(a.copyState)return a.copyState(b);var c={};for(var d in b){var e=b[d];e instanceof Array&&(e=e.concat([])),c[d]=e}return c},te=w.startState=function(a,b,c){return a.startState?a.startState(b,c):!0};w.innerMode=function(a,b){for(;a.innerMode;){var c=a.innerMode(b);if(!c\|\|c.mode==a)break;b=c.state,a=c.mode}return c\|\|{mode:a,state:b}};var ue=w.commands={selectAll:function(a){a.setSelection(nb(a.firstLine(),0),nb(a.lastLine()),Cg)},singleSelection:function(a){a.setSelection(a.getCursor("anchor"),a.getCursor("head"),Cg)},killLine:function(a){fe(a,function(b){if(b.empty()){var c=Pf(a.doc,b.head.line).text.length;return b.head.ch==c&&b.head.line<a.lastLine()?{from:b.head,to:nb(b.head.line+1,0)}:{from:b.head,to:nb(b.head.line,c)}}return{from:b.from(),to:b.to()}})},deleteLine:function(a){fe(a,function(b){return{from:nb(b.from().line,0),to:xb(a.doc,nb(b.to().line+1,0))}})},delLineLeft:function(a){fe(a,function(a){return{from:nb(a.from().line,0),to:a.from()}})},delWrappedLineLeft:function(a){fe(a,function(b){var c=a.charCoords(b.head,"div").top+5,d=a.coordsChar({left:0,top:c},"div");return{from:d,to:b.from()}})},delWrappedLineRight:function(a){fe(a,function(b){var c=a.charCoords(b.head,"div").top+5,d=a.coordsChar({left:a.display.lineDiv.offsetWidth+100,top:c},"div");return{from:b.from(),to:d}})},undo:function(a){a.undo()},redo:function(a){a.redo()},undoSelection:function(a){a.undoSelection()},redoSelection:function(a){a.redoSelection()},goDocStart:function(a){a.extendSelection(nb(a.firstLine(),0))},goDocEnd:function(a){a.extendSelection(nb(a.lastLine()))},goLineStart:function(a){a.extendSelectionsBy(function(b){return Bh(a,b.head.line)},{origin:"+move",bias:1})},goLineStartSmart:function(a){a.extendSelectionsBy(function(b){return Dh(a,b.head)},{origin:"+move",bias:1})},goLineEnd:function(a){a.extendSelectionsBy(function(b){return Ch(a,b.head.line)},{origin:"+move",bias:-1})},goLineRight:function(a){a.extendSelectionsBy(function(b){var c=a.charCoords(b.head,"div").top+5;return a.coordsChar({left:a.display.lineDiv.offsetWidth+100,top:c},"div")},Eg)},goLineLeft:function(a){a.extendSelectionsBy(function(b){var c=a.charCoords(b.head,"div").top+5;return a.coordsChar({left:0,top:c},"div")},Eg)},goLineLeftSmart:function(a){a.extendSelectionsBy(function(b){var c=a.charCoords(b.head,"div").top+5,d=a.coordsChar({left:0,top:c},"div");return d.ch<a.getLine(d.line).search(/\S/)?Dh(a,b.head):d},Eg)},goLineUp:function(a){a.moveV(-1,"line")},goLineDown:function(a){a.moveV(1,"line")},goPageUp:function(a){a.moveV(-1,"page")},goPageDown:function(a){a.moveV(1,"page")},goCharLeft:function(a){a.moveH(-1,"char")},goCharRight:function(a){a.moveH(1,"char")},goColumnLeft:function(a){a.moveH(-1,"column")},goColumnRight:function(a){a.moveH(1,"column")},goWordLeft:function(a){a.moveH(-1,"word")},goGroupRight:function(a){a.moveH(1,"group")},goGroupLeft:function(a){a.moveH(-1,"group")},goWordRight:function(a){a.moveH(1,"word")},delCharBefore:function(a){a.deleteH(-1,"char")},delCharAfter:function(a){a.deleteH(1,"char")},delWordBefore:function(a){a.deleteH(-1,"word")},delWordAfter:function(a){a.deleteH(1,"word")},delGroupBefore:function(a){a.deleteH(-1,"group")},delGroupAfter:function(a){a.deleteH(1,"group")},indentAuto:function(a){a.indentSelection("smart")},indentMore:function(a){a.indentSelection("add")},indentLess:function(a){a.indentSelection("subtract")},insertTab:function(a){a.replaceSelection(" ")},insertSoftTab:function(a){for(var b=[],c=a.listSelections(),d=a.options.tabSize,e=0;e<c.length;e++){var f=c[e].from(),g=Gg(a.getLine(f.line),f.ch,d);b.push(new Array(d-g%d+1).join(" "))}a.replaceSelections(b)},defaultTab:function(a){a.somethingSelected()?a.indentSelection("add"):a.execCommand("insertTab")},transposeChars:function(a){Kc(a,function(){for(var b=a.listSelections(),c=[],d=0;d<b.length;d++){var e=b[d].head,f=Pf(a.doc,e.line).text;if(f)if(e.ch==f.length&&(e=new nb(e.line,e.ch-1)),e.ch>0)e=new nb(e.line,e.ch+1),a.replaceRange(f.charAt(e.ch-1)+f.charAt(e.ch-2),nb(e.line,e.ch-2),e,"+transpose");else if(e.line>a.doc.first){var g=Pf(a.doc,e.line-1).text;g&&a.replaceRange(f.charAt(0)+"\n"+g.charAt(g.length-1),nb(e.line-1,g.length-1),nb(e.line,1),"+transpose")}c.push(new tb(e,e))}a.setSelections(c)})},newlineAndIndent:function(a){Kc(a,function(){for(var b=a.listSelections().length,c=0;b>c;c++){var d=a.listSelections()[c];a.replaceRange("\n",d.anchor,d.head,"+input"),a.indentLine(d.from().line+1,null,!0),be(a)}})},toggleOverwrite:function(a){a.toggleOverwrite()}},ve=w.keyMap={};ve.basic={Left:"goCharLeft",Right:"goCharRight",Up:"goLineUp",Down:"goLineDown",End:"goLineEnd",Home:"goLineStartSmart",PageUp:"goPageUp",PageDown:"goPageDown",Delete:"delCharAfter",Backspace:"delCharBefore","Shift-Backspace":"delCharBefore",Tab:"defaultTab","Shift-Tab":"indentAuto",Enter:"newlineAndIndent",Insert:"toggleOverwrite",Esc:"singleSelection"},ve.pcDefault={"Ctrl-A":"selectAll","Ctrl-D":"deleteLine","Ctrl-Z":"undo","Shift-Ctrl-Z":"redo","Ctrl-Y":"redo","Ctrl-Home":"goDocStart","Ctrl-Up":"goDocStart","Ctrl-End":"goDocEnd","Ctrl-Down":"goDocEnd","Ctrl-Left":"goGroupLeft","Ctrl-Right":"goGroupRight","Alt-Left":"goLineStart","Alt-Right":"goLineEnd","Ctrl-Backspace":"delGroupBefore","Ctrl-Delete":"delGroupAfter","Ctrl-S":"save","Ctrl-F":"find","Ctrl-G":"findNext","Shift-Ctrl-G":"findPrev","Shift-Ctrl-F":"replace","Shift-Ctrl-R":"replaceAll","Ctrl-[":"indentLess","Ctrl-]":"indentMore","Ctrl-U":"undoSelection","Shift-Ctrl-U":"redoSelection","Alt-U":"redoSelection",fallthrough:"basic"},ve.macDefault={"Cmd-A":"selectAll","Cmd-D":"deleteLine","Cmd-Z":"undo","Shift-Cmd-Z":"redo","Cmd-Y":"redo","Cmd-Home":"goDocStart","Cmd-Up":"goDocStart","Cmd-End":"goDocEnd","Cmd-Down":"goDocEnd","Alt-Left":"goGroupLeft","Alt-Right":"goGroupRight","Cmd-Left":"goLineLeft","Cmd-Right":"goLineRight","Alt-Backspace":"delGroupBefore","Ctrl-Alt-Backspace":"delGroupAfter","Alt-Delete":"delGroupAfter","Cmd-S":"save","Cmd-F":"find","Cmd-G":"findNext","Shift-Cmd-G":"findPrev","Cmd-Alt-F":"replace","Shift-Cmd-Alt-F":"replaceAll","Cmd-[":"indentLess","Cmd-]":"indentMore","Cmd-Backspace":"delWrappedLineLeft","Cmd-Delete":"delWrappedLineRight","Cmd-U":"undoSelection","Shift-Cmd-U":"redoSelection",fallthrough:["basic","emacsy"]},ve.emacsy={"Ctrl-F":"goCharRight","Ctrl-B":"goCharLeft","Ctrl-P":"goLineUp","Ctrl-N":"goLineDown","Alt-F":"goWordRight","Alt-B":"goWordLeft","Ctrl-A":"goLineStart","Ctrl-E":"goLineEnd","Ctrl-V":"goPageDown","Shift-Ctrl-V":"goPageUp","Ctrl-D":"delCharAfter","Ctrl-H":"delCharBefore","Alt-D":"delWordAfter","Alt-Backspace":"delWordBefore","Ctrl-K":"killLine","Ctrl-T":"transposeChars"},ve["default"]=p?ve.macDefault:ve.pcDefault;var xe=w.lookupKey=function(a,b,c){function d(b){b=we(b);var e=b[a];if(e===!1)return"stop";if(null!=e&&c(e))return!0;if(b.nofallthrough)return"stop";var f=b.fallthrough;if(null==f)return!1;if("[object Array]"!=Object.prototype.toString.call(f))return d(f);for(var g=0;g<f.length;++g){var h=d(f[g]);if(h)return h}return!1}for(var e=0;e<b.length;++e){var f=d(b[e]);if(f)return"stop"!=f}},ye=w.isModifierKey=function(a){var b=vh[a.keyCode];return"Ctrl"==b\|\|"Alt"==b\|\|"Shift"==b\|\|"Mod"==b},ze=w.keyName=function(a,b){if(i&&34==a.keyCode&&a["char"])return!1;var c=vh[a.keyCode];return null==c\|\|a.altGraphKey?!1:(a.altKey&&(c="Alt-"+c),(s?a.metaKey:a.ctrlKey)&&(c="Ctrl-"+c),(s?a.ctrlKey:a.metaKey)&&(c="Cmd-"+c),!b&&a.shiftKey&&(c="Shift-"+c),c)};w.fromTextArea=function(a,b){function d(){a.value=i.getValue()}if(b\|\|(b={}),b.value=a.value,!b.tabindex&&a.tabindex&&(b.tabindex=a.tabindex),!b.placeholder&&a.placeholder&&(b.placeholder=a.placeholder),null==b.autofocus){var c=ah();b.autofocus=c==a\|\|null!=a.getAttribute("autofocus")&&c==document.body}if(a.form&&(qg(a.form,"submit",d),!b.leaveSubmitMethodAlone)){var e=a.form,f=e.submit;try{var g=e.submit=function(){d(),e.submit=f,e.submit(),e.submit=g}}catch(h){}}a.style.display="none";var i=w(function(b){a.parentNode.insertBefore(b,a.nextSibling)},b);return i.save=d,i.getTextArea=function(){return a},i.toTextArea=function(){d(),a.parentNode.removeChild(i.getWrapperElement()),a.style.display="",a.form&&(rg(a.form,"submit",d),"function"==typeof a.form.submit&&(a.form.submit=f))},i};var Ae=w.StringStream=function(a,b){this.pos=this.start=0,this.string=a,this.tabSize=b\|\|8,this.lastColumnPos=this.lastColumnValue=0,this.lineStart=0};Ae.prototype={eol:function(){return this.pos>=this.string.length},sol:function(){return this.pos==this.lineStart},peek:function(){return this.string.charAt(this.pos)\|\|void 0},next:function(){return this.pos<this.string.length?this.string.charAt(this.pos++):void 0},eat:function(a){var b=this.string.charAt(this.pos);if("string"==typeof a)var c=b==a;else var c=b&&(a.test?a.test(b):a(b));return c?(++this.pos,b):void 0},eatWhile:function(a){for(var b=this.pos;this.eat(a););return this.pos>b},eatSpace:function(){for(var a=this.pos;/[\s\u00a0]/.test(this.string.charAt(this.pos));)++this.pos;return this.pos>a},skipToEnd:function(){this.pos=this.string.length},skipTo:function(a){var b=this.string.indexOf(a,this.pos);return b>-1?(this.pos=b,!0):void 0},backUp:function(a){this.pos-=a},column:function(){return this.lastColumnPos<this.start&&(this.lastColumnValue=Gg(this.string,this.start,this.tabSize,this.lastColumnPos,this.lastColumnValue),this.lastColumnPos=this.start),this.lastColumnValue-(this.lineStart?Gg(this.string,this.lineStart,this.tabSize):0)},indentation:function(){return Gg(this.string,null,this.tabSize)-(this.lineStart?Gg(this.string,this.lineStart,this.tabSize):0)},match:function(a,b,c){if("string"!=typeof a){var f=this.string.slice(this.pos).match(a);return f&&f.index>0?null:(f&&b!==!1&&(this.pos+=f[0].length),f)}var d=function(a){return c?a.toLowerCase():a},e=this.string.substr(this.pos,a.length);return d(e)==d(a)?(b!==!1&&(this.pos+=a.length),!0):void 0},current:function(){return this.string.slice(this.start,this.pos)},hideFirstChars:function(a,b){this.lineStart+=a;try{return b()}finally{this.lineStart-=a}}};var Be=w.TextMarker=function(a,b){this.lines=[],this.type=b,this.doc=a};zg(Be),Be.prototype.clear=function(){if(!this.explicitlyCleared){var a=this.doc.cm,b=a&&!a.curOp;if(b&&Bc(a),yg(this,"clear")){var c=this.find();c&&ug(this,"clear",c.from,c.to)}for(var d=null,e=null,f=0;f<this.lines.length;++f){var g=this.lines[f],h=Ke(g.markedSpans,this);a&&!this.collapsed?Rc(a,Tf(g),"text"):a&&(null!=h.to&&(e=Tf(g)),null!=h.from&&(d=Tf(g))),g.markedSpans=Le(g.markedSpans,h),null==h.from&&this.collapsed&&!ef(this.doc,g)&&a&&Sf(g,xc(a.display))}if(a&&this.collapsed&&!a.options.lineWrapping)for(var f=0;f<this.lines.length;++f){var i=af(this.lines[f]),j=I(i);j>a.display.maxLineLength&&(a.display.maxLine=i,a.display.maxLineLength=j,a.display.maxLineChanged=!0)}null!=d&&a&&this.collapsed&&Qc(a,d,e+1),this.lines.length=0,this.explicitlyCleared=!0,this.atomic&&this.doc.cantEdit&&(this.doc.cantEdit=!1,a&&Lb(a.doc)),a&&ug(a,"markerCleared",a,this),b&&Dc(a),this.parent&&this.parent.clear()}},Be.prototype.find=function(a,b){null==a&&"bookmark"==this.type&&(a=1);for(var c,d,e=0;e<this.lines.length;++e){var f=this.lines[e],g=Ke(f.markedSpans,this);if(null!=g.from&&(c=nb(b?f:Tf(f),g.from),-1==a))return c;if(null!=g.to&&(d=nb(b?f:Tf(f),g.to),1==a))return d}return c&&{from:c,to:d}},Be.prototype.changed=function(){var a=this.find(-1,!0),b=this,c=this.doc.cm;a&&c&&Kc(c,function(){var d=a.line,e=Tf(a.line),f=dc(c,e);if(f&&(jc(f),c.curOp.selectionChanged=c.curOp.forceUpdate=!0),c.curOp.updateMaxLine=!0,!ef(b.doc,d)&&null!=b.height){var g=b.height;b.height=null;var h=jf(b)-g;h&&Sf(d,d.height+h)}})},Be.prototype.attachLine=function(a){if(!this.lines.length&&this.doc.cm){var b=this.doc.cm.curOp;b.maybeHiddenMarkers&&-1!=Mg(b.maybeHiddenMarkers,this)\|\|(b.maybeUnhiddenMarkers\|\|(b.maybeUnhiddenMarkers=[])).push(this)}this.lines.push(a)},Be.prototype.detachLine=function(a){if(this.lines.splice(Mg(this.lines,a),1),!this.lines.length&&this.doc.cm){var b=this.doc.cm.curOp;(b.maybeHiddenMarkers\|\|(b.maybeHiddenMarkers=[])).push(this)}};var Ce=0,Ee=w.SharedTextMarker=function(a,b){this.markers=a,this.primary=b;for(var c=0;c<a.length;++c)a[c].parent=this};zg(Ee),Ee.prototype.clear=function(){if(!this.explicitlyCleared){this.explicitlyCleared=!0;for(var a=0;a<this.markers.length;++a)this.markers[a].clear();ug(this,"clear")}},Ee.prototype.find=function(a,b){return this.primary.find(a,b)};var gf=w.LineWidget=function(a,b,c){if(c)for(var d in c)c.hasOwnProperty(d)&&(this[d]=c[d]);this.cm=a,this.node=b};zg(gf),gf.prototype.clear=function(){var a=this.cm,b=this.line.widgets,c=this.line,d=Tf(c);if(null!=d&&b){for(var e=0;e<b.length;++e)b[e]==this&&b.splice(e--,1);b.length\|\|(c.widgets=null);var f=jf(this);Kc(a,function(){hf(a,c,-f),Rc(a,d,"widget"),Sf(c,Math.max(0,c.height-f))})}},gf.prototype.changed=function(){var a=this.height,b=this.cm,c=this.line;this.height=null;var d=jf(this)-a;d&&Kc(b,function(){b.curOp.forceUpdate=!0,hf(b,c,d),Sf(c,c.height+d)})};var lf=w.Line=function(a,b,c){this.text=a,Ue(this,b),this.height=c?c(this):1};zg(lf),lf.prototype.lineNo=function(){return Tf(this)};var vf={},wf={};Hf.prototype={chunkSize:function(){return this.lines.length},removeInner:function(a,b){for(var c=a,d=a+b;d>c;++c){var e=this.lines[c];this.height-=e.height,nf(e),ug(e,"delete")}this.lines.splice(a,b)},collapse:function(a){a.push.apply(a,this.lines)},insertInner:function(a,b,c){this.height+=c,this.lines=this.lines.slice(0,a).concat(b).concat(this.lines.slice(a));for(var d=0;d<b.length;++d)b[d].parent=this},iterN:function(a,b,c){for(var d=a+b;d>a;++a)if(c(this.lines[a]))return!0}},If.prototype={chunkSize:function(){return this.size},removeInner:function(a,b){this.size-=b;for(var c=0;c<this.children.length;++c){var d=this.children[c],e=d.chunkSize();if(e>a){var f=Math.min(b,e-a),g=d.height;if(d.removeInner(a,f),this.height-=g-d.height,e==f&&(this.children.splice(c--,1),d.parent=null),0==(b-=f))break;a=0}else a-=e}if(this.size-b<25&&(this.children.length>1\|\|!(this.children[0]instanceof Hf))){var h=[];this.collapse(h),this.children=[new Hf(h)],this.children[0].parent=this}},collapse:function(a){for(var b=0;b<this.children.length;++b)this.children[b].collapse(a)},insertInner:function(a,b,c){this.size+=b.length,this.height+=c;for(var d=0;d<this.children.length;++d){var e=this.children[d],f=e.chunkSize();if(f>=a){if(e.insertInner(a,b,c),e.lines&&e.lines.length>50){for(;e.lines.length>50;){var g=e.lines.splice(e.lines.length-25,25),h=new Hf(g);e.height-=h.height,this.children.splice(d+1,0,h),h.parent=this}this.maybeSpill()}break}a-=f}},maybeSpill:function(){if(!(this.children.length<=10)){var a=this;do{var b=a.children.splice(a.children.length-5,5),c=new If(b);if(a.parent){a.size-=c.size,a.height-=c.height;var e=Mg(a.parent.children,a);a.parent.children.splice(e+1,0,c)}else{var d=new If(a.children);d.parent=a,a.children=[d,c],a=d}c.parent=a.parent}while(a.children.length>10);a.parent.maybeSpill()}},iterN:function(a,b,c){for(var d=0;d<this.children.length;++d){var e=this.children[d],f=e.chunkSize();if(f>a){var g=Math.min(b,f-a);if(e.iterN(a,g,c))return!0;if(0==(b-=g))break;a=0}else a-=f}}};var Jf=0,Kf=w.Doc=function(a,b,c){if(!(this instanceof Kf))return new Kf(a,b,c);null==c&&(c=0),If.call(this,[new Hf([new lf("",null)])]),this.first=c,this.scrollTop=this.scrollLeft=0,this.cantEdit=!1,this.cleanGeneration=1,this.frontier=c;var d=nb(c,0);this.sel=vb(d),this.history=new Xf(null),this.id=++Jf,this.modeOption=b,"string"==typeof a&&(a=qh(a)),Gf(this,{from:d,to:d,text:a}),Ib(this,vb(d),Cg)};Kf.prototype=Og(If.prototype,{constructor:Kf,iter:function(a,b,c){c?this.iterN(a-this.first,b-a,c):this.iterN(this.first,this.first+this.size,a)},insert:function(a,b){for(var c=0,d=0;d<b.length;++d)c+=b[d].height;this.insertInner(a-this.first,b,c)},remove:function(a,b){this.removeInner(a-this.first,b)},getValue:function(a){var b=Rf(this,this.first,this.first+this.size);return a===!1?b:b.join(a\|\|"\n")},setValue:Nc(function(a){var b=nb(this.first,0),c=this.first+this.size-1;Rd(this,{from:b,to:nb(c,Pf(this,c).text.length),text:qh(a),origin:"setValue"},!0),Ib(this,vb(b))}),replaceRange:function(a,b,c,d){b=xb(this,b),c=c?xb(this,c):b,Xd(this,a,b,c,d)},getRange:function(a,b,c){var d=Qf(this,xb(this,a),xb(this,b));return c===!1?d:d.join(c\|\|"\n")},getLine:function(a){var b=this.getLineHandle(a);return b&&b.text},getLineHandle:function(a){return zb(this,a)?Pf(this,a):void 0},getLineNumber:function(a){return Tf(a)},getLineHandleVisualStart:function(a){return"number"==typeof a&&(a=Pf(this,a)),af(a)},lineCount:function(){return this.size},firstLine:function(){return this.first},lastLine:function(){return this.first+this.size-1},clipPos:function(a){return xb(this,a)},getCursor:function(a){var c,b=this.sel.primary();return c=null==a\|\|"head"==a?b.head:"anchor"==a?b.anchor:"end"==a\|\|"to"==a\|\|a===!1?b.to():b.from()},listSelections:function(){return this.sel.ranges},somethingSelected:function(){return this.sel.somethingSelected()},setCursor:Nc(function(a,b,c){Fb(this,xb(this,"number"==typeof a?nb(a,b\|\|0):a),null,c)}),setSelection:Nc(function(a,b,c){Fb(this,xb(this,a),xb(this,b\|\|a),c)}),extendSelection:Nc(function(a,b,c){Cb(this,xb(this,a),b&&xb(this,b),c)}),extendSelections:Nc(function(a,b){Db(this,Ab(this,a,b))}),extendSelectionsBy:Nc(function(a,b){Db(this,Ng(this.sel.ranges,a),b)}),setSelections:Nc(function(a,b,c){if(a.length){for(var d=0,e=[];d<a.length;d++)e[d]=new tb(xb(this,a[d].anchor),xb(this,a[d].head));null==b&&(b=Math.min(a.length-1,this.sel.primIndex)),Ib(this,ub(e,b),c)}}),addSelection:Nc(function(a,b,c){var d=this.sel.ranges.slice(0);d.push(new tb(xb(this,a),xb(this,b\|\|a))),Ib(this,ub(d,d.length-1),c)}),getSelection:function(a){for(var c,b=this.sel.ranges,d=0;d<b.length;d++){var e=Qf(this,b[d].from(),b[d].to());c=c?c.concat(e):e}return a===!1?c:c.join(a\|\|"\n")},getSelections:function(a){for(var b=[],c=this.sel.ranges,d=0;d<c.length;d++){var e=Qf(this,c[d].from(),c[d].to());a!==!1&&(e=e.join(a\|\|"\n")),b[d]=e}return b},replaceSelection:function(a,b,c){for(var d=[],e=0;e<this.sel.ranges.length;e++)d[e]=a;this.replaceSelections(d,b,c\|\|"+input")},replaceSelections:Nc(function(a,b,c){for(var d=[],e=this.sel,f=0;f<e.ranges.length;f++){var g=e.ranges[f];d[f]={from:g.from(),to:g.to(),text:qh(a[f]),origin:c}}for(var h=b&&"end"!=b&&Pd(this,d,b),f=d.length-1;f>=0;f--)Rd(this,d[f]);h?Hb(this,h):this.cm&&be(this.cm)}),undo:Nc(function(){Td(this,"undo")}),redo:Nc(function(){Td(this,"redo")}),undoSelection:Nc(function(){Td(this,"undo",!0)}),redoSelection:Nc(function(){Td(this,"redo",!0)}),setExtending:function(a){this.extend=a},getExtending:function(){return this.extend},historySize:function(){for(var a=this.history,b=0,c=0,d=0;d<a.done.length;d++)a.done[d].ranges\|\|++b;for(var d=0;d<a.undone.length;d++)a.undone[d].ranges\|\|++c;return{undo:b,redo:c}},clearHistory:function(){this.history=new Xf(this.history.maxGeneration)},markClean:function(){this.cleanGeneration=this.changeGeneration(!0)},changeGeneration:function(a){return a&&(this.history.lastOp=this.history.lastSelOp=this.history.lastOrigin=null),this.history.generation},isClean:function(a){return this.history.generation==(a\|\|this.cleanGeneration)},getHistory:function(){return{done:gg(this.history.done),undone:gg(this.history.undone)}},setHistory:function(a){var b=this.history=new Xf(this.history.maxGeneration);b.done=gg(a.done.slice(0),null,!0),b.undone=gg(a.undone.slice(0),null,!0)},addLineClass:Nc(function(a,b,c){return ee(this,a,"class",function(a){var d="text"==b?"textClass":"background"==b?"bgClass":"wrapClass";if(a[d]){if(new RegExp("(?:^\|\\s)"+c+"(?:$\|\\s)").test(a[d]))return!1;a[d]+=" "+c}else a[d]=c;return!0})}),removeLineClass:Nc(function(a,b,c){return ee(this,a,"class",function(a){var d="text"==b?"textClass":"background"==b?"bgClass":"wrapClass",e=a[d];if(!e)return!1;if(null==c)a[d]=null;else{var f=e.match(new RegExp("(?:^\|\\s+)"+c+"(?:$\|\\s+)"));if(!f)return!1;var g=f.index+f[0].length;a[d]=e.slice(0,f.index)+(f.index&&g!=e.length?" ":"")+e.slice(g)\|\|null}return!0})}),markText:function(a,b,c){return De(this,xb(this,a),xb(this,b),c,"range")},setBookmark:function(a,b){var c={replacedWith:b&&(null==b.nodeType?b.widget:b),insertLeft:b&&b.insertLeft,clearWhenEmpty:!1,shared:b&&b.shared};return a=xb(this,a),De(this,a,a,c,"bookmark")},findMarksAt:function(a){a=xb(this,a);var b=[],c=Pf(this,a.line).markedSpans;if(c)for(var d=0;d<c.length;++d){var e=c[d];(null==e.from\|\|e.from<=a.ch)&&(null==e.to\|\|e.to>=a.ch)&&b.push(e.marker.parent\|\|e.marker)}return b},findMarks:function(a,b,c){a=xb(this,a),b=xb(this,b);var d=[],e=a.line;return this.iter(a.line,b.line+1,function(f){var g=f.markedSpans;if(g)for(var h=0;h<g.length;h++){var i=g[h];e==a.line&&a.ch>i.to\|\|null==i.from&&e!=a.line\|\|e==b.line&&i.from>b.ch\|\|c&&!c(i.marker)\|\|d.push(i.marker.parent\|\|i.marker)}++e}),d},getAllMarks:function(){var a=[];return this.iter(function(b){var c=b.markedSpans;if(c)for(var d=0;d<c.length;++d)null!=c[d].from&&a.push(c[d].marker)}),a},posFromIndex:function(a){var b,c=this.first;return this.iter(function(d){var e=d.text.length+1;return e>a?(b=a,!0):(a-=e,++c,void 0)}),xb(this,nb(c,b))},indexFromPos:function(a){a=xb(this,a);var b=a.ch;return a.line<this.first\|\|a.ch<0?0:(this.iter(this.first,a.line,function(a){b+=a.text.length+1}),b)},copy:function(a){var b=new Kf(Rf(this,this.first,this.first+this.size),this.modeOption,this.first);return b.scrollTop=this.scrollTop,b.scrollLeft=this.scrollLeft,b.sel=this.sel,b.extend=!1,a&&(b.history.undoDepth=this.history.undoDepth,b.setHistory(this.getHistory())),b},linkedDoc:function(a){a\|\|(a={});var b=this.first,c=this.first+this.size;null!=a.from&&a.from>b&&(b=a.from),null!=a.to&&a.to<c&&(c=a.to);var d=new Kf(Rf(this,b,c),a.mode\|\|this.modeOption,b);return a.sharedHist&&(d.history=this.history),(this.linked\|\|(this.linked=[])).push({doc:d,sharedHist:a.sharedHist}),d.linked=[{doc:this,isParent:!0,sharedHist:a.sharedHist}],He(d,Ge(this)),d},unlinkDoc:function(a){if(a instanceof w&&(a=a.doc),this.linked)for(var b=0;b<this.linked.length;++b){var c=this.linked[b];if(c.doc==a){this.linked.splice(b,1),a.unlinkDoc(this),Ie(Ge(this));break}}if(a.history==this.history){var d=[a.id];Nf(a,function(a){d.push(a.id)},!0),a.history=new Xf(null),a.history.done=gg(this.history.done,d),a.history.undone=gg(this.history.undone,d)}},iterLinkedDocs:function(a){Nf(this,a)},getMode:function(){return this.mode},getEditor:function(){return this.cm}}),Kf.prototype.eachLine=Kf.prototype.iter;var Lf="iter insert remove copy getEditor".split(" ");for(var Mf in Kf.prototype)Kf.prototype.hasOwnProperty(Mf)&&Mg(Lf,Mf)<0&&(w.prototype[Mf]=function(a){return function(){return a.apply(this.doc,arguments)}}(Kf.prototype[Mf]));zg(Kf);var kg=w.e_preventDefault=function(a){a.preventDefault?a.preventDefault():a.returnValue=!1},lg=w.e_stopPropagation=function(a){a.stopPropagation?a.stopPropagation():a.cancelBubble=!0},ng=w.e_stop=function(a){kg(a),lg(a)},qg=w.on=function(a,b,c){if(a.addEventListener)a.addEventListener(b,c,!1);else if(a.attachEvent)a.attachEvent("on"+b,c);else{var d=a._handlers\|\|(a._handlers={}),e=d[b]\|\|(d[b]=[]);e.push(c)}},rg=w.off=function(a,b,c){if(a.removeEventListener)a.removeEventListener(b,c,!1);else if(a.detachEvent)a.detachEvent("on"+b,c);else{var d=a._handlers&&a._handlers[b];if(!d)return;for(var e=0;e<d.length;++e)if(d[e]==c){d.splice(e,1);break}}},sg=w.signal=function(a,b){var c=a._handlers&&a._handlers[b];if(c)for(var d=Array.prototype.slice.call(arguments,2),e=0;e<c.length;++e)c[e].apply(null,d)},tg=null,Ag=30,Bg=w.Pass={toString:function(){return"CodeMirror.Pass"}},Cg={scroll:!1},Dg={origin:"*mouse"},Eg={origin:"+move"};Fg.prototype.set=function(a,b){clearTimeout(this.id),this.id=setTimeout(b,a)};var Gg=w.countColumn=function(a,b,c,d,e){null==b&&(b=a.search(/[^\s\u00a0]/),-1==b&&(b=a.length));for(var f=d\|\|0,g=e\|\|0;;){var h=a.indexOf(" ",f);if(0>h\|\|h>=b)return g+(b-f);g+=h-f,g+=c-g%c,f=h+1}},Ig=[""],Lg=function(a){a.select()};n?Lg=function(a){a.selectionStart=0,a.selectionEnd=a.value.length}:d&&(Lg=function(a){try{a.select()}catch(b){}}),[].indexOf&&(Mg=function(a,b){return a.indexOf(b)}),[].map&&(Ng=function(a,b){return a.map(b)});var Yg,Rg=/[\u00df\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/,Sg=w.isWordChar=function(a){return/\w/.test(a)\|\|a>"\x80"&&(a.toUpperCase()!=a.toLowerCase()\|\|Rg.test(a))},Vg=/[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/;
13	+ Yg=document.createRange?function(a,b,c){var d=document.createRange();return d.setEnd(a,c),d.setStart(a,b),d}:function(a,b,c){var d=document.body.createTextRange();return d.moveToElementText(a.parentNode),d.collapse(!0),d.moveEnd("character",c),d.moveStart("character",b),d},d&&11>e&&(ah=function(){try{return document.activeElement}catch(a){return document.body}});var kh,mh,oh,gh=!1,jh=function(){if(d&&9>e)return!1;var a=Xg("div");return"draggable"in a\|\|"dragDrop"in a}(),qh=w.splitLines=3!="\n\nb".split(/\n/).length?function(a){for(var b=0,c=[],d=a.length;d>=b;){var e=a.indexOf("\n",b);-1==e&&(e=a.length);var f=a.slice(b,"\r"==a.charAt(e-1)?e-1:e),g=f.indexOf("\r");-1!=g?(c.push(f.slice(0,g)),b+=g+1):(c.push(f),b=e+1)}return c}:function(a){return a.split(/\r\n?\|\n/)},rh=window.getSelection?function(a){try{return a.selectionStart!=a.selectionEnd}catch(b){return!1}}:function(a){try{var b=a.ownerDocument.selection.createRange()}catch(c){}return b&&b.parentElement()==a?0!=b.compareEndPoints("StartToEnd",b):!1},sh=function(){var a=Xg("div");return"oncopy"in a?!0:(a.setAttribute("oncopy","return;"),"function"==typeof a.oncopy)}(),th=null,vh={3:"Enter",8:"Backspace",9:"Tab",13:"Enter",16:"Shift",17:"Ctrl",18:"Alt",19:"Pause",20:"CapsLock",27:"Esc",32:"Space",33:"PageUp",34:"PageDown",35:"End",36:"Home",37:"Left",38:"Up",39:"Right",40:"Down",44:"PrintScrn",45:"Insert",46:"Delete",59:";",61:"=",91:"Mod",92:"Mod",93:"Mod",107:"=",109:"-",127:"Delete",173:"-",186:";",187:"=",188:",",189:"-",190:".",191:"/",192:"`",219:"[",220:"\\",221:"]",222:"'",63232:"Up",63233:"Down",63234:"Left",63235:"Right",63272:"Delete",63273:"Home",63275:"End",63276:"PageUp",63277:"PageDown",63302:"Insert"};w.keyNames=vh,function(){for(var a=0;10>a;a++)vh[a+48]=vh[a+96]=String(a);for(var a=65;90>=a;a++)vh[a]=String.fromCharCode(a);for(var a=1;12>=a;a++)vh[a+111]=vh[a+63235]="F"+a}();var Fh,Kh=function(){function c(c){return 247>=c?a.charAt(c):c>=1424&&1524>=c?"R":c>=1536&&1773>=c?b.charAt(c-1536):c>=1774&&2220>=c?"r":c>=8192&&8203>=c?"w":8204==c?"b":"L"}function j(a,b,c){this.level=a,this.from=b,this.to=c}var a="bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN",b="rrrrrrrrrrrr,rNNmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmrrrrrrrnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmNmmmm",d=/[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/,e=/[stwN]/,f=/[LRr]/,g=/[Lb1n]/,h=/[1n]/,i="L";return function(a){if(!d.test(a))return!1;for(var m,b=a.length,k=[],l=0;b>l;++l)k.push(m=c(a.charCodeAt(l)));for(var l=0,n=i;b>l;++l){var m=k[l];"m"==m?k[l]=n:n=m}for(var l=0,o=i;b>l;++l){var m=k[l];"1"==m&&"r"==o?k[l]="n":f.test(m)&&(o=m,"r"==m&&(k[l]="R"))}for(var l=1,n=k[0];b-1>l;++l){var m=k[l];"+"==m&&"1"==n&&"1"==k[l+1]?k[l]="1":","!=m\|\|n!=k[l+1]\|\|"1"!=n&&"n"!=n\|\|(k[l]=n),n=m}for(var l=0;b>l;++l){var m=k[l];if(","==m)k[l]="N";else if("%"==m){for(var p=l+1;b>p&&"%"==k[p];++p);for(var q=l&&"!"==k[l-1]\|\|b>p&&"1"==k[p]?"1":"N",r=l;p>r;++r)k[r]=q;l=p-1}}for(var l=0,o=i;b>l;++l){var m=k[l];"L"==o&&"1"==m?k[l]="L":f.test(m)&&(o=m)}for(var l=0;b>l;++l)if(e.test(k[l])){for(var p=l+1;b>p&&e.test(k[p]);++p);for(var s="L"==(l?k[l-1]:i),t="L"==(b>p?k[p]:i),q=s\|\|t?"L":"R",r=l;p>r;++r)k[r]=q;l=p-1}for(var v,u=[],l=0;b>l;)if(g.test(k[l])){var w=l;for(++l;b>l&&g.test(k[l]);++l);u.push(new j(0,w,l))}else{var x=l,y=u.length;for(++l;b>l&&"L"!=k[l];++l);for(var r=x;l>r;)if(h.test(k[r])){r>x&&u.splice(y,0,new j(1,x,r));var z=r;for(++r;l>r&&h.test(k[r]);++r);u.splice(y,0,new j(2,z,r)),x=r}else++r;l>x&&u.splice(y,0,new j(1,x,l))}return 1==u[0].level&&(v=a.match(/^\s+/))&&(u[0].from=v[0].length,u.unshift(new j(0,0,v[0].length))),1==Kg(u).level&&(v=a.match(/\s+$/))&&(Kg(u).to-=v[0].length,u.push(new j(0,b-v[0].length,b))),u[0].level!=Kg(u).level&&u.push(new j(u[0].level,b,b)),u}}();return w.version="4.4.1",w});

js/colorbox/colorbox.css ADDED Viewed

	@@ -0,0 +1,86 @@


1	+ /*
2	+ ColorBox Core Style:
3	+ The following CSS is consistent between example themes and should not be altered.
4	+ */
5	+ #colorbox, #cboxOverlay, #cboxWrapper{position:absolute; top:0; left:0; z-index:9999;}
6	+ #cboxOverlay{position:fixed; width:100%; height:100%;}
7	+ #cboxMiddleLeft, #cboxBottomLeft{clear:left;}
8	+ #cboxContent{position:relative;}
9	+ #cboxLoadedContent{overflow:auto; -webkit-overflow-scrolling: touch;}
10	+ #cboxTitle{margin:0;}
11	+ #cboxLoadingOverlay, #cboxLoadingGraphic{position:absolute; top:0; left:0; width:100%; height:100%;}
12	+ #cboxPrevious, #cboxNext, #cboxClose, #cboxSlideshow{cursor:pointer;}
13	+ .cboxPhoto{float:left; margin:auto; border:0; display:block; max-width:none;}
14	+ .cboxIframe{width:100%; height:100%; display:block; border:0;}
15	+ #colorbox, #cboxContent, #cboxLoadedContent{box-sizing:content-box; -moz-box-sizing:content-box; -webkit-box-sizing:content-box;}
16	+
17	+ /*
18	+ User Style:
19	+ Change the following styles to modify the appearance of ColorBox. They are
20	+ ordered & tabbed in a way that represents the nesting of the generated HTML.
21	+ */
22	+ #cboxOverlay{background:#222;}
23	+ #colorbox{outline:0;}
24	+
25	+ #cboxContent{background:#fff; padding: 10px;}
26	+ .cboxIframe{background:#fff;}
27	+ #cboxError{padding:50px; border:1px solid #ccc;}
28	+ #cboxLoadedContent{margin-bottom:28px;}
29	+ #cboxTitle{position:absolute; bottom:4px; left:0; text-align:center; width:100%; color:#949494;}
30	+ #cboxCurrent{position:absolute; bottom:4px; left:58px; color:#949494;}
31	+ #cboxLoadingOverlay{background:url(images/loading_background.png) no-repeat center center;}
32	+ #cboxLoadingGraphic{background:url(images/loading.gif) no-repeat center center;}
33	+
34	+ /* these elements are buttons, and may need to have additional styles reset to avoid unwanted base styles */
35	+ #cboxPrevious, #cboxNext, #cboxSlideshow, #cboxClose {border:0; padding:0; margin:0; overflow:visible; width:auto; background:none; }
36	+
37	+ /* avoid outlines on :active (mouseclick), but preserve outlines on :focus (tabbed navigating) */
38	+ #cboxPrevious:active, #cboxNext:active, #cboxSlideshow:active, #cboxClose:active {outline:0;}
39	+
40	+ #cboxSlideshow{position:absolute; bottom:4px; right:30px; color:#0092ef;}
41	+ #cboxPrevious{position:absolute; bottom:0; left:0; background:url(images/controls.png) no-repeat -75px 0; width:25px; height:25px; text-indent:-9999px;}
42	+ #cboxPrevious:hover{background-position:-75px -25px;}
43	+ #cboxNext{position:absolute; bottom:0; left:27px; background:url(images/controls.png) no-repeat -50px 0; width:25px; height:25px; text-indent:-9999px;}
44	+ #cboxNext:hover{background-position:-50px -25px;}
45	+ #cboxClose{position:absolute; top:12px; right:6px; background:url(images/controls.png) no-repeat -25px 0; width:25px; height:25px; text-indent:-9999px;}
46	+ #cboxClose:hover{background-position:-25px -25px;}
47	+
48	+ /*
49	+ The following fixes a problem where IE7 and IE8 replace a PNG's alpha transparency with a black fill
50	+ when an alpha filter (opacity change) is set on the element or ancestor element. This style is not applied to or needed in IE9.
51	+ See: http://jacklmoore.com/notes/ie-transparency-problems/
52	+ */
53	+ .cboxIE #cboxTopLeft,
54	+ .cboxIE #cboxTopCenter,
55	+ .cboxIE #cboxTopRight,
56	+ .cboxIE #cboxBottomLeft,
57	+ .cboxIE #cboxBottomCenter,
58	+ .cboxIE #cboxBottomRight,
59	+ .cboxIE #cboxMiddleLeft,
60	+ .cboxIE #cboxMiddleRight {
61	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF);
62	+ }
63	+
64	+ /*
65	+ The following provides PNG transparency support for IE6
66	+ Feel free to remove this and the /ie6/ directory if you have dropped IE6 support.
67	+ */
68	+ .cboxIE6 #cboxTopLeft{background:url(images/ie6/borderTopLeft.png);}
69	+ .cboxIE6 #cboxTopCenter{background:url(images/ie6/borderTopCenter.png);}
70	+ .cboxIE6 #cboxTopRight{background:url(images/ie6/borderTopRight.png);}
71	+ .cboxIE6 #cboxBottomLeft{background:url(images/ie6/borderBottomLeft.png);}
72	+ .cboxIE6 #cboxBottomCenter{background:url(images/ie6/borderBottomCenter.png);}
73	+ .cboxIE6 #cboxBottomRight{background:url(images/ie6/borderBottomRight.png);}
74	+ .cboxIE6 #cboxMiddleLeft{background:url(images/ie6/borderMiddleLeft.png);}
75	+ .cboxIE6 #cboxMiddleRight{background:url(images/ie6/borderMiddleRight.png);}
76	+
77	+ .cboxIE6 #cboxTopLeft,
78	+ .cboxIE6 #cboxTopCenter,
79	+ .cboxIE6 #cboxTopRight,
80	+ .cboxIE6 #cboxBottomLeft,
81	+ .cboxIE6 #cboxBottomCenter,
82	+ .cboxIE6 #cboxBottomRight,
83	+ .cboxIE6 #cboxMiddleLeft,
84	+ .cboxIE6 #cboxMiddleRight {
85	+ _behavior: expression(this.src = this.src ? this.src : this.currentStyle.backgroundImage.split('"')[1], this.style.background = "none", this.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src=" + this.src + ", sizingMethod='scale')");
86	+ }

js/colorbox/images/border.png ADDED Viewed

Binary file

js/colorbox/images/controls.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderBottomCenter.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderBottomLeft.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderBottomRight.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderMiddleLeft.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderMiddleRight.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderTopCenter.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderTopLeft.png ADDED Viewed

Binary file

js/colorbox/images/ie6/borderTopRight.png ADDED Viewed

Binary file

js/colorbox/images/loading.gif ADDED Viewed

Binary file

js/colorbox/images/loading_background.png ADDED Viewed

Binary file

js/colorbox/images/overlay.png ADDED Viewed

Binary file

js/colorbox/jquery.colorbox-min.js ADDED Viewed

	@@ -0,0 +1,1061 @@


1	+ /*!
2	+ Colorbox v1.4.25 - 2013-06-28
3	+ jQuery lightbox and modal window plugin
4	+ (c) 2013 Jack Moore - http://www.jacklmoore.com/colorbox
5	+ license: http://www.opensource.org/licenses/mit-license.php
6	+ */
7	+ (function ($, document, window) {
8	+ var
9	+ // Default settings object.
10	+ // See http://jacklmoore.com/colorbox for details.
11	+ defaults = {
12	+ transition: "elastic",
13	+ speed: 300,
14	+ fadeOut: 300,
15	+ width: false,
16	+ initialWidth: "600",
17	+ innerWidth: false,
18	+ maxWidth: false,
19	+ height: false,
20	+ initialHeight: "450",
21	+ innerHeight: false,
22	+ maxHeight: false,
23	+ scalePhotos: true,
24	+ scrolling: true,
25	+ inline: false,
26	+ html: false,
27	+ iframe: false,
28	+ fastIframe: true,
29	+ photo: false,
30	+ href: false,
31	+ title: false,
32	+ rel: false,
33	+ opacity: 0.9,
34	+ preloading: true,
35	+ className: false,
36	+
37	+ // alternate image paths for high-res displays
38	+ retinaImage: false,
39	+ retinaUrl: false,
40	+ retinaSuffix: '@2x.$1',
41	+
42	+ // internationalization
43	+ current: "image {current} of {total}",
44	+ previous: "previous",
45	+ next: "next",
46	+ close: "close",
47	+ xhrError: "This content failed to load.",
48	+ imgError: "This image failed to load.",
49	+
50	+ open: false,
51	+ returnFocus: true,
52	+ trapFocus: false,
53	+ reposition: true,
54	+ loop: true,
55	+ slideshow: false,
56	+ slideshowAuto: true,
57	+ slideshowSpeed: 2500,
58	+ slideshowStart: "start slideshow",
59	+ slideshowStop: "stop slideshow",
60	+ photoRegex: /\.(gif\|png\|jp(e\|g\|eg)\|bmp\|ico\|webp)((#\|\?).*)?$/i,
61	+
62	+ onOpen: false,
63	+ onLoad: false,
64	+ onComplete: false,
65	+ onCleanup: false,
66	+ onClosed: false,
67	+
68	+ overlayClose: true,
69	+ escKey: true,
70	+ arrowKey: true,
71	+ top: false,
72	+ bottom: false,
73	+ left: false,
74	+ right: false,
75	+ fixed: false,
76	+ data: undefined,
77	+ closeButton: true
78	+ },
79	+
80	+ // Abstracting the HTML and event identifiers for easy rebranding
81	+ colorbox = 'colorbox',
82	+ prefix = 'cbox',
83	+ boxElement = prefix + 'Element',
84	+
85	+ // Events
86	+ event_open = prefix + '_open',
87	+ event_load = prefix + '_load',
88	+ event_complete = prefix + '_complete',
89	+ event_cleanup = prefix + '_cleanup',
90	+ event_closed = prefix + '_closed',
91	+ event_purge = prefix + '_purge',
92	+
93	+ // Cached jQuery Object Variables
94	+ $overlay,
95	+ $box,
96	+ $wrap,
97	+ $content,
98	+ $topBorder,
99	+ $leftBorder,
100	+ $rightBorder,
101	+ $bottomBorder,
102	+ $related,
103	+ $window,
104	+ $loaded,
105	+ $loadingBay,
106	+ $loadingOverlay,
107	+ $title,
108	+ $current,
109	+ $slideshow,
110	+ $next,
111	+ $prev,
112	+ $close,
113	+ $groupControls,
114	+ $events = $('<a/>'),
115	+
116	+ // Variables for cached values or use across multiple functions
117	+ settings,
118	+ interfaceHeight,
119	+ interfaceWidth,
120	+ loadedHeight,
121	+ loadedWidth,
122	+ element,
123	+ index,
124	+ photo,
125	+ open,
126	+ active,
127	+ closing,
128	+ loadingTimer,
129	+ publicMethod,
130	+ div = "div",
131	+ className,
132	+ requests = 0,
133	+ previousCSS = {},
134	+ init;
135	+
136	+ // ****************
137	+ // HELPER FUNCTIONS
138	+ // ****************
139	+
140	+ // Convenience function for creating new jQuery objects
141	+ function $tag(tag, id, css) {
142	+ var element = document.createElement(tag);
143	+
144	+ if (id) {
145	+ element.id = prefix + id;
146	+ }
147	+
148	+ if (css) {
149	+ element.style.cssText = css;
150	+ }
151	+
152	+ return $(element);
153	+ }
154	+
155	+ // Get the window height using innerHeight when available to avoid an issue with iOS
156	+ // http://bugs.jquery.com/ticket/6724
157	+ function winheight() {
158	+ return window.innerHeight ? window.innerHeight : $(window).height();
159	+ }
160	+
161	+ // Determine the next and previous members in a group.
162	+ function getIndex(increment) {
163	+ var
164	+ max = $related.length,
165	+ newIndex = (index + increment) % max;
166	+
167	+ return (newIndex < 0) ? max + newIndex : newIndex;
168	+ }
169	+
170	+ // Convert '%' and 'px' values to integers
171	+ function setSize(size, dimension) {
172	+ return Math.round((/%/.test(size) ? ((dimension === 'x' ? $window.width() : winheight()) / 100) : 1) * parseInt(size, 10));
173	+ }
174	+
175	+ // Checks an href to see if it is a photo.
176	+ // There is a force photo option (photo: true) for hrefs that cannot be matched by the regex.
177	+ function isImage(settings, url) {
178	+ return settings.photo \|\| settings.photoRegex.test(url);
179	+ }
180	+
181	+ function retinaUrl(settings, url) {
182	+ return settings.retinaUrl && window.devicePixelRatio > 1 ? url.replace(settings.photoRegex, settings.retinaSuffix) : url;
183	+ }
184	+
185	+ function trapFocus(e) {
186	+ if ('contains' in $box[0] && !$box[0].contains(e.target)) {
187	+ e.stopPropagation();
188	+ $box.focus();
189	+ }
190	+ }
191	+
192	+ // Assigns function results to their respective properties
193	+ function makeSettings() {
194	+ var i,
195	+ data = $.data(element, colorbox);
196	+
197	+ if (data == null) {
198	+ settings = $.extend({}, defaults);
199	+ if (console && console.log) {
200	+ console.log('Error: cboxElement missing settings object');
201	+ }
202	+ } else {
203	+ settings = $.extend({}, data);
204	+ }
205	+
206	+ for (i in settings) {
207	+ if ($.isFunction(settings[i]) && i.slice(0, 2) !== 'on') { // checks to make sure the function isn't one of the callbacks, they will be handled at the appropriate time.
208	+ settings[i] = settings[i].call(element);
209	+ }
210	+ }
211	+
212	+ settings.rel = settings.rel \|\| element.rel \|\| $(element).data('rel') \|\| 'nofollow';
213	+ settings.href = settings.href \|\| $(element).attr('href');
214	+ settings.title = settings.title \|\| element.title;
215	+
216	+ if (typeof settings.href === "string") {
217	+ settings.href = $.trim(settings.href);
218	+ }
219	+ }
220	+
221	+ function trigger(event, callback) {
222	+ // for external use
223	+ $(document).trigger(event);
224	+
225	+ // for internal use
226	+ $events.trigger(event);
227	+
228	+ if ($.isFunction(callback)) {
229	+ callback.call(element);
230	+ }
231	+ }
232	+
233	+ // Slideshow functionality
234	+ function slideshow() {
235	+ var
236	+ timeOut,
237	+ className = prefix + "Slideshow_",
238	+ click = "click." + prefix,
239	+ clear,
240	+ set,
241	+ start,
242	+ stop;
243	+
244	+ if (settings.slideshow && $related[1]) {
245	+ clear = function () {
246	+ clearTimeout(timeOut);
247	+ };
248	+
249	+ set = function () {
250	+ if (settings.loop \|\| $related[index + 1]) {
251	+ timeOut = setTimeout(publicMethod.next, settings.slideshowSpeed);
252	+ }
253	+ };
254	+
255	+ start = function () {
256	+ $slideshow
257	+ .html(settings.slideshowStop)
258	+ .unbind(click)
259	+ .one(click, stop);
260	+
261	+ $events
262	+ .bind(event_complete, set)
263	+ .bind(event_load, clear)
264	+ .bind(event_cleanup, stop);
265	+
266	+ $box.removeClass(className + "off").addClass(className + "on");
267	+ };
268	+
269	+ stop = function () {
270	+ clear();
271	+
272	+ $events
273	+ .unbind(event_complete, set)
274	+ .unbind(event_load, clear)
275	+ .unbind(event_cleanup, stop);
276	+
277	+ $slideshow
278	+ .html(settings.slideshowStart)
279	+ .unbind(click)
280	+ .one(click, function () {
281	+ publicMethod.next();
282	+ start();
283	+ });
284	+
285	+ $box.removeClass(className + "on").addClass(className + "off");
286	+ };
287	+
288	+ if (settings.slideshowAuto) {
289	+ start();
290	+ } else {
291	+ stop();
292	+ }
293	+ } else {
294	+ $box.removeClass(className + "off " + className + "on");
295	+ }
296	+ }
297	+
298	+ function launch(target) {
299	+ if (!closing) {
300	+
301	+ element = target;
302	+
303	+ makeSettings();
304	+
305	+ $related = $(element);
306	+
307	+ index = 0;
308	+
309	+ if (settings.rel !== 'nofollow') {
310	+ $related = $('.' + boxElement).filter(function () {
311	+ var data = $.data(this, colorbox),
312	+ relRelated;
313	+
314	+ if (data) {
315	+ relRelated = $(this).data('rel') \|\| data.rel \|\| this.rel;
316	+ }
317	+
318	+ return (relRelated === settings.rel);
319	+ });
320	+ index = $related.index(element);
321	+
322	+ // Check direct calls to Colorbox.
323	+ if (index === -1) {
324	+ $related = $related.add(element);
325	+ index = $related.length - 1;
326	+ }
327	+ }
328	+
329	+ $overlay.css({
330	+ opacity: parseFloat(settings.opacity),
331	+ cursor: settings.overlayClose ? "pointer" : "auto",
332	+ visibility: 'visible'
333	+ }).show();
334	+
335	+
336	+ if (className) {
337	+ $box.add($overlay).removeClass(className);
338	+ }
339	+ if (settings.className) {
340	+ $box.add($overlay).addClass(settings.className);
341	+ }
342	+ className = settings.className;
343	+
344	+ if (settings.closeButton) {
345	+ $close.html(settings.close).appendTo($content);
346	+ } else {
347	+ $close.appendTo('<div/>');
348	+ }
349	+
350	+ if (!open) {
351	+ open = active = true; // Prevents the page-change action from queuing up if the visitor holds down the left or right keys.
352	+
353	+ // Show colorbox so the sizes can be calculated in older versions of jQuery
354	+ $box.css({visibility:'hidden', display:'block'});
355	+
356	+ $loaded = $tag(div, 'LoadedContent', 'width:0; height:0; overflow:hidden').appendTo($content);
357	+
358	+ // Cache values needed for size calculations
359	+ interfaceHeight = $topBorder.height() + $bottomBorder.height() + $content.outerHeight(true) - $content.height();
360	+ interfaceWidth = $leftBorder.width() + $rightBorder.width() + $content.outerWidth(true) - $content.width();
361	+ loadedHeight = $loaded.outerHeight(true);
362	+ loadedWidth = $loaded.outerWidth(true);
363	+
364	+
365	+ // Opens inital empty Colorbox prior to content being loaded.
366	+ settings.w = setSize(settings.initialWidth, 'x');
367	+ settings.h = setSize(settings.initialHeight, 'y');
368	+ publicMethod.position();
369	+
370	+ slideshow();
371	+
372	+ trigger(event_open, settings.onOpen);
373	+
374	+ $groupControls.add($title).hide();
375	+
376	+ $box.focus();
377	+
378	+
379	+ if (settings.trapFocus) {
380	+ // Confine focus to the modal
381	+ // Uses event capturing that is not supported in IE8-
382	+ if (document.addEventListener) {
383	+
384	+ document.addEventListener('focus', trapFocus, true);
385	+
386	+ $events.one(event_closed, function () {
387	+ document.removeEventListener('focus', trapFocus, true);
388	+ });
389	+ }
390	+ }
391	+
392	+ // Return focus on closing
393	+ if (settings.returnFocus) {
394	+ $events.one(event_closed, function () {
395	+ $(element).focus();
396	+ });
397	+ }
398	+ }
399	+
400	+ load();
401	+ }
402	+ }
403	+
404	+ // Colorbox's markup needs to be added to the DOM prior to being called
405	+ // so that the browser will go ahead and load the CSS background images.
406	+ function appendHTML() {
407	+ if (!$box && document.body) {
408	+ init = false;
409	+ $window = $(window);
410	+ $box = $tag(div).attr({
411	+ id: colorbox,
412	+ 'class': $.support.opacity === false ? prefix + 'IE' : '', // class for optional IE8 & lower targeted CSS.
413	+ role: 'dialog',
414	+ tabindex: '-1'
415	+ }).hide();
416	+ $overlay = $tag(div, "Overlay").hide();
417	+ $loadingOverlay = $([$tag(div, "LoadingOverlay")[0],$tag(div, "LoadingGraphic")[0]]);
418	+ $wrap = $tag(div, "Wrapper");
419	+ $content = $tag(div, "Content").append(
420	+ $title = $tag(div, "Title"),
421	+ $current = $tag(div, "Current"),
422	+ $prev = $('<button type="button"/>').attr({id:prefix+'Previous'}),
423	+ $next = $('<button type="button"/>').attr({id:prefix+'Next'}),
424	+ $slideshow = $tag('button', "Slideshow"),
425	+ $loadingOverlay
426	+ );
427	+
428	+ $close = $('<button type="button"/>').attr({id:prefix+'Close'});
429	+
430	+ $wrap.append( // The 3x3 Grid that makes up Colorbox
431	+ $tag(div).append(
432	+ $tag(div, "TopLeft"),
433	+ $topBorder = $tag(div, "TopCenter"),
434	+ $tag(div, "TopRight")
435	+ ),
436	+ $tag(div, false, 'clear:left').append(
437	+ $leftBorder = $tag(div, "MiddleLeft"),
438	+ $content,
439	+ $rightBorder = $tag(div, "MiddleRight")
440	+ ),
441	+ $tag(div, false, 'clear:left').append(
442	+ $tag(div, "BottomLeft"),
443	+ $bottomBorder = $tag(div, "BottomCenter"),
444	+ $tag(div, "BottomRight")
445	+ )
446	+ ).find('div div').css({'float': 'left'});
447	+
448	+ $loadingBay = $tag(div, false, 'position:absolute; width:9999px; visibility:hidden; display:none');
449	+
450	+ $groupControls = $next.add($prev).add($current).add($slideshow);
451	+
452	+ $(document.body).append($overlay, $box.append($wrap, $loadingBay));
453	+ }
454	+ }
455	+
456	+ // Add Colorbox's event bindings
457	+ function addBindings() {
458	+ function clickHandler(e) {
459	+ // ignore non-left-mouse-clicks and clicks modified with ctrl / command, shift, or alt.
460	+ // See: http://jacklmoore.com/notes/click-events/
461	+ if (!(e.which > 1 \|\| e.shiftKey \|\| e.altKey \|\| e.metaKey \|\| e.ctrlKey)) {
462	+ e.preventDefault();
463	+ launch(this);
464	+ }
465	+ }
466	+
467	+ if ($box) {
468	+ if (!init) {
469	+ init = true;
470	+
471	+ // Anonymous functions here keep the public method from being cached, thereby allowing them to be redefined on the fly.
472	+ $next.click(function () {
473	+ publicMethod.next();
474	+ });
475	+ $prev.click(function () {
476	+ publicMethod.prev();
477	+ });
478	+ $close.click(function () {
479	+ publicMethod.close();
480	+ });
481	+ $overlay.click(function () {
482	+ if (settings.overlayClose) {
483	+ publicMethod.close();
484	+ }
485	+ });
486	+
487	+ // Key Bindings
488	+ $(document).bind('keydown.' + prefix, function (e) {
489	+ var key = e.keyCode;
490	+ if (open && settings.escKey && key === 27) {
491	+ e.preventDefault();
492	+ publicMethod.close();
493	+ }
494	+ if (open && settings.arrowKey && $related[1] && !e.altKey) {
495	+ if (key === 37) {
496	+ e.preventDefault();
497	+ $prev.click();
498	+ } else if (key === 39) {
499	+ e.preventDefault();
500	+ $next.click();
501	+ }
502	+ }
503	+ });
504	+
505	+ if ($.isFunction($.fn.on)) {
506	+ // For jQuery 1.7+
507	+ $(document).on('click.'+prefix, '.'+boxElement, clickHandler);
508	+ } else {
509	+ // For jQuery 1.3.x -> 1.6.x
510	+ // This code is never reached in jQuery 1.9, so do not contact me about 'live' being removed.
511	+ // This is not here for jQuery 1.9, it's here for legacy users.
512	+ $('.'+boxElement).live('click.'+prefix, clickHandler);
513	+ }
514	+ }
515	+ return true;
516	+ }
517	+ return false;
518	+ }
519	+
520	+ // Don't do anything if Colorbox already exists.
521	+ if ($.colorbox) {
522	+ return;
523	+ }
524	+
525	+ // Append the HTML when the DOM loads
526	+ $(appendHTML);
527	+
528	+
529	+ // ****************
530	+ // PUBLIC FUNCTIONS
531	+ // Usage format: $.colorbox.close();
532	+ // Usage from within an iframe: parent.jQuery.colorbox.close();
533	+ // ****************
534	+
535	+ publicMethod = $.fn[colorbox] = $[colorbox] = function (options, callback) {
536	+ var $this = this;
537	+
538	+ options = options \|\| {};
539	+
540	+ appendHTML();
541	+
542	+ if (addBindings()) {
543	+ if ($.isFunction($this)) { // assume a call to $.colorbox
544	+ $this = $('<a/>');
545	+ options.open = true;
546	+ } else if (!$this[0]) { // colorbox being applied to empty collection
547	+ return $this;
548	+ }
549	+
550	+ if (callback) {
551	+ options.onComplete = callback;
552	+ }
553	+
554	+ $this.each(function () {
555	+ $.data(this, colorbox, $.extend({}, $.data(this, colorbox) \|\| defaults, options));
556	+ }).addClass(boxElement);
557	+
558	+ if (($.isFunction(options.open) && options.open.call($this)) \|\| options.open) {
559	+ launch($this[0]);
560	+ }
561	+ }
562	+
563	+ return $this;
564	+ };
565	+
566	+ publicMethod.position = function (speed, loadedCallback) {
567	+ var
568	+ css,
569	+ top = 0,
570	+ left = 0,
571	+ offset = $box.offset(),
572	+ scrollTop,
573	+ scrollLeft;
574	+
575	+ $window.unbind('cbResize.' + prefix);
576	+
577	+ // remove the modal so that it doesn't influence the document width/height
578	+ $box.css({top: -9e4, left: -9e4});
579	+
580	+ scrollTop = $window.scrollTop();
581	+ scrollLeft = $window.scrollLeft();
582	+
583	+ if (settings.fixed) {
584	+ offset.top -= scrollTop;
585	+ offset.left -= scrollLeft;
586	+ $box.css({position: 'fixed'});
587	+ } else {
588	+ top = scrollTop;
589	+ left = scrollLeft;
590	+ $box.css({position: 'absolute'});
591	+ }
592	+
593	+ // keeps the top and left positions within the browser's viewport.
594	+ if (settings.right !== false) {
595	+ left += Math.max($window.width() - settings.w - loadedWidth - interfaceWidth - setSize(settings.right, 'x'), 0);
596	+ } else if (settings.left !== false) {
597	+ left += setSize(settings.left, 'x');
598	+ } else {
599	+ left += Math.round(Math.max($window.width() - settings.w - loadedWidth - interfaceWidth, 0) / 2);
600	+ }
601	+
602	+ if (settings.bottom !== false) {
603	+ top += Math.max(winheight() - settings.h - loadedHeight - interfaceHeight - setSize(settings.bottom, 'y'), 0);
604	+ } else if (settings.top !== false) {
605	+ top += setSize(settings.top, 'y');
606	+ } else {
607	+ top += Math.round(Math.max(winheight() - settings.h - loadedHeight - interfaceHeight, 0) / 2);
608	+ }
609	+
610	+ $box.css({top: offset.top, left: offset.left, visibility:'visible'});
611	+
612	+ // this gives the wrapper plenty of breathing room so it's floated contents can move around smoothly,
613	+ // but it has to be shrank down around the size of div#colorbox when it's done. If not,
614	+ // it can invoke an obscure IE bug when using iframes.
615	+ $wrap[0].style.width = $wrap[0].style.height = "9999px";
616	+
617	+ function modalDimensions(that) {
618	+ $topBorder[0].style.width = $bottomBorder[0].style.width = $content[0].style.width = (parseInt(that.style.width,10) - interfaceWidth)+'px';
619	+ $content[0].style.height = $leftBorder[0].style.height = $rightBorder[0].style.height = (parseInt(that.style.height,10) - interfaceHeight)+'px';
620	+ }
621	+
622	+ css = {width: settings.w + loadedWidth + interfaceWidth, height: settings.h + loadedHeight + interfaceHeight, top: top, left: left};
623	+
624	+ // setting the speed to 0 if the content hasn't changed size or position
625	+ if (speed) {
626	+ var tempSpeed = 0;
627	+ $.each(css, function(i){
628	+ if (css[i] !== previousCSS[i]) {
629	+ tempSpeed = speed;
630	+ return;
631	+ }
632	+ });
633	+ speed = tempSpeed;
634	+ }
635	+
636	+ previousCSS = css;
637	+
638	+ $box.dequeue().animate(css, {
639	+ duration: speed \|\| 0,
640	+ complete: function () {
641	+ modalDimensions(this);
642	+
643	+ active = false;
644	+
645	+ // shrink the wrapper down to exactly the size of colorbox to avoid a bug in IE's iframe implementation.
646	+ $wrap[0].style.width = (settings.w + loadedWidth + interfaceWidth) + "px";
647	+ $wrap[0].style.height = (settings.h + loadedHeight + interfaceHeight) + "px";
648	+
649	+ if (settings.reposition) {
650	+ setTimeout(function () { // small delay before binding oncbResize due to an IE8 bug.
651	+ $window.bind('cbResize.' + prefix, publicMethod.position);
652	+ }, 1);
653	+ }
654	+
655	+ if (loadedCallback) {
656	+ loadedCallback();
657	+ }
658	+ },
659	+ step: function () {
660	+ modalDimensions(this);
661	+ }
662	+ });
663	+ };
664	+
665	+ publicMethod.cbResize = function (options) {
666	+ var scrolltop;
667	+
668	+ if (open) {
669	+ options = options \|\| {};
670	+
671	+ if (options.width) {
672	+ settings.w = setSize(options.width, 'x') - loadedWidth - interfaceWidth;
673	+ }
674	+
675	+ if (options.innerWidth) {
676	+ settings.w = setSize(options.innerWidth, 'x');
677	+ }
678	+
679	+ $loaded.css({width: settings.w});
680	+
681	+ if (options.height) {
682	+ settings.h = setSize(options.height, 'y') - loadedHeight - interfaceHeight;
683	+ }
684	+
685	+ if (options.innerHeight) {
686	+ settings.h = setSize(options.innerHeight, 'y');
687	+ }
688	+
689	+ if (!options.innerHeight && !options.height) {
690	+ scrolltop = $loaded.scrollTop();
691	+ $loaded.css({height: "auto"});
692	+ settings.h = $loaded.height();
693	+ }
694	+
695	+ $loaded.css({height: settings.h});
696	+
697	+ if(scrolltop) {
698	+ $loaded.scrollTop(scrolltop);
699	+ }
700	+
701	+ publicMethod.position(settings.transition === "none" ? 0 : settings.speed);
702	+ }
703	+ };
704	+
705	+ publicMethod.prep = function (object) {
706	+ if (!open) {
707	+ return;
708	+ }
709	+
710	+ var callback, speed = settings.transition === "none" ? 0 : settings.speed;
711	+
712	+ $loaded.empty().remove(); // Using empty first may prevent some IE7 issues.
713	+
714	+ $loaded = $tag(div, 'LoadedContent').append(object);
715	+
716	+ function getWidth() {
717	+ settings.w = settings.w \|\| $loaded.width();
718	+ settings.w = settings.mw && settings.mw < settings.w ? settings.mw : settings.w;
719	+ return settings.w;
720	+ }
721	+ function getHeight() {
722	+ settings.h = settings.h \|\| $loaded.height();
723	+ settings.h = settings.mh && settings.mh < settings.h ? settings.mh : settings.h;
724	+ return settings.h;
725	+ }
726	+
727	+ $loaded.hide()
728	+ .appendTo($loadingBay.show())// content has to be appended to the DOM for accurate size calculations.
729	+ .css({width: getWidth(), overflow: settings.scrolling ? 'auto' : 'hidden'})
730	+ .css({height: getHeight()})// sets the height independently from the width in case the new width influences the value of height.
731	+ .prependTo($content);
732	+
733	+ $loadingBay.hide();
734	+
735	+ // floating the IMG removes the bottom line-height and fixed a problem where IE miscalculates the width of the parent element as 100% of the document width.
736	+
737	+ $(photo).css({'float': 'none'});
738	+
739	+ callback = function () {
740	+ var total = $related.length,
741	+ iframe,
742	+ frameBorder = 'frameBorder',
743	+ allowTransparency = 'allowTransparency',
744	+ complete;
745	+
746	+ if (!open) {
747	+ return;
748	+ }
749	+
750	+ function removeFilter() { // Needed for IE7 & IE8 in versions of jQuery prior to 1.7.2
751	+ if ($.support.opacity === false) {
752	+ $box[0].style.removeAttribute('filter');
753	+ }
754	+ }
755	+
756	+ complete = function () {
757	+ clearTimeout(loadingTimer);
758	+ $loadingOverlay.hide();
759	+ trigger(event_complete, settings.onComplete);
760	+ };
761	+
762	+
763	+ $title.html(settings.title).add($loaded).show();
764	+
765	+ if (total > 1) { // handle grouping
766	+ if (typeof settings.current === "string") {
767	+ $current.html(settings.current.replace('{current}', index + 1).replace('{total}', total)).show();
768	+ }
769	+
770	+ $next[(settings.loop \|\| index < total - 1) ? "show" : "hide"]().html(settings.next);
771	+ $prev[(settings.loop \|\| index) ? "show" : "hide"]().html(settings.previous);
772	+
773	+ if (settings.slideshow) {
774	+ $slideshow.show();
775	+ }
776	+
777	+ // Preloads images within a rel group
778	+ if (settings.preloading) {
779	+ $.each([getIndex(-1), getIndex(1)], function(){
780	+ var src,
781	+ img,
782	+ i = $related[this],
783	+ data = $.data(i, colorbox);
784	+
785	+ if (data && data.href) {
786	+ src = data.href;
787	+ if ($.isFunction(src)) {
788	+ src = src.call(i);
789	+ }
790	+ } else {
791	+ src = $(i).attr('href');
792	+ }
793	+
794	+ if (src && isImage(data, src)) {
795	+ src = retinaUrl(data, src);
796	+ img = document.createElement('img');
797	+ img.src = src;
798	+ }
799	+ });
800	+ }
801	+ } else {
802	+ $groupControls.hide();
803	+ }
804	+
805	+ if (settings.iframe) {
806	+ iframe = $tag('iframe')[0];
807	+
808	+ if (frameBorder in iframe) {
809	+ iframe[frameBorder] = 0;
810	+ }
811	+
812	+ if (allowTransparency in iframe) {
813	+ iframe[allowTransparency] = "true";
814	+ }
815	+
816	+ if (!settings.scrolling) {
817	+ iframe.scrolling = "no";
818	+ }
819	+
820	+ $(iframe)
821	+ .attr({
822	+ src: settings.href,
823	+ name: (new Date()).getTime(), // give the iframe a unique name to prevent caching
824	+ 'class': prefix + 'Iframe',
825	+ allowFullScreen : true, // allow HTML5 video to go fullscreen
826	+ webkitAllowFullScreen : true,
827	+ mozallowfullscreen : true
828	+ })
829	+ .one('load', complete)
830	+ .appendTo($loaded);
831	+
832	+ $events.one(event_purge, function () {
833	+ iframe.src = "//about:blank";
834	+ });
835	+
836	+ if (settings.fastIframe) {
837	+ $(iframe).trigger('load');
838	+ }
839	+ } else {
840	+ complete();
841	+ }
842	+
843	+ if (settings.transition === 'fade') {
844	+ $box.fadeTo(speed, 1, removeFilter);
845	+ } else {
846	+ removeFilter();
847	+ }
848	+ };
849	+
850	+ if (settings.transition === 'fade') {
851	+ $box.fadeTo(speed, 0, function () {
852	+ publicMethod.position(0, callback);
853	+ });
854	+ } else {
855	+ publicMethod.position(speed, callback);
856	+ }
857	+ };
858	+
859	+ function load () {
860	+ var href, setResize, prep = publicMethod.prep, $inline, request = ++requests;
861	+
862	+ active = true;
863	+
864	+ photo = false;
865	+
866	+ element = $related[index];
867	+
868	+ makeSettings();
869	+
870	+ trigger(event_purge);
871	+
872	+ trigger(event_load, settings.onLoad);
873	+
874	+ settings.h = settings.height ?
875	+ setSize(settings.height, 'y') - loadedHeight - interfaceHeight :
876	+ settings.innerHeight && setSize(settings.innerHeight, 'y');
877	+
878	+ settings.w = settings.width ?
879	+ setSize(settings.width, 'x') - loadedWidth - interfaceWidth :
880	+ settings.innerWidth && setSize(settings.innerWidth, 'x');
881	+
882	+ // Sets the minimum dimensions for use in image scaling
883	+ settings.mw = settings.w;
884	+ settings.mh = settings.h;
885	+
886	+ // Re-evaluate the minimum width and height based on maxWidth and maxHeight values.
887	+ // If the width or height exceed the maxWidth or maxHeight, use the maximum values instead.
888	+ if (settings.maxWidth) {
889	+ settings.mw = setSize(settings.maxWidth, 'x') - loadedWidth - interfaceWidth;
890	+ settings.mw = settings.w && settings.w < settings.mw ? settings.w : settings.mw;
891	+ }
892	+ if (settings.maxHeight) {
893	+ settings.mh = setSize(settings.maxHeight, 'y') - loadedHeight - interfaceHeight;
894	+ settings.mh = settings.h && settings.h < settings.mh ? settings.h : settings.mh;
895	+ }
896	+
897	+ href = settings.href;
898	+
899	+ loadingTimer = setTimeout(function () {
900	+ $loadingOverlay.show();
901	+ }, 100);
902	+
903	+ if (settings.inline) {
904	+ // Inserts an empty placeholder where inline content is being pulled from.
905	+ // An event is bound to put inline content back when Colorbox closes or loads new content.
906	+ $inline = $tag(div).hide().insertBefore($(href)[0]);
907	+
908	+ $events.one(event_purge, function () {
909	+ $inline.replaceWith($loaded.children());
910	+ });
911	+
912	+ prep($(href));
913	+ } else if (settings.iframe) {
914	+ // IFrame element won't be added to the DOM until it is ready to be displayed,
915	+ // to avoid problems with DOM-ready JS that might be trying to run in that iframe.
916	+ prep(" ");
917	+ } else if (settings.html) {
918	+ prep(settings.html);
919	+ } else if (isImage(settings, href)) {
920	+
921	+ href = retinaUrl(settings, href);
922	+
923	+ photo = document.createElement('img');
924	+
925	+ $(photo)
926	+ .addClass(prefix + 'Photo')
927	+ .bind('error',function () {
928	+ settings.title = false;
929	+ prep($tag(div, 'Error').html(settings.imgError));
930	+ })
931	+ .one('load', function () {
932	+ var percent;
933	+
934	+ if (request !== requests) {
935	+ return;
936	+ }
937	+
938	+ photo.alt = $(element).attr('alt') \|\| $(element).attr('data-alt') \|\| '';
939	+
940	+ if (settings.retinaImage && window.devicePixelRatio > 1) {
941	+ photo.height = photo.height / window.devicePixelRatio;
942	+ photo.width = photo.width / window.devicePixelRatio;
943	+ }
944	+
945	+ if (settings.scalePhotos) {
946	+ setResize = function () {
947	+ photo.height -= photo.height * percent;
948	+ photo.width -= photo.width * percent;
949	+ };
950	+ if (settings.mw && photo.width > settings.mw) {
951	+ percent = (photo.width - settings.mw) / photo.width;
952	+ setResize();
953	+ }
954	+ if (settings.mh && photo.height > settings.mh) {
955	+ percent = (photo.height - settings.mh) / photo.height;
956	+ setResize();
957	+ }
958	+ }
959	+
960	+ if (settings.h) {
961	+ photo.style.marginTop = Math.max(settings.mh - photo.height, 0) / 2 + 'px';
962	+ }
963	+
964	+ if ($related[1] && (settings.loop \|\| $related[index + 1])) {
965	+ photo.style.cursor = 'pointer';
966	+ photo.onclick = function () {
967	+ publicMethod.next();
968	+ };
969	+ }
970	+
971	+ photo.style.width = photo.width + 'px';
972	+ photo.style.height = photo.height + 'px';
973	+
974	+ setTimeout(function () { // A pause because Chrome will sometimes report a 0 by 0 size otherwise.
975	+ prep(photo);
976	+ }, 1);
977	+ });
978	+
979	+ setTimeout(function () { // A pause because Opera 10.6+ will sometimes not run the onload function otherwise.
980	+ photo.src = href;
981	+ }, 1);
982	+ } else if (href) {
983	+ $loadingBay.load(href, settings.data, function (data, status) {
984	+ if (request === requests) {
985	+ prep(status === 'error' ? $tag(div, 'Error').html(settings.xhrError) : $(this).contents());
986	+ }
987	+ });
988	+ }
989	+ }
990	+
991	+ // Navigates to the next page/image in a set.
992	+ publicMethod.next = function () {
993	+ if (!active && $related[1] && (settings.loop \|\| $related[index + 1])) {
994	+ index = getIndex(1);
995	+ launch($related[index]);
996	+ }
997	+ };
998	+
999	+ publicMethod.prev = function () {
1000	+ if (!active && $related[1] && (settings.loop \|\| index)) {
1001	+ index = getIndex(-1);
1002	+ launch($related[index]);
1003	+ }
1004	+ };
1005	+
1006	+ // Note: to use this within an iframe use the following format: parent.jQuery.colorbox.close();
1007	+ publicMethod.close = function () {
1008	+ if (open && !closing) {
1009	+
1010	+ closing = true;
1011	+
1012	+ open = false;
1013	+
1014	+ trigger(event_cleanup, settings.onCleanup);
1015	+
1016	+ $window.unbind('.' + prefix);
1017	+
1018	+ $overlay.fadeTo(settings.fadeOut \|\| 0, 0);
1019	+
1020	+ $box.stop().fadeTo(settings.fadeOut \|\| 0, 0, function () {
1021	+
1022	+ $box.add($overlay).css({'opacity': 1, cursor: 'auto'}).hide();
1023	+
1024	+ trigger(event_purge);
1025	+
1026	+ $loaded.empty().remove(); // Using empty first may prevent some IE7 issues.
1027	+
1028	+ setTimeout(function () {
1029	+ closing = false;
1030	+ trigger(event_closed, settings.onClosed);
1031	+ }, 1);
1032	+ });
1033	+ }
1034	+ };
1035	+
1036	+ // Removes changes Colorbox made to the document, but does not remove the plugin.
1037	+ publicMethod.remove = function () {
1038	+ if (!$box) { return; }
1039	+
1040	+ $box.stop();
1041	+ $.colorbox.close();
1042	+ $box.stop().remove();
1043	+ $overlay.remove();
1044	+ closing = false;
1045	+ $box = null;
1046	+ $('.' + boxElement)
1047	+ .removeData(colorbox)
1048	+ .removeClass(boxElement);
1049	+
1050	+ $(document).unbind('click.'+prefix);
1051	+ };
1052	+
1053	+ // A method for fetching the current element Colorbox is referencing.
1054	+ // returns a jQuery object.
1055	+ publicMethod.element = function () {
1056	+ return $(element);
1057	+ };
1058	+
1059	+ publicMethod.settings = defaults;
1060	+
1061	+ }(jQuery, document, window));

js/maxmegamenu.js ADDED Viewed

	@@ -0,0 +1,264 @@


1	+ /jslint browser: true, white: true /
2	+ /global console,jQuery,megamenu,window,navigator/
3	+
4	+ /**
5	+ * Max Mega Menu jQuery Plugin
6	+ */
7	+ (function($) {
8	+
9	+ "use strict";
10	+
11	+ $.maxmegamenu = function(menu, options) {
12	+
13	+ var plugin = this;
14	+ var $menu = $(menu);
15	+
16	+ var defaults = {
17	+ event: $menu.attr('data-event'),
18	+ effect: $menu.attr('data-effect'),
19	+ panel_width: $menu.attr('data-panel-width'),
20	+ panel_inner_width: $menu.attr('data-panel-inner-width'),
21	+ second_click: $menu.attr('data-second-click'),
22	+ vertical_behaviour: $menu.attr('data-vertical-behaviour'),
23	+ reverse_mobile_items: $menu.attr('data-reverse-mobile-items'),
24	+ document_click: $menu.attr('data-document-click'),
25	+ breakpoint: $menu.attr('data-breakpoint')
26	+ };
27	+
28	+ plugin.settings = {};
29	+
30	+ var isTouchDevice = function() {
31	+ return (('ontouchstart' in window) \|\| window.DocumentTouch && document instanceof DocumentTouch);
32	+ };
33	+
34	+
35	+ plugin.hidePanel = function(anchor, immediate) {
36	+
37	+ anchor.siblings('.mega-sub-menu').children('.mega-toggle-on').removeClass('mega-toggle-on');
38	+
39	+ if (immediate) {
40	+ anchor.siblings('.mega-sub-menu').removeClass('mega-toggle-on').css('display', '');
41	+ anchor.parent().removeClass('mega-toggle-on').triggerHandler("close_panel");
42	+ return;
43	+ }
44	+
45	+ if ( megamenu.effect[plugin.settings.effect] ) {
46	+ var effect = megamenu.effect[plugin.settings.effect]['out'];
47	+ var speed = megamenu.effect[plugin.settings.effect]['speed'] ? megamenu.effect[plugin.settings.effect]['speed'] : "fast";
48	+
49	+ if (effect.css) {
50	+ anchor.siblings('.mega-sub-menu').css(effect.css);
51	+ }
52	+
53	+ if (effect.animate) {
54	+ anchor.siblings('.mega-sub-menu').animate(effect.animate, speed, function() {
55	+ anchor.parent().removeClass('mega-toggle-on').triggerHandler("close_panel");
56	+ });
57	+ } else {
58	+ anchor.parent().removeClass('mega-toggle-on').triggerHandler("close_panel");
59	+ }
60	+ } else {
61	+ anchor.parent().removeClass('mega-toggle-on').triggerHandler("close_panel");
62	+ }
63	+
64	+ };
65	+
66	+
67	+ plugin.hideAllPanels = function() {
68	+ $('.mega-toggle-on > a', $menu).each(function() {
69	+ plugin.hidePanel($(this), true);
70	+ });
71	+ };
72	+
73	+
74	+ plugin.hideSiblingPanels = function(anchor, immediate) {
75	+ // all open children of open siblings
76	+ anchor.parent().siblings().find('.mega-toggle-on').andSelf().children('a').each(function() {
77	+ plugin.hidePanel($(this), immediate);
78	+ });
79	+ }
80	+
81	+
82	+ plugin.isDesktopView = function() {
83	+ return $(window).width() > plugin.settings.breakpoint;
84	+ }
85	+
86	+
87	+ plugin.hideOpenSiblings = function() {
88	+ // desktops, horizontal
89	+ if ( plugin.isDesktopView() && ( $menu.hasClass('mega-menu-horizontal') \|\| $menu.hasClass('mega-menu-vertical') ) ) {
90	+ return 'immediately';
91	+ }
92	+
93	+ if ( plugin.settings.vertical_behaviour == 'accordion' ) {
94	+ return 'animated';
95	+ }
96	+
97	+ }
98	+
99	+
100	+ plugin.showPanel = function(anchor) {
101	+
102	+ if ( !plugin.isDesktopView() && anchor.parent().hasClass('mega-hide-sub-menu-on-mobile') ) {
103	+ return;
104	+ }
105	+
106	+ switch( plugin.hideOpenSiblings() ) {
107	+ case 'immediately':
108	+ plugin.hideSiblingPanels(anchor, true);
109	+ break;
110	+ case 'animated':
111	+ plugin.hideSiblingPanels(anchor, false);
112	+ break;
113	+ }
114	+
115	+ // apply dynamic width and sub menu position
116	+ if ( anchor.parent().hasClass('mega-menu-megamenu') && $(plugin.settings.panel_width).length ) {
117	+ var submenu_offset = $menu.offset();
118	+ var target_offset = $(plugin.settings.panel_width).offset();
119	+
120	+ anchor.siblings('.mega-sub-menu').css({
121	+ width: $(plugin.settings.panel_width).outerWidth(),
122	+ left: (target_offset.left - submenu_offset.left) + "px"
123	+ });
124	+ }
125	+
126	+
127	+ // apply inner width to sub menu by adding padding to the left and right of the mega menu
128	+ if ( anchor.parent().hasClass('mega-menu-megamenu') && plugin.settings.panel_inner_width && plugin.settings.panel_inner_width.length > 0 ) {
129	+
130	+ if ( $(plugin.settings.panel_inner_width).length ) {
131	+ // jQuery selector
132	+ var target_width = parseInt($(plugin.settings.panel_inner_width).width(), 10);
133	+ } else {
134	+ // we're using a pixel width
135	+ var target_width = parseInt(plugin.settings.panel_inner_width, 10);
136	+ }
137	+
138	+ var submenu_width = parseInt(anchor.siblings('.mega-sub-menu').innerWidth(), 10);
139	+
140	+ if ( (target_width > 0) && (target_width < submenu_width) ) {
141	+ anchor.siblings('.mega-sub-menu').css({
142	+ 'paddingLeft': (submenu_width - target_width) / 2 + 'px',
143	+ 'paddingRight': (submenu_width - target_width) / 2 + 'px'
144	+ });
145	+ }
146	+ }
147	+
148	+
149	+ if ( megamenu.effect[plugin.settings.effect] ) {
150	+ var effect = megamenu.effect[plugin.settings.effect]['in'];
151	+ var speed = megamenu.effect[plugin.settings.effect]['speed'] ? megamenu.effect[plugin.settings.effect]['speed'] : "fast";
152	+
153	+ if (effect.css) {
154	+ anchor.siblings('.mega-sub-menu').css(effect.css);
155	+ }
156	+
157	+ if (effect.animate) {
158	+ anchor.siblings('.mega-sub-menu').animate(effect.animate, speed, 'swing', function() {
159	+ $(this).css('visiblity', 'visible');
160	+ });
161	+ }
162	+ }
163	+
164	+ anchor.parent().addClass('mega-toggle-on').triggerHandler("open_panel");
165	+ };
166	+
167	+
168	+ var openOnClick = function() {
169	+ // hide menu when clicked away from
170	+ $(document).on('click touchstart', function(event) {
171	+ if ( ( plugin.settings.document_click == 'collapse' \|\| ! plugin.isDesktopView() ) && ! $(event.target).closest(".mega-menu li").length ) {
172	+ plugin.hideAllPanels();
173	+ }
174	+ });
175	+
176	+ $('li.mega-menu-megamenu.mega-menu-item-has-children > a, li.mega-menu-flyout.mega-menu-item-has-children > a, li.mega-menu-flyout li.mega-menu-item-has-children > a', menu).on({
177	+ click: function(e) {
178	+
179	+ // all clicks on parent items when sub menu is hidden on mobile
180	+ if ( ! plugin.isDesktopView() && $(this).parent().hasClass('mega-hide-sub-menu-on-mobile') ) {
181	+ return;
182	+ }
183	+
184	+ // check for second click
185	+ if ( plugin.settings.second_click == 'go' \|\| $(this).parent().hasClass("mega-click-click-go") ) {
186	+ if ( ! $(this).parent().hasClass("mega-toggle-on") ) {
187	+ e.preventDefault();
188	+ plugin.showPanel($(this));
189	+ }
190	+ } else {
191	+ e.preventDefault();
192	+
193	+ if ( $(this).parent().hasClass("mega-toggle-on") ) {
194	+ plugin.hidePanel($(this), false);
195	+ } else {
196	+ plugin.showPanel($(this));
197	+ }
198	+ }
199	+ }
200	+ });
201	+ };
202	+
203	+
204	+ var openOnHover = function() {
205	+
206	+ $('li.mega-menu-item-has-children', menu).not('li.mega-menu-megamenu li.mega-menu-item-has-children', menu).hoverIntent({
207	+ over: function () {
208	+ plugin.showPanel($(this).children('a'));
209	+ },
210	+ out: function () {
211	+ if ($(this).hasClass("mega-toggle-on")) {
212	+ plugin.hidePanel($(this).children('a'), false);
213	+ }
214	+ },
215	+ timeout: megamenu.timeout,
216	+ interval: megamenu.interval
217	+ });
218	+ };
219	+
220	+
221	+ plugin.init = function() {
222	+ plugin.settings = $.extend({}, defaults, options);
223	+
224	+ $menu.removeClass('mega-no-js');
225	+
226	+ $menu.siblings('.mega-menu-toggle').on('click', function() {
227	+ $(this).toggleClass('mega-menu-open');
228	+ });
229	+
230	+ $('li.mega-menu-item, ul.mega-sub-menu', menu).unbind();
231	+
232	+ if (isTouchDevice() \|\| plugin.settings.event === 'click') {
233	+ openOnClick();
234	+ } else {
235	+ openOnHover();
236	+ }
237	+
238	+ if (!plugin.isDesktopView() && plugin.settings.reverse_mobile_items == 'true') {
239	+ $menu.append($menu.children('li.mega-item-align-right').get().reverse());
240	+ }
241	+
242	+ };
243	+
244	+ plugin.init();
245	+
246	+ };
247	+
248	+
249	+ $.fn.maxmegamenu = function(options) {
250	+ return this.each(function() {
251	+ if (undefined === $(this).data('maxmegamenu')) {
252	+ var plugin = new $.maxmegamenu(this, options);
253	+ $(this).data('maxmegamenu', plugin);
254	+ }
255	+ });
256	+ };
257	+
258	+
259	+ $(function() {
260	+ $(".mega-menu").maxmegamenu();
261	+ });
262	+
263	+
264	+ })(jQuery);

js/select2/select2.css ADDED Viewed

	@@ -0,0 +1,702 @@


1	+ /*
2	+ Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
3	+ */
4	+ .select2-container {
5	+ margin: 0;
6	+ position: relative;
7	+ display: inline-block;
8	+ vertical-align: middle;
9	+ }
10	+
11	+ .select2-container,
12	+ .select2-drop,
13	+ .select2-search,
14	+ .select2-search input {
15	+ /*
16	+ Force border-box so that % widths fit the parent
17	+ container without overlap because of margin/padding.
18	+ More Info : http://www.quirksmode.org/css/box.html
19	+ */
20	+ -webkit-box-sizing: border-box; /* webkit */
21	+ -moz-box-sizing: border-box; /* firefox */
22	+ box-sizing: border-box; /* css3 */
23	+ }
24	+
25	+ .select2-container .select2-choice {
26	+ display: block;
27	+ height: 26px;
28	+ padding: 0 0 0 8px;
29	+ overflow: hidden;
30	+ position: relative;
31	+
32	+ border: 1px solid #aaa;
33	+ white-space: nowrap;
34	+ line-height: 26px;
35	+ color: #444;
36	+ text-decoration: none;
37	+
38	+ border-radius: 4px;
39	+
40	+ background-clip: padding-box;
41	+
42	+ -webkit-touch-callout: none;
43	+ -webkit-user-select: none;
44	+ -moz-user-select: none;
45	+ -ms-user-select: none;
46	+ user-select: none;
47	+
48	+ background-color: #fff;
49	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
50	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
51	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
52	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
53	+ background-image: linear-gradient(to top, #eee 0%, #fff 50%);
54	+ }
55	+
56	+ html[dir="rtl"] .select2-container .select2-choice {
57	+ padding: 0 8px 0 0;
58	+ }
59	+
60	+ .select2-container.select2-drop-above .select2-choice {
61	+ border-bottom-color: #aaa;
62	+
63	+ border-radius: 0 0 4px 4px;
64	+
65	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
66	+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
67	+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
68	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
69	+ background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
70	+ }
71	+
72	+ .select2-container.select2-allowclear .select2-choice .select2-chosen {
73	+ margin-right: 42px;
74	+ }
75	+
76	+ .select2-container .select2-choice > .select2-chosen {
77	+ margin-right: 26px;
78	+ display: block;
79	+ overflow: hidden;
80	+
81	+ white-space: nowrap;
82	+
83	+ text-overflow: ellipsis;
84	+ float: none;
85	+ width: auto;
86	+ }
87	+
88	+ html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
89	+ margin-left: 26px;
90	+ margin-right: 0;
91	+ }
92	+
93	+ .select2-container .select2-choice abbr {
94	+ display: none;
95	+ width: 12px;
96	+ height: 12px;
97	+ position: absolute;
98	+ right: 24px;
99	+ top: 8px;
100	+
101	+ font-size: 1px;
102	+ text-decoration: none;
103	+
104	+ border: 0;
105	+ background: url('select2.png') right top no-repeat;
106	+ cursor: pointer;
107	+ outline: 0;
108	+ }
109	+
110	+ .select2-container.select2-allowclear .select2-choice abbr {
111	+ display: inline-block;
112	+ }
113	+
114	+ .select2-container .select2-choice abbr:hover {
115	+ background-position: right -11px;
116	+ cursor: pointer;
117	+ }
118	+
119	+ .select2-drop-mask {
120	+ border: 0;
121	+ margin: 0;
122	+ padding: 0;
123	+ position: fixed;
124	+ left: 0;
125	+ top: 0;
126	+ min-height: 100%;
127	+ min-width: 100%;
128	+ height: auto;
129	+ width: auto;
130	+ opacity: 0;
131	+ z-index: 9998;
132	+ /* styles required for IE to work */
133	+ background-color: #fff;
134	+ filter: alpha(opacity=0);
135	+ }
136	+
137	+ .select2-drop {
138	+ width: 100%;
139	+ margin-top: -1px;
140	+ position: absolute;
141	+ z-index: 9999;
142	+ top: 100%;
143	+
144	+ background: #fff;
145	+ color: #000;
146	+ border: 1px solid #aaa;
147	+ border-top: 0;
148	+
149	+ border-radius: 0 0 4px 4px;
150	+
151	+ -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
152	+ box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
153	+ }
154	+
155	+ .select2-drop.select2-drop-above {
156	+ margin-top: 1px;
157	+ border-top: 1px solid #aaa;
158	+ border-bottom: 0;
159	+
160	+ border-radius: 4px 4px 0 0;
161	+
162	+ -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
163	+ box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
164	+ }
165	+
166	+ .select2-drop-active {
167	+ border: 1px solid #5897fb;
168	+ border-top: none;
169	+ }
170	+
171	+ .select2-drop.select2-drop-above.select2-drop-active {
172	+ border-top: 1px solid #5897fb;
173	+ }
174	+
175	+ .select2-drop-auto-width {
176	+ border-top: 1px solid #aaa;
177	+ width: auto;
178	+ }
179	+
180	+ .select2-container .select2-choice .select2-arrow {
181	+ display: inline-block;
182	+ width: 18px;
183	+ height: 100%;
184	+ position: absolute;
185	+ right: 0;
186	+ top: 0;
187	+
188	+ border-left: 1px solid #aaa;
189	+ border-radius: 0 4px 4px 0;
190	+
191	+ background-clip: padding-box;
192	+
193	+ background: #ccc;
194	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
195	+ background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
196	+ background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
197	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
198	+ background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
199	+ }
200	+
201	+ html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
202	+ left: 0;
203	+ right: auto;
204	+
205	+ border-left: none;
206	+ border-right: 1px solid #aaa;
207	+ border-radius: 4px 0 0 4px;
208	+ }
209	+
210	+ .select2-container .select2-choice .select2-arrow b {
211	+ display: block;
212	+ width: 100%;
213	+ height: 100%;
214	+ background: url('select2.png') no-repeat 0 1px;
215	+ }
216	+
217	+ html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
218	+ background-position: 2px 1px;
219	+ }
220	+
221	+ .select2-search {
222	+ display: inline-block;
223	+ width: 100%;
224	+ min-height: 26px;
225	+ margin: 0;
226	+ padding: 4px 4px 0 4px;
227	+
228	+ position: relative;
229	+ z-index: 10000;
230	+
231	+ white-space: nowrap;
232	+ }
233	+
234	+ .select2-search input {
235	+ width: 100%;
236	+ height: auto !important;
237	+ min-height: 26px;
238	+ padding: 4px 20px 4px 5px;
239	+ margin: 0;
240	+
241	+ outline: 0;
242	+ font-family: sans-serif;
243	+ font-size: 1em;
244	+
245	+ border: 1px solid #aaa;
246	+ border-radius: 0;
247	+
248	+ -webkit-box-shadow: none;
249	+ box-shadow: none;
250	+
251	+ background: #fff url('select2.png') no-repeat 100% -22px;
252	+ background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
253	+ background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
254	+ background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
255	+ background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
256	+ }
257	+
258	+ html[dir="rtl"] .select2-search input {
259	+ padding: 4px 5px 4px 20px;
260	+
261	+ background: #fff url('select2.png') no-repeat -37px -22px;
262	+ background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
263	+ background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
264	+ background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
265	+ background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
266	+ }
267	+
268	+ .select2-search input.select2-active {
269	+ background: #fff url('select2-spinner.gif') no-repeat 100%;
270	+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
271	+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
272	+ background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
273	+ background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
274	+ }
275	+
276	+ .select2-container-active .select2-choice,
277	+ .select2-container-active .select2-choices {
278	+ border: 1px solid #5897fb;
279	+ outline: none;
280	+
281	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
282	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
283	+ }
284	+
285	+ .select2-dropdown-open .select2-choice {
286	+ border-bottom-color: transparent;
287	+ -webkit-box-shadow: 0 1px 0 #fff inset;
288	+ box-shadow: 0 1px 0 #fff inset;
289	+
290	+ border-bottom-left-radius: 0;
291	+ border-bottom-right-radius: 0;
292	+
293	+ background-color: #eee;
294	+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
295	+ background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
296	+ background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
297	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
298	+ background-image: linear-gradient(to top, #fff 0%, #eee 50%);
299	+ }
300	+
301	+ .select2-dropdown-open.select2-drop-above .select2-choice,
302	+ .select2-dropdown-open.select2-drop-above .select2-choices {
303	+ border: 1px solid #5897fb;
304	+ border-top-color: transparent;
305	+
306	+ background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
307	+ background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
308	+ background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
309	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
310	+ background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
311	+ }
312	+
313	+ .select2-dropdown-open .select2-choice .select2-arrow {
314	+ background: transparent;
315	+ border-left: none;
316	+ filter: none;
317	+ }
318	+ html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
319	+ border-right: none;
320	+ }
321	+
322	+ .select2-dropdown-open .select2-choice .select2-arrow b {
323	+ background-position: -18px 1px;
324	+ }
325	+
326	+ html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
327	+ background-position: -16px 1px;
328	+ }
329	+
330	+ .select2-hidden-accessible {
331	+ border: 0;
332	+ clip: rect(0 0 0 0);
333	+ height: 1px;
334	+ margin: -1px;
335	+ overflow: hidden;
336	+ padding: 0;
337	+ position: absolute;
338	+ width: 1px;
339	+ }
340	+
341	+ /* results */
342	+ .select2-results {
343	+ max-height: 200px;
344	+ padding: 0 0 0 4px;
345	+ margin: 4px 4px 4px 0;
346	+ position: relative;
347	+ overflow-x: hidden;
348	+ overflow-y: auto;
349	+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
350	+ }
351	+
352	+ html[dir="rtl"] .select2-results {
353	+ padding: 0 4px 0 0;
354	+ margin: 4px 0 4px 4px;
355	+ }
356	+
357	+ .select2-results ul.select2-result-sub {
358	+ margin: 0;
359	+ padding-left: 0;
360	+ }
361	+
362	+ .select2-results li {
363	+ list-style: none;
364	+ display: list-item;
365	+ background-image: none;
366	+ }
367	+
368	+ .select2-results li.select2-result-with-children > .select2-result-label {
369	+ font-weight: bold;
370	+ }
371	+
372	+ .select2-results .select2-result-label {
373	+ padding: 3px 7px 4px;
374	+ margin: 0;
375	+ cursor: pointer;
376	+
377	+ min-height: 1em;
378	+
379	+ -webkit-touch-callout: none;
380	+ -webkit-user-select: none;
381	+ -moz-user-select: none;
382	+ -ms-user-select: none;
383	+ user-select: none;
384	+ }
385	+
386	+ .select2-results-dept-1 .select2-result-label { padding-left: 20px }
387	+ .select2-results-dept-2 .select2-result-label { padding-left: 40px }
388	+ .select2-results-dept-3 .select2-result-label { padding-left: 60px }
389	+ .select2-results-dept-4 .select2-result-label { padding-left: 80px }
390	+ .select2-results-dept-5 .select2-result-label { padding-left: 100px }
391	+ .select2-results-dept-6 .select2-result-label { padding-left: 110px }
392	+ .select2-results-dept-7 .select2-result-label { padding-left: 120px }
393	+
394	+ .select2-results .select2-highlighted {
395	+ background: #3875d7;
396	+ color: #fff;
397	+ }
398	+
399	+ .select2-results li em {
400	+ background: #feffde;
401	+ font-style: normal;
402	+ }
403	+
404	+ .select2-results .select2-highlighted em {
405	+ background: transparent;
406	+ }
407	+
408	+ .select2-results .select2-highlighted ul {
409	+ background: #fff;
410	+ color: #000;
411	+ }
412	+
413	+ .select2-results .select2-no-results,
414	+ .select2-results .select2-searching,
415	+ .select2-results .select2-ajax-error,
416	+ .select2-results .select2-selection-limit {
417	+ background: #f4f4f4;
418	+ display: list-item;
419	+ padding-left: 5px;
420	+ }
421	+
422	+ /*
423	+ disabled look for disabled choices in the results dropdown
424	+ */
425	+ .select2-results .select2-disabled.select2-highlighted {
426	+ color: #666;
427	+ background: #f4f4f4;
428	+ display: list-item;
429	+ cursor: default;
430	+ }
431	+ .select2-results .select2-disabled {
432	+ background: #f4f4f4;
433	+ display: list-item;
434	+ cursor: default;
435	+ }
436	+
437	+ .select2-results .select2-selected {
438	+ display: none;
439	+ }
440	+
441	+ .select2-more-results.select2-active {
442	+ background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
443	+ }
444	+
445	+ .select2-results .select2-ajax-error {
446	+ background: rgba(255, 50, 50, .2);
447	+ }
448	+
449	+ .select2-more-results {
450	+ background: #f4f4f4;
451	+ display: list-item;
452	+ }
453	+
454	+ /* disabled styles */
455	+
456	+ .select2-container.select2-container-disabled .select2-choice {
457	+ background-color: #f4f4f4;
458	+ background-image: none;
459	+ border: 1px solid #ddd;
460	+ cursor: default;
461	+ }
462	+
463	+ .select2-container.select2-container-disabled .select2-choice .select2-arrow {
464	+ background-color: #f4f4f4;
465	+ background-image: none;
466	+ border-left: 0;
467	+ }
468	+
469	+ .select2-container.select2-container-disabled .select2-choice abbr {
470	+ display: none;
471	+ }
472	+
473	+
474	+ /* multiselect */
475	+
476	+ .select2-container-multi .select2-choices {
477	+ height: auto !important;
478	+ height: 1%;
479	+ margin: 0;
480	+ padding: 0 5px 0 0;
481	+ position: relative;
482	+
483	+ border: 1px solid #aaa;
484	+ cursor: text;
485	+ overflow: hidden;
486	+
487	+ background-color: #fff;
488	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
489	+ background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
490	+ background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
491	+ background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
492	+ }
493	+
494	+ html[dir="rtl"] .select2-container-multi .select2-choices {
495	+ padding: 0 0 0 5px;
496	+ }
497	+
498	+ .select2-locked {
499	+ padding: 3px 5px 3px 5px !important;
500	+ }
501	+
502	+ .select2-container-multi .select2-choices {
503	+ min-height: 26px;
504	+ }
505	+
506	+ .select2-container-multi.select2-container-active .select2-choices {
507	+ border: 1px solid #5897fb;
508	+ outline: none;
509	+
510	+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
511	+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
512	+ }
513	+ .select2-container-multi .select2-choices li {
514	+ float: left;
515	+ list-style: none;
516	+ }
517	+ html[dir="rtl"] .select2-container-multi .select2-choices li
518	+ {
519	+ float: right;
520	+ }
521	+ .select2-container-multi .select2-choices .select2-search-field {
522	+ margin: 0;
523	+ padding: 0;
524	+ white-space: nowrap;
525	+ }
526	+
527	+ .select2-container-multi .select2-choices .select2-search-field input {
528	+ padding: 5px;
529	+ margin: 1px 0;
530	+
531	+ font-family: sans-serif;
532	+ font-size: 100%;
533	+ color: #666;
534	+ outline: 0;
535	+ border: 0;
536	+ -webkit-box-shadow: none;
537	+ box-shadow: none;
538	+ background: transparent !important;
539	+ }
540	+
541	+ .select2-container-multi .select2-choices .select2-search-field input.select2-active {
542	+ background: #fff url('select2-spinner.gif') no-repeat 100% !important;
543	+ }
544	+
545	+ .select2-default {
546	+ color: #999 !important;
547	+ }
548	+
549	+ .select2-container-multi .select2-choices .select2-search-choice {
550	+ padding: 3px 5px 3px 18px;
551	+ margin: 3px 0 3px 5px;
552	+ position: relative;
553	+
554	+ line-height: 13px;
555	+ color: #333;
556	+ cursor: default;
557	+ border: 1px solid #aaaaaa;
558	+
559	+ border-radius: 3px;
560	+
561	+ -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
562	+ box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
563	+
564	+ background-clip: padding-box;
565	+
566	+ -webkit-touch-callout: none;
567	+ -webkit-user-select: none;
568	+ -moz-user-select: none;
569	+ -ms-user-select: none;
570	+ user-select: none;
571	+
572	+ background-color: #e4e4e4;
573	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
574	+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
575	+ background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
576	+ background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
577	+ background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
578	+ }
579	+ html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
580	+ {
581	+ margin: 3px 5px 3px 0;
582	+ padding: 3px 18px 3px 5px;
583	+ }
584	+ .select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
585	+ cursor: default;
586	+ }
587	+ .select2-container-multi .select2-choices .select2-search-choice-focus {
588	+ background: #d4d4d4;
589	+ }
590	+
591	+ .select2-search-choice-close {
592	+ display: block;
593	+ width: 12px;
594	+ height: 13px;
595	+ position: absolute;
596	+ right: 3px;
597	+ top: 4px;
598	+
599	+ font-size: 1px;
600	+ outline: none;
601	+ background: url('select2.png') right top no-repeat;
602	+ }
603	+ html[dir="rtl"] .select2-search-choice-close {
604	+ right: auto;
605	+ left: 3px;
606	+ }
607	+
608	+ .select2-container-multi .select2-search-choice-close {
609	+ left: 3px;
610	+ }
611	+
612	+ html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
613	+ left: auto;
614	+ right: 2px;
615	+ }
616	+
617	+ .select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
618	+ background-position: right -11px;
619	+ }
620	+ .select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
621	+ background-position: right -11px;
622	+ }
623	+
624	+ /* disabled styles */
625	+ .select2-container-multi.select2-container-disabled .select2-choices {
626	+ background-color: #f4f4f4;
627	+ background-image: none;
628	+ border: 1px solid #ddd;
629	+ cursor: default;
630	+ }
631	+
632	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
633	+ padding: 3px 5px 3px 5px;
634	+ border: 1px solid #ddd;
635	+ background-image: none;
636	+ background-color: #f4f4f4;
637	+ }
638	+
639	+ .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
640	+ background: none;
641	+ }
642	+ /* end multiselect */
643	+
644	+
645	+ .select2-result-selectable .select2-match,
646	+ .select2-result-unselectable .select2-match {
647	+ text-decoration: underline;
648	+ }
649	+
650	+ .select2-offscreen, .select2-offscreen:focus {
651	+ clip: rect(0 0 0 0) !important;
652	+ width: 1px !important;
653	+ height: 1px !important;
654	+ border: 0 !important;
655	+ margin: 0 !important;
656	+ padding: 0 !important;
657	+ overflow: hidden !important;
658	+ position: absolute !important;
659	+ outline: 0 !important;
660	+ left: 0px !important;
661	+ top: 0px !important;
662	+ }
663	+
664	+ .select2-display-none {
665	+ display: none;
666	+ }
667	+
668	+ .select2-measure-scrollbar {
669	+ position: absolute;
670	+ top: -10000px;
671	+ left: -10000px;
672	+ width: 100px;
673	+ height: 100px;
674	+ overflow: scroll;
675	+ }
676	+
677	+ /* Retina-ize icons */
678	+
679	+ @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
680	+ .select2-search input,
681	+ .select2-search-choice-close,
682	+ .select2-container .select2-choice abbr,
683	+ .select2-container .select2-choice .select2-arrow b {
684	+ background-image: url('select2x2.png') !important;
685	+ background-repeat: no-repeat !important;
686	+ background-size: 60px 40px !important;
687	+ }
688	+
689	+ .select2-search input {
690	+ background-position: 100% -21px !important;
691	+ }
692	+ }
693	+
694	+
695	+ /*!
696	+ * select2-skins
697	+ * Released under MIT. Copyright 2014 Mienard Lumaad
698	+ * http://ui.themepixels.com/select2-skins
699	+ *
700	+ * Github Repository: https://github.com/themepixels/select2-skins
701	+ *
702	+ */.tpx-select2-container{font-family:'Helvetica Neue',Helvetica,sans-serif}.tpx-select2-container .select2-choice{height:34px;background-image:none;border-radius:3px;border-color:rgba(0,0,0,0.2)}.tpx-select2-container .select2-choice>.select2-chosen{line-height:30px;font-size:14px;margin-right:34px}.tpx-select2-container .select2-choice .select2-arrow{background-image:none;background-color:#fff;width:30px;border-left-color:rgba(0,0,0,0.2)}.tpx-select2-container .select2-choice .select2-arrow b{display:none}.tpx-select2-container .select2-choice .select2-arrow:before{position:absolute;width:28px;content:'\f078';font-family:'FontAwesome';font-size:12px;text-align:center;line-height:32px;opacity:.5}.tpx-select2-container.select2-dropdown-open .select2-choice{background-color:#fff;border-bottom-left-radius:0;border-bottom-right-radius:0}.tpx-select2-container.select2-dropdown-open .select2-choice .select2-arrow{border-left:1px solid rgba(0,0,0,0.2)}.tpx-select2-container.select2-dropdown-open .select2-choice .select2-arrow:before{content:'\f077';opacity:.7}.tpx-select2-container.select2-dropdown-open.select2-container-active .select2-choice{box-shadow:none}.tpx-select2-container.select2-dropdown-open.select2-drop-above .select2-choice{background-image:none;border-top:1px solid rgba(0,0,0,0.3);border-radius:0 0 3px 3px}.tpx-select2-container.select2-container-active .select2-choice{border-color:rgba(0,0,0,0.3);box-shadow:0 0 3px rgba(0,0,0,0.2)}.tpx-select2-container.select2-container-active .select2-choice .select2-arrow{border-left-color:rgba(0,0,0,0.3)}.tpx-select2-container .select2-drop-active{border-color:rgba(0,0,0,0.3)}.tpx-select2-container.select2-container-disabled .select2-choice .select2-arrow{border-left:1px solid rgba(0,0,0,0.1)}.tpx-select2-container.select2-container-multi .select2-choices{min-height:34px;background-image:none;border-color:rgba(0,0,0,0.2);border-radius:3px}.tpx-select2-container.select2-container-multi .select2-choices .select2-search-choice{position:relative;border-color:rgba(0,0,0,0.2);background-image:none;box-shadow:none;font-size:13px;background-color:#f7f7f7;border-radius:2px;padding-top:4px;padding-bottom:4px;line-height:16px;margin-left:3px;margin-bottom:0}.tpx-select2-container.select2-container-multi .select2-choices .select2-search-choice:before{position:absolute;top:4px;left:5px;font-family:'FontAwesome';content:'\f00d';z-index:5;font-size:11px}.tpx-select2-container.select2-container-multi .select2-choices .select2-search-field input{font-family:'Helvetica Neue',Helvetica,sans-serif;font-size:14px;margin:0;padding-left:8px;line-height:21px}.tpx-select2-container.select2-container-multi.select2-container-active .select2-choices{box-shadow:0 0 3px rgba(0,0,0,0.2);border-color:rgba(0,0,0,0.3)}.tpx-select2-container.select2-container-multi.select2-container-active.select2-dropdown-open .select2-choices{border-radius:3px 3px 0 0}.tpx-select2-container.select2-container-multi.select2-container-active.select2-drop-above .select2-choices{border-radius:0 0 3px 3px}.tpx-select2-container .select2-search-choice-close{top:5px;background:none;z-index:10}.tpx-select2-drop{font-family:'Helvetica Neue',Helvetica,sans-serif;border-color:rgba(0,0,0,0.3);box-shadow:0 3px 3px rgba(0,0,0,0.15);border-top:1px solid rgba(0,0,0,0.3);border-radius:0 0 3px 3px}.tpx-select2-drop .select2-search{padding-top:5px;position:relative}.tpx-select2-drop .select2-search input{background-color:#fff;background-image:none;border-color:rgba(0,0,0,0.3);font-size:14px;padding:7px 20px 7px 5px}.tpx-select2-drop .select2-search:after{position:absolute;font-family:'FontAwesome';content:'\f002';top:10px;right:12px;font-size:15px;opacity:.5}.tpx-select2-drop .select2-results{font-size:14px}.tpx-select2-drop .select2-results li{line-height:1.42857}.tpx-select2-drop .select2-results .select2-highlighted{background-color:#428bca;border-radius:2px}.tpx-select2-drop.select2-drop-above{border-radius:3px 3px 0 0;border-bottom:1px solid rgba(0,0,0,0.3)}.tpx-select2-drop.select2-drop-above .select2-search input{margin-top:0}.tpx-select2-drop.select2-drop-above.select2-drop-active{border-top-color:rgba(0,0,0,0.3)}.select2-container-lg .select2-choice{height:46px;padding-left:12px}.select2-container-lg .select2-choice .select2-arrow{width:40px}.select2-container-lg .select2-choice .select2-arrow:before{width:38px;font-size:17px;top:6px}.select2-container-lg .select2-choice>.select2-chosen{font-size:16px;line-height:44px}.select2-container-lg.select2-container-multi .select2-choices{min-height:46px}.select2-container-lg.select2-container-multi .select2-choices .select2-search-field input{font-size:16px;padding-top:11px;padding-bottom:11px;padding-left:10px}.select2-container-lg.select2-container-multi .select2-choices .select2-search-choice{padding-top:10px;padding-bottom:10px;padding-right:10px;padding-left:25px;font-size:15px}.select2-container-lg.select2-container-multi .select2-choices .select2-search-choice:before{top:10px;left:8px}.select2-container-lg.select2-container-multi .select2-search-choice-close{top:12px;left:8px}.select2-container-sm .select2-choice{height:30px}.select2-container-sm .select2-choice .select2-arrow{width:28px}.select2-container-sm .select2-choice .select2-arrow:before{line-height:26px;width:26px;font-size:10px}.select2-container-sm .select2-choice>.select2-chosen{font-size:12px;line-height:26px}.select2-container-sm.select2-container-multi .select2-choices{min-height:30px}.select2-container-sm.select2-container-multi .select2-choices .select2-search-field input{padding-bottom:3px;padding-top:3px;font-size:12px;padding-left:8px}.select2-container-sm.select2-container-multi .select2-choices .select2-search-choice{font-size:11px;line-height:12px}.select2-container-sm.select2-container-multi .select2-search-choice-close{top:3px}.select2-drop-sm .select2-search input{font-size:12px}.select2-drop-sm .select2-results{font-size:12px}.tpx-select2-container.select2-error .select2-choice{border-color:#c00;background-color:#fff;box-shadow:none;color:#333}.tpx-select2-container.select2-error .select2-choice .select2-arrow{border-left-color:#c00;background-color:#fff;color:#333}.tpx-select2-container.select2-error .select2-default .select2-chosen{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-error.select2-container-multi .select2-choices .select2-search-choice{border-color:#b30000;background-color:#fff;color:#333}.tpx-select2-container.select2-error.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-error.select2-container-active .select2-choice{border-color:#a80000}.tpx-select2-container.select2-error.select2-container-active .select2-choice .select2-arrow{border-left-color:#a80000}.tpx-select2-drop.select2-error{border-color:#a80000;background-color:#fff}.tpx-select2-drop.select2-error .select2-search input{border-color:#a80000}.tpx-select2-drop.select2-error .select2-results{color:#333}.tpx-select2-drop.select2-error .select2-highlighted{background-color:#ccc}.tpx-select2-container.select2-success .select2-choice{border-color:#3c763d;background-color:#fff;box-shadow:none;color:#333}.tpx-select2-container.select2-success .select2-choice .select2-arrow{border-left-color:#3c763d;background-color:#fff;color:#333}.tpx-select2-container.select2-success .select2-default .select2-chosen{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-success.select2-container-multi .select2-choices .select2-search-choice{border-color:#336534;background-color:#fff;color:#333}.tpx-select2-container.select2-success.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-success.select2-container-active .select2-choice{border-color:#305e31}.tpx-select2-container.select2-success.select2-container-active .select2-choice .select2-arrow{border-left-color:#305e31}.tpx-select2-drop.select2-success{border-color:#305e31;background-color:#fff}.tpx-select2-drop.select2-success .select2-search input{border-color:#305e31}.tpx-select2-drop.select2-success .select2-results{color:#333}.tpx-select2-drop.select2-success .select2-highlighted{background-color:#ccc}.tpx-select2-container.select2-warning .select2-choice{border-color:#c0753b;background-color:#fff;box-shadow:none;color:#333}.tpx-select2-container.select2-warning .select2-choice .select2-arrow{border-left-color:#c0753b;background-color:#fff;color:#333}.tpx-select2-container.select2-warning .select2-default .select2-chosen{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-warning.select2-container-multi .select2-choices .select2-search-choice{border-color:#ac6935;background-color:#fff;color:#333}.tpx-select2-container.select2-warning.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-warning.select2-container-active .select2-choice{border-color:#a56433}.tpx-select2-container.select2-warning.select2-container-active .select2-choice .select2-arrow{border-left-color:#a56433}.tpx-select2-drop.select2-warning{border-color:#a56433;background-color:#fff}.tpx-select2-drop.select2-warning .select2-search input{border-color:#a56433}.tpx-select2-drop.select2-warning .select2-results{color:#333}.tpx-select2-drop.select2-warning .select2-highlighted{background-color:#ccc}.tpx-select2-container.select2-grey .select2-choice{border-color:#ccc;background-color:#eee;box-shadow:none;color:#333}.tpx-select2-container.select2-grey .select2-choice .select2-arrow{border-left-color:#ccc;background-color:#eee;color:#333}.tpx-select2-container.select2-grey .select2-default .select2-chosen{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-grey.select2-container-multi .select2-choices .select2-search-choice{border-color:#bfbfbf;background-color:#eee;color:#333}.tpx-select2-container.select2-grey.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(51,51,51,0.5)}.tpx-select2-container.select2-grey.select2-container-active .select2-choice{border-color:#bababa}.tpx-select2-container.select2-grey.select2-container-active .select2-choice .select2-arrow{border-left-color:#bababa}.tpx-select2-drop.select2-grey{border-color:#bababa;background-color:#eee}.tpx-select2-drop.select2-grey .select2-search input{border-color:#bababa}.tpx-select2-drop.select2-grey .select2-results{color:#333}.tpx-select2-drop.select2-grey .select2-highlighted{background-color:#bbb}.tpx-select2-container.select2-darkgrey .select2-choice{border-color:#555;background-color:#666;box-shadow:none;color:#fff}.tpx-select2-container.select2-darkgrey .select2-choice .select2-arrow{border-left-color:#555;background-color:#666;color:#fff}.tpx-select2-container.select2-darkgrey .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-darkgrey.select2-container-multi .select2-choices .select2-search-choice{border-color:#484848;background-color:#666;color:#fff}.tpx-select2-container.select2-darkgrey.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-darkgrey.select2-container-active .select2-choice{border-color:#434343}.tpx-select2-container.select2-darkgrey.select2-container-active .select2-choice .select2-arrow{border-left-color:#434343}.tpx-select2-drop.select2-darkgrey{border-color:#434343;background-color:#666}.tpx-select2-drop.select2-darkgrey .select2-search input{border-color:#434343}.tpx-select2-drop.select2-darkgrey .select2-results{color:#fff}.tpx-select2-drop.select2-darkgrey .select2-highlighted{background-color:#333}.tpx-select2-container.select2-lightblue .select2-choice{border-color:#bce8f1;background-color:#ebf6fc;box-shadow:none;color:#31708f}.tpx-select2-container.select2-lightblue .select2-choice .select2-arrow{border-left-color:#bce8f1;background-color:#ebf6fc;color:#31708f}.tpx-select2-container.select2-lightblue .select2-default .select2-chosen{color:rgba(49,112,143,0.5)}.tpx-select2-container.select2-lightblue.select2-container-multi .select2-choices .select2-search-choice{border-color:#a7e1ed;background-color:#ebf6fc;color:#31708f}.tpx-select2-container.select2-lightblue.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(49,112,143,0.5)}.tpx-select2-container.select2-lightblue.select2-container-active .select2-choice{border-color:#9edeeb}.tpx-select2-container.select2-lightblue.select2-container-active .select2-choice .select2-arrow{border-left-color:#9edeeb}.tpx-select2-drop.select2-lightblue{border-color:#9edeeb;background-color:#ebf6fc}.tpx-select2-drop.select2-lightblue .select2-search input{border-color:#9edeeb}.tpx-select2-drop.select2-lightblue .select2-results{color:#31708f}.tpx-select2-drop.select2-lightblue .select2-highlighted{background-color:#92ceef}.tpx-select2-container.select2-blue .select2-choice{border-color:#2e83cf;background-color:#3f8cd3;box-shadow:none;color:#fff}.tpx-select2-container.select2-blue .select2-choice .select2-arrow{border-left-color:#2e83cf;background-color:#3f8cd3;color:#fff}.tpx-select2-container.select2-blue .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-blue.select2-container-multi .select2-choices .select2-search-choice{border-color:#2976ba;background-color:#3f8cd3;color:#fff}.tpx-select2-container.select2-blue.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-blue.select2-container-active .select2-choice{border-color:#2871b2}.tpx-select2-container.select2-blue.select2-container-active .select2-choice .select2-arrow{border-left-color:#2871b2}.tpx-select2-drop.select2-blue{border-color:#2871b2;background-color:#3f8cd3}.tpx-select2-drop.select2-blue .select2-search input{border-color:#2871b2}.tpx-select2-drop.select2-blue .select2-results{color:#fff}.tpx-select2-drop.select2-blue .select2-highlighted{background-color:#20588c}.tpx-select2-container.select2-lime .select2-choice{border-color:#8ec400;background-color:#9dd800;box-shadow:none;color:#fff}.tpx-select2-container.select2-lime .select2-choice .select2-arrow{border-left-color:#8ec400;background-color:#9dd800;color:#fff}.tpx-select2-container.select2-lime .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-lime.select2-container-multi .select2-choices .select2-search-choice{border-color:#7caa00;background-color:#9dd800;color:#fff}.tpx-select2-container.select2-lime.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-lime.select2-container-active .select2-choice{border-color:#74a000}.tpx-select2-container.select2-lime.select2-container-active .select2-choice .select2-arrow{border-left-color:#74a000}.tpx-select2-drop.select2-lime{border-color:#74a000;background-color:#9dd800}.tpx-select2-drop.select2-lime .select2-search input{border-color:#74a000}.tpx-select2-drop.select2-lime .select2-results{color:#fff}.tpx-select2-drop.select2-lime .select2-highlighted{background-color:#537200}.tpx-select2-container.select2-pomelo .select2-choice{border-color:#ff6034;background-color:#ff744e;box-shadow:none;color:#fff}.tpx-select2-container.select2-pomelo .select2-choice .select2-arrow{border-left-color:#ff6034;background-color:#ff744e;color:#fff}.tpx-select2-container.select2-pomelo .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-pomelo.select2-container-multi .select2-choices .select2-search-choice{border-color:#ff4c1b;background-color:#ff744e;color:#fff}.tpx-select2-container.select2-pomelo.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-pomelo.select2-container-active .select2-choice{border-color:#f41}.tpx-select2-container.select2-pomelo.select2-container-active .select2-choice .select2-arrow{border-left-color:#f41}.tpx-select2-drop.select2-pomelo{border-color:#f41;background-color:#ff744e}.tpx-select2-drop.select2-pomelo .select2-search input{border-color:#f41}.tpx-select2-drop.select2-pomelo .select2-results{color:#fff}.tpx-select2-drop.select2-pomelo .select2-highlighted{background-color:#e73200}.tpx-select2-container.select2-orange .select2-choice{border-color:#e69800;background-color:#ffa900;box-shadow:none;color:#fff}.tpx-select2-container.select2-orange .select2-choice .select2-arrow{border-left-color:#e69800;background-color:#ffa900;color:#fff}.tpx-select2-container.select2-orange .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-orange.select2-container-multi .select2-choices .select2-search-choice{border-color:#cc8700;background-color:#ffa900;color:#fff}.tpx-select2-container.select2-orange.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-orange.select2-container-active .select2-choice{border-color:#c28000}.tpx-select2-container.select2-orange.select2-container-active .select2-choice .select2-arrow{border-left-color:#c28000}.tpx-select2-drop.select2-orange{border-color:#c28000;background-color:#ffa900}.tpx-select2-drop.select2-orange .select2-search input{border-color:#c28000}.tpx-select2-drop.select2-orange .select2-results{color:#fff}.tpx-select2-drop.select2-orange .select2-highlighted{background-color:#996500}.tpx-select2-container.select2-bluegreen .select2-choice{border-color:#00b7b1;background-color:#00d0ca;box-shadow:none;color:#fff}.tpx-select2-container.select2-bluegreen .select2-choice .select2-arrow{border-left-color:#00b7b1;background-color:#00d0ca;color:#fff}.tpx-select2-container.select2-bluegreen .select2-default .select2-chosen{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-bluegreen.select2-container-multi .select2-choices .select2-search-choice{border-color:#009d98;background-color:#00d0ca;color:#fff}.tpx-select2-container.select2-bluegreen.select2-container-multi .select2-choices .select2-search-choice:before{color:rgba(255,255,255,0.5)}.tpx-select2-container.select2-bluegreen.select2-container-active .select2-choice{border-color:#00938f}.tpx-select2-container.select2-bluegreen.select2-container-active .select2-choice .select2-arrow{border-left-color:#00938f}.tpx-select2-drop.select2-bluegreen{border-color:#00938f;background-color:#00d0ca}.tpx-select2-drop.select2-bluegreen .select2-search input{border-color:#00938f}.tpx-select2-drop.select2-bluegreen .select2-results{color:#fff}.tpx-select2-drop.select2-bluegreen .select2-highlighted{background-color:#006a67}

js/select2/select2.min.js ADDED Viewed

	@@ -0,0 +1,23 @@


1	+ /*
2	+ Copyright 2014 Igor Vaynberg
3	+
4	+ Version: 3.5.4 Timestamp: Sun Aug 30 13:30:32 EDT 2015
5	+
6	+ This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
7	+ General Public License version 2 (the "GPL License"). You may choose either license to govern your
8	+ use of this software only upon the condition that you accept all of the terms of either the Apache
9	+ License or the GPL License.
10	+
11	+ You may obtain a copy of the Apache License and the GPL License at:
12	+
13	+ http://www.apache.org/licenses/LICENSE-2.0
14	+ http://www.gnu.org/licenses/gpl-2.0.html
15	+
16	+ Unless required by applicable law or agreed to in writing, software distributed under the Apache License
17	+ or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
18	+ either express or implied. See the Apache License and the GPL License for the specific language governing
19	+ permissions and limitations under the Apache License and the GPL License.
20	+ */
21	+ !function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]\|\|a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b\|\|c===b?!1:null===a\|\|null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a\|\|a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b\|\|d.x!==c.pageX\|\|d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d\|\|b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0\|\|b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle\|\|window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?void c.push(d(a)):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),void c.push(d(a.substring(e+f,a.length))))}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis\|\|100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport\|\|a.fn.select2.ajaxDefaults.transport,k={type:c.type\|\|"GET",cache:c.cache\|\|!1,jsonpCallback:c.jsonpCallback\|\|b,dataType:c.dataType\|\|"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)\|\|(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?void b.callback(c()):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length\|\|b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),void b.callback(e))}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f\|\|e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice\|\|!e.tokenSeparators\|\|e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g\|\|d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")\|\|"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]=>\\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(a){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.lastSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j\|\|q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.removeData("select2").off(".select2"),a.is("input[type='hidden']")?a.css("display",""):(a.show().prop("autofocus",this.autofocus\|\|!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show())),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")\|\|r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c.debug=c.debug\|\|a.fn.select2.defaults.debug,c.debug&&console&&console.warn&&(null!=c.id&&console.warn("Select2: The `id` option has been removed in Select2 4.0.0, consider renaming your `id` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.text&&console.warn("Select2: The `text` option has been removed in Select2 4.0.0, consider renaming your `text` property or mapping the property before your data makes it to Select2. You can read more at https://select2.github.io/announcements-4.0.html#changed-id"),null!=c.sortResults&&console.warn("Select2: the `sortResults` option has been renamed to `sorter` in Select2 4.0.0. "),null!=c.selectOnBlur&&console.warn("Select2: The `selectOnBlur` option has been renamed to `selectOnClose` in Select2 4.0.0."),null!=c.ajax&&null!=c.ajax.results&&console.warn("Select2: The `ajax.results` option has been renamed to `ajax.processResults` in Select2 4.0.0."),null!=c.formatNoResults&&console.warn("Select2: The `formatNoResults` option has been renamed to `language.noResults` in Select2 4.0.0."),null!=c.formatSearching&&console.warn("Select2: The `formatSearching` option has been renamed to `language.searching` in Select2 4.0.0."),null!=c.formatInputTooShort&&console.warn("Select2: The `formatInputTooShort` option has been renamed to `language.inputTooShort` in Select2 4.0.0."),null!=c.formatInputTooLong&&console.warn("Select2: The `formatInputTooLong` option has been renamed to `language.inputTooLong` in Select2 4.0.0."),null!=c.formatLoading&&console.warn("Select2: The `formatLoading` option has been renamed to `language.loadingMore` in Select2 4.0.0."),null!=c.formatSelectionTooBig&&console.warn("Select2: The `formatSelectionTooBig` option has been renamed to `language.maximumSelected` in Select2 4.0.0."),c.element.data("select2Tags")&&console.warn("Select2: The `data-select2-tags` attribute has been renamed to `data-tags` in Select2 4.0.0.")),null!=c.element.data("tags")){var j=c.element.data("tags");a.isArray(j)\|\|(j=[]),c.element.data("select2Tags",j)}if(null!=c.sorter&&(c.sortResults=c.sorter),null!=c.selectOnClose&&(c.selectOnBlur=c.selectOnClose),null!=c.ajax&&a.isFunction(c.ajax.processResults)&&(c.ajax.results=c.ajax.processResults),null!=c.language){var k=c.language;a.isFunction(k.noMatches)&&(c.formatNoMatches=k.noMatches),a.isFunction(k.searching)&&(c.formatSearching=k.searching),a.isFunction(k.inputTooShort)&&(c.formatInputTooShort=k.inputTooShort),a.isFunction(k.inputTooLong)&&(c.formatInputTooLong=k.inputTooLong),a.isFunction(k.loadingMore)&&(c.formatLoading=k.loadingMore),a.isFunction(k.maximumSelected)&&(c.formatSelectionTooBig=k.maximumSelected)}if(c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;(h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))})(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c\|\|("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(a){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver\|\|window.WebKitMutationObserver\|\|window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b\|\|{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above"),g=b.outerHeight(!1),y.top=d.top-g,y.bottom="auto"):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1\|\|this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),
22	+ this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(a){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.search.removeAttr("aria-activedescendant"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},prefillNextSearchTerm:function(){if(""!==this.search.val())return!1;var a=this.opts.nextSearchTerm(this.data(),this.lastSearchTerm);return a!==b?(this.search.val(a),this.search.select(),!0):!1},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return void b.scrollTop(0);c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()\|\|{}).top\|\|0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),void(e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e})))},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0\|\|!k\|\|!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0\|\|this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return void n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>");if(d.val().length<f.minimumInputLength)return n(J(f.formatInputTooShort,"formatInputTooShort")?"<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>":""),void(c&&this.showSearch&&this.showSearch(!0));if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return void n(J(f.formatInputTooLong,"formatInputTooLong")?"<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>":"");f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return void this.search.removeClass("select2-active");if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return void n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>");if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void(this.showSearch&&this.showSearch(d.val()));e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return void this.clearTouchMoved();var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")\|\|this.opts.element.attr("data-placeholder")\|\|this.opts.element.data("placeholder")\|\|this.opts.placeholder\|\|((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c\|\|"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function b(){var b,c,d,e,f,g;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width\|\|"resolve"===this.opts.width){if(b=this.opts.element.attr("style"),"string"==typeof b)for(c=b.split(";"),e=0,f=c.length;f>e;e+=1)if(g=c[e].replace(/\s/g,""),d=g.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px\|em\|ex\|%\|in\|cm\|mm\|pt\|pc))/i),null!==d&&d.length>=1)return d[1];return"resolve"===this.opts.width?(b=this.opts.element.css("width"),b.indexOf("%")>0?b:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var c=b.call(this);null!==c&&this.container.css("width",c)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var b,c,d;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),b=this.search.get(0),b.createTextRange?(c=b.createTextRange(),c.collapse(!1),c.select()):b.setSelectionRange&&(d=this.search.val().length,b.setSelectionRange(d,d))),this.prefillNextSearchTerm(),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h\|\|g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP\|\|a.which===k.PAGE_DOWN)return void A(a);switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return void this.selectHighlighted({noFocus:!0});case k.ESC:return this.cancel(a),void A(a)}}})),this.search.on("blur",this.bind(function(a){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.results&&this.results.length>1&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return void A(a);if(a.which==k.DOWN\|\|a.which==k.UP\|\|a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return;return this.open(),void A(a)}return a.which==k.DELETE\|\|a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),void A(a)):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()\|\|(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.lastSearchTerm=c.search.val())})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")\|\|""===this.opts.element.val()\|\|this.opts.element.val()===b\|\|null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.close(),b&&b.noFocus\|\|!this.opts.shouldFocusInput(this)\|\|this.focusser.focus(),r(c,this.id(a))\|\|this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1],this.opts.debug&&console&&console.warn&&console.warn('Select2: The second option to `select2("val")` is not supported in Select2 4.0.0. The `change` event will always be triggered in 4.0.0.')),this.select)this.opts.debug&&console&&console.warn&&console.warn('Select2: Setting the value on a <select> using `select2("val")` is no longer supported in 4.0.0. You can use the `.val(newValue).trigger("change")` method provided by jQuery instead.'),this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return void this.clear(c);if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(this.opts.debug&&console&&console.warn&&console.warn('Select2: The `select2("data")` method can no longer set selected values in 4.0.0, consider using the `.val()` method instead.'),arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection\|\|function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]\|\|(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(b){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.on("focus.select2",this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length\|\|this.isInterfaceEnabled()&&(this.opened()\|\|this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT\|\|a.which==k.RIGHT\|\|a.which==k.BACKSPACE\|\|a.which==k.DELETE\|\|a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),void(g&&g.length\|\|this.open())}if((a.which===k.BACKSPACE&&1==this.keydowns\|\|a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),void A(a);if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),void A(a);case k.ENTER:return this.selectHighlighted(),void A(a);case k.TAB:return this.selectHighlighted({noFocus:!0}),void this.close();case k.ESC:return this.cancel(a),void A(a)}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey\|\|a.ctrlKey\|\|a.shiftKey\|\|a.metaKey)return}this.open(),(a.which===k.PAGE_UP\|\|a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(a){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()\|\|this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0\|\|(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")\|\|this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select\|\|""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),this.prefillNextSearchTerm(),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c={},d=[],e=this;a(b).each(function(){e.id(this)in c\|\|(c[e.id(this)]=0,d.push(this))}),this.selection.find(".select2-search-choice").remove(),this.addSelectedChoice(d),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,b){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.lastSearchTerm=this.search.val(),this.clearSearch(),this.updateResults(),(this.select\|\|!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.prefillNextSearchTerm()&&this.updateResults(),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),b&&b.noFocus\|\|this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(b){var c=this.getVal(),d=this;a(b).each(function(){c.push(d.createChoice(this))}),this.setVal(c)},createChoice:function(c){var i,j,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c);return i=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),i!=b&&g.find("div").replaceWith(a("<div></div>").html(i)),j=this.opts.formatSelectionCssClass(c,g.find("div")),j!=b&&g.addClass(j),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),h},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")\|\|0!==b.find(".select2-result-selectable:not(.select2-selected)").length\|\|b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a\|\|a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){if(this.select)this.select.val(b);else{var c=[],d={};a(b).each(function(){this in d\|\|(c.push(this),d[this]=0)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator))}},buildChangeDetails:function(a,b){
23	+ for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)if(r(this.opts.id(b[c]),this.opts.id(a[d]))){b.splice(c,1),c--,a.splice(d,1);break}return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length\|\|(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),void(d&&this.triggerChange({added:this.data(),removed:e}));if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b\|\|(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length\|\|"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple\|\|!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0\|\|p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={debug:!1,width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a,b,c){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(a,c){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(a){return null},nextSearchTerm:function(a,c){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window\|\|navigator.msMaxTouchPoints>0;return b&&a.opts.minimumResultsForSearch<0?!1:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(a,b,c){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(a){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);

js/settings.js ADDED Viewed

	@@ -0,0 +1,105 @@


1	+ /global console,ajaxurl,$,jQuery/
2	+
3	+ /**
4	+ *
5	+ */
6	+ jQuery(function ($) {
7	+ "use strict";
8	+
9	+ if ($('#codemirror').length) {
10	+ var codeMirror = CodeMirror.fromTextArea(document.getElementById('codemirror'), {
11	+ tabMode: 'indent',
12	+ lineNumbers: true,
13	+ lineWrapping: true,
14	+ onChange: function(cm) {
15	+ cm.save();
16	+ }
17	+ });
18	+ }
19	+
20	+ $('.mega-custom_styling > h4').on('click', function() {
21	+ setTimeout( function() {
22	+ $('.mega-custom_styling').find('.CodeMirror').each(function(key, value) {
23	+ value.CodeMirror.refresh();
24	+ });
25	+ }, 160);
26	+ });
27	+
28	+ $(".mm_colorpicker").spectrum({
29	+ preferredFormat: "rgb",
30	+ showInput: true,
31	+ showAlpha: true,
32	+ clickoutFiresChange: true,
33	+ change: function(color) {
34	+ if (color.getAlpha() === 0) {
35	+ $(this).siblings('div.chosen-color').html('transparent');
36	+ } else {
37	+ $(this).siblings('div.chosen-color').html(color.toRgbString());
38	+ }
39	+ }
40	+ });
41	+
42	+ $(".confirm").on("click", function() {
43	+ return confirm(megamenu_settings.confirm);
44	+ });
45	+
46	+ $('#theme_selector').bind('change', function () {
47	+ var url = $(this).val();
48	+ if (url) {
49	+ window.location = url;
50	+ }
51	+ return false;
52	+ });
53	+
54	+ $('.mega-location-header').on("click", function(e) {
55	+ if (e.target.nodeName.toLowerCase() != 'a') {
56	+ $(this).parent().toggleClass('mega-closed').toggleClass('mega-open');
57	+ $(this).siblings('.mega-inner').slideToggle();
58	+ }
59	+ });
60	+
61	+ $('.icon_dropdown').select2({
62	+ containerCssClass: 'tpx-select2-container select2-container-sm',
63	+ dropdownCssClass: 'tpx-select2-drop',
64	+ minimumResultsForSearch: -1,
65	+ formatResult: function(icon) {
66	+ return '<i class="dashicons ' + $(icon.element).attr('data-class') + '"></i>';
67	+ },
68	+ formatSelection: function (icon) {
69	+ return '<i class="dashicons ' + $(icon.element).attr('data-class') + '"></i>';
70	+ }
71	+ });
72	+
73	+
74	+ $('select#mega_css').on("change", function() {
75	+ var select = $(this);
76	+ var selected = $(this).val();
77	+ select.next().children().hide();
78	+ select.next().children('.' + selected).show();
79	+ });
80	+
81	+ $('form.theme_editor label[data-validation]').each(function() {
82	+ var label = $(this);
83	+ var validation = label.attr('data-validation');
84	+ var error_message = label.siblings( '.mega-validation-message-' + label.attr('class') );
85	+ var input = $('input', label);
86	+
87	+ input.on('blur', function() {
88	+
89	+ var value = $(this).val();
90	+
91	+ if ( ( validation == 'int' && Math.floor(value) != value )
92	+ \|\| ( validation == 'px' && ! ( value.substr(value.length - 2) == 'px' \|\| value.substr(value.length - 2) == 'em' \|\| value.substr(value.length - 2) == 'pt' \|\| value.substr(value.length - 3) == 'rem' \|\| value.substr(value.length - 1) == '%' ) && value != 0 )
93	+ \|\| ( validation == 'float' && ! $.isNumeric(value) ) ) {
94	+ label.addClass('mega-error');
95	+ error_message.show();
96	+ } else {
97	+ label.removeClass('mega-error');
98	+ label.siblings( '.mega-validation-message-' + label.attr('class') ).hide();
99	+ }
100	+
101	+ });
102	+
103	+ });
104	+
105	+ });

js/spectrum/spectrum.css ADDED Viewed

	@@ -0,0 +1,446 @@


1	+ /***
2	+ Spectrum Colorpicker v1.1.0
3	+ https://github.com/bgrins/spectrum
4	+ Author: Brian Grinstead
5	+ License: MIT
6	+ ***/
7	+
8	+ .sp-container {
9	+ position:absolute;
10	+ top:0;
11	+ left:0;
12	+ display:inline-block;
13	+ *display: inline;
14	+ *zoom: 1;
15	+ z-index: 2147483647;
16	+ overflow: hidden;
17	+ }
18	+ .sp-container.sp-flat {
19	+ position: relative;
20	+ }
21	+
22	+ /* http://ansciath.tumblr.com/post/7347495869/css-aspect-ratio */
23	+ .sp-top {
24	+ position:relative;
25	+ width: 100%;
26	+ display:inline-block;
27	+ }
28	+ .sp-top-inner {
29	+ position:absolute;
30	+ top:0;
31	+ left:0;
32	+ bottom:0;
33	+ right:0;
34	+ }
35	+ .sp-color {
36	+ position: absolute;
37	+ top:0;
38	+ left:0;
39	+ bottom:0;
40	+ right:20%;
41	+ }
42	+ .sp-hue {
43	+ position: absolute;
44	+ top:0;
45	+ right:0;
46	+ bottom:0;
47	+ left:84%;
48	+ height: 100%;
49	+ }
50	+ .sp-fill {
51	+ padding-top: 80%;
52	+ }
53	+ .sp-sat, .sp-val {
54	+ position: absolute;
55	+ top:0;
56	+ left:0;
57	+ right:0;
58	+ bottom:0;
59	+ }
60	+
61	+ .sp-alpha-enabled .sp-top
62	+ {
63	+ margin-bottom: 18px;
64	+ }
65	+ .sp-alpha-enabled .sp-alpha
66	+ {
67	+ display: block;
68	+ }
69	+
70	+ .sp-alpha-handle
71	+ {
72	+ position:absolute;
73	+ top:-4px;
74	+ bottom: -4px;
75	+ width: 6px;
76	+ left: 50%;
77	+ cursor: pointer;
78	+ border: 1px solid black;
79	+ background: white;
80	+ opacity: .8;
81	+ }
82	+
83	+ .sp-alpha
84	+ {
85	+ display: none;
86	+ position: absolute;
87	+ bottom: -14px;
88	+ right: 0;
89	+ left: 0;
90	+ height: 8px;
91	+ }
92	+ .sp-alpha-inner{
93	+ border: solid 1px #333;
94	+ }
95	+
96	+ /* Don't allow text selection */
97	+ .sp-container, .sp-replacer, .sp-preview, .sp-dragger, .sp-slider, .sp-alpha, .sp-alpha-handle, .sp-container.sp-dragging .sp-input, .sp-container button {
98	+ -webkit-user-select:none;
99	+ -moz-user-select: -moz-none;
100	+ -o-user-select:none;
101	+ user-select: none;
102	+ }
103	+
104	+ .sp-container.sp-input-disabled .sp-input-container {
105	+ display: none;
106	+ }
107	+ .sp-container.sp-buttons-disabled .sp-button-container {
108	+ display: none;
109	+ }
110	+ .sp-palette-only .sp-picker-container {
111	+ display: none;
112	+ }
113	+ .sp-palette-disabled .sp-palette-container {
114	+ display: none;
115	+ }
116	+
117	+ .sp-initial-disabled .sp-initial {
118	+ display: none;
119	+ }
120	+
121	+
122	+ /* Gradients for hue, saturation and value instead of images. Not pretty... but it works */
123	+ .sp-sat {
124	+ background-image: -webkit-gradient(linear, 0 0, 100% 0, from(#FFF), to(rgba(204, 154, 129, 0)));
125	+ background-image: -webkit-linear-gradient(left, #FFF, rgba(204, 154, 129, 0));
126	+ background-image: -moz-linear-gradient(left, #fff, rgba(204, 154, 129, 0));
127	+ background-image: -o-linear-gradient(left, #fff, rgba(204, 154, 129, 0));
128	+ background-image: -ms-linear-gradient(left, #fff, rgba(204, 154, 129, 0));
129	+ background-image: linear-gradient(to right, #fff, rgba(204, 154, 129, 0));
130	+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(GradientType = 1, startColorstr=#FFFFFFFF, endColorstr=#00CC9A81)";
131	+ filter : progid:DXImageTransform.Microsoft.gradient(GradientType = 1, startColorstr='#FFFFFFFF', endColorstr='#00CC9A81');
132	+ }
133	+ .sp-val {
134	+ background-image: -webkit-gradient(linear, 0 100%, 0 0, from(#000000), to(rgba(204, 154, 129, 0)));
135	+ background-image: -webkit-linear-gradient(bottom, #000000, rgba(204, 154, 129, 0));
136	+ background-image: -moz-linear-gradient(bottom, #000, rgba(204, 154, 129, 0));
137	+ background-image: -o-linear-gradient(bottom, #000, rgba(204, 154, 129, 0));
138	+ background-image: -ms-linear-gradient(bottom, #000, rgba(204, 154, 129, 0));
139	+ background-image: linear-gradient(to top, #000, rgba(204, 154, 129, 0));
140	+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#00CC9A81, endColorstr=#FF000000)";
141	+ filter : progid:DXImageTransform.Microsoft.gradient(startColorstr='#00CC9A81', endColorstr='#FF000000');
142	+ }
143	+
144	+ .sp-hue {
145	+ background: -moz-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%);
146	+ background: -ms-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%);
147	+ background: -o-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%);
148	+ background: -webkit-gradient(linear, left top, left bottom, from(#ff0000), color-stop(0.17, #ffff00), color-stop(0.33, #00ff00), color-stop(0.5, #00ffff), color-stop(0.67, #0000ff), color-stop(0.83, #ff00ff), to(#ff0000));
149	+ background: -webkit-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%);
150	+ }
151	+
152	+ /* IE filters do not support multiple color stops.
153	+ Generate 6 divs, line them up, and do two color gradients for each.
154	+ Yes, really.
155	+ */
156	+
157	+ .sp-1 {
158	+ height:17%;
159	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0000', endColorstr='#ffff00');
160	+ }
161	+ .sp-2 {
162	+ height:16%;
163	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffff00', endColorstr='#00ff00');
164	+ }
165	+ .sp-3 {
166	+ height:17%;
167	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00ff00', endColorstr='#00ffff');
168	+ }
169	+ .sp-4 {
170	+ height:17%;
171	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00ffff', endColorstr='#0000ff');
172	+ }
173	+ .sp-5 {
174	+ height:16%;
175	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0000ff', endColorstr='#ff00ff');
176	+ }
177	+ .sp-6 {
178	+ height:17%;
179	+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff00ff', endColorstr='#ff0000');
180	+ }
181	+
182	+ .sp-hidden {
183	+ display: none !important;
184	+ }
185	+
186	+ /* Clearfix hack */
187	+ .sp-cf:before, .sp-cf:after { content: ""; display: table; }
188	+ .sp-cf:after { clear: both; }
189	+ .sp-cf { *zoom: 1; }
190	+
191	+ /* Mobile devices, make hue slider bigger so it is easier to slide */
192	+ @media (max-device-width: 480px) {
193	+ .sp-color { right: 40%; }
194	+ .sp-hue { left: 63%; }
195	+ .sp-fill { padding-top: 60%; }
196	+ }
197	+
198	+ .sp-dragger {
199	+ border-radius: 5px;
200	+ height: 5px;
201	+ width: 5px;
202	+ border: 1px solid #fff;
203	+ background: #000;
204	+ cursor: pointer;
205	+ position:absolute;
206	+ top:0;
207	+ left: 0;
208	+ }
209	+ .sp-slider {
210	+ position: absolute;
211	+ top:0;
212	+ cursor:pointer;
213	+ height: 3px;
214	+ left: -1px;
215	+ right: -1px;
216	+ border: 1px solid #000;
217	+ background: white;
218	+ opacity: .8;
219	+ }
220	+
221	+ /* Basic display options (colors, fonts, global widths) */
222	+ .sp-container {
223	+ border-radius: 0;
224	+ background-color: #efefef;
225	+ border: solid 1px #ccc;
226	+ padding: 0;
227	+ }
228	+ .sp-container, .sp-container button, .sp-container input, .sp-color, .sp-hue
229	+ {
230	+ -webkit-box-sizing: border-box;
231	+ -moz-box-sizing: border-box;
232	+ -ms-box-sizing: border-box;
233	+ box-sizing: border-box;
234	+ }
235	+ .sp-top
236	+ {
237	+ margin-bottom: 3px;
238	+ }
239	+ .sp-color, .sp-hue
240	+ {
241	+ border: solid 1px #666;
242	+ }
243	+
244	+ /* Input */
245	+ .sp-input-container {
246	+ float:right;
247	+ width: 100px;
248	+ margin-bottom: 4px;
249	+ }
250	+ .sp-initial-disabled .sp-input-container {
251	+ width: 100%;
252	+ }
253	+ .sp-input {
254	+ font-size: 12px !important;
255	+ border: 1px inset;
256	+ padding: 4px 5px;
257	+ margin: 0;
258	+ width: 100%;
259	+ background:transparent;
260	+ border-radius: 3px;
261	+ color: #222;
262	+ }
263	+ .sp-input:focus {
264	+ border: 1px solid orange;
265	+ }
266	+ .sp-input.sp-validation-error
267	+ {
268	+ border: 1px solid red;
269	+ background: #fdd;
270	+ }
271	+ .sp-picker-container , .sp-palette-container
272	+ {
273	+ float:left;
274	+ position: relative;
275	+ padding: 10px;
276	+ padding-bottom: 300px;
277	+ margin-bottom: -290px;
278	+ }
279	+ .sp-picker-container
280	+ {
281	+ width: 172px;
282	+ border-left: solid 1px #fff;
283	+ }
284	+
285	+ /* Palettes */
286	+ .sp-palette-container
287	+ {
288	+ border-right: solid 1px #ccc;
289	+ }
290	+
291	+ .sp-palette .sp-thumb-el {
292	+ display: block;
293	+ position:relative;
294	+ float:left;
295	+ width: 24px;
296	+ height: 15px;
297	+ margin: 3px;
298	+ cursor: pointer;
299	+ border:solid 2px transparent;
300	+ }
301	+ .sp-palette .sp-thumb-el:hover, .sp-palette .sp-thumb-el.sp-thumb-active {
302	+ border-color: orange;
303	+ }
304	+ .sp-thumb-el
305	+ {
306	+ position:relative;
307	+ }
308	+
309	+ /* Initial */
310	+ .sp-initial
311	+ {
312	+ float: left;
313	+ border: solid 1px #333;
314	+ }
315	+ .sp-initial span {
316	+ width: 30px;
317	+ height: 25px;
318	+ border:none;
319	+ display:block;
320	+ float:left;
321	+ margin:0;
322	+ }
323	+
324	+ /* Buttons */
325	+ .sp-button-container {
326	+ float: right;
327	+ }
328	+
329	+ /* Replacer (the little preview div that shows up instead of the <input>) */
330	+ .sp-replacer {
331	+ margin:0;
332	+ overflow:hidden;
333	+ cursor:pointer;
334	+ display:inline-block;
335	+ *zoom: 1;
336	+ *display: inline;
337	+ color: #333;
338	+ vertical-align: middle;
339	+ }
340	+ .sp-replacer:hover, .sp-replacer.sp-active {
341	+ border-color: #F0C49B;
342	+ color: #111;
343	+ }
344	+ .sp-replacer.sp-disabled {
345	+ cursor:default;
346	+ border-color: silver;
347	+ color: silver;
348	+ }
349	+ .sp-dd {
350	+ padding: 2px 0;
351	+ height: 16px;
352	+ line-height: 16px;
353	+ float:left;
354	+ font-size:10px;
355	+ display: none;
356	+ }
357	+ .sp-preview
358	+ {
359	+ position:relative;
360	+ width: 48px;
361	+ height: 18px;
362	+ border: solid 1px #222;
363	+ border-radius: 3px;
364	+ margin-right: 5px;
365	+ float:left;
366	+ z-index: 0;
367	+ }
368	+
369	+ .sp-palette
370	+ {
371	+ *width: 220px;
372	+ max-width: 220px;
373	+ }
374	+ .sp-palette .sp-thumb-el
375	+ {
376	+ width:16px;
377	+ height: 16px;
378	+ margin:2px 1px;
379	+ border: solid 1px #d0d0d0;
380	+ }
381	+
382	+ .sp-container
383	+ {
384	+ padding-bottom:0;
385	+ }
386	+
387	+
388	+ /* Buttons: http://hellohappy.org/css3-buttons/ */
389	+ .sp-container button {
390	+ text-transform: capitalize;
391	+ }
392	+ .sp-container button:hover {
393	+ }
394	+ .sp-container button:active {
395	+ }
396	+ .sp-cancel
397	+ {
398	+ display: none;
399	+ font-size: 11px;
400	+ color: #d93f3f !important;
401	+ margin:0;
402	+ padding:2px;
403	+ margin-right: 5px;
404	+ vertical-align: middle;
405	+ text-decoration:none;
406	+
407	+ }
408	+ .sp-cancel:hover
409	+ {
410	+ color: #d93f3f !important;
411	+ text-decoration: underline;
412	+ }
413	+
414	+
415	+ .sp-palette span:hover, .sp-palette span.sp-thumb-active
416	+ {
417	+ border-color: #000;
418	+ }
419	+
420	+ .sp-preview, .sp-alpha, .sp-thumb-el
421	+ {
422	+ position:relative;
423	+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAwAAAAMCAIAAADZF8uwAAAAGUlEQVQYV2M4gwH+YwCGIasIUwhT25BVBADtzYNYrHvv4gAAAABJRU5ErkJggg==);
424	+ }
425	+ .sp-preview-inner, .sp-alpha-inner, .sp-thumb-inner
426	+ {
427	+ display:block;
428	+ position:absolute;
429	+ top:0;left:0;bottom:0;right:0;
430	+ }
431	+
432	+ .sp-palette .sp-thumb-inner
433	+ {
434	+ background-position: 50% 50%;
435	+ background-repeat: no-repeat;
436	+ }
437	+
438	+ .sp-palette .sp-thumb-light.sp-thumb-active .sp-thumb-inner
439	+ {
440	+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAYAAABWzo5XAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAIVJREFUeNpiYBhsgJFMffxAXABlN5JruT4Q3wfi/0DsT64h8UD8HmpIPCWG/KemIfOJCUB+Aoacx6EGBZyHBqI+WsDCwuQ9mhxeg2A210Ntfo8klk9sOMijaURm7yc1UP2RNCMbKE9ODK1HM6iegYLkfx8pligC9lCD7KmRof0ZhjQACDAAceovrtpVBRkAAAAASUVORK5CYII=);
441	+ }
442	+
443	+ .sp-palette .sp-thumb-dark.sp-thumb-active .sp-thumb-inner
444	+ {
445	+ background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAYAAABWzo5XAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAadEVYdFNvZnR3YXJlAFBhaW50Lk5FVCB2My41LjEwMPRyoQAAAMdJREFUOE+tkgsNwzAMRMugEAahEAahEAZhEAqlEAZhEAohEAYh81X2dIm8fKpEspLGvudPOsUYpxE2BIJCroJmEW9qJ+MKaBFhEMNabSy9oIcIPwrB+afvAUFoK4H0tMaQ3XtlrggDhOVVMuT4E5MMG0FBbCEYzjYT7OxLEvIHQLY2zWwQ3D+9luyOQTfKDiFD3iUIfPk8VqrKjgAiSfGFPecrg6HN6m/iBcwiDAo7WiBeawa+Kwh7tZoSCGLMqwlSAzVDhoK+6vH4G0P5wdkAAAAASUVORK5CYII=);
446	+ }

js/spectrum/spectrum.js ADDED Viewed

	@@ -0,0 +1,2109 @@


1	+ // Spectrum Colorpicker v1.3.4
2	+ // https://github.com/bgrins/spectrum
3	+ // Author: Brian Grinstead
4	+ // License: MIT
5	+
6	+ (function (window, $, undefined) {
7	+ "use strict";
8	+
9	+ var defaultOpts = {
10	+
11	+ // Callbacks
12	+ beforeShow: noop,
13	+ move: noop,
14	+ change: noop,
15	+ show: noop,
16	+ hide: noop,
17	+
18	+ // Options
19	+ color: false,
20	+ flat: false,
21	+ showInput: false,
22	+ allowEmpty: false,
23	+ showButtons: true,
24	+ clickoutFiresChange: false,
25	+ showInitial: false,
26	+ showPalette: false,
27	+ showPaletteOnly: false,
28	+ showSelectionPalette: true,
29	+ localStorageKey: false,
30	+ appendTo: "body",
31	+ maxSelectionSize: 7,
32	+ cancelText: "cancel",
33	+ chooseText: "choose",
34	+ clearText: "Clear Color Selection",
35	+ noColorSelectedText: "No Color Selected",
36	+ preferredFormat: false,
37	+ className: "", // Deprecated - use containerClassName and replacerClassName instead.
38	+ containerClassName: "",
39	+ replacerClassName: "",
40	+ showAlpha: false,
41	+ theme: "sp-light",
42	+ palette: [["#ffffff", "#000000", "#ff0000", "#ff8000", "#ffff00", "#008000", "#0000ff", "#4b0082", "#9400d3"]],
43	+ selectionPalette: [],
44	+ disabled: false
45	+ },
46	+ spectrums = [],
47	+ IE = !!/msie/i.exec( window.navigator.userAgent ),
48	+ rgbaSupport = (function() {
49	+ function contains( str, substr ) {
50	+ return !!~('' + str).indexOf(substr);
51	+ }
52	+
53	+ var elem = document.createElement('div');
54	+ var style = elem.style;
55	+ style.cssText = 'background-color:rgba(0,0,0,.5)';
56	+ return contains(style.backgroundColor, 'rgba') \|\| contains(style.backgroundColor, 'hsla');
57	+ })(),
58	+ inputTypeColorSupport = (function() {
59	+ var colorInput = $("<input type='color' value='!' />")[0];
60	+ return colorInput.type === "color" && colorInput.value !== "!";
61	+ })(),
62	+ replaceInput = [
63	+ "<div class='sp-replacer'>",
64	+ "<div class='sp-preview'><div class='sp-preview-inner'></div></div>",
65	+ "<div class='sp-dd'>▼</div>",
66	+ "</div>"
67	+ ].join(''),
68	+ markup = (function () {
69	+
70	+ // IE does not support gradients with multiple stops, so we need to simulate
71	+ // that for the rainbow slider with 8 divs that each have a single gradient
72	+ var gradientFix = "";
73	+ if (IE) {
74	+ for (var i = 1; i <= 6; i++) {
75	+ gradientFix += "<div class='sp-" + i + "'></div>";
76	+ }
77	+ }
78	+
79	+ return [
80	+ "<div class='sp-container sp-hidden'>",
81	+ "<div class='sp-palette-container'>",
82	+ "<div class='sp-palette sp-thumb sp-cf'></div>",
83	+ "</div>",
84	+ "<div class='sp-picker-container'>",
85	+ "<div class='sp-top sp-cf'>",
86	+ "<div class='sp-fill'></div>",
87	+ "<div class='sp-top-inner'>",
88	+ "<div class='sp-color'>",
89	+ "<div class='sp-sat'>",
90	+ "<div class='sp-val'>",
91	+ "<div class='sp-dragger'></div>",
92	+ "</div>",
93	+ "</div>",
94	+ "</div>",
95	+ "<div class='sp-clear sp-clear-display'>",
96	+ "</div>",
97	+ "<div class='sp-hue'>",
98	+ "<div class='sp-slider'></div>",
99	+ gradientFix,
100	+ "</div>",
101	+ "</div>",
102	+ "<div class='sp-alpha'><div class='sp-alpha-inner'><div class='sp-alpha-handle'></div></div></div>",
103	+ "</div>",
104	+ "<div class='sp-input-container sp-cf'>",
105	+ "<input class='sp-input' type='text' spellcheck='false' />",
106	+ "</div>",
107	+ "<div class='sp-initial sp-thumb sp-cf'></div>",
108	+ "<div class='sp-button-container sp-cf'>",
109	+ "<a class='sp-cancel' href='#'></a>",
110	+ "<button type='button' class='sp-choose button-secondary'></button>",
111	+ "</div>",
112	+ "</div>",
113	+ "</div>"
114	+ ].join("");
115	+ })();
116	+
117	+ function paletteTemplate (p, color, className, opts) {
118	+ var html = [];
119	+ for (var i = 0; i < p.length; i++) {
120	+ var current = p[i];
121	+ if(current) {
122	+ var tiny = tinycolor(current);
123	+ var c = tiny.toHsl().l < 0.5 ? "sp-thumb-el sp-thumb-dark" : "sp-thumb-el sp-thumb-light";
124	+ c += (tinycolor.equals(color, current)) ? " sp-thumb-active" : "";
125	+ var formattedString = tiny.toString(opts.preferredFormat \|\| "rgb");
126	+ var swatchStyle = rgbaSupport ? ("background-color:" + tiny.toRgbString()) : "filter:" + tiny.toFilter();
127	+ html.push('<span title="' + formattedString + '" data-color="' + tiny.toRgbString() + '" class="' + c + '"><span class="sp-thumb-inner" style="' + swatchStyle + ';" /></span>');
128	+ } else {
129	+ var cls = 'sp-clear-display';
130	+ html.push($('<div />')
131	+ .append($('<span data-color="" style="background-color:transparent;" class="' + cls + '"></span>')
132	+ .attr('title', opts.noColorSelectedText)
133	+ )
134	+ .html()
135	+ );
136	+ }
137	+ }
138	+ return "<div class='sp-cf " + className + "'>" + html.join('') + "</div>";
139	+ }
140	+
141	+ function hideAll() {
142	+ for (var i = 0; i < spectrums.length; i++) {
143	+ if (spectrums[i]) {
144	+ spectrums[i].hide();
145	+ }
146	+ }
147	+ }
148	+
149	+ function instanceOptions(o, callbackContext) {
150	+ var opts = $.extend({}, defaultOpts, o);
151	+ opts.callbacks = {
152	+ 'move': bind(opts.move, callbackContext),
153	+ 'change': bind(opts.change, callbackContext),
154	+ 'show': bind(opts.show, callbackContext),
155	+ 'hide': bind(opts.hide, callbackContext),
156	+ 'beforeShow': bind(opts.beforeShow, callbackContext)
157	+ };
158	+
159	+ return opts;
160	+ }
161	+
162	+ function spectrum(element, o) {
163	+
164	+ var opts = instanceOptions(o, element),
165	+ flat = opts.flat,
166	+ showSelectionPalette = opts.showSelectionPalette,
167	+ localStorageKey = opts.localStorageKey,
168	+ theme = opts.theme,
169	+ callbacks = opts.callbacks,
170	+ resize = throttle(reflow, 10),
171	+ visible = false,
172	+ dragWidth = 0,
173	+ dragHeight = 0,
174	+ dragHelperHeight = 0,
175	+ slideHeight = 0,
176	+ slideWidth = 0,
177	+ alphaWidth = 0,
178	+ alphaSlideHelperWidth = 0,
179	+ slideHelperHeight = 0,
180	+ currentHue = 0,
181	+ currentSaturation = 0,
182	+ currentValue = 0,
183	+ currentAlpha = 1,
184	+ palette = [],
185	+ paletteArray = [],
186	+ paletteLookup = {},
187	+ selectionPalette = opts.selectionPalette.slice(0),
188	+ maxSelectionSize = opts.maxSelectionSize,
189	+ draggingClass = "sp-dragging",
190	+ shiftMovementDirection = null;
191	+
192	+ var doc = element.ownerDocument,
193	+ body = doc.body,
194	+ boundElement = $(element),
195	+ disabled = false,
196	+ container = $(markup, doc).addClass(theme),
197	+ dragger = container.find(".sp-color"),
198	+ dragHelper = container.find(".sp-dragger"),
199	+ slider = container.find(".sp-hue"),
200	+ slideHelper = container.find(".sp-slider"),
201	+ alphaSliderInner = container.find(".sp-alpha-inner"),
202	+ alphaSlider = container.find(".sp-alpha"),
203	+ alphaSlideHelper = container.find(".sp-alpha-handle"),
204	+ textInput = container.find(".sp-input"),
205	+ paletteContainer = container.find(".sp-palette"),
206	+ initialColorContainer = container.find(".sp-initial"),
207	+ cancelButton = container.find(".sp-cancel"),
208	+ clearButton = container.find(".sp-clear"),
209	+ chooseButton = container.find(".sp-choose"),
210	+ isInput = boundElement.is("input"),
211	+ isInputTypeColor = isInput && inputTypeColorSupport && boundElement.attr("type") === "color",
212	+ shouldReplace = isInput && !flat,
213	+ replacer = (shouldReplace) ? $(replaceInput).addClass(theme).addClass(opts.className).addClass(opts.replacerClassName) : $([]),
214	+ offsetElement = (shouldReplace) ? replacer : boundElement,
215	+ previewElement = replacer.find(".sp-preview-inner"),
216	+ initialColor = opts.color \|\| (isInput && boundElement.val()),
217	+ colorOnShow = false,
218	+ preferredFormat = opts.preferredFormat,
219	+ currentPreferredFormat = preferredFormat,
220	+ clickoutFiresChange = !opts.showButtons \|\| opts.clickoutFiresChange,
221	+ isEmpty = !initialColor,
222	+ allowEmpty = opts.allowEmpty && !isInputTypeColor;
223	+
224	+ function applyOptions() {
225	+
226	+ if (opts.showPaletteOnly) {
227	+ opts.showPalette = true;
228	+ }
229	+
230	+ if (opts.palette) {
231	+ palette = opts.palette.slice(0);
232	+ paletteArray = $.isArray(palette[0]) ? palette : [palette];
233	+ paletteLookup = {};
234	+ for (var i = 0; i < paletteArray.length; i++) {
235	+ for (var j = 0; j < paletteArray[i].length; j++) {
236	+ var rgb = tinycolor(paletteArray[i][j]).toRgbString();
237	+ paletteLookup[rgb] = true;
238	+ }
239	+ }
240	+ }
241	+
242	+ container.toggleClass("sp-flat", flat);
243	+ container.toggleClass("sp-input-disabled", !opts.showInput);
244	+ container.toggleClass("sp-alpha-enabled", opts.showAlpha);
245	+ container.toggleClass("sp-clear-enabled", allowEmpty);
246	+ container.toggleClass("sp-buttons-disabled", !opts.showButtons);
247	+ container.toggleClass("sp-palette-disabled", !opts.showPalette);
248	+ container.toggleClass("sp-palette-only", opts.showPaletteOnly);
249	+ container.toggleClass("sp-initial-disabled", !opts.showInitial);
250	+ container.addClass(opts.className).addClass(opts.containerClassName);
251	+
252	+ reflow();
253	+ }
254	+
255	+ function initialize() {
256	+
257	+ if (IE) {
258	+ container.find("*:not(input)").attr("unselectable", "on");
259	+ }
260	+
261	+ applyOptions();
262	+
263	+ if (shouldReplace) {
264	+ boundElement.after(replacer).hide();
265	+ }
266	+
267	+ if (!allowEmpty) {
268	+ clearButton.hide();
269	+ }
270	+
271	+ if (flat) {
272	+ boundElement.after(container).hide();
273	+ }
274	+ else {
275	+
276	+ var appendTo = opts.appendTo === "parent" ? boundElement.parent() : $(opts.appendTo);
277	+ if (appendTo.length !== 1) {
278	+ appendTo = $("body");
279	+ }
280	+
281	+ appendTo.append(container);
282	+ }
283	+
284	+ updateSelectionPaletteFromStorage();
285	+
286	+ offsetElement.bind("click.spectrum touchstart.spectrum", function (e) {
287	+ if (!disabled) {
288	+ toggle();
289	+ }
290	+
291	+ e.stopPropagation();
292	+
293	+ if (!$(e.target).is("input")) {
294	+ e.preventDefault();
295	+ }
296	+ });
297	+
298	+ if(boundElement.is(":disabled") \|\| (opts.disabled === true)) {
299	+ disable();
300	+ }
301	+
302	+ // Prevent clicks from bubbling up to document. This would cause it to be hidden.
303	+ container.click(stopPropagation);
304	+
305	+ // Handle user typed input
306	+ textInput.change(setFromTextInput);
307	+ textInput.bind("paste", function () {
308	+ setTimeout(setFromTextInput, 1);
309	+ });
310	+ textInput.keydown(function (e) { if (e.keyCode == 13) { setFromTextInput(); } });
311	+
312	+ cancelButton.text(opts.cancelText);
313	+ cancelButton.bind("click.spectrum", function (e) {
314	+ e.stopPropagation();
315	+ e.preventDefault();
316	+ hide("cancel");
317	+ });
318	+
319	+ clearButton.attr("title", opts.clearText);
320	+ clearButton.bind("click.spectrum", function (e) {
321	+ e.stopPropagation();
322	+ e.preventDefault();
323	+ isEmpty = true;
324	+ move();
325	+
326	+ if(flat) {
327	+ //for the flat style, this is a change event
328	+ updateOriginalInput(true);
329	+ }
330	+ });
331	+
332	+ chooseButton.text(opts.chooseText);
333	+ chooseButton.bind("click.spectrum", function (e) {
334	+ e.stopPropagation();
335	+ e.preventDefault();
336	+
337	+ if (isValid()) {
338	+ updateOriginalInput(true);
339	+ hide();
340	+ }
341	+ });
342	+
343	+ draggable(alphaSlider, function (dragX, dragY, e) {
344	+ currentAlpha = (dragX / alphaWidth);
345	+ isEmpty = false;
346	+ if (e.shiftKey) {
347	+ currentAlpha = Math.round(currentAlpha * 10) / 10;
348	+ }
349	+
350	+ move();
351	+ }, dragStart, dragStop);
352	+
353	+ draggable(slider, function (dragX, dragY) {
354	+ currentHue = parseFloat(dragY / slideHeight);
355	+ isEmpty = false;
356	+ if (!opts.showAlpha) {
357	+ currentAlpha = 1;
358	+ }
359	+ move();
360	+ }, dragStart, dragStop);
361	+
362	+ draggable(dragger, function (dragX, dragY, e) {
363	+
364	+ // shift+drag should snap the movement to either the x or y axis.
365	+ if (!e.shiftKey) {
366	+ shiftMovementDirection = null;
367	+ }
368	+ else if (!shiftMovementDirection) {
369	+ var oldDragX = currentSaturation * dragWidth;
370	+ var oldDragY = dragHeight - (currentValue * dragHeight);
371	+ var furtherFromX = Math.abs(dragX - oldDragX) > Math.abs(dragY - oldDragY);
372	+
373	+ shiftMovementDirection = furtherFromX ? "x" : "y";
374	+ }
375	+
376	+ var setSaturation = !shiftMovementDirection \|\| shiftMovementDirection === "x";
377	+ var setValue = !shiftMovementDirection \|\| shiftMovementDirection === "y";
378	+
379	+ if (setSaturation) {
380	+ currentSaturation = parseFloat(dragX / dragWidth);
381	+ }
382	+ if (setValue) {
383	+ currentValue = parseFloat((dragHeight - dragY) / dragHeight);
384	+ }
385	+
386	+ isEmpty = false;
387	+ if (!opts.showAlpha) {
388	+ currentAlpha = 1;
389	+ }
390	+
391	+ move();
392	+
393	+ }, dragStart, dragStop);
394	+
395	+ if (!!initialColor) {
396	+ set(initialColor);
397	+
398	+ // In case color was black - update the preview UI and set the format
399	+ // since the set function will not run (default color is black).
400	+ updateUI();
401	+ currentPreferredFormat = preferredFormat \|\| tinycolor(initialColor).format;
402	+
403	+ addColorToSelectionPalette(initialColor);
404	+ }
405	+ else {
406	+ updateUI();
407	+ }
408	+
409	+ if (flat) {
410	+ show();
411	+ }
412	+
413	+ function paletteElementClick(e) {
414	+ if (e.data && e.data.ignore) {
415	+ set($(e.target).closest(".sp-thumb-el").data("color"));
416	+ move();
417	+ }
418	+ else {
419	+ set($(e.target).closest(".sp-thumb-el").data("color"));
420	+ move();
421	+ updateOriginalInput(true);
422	+ hide();
423	+ }
424	+
425	+ return false;
426	+ }
427	+
428	+ var paletteEvent = IE ? "mousedown.spectrum" : "click.spectrum touchstart.spectrum";
429	+ paletteContainer.delegate(".sp-thumb-el", paletteEvent, paletteElementClick);
430	+ initialColorContainer.delegate(".sp-thumb-el:nth-child(1)", paletteEvent, { ignore: true }, paletteElementClick);
431	+ }
432	+
433	+ function updateSelectionPaletteFromStorage() {
434	+
435	+ if (localStorageKey && window.localStorage) {
436	+
437	+ // Migrate old palettes over to new format. May want to remove this eventually.
438	+ try {
439	+ var oldPalette = window.localStorage[localStorageKey].split(",#");
440	+ if (oldPalette.length > 1) {
441	+ delete window.localStorage[localStorageKey];
442	+ $.each(oldPalette, function(i, c) {
443	+ addColorToSelectionPalette(c);
444	+ });
445	+ }
446	+ }
447	+ catch(e) { }
448	+
449	+ try {
450	+ selectionPalette = window.localStorage[localStorageKey].split(";");
451	+ }
452	+ catch (e) { }
453	+ }
454	+ }
455	+
456	+ function addColorToSelectionPalette(color) {
457	+ if (showSelectionPalette) {
458	+ var rgb = tinycolor(color).toRgbString();
459	+ if (!paletteLookup[rgb] && $.inArray(rgb, selectionPalette) === -1) {
460	+ selectionPalette.push(rgb);
461	+ while(selectionPalette.length > maxSelectionSize) {
462	+ selectionPalette.shift();
463	+ }
464	+ }
465	+
466	+ if (localStorageKey && window.localStorage) {
467	+ try {
468	+ window.localStorage[localStorageKey] = selectionPalette.join(";");
469	+ }
470	+ catch(e) { }
471	+ }
472	+ }
473	+ }
474	+
475	+ function getUniqueSelectionPalette() {
476	+ var unique = [];
477	+ if (opts.showPalette) {
478	+ for (var i = 0; i < selectionPalette.length; i++) {
479	+ var rgb = tinycolor(selectionPalette[i]).toRgbString();
480	+
481	+ if (!paletteLookup[rgb]) {
482	+ unique.push(selectionPalette[i]);
483	+ }
484	+ }
485	+ }
486	+
487	+ return unique.reverse().slice(0, opts.maxSelectionSize);
488	+ }
489	+
490	+ function drawPalette() {
491	+
492	+ var currentColor = get();
493	+
494	+ var html = $.map(paletteArray, function (palette, i) {
495	+ return paletteTemplate(palette, currentColor, "sp-palette-row sp-palette-row-" + i, opts);
496	+ });
497	+
498	+ updateSelectionPaletteFromStorage();
499	+
500	+ if (selectionPalette) {
501	+ html.push(paletteTemplate(getUniqueSelectionPalette(), currentColor, "sp-palette-row sp-palette-row-selection", opts));
502	+ }
503	+
504	+ paletteContainer.html(html.join(""));
505	+ }
506	+
507	+ function drawInitial() {
508	+ if (opts.showInitial) {
509	+ var initial = colorOnShow;
510	+ var current = get();
511	+ initialColorContainer.html(paletteTemplate([initial, current], current, "sp-palette-row-initial", opts));
512	+ }
513	+ }
514	+
515	+ function dragStart() {
516	+ if (dragHeight <= 0 \|\| dragWidth <= 0 \|\| slideHeight <= 0) {
517	+ reflow();
518	+ }
519	+ container.addClass(draggingClass);
520	+ shiftMovementDirection = null;
521	+ boundElement.trigger('dragstart.spectrum', [ get() ]);
522	+ }
523	+
524	+ function dragStop() {
525	+ container.removeClass(draggingClass);
526	+ boundElement.trigger('dragstop.spectrum', [ get() ]);
527	+ }
528	+
529	+ function setFromTextInput() {
530	+
531	+ var value = textInput.val();
532	+
533	+ if ((value === null \|\| value === "") && allowEmpty) {
534	+ set(null);
535	+ updateOriginalInput(true);
536	+ }
537	+ else {
538	+ var tiny = tinycolor(value);
539	+ if (tiny.isValid()) {
540	+ set(tiny);
541	+ updateOriginalInput(true);
542	+ }
543	+ else {
544	+ textInput.addClass("sp-validation-error");
545	+ }
546	+ }
547	+ }
548	+
549	+ function toggle() {
550	+ if (visible) {
551	+ hide();
552	+ }
553	+ else {
554	+ show();
555	+ }
556	+ }
557	+
558	+ function show() {
559	+ var event = $.Event('beforeShow.spectrum');
560	+
561	+ if (visible) {
562	+ reflow();
563	+ return;
564	+ }
565	+
566	+ boundElement.trigger(event, [ get() ]);
567	+
568	+ if (callbacks.beforeShow(get()) === false \|\| event.isDefaultPrevented()) {
569	+ return;
570	+ }
571	+
572	+ hideAll();
573	+ visible = true;
574	+
575	+ $(doc).bind("click.spectrum", hide);
576	+ $(window).bind("resize.spectrum", resize);
577	+ replacer.addClass("sp-active");
578	+ container.removeClass("sp-hidden");
579	+
580	+ reflow();
581	+ updateUI();
582	+
583	+ colorOnShow = get();
584	+
585	+ drawInitial();
586	+ callbacks.show(colorOnShow);
587	+ boundElement.trigger('show.spectrum', [ colorOnShow ]);
588	+ }
589	+
590	+ function hide(e) {
591	+
592	+ // Return on right click
593	+ if (e && e.type == "click" && e.button == 2) { return; }
594	+
595	+ // Return if hiding is unnecessary
596	+ if (!visible \|\| flat) { return; }
597	+ visible = false;
598	+
599	+ $(doc).unbind("click.spectrum", hide);
600	+ $(window).unbind("resize.spectrum", resize);
601	+
602	+ replacer.removeClass("sp-active");
603	+ container.addClass("sp-hidden");
604	+
605	+ var colorHasChanged = !tinycolor.equals(get(), colorOnShow);
606	+
607	+ if (colorHasChanged) {
608	+ if (clickoutFiresChange && e !== "cancel") {
609	+ updateOriginalInput(true);
610	+ }
611	+ else {
612	+ revert();
613	+ }
614	+ }
615	+
616	+ callbacks.hide(get());
617	+ boundElement.trigger('hide.spectrum', [ get() ]);
618	+ }
619	+
620	+ function revert() {
621	+ set(colorOnShow, true);
622	+ }
623	+
624	+ function set(color, ignoreFormatChange) {
625	+ if (tinycolor.equals(color, get())) {
626	+ // Update UI just in case a validation error needs
627	+ // to be cleared.
628	+ updateUI();
629	+ return;
630	+ }
631	+
632	+ var newColor, newHsv;
633	+ if (!color && allowEmpty) {
634	+ isEmpty = true;
635	+ } else {
636	+ isEmpty = false;
637	+ newColor = tinycolor(color);
638	+ newHsv = newColor.toHsv();
639	+
640	+ currentHue = (newHsv.h % 360) / 360;
641	+ currentSaturation = newHsv.s;
642	+ currentValue = newHsv.v;
643	+ currentAlpha = newHsv.a;
644	+ }
645	+ updateUI();
646	+
647	+ if (newColor && newColor.isValid() && !ignoreFormatChange) {
648	+ currentPreferredFormat = preferredFormat \|\| newColor.getFormat();
649	+ }
650	+ }
651	+
652	+ function get(opts) {
653	+ opts = opts \|\| { };
654	+
655	+ if (allowEmpty && isEmpty) {
656	+ return null;
657	+ }
658	+
659	+ return tinycolor.fromRatio({
660	+ h: currentHue,
661	+ s: currentSaturation,
662	+ v: currentValue,
663	+ a: Math.round(currentAlpha * 100) / 100
664	+ }, { format: opts.format \|\| currentPreferredFormat });
665	+ }
666	+
667	+ function isValid() {
668	+ return !textInput.hasClass("sp-validation-error");
669	+ }
670	+
671	+ function move() {
672	+ updateUI();
673	+
674	+ callbacks.move(get());
675	+ boundElement.trigger('move.spectrum', [ get() ]);
676	+ }
677	+
678	+ function updateUI() {
679	+
680	+ textInput.removeClass("sp-validation-error");
681	+
682	+ updateHelperLocations();
683	+
684	+ // Update dragger background color (gradients take care of saturation and value).
685	+ var flatColor = tinycolor.fromRatio({ h: currentHue, s: 1, v: 1 });
686	+ dragger.css("background-color", flatColor.toHexString());
687	+
688	+ // Get a format that alpha will be included in (hex and names ignore alpha)
689	+ var format = currentPreferredFormat;
690	+ if (currentAlpha < 1 && !(currentAlpha === 0 && format === "name")) {
691	+ if (format === "hex" \|\| format === "hex3" \|\| format === "hex6" \|\| format === "name") {
692	+ format = "rgb";
693	+ }
694	+ }
695	+
696	+ var realColor = get({ format: format }),
697	+ displayColor = '';
698	+
699	+ //reset background info for preview element
700	+ previewElement.removeClass("sp-clear-display");
701	+ previewElement.css('background-color', 'transparent');
702	+
703	+ if (!realColor && allowEmpty) {
704	+ // Update the replaced elements background with icon indicating no color selection
705	+ previewElement.addClass("sp-clear-display");
706	+ }
707	+ else {
708	+ var realHex = realColor.toHexString(),
709	+ realRgb = realColor.toRgbString();
710	+
711	+ // Update the replaced elements background color (with actual selected color)
712	+ if (rgbaSupport \|\| realColor.alpha === 1) {
713	+ previewElement.css("background-color", realRgb);
714	+ }
715	+ else {
716	+ previewElement.css("background-color", "transparent");
717	+ previewElement.css("filter", realColor.toFilter());
718	+ }
719	+
720	+ if (opts.showAlpha) {
721	+ var rgb = realColor.toRgb();
722	+ rgb.a = 0;
723	+ var realAlpha = tinycolor(rgb).toRgbString();
724	+ var gradient = "linear-gradient(left, " + realAlpha + ", " + realHex + ")";
725	+
726	+ if (IE) {
727	+ alphaSliderInner.css("filter", tinycolor(realAlpha).toFilter({ gradientType: 1 }, realHex));
728	+ }
729	+ else {
730	+ alphaSliderInner.css("background", "-webkit-" + gradient);
731	+ alphaSliderInner.css("background", "-moz-" + gradient);
732	+ alphaSliderInner.css("background", "-ms-" + gradient);
733	+ // Use current syntax gradient on unprefixed property.
734	+ alphaSliderInner.css("background",
735	+ "linear-gradient(to right, " + realAlpha + ", " + realHex + ")");
736	+ }
737	+ }
738	+
739	+ displayColor = realColor.toString(format);
740	+ }
741	+
742	+ // Update the text entry input as it changes happen
743	+ if (opts.showInput) {
744	+ textInput.val(displayColor);
745	+ }
746	+
747	+ if (opts.showPalette) {
748	+ drawPalette();
749	+ }
750	+
751	+ drawInitial();
752	+ }
753	+
754	+ function updateHelperLocations() {
755	+ var s = currentSaturation;
756	+ var v = currentValue;
757	+
758	+ if(allowEmpty && isEmpty) {
759	+ //if selected color is empty, hide the helpers
760	+ alphaSlideHelper.hide();
761	+ slideHelper.hide();
762	+ dragHelper.hide();
763	+ }
764	+ else {
765	+ //make sure helpers are visible
766	+ alphaSlideHelper.show();
767	+ slideHelper.show();
768	+ dragHelper.show();
769	+
770	+ // Where to show the little circle in that displays your current selected color
771	+ var dragX = s * dragWidth;
772	+ var dragY = dragHeight - (v * dragHeight);
773	+ dragX = Math.max(
774	+ -dragHelperHeight,
775	+ Math.min(dragWidth - dragHelperHeight, dragX - dragHelperHeight)
776	+ );
777	+ dragY = Math.max(
778	+ -dragHelperHeight,
779	+ Math.min(dragHeight - dragHelperHeight, dragY - dragHelperHeight)
780	+ );
781	+ dragHelper.css({
782	+ "top": dragY + "px",
783	+ "left": dragX + "px"
784	+ });
785	+
786	+ var alphaX = currentAlpha * alphaWidth;
787	+ alphaSlideHelper.css({
788	+ "left": (alphaX - (alphaSlideHelperWidth / 2)) + "px"
789	+ });
790	+
791	+ // Where to show the bar that displays your current selected hue
792	+ var slideY = (currentHue) * slideHeight;
793	+ slideHelper.css({
794	+ "top": (slideY - slideHelperHeight) + "px"
795	+ });
796	+ }
797	+ }
798	+
799	+ function updateOriginalInput(fireCallback) {
800	+ var color = get(),
801	+ displayColor = '',
802	+ hasChanged = !tinycolor.equals(color, colorOnShow);
803	+
804	+ if (color) {
805	+ displayColor = color.toString(currentPreferredFormat);
806	+ // Update the selection palette with the current color
807	+ addColorToSelectionPalette(color);
808	+ }
809	+
810	+ if (isInput) {
811	+ boundElement.val(displayColor);
812	+ }
813	+
814	+ colorOnShow = color;
815	+
816	+ if (fireCallback && hasChanged) {
817	+ callbacks.change(color);
818	+ boundElement.trigger('change', [ color ]);
819	+ }
820	+ }
821	+
822	+ function reflow() {
823	+ dragWidth = dragger.width();
824	+ dragHeight = dragger.height();
825	+ dragHelperHeight = dragHelper.height();
826	+ slideWidth = slider.width();
827	+ slideHeight = slider.height();
828	+ slideHelperHeight = slideHelper.height();
829	+ alphaWidth = alphaSlider.width();
830	+ alphaSlideHelperWidth = alphaSlideHelper.width();
831	+
832	+ if (!flat) {
833	+ container.css("position", "absolute");
834	+ container.offset(getOffset(container, offsetElement));
835	+ }
836	+
837	+ updateHelperLocations();
838	+
839	+ if (opts.showPalette) {
840	+ drawPalette();
841	+ }
842	+
843	+ boundElement.trigger('reflow.spectrum');
844	+ }
845	+
846	+ function destroy() {
847	+ boundElement.show();
848	+ offsetElement.unbind("click.spectrum touchstart.spectrum");
849	+ container.remove();
850	+ replacer.remove();
851	+ spectrums[spect.id] = null;
852	+ }
853	+
854	+ function option(optionName, optionValue) {
855	+ if (optionName === undefined) {
856	+ return $.extend({}, opts);
857	+ }
858	+ if (optionValue === undefined) {
859	+ return opts[optionName];
860	+ }
861	+
862	+ opts[optionName] = optionValue;
863	+ applyOptions();
864	+ }
865	+
866	+ function enable() {
867	+ disabled = false;
868	+ boundElement.attr("disabled", false);
869	+ offsetElement.removeClass("sp-disabled");
870	+ }
871	+
872	+ function disable() {
873	+ hide();
874	+ disabled = true;
875	+ boundElement.attr("disabled", true);
876	+ offsetElement.addClass("sp-disabled");
877	+ }
878	+
879	+ initialize();
880	+
881	+ var spect = {
882	+ show: show,
883	+ hide: hide,
884	+ toggle: toggle,
885	+ reflow: reflow,
886	+ option: option,
887	+ enable: enable,
888	+ disable: disable,
889	+ set: function (c) {
890	+ set(c);
891	+ updateOriginalInput();
892	+ },
893	+ get: get,
894	+ destroy: destroy,
895	+ container: container
896	+ };
897	+
898	+ spect.id = spectrums.push(spect) - 1;
899	+
900	+ return spect;
901	+ }
902	+
903	+ /**
904	+ * checkOffset - get the offset below/above and left/right element depending on screen position
905	+ * Thanks https://github.com/jquery/jquery-ui/blob/master/ui/jquery.ui.datepicker.js
906	+ */
907	+ function getOffset(picker, input) {
908	+ var extraY = 0;
909	+ var dpWidth = picker.outerWidth();
910	+ var dpHeight = picker.outerHeight();
911	+ var inputHeight = input.outerHeight();
912	+ var doc = picker[0].ownerDocument;
913	+ var docElem = doc.documentElement;
914	+ var viewWidth = docElem.clientWidth + $(doc).scrollLeft();
915	+ var viewHeight = docElem.clientHeight + $(doc).scrollTop();
916	+ var offset = input.offset();
917	+ offset.top += inputHeight;
918	+
919	+ offset.left -=
920	+ Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
921	+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
922	+
923	+ offset.top -=
924	+ Math.min(offset.top, ((offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
925	+ Math.abs(dpHeight + inputHeight - extraY) : extraY));
926	+
927	+ return offset;
928	+ }
929	+
930	+ /**
931	+ * noop - do nothing
932	+ */
933	+ function noop() {
934	+
935	+ }
936	+
937	+ /**
938	+ * stopPropagation - makes the code only doing this a little easier to read in line
939	+ */
940	+ function stopPropagation(e) {
941	+ e.stopPropagation();
942	+ }
943	+
944	+ /**
945	+ * Create a function bound to a given object
946	+ * Thanks to underscore.js
947	+ */
948	+ function bind(func, obj) {
949	+ var slice = Array.prototype.slice;
950	+ var args = slice.call(arguments, 2);
951	+ return function () {
952	+ return func.apply(obj, args.concat(slice.call(arguments)));
953	+ };
954	+ }
955	+
956	+ /**
957	+ * Lightweight drag helper. Handles containment within the element, so that
958	+ * when dragging, the x is within [0,element.width] and y is within [0,element.height]
959	+ */
960	+ function draggable(element, onmove, onstart, onstop) {
961	+ onmove = onmove \|\| function () { };
962	+ onstart = onstart \|\| function () { };
963	+ onstop = onstop \|\| function () { };
964	+ var doc = element.ownerDocument \|\| document;
965	+ var dragging = false;
966	+ var offset = {};
967	+ var maxHeight = 0;
968	+ var maxWidth = 0;
969	+ var hasTouch = ('ontouchstart' in window);
970	+
971	+ var duringDragEvents = {};
972	+ duringDragEvents["selectstart"] = prevent;
973	+ duringDragEvents["dragstart"] = prevent;
974	+ duringDragEvents["touchmove mousemove"] = move;
975	+ duringDragEvents["touchend mouseup"] = stop;
976	+
977	+ function prevent(e) {
978	+ if (e.stopPropagation) {
979	+ e.stopPropagation();
980	+ }
981	+ if (e.preventDefault) {
982	+ e.preventDefault();
983	+ }
984	+ e.returnValue = false;
985	+ }
986	+
987	+ function move(e) {
988	+ if (dragging) {
989	+ // Mouseup happened outside of window
990	+ if (IE && document.documentMode < 9 && !e.button) {
991	+ return stop();
992	+ }
993	+
994	+ var touches = e.originalEvent.touches;
995	+ var pageX = touches ? touches[0].pageX : e.pageX;
996	+ var pageY = touches ? touches[0].pageY : e.pageY;
997	+
998	+ var dragX = Math.max(0, Math.min(pageX - offset.left, maxWidth));
999	+ var dragY = Math.max(0, Math.min(pageY - offset.top, maxHeight));
1000	+
1001	+ if (hasTouch) {
1002	+ // Stop scrolling in iOS
1003	+ prevent(e);
1004	+ }
1005	+
1006	+ onmove.apply(element, [dragX, dragY, e]);
1007	+ }
1008	+ }
1009	+
1010	+ function start(e) {
1011	+ var rightclick = (e.which) ? (e.which == 3) : (e.button == 2);
1012	+ var touches = e.originalEvent.touches;
1013	+
1014	+ if (!rightclick && !dragging) {
1015	+ if (onstart.apply(element, arguments) !== false) {
1016	+ dragging = true;
1017	+ maxHeight = $(element).height();
1018	+ maxWidth = $(element).width();
1019	+ offset = $(element).offset();
1020	+
1021	+ $(doc).bind(duringDragEvents);
1022	+ $(doc.body).addClass("sp-dragging");
1023	+
1024	+ if (!hasTouch) {
1025	+ move(e);
1026	+ }
1027	+
1028	+ prevent(e);
1029	+ }
1030	+ }
1031	+ }
1032	+
1033	+ function stop() {
1034	+ if (dragging) {
1035	+ $(doc).unbind(duringDragEvents);
1036	+ $(doc.body).removeClass("sp-dragging");
1037	+ onstop.apply(element, arguments);
1038	+ }
1039	+ dragging = false;
1040	+ }
1041	+
1042	+ $(element).bind("touchstart mousedown", start);
1043	+ }
1044	+
1045	+ function throttle(func, wait, debounce) {
1046	+ var timeout;
1047	+ return function () {
1048	+ var context = this, args = arguments;
1049	+ var throttler = function () {
1050	+ timeout = null;
1051	+ func.apply(context, args);
1052	+ };
1053	+ if (debounce) clearTimeout(timeout);
1054	+ if (debounce \|\| !timeout) timeout = setTimeout(throttler, wait);
1055	+ };
1056	+ }
1057	+
1058	+ /**
1059	+ * Define a jQuery plugin
1060	+ */
1061	+ var dataID = "spectrum.id";
1062	+ $.fn.spectrum = function (opts, extra) {
1063	+
1064	+ if (typeof opts == "string") {
1065	+
1066	+ var returnValue = this;
1067	+ var args = Array.prototype.slice.call( arguments, 1 );
1068	+
1069	+ this.each(function () {
1070	+ var spect = spectrums[$(this).data(dataID)];
1071	+ if (spect) {
1072	+ var method = spect[opts];
1073	+ if (!method) {
1074	+ throw new Error( "Spectrum: no such method: '" + opts + "'" );
1075	+ }
1076	+
1077	+ if (opts == "get") {
1078	+ returnValue = spect.get();
1079	+ }
1080	+ else if (opts == "container") {
1081	+ returnValue = spect.container;
1082	+ }
1083	+ else if (opts == "option") {
1084	+ returnValue = spect.option.apply(spect, args);
1085	+ }
1086	+ else if (opts == "destroy") {
1087	+ spect.destroy();
1088	+ $(this).removeData(dataID);
1089	+ }
1090	+ else {
1091	+ method.apply(spect, args);
1092	+ }
1093	+ }
1094	+ });
1095	+
1096	+ return returnValue;
1097	+ }
1098	+
1099	+ // Initializing a new instance of spectrum
1100	+ return this.spectrum("destroy").each(function () {
1101	+ var options = $.extend({}, opts, $(this).data());
1102	+ var spect = spectrum(this, options);
1103	+ $(this).data(dataID, spect.id);
1104	+ });
1105	+ };
1106	+
1107	+ $.fn.spectrum.load = true;
1108	+ $.fn.spectrum.loadOpts = {};
1109	+ $.fn.spectrum.draggable = draggable;
1110	+ $.fn.spectrum.defaults = defaultOpts;
1111	+
1112	+ $.spectrum = { };
1113	+ $.spectrum.localization = { };
1114	+ $.spectrum.palettes = { };
1115	+
1116	+ $.fn.spectrum.processNativeColorInputs = function () {
1117	+ if (!inputTypeColorSupport) {
1118	+ $("input[type=color]").spectrum({
1119	+ preferredFormat: "hex6"
1120	+ });
1121	+ }
1122	+ };
1123	+
1124	+ // TinyColor v0.10.0
1125	+ // https://github.com/bgrins/TinyColor
1126	+ // 2013-08-10, Brian Grinstead, MIT License
1127	+
1128	+ (function() {
1129	+
1130	+ var trimLeft = /^[\s,#]+/,
1131	+ trimRight = /\s+$/,
1132	+ tinyCounter = 0,
1133	+ math = Math,
1134	+ mathRound = math.round,
1135	+ mathMin = math.min,
1136	+ mathMax = math.max,
1137	+ mathRandom = math.random;
1138	+
1139	+ var tinycolor = function tinycolor (color, opts) {
1140	+
1141	+ color = (color) ? color : '';
1142	+ opts = opts \|\| { };
1143	+
1144	+ // If input is already a tinycolor, return itself
1145	+ if (color instanceof tinycolor) {
1146	+ return color;
1147	+ }
1148	+ // If we are called as a function, call using new instead
1149	+ if (!(this instanceof tinycolor)) {
1150	+ return new tinycolor(color, opts);
1151	+ }
1152	+
1153	+ var rgb = inputToRGB(color);
1154	+ this._r = rgb.r,
1155	+ this._g = rgb.g,
1156	+ this._b = rgb.b,
1157	+ this._a = rgb.a,
1158	+ this._roundA = mathRound(100*this._a) / 100,
1159	+ this._format = opts.format \|\| rgb.format;
1160	+ this._gradientType = opts.gradientType;
1161	+
1162	+ // Don't let the range of [0,255] come back in [0,1].
1163	+ // Potentially lose a little bit of precision here, but will fix issues where
1164	+ // .5 gets interpreted as half of the total, instead of half of 1
1165	+ // If it was supposed to be 128, this was already taken care of by `inputToRgb`
1166	+ if (this._r < 1) { this._r = mathRound(this._r); }
1167	+ if (this._g < 1) { this._g = mathRound(this._g); }
1168	+ if (this._b < 1) { this._b = mathRound(this._b); }
1169	+
1170	+ this._ok = rgb.ok;
1171	+ this._tc_id = tinyCounter++;
1172	+ };
1173	+
1174	+ tinycolor.prototype = {
1175	+ isValid: function() {
1176	+ return this._ok;
1177	+ },
1178	+ getFormat: function() {
1179	+ return this._format;
1180	+ },
1181	+ getAlpha: function() {
1182	+ return this._a;
1183	+ },
1184	+ setAlpha: function(value) {
1185	+ this._a = boundAlpha(value);
1186	+ this._roundA = mathRound(100*this._a) / 100;
1187	+ },
1188	+ toHsv: function() {
1189	+ var hsv = rgbToHsv(this._r, this._g, this._b);
1190	+ return { h: hsv.h * 360, s: hsv.s, v: hsv.v, a: this._a };
1191	+ },
1192	+ toHsvString: function() {
1193	+ var hsv = rgbToHsv(this._r, this._g, this._b);
1194	+ var h = mathRound(hsv.h * 360), s = mathRound(hsv.s * 100), v = mathRound(hsv.v * 100);
1195	+ return (this._a == 1) ?
1196	+ "hsv(" + h + ", " + s + "%, " + v + "%)" :
1197	+ "hsva(" + h + ", " + s + "%, " + v + "%, "+ this._roundA + ")";
1198	+ },
1199	+ toHsl: function() {
1200	+ var hsl = rgbToHsl(this._r, this._g, this._b);
1201	+ return { h: hsl.h * 360, s: hsl.s, l: hsl.l, a: this._a };
1202	+ },
1203	+ toHslString: function() {
1204	+ var hsl = rgbToHsl(this._r, this._g, this._b);
1205	+ var h = mathRound(hsl.h * 360), s = mathRound(hsl.s * 100), l = mathRound(hsl.l * 100);
1206	+ return (this._a == 1) ?
1207	+ "hsl(" + h + ", " + s + "%, " + l + "%)" :
1208	+ "hsla(" + h + ", " + s + "%, " + l + "%, "+ this._roundA + ")";
1209	+ },
1210	+ toHex: function(allow3Char) {
1211	+ return rgbToHex(this._r, this._g, this._b, allow3Char);
1212	+ },
1213	+ toHexString: function(allow3Char) {
1214	+ return '#' + this.toHex(allow3Char);
1215	+ },
1216	+ toHex8: function() {
1217	+ return rgbaToHex(this._r, this._g, this._b, this._a);
1218	+ },
1219	+ toHex8String: function() {
1220	+ return '#' + this.toHex8();
1221	+ },
1222	+ toRgb: function() {
1223	+ return { r: mathRound(this._r), g: mathRound(this._g), b: mathRound(this._b), a: this._a };
1224	+ },
1225	+ toRgbString: function() {
1226	+ return (this._a == 1) ?
1227	+ "rgb(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ")" :
1228	+ "rgba(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ", " + this._roundA + ")";
1229	+ },
1230	+ toPercentageRgb: function() {
1231	+ return { r: mathRound(bound01(this._r, 255) * 100) + "%", g: mathRound(bound01(this._g, 255) * 100) + "%", b: mathRound(bound01(this._b, 255) * 100) + "%", a: this._a };
1232	+ },
1233	+ toPercentageRgbString: function() {
1234	+ return (this._a == 1) ?
1235	+ "rgb(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%)" :
1236	+ "rgba(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%, " + this._roundA + ")";
1237	+ },
1238	+ toName: function() {
1239	+ if (this._a === 0) {
1240	+ return "transparent";
1241	+ }
1242	+
1243	+ if (this._a < 1) {
1244	+ return false;
1245	+ }
1246	+
1247	+ return hexNames[rgbToHex(this._r, this._g, this._b, true)] \|\| false;
1248	+ },
1249	+ toFilter: function(secondColor) {
1250	+ var hex8String = '#' + rgbaToHex(this._r, this._g, this._b, this._a);
1251	+ var secondHex8String = hex8String;
1252	+ var gradientType = this._gradientType ? "GradientType = 1, " : "";
1253	+
1254	+ if (secondColor) {
1255	+ var s = tinycolor(secondColor);
1256	+ secondHex8String = s.toHex8String();
1257	+ }
1258	+
1259	+ return "progid:DXImageTransform.Microsoft.gradient("+gradientType+"startColorstr="+hex8String+",endColorstr="+secondHex8String+")";
1260	+ },
1261	+ toString: function(format) {
1262	+ var formatSet = !!format;
1263	+ format = format \|\| this._format;
1264	+
1265	+ var formattedString = false;
1266	+ var hasAlpha = this._a < 1 && this._a >= 0;
1267	+ var needsAlphaFormat = !formatSet && hasAlpha && (format === "hex" \|\| format === "hex6" \|\| format === "hex3" \|\| format === "name");
1268	+
1269	+ if (needsAlphaFormat) {
1270	+ // Special case for "transparent", all other non-alpha formats
1271	+ // will return rgba when there is transparency.
1272	+ if (format === "name" && this._a === 0) {
1273	+ return this.toName();
1274	+ }
1275	+ return this.toRgbString();
1276	+ }
1277	+ if (format === "rgb") {
1278	+ formattedString = this.toRgbString();
1279	+ }
1280	+ if (format === "prgb") {
1281	+ formattedString = this.toPercentageRgbString();
1282	+ }
1283	+ if (format === "hex" \|\| format === "hex6") {
1284	+ formattedString = this.toHexString();
1285	+ }
1286	+ if (format === "hex3") {
1287	+ formattedString = this.toHexString(true);
1288	+ }
1289	+ if (format === "hex8") {
1290	+ formattedString = this.toHex8String();
1291	+ }
1292	+ if (format === "name") {
1293	+ formattedString = this.toName();
1294	+ }
1295	+ if (format === "hsl") {
1296	+ formattedString = this.toHslString();
1297	+ }
1298	+ if (format === "hsv") {
1299	+ formattedString = this.toHsvString();
1300	+ }
1301	+
1302	+ return formattedString \|\| this.toHexString();
1303	+ }
1304	+ };
1305	+
1306	+ // If input is an object, force 1 into "1.0" to handle ratios properly
1307	+ // String input requires "1.0" as input, so 1 will be treated as 1
1308	+ tinycolor.fromRatio = function(color, opts) {
1309	+ if (typeof color == "object") {
1310	+ var newColor = {};
1311	+ for (var i in color) {
1312	+ if (color.hasOwnProperty(i)) {
1313	+ if (i === "a") {
1314	+ newColor[i] = color[i];
1315	+ }
1316	+ else {
1317	+ newColor[i] = convertToPercentage(color[i]);
1318	+ }
1319	+ }
1320	+ }
1321	+ color = newColor;
1322	+ }
1323	+
1324	+ return tinycolor(color, opts);
1325	+ };
1326	+
1327	+ // Given a string or object, convert that input to RGB
1328	+ // Possible string inputs:
1329	+ //
1330	+ // "red"
1331	+ // "#f00" or "f00"
1332	+ // "#ff0000" or "ff0000"
1333	+ // "#ff000000" or "ff000000"
1334	+ // "rgb 255 0 0" or "rgb (255, 0, 0)"
1335	+ // "rgb 1.0 0 0" or "rgb (1, 0, 0)"
1336	+ // "rgba (255, 0, 0, 1)" or "rgba 255, 0, 0, 1"
1337	+ // "rgba (1.0, 0, 0, 1)" or "rgba 1.0, 0, 0, 1"
1338	+ // "hsl(0, 100%, 50%)" or "hsl 0 100% 50%"
1339	+ // "hsla(0, 100%, 50%, 1)" or "hsla 0 100% 50%, 1"
1340	+ // "hsv(0, 100%, 100%)" or "hsv 0 100% 100%"
1341	+ //
1342	+ function inputToRGB(color) {
1343	+
1344	+ var rgb = { r: 0, g: 0, b: 0 };
1345	+ var a = 1;
1346	+ var ok = false;
1347	+ var format = false;
1348	+
1349	+ if (typeof color == "string") {
1350	+ color = stringInputToObject(color);
1351	+ }
1352	+
1353	+ if (typeof color == "object") {
1354	+ if (color.hasOwnProperty("r") && color.hasOwnProperty("g") && color.hasOwnProperty("b")) {
1355	+ rgb = rgbToRgb(color.r, color.g, color.b);
1356	+ ok = true;
1357	+ format = String(color.r).substr(-1) === "%" ? "prgb" : "rgb";
1358	+ }
1359	+ else if (color.hasOwnProperty("h") && color.hasOwnProperty("s") && color.hasOwnProperty("v")) {
1360	+ color.s = convertToPercentage(color.s);
1361	+ color.v = convertToPercentage(color.v);
1362	+ rgb = hsvToRgb(color.h, color.s, color.v);
1363	+ ok = true;
1364	+ format = "hsv";
1365	+ }
1366	+ else if (color.hasOwnProperty("h") && color.hasOwnProperty("s") && color.hasOwnProperty("l")) {
1367	+ color.s = convertToPercentage(color.s);
1368	+ color.l = convertToPercentage(color.l);
1369	+ rgb = hslToRgb(color.h, color.s, color.l);
1370	+ ok = true;
1371	+ format = "hsl";
1372	+ }
1373	+
1374	+ if (color.hasOwnProperty("a")) {
1375	+ a = color.a;
1376	+ }
1377	+ }
1378	+
1379	+ a = boundAlpha(a);
1380	+
1381	+ return {
1382	+ ok: ok,
1383	+ format: color.format \|\| format,
1384	+ r: mathMin(255, mathMax(rgb.r, 0)),
1385	+ g: mathMin(255, mathMax(rgb.g, 0)),
1386	+ b: mathMin(255, mathMax(rgb.b, 0)),
1387	+ a: a
1388	+ };
1389	+ }
1390	+
1391	+
1392	+ // Conversion Functions
1393	+ // --------------------
1394	+
1395	+ // `rgbToHsl`, `rgbToHsv`, `hslToRgb`, `hsvToRgb` modified from:
1396	+ // <http://mjijackson.com/2008/02/rgb-to-hsl-and-rgb-to-hsv-color-model-conversion-algorithms-in-javascript>
1397	+
1398	+ // `rgbToRgb`
1399	+ // Handle bounds / percentage checking to conform to CSS color spec
1400	+ // <http://www.w3.org/TR/css3-color/>
1401	+ // Assumes: r, g, b in [0, 255] or [0, 1]
1402	+ // Returns: { r, g, b } in [0, 255]
1403	+ function rgbToRgb(r, g, b){
1404	+ return {
1405	+ r: bound01(r, 255) * 255,
1406	+ g: bound01(g, 255) * 255,
1407	+ b: bound01(b, 255) * 255
1408	+ };
1409	+ }
1410	+
1411	+ // `rgbToHsl`
1412	+ // Converts an RGB color value to HSL.
1413	+ // Assumes: r, g, and b are contained in [0, 255] or [0, 1]
1414	+ // Returns: { h, s, l } in [0,1]
1415	+ function rgbToHsl(r, g, b) {
1416	+
1417	+ r = bound01(r, 255);
1418	+ g = bound01(g, 255);
1419	+ b = bound01(b, 255);
1420	+
1421	+ var max = mathMax(r, g, b), min = mathMin(r, g, b);
1422	+ var h, s, l = (max + min) / 2;
1423	+
1424	+ if(max == min) {
1425	+ h = s = 0; // achromatic
1426	+ }
1427	+ else {
1428	+ var d = max - min;
1429	+ s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
1430	+ switch(max) {
1431	+ case r: h = (g - b) / d + (g < b ? 6 : 0); break;
1432	+ case g: h = (b - r) / d + 2; break;
1433	+ case b: h = (r - g) / d + 4; break;
1434	+ }
1435	+
1436	+ h /= 6;
1437	+ }
1438	+
1439	+ return { h: h, s: s, l: l };
1440	+ }
1441	+
1442	+ // `hslToRgb`
1443	+ // Converts an HSL color value to RGB.
1444	+ // Assumes: h is contained in [0, 1] or [0, 360] and s and l are contained [0, 1] or [0, 100]
1445	+ // Returns: { r, g, b } in the set [0, 255]
1446	+ function hslToRgb(h, s, l) {
1447	+ var r, g, b;
1448	+
1449	+ h = bound01(h, 360);
1450	+ s = bound01(s, 100);
1451	+ l = bound01(l, 100);
1452	+
1453	+ function hue2rgb(p, q, t) {
1454	+ if(t < 0) t += 1;
1455	+ if(t > 1) t -= 1;
1456	+ if(t < 1/6) return p + (q - p) * 6 * t;
1457	+ if(t < 1/2) return q;
1458	+ if(t < 2/3) return p + (q - p) * (2/3 - t) * 6;
1459	+ return p;
1460	+ }
1461	+
1462	+ if(s === 0) {
1463	+ r = g = b = l; // achromatic
1464	+ }
1465	+ else {
1466	+ var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
1467	+ var p = 2 * l - q;
1468	+ r = hue2rgb(p, q, h + 1/3);
1469	+ g = hue2rgb(p, q, h);
1470	+ b = hue2rgb(p, q, h - 1/3);
1471	+ }
1472	+
1473	+ return { r: r * 255, g: g * 255, b: b * 255 };
1474	+ }
1475	+
1476	+ // `rgbToHsv`
1477	+ // Converts an RGB color value to HSV
1478	+ // Assumes: r, g, and b are contained in the set [0, 255] or [0, 1]
1479	+ // Returns: { h, s, v } in [0,1]
1480	+ function rgbToHsv(r, g, b) {
1481	+
1482	+ r = bound01(r, 255);
1483	+ g = bound01(g, 255);
1484	+ b = bound01(b, 255);
1485	+
1486	+ var max = mathMax(r, g, b), min = mathMin(r, g, b);
1487	+ var h, s, v = max;
1488	+
1489	+ var d = max - min;
1490	+ s = max === 0 ? 0 : d / max;
1491	+
1492	+ if(max == min) {
1493	+ h = 0; // achromatic
1494	+ }
1495	+ else {
1496	+ switch(max) {
1497	+ case r: h = (g - b) / d + (g < b ? 6 : 0); break;
1498	+ case g: h = (b - r) / d + 2; break;
1499	+ case b: h = (r - g) / d + 4; break;
1500	+ }
1501	+ h /= 6;
1502	+ }
1503	+ return { h: h, s: s, v: v };
1504	+ }
1505	+
1506	+ // `hsvToRgb`
1507	+ // Converts an HSV color value to RGB.
1508	+ // Assumes: h is contained in [0, 1] or [0, 360] and s and v are contained in [0, 1] or [0, 100]
1509	+ // Returns: { r, g, b } in the set [0, 255]
1510	+ function hsvToRgb(h, s, v) {
1511	+
1512	+ h = bound01(h, 360) * 6;
1513	+ s = bound01(s, 100);
1514	+ v = bound01(v, 100);
1515	+
1516	+ var i = math.floor(h),
1517	+ f = h - i,
1518	+ p = v * (1 - s),
1519	+ q = v * (1 - f * s),
1520	+ t = v * (1 - (1 - f) * s),
1521	+ mod = i % 6,
1522	+ r = [v, q, p, p, t, v][mod],
1523	+ g = [t, v, v, q, p, p][mod],
1524	+ b = [p, p, t, v, v, q][mod];
1525	+
1526	+ return { r: r * 255, g: g * 255, b: b * 255 };
1527	+ }
1528	+
1529	+ // `rgbToHex`
1530	+ // Converts an RGB color to hex
1531	+ // Assumes r, g, and b are contained in the set [0, 255]
1532	+ // Returns a 3 or 6 character hex
1533	+ function rgbToHex(r, g, b, allow3Char) {
1534	+
1535	+ var hex = [
1536	+ pad2(mathRound(r).toString(16)),
1537	+ pad2(mathRound(g).toString(16)),
1538	+ pad2(mathRound(b).toString(16))
1539	+ ];
1540	+
1541	+ // Return a 3 character hex if possible
1542	+ if (allow3Char && hex[0].charAt(0) == hex[0].charAt(1) && hex[1].charAt(0) == hex[1].charAt(1) && hex[2].charAt(0) == hex[2].charAt(1)) {
1543	+ return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0);
1544	+ }
1545	+
1546	+ return hex.join("");
1547	+ }
1548	+ // `rgbaToHex`
1549	+ // Converts an RGBA color plus alpha transparency to hex
1550	+ // Assumes r, g, b and a are contained in the set [0, 255]
1551	+ // Returns an 8 character hex
1552	+ function rgbaToHex(r, g, b, a) {
1553	+
1554	+ var hex = [
1555	+ pad2(convertDecimalToHex(a)),
1556	+ pad2(mathRound(r).toString(16)),
1557	+ pad2(mathRound(g).toString(16)),
1558	+ pad2(mathRound(b).toString(16))
1559	+ ];
1560	+
1561	+ return hex.join("");
1562	+ }
1563	+
1564	+ // `equals`
1565	+ // Can be called with any tinycolor input
1566	+ tinycolor.equals = function (color1, color2) {
1567	+ if (!color1 \|\| !color2) { return false; }
1568	+ return tinycolor(color1).toRgbString() == tinycolor(color2).toRgbString();
1569	+ };
1570	+ tinycolor.random = function() {
1571	+ return tinycolor.fromRatio({
1572	+ r: mathRandom(),
1573	+ g: mathRandom(),
1574	+ b: mathRandom()
1575	+ });
1576	+ };
1577	+
1578	+
1579	+ // Modification Functions
1580	+ // ----------------------
1581	+ // Thanks to less.js for some of the basics here
1582	+ // <https://github.com/cloudhead/less.js/blob/master/lib/less/functions.js>
1583	+
1584	+ tinycolor.desaturate = function (color, amount) {
1585	+ amount = (amount === 0) ? 0 : (amount \|\| 10);
1586	+ var hsl = tinycolor(color).toHsl();
1587	+ hsl.s -= amount / 100;
1588	+ hsl.s = clamp01(hsl.s);
1589	+ return tinycolor(hsl);
1590	+ };
1591	+ tinycolor.saturate = function (color, amount) {
1592	+ amount = (amount === 0) ? 0 : (amount \|\| 10);
1593	+ var hsl = tinycolor(color).toHsl();
1594	+ hsl.s += amount / 100;
1595	+ hsl.s = clamp01(hsl.s);
1596	+ return tinycolor(hsl);
1597	+ };
1598	+ tinycolor.greyscale = function(color) {
1599	+ return tinycolor.desaturate(color, 100);
1600	+ };
1601	+ tinycolor.lighten = function(color, amount) {
1602	+ amount = (amount === 0) ? 0 : (amount \|\| 10);
1603	+ var hsl = tinycolor(color).toHsl();
1604	+ hsl.l += amount / 100;
1605	+ hsl.l = clamp01(hsl.l);
1606	+ return tinycolor(hsl);
1607	+ };
1608	+ tinycolor.brighten = function(color, amount) {
1609	+ amount = (amount === 0) ? 0 : (amount \|\| 10);
1610	+ var rgb = tinycolor(color).toRgb();
1611	+ rgb.r = mathMax(0, mathMin(255, rgb.r - mathRound(255 * - (amount / 100))));
1612	+ rgb.g = mathMax(0, mathMin(255, rgb.g - mathRound(255 * - (amount / 100))));
1613	+ rgb.b = mathMax(0, mathMin(255, rgb.b - mathRound(255 * - (amount / 100))));
1614	+ return tinycolor(rgb);
1615	+ };
1616	+ tinycolor.darken = function (color, amount) {
1617	+ amount = (amount === 0) ? 0 : (amount \|\| 10);
1618	+ var hsl = tinycolor(color).toHsl();
1619	+ hsl.l -= amount / 100;
1620	+ hsl.l = clamp01(hsl.l);
1621	+ return tinycolor(hsl);
1622	+ };
1623	+ tinycolor.complement = function(color) {
1624	+ var hsl = tinycolor(color).toHsl();
1625	+ hsl.h = (hsl.h + 180) % 360;
1626	+ return tinycolor(hsl);
1627	+ };
1628	+
1629	+
1630	+ // Combination Functions
1631	+ // ---------------------
1632	+ // Thanks to jQuery xColor for some of the ideas behind these
1633	+ // <https://github.com/infusion/jQuery-xcolor/blob/master/jquery.xcolor.js>
1634	+
1635	+ tinycolor.triad = function(color) {
1636	+ var hsl = tinycolor(color).toHsl();
1637	+ var h = hsl.h;
1638	+ return [
1639	+ tinycolor(color),
1640	+ tinycolor({ h: (h + 120) % 360, s: hsl.s, l: hsl.l }),
1641	+ tinycolor({ h: (h + 240) % 360, s: hsl.s, l: hsl.l })
1642	+ ];
1643	+ };
1644	+ tinycolor.tetrad = function(color) {
1645	+ var hsl = tinycolor(color).toHsl();
1646	+ var h = hsl.h;
1647	+ return [
1648	+ tinycolor(color),
1649	+ tinycolor({ h: (h + 90) % 360, s: hsl.s, l: hsl.l }),
1650	+ tinycolor({ h: (h + 180) % 360, s: hsl.s, l: hsl.l }),
1651	+ tinycolor({ h: (h + 270) % 360, s: hsl.s, l: hsl.l })
1652	+ ];
1653	+ };
1654	+ tinycolor.splitcomplement = function(color) {
1655	+ var hsl = tinycolor(color).toHsl();
1656	+ var h = hsl.h;
1657	+ return [
1658	+ tinycolor(color),
1659	+ tinycolor({ h: (h + 72) % 360, s: hsl.s, l: hsl.l}),
1660	+ tinycolor({ h: (h + 216) % 360, s: hsl.s, l: hsl.l})
1661	+ ];
1662	+ };
1663	+ tinycolor.analogous = function(color, results, slices) {
1664	+ results = results \|\| 6;
1665	+ slices = slices \|\| 30;
1666	+
1667	+ var hsl = tinycolor(color).toHsl();
1668	+ var part = 360 / slices;
1669	+ var ret = [tinycolor(color)];
1670	+
1671	+ for (hsl.h = ((hsl.h - (part * results >> 1)) + 720) % 360; --results; ) {
1672	+ hsl.h = (hsl.h + part) % 360;
1673	+ ret.push(tinycolor(hsl));
1674	+ }
1675	+ return ret;
1676	+ };
1677	+ tinycolor.monochromatic = function(color, results) {
1678	+ results = results \|\| 6;
1679	+ var hsv = tinycolor(color).toHsv();
1680	+ var h = hsv.h, s = hsv.s, v = hsv.v;
1681	+ var ret = [];
1682	+ var modification = 1 / results;
1683	+
1684	+ while (results--) {
1685	+ ret.push(tinycolor({ h: h, s: s, v: v}));
1686	+ v = (v + modification) % 1;
1687	+ }
1688	+
1689	+ return ret;
1690	+ };
1691	+
1692	+
1693	+ // Readability Functions
1694	+ // ---------------------
1695	+ // <http://www.w3.org/TR/AERT#color-contrast>
1696	+
1697	+ // `readability`
1698	+ // Analyze the 2 colors and returns an object with the following properties:
1699	+ // `brightness`: difference in brightness between the two colors
1700	+ // `color`: difference in color/hue between the two colors
1701	+ tinycolor.readability = function(color1, color2) {
1702	+ var a = tinycolor(color1).toRgb();
1703	+ var b = tinycolor(color2).toRgb();
1704	+ var brightnessA = (a.r * 299 + a.g * 587 + a.b * 114) / 1000;
1705	+ var brightnessB = (b.r * 299 + b.g * 587 + b.b * 114) / 1000;
1706	+ var colorDiff = (
1707	+ Math.max(a.r, b.r) - Math.min(a.r, b.r) +
1708	+ Math.max(a.g, b.g) - Math.min(a.g, b.g) +
1709	+ Math.max(a.b, b.b) - Math.min(a.b, b.b)
1710	+ );
1711	+
1712	+ return {
1713	+ brightness: Math.abs(brightnessA - brightnessB),
1714	+ color: colorDiff
1715	+ };
1716	+ };
1717	+
1718	+ // `readable`
1719	+ // http://www.w3.org/TR/AERT#color-contrast
1720	+ // Ensure that foreground and background color combinations provide sufficient contrast.
1721	+ // Example
1722	+ // tinycolor.readable("#000", "#111") => false
1723	+ tinycolor.readable = function(color1, color2) {
1724	+ var readability = tinycolor.readability(color1, color2);
1725	+ return readability.brightness > 125 && readability.color > 500;
1726	+ };
1727	+
1728	+ // `mostReadable`
1729	+ // Given a base color and a list of possible foreground or background
1730	+ // colors for that base, returns the most readable color.
1731	+ // Example
1732	+ // tinycolor.mostReadable("#123", ["#fff", "#000"]) => "#000"
1733	+ tinycolor.mostReadable = function(baseColor, colorList) {
1734	+ var bestColor = null;
1735	+ var bestScore = 0;
1736	+ var bestIsReadable = false;
1737	+ for (var i=0; i < colorList.length; i++) {
1738	+
1739	+ // We normalize both around the "acceptable" breaking point,
1740	+ // but rank brightness constrast higher than hue.
1741	+
1742	+ var readability = tinycolor.readability(baseColor, colorList[i]);
1743	+ var readable = readability.brightness > 125 && readability.color > 500;
1744	+ var score = 3 * (readability.brightness / 125) + (readability.color / 500);
1745	+
1746	+ if ((readable && ! bestIsReadable) \|\|
1747	+ (readable && bestIsReadable && score > bestScore) \|\|
1748	+ ((! readable) && (! bestIsReadable) && score > bestScore)) {
1749	+ bestIsReadable = readable;
1750	+ bestScore = score;
1751	+ bestColor = tinycolor(colorList[i]);
1752	+ }
1753	+ }
1754	+ return bestColor;
1755	+ };
1756	+
1757	+
1758	+ // Big List of Colors
1759	+ // ------------------
1760	+ // <http://www.w3.org/TR/css3-color/#svg-color>
1761	+ var names = tinycolor.names = {
1762	+ aliceblue: "f0f8ff",
1763	+ antiquewhite: "faebd7",
1764	+ aqua: "0ff",
1765	+ aquamarine: "7fffd4",
1766	+ azure: "f0ffff",
1767	+ beige: "f5f5dc",
1768	+ bisque: "ffe4c4",
1769	+ black: "000",
1770	+ blanchedalmond: "ffebcd",
1771	+ blue: "00f",
1772	+ blueviolet: "8a2be2",
1773	+ brown: "a52a2a",
1774	+ burlywood: "deb887",
1775	+ burntsienna: "ea7e5d",
1776	+ cadetblue: "5f9ea0",
1777	+ chartreuse: "7fff00",
1778	+ chocolate: "d2691e",
1779	+ coral: "ff7f50",
1780	+ cornflowerblue: "6495ed",
1781	+ cornsilk: "fff8dc",
1782	+ crimson: "dc143c",
1783	+ cyan: "0ff",
1784	+ darkblue: "00008b",
1785	+ darkcyan: "008b8b",
1786	+ darkgoldenrod: "b8860b",
1787	+ darkgray: "a9a9a9",
1788	+ darkgreen: "006400",
1789	+ darkgrey: "a9a9a9",
1790	+ darkkhaki: "bdb76b",
1791	+ darkmagenta: "8b008b",
1792	+ darkolivegreen: "556b2f",
1793	+ darkorange: "ff8c00",
1794	+ darkorchid: "9932cc",
1795	+ darkred: "8b0000",
1796	+ darksalmon: "e9967a",
1797	+ darkseagreen: "8fbc8f",
1798	+ darkslateblue: "483d8b",
1799	+ darkslategray: "2f4f4f",
1800	+ darkslategrey: "2f4f4f",
1801	+ darkturquoise: "00ced1",
1802	+ darkviolet: "9400d3",
1803	+ deeppink: "ff1493",
1804	+ deepskyblue: "00bfff",
1805	+ dimgray: "696969",
1806	+ dimgrey: "696969",
1807	+ dodgerblue: "1e90ff",
1808	+ firebrick: "b22222",
1809	+ floralwhite: "fffaf0",
1810	+ forestgreen: "228b22",
1811	+ fuchsia: "f0f",
1812	+ gainsboro: "dcdcdc",
1813	+ ghostwhite: "f8f8ff",
1814	+ gold: "ffd700",
1815	+ goldenrod: "daa520",
1816	+ gray: "808080",
1817	+ green: "008000",
1818	+ greenyellow: "adff2f",
1819	+ grey: "808080",
1820	+ honeydew: "f0fff0",
1821	+ hotpink: "ff69b4",
1822	+ indianred: "cd5c5c",
1823	+ indigo: "4b0082",
1824	+ ivory: "fffff0",
1825	+ khaki: "f0e68c",
1826	+ lavender: "e6e6fa",
1827	+ lavenderblush: "fff0f5",
1828	+ lawngreen: "7cfc00",
1829	+ lemonchiffon: "fffacd",
1830	+ lightblue: "add8e6",
1831	+ lightcoral: "f08080",
1832	+ lightcyan: "e0ffff",
1833	+ lightgoldenrodyellow: "fafad2",
1834	+ lightgray: "d3d3d3",
1835	+ lightgreen: "90ee90",
1836	+ lightgrey: "d3d3d3",
1837	+ lightpink: "ffb6c1",
1838	+ lightsalmon: "ffa07a",
1839	+ lightseagreen: "20b2aa",
1840	+ lightskyblue: "87cefa",
1841	+ lightslategray: "789",
1842	+ lightslategrey: "789",
1843	+ lightsteelblue: "b0c4de",
1844	+ lightyellow: "ffffe0",
1845	+ lime: "0f0",
1846	+ limegreen: "32cd32",
1847	+ linen: "faf0e6",
1848	+ magenta: "f0f",
1849	+ maroon: "800000",
1850	+ mediumaquamarine: "66cdaa",
1851	+ mediumblue: "0000cd",
1852	+ mediumorchid: "ba55d3",
1853	+ mediumpurple: "9370db",
1854	+ mediumseagreen: "3cb371",
1855	+ mediumslateblue: "7b68ee",
1856	+ mediumspringgreen: "00fa9a",
1857	+ mediumturquoise: "48d1cc",
1858	+ mediumvioletred: "c71585",
1859	+ midnightblue: "191970",
1860	+ mintcream: "f5fffa",
1861	+ mistyrose: "ffe4e1",
1862	+ moccasin: "ffe4b5",
1863	+ navajowhite: "ffdead",
1864	+ navy: "000080",
1865	+ oldlace: "fdf5e6",
1866	+ olive: "808000",
1867	+ olivedrab: "6b8e23",
1868	+ orange: "ffa500",
1869	+ orangered: "ff4500",
1870	+ orchid: "da70d6",
1871	+ palegoldenrod: "eee8aa",
1872	+ palegreen: "98fb98",
1873	+ paleturquoise: "afeeee",
1874	+ palevioletred: "db7093",
1875	+ papayawhip: "ffefd5",
1876	+ peachpuff: "ffdab9",
1877	+ peru: "cd853f",
1878	+ pink: "ffc0cb",
1879	+ plum: "dda0dd",
1880	+ powderblue: "b0e0e6",
1881	+ purple: "800080",
1882	+ red: "f00",
1883	+ rosybrown: "bc8f8f",
1884	+ royalblue: "4169e1",
1885	+ saddlebrown: "8b4513",
1886	+ salmon: "fa8072",
1887	+ sandybrown: "f4a460",
1888	+ seagreen: "2e8b57",
1889	+ seashell: "fff5ee",
1890	+ sienna: "a0522d",
1891	+ silver: "c0c0c0",
1892	+ skyblue: "87ceeb",
1893	+ slateblue: "6a5acd",
1894	+ slategray: "708090",
1895	+ slategrey: "708090",
1896	+ snow: "fffafa",
1897	+ springgreen: "00ff7f",
1898	+ steelblue: "4682b4",
1899	+ tan: "d2b48c",
1900	+ teal: "008080",
1901	+ thistle: "d8bfd8",
1902	+ tomato: "ff6347",
1903	+ turquoise: "40e0d0",
1904	+ violet: "ee82ee",
1905	+ wheat: "f5deb3",
1906	+ white: "fff",
1907	+ whitesmoke: "f5f5f5",
1908	+ yellow: "ff0",
1909	+ yellowgreen: "9acd32"
1910	+ };
1911	+
1912	+ // Make it easy to access colors via `hexNames[hex]`
1913	+ var hexNames = tinycolor.hexNames = flip(names);
1914	+
1915	+
1916	+ // Utilities
1917	+ // ---------
1918	+
1919	+ // `{ 'name1': 'val1' }` becomes `{ 'val1': 'name1' }`
1920	+ function flip(o) {
1921	+ var flipped = { };
1922	+ for (var i in o) {
1923	+ if (o.hasOwnProperty(i)) {
1924	+ flipped[o[i]] = i;
1925	+ }
1926	+ }
1927	+ return flipped;
1928	+ }
1929	+
1930	+ // Return a valid alpha value [0,1] with all invalid values being set to 1
1931	+ function boundAlpha(a) {
1932	+ a = parseFloat(a);
1933	+
1934	+ if (isNaN(a) \|\| a < 0 \|\| a > 1) {
1935	+ a = 1;
1936	+ }
1937	+
1938	+ return a;
1939	+ }
1940	+
1941	+ // Take input from [0, n] and return it as [0, 1]
1942	+ function bound01(n, max) {
1943	+ if (isOnePointZero(n)) { n = "100%"; }
1944	+
1945	+ var processPercent = isPercentage(n);
1946	+ n = mathMin(max, mathMax(0, parseFloat(n)));
1947	+
1948	+ // Automatically convert percentage into number
1949	+ if (processPercent) {
1950	+ n = parseInt(n * max, 10) / 100;
1951	+ }
1952	+
1953	+ // Handle floating point rounding errors
1954	+ if ((math.abs(n - max) < 0.000001)) {
1955	+ return 1;
1956	+ }
1957	+
1958	+ // Convert into [0, 1] range if it isn't already
1959	+ return (n % max) / parseFloat(max);
1960	+ }
1961	+
1962	+ // Force a number between 0 and 1
1963	+ function clamp01(val) {
1964	+ return mathMin(1, mathMax(0, val));
1965	+ }
1966	+
1967	+ // Parse a base-16 hex value into a base-10 integer
1968	+ function parseIntFromHex(val) {
1969	+ return parseInt(val, 16);
1970	+ }
1971	+
1972	+ // Need to handle 1.0 as 100%, since once it is a number, there is no difference between it and 1
1973	+ // <http://stackoverflow.com/questions/7422072/javascript-how-to-detect-number-as-a-decimal-including-1-0>
1974	+ function isOnePointZero(n) {
1975	+ return typeof n == "string" && n.indexOf('.') != -1 && parseFloat(n) === 1;
1976	+ }
1977	+
1978	+ // Check to see if string passed in is a percentage
1979	+ function isPercentage(n) {
1980	+ return typeof n === "string" && n.indexOf('%') != -1;
1981	+ }
1982	+
1983	+ // Force a hex value to have 2 characters
1984	+ function pad2(c) {
1985	+ return c.length == 1 ? '0' + c : '' + c;
1986	+ }
1987	+
1988	+ // Replace a decimal with it's percentage value
1989	+ function convertToPercentage(n) {
1990	+ if (n <= 1) {
1991	+ n = (n * 100) + "%";
1992	+ }
1993	+
1994	+ return n;
1995	+ }
1996	+
1997	+ // Converts a decimal to a hex value
1998	+ function convertDecimalToHex(d) {
1999	+ return Math.round(parseFloat(d) * 255).toString(16);
2000	+ }
2001	+ // Converts a hex value to a decimal
2002	+ function convertHexToDecimal(h) {
2003	+ return (parseIntFromHex(h) / 255);
2004	+ }
2005	+
2006	+ var matchers = (function() {
2007	+
2008	+ // <http://www.w3.org/TR/css3-values/#integers>
2009	+ var CSS_INTEGER = "[-\\+]?\\d+%?";
2010	+
2011	+ // <http://www.w3.org/TR/css3-values/#number-value>
2012	+ var CSS_NUMBER = "[-\\+]?\\d*\\.\\d+%?";
2013	+
2014	+ // Allow positive/negative integer/number. Don't capture the either/or, just the entire outcome.
2015	+ var CSS_UNIT = "(?:" + CSS_NUMBER + ")\|(?:" + CSS_INTEGER + ")";
2016	+
2017	+ // Actual matching.
2018	+ // Parentheses and commas are optional, but not required.
2019	+ // Whitespace can take the place of commas or opening paren
2020	+ var PERMISSIVE_MATCH3 = "[\\s\|\$]+(" + CSS_UNIT + ")[,\|\\s]+(" + CSS_UNIT + ")[,\|\\s]+(" + CSS_UNIT + ")\\s*\$?";
2021	+ var PERMISSIVE_MATCH4 = "[\\s\|\$]+(" + CSS_UNIT + ")[,\|\\s]+(" + CSS_UNIT + ")[,\|\\s]+(" + CSS_UNIT + ")[,\|\\s]+(" + CSS_UNIT + ")\\s*\$?";
2022	+
2023	+ return {
2024	+ rgb: new RegExp("rgb" + PERMISSIVE_MATCH3),
2025	+ rgba: new RegExp("rgba" + PERMISSIVE_MATCH4),
2026	+ hsl: new RegExp("hsl" + PERMISSIVE_MATCH3),
2027	+ hsla: new RegExp("hsla" + PERMISSIVE_MATCH4),
2028	+ hsv: new RegExp("hsv" + PERMISSIVE_MATCH3),
2029	+ hex3: /^([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
2030	+ hex6: /^([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/,
2031	+ hex8: /^([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/
2032	+ };
2033	+ })();
2034	+
2035	+ // `stringInputToObject`
2036	+ // Permissive string parsing. Take in a number of formats, and output an object
2037	+ // based on detected format. Returns `{ r, g, b }` or `{ h, s, l }` or `{ h, s, v}`
2038	+ function stringInputToObject(color) {
2039	+
2040	+ color = color.replace(trimLeft,'').replace(trimRight, '').toLowerCase();
2041	+ var named = false;
2042	+ if (names[color]) {
2043	+ color = names[color];
2044	+ named = true;
2045	+ }
2046	+ else if (color == 'transparent') {
2047	+ return { r: 0, g: 0, b: 0, a: 0, format: "name" };
2048	+ }
2049	+
2050	+ // Try to match string input using regular expressions.
2051	+ // Keep most of the number bounding out of this function - don't worry about [0,1] or [0,100] or [0,360]
2052	+ // Just return an object and let the conversion functions handle that.
2053	+ // This way the result will be the same whether the tinycolor is initialized with string or object.
2054	+ var match;
2055	+ if ((match = matchers.rgb.exec(color))) {
2056	+ return { r: match[1], g: match[2], b: match[3] };
2057	+ }
2058	+ if ((match = matchers.rgba.exec(color))) {
2059	+ return { r: match[1], g: match[2], b: match[3], a: match[4] };
2060	+ }
2061	+ if ((match = matchers.hsl.exec(color))) {
2062	+ return { h: match[1], s: match[2], l: match[3] };
2063	+ }
2064	+ if ((match = matchers.hsla.exec(color))) {
2065	+ return { h: match[1], s: match[2], l: match[3], a: match[4] };
2066	+ }
2067	+ if ((match = matchers.hsv.exec(color))) {
2068	+ return { h: match[1], s: match[2], v: match[3] };
2069	+ }
2070	+ if ((match = matchers.hex8.exec(color))) {
2071	+ return {
2072	+ a: convertHexToDecimal(match[1]),
2073	+ r: parseIntFromHex(match[2]),
2074	+ g: parseIntFromHex(match[3]),
2075	+ b: parseIntFromHex(match[4]),
2076	+ format: named ? "name" : "hex8"
2077	+ };
2078	+ }
2079	+ if ((match = matchers.hex6.exec(color))) {
2080	+ return {
2081	+ r: parseIntFromHex(match[1]),
2082	+ g: parseIntFromHex(match[2]),
2083	+ b: parseIntFromHex(match[3]),
2084	+ format: named ? "name" : "hex"
2085	+ };
2086	+ }
2087	+ if ((match = matchers.hex3.exec(color))) {
2088	+ return {
2089	+ r: parseIntFromHex(match[1] + '' + match[1]),
2090	+ g: parseIntFromHex(match[2] + '' + match[2]),
2091	+ b: parseIntFromHex(match[3] + '' + match[3]),
2092	+ format: named ? "name" : "hex"
2093	+ };
2094	+ }
2095	+
2096	+ return false;
2097	+ }
2098	+
2099	+ window.tinycolor = tinycolor;
2100	+ })();
2101	+
2102	+
2103	+ $(function () {
2104	+ if ($.fn.spectrum.load) {
2105	+ $.fn.spectrum.processNativeColorInputs();
2106	+ }
2107	+ });
2108	+
2109	+ })(window, jQuery);

js/toggledesigner.js ADDED Viewed

	@@ -0,0 +1,153 @@


1	+ /jslint browser: true, white: true /
2	+ /global console,jQuery,megamenu,window,navigator/
3	+
4	+ /**
5	+ * Max Mega Menu jQuery Plugin
6	+ */
7	+ jQuery(function($) {
8	+
9	+ // Make block areas sortable
10	+ $( ".mega-blocks .mega-left" ).sortable({
11	+ forcePlaceholderSize: false,
12	+ items : '.block',
13	+ stop: function() {
14	+ reindex_blocks();
15	+ },
16	+ connectWith: ".mega-blocks .mega-right, .mega-blocks .mega-center"
17	+ });
18	+
19	+ $( ".mega-blocks .mega-right" ).sortable({
20	+ forcePlaceholderSize: false,
21	+ items : '.block',
22	+ stop: function() {
23	+ reindex_blocks();
24	+ },
25	+ connectWith: ".mega-blocks .mega-left, .mega-blocks .mega-center"
26	+ });
27	+
28	+ $( ".mega-blocks .mega-center" ).sortable({
29	+ forcePlaceholderSize: false,
30	+ items : '.block',
31	+ stop: function() {
32	+ reindex_blocks();
33	+ },
34	+ connectWith: ".mega-blocks .mega-left, .mega-blocks .mega-right"
35	+ });
36	+
37	+
38	+ // Reindex blocks based on position
39	+ var reindex_blocks = function() {
40	+ var i = 0;
41	+
42	+ $(".mega-blocks .block").each(function() {
43	+ i++;
44	+
45	+ var block = $(this);
46	+
47	+ block.find('input, select').each(function() {
48	+ // account for inputs created by select2
49	+ if (typeof $(this).attr('name') !== 'undefined') {
50	+ $(this).attr('name', $(this).attr('name').replace(/\[\d+\]/g, "[" + i + "]"));
51	+ }
52	+ });
53	+
54	+ // update the align value based on block position
55	+ block.find('input.align').each(function() {
56	+ if (block.parent().hasClass('mega-right')) {
57	+ $(this).attr('value', 'right');
58	+ } else if (block.parent().hasClass('mega-center')) {
59	+ $(this).attr('value', 'center');
60	+ } else {
61	+ $(this).attr('value', 'left');
62	+ }
63	+ });
64	+ });
65	+ };
66	+
67	+
68	+ // Delete block
69	+ $( ".block-settings a.mega-delete").live('click', function(e) {
70	+ e.preventDefault();
71	+ $(this).parent(".block-settings").parent(".block").remove();
72	+ reindex_blocks();
73	+ });
74	+
75	+
76	+ // Show/hide block settings
77	+ $( ".block-title span").live('click', function() {
78	+ var settings = $(this).parent().parent().find(".block-settings");
79	+ $(".block").removeClass('mega-open');
80	+
81	+ if ( settings.is(":visible") ) {
82	+ settings.parent().removeClass('mega-open');
83	+ settings.hide();
84	+ } else {
85	+ settings.parent().addClass('mega-open');
86	+ $(".block-settings").hide();
87	+ settings.show();
88	+ }
89	+
90	+ });
91	+
92	+
93	+ // Add block to designer
94	+ $( "#toggle-block-selector").on('change', function() {
95	+ var selected_option = $("#toggle-block-selector").find(":selected");
96	+ var val = selected_option.attr('value');
97	+
98	+ if (val == 'title') {
99	+ return;
100	+ }
101	+
102	+ $.ajax({
103	+ type: 'POST',
104	+ url: ajaxurl,
105	+ data: {
106	+ action: "mm_get_toggle_block_" + val,
107	+ _wpnonce: megamenu.nonce
108	+ },
109	+ cache: false,
110	+ success: function(response) {
111	+
112	+ var $response = $(response);
113	+
114	+ // initiate color picker fields
115	+ $(".mm_colorpicker", $response).spectrum({
116	+ preferredFormat: "rgb",
117	+ showInput: true,
118	+ showAlpha: true,
119	+ clickoutFiresChange: true,
120	+ change: function(color) {
121	+ if (color.getAlpha() === 0) {
122	+ $(this).siblings('div.chosen-color').html('transparent');
123	+ } else {
124	+ $(this).siblings('div.chosen-color').html(color.toRgbString());
125	+ }
126	+ }
127	+ });
128	+
129	+ // initiate icon selector dropdowns
130	+ $('.icon_dropdown', $response).select2({
131	+ containerCssClass: 'tpx-select2-container select2-container-sm',
132	+ dropdownCssClass: 'tpx-select2-drop',
133	+ minimumResultsForSearch: -1,
134	+ formatResult: function(icon) {
135	+ return '<i class="dashicons ' + $(icon.element).attr('data-class') + '"></i>';
136	+ },
137	+ formatSelection: function (icon) {
138	+ return '<i class="dashicons ' + $(icon.element).attr('data-class') + '"></i>';
139	+ }
140	+ });
141	+
142	+ // add the block
143	+ $(".mega-blocks .mega-left").append($response);
144	+
145	+ // reinded blocks
146	+ reindex_blocks();
147	+
148	+ // reset the select dropdown
149	+ $("#toggle-block-selector").val("title");
150	+ }
151	+ });
152	+ });
153	+ });

languages/megamenu-de_DE.mo ADDED Viewed

Binary file

languages/megamenu-de_DE.po ADDED Viewed

	@@ -0,0 +1,1122 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: MaxMenu v1.2.2\n"
4	+ "Report-Msgid-Bugs-To: \n"
5	+ "POT-Creation-Date: 2015-03-28 18:52-0000\n"
6	+ "PO-Revision-Date: 2015-03-28 18:53-0000\n"
7	+ "Last-Translator: thomas <t.meyer@me.com>\n"
8	+ "Language-Team: \n"
9	+ "Language: de_DE\n"
10	+ "MIME-Version: 1.0\n"
11	+ "Content-Type: text/plain; charset=UTF-8\n"
12	+ "Content-Transfer-Encoding: 8bit\n"
13	+ "Plural-Forms: nplurals=2; plural=n != 1;\n"
14	+ "X-Generator: Poedit 1.5.7\n"
15	+ "X-Poedit-SourceCharset: utf-8\n"
16	+ "X-Poedit-KeywordsList: __;_e;__ngettext:1,2;_n:1,2;__ngettext_noop:1,2;"
17	+ "_n_noop:1,2;_c,_nc:4c,1,2;_x:1,2c;_ex:1,2c;_nx:4c,1,2;_nx_noop:4c,1,2\n"
18	+ "X-Poedit-Basepath: ../\n"
19	+ "X-Textdomain-Support: yes\n"
20	+ "X-Poedit-SearchPath-0: .\n"
21	+
22	+ # @ megamenu
23	+ #: megamenu.php:456
24	+ #, fuzzy
25	+ msgid ""
26	+ "Max Mega Menu is not compatible with your version of WordPress. Please "
27	+ "upgrade WordPress to the latest version or disable Max Mega Menu."
28	+ msgstr ""
29	+ "Mega Menu ist nicht kompatibel mit dieser WordPress Version. Bitte WordPress "
30	+ "auf die aktuelle Version aktualisieren oder Mega Menu deaktivieren."
31	+
32	+ # @ megamenu
33	+ #: megamenu.php:467
34	+ #, fuzzy
35	+ msgid ""
36	+ "Max Mega Menu is not compatible with Uber Menu. Please disable Uber Menu."
37	+ msgstr ""
38	+ "Mega Menu ist nicht kompatibel mit Über Menu. Bitte Über Menu deaktivieren."
39	+
40	+ #: megamenu.php:480
41	+ msgid "click here"
42	+ msgstr ""
43	+
44	+ #: megamenu.php:483
45	+ #, php-format
46	+ msgid "Thanks for installing Max Mega Menu! Please %s to get started."
47	+ msgstr ""
48	+
49	+ # @ megamenu
50	+ #: classes/menu-item-manager.class.php:171
51	+ #: classes/menu-item-manager.class.php:264 classes/nav-menus.class.php:127
52	+ #, fuzzy
53	+ msgid "Mega Menu"
54	+ msgstr "Mega Menu Panel"
55	+
56	+ #: classes/menu-item-manager.class.php:172
57	+ msgid "Mega Menus can only be created on top level menu items."
58	+ msgstr ""
59	+
60	+ #: classes/menu-item-manager.class.php:183
61	+ msgid "Enable Mega Menu"
62	+ msgstr ""
63	+
64	+ #: classes/menu-item-manager.class.php:186
65	+ msgid "column"
66	+ msgstr ""
67	+
68	+ #: classes/menu-item-manager.class.php:187
69	+ #: classes/menu-item-manager.class.php:188
70	+ #: classes/menu-item-manager.class.php:189
71	+ #: classes/menu-item-manager.class.php:190
72	+ #: classes/menu-item-manager.class.php:191
73	+ #: classes/menu-item-manager.class.php:192
74	+ #: classes/menu-item-manager.class.php:193
75	+ msgid "columns"
76	+ msgstr ""
77	+
78	+ # @ megamenu
79	+ #: classes/menu-item-manager.class.php:197
80	+ #, fuzzy
81	+ msgid "Select a Widget to add to the panel"
82	+ msgstr "Widget für das Mega Panel auswählen"
83	+
84	+ # @ megamenu
85	+ #: classes/menu-item-manager.class.php:213
86	+ #, fuzzy
87	+ msgid "Sub menu items"
88	+ msgstr "Untermenü Typ"
89	+
90	+ #: classes/menu-item-manager.class.php:233
91	+ msgid "Widgets"
92	+ msgstr ""
93	+
94	+ #: classes/menu-item-manager.class.php:258
95	+ msgid ""
96	+ "No widgets found. Add a widget to this area using the Widget Selector (top "
97	+ "right)"
98	+ msgstr ""
99	+
100	+ # @ megamenu
101	+ #: classes/menu-item-manager.class.php:284
102	+ #, fuzzy
103	+ msgid "Menu Item Settings"
104	+ msgstr "Mega Menu Einstellungen"
105	+
106	+ #: classes/menu-item-manager.class.php:288
107	+ msgid "Hide Text"
108	+ msgstr ""
109	+
110	+ #: classes/menu-item-manager.class.php:295
111	+ #: classes/menu-item-manager.class.php:331
112	+ #: classes/menu-item-manager.class.php:356
113	+ msgid "Option only available for top level menu items"
114	+ msgstr ""
115	+
116	+ #: classes/menu-item-manager.class.php:302
117	+ msgid "Hide Arrow"
118	+ msgstr ""
119	+
120	+ # @ megamenu
121	+ #: classes/menu-item-manager.class.php:310
122	+ #, fuzzy
123	+ msgid "Disable Link"
124	+ msgstr "Deaktiviert"
125	+
126	+ #: classes/menu-item-manager.class.php:318
127	+ msgid "Menu Item Align"
128	+ msgstr ""
129	+
130	+ # @ megamenu
131	+ #: classes/menu-item-manager.class.php:324
132	+ #: classes/menu-item-manager.class.php:349 classes/settings.class.php:815
133	+ #: classes/settings.class.php:904 classes/settings.class.php:1086
134	+ #: classes/settings.class.php:1208 classes/settings.class.php:1234
135	+ #: classes/settings.class.php:1286 classes/settings.class.php:1368
136	+ #: classes/settings.class.php:1447 classes/settings.class.php:1488
137	+ #: classes/settings.class.php:1641
138	+ msgid "Left"
139	+ msgstr "Links"
140	+
141	+ # @ megamenu
142	+ #: classes/menu-item-manager.class.php:325
143	+ #: classes/menu-item-manager.class.php:350 classes/settings.class.php:819
144	+ #: classes/settings.class.php:896 classes/settings.class.php:1078
145	+ #: classes/settings.class.php:1200 classes/settings.class.php:1226
146	+ #: classes/settings.class.php:1278 classes/settings.class.php:1360
147	+ #: classes/settings.class.php:1439 classes/settings.class.php:1480
148	+ #: classes/settings.class.php:1643
149	+ msgid "Right"
150	+ msgstr "Rechts"
151	+
152	+ #: classes/menu-item-manager.class.php:328
153	+ msgid ""
154	+ "Right aligned items will appear in reverse order on the right hand side of "
155	+ "the menu bar"
156	+ msgstr ""
157	+
158	+ # @ megamenu
159	+ #: classes/menu-item-manager.class.php:338
160	+ #, fuzzy
161	+ msgid "Sub Menu Settings"
162	+ msgstr "Mega Menu Einstellungen"
163	+
164	+ # @ megamenu
165	+ #: classes/menu-item-manager.class.php:343
166	+ #, fuzzy
167	+ msgid "Sub Menu Align"
168	+ msgstr "Untermenü Position"
169	+
170	+ #: classes/menu-item-manager.class.php:353
171	+ msgid ""
172	+ "Right aligned sub menus will align to the right of the parent menu item and "
173	+ "expand to the left"
174	+ msgstr ""
175	+
176	+ # @ megamenu
177	+ #: classes/menu-item-manager.class.php:366 classes/settings.class.php:439
178	+ #: classes/settings.class.php:626
179	+ msgid "General Settings"
180	+ msgstr "Allgemeine Einstellungen"
181	+
182	+ #: classes/menu-item-manager.class.php:385
183	+ msgid "Dashicons"
184	+ msgstr ""
185	+
186	+ # @ megamenu
187	+ #: classes/menu-item-manager.class.php:422
188	+ msgid "Menu Icon"
189	+ msgstr "Menü Icon"
190	+
191	+ # @ megamenu
192	+ #: classes/nav-menus.class.php:84
193	+ msgid "Mega Menu Settings"
194	+ msgstr "Mega Menu Einstellungen"
195	+
196	+ # @ megamenu
197	+ #: classes/nav-menus.class.php:126
198	+ msgid "Launched for Menu ID"
199	+ msgstr "Für Menü-ID gestartet"
200	+
201	+ #: classes/nav-menus.class.php:128
202	+ msgid "Saving"
203	+ msgstr ""
204	+
205	+ # @ megamenu
206	+ #: classes/nav-menus.class.php:130
207	+ msgid "Oops. Something went wrong. Please reload the page."
208	+ msgstr "Oops. Irgendwas ist schief gelaufen. Bitte lade die Seite neu."
209	+
210	+ # @ megamenu
211	+ #: classes/nav-menus.class.php:201
212	+ msgid "This theme does not have any menu locations."
213	+ msgstr "Dieses Theme besitzt keine Menü Positionen."
214	+
215	+ # @ megamenu
216	+ #: classes/nav-menus.class.php:205
217	+ msgid ""
218	+ "This menu is not tagged to a location. Please tag a location to enable the "
219	+ "Mega Menu settings."
220	+ msgstr ""
221	+ "Dieses Menü ist keiner Position zugeordnet. Bitte weise dem Menü eine "
222	+ "Position zu, um die Mega Menü Einstellungen zu aktivieren. "
223	+
224	+ # @ default
225	+ #: classes/nav-menus.class.php:245 classes/widget-manager.class.php:456
226	+ msgid "Save"
227	+ msgstr ""
228	+
229	+ # @ megamenu
230	+ #: classes/nav-menus.class.php:260
231	+ msgid "Enable"
232	+ msgstr "Aktiv"
233	+
234	+ # @ megamenu
235	+ #: classes/nav-menus.class.php:266
236	+ msgid "Event"
237	+ msgstr "Auslöser"
238	+
239	+ # @ megamenu
240	+ #: classes/nav-menus.class.php:269
241	+ msgid "Hover"
242	+ msgstr "Hover"
243	+
244	+ # @ megamenu
245	+ #: classes/nav-menus.class.php:270
246	+ msgid "Click"
247	+ msgstr "Klick"
248	+
249	+ # @ megamenu
250	+ #: classes/nav-menus.class.php:275
251	+ msgid "Effect"
252	+ msgstr "Effekt"
253	+
254	+ # @ megamenu
255	+ #: classes/nav-menus.class.php:284 classes/settings.class.php:1663
256	+ msgid "None"
257	+ msgstr "Keiner"
258	+
259	+ # @ megamenu
260	+ #: classes/nav-menus.class.php:288
261	+ msgid "Fade"
262	+ msgstr "Einblenden"
263	+
264	+ # @ megamenu
265	+ #: classes/nav-menus.class.php:292
266	+ msgid "Slide"
267	+ msgstr "Herunterklappen"
268	+
269	+ # @ megamenu
270	+ #: classes/nav-menus.class.php:306
271	+ msgid "Theme"
272	+ msgstr "Vorlage"
273	+
274	+ # @ megamenu
275	+ #: classes/settings.class.php:239
276	+ #, fuzzy
277	+ msgid "Copy"
278	+ msgstr " Kopie"
279	+
280	+ # @ megamenu
281	+ #: classes/settings.class.php:416 classes/settings.class.php:584
282	+ #, fuzzy
283	+ msgid "Max Mega Menu"
284	+ msgstr "Mega Menu Panel"
285	+
286	+ #: classes/settings.class.php:444
287	+ msgid "CSS Output"
288	+ msgstr ""
289	+
290	+ #: classes/settings.class.php:450
291	+ msgid "Enqueue dynamically via admin-ajax.php"
292	+ msgstr ""
293	+
294	+ #: classes/settings.class.php:451
295	+ msgid "Save to filesystem"
296	+ msgstr ""
297	+
298	+ #: classes/settings.class.php:452
299	+ msgid "Output in <head>"
300	+ msgstr ""
301	+
302	+ #: classes/settings.class.php:453
303	+ msgid "Don't output CSS"
304	+ msgstr ""
305	+
306	+ #: classes/settings.class.php:456
307	+ msgid ""
308	+ "Default. CSS will be enqueued dynamically through admin-ajax.php and loaded "
309	+ "from the cache."
310	+ msgstr ""
311	+
312	+ #: classes/settings.class.php:457
313	+ msgid ""
314	+ "CSS will be saved to wp-content/uploads/maxmegamenu/style.css and enqueued "
315	+ "from there."
316	+ msgstr ""
317	+
318	+ #: classes/settings.class.php:458
319	+ msgid ""
320	+ "CSS will be loaded from the cache in a <style> tag in the <head> "
321	+ "of the page."
322	+ msgstr ""
323	+
324	+ #: classes/settings.class.php:459
325	+ msgid "CSS will not be output, you must enqueue the CSS for the menu manually."
326	+ msgstr ""
327	+
328	+ #: classes/settings.class.php:465
329	+ msgid "Click Event Behaviour"
330	+ msgstr ""
331	+
332	+ #: classes/settings.class.php:467
333	+ msgid ""
334	+ "Define what should happen when the event is set to 'click'. This also "
335	+ "applies to mobiles."
336	+ msgstr ""
337	+
338	+ #: classes/settings.class.php:472
339	+ msgid "First click will open a sub menu, second click will close the sub menu."
340	+ msgstr ""
341	+
342	+ #: classes/settings.class.php:473
343	+ msgid "First click will open a sub menu, second click will follow the link."
344	+ msgstr ""
345	+
346	+ # @ megamenu
347	+ #: classes/settings.class.php:483
348	+ #, fuzzy
349	+ msgid "Menu Settings"
350	+ msgstr "Mega Menu Einstellungen"
351	+
352	+ #: classes/settings.class.php:485
353	+ msgid ""
354	+ "Menu specific settings (e.g, click or hover event, menu theme, transition "
355	+ "effect) can be found under"
356	+ msgstr ""
357	+
358	+ #: classes/settings.class.php:485
359	+ msgid "Appearance > Menus"
360	+ msgstr ""
361	+
362	+ #: classes/settings.class.php:515
363	+ msgid "Cache"
364	+ msgstr ""
365	+
366	+ #: classes/settings.class.php:517
367	+ msgid "Regenerate CSS"
368	+ msgstr ""
369	+
370	+ #: classes/settings.class.php:518
371	+ msgid "Regenerate the CSS."
372	+ msgstr ""
373	+
374	+ #: classes/settings.class.php:525
375	+ msgid "Plugin Data"
376	+ msgstr ""
377	+
378	+ # @ megamenu
379	+ #: classes/settings.class.php:527
380	+ #, fuzzy
381	+ msgid "Delete Data"
382	+ msgstr "%s gelöscht"
383	+
384	+ #: classes/settings.class.php:528
385	+ msgid ""
386	+ "Delete all saved Max Mega Menu plugin data from the database. Use with "
387	+ "caution!"
388	+ msgstr ""
389	+
390	+ #: classes/settings.class.php:548
391	+ msgid "Homepage"
392	+ msgstr ""
393	+
394	+ #: classes/settings.class.php:553
395	+ msgid "Documentation"
396	+ msgstr ""
397	+
398	+ #: classes/settings.class.php:558
399	+ msgid "Support"
400	+ msgstr ""
401	+
402	+ #: classes/settings.class.php:566
403	+ msgid "Core version"
404	+ msgstr ""
405	+
406	+ #: classes/settings.class.php:627
407	+ msgid "Tools"
408	+ msgstr ""
409	+
410	+ # @ megamenu
411	+ #: classes/settings.class.php:628
412	+ #, fuzzy
413	+ msgid "Theme Editor"
414	+ msgstr "Theme gelöscht"
415	+
416	+ # @ megamenu
417	+ #: classes/settings.class.php:685
418	+ msgid "Failed to delete theme. The theme is in use by a menu."
419	+ msgstr "Theme kann nicht gelöscht werden, da es von einem Menü benutzt wird."
420	+
421	+ #: classes/settings.class.php:689
422	+ msgid "CSS cache cleared and CSS regenerated"
423	+ msgstr ""
424	+
425	+ #: classes/settings.class.php:693
426	+ msgid "All plugin data removed"
427	+ msgstr ""
428	+
429	+ # @ megamenu
430	+ #: classes/settings.class.php:698
431	+ msgid "Theme Deleted"
432	+ msgstr "Theme gelöscht"
433	+
434	+ # @ megamenu
435	+ #: classes/settings.class.php:702
436	+ msgid "Theme Duplicated"
437	+ msgstr "Theme dupliziert"
438	+
439	+ # @ megamenu
440	+ #: classes/settings.class.php:706
441	+ msgid "Changes Saved"
442	+ msgstr "Änderungen gespeichert"
443	+
444	+ # @ megamenu
445	+ #: classes/settings.class.php:710
446	+ msgid "Theme Reverted"
447	+ msgstr "Theme wiederhergestellt"
448	+
449	+ # @ megamenu
450	+ #: classes/settings.class.php:714
451	+ msgid "New Theme Created"
452	+ msgstr "Neues Theme erstellt"
453	+
454	+ # @ megamenu
455	+ #: classes/settings.class.php:775
456	+ msgid "Select theme to edit"
457	+ msgstr "Theme zum Bearbeiten auswählen"
458	+
459	+ #: classes/settings.class.php:775 classes/settings.class.php:776
460	+ msgid "or"
461	+ msgstr ""
462	+
463	+ # @ megamenu
464	+ #: classes/settings.class.php:776
465	+ #, fuzzy
466	+ msgid "create a new theme"
467	+ msgstr "Neues Theme erstellen"
468	+
469	+ # @ megamenu
470	+ #: classes/settings.class.php:777
471	+ #, fuzzy
472	+ msgid "duplicate this theme"
473	+ msgstr "Theme kopieren"
474	+
475	+ # @ megamenu
476	+ #: classes/settings.class.php:786
477	+ #, fuzzy
478	+ msgid "Editing Theme:"
479	+ msgstr "Bearbeiten von Theme: "
480	+
481	+ # @ megamenu
482	+ #: classes/settings.class.php:787
483	+ #, fuzzy
484	+ msgid "General Theme Settings"
485	+ msgstr "Allgemeine Einstellungen"
486	+
487	+ # @ megamenu
488	+ #: classes/settings.class.php:792
489	+ #, fuzzy
490	+ msgid "Theme Title"
491	+ msgstr "Theme gelöscht"
492	+
493	+ # @ megamenu
494	+ #: classes/settings.class.php:800
495	+ #, fuzzy
496	+ msgid "Arrow"
497	+ msgstr "Rechts"
498	+
499	+ # @ megamenu
500	+ #: classes/settings.class.php:802
501	+ #, fuzzy
502	+ msgid "Select the arrow styles."
503	+ msgstr "Theme zum Bearbeiten auswählen"
504	+
505	+ #: classes/settings.class.php:807
506	+ msgid "Up"
507	+ msgstr ""
508	+
509	+ #: classes/settings.class.php:811
510	+ msgid "Down"
511	+ msgstr ""
512	+
513	+ #: classes/settings.class.php:826
514	+ msgid "Responsive Breakpoint"
515	+ msgstr ""
516	+
517	+ #: classes/settings.class.php:828
518	+ msgid ""
519	+ "Set the width at which the menu turns into a mobile menu. Set to 0 to "
520	+ "disable responsive menu."
521	+ msgstr ""
522	+
523	+ #: classes/settings.class.php:835
524	+ msgid "Responsive Menu Text"
525	+ msgstr ""
526	+
527	+ #: classes/settings.class.php:837
528	+ msgid "Text to display next to the mobile toggle icon."
529	+ msgstr ""
530	+
531	+ #: classes/settings.class.php:844
532	+ msgid "Line Height"
533	+ msgstr ""
534	+
535	+ #: classes/settings.class.php:846
536	+ msgid "Set the general line height to use in the panel contents."
537	+ msgstr ""
538	+
539	+ #: classes/settings.class.php:853
540	+ msgid "Z-Index"
541	+ msgstr ""
542	+
543	+ #: classes/settings.class.php:855
544	+ msgid "Set the z-index to ensure the panels appear ontop of other content."
545	+ msgstr ""
546	+
547	+ # @ megamenu
548	+ #: classes/settings.class.php:862
549	+ msgid "Menu Bar"
550	+ msgstr "Menü Leiste"
551	+
552	+ # @ megamenu
553	+ #: classes/settings.class.php:867
554	+ #, fuzzy
555	+ msgid "Menu Background"
556	+ msgstr "Menü Leiste"
557	+
558	+ #: classes/settings.class.php:869
559	+ msgid ""
560	+ "The background color for the main menu bar. Set each value to transparent "
561	+ "for a 'button' style menu."
562	+ msgstr ""
563	+
564	+ #: classes/settings.class.php:874 classes/settings.class.php:960
565	+ #: classes/settings.class.php:978 classes/settings.class.php:1163
566	+ #: classes/settings.class.php:1388 classes/settings.class.php:1406
567	+ msgid "From"
568	+ msgstr ""
569	+
570	+ #: classes/settings.class.php:878 classes/settings.class.php:964
571	+ #: classes/settings.class.php:982 classes/settings.class.php:1167
572	+ #: classes/settings.class.php:1392 classes/settings.class.php:1410
573	+ msgid "To"
574	+ msgstr ""
575	+
576	+ # @ megamenu
577	+ #: classes/settings.class.php:885
578	+ #, fuzzy
579	+ msgid "Menu Padding"
580	+ msgstr "Menü Leiste"
581	+
582	+ #: classes/settings.class.php:887
583	+ msgid "Padding for the main menu bar."
584	+ msgstr ""
585	+
586	+ #: classes/settings.class.php:892 classes/settings.class.php:1074
587	+ #: classes/settings.class.php:1196 classes/settings.class.php:1222
588	+ #: classes/settings.class.php:1274 classes/settings.class.php:1356
589	+ #: classes/settings.class.php:1435 classes/settings.class.php:1476
590	+ msgid "Top"
591	+ msgstr ""
592	+
593	+ #: classes/settings.class.php:900 classes/settings.class.php:1082
594	+ #: classes/settings.class.php:1204 classes/settings.class.php:1230
595	+ #: classes/settings.class.php:1282 classes/settings.class.php:1364
596	+ #: classes/settings.class.php:1443 classes/settings.class.php:1484
597	+ msgid "Bottom"
598	+ msgstr ""
599	+
600	+ #: classes/settings.class.php:911 classes/settings.class.php:1241
601	+ #: classes/settings.class.php:1495
602	+ msgid "Rounded Corners"
603	+ msgstr ""
604	+
605	+ #: classes/settings.class.php:913
606	+ msgid "Set a border radius on the main menu bar."
607	+ msgstr ""
608	+
609	+ # @ megamenu
610	+ #: classes/settings.class.php:918 classes/settings.class.php:1100
611	+ #: classes/settings.class.php:1248 classes/settings.class.php:1502
612	+ #, fuzzy
613	+ msgid "Top Left"
614	+ msgstr "Links"
615	+
616	+ # @ megamenu
617	+ #: classes/settings.class.php:922 classes/settings.class.php:1104
618	+ #: classes/settings.class.php:1252 classes/settings.class.php:1506
619	+ #, fuzzy
620	+ msgid "Top Right"
621	+ msgstr "Rechts"
622	+
623	+ #: classes/settings.class.php:926 classes/settings.class.php:1108
624	+ #: classes/settings.class.php:1256 classes/settings.class.php:1510
625	+ msgid "Bottom Right"
626	+ msgstr ""
627	+
628	+ #: classes/settings.class.php:930 classes/settings.class.php:1112
629	+ #: classes/settings.class.php:1260 classes/settings.class.php:1514
630	+ msgid "Bottom Left"
631	+ msgstr ""
632	+
633	+ # @ megamenu
634	+ #: classes/settings.class.php:937
635	+ #, fuzzy
636	+ msgid "Menu Items Align"
637	+ msgstr "Menü Icon"
638	+
639	+ #: classes/settings.class.php:939
640	+ msgid ""
641	+ "Align all menu items to the left (default), centrally or to the right. To "
642	+ "align a single menu item to the right, use the Mega Menu options for the "
643	+ "menu item."
644	+ msgstr ""
645	+
646	+ # @ megamenu
647	+ #: classes/settings.class.php:948
648	+ msgid "Top Level Menu Items"
649	+ msgstr "Hauptmenü Einträge"
650	+
651	+ # @ megamenu
652	+ #: classes/settings.class.php:953
653	+ #, fuzzy
654	+ msgid "Menu Item Background"
655	+ msgstr "Menü Icon"
656	+
657	+ #: classes/settings.class.php:955
658	+ msgid ""
659	+ "The background color for each top level menu item. Tip: Set these values to "
660	+ "transparent if you've already set a background color on the menu container."
661	+ msgstr ""
662	+
663	+ #: classes/settings.class.php:971
664	+ msgid "Menu Item Background (Hover)"
665	+ msgstr ""
666	+
667	+ #: classes/settings.class.php:973
668	+ msgid "The background color for a top level menu item (on hover)."
669	+ msgstr ""
670	+
671	+ # @ megamenu
672	+ #: classes/settings.class.php:989
673	+ #, fuzzy
674	+ msgid "Menu Item Spacing"
675	+ msgstr "Menü Icon"
676	+
677	+ #: classes/settings.class.php:991
678	+ msgid "Define the size of the gap between each top level menu item."
679	+ msgstr ""
680	+
681	+ #: classes/settings.class.php:1000
682	+ msgid "Menu Item Height"
683	+ msgstr ""
684	+
685	+ #: classes/settings.class.php:1002
686	+ msgid ""
687	+ "Define the height of each top level menu item. This value, plus the "
688	+ "container top and bottom padding values define the overall height of the "
689	+ "menu bar."
690	+ msgstr ""
691	+
692	+ #: classes/settings.class.php:1011 classes/settings.class.php:1521
693	+ msgid "Font"
694	+ msgstr ""
695	+
696	+ #: classes/settings.class.php:1013
697	+ msgid "The font to use for each top level menu item."
698	+ msgstr ""
699	+
700	+ #: classes/settings.class.php:1018 classes/settings.class.php:1052
701	+ #: classes/settings.class.php:1130 classes/settings.class.php:1192
702	+ #: classes/settings.class.php:1300 classes/settings.class.php:1334
703	+ #: classes/settings.class.php:1472 classes/settings.class.php:1528
704	+ #: classes/settings.class.php:1562
705	+ msgid "Color"
706	+ msgstr ""
707	+
708	+ #: classes/settings.class.php:1022 classes/settings.class.php:1304
709	+ #: classes/settings.class.php:1338 classes/settings.class.php:1532
710	+ msgid "Size"
711	+ msgstr ""
712	+
713	+ #: classes/settings.class.php:1026 classes/settings.class.php:1308
714	+ #: classes/settings.class.php:1342 classes/settings.class.php:1536
715	+ msgid "Family"
716	+ msgstr ""
717	+
718	+ #: classes/settings.class.php:1030 classes/settings.class.php:1316
719	+ #: classes/settings.class.php:1540
720	+ msgid "Transform"
721	+ msgstr ""
722	+
723	+ # @ megamenu
724	+ #: classes/settings.class.php:1034 classes/settings.class.php:1056
725	+ #: classes/settings.class.php:1312 classes/settings.class.php:1544
726	+ #: classes/settings.class.php:1566
727	+ #, fuzzy
728	+ msgid "Weight"
729	+ msgstr "Rechts"
730	+
731	+ #: classes/settings.class.php:1038 classes/settings.class.php:1060
732	+ #: classes/settings.class.php:1320 classes/settings.class.php:1548
733	+ #: classes/settings.class.php:1570
734	+ msgid "Decoration"
735	+ msgstr ""
736	+
737	+ #: classes/settings.class.php:1045 classes/settings.class.php:1555
738	+ msgid "Font (Hover)"
739	+ msgstr ""
740	+
741	+ #: classes/settings.class.php:1047
742	+ msgid "Set the font to use for each top level menu item (on hover)."
743	+ msgstr ""
744	+
745	+ #: classes/settings.class.php:1067
746	+ msgid "Menu Item Padding"
747	+ msgstr ""
748	+
749	+ #: classes/settings.class.php:1069
750	+ msgid "Set the padding for each top level menu item."
751	+ msgstr ""
752	+
753	+ #: classes/settings.class.php:1093
754	+ msgid "Menu Item Rounded Corners"
755	+ msgstr ""
756	+
757	+ #: classes/settings.class.php:1095
758	+ msgid "Set rounded corners for each top level menu item."
759	+ msgstr ""
760	+
761	+ # @ megamenu
762	+ #: classes/settings.class.php:1119
763	+ #, fuzzy
764	+ msgid "Menu Item Divider"
765	+ msgstr "Menü Icon"
766	+
767	+ #: classes/settings.class.php:1121
768	+ msgid "Show a small divider bar between each menu item."
769	+ msgstr ""
770	+
771	+ # @ megamenu
772	+ #: classes/settings.class.php:1126
773	+ #, fuzzy
774	+ msgid "Enabled"
775	+ msgstr "Aktiv"
776	+
777	+ #: classes/settings.class.php:1134
778	+ msgid "Glow Opacity"
779	+ msgstr ""
780	+
781	+ #: classes/settings.class.php:1142
782	+ msgid "Highlight Current Item"
783	+ msgstr ""
784	+
785	+ #: classes/settings.class.php:1144
786	+ msgid "Apply the 'hover' styling to current menu items."
787	+ msgstr ""
788	+
789	+ # @ megamenu
790	+ #: classes/settings.class.php:1151
791	+ msgid "Mega Panels"
792	+ msgstr "Mega Panels"
793	+
794	+ #: classes/settings.class.php:1156
795	+ msgid "Panel Background"
796	+ msgstr ""
797	+
798	+ #: classes/settings.class.php:1158
799	+ msgid "Set a background color for a whole panel."
800	+ msgstr ""
801	+
802	+ #: classes/settings.class.php:1174
803	+ msgid "Panel Width"
804	+ msgstr ""
805	+
806	+ #: classes/settings.class.php:1176
807	+ msgid ""
808	+ "Mega Panel width. Note: A 100% wide panel will only ever be as wide as the "
809	+ "menu itself. For a fixed panel width set this to a pixel value. Advanced: "
810	+ "enter a jQuery selector to align the sub menu to a page element."
811	+ msgstr ""
812	+
813	+ #: classes/settings.class.php:1185
814	+ msgid "Panel Border"
815	+ msgstr ""
816	+
817	+ # @ megamenu
818	+ #: classes/settings.class.php:1187
819	+ #, fuzzy
820	+ msgid "Set the border to display on the Mega Panel."
821	+ msgstr "Widget für das Mega Panel auswählen"
822	+
823	+ #: classes/settings.class.php:1215
824	+ msgid "Panel Padding"
825	+ msgstr ""
826	+
827	+ #: classes/settings.class.php:1217
828	+ msgid ""
829	+ "Set the padding for the whole panel. Set these values 0px if you wish your "
830	+ "panel content to go edge-to-edge."
831	+ msgstr ""
832	+
833	+ #: classes/settings.class.php:1243
834	+ msgid "Set rounded corners for the panel."
835	+ msgstr ""
836	+
837	+ #: classes/settings.class.php:1267
838	+ msgid "Widget Padding"
839	+ msgstr ""
840	+
841	+ #: classes/settings.class.php:1269
842	+ msgid ""
843	+ "Set the padding for each widget in the panel. Use this to define the spacing "
844	+ "between each widget in the panel."
845	+ msgstr ""
846	+
847	+ #: classes/settings.class.php:1293
848	+ msgid "Heading Font"
849	+ msgstr ""
850	+
851	+ #: classes/settings.class.php:1295
852	+ msgid ""
853	+ "Set the font to use for Widget Headers. This setting is also used for second "
854	+ "level menu items when they're displayed in a Mega Menu."
855	+ msgstr ""
856	+
857	+ #: classes/settings.class.php:1327
858	+ msgid "Content Font"
859	+ msgstr ""
860	+
861	+ #: classes/settings.class.php:1329
862	+ msgid "Set the font to use for panel contents."
863	+ msgstr ""
864	+
865	+ #: classes/settings.class.php:1349
866	+ msgid "Heading Padding"
867	+ msgstr ""
868	+
869	+ #: classes/settings.class.php:1351
870	+ msgid ""
871	+ "Set the padding for the headings. Use this to set the gap between the widget "
872	+ "heading and the widget content."
873	+ msgstr ""
874	+
875	+ # @ megamenu
876	+ #: classes/settings.class.php:1376
877	+ msgid "Flyout Menus"
878	+ msgstr "Flyout-Menü"
879	+
880	+ #: classes/settings.class.php:1381
881	+ msgid "Item Background"
882	+ msgstr ""
883	+
884	+ #: classes/settings.class.php:1383
885	+ msgid "Set the background color for a flyout menu item."
886	+ msgstr ""
887	+
888	+ #: classes/settings.class.php:1399
889	+ msgid "Item Background (Hover)"
890	+ msgstr ""
891	+
892	+ #: classes/settings.class.php:1401
893	+ msgid "Set the background color for a flyout menu item (on hover)."
894	+ msgstr ""
895	+
896	+ #: classes/settings.class.php:1417
897	+ msgid "Item Height"
898	+ msgstr ""
899	+
900	+ #: classes/settings.class.php:1419
901	+ msgid "The height of each flyout menu item."
902	+ msgstr ""
903	+
904	+ #: classes/settings.class.php:1428
905	+ msgid "Item Padding"
906	+ msgstr ""
907	+
908	+ #: classes/settings.class.php:1430
909	+ msgid "Set the padding for each flyout menu item."
910	+ msgstr ""
911	+
912	+ # @ megamenu
913	+ #: classes/settings.class.php:1454
914	+ #, fuzzy
915	+ msgid "Flyout Menu Width"
916	+ msgstr "Flyout-Menü"
917	+
918	+ #: classes/settings.class.php:1456
919	+ msgid "The width of each flyout menu."
920	+ msgstr ""
921	+
922	+ # @ megamenu
923	+ #: classes/settings.class.php:1465
924	+ #, fuzzy
925	+ msgid "Flyout Menu Border"
926	+ msgstr "Flyout-Menü"
927	+
928	+ #: classes/settings.class.php:1467
929	+ msgid "Set the border for the flyout menu."
930	+ msgstr ""
931	+
932	+ #: classes/settings.class.php:1497
933	+ msgid ""
934	+ "Set rounded corners for flyout menus. Rounded corners will be applied to all "
935	+ "flyout menu levels."
936	+ msgstr ""
937	+
938	+ #: classes/settings.class.php:1523
939	+ msgid "Set the font for the flyout menu items."
940	+ msgstr ""
941	+
942	+ #: classes/settings.class.php:1557
943	+ msgid "Set the font weight for the flyout menu items (on hover)."
944	+ msgstr ""
945	+
946	+ # @ megamenu
947	+ #: classes/settings.class.php:1577
948	+ #, fuzzy
949	+ msgid "Custom Styling"
950	+ msgstr "Eigenes CSS"
951	+
952	+ #: classes/settings.class.php:1582
953	+ msgid "CSS Editor"
954	+ msgstr ""
955	+
956	+ #: classes/settings.class.php:1584
957	+ msgid ""
958	+ "Define any custom CSS you wish to add to menus using this theme. You can use "
959	+ "standard CSS or SCSS."
960	+ msgstr ""
961	+
962	+ #: classes/settings.class.php:1590
963	+ msgid "Custom Styling Tips"
964	+ msgstr ""
965	+
966	+ #: classes/settings.class.php:1592
967	+ msgid ""
968	+ "converts to the ID selector of the menu wrapper, e.g. div#mega-menu-wrap-"
969	+ "primary"
970	+ msgstr ""
971	+
972	+ #: classes/settings.class.php:1593
973	+ msgid "converts to the ID selector of the menu, e.g. ul#mega-menu-primary"
974	+ msgstr ""
975	+
976	+ #: classes/settings.class.php:1594
977	+ msgid ""
978	+ "Use @import rules to import CSS from other plugins or your theme directory, "
979	+ "e.g:"
980	+ msgstr ""
981	+
982	+ # @ megamenu
983	+ #: classes/settings.class.php:1609
984	+ msgid "Delete Theme"
985	+ msgstr "Theme löschen"
986	+
987	+ # @ megamenu
988	+ #: classes/settings.class.php:1613
989	+ #, fuzzy
990	+ msgid "Revert Theme"
991	+ msgstr "Theme löschen"
992	+
993	+ #: classes/settings.class.php:1642
994	+ msgid "Center"
995	+ msgstr ""
996	+
997	+ #: classes/settings.class.php:1664
998	+ msgid "Underline"
999	+ msgstr ""
1000	+
1001	+ # @ megamenu
1002	+ #: classes/settings.class.php:1708
1003	+ msgid "Disabled"
1004	+ msgstr "Deaktiviert"
1005	+
1006	+ # @ megamenu
1007	+ #: classes/settings.class.php:1765 classes/settings.class.php:1784
1008	+ msgid "Normal"
1009	+ msgstr "Normal"
1010	+
1011	+ # @ megamenu
1012	+ #: classes/settings.class.php:1766
1013	+ msgid "Bold"
1014	+ msgstr "Fett"
1015	+
1016	+ # @ megamenu
1017	+ #: classes/settings.class.php:1785
1018	+ msgid "Capitalize"
1019	+ msgstr "Großschreibung"
1020	+
1021	+ # @ megamenu
1022	+ #: classes/settings.class.php:1786
1023	+ msgid "Uppercase"
1024	+ msgstr "GROSSBUCHSTABEN"
1025	+
1026	+ # @ megamenu
1027	+ #: classes/settings.class.php:1787
1028	+ msgid "Lowercase"
1029	+ msgstr "kleinschreibung"
1030	+
1031	+ # @ megamenu
1032	+ #: classes/settings.class.php:1822
1033	+ msgid "Theme Default"
1034	+ msgstr "Theme Vorgabe"
1035	+
1036	+ # @ megamenu
1037	+ #: classes/settings.class.php:1929
1038	+ msgid "Are you sure?"
1039	+ msgstr "Bist Du sicher?"
1040	+
1041	+ # @ megamenu
1042	+ #: classes/style-manager.class.php:67
1043	+ msgid "Default"
1044	+ msgstr "Standard"
1045	+
1046	+ # @ megamenu
1047	+ #: classes/style-manager.class.php:450
1048	+ msgid ""
1049	+ "Warning: CSS compilation failed. Please check your changes or revert the "
1050	+ "theme."
1051	+ msgstr ""
1052	+ "Achtung: CSS-Erstellung fehlgeschlagen. Bitte überprüfe die Änderungen oder "
1053	+ "setze das Theme zurück."
1054	+
1055	+ # @ megamenu
1056	+ #: classes/widget-manager.class.php:76
1057	+ msgid "Mega Menu Widgets"
1058	+ msgstr "Mega Menu Widgets"
1059	+
1060	+ # @ megamenu
1061	+ #: classes/widget-manager.class.php:77
1062	+ msgid "Do not manually edit this area."
1063	+ msgstr "Diesen Bereich bitte nicht manuell ändern."
1064	+
1065	+ # @ megamenu
1066	+ #: classes/widget-manager.class.php:114
1067	+ #, php-format
1068	+ msgid "Saved %s"
1069	+ msgstr "%s gesichert"
1070	+
1071	+ # @ megamenu
1072	+ #: classes/widget-manager.class.php:115
1073	+ #, php-format
1074	+ msgid "Failed to save %s"
1075	+ msgstr "Fehler beim Speichern von %s"
1076	+
1077	+ # @ megamenu
1078	+ #: classes/widget-manager.class.php:139
1079	+ #, php-format
1080	+ msgid "Updated %s (new columns: %d)"
1081	+ msgstr "%s aktualisiert (neue Spalten: %d)"
1082	+
1083	+ # @ megamenu
1084	+ #: classes/widget-manager.class.php:140
1085	+ #, php-format
1086	+ msgid "Failed to update %s"
1087	+ msgstr "Fehler beim Aktualisieren von %s"
1088	+
1089	+ # @ megamenu
1090	+ #: classes/widget-manager.class.php:166
1091	+ #, php-format
1092	+ msgid "Failed to add %s to %d"
1093	+ msgstr "Fehler beim Hinzufügen von %s zu %d"
1094	+
1095	+ # @ megamenu
1096	+ #: classes/widget-manager.class.php:189
1097	+ #, php-format
1098	+ msgid "Deleted %s"
1099	+ msgstr "%s gelöscht"
1100	+
1101	+ # @ megamenu
1102	+ #: classes/widget-manager.class.php:190
1103	+ #, php-format
1104	+ msgid "Failed to delete %s"
1105	+ msgstr "Fehler beim Löschen von %s"
1106	+
1107	+ # @ megamenu
1108	+ #: classes/widget-manager.class.php:215
1109	+ #, php-format
1110	+ msgid "Moved %s to %d (%s)"
1111	+ msgstr "%s verschoben zu %d (%s)"
1112	+
1113	+ # @ megamenu
1114	+ #: classes/widget-manager.class.php:216
1115	+ #, php-format
1116	+ msgid "Failed to move %s to %d"
1117	+ msgstr "Fehler beim Verschieben von %s zu %d"
1118	+
1119	+ # @ megamenu
1120	+ #, fuzzy
1121	+ #~ msgid "Global Settings"
1122	+ #~ msgstr "Allgemeine Einstellungen"

languages/megamenu-fr_FR.mo ADDED Viewed

Binary file

languages/megamenu-fr_FR.po ADDED Viewed

	@@ -0,0 +1,1580 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: megamenu\n"
4	+ "POT-Creation-Date: 2015-09-28 17:08+0100\n"
5	+ "PO-Revision-Date: 2015-09-28 17:20+0100\n"
6	+ "Last-Translator: \n"
7	+ "Language-Team: Pierre Sudarovich <translate@tips02.fr>\n"
8	+ "Language: French\n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "X-Generator: Poedit 1.5.7\n"
13	+ "X-Poedit-KeywordsList: __;_e\n"
14	+ "X-Poedit-Basepath: .\n"
15	+ "X-Poedit-SourceCharset: UTF-8\n"
16	+ "X-Poedit-SearchPath-0: ..\n"
17	+ "X-Poedit-SearchPath-1: .\n"
18	+
19	+ #: ../megamenu.php:145
20	+ msgid "Go Pro"
21	+ msgstr "Passer à la version Pro"
22	+
23	+ #: ../megamenu.php:683
24	+ msgid ""
25	+ "Max Mega Menu is not compatible with your version of WordPress. Please "
26	+ "upgrade WordPress to the latest version or disable Max Mega Menu."
27	+ msgstr ""
28	+ "Max Mega Menu n'est pas compatible avec votre version de WordPress. Mettez à "
29	+ "jour WordPress à la dernière version, svp, ou désactivez Max Mega Menu."
30	+
31	+ #: ../megamenu.php:694
32	+ msgid ""
33	+ "Max Mega Menu is not compatible with Uber Menu. Please disable Uber Menu."
34	+ msgstr ""
35	+ "Max Mega Menu n'est pas compatible avec Uber Menu. Désactivez Uber Menu, svp."
36	+
37	+ #: ../megamenu.php:707
38	+ msgid "click here"
39	+ msgstr "cliquez ici"
40	+
41	+ #: ../megamenu.php:710
42	+ #, php-format
43	+ msgid "Thanks for installing Max Mega Menu! Please %s to get started."
44	+ msgstr "Merci d'avoir installé Max Mega Menu ! %s, svp pour commencer."
45	+
46	+ #: ../megamenu.php:725
47	+ msgid "clear the CSS cache"
48	+ msgstr "vider le cache CSS"
49	+
50	+ #: ../megamenu.php:728
51	+ #, php-format
52	+ msgid ""
53	+ "Max Mega Menu has been updated. Please %s to ensure maximum compatibility "
54	+ "with the latest version."
55	+ msgstr ""
56	+ "Max Mega Menu mis à jour. %s, svp pour vous assurer du maximum de "
57	+ "compatibilité avec la dernière version."
58	+
59	+ #: ../classes/menu-item-manager.class.php:175
60	+ #: ../classes/menu-item-manager.class.php:190
61	+ #: ../classes/menu-item-manager.class.php:273
62	+ #: ../classes/nav-menus.class.php:161 ../classes/settings.class.php:554
63	+ msgid "Mega Menu"
64	+ msgstr ""
65	+
66	+ #: ../classes/menu-item-manager.class.php:176
67	+ msgid "Mega Menus can only be created on top level menu items."
68	+ msgstr "Mega Menu peut seulement être créé pour les items de plus haut niveau."
69	+
70	+ #: ../classes/menu-item-manager.class.php:186
71	+ msgid "Sub menu display mode"
72	+ msgstr "Mode d'affichage du sous-menu"
73	+
74	+ #: ../classes/menu-item-manager.class.php:189
75	+ msgid "Flyout Menu"
76	+ msgstr "Menu volant"
77	+
78	+ #: ../classes/menu-item-manager.class.php:194
79	+ msgid "column"
80	+ msgstr "colonne"
81	+
82	+ #: ../classes/menu-item-manager.class.php:195
83	+ #: ../classes/menu-item-manager.class.php:196
84	+ #: ../classes/menu-item-manager.class.php:197
85	+ #: ../classes/menu-item-manager.class.php:198
86	+ #: ../classes/menu-item-manager.class.php:199
87	+ #: ../classes/menu-item-manager.class.php:200
88	+ #: ../classes/menu-item-manager.class.php:201
89	+ msgid "columns"
90	+ msgstr "colonnes"
91	+
92	+ #: ../classes/menu-item-manager.class.php:205
93	+ msgid "Select a Widget to add to the panel"
94	+ msgstr "Sélectionner un widget à ajouter au panneau"
95	+
96	+ #: ../classes/menu-item-manager.class.php:223
97	+ msgid "Sub menu items"
98	+ msgstr "Items de sous-menu"
99	+
100	+ #: ../classes/menu-item-manager.class.php:243
101	+ msgid "Widgets"
102	+ msgstr ""
103	+
104	+ #: ../classes/menu-item-manager.class.php:267
105	+ msgid ""
106	+ "No widgets found. Add a widget to this area using the Widget Selector (top "
107	+ "right)"
108	+ msgstr ""
109	+ "Aucun widget trouvé. Ajoutez un widget à cette zone en utilisant le "
110	+ "sélecteur de widget (en haut à droite)"
111	+
112	+ #: ../classes/menu-item-manager.class.php:294
113	+ msgid "Menu Item Settings"
114	+ msgstr "Paramètres des items du menu"
115	+
116	+ #: ../classes/menu-item-manager.class.php:298
117	+ msgid "Hide Text"
118	+ msgstr "Cacher le texte"
119	+
120	+ #: ../classes/menu-item-manager.class.php:305
121	+ #: ../classes/menu-item-manager.class.php:341
122	+ #: ../classes/menu-item-manager.class.php:366
123	+ msgid "Option only available for top level menu items"
124	+ msgstr "Option seulement disponible pour les items du plus haut niveau"
125	+
126	+ #: ../classes/menu-item-manager.class.php:312
127	+ msgid "Hide Arrow"
128	+ msgstr "Cacher la flèche"
129	+
130	+ #: ../classes/menu-item-manager.class.php:320
131	+ msgid "Disable Link"
132	+ msgstr "Désactiver le lien"
133	+
134	+ #: ../classes/menu-item-manager.class.php:328
135	+ msgid "Menu Item Align"
136	+ msgstr "Alignement de l'item du menu"
137	+
138	+ #: ../classes/menu-item-manager.class.php:334
139	+ #: ../classes/menu-item-manager.class.php:359
140	+ #: ../classes/settings.class.php:1309 ../classes/settings.class.php:1460
141	+ #: ../classes/settings.class.php:1643 ../classes/settings.class.php:1673
142	+ #: ../classes/settings.class.php:1806 ../classes/settings.class.php:1836
143	+ #: ../classes/settings.class.php:1888 ../classes/settings.class.php:1970
144	+ #: ../classes/settings.class.php:1996 ../classes/settings.class.php:2026
145	+ #: ../classes/settings.class.php:2132 ../classes/settings.class.php:2158
146	+ #: ../classes/settings.class.php:2188 ../classes/settings.class.php:2294
147	+ #: ../classes/settings.class.php:2356 ../classes/settings.class.php:2387
148	+ #: ../classes/settings.class.php:2486 ../classes/settings.class.php:2626
149	+ msgid "Left"
150	+ msgstr "Gauche"
151	+
152	+ #: ../classes/menu-item-manager.class.php:335
153	+ #: ../classes/menu-item-manager.class.php:360
154	+ #: ../classes/settings.class.php:1313 ../classes/settings.class.php:1452
155	+ #: ../classes/settings.class.php:1635 ../classes/settings.class.php:1665
156	+ #: ../classes/settings.class.php:1798 ../classes/settings.class.php:1828
157	+ #: ../classes/settings.class.php:1880 ../classes/settings.class.php:1962
158	+ #: ../classes/settings.class.php:1988 ../classes/settings.class.php:2018
159	+ #: ../classes/settings.class.php:2124 ../classes/settings.class.php:2150
160	+ #: ../classes/settings.class.php:2180 ../classes/settings.class.php:2286
161	+ #: ../classes/settings.class.php:2348 ../classes/settings.class.php:2379
162	+ #: ../classes/settings.class.php:2478 ../classes/settings.class.php:2628
163	+ msgid "Right"
164	+ msgstr "Droite"
165	+
166	+ #: ../classes/menu-item-manager.class.php:338
167	+ msgid ""
168	+ "Right aligned items will appear in reverse order on the right hand side of "
169	+ "the menu bar"
170	+ msgstr ""
171	+ "Les items alignés à droite apparaîtront dans un ordre inversé sur le côté "
172	+ "droit de la barre de menu"
173	+
174	+ #: ../classes/menu-item-manager.class.php:348
175	+ msgid "Sub Menu Settings"
176	+ msgstr "Paramètres du sous-menu"
177	+
178	+ #: ../classes/menu-item-manager.class.php:353
179	+ msgid "Sub Menu Align"
180	+ msgstr "Alignement du sous-menu"
181	+
182	+ #: ../classes/menu-item-manager.class.php:363
183	+ msgid ""
184	+ "Right aligned sub menus will align to the right of the parent menu item and "
185	+ "expand to the left"
186	+ msgstr ""
187	+ "Les sous-menus aligné à droite seront alignés à droite de l'item parent du "
188	+ "menu et étendu à gauche"
189	+
190	+ #: ../classes/menu-item-manager.class.php:376
191	+ #: ../classes/settings.class.php:600 ../classes/settings.class.php:1061
192	+ msgid "General Settings"
193	+ msgstr "Paramètres généraux"
194	+
195	+ #: ../classes/menu-item-manager.class.php:395
196	+ msgid "Dashicons"
197	+ msgstr ""
198	+
199	+ #: ../classes/menu-item-manager.class.php:400
200	+ msgid "Font Awesome"
201	+ msgstr ""
202	+
203	+ #: ../classes/menu-item-manager.class.php:402
204	+ #: ../classes/menu-item-manager.class.php:407
205	+ #: ../classes/menu-item-manager.class.php:412
206	+ msgid "Max Mega Menu Pro"
207	+ msgstr "Max Mega Menu Pro"
208	+
209	+ #: ../classes/menu-item-manager.class.php:402
210	+ msgid "Get access to over 400 Font Awesome Icons with {link}"
211	+ msgstr "Accédez à plus de 400 icones de Font Awesome avec {link}"
212	+
213	+ #: ../classes/menu-item-manager.class.php:405
214	+ msgid "Genericons"
215	+ msgstr ""
216	+
217	+ #: ../classes/menu-item-manager.class.php:407
218	+ msgid "Choose from over 100 genericons with {link}"
219	+ msgstr "Choisissez parmi plus de 100 genericons avec {link}"
220	+
221	+ #: ../classes/menu-item-manager.class.php:410
222	+ msgid "Custom Icon"
223	+ msgstr "Icone personnalisée"
224	+
225	+ #: ../classes/menu-item-manager.class.php:412
226	+ msgid "Select icons from your media library with {link}"
227	+ msgstr "Sélectionnez une icone depuis votre bibliothèque de médias avec {link}"
228	+
229	+ #: ../classes/menu-item-manager.class.php:448
230	+ msgid "Menu Icon"
231	+ msgstr "Icone du menu"
232	+
233	+ #: ../classes/nav-menus.class.php:110
234	+ msgid "Max Mega Menu Settings"
235	+ msgstr "Paramètres Max Mega Menu"
236	+
237	+ #: ../classes/nav-menus.class.php:160
238	+ msgid "Launched for Menu ID"
239	+ msgstr "Chargé pour l'ID du menu"
240	+
241	+ #: ../classes/nav-menus.class.php:162
242	+ msgid ""
243	+ "Please enable Max Mega Menu using the settings on the left of this page."
244	+ msgstr ""
245	+ "Activez Max Mega Menu en utilisant les paramètres sur la gauche de cette "
246	+ "page, svp."
247	+
248	+ #: ../classes/nav-menus.class.php:163
249	+ msgid "Saving"
250	+ msgstr "Sauvegarde"
251	+
252	+ #: ../classes/nav-menus.class.php:165
253	+ msgid "Oops. Something went wrong. Please reload the page."
254	+ msgstr "Oups... Quelque chose a cloché. Rechargez la page, svp."
255	+
256	+ #: ../classes/nav-menus.class.php:236
257	+ msgid "here"
258	+ msgstr "ici"
259	+
260	+ #: ../classes/nav-menus.class.php:238
261	+ msgid "This theme does not register any menu locations."
262	+ msgstr "Ce thème n'a aucun emplacement de menu."
263	+
264	+ #: ../classes/nav-menus.class.php:239
265	+ msgid ""
266	+ "You will need to create a new menu location and use the Max Mega Menu widget "
267	+ "or shortcode to display the menu on your site."
268	+ msgstr ""
269	+ "Vous aurez besoin de créer un nouvel emplacement de menu et d'utiliser le "
270	+ "widget Max Mega Menu ou un shortcode pour afficher le menu sur votre site."
271	+
272	+ #: ../classes/nav-menus.class.php:240
273	+ msgid "Click {link} for instructions."
274	+ msgstr "Cliquez sur {link pour les instructions."
275	+
276	+ #: ../classes/nav-menus.class.php:244
277	+ msgid ""
278	+ "Please assign this menu to a theme location to enable the Mega Menu settings."
279	+ msgstr ""
280	+ "Assignez ce menu à un emplacement de thème, svp, pour activer les paramètres "
281	+ "de Mega Menu."
282	+
283	+ #: ../classes/nav-menus.class.php:284 ../classes/widget-manager.class.php:463
284	+ msgid "Save"
285	+ msgstr "Sauver"
286	+
287	+ #: ../classes/nav-menus.class.php:299
288	+ msgid "Enable"
289	+ msgstr "Activer"
290	+
291	+ #: ../classes/nav-menus.class.php:305
292	+ msgid "Event"
293	+ msgstr "Evénement"
294	+
295	+ #: ../classes/nav-menus.class.php:308
296	+ msgid "Hover"
297	+ msgstr "Survol"
298	+
299	+ #: ../classes/nav-menus.class.php:309
300	+ msgid "Click"
301	+ msgstr "Clic"
302	+
303	+ #: ../classes/nav-menus.class.php:314
304	+ msgid "Effect"
305	+ msgstr "Effet"
306	+
307	+ #: ../classes/nav-menus.class.php:323 ../classes/settings.class.php:2648
308	+ msgid "None"
309	+ msgstr "Aucun"
310	+
311	+ #: ../classes/nav-menus.class.php:327
312	+ msgid "Fade"
313	+ msgstr "Fondu"
314	+
315	+ #: ../classes/nav-menus.class.php:331
316	+ msgid "Slide"
317	+ msgstr "Glissement"
318	+
319	+ #: ../classes/nav-menus.class.php:345
320	+ msgid "Theme"
321	+ msgstr "Thème"
322	+
323	+ #: ../classes/settings.class.php:291
324	+ msgid "(Imported)"
325	+ msgstr "(Importé)"
326	+
327	+ #: ../classes/settings.class.php:331
328	+ msgid "Copy"
329	+ msgstr "Copier"
330	+
331	+ #: ../classes/settings.class.php:554 ../classes/settings.class.php:1019
332	+ msgid "Max Mega Menu"
333	+ msgstr ""
334	+
335	+ #: ../classes/settings.class.php:605
336	+ msgid "CSS Output"
337	+ msgstr "Sortie CSS"
338	+
339	+ #: ../classes/settings.class.php:611
340	+ msgid "Save to filesystem"
341	+ msgstr "Sauver dans un fichier"
342	+
343	+ #: ../classes/settings.class.php:612
344	+ msgid "Output in <head>"
345	+ msgstr "Dans la section <head>"
346	+
347	+ #: ../classes/settings.class.php:613
348	+ msgid "Enqueue dynamically via admin-ajax.php"
349	+ msgstr "Mettre à la file dynamiquement via admin-ajax.php"
350	+
351	+ #: ../classes/settings.class.php:614
352	+ msgid "Don't output CSS"
353	+ msgstr "Ne pas générer de sortie CSS"
354	+
355	+ #: ../classes/settings.class.php:617
356	+ msgid ""
357	+ "CSS will be enqueued dynamically through admin-ajax.php and loaded from the "
358	+ "cache."
359	+ msgstr ""
360	+ "La CSS sera dynamiquement placé dans la file à travers admin-ajax.php et "
361	+ "chargé depuis le cache."
362	+
363	+ #: ../classes/settings.class.php:618
364	+ msgid ""
365	+ "CSS will be saved to wp-content/uploads/maxmegamenu/style.css and enqueued "
366	+ "from there."
367	+ msgstr ""
368	+ "Le CSS sera sauvegardé dans wp-content/uploads/maxmegamenu/style.css et mis "
369	+ "dans la file depuis cet emplacement."
370	+
371	+ #: ../classes/settings.class.php:619
372	+ msgid ""
373	+ "CSS will be loaded from the cache in a <style> tag in the <head> "
374	+ "of the page."
375	+ msgstr ""
376	+ "Le CSS sera chargé depuis le cache dans une balise <style> dans la "
377	+ "section <head> de la page."
378	+
379	+ #: ../classes/settings.class.php:620
380	+ msgid "CSS will not be output, you must enqueue the CSS for the menu manually."
381	+ msgstr ""
382	+ "Le CSS ne sera pas généré, vous devez le placer dans la file manuellement "
383	+ "pour le menu."
384	+
385	+ #: ../classes/settings.class.php:626
386	+ msgid "Click Event Behaviour"
387	+ msgstr "Comportement de l'événement sur clic"
388	+
389	+ #: ../classes/settings.class.php:628
390	+ msgid ""
391	+ "Define what should happen when the event is set to 'click'. This also "
392	+ "applies to mobiles."
393	+ msgstr ""
394	+ "Définissez ce qu'il arrivera lorsque l'évènement est paramétré sur 'click'. "
395	+ "Cela s'applique aussi aux mobiles."
396	+
397	+ #: ../classes/settings.class.php:633
398	+ msgid "First click will open a sub menu, second click will close the sub menu."
399	+ msgstr "Le premier clic ouvrira un sous-menu, le second fermera le sous-menu."
400	+
401	+ #: ../classes/settings.class.php:634
402	+ msgid "First click will open a sub menu, second click will follow the link."
403	+ msgstr "Le premier clic ouvrira un sous-menu, le second suivra le lien."
404	+
405	+ #: ../classes/settings.class.php:642
406	+ msgid "Mobile Menu Behaviour"
407	+ msgstr "Comportement du Menu Mobile"
408	+
409	+ #: ../classes/settings.class.php:644
410	+ msgid "Define the sub menu toggle behaviour for the mobile menu."
411	+ msgstr "Définir le comportement du menu bascule sous le menu pour mobile."
412	+
413	+ #: ../classes/settings.class.php:649
414	+ msgid "Standard - Open sub menus will remain open until closed by the user."
415	+ msgstr ""
416	+ "Standard - Un sous menu restera ouvert tant qu'il n'est pas fermé par "
417	+ "l'utilisateur."
418	+
419	+ #: ../classes/settings.class.php:650
420	+ msgid ""
421	+ "Accordion - Open sub menus will automatically close when another one is "
422	+ "opened."
423	+ msgstr ""
424	+ "Accordéon - Un sous menu ouvert se fermera automatiquement quand un autre "
425	+ "s'ouvrira"
426	+
427	+ #: ../classes/settings.class.php:658
428	+ msgid "Menu Locations"
429	+ msgstr "Emplacement de menu"
430	+
431	+ #: ../classes/settings.class.php:663
432	+ msgid "Registered Menu Locations"
433	+ msgstr "Emplacements de menu enregistrés"
434	+
435	+ #: ../classes/settings.class.php:664
436	+ msgid ""
437	+ "An overview of the menu locations supported by your theme. You can enable "
438	+ "Max Mega Menu and adjust the settings for a specific menu location by going "
439	+ "to Appearance > Menus."
440	+ msgstr ""
441	+ "Un aperçu des emplacements supportés par votre thème. Vous pouvez activer "
442	+ "Max Mega Menu et ajuster les paramètres pour un emplacement spécifique de "
443	+ "menu en allant dans Apparence > Menus."
444	+
445	+ #: ../classes/settings.class.php:669
446	+ msgid ""
447	+ "Your theme does not natively support menus, but you can add a new menu "
448	+ "location using Max Mega Menu and display the menu using the Max Mega Menu "
449	+ "widget or shortcode."
450	+ msgstr ""
451	+ "Votre thème ne supporte pas nativement les menus, mais vous pouvez ajouter "
452	+ "un nouvel emplacement de menu en utilisant Max Mega Menu et afficher le menu "
453	+ "en utilisant le widget Max Mega Menu ou le shortcode."
454	+
455	+ #: ../classes/settings.class.php:670
456	+ msgid "Your theme supports one menu."
457	+ msgstr "Votre thème supporte un menu."
458	+
459	+ #: ../classes/settings.class.php:671
460	+ msgid "Your theme supports {number} menus."
461	+ msgstr "Votre thème supporte {number} menus."
462	+
463	+ #: ../classes/settings.class.php:687
464	+ msgid "Add another menu location."
465	+ msgstr "Ajouter un autre emplacement de menu."
466	+
467	+ #: ../classes/settings.class.php:713
468	+ msgid "Menu"
469	+ msgstr ""
470	+
471	+ #: ../classes/settings.class.php:718
472	+ msgid "Assign a menu"
473	+ msgstr "Assigner un menu"
474	+
475	+ #: ../classes/settings.class.php:732
476	+ msgid "Location Description"
477	+ msgstr "Description d'emplacement"
478	+
479	+ #: ../classes/settings.class.php:733
480	+ msgid "Change the name of the location."
481	+ msgstr "Changer le nom de l'emplacement."
482	+
483	+ #: ../classes/settings.class.php:742
484	+ msgid "Menu Display Options"
485	+ msgstr "Options d'affichage de menu"
486	+
487	+ #: ../classes/settings.class.php:745
488	+ msgid ""
489	+ "These options are for advanced users only. Your theme should already include "
490	+ "the code required to display this menu on your site."
491	+ msgstr ""
492	+ "Ces options sont pour les utilisateurs expérimentés seulement. Votre thème "
493	+ "devrait déjà inclure le code nécessaire pour afficher ce menu sur votre site."
494	+
495	+ #: ../classes/settings.class.php:751
496	+ msgid "PHP Function"
497	+ msgstr "fonction PHP"
498	+
499	+ #: ../classes/settings.class.php:752
500	+ msgid "For use in a theme template (usually header.php)"
501	+ msgstr "Pour l'utiliser dans un modèle du thème (habituellement header.php)"
502	+
503	+ #: ../classes/settings.class.php:760
504	+ msgid "Shortcode"
505	+ msgstr ""
506	+
507	+ #: ../classes/settings.class.php:761
508	+ msgid "For use in a post or page."
509	+ msgstr "Pour l'utiliser dans un article ou dans une page."
510	+
511	+ #: ../classes/settings.class.php:769
512	+ msgid "Widget"
513	+ msgstr ""
514	+
515	+ #: ../classes/settings.class.php:770
516	+ msgid "For use in a widget area."
517	+ msgstr "Pour l'utiliser dans une zone widget."
518	+
519	+ #: ../classes/settings.class.php:773
520	+ msgid "Add the 'Max Mega Menu' widget to a widget area."
521	+ msgstr "Ajouter le widget 'Max Mega Menu' à une zone de widget."
522	+
523	+ #: ../classes/settings.class.php:791
524	+ msgid "Delete location"
525	+ msgstr "Effacer l'emplacement"
526	+
527	+ #: ../classes/settings.class.php:872 ../classes/settings.class.php:1063
528	+ msgid "Tools"
529	+ msgstr "Outils"
530	+
531	+ #: ../classes/settings.class.php:877
532	+ msgid "Cache"
533	+ msgstr ""
534	+
535	+ #: ../classes/settings.class.php:878
536	+ msgid "Use this tool to clear the CSS cache."
537	+ msgstr "Utilisez cet outil pour nettoyer le cache."
538	+
539	+ #: ../classes/settings.class.php:885
540	+ msgid "Clear CSS Cache"
541	+ msgstr "Vider le cache CSS"
542	+
543	+ #: ../classes/settings.class.php:891
544	+ msgid "Plugin Data"
545	+ msgstr "Données du plugin"
546	+
547	+ #: ../classes/settings.class.php:892
548	+ msgid ""
549	+ "Delete all saved Max Mega Menu plugin data from the database. Use with "
550	+ "caution!"
551	+ msgstr ""
552	+ "Effacer toutes les données de Max Mega Menu de la base de données. A "
553	+ "utiliser avec précaution !"
554	+
555	+ #: ../classes/settings.class.php:899
556	+ msgid "Delete Data"
557	+ msgstr "Effacer les données"
558	+
559	+ #: ../classes/settings.class.php:905 ../classes/settings.class.php:930
560	+ msgid "Export Theme"
561	+ msgstr "Exporter thème"
562	+
563	+ #: ../classes/settings.class.php:906
564	+ msgid "Export a menu theme"
565	+ msgstr "Exporter un thème de menu"
566	+
567	+ #: ../classes/settings.class.php:940 ../classes/settings.class.php:948
568	+ msgid "Import Theme"
569	+ msgstr "Importer thème"
570	+
571	+ #: ../classes/settings.class.php:941
572	+ msgid "Import a menu theme"
573	+ msgstr "Importer un thème de menu"
574	+
575	+ #: ../classes/settings.class.php:972
576	+ msgid "Homepage"
577	+ msgstr "Page d'accueil"
578	+
579	+ #: ../classes/settings.class.php:977
580	+ msgid "Documentation"
581	+ msgstr ""
582	+
583	+ #: ../classes/settings.class.php:987
584	+ msgid "Upgrade to Pro - $19"
585	+ msgstr "Mettre à jour vers Pro - 19$"
586	+
587	+ #: ../classes/settings.class.php:995
588	+ msgid "Core version"
589	+ msgstr "version du noyau"
590	+
591	+ #: ../classes/settings.class.php:999
592	+ msgid "Pro extension"
593	+ msgstr "Extension Pro"
594	+
595	+ #: ../classes/settings.class.php:1062
596	+ msgid "Menu Themes"
597	+ msgstr "Thèmes de menu"
598	+
599	+ #: ../classes/settings.class.php:1129
600	+ msgid "Failed to delete theme. The theme is in use by a menu."
601	+ msgstr ""
602	+ "Echec lors de la suppression du thème. Le thème est utilisé par un menu."
603	+
604	+ #: ../classes/settings.class.php:1133
605	+ msgid "CSS cache cleared"
606	+ msgstr "Cache CSS vidé"
607	+
608	+ #: ../classes/settings.class.php:1137
609	+ msgid "All plugin data removed"
610	+ msgstr "Tous les plugins ont été enlevés"
611	+
612	+ #: ../classes/settings.class.php:1141
613	+ msgid "Theme Deleted"
614	+ msgstr "Thème effacé"
615	+
616	+ #: ../classes/settings.class.php:1145
617	+ msgid "Theme Duplicated"
618	+ msgstr "Thème dupliqué"
619	+
620	+ #: ../classes/settings.class.php:1149
621	+ msgid "Changes Saved"
622	+ msgstr "Changements sauvegardés"
623	+
624	+ #: ../classes/settings.class.php:1153
625	+ msgid "Theme Reverted"
626	+ msgstr "Thème rétabli"
627	+
628	+ #: ../classes/settings.class.php:1157
629	+ msgid "New Theme Created"
630	+ msgstr "Nouveau thème créé"
631	+
632	+ #: ../classes/settings.class.php:1161
633	+ msgid "New Menu Location Created"
634	+ msgstr "Nouvel emplacement de thème créé"
635	+
636	+ #: ../classes/settings.class.php:1165
637	+ msgid "Menu Location Deleted"
638	+ msgstr "Emplacement de menu effacé"
639	+
640	+ #: ../classes/settings.class.php:1169
641	+ msgid "Theme Imported"
642	+ msgstr "Thème Importé"
643	+
644	+ #: ../classes/settings.class.php:1173
645	+ msgid "Theme Import Failed"
646	+ msgstr "Echec d'importation du thème"
647	+
648	+ #: ../classes/settings.class.php:1177
649	+ msgid "Theme Exported"
650	+ msgstr "Thème Exporté"
651	+
652	+ #: ../classes/settings.class.php:1271
653	+ msgid "Select theme to edit"
654	+ msgstr "Sélectionner un thème à éditer"
655	+
656	+ #: ../classes/settings.class.php:1271 ../classes/settings.class.php:1272
657	+ msgid "or"
658	+ msgstr "ou"
659	+
660	+ #: ../classes/settings.class.php:1272
661	+ msgid "create a new theme"
662	+ msgstr "Créer un nouveau thème"
663	+
664	+ #: ../classes/settings.class.php:1273
665	+ msgid "duplicate this theme"
666	+ msgstr "Dupliquer ce thème"
667	+
668	+ #: ../classes/settings.class.php:1280
669	+ msgid "Editing Theme:"
670	+ msgstr "Edition du thème :"
671	+
672	+ #: ../classes/settings.class.php:1281
673	+ msgid "General Theme Settings"
674	+ msgstr "Paramètres généraux du thème"
675	+
676	+ #: ../classes/settings.class.php:1286
677	+ msgid "Theme Title"
678	+ msgstr "Titre du thème"
679	+
680	+ #: ../classes/settings.class.php:1294
681	+ msgid "Arrow"
682	+ msgstr "Flèche"
683	+
684	+ #: ../classes/settings.class.php:1296
685	+ msgid "Select the arrow styles."
686	+ msgstr "Choisissez le stle de flèche."
687	+
688	+ #: ../classes/settings.class.php:1301
689	+ msgid "Up"
690	+ msgstr "Haut"
691	+
692	+ #: ../classes/settings.class.php:1305
693	+ msgid "Down"
694	+ msgstr "Bas"
695	+
696	+ #: ../classes/settings.class.php:1320
697	+ msgid "Responsive Breakpoint"
698	+ msgstr "Point de bascule responsive."
699	+
700	+ #: ../classes/settings.class.php:1322
701	+ msgid ""
702	+ "Set the width at which the menu turns into a mobile menu. Set to 0 to "
703	+ "disable responsive menu."
704	+ msgstr ""
705	+ "Régler la largeur à laquelle le menu se transformera en version mobile. "
706	+ "Mettez 0 pour désactiver le menu responsive."
707	+
708	+ #: ../classes/settings.class.php:1329
709	+ msgid "Responsive Menu Text"
710	+ msgstr "Text du menu responsive"
711	+
712	+ #: ../classes/settings.class.php:1331
713	+ msgid "Text to display next to the mobile toggle icon."
714	+ msgstr "Texte à afficher à côté de l'icone pour les mobiles."
715	+
716	+ #: ../classes/settings.class.php:1338
717	+ msgid "Line Height"
718	+ msgstr "Hauteur de ligne"
719	+
720	+ #: ../classes/settings.class.php:1340
721	+ msgid "Set the general line height to use in the panel contents."
722	+ msgstr ""
723	+ "Régler la hauteur de ligne général à utiliser dans le contenu des panneaux."
724	+
725	+ #: ../classes/settings.class.php:1347
726	+ msgid "Z-Index"
727	+ msgstr ""
728	+
729	+ #: ../classes/settings.class.php:1349
730	+ msgid "Set the z-index to ensure the panels appear ontop of other content."
731	+ msgstr ""
732	+ "Régler le z-index pour être sûr que les panneaux apparaîtront au-dessus des "
733	+ "autres contenus."
734	+
735	+ #: ../classes/settings.class.php:1356
736	+ msgid "Shadow"
737	+ msgstr "Ombre"
738	+
739	+ #: ../classes/settings.class.php:1358
740	+ msgid "Apply a shadow to mega and flyout menus."
741	+ msgstr "Applique une ombre au menus Mega et volant"
742	+
743	+ #: ../classes/settings.class.php:1363 ../classes/settings.class.php:1397
744	+ #: ../classes/settings.class.php:1411 ../classes/settings.class.php:1727
745	+ #: ../classes/settings.class.php:2557
746	+ msgid "Enabled"
747	+ msgstr "Activé"
748	+
749	+ #: ../classes/settings.class.php:1367
750	+ msgid "Horizonal"
751	+ msgstr ""
752	+
753	+ #: ../classes/settings.class.php:1371
754	+ msgid "Vertical"
755	+ msgstr ""
756	+
757	+ #: ../classes/settings.class.php:1375
758	+ msgid "Blur"
759	+ msgstr "Flou"
760	+
761	+ #: ../classes/settings.class.php:1379
762	+ msgid "Spread"
763	+ msgstr "Propagation"
764	+
765	+ #: ../classes/settings.class.php:1383 ../classes/settings.class.php:1575
766	+ #: ../classes/settings.class.php:1609 ../classes/settings.class.php:1657
767	+ #: ../classes/settings.class.php:1687 ../classes/settings.class.php:1731
768	+ #: ../classes/settings.class.php:1820 ../classes/settings.class.php:1902
769	+ #: ../classes/settings.class.php:1936 ../classes/settings.class.php:2010
770	+ #: ../classes/settings.class.php:2046 ../classes/settings.class.php:2080
771	+ #: ../classes/settings.class.php:2172 ../classes/settings.class.php:2208
772	+ #: ../classes/settings.class.php:2242 ../classes/settings.class.php:2371
773	+ #: ../classes/settings.class.php:2501 ../classes/settings.class.php:2535
774	+ #: ../classes/settings.class.php:2561
775	+ msgid "Color"
776	+ msgstr "Couleur"
777	+
778	+ #: ../classes/settings.class.php:1390
779	+ msgid "Hover Transitions"
780	+ msgstr "Transitions au survol"
781	+
782	+ #: ../classes/settings.class.php:1392
783	+ msgid ""
784	+ "Apply hover transitions to menu items. Note: Transitions will not apply to "
785	+ "gradient backgrounds."
786	+ msgstr ""
787	+ "Applique la transition au survol de souris aux items de menu. Note : les "
788	+ "transitions ne seront pas appliquées au couleur de fond dégradées."
789	+
790	+ #: ../classes/settings.class.php:1404
791	+ msgid "Reset Widget Styling"
792	+ msgstr "Réinitialiser le style des widgets"
793	+
794	+ #: ../classes/settings.class.php:1406
795	+ msgid "Reset the styling of widgets within the mega menu?"
796	+ msgstr "Réinitialiser le style des widgets avec le mega menu ?"
797	+
798	+ #: ../classes/settings.class.php:1418
799	+ msgid "Menu Bar"
800	+ msgstr "Barre de menu"
801	+
802	+ #: ../classes/settings.class.php:1423 ../classes/settings.class.php:2306
803	+ msgid "Menu Background"
804	+ msgstr "Couleur de fond du menu"
805	+
806	+ #: ../classes/settings.class.php:1425
807	+ msgid ""
808	+ "The background color for the main menu bar. Set each value to transparent "
809	+ "for a 'button' style menu."
810	+ msgstr ""
811	+ "La couleur de fond pour la barre de menu principale. Réglez chaque valeur à "
812	+ "transparent pour un style de menu 'bouton'."
813	+
814	+ #: ../classes/settings.class.php:1430 ../classes/settings.class.php:1517
815	+ #: ../classes/settings.class.php:1535 ../classes/settings.class.php:1763
816	+ #: ../classes/settings.class.php:2102 ../classes/settings.class.php:2264
817	+ #: ../classes/settings.class.php:2313 ../classes/settings.class.php:2427
818	+ #: ../classes/settings.class.php:2445
819	+ msgid "From"
820	+ msgstr "De"
821	+
822	+ #: ../classes/settings.class.php:1434 ../classes/settings.class.php:1521
823	+ #: ../classes/settings.class.php:1539 ../classes/settings.class.php:1767
824	+ #: ../classes/settings.class.php:2106 ../classes/settings.class.php:2268
825	+ #: ../classes/settings.class.php:2317 ../classes/settings.class.php:2431
826	+ #: ../classes/settings.class.php:2449
827	+ msgid "To"
828	+ msgstr "à"
829	+
830	+ #: ../classes/settings.class.php:1441 ../classes/settings.class.php:2337
831	+ msgid "Menu Padding"
832	+ msgstr "Padding de menu"
833	+
834	+ #: ../classes/settings.class.php:1443
835	+ msgid "Padding for the main menu bar."
836	+ msgstr "Pas pour la barre de menu principale."
837	+
838	+ #: ../classes/settings.class.php:1448 ../classes/settings.class.php:1631
839	+ #: ../classes/settings.class.php:1661 ../classes/settings.class.php:1794
840	+ #: ../classes/settings.class.php:1824 ../classes/settings.class.php:1876
841	+ #: ../classes/settings.class.php:1958 ../classes/settings.class.php:1984
842	+ #: ../classes/settings.class.php:2014 ../classes/settings.class.php:2120
843	+ #: ../classes/settings.class.php:2146 ../classes/settings.class.php:2176
844	+ #: ../classes/settings.class.php:2282 ../classes/settings.class.php:2344
845	+ #: ../classes/settings.class.php:2375 ../classes/settings.class.php:2474
846	+ msgid "Top"
847	+ msgstr "Haut"
848	+
849	+ #: ../classes/settings.class.php:1456 ../classes/settings.class.php:1639
850	+ #: ../classes/settings.class.php:1669 ../classes/settings.class.php:1802
851	+ #: ../classes/settings.class.php:1832 ../classes/settings.class.php:1884
852	+ #: ../classes/settings.class.php:1966 ../classes/settings.class.php:1992
853	+ #: ../classes/settings.class.php:2022 ../classes/settings.class.php:2128
854	+ #: ../classes/settings.class.php:2154 ../classes/settings.class.php:2184
855	+ #: ../classes/settings.class.php:2290 ../classes/settings.class.php:2352
856	+ #: ../classes/settings.class.php:2383 ../classes/settings.class.php:2482
857	+ msgid "Bottom"
858	+ msgstr "Bas"
859	+
860	+ #: ../classes/settings.class.php:1467 ../classes/settings.class.php:2394
861	+ msgid "Menu Border Radius"
862	+ msgstr "Radius de la bordure de menu"
863	+
864	+ #: ../classes/settings.class.php:1469
865	+ msgid "Set a border radius on the main menu bar."
866	+ msgstr "Régler le radius de la bordure sur la barre de menu principale."
867	+
868	+ #: ../classes/settings.class.php:1474 ../classes/settings.class.php:1701
869	+ #: ../classes/settings.class.php:1850 ../classes/settings.class.php:2401
870	+ msgid "Top Left"
871	+ msgstr "En haut à gauche"
872	+
873	+ #: ../classes/settings.class.php:1478 ../classes/settings.class.php:1705
874	+ #: ../classes/settings.class.php:1854 ../classes/settings.class.php:2405
875	+ msgid "Top Right"
876	+ msgstr "En haut à droite"
877	+
878	+ #: ../classes/settings.class.php:1482 ../classes/settings.class.php:1709
879	+ #: ../classes/settings.class.php:1858 ../classes/settings.class.php:2409
880	+ msgid "Bottom Right"
881	+ msgstr "E n bas à droite"
882	+
883	+ #: ../classes/settings.class.php:1486 ../classes/settings.class.php:1713
884	+ #: ../classes/settings.class.php:1862 ../classes/settings.class.php:2413
885	+ msgid "Bottom Left"
886	+ msgstr "En bas à gauche"
887	+
888	+ #: ../classes/settings.class.php:1493
889	+ msgid "Menu Items Align"
890	+ msgstr "Alignement des items du menu"
891	+
892	+ #: ../classes/settings.class.php:1495
893	+ msgid ""
894	+ "Align <i>all</i> menu items to the left (default), centrally or to the right."
895	+ msgstr ""
896	+ "Aligner <i>tous</i> les items de menu (la barre de menu) à gauche (par "
897	+ "défaut), centré ou à droite."
898	+
899	+ #: ../classes/settings.class.php:1500
900	+ msgid ""
901	+ "This option will apply to all menu items. To align an individual menu item "
902	+ "to the right, edit the menu item itself and set 'Menu Item Align' to 'Right'."
903	+ msgstr ""
904	+ "Cette option s'appliquera à tous les éléments du menu. Pour aligner un item "
905	+ "du menu spécifique à droite, éditez l'item de menu lui-même et définissez "
906	+ "'Alignement d'item de menu' à 'Droite'."
907	+
908	+ #: ../classes/settings.class.php:1505
909	+ msgid "Top Level Menu Items"
910	+ msgstr "Items de menu du plus haut niveau"
911	+
912	+ #: ../classes/settings.class.php:1510
913	+ msgid "Menu Item Background"
914	+ msgstr "Couleur de fond d'item de menu"
915	+
916	+ #: ../classes/settings.class.php:1512
917	+ msgid ""
918	+ "The background color for each top level menu item. Tip: Set these values to "
919	+ "transparent if you've already set a background color on the menu bar."
920	+ msgstr ""
921	+ "La couleur de fond pour chaque item de menu du niveau le plus haut. Astuce : "
922	+ "Définissez ces valeurs à transparent si vous avez déjà défini une couleur de "
923	+ "fond à la barre de menu."
924	+
925	+ #: ../classes/settings.class.php:1528
926	+ msgid "Menu Item Background (Hover)"
927	+ msgstr "Couleur de fond d'item de menu (au survol de la souris)"
928	+
929	+ #: ../classes/settings.class.php:1530
930	+ msgid "The background color for a top level menu item (on hover)."
931	+ msgstr ""
932	+ "Couleur de fond pour un item du menu du plus haut niveau (au survol de la "
933	+ "souris)."
934	+
935	+ #: ../classes/settings.class.php:1546
936	+ msgid "Menu Item Spacing"
937	+ msgstr "Espacement d'item du menu"
938	+
939	+ #: ../classes/settings.class.php:1548
940	+ msgid "Define the size of the gap between each top level menu item."
941	+ msgstr ""
942	+ "Définir la taille de l'écart entre chaque élément du niveau le plus haut."
943	+
944	+ #: ../classes/settings.class.php:1557
945	+ msgid "Menu Item Height"
946	+ msgstr "Hauteur d'item du menu"
947	+
948	+ #: ../classes/settings.class.php:1559
949	+ msgid ""
950	+ "Define the height of each top level menu item. This value, plus the "
951	+ "container top and bottom padding values define the overall height of the "
952	+ "menu bar."
953	+ msgstr ""
954	+ "Définir la hauteur de chaque item de menu du plus haut niveau. Cette valeur, "
955	+ "plus les valeurs de pas haut et bas du contenant définissent la hauteur "
956	+ "totale de la barre de menu."
957	+
958	+ #: ../classes/settings.class.php:1568 ../classes/settings.class.php:2039
959	+ #: ../classes/settings.class.php:2201
960	+ msgid "Font"
961	+ msgstr "Police"
962	+
963	+ #: ../classes/settings.class.php:1570
964	+ msgid "The font to use for each top level menu item."
965	+ msgstr "La police à utiliser pour chaque item de menu du plus haut niveau."
966	+
967	+ #: ../classes/settings.class.php:1579 ../classes/settings.class.php:1906
968	+ #: ../classes/settings.class.php:1940 ../classes/settings.class.php:2050
969	+ #: ../classes/settings.class.php:2212 ../classes/settings.class.php:2505
970	+ msgid "Size"
971	+ msgstr "Taille"
972	+
973	+ #: ../classes/settings.class.php:1583 ../classes/settings.class.php:1910
974	+ #: ../classes/settings.class.php:1944 ../classes/settings.class.php:2054
975	+ #: ../classes/settings.class.php:2216 ../classes/settings.class.php:2509
976	+ msgid "Family"
977	+ msgstr "Famille"
978	+
979	+ #: ../classes/settings.class.php:1587 ../classes/settings.class.php:1918
980	+ #: ../classes/settings.class.php:2062 ../classes/settings.class.php:2224
981	+ #: ../classes/settings.class.php:2513
982	+ msgid "Transform"
983	+ msgstr "Transformation"
984	+
985	+ #: ../classes/settings.class.php:1591 ../classes/settings.class.php:1613
986	+ #: ../classes/settings.class.php:1914 ../classes/settings.class.php:2058
987	+ #: ../classes/settings.class.php:2084 ../classes/settings.class.php:2220
988	+ #: ../classes/settings.class.php:2246 ../classes/settings.class.php:2517
989	+ #: ../classes/settings.class.php:2539
990	+ msgid "Weight"
991	+ msgstr "Poids"
992	+
993	+ #: ../classes/settings.class.php:1595 ../classes/settings.class.php:1617
994	+ #: ../classes/settings.class.php:1922 ../classes/settings.class.php:2066
995	+ #: ../classes/settings.class.php:2088 ../classes/settings.class.php:2228
996	+ #: ../classes/settings.class.php:2250 ../classes/settings.class.php:2521
997	+ #: ../classes/settings.class.php:2543
998	+ msgid "Decoration"
999	+ msgstr "Décoration"
1000	+
1001	+ #: ../classes/settings.class.php:1602 ../classes/settings.class.php:2073
1002	+ #: ../classes/settings.class.php:2235
1003	+ msgid "Font (Hover)"
1004	+ msgstr "Police (au survol de la souris)"
1005	+
1006	+ #: ../classes/settings.class.php:1604
1007	+ msgid "Set the font to use for each top level menu item (on hover)."
1008	+ msgstr ""
1009	+ "Régler la police à utiliser pour chaque item de menu du plus niveau (au "
1010	+ "survol de la souris)."
1011	+
1012	+ #: ../classes/settings.class.php:1624
1013	+ msgid "Menu Item Padding"
1014	+ msgstr "Padding d'item de menu"
1015	+
1016	+ #: ../classes/settings.class.php:1626
1017	+ msgid "Set the padding for each top level menu item."
1018	+ msgstr "Régler le pas pour chaque item du menu du plus haut niveau."
1019	+
1020	+ #: ../classes/settings.class.php:1650
1021	+ msgid "Menu Item Border"
1022	+ msgstr "Bordure d'item du menu"
1023	+
1024	+ #: ../classes/settings.class.php:1652
1025	+ msgid "Set the border to display on each top level menu item."
1026	+ msgstr ""
1027	+ "Régler la bordure à afficher sur chaque item de menu du plus haut niveau."
1028	+
1029	+ #: ../classes/settings.class.php:1680
1030	+ msgid "Menu Item Border (Hover)"
1031	+ msgstr "Bordure d'item de menu (au survol de la souris)"
1032	+
1033	+ #: ../classes/settings.class.php:1682
1034	+ msgid "Set the hover border color."
1035	+ msgstr "Régler la couleur de la bordure au survol de la souris."
1036	+
1037	+ #: ../classes/settings.class.php:1694
1038	+ msgid "Menu Item Border Radius"
1039	+ msgstr "Radius des bordures des items du menu"
1040	+
1041	+ #: ../classes/settings.class.php:1696
1042	+ msgid "Set rounded corners for each top level menu item."
1043	+ msgstr ""
1044	+ "Régler des bords arrondis pour chaque item de menu du plus haut niveau."
1045	+
1046	+ #: ../classes/settings.class.php:1720
1047	+ msgid "Menu Item Divider"
1048	+ msgstr "Séparateur d'item de menu"
1049	+
1050	+ #: ../classes/settings.class.php:1722
1051	+ msgid "Show a small divider bar between each menu item."
1052	+ msgstr "Afficher une petite barre de séparation entre chaque item de menu."
1053	+
1054	+ #: ../classes/settings.class.php:1735
1055	+ msgid "Glow Opacity"
1056	+ msgstr "Opacité de la lueur"
1057	+
1058	+ #: ../classes/settings.class.php:1742
1059	+ msgid "Highlight Current Item"
1060	+ msgstr "Item actuel en surbrillance"
1061	+
1062	+ #: ../classes/settings.class.php:1744
1063	+ msgid "Apply the 'hover' styling to current menu items."
1064	+ msgstr ""
1065	+ "Appliquer le style 'survol de la souris' (hover) aux items de menu actuels."
1066	+
1067	+ #: ../classes/settings.class.php:1751
1068	+ msgid "Mega Panels"
1069	+ msgstr "Mega Panneaux"
1070	+
1071	+ #: ../classes/settings.class.php:1756
1072	+ msgid "Panel Background"
1073	+ msgstr "Couleur de fond du panneau"
1074	+
1075	+ #: ../classes/settings.class.php:1758
1076	+ msgid "Set a background color for a whole panel."
1077	+ msgstr "Régler une couleur de fond pour tout le panneau."
1078	+
1079	+ #: ../classes/settings.class.php:1774
1080	+ msgid "Panel Width"
1081	+ msgstr "Largeur de panneau"
1082	+
1083	+ #: ../classes/settings.class.php:1776
1084	+ msgid "Mega Panel width"
1085	+ msgstr "Largeur de Mega Panneau"
1086	+
1087	+ #: ../classes/settings.class.php:1781
1088	+ msgid ""
1089	+ "A 100% wide panel will only ever be as wide as the menu itself. For a fixed "
1090	+ "panel width set this to a pixel value."
1091	+ msgstr ""
1092	+ "Un panneau large de 100% sera seulement aussi large que le menu lui-même. "
1093	+ "Pour une taille fixe de panneau, définissez celle-ci en pixel."
1094	+
1095	+ #: ../classes/settings.class.php:1782
1096	+ msgid ""
1097	+ "Advanced: Enter a jQuery selector to synchronize the width and position of "
1098	+ "the sub menu with existing page element (e.g. body, #container, .page)."
1099	+ msgstr ""
1100	+ "Avancé : Entrez un sélecteur jQuery pour synchroniser la largeur et la "
1101	+ "position du sous-menu avec un élement existant de la page (ex : body, "
1102	+ "#container, .page)."
1103	+
1104	+ #: ../classes/settings.class.php:1787
1105	+ msgid "Panel Padding"
1106	+ msgstr "Padding de panneau"
1107	+
1108	+ #: ../classes/settings.class.php:1789
1109	+ msgid ""
1110	+ "Set the padding for the whole panel. Set these values 0px if you wish your "
1111	+ "panel content to go edge-to-edge."
1112	+ msgstr ""
1113	+ "Régler le pas pour tout le panneau. Définissez cette valeur à 0px si vous "
1114	+ "souhaitez que le contenu de votre panneau soit bord-à-bord."
1115	+
1116	+ #: ../classes/settings.class.php:1813
1117	+ msgid "Panel Border"
1118	+ msgstr "Bordure du panneau"
1119	+
1120	+ #: ../classes/settings.class.php:1815
1121	+ msgid "Set the border to display on the Mega Panel."
1122	+ msgstr "Régler la bordure à afficher sur le Mega Panneau."
1123	+
1124	+ #: ../classes/settings.class.php:1843
1125	+ msgid "Panel Border Radius"
1126	+ msgstr "Radius de la bordure du panneau"
1127	+
1128	+ #: ../classes/settings.class.php:1845
1129	+ msgid "Set rounded corners for the panel."
1130	+ msgstr "Définir des bords arrondis pour le panneau."
1131	+
1132	+ #: ../classes/settings.class.php:1869
1133	+ msgid "Widget Padding"
1134	+ msgstr "Paddind de widget"
1135	+
1136	+ #: ../classes/settings.class.php:1871
1137	+ msgid ""
1138	+ "Set the padding for each widget in the panel. Use this to define the spacing "
1139	+ "between each widget in the panel."
1140	+ msgstr ""
1141	+ "Régler le pas pour chaque widget dans le panneau. Utilisez cela pour définir "
1142	+ "un espace entre chaque widget dans le panneau."
1143	+
1144	+ #: ../classes/settings.class.php:1895
1145	+ msgid "Widget Heading Font"
1146	+ msgstr "Police d'en-tête de widget"
1147	+
1148	+ #: ../classes/settings.class.php:1897
1149	+ msgid ""
1150	+ "Set the font to use Widget headers in the mega menu. Tip: set this to the "
1151	+ "same style as the Second Level Menu Item Header font to keep your styling "
1152	+ "consistent."
1153	+ msgstr ""
1154	+ "Définissez la police à utiliser en en-tête de widget dans un Mega Menu. "
1155	+ "Astuce : définissez le même style qu'avec la police des en-têtes des items "
1156	+ "de menu de 2ème niveau pour garder une cohérence de style."
1157	+
1158	+ #: ../classes/settings.class.php:1929
1159	+ msgid "Widget Content Font"
1160	+ msgstr "Police du contenu de widget"
1161	+
1162	+ #: ../classes/settings.class.php:1931
1163	+ msgid "Set the font to use for panel contents."
1164	+ msgstr "Définissez la police à utiliser pour le contenu du panneau."
1165	+
1166	+ #: ../classes/settings.class.php:1951
1167	+ msgid "Widget Heading Padding"
1168	+ msgstr "Padding des en-têtes de widget"
1169	+
1170	+ #: ../classes/settings.class.php:1953
1171	+ msgid "Set the padding for the widget headings."
1172	+ msgstr "Régler le pas pour les en-têtes de widget."
1173	+
1174	+ #: ../classes/settings.class.php:1977
1175	+ msgid "Widget Heading Margin"
1176	+ msgstr "Marge des en-têtes de widget"
1177	+
1178	+ #: ../classes/settings.class.php:1979
1179	+ msgid "Set the margin for the widget headings."
1180	+ msgstr "Régler la marge pour les en-têtes de widget."
1181	+
1182	+ #: ../classes/settings.class.php:2003 ../classes/settings.class.php:2165
1183	+ msgid "Border"
1184	+ msgstr "Bordure"
1185	+
1186	+ #: ../classes/settings.class.php:2005
1187	+ msgid "Set the border for the widget headings."
1188	+ msgstr "Régler la bordure pour les en-têtes du widget."
1189	+
1190	+ #: ../classes/settings.class.php:2033
1191	+ msgid "Second Level Menu Items"
1192	+ msgstr "Items du menu de 2ème niveau"
1193	+
1194	+ #: ../classes/settings.class.php:2041
1195	+ msgid ""
1196	+ "Set the font for second level menu items when they're displayed in a Mega "
1197	+ "Menu."
1198	+ msgstr ""
1199	+ "Régler la police pour les items du menu de 2ème niveau quand ils sont "
1200	+ "affichés dans un Mega Menu."
1201	+
1202	+ #: ../classes/settings.class.php:2075 ../classes/settings.class.php:2237
1203	+ msgid "Set the font style on hover."
1204	+ msgstr "Régler le style de police au survol de la souris."
1205	+
1206	+ #: ../classes/settings.class.php:2095 ../classes/settings.class.php:2257
1207	+ msgid "Background (Hover)"
1208	+ msgstr "Couleur de fond (au survol de la souris)"
1209	+
1210	+ #: ../classes/settings.class.php:2097
1211	+ msgid "Set the background hover color for second level menu items."
1212	+ msgstr ""
1213	+ "Régler la couleur de fond au survol de la souris pour les items de menus de "
1214	+ "2ème niveau."
1215	+
1216	+ #: ../classes/settings.class.php:2113 ../classes/settings.class.php:2275
1217	+ msgid "Padding"
1218	+ msgstr ""
1219	+
1220	+ #: ../classes/settings.class.php:2115
1221	+ msgid "Set the padding for the second level menu items."
1222	+ msgstr "Régler le pas pour les items du menu de 2ème niveau."
1223	+
1224	+ #: ../classes/settings.class.php:2139
1225	+ msgid "Margin"
1226	+ msgstr "Marge"
1227	+
1228	+ #: ../classes/settings.class.php:2141
1229	+ msgid "Set the margin for the second level menu items."
1230	+ msgstr "Régler la marge pour les items du menu de 2ème niveau."
1231	+
1232	+ #: ../classes/settings.class.php:2167
1233	+ msgid "Set the border for the second level menu items."
1234	+ msgstr "Régler la bordure pour les items du menu de 2ème niveau."
1235	+
1236	+ #: ../classes/settings.class.php:2195
1237	+ msgid "Third Level Menu Items"
1238	+ msgstr "Items de 3ème niveau du menu"
1239	+
1240	+ #: ../classes/settings.class.php:2203
1241	+ msgid ""
1242	+ "Set the font for third level menu items when they're displayed in a Mega "
1243	+ "Menu."
1244	+ msgstr ""
1245	+ "Régler la police pour les items du menu de 3ème niveau quand ils seront "
1246	+ "affichés dans un Mega Menu."
1247	+
1248	+ #: ../classes/settings.class.php:2259
1249	+ msgid "Set the background hover color for third level menu items."
1250	+ msgstr ""
1251	+ "Régler la couleur de fond au survol de la souris pour les items du menu de "
1252	+ "3ème niveau."
1253	+
1254	+ #: ../classes/settings.class.php:2277
1255	+ msgid "Set the padding for the third level menu items."
1256	+ msgstr "Régler le pas pour les items du menu de 3ème niveau."
1257	+
1258	+ #: ../classes/settings.class.php:2301
1259	+ msgid "Flyout Menus"
1260	+ msgstr "Menus volants"
1261	+
1262	+ #: ../classes/settings.class.php:2308
1263	+ msgid "Set the background color for the flyout menu."
1264	+ msgstr "Régler la couleur de fond du menu volant."
1265	+
1266	+ #: ../classes/settings.class.php:2325
1267	+ msgid "Menu Width"
1268	+ msgstr "Largeur du menu"
1269	+
1270	+ #: ../classes/settings.class.php:2327
1271	+ msgid "The width of each flyout menu. This must be a fixed pixel value."
1272	+ msgstr "La largeur de chaque menu volant. Ce doit être une valeur fixe."
1273	+
1274	+ #: ../classes/settings.class.php:2332
1275	+ msgid ""
1276	+ "Set this value to the width of your longest menu item title to stop menu "
1277	+ "items wrapping onto 2 lines."
1278	+ msgstr ""
1279	+ "Régler cette valeur à la largeur de votre titre d'item de menu le plus grand "
1280	+ "pour que votre menu ne se retrouve plus sur 2 lignes."
1281	+
1282	+ #: ../classes/settings.class.php:2339
1283	+ msgid "Set the padding for the whole flyout menu."
1284	+ msgstr "Régler le pas pour tout le menu volant."
1285	+
1286	+ #: ../classes/settings.class.php:2359
1287	+ msgid ""
1288	+ "Only suitable for single level flyout menus. If you're using multi level "
1289	+ "flyout menus set these values to 0px."
1290	+ msgstr ""
1291	+ "Applicable seulement au premier niveau des menus volants. Si vous utilisez "
1292	+ "plusieurs niveaux de menus volants réglez cette valeur à 0px."
1293	+
1294	+ #: ../classes/settings.class.php:2364
1295	+ msgid "Menu Border"
1296	+ msgstr "Bordure du menu"
1297	+
1298	+ #: ../classes/settings.class.php:2366
1299	+ msgid "Set the border for the flyout menu."
1300	+ msgstr "Régler la bordure pour les menus volants."
1301	+
1302	+ #: ../classes/settings.class.php:2396
1303	+ msgid ""
1304	+ "Set rounded corners for flyout menus. Rounded corners will be applied to all "
1305	+ "flyout menu levels."
1306	+ msgstr ""
1307	+ "Régler l'arrondi des angles pour les menus volants. Les angles arrondis "
1308	+ "seront appliqués à tous les niveaux des menus volants."
1309	+
1310	+ #: ../classes/settings.class.php:2420
1311	+ msgid "Item Background"
1312	+ msgstr "Couleur de fond de l'item"
1313	+
1314	+ #: ../classes/settings.class.php:2422
1315	+ msgid "Set the background color for a flyout menu item."
1316	+ msgstr "Régler la couleur de fond pour un item du menu volant."
1317	+
1318	+ #: ../classes/settings.class.php:2438
1319	+ msgid "Item Background (Hover)"
1320	+ msgstr "Couleur de fond de l'item (au survol de la souris)"
1321	+
1322	+ #: ../classes/settings.class.php:2440
1323	+ msgid "Set the background color for a flyout menu item (on hover)."
1324	+ msgstr ""
1325	+ "Régler la couleur de fond pour un item du menu volant (au survol de la "
1326	+ "souris)."
1327	+
1328	+ #: ../classes/settings.class.php:2456
1329	+ msgid "Item Height"
1330	+ msgstr "Hauteur de l'item"
1331	+
1332	+ #: ../classes/settings.class.php:2458
1333	+ msgid "The height of each flyout menu item."
1334	+ msgstr "La hauteur de chaque item du menu volant."
1335	+
1336	+ #: ../classes/settings.class.php:2467
1337	+ msgid "Item Padding"
1338	+ msgstr "Padding de l'item"
1339	+
1340	+ #: ../classes/settings.class.php:2469
1341	+ msgid "Set the padding for each flyout menu item."
1342	+ msgstr "Régler le pas pour chaque item du menu volant."
1343	+
1344	+ #: ../classes/settings.class.php:2494
1345	+ msgid "Item Font"
1346	+ msgstr "Police de l'item"
1347	+
1348	+ #: ../classes/settings.class.php:2496
1349	+ msgid "Set the font for the flyout menu items."
1350	+ msgstr "Régler la police pour les items du menu volant"
1351	+
1352	+ #: ../classes/settings.class.php:2528
1353	+ msgid "Item Font (Hover)"
1354	+ msgstr "Police de l'item (au survol de la souris)"
1355	+
1356	+ #: ../classes/settings.class.php:2530
1357	+ msgid "Set the font weight for the flyout menu items (on hover)."
1358	+ msgstr ""
1359	+ "Régler le poids de la police pour les items du menus volants (au survol de "
1360	+ "la souris)"
1361	+
1362	+ #: ../classes/settings.class.php:2550
1363	+ msgid "Item Divider"
1364	+ msgstr "Séparateur d'item"
1365	+
1366	+ #: ../classes/settings.class.php:2552
1367	+ msgid "Show a line divider below each menu item."
1368	+ msgstr "Afficher une ligne séparatrice entre chaque item du menu."
1369	+
1370	+ #: ../classes/settings.class.php:2568
1371	+ msgid "Custom Styling"
1372	+ msgstr "Style personnalisé"
1373	+
1374	+ #: ../classes/settings.class.php:2573
1375	+ msgid "CSS Editor"
1376	+ msgstr "Editeur CSS"
1377	+
1378	+ #: ../classes/settings.class.php:2575
1379	+ msgid ""
1380	+ "Define any custom CSS you wish to add to menus using this theme. You can use "
1381	+ "standard CSS or SCSS."
1382	+ msgstr ""
1383	+ "Définissez des règles CSS que vous souhaitez ajouter aux menus utilisant ce "
1384	+ "thème. Vous pouvez utiliser du CSS standard ou du SCSS."
1385	+
1386	+ #: ../classes/settings.class.php:2581
1387	+ msgid "Custom Styling Tips"
1388	+ msgstr "Astuce de style personnalisé"
1389	+
1390	+ #: ../classes/settings.class.php:2583
1391	+ msgid ""
1392	+ "converts to the ID selector of the menu wrapper, e.g. div#mega-menu-wrap-"
1393	+ "primary"
1394	+ msgstr ""
1395	+ "converti vers le sélecteur ID du menu wrapper, ex : ul#mega-menu-wrap-primary"
1396	+
1397	+ #: ../classes/settings.class.php:2584
1398	+ msgid "converts to the ID selector of the menu, e.g. ul#mega-menu-primary"
1399	+ msgstr "converti vers le sélecteur ID du menu, ex : ul#mega-menu-primary"
1400	+
1401	+ #: ../classes/settings.class.php:2585
1402	+ msgid ""
1403	+ "Use @import rules to import CSS from other plugins or your theme directory, "
1404	+ "e.g:"
1405	+ msgstr ""
1406	+ "Utilisez la règle @import pour importer une CSS d'un autre plugin ou du "
1407	+ "répertoire de votre thème, ex :"
1408	+
1409	+ #: ../classes/settings.class.php:2598
1410	+ msgid "Delete Theme"
1411	+ msgstr "Supprimer le thème"
1412	+
1413	+ #: ../classes/settings.class.php:2600
1414	+ msgid "Revert Theme"
1415	+ msgstr "Rétablir le thème"
1416	+
1417	+ #: ../classes/settings.class.php:2627
1418	+ msgid "Center"
1419	+ msgstr "Centré"
1420	+
1421	+ #: ../classes/settings.class.php:2649
1422	+ msgid "Underline"
1423	+ msgstr "Souligné"
1424	+
1425	+ #: ../classes/settings.class.php:2693
1426	+ msgid "Disabled"
1427	+ msgstr "Désactivé"
1428	+
1429	+ #: ../classes/settings.class.php:2750 ../classes/settings.class.php:2829
1430	+ msgid "Theme Default"
1431	+ msgstr "Thème par défaut"
1432	+
1433	+ #: ../classes/settings.class.php:2751
1434	+ msgid "Light (300)"
1435	+ msgstr "Léger (300)"
1436	+
1437	+ #: ../classes/settings.class.php:2752
1438	+ msgid "Normal (400)"
1439	+ msgstr ""
1440	+
1441	+ #: ../classes/settings.class.php:2753
1442	+ msgid "Bold (700)"
1443	+ msgstr "Gras (700)"
1444	+
1445	+ #: ../classes/settings.class.php:2791
1446	+ msgid "Normal"
1447	+ msgstr ""
1448	+
1449	+ #: ../classes/settings.class.php:2792
1450	+ msgid "Capitalize"
1451	+ msgstr "Capitalisation"
1452	+
1453	+ #: ../classes/settings.class.php:2793
1454	+ msgid "Uppercase"
1455	+ msgstr "Majuscule"
1456	+
1457	+ #: ../classes/settings.class.php:2794
1458	+ msgid "Lowercase"
1459	+ msgstr "minuscule"
1460	+
1461	+ #: ../classes/settings.class.php:2933
1462	+ msgid "Are you sure?"
1463	+ msgstr "Etes-vous sûr ?"
1464	+
1465	+ #: ../classes/style-manager.class.php:80
1466	+ msgid "Default"
1467	+ msgstr "Défaut"
1468	+
1469	+ #: ../classes/style-manager.class.php:543
1470	+ msgid ""
1471	+ "Warning: CSS compilation failed. Please check your changes or revert the "
1472	+ "theme."
1473	+ msgstr ""
1474	+ "Attention : Echec lors de la compilation de la CSS. Vérifiez vos changements "
1475	+ "ou rétablissez votre thème."
1476	+
1477	+ #: ../classes/widget-manager.class.php:76
1478	+ msgid "Mega Menu Widgets"
1479	+ msgstr "Widgets Mega Menu"
1480	+
1481	+ #: ../classes/widget-manager.class.php:77
1482	+ msgid "Do not manually edit this area."
1483	+ msgstr "N'éditez pas manuellement cet emplacement."
1484	+
1485	+ #: ../classes/widget-manager.class.php:116
1486	+ #, php-format
1487	+ msgid "Saved %s"
1488	+ msgstr "%s sauvegardé"
1489	+
1490	+ #: ../classes/widget-manager.class.php:118
1491	+ #, php-format
1492	+ msgid "Failed to save %s"
1493	+ msgstr "Echec lors de la sauvegarde de %s"
1494	+
1495	+ #: ../classes/widget-manager.class.php:139
1496	+ #, php-format
1497	+ msgid "Updated %s (new columns: %d)"
1498	+ msgstr "Mise à jour de %s (nouvelle colonne : %d)"
1499	+
1500	+ #: ../classes/widget-manager.class.php:141
1501	+ #, php-format
1502	+ msgid "Failed to update %s"
1503	+ msgstr "Echec lors de la mise à jour de %s"
1504	+
1505	+ #: ../classes/widget-manager.class.php:165
1506	+ #, php-format
1507	+ msgid "Failed to add %s to %d"
1508	+ msgstr "Echec lors de l'ajout de %s vers %d"
1509	+
1510	+ #: ../classes/widget-manager.class.php:185
1511	+ #, php-format
1512	+ msgid "Deleted %s"
1513	+ msgstr "%s supprimé"
1514	+
1515	+ #: ../classes/widget-manager.class.php:187
1516	+ #, php-format
1517	+ msgid "Failed to delete %s"
1518	+ msgstr "Echec lors de la suppresion de %s"
1519	+
1520	+ #: ../classes/widget-manager.class.php:209
1521	+ #, php-format
1522	+ msgid "Moved %s to %d (%s)"
1523	+ msgstr "Déplacement de %s vers %d (%s)"
1524	+
1525	+ #: ../classes/widget-manager.class.php:211
1526	+ #, php-format
1527	+ msgid "Failed to move %s to %d"
1528	+ msgstr "Echec lors du déplacement de %s vers %d"
1529	+
1530	+ #: ../classes/widget-manager.class.php:458
1531	+ msgid "Delete"
1532	+ msgstr "Supprimer"
1533	+
1534	+ #: ../classes/widget-manager.class.php:459
1535	+ msgid "Close"
1536	+ msgstr "Fermer"
1537	+
1538	+ #: ../classes/widget.class.php:21
1539	+ msgid "Outputs a menu for a selected theme location."
1540	+ msgstr "Sorties de menu pour un emplacement sélectionné de thème."
1541	+
1542	+ #: ../classes/widget.class.php:97
1543	+ msgid "Title:"
1544	+ msgstr "Titre :"
1545	+
1546	+ #: ../classes/widget.class.php:100
1547	+ msgid "Menu Location:"
1548	+ msgstr "Emplacement de menu"
1549	+
1550	+ #: ../classes/widget.class.php:109
1551	+ msgid "No menu locations found"
1552	+ msgstr "Aucun emplacement de menu trouvé"
1553	+
1554	+ #~ msgid "regenerate the CSS"
1555	+ #~ msgstr "Regénérer le CSS"
1556	+
1557	+ #~ msgid "Regenerate CSS"
1558	+ #~ msgstr "Regénération CSS"
1559	+
1560	+ #~ msgid "Bold"
1561	+ #~ msgstr "Gras"
1562	+
1563	+ #~ msgid "Menu Settings"
1564	+ #~ msgstr "Paramètres du menu"
1565	+
1566	+ #~ msgid ""
1567	+ #~ "Menu specific settings (e.g, click or hover event, menu theme, transition "
1568	+ #~ "effect) can be found under"
1569	+ #~ msgstr ""
1570	+ #~ "Paramètres spécifiques du menu (ex: clic ou survol, thème du menu, effet "
1571	+ #~ "de transition) peuvent être trouver sous"
1572	+
1573	+ #~ msgid "Appearance > Menus"
1574	+ #~ msgstr "Apparence > Menus"
1575	+
1576	+ #~ msgid "Regenerate the CSS."
1577	+ #~ msgstr "Regénérer le CSS"
1578	+
1579	+ #~ msgid "Theme Editor"
1580	+ #~ msgstr "Editeur de thème"

languages/megamenu-it_IT.mo ADDED Viewed

Binary file

languages/megamenu-it_IT.po ADDED Viewed

	@@ -0,0 +1,1039 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: megamenu\n"
4	+ "POT-Creation-Date: 2015-03-28 18:52-0000\n"
5	+ "PO-Revision-Date: 2015-03-28 18:52-0000\n"
6	+ "Last-Translator: \n"
7	+ "Language-Team: \n"
8	+ "Language: en\n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "X-Generator: Poedit 1.5.7\n"
13	+ "X-Poedit-KeywordsList: __;_e\n"
14	+ "X-Poedit-Basepath: .\n"
15	+ "X-Poedit-SearchPath-0: ..\n"
16	+ "X-Poedit-SearchPath-1: .\n"
17	+
18	+ #: ../megamenu.php:456
19	+ #, fuzzy
20	+ msgid ""
21	+ "Max Mega Menu is not compatible with your version of WordPress. Please "
22	+ "upgrade WordPress to the latest version or disable Max Mega Menu."
23	+ msgstr ""
24	+ "Mega Menu non è compatibile con la tua versione di WordPress. Si prega di "
25	+ "aggiornare WordPress alla versione più recente o disattivare Mega Menu."
26	+
27	+ #: ../megamenu.php:467
28	+ #, fuzzy
29	+ msgid ""
30	+ "Max Mega Menu is not compatible with Uber Menu. Please disable Uber Menu."
31	+ msgstr ""
32	+ "Mega Menu non è compatibile con Uber Menu. Si prega di disattivare Uber Menu."
33	+
34	+ #: ../megamenu.php:480
35	+ msgid "click here"
36	+ msgstr ""
37	+
38	+ #: ../megamenu.php:483
39	+ #, php-format
40	+ msgid "Thanks for installing Max Mega Menu! Please %s to get started."
41	+ msgstr ""
42	+
43	+ #: ../classes/menu-item-manager.class.php:171
44	+ #: ../classes/menu-item-manager.class.php:264
45	+ #: ../classes/nav-menus.class.php:127
46	+ #, fuzzy
47	+ msgid "Mega Menu"
48	+ msgstr "Pannello di Mega Menu"
49	+
50	+ #: ../classes/menu-item-manager.class.php:172
51	+ msgid "Mega Menus can only be created on top level menu items."
52	+ msgstr ""
53	+
54	+ #: ../classes/menu-item-manager.class.php:183
55	+ msgid "Enable Mega Menu"
56	+ msgstr ""
57	+
58	+ #: ../classes/menu-item-manager.class.php:186
59	+ msgid "column"
60	+ msgstr ""
61	+
62	+ #: ../classes/menu-item-manager.class.php:187
63	+ #: ../classes/menu-item-manager.class.php:188
64	+ #: ../classes/menu-item-manager.class.php:189
65	+ #: ../classes/menu-item-manager.class.php:190
66	+ #: ../classes/menu-item-manager.class.php:191
67	+ #: ../classes/menu-item-manager.class.php:192
68	+ #: ../classes/menu-item-manager.class.php:193
69	+ msgid "columns"
70	+ msgstr ""
71	+
72	+ #: ../classes/menu-item-manager.class.php:197
73	+ #, fuzzy
74	+ msgid "Select a Widget to add to the panel"
75	+ msgstr "Selezionate un widget da visualizzare nel Pannello Mega"
76	+
77	+ #: ../classes/menu-item-manager.class.php:213
78	+ #, fuzzy
79	+ msgid "Sub menu items"
80	+ msgstr "Tipo di sottomenu"
81	+
82	+ #: ../classes/menu-item-manager.class.php:233
83	+ msgid "Widgets"
84	+ msgstr ""
85	+
86	+ #: ../classes/menu-item-manager.class.php:258
87	+ msgid ""
88	+ "No widgets found. Add a widget to this area using the Widget Selector (top "
89	+ "right)"
90	+ msgstr ""
91	+
92	+ #: ../classes/menu-item-manager.class.php:284
93	+ #, fuzzy
94	+ msgid "Menu Item Settings"
95	+ msgstr "Impostazioni Mega Menu"
96	+
97	+ #: ../classes/menu-item-manager.class.php:288
98	+ msgid "Hide Text"
99	+ msgstr ""
100	+
101	+ #: ../classes/menu-item-manager.class.php:295
102	+ #: ../classes/menu-item-manager.class.php:331
103	+ #: ../classes/menu-item-manager.class.php:356
104	+ msgid "Option only available for top level menu items"
105	+ msgstr ""
106	+
107	+ #: ../classes/menu-item-manager.class.php:302
108	+ msgid "Hide Arrow"
109	+ msgstr ""
110	+
111	+ #: ../classes/menu-item-manager.class.php:310
112	+ #, fuzzy
113	+ msgid "Disable Link"
114	+ msgstr "Disabilitato"
115	+
116	+ #: ../classes/menu-item-manager.class.php:318
117	+ msgid "Menu Item Align"
118	+ msgstr ""
119	+
120	+ #: ../classes/menu-item-manager.class.php:324
121	+ #: ../classes/menu-item-manager.class.php:349
122	+ #: ../classes/settings.class.php:815 ../classes/settings.class.php:904
123	+ #: ../classes/settings.class.php:1086 ../classes/settings.class.php:1208
124	+ #: ../classes/settings.class.php:1234 ../classes/settings.class.php:1286
125	+ #: ../classes/settings.class.php:1368 ../classes/settings.class.php:1447
126	+ #: ../classes/settings.class.php:1488 ../classes/settings.class.php:1641
127	+ msgid "Left"
128	+ msgstr "Sinistra"
129	+
130	+ #: ../classes/menu-item-manager.class.php:325
131	+ #: ../classes/menu-item-manager.class.php:350
132	+ #: ../classes/settings.class.php:819 ../classes/settings.class.php:896
133	+ #: ../classes/settings.class.php:1078 ../classes/settings.class.php:1200
134	+ #: ../classes/settings.class.php:1226 ../classes/settings.class.php:1278
135	+ #: ../classes/settings.class.php:1360 ../classes/settings.class.php:1439
136	+ #: ../classes/settings.class.php:1480 ../classes/settings.class.php:1643
137	+ msgid "Right"
138	+ msgstr "Destra"
139	+
140	+ #: ../classes/menu-item-manager.class.php:328
141	+ msgid ""
142	+ "Right aligned items will appear in reverse order on the right hand side of "
143	+ "the menu bar"
144	+ msgstr ""
145	+
146	+ #: ../classes/menu-item-manager.class.php:338
147	+ #, fuzzy
148	+ msgid "Sub Menu Settings"
149	+ msgstr "Impostazioni Mega Menu"
150	+
151	+ #: ../classes/menu-item-manager.class.php:343
152	+ #, fuzzy
153	+ msgid "Sub Menu Align"
154	+ msgstr "Posizione sottomenu"
155	+
156	+ #: ../classes/menu-item-manager.class.php:353
157	+ msgid ""
158	+ "Right aligned sub menus will align to the right of the parent menu item and "
159	+ "expand to the left"
160	+ msgstr ""
161	+
162	+ #: ../classes/menu-item-manager.class.php:366
163	+ #: ../classes/settings.class.php:439 ../classes/settings.class.php:626
164	+ msgid "General Settings"
165	+ msgstr "Impostazioni generali"
166	+
167	+ #: ../classes/menu-item-manager.class.php:385
168	+ msgid "Dashicons"
169	+ msgstr ""
170	+
171	+ #: ../classes/menu-item-manager.class.php:422
172	+ msgid "Menu Icon"
173	+ msgstr "Icona Menu"
174	+
175	+ #: ../classes/nav-menus.class.php:84
176	+ msgid "Mega Menu Settings"
177	+ msgstr "Impostazioni Mega Menu"
178	+
179	+ #: ../classes/nav-menus.class.php:126
180	+ msgid "Launched for Menu ID"
181	+ msgstr "Avviato per Menu ID"
182	+
183	+ #: ../classes/nav-menus.class.php:128
184	+ msgid "Saving"
185	+ msgstr ""
186	+
187	+ #: ../classes/nav-menus.class.php:130
188	+ msgid "Oops. Something went wrong. Please reload the page."
189	+ msgstr "Oops. Qualcosa è andato storto. Si prega di ricaricare la pagina."
190	+
191	+ #: ../classes/nav-menus.class.php:201
192	+ msgid "This theme does not have any menu locations."
193	+ msgstr "Questo tema non ha posizioni per il menu."
194	+
195	+ #: ../classes/nav-menus.class.php:205
196	+ msgid ""
197	+ "This menu is not tagged to a location. Please tag a location to enable the "
198	+ "Mega Menu settings."
199	+ msgstr ""
200	+ "Questo menu non è collocato in una posizione. Si prega di contrassegnare una "
201	+ "posizione per attivare le impostazioni di Mega Menu."
202	+
203	+ #: ../classes/nav-menus.class.php:245 ../classes/widget-manager.class.php:456
204	+ msgid "Save"
205	+ msgstr "Salva"
206	+
207	+ #: ../classes/nav-menus.class.php:260
208	+ msgid "Enable"
209	+ msgstr "Attiva"
210	+
211	+ #: ../classes/nav-menus.class.php:266
212	+ msgid "Event"
213	+ msgstr "Evento"
214	+
215	+ #: ../classes/nav-menus.class.php:269
216	+ msgid "Hover"
217	+ msgstr "Svolazza"
218	+
219	+ #: ../classes/nav-menus.class.php:270
220	+ msgid "Click"
221	+ msgstr "Fare clic"
222	+
223	+ #: ../classes/nav-menus.class.php:275
224	+ msgid "Effect"
225	+ msgstr ""
226	+
227	+ #: ../classes/nav-menus.class.php:284 ../classes/settings.class.php:1663
228	+ msgid "None"
229	+ msgstr ""
230	+
231	+ #: ../classes/nav-menus.class.php:288
232	+ msgid "Fade"
233	+ msgstr ""
234	+
235	+ #: ../classes/nav-menus.class.php:292
236	+ msgid "Slide"
237	+ msgstr ""
238	+
239	+ #: ../classes/nav-menus.class.php:306
240	+ msgid "Theme"
241	+ msgstr "Tema"
242	+
243	+ #: ../classes/settings.class.php:239
244	+ msgid "Copy"
245	+ msgstr ""
246	+
247	+ #: ../classes/settings.class.php:416 ../classes/settings.class.php:584
248	+ #, fuzzy
249	+ msgid "Max Mega Menu"
250	+ msgstr "Pannello di Mega Menu"
251	+
252	+ #: ../classes/settings.class.php:444
253	+ msgid "CSS Output"
254	+ msgstr ""
255	+
256	+ #: ../classes/settings.class.php:450
257	+ msgid "Enqueue dynamically via admin-ajax.php"
258	+ msgstr ""
259	+
260	+ #: ../classes/settings.class.php:451
261	+ msgid "Save to filesystem"
262	+ msgstr ""
263	+
264	+ #: ../classes/settings.class.php:452
265	+ msgid "Output in <head>"
266	+ msgstr ""
267	+
268	+ #: ../classes/settings.class.php:453
269	+ msgid "Don't output CSS"
270	+ msgstr ""
271	+
272	+ #: ../classes/settings.class.php:456
273	+ msgid ""
274	+ "Default. CSS will be enqueued dynamically through admin-ajax.php and loaded "
275	+ "from the cache."
276	+ msgstr ""
277	+
278	+ #: ../classes/settings.class.php:457
279	+ msgid ""
280	+ "CSS will be saved to wp-content/uploads/maxmegamenu/style.css and enqueued "
281	+ "from there."
282	+ msgstr ""
283	+
284	+ #: ../classes/settings.class.php:458
285	+ msgid ""
286	+ "CSS will be loaded from the cache in a <style> tag in the <head> "
287	+ "of the page."
288	+ msgstr ""
289	+
290	+ #: ../classes/settings.class.php:459
291	+ msgid "CSS will not be output, you must enqueue the CSS for the menu manually."
292	+ msgstr ""
293	+
294	+ #: ../classes/settings.class.php:465
295	+ msgid "Click Event Behaviour"
296	+ msgstr ""
297	+
298	+ #: ../classes/settings.class.php:467
299	+ msgid ""
300	+ "Define what should happen when the event is set to 'click'. This also "
301	+ "applies to mobiles."
302	+ msgstr ""
303	+
304	+ #: ../classes/settings.class.php:472
305	+ msgid "First click will open a sub menu, second click will close the sub menu."
306	+ msgstr ""
307	+
308	+ #: ../classes/settings.class.php:473
309	+ msgid "First click will open a sub menu, second click will follow the link."
310	+ msgstr ""
311	+
312	+ #: ../classes/settings.class.php:483
313	+ #, fuzzy
314	+ msgid "Menu Settings"
315	+ msgstr "Impostazioni Mega Menu"
316	+
317	+ #: ../classes/settings.class.php:485
318	+ msgid ""
319	+ "Menu specific settings (e.g, click or hover event, menu theme, transition "
320	+ "effect) can be found under"
321	+ msgstr ""
322	+
323	+ #: ../classes/settings.class.php:485
324	+ msgid "Appearance > Menus"
325	+ msgstr ""
326	+
327	+ #: ../classes/settings.class.php:515
328	+ msgid "Cache"
329	+ msgstr ""
330	+
331	+ #: ../classes/settings.class.php:517
332	+ msgid "Regenerate CSS"
333	+ msgstr ""
334	+
335	+ #: ../classes/settings.class.php:518
336	+ msgid "Regenerate the CSS."
337	+ msgstr ""
338	+
339	+ #: ../classes/settings.class.php:525
340	+ msgid "Plugin Data"
341	+ msgstr ""
342	+
343	+ #: ../classes/settings.class.php:527
344	+ #, fuzzy
345	+ msgid "Delete Data"
346	+ msgstr "%s eliminato"
347	+
348	+ #: ../classes/settings.class.php:528
349	+ msgid ""
350	+ "Delete all saved Max Mega Menu plugin data from the database. Use with "
351	+ "caution!"
352	+ msgstr ""
353	+
354	+ #: ../classes/settings.class.php:548
355	+ msgid "Homepage"
356	+ msgstr ""
357	+
358	+ #: ../classes/settings.class.php:553
359	+ msgid "Documentation"
360	+ msgstr ""
361	+
362	+ #: ../classes/settings.class.php:558
363	+ msgid "Support"
364	+ msgstr ""
365	+
366	+ #: ../classes/settings.class.php:566
367	+ msgid "Core version"
368	+ msgstr ""
369	+
370	+ #: ../classes/settings.class.php:627
371	+ msgid "Tools"
372	+ msgstr ""
373	+
374	+ #: ../classes/settings.class.php:628
375	+ msgid "Theme Editor"
376	+ msgstr ""
377	+
378	+ #: ../classes/settings.class.php:685
379	+ msgid "Failed to delete theme. The theme is in use by a menu."
380	+ msgstr "Impossibile eliminare tema. Il tema è in uso da un menu."
381	+
382	+ #: ../classes/settings.class.php:689
383	+ msgid "CSS cache cleared and CSS regenerated"
384	+ msgstr ""
385	+
386	+ #: ../classes/settings.class.php:693
387	+ msgid "All plugin data removed"
388	+ msgstr ""
389	+
390	+ #: ../classes/settings.class.php:698
391	+ msgid "Theme Deleted"
392	+ msgstr "Tema Eliminato"
393	+
394	+ #: ../classes/settings.class.php:702
395	+ msgid "Theme Duplicated"
396	+ msgstr "Tema duplicato"
397	+
398	+ #: ../classes/settings.class.php:706
399	+ msgid "Changes Saved"
400	+ msgstr "Modifiche salvate"
401	+
402	+ #: ../classes/settings.class.php:710
403	+ msgid "Theme Reverted"
404	+ msgstr "Tema convertito"
405	+
406	+ #: ../classes/settings.class.php:714
407	+ msgid "New Theme Created"
408	+ msgstr "Nuovo Tema Creato"
409	+
410	+ #: ../classes/settings.class.php:775
411	+ msgid "Select theme to edit"
412	+ msgstr "Seleziona tema da modificare"
413	+
414	+ #: ../classes/settings.class.php:775 ../classes/settings.class.php:776
415	+ msgid "or"
416	+ msgstr ""
417	+
418	+ #: ../classes/settings.class.php:776
419	+ #, fuzzy
420	+ msgid "create a new theme"
421	+ msgstr "Creare un nuovo tema"
422	+
423	+ #: ../classes/settings.class.php:777
424	+ #, fuzzy
425	+ msgid "duplicate this theme"
426	+ msgstr "Duplica Tema"
427	+
428	+ #: ../classes/settings.class.php:786
429	+ #, fuzzy
430	+ msgid "Editing Theme:"
431	+ msgstr "Modifica Tema: "
432	+
433	+ #: ../classes/settings.class.php:787
434	+ #, fuzzy
435	+ msgid "General Theme Settings"
436	+ msgstr "Impostazioni generali"
437	+
438	+ #: ../classes/settings.class.php:792
439	+ #, fuzzy
440	+ msgid "Theme Title"
441	+ msgstr "Tema Eliminato"
442	+
443	+ #: ../classes/settings.class.php:800
444	+ msgid "Arrow"
445	+ msgstr ""
446	+
447	+ #: ../classes/settings.class.php:802
448	+ #, fuzzy
449	+ msgid "Select the arrow styles."
450	+ msgstr "Seleziona tema da modificare"
451	+
452	+ #: ../classes/settings.class.php:807
453	+ msgid "Up"
454	+ msgstr ""
455	+
456	+ #: ../classes/settings.class.php:811
457	+ msgid "Down"
458	+ msgstr ""
459	+
460	+ #: ../classes/settings.class.php:826
461	+ msgid "Responsive Breakpoint"
462	+ msgstr ""
463	+
464	+ #: ../classes/settings.class.php:828
465	+ msgid ""
466	+ "Set the width at which the menu turns into a mobile menu. Set to 0 to "
467	+ "disable responsive menu."
468	+ msgstr ""
469	+
470	+ #: ../classes/settings.class.php:835
471	+ msgid "Responsive Menu Text"
472	+ msgstr ""
473	+
474	+ #: ../classes/settings.class.php:837
475	+ msgid "Text to display next to the mobile toggle icon."
476	+ msgstr ""
477	+
478	+ #: ../classes/settings.class.php:844
479	+ msgid "Line Height"
480	+ msgstr ""
481	+
482	+ #: ../classes/settings.class.php:846
483	+ msgid "Set the general line height to use in the panel contents."
484	+ msgstr ""
485	+
486	+ #: ../classes/settings.class.php:853
487	+ msgid "Z-Index"
488	+ msgstr ""
489	+
490	+ #: ../classes/settings.class.php:855
491	+ msgid "Set the z-index to ensure the panels appear ontop of other content."
492	+ msgstr ""
493	+
494	+ #: ../classes/settings.class.php:862
495	+ msgid "Menu Bar"
496	+ msgstr "Barra dei menu"
497	+
498	+ #: ../classes/settings.class.php:867
499	+ #, fuzzy
500	+ msgid "Menu Background"
501	+ msgstr "Barra dei menu"
502	+
503	+ #: ../classes/settings.class.php:869
504	+ msgid ""
505	+ "The background color for the main menu bar. Set each value to transparent "
506	+ "for a 'button' style menu."
507	+ msgstr ""
508	+
509	+ #: ../classes/settings.class.php:874 ../classes/settings.class.php:960
510	+ #: ../classes/settings.class.php:978 ../classes/settings.class.php:1163
511	+ #: ../classes/settings.class.php:1388 ../classes/settings.class.php:1406
512	+ msgid "From"
513	+ msgstr ""
514	+
515	+ #: ../classes/settings.class.php:878 ../classes/settings.class.php:964
516	+ #: ../classes/settings.class.php:982 ../classes/settings.class.php:1167
517	+ #: ../classes/settings.class.php:1392 ../classes/settings.class.php:1410
518	+ msgid "To"
519	+ msgstr ""
520	+
521	+ #: ../classes/settings.class.php:885
522	+ #, fuzzy
523	+ msgid "Menu Padding"
524	+ msgstr "Barra dei menu"
525	+
526	+ #: ../classes/settings.class.php:887
527	+ msgid "Padding for the main menu bar."
528	+ msgstr ""
529	+
530	+ #: ../classes/settings.class.php:892 ../classes/settings.class.php:1074
531	+ #: ../classes/settings.class.php:1196 ../classes/settings.class.php:1222
532	+ #: ../classes/settings.class.php:1274 ../classes/settings.class.php:1356
533	+ #: ../classes/settings.class.php:1435 ../classes/settings.class.php:1476
534	+ msgid "Top"
535	+ msgstr ""
536	+
537	+ #: ../classes/settings.class.php:900 ../classes/settings.class.php:1082
538	+ #: ../classes/settings.class.php:1204 ../classes/settings.class.php:1230
539	+ #: ../classes/settings.class.php:1282 ../classes/settings.class.php:1364
540	+ #: ../classes/settings.class.php:1443 ../classes/settings.class.php:1484
541	+ msgid "Bottom"
542	+ msgstr ""
543	+
544	+ #: ../classes/settings.class.php:911 ../classes/settings.class.php:1241
545	+ #: ../classes/settings.class.php:1495
546	+ msgid "Rounded Corners"
547	+ msgstr ""
548	+
549	+ #: ../classes/settings.class.php:913
550	+ msgid "Set a border radius on the main menu bar."
551	+ msgstr ""
552	+
553	+ #: ../classes/settings.class.php:918 ../classes/settings.class.php:1100
554	+ #: ../classes/settings.class.php:1248 ../classes/settings.class.php:1502
555	+ #, fuzzy
556	+ msgid "Top Left"
557	+ msgstr "Sinistra"
558	+
559	+ #: ../classes/settings.class.php:922 ../classes/settings.class.php:1104
560	+ #: ../classes/settings.class.php:1252 ../classes/settings.class.php:1506
561	+ #, fuzzy
562	+ msgid "Top Right"
563	+ msgstr "Destra"
564	+
565	+ #: ../classes/settings.class.php:926 ../classes/settings.class.php:1108
566	+ #: ../classes/settings.class.php:1256 ../classes/settings.class.php:1510
567	+ msgid "Bottom Right"
568	+ msgstr ""
569	+
570	+ #: ../classes/settings.class.php:930 ../classes/settings.class.php:1112
571	+ #: ../classes/settings.class.php:1260 ../classes/settings.class.php:1514
572	+ msgid "Bottom Left"
573	+ msgstr ""
574	+
575	+ #: ../classes/settings.class.php:937
576	+ msgid "Menu Items Align"
577	+ msgstr ""
578	+
579	+ #: ../classes/settings.class.php:939
580	+ msgid ""
581	+ "Align all menu items to the left (default), centrally or to the right. To "
582	+ "align a single menu item to the right, use the Mega Menu options for the "
583	+ "menu item."
584	+ msgstr ""
585	+
586	+ #: ../classes/settings.class.php:948
587	+ msgid "Top Level Menu Items"
588	+ msgstr "Voci nel menu"
589	+
590	+ #: ../classes/settings.class.php:953
591	+ #, fuzzy
592	+ msgid "Menu Item Background"
593	+ msgstr "Icona Menu"
594	+
595	+ #: ../classes/settings.class.php:955
596	+ msgid ""
597	+ "The background color for each top level menu item. Tip: Set these values to "
598	+ "transparent if you've already set a background color on the menu container."
599	+ msgstr ""
600	+
601	+ #: ../classes/settings.class.php:971
602	+ msgid "Menu Item Background (Hover)"
603	+ msgstr ""
604	+
605	+ #: ../classes/settings.class.php:973
606	+ msgid "The background color for a top level menu item (on hover)."
607	+ msgstr ""
608	+
609	+ #: ../classes/settings.class.php:989
610	+ #, fuzzy
611	+ msgid "Menu Item Spacing"
612	+ msgstr "Icona Menu"
613	+
614	+ #: ../classes/settings.class.php:991
615	+ msgid "Define the size of the gap between each top level menu item."
616	+ msgstr ""
617	+
618	+ #: ../classes/settings.class.php:1000
619	+ msgid "Menu Item Height"
620	+ msgstr ""
621	+
622	+ #: ../classes/settings.class.php:1002
623	+ msgid ""
624	+ "Define the height of each top level menu item. This value, plus the "
625	+ "container top and bottom padding values define the overall height of the "
626	+ "menu bar."
627	+ msgstr ""
628	+
629	+ #: ../classes/settings.class.php:1011 ../classes/settings.class.php:1521
630	+ msgid "Font"
631	+ msgstr ""
632	+
633	+ #: ../classes/settings.class.php:1013
634	+ msgid "The font to use for each top level menu item."
635	+ msgstr ""
636	+
637	+ #: ../classes/settings.class.php:1018 ../classes/settings.class.php:1052
638	+ #: ../classes/settings.class.php:1130 ../classes/settings.class.php:1192
639	+ #: ../classes/settings.class.php:1300 ../classes/settings.class.php:1334
640	+ #: ../classes/settings.class.php:1472 ../classes/settings.class.php:1528
641	+ #: ../classes/settings.class.php:1562
642	+ msgid "Color"
643	+ msgstr ""
644	+
645	+ #: ../classes/settings.class.php:1022 ../classes/settings.class.php:1304
646	+ #: ../classes/settings.class.php:1338 ../classes/settings.class.php:1532
647	+ msgid "Size"
648	+ msgstr ""
649	+
650	+ #: ../classes/settings.class.php:1026 ../classes/settings.class.php:1308
651	+ #: ../classes/settings.class.php:1342 ../classes/settings.class.php:1536
652	+ msgid "Family"
653	+ msgstr ""
654	+
655	+ #: ../classes/settings.class.php:1030 ../classes/settings.class.php:1316
656	+ #: ../classes/settings.class.php:1540
657	+ msgid "Transform"
658	+ msgstr ""
659	+
660	+ #: ../classes/settings.class.php:1034 ../classes/settings.class.php:1056
661	+ #: ../classes/settings.class.php:1312 ../classes/settings.class.php:1544
662	+ #: ../classes/settings.class.php:1566
663	+ #, fuzzy
664	+ msgid "Weight"
665	+ msgstr "Destra"
666	+
667	+ #: ../classes/settings.class.php:1038 ../classes/settings.class.php:1060
668	+ #: ../classes/settings.class.php:1320 ../classes/settings.class.php:1548
669	+ #: ../classes/settings.class.php:1570
670	+ msgid "Decoration"
671	+ msgstr ""
672	+
673	+ #: ../classes/settings.class.php:1045 ../classes/settings.class.php:1555
674	+ msgid "Font (Hover)"
675	+ msgstr ""
676	+
677	+ #: ../classes/settings.class.php:1047
678	+ msgid "Set the font to use for each top level menu item (on hover)."
679	+ msgstr ""
680	+
681	+ #: ../classes/settings.class.php:1067
682	+ msgid "Menu Item Padding"
683	+ msgstr ""
684	+
685	+ #: ../classes/settings.class.php:1069
686	+ msgid "Set the padding for each top level menu item."
687	+ msgstr ""
688	+
689	+ #: ../classes/settings.class.php:1093
690	+ msgid "Menu Item Rounded Corners"
691	+ msgstr ""
692	+
693	+ #: ../classes/settings.class.php:1095
694	+ msgid "Set rounded corners for each top level menu item."
695	+ msgstr ""
696	+
697	+ #: ../classes/settings.class.php:1119
698	+ msgid "Menu Item Divider"
699	+ msgstr ""
700	+
701	+ #: ../classes/settings.class.php:1121
702	+ msgid "Show a small divider bar between each menu item."
703	+ msgstr ""
704	+
705	+ #: ../classes/settings.class.php:1126
706	+ #, fuzzy
707	+ msgid "Enabled"
708	+ msgstr "Attiva"
709	+
710	+ #: ../classes/settings.class.php:1134
711	+ msgid "Glow Opacity"
712	+ msgstr ""
713	+
714	+ #: ../classes/settings.class.php:1142
715	+ msgid "Highlight Current Item"
716	+ msgstr ""
717	+
718	+ #: ../classes/settings.class.php:1144
719	+ msgid "Apply the 'hover' styling to current menu items."
720	+ msgstr ""
721	+
722	+ #: ../classes/settings.class.php:1151
723	+ msgid "Mega Panels"
724	+ msgstr "Pannelli Mega"
725	+
726	+ #: ../classes/settings.class.php:1156
727	+ msgid "Panel Background"
728	+ msgstr ""
729	+
730	+ #: ../classes/settings.class.php:1158
731	+ msgid "Set a background color for a whole panel."
732	+ msgstr ""
733	+
734	+ #: ../classes/settings.class.php:1174
735	+ msgid "Panel Width"
736	+ msgstr ""
737	+
738	+ #: ../classes/settings.class.php:1176
739	+ msgid ""
740	+ "Mega Panel width. Note: A 100% wide panel will only ever be as wide as the "
741	+ "menu itself. For a fixed panel width set this to a pixel value. Advanced: "
742	+ "enter a jQuery selector to align the sub menu to a page element."
743	+ msgstr ""
744	+
745	+ #: ../classes/settings.class.php:1185
746	+ msgid "Panel Border"
747	+ msgstr ""
748	+
749	+ #: ../classes/settings.class.php:1187
750	+ #, fuzzy
751	+ msgid "Set the border to display on the Mega Panel."
752	+ msgstr "Selezionate un widget da visualizzare nel Pannello Mega"
753	+
754	+ #: ../classes/settings.class.php:1215
755	+ msgid "Panel Padding"
756	+ msgstr ""
757	+
758	+ #: ../classes/settings.class.php:1217
759	+ msgid ""
760	+ "Set the padding for the whole panel. Set these values 0px if you wish your "
761	+ "panel content to go edge-to-edge."
762	+ msgstr ""
763	+
764	+ #: ../classes/settings.class.php:1243
765	+ msgid "Set rounded corners for the panel."
766	+ msgstr ""
767	+
768	+ #: ../classes/settings.class.php:1267
769	+ msgid "Widget Padding"
770	+ msgstr ""
771	+
772	+ #: ../classes/settings.class.php:1269
773	+ msgid ""
774	+ "Set the padding for each widget in the panel. Use this to define the spacing "
775	+ "between each widget in the panel."
776	+ msgstr ""
777	+
778	+ #: ../classes/settings.class.php:1293
779	+ msgid "Heading Font"
780	+ msgstr ""
781	+
782	+ #: ../classes/settings.class.php:1295
783	+ msgid ""
784	+ "Set the font to use for Widget Headers. This setting is also used for second "
785	+ "level menu items when they're displayed in a Mega Menu."
786	+ msgstr ""
787	+
788	+ #: ../classes/settings.class.php:1327
789	+ msgid "Content Font"
790	+ msgstr ""
791	+
792	+ #: ../classes/settings.class.php:1329
793	+ msgid "Set the font to use for panel contents."
794	+ msgstr ""
795	+
796	+ #: ../classes/settings.class.php:1349
797	+ msgid "Heading Padding"
798	+ msgstr ""
799	+
800	+ #: ../classes/settings.class.php:1351
801	+ msgid ""
802	+ "Set the padding for the headings. Use this to set the gap between the widget "
803	+ "heading and the widget content."
804	+ msgstr ""
805	+
806	+ #: ../classes/settings.class.php:1376
807	+ msgid "Flyout Menus"
808	+ msgstr "Menu Flyout"
809	+
810	+ #: ../classes/settings.class.php:1381
811	+ msgid "Item Background"
812	+ msgstr ""
813	+
814	+ #: ../classes/settings.class.php:1383
815	+ msgid "Set the background color for a flyout menu item."
816	+ msgstr ""
817	+
818	+ #: ../classes/settings.class.php:1399
819	+ msgid "Item Background (Hover)"
820	+ msgstr ""
821	+
822	+ #: ../classes/settings.class.php:1401
823	+ msgid "Set the background color for a flyout menu item (on hover)."
824	+ msgstr ""
825	+
826	+ #: ../classes/settings.class.php:1417
827	+ msgid "Item Height"
828	+ msgstr ""
829	+
830	+ #: ../classes/settings.class.php:1419
831	+ msgid "The height of each flyout menu item."
832	+ msgstr ""
833	+
834	+ #: ../classes/settings.class.php:1428
835	+ msgid "Item Padding"
836	+ msgstr ""
837	+
838	+ #: ../classes/settings.class.php:1430
839	+ msgid "Set the padding for each flyout menu item."
840	+ msgstr ""
841	+
842	+ #: ../classes/settings.class.php:1454
843	+ #, fuzzy
844	+ msgid "Flyout Menu Width"
845	+ msgstr "Menu Flyout"
846	+
847	+ #: ../classes/settings.class.php:1456
848	+ msgid "The width of each flyout menu."
849	+ msgstr ""
850	+
851	+ #: ../classes/settings.class.php:1465
852	+ #, fuzzy
853	+ msgid "Flyout Menu Border"
854	+ msgstr "Menu Flyout"
855	+
856	+ #: ../classes/settings.class.php:1467
857	+ msgid "Set the border for the flyout menu."
858	+ msgstr ""
859	+
860	+ #: ../classes/settings.class.php:1497
861	+ msgid ""
862	+ "Set rounded corners for flyout menus. Rounded corners will be applied to all "
863	+ "flyout menu levels."
864	+ msgstr ""
865	+
866	+ #: ../classes/settings.class.php:1523
867	+ msgid "Set the font for the flyout menu items."
868	+ msgstr ""
869	+
870	+ #: ../classes/settings.class.php:1557
871	+ msgid "Set the font weight for the flyout menu items (on hover)."
872	+ msgstr ""
873	+
874	+ #: ../classes/settings.class.php:1577
875	+ #, fuzzy
876	+ msgid "Custom Styling"
877	+ msgstr "SCSS Personalizzato"
878	+
879	+ #: ../classes/settings.class.php:1582
880	+ msgid "CSS Editor"
881	+ msgstr ""
882	+
883	+ #: ../classes/settings.class.php:1584
884	+ msgid ""
885	+ "Define any custom CSS you wish to add to menus using this theme. You can use "
886	+ "standard CSS or SCSS."
887	+ msgstr ""
888	+
889	+ #: ../classes/settings.class.php:1590
890	+ msgid "Custom Styling Tips"
891	+ msgstr ""
892	+
893	+ #: ../classes/settings.class.php:1592
894	+ msgid ""
895	+ "converts to the ID selector of the menu wrapper, e.g. div#mega-menu-wrap-"
896	+ "primary"
897	+ msgstr ""
898	+
899	+ #: ../classes/settings.class.php:1593
900	+ msgid "converts to the ID selector of the menu, e.g. ul#mega-menu-primary"
901	+ msgstr ""
902	+
903	+ #: ../classes/settings.class.php:1594
904	+ msgid ""
905	+ "Use @import rules to import CSS from other plugins or your theme directory, "
906	+ "e.g:"
907	+ msgstr ""
908	+
909	+ #: ../classes/settings.class.php:1609
910	+ msgid "Delete Theme"
911	+ msgstr "Elimina Tema"
912	+
913	+ #: ../classes/settings.class.php:1613
914	+ #, fuzzy
915	+ msgid "Revert Theme"
916	+ msgstr "Elimina Tema"
917	+
918	+ #: ../classes/settings.class.php:1642
919	+ msgid "Center"
920	+ msgstr ""
921	+
922	+ #: ../classes/settings.class.php:1664
923	+ msgid "Underline"
924	+ msgstr ""
925	+
926	+ #: ../classes/settings.class.php:1708
927	+ msgid "Disabled"
928	+ msgstr "Disabilitato"
929	+
930	+ #: ../classes/settings.class.php:1765 ../classes/settings.class.php:1784
931	+ msgid "Normal"
932	+ msgstr "Normale"
933	+
934	+ #: ../classes/settings.class.php:1766
935	+ msgid "Bold"
936	+ msgstr "Grassetto"
937	+
938	+ #: ../classes/settings.class.php:1785
939	+ msgid "Capitalize"
940	+ msgstr "Capitalizza"
941	+
942	+ #: ../classes/settings.class.php:1786
943	+ msgid "Uppercase"
944	+ msgstr "Maiuscolo"
945	+
946	+ #: ../classes/settings.class.php:1787
947	+ msgid "Lowercase"
948	+ msgstr "Minuscolo"
949	+
950	+ #: ../classes/settings.class.php:1822
951	+ msgid "Theme Default"
952	+ msgstr "Tema di Default"
953	+
954	+ #: ../classes/settings.class.php:1929
955	+ msgid "Are you sure?"
956	+ msgstr "Sei sicuro?"
957	+
958	+ #: ../classes/style-manager.class.php:67
959	+ msgid "Default"
960	+ msgstr "Default"
961	+
962	+ #: ../classes/style-manager.class.php:450
963	+ msgid ""
964	+ "Warning: CSS compilation failed. Please check your changes or revert the "
965	+ "theme."
966	+ msgstr ""
967	+ "Attenzione: compilazione CSS non riuscita. Si prega di verificare le "
968	+ "modifiche o ripristinare il tema."
969	+
970	+ #: ../classes/widget-manager.class.php:76
971	+ msgid "Mega Menu Widgets"
972	+ msgstr "Widgets di Mega Menu"
973	+
974	+ #: ../classes/widget-manager.class.php:77
975	+ msgid "Do not manually edit this area."
976	+ msgstr "Non modificare manualmente quest'area."
977	+
978	+ #: ../classes/widget-manager.class.php:114
979	+ #, php-format
980	+ msgid "Saved %s"
981	+ msgstr "Salvato %s"
982	+
983	+ #: ../classes/widget-manager.class.php:115
984	+ #, php-format
985	+ msgid "Failed to save %s"
986	+ msgstr "Salvataggio di %s fallito"
987	+
988	+ #: ../classes/widget-manager.class.php:139
989	+ #, php-format
990	+ msgid "Updated %s (new columns: %d)"
991	+ msgstr "Aggiornato %s (nuove colonne: %d )"
992	+
993	+ #: ../classes/widget-manager.class.php:140
994	+ #, php-format
995	+ msgid "Failed to update %s"
996	+ msgstr "Fallito nell'aggiornamento di %s"
997	+
998	+ #: ../classes/widget-manager.class.php:166
999	+ #, php-format
1000	+ msgid "Failed to add %s to %d"
1001	+ msgstr "Fallito nell'aggiungere %s a %d"
1002	+
1003	+ #: ../classes/widget-manager.class.php:189
1004	+ #, php-format
1005	+ msgid "Deleted %s"
1006	+ msgstr "%s eliminato"
1007	+
1008	+ #: ../classes/widget-manager.class.php:190
1009	+ #, php-format
1010	+ msgid "Failed to delete %s"
1011	+ msgstr "Impossibile eliminare %s"
1012	+
1013	+ #: ../classes/widget-manager.class.php:215
1014	+ #, php-format
1015	+ msgid "Moved %s to %d (%s)"
1016	+ msgstr "%s spostato a %d (%s)"
1017	+
1018	+ #: ../classes/widget-manager.class.php:216
1019	+ #, php-format
1020	+ msgid "Failed to move %s to %d"
1021	+ msgstr "Impossibile spostare %s a %d"
1022	+
1023	+ #~ msgid "Mega Menu Options"
1024	+ #~ msgstr "Opzioni Mega Menu"
1025	+
1026	+ #~ msgid "Configure Panel Widgets for"
1027	+ #~ msgstr "Configura il pannello Widgets per"
1028	+
1029	+ #~ msgid "Added to list"
1030	+ #~ msgstr "Aggiunto alla lista"
1031	+
1032	+ #~ msgid "Mega Menu Themes"
1033	+ #~ msgstr "Temi Mega Menu"
1034	+
1035	+ #~ msgid "Menu Themes"
1036	+ #~ msgstr "Temi menu"
1037	+
1038	+ #~ msgid "Revert Changes"
1039	+ #~ msgstr "Ripristina modifiche"

languages/megamenu.mo ADDED Viewed

Binary file

languages/megamenu.po ADDED Viewed

	@@ -0,0 +1,1218 @@


1	+ msgid ""
2	+ msgstr ""
3	+ "Project-Id-Version: megamenu\n"
4	+ "POT-Creation-Date: 2015-04-26 16:16-0000\n"
5	+ "PO-Revision-Date: 2015-04-26 16:16-0000\n"
6	+ "Last-Translator: \n"
7	+ "Language-Team: \n"
8	+ "Language: English\n"
9	+ "MIME-Version: 1.0\n"
10	+ "Content-Type: text/plain; charset=UTF-8\n"
11	+ "Content-Transfer-Encoding: 8bit\n"
12	+ "X-Generator: Poedit 1.5.7\n"
13	+ "X-Poedit-KeywordsList: __;_e\n"
14	+ "X-Poedit-Basepath: .\n"
15	+ "X-Poedit-SearchPath-0: ..\n"
16	+ "X-Poedit-SearchPath-1: .\n"
17	+
18	+ #: ../megamenu.php:455
19	+ msgid ""
20	+ "Max Mega Menu is not compatible with your version of WordPress. Please "
21	+ "upgrade WordPress to the latest version or disable Max Mega Menu."
22	+ msgstr ""
23	+
24	+ #: ../megamenu.php:466
25	+ msgid ""
26	+ "Max Mega Menu is not compatible with Uber Menu. Please disable Uber Menu."
27	+ msgstr ""
28	+
29	+ #: ../megamenu.php:479
30	+ msgid "click here"
31	+ msgstr ""
32	+
33	+ #: ../megamenu.php:482
34	+ #, php-format
35	+ msgid "Thanks for installing Max Mega Menu! Please %s to get started."
36	+ msgstr ""
37	+
38	+ #: ../megamenu.php:494
39	+ msgid "regenerate the CSS"
40	+ msgstr ""
41	+
42	+ #: ../megamenu.php:497
43	+ #, php-format
44	+ msgid ""
45	+ "Max Mega Menu Updated. Please %s to ensure maximum compatibility with the "
46	+ "latest version."
47	+ msgstr ""
48	+
49	+ #: ../classes/menu-item-manager.class.php:171
50	+ #: ../classes/menu-item-manager.class.php:264
51	+ #: ../classes/nav-menus.class.php:127
52	+ msgid "Mega Menu"
53	+ msgstr ""
54	+
55	+ #: ../classes/menu-item-manager.class.php:172
56	+ msgid "Mega Menus can only be created on top level menu items."
57	+ msgstr ""
58	+
59	+ #: ../classes/menu-item-manager.class.php:183
60	+ msgid "Enable Mega Menu"
61	+ msgstr ""
62	+
63	+ #: ../classes/menu-item-manager.class.php:186
64	+ msgid "column"
65	+ msgstr ""
66	+
67	+ #: ../classes/menu-item-manager.class.php:187
68	+ #: ../classes/menu-item-manager.class.php:188
69	+ #: ../classes/menu-item-manager.class.php:189
70	+ #: ../classes/menu-item-manager.class.php:190
71	+ #: ../classes/menu-item-manager.class.php:191
72	+ #: ../classes/menu-item-manager.class.php:192
73	+ #: ../classes/menu-item-manager.class.php:193
74	+ msgid "columns"
75	+ msgstr ""
76	+
77	+ #: ../classes/menu-item-manager.class.php:197
78	+ msgid "Select a Widget to add to the panel"
79	+ msgstr ""
80	+
81	+ #: ../classes/menu-item-manager.class.php:213
82	+ msgid "Sub menu items"
83	+ msgstr ""
84	+
85	+ #: ../classes/menu-item-manager.class.php:233
86	+ msgid "Widgets"
87	+ msgstr ""
88	+
89	+ #: ../classes/menu-item-manager.class.php:258
90	+ msgid ""
91	+ "No widgets found. Add a widget to this area using the Widget Selector (top "
92	+ "right)"
93	+ msgstr ""
94	+
95	+ #: ../classes/menu-item-manager.class.php:284
96	+ msgid "Menu Item Settings"
97	+ msgstr ""
98	+
99	+ #: ../classes/menu-item-manager.class.php:288
100	+ msgid "Hide Text"
101	+ msgstr ""
102	+
103	+ #: ../classes/menu-item-manager.class.php:295
104	+ #: ../classes/menu-item-manager.class.php:331
105	+ #: ../classes/menu-item-manager.class.php:356
106	+ msgid "Option only available for top level menu items"
107	+ msgstr ""
108	+
109	+ #: ../classes/menu-item-manager.class.php:302
110	+ msgid "Hide Arrow"
111	+ msgstr ""
112	+
113	+ #: ../classes/menu-item-manager.class.php:310
114	+ msgid "Disable Link"
115	+ msgstr ""
116	+
117	+ #: ../classes/menu-item-manager.class.php:318
118	+ msgid "Menu Item Align"
119	+ msgstr ""
120	+
121	+ #: ../classes/menu-item-manager.class.php:324
122	+ #: ../classes/menu-item-manager.class.php:349
123	+ #: ../classes/settings.class.php:847 ../classes/settings.class.php:984
124	+ #: ../classes/settings.class.php:1167 ../classes/settings.class.php:1197
125	+ #: ../classes/settings.class.php:1330 ../classes/settings.class.php:1360
126	+ #: ../classes/settings.class.php:1412 ../classes/settings.class.php:1494
127	+ #: ../classes/settings.class.php:1520 ../classes/settings.class.php:1550
128	+ #: ../classes/settings.class.php:1656 ../classes/settings.class.php:1682
129	+ #: ../classes/settings.class.php:1712 ../classes/settings.class.php:1818
130	+ #: ../classes/settings.class.php:1880 ../classes/settings.class.php:1911
131	+ #: ../classes/settings.class.php:2010 ../classes/settings.class.php:2150
132	+ msgid "Left"
133	+ msgstr ""
134	+
135	+ #: ../classes/menu-item-manager.class.php:325
136	+ #: ../classes/menu-item-manager.class.php:350
137	+ #: ../classes/settings.class.php:851 ../classes/settings.class.php:976
138	+ #: ../classes/settings.class.php:1159 ../classes/settings.class.php:1189
139	+ #: ../classes/settings.class.php:1322 ../classes/settings.class.php:1352
140	+ #: ../classes/settings.class.php:1404 ../classes/settings.class.php:1486
141	+ #: ../classes/settings.class.php:1512 ../classes/settings.class.php:1542
142	+ #: ../classes/settings.class.php:1648 ../classes/settings.class.php:1674
143	+ #: ../classes/settings.class.php:1704 ../classes/settings.class.php:1810
144	+ #: ../classes/settings.class.php:1872 ../classes/settings.class.php:1903
145	+ #: ../classes/settings.class.php:2002 ../classes/settings.class.php:2152
146	+ msgid "Right"
147	+ msgstr ""
148	+
149	+ #: ../classes/menu-item-manager.class.php:328
150	+ msgid ""
151	+ "Right aligned items will appear in reverse order on the right hand side of "
152	+ "the menu bar"
153	+ msgstr ""
154	+
155	+ #: ../classes/menu-item-manager.class.php:338
156	+ msgid "Sub Menu Settings"
157	+ msgstr ""
158	+
159	+ #: ../classes/menu-item-manager.class.php:343
160	+ msgid "Sub Menu Align"
161	+ msgstr ""
162	+
163	+ #: ../classes/menu-item-manager.class.php:353
164	+ msgid ""
165	+ "Right aligned sub menus will align to the right of the parent menu item and "
166	+ "expand to the left"
167	+ msgstr ""
168	+
169	+ #: ../classes/menu-item-manager.class.php:366
170	+ #: ../classes/settings.class.php:426 ../classes/settings.class.php:617
171	+ msgid "General Settings"
172	+ msgstr ""
173	+
174	+ #: ../classes/menu-item-manager.class.php:385
175	+ msgid "Dashicons"
176	+ msgstr ""
177	+
178	+ #: ../classes/menu-item-manager.class.php:423
179	+ msgid "Menu Icon"
180	+ msgstr ""
181	+
182	+ #: ../classes/nav-menus.class.php:84
183	+ msgid "Mega Menu Settings"
184	+ msgstr ""
185	+
186	+ #: ../classes/nav-menus.class.php:126
187	+ msgid "Launched for Menu ID"
188	+ msgstr ""
189	+
190	+ #: ../classes/nav-menus.class.php:128
191	+ msgid "Saving"
192	+ msgstr ""
193	+
194	+ #: ../classes/nav-menus.class.php:130
195	+ msgid "Oops. Something went wrong. Please reload the page."
196	+ msgstr ""
197	+
198	+ #: ../classes/nav-menus.class.php:201
199	+ msgid "This theme does not have any menu locations."
200	+ msgstr ""
201	+
202	+ #: ../classes/nav-menus.class.php:205
203	+ msgid ""
204	+ "This menu is not tagged to a location. Please tag a location to enable the "
205	+ "Mega Menu settings."
206	+ msgstr ""
207	+
208	+ #: ../classes/nav-menus.class.php:245 ../classes/widget-manager.class.php:446
209	+ msgid "Save"
210	+ msgstr ""
211	+
212	+ #: ../classes/nav-menus.class.php:260
213	+ msgid "Enable"
214	+ msgstr ""
215	+
216	+ #: ../classes/nav-menus.class.php:266
217	+ msgid "Event"
218	+ msgstr ""
219	+
220	+ #: ../classes/nav-menus.class.php:269
221	+ msgid "Hover"
222	+ msgstr ""
223	+
224	+ #: ../classes/nav-menus.class.php:270
225	+ msgid "Click"
226	+ msgstr ""
227	+
228	+ #: ../classes/nav-menus.class.php:275
229	+ msgid "Effect"
230	+ msgstr ""
231	+
232	+ #: ../classes/nav-menus.class.php:284 ../classes/settings.class.php:2172
233	+ msgid "None"
234	+ msgstr ""
235	+
236	+ #: ../classes/nav-menus.class.php:288
237	+ msgid "Fade"
238	+ msgstr ""
239	+
240	+ #: ../classes/nav-menus.class.php:292
241	+ msgid "Slide"
242	+ msgstr ""
243	+
244	+ #: ../classes/nav-menus.class.php:306
245	+ msgid "Theme"
246	+ msgstr ""
247	+
248	+ #: ../classes/settings.class.php:226
249	+ msgid "Copy"
250	+ msgstr ""
251	+
252	+ #: ../classes/settings.class.php:403 ../classes/settings.class.php:575
253	+ msgid "Max Mega Menu"
254	+ msgstr ""
255	+
256	+ #: ../classes/settings.class.php:431
257	+ msgid "CSS Output"
258	+ msgstr ""
259	+
260	+ #: ../classes/settings.class.php:437
261	+ msgid "Enqueue dynamically via admin-ajax.php"
262	+ msgstr ""
263	+
264	+ #: ../classes/settings.class.php:438
265	+ msgid "Save to filesystem"
266	+ msgstr ""
267	+
268	+ #: ../classes/settings.class.php:439
269	+ msgid "Output in <head>"
270	+ msgstr ""
271	+
272	+ #: ../classes/settings.class.php:440
273	+ msgid "Don't output CSS"
274	+ msgstr ""
275	+
276	+ #: ../classes/settings.class.php:443
277	+ msgid ""
278	+ "Default. CSS will be enqueued dynamically through admin-ajax.php and loaded "
279	+ "from the cache."
280	+ msgstr ""
281	+
282	+ #: ../classes/settings.class.php:444
283	+ msgid ""
284	+ "CSS will be saved to wp-content/uploads/maxmegamenu/style.css and enqueued "
285	+ "from there."
286	+ msgstr ""
287	+
288	+ #: ../classes/settings.class.php:445
289	+ msgid ""
290	+ "CSS will be loaded from the cache in a <style> tag in the <head> "
291	+ "of the page."
292	+ msgstr ""
293	+
294	+ #: ../classes/settings.class.php:446
295	+ msgid "CSS will not be output, you must enqueue the CSS for the menu manually."
296	+ msgstr ""
297	+
298	+ #: ../classes/settings.class.php:452
299	+ msgid "Click Event Behaviour"
300	+ msgstr ""
301	+
302	+ #: ../classes/settings.class.php:454
303	+ msgid ""
304	+ "Define what should happen when the event is set to 'click'. This also "
305	+ "applies to mobiles."
306	+ msgstr ""
307	+
308	+ #: ../classes/settings.class.php:459
309	+ msgid "First click will open a sub menu, second click will close the sub menu."
310	+ msgstr ""
311	+
312	+ #: ../classes/settings.class.php:460
313	+ msgid "First click will open a sub menu, second click will follow the link."
314	+ msgstr ""
315	+
316	+ #: ../classes/settings.class.php:470
317	+ msgid "Menu Settings"
318	+ msgstr ""
319	+
320	+ #: ../classes/settings.class.php:472
321	+ msgid ""
322	+ "Menu specific settings (e.g, click or hover event, menu theme, transition "
323	+ "effect) can be found under"
324	+ msgstr ""
325	+
326	+ #: ../classes/settings.class.php:472
327	+ msgid "Appearance > Menus"
328	+ msgstr ""
329	+
330	+ #: ../classes/settings.class.php:502
331	+ msgid "Cache"
332	+ msgstr ""
333	+
334	+ #: ../classes/settings.class.php:504
335	+ msgid "Regenerate CSS"
336	+ msgstr ""
337	+
338	+ #: ../classes/settings.class.php:505
339	+ msgid "Regenerate the CSS."
340	+ msgstr ""
341	+
342	+ #: ../classes/settings.class.php:512
343	+ msgid "Plugin Data"
344	+ msgstr ""
345	+
346	+ #: ../classes/settings.class.php:514
347	+ msgid "Delete Data"
348	+ msgstr ""
349	+
350	+ #: ../classes/settings.class.php:515
351	+ msgid ""
352	+ "Delete all saved Max Mega Menu plugin data from the database. Use with "
353	+ "caution!"
354	+ msgstr ""
355	+
356	+ #: ../classes/settings.class.php:535
357	+ msgid "Homepage"
358	+ msgstr ""
359	+
360	+ #: ../classes/settings.class.php:540
361	+ msgid "Documentation"
362	+ msgstr ""
363	+
364	+ #: ../classes/settings.class.php:545
365	+ msgid "Support"
366	+ msgstr ""
367	+
368	+ #: ../classes/settings.class.php:553
369	+ msgid "Core version"
370	+ msgstr ""
371	+
372	+ #: ../classes/settings.class.php:557
373	+ msgid "Pro extension"
374	+ msgstr ""
375	+
376	+ #: ../classes/settings.class.php:618
377	+ msgid "Tools"
378	+ msgstr ""
379	+
380	+ #: ../classes/settings.class.php:619
381	+ msgid "Theme Editor"
382	+ msgstr ""
383	+
384	+ #: ../classes/settings.class.php:685
385	+ msgid "Failed to delete theme. The theme is in use by a menu."
386	+ msgstr ""
387	+
388	+ #: ../classes/settings.class.php:689
389	+ msgid "CSS cache cleared and CSS regenerated"
390	+ msgstr ""
391	+
392	+ #: ../classes/settings.class.php:693
393	+ msgid "All plugin data removed"
394	+ msgstr ""
395	+
396	+ #: ../classes/settings.class.php:698
397	+ msgid "Theme Deleted"
398	+ msgstr ""
399	+
400	+ #: ../classes/settings.class.php:702
401	+ msgid "Theme Duplicated"
402	+ msgstr ""
403	+
404	+ #: ../classes/settings.class.php:706
405	+ msgid "Changes Saved"
406	+ msgstr ""
407	+
408	+ #: ../classes/settings.class.php:710
409	+ msgid "Theme Reverted"
410	+ msgstr ""
411	+
412	+ #: ../classes/settings.class.php:714
413	+ msgid "New Theme Created"
414	+ msgstr ""
415	+
416	+ #: ../classes/settings.class.php:808
417	+ msgid "Select theme to edit"
418	+ msgstr ""
419	+
420	+ #: ../classes/settings.class.php:808 ../classes/settings.class.php:809
421	+ msgid "or"
422	+ msgstr ""
423	+
424	+ #: ../classes/settings.class.php:809
425	+ msgid "create a new theme"
426	+ msgstr ""
427	+
428	+ #: ../classes/settings.class.php:810
429	+ msgid "duplicate this theme"
430	+ msgstr ""
431	+
432	+ #: ../classes/settings.class.php:818
433	+ msgid "Editing Theme:"
434	+ msgstr ""
435	+
436	+ #: ../classes/settings.class.php:819
437	+ msgid "General Theme Settings"
438	+ msgstr ""
439	+
440	+ #: ../classes/settings.class.php:824
441	+ msgid "Theme Title"
442	+ msgstr ""
443	+
444	+ #: ../classes/settings.class.php:832
445	+ msgid "Arrow"
446	+ msgstr ""
447	+
448	+ #: ../classes/settings.class.php:834
449	+ msgid "Select the arrow styles."
450	+ msgstr ""
451	+
452	+ #: ../classes/settings.class.php:839
453	+ msgid "Up"
454	+ msgstr ""
455	+
456	+ #: ../classes/settings.class.php:843
457	+ msgid "Down"
458	+ msgstr ""
459	+
460	+ #: ../classes/settings.class.php:858
461	+ msgid "Responsive Breakpoint"
462	+ msgstr ""
463	+
464	+ #: ../classes/settings.class.php:860
465	+ msgid ""
466	+ "Set the width at which the menu turns into a mobile menu. Set to 0 to "
467	+ "disable responsive menu."
468	+ msgstr ""
469	+
470	+ #: ../classes/settings.class.php:867
471	+ msgid "Responsive Menu Text"
472	+ msgstr ""
473	+
474	+ #: ../classes/settings.class.php:869
475	+ msgid "Text to display next to the mobile toggle icon."
476	+ msgstr ""
477	+
478	+ #: ../classes/settings.class.php:876
479	+ msgid "Line Height"
480	+ msgstr ""
481	+
482	+ #: ../classes/settings.class.php:878
483	+ msgid "Set the general line height to use in the panel contents."
484	+ msgstr ""
485	+
486	+ #: ../classes/settings.class.php:885
487	+ msgid "Z-Index"
488	+ msgstr ""
489	+
490	+ #: ../classes/settings.class.php:887
491	+ msgid "Set the z-index to ensure the panels appear ontop of other content."
492	+ msgstr ""
493	+
494	+ #: ../classes/settings.class.php:894
495	+ msgid "Shadow"
496	+ msgstr ""
497	+
498	+ #: ../classes/settings.class.php:896
499	+ msgid "Apply a shadow to mega and flyout menus."
500	+ msgstr ""
501	+
502	+ #: ../classes/settings.class.php:901 ../classes/settings.class.php:935
503	+ #: ../classes/settings.class.php:1251 ../classes/settings.class.php:2081
504	+ msgid "Enabled"
505	+ msgstr ""
506	+
507	+ #: ../classes/settings.class.php:905
508	+ msgid "Horizonal"
509	+ msgstr ""
510	+
511	+ #: ../classes/settings.class.php:909
512	+ msgid "Vertical"
513	+ msgstr ""
514	+
515	+ #: ../classes/settings.class.php:913
516	+ msgid "Blur"
517	+ msgstr ""
518	+
519	+ #: ../classes/settings.class.php:917
520	+ msgid "Spread"
521	+ msgstr ""
522	+
523	+ #: ../classes/settings.class.php:921 ../classes/settings.class.php:1099
524	+ #: ../classes/settings.class.php:1133 ../classes/settings.class.php:1181
525	+ #: ../classes/settings.class.php:1211 ../classes/settings.class.php:1255
526	+ #: ../classes/settings.class.php:1344 ../classes/settings.class.php:1426
527	+ #: ../classes/settings.class.php:1460 ../classes/settings.class.php:1534
528	+ #: ../classes/settings.class.php:1570 ../classes/settings.class.php:1604
529	+ #: ../classes/settings.class.php:1696 ../classes/settings.class.php:1732
530	+ #: ../classes/settings.class.php:1766 ../classes/settings.class.php:1895
531	+ #: ../classes/settings.class.php:2025 ../classes/settings.class.php:2059
532	+ #: ../classes/settings.class.php:2085
533	+ msgid "Color"
534	+ msgstr ""
535	+
536	+ #: ../classes/settings.class.php:928
537	+ msgid "Hover Transitions"
538	+ msgstr ""
539	+
540	+ #: ../classes/settings.class.php:930
541	+ msgid ""
542	+ "Apply hover transitions to menu items. Note: Transitions will not apply to "
543	+ "gradient backgrounds."
544	+ msgstr ""
545	+
546	+ #: ../classes/settings.class.php:942
547	+ msgid "Menu Bar"
548	+ msgstr ""
549	+
550	+ #: ../classes/settings.class.php:947 ../classes/settings.class.php:1830
551	+ msgid "Menu Background"
552	+ msgstr ""
553	+
554	+ #: ../classes/settings.class.php:949
555	+ msgid ""
556	+ "The background color for the main menu bar. Set each value to transparent "
557	+ "for a 'button' style menu."
558	+ msgstr ""
559	+
560	+ #: ../classes/settings.class.php:954 ../classes/settings.class.php:1041
561	+ #: ../classes/settings.class.php:1059 ../classes/settings.class.php:1287
562	+ #: ../classes/settings.class.php:1626 ../classes/settings.class.php:1788
563	+ #: ../classes/settings.class.php:1837 ../classes/settings.class.php:1951
564	+ #: ../classes/settings.class.php:1969
565	+ msgid "From"
566	+ msgstr ""
567	+
568	+ #: ../classes/settings.class.php:958 ../classes/settings.class.php:1045
569	+ #: ../classes/settings.class.php:1063 ../classes/settings.class.php:1291
570	+ #: ../classes/settings.class.php:1630 ../classes/settings.class.php:1792
571	+ #: ../classes/settings.class.php:1841 ../classes/settings.class.php:1955
572	+ #: ../classes/settings.class.php:1973
573	+ msgid "To"
574	+ msgstr ""
575	+
576	+ #: ../classes/settings.class.php:965 ../classes/settings.class.php:1861
577	+ msgid "Menu Padding"
578	+ msgstr ""
579	+
580	+ #: ../classes/settings.class.php:967
581	+ msgid "Padding for the main menu bar."
582	+ msgstr ""
583	+
584	+ #: ../classes/settings.class.php:972 ../classes/settings.class.php:1155
585	+ #: ../classes/settings.class.php:1185 ../classes/settings.class.php:1318
586	+ #: ../classes/settings.class.php:1348 ../classes/settings.class.php:1400
587	+ #: ../classes/settings.class.php:1482 ../classes/settings.class.php:1508
588	+ #: ../classes/settings.class.php:1538 ../classes/settings.class.php:1644
589	+ #: ../classes/settings.class.php:1670 ../classes/settings.class.php:1700
590	+ #: ../classes/settings.class.php:1806 ../classes/settings.class.php:1868
591	+ #: ../classes/settings.class.php:1899 ../classes/settings.class.php:1998
592	+ msgid "Top"
593	+ msgstr ""
594	+
595	+ #: ../classes/settings.class.php:980 ../classes/settings.class.php:1163
596	+ #: ../classes/settings.class.php:1193 ../classes/settings.class.php:1326
597	+ #: ../classes/settings.class.php:1356 ../classes/settings.class.php:1408
598	+ #: ../classes/settings.class.php:1490 ../classes/settings.class.php:1516
599	+ #: ../classes/settings.class.php:1546 ../classes/settings.class.php:1652
600	+ #: ../classes/settings.class.php:1678 ../classes/settings.class.php:1708
601	+ #: ../classes/settings.class.php:1814 ../classes/settings.class.php:1876
602	+ #: ../classes/settings.class.php:1907 ../classes/settings.class.php:2006
603	+ msgid "Bottom"
604	+ msgstr ""
605	+
606	+ #: ../classes/settings.class.php:991 ../classes/settings.class.php:1918
607	+ msgid "Menu Border Radius"
608	+ msgstr ""
609	+
610	+ #: ../classes/settings.class.php:993
611	+ msgid "Set a border radius on the main menu bar."
612	+ msgstr ""
613	+
614	+ #: ../classes/settings.class.php:998 ../classes/settings.class.php:1225
615	+ #: ../classes/settings.class.php:1374 ../classes/settings.class.php:1925
616	+ msgid "Top Left"
617	+ msgstr ""
618	+
619	+ #: ../classes/settings.class.php:1002 ../classes/settings.class.php:1229
620	+ #: ../classes/settings.class.php:1378 ../classes/settings.class.php:1929
621	+ msgid "Top Right"
622	+ msgstr ""
623	+
624	+ #: ../classes/settings.class.php:1006 ../classes/settings.class.php:1233
625	+ #: ../classes/settings.class.php:1382 ../classes/settings.class.php:1933
626	+ msgid "Bottom Right"
627	+ msgstr ""
628	+
629	+ #: ../classes/settings.class.php:1010 ../classes/settings.class.php:1237
630	+ #: ../classes/settings.class.php:1386 ../classes/settings.class.php:1937
631	+ msgid "Bottom Left"
632	+ msgstr ""
633	+
634	+ #: ../classes/settings.class.php:1017
635	+ msgid "Menu Items Align"
636	+ msgstr ""
637	+
638	+ #: ../classes/settings.class.php:1019
639	+ msgid ""
640	+ "Align <i>all</i> menu items to the left (default), centrally or to the right."
641	+ msgstr ""
642	+
643	+ #: ../classes/settings.class.php:1024
644	+ msgid ""
645	+ "This option will apply to all menu items. To align an individual menu item "
646	+ "to the right, edit the menu item itself and set 'Menu Item Align' to 'Right'."
647	+ msgstr ""
648	+
649	+ #: ../classes/settings.class.php:1029
650	+ msgid "Top Level Menu Items"
651	+ msgstr ""
652	+
653	+ #: ../classes/settings.class.php:1034
654	+ msgid "Menu Item Background"
655	+ msgstr ""
656	+
657	+ #: ../classes/settings.class.php:1036
658	+ msgid ""
659	+ "The background color for each top level menu item. Tip: Set these values to "
660	+ "transparent if you've already set a background color on the menu bar."
661	+ msgstr ""
662	+
663	+ #: ../classes/settings.class.php:1052
664	+ msgid "Menu Item Background (Hover)"
665	+ msgstr ""
666	+
667	+ #: ../classes/settings.class.php:1054
668	+ msgid "The background color for a top level menu item (on hover)."
669	+ msgstr ""
670	+
671	+ #: ../classes/settings.class.php:1070
672	+ msgid "Menu Item Spacing"
673	+ msgstr ""
674	+
675	+ #: ../classes/settings.class.php:1072
676	+ msgid "Define the size of the gap between each top level menu item."
677	+ msgstr ""
678	+
679	+ #: ../classes/settings.class.php:1081
680	+ msgid "Menu Item Height"
681	+ msgstr ""
682	+
683	+ #: ../classes/settings.class.php:1083
684	+ msgid ""
685	+ "Define the height of each top level menu item. This value, plus the "
686	+ "container top and bottom padding values define the overall height of the "
687	+ "menu bar."
688	+ msgstr ""
689	+
690	+ #: ../classes/settings.class.php:1092 ../classes/settings.class.php:1563
691	+ #: ../classes/settings.class.php:1725
692	+ msgid "Font"
693	+ msgstr ""
694	+
695	+ #: ../classes/settings.class.php:1094
696	+ msgid "The font to use for each top level menu item."
697	+ msgstr ""
698	+
699	+ #: ../classes/settings.class.php:1103 ../classes/settings.class.php:1430
700	+ #: ../classes/settings.class.php:1464 ../classes/settings.class.php:1574
701	+ #: ../classes/settings.class.php:1736 ../classes/settings.class.php:2029
702	+ msgid "Size"
703	+ msgstr ""
704	+
705	+ #: ../classes/settings.class.php:1107 ../classes/settings.class.php:1434
706	+ #: ../classes/settings.class.php:1468 ../classes/settings.class.php:1578
707	+ #: ../classes/settings.class.php:1740 ../classes/settings.class.php:2033
708	+ msgid "Family"
709	+ msgstr ""
710	+
711	+ #: ../classes/settings.class.php:1111 ../classes/settings.class.php:1442
712	+ #: ../classes/settings.class.php:1586 ../classes/settings.class.php:1748
713	+ #: ../classes/settings.class.php:2037
714	+ msgid "Transform"
715	+ msgstr ""
716	+
717	+ #: ../classes/settings.class.php:1115 ../classes/settings.class.php:1137
718	+ #: ../classes/settings.class.php:1438 ../classes/settings.class.php:1582
719	+ #: ../classes/settings.class.php:1608 ../classes/settings.class.php:1744
720	+ #: ../classes/settings.class.php:1770 ../classes/settings.class.php:2041
721	+ #: ../classes/settings.class.php:2063
722	+ msgid "Weight"
723	+ msgstr ""
724	+
725	+ #: ../classes/settings.class.php:1119 ../classes/settings.class.php:1141
726	+ #: ../classes/settings.class.php:1446 ../classes/settings.class.php:1590
727	+ #: ../classes/settings.class.php:1612 ../classes/settings.class.php:1752
728	+ #: ../classes/settings.class.php:1774 ../classes/settings.class.php:2045
729	+ #: ../classes/settings.class.php:2067
730	+ msgid "Decoration"
731	+ msgstr ""
732	+
733	+ #: ../classes/settings.class.php:1126 ../classes/settings.class.php:1597
734	+ #: ../classes/settings.class.php:1759
735	+ msgid "Font (Hover)"
736	+ msgstr ""
737	+
738	+ #: ../classes/settings.class.php:1128
739	+ msgid "Set the font to use for each top level menu item (on hover)."
740	+ msgstr ""
741	+
742	+ #: ../classes/settings.class.php:1148
743	+ msgid "Menu Item Padding"
744	+ msgstr ""
745	+
746	+ #: ../classes/settings.class.php:1150
747	+ msgid "Set the padding for each top level menu item."
748	+ msgstr ""
749	+
750	+ #: ../classes/settings.class.php:1174
751	+ msgid "Menu Item Border"
752	+ msgstr ""
753	+
754	+ #: ../classes/settings.class.php:1176
755	+ msgid "Set the border to display on each top level menu item."
756	+ msgstr ""
757	+
758	+ #: ../classes/settings.class.php:1204
759	+ msgid "Menu Item Border (Hover)"
760	+ msgstr ""
761	+
762	+ #: ../classes/settings.class.php:1206
763	+ msgid "Set the hover border color."
764	+ msgstr ""
765	+
766	+ #: ../classes/settings.class.php:1218
767	+ msgid "Menu Item Border Radius"
768	+ msgstr ""
769	+
770	+ #: ../classes/settings.class.php:1220
771	+ msgid "Set rounded corners for each top level menu item."
772	+ msgstr ""
773	+
774	+ #: ../classes/settings.class.php:1244
775	+ msgid "Menu Item Divider"
776	+ msgstr ""
777	+
778	+ #: ../classes/settings.class.php:1246
779	+ msgid "Show a small divider bar between each menu item."
780	+ msgstr ""
781	+
782	+ #: ../classes/settings.class.php:1259
783	+ msgid "Glow Opacity"
784	+ msgstr ""
785	+
786	+ #: ../classes/settings.class.php:1266
787	+ msgid "Highlight Current Item"
788	+ msgstr ""
789	+
790	+ #: ../classes/settings.class.php:1268
791	+ msgid "Apply the 'hover' styling to current menu items."
792	+ msgstr ""
793	+
794	+ #: ../classes/settings.class.php:1275
795	+ msgid "Mega Panels"
796	+ msgstr ""
797	+
798	+ #: ../classes/settings.class.php:1280
799	+ msgid "Panel Background"
800	+ msgstr ""
801	+
802	+ #: ../classes/settings.class.php:1282
803	+ msgid "Set a background color for a whole panel."
804	+ msgstr ""
805	+
806	+ #: ../classes/settings.class.php:1298
807	+ msgid "Panel Width"
808	+ msgstr ""
809	+
810	+ #: ../classes/settings.class.php:1300
811	+ msgid "Mega Panel width"
812	+ msgstr ""
813	+
814	+ #: ../classes/settings.class.php:1305
815	+ msgid ""
816	+ "A 100% wide panel will only ever be as wide as the menu itself. For a fixed "
817	+ "panel width set this to a pixel value."
818	+ msgstr ""
819	+
820	+ #: ../classes/settings.class.php:1306
821	+ msgid ""
822	+ "Advanced: Enter a jQuery selector to synchronize the width and position of "
823	+ "the sub menu with existing page element (e.g. body, #container, .page)."
824	+ msgstr ""
825	+
826	+ #: ../classes/settings.class.php:1311
827	+ msgid "Panel Padding"
828	+ msgstr ""
829	+
830	+ #: ../classes/settings.class.php:1313
831	+ msgid ""
832	+ "Set the padding for the whole panel. Set these values 0px if you wish your "
833	+ "panel content to go edge-to-edge."
834	+ msgstr ""
835	+
836	+ #: ../classes/settings.class.php:1337
837	+ msgid "Panel Border"
838	+ msgstr ""
839	+
840	+ #: ../classes/settings.class.php:1339
841	+ msgid "Set the border to display on the Mega Panel."
842	+ msgstr ""
843	+
844	+ #: ../classes/settings.class.php:1367
845	+ msgid "Panel Border Radius"
846	+ msgstr ""
847	+
848	+ #: ../classes/settings.class.php:1369
849	+ msgid "Set rounded corners for the panel."
850	+ msgstr ""
851	+
852	+ #: ../classes/settings.class.php:1393
853	+ msgid "Widget Padding"
854	+ msgstr ""
855	+
856	+ #: ../classes/settings.class.php:1395
857	+ msgid ""
858	+ "Set the padding for each widget in the panel. Use this to define the spacing "
859	+ "between each widget in the panel."
860	+ msgstr ""
861	+
862	+ #: ../classes/settings.class.php:1419
863	+ msgid "Widget Heading Font"
864	+ msgstr ""
865	+
866	+ #: ../classes/settings.class.php:1421
867	+ msgid ""
868	+ "Set the font to use Widget headers in the mega menu. Tip: set this to the "
869	+ "same style as the Second Level Menu Item Header font to keep your styling "
870	+ "consistent."
871	+ msgstr ""
872	+
873	+ #: ../classes/settings.class.php:1453
874	+ msgid "Widget Content Font"
875	+ msgstr ""
876	+
877	+ #: ../classes/settings.class.php:1455
878	+ msgid "Set the font to use for panel contents."
879	+ msgstr ""
880	+
881	+ #: ../classes/settings.class.php:1475
882	+ msgid "Widget Heading Padding"
883	+ msgstr ""
884	+
885	+ #: ../classes/settings.class.php:1477
886	+ msgid "Set the padding for the widget headings."
887	+ msgstr ""
888	+
889	+ #: ../classes/settings.class.php:1501
890	+ msgid "Widget Heading Margin"
891	+ msgstr ""
892	+
893	+ #: ../classes/settings.class.php:1503
894	+ msgid "Set the margin for the widget headings."
895	+ msgstr ""
896	+
897	+ #: ../classes/settings.class.php:1527 ../classes/settings.class.php:1689
898	+ msgid "Border"
899	+ msgstr ""
900	+
901	+ #: ../classes/settings.class.php:1529
902	+ msgid "Set the border for the widget headings."
903	+ msgstr ""
904	+
905	+ #: ../classes/settings.class.php:1557
906	+ msgid "Second Level Menu Items"
907	+ msgstr ""
908	+
909	+ #: ../classes/settings.class.php:1565
910	+ msgid ""
911	+ "Set the font for second level menu items when they're displayed in a Mega "
912	+ "Menu."
913	+ msgstr ""
914	+
915	+ #: ../classes/settings.class.php:1599 ../classes/settings.class.php:1761
916	+ msgid "Set the font style on hover."
917	+ msgstr ""
918	+
919	+ #: ../classes/settings.class.php:1619 ../classes/settings.class.php:1781
920	+ msgid "Background (Hover)"
921	+ msgstr ""
922	+
923	+ #: ../classes/settings.class.php:1621
924	+ msgid "Set the background hover color for second level menu items."
925	+ msgstr ""
926	+
927	+ #: ../classes/settings.class.php:1637 ../classes/settings.class.php:1799
928	+ msgid "Padding"
929	+ msgstr ""
930	+
931	+ #: ../classes/settings.class.php:1639
932	+ msgid "Set the padding for the second level menu items."
933	+ msgstr ""
934	+
935	+ #: ../classes/settings.class.php:1663
936	+ msgid "Margin"
937	+ msgstr ""
938	+
939	+ #: ../classes/settings.class.php:1665
940	+ msgid "Set the margin for the second level menu items."
941	+ msgstr ""
942	+
943	+ #: ../classes/settings.class.php:1691
944	+ msgid "Set the border for the second level menu items."
945	+ msgstr ""
946	+
947	+ #: ../classes/settings.class.php:1719
948	+ msgid "Third Level Menu Items"
949	+ msgstr ""
950	+
951	+ #: ../classes/settings.class.php:1727
952	+ msgid ""
953	+ "Set the font for third level menu items when they're displayed in a Mega "
954	+ "Menu."
955	+ msgstr ""
956	+
957	+ #: ../classes/settings.class.php:1783
958	+ msgid "Set the background hover color for third level menu items."
959	+ msgstr ""
960	+
961	+ #: ../classes/settings.class.php:1801
962	+ msgid "Set the padding for the third level menu items."
963	+ msgstr ""
964	+
965	+ #: ../classes/settings.class.php:1825
966	+ msgid "Flyout Menus"
967	+ msgstr ""
968	+
969	+ #: ../classes/settings.class.php:1832
970	+ msgid "Set the background color for the flyout menu."
971	+ msgstr ""
972	+
973	+ #: ../classes/settings.class.php:1849
974	+ msgid "Menu Width"
975	+ msgstr ""
976	+
977	+ #: ../classes/settings.class.php:1851
978	+ msgid "The width of each flyout menu. This must be a fixed pixel value."
979	+ msgstr ""
980	+
981	+ #: ../classes/settings.class.php:1856
982	+ msgid ""
983	+ "Set this value to the width of your longest menu item title to stop menu "
984	+ "items wrapping onto 2 lines."
985	+ msgstr ""
986	+
987	+ #: ../classes/settings.class.php:1863
988	+ msgid "Set the padding for the whole flyout menu."
989	+ msgstr ""
990	+
991	+ #: ../classes/settings.class.php:1883
992	+ msgid ""
993	+ "Only suitable for single level flyout menus. If you're using multi level "
994	+ "flyout menus set these values to 0px."
995	+ msgstr ""
996	+
997	+ #: ../classes/settings.class.php:1888
998	+ msgid "Menu Border"
999	+ msgstr ""
1000	+
1001	+ #: ../classes/settings.class.php:1890
1002	+ msgid "Set the border for the flyout menu."
1003	+ msgstr ""
1004	+
1005	+ #: ../classes/settings.class.php:1920
1006	+ msgid ""
1007	+ "Set rounded corners for flyout menus. Rounded corners will be applied to all "
1008	+ "flyout menu levels."
1009	+ msgstr ""
1010	+
1011	+ #: ../classes/settings.class.php:1944
1012	+ msgid "Item Background"
1013	+ msgstr ""
1014	+
1015	+ #: ../classes/settings.class.php:1946
1016	+ msgid "Set the background color for a flyout menu item."
1017	+ msgstr ""
1018	+
1019	+ #: ../classes/settings.class.php:1962
1020	+ msgid "Item Ba